raylib/docs/games/raylib_zerouno.js
Ray San 1f6eb1fc61 Moved raylib webpage to docs folder
raylib webpage has been completely reorganized and moved from gh-pages
(a pain to work with) to docs folder. Useless libs have been removed,
webs have been renamed, etc.

Now it would be easier (hopefully) to update webpage. :)
2017-02-06 18:48:56 +01:00

67043 lines
2.1 MiB

var Module;
if (typeof Module === 'undefined') Module = {};
if (!Module.expectedDataFileDownloads) {
Module.expectedDataFileDownloads = 0;
Module.finishedDataFileDownloads = 0;
}
Module.expectedDataFileDownloads++;
(function() {
var loadPackage = function(metadata) {
var PACKAGE_PATH;
if (typeof window === 'object') {
PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
} else if (typeof location !== 'undefined') {
// worker
PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
} else {
throw 'using preloaded data can only be done on a web page or in a web worker';
}
var PACKAGE_NAME = 'raylib_zerouno.data';
var REMOTE_PACKAGE_BASE = 'raylib_zerouno.data';
if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
Module['locateFile'] = Module['locateFilePackage'];
Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
}
var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ?
Module['locateFile'](REMOTE_PACKAGE_BASE) :
((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE);
var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
var PACKAGE_UUID = metadata.package_uuid;
function fetchRemotePackage(packageName, packageSize, callback, errback) {
var xhr = new XMLHttpRequest();
xhr.open('GET', packageName, true);
xhr.responseType = 'arraybuffer';
xhr.onprogress = function(event) {
var url = packageName;
var size = packageSize;
if (event.total) size = event.total;
if (event.loaded) {
if (!xhr.addedTotal) {
xhr.addedTotal = true;
if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
Module.dataFileDownloads[url] = {
loaded: event.loaded,
total: size
};
} else {
Module.dataFileDownloads[url].loaded = event.loaded;
}
var total = 0;
var loaded = 0;
var num = 0;
for (var download in Module.dataFileDownloads) {
var data = Module.dataFileDownloads[download];
total += data.total;
loaded += data.loaded;
num++;
}
total = Math.ceil(total * Module.expectedDataFileDownloads/num);
if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
} else if (!Module.dataFileDownloads) {
if (Module['setStatus']) Module['setStatus']('Downloading data...');
}
};
xhr.onload = function(event) {
var packageData = xhr.response;
callback(packageData);
};
xhr.send(null);
};
function handleError(error) {
console.error('package error:', error);
};
var fetched = null, fetchedCallback = null;
fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
if (fetchedCallback) {
fetchedCallback(data);
fetchedCallback = null;
} else {
fetched = data;
}
}, handleError);
function runWithFS() {
function assert(check, msg) {
if (!check) throw msg + new Error().stack;
}
Module['FS_createPath']('/', 'resources', true, true);
function DataRequest(start, end, crunched, audio) {
this.start = start;
this.end = end;
this.crunched = crunched;
this.audio = audio;
}
DataRequest.prototype = {
requests: {},
open: function(mode, name) {
this.name = name;
this.requests[name] = this;
Module['addRunDependency']('fp ' + this.name);
},
send: function() {},
onload: function() {
var byteArray = this.byteArray.subarray(this.start, this.end);
this.finish(byteArray);
},
finish: function(byteArray) {
var that = this;
Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
Module['removeRunDependency']('fp ' + that.name);
this.requests[this.name] = null;
},
};
var files = metadata.files;
for (i = 0; i < files.length; ++i) {
new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename);
}
function processPackageData(arrayBuffer) {
Module.finishedDataFileDownloads++;
assert(arrayBuffer, 'Loading data file failed.');
assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
var byteArray = new Uint8Array(arrayBuffer);
var curr;
// copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though
// (we may be allocating before malloc is ready, during startup).
if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting');
var ptr = Module['getMemory'](byteArray.length);
Module['HEAPU8'].set(byteArray, ptr);
DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length);
var files = metadata.files;
for (i = 0; i < files.length; ++i) {
DataRequest.prototype.requests[files[i].filename].onload();
}
Module['removeRunDependency']('datafile_raylib_zerouno.data');
};
Module['addRunDependency']('datafile_raylib_zerouno.data');
if (!Module.preloadResults) Module.preloadResults = {};
Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
if (fetched) {
processPackageData(fetched);
fetched = null;
} else {
fetchedCallback = processPackageData;
}
}
if (Module['calledRun']) {
runWithFS();
} else {
if (!Module['preRun']) Module['preRun'] = [];
Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
}
}
loadPackage({"files": [{"audio": 1, "start": 0, "crunched": 0, "end": 1752213, "filename": "/resources/buddy.ogg"}, {"audio": 0, "start": 1752213, "crunched": 0, "end": 1766897, "filename": "/resources/courier.png"}, {"audio": 0, "start": 1766897, "crunched": 0, "end": 4515146, "filename": "/resources/dwarf.obj"}, {"audio": 0, "start": 4515146, "crunched": 0, "end": 5789769, "filename": "/resources/dwarf_diffuse.png"}, {"audio": 0, "start": 5789769, "crunched": 0, "end": 5799010, "filename": "/resources/example01.png"}, {"audio": 0, "start": 5799010, "crunched": 0, "end": 5814217, "filename": "/resources/example02.png"}, {"audio": 0, "start": 5814217, "crunched": 0, "end": 5865944, "filename": "/resources/example03.png"}, {"audio": 0, "start": 5865944, "crunched": 0, "end": 5905112, "filename": "/resources/example04.png"}, {"audio": 0, "start": 5905112, "crunched": 0, "end": 6011868, "filename": "/resources/example05.png"}, {"audio": 0, "start": 6011868, "crunched": 0, "end": 6110410, "filename": "/resources/parrot_head.png"}, {"audio": 0, "start": 6110410, "crunched": 0, "end": 6162976, "filename": "/resources/raylib_platforms.png"}, {"audio": 0, "start": 6162976, "crunched": 0, "end": 6166241, "filename": "/resources/sample01.png"}, {"audio": 0, "start": 6166241, "crunched": 0, "end": 6173325, "filename": "/resources/sample02.png"}, {"audio": 0, "start": 6173325, "crunched": 0, "end": 6177971, "filename": "/resources/sample03.png"}, {"audio": 0, "start": 6177971, "crunched": 0, "end": 6182206, "filename": "/resources/sample04.png"}, {"audio": 0, "start": 6182206, "crunched": 0, "end": 6187055, "filename": "/resources/sample05.png"}], "remote_package_size": 6187055, "package_uuid": "f758ed76-06b5-4734-9430-c1125a649aab"});
})();
// The Module object: Our interface to the outside world. We import
// and export values on it, and do the work to get that through
// closure compiler if necessary. There are various ways Module can be used:
// 1. Not defined. We create it here
// 2. A function parameter, function(Module) { ..generated code.. }
// 3. pre-run appended it, var Module = {}; ..generated code..
// 4. External script tag defines var Module.
// We need to do an eval in order to handle the closure compiler
// case, where this code here is minified but Module was defined
// elsewhere (e.g. case 4 above). We also need to check if Module
// already exists (e.g. case 3 above).
// Note that if you want to run closure, and also to use Module
// after the generated code, you will need to define var Module = {};
// before the code. Then that object will be used in the code, and you
// can continue to use Module afterwards as well.
var Module;
if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};
// Sometimes an existing Module object exists with properties
// meant to overwrite the default module functionality. Here
// we collect those properties and reapply _after_ we configure
// the current environment's defaults to avoid having to be so
// defensive during initialization.
var moduleOverrides = {};
for (var key in Module) {
if (Module.hasOwnProperty(key)) {
moduleOverrides[key] = Module[key];
}
}
// The environment setup code below is customized to use Module.
// *** Environment setup code ***
var ENVIRONMENT_IS_WEB = typeof window === 'object';
// Three configurations we can be running in:
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
var ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
var ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
if (ENVIRONMENT_IS_NODE) {
// Expose functionality in the same simple way that the shells work
// Note that we pollute the global namespace here, otherwise we break in node
if (!Module['print']) Module['print'] = function print(x) {
process['stdout'].write(x + '\n');
};
if (!Module['printErr']) Module['printErr'] = function printErr(x) {
process['stderr'].write(x + '\n');
};
var nodeFS = require('fs');
var nodePath = require('path');
Module['read'] = function read(filename, binary) {
filename = nodePath['normalize'](filename);
var ret = nodeFS['readFileSync'](filename);
// The path is absolute if the normalized version is the same as the resolved.
if (!ret && filename != nodePath['resolve'](filename)) {
filename = path.join(__dirname, '..', 'src', filename);
ret = nodeFS['readFileSync'](filename);
}
if (ret && !binary) ret = ret.toString();
return ret;
};
Module['readBinary'] = function readBinary(filename) {
var ret = Module['read'](filename, true);
if (!ret.buffer) {
ret = new Uint8Array(ret);
}
assert(ret.buffer);
return ret;
};
Module['load'] = function load(f) {
globalEval(read(f));
};
if (!Module['thisProgram']) {
if (process['argv'].length > 1) {
Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
} else {
Module['thisProgram'] = 'unknown-program';
}
}
Module['arguments'] = process['argv'].slice(2);
if (typeof module !== 'undefined') {
module['exports'] = Module;
}
process['on']('uncaughtException', function(ex) {
// suppress ExitStatus exceptions from showing an error
if (!(ex instanceof ExitStatus)) {
throw ex;
}
});
Module['inspect'] = function () { return '[Emscripten Module object]'; };
}
else if (ENVIRONMENT_IS_SHELL) {
if (!Module['print']) Module['print'] = print;
if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm
if (typeof read != 'undefined') {
Module['read'] = read;
} else {
Module['read'] = function read() { throw 'no read() available (jsc?)' };
}
Module['readBinary'] = function readBinary(f) {
if (typeof readbuffer === 'function') {
return new Uint8Array(readbuffer(f));
}
var data = read(f, 'binary');
assert(typeof data === 'object');
return data;
};
if (typeof scriptArgs != 'undefined') {
Module['arguments'] = scriptArgs;
} else if (typeof arguments != 'undefined') {
Module['arguments'] = arguments;
}
}
else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
Module['read'] = function read(url) {
var xhr = new XMLHttpRequest();
xhr.open('GET', url, false);
xhr.send(null);
return xhr.responseText;
};
if (typeof arguments != 'undefined') {
Module['arguments'] = arguments;
}
if (typeof console !== 'undefined') {
if (!Module['print']) Module['print'] = function print(x) {
console.log(x);
};
if (!Module['printErr']) Module['printErr'] = function printErr(x) {
console.log(x);
};
} else {
// Probably a worker, and without console.log. We can do very little here...
var TRY_USE_DUMP = false;
if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
dump(x);
}) : (function(x) {
// self.postMessage(x); // enable this if you want stdout to be sent as messages
}));
}
if (ENVIRONMENT_IS_WORKER) {
Module['load'] = importScripts;
}
if (typeof Module['setWindowTitle'] === 'undefined') {
Module['setWindowTitle'] = function(title) { document.title = title };
}
}
else {
// Unreachable because SHELL is dependant on the others
throw 'Unknown runtime environment. Where are we?';
}
function globalEval(x) {
eval.call(null, x);
}
if (!Module['load'] && Module['read']) {
Module['load'] = function load(f) {
globalEval(Module['read'](f));
};
}
if (!Module['print']) {
Module['print'] = function(){};
}
if (!Module['printErr']) {
Module['printErr'] = Module['print'];
}
if (!Module['arguments']) {
Module['arguments'] = [];
}
if (!Module['thisProgram']) {
Module['thisProgram'] = './this.program';
}
// *** Environment setup code ***
// Closure helpers
Module.print = Module['print'];
Module.printErr = Module['printErr'];
// Callbacks
Module['preRun'] = [];
Module['postRun'] = [];
// Merge back in the overrides
for (var key in moduleOverrides) {
if (moduleOverrides.hasOwnProperty(key)) {
Module[key] = moduleOverrides[key];
}
}
// === Preamble library stuff ===
// Documentation for the public APIs defined in this file must be updated in:
// site/source/docs/api_reference/preamble.js.rst
// A prebuilt local version of the documentation is available at:
// site/build/text/docs/api_reference/preamble.js.txt
// You can also build docs locally as HTML or other formats in site/
// An online HTML version (which may be of a different version of Emscripten)
// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
//========================================
// Runtime code shared with compiler
//========================================
var Runtime = {
setTempRet0: function (value) {
tempRet0 = value;
},
getTempRet0: function () {
return tempRet0;
},
stackSave: function () {
return STACKTOP;
},
stackRestore: function (stackTop) {
STACKTOP = stackTop;
},
getNativeTypeSize: function (type) {
switch (type) {
case 'i1': case 'i8': return 1;
case 'i16': return 2;
case 'i32': return 4;
case 'i64': return 8;
case 'float': return 4;
case 'double': return 8;
default: {
if (type[type.length-1] === '*') {
return Runtime.QUANTUM_SIZE; // A pointer
} else if (type[0] === 'i') {
var bits = parseInt(type.substr(1));
assert(bits % 8 === 0);
return bits/8;
} else {
return 0;
}
}
}
},
getNativeFieldSize: function (type) {
return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
},
STACK_ALIGN: 16,
prepVararg: function (ptr, type) {
if (type === 'double' || type === 'i64') {
// move so the load is aligned
if (ptr & 7) {
assert((ptr & 7) === 4);
ptr += 4;
}
} else {
assert((ptr & 3) === 0);
}
return ptr;
},
getAlignSize: function (type, size, vararg) {
// we align i64s and doubles on 64-bit boundaries, unlike x86
if (!vararg && (type == 'i64' || type == 'double')) return 8;
if (!type) return Math.min(size, 8); // align structures internally to 64 bits
return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
},
dynCall: function (sig, ptr, args) {
if (args && args.length) {
if (!args.splice) args = Array.prototype.slice.call(args);
args.splice(0, 0, ptr);
return Module['dynCall_' + sig].apply(null, args);
} else {
return Module['dynCall_' + sig].call(null, ptr);
}
},
functionPointers: [],
addFunction: function (func) {
for (var i = 0; i < Runtime.functionPointers.length; i++) {
if (!Runtime.functionPointers[i]) {
Runtime.functionPointers[i] = func;
return 2*(1 + i);
}
}
throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
},
removeFunction: function (index) {
Runtime.functionPointers[(index-2)/2] = null;
},
warnOnce: function (text) {
if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
if (!Runtime.warnOnce.shown[text]) {
Runtime.warnOnce.shown[text] = 1;
Module.printErr(text);
}
},
funcWrappers: {},
getFuncWrapper: function (func, sig) {
assert(sig);
if (!Runtime.funcWrappers[sig]) {
Runtime.funcWrappers[sig] = {};
}
var sigCache = Runtime.funcWrappers[sig];
if (!sigCache[func]) {
sigCache[func] = function dynCall_wrapper() {
return Runtime.dynCall(sig, func, arguments);
};
}
return sigCache[func];
},
getCompilerSetting: function (name) {
throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
},
stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; },
staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
dynamicAlloc: function (size) { var ret = DYNAMICTOP;DYNAMICTOP = (DYNAMICTOP + size)|0;DYNAMICTOP = (((DYNAMICTOP)+15)&-16); if (DYNAMICTOP >= TOTAL_MEMORY) { var success = enlargeMemory(); if (!success) { DYNAMICTOP = ret; return 0; } }; return ret; },
alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
GLOBAL_BASE: 8,
QUANTUM_SIZE: 4,
__dummy__: 0
}
Module["Runtime"] = Runtime;
//========================================
// Runtime essentials
//========================================
var __THREW__ = 0; // Used in checking for thrown exceptions.
var ABORT = false; // whether we are quitting the application. no code should run after this. set in exit() and abort()
var EXITSTATUS = 0;
var undef = 0;
// tempInt is used for 32-bit signed values or smaller. tempBigInt is used
// for 32-bit unsigned values or more than 32 bits. TODO: audit all uses of tempInt
var tempValue, tempInt, tempBigInt, tempInt2, tempBigInt2, tempPair, tempBigIntI, tempBigIntR, tempBigIntS, tempBigIntP, tempBigIntD, tempDouble, tempFloat;
var tempI64, tempI64b;
var tempRet0, tempRet1, tempRet2, tempRet3, tempRet4, tempRet5, tempRet6, tempRet7, tempRet8, tempRet9;
function assert(condition, text) {
if (!condition) {
abort('Assertion failed: ' + text);
}
}
var globalScope = this;
// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
function getCFunc(ident) {
var func = Module['_' + ident]; // closure exported function
if (!func) {
try {
func = eval('_' + ident); // explicit lookup
} catch(e) {}
}
assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
return func;
}
var cwrap, ccall;
(function(){
var JSfuncs = {
// Helpers for cwrap -- it can't refer to Runtime directly because it might
// be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
// out what the minified function name is.
'stackSave': function() {
Runtime.stackSave()
},
'stackRestore': function() {
Runtime.stackRestore()
},
// type conversion from js to c
'arrayToC' : function(arr) {
var ret = Runtime.stackAlloc(arr.length);
writeArrayToMemory(arr, ret);
return ret;
},
'stringToC' : function(str) {
var ret = 0;
if (str !== null && str !== undefined && str !== 0) { // null string
// at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
ret = Runtime.stackAlloc((str.length << 2) + 1);
writeStringToMemory(str, ret);
}
return ret;
}
};
// For fast lookup of conversion functions
var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};
// C calling interface.
ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
var func = getCFunc(ident);
var cArgs = [];
var stack = 0;
if (args) {
for (var i = 0; i < args.length; i++) {
var converter = toC[argTypes[i]];
if (converter) {
if (stack === 0) stack = Runtime.stackSave();
cArgs[i] = converter(args[i]);
} else {
cArgs[i] = args[i];
}
}
}
var ret = func.apply(null, cArgs);
if (returnType === 'string') ret = Pointer_stringify(ret);
if (stack !== 0) {
if (opts && opts.async) {
EmterpreterAsync.asyncFinalizers.push(function() {
Runtime.stackRestore(stack);
});
return;
}
Runtime.stackRestore(stack);
}
return ret;
}
var sourceRegex = /^function\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
function parseJSFunc(jsfunc) {
// Match the body and the return value of a javascript function source
var parsed = jsfunc.toString().match(sourceRegex).slice(1);
return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
}
var JSsource = {};
for (var fun in JSfuncs) {
if (JSfuncs.hasOwnProperty(fun)) {
// Elements of toCsource are arrays of three items:
// the code, and the return value
JSsource[fun] = parseJSFunc(JSfuncs[fun]);
}
}
cwrap = function cwrap(ident, returnType, argTypes) {
argTypes = argTypes || [];
var cfunc = getCFunc(ident);
// When the function takes numbers and returns a number, we can just return
// the original function
var numericArgs = argTypes.every(function(type){ return type === 'number'});
var numericRet = (returnType !== 'string');
if ( numericRet && numericArgs) {
return cfunc;
}
// Creation of the arguments list (["$1","$2",...,"$nargs"])
var argNames = argTypes.map(function(x,i){return '$'+i});
var funcstr = "(function(" + argNames.join(',') + ") {";
var nargs = argTypes.length;
if (!numericArgs) {
// Generate the code needed to convert the arguments from javascript
// values to pointers
funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
for (var i = 0; i < nargs; i++) {
var arg = argNames[i], type = argTypes[i];
if (type === 'number') continue;
var convertCode = JSsource[type + 'ToC']; // [code, return]
funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
funcstr += convertCode.body + ';';
funcstr += arg + '=' + convertCode.returnValue + ';';
}
}
// When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
// Call the function
funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
if (!numericRet) { // Return type can only by 'string' or 'number'
// Convert the result to a string
var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
funcstr += 'ret = ' + strgfy + '(ret);';
}
if (!numericArgs) {
// If we had a stack, restore it
funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
}
funcstr += 'return ret})';
return eval(funcstr);
};
})();
Module["ccall"] = ccall;
Module["cwrap"] = cwrap;
function setValue(ptr, value, type, noSafe) {
type = type || 'i8';
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
switch(type) {
case 'i1': HEAP8[((ptr)>>0)]=value; break;
case 'i8': HEAP8[((ptr)>>0)]=value; break;
case 'i16': HEAP16[((ptr)>>1)]=value; break;
case 'i32': HEAP32[((ptr)>>2)]=value; break;
case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
case 'float': HEAPF32[((ptr)>>2)]=value; break;
case 'double': HEAPF64[((ptr)>>3)]=value; break;
default: abort('invalid type for setValue: ' + type);
}
}
Module["setValue"] = setValue;
function getValue(ptr, type, noSafe) {
type = type || 'i8';
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
switch(type) {
case 'i1': return HEAP8[((ptr)>>0)];
case 'i8': return HEAP8[((ptr)>>0)];
case 'i16': return HEAP16[((ptr)>>1)];
case 'i32': return HEAP32[((ptr)>>2)];
case 'i64': return HEAP32[((ptr)>>2)];
case 'float': return HEAPF32[((ptr)>>2)];
case 'double': return HEAPF64[((ptr)>>3)];
default: abort('invalid type for setValue: ' + type);
}
return null;
}
Module["getValue"] = getValue;
var ALLOC_NORMAL = 0; // Tries to use _malloc()
var ALLOC_STACK = 1; // Lives for the duration of the current function call
var ALLOC_STATIC = 2; // Cannot be freed
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
var ALLOC_NONE = 4; // Do not allocate
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
Module["ALLOC_STACK"] = ALLOC_STACK;
Module["ALLOC_STATIC"] = ALLOC_STATIC;
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
Module["ALLOC_NONE"] = ALLOC_NONE;
// allocate(): This is for internal use. You can use it yourself as well, but the interface
// is a little tricky (see docs right below). The reason is that it is optimized
// for multiple syntaxes to save space in generated code. So you should
// normally not use allocate(), and instead allocate memory using _malloc(),
// initialize it with setValue(), and so forth.
// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
// in *bytes* (note that this is sometimes confusing: the next parameter does not
// affect this!)
// @types: Either an array of types, one for each byte (or 0 if no type at that position),
// or a single type which is used for the entire block. This only matters if there
// is initial data - if @slab is a number, then this does not matter at all and is
// ignored.
// @allocator: How to allocate memory, see ALLOC_*
function allocate(slab, types, allocator, ptr) {
var zeroinit, size;
if (typeof slab === 'number') {
zeroinit = true;
size = slab;
} else {
zeroinit = false;
size = slab.length;
}
var singleType = typeof types === 'string' ? types : null;
var ret;
if (allocator == ALLOC_NONE) {
ret = ptr;
} else {
ret = [_malloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
}
if (zeroinit) {
var ptr = ret, stop;
assert((ret & 3) == 0);
stop = ret + (size & ~3);
for (; ptr < stop; ptr += 4) {
HEAP32[((ptr)>>2)]=0;
}
stop = ret + size;
while (ptr < stop) {
HEAP8[((ptr++)>>0)]=0;
}
return ret;
}
if (singleType === 'i8') {
if (slab.subarray || slab.slice) {
HEAPU8.set(slab, ret);
} else {
HEAPU8.set(new Uint8Array(slab), ret);
}
return ret;
}
var i = 0, type, typeSize, previousType;
while (i < size) {
var curr = slab[i];
if (typeof curr === 'function') {
curr = Runtime.getFunctionIndex(curr);
}
type = singleType || types[i];
if (type === 0) {
i++;
continue;
}
if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
setValue(ret+i, curr, type);
// no need to look up size unless type changes, so cache it
if (previousType !== type) {
typeSize = Runtime.getNativeTypeSize(type);
previousType = type;
}
i += typeSize;
}
return ret;
}
Module["allocate"] = allocate;
// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
function getMemory(size) {
if (!staticSealed) return Runtime.staticAlloc(size);
if ((typeof _sbrk !== 'undefined' && !_sbrk.called) || !runtimeInitialized) return Runtime.dynamicAlloc(size);
return _malloc(size);
}
Module["getMemory"] = getMemory;
function Pointer_stringify(ptr, /* optional */ length) {
if (length === 0 || !ptr) return '';
// TODO: use TextDecoder
// Find the length, and check for UTF while doing so
var hasUtf = 0;
var t;
var i = 0;
while (1) {
t = HEAPU8[(((ptr)+(i))>>0)];
hasUtf |= t;
if (t == 0 && !length) break;
i++;
if (length && i == length) break;
}
if (!length) length = i;
var ret = '';
if (hasUtf < 128) {
var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
var curr;
while (length > 0) {
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
ret = ret ? ret + curr : curr;
ptr += MAX_CHUNK;
length -= MAX_CHUNK;
}
return ret;
}
return Module['UTF8ToString'](ptr);
}
Module["Pointer_stringify"] = Pointer_stringify;
// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.
function AsciiToString(ptr) {
var str = '';
while (1) {
var ch = HEAP8[((ptr++)>>0)];
if (!ch) return str;
str += String.fromCharCode(ch);
}
}
Module["AsciiToString"] = AsciiToString;
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
function stringToAscii(str, outPtr) {
return writeAsciiToMemory(str, outPtr, false);
}
Module["stringToAscii"] = stringToAscii;
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
// a copy of that string as a Javascript String object.
function UTF8ArrayToString(u8Array, idx) {
var u0, u1, u2, u3, u4, u5;
var str = '';
while (1) {
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
u0 = u8Array[idx++];
if (!u0) return str;
if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
u1 = u8Array[idx++] & 63;
if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
u2 = u8Array[idx++] & 63;
if ((u0 & 0xF0) == 0xE0) {
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
} else {
u3 = u8Array[idx++] & 63;
if ((u0 & 0xF8) == 0xF0) {
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
} else {
u4 = u8Array[idx++] & 63;
if ((u0 & 0xFC) == 0xF8) {
u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
} else {
u5 = u8Array[idx++] & 63;
u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
}
}
}
if (u0 < 0x10000) {
str += String.fromCharCode(u0);
} else {
var ch = u0 - 0x10000;
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
}
}
}
Module["UTF8ArrayToString"] = UTF8ArrayToString;
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.
function UTF8ToString(ptr) {
return UTF8ArrayToString(HEAPU8,ptr);
}
Module["UTF8ToString"] = UTF8ToString;
// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
// str: the Javascript string to copy.
// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
// outIdx: The starting offset in the array to begin the copying.
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
return 0;
var startIdx = outIdx;
var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
for (var i = 0; i < str.length; ++i) {
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
// See http://unicode.org/faq/utf_bom.html#utf16-3
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
var u = str.charCodeAt(i); // possibly a lead surrogate
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
if (u <= 0x7F) {
if (outIdx >= endIdx) break;
outU8Array[outIdx++] = u;
} else if (u <= 0x7FF) {
if (outIdx + 1 >= endIdx) break;
outU8Array[outIdx++] = 0xC0 | (u >> 6);
outU8Array[outIdx++] = 0x80 | (u & 63);
} else if (u <= 0xFFFF) {
if (outIdx + 2 >= endIdx) break;
outU8Array[outIdx++] = 0xE0 | (u >> 12);
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
outU8Array[outIdx++] = 0x80 | (u & 63);
} else if (u <= 0x1FFFFF) {
if (outIdx + 3 >= endIdx) break;
outU8Array[outIdx++] = 0xF0 | (u >> 18);
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
outU8Array[outIdx++] = 0x80 | (u & 63);
} else if (u <= 0x3FFFFFF) {
if (outIdx + 4 >= endIdx) break;
outU8Array[outIdx++] = 0xF8 | (u >> 24);
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
outU8Array[outIdx++] = 0x80 | (u & 63);
} else {
if (outIdx + 5 >= endIdx) break;
outU8Array[outIdx++] = 0xFC | (u >> 30);
outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
outU8Array[outIdx++] = 0x80 | (u & 63);
}
}
// Null-terminate the pointer to the buffer.
outU8Array[outIdx] = 0;
return outIdx - startIdx;
}
Module["stringToUTF8Array"] = stringToUTF8Array;
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Returns the number of bytes written, EXCLUDING the null terminator.
function stringToUTF8(str, outPtr, maxBytesToWrite) {
return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
}
Module["stringToUTF8"] = stringToUTF8;
// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
function lengthBytesUTF8(str) {
var len = 0;
for (var i = 0; i < str.length; ++i) {
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
// See http://unicode.org/faq/utf_bom.html#utf16-3
var u = str.charCodeAt(i); // possibly a lead surrogate
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
if (u <= 0x7F) {
++len;
} else if (u <= 0x7FF) {
len += 2;
} else if (u <= 0xFFFF) {
len += 3;
} else if (u <= 0x1FFFFF) {
len += 4;
} else if (u <= 0x3FFFFFF) {
len += 5;
} else {
len += 6;
}
}
return len;
}
Module["lengthBytesUTF8"] = lengthBytesUTF8;
// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.
function UTF16ToString(ptr) {
var i = 0;
var str = '';
while (1) {
var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
if (codeUnit == 0)
return str;
++i;
// fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
str += String.fromCharCode(codeUnit);
}
}
Module["UTF16ToString"] = UTF16ToString;
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
// str: the Javascript string to copy.
// outPtr: Byte address in Emscripten HEAP where to write the string to.
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.
function stringToUTF16(str, outPtr, maxBytesToWrite) {
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
if (maxBytesToWrite === undefined) {
maxBytesToWrite = 0x7FFFFFFF;
}
if (maxBytesToWrite < 2) return 0;
maxBytesToWrite -= 2; // Null terminator.
var startPtr = outPtr;
var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
for (var i = 0; i < numCharsToWrite; ++i) {
// charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
HEAP16[((outPtr)>>1)]=codeUnit;
outPtr += 2;
}
// Null-terminate the pointer to the HEAP.
HEAP16[((outPtr)>>1)]=0;
return outPtr - startPtr;
}
Module["stringToUTF16"] = stringToUTF16;
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
function lengthBytesUTF16(str) {
return str.length*2;
}
Module["lengthBytesUTF16"] = lengthBytesUTF16;
function UTF32ToString(ptr) {
var i = 0;
var str = '';
while (1) {
var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
if (utf32 == 0)
return str;
++i;
// Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
// See http://unicode.org/faq/utf_bom.html#utf16-3
if (utf32 >= 0x10000) {
var ch = utf32 - 0x10000;
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
} else {
str += String.fromCharCode(utf32);
}
}
}
Module["UTF32ToString"] = UTF32ToString;
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
// str: the Javascript string to copy.
// outPtr: Byte address in Emscripten HEAP where to write the string to.
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.
function stringToUTF32(str, outPtr, maxBytesToWrite) {
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
if (maxBytesToWrite === undefined) {
maxBytesToWrite = 0x7FFFFFFF;
}
if (maxBytesToWrite < 4) return 0;
var startPtr = outPtr;
var endPtr = startPtr + maxBytesToWrite - 4;
for (var i = 0; i < str.length; ++i) {
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
// See http://unicode.org/faq/utf_bom.html#utf16-3
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
var trailSurrogate = str.charCodeAt(++i);
codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
}
HEAP32[((outPtr)>>2)]=codeUnit;
outPtr += 4;
if (outPtr + 4 > endPtr) break;
}
// Null-terminate the pointer to the HEAP.
HEAP32[((outPtr)>>2)]=0;
return outPtr - startPtr;
}
Module["stringToUTF32"] = stringToUTF32;
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
function lengthBytesUTF32(str) {
var len = 0;
for (var i = 0; i < str.length; ++i) {
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
// See http://unicode.org/faq/utf_bom.html#utf16-3
var codeUnit = str.charCodeAt(i);
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
len += 4;
}
return len;
}
Module["lengthBytesUTF32"] = lengthBytesUTF32;
function demangle(func) {
var hasLibcxxabi = !!Module['___cxa_demangle'];
if (hasLibcxxabi) {
try {
var buf = _malloc(func.length);
writeStringToMemory(func.substr(1), buf);
var status = _malloc(4);
var ret = Module['___cxa_demangle'](buf, 0, 0, status);
if (getValue(status, 'i32') === 0 && ret) {
return Pointer_stringify(ret);
}
// otherwise, libcxxabi failed, we can try ours which may return a partial result
} catch(e) {
// failure when using libcxxabi, we can try ours which may return a partial result
} finally {
if (buf) _free(buf);
if (status) _free(status);
if (ret) _free(ret);
}
}
var i = 3;
// params, etc.
var basicTypes = {
'v': 'void',
'b': 'bool',
'c': 'char',
's': 'short',
'i': 'int',
'l': 'long',
'f': 'float',
'd': 'double',
'w': 'wchar_t',
'a': 'signed char',
'h': 'unsigned char',
't': 'unsigned short',
'j': 'unsigned int',
'm': 'unsigned long',
'x': 'long long',
'y': 'unsigned long long',
'z': '...'
};
var subs = [];
var first = true;
function dump(x) {
//return;
if (x) Module.print(x);
Module.print(func);
var pre = '';
for (var a = 0; a < i; a++) pre += ' ';
Module.print (pre + '^');
}
function parseNested() {
i++;
if (func[i] === 'K') i++; // ignore const
var parts = [];
while (func[i] !== 'E') {
if (func[i] === 'S') { // substitution
i++;
var next = func.indexOf('_', i);
var num = func.substring(i, next) || 0;
parts.push(subs[num] || '?');
i = next+1;
continue;
}
if (func[i] === 'C') { // constructor
parts.push(parts[parts.length-1]);
i += 2;
continue;
}
var size = parseInt(func.substr(i));
var pre = size.toString().length;
if (!size || !pre) { i--; break; } // counter i++ below us
var curr = func.substr(i + pre, size);
parts.push(curr);
subs.push(curr);
i += pre + size;
}
i++; // skip E
return parts;
}
function parse(rawList, limit, allowVoid) { // main parser
limit = limit || Infinity;
var ret = '', list = [];
function flushList() {
return '(' + list.join(', ') + ')';
}
var name;
if (func[i] === 'N') {
// namespaced N-E
name = parseNested().join('::');
limit--;
if (limit === 0) return rawList ? [name] : name;
} else {
// not namespaced
if (func[i] === 'K' || (first && func[i] === 'L')) i++; // ignore const and first 'L'
var size = parseInt(func.substr(i));
if (size) {
var pre = size.toString().length;
name = func.substr(i + pre, size);
i += pre + size;
}
}
first = false;
if (func[i] === 'I') {
i++;
var iList = parse(true);
var iRet = parse(true, 1, true);
ret += iRet[0] + ' ' + name + '<' + iList.join(', ') + '>';
} else {
ret = name;
}
paramLoop: while (i < func.length && limit-- > 0) {
//dump('paramLoop');
var c = func[i++];
if (c in basicTypes) {
list.push(basicTypes[c]);
} else {
switch (c) {
case 'P': list.push(parse(true, 1, true)[0] + '*'); break; // pointer
case 'R': list.push(parse(true, 1, true)[0] + '&'); break; // reference
case 'L': { // literal
i++; // skip basic type
var end = func.indexOf('E', i);
var size = end - i;
list.push(func.substr(i, size));
i += size + 2; // size + 'EE'
break;
}
case 'A': { // array
var size = parseInt(func.substr(i));
i += size.toString().length;
if (func[i] !== '_') throw '?';
i++; // skip _
list.push(parse(true, 1, true)[0] + ' [' + size + ']');
break;
}
case 'E': break paramLoop;
default: ret += '?' + c; break paramLoop;
}
}
}
if (!allowVoid && list.length === 1 && list[0] === 'void') list = []; // avoid (void)
if (rawList) {
if (ret) {
list.push(ret + '?');
}
return list;
} else {
return ret + flushList();
}
}
var parsed = func;
try {
// Special-case the entry point, since its name differs from other name mangling.
if (func == 'Object._main' || func == '_main') {
return 'main()';
}
if (typeof func === 'number') func = Pointer_stringify(func);
if (func[0] !== '_') return func;
if (func[1] !== '_') return func; // C function
if (func[2] !== 'Z') return func;
switch (func[3]) {
case 'n': return 'operator new()';
case 'd': return 'operator delete()';
}
parsed = parse();
} catch(e) {
parsed += '?';
}
if (parsed.indexOf('?') >= 0 && !hasLibcxxabi) {
Runtime.warnOnce('warning: a problem occurred in builtin C++ name demangling; build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling');
}
return parsed;
}
function demangleAll(text) {
return text.replace(/__Z[\w\d_]+/g, function(x) { var y = demangle(x); return x === y ? x : (x + ' [' + y + ']') });
}
function jsStackTrace() {
var err = new Error();
if (!err.stack) {
// IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
// so try that as a special-case.
try {
throw new Error(0);
} catch(e) {
err = e;
}
if (!err.stack) {
return '(no stack trace available)';
}
}
return err.stack.toString();
}
function stackTrace() {
return demangleAll(jsStackTrace());
}
Module["stackTrace"] = stackTrace;
// Memory management
var PAGE_SIZE = 4096;
function alignMemoryPage(x) {
if (x % 4096 > 0) {
x += (4096 - (x % 4096));
}
return x;
}
var HEAP;
var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
var STATIC_BASE = 0, STATICTOP = 0, staticSealed = false; // static area
var STACK_BASE = 0, STACKTOP = 0, STACK_MAX = 0; // stack area
var DYNAMIC_BASE = 0, DYNAMICTOP = 0; // dynamic area handled by sbrk
function enlargeMemory() {
// TOTAL_MEMORY is the current size of the actual array, and DYNAMICTOP is the new top.
var OLD_TOTAL_MEMORY = TOTAL_MEMORY;
var LIMIT = Math.pow(2, 31); // 2GB is a practical maximum, as we use signed ints as pointers
// and JS engines seem unhappy to give us 2GB arrays currently
if (DYNAMICTOP >= LIMIT) return false;
while (TOTAL_MEMORY <= DYNAMICTOP) { // Simple heuristic.
if (TOTAL_MEMORY < LIMIT/2) {
TOTAL_MEMORY = alignMemoryPage(2*TOTAL_MEMORY); // double until 1GB
} else {
var last = TOTAL_MEMORY;
TOTAL_MEMORY = alignMemoryPage((3*TOTAL_MEMORY + LIMIT)/4); // add smaller increments towards 2GB, which we cannot reach
if (TOTAL_MEMORY <= last) return false;
}
}
TOTAL_MEMORY = Math.max(TOTAL_MEMORY, 16*1024*1024);
if (TOTAL_MEMORY >= LIMIT) return false;
try {
if (ArrayBuffer.transfer) {
buffer = ArrayBuffer.transfer(buffer, TOTAL_MEMORY);
} else {
var oldHEAP8 = HEAP8;
buffer = new ArrayBuffer(TOTAL_MEMORY);
}
} catch(e) {
return false;
}
var success = _emscripten_replace_memory(buffer);
if (!success) return false;
// everything worked
Module['buffer'] = buffer;
Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
if (!ArrayBuffer.transfer) {
HEAP8.set(oldHEAP8);
}
return true;
}
var byteLength;
try {
byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, 'byteLength').get);
byteLength(new ArrayBuffer(4)); // can fail on older ie
} catch(e) { // can fail on older node/v8
byteLength = function(buffer) { return buffer.byteLength; };
}
var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
var totalMemory = 64*1024;
while (totalMemory < TOTAL_MEMORY || totalMemory < 2*TOTAL_STACK) {
if (totalMemory < 16*1024*1024) {
totalMemory *= 2;
} else {
totalMemory += 16*1024*1024
}
}
totalMemory = Math.max(totalMemory, 16*1024*1024);
if (totalMemory !== TOTAL_MEMORY) {
TOTAL_MEMORY = totalMemory;
}
// Initialize the runtime's memory
// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']),
'JS engine does not provide full typed array support');
var buffer;
buffer = new ArrayBuffer(TOTAL_MEMORY);
HEAP8 = new Int8Array(buffer);
HEAP16 = new Int16Array(buffer);
HEAP32 = new Int32Array(buffer);
HEAPU8 = new Uint8Array(buffer);
HEAPU16 = new Uint16Array(buffer);
HEAPU32 = new Uint32Array(buffer);
HEAPF32 = new Float32Array(buffer);
HEAPF64 = new Float64Array(buffer);
// Endianness check (note: assumes compiler arch was little-endian)
HEAP32[0] = 255;
assert(HEAPU8[0] === 255 && HEAPU8[3] === 0, 'Typed arrays 2 must be run on a little-endian system');
Module['HEAP'] = HEAP;
Module['buffer'] = buffer;
Module['HEAP8'] = HEAP8;
Module['HEAP16'] = HEAP16;
Module['HEAP32'] = HEAP32;
Module['HEAPU8'] = HEAPU8;
Module['HEAPU16'] = HEAPU16;
Module['HEAPU32'] = HEAPU32;
Module['HEAPF32'] = HEAPF32;
Module['HEAPF64'] = HEAPF64;
function callRuntimeCallbacks(callbacks) {
while(callbacks.length > 0) {
var callback = callbacks.shift();
if (typeof callback == 'function') {
callback();
continue;
}
var func = callback.func;
if (typeof func === 'number') {
if (callback.arg === undefined) {
Runtime.dynCall('v', func);
} else {
Runtime.dynCall('vi', func, [callback.arg]);
}
} else {
func(callback.arg === undefined ? null : callback.arg);
}
}
}
var __ATPRERUN__ = []; // functions called before the runtime is initialized
var __ATINIT__ = []; // functions called during startup
var __ATMAIN__ = []; // functions called when main() is to be run
var __ATEXIT__ = []; // functions called during shutdown
var __ATPOSTRUN__ = []; // functions called after the runtime has exited
var runtimeInitialized = false;
var runtimeExited = false;
function preRun() {
// compatibility - merge in anything from Module['preRun'] at this time
if (Module['preRun']) {
if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
while (Module['preRun'].length) {
addOnPreRun(Module['preRun'].shift());
}
}
callRuntimeCallbacks(__ATPRERUN__);
}
function ensureInitRuntime() {
if (runtimeInitialized) return;
runtimeInitialized = true;
callRuntimeCallbacks(__ATINIT__);
}
function preMain() {
callRuntimeCallbacks(__ATMAIN__);
}
function exitRuntime() {
callRuntimeCallbacks(__ATEXIT__);
runtimeExited = true;
}
function postRun() {
// compatibility - merge in anything from Module['postRun'] at this time
if (Module['postRun']) {
if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
while (Module['postRun'].length) {
addOnPostRun(Module['postRun'].shift());
}
}
callRuntimeCallbacks(__ATPOSTRUN__);
}
function addOnPreRun(cb) {
__ATPRERUN__.unshift(cb);
}
Module["addOnPreRun"] = addOnPreRun;
function addOnInit(cb) {
__ATINIT__.unshift(cb);
}
Module["addOnInit"] = addOnInit;
function addOnPreMain(cb) {
__ATMAIN__.unshift(cb);
}
Module["addOnPreMain"] = addOnPreMain;
function addOnExit(cb) {
__ATEXIT__.unshift(cb);
}
Module["addOnExit"] = addOnExit;
function addOnPostRun(cb) {
__ATPOSTRUN__.unshift(cb);
}
Module["addOnPostRun"] = addOnPostRun;
// Tools
function intArrayFromString(stringy, dontAddNull, length /* optional */) {
var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
var u8array = new Array(len);
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
if (dontAddNull) u8array.length = numBytesWritten;
return u8array;
}
Module["intArrayFromString"] = intArrayFromString;
function intArrayToString(array) {
var ret = [];
for (var i = 0; i < array.length; i++) {
var chr = array[i];
if (chr > 0xFF) {
chr &= 0xFF;
}
ret.push(String.fromCharCode(chr));
}
return ret.join('');
}
Module["intArrayToString"] = intArrayToString;
function writeStringToMemory(string, buffer, dontAddNull) {
var array = intArrayFromString(string, dontAddNull);
var i = 0;
while (i < array.length) {
var chr = array[i];
HEAP8[(((buffer)+(i))>>0)]=chr;
i = i + 1;
}
}
Module["writeStringToMemory"] = writeStringToMemory;
function writeArrayToMemory(array, buffer) {
for (var i = 0; i < array.length; i++) {
HEAP8[((buffer++)>>0)]=array[i];
}
}
Module["writeArrayToMemory"] = writeArrayToMemory;
function writeAsciiToMemory(str, buffer, dontAddNull) {
for (var i = 0; i < str.length; ++i) {
HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
}
// Null-terminate the pointer to the HEAP.
if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
}
Module["writeAsciiToMemory"] = writeAsciiToMemory;
function unSign(value, bits, ignore) {
if (value >= 0) {
return value;
}
return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
: Math.pow(2, bits) + value;
}
function reSign(value, bits, ignore) {
if (value <= 0) {
return value;
}
var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
: Math.pow(2, bits-1);
if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
// but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
// TODO: In i64 mode 1, resign the two parts separately and safely
value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
}
return value;
}
// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
var ah = a >>> 16;
var al = a & 0xffff;
var bh = b >>> 16;
var bl = b & 0xffff;
return (al*bl + ((ah*bl + al*bh) << 16))|0;
};
Math.imul = Math['imul'];
if (!Math['clz32']) Math['clz32'] = function(x) {
x = x >>> 0;
for (var i = 0; i < 32; i++) {
if (x & (1 << (31 - i))) return i;
}
return 32;
};
Math.clz32 = Math['clz32']
var Math_abs = Math.abs;
var Math_cos = Math.cos;
var Math_sin = Math.sin;
var Math_tan = Math.tan;
var Math_acos = Math.acos;
var Math_asin = Math.asin;
var Math_atan = Math.atan;
var Math_atan2 = Math.atan2;
var Math_exp = Math.exp;
var Math_log = Math.log;
var Math_sqrt = Math.sqrt;
var Math_ceil = Math.ceil;
var Math_floor = Math.floor;
var Math_pow = Math.pow;
var Math_imul = Math.imul;
var Math_fround = Math.fround;
var Math_min = Math.min;
var Math_clz32 = Math.clz32;
// A counter of dependencies for calling run(). If we need to
// do asynchronous work before running, increment this and
// decrement it. Incrementing must happen in a place like
// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
// Note that you can add dependencies in preRun, even though
// it happens right before run - run will be postponed until
// the dependencies are met.
var runDependencies = 0;
var runDependencyWatcher = null;
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
function getUniqueRunDependency(id) {
return id;
}
function addRunDependency(id) {
runDependencies++;
if (Module['monitorRunDependencies']) {
Module['monitorRunDependencies'](runDependencies);
}
}
Module["addRunDependency"] = addRunDependency;
function removeRunDependency(id) {
runDependencies--;
if (Module['monitorRunDependencies']) {
Module['monitorRunDependencies'](runDependencies);
}
if (runDependencies == 0) {
if (runDependencyWatcher !== null) {
clearInterval(runDependencyWatcher);
runDependencyWatcher = null;
}
if (dependenciesFulfilled) {
var callback = dependenciesFulfilled;
dependenciesFulfilled = null;
callback(); // can add another dependenciesFulfilled
}
}
}
Module["removeRunDependency"] = removeRunDependency;
Module["preloadedImages"] = {}; // maps url to image data
Module["preloadedAudios"] = {}; // maps url to audio data
var memoryInitializer = null;
// === Body ===
var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }];
function _emscripten_asm_const_2(code, a0, a1) {
return ASM_CONSTS[code](a0, a1);
}
STATIC_BASE = 8;
STATICTOP = STATIC_BASE + 30528;
/* global initializers */ __ATINIT__.push();
/* memory initializer */ allocate([0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,16,0,0,0,16,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,255,255,255,0,0,0,0,0,0,0,0,60,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
/* memory initializer */ allocate([128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,79,103,103,83], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+2222);
/* memory initializer */ allocate([1,0,0,128,0,0,0,86,0,0,0,64,0,0,0,62,180,228,51,9,145,243,51,139,178,1,52,60,32,10,52,35,26,19,52,96,169,28,52,167,215,38,52,75,175,49,52,80,59,61,52,112,135,73,52,35,160,86,52,184,146,100,52,85,109,115,52,136,159,129,52,252,11,138,52,147,4,147,52,105,146,156,52,50,191,166,52,63,149,177,52,147,31,189,52,228,105,201,52,173,128,214,52,54,113,228,52,166,73,243,52,136,140,1,53,192,247,9,53,6,239,18,53,118,123,28,53,192,166,38,53,55,123,49,53,218,3,61,53,94,76,73,53,59,97,86,53,185,79,100,53,252,37,115,53,138,121,129,53,134,227,137,53,124,217,146,53,133,100,156,53,82,142,166,53,51,97,177,53,37,232,188,53,220,46,201,53,206,65,214,53,65,46,228,53,87,2,243,53,143,102,1,54,79,207,9,54,245,195,18,54,152,77,28,54,232,117,38,54,50,71,49,54,116,204,60,54,94,17,73,54,101,34,86,54,206,12,100,54,184,222,114,54,151,83,129,54,28,187,137,54,114,174,146,54,175,54,156,54,129,93,166,54,53,45,177,54,199,176,188,54,228,243,200,54,1,3,214,54,96,235,227,54,30,187,242,54,162,64,1,55,235,166,9,55,241,152,18,55,201,31,28,55,30,69,38,55,61,19,49,55,30,149,60,55,111,214,72,55,162,227,85,55,247,201,99,55,137,151,114,55,175,45,129,55,190,146,137,55,116,131,146,55,230,8,156,55,190,44,166,55,71,249,176,55,121,121,188,55,254,184,200,55,71,196,213,55,146,168,227,55,248,115,242,55,192,26,1,56,147,126,9,56,249,109,18,56,6,242,27,56,98,20,38,56,86,223,48,56,216,93,60,56,146,155,72,56,242,164,85,56,51,135,99,56,110,80,114,56,211,7,129,56,107,106,137,56,130,88,146,56,42,219,155,56,9,252,165,56,104,197,176,56,59,66,188,56,41,126,200,56,160,133,213,56,217,101,227,56,232,44,242,56,233,244,0,57,70,86,9,57,14,67,18,57,81,196,27,57,181,227,37,57,127,171,48,57,162,38,60,57,197,96,72,57,83,102,85,57,131,68,99,57,104,9,114,57,1,226,128,57,36,66,137,57,157,45,146,57,123,173,155,57,99,203,165,57,153,145,176,57,13,11,188,57,102,67,200,57,11,71,213,57,50,35,227,57,237,229,241,57,29,207,0,58,5,46,9,58,48,24,18,58,169,150,27,58,21,179,37,58,183,119,48,58,124,239,59,58,10,38,72,58,199,39,85,58,230,1,99,58,120,194,113,58,59,188,128,58,233,25,137,58,198,2,146,58,219,127,155,58,203,154,165,58,216,93,176,58,239,211,187,58,179,8,200,58,136,8,213,58,159,224,226,58,7,159,241,58,92,169,0,59,208,5,9,59,94,237,17,59,15,105,27,59,132,130,37,59,253,67,48,59,103,184,59,59,97,235,71,59,77,233,84,59,93,191,98,59,156,123,113,59,127,150,128,59,186,241,136,59,249,215,145,59,71,82,155,59,65,106,165,59,39,42,176,59,226,156,187,59,18,206,199,59,23,202,212,59,32,158,226,59,53,88,241,59,166,131,0,60,167,221,8,60,152,194,17,60,130,59,27,60,1,82,37,60,84,16,48,60,97,129,59,60,200,176,71,60,229,170,84,60,232,124,98,60,212,52,113,60,207,112,128,60,150,201,136,60,58,173,145,60,192,36,155,60,197,57,165,60,133,246,175,60,229,101,187,60,130,147,199,60,185,139,212,60,180,91,226,60,121,17,241,60,251,93,0,61,137,181,8,61,223,151,17,61,2,14,27,61,141,33,37,61,185,220,47,61,109,74,59,61,64,118,71,61,145,108,84,61,133,58,98,61,34,238,112,61,42,75,128,61,127,161,136,61,136,130,145,61,72,247,154,61,88,9,165,61,242,194,175,61,248,46,187,61,3,89,199,61,109,77,212,61,92,25,226,61,209,202,240,61,91,56,0,62,119,141,8,62,51,109,17,62,144,224,26,62,39,241,36,62,46,169,47,62,135,19,59,62,202,59,71,62,77,46,84,62,55,248,97,62,132,167,112,62,143,37,128,62,115,121,136,62,226,87,145,62,220,201,154,62,249,216,164,62,109,143,175,62,27,248,186,62,149,30,199,62,51,15,212,62,23,215,225,62,61,132,240,62,198,18,0,63,114,101,8,63,147,66,17,63,43,179,26,63,206,192,36,63,177,117,47,63,178,220,58,63,101,1,71,63,29,240,83,63,251,181,97,63,251,96,112,63,0,0,128,63,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,3,0,0,0,7,0,0,0,15,0,0,0,31,0,0,0,63,0,0,0,127,0,0,0,255,0,0,0,255,1,0,0,255,3,0,0,255,7,0,0,255,15,0,0,255,31,0,0,255,63,0,0,255,127,0,0,255,255,0,0,0,0,0,0,255,255,255,255,253,255,255,255,249,255,255,255,241,255,255,255,225,255,255,255,193,255,255,255,129,255,255,255,1,255,255,255,1,254,255,255,1,252,255,255,1,248,255,255,1,240,255,255,1,224,255,255,1,192,255,255,1,128,255,255,1,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,248,34,0,0,248,34,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,3,0,0,0,37,113,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,65,32,115,105,109,112,108,101,32,97,110,100,32,101,97,115,121,45,116,111,45,117,115,101,32,108,105,98,114,97,114,121,10,116,111,32,108,101,97,114,110,32,118,105,100,101,111,103,97,109,101,115,32,112,114,111,103,114,97,109,109,105,110,103,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,35,105,110,99,108,117,100,101,32,34,114,97,121,108,105,98,46,104,34,10,10,105,110,116,32,109,97,105,110,40,41,10,123,10,32,32,32,32,73,110,105,116,87,105,110,100,111,119,40,56,48,48,44,32,52,53,48,44,32,34,104,101,108,108,111,34,41,59,10,10,32,32,32,32,119,104,105,108,101,32,40,33,87,105,110,100,111,119,83,104,111,117,108,100,67,108,111,115,101,40,41,41,10,32,32,32,32,123,10,32,32,32,32,32,32,32,32,66,101,103,105,110,68,114,97,119,105,110,103,40,41,59,10,10,32,32,32,32,32,32,32,32,32,32,32,32,67,108,101,97,114,66,97,99,107,103,114,111,117,110,100,40,82,65,89,87,72,73,84,69,41,59,10,10,32,32,32,32,32,32,32,32,32,32,32,32,68,114,97,119,84,101,120,116,40,34,104,101,108,108,111,32,114,97,121,108,105,98,33,34,44,32,49,57,48,44,32,50,48,48,44,32,52,48,44,32,82,69,68,41,59,10,10,32,32,32,32,32,32,32,32,69,110,100,68,114,97,119,105,110,103,40,41,59,10,32,32,32,32,125,10,32,32,32,32,67,108,111,115,101,87,105,110,100,111,119,40,41,59,10,125,10,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,114,97,121,108,105,98,32,90,69,82,79,85,78,79,0,114,101,115,111,117,114,99,101,115,47,99,111,117,114,105,101,114,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,114,97,121,108,105,98,95,112,108,97,116,102,111,114,109,115,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,112,97,114,114,111,116,95,104,101,97,100,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,100,119,97,114,102,46,111,98,106,0,114,101,115,111,117,114,99,101,115,47,100,119,97,114,102,95,100,105,102,102,117,115,101,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,49,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,50,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,51,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,52,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,53,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,49,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,50,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,51,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,52,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,53,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,98,117,100,100,121,46,111,103,103,0,80,114,101,115,115,32,69,78,84,69,82,32,116,111,32,80,76,65,89,0,114,97,121,108,105,98,0,112,108,97,105,110,32,67,32,112,114,111,103,114,97,109,109,105,110,103,33,0,104,101,108,108,111,32,114,97,121,108,105,98,33,0,109,117,108,116,105,112,108,97,116,102,111,114,109,33,0,109,97,107,101,32,50,68,32,103,97,109,101,115,33,0,79,77,71,33,0,97,110,100,32,97,108,115,111,32,51,68,32,103,97,109,101,115,33,0,108,111,116,115,32,111,102,32,99,111,100,101,32,101,120,97,109,112,108,101,115,33,0,65,77,65,90,73,78,71,33,0,97,110,100,32,97,108,115,111,32,99,111,109,112,108,101,116,101,32,103,97,109,101,115,33,0,65,87,69,83,79,77,69,33,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,52,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+6841);
/* memory initializer */ allocate([83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,86,65,79,32,73,68,32,37,105,93,32,77,111,100,101,108,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,111,100,101,108,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,77,111,100,101,108,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,70,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,102,114,97,109,101,98,117,102,102,101,114,32,111,98,106,101,99,116,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,85,110,108,111,97,100,101,100,32,112,111,115,116,112,114,111,99,101,115,115,105,110,103,32,100,97,116,97,0,79,112,101,110,71,76,32,103,114,97,112,104,105,99,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,78,111,114,109,97,108,0,109,118,112,77,97,116,114,105,120,0,102,114,97,103,84,105,110,116,67,111,108,111,114,0,116,101,120,116,117,114,101,48,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,99,109,97,112,0,108,111,99,97,0,104,101,97,100,0,103,108,121,102,0,104,104,101,97,0,104,109,116,120,0,107,101,114,110,0,109,97,120,112,0,46,47,115,116,98,95,116,114,117,101,116,121,112,101,46,104,0,115,116,98,116,116,95,70,105,110,100,71,108,121,112,104,73,110,100,101,120,0,117,110,105,99,111,100,101,95,99,111,100,101,112,111,105,110,116,32,60,61,32,116,116,85,83,72,79,82,84,40,100,97,116,97,32,43,32,101,110,100,67,111,117,110,116,32,43,32,50,42,105,116,101,109,41,0,115,116,98,116,116,95,71,101,116,71,108,121,112,104,83,104,97,112,101,0,120,43,103,119,32,60,32,112,119,0,115,116,98,116,116,95,66,97,107,101,70,111,110,116,66,105,116,109,97,112,0,121,43,103,104,32,60,32,112,104,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,114,98,109,102,0,116,116,102,0,102,110,116,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,100,97,116,97,32,112,97,114,115,101,100,32,99,111,114,114,101,99,116,108,121,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,110,117,109,32,99,104,97,114,115,32,100,101,116,101,99,116,101,100,58,32,37,105,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,85,110,108,111,97,100,101,100,32,115,112,114,105,116,101,32,102,111,110,116,32,100,97,116,97,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,99,97,110,39,116,32,102,111,112,101,110,0,112,110,103,0,98,109,112,0,116,103,97,0,106,112,103,0,103,105,102,0,112,115,100,0,112,105,99,0,100,100,115,0,112,107,109,0,107,116,120,0,112,118,114,0,97,115,116,99,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,102,105,108,101,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,111,98,106,0,91,37,115,93,32,77,111,100,101,108,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,77,111,100,101,108,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,65,117,100,105,111,32,100,101,118,105,99,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,67,111,117,108,100,32,110,111,116,32,115,101,116,117,112,32,97,117,100,105,111,32,99,111,110,116,101,120,116,0,65,117,100,105,111,32,100,101,118,105,99,101,32,97,110,100,32,99,111,110,116,101,120,116,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,58,32,37,115,0,67,111,117,108,100,32,110,111,116,32,103,101,116,32,99,117,114,114,101,110,116,32,97,117,100,105,111,32,99,111,110,116,101,120,116,32,102,111,114,32,99,108,111,115,105,110,103,0,111,103,103,0,91,37,115,93,32,79,71,71,32,97,117,100,105,111,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,79,103,103,32,115,97,109,112,108,101,32,114,97,116,101,58,32,37,105,0,91,37,115,93,32,79,103,103,32,99,104,97,110,110,101,108,115,58,32,37,105,0,91,37,115,93,32,84,101,109,112,32,109,101,109,111,114,121,32,114,101,113,117,105,114,101,100,58,32,37,105,0,91,37,115,93,32,77,117,115,105,99,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,79,103,103,32,112,108,97,121,105,110,103,44,32,101,114,114,111,114,32,98,117,102,102,101,114,105,110,103,32,100,97,116,97,46,46,46,0,115,116,98,95,118,111,114,98,105,115,46,99,0,73,78,70,79,58,32,0,69,82,82,79,82,58,32,0,87,65,82,78,73,78,71,58,32,0,98,117,102,95,99,32,61,61,32,50,0,99,111,110,118,101,114,116,95,99,104,97,110,110,101,108,115,95,115,104,111,114,116,95,105,110,116,101,114,108,101,97,118,101,100,0,0,0,0,0,0,0,7,0,0,0,0,0,3,5,0,0,0,0,3,7,5,0,0,0,3,5,3,5,0,0,3,7,5,3,5,0,3,7,5,3,5,7,102,45,62,98,121,116,101,115,95,105,110,95,115,101,103,32,62,32,48,0,103,101,116,56,95,112,97,99,107,101,116,95,114,97,119,0,102,45,62,98,121,116,101,115,95,105,110,95,115,101,103,32,61,61,32,48,0,110,101,120,116,95,115,101,103,109,101,110,116,0,0,1,2,2,3,3,3,3,4,4,4,4,4,4,4,4,102,45,62,97,108,108,111,99,46,97,108,108,111,99,95,98,117,102,102,101,114,95,108,101,110,103,116,104,95,105,110,95,98,121,116,101,115,32,61,61,32,102,45,62,116,101,109,112,95,111,102,102,115,101,116,0,118,111,114,98,105,115,95,100,101,99,111,100,101,95,105,110,105,116,105,97,108,0,102,45,62,116,101,109,112,95,111,102,102,115,101,116,32,61,61,32,102,45,62,97,108,108,111,99,46,97,108,108,111,99,95,98,117,102,102,101,114,95,108,101,110,103,116,104,95,105,110,95,98,121,116,101,115,0,115,116,97,114,116,95,100,101,99,111,100,101,114,0,112,111,119,40,40,102,108,111,97,116,41,32,114,43,49,44,32,100,105,109,41,32,62,32,101,110,116,114,105,101,115,0,108,111,111,107,117,112,49,95,118,97,108,117,101,115,0,40,105,110,116,41,32,102,108,111,111,114,40,112,111,119,40,40,102,108,111,97,116,41,32,114,44,32,100,105,109,41,41,32,60,61,32,101,110,116,114,105,101,115,0,107,32,61,61,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,109,112,117,116,101,95,115,111,114,116,101,100,95,104,117,102,102,109,97,110,0,99,45,62,115,111,114,116,101,100,95,99,111,100,101,119,111,114,100,115,91,120,93,32,61,61,32,99,111,100,101,0,108,101,110,32,33,61,32,78,79,95,67,79,68,69,0,105,110,99,108,117,100,101,95,105,110,95,115,111,114,116,0,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,32,61,61,32,48,0,99,111,109,112,117,116,101,95,99,111,100,101,119,111,114,100,115,0,122,32,62,61,32,48,32,38,38,32,122,32,60,32,51,50,0,108,101,110,91,105,93,32,62,61,32,48,32,38,38,32,108,101,110,91,105,93,32,60,32,51,50,0,97,118,97,105,108,97,98,108,101,91,121,93,32,61,61,32,48,0,118,111,114,98,105,115,103,101,116,95,119,105,110,100,111,119,0,118,111,114,98,105,115,95,100,101,99,111,100,101,95,112,97,99,107,101,116,95,114,101,115,116,0,40,110,32,38,32,51,41,32,61,61,32,48,0,105,109,100,99,116,95,115,116,101,112,51,95,105,116,101,114,48,95,108,111,111,112,0,122,32,60,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,115,116,97,114,116,0,33,99,45,62,115,112,97,114,115,101,32,124,124,32,122,32,60,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,100,101,105,110,116,101,114,108,101,97,118,101,95,114,101,112,101,97,116,0,33,99,45,62,115,112,97,114,115,101,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,115,99,97,108,97,114,95,114,97,119,0,78,111,32,109,111,114,101,32,100,97,116,97,32,111,98,116,97,105,110,101,100,32,102,114,111,109,32,115,116,114,101,97,109,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,65,83,84,67,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,98,108,111,99,107,115,58,32,37,105,120,37,105,0,91,37,115,93,32,65,83,84,67,32,98,108,111,99,107,32,115,105,122,101,32,99,111,110,102,105,103,117,114,97,116,105,111,110,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,86,82,32,118,50,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,117,112,100,97,116,101,32,121,111,117,114,32,102,105,108,101,115,32,116,111,32,80,86,82,32,118,51,0,91,37,115,93,32,75,84,88,32,105,109,97,103,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,75,84,88,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,102,105,108,101,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,80,75,77,32,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,68,68,83,32,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,104,101,97,100,101,114,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,102,108,97,103,115,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,98,105,116,32,99,111,117,110,116,58,32,48,120,37,120,0,80,105,116,99,104,32,111,114,32,108,105,110,101,97,114,32,115,105,122,101,58,32,37,105,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,109,97,120,32,118,97,108,117,101,32,62,32,50,53,53,0,83,128,246,52,0,110,111,116,32,66,77,80,0,117,110,107,110,111,119,110,32,66,77,80,0,98,97,100,32,66,77,80,0,109,111,110,111,99,104,114,111,109,101,0,66,77,80,32,82,76,69,0,110,111,116,32,71,73,70,0,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,109,101,109,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,46,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,109,103,95,110,32,61,61,32,51,0,98,97,100,32,112,110,103,32,115,105,103,0,110,111,32,83,79,73,0,110,111,32,83,79,70,0,98,97,100,32,83,79,70,32,108,101,110,0,111,110,108,121,32,56,45,98,105,116,0,110,111,32,104,101,97,100,101,114,32,104,101,105,103,104,116,0,48,32,119,105,100,116,104,0,98,97,100,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,98,97,100,32,99,111,109,112,111,110,101,110,116,32,73,68,0,98,97,100,32,72,0,98,97,100,32,86,0,98,97,100,32,84,81,0,101,120,112,101,99,116,101,100,32,109,97,114,107,101,114,0,98,97,100,32,68,82,73,32,108,101,110,0,98,97,100,32,68,81,84,32,116,121,112,101,0,98,97,100,32,68,81,84,32,116,97,98,108,101,0,0,1,8,16,9,2,3,10,17,24,32,25,18,11,4,5,12,19,26,33,40,48,41,34,27,20,13,6,7,14,21,28,35,42,49,56,57,50,43,36,29,22,15,23,30,37,44,51,58,59,52,45,38,31,39,46,53,60,61,54,47,55,62,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,98,97,100,32,68,72,84,32,104,101,97,100,101,114,0,98,97,100,32,99,111,100,101,32,108,101,110,103,116,104,115,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,101,114,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,102,111,114,109,97,116,0,116,103,97,95,99,111,109,112,32,61,61,32,83,84,66,73,95,114,103,98,0,115,116,98,105,95,95,116,103,97,95,108,111,97,100,0,98,97,100,32,112,97,108,101,116,116,101,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,48,0,98,97,100,32,102,105,108,101,0,80,73,67,84,0,110,111,116,32,80,83,68,0,119,114,111,110,103,32,118,101,114,115,105,111,110,0,119,114,111,110,103,32,99,104,97,110,110,101,108,32,99,111,117,110,116,0,117,110,115,117,112,112,111,114,116,101,100,32,98,105,116,32,100,101,112,116,104,0,119,114,111,110,103,32,99,111,108,111,114,32,102,111,114,109,97,116,0,98,97,100,32,73,109,97,103,101,32,68,101,115,99,114,105,112,116,111,114,0,109,105,115,115,105,110,103,32,99,111,108,111,114,32,116,97,98,108,101,0,117,110,107,110,111,119,110,32,99,111,100,101,0,110,111,32,99,108,101,97,114,32,99,111,100,101,0,116,111,111,32,109,97,110,121,32,99,111,100,101,115,0,105,108,108,101,103,97,108,32,99,111,100,101,32,105,110,32,114,97,115,116,101,114,0,105,110,118,97,108,105,100,0,98,97,100,32,98,112,112,0,98,97,100,32,109,97,115,107,115,0,98,97,100,32,114,101,113,95,99,111,109,112,0,106,117,110,107,32,98,101,102,111,114,101,32,109,97,114,107,101,114,0,99,97,110,39,116,32,109,101,114,103,101,32,100,99,32,97,110,100,32,97,99,0,110,32,62,61,32,48,32,38,38,32,110,32,60,32,40,105,110,116,41,32,40,115,105,122,101,111,102,40,115,116,98,105,95,95,98,109,97,115,107,41,47,115,105,122,101,111,102,40,42,115,116,98,105,95,95,98,109,97,115,107,41,41,0,115,116,98,105,95,95,101,120,116,101,110,100,95,114,101,99,101,105,118,101,0,40,40,40,106,45,62,99,111,100,101,95,98,117,102,102,101,114,41,32,62,62,32,40,51,50,32,45,32,104,45,62,115,105,122,101,91,99,93,41,41,32,38,32,115,116,98,105,95,95,98,109,97,115,107,91,104,45,62,115,105,122,101,91,99,93,93,41,32,61,61,32,104,45,62,99,111,100,101,91,99,93,0,115,116,98,105,95,95,106,112,101,103,95,104,117,102,102,95,100,101,99,111,100,101,0,98,97,100,32,83,79,83,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,98,97,100,32,83,79,83,32,108,101,110,0,98,97,100,32,68,67,32,104,117,102,102,0,98,97,100,32,65,67,32,104,117,102,102,0,98,97,100,32,83,79,83,0,114,116,0,91,37,115,93,32,70,78,84,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,108,105,110,101,72,101,105,103,104,116,0,108,105,110,101,72,101,105,103,104,116,61,37,105,32,98,97,115,101,61,37,105,32,115,99,97,108,101,87,61,37,105,32,115,99,97,108,101,72,61,37,105,0,91,37,115,93,32,70,111,110,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,115,99,97,108,101,58,32,37,105,120,37,105,0,102,105,108,101,0,102,105,108,101,61,34,37,49,50,56,91,94,34,93,34,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,102,105,108,101,110,97,109,101,58,32,37,115,0,99,111,117,110,116,0,99,111,117,110,116,61,37,105,0,91,37,115,93,32,70,111,110,116,32,110,117,109,32,99,104,97,114,115,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,108,111,97,100,105,110,103,32,112,97,116,104,58,32,37,115,0,99,104,97,114,32,105,100,61,37,105,32,120,61,37,105,32,121,61,37,105,32,119,105,100,116,104,61,37,105,32,104,101,105,103,104,116,61,37,105,32,120,111,102,102,115,101,116,61,37,105,32,121,111,102,102,115,101,116,61,37,105,32,120,97,100,118,97,110,99,101,61,37,105,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,114,98,0,91,37,115,93,32,114,66,77,70,32,102,111,110,116,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,91,37,115,93,32,76,111,97,100,105,110,103,32,114,66,77,70,32,102,105,108,101,44,32,115,105,122,101,58,32,37,105,120,37,105,44,32,110,117,109,67,104,97,114,115,58,32,37,105,44,32,99,104,97,114,72,101,105,103,104,116,58,32,37,105,0,91,37,115,93,32,73,109,97,103,101,32,114,101,99,111,110,115,116,114,117,99,116,101,100,32,99,111,114,114,101,99,116,108,121,44,32,110,111,119,32,99,111,110,118,101,114,116,105,110,103,32,105,116,32,116,111,32,116,101,120,116,117,114,101,0,91,37,115,93,32,114,66,77,70,32,102,105,108,101,32,108,111,97,100,101,100,32,99,111,114,114,101,99,116,108,121,32,97,115,32,83,112,114,105,116,101,70,111,110,116,0,122,45,62,100,105,114,101,99,116,105,111,110,0,115,116,98,116,116,95,95,114,97,115,116,101,114,105,122,101,95,115,111,114,116,101,100,95,101,100,103,101,115,0,122,45,62,101,121,32,62,61,32,115,99,97,110,95,121,95,116,111,112,0,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,115,116,98,116,116,95,95,102,105,108,108,95,97,99,116,105,118,101,95,101,100,103,101,115,95,110,101,119,0,101,45,62,115,121,32,60,61,32,121,95,98,111,116,116,111,109,32,38,38,32,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,120,32,62,61,32,48,32,38,38,32,120,32,60,32,108,101,110,0,102,97,98,115,40,97,114,101,97,41,32,60,61,32,49,46,48,49,102,0,121,48,32,60,32,121,49,0,115,116,98,116,116,95,95,104,97,110,100,108,101,95,99,108,105,112,112,101,100,95,101,100,103,101,0,101,45,62,115,121,32,60,61,32,101,45,62,101,121,0,120,49,32,60,61,32,120,43,49,0,120,49,32,62,61,32,120,0,120,49,32,60,61,32,120,0,120,49,32,62,61,32,120,43,49,0,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,120,48,32,62,61,32,120,32,38,38,32,120,48,32,60,61,32,120,43,49,32,38,38,32,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,122,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,115,116,98,116,116,95,95,110,101,119,95,97,99,116,105,118,101,0,91,86,65,79,32,73,68,32,37,105,93,32,76,105,110,101,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,76,105,110,101,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,65,79,32,73,68,32,37,105,93,32,84,114,105,97,110,103,108,101,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,84,114,105,97,110,103,108,101,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,65,79,32,73,68,32,37,105,93,32,81,117,97,100,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,81,117,97,100,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,67,80,85,32,98,117,102,102,101,114,115,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,78,111,114,109,97,108,59,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,10,125,32,32,32,32,32,32], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+11910);
/* memory initializer */ allocate([32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,105,109,112,108,101,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,105,109,112,108,101,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,84,105,110,116,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,67,111,108,111,114,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,114,119,97], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+22150);
/* memory initializer */ allocate([17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,46,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+29981);
/* no memory initializer */
var tempDoublePtr = Runtime.alignMemory(allocate(12, "i8", ALLOC_STATIC), 8);
assert(tempDoublePtr % 8 == 0);
function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
HEAP8[tempDoublePtr] = HEAP8[ptr];
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
}
function copyTempDouble(ptr) {
HEAP8[tempDoublePtr] = HEAP8[ptr];
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
}
// {{PRE_LIBRARY}}
var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},packAlignment:4,unpackAlignment:4,init:function () {
GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
}
},recordError:function recordError(errorCode) {
if (!GL.lastError) {
GL.lastError = errorCode;
}
},getNewId:function (table) {
var ret = GL.counter++;
for (var i = table.length; i < ret; i++) {
table[i] = null;
}
return ret;
},MINI_TEMP_BUFFER_SIZE:16,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
var source = '';
for (var i = 0; i < count; ++i) {
var frag;
if (length) {
var len = HEAP32[(((length)+(i*4))>>2)];
if (len < 0) {
frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
} else {
frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
}
} else {
frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
}
source += frag;
}
return source;
},createContext:function (canvas, webGLContextAttributes) {
if (typeof webGLContextAttributes.majorVersion === 'undefined' && typeof webGLContextAttributes.minorVersion === 'undefined') {
webGLContextAttributes.majorVersion = 1;
webGLContextAttributes.minorVersion = 0;
}
var ctx;
var errorInfo = '?';
function onContextCreationError(event) {
errorInfo = event.statusMessage || errorInfo;
}
try {
canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
try {
if (webGLContextAttributes.majorVersion == 1 && webGLContextAttributes.minorVersion == 0) {
ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
} else if (webGLContextAttributes.majorVersion == 2 && webGLContextAttributes.minorVersion == 0) {
ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
} else {
throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
}
} finally {
canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
}
if (!ctx) throw ':(';
} catch (e) {
Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
return 0;
}
// possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
if (!ctx) return 0;
return GL.registerContext(ctx, webGLContextAttributes);
},registerContext:function (ctx, webGLContextAttributes) {
var handle = GL.getNewId(GL.contexts);
var context = {
handle: handle,
version: webGLContextAttributes.majorVersion,
GLctx: ctx
};
// Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
if (ctx.canvas) ctx.canvas.GLctxObject = context;
GL.contexts[handle] = context;
if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) {
GL.initExtensions(context);
}
return handle;
},makeContextCurrent:function (contextHandle) {
var context = GL.contexts[contextHandle];
if (!context) return false;
GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
GL.currentContext = context; // Active Emscripten GL layer context object.
return true;
},getContext:function (contextHandle) {
return GL.contexts[contextHandle];
},deleteContext:function (contextHandle) {
if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
GL.contexts[contextHandle] = null;
},initExtensions:function (context) {
// If this function is called without a specific context object, init the extensions of the currently active context.
if (!context) context = GL.currentContext;
if (context.initExtensionsDone) return;
context.initExtensionsDone = true;
var GLctx = context.GLctx;
context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
// Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
if (context.version < 2) {
// Extension available from Firefox 26 and Google Chrome 30
var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
if (instancedArraysExt) {
GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
}
// Extension available from Firefox 25 and WebKit
var vaoExt = GLctx.getExtension('OES_vertex_array_object');
if (vaoExt) {
GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
}
var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
if (drawBuffersExt) {
GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
}
}
// These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
// should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
// As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
// here, as long as they don't produce a performance impact for users that might not be using those extensions.
// E.g. debugging-related extensions should probably be off by default.
var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
"OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
"OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
"OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
"WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
"EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
"EXT_shader_texture_lod" ];
function shouldEnableAutomatically(extension) {
var ret = false;
automaticallyEnabledExtensions.forEach(function(include) {
if (ext.indexOf(include) != -1) {
ret = true;
}
});
return ret;
}
var exts = GLctx.getSupportedExtensions();
if (exts && exts.length > 0) {
GLctx.getSupportedExtensions().forEach(function(ext) {
if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
}
});
}
},populateUniformTable:function (program) {
var p = GL.programs[program];
GL.programInfos[program] = {
uniforms: {},
maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
maxAttributeLength: -1 // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
};
var ptable = GL.programInfos[program];
var utable = ptable.uniforms;
// A program's uniform table maps the string name of an uniform to an integer location of that uniform.
// The global GL.uniforms map maps integer locations to WebGLUniformLocations.
var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
for (var i = 0; i < numUniforms; ++i) {
var u = GLctx.getActiveUniform(p, i);
var name = u.name;
ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
// Strip off any trailing array specifier we might have got, e.g. "[0]".
if (name.indexOf(']', name.length-1) !== -1) {
var ls = name.lastIndexOf('[');
name = name.slice(0, ls);
}
// Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
// only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
// Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
var loc = GLctx.getUniformLocation(p, name);
var id = GL.getNewId(GL.uniforms);
utable[name] = [u.size, id];
GL.uniforms[id] = loc;
for (var j = 1; j < u.size; ++j) {
var n = name + '['+j+']';
loc = GLctx.getUniformLocation(p, n);
id = GL.getNewId(GL.uniforms);
GL.uniforms[id] = loc;
}
}
}};function _emscripten_glIsRenderbuffer(renderbuffer) {
var rb = GL.renderbuffers[renderbuffer];
if (!rb) return 0;
return GLctx.isRenderbuffer(rb);
}
function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx.stencilMaskSeparate(x0, x1) }
var _ceilf=Math_ceil;
function _emscripten_get_now() {
if (!_emscripten_get_now.actual) {
if (ENVIRONMENT_IS_NODE) {
_emscripten_get_now.actual = function _emscripten_get_now_actual() {
var t = process['hrtime']();
return t[0] * 1e3 + t[1] / 1e6;
}
} else if (typeof dateNow !== 'undefined') {
_emscripten_get_now.actual = dateNow;
} else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
_emscripten_get_now.actual = function _emscripten_get_now_actual() { return self['performance']['now'](); };
} else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
_emscripten_get_now.actual = function _emscripten_get_now_actual() { return performance['now'](); };
} else {
_emscripten_get_now.actual = Date.now;
}
}
return _emscripten_get_now.actual();
}var GLFW={Window:function (id, width, height, title, monitor, share) {
this.id = id;
this.x = 0;
this.y = 0;
this.storedX = 0; // Used to store X before fullscreen
this.storedY = 0; // Used to store Y before fullscreen
this.width = width;
this.height = height;
this.storedWidth = width; // Used to store width before fullscreen
this.storedHeight = height; // Used to store height before fullscreen
this.title = title;
this.monitor = monitor;
this.share = share;
this.attributes = GLFW.hints;
this.inputModes = {
0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
0x00033002:0, // GLFW_STICKY_KEYS
0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
};
this.buttons = 0;
this.keys = new Array();
this.shouldClose = 0;
this.title = null;
this.windowPosFunc = null; // GLFWwindowposfun
this.windowSizeFunc = null; // GLFWwindowsizefun
this.windowCloseFunc = null; // GLFWwindowclosefun
this.windowRefreshFunc = null; // GLFWwindowrefreshfun
this.windowFocusFunc = null; // GLFWwindowfocusfun
this.windowIconifyFunc = null; // GLFWwindowiconifyfun
this.framebufferSizeFunc = null; // GLFWframebuffersizefun
this.mouseButtonFunc = null; // GLFWmousebuttonfun
this.cursorPosFunc = null; // GLFWcursorposfun
this.cursorEnterFunc = null; // GLFWcursorenterfun
this.scrollFunc = null; // GLFWscrollfun
this.keyFunc = null; // GLFWkeyfun
this.charFunc = null; // GLFWcharfun
this.userptr = null;
},WindowFromId:function (id) {
if (id <= 0 || !GLFW.windows) return null;
return GLFW.windows[id - 1];
},errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
switch (keycode) {
case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
case 0x61:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
// case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
// case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
// case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
// case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
// case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
// case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
// XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
default:return -1; // GLFW_KEY_UNKNOWN
};
},getModBits:function (win) {
var mod = 0;
if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
return mod;
},onKeyPress:function (event) {
if (!GLFW.active || !GLFW.active.charFunc) return;
// correct unicode charCode is only available with onKeyPress event
var charCode = event.charCode;
if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
Runtime.dynCall('vii', GLFW.active.charFunc, [GLFW.active.id, charCode]);
},onKeyChanged:function (event, status) {
if (!GLFW.active) return;
var key = GLFW.DOMToGLFWKeyCode(event.keyCode);
if (key == -1) return;
GLFW.active.keys[key] = status;
if (!GLFW.active.keyFunc) return;
Runtime.dynCall('viiiii', GLFW.active.keyFunc, [GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active)]);
},onKeydown:function (event) {
GLFW.onKeyChanged(event, 1); // GLFW_PRESS
// This logic comes directly from the sdl implementation. We cannot
// call preventDefault on all keydown events otherwise onKeyPress will
// not get called
if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
event.preventDefault();
}
},onKeyup:function (event) {
GLFW.onKeyChanged(event, 0); // GLFW_RELEASE
},onMousemove:function (event) {
if (!GLFW.active) return;
Browser.calculateMouseEvent(event);
if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
Runtime.dynCall('vidd', GLFW.active.cursorPosFunc, [GLFW.active.id, Browser.mouseX, Browser.mouseY]);
},onMouseButtonChanged:function (event, status) {
if (!GLFW.active || !GLFW.active.mouseButtonFunc) return;
Browser.calculateMouseEvent(event);
if (event.target != Module["canvas"]) return;
if (status == 1) { // GLFW_PRESS
try {
event.target.setCapture();
} catch (e) {}
}
// DOM and glfw have different button codes
var eventButton = event['button'];
if (eventButton > 0) {
if (eventButton == 1) {
eventButton = 2;
} else {
eventButton = 1;
}
}
Runtime.dynCall('viiii', GLFW.active.mouseButtonFunc, [GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)]);
},onMouseButtonDown:function (event) {
if (!GLFW.active) return;
GLFW.active.buttons |= (1 << event['button']);
GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
},onMouseButtonUp:function (event) {
if (!GLFW.active) return;
GLFW.active.buttons &= ~(1 << event['button']);
GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
},onMouseWheel:function (event) {
// Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
var delta = -Browser.getMouseWheelDelta(event);
delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
GLFW.wheelPos += delta;
if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
var sx = 0;
var sy = 0;
if (event.type == 'mousewheel') {
sx = event.wheelDeltaX;
sy = event.wheelDeltaY;
} else {
sx = event.deltaX;
sy = event.deltaY;
}
Runtime.dynCall('vidd', GLFW.active.scrollFunc, [GLFW.active.id, sx, sy]);
event.preventDefault();
},onFullScreenEventChange:function () {
if (!GLFW.active) return;
if (document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
GLFW.active.storedX = GLFW.active.x;
GLFW.active.storedY = GLFW.active.y;
GLFW.active.storedWidth = GLFW.active.width;
GLFW.active.storedHeight = GLFW.active.height;
GLFW.active.x = GLFW.active.y = 0;
GLFW.active.width = screen.width;
GLFW.active.height = screen.height;
} else {
GLFW.active.x = GLFW.active.storedX;
GLFW.active.y = GLFW.active.storedY;
GLFW.active.width = GLFW.active.storedWidth;
GLFW.active.height = GLFW.active.storedHeight;
}
Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
if (!GLFW.active.windowSizeFunc) return;
Runtime.dynCall('viii', GLFW.active.windowSizeFunc, [GLFW.active.id, GLFW.active.width, GLFW.active.height]);
},requestFullScreen:function () {
var RFS = Module["canvas"]['requestFullscreen'] ||
Module["canvas"]['requestFullScreen'] ||
Module["canvas"]['mozRequestFullScreen'] ||
Module["canvas"]['webkitRequestFullScreen'] ||
(function() {});
RFS.apply(Module["canvas"], []);
},cancelFullScreen:function () {
var CFS = document['exitFullscreen'] ||
document['cancelFullScreen'] ||
document['mozCancelFullScreen'] ||
document['webkitCancelFullScreen'] ||
(function() {});
CFS.apply(document, []);
},getTime:function () {
return _emscripten_get_now() / 1000;
},setWindowTitle:function (winid, title) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.title = Pointer_stringify(title);
if (GLFW.active.id == win.id) {
document.title = win.title;
}
},setKeyCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.keyFunc = cbfun;
},setCharCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.charFunc = cbfun;
},setMouseButtonCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.mouseButtonFunc = cbfun;
},setCursorPosCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.cursorPosFunc = cbfun;
},setScrollCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.scrollFunc = cbfun;
},setWindowSizeCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.windowSizeFunc = cbfun;
},setWindowCloseCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.windowCloseFunc = cbfun;
},setWindowRefreshCallback:function (winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.windowRefreshFunc = cbfun;
},getKey:function (winid, key) {
var win = GLFW.WindowFromId(winid);
if (!win) return 0;
return win.keys[key];
},getMouseButton:function (winid, button) {
var win = GLFW.WindowFromId(winid);
if (!win) return 0;
return (win.buttons & (1 << button)) > 0;
},getCursorPos:function (winid, x, y) {
setValue(x, Browser.mouseX, 'double');
setValue(y, Browser.mouseY, 'double');
},getMousePos:function (winid, x, y) {
setValue(x, Browser.mouseX, 'i32');
setValue(y, Browser.mouseY, 'i32');
},setCursorPos:function (winid, x, y) {
},getWindowPos:function (winid, x, y) {
var wx = 0;
var wy = 0;
var win = GLFW.WindowFromId(winid);
if (win) {
wx = win.x;
wy = win.y;
}
setValue(x, wx, 'i32');
setValue(y, wy, 'i32');
},setWindowPos:function (winid, x, y) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.x = x;
win.y = y;
},getWindowSize:function (winid, width, height) {
var ww = 0;
var wh = 0;
var win = GLFW.WindowFromId(winid);
if (win) {
ww = win.width;
wh = win.height;
}
setValue(width, ww, 'i32');
setValue(height, wh, 'i32');
},setWindowSize:function (winid, width, height) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
if (GLFW.active.id == win.id) {
if (width == screen.width && height == screen.height) {
GLFW.requestFullScreen();
} else {
GLFW.cancelFullScreen();
Browser.setCanvasSize(width, height);
win.width = width;
win.height = height;
}
}
if (!win.windowResizeFunc) return;
Runtime.dynCall('viii', win.windowResizeFunc, [win.id, width, height]);
},createWindow:function (width, height, title, monitor, share) {
var i, id;
for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
// id for window
id = i + 1;
// not valid
if (width <= 0 || height <= 0) return 0;
if (monitor) {
GLFW.requestFullScreen();
} else {
Browser.setCanvasSize(width, height);
}
// Create context when there are no existing alive windows
for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
if (i == GLFW.windows.length) {
var contextAttributes = {
antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS
stencil: (GLFW.hints[0x00021006] > 0) // GLFW_STENCIL_BITS
}
Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
}
// If context creation failed, do not return a valid window
if (!Module.ctx) return 0;
// Get non alive id
var win = new GLFW.Window(id, width, height, title, monitor, share);
// Set window to array
if (id - 1 == GLFW.windows.length) {
GLFW.windows.push(win);
} else {
GLFW.windows[id - 1] = win;
}
GLFW.active = win;
return win.id;
},destroyWindow:function (winid) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
if (win.windowCloseFunc)
Runtime.dynCall('vi', win.windowCloseFunc, [win.id]);
GLFW.windows[win.id - 1] = null;
if (GLFW.active.id == win.id)
GLFW.active = null;
// Destroy context when no alive windows
for (var i = 0; i < GLFW.windows.length; i++)
if (GLFW.windows[i] !== null) return;
Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
},swapBuffers:function (winid) {
},GLFW2ParamToGLFW3Param:function (param) {
table = {
0x00030001:0, // GLFW_MOUSE_CURSOR
0x00030002:0, // GLFW_STICKY_KEYS
0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
0x00030004:0, // GLFW_SYSTEM_KEYS
0x00030005:0, // GLFW_KEY_REPEAT
0x00030006:0, // GLFW_AUTO_POLL_EVENTS
0x00020001:0, // GLFW_OPENED
0x00020002:0, // GLFW_ACTIVE
0x00020003:0, // GLFW_ICONIFIED
0x00020004:0, // GLFW_ACCELERATED
0x00020005:0x00021001, // GLFW_RED_BITS
0x00020006:0x00021002, // GLFW_GREEN_BITS
0x00020007:0x00021003, // GLFW_BLUE_BITS
0x00020008:0x00021004, // GLFW_ALPHA_BITS
0x00020009:0x00021005, // GLFW_DEPTH_BITS
0x0002000A:0x00021006, // GLFW_STENCIL_BITS
0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
0x00020011:0x0002100C, // GLFW_STEREO
0x00020012:0, // GLFW_WINDOW_NO_RESIZE
0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
};
return table[param];
}};function _glfwGetVideoModes(monitor, count) {
setValue(count, 0, 'i32');
return 0;
}
function _glLinkProgram(program) {
GLctx.linkProgram(GL.programs[program]);
GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
GL.populateUniformTable(program);
}
function _glBindTexture(target, texture) {
GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
}
function _emscripten_glStencilFunc(x0, x1, x2) { GLctx.stencilFunc(x0, x1, x2) }
function _glGetString(name_) {
if (GL.stringCache[name_]) return GL.stringCache[name_];
var ret;
switch(name_) {
case 0x1F00 /* GL_VENDOR */:
case 0x1F01 /* GL_RENDERER */:
case 0x1F02 /* GL_VERSION */:
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
break;
case 0x1F03 /* GL_EXTENSIONS */:
var exts = GLctx.getSupportedExtensions();
var gl_exts = [];
for (var i in exts) {
gl_exts.push(exts[i]);
gl_exts.push("GL_" + exts[i]);
}
ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
break;
case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL);
break;
default:
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
return 0;
}
GL.stringCache[name_] = ret;
return ret;
}
function _emscripten_glUniform3iv(location, count, value) {
location = GL.uniforms[location];
count *= 3;
value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
GLctx.uniform3iv(location, value);
}
function _emscripten_glShaderSource(shader, count, string, length) {
var source = GL.getSource(shader, count, string, length);
GLctx.shaderSource(GL.shaders[shader], source);
}
function _emscripten_glReleaseShaderCompiler() {
// NOP (as allowed by GLES 2.0 spec)
}
function _glfwSetScrollCallback(winid, cbfun) {
GLFW.setScrollCallback(winid, cbfun);
}
function _emscripten_glTexParameterf(x0, x1, x2) { GLctx.texParameterf(x0, x1, x2) }
function _emscripten_glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) }
function _glCompileShader(shader) {
GLctx.compileShader(GL.shaders[shader]);
}
var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
function ___setErrNo(value) {
if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
return value;
}
var PATH={splitPath:function (filename) {
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
return splitPathRe.exec(filename).slice(1);
},normalizeArray:function (parts, allowAboveRoot) {
// if the path tries to go above the root, `up` ends up > 0
var up = 0;
for (var i = parts.length - 1; i >= 0; i--) {
var last = parts[i];
if (last === '.') {
parts.splice(i, 1);
} else if (last === '..') {
parts.splice(i, 1);
up++;
} else if (up) {
parts.splice(i, 1);
up--;
}
}
// if the path is allowed to go above the root, restore leading ..s
if (allowAboveRoot) {
for (; up--; up) {
parts.unshift('..');
}
}
return parts;
},normalize:function (path) {
var isAbsolute = path.charAt(0) === '/',
trailingSlash = path.substr(-1) === '/';
// Normalize the path
path = PATH.normalizeArray(path.split('/').filter(function(p) {
return !!p;
}), !isAbsolute).join('/');
if (!path && !isAbsolute) {
path = '.';
}
if (path && trailingSlash) {
path += '/';
}
return (isAbsolute ? '/' : '') + path;
},dirname:function (path) {
var result = PATH.splitPath(path),
root = result[0],
dir = result[1];
if (!root && !dir) {
// No dirname whatsoever
return '.';
}
if (dir) {
// It has a dirname, strip trailing slash
dir = dir.substr(0, dir.length - 1);
}
return root + dir;
},basename:function (path) {
// EMSCRIPTEN return '/'' for '/', not an empty string
if (path === '/') return '/';
var lastSlash = path.lastIndexOf('/');
if (lastSlash === -1) return path;
return path.substr(lastSlash+1);
},extname:function (path) {
return PATH.splitPath(path)[3];
},join:function () {
var paths = Array.prototype.slice.call(arguments, 0);
return PATH.normalize(paths.join('/'));
},join2:function (l, r) {
return PATH.normalize(l + '/' + r);
},resolve:function () {
var resolvedPath = '',
resolvedAbsolute = false;
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
var path = (i >= 0) ? arguments[i] : FS.cwd();
// Skip empty and invalid entries
if (typeof path !== 'string') {
throw new TypeError('Arguments to path.resolve must be strings');
} else if (!path) {
return ''; // an invalid portion invalidates the whole thing
}
resolvedPath = path + '/' + resolvedPath;
resolvedAbsolute = path.charAt(0) === '/';
}
// At this point the path should be resolved to a full absolute path, but
// handle relative paths to be safe (might happen when process.cwd() fails)
resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
return !!p;
}), !resolvedAbsolute).join('/');
return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
},relative:function (from, to) {
from = PATH.resolve(from).substr(1);
to = PATH.resolve(to).substr(1);
function trim(arr) {
var start = 0;
for (; start < arr.length; start++) {
if (arr[start] !== '') break;
}
var end = arr.length - 1;
for (; end >= 0; end--) {
if (arr[end] !== '') break;
}
if (start > end) return [];
return arr.slice(start, end - start + 1);
}
var fromParts = trim(from.split('/'));
var toParts = trim(to.split('/'));
var length = Math.min(fromParts.length, toParts.length);
var samePartsLength = length;
for (var i = 0; i < length; i++) {
if (fromParts[i] !== toParts[i]) {
samePartsLength = i;
break;
}
}
var outputParts = [];
for (var i = samePartsLength; i < fromParts.length; i++) {
outputParts.push('..');
}
outputParts = outputParts.concat(toParts.slice(samePartsLength));
return outputParts.join('/');
}};
var TTY={ttys:[],init:function () {
// https://github.com/kripken/emscripten/pull/1555
// if (ENVIRONMENT_IS_NODE) {
// // currently, FS.init does not distinguish if process.stdin is a file or TTY
// // device, it always assumes it's a TTY device. because of this, we're forcing
// // process.stdin to UTF8 encoding to at least make stdin reading compatible
// // with text files until FS.init can be refactored.
// process['stdin']['setEncoding']('utf8');
// }
},shutdown:function () {
// https://github.com/kripken/emscripten/pull/1555
// if (ENVIRONMENT_IS_NODE) {
// // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
// // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
// // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
// // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
// // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
// process['stdin']['pause']();
// }
},register:function (dev, ops) {
TTY.ttys[dev] = { input: [], output: [], ops: ops };
FS.registerDevice(dev, TTY.stream_ops);
},stream_ops:{open:function (stream) {
var tty = TTY.ttys[stream.node.rdev];
if (!tty) {
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
}
stream.tty = tty;
stream.seekable = false;
},close:function (stream) {
// flush any pending line data
stream.tty.ops.flush(stream.tty);
},flush:function (stream) {
stream.tty.ops.flush(stream.tty);
},read:function (stream, buffer, offset, length, pos /* ignored */) {
if (!stream.tty || !stream.tty.ops.get_char) {
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
}
var bytesRead = 0;
for (var i = 0; i < length; i++) {
var result;
try {
result = stream.tty.ops.get_char(stream.tty);
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
}
if (result === undefined && bytesRead === 0) {
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
}
if (result === null || result === undefined) break;
bytesRead++;
buffer[offset+i] = result;
}
if (bytesRead) {
stream.node.timestamp = Date.now();
}
return bytesRead;
},write:function (stream, buffer, offset, length, pos) {
if (!stream.tty || !stream.tty.ops.put_char) {
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
}
for (var i = 0; i < length; i++) {
try {
stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
}
}
if (length) {
stream.node.timestamp = Date.now();
}
return i;
}},default_tty_ops:{get_char:function (tty) {
if (!tty.input.length) {
var result = null;
if (ENVIRONMENT_IS_NODE) {
// we will read data by chunks of BUFSIZE
var BUFSIZE = 256;
var buf = new Buffer(BUFSIZE);
var bytesRead = 0;
var fd = process.stdin.fd;
// Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
var usingDevice = false;
try {
fd = fs.openSync('/dev/stdin', 'r');
usingDevice = true;
} catch (e) {}
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
if (usingDevice) { fs.closeSync(fd); }
if (bytesRead > 0) {
result = buf.slice(0, bytesRead).toString('utf-8');
} else {
result = null;
}
} else if (typeof window != 'undefined' &&
typeof window.prompt == 'function') {
// Browser.
result = window.prompt('Input: '); // returns null on cancel
if (result !== null) {
result += '\n';
}
} else if (typeof readline == 'function') {
// Command line.
result = readline();
if (result !== null) {
result += '\n';
}
}
if (!result) {
return null;
}
tty.input = intArrayFromString(result, true);
}
return tty.input.shift();
},put_char:function (tty, val) {
if (val === null || val === 10) {
Module['print'](UTF8ArrayToString(tty.output, 0));
tty.output = [];
} else {
if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
}
},flush:function (tty) {
if (tty.output && tty.output.length > 0) {
Module['print'](UTF8ArrayToString(tty.output, 0));
tty.output = [];
}
}},default_tty1_ops:{put_char:function (tty, val) {
if (val === null || val === 10) {
Module['printErr'](UTF8ArrayToString(tty.output, 0));
tty.output = [];
} else {
if (val != 0) tty.output.push(val);
}
},flush:function (tty) {
if (tty.output && tty.output.length > 0) {
Module['printErr'](UTF8ArrayToString(tty.output, 0));
tty.output = [];
}
}}};
var MEMFS={ops_table:null,mount:function (mount) {
return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
},createNode:function (parent, name, mode, dev) {
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
// no supported
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
if (!MEMFS.ops_table) {
MEMFS.ops_table = {
dir: {
node: {
getattr: MEMFS.node_ops.getattr,
setattr: MEMFS.node_ops.setattr,
lookup: MEMFS.node_ops.lookup,
mknod: MEMFS.node_ops.mknod,
rename: MEMFS.node_ops.rename,
unlink: MEMFS.node_ops.unlink,
rmdir: MEMFS.node_ops.rmdir,
readdir: MEMFS.node_ops.readdir,
symlink: MEMFS.node_ops.symlink
},
stream: {
llseek: MEMFS.stream_ops.llseek
}
},
file: {
node: {
getattr: MEMFS.node_ops.getattr,
setattr: MEMFS.node_ops.setattr
},
stream: {
llseek: MEMFS.stream_ops.llseek,
read: MEMFS.stream_ops.read,
write: MEMFS.stream_ops.write,
allocate: MEMFS.stream_ops.allocate,
mmap: MEMFS.stream_ops.mmap,
msync: MEMFS.stream_ops.msync
}
},
link: {
node: {
getattr: MEMFS.node_ops.getattr,
setattr: MEMFS.node_ops.setattr,
readlink: MEMFS.node_ops.readlink
},
stream: {}
},
chrdev: {
node: {
getattr: MEMFS.node_ops.getattr,
setattr: MEMFS.node_ops.setattr
},
stream: FS.chrdev_stream_ops
}
};
}
var node = FS.createNode(parent, name, mode, dev);
if (FS.isDir(node.mode)) {
node.node_ops = MEMFS.ops_table.dir.node;
node.stream_ops = MEMFS.ops_table.dir.stream;
node.contents = {};
} else if (FS.isFile(node.mode)) {
node.node_ops = MEMFS.ops_table.file.node;
node.stream_ops = MEMFS.ops_table.file.stream;
node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.buffer.byteLength which gives the whole capacity.
// When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
// for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
// penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
node.contents = null;
} else if (FS.isLink(node.mode)) {
node.node_ops = MEMFS.ops_table.link.node;
node.stream_ops = MEMFS.ops_table.link.stream;
} else if (FS.isChrdev(node.mode)) {
node.node_ops = MEMFS.ops_table.chrdev.node;
node.stream_ops = MEMFS.ops_table.chrdev.stream;
}
node.timestamp = Date.now();
// add the new node to the parent
if (parent) {
parent.contents[name] = node;
}
return node;
},getFileDataAsRegularArray:function (node) {
if (node.contents && node.contents.subarray) {
var arr = [];
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
return arr; // Returns a copy of the original data.
}
return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
},getFileDataAsTypedArray:function (node) {
if (!node.contents) return new Uint8Array;
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
return new Uint8Array(node.contents);
},expandFileStorage:function (node, newCapacity) {
// If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
// instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
// increase the size.
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
node.contents = MEMFS.getFileDataAsRegularArray(node);
node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
}
if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
var prevCapacity = node.contents ? node.contents.buffer.byteLength : 0;
if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
// Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
// For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
// avoid overshooting the allocation cap by a very large margin.
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
var oldContents = node.contents;
node.contents = new Uint8Array(newCapacity); // Allocate new storage.
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
return;
}
// Not using a typed array to back the file storage. Use a standard JS array instead.
if (!node.contents && newCapacity > 0) node.contents = [];
while (node.contents.length < newCapacity) node.contents.push(0);
},resizeFileStorage:function (node, newSize) {
if (node.usedBytes == newSize) return;
if (newSize == 0) {
node.contents = null; // Fully decommit when requesting a resize to zero.
node.usedBytes = 0;
return;
}
if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
var oldContents = node.contents;
node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
if (oldContents) {
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
}
node.usedBytes = newSize;
return;
}
// Backing with a JS array.
if (!node.contents) node.contents = [];
if (node.contents.length > newSize) node.contents.length = newSize;
else while (node.contents.length < newSize) node.contents.push(0);
node.usedBytes = newSize;
},node_ops:{getattr:function (node) {
var attr = {};
// device numbers reuse inode numbers.
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
attr.ino = node.id;
attr.mode = node.mode;
attr.nlink = 1;
attr.uid = 0;
attr.gid = 0;
attr.rdev = node.rdev;
if (FS.isDir(node.mode)) {
attr.size = 4096;
} else if (FS.isFile(node.mode)) {
attr.size = node.usedBytes;
} else if (FS.isLink(node.mode)) {
attr.size = node.link.length;
} else {
attr.size = 0;
}
attr.atime = new Date(node.timestamp);
attr.mtime = new Date(node.timestamp);
attr.ctime = new Date(node.timestamp);
// NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
// but this is not required by the standard.
attr.blksize = 4096;
attr.blocks = Math.ceil(attr.size / attr.blksize);
return attr;
},setattr:function (node, attr) {
if (attr.mode !== undefined) {
node.mode = attr.mode;
}
if (attr.timestamp !== undefined) {
node.timestamp = attr.timestamp;
}
if (attr.size !== undefined) {
MEMFS.resizeFileStorage(node, attr.size);
}
},lookup:function (parent, name) {
throw FS.genericErrors[ERRNO_CODES.ENOENT];
},mknod:function (parent, name, mode, dev) {
return MEMFS.createNode(parent, name, mode, dev);
},rename:function (old_node, new_dir, new_name) {
// if we're overwriting a directory at new_name, make sure it's empty.
if (FS.isDir(old_node.mode)) {
var new_node;
try {
new_node = FS.lookupNode(new_dir, new_name);
} catch (e) {
}
if (new_node) {
for (var i in new_node.contents) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
}
}
}
// do the internal rewiring
delete old_node.parent.contents[old_node.name];
old_node.name = new_name;
new_dir.contents[new_name] = old_node;
old_node.parent = new_dir;
},unlink:function (parent, name) {
delete parent.contents[name];
},rmdir:function (parent, name) {
var node = FS.lookupNode(parent, name);
for (var i in node.contents) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
}
delete parent.contents[name];
},readdir:function (node) {
var entries = ['.', '..']
for (var key in node.contents) {
if (!node.contents.hasOwnProperty(key)) {
continue;
}
entries.push(key);
}
return entries;
},symlink:function (parent, newname, oldpath) {
var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
node.link = oldpath;
return node;
},readlink:function (node) {
if (!FS.isLink(node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
return node.link;
}},stream_ops:{read:function (stream, buffer, offset, length, position) {
var contents = stream.node.contents;
if (position >= stream.node.usedBytes) return 0;
var size = Math.min(stream.node.usedBytes - position, length);
assert(size >= 0);
if (size > 8 && contents.subarray) { // non-trivial, and typed array
buffer.set(contents.subarray(position, position + size), offset);
} else {
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
}
return size;
},write:function (stream, buffer, offset, length, position, canOwn) {
if (!length) return 0;
var node = stream.node;
node.timestamp = Date.now();
if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
if (canOwn) { // Can we just reuse the buffer we are given?
node.contents = buffer.subarray(offset, offset + length);
node.usedBytes = length;
return length;
} else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
node.usedBytes = length;
return length;
} else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
node.contents.set(buffer.subarray(offset, offset + length), position);
return length;
}
}
// Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
MEMFS.expandFileStorage(node, position+length);
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
else {
for (var i = 0; i < length; i++) {
node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
}
}
node.usedBytes = Math.max(node.usedBytes, position+length);
return length;
},llseek:function (stream, offset, whence) {
var position = offset;
if (whence === 1) { // SEEK_CUR.
position += stream.position;
} else if (whence === 2) { // SEEK_END.
if (FS.isFile(stream.node.mode)) {
position += stream.node.usedBytes;
}
}
if (position < 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
return position;
},allocate:function (stream, offset, length) {
MEMFS.expandFileStorage(stream.node, offset + length);
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
},mmap:function (stream, buffer, offset, length, position, prot, flags) {
if (!FS.isFile(stream.node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
}
var ptr;
var allocated;
var contents = stream.node.contents;
// Only make a new copy when MAP_PRIVATE is specified.
if ( !(flags & 2) &&
(contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
// We can't emulate MAP_SHARED when the file is not backed by the buffer
// we're mapping to (e.g. the HEAP buffer).
allocated = false;
ptr = contents.byteOffset;
} else {
// Try to avoid unnecessary slices.
if (position > 0 || position + length < stream.node.usedBytes) {
if (contents.subarray) {
contents = contents.subarray(position, position + length);
} else {
contents = Array.prototype.slice.call(contents, position, position + length);
}
}
allocated = true;
ptr = _malloc(length);
if (!ptr) {
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
}
buffer.set(contents, ptr);
}
return { ptr: ptr, allocated: allocated };
},msync:function (stream, buffer, offset, length, mmapFlags) {
if (!FS.isFile(stream.node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
}
if (mmapFlags & 2) {
// MAP_PRIVATE calls need not to be synced back to underlying fs
return 0;
}
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
// should we check if bytesWritten and length are the same?
return 0;
}}};
var IDBFS={dbs:{},indexedDB:function () {
if (typeof indexedDB !== 'undefined') return indexedDB;
var ret = null;
if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
assert(ret, 'IDBFS used, but indexedDB not supported');
return ret;
},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
// reuse all of the core MEMFS functionality
return MEMFS.mount.apply(null, arguments);
},syncfs:function (mount, populate, callback) {
IDBFS.getLocalSet(mount, function(err, local) {
if (err) return callback(err);
IDBFS.getRemoteSet(mount, function(err, remote) {
if (err) return callback(err);
var src = populate ? remote : local;
var dst = populate ? local : remote;
IDBFS.reconcile(src, dst, callback);
});
});
},getDB:function (name, callback) {
// check the cache first
var db = IDBFS.dbs[name];
if (db) {
return callback(null, db);
}
var req;
try {
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
} catch (e) {
return callback(e);
}
req.onupgradeneeded = function(e) {
var db = e.target.result;
var transaction = e.target.transaction;
var fileStore;
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
} else {
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
}
if (!fileStore.indexNames.contains('timestamp')) {
fileStore.createIndex('timestamp', 'timestamp', { unique: false });
}
};
req.onsuccess = function() {
db = req.result;
// add to the cache
IDBFS.dbs[name] = db;
callback(null, db);
};
req.onerror = function(e) {
callback(this.error);
e.preventDefault();
};
},getLocalSet:function (mount, callback) {
var entries = {};
function isRealDir(p) {
return p !== '.' && p !== '..';
};
function toAbsolute(root) {
return function(p) {
return PATH.join2(root, p);
}
};
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
while (check.length) {
var path = check.pop();
var stat;
try {
stat = FS.stat(path);
} catch (e) {
return callback(e);
}
if (FS.isDir(stat.mode)) {
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
}
entries[path] = { timestamp: stat.mtime };
}
return callback(null, { type: 'local', entries: entries });
},getRemoteSet:function (mount, callback) {
var entries = {};
IDBFS.getDB(mount.mountpoint, function(err, db) {
if (err) return callback(err);
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
transaction.onerror = function(e) {
callback(this.error);
e.preventDefault();
};
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
var index = store.index('timestamp');
index.openKeyCursor().onsuccess = function(event) {
var cursor = event.target.result;
if (!cursor) {
return callback(null, { type: 'remote', db: db, entries: entries });
}
entries[cursor.primaryKey] = { timestamp: cursor.key };
cursor.continue();
};
});
},loadLocalEntry:function (path, callback) {
var stat, node;
try {
var lookup = FS.lookupPath(path);
node = lookup.node;
stat = FS.stat(path);
} catch (e) {
return callback(e);
}
if (FS.isDir(stat.mode)) {
return callback(null, { timestamp: stat.mtime, mode: stat.mode });
} else if (FS.isFile(stat.mode)) {
// Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
// Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
node.contents = MEMFS.getFileDataAsTypedArray(node);
return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
} else {
return callback(new Error('node type not supported'));
}
},storeLocalEntry:function (path, entry, callback) {
try {
if (FS.isDir(entry.mode)) {
FS.mkdir(path, entry.mode);
} else if (FS.isFile(entry.mode)) {
FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
} else {
return callback(new Error('node type not supported'));
}
FS.chmod(path, entry.mode);
FS.utime(path, entry.timestamp, entry.timestamp);
} catch (e) {
return callback(e);
}
callback(null);
},removeLocalEntry:function (path, callback) {
try {
var lookup = FS.lookupPath(path);
var stat = FS.stat(path);
if (FS.isDir(stat.mode)) {
FS.rmdir(path);
} else if (FS.isFile(stat.mode)) {
FS.unlink(path);
}
} catch (e) {
return callback(e);
}
callback(null);
},loadRemoteEntry:function (store, path, callback) {
var req = store.get(path);
req.onsuccess = function(event) { callback(null, event.target.result); };
req.onerror = function(e) {
callback(this.error);
e.preventDefault();
};
},storeRemoteEntry:function (store, path, entry, callback) {
var req = store.put(entry, path);
req.onsuccess = function() { callback(null); };
req.onerror = function(e) {
callback(this.error);
e.preventDefault();
};
},removeRemoteEntry:function (store, path, callback) {
var req = store.delete(path);
req.onsuccess = function() { callback(null); };
req.onerror = function(e) {
callback(this.error);
e.preventDefault();
};
},reconcile:function (src, dst, callback) {
var total = 0;
var create = [];
Object.keys(src.entries).forEach(function (key) {
var e = src.entries[key];
var e2 = dst.entries[key];
if (!e2 || e.timestamp > e2.timestamp) {
create.push(key);
total++;
}
});
var remove = [];
Object.keys(dst.entries).forEach(function (key) {
var e = dst.entries[key];
var e2 = src.entries[key];
if (!e2) {
remove.push(key);
total++;
}
});
if (!total) {
return callback(null);
}
var errored = false;
var completed = 0;
var db = src.type === 'remote' ? src.db : dst.db;
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
function done(err) {
if (err) {
if (!done.errored) {
done.errored = true;
return callback(err);
}
return;
}
if (++completed >= total) {
return callback(null);
}
};
transaction.onerror = function(e) {
done(this.error);
e.preventDefault();
};
// sort paths in ascending order so directory entries are created
// before the files inside them
create.sort().forEach(function (path) {
if (dst.type === 'local') {
IDBFS.loadRemoteEntry(store, path, function (err, entry) {
if (err) return done(err);
IDBFS.storeLocalEntry(path, entry, done);
});
} else {
IDBFS.loadLocalEntry(path, function (err, entry) {
if (err) return done(err);
IDBFS.storeRemoteEntry(store, path, entry, done);
});
}
});
// sort paths in descending order so files are deleted before their
// parent directories
remove.sort().reverse().forEach(function(path) {
if (dst.type === 'local') {
IDBFS.removeLocalEntry(path, done);
} else {
IDBFS.removeRemoteEntry(store, path, done);
}
});
}};
var NODEFS={isWindows:false,staticInit:function () {
NODEFS.isWindows = !!process.platform.match(/^win/);
},mount:function (mount) {
assert(ENVIRONMENT_IS_NODE);
return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
},createNode:function (parent, name, mode, dev) {
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
var node = FS.createNode(parent, name, mode);
node.node_ops = NODEFS.node_ops;
node.stream_ops = NODEFS.stream_ops;
return node;
},getMode:function (path) {
var stat;
try {
stat = fs.lstatSync(path);
if (NODEFS.isWindows) {
// On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
// propagate write bits to execute bits.
stat.mode = stat.mode | ((stat.mode & 146) >> 1);
}
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
return stat.mode;
},realPath:function (node) {
var parts = [];
while (node.parent !== node) {
parts.push(node.name);
node = node.parent;
}
parts.push(node.mount.opts.root);
parts.reverse();
return PATH.join.apply(null, parts);
},flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
flags &= ~0100000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
if (flags in NODEFS.flagsToPermissionStringMap) {
return NODEFS.flagsToPermissionStringMap[flags];
} else {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
},node_ops:{getattr:function (node) {
var path = NODEFS.realPath(node);
var stat;
try {
stat = fs.lstatSync(path);
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
// node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
// See http://support.microsoft.com/kb/140365
if (NODEFS.isWindows && !stat.blksize) {
stat.blksize = 4096;
}
if (NODEFS.isWindows && !stat.blocks) {
stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
}
return {
dev: stat.dev,
ino: stat.ino,
mode: stat.mode,
nlink: stat.nlink,
uid: stat.uid,
gid: stat.gid,
rdev: stat.rdev,
size: stat.size,
atime: stat.atime,
mtime: stat.mtime,
ctime: stat.ctime,
blksize: stat.blksize,
blocks: stat.blocks
};
},setattr:function (node, attr) {
var path = NODEFS.realPath(node);
try {
if (attr.mode !== undefined) {
fs.chmodSync(path, attr.mode);
// update the common node structure mode as well
node.mode = attr.mode;
}
if (attr.timestamp !== undefined) {
var date = new Date(attr.timestamp);
fs.utimesSync(path, date, date);
}
if (attr.size !== undefined) {
fs.truncateSync(path, attr.size);
}
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},lookup:function (parent, name) {
var path = PATH.join2(NODEFS.realPath(parent), name);
var mode = NODEFS.getMode(path);
return NODEFS.createNode(parent, name, mode);
},mknod:function (parent, name, mode, dev) {
var node = NODEFS.createNode(parent, name, mode, dev);
// create the backing node for this in the fs root as well
var path = NODEFS.realPath(node);
try {
if (FS.isDir(node.mode)) {
fs.mkdirSync(path, node.mode);
} else {
fs.writeFileSync(path, '', { mode: node.mode });
}
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
return node;
},rename:function (oldNode, newDir, newName) {
var oldPath = NODEFS.realPath(oldNode);
var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
try {
fs.renameSync(oldPath, newPath);
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},unlink:function (parent, name) {
var path = PATH.join2(NODEFS.realPath(parent), name);
try {
fs.unlinkSync(path);
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},rmdir:function (parent, name) {
var path = PATH.join2(NODEFS.realPath(parent), name);
try {
fs.rmdirSync(path);
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},readdir:function (node) {
var path = NODEFS.realPath(node);
try {
return fs.readdirSync(path);
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},symlink:function (parent, newName, oldPath) {
var newPath = PATH.join2(NODEFS.realPath(parent), newName);
try {
fs.symlinkSync(oldPath, newPath);
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},readlink:function (node) {
var path = NODEFS.realPath(node);
try {
path = fs.readlinkSync(path);
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
return path;
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
}},stream_ops:{open:function (stream) {
var path = NODEFS.realPath(stream.node);
try {
if (FS.isFile(stream.node.mode)) {
stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
}
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},close:function (stream) {
try {
if (FS.isFile(stream.node.mode) && stream.nfd) {
fs.closeSync(stream.nfd);
}
} catch (e) {
if (!e.code) throw e;
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
},read:function (stream, buffer, offset, length, position) {
if (length === 0) return 0; // node errors on 0 length reads
// FIXME this is terrible.
var nbuffer = new Buffer(length);
var res;
try {
res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
if (res > 0) {
for (var i = 0; i < res; i++) {
buffer[offset + i] = nbuffer[i];
}
}
return res;
},write:function (stream, buffer, offset, length, position) {
// FIXME this is terrible.
var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
var res;
try {
res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
return res;
},llseek:function (stream, offset, whence) {
var position = offset;
if (whence === 1) { // SEEK_CUR.
position += stream.position;
} else if (whence === 2) { // SEEK_END.
if (FS.isFile(stream.node.mode)) {
try {
var stat = fs.fstatSync(stream.nfd);
position += stat.size;
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
}
}
}
if (position < 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
return position;
}}};
var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
assert(ENVIRONMENT_IS_WORKER);
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
var createdParents = {};
function ensureParent(path) {
// return the parent node, creating subdirs as necessary
var parts = path.split('/');
var parent = root;
for (var i = 0; i < parts.length-1; i++) {
var curr = parts.slice(0, i+1).join('/');
if (!createdParents[curr]) {
createdParents[curr] = WORKERFS.createNode(parent, curr, WORKERFS.DIR_MODE, 0);
}
parent = createdParents[curr];
}
return parent;
}
function base(path) {
var parts = path.split('/');
return parts[parts.length-1];
}
// We also accept FileList here, by using Array.prototype
Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
});
(mount.opts["blobs"] || []).forEach(function(obj) {
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
});
(mount.opts["packages"] || []).forEach(function(pack) {
pack['metadata'].files.forEach(function(file) {
var name = file.filename.substr(1); // remove initial slash
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
});
});
return root;
},createNode:function (parent, name, mode, dev, contents, mtime) {
var node = FS.createNode(parent, name, mode);
node.mode = mode;
node.node_ops = WORKERFS.node_ops;
node.stream_ops = WORKERFS.stream_ops;
node.timestamp = (mtime || new Date).getTime();
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
if (mode === WORKERFS.FILE_MODE) {
node.size = contents.size;
node.contents = contents;
} else {
node.size = 4096;
node.contents = {};
}
if (parent) {
parent.contents[name] = node;
}
return node;
},node_ops:{getattr:function (node) {
return {
dev: 1,
ino: undefined,
mode: node.mode,
nlink: 1,
uid: 0,
gid: 0,
rdev: undefined,
size: node.size,
atime: new Date(node.timestamp),
mtime: new Date(node.timestamp),
ctime: new Date(node.timestamp),
blksize: 4096,
blocks: Math.ceil(node.size / 4096),
};
},setattr:function (node, attr) {
if (attr.mode !== undefined) {
node.mode = attr.mode;
}
if (attr.timestamp !== undefined) {
node.timestamp = attr.timestamp;
}
},lookup:function (parent, name) {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
},mknod:function (parent, name, mode, dev) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
},rename:function (oldNode, newDir, newName) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
},unlink:function (parent, name) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
},rmdir:function (parent, name) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
},readdir:function (node) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
},symlink:function (parent, newName, oldPath) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
},readlink:function (node) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}},stream_ops:{read:function (stream, buffer, offset, length, position) {
if (position >= stream.node.size) return 0;
var chunk = stream.node.contents.slice(position, position + length);
var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
buffer.set(new Uint8Array(ab), offset);
return chunk.size;
},write:function (stream, buffer, offset, length, position) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
},llseek:function (stream, offset, whence) {
var position = offset;
if (whence === 1) { // SEEK_CUR.
position += stream.position;
} else if (whence === 2) { // SEEK_END.
if (FS.isFile(stream.node.mode)) {
position += stream.node.size;
}
}
if (position < 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
return position;
}}};
var _stdin=allocate(1, "i32*", ALLOC_STATIC);
var _stdout=allocate(1, "i32*", ALLOC_STATIC);
var _stderr=allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,handleFSError:function (e) {
if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
return ___setErrNo(e.errno);
},lookupPath:function (path, opts) {
path = PATH.resolve(FS.cwd(), path);
opts = opts || {};
if (!path) return { path: '', node: null };
var defaults = {
follow_mount: true,
recurse_count: 0
};
for (var key in defaults) {
if (opts[key] === undefined) {
opts[key] = defaults[key];
}
}
if (opts.recurse_count > 8) { // max recursive lookup of 8
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
}
// split the path
var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
return !!p;
}), false);
// start at the root
var current = FS.root;
var current_path = '/';
for (var i = 0; i < parts.length; i++) {
var islast = (i === parts.length-1);
if (islast && opts.parent) {
// stop resolving
break;
}
current = FS.lookupNode(current, parts[i]);
current_path = PATH.join2(current_path, parts[i]);
// jump to the mount's root node if this is a mountpoint
if (FS.isMountpoint(current)) {
if (!islast || (islast && opts.follow_mount)) {
current = current.mounted.root;
}
}
// by default, lookupPath will not follow a symlink if it is the final path component.
// setting opts.follow = true will override this behavior.
if (!islast || opts.follow) {
var count = 0;
while (FS.isLink(current.mode)) {
var link = FS.readlink(current_path);
current_path = PATH.resolve(PATH.dirname(current_path), link);
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
current = lookup.node;
if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
}
}
}
}
return { path: current_path, node: current };
},getPath:function (node) {
var path;
while (true) {
if (FS.isRoot(node)) {
var mount = node.mount.mountpoint;
if (!path) return mount;
return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
}
path = path ? node.name + '/' + path : node.name;
node = node.parent;
}
},hashName:function (parentid, name) {
var hash = 0;
for (var i = 0; i < name.length; i++) {
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
}
return ((parentid + hash) >>> 0) % FS.nameTable.length;
},hashAddNode:function (node) {
var hash = FS.hashName(node.parent.id, node.name);
node.name_next = FS.nameTable[hash];
FS.nameTable[hash] = node;
},hashRemoveNode:function (node) {
var hash = FS.hashName(node.parent.id, node.name);
if (FS.nameTable[hash] === node) {
FS.nameTable[hash] = node.name_next;
} else {
var current = FS.nameTable[hash];
while (current) {
if (current.name_next === node) {
current.name_next = node.name_next;
break;
}
current = current.name_next;
}
}
},lookupNode:function (parent, name) {
var err = FS.mayLookup(parent);
if (err) {
throw new FS.ErrnoError(err, parent);
}
var hash = FS.hashName(parent.id, name);
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
var nodeName = node.name;
if (node.parent.id === parent.id && nodeName === name) {
return node;
}
}
// if we failed to find it in the cache, call into the VFS
return FS.lookup(parent, name);
},createNode:function (parent, name, mode, rdev) {
if (!FS.FSNode) {
FS.FSNode = function(parent, name, mode, rdev) {
if (!parent) {
parent = this; // root node sets parent to itself
}
this.parent = parent;
this.mount = parent.mount;
this.mounted = null;
this.id = FS.nextInode++;
this.name = name;
this.mode = mode;
this.node_ops = {};
this.stream_ops = {};
this.rdev = rdev;
};
FS.FSNode.prototype = {};
// compatibility
var readMode = 292 | 73;
var writeMode = 146;
// NOTE we must use Object.defineProperties instead of individual calls to
// Object.defineProperty in order to make closure compiler happy
Object.defineProperties(FS.FSNode.prototype, {
read: {
get: function() { return (this.mode & readMode) === readMode; },
set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
},
write: {
get: function() { return (this.mode & writeMode) === writeMode; },
set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
},
isFolder: {
get: function() { return FS.isDir(this.mode); }
},
isDevice: {
get: function() { return FS.isChrdev(this.mode); }
}
});
}
var node = new FS.FSNode(parent, name, mode, rdev);
FS.hashAddNode(node);
return node;
},destroyNode:function (node) {
FS.hashRemoveNode(node);
},isRoot:function (node) {
return node === node.parent;
},isMountpoint:function (node) {
return !!node.mounted;
},isFile:function (mode) {
return (mode & 61440) === 32768;
},isDir:function (mode) {
return (mode & 61440) === 16384;
},isLink:function (mode) {
return (mode & 61440) === 40960;
},isChrdev:function (mode) {
return (mode & 61440) === 8192;
},isBlkdev:function (mode) {
return (mode & 61440) === 24576;
},isFIFO:function (mode) {
return (mode & 61440) === 4096;
},isSocket:function (mode) {
return (mode & 49152) === 49152;
},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
var flags = FS.flagModes[str];
if (typeof flags === 'undefined') {
throw new Error('Unknown file open mode: ' + str);
}
return flags;
},flagsToPermissionString:function (flag) {
var perms = ['r', 'w', 'rw'][flag & 3];
if ((flag & 512)) {
perms += 'w';
}
return perms;
},nodePermissions:function (node, perms) {
if (FS.ignorePermissions) {
return 0;
}
// return 0 if any user, group or owner bits are set.
if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
return ERRNO_CODES.EACCES;
} else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
return ERRNO_CODES.EACCES;
} else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
return ERRNO_CODES.EACCES;
}
return 0;
},mayLookup:function (dir) {
var err = FS.nodePermissions(dir, 'x');
if (err) return err;
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
return 0;
},mayCreate:function (dir, name) {
try {
var node = FS.lookupNode(dir, name);
return ERRNO_CODES.EEXIST;
} catch (e) {
}
return FS.nodePermissions(dir, 'wx');
},mayDelete:function (dir, name, isdir) {
var node;
try {
node = FS.lookupNode(dir, name);
} catch (e) {
return e.errno;
}
var err = FS.nodePermissions(dir, 'wx');
if (err) {
return err;
}
if (isdir) {
if (!FS.isDir(node.mode)) {
return ERRNO_CODES.ENOTDIR;
}
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
return ERRNO_CODES.EBUSY;
}
} else {
if (FS.isDir(node.mode)) {
return ERRNO_CODES.EISDIR;
}
}
return 0;
},mayOpen:function (node, flags) {
if (!node) {
return ERRNO_CODES.ENOENT;
}
if (FS.isLink(node.mode)) {
return ERRNO_CODES.ELOOP;
} else if (FS.isDir(node.mode)) {
if ((flags & 2097155) !== 0 || // opening for write
(flags & 512)) {
return ERRNO_CODES.EISDIR;
}
}
return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
},MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
fd_start = fd_start || 0;
fd_end = fd_end || FS.MAX_OPEN_FDS;
for (var fd = fd_start; fd <= fd_end; fd++) {
if (!FS.streams[fd]) {
return fd;
}
}
throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
},getStream:function (fd) {
return FS.streams[fd];
},createStream:function (stream, fd_start, fd_end) {
if (!FS.FSStream) {
FS.FSStream = function(){};
FS.FSStream.prototype = {};
// compatibility
Object.defineProperties(FS.FSStream.prototype, {
object: {
get: function() { return this.node; },
set: function(val) { this.node = val; }
},
isRead: {
get: function() { return (this.flags & 2097155) !== 1; }
},
isWrite: {
get: function() { return (this.flags & 2097155) !== 0; }
},
isAppend: {
get: function() { return (this.flags & 1024); }
}
});
}
// clone it, so we can return an instance of FSStream
var newStream = new FS.FSStream();
for (var p in stream) {
newStream[p] = stream[p];
}
stream = newStream;
var fd = FS.nextfd(fd_start, fd_end);
stream.fd = fd;
FS.streams[fd] = stream;
return stream;
},closeStream:function (fd) {
FS.streams[fd] = null;
},chrdev_stream_ops:{open:function (stream) {
var device = FS.getDevice(stream.node.rdev);
// override node's stream ops with the device's
stream.stream_ops = device.stream_ops;
// forward the open call
if (stream.stream_ops.open) {
stream.stream_ops.open(stream);
}
},llseek:function () {
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
}},major:function (dev) {
return ((dev) >> 8);
},minor:function (dev) {
return ((dev) & 0xff);
},makedev:function (ma, mi) {
return ((ma) << 8 | (mi));
},registerDevice:function (dev, ops) {
FS.devices[dev] = { stream_ops: ops };
},getDevice:function (dev) {
return FS.devices[dev];
},getMounts:function (mount) {
var mounts = [];
var check = [mount];
while (check.length) {
var m = check.pop();
mounts.push(m);
check.push.apply(check, m.mounts);
}
return mounts;
},syncfs:function (populate, callback) {
if (typeof(populate) === 'function') {
callback = populate;
populate = false;
}
var mounts = FS.getMounts(FS.root.mount);
var completed = 0;
function done(err) {
if (err) {
if (!done.errored) {
done.errored = true;
return callback(err);
}
return;
}
if (++completed >= mounts.length) {
callback(null);
}
};
// sync all mounts
mounts.forEach(function (mount) {
if (!mount.type.syncfs) {
return done(null);
}
mount.type.syncfs(mount, populate, done);
});
},mount:function (type, opts, mountpoint) {
var root = mountpoint === '/';
var pseudo = !mountpoint;
var node;
if (root && FS.root) {
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
} else if (!root && !pseudo) {
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
mountpoint = lookup.path; // use the absolute path
node = lookup.node;
if (FS.isMountpoint(node)) {
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
}
if (!FS.isDir(node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
}
}
var mount = {
type: type,
opts: opts,
mountpoint: mountpoint,
mounts: []
};
// create a root node for the fs
var mountRoot = type.mount(mount);
mountRoot.mount = mount;
mount.root = mountRoot;
if (root) {
FS.root = mountRoot;
} else if (node) {
// set as a mountpoint
node.mounted = mount;
// add the new mount to the current mount's children
if (node.mount) {
node.mount.mounts.push(mount);
}
}
return mountRoot;
},unmount:function (mountpoint) {
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
if (!FS.isMountpoint(lookup.node)) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
// destroy the nodes for this mount, and all its child mounts
var node = lookup.node;
var mount = node.mounted;
var mounts = FS.getMounts(mount);
Object.keys(FS.nameTable).forEach(function (hash) {
var current = FS.nameTable[hash];
while (current) {
var next = current.name_next;
if (mounts.indexOf(current.mount) !== -1) {
FS.destroyNode(current);
}
current = next;
}
});
// no longer a mountpoint
node.mounted = null;
// remove this mount from the child mounts
var idx = node.mount.mounts.indexOf(mount);
assert(idx !== -1);
node.mount.mounts.splice(idx, 1);
},lookup:function (parent, name) {
return parent.node_ops.lookup(parent, name);
},mknod:function (path, mode, dev) {
var lookup = FS.lookupPath(path, { parent: true });
var parent = lookup.node;
var name = PATH.basename(path);
if (!name || name === '.' || name === '..') {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
var err = FS.mayCreate(parent, name);
if (err) {
throw new FS.ErrnoError(err);
}
if (!parent.node_ops.mknod) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
return parent.node_ops.mknod(parent, name, mode, dev);
},create:function (path, mode) {
mode = mode !== undefined ? mode : 438 /* 0666 */;
mode &= 4095;
mode |= 32768;
return FS.mknod(path, mode, 0);
},mkdir:function (path, mode) {
mode = mode !== undefined ? mode : 511 /* 0777 */;
mode &= 511 | 512;
mode |= 16384;
return FS.mknod(path, mode, 0);
},mkdev:function (path, mode, dev) {
if (typeof(dev) === 'undefined') {
dev = mode;
mode = 438 /* 0666 */;
}
mode |= 8192;
return FS.mknod(path, mode, dev);
},symlink:function (oldpath, newpath) {
if (!PATH.resolve(oldpath)) {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
}
var lookup = FS.lookupPath(newpath, { parent: true });
var parent = lookup.node;
if (!parent) {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
}
var newname = PATH.basename(newpath);
var err = FS.mayCreate(parent, newname);
if (err) {
throw new FS.ErrnoError(err);
}
if (!parent.node_ops.symlink) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
return parent.node_ops.symlink(parent, newname, oldpath);
},rename:function (old_path, new_path) {
var old_dirname = PATH.dirname(old_path);
var new_dirname = PATH.dirname(new_path);
var old_name = PATH.basename(old_path);
var new_name = PATH.basename(new_path);
// parents must exist
var lookup, old_dir, new_dir;
try {
lookup = FS.lookupPath(old_path, { parent: true });
old_dir = lookup.node;
lookup = FS.lookupPath(new_path, { parent: true });
new_dir = lookup.node;
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
}
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
// need to be part of the same mount
if (old_dir.mount !== new_dir.mount) {
throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
}
// source must exist
var old_node = FS.lookupNode(old_dir, old_name);
// old path should not be an ancestor of the new path
var relative = PATH.relative(old_path, new_dirname);
if (relative.charAt(0) !== '.') {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
// new path should not be an ancestor of the old path
relative = PATH.relative(new_path, old_dirname);
if (relative.charAt(0) !== '.') {
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
}
// see if the new path already exists
var new_node;
try {
new_node = FS.lookupNode(new_dir, new_name);
} catch (e) {
// not fatal
}
// early out if nothing needs to change
if (old_node === new_node) {
return;
}
// we'll need to delete the old entry
var isdir = FS.isDir(old_node.mode);
var err = FS.mayDelete(old_dir, old_name, isdir);
if (err) {
throw new FS.ErrnoError(err);
}
// need delete permissions if we'll be overwriting.
// need create permissions if new doesn't already exist.
err = new_node ?
FS.mayDelete(new_dir, new_name, isdir) :
FS.mayCreate(new_dir, new_name);
if (err) {
throw new FS.ErrnoError(err);
}
if (!old_dir.node_ops.rename) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
}
// if we are going to change the parent, check write permissions
if (new_dir !== old_dir) {
err = FS.nodePermissions(old_dir, 'w');
if (err) {
throw new FS.ErrnoError(err);
}
}
try {
if (FS.trackingDelegate['willMovePath']) {
FS.trackingDelegate['willMovePath'](old_path, new_path);
}
} catch(e) {
console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
}
// remove the node from the lookup hash
FS.hashRemoveNode(old_node);
// do the underlying fs rename
try {
old_dir.node_ops.rename(old_node, new_dir, new_name);
} catch (e) {
throw e;
} finally {
// add the node back to the hash (in case node_ops.rename
// changed its name)
FS.hashAddNode(old_node);
}
try {
if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
} catch(e) {
console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
}
},rmdir:function (path) {
var lookup = FS.lookupPath(path, { parent: true });
var parent = lookup.node;
var name = PATH.basename(path);
var node = FS.lookupNode(parent, name);
var err = FS.mayDelete(parent, name, true);
if (err) {
throw new FS.ErrnoError(err);
}
if (!parent.node_ops.rmdir) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
if (FS.isMountpoint(node)) {
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
}
try {
if (FS.trackingDelegate['willDeletePath']) {
FS.trackingDelegate['willDeletePath'](path);
}
} catch(e) {
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
}
parent.node_ops.rmdir(parent, name);
FS.destroyNode(node);
try {
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
} catch(e) {
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
}
},readdir:function (path) {
var lookup = FS.lookupPath(path, { follow: true });
var node = lookup.node;
if (!node.node_ops.readdir) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
}
return node.node_ops.readdir(node);
},unlink:function (path) {
var lookup = FS.lookupPath(path, { parent: true });
var parent = lookup.node;
var name = PATH.basename(path);
var node = FS.lookupNode(parent, name);
var err = FS.mayDelete(parent, name, false);
if (err) {
// POSIX says unlink should set EPERM, not EISDIR
if (err === ERRNO_CODES.EISDIR) err = ERRNO_CODES.EPERM;
throw new FS.ErrnoError(err);
}
if (!parent.node_ops.unlink) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
if (FS.isMountpoint(node)) {
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
}
try {
if (FS.trackingDelegate['willDeletePath']) {
FS.trackingDelegate['willDeletePath'](path);
}
} catch(e) {
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
}
parent.node_ops.unlink(parent, name);
FS.destroyNode(node);
try {
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
} catch(e) {
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
}
},readlink:function (path) {
var lookup = FS.lookupPath(path);
var link = lookup.node;
if (!link) {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
}
if (!link.node_ops.readlink) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
},stat:function (path, dontFollow) {
var lookup = FS.lookupPath(path, { follow: !dontFollow });
var node = lookup.node;
if (!node) {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
}
if (!node.node_ops.getattr) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
return node.node_ops.getattr(node);
},lstat:function (path) {
return FS.stat(path, true);
},chmod:function (path, mode, dontFollow) {
var node;
if (typeof path === 'string') {
var lookup = FS.lookupPath(path, { follow: !dontFollow });
node = lookup.node;
} else {
node = path;
}
if (!node.node_ops.setattr) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
node.node_ops.setattr(node, {
mode: (mode & 4095) | (node.mode & ~4095),
timestamp: Date.now()
});
},lchmod:function (path, mode) {
FS.chmod(path, mode, true);
},fchmod:function (fd, mode) {
var stream = FS.getStream(fd);
if (!stream) {
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
}
FS.chmod(stream.node, mode);
},chown:function (path, uid, gid, dontFollow) {
var node;
if (typeof path === 'string') {
var lookup = FS.lookupPath(path, { follow: !dontFollow });
node = lookup.node;
} else {
node = path;
}
if (!node.node_ops.setattr) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
node.node_ops.setattr(node, {
timestamp: Date.now()
// we ignore the uid / gid for now
});
},lchown:function (path, uid, gid) {
FS.chown(path, uid, gid, true);
},fchown:function (fd, uid, gid) {
var stream = FS.getStream(fd);
if (!stream) {
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
}
FS.chown(stream.node, uid, gid);
},truncate:function (path, len) {
if (len < 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
var node;
if (typeof path === 'string') {
var lookup = FS.lookupPath(path, { follow: true });
node = lookup.node;
} else {
node = path;
}
if (!node.node_ops.setattr) {
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
}
if (FS.isDir(node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
}
if (!FS.isFile(node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
var err = FS.nodePermissions(node, 'w');
if (err) {
throw new FS.ErrnoError(err);
}
node.node_ops.setattr(node, {
size: len,
timestamp: Date.now()
});
},ftruncate:function (fd, len) {
var stream = FS.getStream(fd);
if (!stream) {
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
}
if ((stream.flags & 2097155) === 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
FS.truncate(stream.node, len);
},utime:function (path, atime, mtime) {
var lookup = FS.lookupPath(path, { follow: true });
var node = lookup.node;
node.node_ops.setattr(node, {
timestamp: Math.max(atime, mtime)
});
},open:function (path, flags, mode, fd_start, fd_end) {
if (path === "") {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
}
flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
if ((flags & 64)) {
mode = (mode & 4095) | 32768;
} else {
mode = 0;
}
var node;
if (typeof path === 'object') {
node = path;
} else {
path = PATH.normalize(path);
try {
var lookup = FS.lookupPath(path, {
follow: !(flags & 131072)
});
node = lookup.node;
} catch (e) {
// ignore
}
}
// perhaps we need to create the node
var created = false;
if ((flags & 64)) {
if (node) {
// if O_CREAT and O_EXCL are set, error out if the node already exists
if ((flags & 128)) {
throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
}
} else {
// node doesn't exist, try to create it
node = FS.mknod(path, mode, 0);
created = true;
}
}
if (!node) {
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
}
// can't truncate a device
if (FS.isChrdev(node.mode)) {
flags &= ~512;
}
// if asked only for a directory, then this must be one
if ((flags & 65536) && !FS.isDir(node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
}
// check permissions, if this is not a file we just created now (it is ok to
// create and write to a file with read-only permissions; it is read-only
// for later use)
if (!created) {
var err = FS.mayOpen(node, flags);
if (err) {
throw new FS.ErrnoError(err);
}
}
// do truncation if necessary
if ((flags & 512)) {
FS.truncate(node, 0);
}
// we've already handled these, don't pass down to the underlying vfs
flags &= ~(128 | 512);
// register the stream with the filesystem
var stream = FS.createStream({
node: node,
path: FS.getPath(node), // we want the absolute path to the node
flags: flags,
seekable: true,
position: 0,
stream_ops: node.stream_ops,
// used by the file family libc calls (fopen, fwrite, ferror, etc.)
ungotten: [],
error: false
}, fd_start, fd_end);
// call the new stream's open function
if (stream.stream_ops.open) {
stream.stream_ops.open(stream);
}
if (Module['logReadFiles'] && !(flags & 1)) {
if (!FS.readFiles) FS.readFiles = {};
if (!(path in FS.readFiles)) {
FS.readFiles[path] = 1;
Module['printErr']('read file: ' + path);
}
}
try {
if (FS.trackingDelegate['onOpenFile']) {
var trackingFlags = 0;
if ((flags & 2097155) !== 1) {
trackingFlags |= FS.tracking.openFlags.READ;
}
if ((flags & 2097155) !== 0) {
trackingFlags |= FS.tracking.openFlags.WRITE;
}
FS.trackingDelegate['onOpenFile'](path, trackingFlags);
}
} catch(e) {
console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
}
return stream;
},close:function (stream) {
if (stream.getdents) stream.getdents = null; // free readdir state
try {
if (stream.stream_ops.close) {
stream.stream_ops.close(stream);
}
} catch (e) {
throw e;
} finally {
FS.closeStream(stream.fd);
}
},llseek:function (stream, offset, whence) {
if (!stream.seekable || !stream.stream_ops.llseek) {
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
}
stream.position = stream.stream_ops.llseek(stream, offset, whence);
stream.ungotten = [];
return stream.position;
},read:function (stream, buffer, offset, length, position) {
if (length < 0 || position < 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
if ((stream.flags & 2097155) === 1) {
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
}
if (FS.isDir(stream.node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
}
if (!stream.stream_ops.read) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
var seeking = true;
if (typeof position === 'undefined') {
position = stream.position;
seeking = false;
} else if (!stream.seekable) {
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
}
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
if (!seeking) stream.position += bytesRead;
return bytesRead;
},write:function (stream, buffer, offset, length, position, canOwn) {
if (length < 0 || position < 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
if ((stream.flags & 2097155) === 0) {
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
}
if (FS.isDir(stream.node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
}
if (!stream.stream_ops.write) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
if (stream.flags & 1024) {
// seek to the end before writing in append mode
FS.llseek(stream, 0, 2);
}
var seeking = true;
if (typeof position === 'undefined') {
position = stream.position;
seeking = false;
} else if (!stream.seekable) {
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
}
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
if (!seeking) stream.position += bytesWritten;
try {
if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
} catch(e) {
console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
}
return bytesWritten;
},allocate:function (stream, offset, length) {
if (offset < 0 || length <= 0) {
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
}
if ((stream.flags & 2097155) === 0) {
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
}
if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
}
if (!stream.stream_ops.allocate) {
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
}
stream.stream_ops.allocate(stream, offset, length);
},mmap:function (stream, buffer, offset, length, position, prot, flags) {
// TODO if PROT is PROT_WRITE, make sure we have write access
if ((stream.flags & 2097155) === 1) {
throw new FS.ErrnoError(ERRNO_CODES.EACCES);
}
if (!stream.stream_ops.mmap) {
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
}
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
},msync:function (stream, buffer, offset, length, mmapFlags) {
if (!stream || !stream.stream_ops.msync) {
return 0;
}
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
},munmap:function (stream) {
return 0;
},ioctl:function (stream, cmd, arg) {
if (!stream.stream_ops.ioctl) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
}
return stream.stream_ops.ioctl(stream, cmd, arg);
},readFile:function (path, opts) {
opts = opts || {};
opts.flags = opts.flags || 'r';
opts.encoding = opts.encoding || 'binary';
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
throw new Error('Invalid encoding type "' + opts.encoding + '"');
}
var ret;
var stream = FS.open(path, opts.flags);
var stat = FS.stat(path);
var length = stat.size;
var buf = new Uint8Array(length);
FS.read(stream, buf, 0, length, 0);
if (opts.encoding === 'utf8') {
ret = UTF8ArrayToString(buf, 0);
} else if (opts.encoding === 'binary') {
ret = buf;
}
FS.close(stream);
return ret;
},writeFile:function (path, data, opts) {
opts = opts || {};
opts.flags = opts.flags || 'w';
opts.encoding = opts.encoding || 'utf8';
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
throw new Error('Invalid encoding type "' + opts.encoding + '"');
}
var stream = FS.open(path, opts.flags, opts.mode);
if (opts.encoding === 'utf8') {
var buf = new Uint8Array(lengthBytesUTF8(data)+1);
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
} else if (opts.encoding === 'binary') {
FS.write(stream, data, 0, data.length, 0, opts.canOwn);
}
FS.close(stream);
},cwd:function () {
return FS.currentPath;
},chdir:function (path) {
var lookup = FS.lookupPath(path, { follow: true });
if (!FS.isDir(lookup.node.mode)) {
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
}
var err = FS.nodePermissions(lookup.node, 'x');
if (err) {
throw new FS.ErrnoError(err);
}
FS.currentPath = lookup.path;
},createDefaultDirectories:function () {
FS.mkdir('/tmp');
FS.mkdir('/home');
FS.mkdir('/home/web_user');
},createDefaultDevices:function () {
// create /dev
FS.mkdir('/dev');
// setup /dev/null
FS.registerDevice(FS.makedev(1, 3), {
read: function() { return 0; },
write: function(stream, buffer, offset, length, pos) { return length; }
});
FS.mkdev('/dev/null', FS.makedev(1, 3));
// setup /dev/tty and /dev/tty1
// stderr needs to print output using Module['printErr']
// so we register a second tty just for it.
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
FS.mkdev('/dev/tty', FS.makedev(5, 0));
FS.mkdev('/dev/tty1', FS.makedev(6, 0));
// setup /dev/[u]random
var random_device;
if (typeof crypto !== 'undefined') {
// for modern web browsers
var randomBuffer = new Uint8Array(1);
random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
} else if (ENVIRONMENT_IS_NODE) {
// for nodejs
random_device = function() { return require('crypto').randomBytes(1)[0]; };
} else {
// default for ES5 platforms
random_device = function() { return (Math.random()*256)|0; };
}
FS.createDevice('/dev', 'random', random_device);
FS.createDevice('/dev', 'urandom', random_device);
// we're not going to emulate the actual shm device,
// just create the tmp dirs that reside in it commonly
FS.mkdir('/dev/shm');
FS.mkdir('/dev/shm/tmp');
},createSpecialDirectories:function () {
// create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
FS.mkdir('/proc');
FS.mkdir('/proc/self');
FS.mkdir('/proc/self/fd');
FS.mount({
mount: function() {
var node = FS.createNode('/proc/self', 'fd', 16384 | 0777, 73);
node.node_ops = {
lookup: function(parent, name) {
var fd = +name;
var stream = FS.getStream(fd);
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
var ret = {
parent: null,
mount: { mountpoint: 'fake' },
node_ops: { readlink: function() { return stream.path } }
};
ret.parent = ret; // make it look like a simple root node
return ret;
}
};
return node;
}
}, {}, '/proc/self/fd');
},createStandardStreams:function () {
// TODO deprecate the old functionality of a single
// input / output callback and that utilizes FS.createDevice
// and instead require a unique set of stream ops
// by default, we symlink the standard streams to the
// default tty devices. however, if the standard streams
// have been overwritten we create a unique device for
// them instead.
if (Module['stdin']) {
FS.createDevice('/dev', 'stdin', Module['stdin']);
} else {
FS.symlink('/dev/tty', '/dev/stdin');
}
if (Module['stdout']) {
FS.createDevice('/dev', 'stdout', null, Module['stdout']);
} else {
FS.symlink('/dev/tty', '/dev/stdout');
}
if (Module['stderr']) {
FS.createDevice('/dev', 'stderr', null, Module['stderr']);
} else {
FS.symlink('/dev/tty1', '/dev/stderr');
}
// open default streams for the stdin, stdout and stderr devices
var stdin = FS.open('/dev/stdin', 'r');
assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
var stdout = FS.open('/dev/stdout', 'w');
assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
var stderr = FS.open('/dev/stderr', 'w');
assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
},ensureErrnoError:function () {
if (FS.ErrnoError) return;
FS.ErrnoError = function ErrnoError(errno, node) {
//Module.printErr(stackTrace()); // useful for debugging
this.node = node;
this.setErrno = function(errno) {
this.errno = errno;
for (var key in ERRNO_CODES) {
if (ERRNO_CODES[key] === errno) {
this.code = key;
break;
}
}
};
this.setErrno(errno);
this.message = ERRNO_MESSAGES[errno];
};
FS.ErrnoError.prototype = new Error();
FS.ErrnoError.prototype.constructor = FS.ErrnoError;
// Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
[ERRNO_CODES.ENOENT].forEach(function(code) {
FS.genericErrors[code] = new FS.ErrnoError(code);
FS.genericErrors[code].stack = '<generic error, no stack>';
});
},staticInit:function () {
FS.ensureErrnoError();
FS.nameTable = new Array(4096);
FS.mount(MEMFS, {}, '/');
FS.createDefaultDirectories();
FS.createDefaultDevices();
FS.createSpecialDirectories();
FS.filesystems = {
'MEMFS': MEMFS,
'IDBFS': IDBFS,
'NODEFS': NODEFS,
'WORKERFS': WORKERFS,
};
},init:function (input, output, error) {
assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
FS.init.initialized = true;
FS.ensureErrnoError();
// Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
Module['stdin'] = input || Module['stdin'];
Module['stdout'] = output || Module['stdout'];
Module['stderr'] = error || Module['stderr'];
FS.createStandardStreams();
},quit:function () {
FS.init.initialized = false;
// force-flush all streams, so we get musl std streams printed out
var fflush = Module['_fflush'];
if (fflush) fflush(0);
// close all of our streams
for (var i = 0; i < FS.streams.length; i++) {
var stream = FS.streams[i];
if (!stream) {
continue;
}
FS.close(stream);
}
},getMode:function (canRead, canWrite) {
var mode = 0;
if (canRead) mode |= 292 | 73;
if (canWrite) mode |= 146;
return mode;
},joinPath:function (parts, forceRelative) {
var path = PATH.join.apply(null, parts);
if (forceRelative && path[0] == '/') path = path.substr(1);
return path;
},absolutePath:function (relative, base) {
return PATH.resolve(base, relative);
},standardizePath:function (path) {
return PATH.normalize(path);
},findObject:function (path, dontResolveLastLink) {
var ret = FS.analyzePath(path, dontResolveLastLink);
if (ret.exists) {
return ret.object;
} else {
___setErrNo(ret.error);
return null;
}
},analyzePath:function (path, dontResolveLastLink) {
// operate from within the context of the symlink's target
try {
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
path = lookup.path;
} catch (e) {
}
var ret = {
isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
parentExists: false, parentPath: null, parentObject: null
};
try {
var lookup = FS.lookupPath(path, { parent: true });
ret.parentExists = true;
ret.parentPath = lookup.path;
ret.parentObject = lookup.node;
ret.name = PATH.basename(path);
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
ret.exists = true;
ret.path = lookup.path;
ret.object = lookup.node;
ret.name = lookup.node.name;
ret.isRoot = lookup.path === '/';
} catch (e) {
ret.error = e.errno;
};
return ret;
},createFolder:function (parent, name, canRead, canWrite) {
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
var mode = FS.getMode(canRead, canWrite);
return FS.mkdir(path, mode);
},createPath:function (parent, path, canRead, canWrite) {
parent = typeof parent === 'string' ? parent : FS.getPath(parent);
var parts = path.split('/').reverse();
while (parts.length) {
var part = parts.pop();
if (!part) continue;
var current = PATH.join2(parent, part);
try {
FS.mkdir(current);
} catch (e) {
// ignore EEXIST
}
parent = current;
}
return current;
},createFile:function (parent, name, properties, canRead, canWrite) {
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
var mode = FS.getMode(canRead, canWrite);
return FS.create(path, mode);
},createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
var mode = FS.getMode(canRead, canWrite);
var node = FS.create(path, mode);
if (data) {
if (typeof data === 'string') {
var arr = new Array(data.length);
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
data = arr;
}
// make sure we can write to the file
FS.chmod(node, mode | 146);
var stream = FS.open(node, 'w');
FS.write(stream, data, 0, data.length, 0, canOwn);
FS.close(stream);
FS.chmod(node, mode);
}
return node;
},createDevice:function (parent, name, input, output) {
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
var mode = FS.getMode(!!input, !!output);
if (!FS.createDevice.major) FS.createDevice.major = 64;
var dev = FS.makedev(FS.createDevice.major++, 0);
// Create a fake device that a set of stream ops to emulate
// the old behavior.
FS.registerDevice(dev, {
open: function(stream) {
stream.seekable = false;
},
close: function(stream) {
// flush any pending line data
if (output && output.buffer && output.buffer.length) {
output(10);
}
},
read: function(stream, buffer, offset, length, pos /* ignored */) {
var bytesRead = 0;
for (var i = 0; i < length; i++) {
var result;
try {
result = input();
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
}
if (result === undefined && bytesRead === 0) {
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
}
if (result === null || result === undefined) break;
bytesRead++;
buffer[offset+i] = result;
}
if (bytesRead) {
stream.node.timestamp = Date.now();
}
return bytesRead;
},
write: function(stream, buffer, offset, length, pos) {
for (var i = 0; i < length; i++) {
try {
output(buffer[offset+i]);
} catch (e) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
}
}
if (length) {
stream.node.timestamp = Date.now();
}
return i;
}
});
return FS.mkdev(path, mode, dev);
},createLink:function (parent, name, target, canRead, canWrite) {
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
return FS.symlink(target, path);
},forceLoadFile:function (obj) {
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
var success = true;
if (typeof XMLHttpRequest !== 'undefined') {
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
} else if (Module['read']) {
// Command-line.
try {
// WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
// read() will try to parse UTF8.
obj.contents = intArrayFromString(Module['read'](obj.url), true);
obj.usedBytes = obj.contents.length;
} catch (e) {
success = false;
}
} else {
throw new Error('Cannot load without read() or XMLHttpRequest.');
}
if (!success) ___setErrNo(ERRNO_CODES.EIO);
return success;
},createLazyFile:function (parent, name, url, canRead, canWrite) {
// Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
function LazyUint8Array() {
this.lengthKnown = false;
this.chunks = []; // Loaded chunks. Index is the chunk number
}
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
if (idx > this.length-1 || idx < 0) {
return undefined;
}
var chunkOffset = idx % this.chunkSize;
var chunkNum = (idx / this.chunkSize)|0;
return this.getter(chunkNum)[chunkOffset];
}
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
this.getter = getter;
}
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
// Find length
var xhr = new XMLHttpRequest();
xhr.open('HEAD', url, false);
xhr.send(null);
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
var datalength = Number(xhr.getResponseHeader("Content-length"));
var header;
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
var chunkSize = 1024*1024; // Chunk size in bytes
if (!hasByteServing) chunkSize = datalength;
// Function to get a range from the remote URL.
var doXHR = (function(from, to) {
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
// TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
var xhr = new XMLHttpRequest();
xhr.open('GET', url, false);
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
// Some hints to the browser that we want binary data.
if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
if (xhr.overrideMimeType) {
xhr.overrideMimeType('text/plain; charset=x-user-defined');
}
xhr.send(null);
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
if (xhr.response !== undefined) {
return new Uint8Array(xhr.response || []);
} else {
return intArrayFromString(xhr.responseText || '', true);
}
});
var lazyArray = this;
lazyArray.setDataGetter(function(chunkNum) {
var start = chunkNum * chunkSize;
var end = (chunkNum+1) * chunkSize - 1; // including this byte
end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
lazyArray.chunks[chunkNum] = doXHR(start, end);
}
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
return lazyArray.chunks[chunkNum];
});
this._length = datalength;
this._chunkSize = chunkSize;
this.lengthKnown = true;
}
if (typeof XMLHttpRequest !== 'undefined') {
if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
var lazyArray = new LazyUint8Array();
Object.defineProperty(lazyArray, "length", {
get: function() {
if(!this.lengthKnown) {
this.cacheLength();
}
return this._length;
}
});
Object.defineProperty(lazyArray, "chunkSize", {
get: function() {
if(!this.lengthKnown) {
this.cacheLength();
}
return this._chunkSize;
}
});
var properties = { isDevice: false, contents: lazyArray };
} else {
var properties = { isDevice: false, url: url };
}
var node = FS.createFile(parent, name, properties, canRead, canWrite);
// This is a total hack, but I want to get this lazy file code out of the
// core of MEMFS. If we want to keep this lazy file concept I feel it should
// be its own thin LAZYFS proxying calls to MEMFS.
if (properties.contents) {
node.contents = properties.contents;
} else if (properties.url) {
node.contents = null;
node.url = properties.url;
}
// Add a function that defers querying the file size until it is asked the first time.
Object.defineProperty(node, "usedBytes", {
get: function() { return this.contents.length; }
});
// override each stream op with one that tries to force load the lazy file first
var stream_ops = {};
var keys = Object.keys(node.stream_ops);
keys.forEach(function(key) {
var fn = node.stream_ops[key];
stream_ops[key] = function forceLoadLazyFile() {
if (!FS.forceLoadFile(node)) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
}
return fn.apply(null, arguments);
};
});
// use a custom read function
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
if (!FS.forceLoadFile(node)) {
throw new FS.ErrnoError(ERRNO_CODES.EIO);
}
var contents = stream.node.contents;
if (position >= contents.length)
return 0;
var size = Math.min(contents.length - position, length);
assert(size >= 0);
if (contents.slice) { // normal array
for (var i = 0; i < size; i++) {
buffer[offset + i] = contents[position + i];
}
} else {
for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
buffer[offset + i] = contents.get(position + i);
}
}
return size;
};
node.stream_ops = stream_ops;
return node;
},createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
Browser.init();
// TODO we should allow people to just pass in a complete filename instead
// of parent and name being that we just join them anyways
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
function processData(byteArray) {
function finish(byteArray) {
if (preFinish) preFinish();
if (!dontCreateFile) {
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
}
if (onload) onload();
removeRunDependency(dep);
}
var handled = false;
Module['preloadPlugins'].forEach(function(plugin) {
if (handled) return;
if (plugin['canHandle'](fullname)) {
plugin['handle'](byteArray, fullname, finish, function() {
if (onerror) onerror();
removeRunDependency(dep);
});
handled = true;
}
});
if (!handled) finish(byteArray);
}
addRunDependency(dep);
if (typeof url == 'string') {
Browser.asyncLoad(url, function(byteArray) {
processData(byteArray);
}, onerror);
} else {
processData(url);
}
},indexedDB:function () {
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
},DB_NAME:function () {
return 'EM_FS_' + window.location.pathname;
},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
onload = onload || function(){};
onerror = onerror || function(){};
var indexedDB = FS.indexedDB();
try {
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
} catch (e) {
return onerror(e);
}
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
console.log('creating db');
var db = openRequest.result;
db.createObjectStore(FS.DB_STORE_NAME);
};
openRequest.onsuccess = function openRequest_onsuccess() {
var db = openRequest.result;
var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
var files = transaction.objectStore(FS.DB_STORE_NAME);
var ok = 0, fail = 0, total = paths.length;
function finish() {
if (fail == 0) onload(); else onerror();
}
paths.forEach(function(path) {
var putRequest = files.put(FS.analyzePath(path).object.contents, path);
putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
});
transaction.onerror = onerror;
};
openRequest.onerror = onerror;
},loadFilesFromDB:function (paths, onload, onerror) {
onload = onload || function(){};
onerror = onerror || function(){};
var indexedDB = FS.indexedDB();
try {
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
} catch (e) {
return onerror(e);
}
openRequest.onupgradeneeded = onerror; // no database to load from
openRequest.onsuccess = function openRequest_onsuccess() {
var db = openRequest.result;
try {
var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
} catch(e) {
onerror(e);
return;
}
var files = transaction.objectStore(FS.DB_STORE_NAME);
var ok = 0, fail = 0, total = paths.length;
function finish() {
if (fail == 0) onload(); else onerror();
}
paths.forEach(function(path) {
var getRequest = files.get(path);
getRequest.onsuccess = function getRequest_onsuccess() {
if (FS.analyzePath(path).exists) {
FS.unlink(path);
}
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
ok++;
if (ok + fail == total) finish();
};
getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
});
transaction.onerror = onerror;
};
openRequest.onerror = onerror;
}};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
if (path[0] !== '/') {
// relative path
var dir;
if (dirfd === -100) {
dir = FS.cwd();
} else {
var dirstream = FS.getStream(dirfd);
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
dir = dirstream.path;
}
path = PATH.join2(dir, path);
}
return path;
},doStat:function (func, path, buf) {
try {
var stat = func(path);
} catch (e) {
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
// an error occurred while trying to look up the path; we should just report ENOTDIR
return -ERRNO_CODES.ENOTDIR;
}
throw e;
}
HEAP32[((buf)>>2)]=stat.dev;
HEAP32[(((buf)+(4))>>2)]=0;
HEAP32[(((buf)+(8))>>2)]=stat.ino;
HEAP32[(((buf)+(12))>>2)]=stat.mode;
HEAP32[(((buf)+(16))>>2)]=stat.nlink;
HEAP32[(((buf)+(20))>>2)]=stat.uid;
HEAP32[(((buf)+(24))>>2)]=stat.gid;
HEAP32[(((buf)+(28))>>2)]=stat.rdev;
HEAP32[(((buf)+(32))>>2)]=0;
HEAP32[(((buf)+(36))>>2)]=stat.size;
HEAP32[(((buf)+(40))>>2)]=4096;
HEAP32[(((buf)+(44))>>2)]=stat.blocks;
HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
HEAP32[(((buf)+(52))>>2)]=0;
HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
HEAP32[(((buf)+(60))>>2)]=0;
HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
HEAP32[(((buf)+(68))>>2)]=0;
HEAP32[(((buf)+(72))>>2)]=stat.ino;
return 0;
},doMsync:function (addr, stream, len, flags) {
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
FS.msync(stream, buffer, 0, len, flags);
},doMkdir:function (path, mode) {
// remove a trailing slash, if one - /a/b/ has basename of '', but
// we want to create b in the context of this function
path = PATH.normalize(path);
if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
FS.mkdir(path, mode, 0);
return 0;
},doMknod:function (path, mode, dev) {
// we don't want this in the JS API as it uses mknod to create all nodes.
switch (mode & 61440) {
case 32768:
case 8192:
case 24576:
case 4096:
case 49152:
break;
default: return -ERRNO_CODES.EINVAL;
}
FS.mknod(path, mode, dev);
return 0;
},doReadlink:function (path, buf, bufsize) {
if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
var ret = FS.readlink(path);
ret = ret.slice(0, Math.max(0, bufsize));
writeStringToMemory(ret, buf, true);
return ret.length;
},doAccess:function (path, amode) {
if (amode & ~7) {
// need a valid mode
return -ERRNO_CODES.EINVAL;
}
var node;
var lookup = FS.lookupPath(path, { follow: true });
node = lookup.node;
var perms = '';
if (amode & 4) perms += 'r';
if (amode & 2) perms += 'w';
if (amode & 1) perms += 'x';
if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
return -ERRNO_CODES.EACCES;
}
return 0;
},doDup:function (path, flags, suggestFD) {
var suggest = FS.getStream(suggestFD);
if (suggest) FS.close(suggest);
return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
},doReadv:function (stream, iov, iovcnt, offset) {
var ret = 0;
for (var i = 0; i < iovcnt; i++) {
var ptr = HEAP32[(((iov)+(i*8))>>2)];
var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
var curr = FS.read(stream, HEAP8,ptr, len, offset);
if (curr < 0) return -1;
ret += curr;
if (curr < len) break; // nothing more to read
}
return ret;
},doWritev:function (stream, iov, iovcnt, offset) {
var ret = 0;
for (var i = 0; i < iovcnt; i++) {
var ptr = HEAP32[(((iov)+(i*8))>>2)];
var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
var curr = FS.write(stream, HEAP8,ptr, len, offset);
if (curr < 0) return -1;
ret += curr;
}
return ret;
},varargs:0,get:function (varargs) {
SYSCALLS.varargs += 4;
var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
return ret;
},getStr:function () {
var ret = Pointer_stringify(SYSCALLS.get());
return ret;
},getStreamFromFD:function () {
var stream = FS.getStream(SYSCALLS.get());
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
return stream;
},getSocketFromFD:function () {
var socket = SOCKFS.getSocket(SYSCALLS.get());
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
return socket;
},getSocketAddress:function (allowNull) {
var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
if (allowNull && addrp === 0) return null;
var info = __read_sockaddr(addrp, addrlen);
if (info.errno) throw new FS.ErrnoError(info.errno);
info.addr = DNS.lookup_addr(info.addr) || info.addr;
return info;
},get64:function () {
var low = SYSCALLS.get(), high = SYSCALLS.get();
if (low >= 0) assert(high === 0);
else assert(high === -1);
return low;
},getZero:function () {
assert(SYSCALLS.get() === 0);
}};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
try {
// ioctl
var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
switch (op) {
case 21505: {
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
return 0;
}
case 21506: {
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
return 0; // no-op, not actually adjusting terminal settings
}
case 21519: {
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
var argp = SYSCALLS.get();
HEAP32[((argp)>>2)]=0;
return 0;
}
case 21520: {
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
return -ERRNO_CODES.EINVAL; // not supported
}
case 21531: {
var argp = SYSCALLS.get();
return FS.ioctl(stream, op, argp);
}
default: abort('bad ioctl syscall ' + op);
}
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
function _emscripten_glSampleCoverage(x0, x1) { GLctx.sampleCoverage(x0, x1) }
function _glDeleteTextures(n, textures) {
for (var i = 0; i < n; i++) {
var id = HEAP32[(((textures)+(i*4))>>2)];
var texture = GL.textures[id];
if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
GLctx.deleteTexture(texture);
texture.name = 0;
GL.textures[id] = null;
}
}
function _emscripten_glFrustum() {
Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
}
function _glfwSetWindowSizeCallback(winid, cbfun) {
GLFW.setWindowSizeCallback(winid, cbfun);
}
function _emscripten_glGetTexParameterfv(target, pname, params) {
if (!params) {
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
// if p == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
}
function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
location = GL.uniforms[location];
GLctx.uniform4i(location, v0, v1, v2, v3);
}
function _emscripten_glBindRenderbuffer(target, renderbuffer) {
GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
}
function _emscripten_set_main_loop_timing(mode, value) {
Browser.mainLoop.timingMode = mode;
Browser.mainLoop.timingValue = value;
if (!Browser.mainLoop.func) {
return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
}
if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
setTimeout(Browser.mainLoop.runner, value); // doing this each time means that on exception, we stop
};
Browser.mainLoop.method = 'timeout';
} else if (mode == 1 /*EM_TIMING_RAF*/) {
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
Browser.requestAnimationFrame(Browser.mainLoop.runner);
};
Browser.mainLoop.method = 'rAF';
} else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
if (!window['setImmediate']) {
// Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
var setImmediates = [];
var emscriptenMainLoopMessageId = '__emcc';
function Browser_setImmediate_messageHandler(event) {
if (event.source === window && event.data === emscriptenMainLoopMessageId) {
event.stopPropagation();
setImmediates.shift()();
}
}
window.addEventListener("message", Browser_setImmediate_messageHandler, true);
window['setImmediate'] = function Browser_emulated_setImmediate(func) {
setImmediates.push(func);
window.postMessage(emscriptenMainLoopMessageId, "*");
}
}
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
window['setImmediate'](Browser.mainLoop.runner);
};
Browser.mainLoop.method = 'immediate';
}
return 0;
}function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
Module['noExitRuntime'] = true;
assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
Browser.mainLoop.func = func;
Browser.mainLoop.arg = arg;
var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
Browser.mainLoop.runner = function Browser_mainLoop_runner() {
if (ABORT) return;
if (Browser.mainLoop.queue.length > 0) {
var start = Date.now();
var blocker = Browser.mainLoop.queue.shift();
blocker.func(blocker.arg);
if (Browser.mainLoop.remainingBlockers) {
var remaining = Browser.mainLoop.remainingBlockers;
var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
if (blocker.counted) {
Browser.mainLoop.remainingBlockers = next;
} else {
// not counted, but move the progress along a tiny bit
next = next + 0.5; // do not steal all the next one's progress
Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
}
}
console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
Browser.mainLoop.updateStatus();
setTimeout(Browser.mainLoop.runner, 0);
return;
}
// catch pauses from non-main loop sources
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
// Implement very basic swap interval control
Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
// Not the scheduled time to render this frame - skip.
Browser.mainLoop.scheduler();
return;
}
// Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
// VBO double-buffering and reduce GPU stalls.
if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
Browser.mainLoop.method = ''; // just warn once per call to set main loop
}
Browser.mainLoop.runIter(function() {
if (typeof arg !== 'undefined') {
Runtime.dynCall('vi', func, [arg]);
} else {
Runtime.dynCall('v', func);
}
});
// catch pauses from the main loop itself
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
// Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
// to queue the newest produced audio samples.
// TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
// do not need to be hardcoded into this function, but can be more generic.
if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
Browser.mainLoop.scheduler();
}
if (!noSetTiming) {
if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
Browser.mainLoop.scheduler();
}
if (simulateInfiniteLoop) {
throw 'SimulateInfiniteLoop';
}
}var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
Browser.mainLoop.scheduler = null;
Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
},resume:function () {
Browser.mainLoop.currentlyRunningMainloop++;
var timingMode = Browser.mainLoop.timingMode;
var timingValue = Browser.mainLoop.timingValue;
var func = Browser.mainLoop.func;
Browser.mainLoop.func = null;
_emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
_emscripten_set_main_loop_timing(timingMode, timingValue);
Browser.mainLoop.scheduler();
},updateStatus:function () {
if (Module['setStatus']) {
var message = Module['statusMessage'] || 'Please wait...';
var remaining = Browser.mainLoop.remainingBlockers;
var expected = Browser.mainLoop.expectedBlockers;
if (remaining) {
if (remaining < expected) {
Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
} else {
Module['setStatus'](message);
}
} else {
Module['setStatus']('');
}
}
},runIter:function (func) {
if (ABORT) return;
if (Module['preMainLoop']) {
var preRet = Module['preMainLoop']();
if (preRet === false) {
return; // |return false| skips a frame
}
}
try {
func();
} catch (e) {
if (e instanceof ExitStatus) {
return;
} else {
if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
throw e;
}
}
if (Module['postMainLoop']) Module['postMainLoop']();
}},isFullScreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
if (Browser.initted) return;
Browser.initted = true;
try {
new Blob();
Browser.hasBlobConstructor = true;
} catch(e) {
Browser.hasBlobConstructor = false;
console.log("warning: no blob constructor, cannot create blobs with mimetypes");
}
Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
Module.noImageDecoding = true;
}
// Support for plugins that can process preloaded files. You can add more of these to
// your app by creating and appending to Module.preloadPlugins.
//
// Each plugin is asked if it can handle a file based on the file's name. If it can,
// it is given the file's raw data. When it is done, it calls a callback with the file's
// (possibly modified) data. For example, a plugin might decompress a file, or it
// might create some side data structure for use later (like an Image element, etc.).
var imagePlugin = {};
imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
};
imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
var b = null;
if (Browser.hasBlobConstructor) {
try {
b = new Blob([byteArray], { type: Browser.getMimetype(name) });
if (b.size !== byteArray.length) { // Safari bug #118630
// Safari's Blob can only take an ArrayBuffer
b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
}
} catch(e) {
Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
}
}
if (!b) {
var bb = new Browser.BlobBuilder();
bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
b = bb.getBlob();
}
var url = Browser.URLObject.createObjectURL(b);
var img = new Image();
img.onload = function img_onload() {
assert(img.complete, 'Image ' + name + ' could not be decoded');
var canvas = document.createElement('canvas');
canvas.width = img.width;
canvas.height = img.height;
var ctx = canvas.getContext('2d');
ctx.drawImage(img, 0, 0);
Module["preloadedImages"][name] = canvas;
Browser.URLObject.revokeObjectURL(url);
if (onload) onload(byteArray);
};
img.onerror = function img_onerror(event) {
console.log('Image ' + url + ' could not be decoded');
if (onerror) onerror();
};
img.src = url;
};
Module['preloadPlugins'].push(imagePlugin);
var audioPlugin = {};
audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
};
audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
var done = false;
function finish(audio) {
if (done) return;
done = true;
Module["preloadedAudios"][name] = audio;
if (onload) onload(byteArray);
}
function fail() {
if (done) return;
done = true;
Module["preloadedAudios"][name] = new Audio(); // empty shim
if (onerror) onerror();
}
if (Browser.hasBlobConstructor) {
try {
var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
} catch(e) {
return fail();
}
var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
var audio = new Audio();
audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
audio.onerror = function audio_onerror(event) {
if (done) return;
console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
function encode64(data) {
var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
var PAD = '=';
var ret = '';
var leftchar = 0;
var leftbits = 0;
for (var i = 0; i < data.length; i++) {
leftchar = (leftchar << 8) | data[i];
leftbits += 8;
while (leftbits >= 6) {
var curr = (leftchar >> (leftbits-6)) & 0x3f;
leftbits -= 6;
ret += BASE[curr];
}
}
if (leftbits == 2) {
ret += BASE[(leftchar&3) << 4];
ret += PAD + PAD;
} else if (leftbits == 4) {
ret += BASE[(leftchar&0xf) << 2];
ret += PAD;
}
return ret;
}
audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
finish(audio); // we don't wait for confirmation this worked - but it's worth trying
};
audio.src = url;
// workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
Browser.safeSetTimeout(function() {
finish(audio); // try to use it even though it is not necessarily ready to play
}, 10000);
} else {
return fail();
}
};
Module['preloadPlugins'].push(audioPlugin);
// Canvas event setup
var canvas = Module['canvas'];
function pointerLockChange() {
Browser.pointerLock = document['pointerLockElement'] === canvas ||
document['mozPointerLockElement'] === canvas ||
document['webkitPointerLockElement'] === canvas ||
document['msPointerLockElement'] === canvas;
}
if (canvas) {
// forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
// Module['forcedAspectRatio'] = 4 / 3;
canvas.requestPointerLock = canvas['requestPointerLock'] ||
canvas['mozRequestPointerLock'] ||
canvas['webkitRequestPointerLock'] ||
canvas['msRequestPointerLock'] ||
function(){};
canvas.exitPointerLock = document['exitPointerLock'] ||
document['mozExitPointerLock'] ||
document['webkitExitPointerLock'] ||
document['msExitPointerLock'] ||
function(){}; // no-op if function does not exist
canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
document.addEventListener('pointerlockchange', pointerLockChange, false);
document.addEventListener('mozpointerlockchange', pointerLockChange, false);
document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
document.addEventListener('mspointerlockchange', pointerLockChange, false);
if (Module['elementPointerLock']) {
canvas.addEventListener("click", function(ev) {
if (!Browser.pointerLock && canvas.requestPointerLock) {
canvas.requestPointerLock();
ev.preventDefault();
}
}, false);
}
}
},createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
var ctx;
var contextHandle;
if (useWebGL) {
// For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
var contextAttributes = {
antialias: false,
alpha: false
};
if (webGLContextAttributes) {
for (var attribute in webGLContextAttributes) {
contextAttributes[attribute] = webGLContextAttributes[attribute];
}
}
contextHandle = GL.createContext(canvas, contextAttributes);
if (contextHandle) {
ctx = GL.getContext(contextHandle).GLctx;
}
// Set the background of the WebGL canvas to black
canvas.style.backgroundColor = "black";
} else {
ctx = canvas.getContext('2d');
}
if (!ctx) return null;
if (setInModule) {
if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
Module.ctx = ctx;
if (useWebGL) GL.makeContextCurrent(contextHandle);
Module.useWebGL = useWebGL;
Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
Browser.init();
}
return ctx;
},destroyContext:function (canvas, useWebGL, setInModule) {},fullScreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
Browser.lockPointer = lockPointer;
Browser.resizeCanvas = resizeCanvas;
Browser.vrDevice = vrDevice;
if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
var canvas = Module['canvas'];
function fullScreenChange() {
Browser.isFullScreen = false;
var canvasContainer = canvas.parentNode;
if ((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] ||
document['mozFullScreenElement'] || document['mozFullscreenElement'] ||
document['fullScreenElement'] || document['fullscreenElement'] ||
document['msFullScreenElement'] || document['msFullscreenElement'] ||
document['webkitCurrentFullScreenElement']) === canvasContainer) {
canvas.cancelFullScreen = document['cancelFullScreen'] ||
document['mozCancelFullScreen'] ||
document['webkitCancelFullScreen'] ||
document['msExitFullscreen'] ||
document['exitFullscreen'] ||
function() {};
canvas.cancelFullScreen = canvas.cancelFullScreen.bind(document);
if (Browser.lockPointer) canvas.requestPointerLock();
Browser.isFullScreen = true;
if (Browser.resizeCanvas) Browser.setFullScreenCanvasSize();
} else {
// remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
canvasContainer.parentNode.removeChild(canvasContainer);
if (Browser.resizeCanvas) Browser.setWindowedCanvasSize();
}
if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullScreen);
Browser.updateCanvasDimensions(canvas);
}
if (!Browser.fullScreenHandlersInstalled) {
Browser.fullScreenHandlersInstalled = true;
document.addEventListener('fullscreenchange', fullScreenChange, false);
document.addEventListener('mozfullscreenchange', fullScreenChange, false);
document.addEventListener('webkitfullscreenchange', fullScreenChange, false);
document.addEventListener('MSFullscreenChange', fullScreenChange, false);
}
// create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
var canvasContainer = document.createElement("div");
canvas.parentNode.insertBefore(canvasContainer, canvas);
canvasContainer.appendChild(canvas);
// use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
canvasContainer.requestFullScreen = canvasContainer['requestFullScreen'] ||
canvasContainer['mozRequestFullScreen'] ||
canvasContainer['msRequestFullscreen'] ||
(canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
if (vrDevice) {
canvasContainer.requestFullScreen({ vrDisplay: vrDevice });
} else {
canvasContainer.requestFullScreen();
}
},nextRAF:0,fakeRequestAnimationFrame:function (func) {
// try to keep 60fps between calls to here
var now = Date.now();
if (Browser.nextRAF === 0) {
Browser.nextRAF = now + 1000/60;
} else {
while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
Browser.nextRAF += 1000/60;
}
}
var delay = Math.max(Browser.nextRAF - now, 0);
setTimeout(func, delay);
},requestAnimationFrame:function requestAnimationFrame(func) {
if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
Browser.fakeRequestAnimationFrame(func);
} else {
if (!window.requestAnimationFrame) {
window.requestAnimationFrame = window['requestAnimationFrame'] ||
window['mozRequestAnimationFrame'] ||
window['webkitRequestAnimationFrame'] ||
window['msRequestAnimationFrame'] ||
window['oRequestAnimationFrame'] ||
Browser.fakeRequestAnimationFrame;
}
window.requestAnimationFrame(func);
}
},safeCallback:function (func) {
return function() {
if (!ABORT) return func.apply(null, arguments);
};
},allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
Browser.allowAsyncCallbacks = false;
},resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
Browser.allowAsyncCallbacks = true;
if (Browser.queuedAsyncCallbacks.length > 0) {
var callbacks = Browser.queuedAsyncCallbacks;
Browser.queuedAsyncCallbacks = [];
callbacks.forEach(function(func) {
func();
});
}
},safeRequestAnimationFrame:function (func) {
return Browser.requestAnimationFrame(function() {
if (ABORT) return;
if (Browser.allowAsyncCallbacks) {
func();
} else {
Browser.queuedAsyncCallbacks.push(func);
}
});
},safeSetTimeout:function (func, timeout) {
Module['noExitRuntime'] = true;
return setTimeout(function() {
if (ABORT) return;
if (Browser.allowAsyncCallbacks) {
func();
} else {
Browser.queuedAsyncCallbacks.push(func);
}
}, timeout);
},safeSetInterval:function (func, timeout) {
Module['noExitRuntime'] = true;
return setInterval(function() {
if (ABORT) return;
if (Browser.allowAsyncCallbacks) {
func();
} // drop it on the floor otherwise, next interval will kick in
}, timeout);
},getMimetype:function (name) {
return {
'jpg': 'image/jpeg',
'jpeg': 'image/jpeg',
'png': 'image/png',
'bmp': 'image/bmp',
'ogg': 'audio/ogg',
'wav': 'audio/wav',
'mp3': 'audio/mpeg'
}[name.substr(name.lastIndexOf('.')+1)];
},getUserMedia:function (func) {
if(!window.getUserMedia) {
window.getUserMedia = navigator['getUserMedia'] ||
navigator['mozGetUserMedia'];
}
window.getUserMedia(func);
},getMovementX:function (event) {
return event['movementX'] ||
event['mozMovementX'] ||
event['webkitMovementX'] ||
0;
},getMovementY:function (event) {
return event['movementY'] ||
event['mozMovementY'] ||
event['webkitMovementY'] ||
0;
},getMouseWheelDelta:function (event) {
var delta = 0;
switch (event.type) {
case 'DOMMouseScroll':
delta = event.detail;
break;
case 'mousewheel':
delta = event.wheelDelta;
break;
case 'wheel':
delta = event['deltaY'];
break;
default:
throw 'unrecognized mouse wheel event: ' + event.type;
}
return delta;
},mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
if (Browser.pointerLock) {
// When the pointer is locked, calculate the coordinates
// based on the movement of the mouse.
// Workaround for Firefox bug 764498
if (event.type != 'mousemove' &&
('mozMovementX' in event)) {
Browser.mouseMovementX = Browser.mouseMovementY = 0;
} else {
Browser.mouseMovementX = Browser.getMovementX(event);
Browser.mouseMovementY = Browser.getMovementY(event);
}
// check if SDL is available
if (typeof SDL != "undefined") {
Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
} else {
// just add the mouse delta to the current absolut mouse position
// FIXME: ideally this should be clamped against the canvas size and zero
Browser.mouseX += Browser.mouseMovementX;
Browser.mouseY += Browser.mouseMovementY;
}
} else {
// Otherwise, calculate the movement based on the changes
// in the coordinates.
var rect = Module["canvas"].getBoundingClientRect();
var cw = Module["canvas"].width;
var ch = Module["canvas"].height;
// Neither .scrollX or .pageXOffset are defined in a spec, but
// we prefer .scrollX because it is currently in a spec draft.
// (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
var touch = event.touch;
if (touch === undefined) {
return; // the "touch" property is only defined in SDL
}
var adjustedX = touch.pageX - (scrollX + rect.left);
var adjustedY = touch.pageY - (scrollY + rect.top);
adjustedX = adjustedX * (cw / rect.width);
adjustedY = adjustedY * (ch / rect.height);
var coords = { x: adjustedX, y: adjustedY };
if (event.type === 'touchstart') {
Browser.lastTouches[touch.identifier] = coords;
Browser.touches[touch.identifier] = coords;
} else if (event.type === 'touchend' || event.type === 'touchmove') {
var last = Browser.touches[touch.identifier];
if (!last) last = coords;
Browser.lastTouches[touch.identifier] = last;
Browser.touches[touch.identifier] = coords;
}
return;
}
var x = event.pageX - (scrollX + rect.left);
var y = event.pageY - (scrollY + rect.top);
// the canvas might be CSS-scaled compared to its backbuffer;
// SDL-using content will want mouse coordinates in terms
// of backbuffer units.
x = x * (cw / rect.width);
y = y * (ch / rect.height);
Browser.mouseMovementX = x - Browser.mouseX;
Browser.mouseMovementY = y - Browser.mouseY;
Browser.mouseX = x;
Browser.mouseY = y;
}
},xhrLoad:function (url, onload, onerror) {
var xhr = new XMLHttpRequest();
xhr.open('GET', url, true);
xhr.responseType = 'arraybuffer';
xhr.onload = function xhr_onload() {
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
onload(xhr.response);
} else {
onerror();
}
};
xhr.onerror = onerror;
xhr.send(null);
},asyncLoad:function (url, onload, onerror, noRunDep) {
Browser.xhrLoad(url, function(arrayBuffer) {
assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
onload(new Uint8Array(arrayBuffer));
if (!noRunDep) removeRunDependency('al ' + url);
}, function(event) {
if (onerror) {
onerror();
} else {
throw 'Loading data file "' + url + '" failed.';
}
});
if (!noRunDep) addRunDependency('al ' + url);
},resizeListeners:[],updateResizeListeners:function () {
var canvas = Module['canvas'];
Browser.resizeListeners.forEach(function(listener) {
listener(canvas.width, canvas.height);
});
},setCanvasSize:function (width, height, noUpdates) {
var canvas = Module['canvas'];
Browser.updateCanvasDimensions(canvas, width, height);
if (!noUpdates) Browser.updateResizeListeners();
},windowedWidth:0,windowedHeight:0,setFullScreenCanvasSize:function () {
// check if SDL is available
if (typeof SDL != "undefined") {
var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
}
Browser.updateResizeListeners();
},setWindowedCanvasSize:function () {
// check if SDL is available
if (typeof SDL != "undefined") {
var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
}
Browser.updateResizeListeners();
},updateCanvasDimensions:function (canvas, wNative, hNative) {
if (wNative && hNative) {
canvas.widthNative = wNative;
canvas.heightNative = hNative;
} else {
wNative = canvas.widthNative;
hNative = canvas.heightNative;
}
var w = wNative;
var h = hNative;
if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
if (w/h < Module['forcedAspectRatio']) {
w = Math.round(h * Module['forcedAspectRatio']);
} else {
h = Math.round(w / Module['forcedAspectRatio']);
}
}
if (((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] ||
document['mozFullScreenElement'] || document['mozFullscreenElement'] ||
document['fullScreenElement'] || document['fullscreenElement'] ||
document['msFullScreenElement'] || document['msFullscreenElement'] ||
document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
var factor = Math.min(screen.width / w, screen.height / h);
w = Math.round(w * factor);
h = Math.round(h * factor);
}
if (Browser.resizeCanvas) {
if (canvas.width != w) canvas.width = w;
if (canvas.height != h) canvas.height = h;
if (typeof canvas.style != 'undefined') {
canvas.style.removeProperty( "width");
canvas.style.removeProperty("height");
}
} else {
if (canvas.width != wNative) canvas.width = wNative;
if (canvas.height != hNative) canvas.height = hNative;
if (typeof canvas.style != 'undefined') {
if (w != wNative || h != hNative) {
canvas.style.setProperty( "width", w + "px", "important");
canvas.style.setProperty("height", h + "px", "important");
} else {
canvas.style.removeProperty( "width");
canvas.style.removeProperty("height");
}
}
}
},wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
var handle = Browser.nextWgetRequestHandle;
Browser.nextWgetRequestHandle++;
return handle;
}};var AL={contexts:[],currentContext:null,alcErr:0,stringCache:{},alcStringCache:{},QUEUE_INTERVAL:25,QUEUE_LOOKAHEAD:100,newSrcId:1,updateSources:function updateSources(context) {
// If we are animating using the requestAnimationFrame method, then the main loop does not run when in the background.
// To give a perfect glitch-free audio stop when switching from foreground to background, we need to avoid updating
// audio altogether when in the background, so detect that case and kill audio buffer streaming if so.
if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && document['visibilityState'] != 'visible') return;
for (var srcId in context.src) {
AL.updateSource(context.src[srcId]);
}
},updateSource:function updateSource(src) {
if (src.state !== 0x1012 /* AL_PLAYING */) {
return;
}
var currentTime = AL.currentContext.ctx.currentTime;
var startTime = src.bufferPosition;
for (var i = src.buffersPlayed; i < src.queue.length; i++) {
var entry = src.queue[i];
var startOffset = startTime - currentTime;
var endTime = startTime + entry.buffer.duration;
// Clean up old buffers.
if (currentTime >= endTime) {
// Update our location in the queue.
src.bufferPosition = endTime;
src.buffersPlayed = i + 1;
// Stop / restart the source when we hit the end.
if (src.buffersPlayed >= src.queue.length) {
if (src.loop) {
AL.setSourceState(src, 0x1012 /* AL_PLAYING */);
} else {
AL.setSourceState(src, 0x1014 /* AL_STOPPED */);
}
}
}
// Process all buffers that'll be played before the next tick.
else if (startOffset < (AL.QUEUE_LOOKAHEAD / 1000) && !entry.src) {
// If the start offset is negative, we need to offset the actual buffer.
var offset = Math.abs(Math.min(startOffset, 0));
entry.src = AL.currentContext.ctx.createBufferSource();
entry.src.buffer = entry.buffer;
entry.src.connect(src.gain);
if (typeof(entry.src.start) !== 'undefined') {
entry.src.start(startTime, offset);
} else if (typeof(entry.src.noteOn) !== 'undefined') {
entry.src.noteOn(startTime);
}
}
startTime = endTime;
}
},setSourceState:function setSourceState(src, state) {
if (state === 0x1012 /* AL_PLAYING */) {
if (src.state !== 0x1013 /* AL_PAUSED */) {
src.state = 0x1012 /* AL_PLAYING */;
// Reset our position.
src.bufferPosition = AL.currentContext.ctx.currentTime;
src.buffersPlayed = 0;
} else {
src.state = 0x1012 /* AL_PLAYING */;
// Use the current offset from src.bufferPosition to resume at the correct point.
src.bufferPosition = AL.currentContext.ctx.currentTime - src.bufferPosition;
}
AL.stopSourceQueue(src);
AL.updateSource(src);
} else if (state === 0x1013 /* AL_PAUSED */) {
if (src.state === 0x1012 /* AL_PLAYING */) {
src.state = 0x1013 /* AL_PAUSED */;
// Store off the current offset to restore with on resume.
src.bufferPosition = AL.currentContext.ctx.currentTime - src.bufferPosition;
AL.stopSourceQueue(src);
}
} else if (state === 0x1014 /* AL_STOPPED */) {
if (src.state !== 0x1011 /* AL_INITIAL */) {
src.state = 0x1014 /* AL_STOPPED */;
src.buffersPlayed = src.queue.length;
AL.stopSourceQueue(src);
}
} else if (state == 0x1011 /* AL_INITIAL */) {
if (src.state !== 0x1011 /* AL_INITIAL */) {
src.state = 0x1011 /* AL_INITIAL */;
src.bufferPosition = 0;
src.buffersPlayed = 0;
}
}
},stopSourceQueue:function stopSourceQueue(src) {
for (var i = 0; i < src.queue.length; i++) {
var entry = src.queue[i];
if (entry.src) {
entry.src.stop(0);
entry.src = null;
}
}
}};function _alcGetCurrentContext() {
for (var i = 0; i < AL.contexts.length; ++i) {
if (AL.contexts[i] == AL.currentContext) {
return i + 1;
}
}
return 0;
}
function _emscripten_glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) }
function _emscripten_memcpy_big(dest, src, num) {
HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
return dest;
}
Module["_memcpy"] = _memcpy;
var _llvm_pow_f64=Math_pow;
function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) }
function _alcGetString(device, param) {
if (AL.alcStringCache[param]) return AL.alcStringCache[param];
var ret;
switch (param) {
case 0 /* ALC_NO_ERROR */:
ret = 'No Error';
break;
case 0xA001 /* ALC_INVALID_DEVICE */:
ret = 'Invalid Device';
break;
case 0xA002 /* ALC_INVALID_CONTEXT */:
ret = 'Invalid Context';
break;
case 0xA003 /* ALC_INVALID_ENUM */:
ret = 'Invalid Enum';
break;
case 0xA004 /* ALC_INVALID_VALUE */:
ret = 'Invalid Value';
break;
case 0xA005 /* ALC_OUT_OF_MEMORY */:
ret = 'Out of Memory';
break;
case 0x1004 /* ALC_DEFAULT_DEVICE_SPECIFIER */:
if (typeof(AudioContext) !== "undefined" ||
typeof(webkitAudioContext) !== "undefined") {
ret = 'Device';
} else {
return 0;
}
break;
case 0x1005 /* ALC_DEVICE_SPECIFIER */:
if (typeof(AudioContext) !== "undefined" ||
typeof(webkitAudioContext) !== "undefined") {
ret = 'Device\0';
} else {
ret = '\0';
}
break;
case 0x311 /* ALC_CAPTURE_DEFAULT_DEVICE_SPECIFIER */:
return 0;
break;
case 0x310 /* ALC_CAPTURE_DEVICE_SPECIFIER */:
ret = '\0'
break;
case 0x1006 /* ALC_EXTENSIONS */:
if (!device) {
AL.alcErr = 0xA001 /* ALC_INVALID_DEVICE */;
return 0;
}
ret = '';
break;
default:
AL.alcErr = 0xA003 /* ALC_INVALID_ENUM */;
return 0;
}
ret = allocate(intArrayFromString(ret), 'i8', ALLOC_NORMAL);
AL.alcStringCache[param] = ret;
return ret;
}
function _emscripten_glTexParameterfv(target, pname, params) {
var param = HEAPF32[((params)>>2)];
GLctx.texParameterf(target, pname, param);
}
function _emscripten_glLinkProgram(program) {
GLctx.linkProgram(GL.programs[program]);
GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
GL.populateUniformTable(program);
}
function _emscripten_glUniform3f(location, v0, v1, v2) {
location = GL.uniforms[location];
GLctx.uniform3f(location, v0, v1, v2);
}
function _emscripten_glGetObjectParameterivARB() {
Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
}
function _emscripten_glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) }
function _emscripten_glUniform3i(location, v0, v1, v2) {
location = GL.uniforms[location];
GLctx.uniform3i(location, v0, v1, v2);
}
function _emscripten_glStencilOp(x0, x1, x2) { GLctx.stencilOp(x0, x1, x2) }
function _glCreateShader(shaderType) {
var id = GL.getNewId(GL.shaders);
GL.shaders[id] = GLctx.createShader(shaderType);
return id;
}
function _glUniform1i(location, v0) {
location = GL.uniforms[location];
GLctx.uniform1i(location, v0);
}
function _emscripten_glBindAttribLocation(program, index, name) {
name = Pointer_stringify(name);
GLctx.bindAttribLocation(GL.programs[program], index, name);
}
var _cosf=Math_cos;
function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
var heapView;
if (data) {
heapView = HEAPU8.subarray((data),(data+imageSize));
} else {
heapView = null;
}
GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView);
}
function _emscripten_glEnableVertexAttribArray(index) {
GLctx.enableVertexAttribArray(index);
}
Module["_memset"] = _memset;
var _BDtoILow=true;
function _alDeleteBuffers(count, buffers)
{
if (!AL.currentContext) {
return;
}
if (count > AL.currentContext.buf.length) {
AL.currentContext.err = 0xA003 /* AL_INVALID_VALUE */;
return;
}
for (var i = 0; i < count; ++i) {
var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)] - 1;
// Make sure the buffer index is valid.
if (bufferIdx >= AL.currentContext.buf.length || !AL.currentContext.buf[bufferIdx]) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
// Make sure the buffer is no longer in use.
var buffer = AL.currentContext.buf[bufferIdx];
for (var srcId in AL.currentContext.src) {
var src = AL.currentContext.src[srcId];
if (!src) {
continue;
}
for (var k = 0; k < src.queue.length; k++) {
if (buffer === src.queue[k].buffer) {
AL.currentContext.err = 0xA004 /* AL_INVALID_OPERATION */;
return;
}
}
}
}
for (var i = 0; i < count; ++i) {
var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)] - 1;
delete AL.currentContext.buf[bufferIdx];
}
}
function _alListener3f(param, v1, v2, v3) {
if (!AL.currentContext) {
return;
}
switch (param) {
case 0x1004 /* AL_POSITION */:
AL.currentContext.ctx.listener._position = [v1, v2, v3];
AL.currentContext.ctx.listener.setPosition(v1, v2, v3);
break;
case 0x1006 /* AL_VELOCITY */:
AL.currentContext.ctx.listener._velocity = [v1, v2, v3];
AL.currentContext.ctx.listener.setVelocity(v1, v2, v3);
break;
default:
AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */;
break;
}
}
function _glfwMakeContextCurrent(winid) {}
var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,registerRemoveEventListeners:function () {
if (!JSEvents.removeEventListenersRegistered) {
__ATEXIT__.push(function() {
for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
JSEvents._removeHandler(i);
}
});
JSEvents.removeEventListenersRegistered = true;
}
},findEventTarget:function (target) {
if (target) {
if (typeof target == "number") {
target = Pointer_stringify(target);
}
if (target == '#window') return window;
else if (target == '#document') return document;
else if (target == '#screen') return window.screen;
else if (target == '#canvas') return Module['canvas'];
if (typeof target == 'string') return document.getElementById(target);
else return target;
} else {
// The sensible target varies between events, but use window as the default
// since DOM events mostly can default to that. Specific callback registrations
// override their own defaults.
return window;
}
},deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
function arraysHaveEqualContent(arrA, arrB) {
if (arrA.length != arrB.length) return false;
for(var i in arrA) {
if (arrA[i] != arrB[i]) return false;
}
return true;
}
// Test if the given call was already queued, and if so, don't add it again.
for(var i in JSEvents.deferredCalls) {
var call = JSEvents.deferredCalls[i];
if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
return;
}
}
JSEvents.deferredCalls.push({
targetFunction: targetFunction,
precedence: precedence,
argsList: argsList
});
JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
},removeDeferredCalls:function (targetFunction) {
for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
JSEvents.deferredCalls.splice(i, 1);
--i;
}
}
},canPerformEventHandlerRequests:function () {
return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
},runDeferredCalls:function () {
if (!JSEvents.canPerformEventHandlerRequests()) {
return;
}
for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
var call = JSEvents.deferredCalls[i];
JSEvents.deferredCalls.splice(i, 1);
--i;
call.targetFunction.apply(this, call.argsList);
}
},inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
if (JSEvents.eventHandlers[i].target == target &&
(!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
JSEvents._removeHandler(i--);
}
}
},_removeHandler:function (i) {
var h = JSEvents.eventHandlers[i];
h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
JSEvents.eventHandlers.splice(i, 1);
},registerOrRemoveHandler:function (eventHandler) {
var jsEventHandler = function jsEventHandler(event) {
// Increment nesting count for the event handler.
++JSEvents.inEventHandler;
JSEvents.currentEventHandler = eventHandler;
// Process any old deferred calls the user has placed.
JSEvents.runDeferredCalls();
// Process the actual event, calls back to user C code handler.
eventHandler.handlerFunc(event);
// Process any new deferred calls that were placed right now from this event handler.
JSEvents.runDeferredCalls();
// Out of event handler - restore nesting count.
--JSEvents.inEventHandler;
}
if (eventHandler.callbackfunc) {
eventHandler.eventListenerFunc = jsEventHandler;
eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
JSEvents.eventHandlers.push(eventHandler);
JSEvents.registerRemoveEventListeners();
} else {
for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
if (JSEvents.eventHandlers[i].target == eventHandler.target
&& JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
JSEvents._removeHandler(i--);
}
}
}
},registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.keyEvent) {
JSEvents.keyEvent = _malloc( 164 );
}
var handlerFunc = function(event) {
var e = event || window.event;
writeStringToMemory(e.key ? e.key : "", JSEvents.keyEvent + 0 );
writeStringToMemory(e.code ? e.code : "", JSEvents.keyEvent + 32 );
HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location;
HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey;
HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey;
HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey;
HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey;
HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat;
writeStringToMemory(e.locale ? e.locale : "", JSEvents.keyEvent + 88 );
writeStringToMemory(e.char ? e.char : "", JSEvents.keyEvent + 120 );
HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode;
HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode;
HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which;
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.keyEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},getBoundingClientRectOrZeros:function (target) {
return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
},fillMouseEventData:function (eventStruct, e, target) {
HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
HEAP16[(((eventStruct)+(40))>>1)]=e.button;
HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
if (Module['canvas']) {
var rect = Module['canvas'].getBoundingClientRect();
HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
} else { // Canvas is not initialized, return 0.
HEAP32[(((eventStruct)+(60))>>2)]=0;
HEAP32[(((eventStruct)+(64))>>2)]=0;
}
if (target) {
var rect = JSEvents.getBoundingClientRectOrZeros(target);
HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
} else { // No specific target passed, return 0.
HEAP32[(((eventStruct)+(52))>>2)]=0;
HEAP32[(((eventStruct)+(56))>>2)]=0;
}
JSEvents.previousScreenX = e.screenX;
JSEvents.previousScreenY = e.screenY;
},registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.mouseEvent) {
JSEvents.mouseEvent = _malloc( 72 );
}
target = JSEvents.findEventTarget(target);
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.mouseEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
// In IE, mousedown events don't either allow deferred calls to be run!
if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
JSEvents.registerOrRemoveHandler(eventHandler);
},registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.wheelEvent) {
JSEvents.wheelEvent = _malloc( 104 );
}
target = JSEvents.findEventTarget(target);
// The DOM Level 3 events spec event 'wheel'
var wheelHandlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"];
HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"];
HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"];
HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"];
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
// The 'mousewheel' event as implemented in Safari 6.0.5
var mouseWheelHandlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"];
HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-e["wheelDeltaY"] /* Invert to unify direction with the DOM Level 3 wheel event. */;
HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: true,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},pageScrollPos:function () {
if (window.pageXOffset > 0 || window.pageYOffset > 0) {
return [window.pageXOffset, window.pageYOffset];
}
if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
}
return [document.body.scrollLeft|0, document.body.scrollTop|0];
},registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.uiEvent) {
JSEvents.uiEvent = _malloc( 36 );
}
if (eventTypeString == "scroll" && !target) {
target = document; // By default read scroll events on document rather than window.
} else {
target = JSEvents.findEventTarget(target);
}
var handlerFunc = function(event) {
var e = event || window.event;
if (e.target != target) {
// Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
// was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
// message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
// causing a new scroll, etc..
return;
}
var scrollPos = JSEvents.pageScrollPos();
HEAP32[((JSEvents.uiEvent)>>2)]=e.detail;
HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth;
HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight;
HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth;
HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight;
HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth;
HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight;
HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0];
HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1];
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.uiEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},getNodeNameForTarget:function (target) {
if (!target) return '';
if (target == window) return '#window';
if (target == window.screen) return '#screen';
return (target && target.nodeName) ? target.nodeName : '';
},registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.focusEvent) {
JSEvents.focusEvent = _malloc( 256 );
}
var handlerFunc = function(event) {
var e = event || window.event;
var nodeName = JSEvents.getNodeNameForTarget(e.target);
var id = e.target.id ? e.target.id : '';
writeStringToMemory(nodeName, JSEvents.focusEvent + 0 );
writeStringToMemory(id, JSEvents.focusEvent + 128 );
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.focusEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},tick:function () {
if (window['performance'] && window['performance']['now']) return window['performance']['now']();
else return Date.now();
},registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.deviceOrientationEvent) {
JSEvents.deviceOrientationEvent = _malloc( 40 );
}
var handlerFunc = function(event) {
var e = event || window.event;
HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha;
HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta;
HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma;
HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute;
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceOrientationEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.deviceMotionEvent) {
JSEvents.deviceMotionEvent = _malloc( 80 );
}
var handlerFunc = function(event) {
var e = event || window.event;
HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x;
HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y;
HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z;
HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x;
HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y;
HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z;
HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha;
HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta;
HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma;
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceMotionEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},screenOrientation:function () {
if (!window.screen) return undefined;
return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
},fillOrientationChangeEventData:function (eventStruct, e) {
var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
var orientationString = JSEvents.screenOrientation();
var orientation = orientations.indexOf(orientationString);
if (orientation == -1) {
orientation = orientations2.indexOf(orientationString);
}
HEAP32[((eventStruct)>>2)]=1 << orientation;
HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
},registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.orientationChangeEvent) {
JSEvents.orientationChangeEvent = _malloc( 8 );
}
if (!target) {
target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
} else {
target = JSEvents.findEventTarget(target);
}
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e);
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.orientationChangeEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
eventTypeString = "mozorientationchange";
}
var eventHandler = {
target: target,
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},fullscreenEnabled:function () {
return document.fullscreenEnabled || document.mozFullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
},fillFullscreenChangeEventData:function (eventStruct, e) {
var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
var isFullscreen = !!fullscreenElement;
HEAP32[((eventStruct)>>2)]=isFullscreen;
HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
// If transitioning to fullscreen, report info about the element that is now fullscreen.
// If transitioning to windowed mode, report info about the element that just was fullscreen.
var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
writeStringToMemory(nodeName, eventStruct + 8 );
writeStringToMemory(id, eventStruct + 136 );
HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
if (isFullscreen) {
JSEvents.previousFullscreenElement = fullscreenElement;
}
},registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.fullscreenChangeEvent) {
JSEvents.fullscreenChangeEvent = _malloc( 280 );
}
if (!target) {
target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
} else {
target = JSEvents.findEventTarget(target);
}
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e);
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.fullscreenChangeEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},resizeCanvasForFullscreen:function (target, strategy) {
var restoreOldStyle = __registerRestoreOldStyle(target);
var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
var rect = target.getBoundingClientRect();
var windowedCssWidth = rect.right - rect.left;
var windowedCssHeight = rect.bottom - rect.top;
var windowedRttWidth = target.width;
var windowedRttHeight = target.height;
if (strategy.scaleMode == 3) {
__setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
cssWidth = windowedCssWidth;
cssHeight = windowedCssHeight;
} else if (strategy.scaleMode == 2) {
if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
__setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
cssHeight = desiredCssHeight;
} else {
var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
__setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
cssWidth = desiredCssWidth;
}
}
// If we are adding padding, must choose a background color or otherwise Chrome will give the
// padding a default white color. Do it only if user has not customized their own background color.
if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
// IE11 does the same, but requires the color to be set in the document body.
if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
// Firefox always shows black letterboxes independent of style color.
target.style.width = cssWidth + 'px';
target.style.height = cssHeight + 'px';
if (strategy.filteringMode == 1) {
target.style.imageRendering = 'optimizeSpeed';
target.style.imageRendering = '-moz-crisp-edges';
target.style.imageRendering = '-o-crisp-edges';
target.style.imageRendering = '-webkit-optimize-contrast';
target.style.imageRendering = 'optimize-contrast';
target.style.imageRendering = 'crisp-edges';
target.style.imageRendering = 'pixelated';
}
var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
if (strategy.canvasResolutionScaleMode != 0) {
target.width = cssWidth * dpiScale;
target.height = cssHeight * dpiScale;
if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height);
}
return restoreOldStyle;
},requestFullscreen:function (target, strategy) {
// EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
JSEvents.resizeCanvasForFullscreen(target, strategy);
}
if (target.requestFullscreen) {
target.requestFullscreen();
} else if (target.msRequestFullscreen) {
target.msRequestFullscreen();
} else if (target.mozRequestFullScreen) {
target.mozRequestFullScreen();
} else if (target.mozRequestFullscreen) {
target.mozRequestFullscreen();
} else if (target.webkitRequestFullscreen) {
target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
} else {
if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
return -1;
} else {
return -3;
}
}
if (strategy.canvasResizedCallback) {
Runtime.dynCall('iiii', strategy.canvasResizedCallback, [37, 0, strategy.canvasResizedCallbackUserData]);
}
return 0;
},fillPointerlockChangeEventData:function (eventStruct, e) {
var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
var isPointerlocked = !!pointerLockElement;
HEAP32[((eventStruct)>>2)]=isPointerlocked;
var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
writeStringToMemory(nodeName, eventStruct + 4 );
writeStringToMemory(id, eventStruct + 132);
},registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.pointerlockChangeEvent) {
JSEvents.pointerlockChangeEvent = _malloc( 260 );
}
if (!target) {
target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
} else {
target = JSEvents.findEventTarget(target);
}
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e);
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.pointerlockChangeEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},requestPointerLock:function (target) {
if (target.requestPointerLock) {
target.requestPointerLock();
} else if (target.mozRequestPointerLock) {
target.mozRequestPointerLock();
} else if (target.webkitRequestPointerLock) {
target.webkitRequestPointerLock();
} else if (target.msRequestPointerLock) {
target.msRequestPointerLock();
} else {
// document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
// or if the whole browser just doesn't support the feature.
if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
return -3;
} else {
return -1;
}
}
return 0;
},fillVisibilityChangeEventData:function (eventStruct, e) {
var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
var visibilityState = visibilityStates.indexOf(document.visibilityState);
HEAP32[((eventStruct)>>2)]=document.hidden;
HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
},registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.visibilityChangeEvent) {
JSEvents.visibilityChangeEvent = _malloc( 8 );
}
if (!target) {
target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
} else {
target = JSEvents.findEventTarget(target);
}
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e);
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.visibilityChangeEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.touchEvent) {
JSEvents.touchEvent = _malloc( 1684 );
}
target = JSEvents.findEventTarget(target);
var handlerFunc = function(event) {
var e = event || window.event;
var touches = {};
for(var i = 0; i < e.touches.length; ++i) {
var touch = e.touches[i];
touches[touch.identifier] = touch;
}
for(var i = 0; i < e.changedTouches.length; ++i) {
var touch = e.changedTouches[i];
touches[touch.identifier] = touch;
touch.changed = true;
}
for(var i = 0; i < e.targetTouches.length; ++i) {
var touch = e.targetTouches[i];
touches[touch.identifier].onTarget = true;
}
var ptr = JSEvents.touchEvent;
HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
HEAP32[(((ptr)+(12))>>2)]=e.altKey;
HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
ptr += 20; // Advance to the start of the touch array.
var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
var numTouches = 0;
for(var i in touches) {
var t = touches[i];
HEAP32[((ptr)>>2)]=t.identifier;
HEAP32[(((ptr)+(4))>>2)]=t.screenX;
HEAP32[(((ptr)+(8))>>2)]=t.screenY;
HEAP32[(((ptr)+(12))>>2)]=t.clientX;
HEAP32[(((ptr)+(16))>>2)]=t.clientY;
HEAP32[(((ptr)+(20))>>2)]=t.pageX;
HEAP32[(((ptr)+(24))>>2)]=t.pageY;
HEAP32[(((ptr)+(28))>>2)]=t.changed;
HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
if (canvasRect) {
HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
} else {
HEAP32[(((ptr)+(44))>>2)]=0;
HEAP32[(((ptr)+(48))>>2)]=0;
}
HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
ptr += 52;
if (++numTouches >= 32) {
break;
}
}
HEAP32[((JSEvents.touchEvent)>>2)]=numTouches;
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.touchEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: target,
allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493
// Once the above bug is resolved, enable the following condition if possible:
// allowsDeferredCalls: eventTypeString == 'touchstart',
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},fillGamepadEventData:function (eventStruct, e) {
HEAPF64[((eventStruct)>>3)]=e.timestamp;
for(var i = 0; i < e.axes.length; ++i) {
HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
}
for(var i = 0; i < e.buttons.length; ++i) {
if (typeof(e.buttons[i]) === 'object') {
HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
} else {
HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
}
}
for(var i = 0; i < e.buttons.length; ++i) {
if (typeof(e.buttons[i]) === 'object') {
HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
} else {
HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
}
}
HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
writeStringToMemory(e.id, eventStruct + 1304 );
writeStringToMemory(e.mapping, eventStruct + 1368 );
},registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.gamepadEvent) {
JSEvents.gamepadEvent = _malloc( 1432 );
}
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad);
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.gamepadEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: true,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
var handlerFunc = function(event) {
var e = event || window.event;
var confirmationMessage = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]);
if (confirmationMessage) {
confirmationMessage = Pointer_stringify(confirmationMessage);
}
if (confirmationMessage) {
e.preventDefault();
e.returnValue = confirmationMessage;
return confirmationMessage;
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
HEAPF64[((eventStruct)>>3)]=e.chargingTime;
HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
},registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!JSEvents.batteryEvent) {
JSEvents.batteryEvent = _malloc( 32 );
}
var handlerFunc = function(event) {
var e = event || window.event;
JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery());
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.batteryEvent, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
},registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
if (!target) {
target = Module['canvas'];
}
var handlerFunc = function(event) {
var e = event || window.event;
var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]);
if (shouldCancel) {
e.preventDefault();
}
};
var eventHandler = {
target: JSEvents.findEventTarget(target),
allowsDeferredCalls: false,
eventTypeString: eventTypeString,
callbackfunc: callbackfunc,
handlerFunc: handlerFunc,
useCapture: useCapture
};
JSEvents.registerOrRemoveHandler(eventHandler);
}};function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) {
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel");
return 0;
}
function _glBindFramebuffer(target, framebuffer) {
GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
}
function ___lock() {}
function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx.blendFuncSeparate(x0, x1, x2, x3) }
function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
if (!pointer) {
// GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
// if pointer == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
}
function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx.vertexAttrib3f(x0, x1, x2, x3) }
function _alSource3f(source, param, v1, v2, v3) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
switch (param) {
case 0x1004 /* AL_POSITION */:
src.position = [v1, v2, v3];
break;
case 0x1005 /* AL_DIRECTION */:
src.direction = [v1, v2, v3];
break;
case 0x1006 /* AL_VELOCITY */:
src.velocity = [v1, v2, v3];
break;
default:
AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */;
break;
}
}
function _emscripten_glNormalPointer() {
Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
}
var _emscripten_GetProcAddress=undefined;
Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress;
function _eglWaitClient() {
EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
return 1;
}var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) {
EGL.errorCode = code;
},chooseConfig:function (display, attribList, config, config_size, numConfigs) {
if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
return 0;
}
// TODO: read attribList.
if ((!config || !config_size) && !numConfigs) {
EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
return 0;
}
if (numConfigs) {
HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
}
if (config && config_size > 0) {
HEAP32[((config)>>2)]=62002;
}
EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
return 1;
}};function _eglGetProcAddress(name_) {
return _emscripten_GetProcAddress(name_);
}
function _glDeleteProgram(id) {
if (!id) return;
var program = GL.programs[id];
if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
GLctx.deleteProgram(program);
program.name = 0;
GL.programs[id] = null;
GL.programInfos[id] = null;
}
var _setSourceState=undefined;function _alSourcePlay(source) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
AL.setSourceState(src, 0x1012 /* AL_PLAYING */);
}
function _glAttachShader(program, shader) {
GLctx.attachShader(GL.programs[program],
GL.shaders[shader]);
}
function _glfwGetPrimaryMonitor() {
return 1;
}
function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
if (!params) {
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
// if params == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
var data = GLctx.getVertexAttrib(index, pname);
if (typeof data == 'number' || typeof data == 'boolean') {
switch (type) {
case 'Integer': HEAP32[((params)>>2)]=data; break;
case 'Float': HEAPF32[((params)>>2)]=data; break;
case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
}
} else {
for (var i = 0; i < data.length; i++) {
switch (type) {
case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
}
}
}
}function _emscripten_glGetVertexAttribfv(index, pname, params) {
// N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
// otherwise the results are undefined. (GLES3 spec 6.1.12)
emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
}
function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) {
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart");
return 0;
}
function _emscripten_glDeleteShader(id) {
if (!id) return;
var shader = GL.shaders[id];
if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
GLctx.deleteShader(shader);
GL.shaders[id] = null;
}
function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
function _emscripten_glDeleteBuffers(n, buffers) {
for (var i = 0; i < n; i++) {
var id = HEAP32[(((buffers)+(i*4))>>2)];
var buffer = GL.buffers[id];
// From spec: "glDeleteBuffers silently ignores 0's and names that do not
// correspond to existing buffer objects."
if (!buffer) continue;
GLctx.deleteBuffer(buffer);
buffer.name = 0;
GL.buffers[id] = null;
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
}
}
function _emscripten_glTexParameteriv(target, pname, params) {
var param = HEAP32[((params)>>2)];
GLctx.texParameteri(target, pname, param);
}
function _glDrawElements(mode, count, type, indices) {
GLctx.drawElements(mode, count, type, indices);
}
function _glfwTerminate() {
window.removeEventListener("keydown", GLFW.onKeydown, true);
window.removeEventListener("keypress", GLFW.onKeyPress, true);
window.removeEventListener("keyup", GLFW.onKeyup, true);
Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
Module["canvas"].width = Module["canvas"].height = 1;
GLFW.windows = null;
GLFW.active = null;
}
function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform matrix
view = GL.miniTempBufferViews[3];
for (var i = 0; i < 4; i++) {
view[i] = HEAPF32[(((value)+(i*4))>>2)];
}
} else {
view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
}
GLctx.uniformMatrix2fv(location, transpose, view);
}
function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
try {
// open
var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
var stream = FS.open(pathname, flags, mode);
return stream.fd;
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
try {
// close
var stream = SYSCALLS.getStreamFromFD();
FS.close(stream);
return 0;
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
var _cos=Math_cos;
function _llvm_stacksave() {
var self = _llvm_stacksave;
if (!self.LLVM_SAVEDSTACKS) {
self.LLVM_SAVEDSTACKS = [];
}
self.LLVM_SAVEDSTACKS.push(Runtime.stackSave());
return self.LLVM_SAVEDSTACKS.length-1;
}
function _emscripten_glGetVertexAttribiv(index, pname, params) {
// N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
// otherwise the results are undefined. (GLES3 spec 6.1.12)
emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
}
function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform matrix
view = GL.miniTempBufferViews[15];
for (var i = 0; i < 16; i++) {
view[i] = HEAPF32[(((value)+(i*4))>>2)];
}
} else {
view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
}
GLctx.uniformMatrix4fv(location, transpose, view);
}
function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
GLctx['drawArraysInstanced'](mode, first, count, primcount);
}
function _emscripten_glEnableClientState() {
Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
}
function _emscripten_glGetPointerv() {
Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
}
function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
try {
// llseek
var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
var offset = offset_low;
assert(offset_high === 0);
FS.llseek(stream, offset, whence);
HEAP32[((result)>>2)]=stream.position;
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
return 0;
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
try {
// writev
var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
return SYSCALLS.doWritev(stream, iov, iovcnt);
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
function _emscripten_glUniform1i(location, v0) {
location = GL.uniforms[location];
GLctx.uniform1i(location, v0);
}
function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
try {
// readv
var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
return SYSCALLS.doReadv(stream, iov, iovcnt);
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
function _emscripten_glStencilMask(x0) { GLctx.stencilMask(x0) }
function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx.stencilFuncSeparate(x0, x1, x2, x3) }
Module["_i64Subtract"] = _i64Subtract;
var _fabsf=Math_abs;
Module["_i64Add"] = _i64Add;
function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) {
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend");
return 0;
}
function _glUseProgram(program) {
GLctx.useProgram(program ? GL.programs[program] : null);
}
var _sinf=Math_sin;
function _emscripten_glDisableVertexAttribArray(index) {
GLctx.disableVertexAttribArray(index);
}
function _emscripten_glVertexAttrib1f(x0, x1) { GLctx.vertexAttrib1f(x0, x1) }
function _emscripten_glFinish() { GLctx.finish() }
function _glDeleteFramebuffers(n, framebuffers) {
for (var i = 0; i < n; ++i) {
var id = HEAP32[(((framebuffers)+(i*4))>>2)];
var framebuffer = GL.framebuffers[id];
if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
GLctx.deleteFramebuffer(framebuffer);
framebuffer.name = 0;
GL.framebuffers[id] = null;
}
}
function _glDrawArrays(mode, first, count) {
GLctx.drawArrays(mode, first, count);
}
function _emscripten_glDepthFunc(x0) { GLctx.depthFunc(x0) }
function _alcOpenDevice(deviceName) {
if (typeof(AudioContext) !== "undefined" ||
typeof(webkitAudioContext) !== "undefined") {
return 1; // non-null pointer -- we just simulate one device
} else {
return 0;
}
}
function _sysconf(name) {
// long sysconf(int name);
// http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html
switch(name) {
case 30: return PAGE_SIZE;
case 85: return totalMemory / PAGE_SIZE;
case 132:
case 133:
case 12:
case 137:
case 138:
case 15:
case 235:
case 16:
case 17:
case 18:
case 19:
case 20:
case 149:
case 13:
case 10:
case 236:
case 153:
case 9:
case 21:
case 22:
case 159:
case 154:
case 14:
case 77:
case 78:
case 139:
case 80:
case 81:
case 82:
case 68:
case 67:
case 164:
case 11:
case 29:
case 47:
case 48:
case 95:
case 52:
case 51:
case 46:
return 200809;
case 79:
return 0;
case 27:
case 246:
case 127:
case 128:
case 23:
case 24:
case 160:
case 161:
case 181:
case 182:
case 242:
case 183:
case 184:
case 243:
case 244:
case 245:
case 165:
case 178:
case 179:
case 49:
case 50:
case 168:
case 169:
case 175:
case 170:
case 171:
case 172:
case 97:
case 76:
case 32:
case 173:
case 35:
return -1;
case 176:
case 177:
case 7:
case 155:
case 8:
case 157:
case 125:
case 126:
case 92:
case 93:
case 129:
case 130:
case 131:
case 94:
case 91:
return 1;
case 74:
case 60:
case 69:
case 70:
case 4:
return 1024;
case 31:
case 42:
case 72:
return 32;
case 87:
case 26:
case 33:
return 2147483647;
case 34:
case 1:
return 47839;
case 38:
case 36:
return 99;
case 43:
case 37:
return 2048;
case 0: return 2097152;
case 3: return 65536;
case 28: return 32768;
case 44: return 32767;
case 75: return 16384;
case 39: return 1000;
case 89: return 700;
case 71: return 256;
case 40: return 255;
case 2: return 100;
case 180: return 64;
case 25: return 20;
case 5: return 16;
case 6: return 6;
case 73: return 4;
case 84: {
if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1;
return 1;
}
}
___setErrNo(ERRNO_CODES.EINVAL);
return -1;
}
function _emscripten_glUniform4iv(location, count, value) {
location = GL.uniforms[location];
count *= 4;
value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
GLctx.uniform4iv(location, value);
}
function _glClear(x0) { GLctx.clear(x0) }
function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
function _emscripten_glUniform3fv(location, count, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform
view = GL.miniTempBufferViews[2];
view[0] = HEAPF32[((value)>>2)];
view[1] = HEAPF32[(((value)+(4))>>2)];
view[2] = HEAPF32[(((value)+(8))>>2)];
} else {
view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
}
GLctx.uniform3fv(location, view);
}
function _emscripten_glIsTexture(texture) {
var texture = GL.textures[texture];
if (!texture) return 0;
return GLctx.isTexture(texture);
}
function _glEnableVertexAttribArray(index) {
GLctx.enableVertexAttribArray(index);
}
function _emscripten_glAttachShader(program, shader) {
GLctx.attachShader(GL.programs[program],
GL.shaders[shader]);
}
function _alSourceUnqueueBuffers(source, count, buffers) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
if (count > src.buffersPlayed) {
AL.currentContext.err = 0xA003 /* AL_INVALID_VALUE */;
return;
}
for (var i = 0; i < count; i++) {
var entry = src.queue.shift();
// Write the buffers index out to the return list.
for (var j = 0; j < AL.currentContext.buf.length; j++) {
var b = AL.currentContext.buf[j];
if (b && b == entry.buffer) {
HEAP32[(((buffers)+(i*4))>>2)]=j+1;
break;
}
}
src.buffersPlayed--;
}
AL.updateSource(src);
}
function _glfwCreateWindow(width, height, title, monitor, share) {
return GLFW.createWindow(width, height, title, monitor, share);
}
function _alGetSourcei(source, param, value) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
// Being that we have no way to receive end events from buffer nodes,
// we currently proccess and update a source's buffer queue every
// ~QUEUE_INTERVAL milliseconds. However, this interval is not precise,
// so we also forcefully update the source when alGetSourcei is queried
// to aid in the common scenario of application calling alGetSourcei(AL_BUFFERS_PROCESSED)
// to recycle buffers.
AL.updateSource(src);
switch (param) {
case 0x202 /* AL_SOURCE_RELATIVE */:
HEAP32[((value)>>2)]=src.panner ? 1 : 0;
break;
case 0x1001 /* AL_CONE_INNER_ANGLE */:
HEAP32[((value)>>2)]=src.coneInnerAngle;
break;
case 0x1002 /* AL_CONE_OUTER_ANGLE */:
HEAP32[((value)>>2)]=src.coneOuterAngle;
break;
case 0x1007 /* AL_LOOPING */:
HEAP32[((value)>>2)]=src.loop;
break;
case 0x1009 /* AL_BUFFER */:
if (!src.queue.length) {
HEAP32[((value)>>2)]=0;
} else {
// Find the first unprocessed buffer.
var buffer = src.queue[src.buffersPlayed].buffer;
// Return its index.
for (var i = 0; i < AL.currentContext.buf.length; ++i) {
if (buffer == AL.currentContext.buf[i]) {
HEAP32[((value)>>2)]=i+1;
return;
}
}
HEAP32[((value)>>2)]=0;
}
break;
case 0x1010 /* AL_SOURCE_STATE */:
HEAP32[((value)>>2)]=src.state;
break;
case 0x1015 /* AL_BUFFERS_QUEUED */:
HEAP32[((value)>>2)]=src.queue.length
break;
case 0x1016 /* AL_BUFFERS_PROCESSED */:
if (src.loop) {
HEAP32[((value)>>2)]=0
} else {
HEAP32[((value)>>2)]=src.buffersPlayed
}
break;
default:
AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */;
break;
}
}
function _pthread_cleanup_pop() {
assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!');
__ATEXIT__.pop();
_pthread_cleanup_push.level = __ATEXIT__.length;
}
function _emscripten_glClearStencil(x0) { GLctx.clearStencil(x0) }
function _emscripten_glDetachShader(program, shader) {
GLctx.detachShader(GL.programs[program],
GL.shaders[shader]);
}
function _emscripten_glDeleteVertexArrays(n, vaos) {
for(var i = 0; i < n; i++) {
var id = HEAP32[(((vaos)+(i*4))>>2)];
GLctx['deleteVertexArray'](GL.vaos[id]);
GL.vaos[id] = null;
}
}
function _alGenSources(count, sources) {
if (!AL.currentContext) {
return;
}
for (var i = 0; i < count; ++i) {
var gain = AL.currentContext.ctx.createGain();
gain.connect(AL.currentContext.gain);
AL.currentContext.src[AL.newSrcId] = {
state: 0x1011 /* AL_INITIAL */,
queue: [],
loop: false,
get refDistance() {
return this._refDistance || 1;
},
set refDistance(val) {
this._refDistance = val;
if (this.panner) this.panner.refDistance = val;
},
get maxDistance() {
return this._maxDistance || 10000;
},
set maxDistance(val) {
this._maxDistance = val;
if (this.panner) this.panner.maxDistance = val;
},
get rolloffFactor() {
return this._rolloffFactor || 1;
},
set rolloffFactor(val) {
this._rolloffFactor = val;
if (this.panner) this.panner.rolloffFactor = val;
},
get position() {
return this._position || [0, 0, 0];
},
set position(val) {
this._position = val;
if (this.panner) this.panner.setPosition(val[0], val[1], val[2]);
},
get velocity() {
return this._velocity || [0, 0, 0];
},
set velocity(val) {
this._velocity = val;
if (this.panner) this.panner.setVelocity(val[0], val[1], val[2]);
},
get direction() {
return this._direction || [0, 0, 0];
},
set direction(val) {
this._direction = val;
if (this.panner) this.panner.setOrientation(val[0], val[1], val[2]);
},
get coneOuterGain() {
return this._coneOuterGain || 0.0;
},
set coneOuterGain(val) {
this._coneOuterGain = val;
if (this.panner) this.panner.coneOuterGain = val;
},
get coneInnerAngle() {
return this._coneInnerAngle || 360.0;
},
set coneInnerAngle(val) {
this._coneInnerAngle = val;
if (this.panner) this.panner.coneInnerAngle = val;
},
get coneOuterAngle() {
return this._coneOuterAngle || 360.0;
},
set coneOuterAngle(val) {
this._coneOuterAngle = val;
if (this.panner) this.panner.coneOuterAngle = val;
},
gain: gain,
panner: null,
buffersPlayed: 0,
bufferPosition: 0
};
HEAP32[(((sources)+(i*4))>>2)]=AL.newSrcId;
AL.newSrcId++;
}
}
function _glfwInit() {
if (GLFW.windows) return 1; // GL_TRUE
GLFW.initialTime = GLFW.getTime();
GLFW.hints = GLFW.defaultHints;
GLFW.windows = new Array()
GLFW.active = null;
window.addEventListener("keydown", GLFW.onKeydown, true);
window.addEventListener("keypress", GLFW.onKeyPress, true);
window.addEventListener("keyup", GLFW.onKeyup, true);
Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
Browser.resizeListeners.push(function(width, height) {
GLFW.onFullScreenEventChange();
});
return 1; // GL_TRUE
}
function _emscripten_glGetTexParameteriv(target, pname, params) {
if (!params) {
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
// if p == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
}
function _alDeleteSources(count, sources) {
if (!AL.currentContext) {
return;
}
for (var i = 0; i < count; ++i) {
var sourceIdx = HEAP32[(((sources)+(i*4))>>2)];
delete AL.currentContext.src[sourceIdx];
}
}
function _glfwSwapBuffers(winid) {
GLFW.swapBuffers(winid);
}
function _emscripten_glGenerateMipmap(x0) { GLctx.generateMipmap(x0) }
function _emscripten_glCullFace(x0) { GLctx.cullFace(x0) }
function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
location = GL.uniforms[location];
GLctx.uniform4f(location, v0, v1, v2, v3);
}
function _glDisableVertexAttribArray(index) {
GLctx.disableVertexAttribArray(index);
}
function _emscripten_glUseProgram(program) {
GLctx.useProgram(program ? GL.programs[program] : null);
}
function _emscripten_glHint(x0, x1) { GLctx.hint(x0, x1) }
function _emscripten_glUniform2fv(location, count, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform
view = GL.miniTempBufferViews[1];
view[0] = HEAPF32[((value)>>2)];
view[1] = HEAPF32[(((value)+(4))>>2)];
} else {
view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
}
GLctx.uniform2fv(location, view);
}
function _glfwSwapInterval(interval) {
interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
}
function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
if (log === null) log = '(unknown error)';
log = log.substr(0, maxLength - 1);
if (maxLength > 0 && infoLog) {
writeStringToMemory(log, infoLog);
if (length) HEAP32[((length)>>2)]=log.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
}
function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
function _abort() {
Module['abort']();
}
function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
GL.renderbuffers[renderbuffer]);
}
function _alGenBuffers(count, buffers) {
if (!AL.currentContext) {
return;
}
for (var i = 0; i < count; ++i) {
AL.currentContext.buf.push(null);
HEAP32[(((buffers)+(i*4))>>2)]=AL.currentContext.buf.length;
}
}
function _emscripten_glDeleteFramebuffers(n, framebuffers) {
for (var i = 0; i < n; ++i) {
var id = HEAP32[(((framebuffers)+(i*4))>>2)];
var framebuffer = GL.framebuffers[id];
if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
GLctx.deleteFramebuffer(framebuffer);
framebuffer.name = 0;
GL.framebuffers[id] = null;
}
}
function _emscripten_glIsBuffer(buffer) {
var b = GL.buffers[buffer];
if (!b) return 0;
return GLctx.isBuffer(b);
}
function _emscripten_glUniform2iv(location, count, value) {
location = GL.uniforms[location];
count *= 2;
value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
GLctx.uniform2iv(location, value);
}
function _emscripten_glVertexAttrib1fv(index, v) {
v = HEAPF32.subarray((v)>>2,(v+4)>>2);
GLctx.vertexAttrib1fv(index, v);
}
function _glEnable(x0) { GLctx.enable(x0) }
function _alBufferData(buffer, format, data, size, freq) {
if (!AL.currentContext) {
return;
}
if (buffer > AL.currentContext.buf.length) {
return;
}
var channels, bytes;
switch (format) {
case 0x1100 /* AL_FORMAT_MONO8 */:
bytes = 1;
channels = 1;
break;
case 0x1101 /* AL_FORMAT_MONO16 */:
bytes = 2;
channels = 1;
break;
case 0x1102 /* AL_FORMAT_STEREO8 */:
bytes = 1;
channels = 2;
break;
case 0x1103 /* AL_FORMAT_STEREO16 */:
bytes = 2;
channels = 2;
break;
case 0x10010 /* AL_FORMAT_MONO_FLOAT32 */:
bytes = 4;
channels = 1;
break;
case 0x10011 /* AL_FORMAT_STEREO_FLOAT32 */:
bytes = 4;
channels = 2;
break;
default:
return;
}
try {
AL.currentContext.buf[buffer - 1] = AL.currentContext.ctx.createBuffer(channels, size / (bytes * channels), freq);
AL.currentContext.buf[buffer - 1].bytesPerSample = bytes;
} catch (e) {
AL.currentContext.err = 0xA003 /* AL_INVALID_VALUE */;
return;
}
var buf = new Array(channels);
for (var i = 0; i < channels; ++i) {
buf[i] = AL.currentContext.buf[buffer - 1].getChannelData(i);
}
for (var i = 0; i < size / (bytes * channels); ++i) {
for (var j = 0; j < channels; ++j) {
switch (bytes) {
case 1:
var val = HEAP8[(((data)+(i*channels+j))>>0)] & 0xff; // unsigned
buf[j][i] = -1.0 + val * (2/256);
break;
case 2:
var val = HEAP16[(((data)+(2*(i*channels+j)))>>1)];
buf[j][i] = val/32768;
break;
case 4:
buf[j][i] = HEAPF32[(((data)+(4*(i*channels+j)))>>2)];
break;
}
}
}
}
function _alSourceStop(source) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
AL.setSourceState(src, 0x1014 /* AL_STOPPED */);
}
function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
function roundedToNextMultipleOf(x, y) {
return Math.floor((x + y - 1) / y) * y
}
var plainRowSize = width * sizePerPixel;
var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
return (height <= 0) ? 0 :
((height - 1) * alignedRowSize + plainRowSize);
}function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
var sizePerPixel;
var numChannels;
switch(format) {
case 0x1906 /* GL_ALPHA */:
case 0x1909 /* GL_LUMINANCE */:
case 0x1902 /* GL_DEPTH_COMPONENT */:
case 0x1903 /* GL_RED */:
numChannels = 1;
break;
case 0x190A /* GL_LUMINANCE_ALPHA */:
case 0x8227 /* GL_RG */:
numChannels = 2;
break;
case 0x1907 /* GL_RGB */:
case 0x8C40 /* GL_SRGB_EXT */:
numChannels = 3;
break;
case 0x1908 /* GL_RGBA */:
case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
numChannels = 4;
break;
default:
GL.recordError(0x0500); // GL_INVALID_ENUM
return {
pixels: null,
internalFormat: 0x0
};
}
switch (type) {
case 0x1401 /* GL_UNSIGNED_BYTE */:
sizePerPixel = numChannels*1;
break;
case 0x1403 /* GL_UNSIGNED_SHORT */:
case 0x8D61 /* GL_HALF_FLOAT_OES */:
sizePerPixel = numChannels*2;
break;
case 0x1405 /* GL_UNSIGNED_INT */:
case 0x1406 /* GL_FLOAT */:
sizePerPixel = numChannels*4;
break;
case 0x84FA /* UNSIGNED_INT_24_8_WEBGL/UNSIGNED_INT_24_8 */:
sizePerPixel = 4;
break;
case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
sizePerPixel = 2;
break;
default:
GL.recordError(0x0500); // GL_INVALID_ENUM
return {
pixels: null,
internalFormat: 0x0
};
}
var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
if (type == 0x1401 /* GL_UNSIGNED_BYTE */) {
pixels = HEAPU8.subarray((pixels),(pixels+bytes));
} else if (type == 0x1406 /* GL_FLOAT */) {
pixels = HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
} else if (type == 0x1405 /* GL_UNSIGNED_INT */ || type == 0x84FA /* UNSIGNED_INT_24_8_WEBGL */) {
pixels = HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
} else {
pixels = HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
}
return {
pixels: pixels,
internalFormat: internalFormat
};
}function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
var pixelData;
if (pixels) {
pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, -1).pixels;
} else {
pixelData = null;
}
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
}
function _emscripten_glPolygonOffset(x0, x1) { GLctx.polygonOffset(x0, x1) }
var _emscripten_asm_const_int=true;
function _emscripten_glUniform2f(location, v0, v1) {
location = GL.uniforms[location];
GLctx.uniform2f(location, v0, v1);
}
function _glGetAttribLocation(program, name) {
program = GL.programs[program];
name = Pointer_stringify(name);
return GLctx.getAttribLocation(program, name);
}
function _glfwWindowHint(target, hint) {
GLFW.hints[target] = hint;
}
var _sin=Math_sin;
function _glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) }
function _glCreateProgram() {
var id = GL.getNewId(GL.programs);
var program = GLctx.createProgram();
program.name = id;
GL.programs[id] = program;
return id;
}
function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
for (var i = 0; i < n; i++) {
var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
var renderbuffer = GL.renderbuffers[id];
if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
GLctx.deleteRenderbuffer(renderbuffer);
renderbuffer.name = 0;
GL.renderbuffers[id] = null;
}
}
function _emscripten_glGetBufferParameteriv(target, value, data) {
if (!data) {
// GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
// if data == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
}
function emscriptenWebGLGetUniform(program, location, params, type) {
if (!params) {
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
// if params == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
if (typeof data == 'number' || typeof data == 'boolean') {
switch (type) {
case 'Integer': HEAP32[((params)>>2)]=data; break;
case 'Float': HEAPF32[((params)>>2)]=data; break;
default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
}
} else {
for (var i = 0; i < data.length; i++) {
switch (type) {
case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
}
}
}
}function _emscripten_glGetUniformiv(program, location, params) {
emscriptenWebGLGetUniform(program, location, params, 'Integer');
}
function _emscripten_glDepthMask(x0) { GLctx.depthMask(x0) }
function _emscripten_glDepthRangef(x0, x1) { GLctx.depthRange(x0, x1) }
function _emscripten_glDepthRange(x0, x1) { GLctx.depthRange(x0, x1) }
function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) {
if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
if (!target) target = document;
else {
target = JSEvents.findEventTarget(target);
if (!target) return -4;
}
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange");
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange");
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange");
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange");
return 0;
}
var _fabs=Math_abs;
function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
HEAP32[((range)>>2)]=result.rangeMin;
HEAP32[(((range)+(4))>>2)]=result.rangeMax;
HEAP32[((precision)>>2)]=result.precision;
}
function _emscripten_glUniform1fv(location, count, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform
view = GL.miniTempBufferViews[0];
view[0] = HEAPF32[((value)>>2)];
} else {
view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
}
GLctx.uniform1fv(location, view);
}
function _glDeleteBuffers(n, buffers) {
for (var i = 0; i < n; i++) {
var id = HEAP32[(((buffers)+(i*4))>>2)];
var buffer = GL.buffers[id];
// From spec: "glDeleteBuffers silently ignores 0's and names that do not
// correspond to existing buffer objects."
if (!buffer) continue;
GLctx.deleteBuffer(buffer);
buffer.name = 0;
GL.buffers[id] = null;
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
}
}
var _atan2=Math_atan2;
function _emscripten_glBindProgramARB() {
Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
}
function _emscripten_glBindTexture(target, texture) {
GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
}
function _glfwDefaultWindowHints() {
GLFW.hints = GLFW.defaultHints;
}
function _emscripten_glDeleteProgram(id) {
if (!id) return;
var program = GL.programs[id];
if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
GLctx.deleteProgram(program);
program.name = 0;
GL.programs[id] = null;
GL.programInfos[id] = null;
}
function _emscripten_glDisable(x0) { GLctx.disable(x0) }
function _emscripten_glVertexAttrib3fv(index, v) {
v = HEAPF32.subarray((v)>>2,(v+12)>>2);
GLctx.vertexAttrib3fv(index, v);
}
function _glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) }
function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
program = GL.programs[program];
var info = GLctx.getActiveAttrib(program, index);
if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
var infoname = info.name.slice(0, Math.max(0, bufSize - 1));
if (bufSize > 0 && name) {
writeStringToMemory(infoname, name);
if (length) HEAP32[((length)>>2)]=infoname.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
if (size) HEAP32[((size)>>2)]=info.size;
if (type) HEAP32[((type)>>2)]=info.type;
}
function _emscripten_glIsFramebuffer(framebuffer) {
var fb = GL.framebuffers[framebuffer];
if (!fb) return 0;
return GLctx.isFramebuffer(fb);
}
function _emscripten_glLineWidth(x0) { GLctx.lineWidth(x0) }
function _glfwGetCursorPos(winid, x, y) {
GLFW.getCursorPos(winid, x, y);
}
function _emscripten_glGetString(name_) {
if (GL.stringCache[name_]) return GL.stringCache[name_];
var ret;
switch(name_) {
case 0x1F00 /* GL_VENDOR */:
case 0x1F01 /* GL_RENDERER */:
case 0x1F02 /* GL_VERSION */:
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
break;
case 0x1F03 /* GL_EXTENSIONS */:
var exts = GLctx.getSupportedExtensions();
var gl_exts = [];
for (var i in exts) {
gl_exts.push(exts[i]);
gl_exts.push("GL_" + exts[i]);
}
ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
break;
case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL);
break;
default:
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
return 0;
}
GL.stringCache[name_] = ret;
return ret;
}
function _emscripten_glGetAttribLocation(program, name) {
program = GL.programs[program];
name = Pointer_stringify(name);
return GLctx.getAttribLocation(program, name);
}
function _emscripten_glRotatef() {
Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
}
function emscriptenWebGLGet(name_, p, type) {
// Guard against user passing a null pointer.
// Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
// Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
// better to report an error instead of doing anything random.
if (!p) {
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
var ret = undefined;
switch(name_) { // Handle a few trivial GLES values
case 0x8DFA: // GL_SHADER_COMPILER
ret = 1;
break;
case 0x8DF8: // GL_SHADER_BINARY_FORMATS
if (type !== 'Integer' && type !== 'Integer64') {
GL.recordError(0x0500); // GL_INVALID_ENUM
}
return; // Do not write anything to the out pointer, since no binary formats are supported.
case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
ret = 0;
break;
case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
// WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
// so implement it ourselves to allow C++ GLES2 code get the length.
var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
ret = formats.length;
break;
case 0x8B9A: // GL_IMPLEMENTATION_COLOR_READ_TYPE
ret = 0x1401; // GL_UNSIGNED_BYTE
break;
case 0x8B9B: // GL_IMPLEMENTATION_COLOR_READ_FORMAT
ret = 0x1908; // GL_RGBA
break;
}
if (ret === undefined) {
var result = GLctx.getParameter(name_);
switch (typeof(result)) {
case "number":
ret = result;
break;
case "boolean":
ret = result ? 1 : 0;
break;
case "string":
GL.recordError(0x0500); // GL_INVALID_ENUM
return;
case "object":
if (result === null) {
// null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
// can mean an invalid name_, which we need to report as an error
switch(name_) {
case 0x8894: // ARRAY_BUFFER_BINDING
case 0x8B8D: // CURRENT_PROGRAM
case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
case 0x8CA6: // FRAMEBUFFER_BINDING
case 0x8CA7: // RENDERBUFFER_BINDING
case 0x8069: // TEXTURE_BINDING_2D
case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
ret = 0;
break;
}
default: {
GL.recordError(0x0500); // GL_INVALID_ENUM
return;
}
}
} else if (result instanceof Float32Array ||
result instanceof Uint32Array ||
result instanceof Int32Array ||
result instanceof Array) {
for (var i = 0; i < result.length; ++i) {
switch (type) {
case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break;
case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break;
default: throw 'internal glGet error, bad type: ' + type;
}
}
return;
} else if (result instanceof WebGLBuffer ||
result instanceof WebGLProgram ||
result instanceof WebGLFramebuffer ||
result instanceof WebGLRenderbuffer ||
result instanceof WebGLTexture) {
ret = result.name | 0;
} else {
GL.recordError(0x0500); // GL_INVALID_ENUM
return;
}
break;
default:
GL.recordError(0x0500); // GL_INVALID_ENUM
return;
}
}
switch (type) {
case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break;
case 'Integer': HEAP32[((p)>>2)]=ret; break;
case 'Float': HEAPF32[((p)>>2)]=ret; break;
case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
default: throw 'internal glGet error, bad type: ' + type;
}
}function _emscripten_glGetIntegerv(name_, p) {
emscriptenWebGLGet(name_, p, 'Integer');
}
function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
HEAP32[((params)>>2)]=result;
}
function _llvm_stackrestore(p) {
var self = _llvm_stacksave;
var ret = self.LLVM_SAVEDSTACKS[p];
self.LLVM_SAVEDSTACKS.splice(p, 1);
Runtime.stackRestore(ret);
}
function _glfwSetWindowShouldClose(winid, value) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.shouldClose = value;
}
function _emscripten_glClientActiveTexture() {
Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
}
function _glGenBuffers(n, buffers) {
for (var i = 0; i < n; i++) {
var buffer = GLctx.createBuffer();
if (!buffer) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.buffers);
buffer.name = id;
GL.buffers[id] = buffer;
HEAP32[(((buffers)+(i*4))>>2)]=id;
}
}
function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
if (log === null) log = '(unknown error)';
log = log.substr(0, maxLength - 1);
if (maxLength > 0 && infoLog) {
writeStringToMemory(log, infoLog);
if (length) HEAP32[((length)>>2)]=log.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
}
function _glfwGetTime() {
return GLFW.getTime() - GLFW.initialTime;
}
function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
if (!params) {
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
// if params == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
}
function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx.stencilOpSeparate(x0, x1, x2, x3) }
function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
if (!data.pixels) {
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
return;
}
GLctx.readPixels(x, y, width, height, format, type, data.pixels);
}
function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
var heapView;
if (data) {
heapView = HEAPU8.subarray((data),(data+imageSize));
} else {
heapView = null;
}
GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, heapView);
}
function _emscripten_glGetError() {
// First return any GL error generated by the emscripten library_gl.js interop layer.
if (GL.lastError) {
var error = GL.lastError;
GL.lastError = 0/*GL_NO_ERROR*/;
return error;
} else { // If there were none, return the GL error from the browser GL context.
return GLctx.getError();
}
}
function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
GLctx.framebufferTexture2D(target, attachment, textarget,
GL.textures[texture], level);
}
function _pthread_cleanup_push(routine, arg) {
__ATEXIT__.push(function() { Runtime.dynCall('vi', routine, [arg]) })
_pthread_cleanup_push.level = __ATEXIT__.length;
}
function _emscripten_glIsEnabled(x0) { return GLctx.isEnabled(x0) }
function _alSourceQueueBuffers(source, count, buffers) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
for (var i = 0; i < count; ++i) {
var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)];
if (bufferIdx > AL.currentContext.buf.length) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
}
for (var i = 0; i < count; ++i) {
var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)];
var buffer = AL.currentContext.buf[bufferIdx - 1];
src.queue.push({ buffer: buffer, src: null });
}
AL.updateSource(src);
}
function _alSourcef(source, param, value) {
if (!AL.currentContext) {
return;
}
var src = AL.currentContext.src[source];
if (!src) {
AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */;
return;
}
switch (param) {
case 0x1003 /* AL_PITCH */:
break;
case 0x100A /* AL_GAIN */:
src.gain.gain.value = value;
break;
// case 0x100D /* AL_MIN_GAIN */:
// break;
// case 0x100E /* AL_MAX_GAIN */:
// break;
case 0x1023 /* AL_MAX_DISTANCE */:
src.maxDistance = value;
break;
case 0x1021 /* AL_ROLLOFF_FACTOR */:
src.rolloffFactor = value;
break;
case 0x1022 /* AL_CONE_OUTER_GAIN */:
src.coneOuterGain = value;
break;
case 0x1001 /* AL_CONE_INNER_ANGLE */:
src.coneInnerAngle = value;
break;
case 0x1002 /* AL_CONE_OUTER_ANGLE */:
src.coneOuterAngle = value;
break;
case 0x1020 /* AL_REFERENCE_DISTANCE */:
src.refDistance = value;
break;
default:
AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */;
break;
}
}
Module["_memmove"] = _memmove;
function _glGenTextures(n, textures) {
for (var i = 0; i < n; i++) {
var texture = GLctx.createTexture();
if (!texture) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.textures);
texture.name = id;
GL.textures[id] = texture;
HEAP32[(((textures)+(i*4))>>2)]=id;
}
}
function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) }
function _glDepthFunc(x0) { GLctx.depthFunc(x0) }
function _emscripten_glUniform2i(location, v0, v1) {
location = GL.uniforms[location];
GLctx.uniform2i(location, v0, v1);
}
function _emscripten_glClearDepthf(x0) { GLctx.clearDepth(x0) }
function _emscripten_glClear(x0) { GLctx.clear(x0) }
function _alGetError() {
if (!AL.currentContext) {
return 0xA004 /* AL_INVALID_OPERATION */;
} else {
// Reset error on get.
var err = AL.currentContext.err;
AL.currentContext.err = 0 /* AL_NO_ERROR */;
return err;
}
}
function _emscripten_glBindBuffer(target, buffer) {
var bufferObj = buffer ? GL.buffers[buffer] : null;
GLctx.bindBuffer(target, bufferObj);
}
function _emscripten_glGetUniformfv(program, location, params) {
emscriptenWebGLGetUniform(program, location, params, 'Float');
}
function _glGetProgramiv(program, pname, p) {
if (!p) {
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
// if p == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
var log = GLctx.getProgramInfoLog(GL.programs[program]);
if (log === null) log = '(unknown error)';
HEAP32[((p)>>2)]=log.length + 1;
} else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
var ptable = GL.programInfos[program];
if (ptable) {
HEAP32[((p)>>2)]=ptable.maxUniformLength;
return;
} else if (program < GL.counter) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
} else {
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
}
} else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
var ptable = GL.programInfos[program];
if (ptable) {
if (ptable.maxAttributeLength == -1) {
var program = GL.programs[program];
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
for(var i = 0; i < numAttribs; ++i) {
var activeAttrib = GLctx.getActiveAttrib(program, i);
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
}
}
HEAP32[((p)>>2)]=ptable.maxAttributeLength;
return;
} else if (program < GL.counter) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
} else {
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
}
} else {
HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
}
}
function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr);
}
function _alcMakeContextCurrent(context) {
if (context == 0) {
AL.currentContext = null;
return 0;
} else {
AL.currentContext = AL.contexts[context - 1];
return 1;
}
}
function _glGetUniformLocation(program, name) {
name = Pointer_stringify(name);
var arrayOffset = 0;
// If user passed an array accessor "[index]", parse the array index off the accessor.
if (name.indexOf(']', name.length-1) !== -1) {
var ls = name.lastIndexOf('[');
var arrayIndex = name.slice(ls+1, -1);
if (arrayIndex.length > 0) {
arrayOffset = parseInt(arrayIndex);
if (arrayOffset < 0) {
return -1;
}
}
name = name.slice(0, ls);
}
var ptable = GL.programInfos[program];
if (!ptable) {
return -1;
}
var utable = ptable.uniforms;
var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
return uniformInfo[1]+arrayOffset;
} else {
return -1;
}
}
function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
var result = GLctx.getAttachedShaders(GL.programs[program]);
var len = result.length;
if (len > maxCount) {
len = maxCount;
}
HEAP32[((count)>>2)]=len;
for (var i = 0; i < len; ++i) {
var id = GL.shaders.indexOf(result[i]);
HEAP32[(((shaders)+(i*4))>>2)]=id;
}
}
function _emscripten_glGenRenderbuffers(n, renderbuffers) {
for (var i = 0; i < n; i++) {
var renderbuffer = GLctx.createRenderbuffer();
if (!renderbuffer) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.renderbuffers);
renderbuffer.name = id;
GL.renderbuffers[id] = renderbuffer;
HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
}
}
function _emscripten_glFrontFace(x0) { GLctx.frontFace(x0) }
function _emscripten_glActiveTexture(x0) { GLctx.activeTexture(x0) }
function _emscripten_glUniform1iv(location, count, value) {
location = GL.uniforms[location];
value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
GLctx.uniform1iv(location, value);
}
function _glUniform4fv(location, count, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform
view = GL.miniTempBufferViews[3];
view[0] = HEAPF32[((value)>>2)];
view[1] = HEAPF32[(((value)+(4))>>2)];
view[2] = HEAPF32[(((value)+(8))>>2)];
view[3] = HEAPF32[(((value)+(12))>>2)];
} else {
view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
}
GLctx.uniform4fv(location, view);
}
function _emscripten_glTexCoordPointer() {
Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
}
function _emscripten_glGetInfoLogARB() {
Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
}
function __exit(status) {
// void _exit(int status);
// http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
Module['exit'](status);
}function _exit(status) {
__exit(status);
}
function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx.renderbufferStorage(x0, x1, x2, x3) }
function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) }
function _glfwSetCursorPosCallback(winid, cbfun) {
GLFW.setCursorPosCallback(winid, cbfun);
}
function _emscripten_glShaderBinary() {
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
}
function _emscripten_glIsProgram(program) {
var program = GL.programs[program];
if (!program) return 0;
return GLctx.isProgram(program);
}
function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx.blendColor(x0, x1, x2, x3) }
function _emscripten_glGetShaderiv(shader, pname, p) {
if (!p) {
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
// if p == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
if (log === null) log = '(unknown error)';
HEAP32[((p)>>2)]=log.length + 1;
} else {
HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
}
}
function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform matrix
view = GL.miniTempBufferViews[8];
for (var i = 0; i < 9; i++) {
view[i] = HEAPF32[(((value)+(i*4))>>2)];
}
} else {
view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
}
GLctx.uniformMatrix3fv(location, transpose, view);
}
function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx.vertexAttrib2f(x0, x1, x2) }
function _emscripten_glUniform4fv(location, count, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform
view = GL.miniTempBufferViews[3];
view[0] = HEAPF32[((value)>>2)];
view[1] = HEAPF32[(((value)+(4))>>2)];
view[2] = HEAPF32[(((value)+(8))>>2)];
view[3] = HEAPF32[(((value)+(12))>>2)];
} else {
view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
}
GLctx.uniform4fv(location, view);
}
function _glBufferSubData(target, offset, size, data) {
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
}
function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
var log = GLctx.getProgramInfoLog(GL.programs[program]);
if (log === null) log = '(unknown error)';
log = log.substr(0, maxLength - 1);
if (maxLength > 0 && infoLog) {
writeStringToMemory(log, infoLog);
if (length) HEAP32[((length)>>2)]=log.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
}
function _alcDestroyContext(context) {
// Stop playback, etc
clearInterval(AL.contexts[context - 1].interval);
}
function _emscripten_glGenFramebuffers(n, ids) {
for (var i = 0; i < n; ++i) {
var framebuffer = GLctx.createFramebuffer();
if (!framebuffer) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.framebuffers);
framebuffer.name = id;
GL.framebuffers[id] = framebuffer;
HEAP32[(((ids)+(i*4))>>2)]=id;
}
}
function _glGetShaderiv(shader, pname, p) {
if (!p) {
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
// if p == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
if (log === null) log = '(unknown error)';
HEAP32[((p)>>2)]=log.length + 1;
} else {
HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
}
}
function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx.blendEquationSeparate(x0, x1) }
function _glfwSetWindowIconifyCallback(winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.windowIconifyFunc = cbfun;
}
function _emscripten_glDrawRangeElements() {
Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
}
function _emscripten_glGenTextures(n, textures) {
for (var i = 0; i < n; i++) {
var texture = GLctx.createTexture();
if (!texture) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.textures);
texture.name = id;
GL.textures[id] = texture;
HEAP32[(((textures)+(i*4))>>2)]=id;
}
}
function _emscripten_glVertexAttrib2fv(index, v) {
v = HEAPF32.subarray((v)>>2,(v+8)>>2);
GLctx.vertexAttrib2fv(index, v);
}
var _floorf=Math_floor;
function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
program = GL.programs[program];
var info = GLctx.getActiveUniform(program, index);
if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
var infoname = info.name.slice(0, Math.max(0, bufSize - 1));
if (bufSize > 0 && name) {
writeStringToMemory(infoname, name);
if (length) HEAP32[((length)>>2)]=infoname.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
if (size) HEAP32[((size)>>2)]=info.size;
if (type) HEAP32[((type)>>2)]=info.type;
}
function _emscripten_glDeleteObjectARB() {
Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
}
function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) {
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove");
return 0;
}
function _emscripten_glUniform1f(location, v0) {
location = GL.uniforms[location];
GLctx.uniform1f(location, v0);
}
function _alcCreateContext(device, attrList) {
if (device != 1) {
return 0;
}
if (attrList) {
return 0;
}
var ctx;
try {
ctx = new AudioContext();
} catch (e) {
try {
ctx = new webkitAudioContext();
} catch (e) {}
}
if (ctx) {
// Old Web Audio API (e.g. Safari 6.0.5) had an inconsistently named createGainNode function.
if (typeof(ctx.createGain) === 'undefined') ctx.createGain = ctx.createGainNode;
var gain = ctx.createGain();
gain.connect(ctx.destination);
var context = {
ctx: ctx,
err: 0,
src: {},
buf: [],
interval: setInterval(function() { AL.updateSources(context); }, AL.QUEUE_INTERVAL),
gain: gain
};
AL.contexts.push(context);
return AL.contexts.length;
} else {
return 0;
}
}
function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr);
}
function _alcCloseDevice(device) {
// Stop playback, etc
}
function _glShaderSource(shader, count, string, length) {
var source = GL.getSource(shader, count, string, length);
GLctx.shaderSource(GL.shaders[shader], source);
}
var _sqrtf=Math_sqrt;
function _emscripten_glDrawArrays(mode, first, count) {
GLctx.drawArrays(mode, first, count);
}
function _emscripten_glGenBuffers(n, buffers) {
for (var i = 0; i < n; i++) {
var buffer = GLctx.createBuffer();
if (!buffer) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.buffers);
buffer.name = id;
GL.buffers[id] = buffer;
HEAP32[(((buffers)+(i*4))>>2)]=id;
}
}
var _log=Math_log;
function _glfwSetCharCallback(winid, cbfun) {
GLFW.setCharCallback(winid, cbfun);
}
function _emscripten_glGetUniformLocation(program, name) {
name = Pointer_stringify(name);
var arrayOffset = 0;
// If user passed an array accessor "[index]", parse the array index off the accessor.
if (name.indexOf(']', name.length-1) !== -1) {
var ls = name.lastIndexOf('[');
var arrayIndex = name.slice(ls+1, -1);
if (arrayIndex.length > 0) {
arrayOffset = parseInt(arrayIndex);
if (arrayOffset < 0) {
return -1;
}
}
name = name.slice(0, ls);
}
var ptable = GL.programInfos[program];
if (!ptable) {
return -1;
}
var utable = ptable.uniforms;
var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
return uniformInfo[1]+arrayOffset;
} else {
return -1;
}
}
function _glActiveTexture(x0) { GLctx.activeTexture(x0) }
function _glBindBuffer(target, buffer) {
var bufferObj = buffer ? GL.buffers[buffer] : null;
GLctx.bindBuffer(target, bufferObj);
}
function _glPixelStorei(pname, param) {
if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
GL.packAlignment = param;
} else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
GL.unpackAlignment = param;
}
GLctx.pixelStorei(pname, param);
}
function _emscripten_glEnable(x0) { GLctx.enable(x0) }
function _emscripten_glScissor(x0, x1, x2, x3) { GLctx.scissor(x0, x1, x2, x3) }
function _glfwSetCursorEnterCallback(winid, cbfun) {
var win = GLFW.WindowFromId(winid);
if (!win) return;
win.cursorEnterFunc = cbfun;
}
Module["_bitshift64Lshr"] = _bitshift64Lshr;
function _glBufferData(target, size, data, usage) {
switch (usage) { // fix usages, WebGL only has *_DRAW
case 0x88E1: // GL_STREAM_READ
case 0x88E2: // GL_STREAM_COPY
usage = 0x88E0; // GL_STREAM_DRAW
break;
case 0x88E5: // GL_STATIC_READ
case 0x88E6: // GL_STATIC_COPY
usage = 0x88E4; // GL_STATIC_DRAW
break;
case 0x88E9: // GL_DYNAMIC_READ
case 0x88EA: // GL_DYNAMIC_COPY
usage = 0x88E8; // GL_DYNAMIC_DRAW
break;
}
if (!data) {
GLctx.bufferData(target, size, usage);
} else {
GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
}
}
var _BDtoIHigh=true;
function _emscripten_glIsShader(shader) {
var s = GL.shaders[shader];
if (!s) return 0;
return GLctx.isShader(s);
}
function _emscripten_glDrawBuffers(n, bufs) {
var bufArray = [];
for (var i = 0; i < n; i++)
bufArray.push(HEAP32[(((bufs)+(i*4))>>2)]);
GLctx['drawBuffers'](bufArray);
}
function _emscripten_glBindFramebuffer(target, framebuffer) {
GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
}
function _alcGetContextsDevice(context) {
if (context <= AL.contexts.length && context > 0) {
// Returns the only one audio device
return 1;
}
return 0;
}
function _emscripten_glBlendEquation(x0) { GLctx.blendEquation(x0) }
function _emscripten_glBufferSubData(target, offset, size, data) {
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
}
function _emscripten_glBufferData(target, size, data, usage) {
switch (usage) { // fix usages, WebGL only has *_DRAW
case 0x88E1: // GL_STREAM_READ
case 0x88E2: // GL_STREAM_COPY
usage = 0x88E0; // GL_STREAM_DRAW
break;
case 0x88E5: // GL_STATIC_READ
case 0x88E6: // GL_STATIC_COPY
usage = 0x88E4; // GL_STATIC_DRAW
break;
case 0x88E9: // GL_DYNAMIC_READ
case 0x88EA: // GL_DYNAMIC_COPY
usage = 0x88E8; // GL_DYNAMIC_DRAW
break;
}
if (!data) {
GLctx.bufferData(target, size, usage);
} else {
GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
}
}
function _sbrk(bytes) {
// Implement a Linux-like 'memory area' for our 'process'.
// Changes the size of the memory area by |bytes|; returns the
// address of the previous top ('break') of the memory area
// We control the "dynamic" memory - DYNAMIC_BASE to DYNAMICTOP
var self = _sbrk;
if (!self.called) {
DYNAMICTOP = alignMemoryPage(DYNAMICTOP); // make sure we start out aligned
self.called = true;
assert(Runtime.dynamicAlloc);
self.alloc = Runtime.dynamicAlloc;
Runtime.dynamicAlloc = function() { abort('cannot dynamically allocate, sbrk now has control') };
}
var ret = DYNAMICTOP;
if (bytes != 0) {
var success = self.alloc(bytes);
if (!success) return -1 >>> 0; // sbrk failure code
}
return ret; // Previous break location.
}
Module["_bitshift64Shl"] = _bitshift64Shl;
function _emscripten_glVertexAttrib4fv(index, v) {
v = HEAPF32.subarray((v)>>2,(v+16)>>2);
GLctx.vertexAttrib4fv(index, v);
}
var _BItoD=true;
function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
var result = GLctx.getShaderSource(GL.shaders[shader]);
if (!result) return; // If an error occurs, nothing will be written to length or source.
result = result.slice(0, Math.max(0, bufSize - 1));
if (bufSize > 0 && source) {
writeStringToMemory(result, source);
if (length) HEAP32[((length)>>2)]=result.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
}
function _emscripten_glClearDepth(x0) { GLctx.clearDepth(x0) }
function _emscripten_glGetFloatv(name_, p) {
emscriptenWebGLGet(name_, p, 'Float');
}
function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
var pixelData;
if (pixels) {
var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
pixelData = data.pixels;
internalFormat = data.internalFormat;
} else {
pixelData = null;
}
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
}
function ___assert_fail(condition, filename, line, func) {
ABORT = true;
throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace();
}
function _emscripten_glVertexAttribDivisor(index, divisor) {
GLctx['vertexAttribDivisor'](index, divisor);
}
function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
}
function _emscripten_glDrawElements(mode, count, type, indices) {
GLctx.drawElements(mode, count, type, indices);
}
function _glfwSetMouseButtonCallback(winid, cbfun) {
GLFW.setMouseButtonCallback(winid, cbfun);
}
function _emscripten_glCreateProgram() {
var id = GL.getNewId(GL.programs);
var program = GLctx.createProgram();
program.name = id;
GL.programs[id] = program;
return id;
}
function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
var heapView;
if (data) {
heapView = HEAPU8.subarray((data),(data+imageSize));
} else {
heapView = null;
}
GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView);
}
function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) }
function _emscripten_glBindVertexArray(vao) {
GLctx['bindVertexArray'](GL.vaos[vao]);
}
var _floor=Math_floor;
function _emscripten_glLoadMatrixf() {
Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
}
function _glDeleteShader(id) {
if (!id) return;
var shader = GL.shaders[id];
if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
GLctx.deleteShader(shader);
GL.shaders[id] = null;
}
function _emscripten_glGetProgramiv(program, pname, p) {
if (!p) {
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
// if p == null, issue a GL error to notify user about it.
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
return;
}
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
var log = GLctx.getProgramInfoLog(GL.programs[program]);
if (log === null) log = '(unknown error)';
HEAP32[((p)>>2)]=log.length + 1;
} else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
var ptable = GL.programInfos[program];
if (ptable) {
HEAP32[((p)>>2)]=ptable.maxUniformLength;
return;
} else if (program < GL.counter) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
} else {
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
}
} else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
var ptable = GL.programInfos[program];
if (ptable) {
if (ptable.maxAttributeLength == -1) {
var program = GL.programs[program];
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
for(var i = 0; i < numAttribs; ++i) {
var activeAttrib = GLctx.getActiveAttrib(program, i);
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
}
}
HEAP32[((p)>>2)]=ptable.maxAttributeLength;
return;
} else if (program < GL.counter) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
} else {
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
}
} else {
HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
}
}
function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
var log = GLctx.getProgramInfoLog(GL.programs[program]);
if (log === null) log = '(unknown error)';
log = log.substr(0, maxLength - 1);
if (maxLength > 0 && infoLog) {
writeStringToMemory(log, infoLog);
if (length) HEAP32[((length)>>2)]=log.length;
} else {
if (length) HEAP32[((length)>>2)]=0;
}
}
function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
var pixelData;
if (pixels) {
var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
pixelData = data.pixels;
internalFormat = data.internalFormat;
} else {
pixelData = null;
}
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
}
var _exp=Math_exp;
function ___unlock() {}
function _emscripten_glColorPointer() {
Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
}
function _glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) }
function _glfwPollEvents() {}
function _emscripten_glCheckFramebufferStatus(x0) { return GLctx.checkFramebufferStatus(x0) }
function _glfwDestroyWindow(winid) {
return GLFW.destroyWindow(winid);
}
function _emscripten_glFlush() { GLctx.flush() }
function _glfwSetErrorCallback(cbfun) {
GLFW.errorFunc = cbfun;
}
function _emscripten_glCreateShader(shaderType) {
var id = GL.getNewId(GL.shaders);
GL.shaders[id] = GLctx.createShader(shaderType);
return id;
}
function _glUniformMatrix4fv(location, count, transpose, value) {
location = GL.uniforms[location];
var view;
if (count === 1) {
// avoid allocation for the common case of uploading one uniform matrix
view = GL.miniTempBufferViews[15];
for (var i = 0; i < 16; i++) {
view[i] = HEAPF32[(((value)+(i*4))>>2)];
}
} else {
view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
}
GLctx.uniformMatrix4fv(location, transpose, view);
}
function _emscripten_glValidateProgram(program) {
GLctx.validateProgram(GL.programs[program]);
}
function _glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) }
function _glfwSetKeyCallback(winid, cbfun) {
GLFW.setKeyCallback(winid, cbfun);
}
function _emscripten_glColorMask(x0, x1, x2, x3) { GLctx.colorMask(x0, x1, x2, x3) }
function _emscripten_glPixelStorei(pname, param) {
if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
GL.packAlignment = param;
} else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
GL.unpackAlignment = param;
}
GLctx.pixelStorei(pname, param);
}
function _emscripten_glDeleteTextures(n, textures) {
for (var i = 0; i < n; i++) {
var id = HEAP32[(((textures)+(i*4))>>2)];
var texture = GL.textures[id];
if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
GLctx.deleteTexture(texture);
texture.name = 0;
GL.textures[id] = null;
}
}
function _emscripten_glCompileShader(shader) {
GLctx.compileShader(GL.shaders[shader]);
}
function _emscripten_glGenVertexArrays(n, arrays) {
for(var i = 0; i < n; i++) {
var vao = GLctx['createVertexArray']();
if (!vao) {
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
return;
}
var id = GL.getNewId(GL.vaos);
vao.name = id;
GL.vaos[id] = vao;
HEAP32[(((arrays)+(i*4))>>2)]=id;
}
}
function _time(ptr) {
var ret = (Date.now()/1000)|0;
if (ptr) {
HEAP32[((ptr)>>2)]=ret;
}
return ret;
}
function _pthread_self() {
//FIXME: assumes only a single thread
return 0;
}
function _emscripten_glGetBooleanv(name_, p) {
emscriptenWebGLGet(name_, p, 'Boolean');
}
function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
try {
// fcntl64
var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
switch (cmd) {
case 0: {
var arg = SYSCALLS.get();
if (arg < 0) {
return -ERRNO_CODES.EINVAL;
}
var newStream;
newStream = FS.open(stream.path, stream.flags, 0, arg);
return newStream.fd;
}
case 1:
case 2:
return 0; // FD_CLOEXEC makes no sense for a single process.
case 3:
return stream.flags;
case 4: {
var arg = SYSCALLS.get();
stream.flags |= arg;
return 0;
}
case 12:
case 12: {
var arg = SYSCALLS.get();
var offset = 0;
// We're always unlocked.
HEAP16[(((arg)+(offset))>>1)]=2;
return 0;
}
case 13:
case 14:
case 13:
case 14:
return 0; // Pretend that the locking is successful.
case 16:
case 8:
return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
case 9:
// musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
___setErrNo(ERRNO_CODES.EINVAL);
return -1;
default: {
return -ERRNO_CODES.EINVAL;
}
}
} catch (e) {
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
return -e.errno;
}
}
var GLctx; GL.init()
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); }
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) }
STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
staticSealed = true; // seal the static portion of memory
STACK_MAX = STACK_BASE + TOTAL_STACK;
DYNAMIC_BASE = DYNAMICTOP = Runtime.alignMemory(STACK_MAX);
assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");
var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_DYNAMIC);
function invoke_viiiii(index,a1,a2,a3,a4,a5) {
try {
Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vd(index,a1) {
try {
Module["dynCall_vd"](index,a1);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vid(index,a1,a2) {
try {
Module["dynCall_vid"](index,a1,a2);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vi(index,a1) {
try {
Module["dynCall_vi"](index,a1);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vii(index,a1,a2) {
try {
Module["dynCall_vii"](index,a1,a2);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_ii(index,a1) {
try {
return Module["dynCall_ii"](index,a1);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viddd(index,a1,a2,a3,a4) {
try {
Module["dynCall_viddd"](index,a1,a2,a3,a4);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vidd(index,a1,a2,a3) {
try {
Module["dynCall_vidd"](index,a1,a2,a3);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_iiii(index,a1,a2,a3) {
try {
return Module["dynCall_iiii"](index,a1,a2,a3);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
try {
Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
try {
Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viii(index,a1,a2,a3) {
try {
Module["dynCall_viii"](index,a1,a2,a3);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vidddd(index,a1,a2,a3,a4,a5) {
try {
Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vdi(index,a1,a2) {
try {
Module["dynCall_vdi"](index,a1,a2);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
try {
Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
try {
Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_iii(index,a1,a2) {
try {
return Module["dynCall_iii"](index,a1,a2);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_i(index) {
try {
return Module["dynCall_i"](index);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
try {
return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
try {
Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vdddd(index,a1,a2,a3,a4) {
try {
Module["dynCall_vdddd"](index,a1,a2,a3,a4);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_vdd(index,a1,a2) {
try {
Module["dynCall_vdd"](index,a1,a2);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_v(index) {
try {
Module["dynCall_v"](index);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viid(index,a1,a2,a3) {
try {
Module["dynCall_viid"](index,a1,a2,a3);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
function invoke_viiii(index,a1,a2,a3,a4) {
try {
Module["dynCall_viiii"](index,a1,a2,a3,a4);
} catch(e) {
if (typeof e !== 'number' && e !== 'longjmp') throw e;
asm["setThrew"](1, 0);
}
}
Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity, "byteLength": byteLength };
Module.asmLibraryArg = { "abort": abort, "assert": assert, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_iiiiii": invoke_iiiiii, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_exp": _exp, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_alBufferData": _alBufferData, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_alSource3f": _alSource3f, "_sqrtf": _sqrtf, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_ceilf": _ceilf, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_alcGetString": _alcGetString, "_sysconf": _sysconf, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "___syscall221": ___syscall221, "_cos": _cos, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_pthread_cleanup_push": _pthread_cleanup_push, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_alSourcePlay": _alSourcePlay, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "___syscall146": ___syscall146, "_glfwDestroyWindow": _glfwDestroyWindow, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_alcCreateContext": _alcCreateContext, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_abort": _abort, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_atan2": _atan2, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_fabsf": _fabsf, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_glDrawElements": _glDrawElements, "_alGetSourcei": _alGetSourcei, "_glBufferSubData": _glBufferSubData, "_alcMakeContextCurrent": _alcMakeContextCurrent, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_alSourceQueueBuffers": _alSourceQueueBuffers, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_eglGetProcAddress": _eglGetProcAddress, "_alcGetCurrentContext": _alcGetCurrentContext, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_alGenBuffers": _alGenBuffers, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_fabs": _fabs, "_glGenTextures": _glGenTextures, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_alDeleteSources": _alDeleteSources, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_alSourceUnqueueBuffers": _alSourceUnqueueBuffers, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_alGetError": _alGetError, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glFinish": _emscripten_glFinish, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_glBindFramebuffer": _glBindFramebuffer, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_asm_const_2": _emscripten_asm_const_2, "_glGetString": _glGetString, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_alSourcef": _alSourcef, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_llvm_pow_f64": _llvm_pow_f64, "_glDeleteFramebuffers": _glDeleteFramebuffers, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_glfwPollEvents": _glfwPollEvents, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_glfwSwapInterval": _glfwSwapInterval, "_glfwGetVideoModes": _glfwGetVideoModes, "_sin": _sin, "_emscripten_glClear": _emscripten_glClear, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_sbrk": _sbrk, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_emscripten_glUniform2i": _emscripten_glUniform2i, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glHint": _emscripten_glHint, "_glfwSetCharCallback": _glfwSetCharCallback, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_alcDestroyContext": _alcDestroyContext, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_glCreateShader": _glCreateShader, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_floorf": _floorf, "_log": _log, "_glActiveTexture": _glActiveTexture, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_alSourceStop": _alSourceStop, "_eglWaitClient": _eglWaitClient, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_alcCloseDevice": _alcCloseDevice, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_alcGetContextsDevice": _alcGetContextsDevice, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glEnable": _emscripten_glEnable, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_floor": _floor, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_cosf": _cosf, "_glGetProgramiv": _glGetProgramiv, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_alListener3f": _alListener3f, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_glUniform4fv": _glUniform4fv, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_sinf": _sinf, "__exit": __exit, "_glfwTerminate": _glfwTerminate, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_alDeleteBuffers": _alDeleteBuffers, "_pthread_self": _pthread_self, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_alGenSources": _alGenSources, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_alcOpenDevice": _alcOpenDevice, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_glTexParameteri": _glTexParameteri, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "cttz_i8": cttz_i8 };
// EMSCRIPTEN_START_ASM
var asm = (function(global, env, buffer) {
'use asm';
var Int8View = global.Int8Array;
var Int16View = global.Int16Array;
var Int32View = global.Int32Array;
var Uint8View = global.Uint8Array;
var Uint16View = global.Uint16Array;
var Uint32View = global.Uint32Array;
var Float32View = global.Float32Array;
var Float64View = global.Float64Array;
var HEAP8 = new Int8View(buffer);
var HEAP16 = new Int16View(buffer);
var HEAP32 = new Int32View(buffer);
var HEAPU8 = new Uint8View(buffer);
var HEAPU16 = new Uint16View(buffer);
var HEAPU32 = new Uint32View(buffer);
var HEAPF32 = new Float32View(buffer);
var HEAPF64 = new Float64View(buffer);
var byteLength = global.byteLength;
var STACKTOP=env.STACKTOP|0;
var STACK_MAX=env.STACK_MAX|0;
var tempDoublePtr=env.tempDoublePtr|0;
var ABORT=env.ABORT|0;
var cttz_i8=env.cttz_i8|0;
var __THREW__ = 0;
var threwValue = 0;
var setjmpId = 0;
var undef = 0;
var nan = global.NaN, inf = global.Infinity;
var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
var tempRet0 = 0;
var tempRet1 = 0;
var tempRet2 = 0;
var tempRet3 = 0;
var tempRet4 = 0;
var tempRet5 = 0;
var tempRet6 = 0;
var tempRet7 = 0;
var tempRet8 = 0;
var tempRet9 = 0;
var Math_floor=global.Math.floor;
var Math_abs=global.Math.abs;
var Math_sqrt=global.Math.sqrt;
var Math_pow=global.Math.pow;
var Math_cos=global.Math.cos;
var Math_sin=global.Math.sin;
var Math_tan=global.Math.tan;
var Math_acos=global.Math.acos;
var Math_asin=global.Math.asin;
var Math_atan=global.Math.atan;
var Math_atan2=global.Math.atan2;
var Math_exp=global.Math.exp;
var Math_log=global.Math.log;
var Math_ceil=global.Math.ceil;
var Math_imul=global.Math.imul;
var Math_min=global.Math.min;
var Math_clz32=global.Math.clz32;
var abort=env.abort;
var assert=env.assert;
var invoke_viiiii=env.invoke_viiiii;
var invoke_vd=env.invoke_vd;
var invoke_vid=env.invoke_vid;
var invoke_vi=env.invoke_vi;
var invoke_vii=env.invoke_vii;
var invoke_ii=env.invoke_ii;
var invoke_viddd=env.invoke_viddd;
var invoke_vidd=env.invoke_vidd;
var invoke_iiii=env.invoke_iiii;
var invoke_viiiiiiii=env.invoke_viiiiiiii;
var invoke_viiiiii=env.invoke_viiiiii;
var invoke_viii=env.invoke_viii;
var invoke_vidddd=env.invoke_vidddd;
var invoke_vdi=env.invoke_vdi;
var invoke_viiiiiii=env.invoke_viiiiiii;
var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
var invoke_iii=env.invoke_iii;
var invoke_i=env.invoke_i;
var invoke_iiiiii=env.invoke_iiiiii;
var invoke_vdddddd=env.invoke_vdddddd;
var invoke_vdddd=env.invoke_vdddd;
var invoke_vdd=env.invoke_vdd;
var invoke_v=env.invoke_v;
var invoke_viid=env.invoke_viid;
var invoke_viiii=env.invoke_viiii;
var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
var _glUseProgram=env._glUseProgram;
var _exp=env._exp;
var _glfwCreateWindow=env._glfwCreateWindow;
var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
var _emscripten_glCullFace=env._emscripten_glCullFace;
var _emscripten_glIsProgram=env._emscripten_glIsProgram;
var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
var _emscripten_glViewport=env._emscripten_glViewport;
var _emscripten_glFrontFace=env._emscripten_glFrontFace;
var _alBufferData=env._alBufferData;
var ___assert_fail=env.___assert_fail;
var _glDeleteProgram=env._glDeleteProgram;
var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
var _emscripten_glUseProgram=env._emscripten_glUseProgram;
var _emscripten_glBlendColor=env._emscripten_glBlendColor;
var _glBindBuffer=env._glBindBuffer;
var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
var _glGetShaderInfoLog=env._glGetShaderInfoLog;
var _alSource3f=env._alSource3f;
var _sqrtf=env._sqrtf;
var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback;
var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback;
var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing;
var _ceilf=env._ceilf;
var _glBlendFunc=env._glBlendFunc;
var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
var _glGetAttribLocation=env._glGetAttribLocation;
var _glDisableVertexAttribArray=env._glDisableVertexAttribArray;
var _emscripten_memcpy_big=env._emscripten_memcpy_big;
var _emscripten_glReadPixels=env._emscripten_glReadPixels;
var _alcGetString=env._alcGetString;
var _sysconf=env._sysconf;
var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback;
var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
var ___syscall221=env.___syscall221;
var _cos=env._cos;
var _llvm_stacksave=env._llvm_stacksave;
var _emscripten_glUniform1i=env._emscripten_glUniform1i;
var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback;
var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
var _glfwInit=env._glfwInit;
var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
var _glGenBuffers=env._glGenBuffers;
var _glShaderSource=env._glShaderSource;
var _emscripten_glGetString=env._emscripten_glGetString;
var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
var _emscripten_glScissor=env._emscripten_glScissor;
var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
var _pthread_cleanup_push=env._pthread_cleanup_push;
var ___syscall145=env.___syscall145;
var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
var _alSourcePlay=env._alSourcePlay;
var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
var ___syscall140=env.___syscall140;
var _glfwSetErrorCallback=env._glfwSetErrorCallback;
var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback;
var _glfwDefaultWindowHints=env._glfwDefaultWindowHints;
var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
var ___syscall146=env.___syscall146;
var _glfwDestroyWindow=env._glfwDestroyWindow;
var _pthread_cleanup_pop=env._pthread_cleanup_pop;
var _emscripten_glAttachShader=env._emscripten_glAttachShader;
var _glVertexAttribPointer=env._glVertexAttribPointer;
var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
var _emscripten_glUniform2f=env._emscripten_glUniform2f;
var _alcCreateContext=env._alcCreateContext;
var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
var _abort=env._abort;
var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
var _atan2=env._atan2;
var _glGetProgramInfoLog=env._glGetProgramInfoLog;
var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
var _emscripten_glGenTextures=env._emscripten_glGenTextures;
var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
var _llvm_stackrestore=env._llvm_stackrestore;
var _fabsf=env._fabsf;
var _glfwMakeContextCurrent=env._glfwMakeContextCurrent;
var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
var _glDrawElements=env._glDrawElements;
var _alGetSourcei=env._alGetSourcei;
var _glBufferSubData=env._glBufferSubData;
var _alcMakeContextCurrent=env._alcMakeContextCurrent;
var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
var _glViewport=env._glViewport;
var _alSourceQueueBuffers=env._alSourceQueueBuffers;
var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
var ___setErrNo=env.___setErrNo;
var _eglGetProcAddress=env._eglGetProcAddress;
var _alcGetCurrentContext=env._alcGetCurrentContext;
var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
var _glDeleteTextures=env._glDeleteTextures;
var _glDepthFunc=env._glDepthFunc;
var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
var _emscripten_glFlush=env._emscripten_glFlush;
var _emscripten_glUniform4i=env._emscripten_glUniform4i;
var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
var _emscripten_glGetError=env._emscripten_glGetError;
var _alGenBuffers=env._alGenBuffers;
var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
var _emscripten_glBufferData=env._emscripten_glBufferData;
var _emscripten_glUniform3i=env._emscripten_glUniform3i;
var _emscripten_glRotatef=env._emscripten_glRotatef;
var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
var _glEnable=env._glEnable;
var _fabs=env._fabs;
var _glGenTextures=env._glGenTextures;
var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
var _alDeleteSources=env._alDeleteSources;
var _emscripten_glClearStencil=env._emscripten_glClearStencil;
var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
var emscriptenWebGLGet=env.emscriptenWebGLGet;
var _alSourceUnqueueBuffers=env._alSourceUnqueueBuffers;
var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
var _alGetError=env._alGetError;
var _emscripten_get_now=env._emscripten_get_now;
var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
var _glAttachShader=env._glAttachShader;
var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
var _emscripten_glFinish=env._emscripten_glFinish;
var _glCreateProgram=env._glCreateProgram;
var _glUniformMatrix4fv=env._glUniformMatrix4fv;
var _emscripten_glClearDepth=env._emscripten_glClearDepth;
var ___lock=env.___lock;
var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
var ___syscall6=env.___syscall6;
var ___syscall5=env.___syscall5;
var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
var _time=env._time;
var _glBindFramebuffer=env._glBindFramebuffer;
var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
var _exit=env._exit;
var _emscripten_asm_const_2=env._emscripten_asm_const_2;
var _glGetString=env._glGetString;
var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
var _alSourcef=env._alSourcef;
var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
var _llvm_pow_f64=env._llvm_pow_f64;
var _glDeleteFramebuffers=env._glDeleteFramebuffers;
var _glCompressedTexImage2D=env._glCompressedTexImage2D;
var _glfwPollEvents=env._glfwPollEvents;
var _emscripten_glUniform4f=env._emscripten_glUniform4f;
var _glfwSwapInterval=env._glfwSwapInterval;
var _glfwGetVideoModes=env._glfwGetVideoModes;
var _sin=env._sin;
var _emscripten_glClear=env._emscripten_glClear;
var _emscripten_glDrawElements=env._emscripten_glDrawElements;
var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
var _sbrk=env._sbrk;
var _emscripten_glStencilMask=env._emscripten_glStencilMask;
var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
var _emscripten_glUniform2i=env._emscripten_glUniform2i;
var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose;
var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
var _glBindTexture=env._glBindTexture;
var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
var _emscripten_glHint=env._emscripten_glHint;
var _glfwSetCharCallback=env._glfwSetCharCallback;
var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
var _glfwSetScrollCallback=env._glfwSetScrollCallback;
var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
var _alcDestroyContext=env._alcDestroyContext;
var _glDrawArrays=env._glDrawArrays;
var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
var _glCreateShader=env._glCreateShader;
var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
var _glCompileShader=env._glCompileShader;
var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
var _emscripten_glDepthRange=env._emscripten_glDepthRange;
var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
var _floorf=env._floorf;
var _log=env._log;
var _glActiveTexture=env._glActiveTexture;
var _glfwSwapBuffers=env._glfwSwapBuffers;
var _emscripten_glDepthMask=env._emscripten_glDepthMask;
var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback;
var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
var _alSourceStop=env._alSourceStop;
var _eglWaitClient=env._eglWaitClient;
var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
var _alcCloseDevice=env._alcCloseDevice;
var _glUniform1i=env._glUniform1i;
var _glEnableVertexAttribArray=env._glEnableVertexAttribArray;
var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
var _alcGetContextsDevice=env._alcGetContextsDevice;
var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
var _glDeleteBuffers=env._glDeleteBuffers;
var _glBufferData=env._glBufferData;
var _glTexImage2D=env._glTexImage2D;
var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
var _emscripten_glEnable=env._emscripten_glEnable;
var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
var _floor=env._floor;
var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
var _glDeleteShader=env._glDeleteShader;
var _cosf=env._cosf;
var _glGetProgramiv=env._glGetProgramiv;
var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
var _glfwGetTime=env._glfwGetTime;
var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
var _alListener3f=env._alListener3f;
var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback;
var _emscripten_glCreateShader=env._emscripten_glCreateShader;
var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor;
var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
var _glLinkProgram=env._glLinkProgram;
var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback;
var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
var _glGetShaderiv=env._glGetShaderiv;
var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
var _glGetUniformLocation=env._glGetUniformLocation;
var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
var _emscripten_glCompileShader=env._emscripten_glCompileShader;
var _glClear=env._glClear;
var _glUniform4fv=env._glUniform4fv;
var _emscripten_glFrustum=env._emscripten_glFrustum;
var _emscripten_glDisable=env._emscripten_glDisable;
var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
var _sinf=env._sinf;
var __exit=env.__exit;
var _glfwTerminate=env._glfwTerminate;
var _emscripten_glUniform3f=env._emscripten_glUniform3f;
var _emscripten_glStencilOp=env._emscripten_glStencilOp;
var _glPixelStorei=env._glPixelStorei;
var _emscripten_glColorMask=env._emscripten_glColorMask;
var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
var _emscripten_glIsTexture=env._emscripten_glIsTexture;
var _alDeleteBuffers=env._alDeleteBuffers;
var _pthread_self=env._pthread_self;
var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
var _emscripten_glLineWidth=env._emscripten_glLineWidth;
var _emscripten_glBindTexture=env._emscripten_glBindTexture;
var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback;
var _glfwGetCursorPos=env._glfwGetCursorPos;
var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
var ___syscall54=env.___syscall54;
var ___unlock=env.___unlock;
var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
var _emscripten_glColorPointer=env._emscripten_glColorPointer;
var _emscripten_set_main_loop=env._emscripten_set_main_loop;
var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
var _glfwWindowHint=env._glfwWindowHint;
var _alGenSources=env._alGenSources;
var _emscripten_glShaderSource=env._emscripten_glShaderSource;
var _emscripten_glIsShader=env._emscripten_glIsShader;
var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
var _emscripten_glUniform1f=env._emscripten_glUniform1f;
var _alcOpenDevice=env._alcOpenDevice;
var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
var _glfwSetKeyCallback=env._glfwSetKeyCallback;
var _emscripten_glClearColor=env._emscripten_glClearColor;
var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
var _glTexParameteri=env._glTexParameteri;
var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
var _emscripten_glDetachShader=env._emscripten_glDetachShader;
var _glClearColor=env._glClearColor;
var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback;
var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
var tempFloat = 0.0;
function _emscripten_replace_memory(newBuffer) {
if ((byteLength(newBuffer) & 0xffffff || byteLength(newBuffer) <= 0xffffff) || byteLength(newBuffer) > 0x80000000) return false;
HEAP8 = new Int8View(newBuffer);
HEAP16 = new Int16View(newBuffer);
HEAP32 = new Int32View(newBuffer);
HEAPU8 = new Uint8View(newBuffer);
HEAPU16 = new Uint16View(newBuffer);
HEAPU32 = new Uint32View(newBuffer);
HEAPF32 = new Float32View(newBuffer);
HEAPF64 = new Float64View(newBuffer);
buffer = newBuffer;
return true;
}
// EMSCRIPTEN_START_FUNCS
function stackAlloc(size) {
size = size|0;
var ret = 0;
ret = STACKTOP;
STACKTOP = (STACKTOP + size)|0;
STACKTOP = (STACKTOP + 15)&-16;
return ret|0;
}
function stackSave() {
return STACKTOP|0;
}
function stackRestore(top) {
top = top|0;
STACKTOP = top;
}
function establishStackSpace(stackBase, stackMax) {
stackBase = stackBase|0;
stackMax = stackMax|0;
STACKTOP = stackBase;
STACK_MAX = stackMax;
}
function setThrew(threw, value) {
threw = threw|0;
value = value|0;
if ((__THREW__|0) == 0) {
__THREW__ = threw;
threwValue = value;
}
}
function copyTempFloat(ptr) {
ptr = ptr|0;
HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0];
HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0];
HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0];
HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0];
}
function copyTempDouble(ptr) {
ptr = ptr|0;
HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0];
HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0];
HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0];
HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0];
HEAP8[tempDoublePtr+4>>0] = HEAP8[ptr+4>>0];
HEAP8[tempDoublePtr+5>>0] = HEAP8[ptr+5>>0];
HEAP8[tempDoublePtr+6>>0] = HEAP8[ptr+6>>0];
HEAP8[tempDoublePtr+7>>0] = HEAP8[ptr+7>>0];
}
function setTempRet0(value) {
value = value|0;
tempRet0 = value;
}
function getTempRet0() {
return tempRet0|0;
}
function _main() {
var $$byval_copy10 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 752|0;
$$byval_copy10 = sp + 528|0;
$0 = sp + 480|0;
$1 = sp + 460|0;
$2 = sp + 440|0;
$3 = sp + 224|0;
$4 = sp + 200|0;
$5 = sp + 180|0;
$6 = sp + 160|0;
$7 = sp + 140|0;
$8 = sp + 120|0;
$9 = sp + 100|0;
$10 = sp + 80|0;
$11 = sp + 60|0;
$12 = sp + 40|0;
$13 = sp + 20|0;
$14 = sp;
_InitWindow(1280,720,10200);
_InitAudioDevice();
$15 = (_GetScreenWidth()|0);
$16 = (($15|0) / 2)&-1;
$17 = (($16) + -128)|0;
HEAP32[232>>2] = $17;
$18 = (_GetScreenHeight()|0);
$19 = (($18|0) / 2)&-1;
$20 = (($19) + -128)|0;
HEAP32[236>>2] = $20;
_LoadSpriteFont($0,10215);
dest=240; src=$0; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_LoadTexture($1,10237);
;HEAP32[284>>2]=HEAP32[$1>>2]|0;HEAP32[284+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[284+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[284+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[284+16>>2]=HEAP32[$1+16>>2]|0;
_LoadTexture($2,10268);
;HEAP32[304>>2]=HEAP32[$2>>2]|0;HEAP32[304+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[304+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[304+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[304+16>>2]=HEAP32[$2+16>>2]|0;
HEAPF32[324>>2] = -4.0;
HEAPF32[(328)>>2] = 2.0;
HEAPF32[(332)>>2] = 3.0;
HEAPF32[(336)>>2] = -4.0;
HEAPF32[(340)>>2] = 0.80000001192092896;
HEAPF32[(344)>>2] = 0.0;
HEAPF32[(348)>>2] = 0.0;
HEAPF32[(352)>>2] = 1.0;
HEAPF32[(356)>>2] = 0.0;
_LoadModel($3,10294);
_memcpy((360|0),($3|0),216)|0;
_LoadTexture($4,10314);
;HEAP32[576>>2]=HEAP32[$4>>2]|0;HEAP32[576+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[576+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[576+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[576+16>>2]=HEAP32[$4+16>>2]|0;
;HEAP32[$$byval_copy10>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[$4+16>>2]|0;
_SetModelTexture(360,$$byval_copy10);
HEAPF32[596>>2] = -1.0;
HEAPF32[(600)>>2] = 0.0;
HEAPF32[(604)>>2] = 0.0;
_LoadTexture($5,10342);
;HEAP32[608>>2]=HEAP32[$5>>2]|0;HEAP32[608+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[608+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[608+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[608+16>>2]=HEAP32[$5+16>>2]|0;
_LoadTexture($6,10366);
;HEAP32[(628)>>2]=HEAP32[$6>>2]|0;HEAP32[(628)+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[(628)+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[(628)+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[(628)+16>>2]=HEAP32[$6+16>>2]|0;
_LoadTexture($7,10390);
;HEAP32[(648)>>2]=HEAP32[$7>>2]|0;HEAP32[(648)+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[(648)+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[(648)+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[(648)+16>>2]=HEAP32[$7+16>>2]|0;
_LoadTexture($8,10414);
;HEAP32[(668)>>2]=HEAP32[$8>>2]|0;HEAP32[(668)+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[(668)+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[(668)+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[(668)+16>>2]=HEAP32[$8+16>>2]|0;
_LoadTexture($9,10438);
;HEAP32[(688)>>2]=HEAP32[$9>>2]|0;HEAP32[(688)+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[(688)+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[(688)+12>>2]=HEAP32[$9+12>>2]|0;HEAP32[(688)+16>>2]=HEAP32[$9+16>>2]|0;
_LoadTexture($10,10462);
;HEAP32[708>>2]=HEAP32[$10>>2]|0;HEAP32[708+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[708+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[708+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[708+16>>2]=HEAP32[$10+16>>2]|0;
_LoadTexture($11,10485);
;HEAP32[(728)>>2]=HEAP32[$11>>2]|0;HEAP32[(728)+4>>2]=HEAP32[$11+4>>2]|0;HEAP32[(728)+8>>2]=HEAP32[$11+8>>2]|0;HEAP32[(728)+12>>2]=HEAP32[$11+12>>2]|0;HEAP32[(728)+16>>2]=HEAP32[$11+16>>2]|0;
_LoadTexture($12,10508);
;HEAP32[(748)>>2]=HEAP32[$12>>2]|0;HEAP32[(748)+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[(748)+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[(748)+12>>2]=HEAP32[$12+12>>2]|0;HEAP32[(748)+16>>2]=HEAP32[$12+16>>2]|0;
_LoadTexture($13,10531);
;HEAP32[(768)>>2]=HEAP32[$13>>2]|0;HEAP32[(768)+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[(768)+8>>2]=HEAP32[$13+8>>2]|0;HEAP32[(768)+12>>2]=HEAP32[$13+12>>2]|0;HEAP32[(768)+16>>2]=HEAP32[$13+16>>2]|0;
_LoadTexture($14,10554);
;HEAP32[(788)>>2]=HEAP32[$14>>2]|0;HEAP32[(788)+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[(788)+8>>2]=HEAP32[$14+8>>2]|0;HEAP32[(788)+12>>2]=HEAP32[$14+12>>2]|0;HEAP32[(788)+16>>2]=HEAP32[$14+16>>2]|0;
_emscripten_set_main_loop((1|0),0,1);
dest=$$byval_copy10; src=240; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_UnloadSpriteFont($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[284>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[284+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[304>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[304+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[304+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[304+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[304+16>>2]|0;
_UnloadTexture($$byval_copy10);
_memcpy(($$byval_copy10|0),(360|0),216)|0;
_UnloadModel($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[576>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[576+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[576+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[576+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[576+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[608>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[608+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[608+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[608+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[608+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(628)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(628)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(628)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(628)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(628)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(648)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(648)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(648)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(648)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(648)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(668)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(668)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(668)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(668)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(668)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(688)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(688)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(688)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(688)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(688)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[708>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[708+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[708+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[708+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[708+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(728)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(728)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(728)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(728)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(728)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(748)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(748)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(748)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(748)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(748)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(768)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(768)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(768)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(768)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(768)+16>>2]|0;
_UnloadTexture($$byval_copy10);
;HEAP32[$$byval_copy10>>2]=HEAP32[(788)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(788)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(788)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(788)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(788)+16>>2]|0;
_UnloadTexture($$byval_copy10);
_CloseAudioDevice();
_CloseWindow();
STACKTOP = sp;return 0;
}
function _UpdateDrawFrame() {
var $$byval_copy103 = 0, $$byval_copy112 = 0, $$byval_copy76 = 0, $$off = 0, $$pr286 = 0, $$pr288 = 0, $$pr289 = 0, $$pr290 = 0, $$pr293$pr = 0, $$pr296$pr = 0, $$pr299$pr$pr = 0, $$pr302$pr$pr = 0, $$pr305 = 0, $$pr306 = 0, $$pr308 = 0, $$pr311$pr = 0, $$pr314$pr = 0, $$pr317$pr$pr = 0, $$pr320$pr$pr = 0, $$pr323$pr$pr = 0;
var $$pr326$pr$pr = 0, $$pr329$pr$pr$pr = 0, $$pr332 = 0, $$pr334 = 0, $$pr337$pr = 0, $$pr340$pr = 0, $$pr343$pr$pr = 0, $$pr346$pr$pr = 0, $$pr350$pr$pr = 0, $$pr352 = 0, $$pr355$pr = 0, $$pr358$pr = 0, $$pr361$pr$pr = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0;
var $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0;
var $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0;
var $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0;
var $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0.0, $173 = 0, $174 = 0, $175 = 0, $176 = 0;
var $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0;
var $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0;
var $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0;
var $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0;
var $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0.0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0.0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0.0;
var $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0.0, $346 = 0.0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0.0, $353 = 0.0, $354 = 0, $355 = 0, $356 = 0;
var $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0.0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0.0, $367 = 0.0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0.0, $374 = 0.0;
var $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0.0, $381 = 0.0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0.0, $39 = 0, $390 = 0, $391 = 0, $392 = 0;
var $393 = 0, $394 = 0, $395 = 0.0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0.0, $402 = 0, $403 = 0, $404 = 0, $405 = 0.0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0;
var $410 = 0.0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0.0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0.0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0;
var $429 = 0.0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0.0, $435 = 0, $436 = 0, $437 = 0, $438 = 0.0, $439 = 0, $44 = 0, $440 = 0.0, $441 = 0, $442 = 0.0, $443 = 0, $444 = 0, $445 = 0, $446 = 0;
var $447 = 0.0, $448 = 0, $449 = 0, $45 = 0, $450 = 0.0, $451 = 0, $452 = 0, $453 = 0.0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0.0, $462 = 0, $463 = 0, $464 = 0.0;
var $465 = 0, $466 = 0, $467 = 0.0, $468 = 0, $469 = 0.0, $47 = 0, $470 = 0, $471 = 0.0, $472 = 0, $473 = 0.0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0.0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0;
var $483 = 0.0, $484 = 0, $485 = 0, $486 = 0.0, $487 = 0, $488 = 0, $489 = 0.0, $49 = 0, $490 = 0, $491 = 0.0, $492 = 0, $493 = 0.0, $494 = 0, $495 = 0.0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0;
var $500 = 0.0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0, $506 = 0.0, $507 = 0, $508 = 0.0, $509 = 0.0, $51 = 0, $510 = 0.0, $511 = 0.0, $512 = 0, $513 = 0.0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0.0;
var $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0.0, $523 = 0, $524 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dwarf$byval_copy = 0, $or$cond = 0;
var $or$cond365 = 0, $position$byval_copy = 0, $storemerge = 0.0, $storemerge366 = 0.0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 976|0;
$$byval_copy112 = sp + 612|0;
$$byval_copy103 = sp + 592|0;
$$byval_copy76 = sp + 396|0;
$position$byval_copy = sp + 376|0;
$dwarf$byval_copy = sp + 152|0;
$0 = sp + 960|0;
$1 = sp + 956|0;
$2 = sp + 952|0;
$3 = sp + 948|0;
$4 = sp + 944|0;
$5 = sp + 940|0;
$6 = sp + 936|0;
$7 = sp + 932|0;
$8 = sp + 928|0;
$9 = sp + 924|0;
$10 = sp + 920|0;
$11 = sp + 916|0;
$12 = sp + 912|0;
$13 = sp + 908|0;
$14 = sp + 904|0;
$15 = sp + 900|0;
$16 = sp + 896|0;
$17 = sp + 892|0;
$18 = sp + 584|0;
$19 = sp + 888|0;
$20 = sp + 884|0;
$21 = sp + 880|0;
$22 = sp + 876|0;
$23 = sp + 872|0;
$24 = sp + 868|0;
$25 = sp + 568|0;
$26 = sp + 560|0;
$27 = sp + 864|0;
$28 = sp + 552|0;
$29 = sp + 536|0;
$30 = sp + 528|0;
$31 = sp + 860|0;
$32 = sp + 520|0;
$33 = sp + 504|0;
$34 = sp + 496|0;
$35 = sp + 856|0;
$36 = sp + 488|0;
$37 = sp + 472|0;
$38 = sp + 464|0;
$39 = sp + 852|0;
$40 = sp + 456|0;
$41 = sp + 440|0;
$42 = sp + 368|0;
$43 = sp + 848|0;
$44 = sp + 144|0;
$45 = sp + 128|0;
$46 = sp + 120|0;
$47 = sp + 844|0;
$48 = sp + 112|0;
$49 = sp + 840|0;
$50 = sp + 836|0;
$51 = sp + 832|0;
$52 = sp + 828|0;
$53 = sp + 824|0;
$54 = sp + 820|0;
$55 = sp + 816|0;
$56 = sp + 812|0;
$57 = sp + 808|0;
$58 = sp + 804|0;
$59 = sp + 104|0;
$60 = sp + 96|0;
$61 = sp + 88|0;
$62 = sp + 800|0;
$63 = sp + 796|0;
$64 = sp + 792|0;
$65 = sp + 788|0;
$66 = sp + 80|0;
$67 = sp + 784|0;
$68 = sp + 780|0;
$69 = sp + 776|0;
$70 = sp + 772|0;
$71 = sp + 768|0;
$72 = sp + 764|0;
$73 = sp + 760|0;
$74 = sp + 72|0;
$75 = sp + 756|0;
$76 = sp + 68|0;
$77 = sp + 752|0;
$78 = sp + 748|0;
$79 = sp + 56|0;
$80 = sp + 44|0;
$81 = sp + 744|0;
$82 = sp + 40|0;
$83 = sp + 740|0;
$84 = sp + 736|0;
$85 = sp + 732|0;
$86 = sp + 36|0;
$87 = sp + 728|0;
$88 = sp + 32|0;
$89 = sp + 724|0;
$90 = sp + 28|0;
$91 = sp + 720|0;
$92 = sp + 24|0;
$93 = sp + 716|0;
$94 = sp + 20|0;
$95 = sp + 712|0;
$96 = sp + 708|0;
$97 = sp + 704|0;
$98 = sp + 700|0;
$99 = sp + 696|0;
$100 = sp + 16|0;
$101 = sp + 692|0;
$102 = sp + 12|0;
$103 = sp + 688|0;
$104 = sp + 8|0;
$105 = sp + 684|0;
$106 = sp + 4|0;
$107 = sp + 680|0;
$108 = sp;
$109 = sp + 676|0;
$110 = sp + 672|0;
$111 = sp + 668|0;
$112 = sp + 664|0;
$113 = sp + 660|0;
$114 = sp + 656|0;
$115 = sp + 652|0;
$116 = sp + 648|0;
_UpdateMusicStream();
$117 = HEAP32[200>>2]|0;
$118 = ($117|0)==(0);
L1: do {
if ($118) {
$119 = HEAP32[220>>2]|0;
switch ($119|0) {
case 0: {
$120 = (_IsKeyPressed(257)|0);
$121 = ($120|0)==(0);
if ($121) {
break L1;
}
_TransitionToScreen(1);
_PlayMusicStream(10577);
break L1;
break;
}
case 1: {
break;
}
default: {
break L1;
}
}
$122 = HEAP32[176>>2]|0;
switch ($122|0) {
case 0: {
$123 = HEAP32[216>>2]|0;
$124 = (($123) + 1)|0;
HEAP32[216>>2] = $124;
$125 = ($124|0)==(120);
if ($125) {
HEAP32[176>>2] = 1;
HEAP32[216>>2] = 0;
}
break;
}
case 1: {
$126 = HEAP32[160>>2]|0;
$127 = (($126) + 4)|0;
HEAP32[160>>2] = $127;
$128 = HEAP32[164>>2]|0;
$129 = (($128) + 4)|0;
HEAP32[164>>2] = $129;
$130 = ($127|0)==(256);
if ($130) {
HEAP32[176>>2] = 2;
}
break;
}
case 2: {
$131 = HEAP32[168>>2]|0;
$132 = (($131) + 4)|0;
HEAP32[168>>2] = $132;
$133 = HEAP32[172>>2]|0;
$134 = (($133) + 4)|0;
HEAP32[172>>2] = $134;
$135 = ($132|0)==(256);
if ($135) {
HEAP32[180>>2] = 0;
HEAP32[176>>2] = 3;
}
break;
}
case 3: {
$136 = HEAP32[216>>2]|0;
$137 = (($136) + 1)|0;
HEAP32[216>>2] = $137;
$138 = (($137|0) % 12)&-1;
$139 = ($138|0)==(0);
$140 = HEAP32[156>>2]|0;
if ($139) {
$141 = (($140) + 1)|0;
HEAP32[156>>2] = $141;
$142 = $141;
} else {
$142 = $140;
}
$143 = ($142|0)>(9);
if ($143) {
$144 = HEAP32[216>>2]|0;
$145 = $144 & 1;
$146 = ($145|0)==(0);
$147 = HEAP32[180>>2]|0;
if ($146) {
$148 = (($147) + 1)|0;
HEAP32[180>>2] = $148;
$149 = $148;
} else {
$149 = $147;
}
$150 = ($149|0)>(100);
if ($150) {
HEAP32[216>>2] = 0;
HEAP32[176>>2] = 4;
}
}
break;
}
case 4: {
$151 = HEAP32[216>>2]|0;
$152 = (($151) + 1)|0;
HEAP32[216>>2] = $152;
$153 = ($151|0)>(119);
if ($153) {
$154 = HEAP32[152>>2]|0;
$155 = (($154) + 1)|0;
HEAP32[152>>2] = $155;
$$pr286 = HEAP32[216>>2]|0;
$156 = $$pr286;
} else {
$156 = $152;
}
$157 = ($156|0)>(1230);
if ($157) {
$158 = +HEAPF32[184>>2];
$159 = $158 + -0.05000000074505806;
HEAPF32[184>>2] = $159;
$160 = $159 < 0.0;
if ($160) {
HEAP32[216>>2] = 0;
HEAP32[176>>2] = 5;
HEAPF32[184>>2] = 1.0;
}
}
break;
}
case 5: {
$161 = HEAP32[216>>2]|0;
$162 = (($161) + 1)|0;
HEAP32[216>>2] = $162;
$163 = +HEAPF32[192>>2];
$164 = $163 + 1.0;
HEAPF32[192>>2] = $164;
$165 = ($161|0)>(439);
if ($165) {
$166 = +HEAPF32[596>>2];
$167 = $166 + -0.0099999997764825821;
$168 = $167 < -2.4000000953674316;
$storemerge366 = $168 ? -2.4000000953674316 : $167;
HEAPF32[596>>2] = $storemerge366;
$$pr288 = HEAP32[216>>2]|0;
$169 = $$pr288;
} else {
$169 = $162;
}
$170 = ($169|0)>(840);
if ($170) {
$171 = +HEAPF32[184>>2];
$172 = $171 + -0.05000000074505806;
HEAPF32[184>>2] = $172;
$173 = $172 < 0.0;
if ($173) {
HEAP32[216>>2] = 0;
HEAP32[176>>2] = 6;
HEAPF32[184>>2] = 1.0;
}
}
break;
}
case 6: {
$174 = HEAP32[216>>2]|0;
$175 = (($174) + 1)|0;
HEAP32[216>>2] = $175;
$176 = ($174|0)>(899);
if ($176) {
$177 = +HEAPF32[184>>2];
$178 = $177 + -0.05000000074505806;
HEAPF32[184>>2] = $178;
$179 = $178 < 0.0;
if ($179) {
HEAP32[216>>2] = 0;
HEAP32[176>>2] = 7;
HEAPF32[184>>2] = 1.0;
}
}
break;
}
case 7: {
$180 = +HEAPF32[188>>2];
$181 = $180 + -0.004999999888241291;
$182 = $181 < 0.0;
$storemerge = $182 ? 0.0 : $181;
HEAPF32[188>>2] = $storemerge;
_SetMusicVolume($storemerge);
break;
}
default: {
}
}
$183 = HEAP32[228>>2]|0;
$184 = HEAP32[224>>2]|0;
$185 = ($183|0)<($184|0);
if ($185) {
$186 = (($183) + 1)|0;
HEAP32[228>>2] = $186;
}
} else {
_UpdateTransition();
}
} while(0);
_BeginDrawing();
HEAP8[$0>>0] = -11;
$187 = ((($0)) + 1|0);
HEAP8[$187>>0] = -11;
$188 = ((($0)) + 2|0);
HEAP8[$188>>0] = -11;
$189 = ((($0)) + 3|0);
HEAP8[$189>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$0+3>>0]|0;
_ClearBackground($$byval_copy112);
$190 = HEAP32[220>>2]|0;
switch ($190|0) {
case 0: {
HEAP8[$1>>0] = -56;
$191 = ((($1)) + 1|0);
HEAP8[$191>>0] = -56;
$192 = ((($1)) + 2|0);
HEAP8[$192>>0] = -56;
$193 = ((($1)) + 3|0);
HEAP8[$193>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$1+3>>0]|0;
_DrawText(10597,290,260,60,$$byval_copy112);
break;
}
case 1: {
$194 = HEAP32[176>>2]|0;
switch ($194|0) {
case 0: {
$195 = HEAP32[216>>2]|0;
$196 = (($195|0) / 15)&-1;
$197 = $196 & 1;
$198 = ($197|0)==(0);
if (!($198)) {
$199 = HEAP32[232>>2]|0;
$200 = HEAP32[236>>2]|0;
$201 = (($200) + -60)|0;
HEAP8[$2>>0] = 0;
$202 = ((($2)) + 1|0);
HEAP8[$202>>0] = 0;
$203 = ((($2)) + 2|0);
HEAP8[$203>>0] = 0;
$204 = ((($2)) + 3|0);
HEAP8[$204>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$2+3>>0]|0;
_DrawRectangle($199,$201,16,16,$$byval_copy112);
}
break;
}
case 1: {
$205 = HEAP32[232>>2]|0;
$206 = HEAP32[236>>2]|0;
$207 = (($206) + -60)|0;
$208 = HEAP32[160>>2]|0;
HEAP8[$3>>0] = 0;
$209 = ((($3)) + 1|0);
HEAP8[$209>>0] = 0;
$210 = ((($3)) + 2|0);
HEAP8[$210>>0] = 0;
$211 = ((($3)) + 3|0);
HEAP8[$211>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$3+3>>0]|0;
_DrawRectangle($205,$207,$208,16,$$byval_copy112);
$212 = HEAP32[232>>2]|0;
$213 = HEAP32[236>>2]|0;
$214 = (($213) + -60)|0;
$215 = HEAP32[164>>2]|0;
HEAP8[$4>>0] = 0;
$216 = ((($4)) + 1|0);
HEAP8[$216>>0] = 0;
$217 = ((($4)) + 2|0);
HEAP8[$217>>0] = 0;
$218 = ((($4)) + 3|0);
HEAP8[$218>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$4+3>>0]|0;
_DrawRectangle($212,$214,16,$215,$$byval_copy112);
break;
}
case 2: {
$219 = HEAP32[232>>2]|0;
$220 = HEAP32[236>>2]|0;
$221 = (($220) + -60)|0;
$222 = HEAP32[160>>2]|0;
HEAP8[$5>>0] = 0;
$223 = ((($5)) + 1|0);
HEAP8[$223>>0] = 0;
$224 = ((($5)) + 2|0);
HEAP8[$224>>0] = 0;
$225 = ((($5)) + 3|0);
HEAP8[$225>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$5+3>>0]|0;
_DrawRectangle($219,$221,$222,16,$$byval_copy112);
$226 = HEAP32[232>>2]|0;
$227 = HEAP32[236>>2]|0;
$228 = (($227) + -60)|0;
$229 = HEAP32[164>>2]|0;
HEAP8[$6>>0] = 0;
$230 = ((($6)) + 1|0);
HEAP8[$230>>0] = 0;
$231 = ((($6)) + 2|0);
HEAP8[$231>>0] = 0;
$232 = ((($6)) + 3|0);
HEAP8[$232>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$6>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$6+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$6+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$6+3>>0]|0;
_DrawRectangle($226,$228,16,$229,$$byval_copy112);
$233 = HEAP32[232>>2]|0;
$234 = (($233) + 240)|0;
$235 = HEAP32[236>>2]|0;
$236 = (($235) + -60)|0;
$237 = HEAP32[172>>2]|0;
HEAP8[$7>>0] = 0;
$238 = ((($7)) + 1|0);
HEAP8[$238>>0] = 0;
$239 = ((($7)) + 2|0);
HEAP8[$239>>0] = 0;
$240 = ((($7)) + 3|0);
HEAP8[$240>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$7>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$7+3>>0]|0;
_DrawRectangle($234,$236,16,$237,$$byval_copy112);
$241 = HEAP32[232>>2]|0;
$242 = HEAP32[236>>2]|0;
$243 = (($242) + 180)|0;
$244 = HEAP32[168>>2]|0;
HEAP8[$8>>0] = 0;
$245 = ((($8)) + 1|0);
HEAP8[$245>>0] = 0;
$246 = ((($8)) + 2|0);
HEAP8[$246>>0] = 0;
$247 = ((($8)) + 3|0);
HEAP8[$247>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$8>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$8+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$8+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$8+3>>0]|0;
_DrawRectangle($241,$243,$244,16,$$byval_copy112);
break;
}
default: {
$$off = (($194) + -3)|0;
$248 = ($$off>>>0)<(5);
if ($248) {
$249 = HEAP32[232>>2]|0;
$250 = HEAP32[236>>2]|0;
$251 = (($250) + -60)|0;
$252 = HEAP32[160>>2]|0;
HEAP8[$9>>0] = 0;
$253 = ((($9)) + 1|0);
HEAP8[$253>>0] = 0;
$254 = ((($9)) + 2|0);
HEAP8[$254>>0] = 0;
$255 = ((($9)) + 3|0);
HEAP8[$255>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$9>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$9+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$9+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$9+3>>0]|0;
_DrawRectangle($249,$251,$252,16,$$byval_copy112);
$256 = HEAP32[232>>2]|0;
$257 = HEAP32[236>>2]|0;
$258 = (($257) + -44)|0;
$259 = HEAP32[164>>2]|0;
$260 = (($259) + -32)|0;
HEAP8[$10>>0] = 0;
$261 = ((($10)) + 1|0);
HEAP8[$261>>0] = 0;
$262 = ((($10)) + 2|0);
HEAP8[$262>>0] = 0;
$263 = ((($10)) + 3|0);
HEAP8[$263>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$10>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$10+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$10+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$10+3>>0]|0;
_DrawRectangle($256,$258,16,$260,$$byval_copy112);
$264 = HEAP32[232>>2]|0;
$265 = (($264) + 240)|0;
$266 = HEAP32[236>>2]|0;
$267 = (($266) + -44)|0;
$268 = HEAP32[172>>2]|0;
$269 = (($268) + -32)|0;
HEAP8[$11>>0] = 0;
$270 = ((($11)) + 1|0);
HEAP8[$270>>0] = 0;
$271 = ((($11)) + 2|0);
HEAP8[$271>>0] = 0;
$272 = ((($11)) + 3|0);
HEAP8[$272>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$11>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$11+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$11+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$11+3>>0]|0;
_DrawRectangle($265,$267,16,$269,$$byval_copy112);
$273 = HEAP32[232>>2]|0;
$274 = HEAP32[236>>2]|0;
$275 = (($274) + 180)|0;
$276 = HEAP32[168>>2]|0;
HEAP8[$12>>0] = 0;
$277 = ((($12)) + 1|0);
HEAP8[$277>>0] = 0;
$278 = ((($12)) + 2|0);
HEAP8[$278>>0] = 0;
$279 = ((($12)) + 3|0);
HEAP8[$279>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$12>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$12+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$12+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$12+3>>0]|0;
_DrawRectangle($273,$275,$276,16,$$byval_copy112);
$280 = (_GetScreenWidth()|0);
$281 = (($280|0) / 2)&-1;
$282 = (($281) + -112)|0;
$283 = (_GetScreenHeight()|0);
$284 = (($283|0) / 2)&-1;
$285 = (($284) + -172)|0;
HEAP8[$13>>0] = -11;
$286 = ((($13)) + 1|0);
HEAP8[$286>>0] = -11;
$287 = ((($13)) + 2|0);
HEAP8[$287>>0] = -11;
$288 = ((($13)) + 3|0);
HEAP8[$288>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$13>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$13+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$13+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$13+3>>0]|0;
_DrawRectangle($282,$285,224,224,$$byval_copy112);
$289 = HEAP32[156>>2]|0;
$290 = (_SubText(10617,0,$289)|0);
$291 = (_GetScreenWidth()|0);
$292 = (($291|0) / 2)&-1;
$293 = (($292) + -44)|0;
$294 = (_GetScreenHeight()|0);
$295 = (($294|0) / 2)&-1;
$296 = (($295) + -12)|0;
HEAP8[$14>>0] = 0;
$297 = ((($14)) + 1|0);
HEAP8[$297>>0] = 0;
$298 = ((($14)) + 2|0);
HEAP8[$298>>0] = 0;
$299 = ((($14)) + 3|0);
HEAP8[$299>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$14>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$14+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$14+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$14+3>>0]|0;
_DrawText($290,$293,$296,50,$$byval_copy112);
$300 = HEAP32[180>>2]|0;
$301 = (_SubText(9560,0,$300)|0);
$302 = (_GetScreenWidth()|0);
$303 = (($302|0) / 2)&-1;
$304 = (_MeasureText(9560,30)|0);
$305 = (($304|0) / 2)&-1;
$306 = (($303) - ($305))|0;
$307 = HEAP32[236>>2]|0;
$308 = (($307) + 230)|0;
HEAP8[$15>>0] = -126;
$309 = ((($15)) + 1|0);
HEAP8[$309>>0] = -126;
$310 = ((($15)) + 2|0);
HEAP8[$310>>0] = -126;
$311 = ((($15)) + 3|0);
HEAP8[$311>>0] = -1;
;HEAP8[$$byval_copy112>>0]=HEAP8[$15>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$15+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$15+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$15+3>>0]|0;
_DrawText($301,$306,$308,30,$$byval_copy112);
}
}
}
$312 = HEAP32[176>>2]|0;
$313 = ($312|0)==(4);
if ($313) {
$314 = HEAP32[216>>2]|0;
$315 = ($314|0)>(80);
if ($315) {
HEAP8[$17>>0] = 80;
$316 = ((($17)) + 1|0);
HEAP8[$316>>0] = 80;
$317 = ((($17)) + 2|0);
HEAP8[$317>>0] = 80;
$318 = ((($17)) + 3|0);
HEAP8[$318>>0] = -1;
$319 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$17>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$17+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$17+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$17+3>>0]|0;
_Fade($16,$$byval_copy112,$319);
;HEAP8[$$byval_copy112>>0]=HEAP8[$16>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$16+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$16+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$16+3>>0]|0;
_DrawText(10624,50,50,40,$$byval_copy112);
$320 = HEAP32[152>>2]|0;
$321 = (_SubText(9688,0,$320)|0);
HEAPF32[$18>>2] = 60.0;
$322 = ((($18)) + 4|0);
HEAPF32[$322>>2] = 120.0;
$323 = HEAP32[(260)>>2]|0;
HEAP8[$20>>0] = -126;
$324 = ((($20)) + 1|0);
HEAP8[$324>>0] = -126;
$325 = ((($20)) + 2|0);
HEAP8[$325>>0] = -126;
$326 = ((($20)) + 3|0);
HEAP8[$326>>0] = -1;
$327 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$20>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$20+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$20+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$20+3>>0]|0;
_Fade($19,$$byval_copy112,$327);
dest=$$byval_copy76; src=240; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
;HEAP32[$$byval_copy103>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$18+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$19>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$19+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$19+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$19+3>>0]|0;
_DrawTextEx($$byval_copy76,$321,$$byval_copy103,$323,0,$$byval_copy112);
$328 = HEAP32[216>>2]|0;
$329 = ($328|0)>(460);
if ($329) {
HEAP8[$22>>0] = -26;
$330 = ((($22)) + 1|0);
HEAP8[$330>>0] = 41;
$331 = ((($22)) + 2|0);
HEAP8[$331>>0] = 55;
$332 = ((($22)) + 3|0);
HEAP8[$332>>0] = -1;
$333 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$22>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$22+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$22+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$22+3>>0]|0;
_Fade($21,$$byval_copy112,$333);
;HEAP8[$$byval_copy112>>0]=HEAP8[$21>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$21+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$21+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$21+3>>0]|0;
_DrawText(10645,70,318,60,$$byval_copy112);
$$pr289 = HEAP32[216>>2]|0;
$334 = ($$pr289|0)>(550);
if ($334) {
HEAP8[$24>>0] = 80;
$335 = ((($24)) + 1|0);
HEAP8[$335>>0] = 80;
$336 = ((($24)) + 2|0);
HEAP8[$336>>0] = 80;
$337 = ((($24)) + 3|0);
HEAP8[$337>>0] = -1;
$338 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$24>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$24+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$24+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$24+3>>0]|0;
_Fade($23,$$byval_copy112,$338);
;HEAP8[$$byval_copy112>>0]=HEAP8[$23>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$23+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$23+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$23+3>>0]|0;
_DrawText(10659,870,50,40,$$byval_copy112);
$339 = HEAP32[216>>2]|0;
$340 = ($339|0)>(600);
if ($340) {
HEAP32[$25>>2] = 0;
$341 = ((($25)) + 4|0);
HEAP32[$341>>2] = 0;
$342 = ((($25)) + 8|0);
HEAP32[$342>>2] = 160;
$343 = ((($25)) + 12|0);
HEAP32[$343>>2] = 160;
HEAPF32[$26>>2] = 810.0;
$344 = ((($26)) + 4|0);
HEAPF32[$344>>2] = 130.0;
HEAP32[$28>>2] = -1;
$345 = +HEAPF32[184>>2];
$346 = $345 * 0.60000002384185791;
;HEAP8[$$byval_copy112>>0]=HEAP8[$28>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$28+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$28+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$28+3>>0]|0;
_Fade($27,$$byval_copy112,$346);
;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$25>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$25+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$25+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$25+12>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$26>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$26+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$27>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$27+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$27+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$27+3>>0]|0;
_DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
$$pr290 = HEAP32[216>>2]|0;
$347 = ($$pr290|0)>(640);
if ($347) {
HEAP32[$29>>2] = 160;
$348 = ((($29)) + 4|0);
HEAP32[$348>>2] = 0;
$349 = ((($29)) + 8|0);
HEAP32[$349>>2] = 160;
$350 = ((($29)) + 12|0);
HEAP32[$350>>2] = 160;
HEAPF32[$30>>2] = 950.0;
$351 = ((($30)) + 4|0);
HEAPF32[$351>>2] = 130.0;
HEAP32[$32>>2] = -1;
$352 = +HEAPF32[184>>2];
$353 = $352 * 0.60000002384185791;
;HEAP8[$$byval_copy112>>0]=HEAP8[$32>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$32+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$32+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$32+3>>0]|0;
_Fade($31,$$byval_copy112,$353);
;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$29>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$29+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$29+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$29+12>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$30>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$30+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$31>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$31+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$31+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$31+3>>0]|0;
_DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
$$pr293$pr = HEAP32[216>>2]|0;
$354 = ($$pr293$pr|0)>(680);
if ($354) {
HEAP32[$33>>2] = 320;
$355 = ((($33)) + 4|0);
HEAP32[$355>>2] = 0;
$356 = ((($33)) + 8|0);
HEAP32[$356>>2] = 160;
$357 = ((($33)) + 12|0);
HEAP32[$357>>2] = 160;
HEAPF32[$34>>2] = 1090.0;
$358 = ((($34)) + 4|0);
HEAPF32[$358>>2] = 130.0;
HEAP32[$36>>2] = -1;
$359 = +HEAPF32[184>>2];
$360 = $359 * 0.60000002384185791;
;HEAP8[$$byval_copy112>>0]=HEAP8[$36>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$36+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$36+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$36+3>>0]|0;
_Fade($35,$$byval_copy112,$360);
;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$33>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$33+12>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$34>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$34+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$35>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$35+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$35+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$35+3>>0]|0;
_DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
$$pr296$pr = HEAP32[216>>2]|0;
$361 = ($$pr296$pr|0)>(730);
if ($361) {
HEAP32[$37>>2] = 480;
$362 = ((($37)) + 4|0);
HEAP32[$362>>2] = 0;
$363 = ((($37)) + 8|0);
HEAP32[$363>>2] = 160;
$364 = ((($37)) + 12|0);
HEAP32[$364>>2] = 160;
HEAPF32[$38>>2] = 880.0;
$365 = ((($38)) + 4|0);
HEAPF32[$365>>2] = 300.0;
HEAP32[$40>>2] = -1;
$366 = +HEAPF32[184>>2];
$367 = $366 * 0.60000002384185791;
;HEAP8[$$byval_copy112>>0]=HEAP8[$40>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$40+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$40+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$40+3>>0]|0;
_Fade($39,$$byval_copy112,$367);
;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$37>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$37+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$37+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$37+12>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$38>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$38+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$39>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$39+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$39+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$39+3>>0]|0;
_DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
$$pr299$pr$pr = HEAP32[216>>2]|0;
$368 = ($$pr299$pr$pr|0)>(780);
if ($368) {
HEAP32[$41>>2] = 640;
$369 = ((($41)) + 4|0);
HEAP32[$369>>2] = 0;
$370 = ((($41)) + 8|0);
HEAP32[$370>>2] = 160;
$371 = ((($41)) + 12|0);
HEAP32[$371>>2] = 160;
HEAPF32[$42>>2] = 1020.0;
$372 = ((($42)) + 4|0);
HEAPF32[$372>>2] = 300.0;
HEAP32[$44>>2] = -1;
$373 = +HEAPF32[184>>2];
$374 = $373 * 0.60000002384185791;
;HEAP8[$$byval_copy112>>0]=HEAP8[$44>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$44+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$44+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$44+3>>0]|0;
_Fade($43,$$byval_copy112,$374);
;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$41>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$41+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$41+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$41+12>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$42>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$42+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$43>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$43+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$43+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$43+3>>0]|0;
_DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
$$pr302$pr$pr = HEAP32[216>>2]|0;
$375 = ($$pr302$pr$pr|0)>(850);
if ($375) {
HEAP32[$45>>2] = 800;
$376 = ((($45)) + 4|0);
HEAP32[$376>>2] = 0;
$377 = ((($45)) + 8|0);
HEAP32[$377>>2] = 160;
$378 = ((($45)) + 12|0);
HEAP32[$378>>2] = 160;
HEAPF32[$46>>2] = 960.0;
$379 = ((($46)) + 4|0);
HEAPF32[$379>>2] = 450.0;
HEAP32[$48>>2] = -1;
$380 = +HEAPF32[184>>2];
$381 = $380 * 0.60000002384185791;
;HEAP8[$$byval_copy112>>0]=HEAP8[$48>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$48+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$48+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$48+3>>0]|0;
_Fade($47,$$byval_copy112,$381);
;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$45>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$45+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$45+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$45+12>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$46>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$46+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$47>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$47+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$47+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$47+3>>0]|0;
_DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
}
}
}
}
}
}
}
}
}
$$pr305 = HEAP32[176>>2]|0;
$382 = $$pr305;
} else {
$382 = $312;
}
$383 = ($382|0)==(5);
$384 = HEAP32[216>>2]|0;
$385 = ($384|0)>(80);
$or$cond = $383 & $385;
if ($or$cond) {
HEAP8[$50>>0] = 80;
$386 = ((($50)) + 1|0);
HEAP8[$386>>0] = 80;
$387 = ((($50)) + 2|0);
HEAP8[$387>>0] = 80;
$388 = ((($50)) + 3|0);
HEAP8[$388>>0] = -1;
$389 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$50>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$50+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$50+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$50+3>>0]|0;
_Fade($49,$$byval_copy112,$389);
;HEAP8[$$byval_copy112>>0]=HEAP8[$49>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$49+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$49+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$49+3>>0]|0;
_DrawText(10674,100,50,40,$$byval_copy112);
$$pr306 = HEAP32[216>>2]|0;
$390 = ($$pr306|0)>(120);
if ($390) {
$391 = ($$pr306|0)>(130);
if ($391) {
HEAP8[$52>>0] = 0;
$392 = ((($52)) + 1|0);
HEAP8[$392>>0] = -28;
$393 = ((($52)) + 2|0);
HEAP8[$393>>0] = 48;
$394 = ((($52)) + 3|0);
HEAP8[$394>>0] = -1;
$395 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$52>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$52+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$52+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$52+3>>0]|0;
_Fade($51,$$byval_copy112,$395);
;HEAP8[$$byval_copy112>>0]=HEAP8[$51>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$51+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$51+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$51+3>>0]|0;
_DrawCircle(140,240,80.0,$$byval_copy112);
}
$396 = HEAP32[216>>2]|0;
$397 = ($396|0)>(150);
if ($397) {
HEAP8[$54>>0] = -66;
$398 = ((($54)) + 1|0);
HEAP8[$398>>0] = 33;
$399 = ((($54)) + 2|0);
HEAP8[$399>>0] = 55;
$400 = ((($54)) + 3|0);
HEAP8[$400>>0] = -1;
$401 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$54>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$54+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$54+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$54+3>>0]|0;
_Fade($53,$$byval_copy112,$401);
HEAP8[$56>>0] = -1;
$402 = ((($56)) + 1|0);
HEAP8[$402>>0] = -53;
$403 = ((($56)) + 2|0);
HEAP8[$403>>0] = 0;
$404 = ((($56)) + 3|0);
HEAP8[$404>>0] = -1;
$405 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$56>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$56+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$56+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$56+3>>0]|0;
_Fade($55,$$byval_copy112,$405);
;HEAP8[$$byval_copy103>>0]=HEAP8[$53>>0]|0;HEAP8[$$byval_copy103+1>>0]=HEAP8[$53+1>>0]|0;HEAP8[$$byval_copy103+2>>0]=HEAP8[$53+2>>0]|0;HEAP8[$$byval_copy103+3>>0]=HEAP8[$53+3>>0]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$55>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$55+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$55+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$55+3>>0]|0;
_DrawRectangleGradient(220,140,250,130,$$byval_copy103,$$byval_copy112);
$$pr308 = HEAP32[216>>2]|0;
$406 = ($$pr308|0)>(170);
if ($406) {
HEAP8[$58>>0] = 0;
$407 = ((($58)) + 1|0);
HEAP8[$407>>0] = 82;
$408 = ((($58)) + 2|0);
HEAP8[$408>>0] = -84;
$409 = ((($58)) + 3|0);
HEAP8[$409>>0] = -1;
$410 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$58>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$58+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$58+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$58+3>>0]|0;
_Fade($57,$$byval_copy112,$410);
;HEAP8[$$byval_copy112>>0]=HEAP8[$57>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$57+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$57+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$57+3>>0]|0;
_DrawCircleLines(380,330,80.0,$$byval_copy112);
$$pr311$pr = HEAP32[216>>2]|0;
$411 = ($$pr311$pr|0)>(190);
if ($411) {
HEAPF32[$59>>2] = 130.0;
$412 = ((($59)) + 4|0);
HEAPF32[$412>>2] = 350.0;
HEAPF32[$60>>2] = 40.0;
$413 = ((($60)) + 4|0);
HEAPF32[$413>>2] = 520.0;
HEAPF32[$61>>2] = 240.0;
$414 = ((($61)) + 4|0);
HEAPF32[$414>>2] = 520.0;
HEAP8[$63>>0] = -121;
$415 = ((($63)) + 1|0);
HEAP8[$415>>0] = 60;
$416 = ((($63)) + 2|0);
HEAP8[$416>>0] = -66;
$417 = ((($63)) + 3|0);
HEAP8[$417>>0] = -1;
$418 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$63>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$63+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$63+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$63+3>>0]|0;
_Fade($62,$$byval_copy112,$418);
;HEAP32[$position$byval_copy>>2]=HEAP32[$59>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$59+4>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$60>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$60+4>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$61>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$61+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$62>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$62+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$62+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$62+3>>0]|0;
_DrawTriangle($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112);
$$pr314$pr = HEAP32[216>>2]|0;
$419 = ($$pr314$pr|0)>(210);
if ($419) {
HEAP8[$65>>0] = -26;
$420 = ((($65)) + 1|0);
HEAP8[$420>>0] = 41;
$421 = ((($65)) + 2|0);
HEAP8[$421>>0] = 55;
$422 = ((($65)) + 3|0);
HEAP8[$422>>0] = -1;
$423 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$65>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$65+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$65+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$65+3>>0]|0;
_Fade($64,$$byval_copy112,$423);
;HEAP8[$$byval_copy112>>0]=HEAP8[$64>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$64+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$64+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$64+3>>0]|0;
_DrawRectangle(230,300,200,90,$$byval_copy112);
$$pr317$pr$pr = HEAP32[216>>2]|0;
$424 = ($$pr317$pr$pr|0)>(230);
if ($424) {
HEAPF32[$66>>2] = 210.0;
$425 = ((($66)) + 4|0);
HEAPF32[$425>>2] = 560.0;
HEAP8[$68>>0] = 127;
$426 = ((($68)) + 1|0);
HEAP8[$426>>0] = 106;
$427 = ((($68)) + 2|0);
HEAP8[$427>>0] = 79;
$428 = ((($68)) + 3|0);
HEAP8[$428>>0] = -1;
$429 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$68>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$68+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$68+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$68+3>>0]|0;
_Fade($67,$$byval_copy112,$429);
;HEAP32[$$byval_copy103>>2]=HEAP32[$66>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$66+4>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$67>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$67+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$67+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$67+3>>0]|0;
_DrawPoly($$byval_copy103,6,90.0,0.0,$$byval_copy112);
$$pr320$pr$pr = HEAP32[216>>2]|0;
$430 = ($$pr320$pr$pr|0)>(250);
if ($430) {
HEAP8[$70>>0] = 0;
$431 = ((($70)) + 1|0);
HEAP8[$431>>0] = -28;
$432 = ((($70)) + 2|0);
HEAP8[$432>>0] = 48;
$433 = ((($70)) + 3|0);
HEAP8[$433>>0] = -1;
$434 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$70>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$70+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$70+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$70+3>>0]|0;
_Fade($69,$$byval_copy112,$434);
HEAP8[$72>>0] = 102;
$435 = ((($72)) + 1|0);
HEAP8[$435>>0] = -65;
$436 = ((($72)) + 2|0);
HEAP8[$436>>0] = -1;
$437 = ((($72)) + 3|0);
HEAP8[$437>>0] = -1;
$438 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$72>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$72+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$72+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$72+3>>0]|0;
_Fade($71,$$byval_copy112,$438);
;HEAP8[$$byval_copy103>>0]=HEAP8[$69>>0]|0;HEAP8[$$byval_copy103+1>>0]=HEAP8[$69+1>>0]|0;HEAP8[$$byval_copy103+2>>0]=HEAP8[$69+2>>0]|0;HEAP8[$$byval_copy103+3>>0]=HEAP8[$69+3>>0]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$71>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$71+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$71+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$71+3>>0]|0;
_DrawCircleGradient(240,370,60.0,$$byval_copy103,$$byval_copy112);
$$pr323$pr$pr = HEAP32[216>>2]|0;
$439 = ($$pr323$pr$pr|0)>(300);
if ($439) {
HEAP32[$74>>2] = -1;
$440 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$74>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$74+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$74+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$74+3>>0]|0;
_Fade($73,$$byval_copy112,$440);
;HEAP32[$$byval_copy103>>2]=HEAP32[304>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[304+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[304+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[304+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[304+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$73>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$73+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$73+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$73+3>>0]|0;
_DrawTexture($$byval_copy103,100,250,$$byval_copy112);
$$pr326$pr$pr = HEAP32[216>>2]|0;
$441 = ($$pr326$pr$pr|0)>(360);
if ($441) {
HEAP32[$76>>2] = -1;
$442 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$76>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$76+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$76+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$76+3>>0]|0;
_Fade($75,$$byval_copy112,$442);
;HEAP8[$$byval_copy112>>0]=HEAP8[$75>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$75+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$75+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$75+3>>0]|0;
_DrawText(10689,150,410,80,$$byval_copy112);
$$pr329$pr$pr$pr = HEAP32[216>>2]|0;
$443 = ($$pr329$pr$pr$pr|0)>(440);
if ($443) {
HEAP8[$78>>0] = 80;
$444 = ((($78)) + 1|0);
HEAP8[$444>>0] = 80;
$445 = ((($78)) + 2|0);
HEAP8[$445>>0] = 80;
$446 = ((($78)) + 3|0);
HEAP8[$446>>0] = -1;
$447 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$78>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$78+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$78+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$78+3>>0]|0;
_Fade($77,$$byval_copy112,$447);
;HEAP8[$$byval_copy112>>0]=HEAP8[$77>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$77+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$77+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$77+3>>0]|0;
_DrawText(10694,840,50,40,$$byval_copy112);
dest=$$byval_copy112; src=324; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_Begin3dMode($$byval_copy112);
HEAPF32[$79>>2] = 0.0;
$448 = ((($79)) + 4|0);
HEAPF32[$448>>2] = 1.0;
$449 = ((($79)) + 8|0);
HEAPF32[$449>>2] = 0.0;
$450 = +HEAPF32[192>>2];
HEAPF32[$80>>2] = 1.0;
$451 = ((($80)) + 4|0);
HEAPF32[$451>>2] = 1.0;
$452 = ((($80)) + 8|0);
HEAPF32[$452>>2] = 1.0;
HEAP32[$82>>2] = -1;
$453 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$82>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$82+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$82+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$82+3>>0]|0;
_Fade($81,$$byval_copy112,$453);
_memcpy(($dwarf$byval_copy|0),(360|0),216)|0;
;HEAP32[$position$byval_copy>>2]=HEAP32[596>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[596+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[596+8>>2]|0;
;HEAP32[$$byval_copy76>>2]=HEAP32[$79>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$79+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$79+8>>2]|0;
;HEAP32[$$byval_copy103>>2]=HEAP32[$80>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$80+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$80+8>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$81>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$81+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$81+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$81+3>>0]|0;
_DrawModelEx($dwarf$byval_copy,$position$byval_copy,$$byval_copy76,$450,$$byval_copy103,$$byval_copy112);
_End3dMode();
}
}
}
}
}
}
}
}
}
}
}
$454 = HEAP32[176>>2]|0;
$455 = ($454|0)==(6);
$456 = HEAP32[216>>2]|0;
$457 = ($456|0)>(80);
$or$cond365 = $455 & $457;
do {
if ($or$cond365) {
HEAP8[$84>>0] = -66;
$458 = ((($84)) + 1|0);
HEAP8[$458>>0] = 33;
$459 = ((($84)) + 2|0);
HEAP8[$459>>0] = 55;
$460 = ((($84)) + 3|0);
HEAP8[$460>>0] = -1;
$461 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$84>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$84+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$84+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$84+3>>0]|0;
_Fade($83,$$byval_copy112,$461);
;HEAP8[$$byval_copy112>>0]=HEAP8[$83>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$83+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$83+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$83+3>>0]|0;
_DrawText(10713,50,50,40,$$byval_copy112);
$$pr332 = HEAP32[216>>2]|0;
$462 = ($$pr332|0)>(120);
if ($462) {
$463 = ($$pr332|0)>(130);
if ($463) {
HEAP32[$86>>2] = -1;
$464 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$86>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$86+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$86+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$86+3>>0]|0;
_Fade($85,$$byval_copy112,$464);
;HEAP32[$$byval_copy103>>2]=HEAP32[608>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[608+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[608+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[608+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[608+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$85>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$85+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$85+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$85+3>>0]|0;
_DrawTexture($$byval_copy103,70,110,$$byval_copy112);
}
$465 = HEAP32[216>>2]|0;
$466 = ($465|0)>(160);
if ($466) {
HEAP32[$88>>2] = -1;
$467 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$88>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$88+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$88+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$88+3>>0]|0;
_Fade($87,$$byval_copy112,$467);
;HEAP32[$$byval_copy103>>2]=HEAP32[(628)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(628)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(628)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(628)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(628)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$87>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$87+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$87+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$87+3>>0]|0;
_DrawTexture($$byval_copy103,50,135,$$byval_copy112);
$$pr334 = HEAP32[216>>2]|0;
$468 = ($$pr334|0)>(190);
if ($468) {
HEAP32[$90>>2] = -1;
$469 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$90>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$90+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$90+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$90+3>>0]|0;
_Fade($89,$$byval_copy112,$469);
;HEAP32[$$byval_copy103>>2]=HEAP32[(648)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(648)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(648)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(648)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(648)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$89>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$89+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$89+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$89+3>>0]|0;
_DrawTexture($$byval_copy103,75,160,$$byval_copy112);
$$pr337$pr = HEAP32[216>>2]|0;
$470 = ($$pr337$pr|0)>(220);
if ($470) {
HEAP32[$92>>2] = -1;
$471 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$92>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$92+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$92+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$92+3>>0]|0;
_Fade($91,$$byval_copy112,$471);
;HEAP32[$$byval_copy103>>2]=HEAP32[(668)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(668)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(668)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(668)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(668)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$91>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$91+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$91+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$91+3>>0]|0;
_DrawTexture($$byval_copy103,55,185,$$byval_copy112);
$$pr340$pr = HEAP32[216>>2]|0;
$472 = ($$pr340$pr|0)>(250);
if ($472) {
HEAP32[$94>>2] = -1;
$473 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$94>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$94+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$94+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$94+3>>0]|0;
_Fade($93,$$byval_copy112,$473);
;HEAP32[$$byval_copy103>>2]=HEAP32[(688)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(688)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(688)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(688)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(688)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$93>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$93+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$93+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$93+3>>0]|0;
_DrawTexture($$byval_copy103,70,210,$$byval_copy112);
$$pr343$pr$pr = HEAP32[216>>2]|0;
$474 = ($$pr343$pr$pr|0)>(380);
if ($474) {
HEAP8[$96>>0] = -26;
$475 = ((($96)) + 1|0);
HEAP8[$475>>0] = 41;
$476 = ((($96)) + 2|0);
HEAP8[$476>>0] = 55;
$477 = ((($96)) + 3|0);
HEAP8[$477>>0] = -1;
$478 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$96>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$96+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$96+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$96+3>>0]|0;
_Fade($95,$$byval_copy112,$478);
;HEAP8[$$byval_copy112>>0]=HEAP8[$95>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$95+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$95+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$95+3>>0]|0;
_DrawText(10736,70,570,80,$$byval_copy112);
$$pr346$pr$pr = HEAP32[216>>2]|0;
$479 = ($$pr346$pr$pr|0)>(440);
if ($479) {
HEAP8[$98>>0] = -66;
$480 = ((($98)) + 1|0);
HEAP8[$480>>0] = 33;
$481 = ((($98)) + 2|0);
HEAP8[$481>>0] = 55;
$482 = ((($98)) + 3|0);
HEAP8[$482>>0] = -1;
$483 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$98>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$98+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$98+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$98+3>>0]|0;
_Fade($97,$$byval_copy112,$483);
;HEAP8[$$byval_copy112>>0]=HEAP8[$97>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$97+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$97+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$97+3>>0]|0;
_DrawText(10745,750,50,40,$$byval_copy112);
$$pr350$pr$pr = HEAP32[216>>2]|0;
$484 = ($$pr350$pr$pr|0)>(480);
if ($484) {
$485 = ($$pr350$pr$pr|0)>(510);
if ($485) {
HEAP32[$100>>2] = -1;
$486 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$100>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$100+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$100+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$100+3>>0]|0;
_Fade($99,$$byval_copy112,$486);
;HEAP32[$$byval_copy103>>2]=HEAP32[708>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[708+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[708+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[708+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[708+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$99>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$99+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$99+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$99+3>>0]|0;
_DrawTexture($$byval_copy103,800,110,$$byval_copy112);
}
$487 = HEAP32[216>>2]|0;
$488 = ($487|0)>(540);
if ($488) {
HEAP32[$102>>2] = -1;
$489 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$102>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$102+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$102+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$102+3>>0]|0;
_Fade($101,$$byval_copy112,$489);
;HEAP32[$$byval_copy103>>2]=HEAP32[(728)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(728)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(728)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(728)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(728)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$101>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$101+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$101+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$101+3>>0]|0;
_DrawTexture($$byval_copy103,790,135,$$byval_copy112);
$$pr352 = HEAP32[216>>2]|0;
$490 = ($$pr352|0)>(570);
if ($490) {
HEAP32[$104>>2] = -1;
$491 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$104>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$104+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$104+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$104+3>>0]|0;
_Fade($103,$$byval_copy112,$491);
;HEAP32[$$byval_copy103>>2]=HEAP32[(748)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(748)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(748)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(748)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(748)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$103>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$103+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$103+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$103+3>>0]|0;
_DrawTexture($$byval_copy103,810,160,$$byval_copy112);
$$pr355$pr = HEAP32[216>>2]|0;
$492 = ($$pr355$pr|0)>(600);
if ($492) {
HEAP32[$106>>2] = -1;
$493 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$106>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$106+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$106+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$106+3>>0]|0;
_Fade($105,$$byval_copy112,$493);
;HEAP32[$$byval_copy103>>2]=HEAP32[(768)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(768)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(768)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(768)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(768)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$105>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$105+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$105+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$105+3>>0]|0;
_DrawTexture($$byval_copy103,795,185,$$byval_copy112);
$$pr358$pr = HEAP32[216>>2]|0;
$494 = ($$pr358$pr|0)>(630);
if ($494) {
HEAP32[$108>>2] = -1;
$495 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$108>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$108+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$108+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$108+3>>0]|0;
_Fade($107,$$byval_copy112,$495);
;HEAP32[$$byval_copy103>>2]=HEAP32[(788)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(788)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(788)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(788)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(788)+16>>2]|0;
;HEAP8[$$byval_copy112>>0]=HEAP8[$107>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$107+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$107+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$107+3>>0]|0;
_DrawTexture($$byval_copy103,800,210,$$byval_copy112);
$$pr361$pr$pr = HEAP32[216>>2]|0;
$496 = ($$pr361$pr$pr|0)>(690);
if (!($496)) {
break;
}
HEAP8[$110>>0] = -26;
$497 = ((($110)) + 1|0);
HEAP8[$497>>0] = 41;
$498 = ((($110)) + 2|0);
HEAP8[$498>>0] = 55;
$499 = ((($110)) + 3|0);
HEAP8[$499>>0] = -1;
$500 = +HEAPF32[184>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$110>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$110+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$110+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$110+3>>0]|0;
_Fade($109,$$byval_copy112,$500);
;HEAP8[$$byval_copy112>>0]=HEAP8[$109>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$109+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$109+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$109+3>>0]|0;
_DrawText(10770,810,570,80,$$byval_copy112);
}
}
}
}
}
}
}
}
}
}
}
}
}
} while(0);
HEAP8[$112>>0] = -126;
$501 = ((($112)) + 1|0);
HEAP8[$501>>0] = -126;
$502 = ((($112)) + 2|0);
HEAP8[$502>>0] = -126;
$503 = ((($112)) + 3|0);
HEAP8[$503>>0] = -1;
$504 = +HEAPF32[188>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$112>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$112+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$112+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$112+3>>0]|0;
_Fade($111,$$byval_copy112,$504);
;HEAP8[$$byval_copy112>>0]=HEAP8[$111>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$111+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$111+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$111+3>>0]|0;
_DrawRectangle(20,680,1240,20,$$byval_copy112);
$505 = HEAP32[228>>2]|0;
$506 = (+($505|0));
$507 = HEAP32[224>>2]|0;
$508 = (+($507|0));
$509 = $506 / $508;
$510 = $509 * 1240.0;
$511 = $510 + 20.0;
$512 = (~~(($511)));
$513 = 1240.0 - $510;
$514 = (~~(($513)));
HEAP8[$114>>0] = -11;
$515 = ((($114)) + 1|0);
HEAP8[$515>>0] = -11;
$516 = ((($114)) + 2|0);
HEAP8[$516>>0] = -11;
$517 = ((($114)) + 3|0);
HEAP8[$517>>0] = -1;
$518 = +HEAPF32[188>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$114>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$114+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$114+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$114+3>>0]|0;
_Fade($113,$$byval_copy112,$518);
;HEAP8[$$byval_copy112>>0]=HEAP8[$113>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$113+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$113+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$113+3>>0]|0;
_DrawRectangle($512,680,$514,20,$$byval_copy112);
HEAP8[$116>>0] = 80;
$519 = ((($116)) + 1|0);
HEAP8[$519>>0] = 80;
$520 = ((($116)) + 2|0);
HEAP8[$520>>0] = 80;
$521 = ((($116)) + 3|0);
HEAP8[$521>>0] = -1;
$522 = +HEAPF32[188>>2];
;HEAP8[$$byval_copy112>>0]=HEAP8[$116>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$116+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$116+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$116+3>>0]|0;
_Fade($115,$$byval_copy112,$522);
;HEAP8[$$byval_copy112>>0]=HEAP8[$115>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$115+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$115+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$115+3>>0]|0;
_DrawRectangleLines(20,679,1240,20,$$byval_copy112);
break;
}
default: {
}
}
$523 = HEAP32[200>>2]|0;
$524 = ($523|0)==(0);
if ($524) {
_EndDrawing();
STACKTOP = sp;return;
}
_DrawTransition();
_EndDrawing();
STACKTOP = sp;return;
}
function _TransitionToScreen($screen) {
$screen = $screen|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
HEAP32[200>>2] = 1;
$0 = HEAP32[220>>2]|0;
HEAP32[208>>2] = $0;
HEAP32[212>>2] = $screen;
return;
}
function _UpdateTransition() {
var $0 = 0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[204>>2]|0;
$1 = ($0|0)==(0);
$2 = +HEAPF32[196>>2];
if ($1) {
$3 = $2 + 0.05000000074505806;
HEAPF32[196>>2] = $3;
$4 = !($3 >= 1.0);
if ($4) {
return;
}
HEAPF32[196>>2] = 1.0;
$5 = HEAP32[212>>2]|0;
HEAP32[220>>2] = $5;
HEAP32[204>>2] = 1;
HEAP32[216>>2] = 0;
return;
} else {
$6 = $2 + -0.05000000074505806;
HEAPF32[196>>2] = $6;
$7 = !($6 <= 0.0);
if ($7) {
return;
}
HEAPF32[196>>2] = 0.0;
HEAP32[204>>2] = 0;
HEAP32[200>>2] = 0;
HEAP32[208>>2] = -1;
HEAP32[212>>2] = -1;
return;
}
}
function _DrawTransition() {
var $$byval_copy1 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$$byval_copy1 = sp + 8|0;
$0 = sp + 4|0;
$1 = sp;
$2 = (_GetScreenWidth()|0);
$3 = (_GetScreenHeight()|0);
HEAP8[$1>>0] = -11;
$4 = ((($1)) + 1|0);
HEAP8[$4>>0] = -11;
$5 = ((($1)) + 2|0);
HEAP8[$5>>0] = -11;
$6 = ((($1)) + 3|0);
HEAP8[$6>>0] = -1;
$7 = +HEAPF32[196>>2];
;HEAP8[$$byval_copy1>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$1+3>>0]|0;
_Fade($0,$$byval_copy1,$7);
;HEAP8[$$byval_copy1>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$0+3>>0]|0;
_DrawRectangle(0,0,$2,$3,$$byval_copy1);
STACKTOP = sp;return;
}
function _VectorSubtract($agg$result,$v1,$v2) {
$agg$result = $agg$result|0;
$v1 = $v1|0;
$v2 = $v2|0;
var $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$v1>>2];
$1 = +HEAPF32[$v2>>2];
$2 = $0 - $1;
$3 = ((($v1)) + 4|0);
$4 = +HEAPF32[$3>>2];
$5 = ((($v2)) + 4|0);
$6 = +HEAPF32[$5>>2];
$7 = $4 - $6;
$8 = ((($v1)) + 8|0);
$9 = +HEAPF32[$8>>2];
$10 = ((($v2)) + 8|0);
$11 = +HEAPF32[$10>>2];
$12 = $9 - $11;
HEAPF32[$agg$result>>2] = $2;
$13 = ((($agg$result)) + 4|0);
HEAPF32[$13>>2] = $7;
$14 = ((($agg$result)) + 8|0);
HEAPF32[$14>>2] = $12;
return;
}
function _VectorCrossProduct($agg$result,$v1,$v2) {
$agg$result = $agg$result|0;
$v1 = $v1|0;
$v2 = $v2|0;
var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0;
var $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($v1)) + 4|0);
$1 = +HEAPF32[$0>>2];
$2 = ((($v2)) + 8|0);
$3 = +HEAPF32[$2>>2];
$4 = $1 * $3;
$5 = ((($v1)) + 8|0);
$6 = +HEAPF32[$5>>2];
$7 = ((($v2)) + 4|0);
$8 = +HEAPF32[$7>>2];
$9 = $6 * $8;
$10 = $4 - $9;
$11 = +HEAPF32[$v2>>2];
$12 = $6 * $11;
$13 = +HEAPF32[$v1>>2];
$14 = $3 * $13;
$15 = $12 - $14;
$16 = $8 * $13;
$17 = $1 * $11;
$18 = $16 - $17;
HEAPF32[$agg$result>>2] = $10;
$19 = ((($agg$result)) + 4|0);
HEAPF32[$19>>2] = $15;
$20 = ((($agg$result)) + 8|0);
HEAPF32[$20>>2] = $18;
return;
}
function _VectorLength($v) {
$v = $v|0;
var $0 = 0.0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$v>>2];
$1 = $0 * $0;
$2 = ((($v)) + 4|0);
$3 = +HEAPF32[$2>>2];
$4 = $3 * $3;
$5 = $1 + $4;
$6 = ((($v)) + 8|0);
$7 = +HEAPF32[$6>>2];
$8 = $7 * $7;
$9 = $5 + $8;
$sqrtf = (+Math_sqrt((+$9)));
return (+$sqrtf);
}
function _VectorNormalize($v) {
$v = $v|0;
var $$op = 0.0, $0 = 0.0, $1 = 0, $10 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $v$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$v$byval_copy = sp;
;HEAP32[$v$byval_copy>>2]=HEAP32[$v>>2]|0;HEAP32[$v$byval_copy+4>>2]=HEAP32[$v+4>>2]|0;HEAP32[$v$byval_copy+8>>2]=HEAP32[$v+8>>2]|0;
$0 = (+_VectorLength($v$byval_copy));
$1 = $0 == 0.0;
$$op = 1.0 / $0;
$2 = $1 ? 1.0 : $$op;
$3 = +HEAPF32[$v>>2];
$4 = $3 * $2;
HEAPF32[$v>>2] = $4;
$5 = ((($v)) + 4|0);
$6 = +HEAPF32[$5>>2];
$7 = $2 * $6;
HEAPF32[$5>>2] = $7;
$8 = ((($v)) + 8|0);
$9 = +HEAPF32[$8>>2];
$10 = $2 * $9;
HEAPF32[$8>>2] = $10;
STACKTOP = sp;return;
}
function _VectorTransform($v,$mat) {
$v = $v|0;
$mat = $mat|0;
var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0;
var $45 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$v>>2];
$1 = ((($v)) + 4|0);
$2 = +HEAPF32[$1>>2];
$3 = ((($v)) + 8|0);
$4 = +HEAPF32[$3>>2];
$5 = +HEAPF32[$mat>>2];
$6 = $0 * $5;
$7 = ((($mat)) + 4|0);
$8 = +HEAPF32[$7>>2];
$9 = $2 * $8;
$10 = $6 + $9;
$11 = ((($mat)) + 8|0);
$12 = +HEAPF32[$11>>2];
$13 = $4 * $12;
$14 = $10 + $13;
$15 = ((($mat)) + 12|0);
$16 = +HEAPF32[$15>>2];
$17 = $16 + $14;
HEAPF32[$v>>2] = $17;
$18 = ((($mat)) + 16|0);
$19 = +HEAPF32[$18>>2];
$20 = $0 * $19;
$21 = ((($mat)) + 20|0);
$22 = +HEAPF32[$21>>2];
$23 = $2 * $22;
$24 = $20 + $23;
$25 = ((($mat)) + 24|0);
$26 = +HEAPF32[$25>>2];
$27 = $4 * $26;
$28 = $24 + $27;
$29 = ((($mat)) + 28|0);
$30 = +HEAPF32[$29>>2];
$31 = $30 + $28;
HEAPF32[$1>>2] = $31;
$32 = ((($mat)) + 32|0);
$33 = +HEAPF32[$32>>2];
$34 = $0 * $33;
$35 = ((($mat)) + 36|0);
$36 = +HEAPF32[$35>>2];
$37 = $2 * $36;
$38 = $34 + $37;
$39 = ((($mat)) + 40|0);
$40 = +HEAPF32[$39>>2];
$41 = $4 * $40;
$42 = $38 + $41;
$43 = ((($mat)) + 44|0);
$44 = +HEAPF32[$43>>2];
$45 = $44 + $42;
HEAPF32[$3>>2] = $45;
return;
}
function _VectorZero($agg$result) {
$agg$result = $agg$result|0;
var label = 0, sp = 0;
sp = STACKTOP;
;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0;
return;
}
function _MatrixTranspose($mat) {
$mat = $mat|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($mat)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($mat)) + 8|0);
$3 = HEAP32[$2>>2]|0;
$4 = ((($mat)) + 12|0);
$5 = HEAP32[$4>>2]|0;
$6 = ((($mat)) + 16|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($mat)) + 24|0);
$9 = HEAP32[$8>>2]|0;
$10 = ((($mat)) + 28|0);
$11 = HEAP32[$10>>2]|0;
$12 = ((($mat)) + 32|0);
$13 = HEAP32[$12>>2]|0;
$14 = ((($mat)) + 36|0);
$15 = HEAP32[$14>>2]|0;
$16 = ((($mat)) + 44|0);
$17 = HEAP32[$16>>2]|0;
$18 = ((($mat)) + 48|0);
$19 = HEAP32[$18>>2]|0;
$20 = ((($mat)) + 52|0);
$21 = HEAP32[$20>>2]|0;
$22 = ((($mat)) + 56|0);
$23 = HEAP32[$22>>2]|0;
HEAP32[$0>>2] = $7;
HEAP32[$2>>2] = $13;
HEAP32[$4>>2] = $19;
HEAP32[$6>>2] = $1;
HEAP32[$8>>2] = $15;
HEAP32[$10>>2] = $21;
HEAP32[$12>>2] = $3;
HEAP32[$14>>2] = $9;
HEAP32[$16>>2] = $23;
HEAP32[$18>>2] = $5;
HEAP32[$20>>2] = $11;
HEAP32[$22>>2] = $17;
return;
}
function _MatrixIdentity($agg$result) {
$agg$result = $agg$result|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$result$sroa$5 = sp + 32|0;
$result$sroa$6 = sp + 16|0;
$result$sroa$7 = sp;
;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0;
;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0;
;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0;
HEAPF32[$agg$result>>2] = 1.0;
$0 = ((($agg$result)) + 4|0);
;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0;
$1 = ((($agg$result)) + 20|0);
HEAPF32[$1>>2] = 1.0;
$2 = ((($agg$result)) + 24|0);
;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0;
$3 = ((($agg$result)) + 40|0);
HEAPF32[$3>>2] = 1.0;
$4 = ((($agg$result)) + 44|0);
;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0;
$5 = ((($agg$result)) + 60|0);
HEAPF32[$5>>2] = 1.0;
STACKTOP = sp;return;
}
function _MatrixTranslate($agg$result,$x,$y,$z) {
$agg$result = $agg$result|0;
$x = +$x;
$y = +$y;
$z = +$z;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
sp = STACKTOP;
HEAPF32[$agg$result>>2] = 1.0;
$0 = ((($agg$result)) + 4|0);
$1 = ((($agg$result)) + 20|0);
;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0;
HEAPF32[$1>>2] = 1.0;
$2 = ((($agg$result)) + 24|0);
$3 = ((($agg$result)) + 40|0);
;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;
HEAPF32[$3>>2] = 1.0;
$4 = ((($agg$result)) + 44|0);
HEAPF32[$4>>2] = 0.0;
$5 = ((($agg$result)) + 48|0);
HEAPF32[$5>>2] = $x;
$6 = ((($agg$result)) + 52|0);
HEAPF32[$6>>2] = $y;
$7 = ((($agg$result)) + 56|0);
HEAPF32[$7>>2] = $z;
$8 = ((($agg$result)) + 60|0);
HEAPF32[$8>>2] = 1.0;
return;
}
function _MatrixRotate($agg$result,$axis,$angle) {
$agg$result = $agg$result|0;
$axis = $axis|0;
$angle = +$angle;
var $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0;
var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0;
var $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0;
var $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0.0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0;
var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0;
var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0;
var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $mat = 0, $or$cond = 0, $sqrtf = 0.0, $x$0 = 0.0, $y$0 = 0.0, $z$0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$mat = sp;
_MatrixIdentity($mat);
$0 = +HEAPF32[$axis>>2];
$1 = ((($axis)) + 4|0);
$2 = +HEAPF32[$1>>2];
$3 = ((($axis)) + 8|0);
$4 = +HEAPF32[$3>>2];
$5 = $0 * $0;
$6 = $2 * $2;
$7 = $5 + $6;
$8 = $4 * $4;
$9 = $7 + $8;
$sqrtf = (+Math_sqrt((+$9)));
$10 = $sqrtf != 1.0;
$11 = $sqrtf != 0.0;
$or$cond = $10 & $11;
if ($or$cond) {
$12 = 1.0 / $sqrtf;
$13 = $0 * $12;
$14 = $2 * $12;
$15 = $4 * $12;
$x$0 = $13;$y$0 = $14;$z$0 = $15;
} else {
$x$0 = $0;$y$0 = $2;$z$0 = $4;
}
$16 = (+Math_sin((+$angle)));
$17 = (+Math_cos((+$angle)));
$18 = 1.0 - $17;
$19 = +HEAPF32[$mat>>2];
$20 = ((($mat)) + 16|0);
$21 = +HEAPF32[$20>>2];
$22 = ((($mat)) + 32|0);
$23 = +HEAPF32[$22>>2];
$24 = ((($mat)) + 48|0);
$25 = +HEAPF32[$24>>2];
$26 = ((($mat)) + 4|0);
$27 = +HEAPF32[$26>>2];
$28 = ((($mat)) + 20|0);
$29 = +HEAPF32[$28>>2];
$30 = ((($mat)) + 36|0);
$31 = +HEAPF32[$30>>2];
$32 = ((($mat)) + 52|0);
$33 = +HEAPF32[$32>>2];
$34 = ((($mat)) + 8|0);
$35 = +HEAPF32[$34>>2];
$36 = ((($mat)) + 24|0);
$37 = +HEAPF32[$36>>2];
$38 = ((($mat)) + 40|0);
$39 = +HEAPF32[$38>>2];
$40 = ((($mat)) + 56|0);
$41 = +HEAPF32[$40>>2];
$42 = $x$0 * $x$0;
$43 = $42 * $18;
$44 = $17 + $43;
$45 = $y$0 * $x$0;
$46 = $45 * $18;
$47 = $z$0 * $16;
$48 = $47 + $46;
$49 = $z$0 * $x$0;
$50 = $49 * $18;
$51 = $y$0 * $16;
$52 = $50 - $51;
$53 = $46 - $47;
$54 = $y$0 * $y$0;
$55 = $54 * $18;
$56 = $17 + $55;
$57 = $z$0 * $y$0;
$58 = $57 * $18;
$59 = $x$0 * $16;
$60 = $59 + $58;
$61 = $51 + $50;
$62 = $58 - $59;
$63 = $z$0 * $z$0;
$64 = $63 * $18;
$65 = $17 + $64;
$66 = $19 * $44;
$67 = $48 * $27;
$68 = $66 + $67;
$69 = $52 * $35;
$70 = $68 + $69;
$71 = $21 * $44;
$72 = $48 * $29;
$73 = $71 + $72;
$74 = $52 * $37;
$75 = $73 + $74;
$76 = $23 * $44;
$77 = $48 * $31;
$78 = $76 + $77;
$79 = $52 * $39;
$80 = $78 + $79;
$81 = $44 * $25;
$82 = $48 * $33;
$83 = $81 + $82;
$84 = $52 * $41;
$85 = $83 + $84;
$86 = $19 * $53;
$87 = $56 * $27;
$88 = $86 + $87;
$89 = $60 * $35;
$90 = $88 + $89;
$91 = $21 * $53;
$92 = $56 * $29;
$93 = $91 + $92;
$94 = $60 * $37;
$95 = $93 + $94;
$96 = $23 * $53;
$97 = $56 * $31;
$98 = $96 + $97;
$99 = $60 * $39;
$100 = $98 + $99;
$101 = $53 * $25;
$102 = $56 * $33;
$103 = $101 + $102;
$104 = $60 * $41;
$105 = $103 + $104;
$106 = $19 * $61;
$107 = $62 * $27;
$108 = $106 + $107;
$109 = $65 * $35;
$110 = $108 + $109;
$111 = $21 * $61;
$112 = $62 * $29;
$113 = $111 + $112;
$114 = $65 * $37;
$115 = $113 + $114;
$116 = $23 * $61;
$117 = $62 * $31;
$118 = $116 + $117;
$119 = $65 * $39;
$120 = $118 + $119;
$121 = $61 * $25;
$122 = $62 * $33;
$123 = $121 + $122;
$124 = $65 * $41;
$125 = $123 + $124;
$126 = ((($mat)) + 12|0);
$127 = HEAP32[$126>>2]|0;
$128 = ((($mat)) + 28|0);
$129 = HEAP32[$128>>2]|0;
$130 = ((($mat)) + 44|0);
$131 = HEAP32[$130>>2]|0;
$132 = ((($mat)) + 60|0);
$133 = HEAP32[$132>>2]|0;
HEAPF32[$agg$result>>2] = $70;
$134 = ((($agg$result)) + 4|0);
HEAPF32[$134>>2] = $90;
$135 = ((($agg$result)) + 8|0);
HEAPF32[$135>>2] = $110;
$136 = ((($agg$result)) + 12|0);
HEAP32[$136>>2] = $127;
$137 = ((($agg$result)) + 16|0);
HEAPF32[$137>>2] = $75;
$138 = ((($agg$result)) + 20|0);
HEAPF32[$138>>2] = $95;
$139 = ((($agg$result)) + 24|0);
HEAPF32[$139>>2] = $115;
$140 = ((($agg$result)) + 28|0);
HEAP32[$140>>2] = $129;
$141 = ((($agg$result)) + 32|0);
HEAPF32[$141>>2] = $80;
$142 = ((($agg$result)) + 36|0);
HEAPF32[$142>>2] = $100;
$143 = ((($agg$result)) + 40|0);
HEAPF32[$143>>2] = $120;
$144 = ((($agg$result)) + 44|0);
HEAP32[$144>>2] = $131;
$145 = ((($agg$result)) + 48|0);
HEAPF32[$145>>2] = $85;
$146 = ((($agg$result)) + 52|0);
HEAPF32[$146>>2] = $105;
$147 = ((($agg$result)) + 56|0);
HEAPF32[$147>>2] = $125;
$148 = ((($agg$result)) + 60|0);
HEAP32[$148>>2] = $133;
STACKTOP = sp;return;
}
function _MatrixScale($agg$result,$x,$y,$z) {
$agg$result = $agg$result|0;
$x = +$x;
$y = +$y;
$z = +$z;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$result$sroa$5 = sp + 32|0;
$result$sroa$6 = sp + 16|0;
$result$sroa$7 = sp;
;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0;
;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0;
;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0;
HEAPF32[$agg$result>>2] = $x;
$0 = ((($agg$result)) + 4|0);
;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0;
$1 = ((($agg$result)) + 20|0);
HEAPF32[$1>>2] = $y;
$2 = ((($agg$result)) + 24|0);
;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0;
$3 = ((($agg$result)) + 40|0);
HEAPF32[$3>>2] = $z;
$4 = ((($agg$result)) + 44|0);
;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0;
$5 = ((($agg$result)) + 60|0);
HEAPF32[$5>>2] = 1.0;
STACKTOP = sp;return;
}
function _MatrixMultiply($agg$result,$left,$right) {
$agg$result = $agg$result|0;
$left = $left|0;
$right = $right|0;
var $0 = 0.0, $1 = 0.0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0.0;
var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0.0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0.0;
var $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0;
var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0.0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
var $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0;
var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0;
var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0;
var $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0;
var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$right>>2];
$1 = +HEAPF32[$left>>2];
$2 = $0 * $1;
$3 = ((($right)) + 16|0);
$4 = +HEAPF32[$3>>2];
$5 = ((($left)) + 4|0);
$6 = +HEAPF32[$5>>2];
$7 = $4 * $6;
$8 = $2 + $7;
$9 = ((($right)) + 32|0);
$10 = +HEAPF32[$9>>2];
$11 = ((($left)) + 8|0);
$12 = +HEAPF32[$11>>2];
$13 = $10 * $12;
$14 = $8 + $13;
$15 = ((($right)) + 48|0);
$16 = +HEAPF32[$15>>2];
$17 = ((($left)) + 12|0);
$18 = +HEAPF32[$17>>2];
$19 = $16 * $18;
$20 = $14 + $19;
$21 = ((($left)) + 16|0);
$22 = +HEAPF32[$21>>2];
$23 = $0 * $22;
$24 = ((($left)) + 20|0);
$25 = +HEAPF32[$24>>2];
$26 = $4 * $25;
$27 = $23 + $26;
$28 = ((($left)) + 24|0);
$29 = +HEAPF32[$28>>2];
$30 = $10 * $29;
$31 = $27 + $30;
$32 = ((($left)) + 28|0);
$33 = +HEAPF32[$32>>2];
$34 = $16 * $33;
$35 = $31 + $34;
$36 = ((($left)) + 32|0);
$37 = +HEAPF32[$36>>2];
$38 = $0 * $37;
$39 = ((($left)) + 36|0);
$40 = +HEAPF32[$39>>2];
$41 = $4 * $40;
$42 = $38 + $41;
$43 = ((($left)) + 40|0);
$44 = +HEAPF32[$43>>2];
$45 = $10 * $44;
$46 = $42 + $45;
$47 = ((($left)) + 44|0);
$48 = +HEAPF32[$47>>2];
$49 = $16 * $48;
$50 = $46 + $49;
$51 = ((($left)) + 48|0);
$52 = +HEAPF32[$51>>2];
$53 = $0 * $52;
$54 = ((($left)) + 52|0);
$55 = +HEAPF32[$54>>2];
$56 = $4 * $55;
$57 = $53 + $56;
$58 = ((($left)) + 56|0);
$59 = +HEAPF32[$58>>2];
$60 = $10 * $59;
$61 = $57 + $60;
$62 = ((($left)) + 60|0);
$63 = +HEAPF32[$62>>2];
$64 = $16 * $63;
$65 = $61 + $64;
$66 = ((($right)) + 4|0);
$67 = +HEAPF32[$66>>2];
$68 = $1 * $67;
$69 = ((($right)) + 20|0);
$70 = +HEAPF32[$69>>2];
$71 = $6 * $70;
$72 = $68 + $71;
$73 = ((($right)) + 36|0);
$74 = +HEAPF32[$73>>2];
$75 = $12 * $74;
$76 = $72 + $75;
$77 = ((($right)) + 52|0);
$78 = +HEAPF32[$77>>2];
$79 = $18 * $78;
$80 = $76 + $79;
$81 = $22 * $67;
$82 = $25 * $70;
$83 = $81 + $82;
$84 = $29 * $74;
$85 = $83 + $84;
$86 = $33 * $78;
$87 = $85 + $86;
$88 = $37 * $67;
$89 = $40 * $70;
$90 = $88 + $89;
$91 = $44 * $74;
$92 = $90 + $91;
$93 = $48 * $78;
$94 = $92 + $93;
$95 = $52 * $67;
$96 = $55 * $70;
$97 = $95 + $96;
$98 = $59 * $74;
$99 = $97 + $98;
$100 = $63 * $78;
$101 = $99 + $100;
$102 = ((($right)) + 8|0);
$103 = +HEAPF32[$102>>2];
$104 = $1 * $103;
$105 = ((($right)) + 24|0);
$106 = +HEAPF32[$105>>2];
$107 = $6 * $106;
$108 = $104 + $107;
$109 = ((($right)) + 40|0);
$110 = +HEAPF32[$109>>2];
$111 = $12 * $110;
$112 = $108 + $111;
$113 = ((($right)) + 56|0);
$114 = +HEAPF32[$113>>2];
$115 = $18 * $114;
$116 = $112 + $115;
$117 = $22 * $103;
$118 = $25 * $106;
$119 = $117 + $118;
$120 = $29 * $110;
$121 = $119 + $120;
$122 = $33 * $114;
$123 = $121 + $122;
$124 = $37 * $103;
$125 = $40 * $106;
$126 = $124 + $125;
$127 = $44 * $110;
$128 = $126 + $127;
$129 = $48 * $114;
$130 = $128 + $129;
$131 = $52 * $103;
$132 = $55 * $106;
$133 = $131 + $132;
$134 = $59 * $110;
$135 = $133 + $134;
$136 = $63 * $114;
$137 = $135 + $136;
$138 = ((($right)) + 12|0);
$139 = +HEAPF32[$138>>2];
$140 = $1 * $139;
$141 = ((($right)) + 28|0);
$142 = +HEAPF32[$141>>2];
$143 = $6 * $142;
$144 = $140 + $143;
$145 = ((($right)) + 44|0);
$146 = +HEAPF32[$145>>2];
$147 = $12 * $146;
$148 = $144 + $147;
$149 = ((($right)) + 60|0);
$150 = +HEAPF32[$149>>2];
$151 = $18 * $150;
$152 = $148 + $151;
$153 = $22 * $139;
$154 = $25 * $142;
$155 = $153 + $154;
$156 = $29 * $146;
$157 = $155 + $156;
$158 = $33 * $150;
$159 = $157 + $158;
$160 = $37 * $139;
$161 = $40 * $142;
$162 = $160 + $161;
$163 = $44 * $146;
$164 = $162 + $163;
$165 = $48 * $150;
$166 = $164 + $165;
$167 = $52 * $139;
$168 = $55 * $142;
$169 = $167 + $168;
$170 = $59 * $146;
$171 = $169 + $170;
$172 = $63 * $150;
$173 = $171 + $172;
HEAPF32[$agg$result>>2] = $20;
$174 = ((($agg$result)) + 4|0);
HEAPF32[$174>>2] = $80;
$175 = ((($agg$result)) + 8|0);
HEAPF32[$175>>2] = $116;
$176 = ((($agg$result)) + 12|0);
HEAPF32[$176>>2] = $152;
$177 = ((($agg$result)) + 16|0);
HEAPF32[$177>>2] = $35;
$178 = ((($agg$result)) + 20|0);
HEAPF32[$178>>2] = $87;
$179 = ((($agg$result)) + 24|0);
HEAPF32[$179>>2] = $123;
$180 = ((($agg$result)) + 28|0);
HEAPF32[$180>>2] = $159;
$181 = ((($agg$result)) + 32|0);
HEAPF32[$181>>2] = $50;
$182 = ((($agg$result)) + 36|0);
HEAPF32[$182>>2] = $94;
$183 = ((($agg$result)) + 40|0);
HEAPF32[$183>>2] = $130;
$184 = ((($agg$result)) + 44|0);
HEAPF32[$184>>2] = $166;
$185 = ((($agg$result)) + 48|0);
HEAPF32[$185>>2] = $65;
$186 = ((($agg$result)) + 52|0);
HEAPF32[$186>>2] = $101;
$187 = ((($agg$result)) + 56|0);
HEAPF32[$187>>2] = $137;
$188 = ((($agg$result)) + 60|0);
HEAPF32[$188>>2] = $173;
return;
}
function _MatrixFrustum($agg$result,$left,$right,$bottom,$top,$near,$far) {
$agg$result = $agg$result|0;
$left = +$left;
$right = +$right;
$bottom = +$bottom;
$top = +$top;
$near = +$near;
$far = +$far;
var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0.0;
var $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $right - $left;
$1 = $0;
$2 = $top - $bottom;
$3 = $2;
$4 = $far - $near;
$5 = $4;
$6 = $near * 2.0;
$7 = $1;
$8 = $6 / $7;
$9 = $8;
$10 = $3;
$11 = $6 / $10;
$12 = $11;
$13 = $left + $right;
$14 = $13 / $7;
$15 = $14;
$16 = $bottom + $top;
$17 = $16 / $10;
$18 = $17;
$19 = $near + $far;
$20 = -$19;
$21 = $5;
$22 = $20 / $21;
$23 = $22;
$24 = $near * $far;
$25 = $24 * 2.0;
$26 = -$25;
$27 = $26 / $21;
$28 = $27;
HEAPF32[$agg$result>>2] = $9;
$29 = ((($agg$result)) + 4|0);
HEAPF32[$29>>2] = 0.0;
$30 = ((($agg$result)) + 8|0);
HEAPF32[$30>>2] = $15;
$31 = ((($agg$result)) + 12|0);
HEAPF32[$31>>2] = 0.0;
$32 = ((($agg$result)) + 16|0);
HEAPF32[$32>>2] = 0.0;
$33 = ((($agg$result)) + 20|0);
HEAPF32[$33>>2] = $12;
$34 = ((($agg$result)) + 24|0);
HEAPF32[$34>>2] = $18;
$35 = ((($agg$result)) + 28|0);
HEAPF32[$35>>2] = 0.0;
$36 = ((($agg$result)) + 32|0);
HEAPF32[$36>>2] = 0.0;
$37 = ((($agg$result)) + 36|0);
HEAPF32[$37>>2] = 0.0;
$38 = ((($agg$result)) + 40|0);
HEAPF32[$38>>2] = $23;
$39 = ((($agg$result)) + 44|0);
HEAPF32[$39>>2] = $28;
$40 = ((($agg$result)) + 48|0);
HEAPF32[$40>>2] = 0.0;
$41 = ((($agg$result)) + 52|0);
HEAPF32[$41>>2] = 0.0;
$42 = ((($agg$result)) + 56|0);
HEAPF32[$42>>2] = -1.0;
$43 = ((($agg$result)) + 60|0);
HEAPF32[$43>>2] = 0.0;
return;
}
function _MatrixOrtho($agg$result,$left,$right,$bottom,$top,$near,$far) {
$agg$result = $agg$result|0;
$left = +$left;
$right = +$right;
$bottom = +$bottom;
$top = +$top;
$near = +$near;
$far = +$far;
var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = $right - $left;
$1 = $0;
$2 = $top - $bottom;
$3 = $2;
$4 = $far - $near;
$5 = $4;
$6 = 2.0 / $1;
$7 = 2.0 / $3;
$8 = -2.0 / $5;
$9 = $left + $right;
$10 = -$9;
$11 = $1;
$12 = $10 / $11;
$13 = $12;
$14 = $bottom + $top;
$15 = -$14;
$16 = $3;
$17 = $15 / $16;
$18 = $17;
$19 = $near + $far;
$20 = -$19;
$21 = $5;
$22 = $20 / $21;
$23 = $22;
HEAPF32[$agg$result>>2] = $6;
$24 = ((($agg$result)) + 4|0);
HEAPF32[$24>>2] = 0.0;
$25 = ((($agg$result)) + 8|0);
HEAPF32[$25>>2] = 0.0;
$26 = ((($agg$result)) + 12|0);
HEAPF32[$26>>2] = $13;
$27 = ((($agg$result)) + 16|0);
HEAPF32[$27>>2] = 0.0;
$28 = ((($agg$result)) + 20|0);
HEAPF32[$28>>2] = $7;
$29 = ((($agg$result)) + 24|0);
HEAPF32[$29>>2] = 0.0;
$30 = ((($agg$result)) + 28|0);
HEAPF32[$30>>2] = $18;
$31 = ((($agg$result)) + 32|0);
HEAPF32[$31>>2] = 0.0;
$32 = ((($agg$result)) + 36|0);
HEAPF32[$32>>2] = 0.0;
$33 = ((($agg$result)) + 40|0);
HEAPF32[$33>>2] = $8;
$34 = ((($agg$result)) + 44|0);
HEAPF32[$34>>2] = $23;
$35 = ((($agg$result)) + 48|0);
HEAPF32[$35>>2] = 0.0;
$36 = ((($agg$result)) + 52|0);
HEAPF32[$36>>2] = 0.0;
$37 = ((($agg$result)) + 56|0);
HEAPF32[$37>>2] = 0.0;
$38 = ((($agg$result)) + 60|0);
HEAPF32[$38>>2] = 1.0;
return;
}
function _MatrixLookAt($agg$result,$eye,$target,$up) {
$agg$result = $agg$result|0;
$eye = $eye|0;
$target = $target|0;
$up = $up|0;
var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, $x = 0, $x$byval_copy = 0, $y = 0, $z = 0, $z$byval_copy1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$x$byval_copy = sp + 48|0;
$z$byval_copy1 = sp + 36|0;
$z = sp + 24|0;
$x = sp + 12|0;
$y = sp;
;HEAP32[$z$byval_copy1>>2]=HEAP32[$eye>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$eye+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$eye+8>>2]|0;
;HEAP32[$x$byval_copy>>2]=HEAP32[$target>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$target+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$target+8>>2]|0;
_VectorSubtract($z,$z$byval_copy1,$x$byval_copy);
_VectorNormalize($z);
;HEAP32[$z$byval_copy1>>2]=HEAP32[$up>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$up+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$up+8>>2]|0;
;HEAP32[$x$byval_copy>>2]=HEAP32[$z>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$z+8>>2]|0;
_VectorCrossProduct($x,$z$byval_copy1,$x$byval_copy);
_VectorNormalize($x);
;HEAP32[$z$byval_copy1>>2]=HEAP32[$z>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$z+8>>2]|0;
;HEAP32[$x$byval_copy>>2]=HEAP32[$x>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$x+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$x+8>>2]|0;
_VectorCrossProduct($y,$z$byval_copy1,$x$byval_copy);
_VectorNormalize($y);
$0 = +HEAPF32[$x>>2];
$1 = ((($x)) + 4|0);
$2 = +HEAPF32[$1>>2];
$3 = ((($x)) + 8|0);
$4 = +HEAPF32[$3>>2];
$5 = +HEAPF32[$eye>>2];
$6 = $0 * $5;
$7 = ((($eye)) + 4|0);
$8 = +HEAPF32[$7>>2];
$9 = $2 * $8;
$10 = $6 + $9;
$11 = ((($eye)) + 8|0);
$12 = +HEAPF32[$11>>2];
$13 = $4 * $12;
$14 = $10 + $13;
$15 = -$14;
$16 = +HEAPF32[$y>>2];
$17 = ((($y)) + 4|0);
$18 = +HEAPF32[$17>>2];
$19 = ((($y)) + 8|0);
$20 = +HEAPF32[$19>>2];
$21 = $5 * $16;
$22 = $8 * $18;
$23 = $21 + $22;
$24 = $12 * $20;
$25 = $23 + $24;
$26 = -$25;
$27 = +HEAPF32[$z>>2];
$28 = ((($z)) + 4|0);
$29 = +HEAPF32[$28>>2];
$30 = ((($z)) + 8|0);
$31 = +HEAPF32[$30>>2];
$32 = $5 * $27;
$33 = $8 * $29;
$34 = $32 + $33;
$35 = $12 * $31;
$36 = $34 + $35;
$37 = -$36;
HEAPF32[$agg$result>>2] = $0;
$38 = ((($agg$result)) + 4|0);
HEAPF32[$38>>2] = $16;
$39 = ((($agg$result)) + 8|0);
HEAPF32[$39>>2] = $27;
$40 = ((($agg$result)) + 12|0);
HEAPF32[$40>>2] = 0.0;
$41 = ((($agg$result)) + 16|0);
HEAPF32[$41>>2] = $2;
$42 = ((($agg$result)) + 20|0);
HEAPF32[$42>>2] = $18;
$43 = ((($agg$result)) + 24|0);
HEAPF32[$43>>2] = $29;
$44 = ((($agg$result)) + 28|0);
HEAPF32[$44>>2] = 0.0;
$45 = ((($agg$result)) + 32|0);
HEAPF32[$45>>2] = $4;
$46 = ((($agg$result)) + 36|0);
HEAPF32[$46>>2] = $20;
$47 = ((($agg$result)) + 40|0);
HEAPF32[$47>>2] = $31;
$48 = ((($agg$result)) + 44|0);
HEAPF32[$48>>2] = 0.0;
$49 = ((($agg$result)) + 48|0);
HEAPF32[$49>>2] = $15;
$50 = ((($agg$result)) + 52|0);
HEAPF32[$50>>2] = $26;
$51 = ((($agg$result)) + 56|0);
HEAPF32[$51>>2] = $37;
$52 = ((($agg$result)) + 60|0);
HEAPF32[$52>>2] = 1.0;
STACKTOP = sp;return;
}
function _InitWindow($width,$height,$title) {
$width = $width|0;
$height = $height|0;
$title = $title|0;
var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
_TraceLog(0,10779,$vararg_buffer);
HEAP32[812>>2] = $title;
_InitDisplay($width,$height);
_InitGraphics();
_LoadDefaultFont();
_InitTimer();
(_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(4|0))|0);
(_emscripten_set_touchstart_callback((10808|0),(0|0),1,(5|0))|0);
(_emscripten_set_touchend_callback((10808|0),(0|0),1,(5|0))|0);
(_emscripten_set_touchmove_callback((10808|0),(0|0),1,(5|0))|0);
(_emscripten_set_touchcancel_callback((10808|0),(0|0),1,(5|0))|0);
$0 = HEAP32[816>>2]|0;
$1 = (+($0|0));
$2 = $1 * 0.5;
HEAPF32[8>>2] = $2;
$3 = HEAP32[820>>2]|0;
$4 = (+($3|0));
$5 = $4 * 0.5;
HEAPF32[(12)>>2] = $5;
$6 = HEAP32[824>>2]|0;
$7 = ($6|0)==(0);
if ($7) {
STACKTOP = sp;return;
}
_SetTargetFPS(60);
_LogoAnimation();
STACKTOP = sp;return;
}
function _SetTargetFPS($fps) {
$fps = $fps|0;
var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$0 = (+($fps|0));
$1 = 1.0 / $0;
HEAPF64[16>>3] = $1;
$2 = $1;
$3 = $2 * 1000.0;
$4 = $3;
HEAPF64[$vararg_buffer>>3] = $4;
_TraceLog(0,10816,$vararg_buffer);
STACKTOP = sp;return;
}
function _CloseWindow() {
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
_UnloadDefaultFont();
_rlglClose();
$0 = HEAP32[828>>2]|0;
_glfwDestroyWindow(($0|0));
_glfwTerminate();
_TraceLog(0,10860,$vararg_buffer);
STACKTOP = sp;return;
}
function _GetScreenWidth() {
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[816>>2]|0;
return ($0|0);
}
function _GetScreenHeight() {
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[820>>2]|0;
return ($0|0);
}
function _ClearBackground($color) {
$color = $color|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP8[$color>>0]|0;
$1 = ((($color)) + 1|0);
$2 = HEAP8[$1>>0]|0;
$3 = ((($color)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color)) + 3|0);
$6 = HEAP8[$5>>0]|0;
_rlClearColor($0,$2,$4,$6);
return;
}
function _BeginDrawing() {
var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$downscaleView$byval_copy = sp;
$0 = (+_GetTime());
HEAPF64[24>>3] = $0;
$1 = +HEAPF64[32>>3];
$2 = $0 - $1;
HEAPF64[40>>3] = $2;
HEAPF64[32>>3] = $0;
$3 = (_IsPosproShaderEnabled()|0);
$4 = ($3|0)==(0);
if (!($4)) {
_rlEnablePostproFBO();
}
_rlClearScreenBuffers();
_rlLoadIdentity();
dest=$downscaleView$byval_copy; src=840; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
(_MatrixToFloat($downscaleView$byval_copy)|0);
_rlMultMatrixf(904);
STACKTOP = sp;return;
}
function _MatrixToFloat($mat) {
$mat = $mat|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$mat>>2]|0;
HEAP32[904>>2] = $0;
$1 = ((($mat)) + 4|0);
$2 = HEAP32[$1>>2]|0;
HEAP32[(908)>>2] = $2;
$3 = ((($mat)) + 8|0);
$4 = HEAP32[$3>>2]|0;
HEAP32[(912)>>2] = $4;
$5 = ((($mat)) + 12|0);
$6 = HEAP32[$5>>2]|0;
HEAP32[(916)>>2] = $6;
$7 = ((($mat)) + 16|0);
$8 = HEAP32[$7>>2]|0;
HEAP32[(920)>>2] = $8;
$9 = ((($mat)) + 20|0);
$10 = HEAP32[$9>>2]|0;
HEAP32[(924)>>2] = $10;
$11 = ((($mat)) + 24|0);
$12 = HEAP32[$11>>2]|0;
HEAP32[(928)>>2] = $12;
$13 = ((($mat)) + 28|0);
$14 = HEAP32[$13>>2]|0;
HEAP32[(932)>>2] = $14;
$15 = ((($mat)) + 32|0);
$16 = HEAP32[$15>>2]|0;
HEAP32[(936)>>2] = $16;
$17 = ((($mat)) + 36|0);
$18 = HEAP32[$17>>2]|0;
HEAP32[(940)>>2] = $18;
$19 = ((($mat)) + 40|0);
$20 = HEAP32[$19>>2]|0;
HEAP32[(944)>>2] = $20;
$21 = ((($mat)) + 44|0);
$22 = HEAP32[$21>>2]|0;
HEAP32[(948)>>2] = $22;
$23 = ((($mat)) + 48|0);
$24 = HEAP32[$23>>2]|0;
HEAP32[(952)>>2] = $24;
$25 = ((($mat)) + 52|0);
$26 = HEAP32[$25>>2]|0;
HEAP32[(956)>>2] = $26;
$27 = ((($mat)) + 56|0);
$28 = HEAP32[$27>>2]|0;
HEAP32[(960)>>2] = $28;
$29 = ((($mat)) + 60|0);
$30 = HEAP32[$29>>2]|0;
HEAP32[(964)>>2] = $30;
return (904|0);
}
function _EndDrawing() {
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
_rlglDraw();
$0 = (_IsPosproShaderEnabled()|0);
$1 = ($0|0)==(0);
if (!($1)) {
_rlglDrawPostpro();
}
_SwapBuffers();
_PollInputEvents();
$2 = (+_GetTime());
HEAPF64[24>>3] = $2;
$3 = +HEAPF64[32>>3];
$4 = $2 - $3;
HEAPF64[48>>3] = $4;
HEAPF64[32>>3] = $2;
$5 = +HEAPF64[40>>3];
$6 = $5 + $4;
HEAPF64[56>>3] = $6;
$7 = +HEAPF64[16>>3];
$8 = $6 < $7;
if (!($8)) {
return;
}
while(1) {
$9 = (+_GetTime());
HEAPF64[24>>3] = $9;
$10 = +HEAPF64[32>>3];
$11 = $9 - $10;
HEAPF64[32>>3] = $9;
$12 = +HEAPF64[56>>3];
$13 = $12 + $11;
HEAPF64[56>>3] = $13;
$14 = +HEAPF64[16>>3];
$15 = $13 < $14;
if (!($15)) {
break;
}
}
return;
}
function _Begin3dMode($camera) {
$camera = $camera|0;
var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $matView = 0, $matView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 160|0;
$matView$byval_copy = sp + 88|0;
$$byval_copy1 = sp + 76|0;
$$byval_copy = sp + 64|0;
$matView = sp;
_rlglDraw();
_rlMatrixMode(0);
_rlPushMatrix();
_rlLoadIdentity();
$0 = HEAP32[816>>2]|0;
$1 = (+($0|0));
$2 = HEAP32[820>>2]|0;
$3 = (+($2|0));
$4 = $1 / $3;
$5 = $4;
$6 = $5 * 0.041421356237309505;
$7 = -$6;
_rlFrustum($7,$6,-0.041421356237309505,0.041421356237309505,0.10000000149011612,1000.0);
_rlMatrixMode(1);
_rlLoadIdentity();
$8 = ((($camera)) + 12|0);
$9 = ((($camera)) + 24|0);
;HEAP32[$$byval_copy>>2]=HEAP32[$camera>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$camera+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$camera+8>>2]|0;
;HEAP32[$$byval_copy1>>2]=HEAP32[$8>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$8+8>>2]|0;
;HEAP32[$matView$byval_copy>>2]=HEAP32[$9>>2]|0;HEAP32[$matView$byval_copy+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$matView$byval_copy+8>>2]=HEAP32[$9+8>>2]|0;
_MatrixLookAt($matView,$$byval_copy,$$byval_copy1,$matView$byval_copy);
dest=$matView$byval_copy; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
(_MatrixToFloat($matView$byval_copy)|0);
_rlMultMatrixf(904);
STACKTOP = sp;return;
}
function _End3dMode() {
var label = 0, sp = 0;
sp = STACKTOP;
_rlglDraw();
_rlMatrixMode(0);
_rlPopMatrix();
_rlMatrixMode(1);
_rlLoadIdentity();
return;
}
function _Fade($agg$result,$color,$alpha) {
$agg$result = $agg$result|0;
$color = $color|0;
$alpha = +$alpha;
var $$0 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $alpha < 0.0;
if ($0) {
$$0 = 0.0;
} else {
$1 = $alpha > 1.0;
if ($1) {
$$0 = 1.0;
} else {
$$0 = $alpha;
}
}
$2 = ((($color)) + 3|0);
$3 = HEAP8[$2>>0]|0;
$4 = (+($3&255));
$5 = $$0 * $4;
$6 = HEAP8[$color>>0]|0;
HEAP8[$agg$result>>0] = $6;
$7 = ((($agg$result)) + 1|0);
$8 = ((($color)) + 1|0);
$9 = HEAP8[$8>>0]|0;
HEAP8[$7>>0] = $9;
$10 = ((($agg$result)) + 2|0);
$11 = ((($color)) + 2|0);
$12 = HEAP8[$11>>0]|0;
HEAP8[$10>>0] = $12;
$13 = ((($agg$result)) + 3|0);
$14 = (~~(($5))&255);
HEAP8[$13>>0] = $14;
return;
}
function _IsKeyPressed($key) {
$key = $key|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $pressed$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (10888 + ($key)|0);
$1 = HEAP8[$0>>0]|0;
$2 = (11400 + ($key)|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($1<<24>>24)!=($3<<24>>24);
$5 = ($1<<24>>24)==(1);
$or$cond = $5 & $4;
$pressed$0 = $or$cond&1;
return ($pressed$0|0);
}
function _IsMouseButtonPressed($button) {
$button = $button|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $pressed$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (11912 + ($button)|0);
$1 = HEAP8[$0>>0]|0;
$2 = (11915 + ($button)|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($1<<24>>24)!=($3<<24>>24);
$5 = ($1<<24>>24)==(1);
$or$cond = $5 & $4;
$pressed$0 = $or$cond&1;
return ($pressed$0|0);
}
function _IsMouseButtonReleased($button) {
$button = $button|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $released$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (11912 + ($button)|0);
$1 = HEAP8[$0>>0]|0;
$2 = (11915 + ($button)|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($1<<24>>24)!=($3<<24>>24);
$5 = ($1<<24>>24)==(0);
$or$cond = $5 & $4;
$released$0 = $or$cond&1;
return ($released$0|0);
}
function _GetMousePosition($agg$result) {
$agg$result = $agg$result|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = 8;
$1 = $0;
$2 = HEAP32[$1>>2]|0;
$3 = (($0) + 4)|0;
$4 = $3;
$5 = HEAP32[$4>>2]|0;
$6 = $agg$result;
$7 = $6;
HEAP32[$7>>2] = $2;
$8 = (($6) + 4)|0;
$9 = $8;
HEAP32[$9>>2] = $5;
return;
}
function _mystrdup($str) {
$str = $str|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_strlen($str)|0);
$1 = (($0) + 1)|0;
$2 = (_malloc($1)|0);
$3 = ($2|0)==(0|0);
if ($3) {
$$0 = 0;
return ($$0|0);
}
_memcpy(($2|0),($str|0),($1|0))|0;
$$0 = $2;
return ($$0|0);
}
function _rlMatrixMode($mode) {
$mode = $mode|0;
var label = 0, sp = 0;
sp = STACKTOP;
switch ($mode|0) {
case 0: {
HEAP32[1068>>2] = 1004;
break;
}
case 1: {
HEAP32[1068>>2] = 1072;
break;
}
default: {
}
}
HEAP32[1136>>2] = $mode;
return;
}
function _rlPushMatrix() {
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$0 = HEAP32[1140>>2]|0;
$1 = ($0|0)==(15);
if ($1) {
HEAP32[$vararg_buffer>>2] = 16;
_TraceLog(1,11918,$vararg_buffer);
}
$2 = HEAP32[1140>>2]|0;
$3 = (1144 + ($2<<6)|0);
$4 = HEAP32[1068>>2]|0;
dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_rlLoadIdentity();
$5 = HEAP32[1140>>2]|0;
$6 = (($5) + 1)|0;
HEAP32[1140>>2] = $6;
$7 = HEAP32[1136>>2]|0;
$8 = ($7|0)==(1);
if (!($8)) {
STACKTOP = sp;return;
}
HEAP32[2168>>2] = 1;
STACKTOP = sp;return;
}
function _rlLoadIdentity() {
var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$0 = sp;
$1 = HEAP32[1068>>2]|0;
_MatrixIdentity($0);
dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _rlPopMatrix() {
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[1140>>2]|0;
$1 = ($0|0)>(0);
if (!($1)) {
return;
}
$2 = HEAP32[1140>>2]|0;
$3 = (($2) + -1)|0;
$4 = (1144 + ($3<<6)|0);
$5 = HEAP32[1068>>2]|0;
_memmove(($5|0),($4|0),64)|0;
$6 = HEAP32[1140>>2]|0;
$7 = (($6) + -1)|0;
HEAP32[1140>>2] = $7;
return;
}
function _rlTranslatef($x,$y,$z) {
$x = +$x;
$y = +$y;
$z = +$z;
var $$byval_copy = 0, $0 = 0, $1 = 0, $matTranslation = 0, $matTranslation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$matTranslation$byval_copy = sp + 192|0;
$$byval_copy = sp + 128|0;
$matTranslation = sp + 64|0;
$0 = sp;
_MatrixTranslate($matTranslation,$x,$y,$z);
_MatrixTranspose($matTranslation);
$1 = HEAP32[1068>>2]|0;
dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matTranslation$byval_copy; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($0,$$byval_copy,$matTranslation$byval_copy);
dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _rlRotatef($angleDeg,$x,$y,$z) {
$angleDeg = +$angleDeg;
$x = +$x;
$y = +$y;
$z = +$z;
var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $axis = 0, $matRotation = 0, $matRotation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 336|0;
$matRotation$byval_copy = sp + 272|0;
$$byval_copy = sp + 208|0;
$matRotation = sp + 144|0;
$axis = sp + 128|0;
$0 = sp + 64|0;
$1 = sp;
_MatrixIdentity($matRotation);
HEAPF32[$axis>>2] = $x;
$2 = ((($axis)) + 4|0);
HEAPF32[$2>>2] = $y;
$3 = ((($axis)) + 8|0);
HEAPF32[$3>>2] = $z;
_VectorNormalize($axis);
$4 = $angleDeg;
$5 = $4 * 0.017453292519943295;
$6 = $5;
;HEAP32[$matRotation$byval_copy>>2]=HEAP32[$axis>>2]|0;HEAP32[$matRotation$byval_copy+4>>2]=HEAP32[$axis+4>>2]|0;HEAP32[$matRotation$byval_copy+8>>2]=HEAP32[$axis+8>>2]|0;
_MatrixRotate($0,$matRotation$byval_copy,$6);
dest=$matRotation; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixTranspose($matRotation);
$7 = HEAP32[1068>>2]|0;
dest=$$byval_copy; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matRotation$byval_copy; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($1,$$byval_copy,$matRotation$byval_copy);
dest=$7; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _rlMultMatrixf($m) {
$m = $m|0;
var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $mat = 0, $mat$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$mat$byval_copy = sp + 192|0;
$$byval_copy = sp + 128|0;
$mat = sp + 64|0;
$0 = sp;
$1 = HEAP32[$m>>2]|0;
HEAP32[$mat>>2] = $1;
$2 = ((($mat)) + 4|0);
$3 = ((($m)) + 4|0);
$4 = HEAP32[$3>>2]|0;
HEAP32[$2>>2] = $4;
$5 = ((($mat)) + 8|0);
$6 = ((($m)) + 8|0);
$7 = HEAP32[$6>>2]|0;
HEAP32[$5>>2] = $7;
$8 = ((($mat)) + 12|0);
$9 = ((($m)) + 12|0);
$10 = HEAP32[$9>>2]|0;
HEAP32[$8>>2] = $10;
$11 = ((($mat)) + 16|0);
$12 = ((($m)) + 16|0);
$13 = HEAP32[$12>>2]|0;
HEAP32[$11>>2] = $13;
$14 = ((($mat)) + 20|0);
$15 = ((($m)) + 20|0);
$16 = HEAP32[$15>>2]|0;
HEAP32[$14>>2] = $16;
$17 = ((($mat)) + 24|0);
$18 = ((($m)) + 24|0);
$19 = HEAP32[$18>>2]|0;
HEAP32[$17>>2] = $19;
$20 = ((($mat)) + 28|0);
$21 = ((($m)) + 28|0);
$22 = HEAP32[$21>>2]|0;
HEAP32[$20>>2] = $22;
$23 = ((($mat)) + 32|0);
$24 = ((($m)) + 32|0);
$25 = HEAP32[$24>>2]|0;
HEAP32[$23>>2] = $25;
$26 = ((($mat)) + 36|0);
$27 = ((($m)) + 36|0);
$28 = HEAP32[$27>>2]|0;
HEAP32[$26>>2] = $28;
$29 = ((($mat)) + 40|0);
$30 = ((($m)) + 40|0);
$31 = HEAP32[$30>>2]|0;
HEAP32[$29>>2] = $31;
$32 = ((($mat)) + 44|0);
$33 = ((($m)) + 44|0);
$34 = HEAP32[$33>>2]|0;
HEAP32[$32>>2] = $34;
$35 = ((($mat)) + 48|0);
$36 = ((($m)) + 48|0);
$37 = HEAP32[$36>>2]|0;
HEAP32[$35>>2] = $37;
$38 = ((($mat)) + 52|0);
$39 = ((($m)) + 52|0);
$40 = HEAP32[$39>>2]|0;
HEAP32[$38>>2] = $40;
$41 = ((($mat)) + 56|0);
$42 = ((($m)) + 56|0);
$43 = HEAP32[$42>>2]|0;
HEAP32[$41>>2] = $43;
$44 = ((($mat)) + 60|0);
$45 = ((($m)) + 60|0);
$46 = HEAP32[$45>>2]|0;
HEAP32[$44>>2] = $46;
$47 = HEAP32[1068>>2]|0;
dest=$$byval_copy; src=$47; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$mat$byval_copy; src=$mat; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($0,$$byval_copy,$mat$byval_copy);
dest=$47; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _rlFrustum($left,$right,$bottom,$top,$near,$far) {
$left = +$left;
$right = +$right;
$bottom = +$bottom;
$top = +$top;
$near = +$near;
$far = +$far;
var $$byval_copy = 0, $0 = 0, $1 = 0, $matPerps = 0, $matPerps$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$matPerps$byval_copy = sp + 192|0;
$$byval_copy = sp + 128|0;
$matPerps = sp + 64|0;
$0 = sp;
_MatrixFrustum($matPerps,$left,$right,$bottom,$top,$near,$far);
_MatrixTranspose($matPerps);
$1 = HEAP32[1068>>2]|0;
dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matPerps$byval_copy; src=$matPerps; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($0,$$byval_copy,$matPerps$byval_copy);
dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _rlOrtho($left,$right,$bottom,$top,$near,$far) {
$left = +$left;
$right = +$right;
$bottom = +$bottom;
$top = +$top;
$near = +$near;
$far = +$far;
var $$byval_copy = 0, $0 = 0, $1 = 0, $matOrtho = 0, $matOrtho$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$matOrtho$byval_copy = sp + 192|0;
$$byval_copy = sp + 128|0;
$matOrtho = sp + 64|0;
$0 = sp;
_MatrixOrtho($matOrtho,$left,$right,$bottom,$top,$near,$far);
_MatrixTranspose($matOrtho);
$1 = HEAP32[1068>>2]|0;
dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matOrtho$byval_copy; src=$matOrtho; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($0,$$byval_copy,$matOrtho$byval_copy);
dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _rlBegin($mode) {
$mode = $mode|0;
var label = 0, sp = 0;
sp = STACKTOP;
HEAP32[2172>>2] = $mode;
return;
}
function _rlEnd() {
var $$byval_copy = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0;
var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0;
var $150 = 0, $151 = 0.0, $152 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0;
var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0;
var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond16 = 0, $exitcond17 = 0, $exitcond18 = 0, $i$013 = 0;
var $i1$011 = 0, $i2$04 = 0, $i4$05 = 0, $i6$09 = 0, $i7$07 = 0, $quads$1$promoted = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$$byval_copy = sp;
$0 = HEAP32[2168>>2]|0;
$1 = ($0|0)==(0);
if (!($1)) {
$2 = HEAP32[2176>>2]|0;
$3 = ($2|0)>(0);
if ($3) {
$i$013 = 0;
while(1) {
$4 = HEAP32[2180>>2]|0;
$5 = (($4) + (($i$013*12)|0)|0);
$6 = HEAP32[1068>>2]|0;
dest=$$byval_copy; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_VectorTransform($5,$$byval_copy);
$7 = (($i$013) + 1)|0;
$8 = HEAP32[2176>>2]|0;
$9 = ($7|0)<($8|0);
if ($9) {
$i$013 = $7;
} else {
$$lcssa = $8;
break;
}
}
HEAP32[2168>>2] = 0;
$10 = ($$lcssa|0)>(0);
if ($10) {
$i1$011 = 0;
while(1) {
$11 = HEAP32[2180>>2]|0;
$12 = (($11) + (($i1$011*12)|0)|0);
$13 = +HEAPF32[$12>>2];
$14 = (((($11) + (($i1$011*12)|0)|0)) + 4|0);
$15 = +HEAPF32[$14>>2];
$16 = (((($11) + (($i1$011*12)|0)|0)) + 8|0);
$17 = +HEAPF32[$16>>2];
_rlVertex3f($13,$15,$17);
$18 = (($i1$011) + 1)|0;
$19 = HEAP32[2176>>2]|0;
$20 = ($18|0)<($19|0);
if ($20) {
$i1$011 = $18;
} else {
break;
}
}
}
} else {
HEAP32[2168>>2] = 0;
}
HEAP32[2176>>2] = 0;
}
$21 = HEAP32[2172>>2]|0;
switch ($21|0) {
case 0: {
$22 = HEAP32[2184>>2]|0;
$23 = HEAP32[2188>>2]|0;
$24 = ($22|0)>($23|0);
if (!($24)) {
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
}
$25 = (($22) - ($23))|0;
$i2$04 = 0;
while(1) {
$26 = HEAP32[2188>>2]|0;
$27 = $26 << 2;
$28 = (($27) + -4)|0;
$29 = HEAP32[2192>>2]|0;
$30 = (($29) + ($28)|0);
$31 = HEAP8[$30>>0]|0;
$32 = (($29) + ($27)|0);
HEAP8[$32>>0] = $31;
$33 = HEAP32[2188>>2]|0;
$34 = $33 << 2;
$35 = (($34) + -3)|0;
$36 = HEAP32[2192>>2]|0;
$37 = (($36) + ($35)|0);
$38 = HEAP8[$37>>0]|0;
$39 = $34 | 1;
$40 = (($36) + ($39)|0);
HEAP8[$40>>0] = $38;
$41 = HEAP32[2188>>2]|0;
$42 = $41 << 2;
$43 = (($42) + -2)|0;
$44 = HEAP32[2192>>2]|0;
$45 = (($44) + ($43)|0);
$46 = HEAP8[$45>>0]|0;
$47 = $42 | 2;
$48 = (($44) + ($47)|0);
HEAP8[$48>>0] = $46;
$49 = HEAP32[2188>>2]|0;
$50 = $49 << 2;
$51 = (($50) + -1)|0;
$52 = HEAP32[2192>>2]|0;
$53 = (($52) + ($51)|0);
$54 = HEAP8[$53>>0]|0;
$55 = $50 | 3;
$56 = (($52) + ($55)|0);
HEAP8[$56>>0] = $54;
$57 = HEAP32[2188>>2]|0;
$58 = (($57) + 1)|0;
HEAP32[2188>>2] = $58;
$59 = (($i2$04) + 1)|0;
$exitcond = ($59|0)==($25|0);
if ($exitcond) {
break;
} else {
$i2$04 = $59;
}
}
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
break;
}
case 1: {
$60 = HEAP32[2196>>2]|0;
$61 = HEAP32[2200>>2]|0;
$62 = ($60|0)>($61|0);
if (!($62)) {
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
}
$63 = (($60) - ($61))|0;
$i4$05 = 0;
while(1) {
$64 = HEAP32[2200>>2]|0;
$65 = $64 << 2;
$66 = (($65) + -4)|0;
$67 = HEAP32[2204>>2]|0;
$68 = (($67) + ($66)|0);
$69 = HEAP8[$68>>0]|0;
$70 = (($67) + ($65)|0);
HEAP8[$70>>0] = $69;
$71 = HEAP32[2200>>2]|0;
$72 = $71 << 2;
$73 = (($72) + -3)|0;
$74 = HEAP32[2204>>2]|0;
$75 = (($74) + ($73)|0);
$76 = HEAP8[$75>>0]|0;
$77 = $72 | 1;
$78 = (($74) + ($77)|0);
HEAP8[$78>>0] = $76;
$79 = HEAP32[2200>>2]|0;
$80 = $79 << 2;
$81 = (($80) + -2)|0;
$82 = HEAP32[2204>>2]|0;
$83 = (($82) + ($81)|0);
$84 = HEAP8[$83>>0]|0;
$85 = $80 | 2;
$86 = (($82) + ($85)|0);
HEAP8[$86>>0] = $84;
$87 = HEAP32[2200>>2]|0;
$88 = $87 << 2;
$89 = (($88) + -1)|0;
$90 = HEAP32[2204>>2]|0;
$91 = (($90) + ($89)|0);
$92 = HEAP8[$91>>0]|0;
$93 = $88 | 3;
$94 = (($90) + ($93)|0);
HEAP8[$94>>0] = $92;
$95 = HEAP32[2200>>2]|0;
$96 = (($95) + 1)|0;
HEAP32[2200>>2] = $96;
$97 = (($i4$05) + 1)|0;
$exitcond16 = ($97|0)==($63|0);
if ($exitcond16) {
break;
} else {
$i4$05 = $97;
}
}
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
break;
}
case 2: {
$98 = HEAP32[2208>>2]|0;
$99 = HEAP32[2212>>2]|0;
$100 = ($98|0)>($99|0);
if ($100) {
$101 = (($98) - ($99))|0;
$i6$09 = 0;
while(1) {
$102 = HEAP32[2212>>2]|0;
$103 = $102 << 2;
$104 = (($103) + -4)|0;
$105 = HEAP32[2216>>2]|0;
$106 = (($105) + ($104)|0);
$107 = HEAP8[$106>>0]|0;
$108 = (($105) + ($103)|0);
HEAP8[$108>>0] = $107;
$109 = HEAP32[2212>>2]|0;
$110 = $109 << 2;
$111 = (($110) + -3)|0;
$112 = HEAP32[2216>>2]|0;
$113 = (($112) + ($111)|0);
$114 = HEAP8[$113>>0]|0;
$115 = $110 | 1;
$116 = (($112) + ($115)|0);
HEAP8[$116>>0] = $114;
$117 = HEAP32[2212>>2]|0;
$118 = $117 << 2;
$119 = (($118) + -2)|0;
$120 = HEAP32[2216>>2]|0;
$121 = (($120) + ($119)|0);
$122 = HEAP8[$121>>0]|0;
$123 = $118 | 2;
$124 = (($120) + ($123)|0);
HEAP8[$124>>0] = $122;
$125 = HEAP32[2212>>2]|0;
$126 = $125 << 2;
$127 = (($126) + -1)|0;
$128 = HEAP32[2216>>2]|0;
$129 = (($128) + ($127)|0);
$130 = HEAP8[$129>>0]|0;
$131 = $126 | 3;
$132 = (($128) + ($131)|0);
HEAP8[$132>>0] = $130;
$133 = HEAP32[2212>>2]|0;
$134 = (($133) + 1)|0;
HEAP32[2212>>2] = $134;
$135 = (($i6$09) + 1)|0;
$exitcond18 = ($135|0)==($101|0);
if ($exitcond18) {
break;
} else {
$i6$09 = $135;
}
}
}
$136 = HEAP32[2208>>2]|0;
$137 = HEAP32[2220>>2]|0;
$138 = ($136|0)>($137|0);
if (!($138)) {
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
}
$139 = HEAP32[2224>>2]|0;
$quads$1$promoted = HEAP32[2220>>2]|0;
$140 = (($136) + ($quads$1$promoted))|0;
$141 = (($136) - ($137))|0;
$143 = $quads$1$promoted;$i7$07 = 0;
while(1) {
$142 = $143 << 1;
$144 = (($139) + ($142<<2)|0);
HEAPF32[$144>>2] = 0.0;
$145 = $143 << 1;
$146 = $145 | 1;
$147 = (($139) + ($146<<2)|0);
HEAPF32[$147>>2] = 0.0;
$148 = (($143) + 1)|0;
$149 = (($i7$07) + 1)|0;
$exitcond17 = ($149|0)==($141|0);
if ($exitcond17) {
break;
} else {
$143 = $148;$i7$07 = $149;
}
}
$150 = (($140) - ($137))|0;
HEAP32[2220>>2] = $150;
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
break;
}
default: {
$151 = +HEAPF32[2228>>2];
$152 = $151 + 4.9999998736893758E-5;
HEAPF32[2228>>2] = $152;
STACKTOP = sp;return;
}
}
}
function _rlVertex3f($x,$y,$z) {
$x = +$x;
$y = +$y;
$z = +$z;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$0 = HEAP32[2168>>2]|0;
$1 = ($0|0)==(0);
if (!($1)) {
$2 = HEAP32[2176>>2]|0;
$3 = HEAP32[2180>>2]|0;
$4 = (($3) + (($2*12)|0)|0);
HEAPF32[$4>>2] = $x;
$5 = HEAP32[2176>>2]|0;
$6 = HEAP32[2180>>2]|0;
$7 = (((($6) + (($5*12)|0)|0)) + 4|0);
HEAPF32[$7>>2] = $y;
$8 = HEAP32[2176>>2]|0;
$9 = HEAP32[2180>>2]|0;
$10 = (((($9) + (($8*12)|0)|0)) + 8|0);
HEAPF32[$10>>2] = $z;
$11 = HEAP32[2176>>2]|0;
$12 = (($11) + 1)|0;
HEAP32[2176>>2] = $12;
STACKTOP = sp;return;
}
$13 = HEAP32[2172>>2]|0;
switch ($13|0) {
case 0: {
$14 = HEAP32[2184>>2]|0;
$15 = ($14|0)<(2048);
if ($15) {
$16 = ($14*3)|0;
$17 = HEAP32[2232>>2]|0;
$18 = (($17) + ($16<<2)|0);
HEAPF32[$18>>2] = $x;
$19 = HEAP32[2184>>2]|0;
$20 = ($19*3)|0;
$21 = (($20) + 1)|0;
$22 = HEAP32[2232>>2]|0;
$23 = (($22) + ($21<<2)|0);
HEAPF32[$23>>2] = $y;
$24 = HEAP32[2184>>2]|0;
$25 = ($24*3)|0;
$26 = (($25) + 2)|0;
$27 = HEAP32[2232>>2]|0;
$28 = (($27) + ($26<<2)|0);
HEAPF32[$28>>2] = $z;
$29 = HEAP32[2184>>2]|0;
$30 = (($29) + 1)|0;
HEAP32[2184>>2] = $30;
STACKTOP = sp;return;
} else {
_TraceLog(1,11956,$vararg_buffer);
STACKTOP = sp;return;
}
break;
}
case 1: {
$31 = HEAP32[2196>>2]|0;
$32 = ($31|0)<(6144);
if ($32) {
$33 = ($31*3)|0;
$34 = HEAP32[2236>>2]|0;
$35 = (($34) + ($33<<2)|0);
HEAPF32[$35>>2] = $x;
$36 = HEAP32[2196>>2]|0;
$37 = ($36*3)|0;
$38 = (($37) + 1)|0;
$39 = HEAP32[2236>>2]|0;
$40 = (($39) + ($38<<2)|0);
HEAPF32[$40>>2] = $y;
$41 = HEAP32[2196>>2]|0;
$42 = ($41*3)|0;
$43 = (($42) + 2)|0;
$44 = HEAP32[2236>>2]|0;
$45 = (($44) + ($43<<2)|0);
HEAPF32[$45>>2] = $z;
$46 = HEAP32[2196>>2]|0;
$47 = (($46) + 1)|0;
HEAP32[2196>>2] = $47;
STACKTOP = sp;return;
} else {
_TraceLog(1,11981,$vararg_buffer1);
STACKTOP = sp;return;
}
break;
}
case 2: {
$48 = HEAP32[2208>>2]|0;
$49 = ($48|0)<(4096);
if ($49) {
$50 = ($48*3)|0;
$51 = HEAP32[2240>>2]|0;
$52 = (($51) + ($50<<2)|0);
HEAPF32[$52>>2] = $x;
$53 = HEAP32[2208>>2]|0;
$54 = ($53*3)|0;
$55 = (($54) + 1)|0;
$56 = HEAP32[2240>>2]|0;
$57 = (($56) + ($55<<2)|0);
HEAPF32[$57>>2] = $y;
$58 = HEAP32[2208>>2]|0;
$59 = ($58*3)|0;
$60 = (($59) + 2)|0;
$61 = HEAP32[2240>>2]|0;
$62 = (($61) + ($60<<2)|0);
HEAPF32[$62>>2] = $z;
$63 = HEAP32[2208>>2]|0;
$64 = (($63) + 1)|0;
HEAP32[2208>>2] = $64;
$65 = HEAP32[2244>>2]|0;
$66 = (($65) + -1)|0;
$67 = HEAP32[2248>>2]|0;
$68 = (((($67) + ($66<<3)|0)) + 4|0);
$69 = HEAP32[$68>>2]|0;
$70 = (($69) + 1)|0;
HEAP32[$68>>2] = $70;
STACKTOP = sp;return;
} else {
_TraceLog(1,12010,$vararg_buffer3);
STACKTOP = sp;return;
}
break;
}
default: {
STACKTOP = sp;return;
}
}
}
function _rlVertex2f($x,$y) {
$x = +$x;
$y = +$y;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[2228>>2];
_rlVertex3f($x,$y,$0);
return;
}
function _rlVertex2i($x,$y) {
$x = $x|0;
$y = $y|0;
var $0 = 0.0, $1 = 0.0, $2 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+($x|0));
$1 = (+($y|0));
$2 = +HEAPF32[2228>>2];
_rlVertex3f($0,$1,$2);
return;
}
function _rlTexCoord2f($x,$y) {
$x = +$x;
$y = +$y;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[2172>>2]|0;
$1 = ($0|0)==(2);
if (!($1)) {
return;
}
$2 = HEAP32[2220>>2]|0;
$3 = $2 << 1;
$4 = HEAP32[2224>>2]|0;
$5 = (($4) + ($3<<2)|0);
HEAPF32[$5>>2] = $x;
$6 = HEAP32[2220>>2]|0;
$7 = $6 << 1;
$8 = $7 | 1;
$9 = HEAP32[2224>>2]|0;
$10 = (($9) + ($8<<2)|0);
HEAPF32[$10>>2] = $y;
$11 = HEAP32[2220>>2]|0;
$12 = (($11) + 1)|0;
HEAP32[2220>>2] = $12;
return;
}
function _rlNormal3f($x,$y,$z) {
$x = +$x;
$y = +$y;
$z = +$z;
var label = 0, sp = 0;
sp = STACKTOP;
return;
}
function _rlColor4ub($x,$y,$z,$w) {
$x = $x|0;
$y = $y|0;
$z = $z|0;
$w = $w|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[2172>>2]|0;
switch ($0|0) {
case 0: {
$1 = HEAP32[2188>>2]|0;
$2 = $1 << 2;
$3 = HEAP32[2192>>2]|0;
$4 = (($3) + ($2)|0);
HEAP8[$4>>0] = $x;
$5 = HEAP32[2188>>2]|0;
$6 = $5 << 2;
$7 = $6 | 1;
$8 = HEAP32[2192>>2]|0;
$9 = (($8) + ($7)|0);
HEAP8[$9>>0] = $y;
$10 = HEAP32[2188>>2]|0;
$11 = $10 << 2;
$12 = $11 | 2;
$13 = HEAP32[2192>>2]|0;
$14 = (($13) + ($12)|0);
HEAP8[$14>>0] = $z;
$15 = HEAP32[2188>>2]|0;
$16 = $15 << 2;
$17 = $16 | 3;
$18 = HEAP32[2192>>2]|0;
$19 = (($18) + ($17)|0);
HEAP8[$19>>0] = $w;
$20 = HEAP32[2188>>2]|0;
$21 = (($20) + 1)|0;
HEAP32[2188>>2] = $21;
return;
break;
}
case 1: {
$22 = HEAP32[2200>>2]|0;
$23 = $22 << 2;
$24 = HEAP32[2204>>2]|0;
$25 = (($24) + ($23)|0);
HEAP8[$25>>0] = $x;
$26 = HEAP32[2200>>2]|0;
$27 = $26 << 2;
$28 = $27 | 1;
$29 = HEAP32[2204>>2]|0;
$30 = (($29) + ($28)|0);
HEAP8[$30>>0] = $y;
$31 = HEAP32[2200>>2]|0;
$32 = $31 << 2;
$33 = $32 | 2;
$34 = HEAP32[2204>>2]|0;
$35 = (($34) + ($33)|0);
HEAP8[$35>>0] = $z;
$36 = HEAP32[2200>>2]|0;
$37 = $36 << 2;
$38 = $37 | 3;
$39 = HEAP32[2204>>2]|0;
$40 = (($39) + ($38)|0);
HEAP8[$40>>0] = $w;
$41 = HEAP32[2200>>2]|0;
$42 = (($41) + 1)|0;
HEAP32[2200>>2] = $42;
return;
break;
}
case 2: {
$43 = HEAP32[2212>>2]|0;
$44 = $43 << 2;
$45 = HEAP32[2216>>2]|0;
$46 = (($45) + ($44)|0);
HEAP8[$46>>0] = $x;
$47 = HEAP32[2212>>2]|0;
$48 = $47 << 2;
$49 = $48 | 1;
$50 = HEAP32[2216>>2]|0;
$51 = (($50) + ($49)|0);
HEAP8[$51>>0] = $y;
$52 = HEAP32[2212>>2]|0;
$53 = $52 << 2;
$54 = $53 | 2;
$55 = HEAP32[2216>>2]|0;
$56 = (($55) + ($54)|0);
HEAP8[$56>>0] = $z;
$57 = HEAP32[2212>>2]|0;
$58 = $57 << 2;
$59 = $58 | 3;
$60 = HEAP32[2216>>2]|0;
$61 = (($60) + ($59)|0);
HEAP8[$61>>0] = $w;
$62 = HEAP32[2212>>2]|0;
$63 = (($62) + 1)|0;
HEAP32[2212>>2] = $63;
return;
break;
}
default: {
return;
}
}
}
function _rlEnableTexture($id) {
$id = $id|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[2244>>2]|0;
$1 = (($0) + -1)|0;
$2 = HEAP32[2248>>2]|0;
$3 = (($2) + ($1<<3)|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==($id|0);
if ($5) {
return;
}
$6 = (((($2) + ($1<<3)|0)) + 4|0);
$7 = HEAP32[$6>>2]|0;
$8 = ($7|0)>(0);
if ($8) {
$9 = (($0) + 1)|0;
HEAP32[2244>>2] = $9;
}
$10 = HEAP32[2244>>2]|0;
$11 = (($10) + -1)|0;
$12 = HEAP32[2248>>2]|0;
$13 = (($12) + ($11<<3)|0);
HEAP32[$13>>2] = $id;
$14 = HEAP32[2244>>2]|0;
$15 = (($14) + -1)|0;
$16 = HEAP32[2248>>2]|0;
$17 = (((($16) + ($15<<3)|0)) + 4|0);
HEAP32[$17>>2] = 0;
return;
}
function _rlDisableTexture() {
var label = 0, sp = 0;
sp = STACKTOP;
return;
}
function _rlDeleteTextures($id) {
$id = $id|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$0 = sp;
HEAP32[$0>>2] = $id;
_glDeleteTextures(1,($0|0));
STACKTOP = sp;return;
}
function _rlEnablePostproFBO() {
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[2252>>2]|0;
_glBindFramebuffer(36160,($0|0));
return;
}
function _rlDeleteVertexArrays($id) {
$id = $id|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$0 = sp;
HEAP32[$0>>2] = $id;
$1 = HEAP32[2264>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
STACKTOP = sp;return;
}
$3 = HEAP32[2268>>2]|0;
FUNCTION_TABLE_vii[$3 & 63](1,$0);
STACKTOP = sp;return;
}
function _rlDeleteBuffers($id) {
$id = $id|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$0 = sp;
HEAP32[$0>>2] = $id;
_glDeleteBuffers(1,($0|0));
STACKTOP = sp;return;
}
function _rlClearColor($r,$g,$b,$a) {
$r = $r|0;
$g = $g|0;
$b = $b|0;
$a = $a|0;
var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+($r&255));
$1 = $0 / 255.0;
$2 = (+($g&255));
$3 = $2 / 255.0;
$4 = (+($b&255));
$5 = $4 / 255.0;
$6 = (+($a&255));
$7 = $6 / 255.0;
_glClearColor((+$1),(+$3),(+$5),(+$7));
return;
}
function _rlClearScreenBuffers() {
var label = 0, sp = 0;
sp = STACKTOP;
_glClear(16640);
return;
}
function _rlGetVersion() {
var label = 0, sp = 0;
sp = STACKTOP;
return 3;
}
function _rlglInit() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond10 = 0, $exitcond12 = 0, $i$04 = 0, $i2$02 = 0, $i3$01 = 0, $numExt$0$lcssa = 0;
var $numExt$05 = 0, $pixels = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0, $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, dest = 0, label = 0;
var sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 2480|0;
$vararg_buffer34 = sp + 2160|0;
$vararg_buffer31 = sp + 2152|0;
$vararg_buffer29 = sp + 2144|0;
$vararg_buffer27 = sp + 2136|0;
$vararg_buffer25 = sp + 2128|0;
$vararg_buffer23 = sp + 2120|0;
$vararg_buffer21 = sp + 2112|0;
$vararg_buffer19 = sp + 2104|0;
$vararg_buffer17 = sp + 2096|0;
$vararg_buffer15 = sp + 2088|0;
$vararg_buffer13 = sp + 2080|0;
$vararg_buffer10 = sp + 2072|0;
$vararg_buffer7 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$0 = sp + 2416|0;
$1 = sp + 2352|0;
$2 = sp + 2288|0;
$pixels = sp + 2280|0;
$3 = sp + 2228|0;
$4 = sp + 2176|0;
$5 = sp + 2164|0;
$6 = (_glGetString(7936)|0);
HEAP32[$vararg_buffer>>2] = $6;
_TraceLog(0,12035,$vararg_buffer);
$7 = (_glGetString(7937)|0);
HEAP32[$vararg_buffer1>>2] = $7;
_TraceLog(0,12053,$vararg_buffer1);
$8 = (_glGetString(7938)|0);
HEAP32[$vararg_buffer4>>2] = $8;
_TraceLog(0,12071,$vararg_buffer4);
$9 = (_glGetString(35724)|0);
HEAP32[$vararg_buffer7>>2] = $9;
_TraceLog(0,12089,$vararg_buffer7);
$10 = (_glGetString(7939)|0);
$11 = (_mystrdup($10)|0);
$12 = (_strtok($11,12107)|0);
HEAP32[$vararg_buffer7>>2] = $12;
$13 = ($12|0)==(0|0);
if ($13) {
$numExt$0$lcssa = -1;
} else {
$numExt$05 = 0;
while(1) {
$14 = (($numExt$05) + 1)|0;
$15 = (_strtok(0,12107)|0);
$16 = (($vararg_buffer7) + ($14<<2)|0);
HEAP32[$16>>2] = $15;
$17 = ($15|0)==(0|0);
if ($17) {
$numExt$0$lcssa = $numExt$05;
break;
} else {
$numExt$05 = $14;
}
}
}
_free($11);
HEAP32[$vararg_buffer10>>2] = $numExt$0$lcssa;
_TraceLog(0,12109,$vararg_buffer10);
$18 = ($numExt$0$lcssa|0)>(0);
if ($18) {
$i$04 = 0;
while(1) {
$19 = (($vararg_buffer7) + ($i$04<<2)|0);
$20 = HEAP32[$19>>2]|0;
$21 = (_strcmp($20,12144)|0);
$22 = ($21|0)==(0);
if ($22) {
HEAP32[2264>>2] = 1;
$23 = (_eglGetProcAddress((12171|0))|0);
HEAP32[2272>>2] = $23;
$24 = (_eglGetProcAddress((12192|0))|0);
HEAP32[2276>>2] = $24;
$25 = (_eglGetProcAddress((12213|0))|0);
HEAP32[2268>>2] = $25;
}
$26 = HEAP32[$19>>2]|0;
$27 = (_strcmp($26,12237)|0);
$28 = ($27|0)==(0);
if ($28) {
HEAP32[2280>>2] = 1;
}
$29 = HEAP32[$19>>2]|0;
$30 = (_strcmp($29,12257)|0);
$31 = ($30|0)==(0);
if ($31) {
label = 10;
} else {
$32 = (_strcmp($29,12289)|0);
$33 = ($32|0)==(0);
if ($33) {
label = 10;
}
}
if ((label|0) == 10) {
label = 0;
HEAP32[2284>>2] = 1;
}
$34 = HEAP32[$19>>2]|0;
$35 = (_strcmp($34,12329)|0);
$36 = ($35|0)==(0);
if ($36) {
HEAP32[2288>>2] = 1;
}
$37 = HEAP32[$19>>2]|0;
$38 = (_strcmp($37,12365)|0);
$39 = ($38|0)==(0);
if ($39) {
HEAP32[2292>>2] = 1;
}
$40 = HEAP32[$19>>2]|0;
$41 = (_strcmp($40,12390)|0);
$42 = ($41|0)==(0);
if ($42) {
HEAP32[2296>>2] = 1;
}
$43 = HEAP32[$19>>2]|0;
$44 = (_strcmp($43,12423)|0);
$45 = ($44|0)==(0);
if ($45) {
HEAP32[2300>>2] = 1;
}
$46 = (($i$04) + 1)|0;
$exitcond12 = ($46|0)==($numExt$0$lcssa|0);
if ($exitcond12) {
break;
} else {
$i$04 = $46;
}
}
}
$47 = HEAP32[2264>>2]|0;
$48 = ($47|0)==(0);
if ($48) {
_TraceLog(2,12534,$vararg_buffer15);
} else {
_TraceLog(0,12459,$vararg_buffer13);
}
$49 = HEAP32[2280>>2]|0;
$50 = ($49|0)==(0);
if ($50) {
_TraceLog(2,12670,$vararg_buffer19);
} else {
_TraceLog(0,12595,$vararg_buffer17);
}
$51 = HEAP32[2284>>2]|0;
$52 = ($51|0)==(0);
if (!($52)) {
_TraceLog(0,12762,$vararg_buffer21);
}
$53 = HEAP32[2288>>2]|0;
$54 = ($53|0)==(0);
if (!($54)) {
_TraceLog(0,12808,$vararg_buffer23);
}
$55 = HEAP32[2292>>2]|0;
$56 = ($55|0)==(0);
if (!($56)) {
_TraceLog(0,12855,$vararg_buffer25);
}
$57 = HEAP32[2296>>2]|0;
$58 = ($57|0)==(0);
if (!($58)) {
_TraceLog(0,12906,$vararg_buffer27);
}
$59 = HEAP32[2300>>2]|0;
$60 = ($59|0)==(0);
if (!($60)) {
_TraceLog(0,12953,$vararg_buffer29);
}
HEAP32[2172>>2] = 1;
_MatrixIdentity($0);
dest=1004; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($1);
dest=1072; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
HEAP32[1068>>2] = 1072;
_MatrixIdentity($2);
dest=1144; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1208); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1272); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1336); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1400); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1464); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1528); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1592); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1656); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1720); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1784); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1848); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1912); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(1976); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(2040); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixIdentity($2);
dest=(2104); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
HEAP32[$pixels>>2] = -1;
$61 = (_rlglLoadTexture($pixels,1,1,7,1)|0);
HEAP32[808>>2] = $61;
$62 = ($61|0)==(0);
if ($62) {
_TraceLog(2,13051,$vararg_buffer34);
} else {
HEAP32[$vararg_buffer31>>2] = $61;
_TraceLog(0,13000,$vararg_buffer31);
}
_LoadDefaultShader($3);
dest=2304; src=$3; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_LoadSimpleShader($4);
dest=2356; src=$4; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=2408; src=2304; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_InitializeBuffers();
_InitializeBuffersGPU();
$63 = (_malloc(49152)|0);
HEAP32[2180>>2] = $63;
$i2$02 = 0;
while(1) {
$64 = HEAP32[2180>>2]|0;
$65 = (($64) + (($i2$02*12)|0)|0);
_VectorZero($5);
;HEAP32[$65>>2]=HEAP32[$5>>2]|0;HEAP32[$65+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$65+8>>2]=HEAP32[$5+8>>2]|0;
$66 = (($i2$02) + 1)|0;
$exitcond10 = ($66|0)==(4096);
if ($exitcond10) {
break;
} else {
$i2$02 = $66;
}
}
$67 = (_malloc(2048)|0);
HEAP32[2248>>2] = $67;
$i3$01 = 0;
while(1) {
$68 = (($67) + ($i3$01<<3)|0);
HEAP32[$68>>2] = 0;
$69 = (((($67) + ($i3$01<<3)|0)) + 4|0);
HEAP32[$69>>2] = 0;
$70 = (($i3$01) + 1)|0;
$exitcond = ($70|0)==(256);
if ($exitcond) {
break;
} else {
$i3$01 = $70;
}
}
HEAP32[2244>>2] = 1;
$71 = HEAP32[808>>2]|0;
$72 = HEAP32[2248>>2]|0;
HEAP32[$72>>2] = $71;
STACKTOP = sp;return;
}
function _rlglLoadTexture($data,$width,$height,$textureFormat,$mipmapCount) {
$data = $data|0;
$width = $width|0;
$height = $height|0;
$textureFormat = $textureFormat|0;
$mipmapCount = $mipmapCount|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $id = 0, $or$cond = 0, $or$cond20 = 0, $or$cond22 = 0, $or$cond24 = 0, $or$cond9 = 0, $switch = 0, $textureFormat$off = 0, $textureFormat$off16 = 0, $textureFormat$off17 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0;
var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 80|0;
$vararg_buffer15 = sp + 64|0;
$vararg_buffer11 = sp + 48|0;
$vararg_buffer9 = sp + 40|0;
$vararg_buffer7 = sp + 32|0;
$vararg_buffer5 = sp + 24|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$id = sp + 68|0;
_glBindTexture(3553,0);
HEAP32[$id>>2] = 0;
$0 = HEAP32[2284>>2]|0;
$1 = ($0|0)==(0);
$2 = $textureFormat & -4;
$switch = ($2|0)==(8);
$or$cond24 = $switch & $1;
if ($or$cond24) {
_TraceLog(2,13090,$vararg_buffer);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
}
$3 = HEAP32[2288>>2]|0;
$4 = ($3|0)==(0);
$5 = ($textureFormat|0)==(12);
$or$cond9 = $5 & $4;
if ($or$cond9) {
_TraceLog(2,13134,$vararg_buffer1);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
}
$6 = HEAP32[2292>>2]|0;
$7 = ($6|0)==(0);
$textureFormat$off = (($textureFormat) + -13)|0;
$8 = ($textureFormat$off>>>0)<(2);
$or$cond = $8 & $7;
if ($or$cond) {
_TraceLog(2,13179,$vararg_buffer3);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
}
$9 = HEAP32[2296>>2]|0;
$10 = ($9|0)==(0);
$textureFormat$off16 = (($textureFormat) + -15)|0;
$11 = ($textureFormat$off16>>>0)<(2);
$or$cond20 = $11 & $10;
if ($or$cond20) {
_TraceLog(2,13224,$vararg_buffer5);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
}
$12 = HEAP32[2300>>2]|0;
$13 = ($12|0)==(0);
$textureFormat$off17 = (($textureFormat) + -17)|0;
$14 = ($textureFormat$off17>>>0)<(2);
$or$cond22 = $14 & $13;
if ($or$cond22) {
_TraceLog(2,13269,$vararg_buffer7);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
}
_glGenTextures(1,($id|0));
$15 = HEAP32[$id>>2]|0;
_glBindTexture(3553,($15|0));
do {
switch ($textureFormat|0) {
case 1: {
_glTexImage2D(3553,0,6409,($width|0),($height|0),0,6409,5121,($data|0));
break;
}
case 2: {
_glTexImage2D(3553,0,6410,($width|0),($height|0),0,6410,5121,($data|0));
break;
}
case 3: {
_glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,33635,($data|0));
break;
}
case 4: {
_glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,5121,($data|0));
break;
}
case 5: {
_glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32820,($data|0));
break;
}
case 6: {
_glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32819,($data|0));
break;
}
case 7: {
_glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,5121,($data|0));
break;
}
case 8: {
$16 = HEAP32[2284>>2]|0;
$17 = ($16|0)==(0);
if (!($17)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,33776);
}
break;
}
case 9: {
$18 = HEAP32[2284>>2]|0;
$19 = ($18|0)==(0);
if (!($19)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,33777);
}
break;
}
case 10: {
$20 = HEAP32[2284>>2]|0;
$21 = ($20|0)==(0);
if (!($21)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,33778);
}
break;
}
case 11: {
$22 = HEAP32[2284>>2]|0;
$23 = ($22|0)==(0);
if (!($23)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,33779);
}
break;
}
case 12: {
$24 = HEAP32[2288>>2]|0;
$25 = ($24|0)==(0);
if (!($25)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,36196);
}
break;
}
case 13: {
$26 = HEAP32[2292>>2]|0;
$27 = ($26|0)==(0);
if (!($27)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,37492);
}
break;
}
case 14: {
$28 = HEAP32[2292>>2]|0;
$29 = ($28|0)==(0);
if (!($29)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,37496);
}
break;
}
case 15: {
$30 = HEAP32[2296>>2]|0;
$31 = ($30|0)==(0);
if (!($31)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,35840);
}
break;
}
case 16: {
$32 = HEAP32[2296>>2]|0;
$33 = ($32|0)==(0);
if (!($33)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,35842);
}
break;
}
case 17: {
$34 = HEAP32[2300>>2]|0;
$35 = ($34|0)==(0);
if (!($35)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,37808);
}
break;
}
case 18: {
$36 = HEAP32[2300>>2]|0;
$37 = ($36|0)==(0);
if (!($37)) {
_LoadCompressedTexture($data,$width,$height,$mipmapCount,37815);
}
break;
}
default: {
_TraceLog(2,13314,$vararg_buffer9);
}
}
} while(0);
$38 = HEAP32[2280>>2]|0;
$39 = ($38|0)==(0);
if ($39) {
_glTexParameteri(3553,10242,33071);
_glTexParameteri(3553,10243,33071);
} else {
_glTexParameteri(3553,10242,10497);
_glTexParameteri(3553,10243,10497);
}
_glTexParameteri(3553,10240,9728);
_glTexParameteri(3553,10241,9728);
_glBindTexture(3553,0);
$40 = HEAP32[$id>>2]|0;
$41 = ($40|0)==(0);
if ($41) {
_TraceLog(2,14761,$vararg_buffer15);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
} else {
HEAP32[$vararg_buffer11>>2] = $40;
$vararg_ptr13 = ((($vararg_buffer11)) + 4|0);
HEAP32[$vararg_ptr13>>2] = $width;
$vararg_ptr14 = ((($vararg_buffer11)) + 8|0);
HEAP32[$vararg_ptr14>>2] = $height;
_TraceLog(0,13343,$vararg_buffer11);
$$0 = HEAP32[$id>>2]|0;
STACKTOP = sp;return ($$0|0);
}
return (0)|0;
}
function _rlglLoadModel($agg$result,$mesh) {
$agg$result = $agg$result|0;
$mesh = $mesh|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $model$sroa$0 = 0, $model$sroa$15 = 0, $model$sroa$20 = 0, $model$sroa$27 = 0, $model$sroa$4$0 = 0, $vaoModel = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, $vararg_ptr6 = 0;
var $vararg_ptr7 = 0, $vertexBuffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 288|0;
$vararg_buffer3 = sp + 112|0;
$vararg_buffer1 = sp + 104|0;
$vararg_buffer = sp + 96|0;
$model$sroa$0 = sp + 40|0;
$model$sroa$15 = sp + 208|0;
$model$sroa$20 = sp + 24|0;
$model$sroa$27 = sp;
$0 = sp + 144|0;
$vaoModel = sp + 136|0;
$vertexBuffer = sp + 124|0;
dest=$model$sroa$0; src=$mesh; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$1 = ((($mesh)) + 68|0);
;HEAP32[$model$sroa$15>>2]=HEAP32[$1>>2]|0;HEAP32[$model$sroa$15+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$model$sroa$15+8>>2]=HEAP32[$1+8>>2]|0;
_MatrixIdentity($0);
$2 = ((($model$sroa$15)) + 12|0);
dest=$2; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$3 = HEAP32[808>>2]|0;
;HEAP32[$model$sroa$20>>2]=HEAP32[2356>>2]|0;HEAP32[$model$sroa$20+4>>2]=HEAP32[2356+4>>2]|0;HEAP32[$model$sroa$20+8>>2]=HEAP32[2356+8>>2]|0;HEAP32[$model$sroa$20+12>>2]=HEAP32[2356+12>>2]|0;
$4 = HEAP32[(2372)>>2]|0;
$5 = HEAP32[(2376)>>2]|0;
$6 = HEAP32[(2380)>>2]|0;
;HEAP32[$model$sroa$27>>2]=HEAP32[(2384)>>2]|0;HEAP32[$model$sroa$27+4>>2]=HEAP32[(2384)+4>>2]|0;HEAP32[$model$sroa$27+8>>2]=HEAP32[(2384)+8>>2]|0;HEAP32[$model$sroa$27+12>>2]=HEAP32[(2384)+12>>2]|0;HEAP32[$model$sroa$27+16>>2]=HEAP32[(2384)+16>>2]|0;HEAP32[$model$sroa$27+20>>2]=HEAP32[(2384)+20>>2]|0;
HEAP32[$vaoModel>>2] = 0;
$7 = HEAP32[2264>>2]|0;
$8 = ($7|0)==(0);
if (!($8)) {
$9 = HEAP32[2272>>2]|0;
FUNCTION_TABLE_vii[$9 & 63](1,$vaoModel);
$10 = HEAP32[2276>>2]|0;
$11 = HEAP32[$vaoModel>>2]|0;
FUNCTION_TABLE_vi[$10 & 31]($11);
}
_glGenBuffers(3,($vertexBuffer|0));
$12 = HEAP32[$vertexBuffer>>2]|0;
_glBindBuffer(34962,($12|0));
$13 = HEAP32[$mesh>>2]|0;
$14 = ($13*12)|0;
$15 = ((($mesh)) + 4|0);
$16 = HEAP32[$15>>2]|0;
_glBufferData(34962,($14|0),($16|0),35044);
_glVertexAttribPointer(($4|0),3,5126,0,0,(0|0));
_glEnableVertexAttribArray(($4|0));
$17 = ((($vertexBuffer)) + 4|0);
$18 = HEAP32[$17>>2]|0;
_glBindBuffer(34962,($18|0));
$19 = HEAP32[$mesh>>2]|0;
$20 = $19 << 3;
$21 = ((($mesh)) + 8|0);
$22 = HEAP32[$21>>2]|0;
_glBufferData(34962,($20|0),($22|0),35044);
_glVertexAttribPointer(($5|0),2,5126,0,0,(0|0));
_glEnableVertexAttribArray(($5|0));
$23 = ((($vertexBuffer)) + 8|0);
$24 = HEAP32[$23>>2]|0;
_glBindBuffer(34962,($24|0));
$25 = HEAP32[$mesh>>2]|0;
$26 = ($25*12)|0;
$27 = ((($mesh)) + 16|0);
$28 = HEAP32[$27>>2]|0;
_glBufferData(34962,($26|0),($28|0),35044);
_glVertexAttribPointer(($6|0),3,5126,0,0,(0|0));
_glEnableVertexAttribArray(($6|0));
$29 = HEAP32[$vertexBuffer>>2]|0;
$30 = HEAP32[$17>>2]|0;
$31 = HEAP32[$23>>2]|0;
$32 = HEAP32[2264>>2]|0;
$33 = ($32|0)==(0);
do {
if ($33) {
HEAP32[$vararg_buffer3>>2] = $29;
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
HEAP32[$vararg_ptr6>>2] = $30;
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
HEAP32[$vararg_ptr7>>2] = $31;
_TraceLog(0,13488,$vararg_buffer3);
$model$sroa$4$0 = 0;
} else {
$34 = HEAP32[$vaoModel>>2]|0;
$35 = ($34|0)==(0);
if ($35) {
_TraceLog(2,13446,$vararg_buffer1);
$model$sroa$4$0 = 0;
break;
} else {
HEAP32[$vararg_buffer>>2] = $34;
_TraceLog(0,13392,$vararg_buffer);
$model$sroa$4$0 = $34;
break;
}
}
} while(0);
dest=$agg$result; src=$model$sroa$0; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$36 = ((($agg$result)) + 52|0);
HEAP32[$36>>2] = $model$sroa$4$0;
$37 = ((($agg$result)) + 56|0);
HEAP32[$37>>2] = $29;
$38 = ((($agg$result)) + 60|0);
HEAP32[$38>>2] = $30;
$39 = ((($agg$result)) + 64|0);
HEAP32[$39>>2] = $31;
$40 = ((($agg$result)) + 68|0);
dest=$40; src=$model$sroa$15; stop=dest+76|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$41 = ((($agg$result)) + 144|0);
HEAP32[$41>>2] = $3;
$42 = ((($agg$result)) + 148|0);
HEAP32[$42>>2] = 1;
$43 = ((($agg$result)) + 152|0);
HEAP32[$43>>2] = 1;
$44 = ((($agg$result)) + 160|0);
HEAP32[$44>>2] = 7;
$45 = ((($agg$result)) + 164|0);
;HEAP32[$45>>2]=HEAP32[$model$sroa$20>>2]|0;HEAP32[$45+4>>2]=HEAP32[$model$sroa$20+4>>2]|0;HEAP32[$45+8>>2]=HEAP32[$model$sroa$20+8>>2]|0;HEAP32[$45+12>>2]=HEAP32[$model$sroa$20+12>>2]|0;
$46 = ((($agg$result)) + 180|0);
HEAP32[$46>>2] = $4;
$47 = ((($agg$result)) + 184|0);
HEAP32[$47>>2] = $5;
$48 = ((($agg$result)) + 188|0);
HEAP32[$48>>2] = $6;
$49 = ((($agg$result)) + 192|0);
;HEAP32[$49>>2]=HEAP32[$model$sroa$27>>2]|0;HEAP32[$49+4>>2]=HEAP32[$model$sroa$27+4>>2]|0;HEAP32[$49+8>>2]=HEAP32[$model$sroa$27+8>>2]|0;HEAP32[$49+12>>2]=HEAP32[$model$sroa$27+12>>2]|0;HEAP32[$49+16>>2]=HEAP32[$model$sroa$27+16>>2]|0;HEAP32[$49+20>>2]=HEAP32[$model$sroa$27+20>>2]|0;
STACKTOP = sp;return;
}
function _rlglUnloadFBO($fbo) {
$fbo = $fbo|0;
var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
_glDeleteFramebuffers(1,($fbo|0));
$0 = ((($fbo)) + 4|0);
_glDeleteTextures(1,($0|0));
$1 = ((($fbo)) + 8|0);
_glDeleteTextures(1,($1|0));
$2 = HEAP32[$fbo>>2]|0;
HEAP32[$vararg_buffer>>2] = $2;
_TraceLog(0,13564,$vararg_buffer);
STACKTOP = sp;return;
}
function _rlglClose() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0;
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $postproFbo$byval_copy = 0, $vararg_buffer1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$postproFbo$byval_copy = sp + 8|0;
$vararg_buffer1 = sp;
$0 = HEAP32[2264>>2]|0;
$1 = ($0|0)==(0);
if (!($1)) {
$2 = HEAP32[2276>>2]|0;
FUNCTION_TABLE_vi[$2 & 31](0);
}
_glDisableVertexAttribArray(0);
_glDisableVertexAttribArray(1);
_glDisableVertexAttribArray(2);
_glDisableVertexAttribArray(3);
_glBindBuffer(34962,0);
_glBindBuffer(34963,0);
_glUseProgram(0);
_glDeleteBuffers(1,(2684|0));
_glDeleteBuffers(1,((2688)|0));
_glDeleteBuffers(1,(2692|0));
_glDeleteBuffers(1,((2696)|0));
_glDeleteBuffers(1,(2700|0));
_glDeleteBuffers(1,((2704)|0));
_glDeleteBuffers(1,((2708)|0));
_glDeleteBuffers(1,((2712)|0));
$3 = HEAP32[2264>>2]|0;
$4 = ($3|0)==(0);
if (!($4)) {
$5 = HEAP32[2268>>2]|0;
FUNCTION_TABLE_vii[$5 & 63](1,2716);
$6 = HEAP32[2268>>2]|0;
FUNCTION_TABLE_vii[$6 & 63](1,2720);
$7 = HEAP32[2268>>2]|0;
FUNCTION_TABLE_vii[$7 & 63](1,2724);
}
$8 = HEAP32[2304>>2]|0;
_glDeleteProgram(($8|0));
$9 = HEAP32[2356>>2]|0;
_glDeleteProgram(($9|0));
$10 = HEAP32[2232>>2]|0;
_free($10);
$11 = HEAP32[2192>>2]|0;
_free($11);
$12 = HEAP32[2236>>2]|0;
_free($12);
$13 = HEAP32[2204>>2]|0;
_free($13);
$14 = HEAP32[2240>>2]|0;
_free($14);
$15 = HEAP32[2224>>2]|0;
_free($15);
$16 = HEAP32[2216>>2]|0;
_free($16);
$17 = HEAP32[2728>>2]|0;
_free($17);
_glDeleteTextures(1,(808|0));
$18 = HEAP32[808>>2]|0;
HEAP32[$postproFbo$byval_copy>>2] = $18;
_TraceLog(0,13617,$postproFbo$byval_copy);
$19 = HEAP32[2252>>2]|0;
$20 = ($19|0)==(0);
if ($20) {
$25 = HEAP32[2248>>2]|0;
_free($25);
STACKTOP = sp;return;
}
;HEAP32[$postproFbo$byval_copy>>2]=HEAP32[2252>>2]|0;HEAP32[$postproFbo$byval_copy+4>>2]=HEAP32[2252+4>>2]|0;HEAP32[$postproFbo$byval_copy+8>>2]=HEAP32[2252+8>>2]|0;
_rlglUnloadFBO($postproFbo$byval_copy);
$21 = HEAP32[(2524)>>2]|0;
_rlDeleteBuffers($21);
$22 = HEAP32[(2528)>>2]|0;
_rlDeleteBuffers($22);
$23 = HEAP32[(2532)>>2]|0;
_rlDeleteBuffers($23);
$24 = HEAP32[(2520)>>2]|0;
_rlDeleteVertexArrays($24);
_TraceLog(0,13682,$vararg_buffer1);
$25 = HEAP32[2248>>2]|0;
_free($25);
STACKTOP = sp;return;
}
function _rlglDraw() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $i$05 = 0, $indicesOffset$04 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $modelview$byval_copy = 0, $or$cond = 0, $or$cond3 = 0;
var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 192|0;
$matMVP$byval_copy = sp + 128|0;
$modelview$byval_copy = sp + 64|0;
$matMVP = sp;
_UpdateBuffers();
$0 = HEAP32[2184>>2]|0;
$1 = ($0|0)>(0);
$2 = HEAP32[2196>>2]|0;
$3 = ($2|0)>(0);
$or$cond = $1 | $3;
$4 = HEAP32[2208>>2]|0;
$5 = ($4|0)>(0);
$or$cond3 = $or$cond | $5;
if ($or$cond3) {
$6 = HEAP32[2408>>2]|0;
_glUseProgram(($6|0));
dest=$modelview$byval_copy; src=1072; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matMVP$byval_copy; src=1004; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($matMVP,$modelview$byval_copy,$matMVP$byval_copy);
$7 = HEAP32[(2440)>>2]|0;
dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$8 = (_MatrixToFloat($matMVP$byval_copy)|0);
_glUniformMatrix4fv(($7|0),1,0,($8|0));
$9 = HEAP32[(2448)>>2]|0;
_glUniform1i(($9|0),0);
}
$10 = HEAP32[2184>>2]|0;
$11 = ($10|0)>(0);
if ($11) {
$12 = HEAP32[808>>2]|0;
_glBindTexture(3553,($12|0));
$13 = HEAP32[2264>>2]|0;
$14 = ($13|0)==(0);
if ($14) {
$17 = HEAP32[2684>>2]|0;
_glBindBuffer(34962,($17|0));
$18 = HEAP32[(2424)>>2]|0;
_glVertexAttribPointer(($18|0),3,5126,0,0,(0|0));
$19 = HEAP32[(2424)>>2]|0;
_glEnableVertexAttribArray(($19|0));
$20 = HEAP32[(2436)>>2]|0;
$21 = ($20|0)==(-1);
if (!($21)) {
$22 = HEAP32[(2688)>>2]|0;
_glBindBuffer(34962,($22|0));
$23 = HEAP32[(2436)>>2]|0;
_glVertexAttribPointer(($23|0),4,5121,1,0,(0|0));
$24 = HEAP32[(2436)>>2]|0;
_glEnableVertexAttribArray(($24|0));
}
} else {
$15 = HEAP32[2276>>2]|0;
$16 = HEAP32[2716>>2]|0;
FUNCTION_TABLE_vi[$15 & 31]($16);
}
$25 = HEAP32[2184>>2]|0;
_glDrawArrays(1,0,($25|0));
$26 = HEAP32[2264>>2]|0;
$27 = ($26|0)==(0);
if ($27) {
_glBindBuffer(34962,0);
}
_glBindTexture(3553,0);
}
$28 = HEAP32[2196>>2]|0;
$29 = ($28|0)>(0);
if ($29) {
$30 = HEAP32[808>>2]|0;
_glBindTexture(3553,($30|0));
$31 = HEAP32[2264>>2]|0;
$32 = ($31|0)==(0);
if ($32) {
$35 = HEAP32[2692>>2]|0;
_glBindBuffer(34962,($35|0));
$36 = HEAP32[(2424)>>2]|0;
_glVertexAttribPointer(($36|0),3,5126,0,0,(0|0));
$37 = HEAP32[(2424)>>2]|0;
_glEnableVertexAttribArray(($37|0));
$38 = HEAP32[(2436)>>2]|0;
$39 = ($38|0)==(-1);
if (!($39)) {
$40 = HEAP32[(2696)>>2]|0;
_glBindBuffer(34962,($40|0));
$41 = HEAP32[(2436)>>2]|0;
_glVertexAttribPointer(($41|0),4,5121,1,0,(0|0));
$42 = HEAP32[(2436)>>2]|0;
_glEnableVertexAttribArray(($42|0));
}
} else {
$33 = HEAP32[2276>>2]|0;
$34 = HEAP32[2720>>2]|0;
FUNCTION_TABLE_vi[$33 & 31]($34);
}
$43 = HEAP32[2196>>2]|0;
_glDrawArrays(4,0,($43|0));
$44 = HEAP32[2264>>2]|0;
$45 = ($44|0)==(0);
if ($45) {
_glBindBuffer(34962,0);
}
_glBindTexture(3553,0);
}
$46 = HEAP32[2208>>2]|0;
$47 = ($46|0)>(0);
if ($47) {
$48 = HEAP32[2264>>2]|0;
$49 = ($48|0)==(0);
if ($49) {
$52 = HEAP32[2700>>2]|0;
_glBindBuffer(34962,($52|0));
$53 = HEAP32[(2424)>>2]|0;
_glVertexAttribPointer(($53|0),3,5126,0,0,(0|0));
$54 = HEAP32[(2424)>>2]|0;
_glEnableVertexAttribArray(($54|0));
$55 = HEAP32[(2704)>>2]|0;
_glBindBuffer(34962,($55|0));
$56 = HEAP32[(2428)>>2]|0;
_glVertexAttribPointer(($56|0),2,5126,0,0,(0|0));
$57 = HEAP32[(2428)>>2]|0;
_glEnableVertexAttribArray(($57|0));
$58 = HEAP32[(2436)>>2]|0;
$59 = ($58|0)==(-1);
if (!($59)) {
$60 = HEAP32[(2708)>>2]|0;
_glBindBuffer(34962,($60|0));
$61 = HEAP32[(2436)>>2]|0;
_glVertexAttribPointer(($61|0),4,5121,1,0,(0|0));
$62 = HEAP32[(2436)>>2]|0;
_glEnableVertexAttribArray(($62|0));
}
$63 = HEAP32[(2712)>>2]|0;
_glBindBuffer(34963,($63|0));
} else {
$50 = HEAP32[2276>>2]|0;
$51 = HEAP32[2724>>2]|0;
FUNCTION_TABLE_vi[$50 & 31]($51);
}
$64 = HEAP32[2244>>2]|0;
$65 = ($64|0)>(0);
if ($65) {
$i$05 = 0;$indicesOffset$04 = 0;
while(1) {
$66 = HEAP32[2248>>2]|0;
$67 = (((($66) + ($i$05<<3)|0)) + 4|0);
$68 = HEAP32[$67>>2]|0;
$69 = (($68|0) / 4)&-1;
$70 = ($69*6)|0;
$71 = (($66) + ($i$05<<3)|0);
$72 = HEAP32[$71>>2]|0;
_glBindTexture(3553,($72|0));
$73 = $indicesOffset$04 << 1;
$74 = $73;
_glDrawElements(4,($70|0),5123,($74|0));
$75 = HEAP32[2248>>2]|0;
$76 = (((($75) + ($i$05<<3)|0)) + 4|0);
$77 = HEAP32[$76>>2]|0;
$78 = (($77|0) / 4)&-1;
$79 = ($78*6)|0;
$80 = (($79) + ($indicesOffset$04))|0;
$81 = (($i$05) + 1)|0;
$82 = HEAP32[2244>>2]|0;
$83 = ($81|0)<($82|0);
if ($83) {
$i$05 = $81;$indicesOffset$04 = $80;
} else {
break;
}
}
}
$84 = HEAP32[2264>>2]|0;
$85 = ($84|0)==(0);
if ($85) {
_glBindBuffer(34962,0);
_glBindBuffer(34963,0);
}
_glBindTexture(3553,0);
}
$86 = HEAP32[2264>>2]|0;
$87 = ($86|0)==(0);
if ($87) {
_glUseProgram(0);
HEAP32[2244>>2] = 1;
$89 = HEAP32[808>>2]|0;
$90 = HEAP32[2248>>2]|0;
HEAP32[$90>>2] = $89;
$91 = HEAP32[2248>>2]|0;
$92 = ((($91)) + 4|0);
HEAP32[$92>>2] = 0;
HEAP32[2184>>2] = 0;
HEAP32[2188>>2] = 0;
HEAP32[2196>>2] = 0;
HEAP32[2200>>2] = 0;
HEAP32[2208>>2] = 0;
HEAP32[2220>>2] = 0;
HEAP32[2212>>2] = 0;
HEAPF32[2228>>2] = -1.0;
STACKTOP = sp;return;
}
$88 = HEAP32[2276>>2]|0;
FUNCTION_TABLE_vi[$88 & 31](0);
_glUseProgram(0);
HEAP32[2244>>2] = 1;
$89 = HEAP32[808>>2]|0;
$90 = HEAP32[2248>>2]|0;
HEAP32[$90>>2] = $89;
$91 = HEAP32[2248>>2]|0;
$92 = ((($91)) + 4|0);
HEAP32[$92>>2] = 0;
HEAP32[2184>>2] = 0;
HEAP32[2188>>2] = 0;
HEAP32[2196>>2] = 0;
HEAP32[2200>>2] = 0;
HEAP32[2208>>2] = 0;
HEAP32[2220>>2] = 0;
HEAP32[2212>>2] = 0;
HEAPF32[2228>>2] = -1.0;
STACKTOP = sp;return;
}
function _rlglDrawPostpro() {
var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $postproQuad$byval_copy = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 304|0;
$tmpcast$byval_copy = sp + 292|0;
$$byval_copy2 = sp + 280|0;
$$byval_copy1 = sp + 268|0;
$$byval_copy = sp + 256|0;
$postproQuad$byval_copy = sp + 40|0;
$0 = sp + 28|0;
$1 = sp + 16|0;
$2 = sp + 4|0;
$3 = sp;
_glBindFramebuffer(36160,0);
HEAPF32[$0>>2] = 0.0;
$4 = ((($0)) + 4|0);
HEAPF32[$4>>2] = 0.0;
$5 = ((($0)) + 8|0);
HEAPF32[$5>>2] = 0.0;
HEAPF32[$1>>2] = 0.0;
$6 = ((($1)) + 4|0);
HEAPF32[$6>>2] = 0.0;
$7 = ((($1)) + 8|0);
HEAPF32[$7>>2] = 0.0;
HEAPF32[$2>>2] = 1.0;
$8 = ((($2)) + 4|0);
HEAPF32[$8>>2] = 1.0;
$9 = ((($2)) + 8|0);
HEAPF32[$9>>2] = 1.0;
HEAP32[$3>>2] = -1;
_memcpy(($postproQuad$byval_copy|0),(2468|0),216)|0;
;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$1+8>>2]|0;
;HEAP32[$$byval_copy2>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$2+8>>2]|0;
;HEAP8[$tmpcast$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$tmpcast$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$tmpcast$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$tmpcast$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
_rlglDrawModel($postproQuad$byval_copy,$$byval_copy,$$byval_copy1,0.0,$$byval_copy2,$tmpcast$byval_copy,0);
STACKTOP = sp;return;
}
function _rlglDrawModel($model,$position,$rotationAxis,$rotationAngle,$scale,$color,$wires) {
$model = $model|0;
$position = $position|0;
$rotationAxis = $rotationAxis|0;
$rotationAngle = +$rotationAngle;
$scale = $scale|0;
$color = $color|0;
$wires = $wires|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0;
var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0.0, $80 = 0;
var $81 = 0, $9 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $matModel = 0, $matModelView = 0, $matModelView$byval_copy = 0, $matProjection = 0, $matRotation = 0, $matScale = 0, $matTransform = 0, $matTranslation = 0, $matView = 0, $vColor = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 784|0;
$matMVP$byval_copy = sp + 720|0;
$matModelView$byval_copy = sp + 656|0;
$matView = sp + 512|0;
$matProjection = sp + 448|0;
$matRotation = sp + 384|0;
$matScale = sp + 320|0;
$matTranslation = sp + 256|0;
$matTransform = sp + 192|0;
$0 = sp + 592|0;
$matModel = sp + 128|0;
$matModelView = sp + 64|0;
$matMVP = sp;
$vColor = sp + 576|0;
$1 = ((($model)) + 164|0);
$2 = HEAP32[$1>>2]|0;
_glUseProgram(($2|0));
dest=$matView; src=1072; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matProjection; src=1004; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$3 = $rotationAngle;
$4 = $3 * 0.017453292519943295;
$5 = $4;
;HEAP32[$matMVP$byval_copy>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$matMVP$byval_copy+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$matMVP$byval_copy+8>>2]=HEAP32[$rotationAxis+8>>2]|0;
_MatrixRotate($matRotation,$matMVP$byval_copy,$5);
$6 = +HEAPF32[$scale>>2];
$7 = ((($scale)) + 4|0);
$8 = +HEAPF32[$7>>2];
$9 = ((($scale)) + 8|0);
$10 = +HEAPF32[$9>>2];
_MatrixScale($matScale,$6,$8,$10);
$11 = +HEAPF32[$position>>2];
$12 = ((($position)) + 4|0);
$13 = +HEAPF32[$12>>2];
$14 = ((($position)) + 8|0);
$15 = +HEAPF32[$14>>2];
_MatrixTranslate($matTranslation,$11,$13,$15);
dest=$matModelView$byval_copy; src=$matScale; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matMVP$byval_copy; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($0,$matModelView$byval_copy,$matMVP$byval_copy);
dest=$matModelView$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matMVP$byval_copy; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($matTransform,$matModelView$byval_copy,$matMVP$byval_copy);
$16 = ((($model)) + 80|0);
dest=$matModelView$byval_copy; src=$16; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matMVP$byval_copy; src=$matTransform; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($matModel,$matModelView$byval_copy,$matMVP$byval_copy);
dest=$matModelView$byval_copy; src=$matModel; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matMVP$byval_copy; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($matModelView,$matModelView$byval_copy,$matMVP$byval_copy);
dest=$matModelView$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
dest=$matMVP$byval_copy; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MatrixMultiply($matMVP,$matModelView$byval_copy,$matMVP$byval_copy);
$17 = ((($model)) + 196|0);
$18 = HEAP32[$17>>2]|0;
dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
$19 = (_MatrixToFloat($matMVP$byval_copy)|0);
_glUniformMatrix4fv(($18|0),1,0,($19|0));
$20 = HEAP8[$color>>0]|0;
$21 = (+($20&255));
$22 = $21 / 255.0;
HEAPF32[$vColor>>2] = $22;
$23 = ((($vColor)) + 4|0);
$24 = ((($color)) + 1|0);
$25 = HEAP8[$24>>0]|0;
$26 = (+($25&255));
$27 = $26 / 255.0;
HEAPF32[$23>>2] = $27;
$28 = ((($vColor)) + 8|0);
$29 = ((($color)) + 2|0);
$30 = HEAP8[$29>>0]|0;
$31 = (+($30&255));
$32 = $31 / 255.0;
HEAPF32[$28>>2] = $32;
$33 = ((($vColor)) + 12|0);
$34 = ((($color)) + 3|0);
$35 = HEAP8[$34>>0]|0;
$36 = (+($35&255));
$37 = $36 / 255.0;
HEAPF32[$33>>2] = $37;
$38 = ((($model)) + 200|0);
$39 = HEAP32[$38>>2]|0;
_glUniform4fv(($39|0),1,($vColor|0));
_glActiveTexture(33984);
$40 = ((($model)) + 168|0);
$41 = HEAP32[$40>>2]|0;
_glBindTexture(3553,($41|0));
$42 = ((($model)) + 204|0);
$43 = HEAP32[$42>>2]|0;
_glUniform1i(($43|0),0);
$44 = ((($model)) + 172|0);
$45 = HEAP32[$44>>2]|0;
$46 = ($45|0)==(0);
if (!($46)) {
_glActiveTexture(33985);
$47 = HEAP32[$44>>2]|0;
_glBindTexture(3553,($47|0));
}
$48 = ((($model)) + 176|0);
$49 = HEAP32[$48>>2]|0;
$50 = ($49|0)==(0);
if (!($50)) {
_glActiveTexture(33986);
$51 = HEAP32[$48>>2]|0;
_glBindTexture(3553,($51|0));
}
$52 = HEAP32[2264>>2]|0;
$53 = ($52|0)==(0);
if ($53) {
$57 = ((($model)) + 56|0);
$58 = HEAP32[$57>>2]|0;
_glBindBuffer(34962,($58|0));
$59 = ((($model)) + 180|0);
$60 = HEAP32[$59>>2]|0;
_glVertexAttribPointer(($60|0),3,5126,0,0,(0|0));
$61 = HEAP32[$59>>2]|0;
_glEnableVertexAttribArray(($61|0));
$62 = ((($model)) + 60|0);
$63 = HEAP32[$62>>2]|0;
_glBindBuffer(34962,($63|0));
$64 = ((($model)) + 184|0);
$65 = HEAP32[$64>>2]|0;
_glVertexAttribPointer(($65|0),2,5126,0,0,(0|0));
$66 = HEAP32[$64>>2]|0;
_glEnableVertexAttribArray(($66|0));
$67 = ((($model)) + 188|0);
$68 = HEAP32[$67>>2]|0;
$69 = ($68|0)==(-1);
if (!($69)) {
$70 = ((($model)) + 64|0);
$71 = HEAP32[$70>>2]|0;
_glBindBuffer(34962,($71|0));
$72 = HEAP32[$67>>2]|0;
_glVertexAttribPointer(($72|0),3,5126,0,0,(0|0));
$73 = HEAP32[$67>>2]|0;
_glEnableVertexAttribArray(($73|0));
}
} else {
$54 = HEAP32[2276>>2]|0;
$55 = ((($model)) + 52|0);
$56 = HEAP32[$55>>2]|0;
FUNCTION_TABLE_vi[$54 & 31]($56);
}
$74 = HEAP32[$model>>2]|0;
_glDrawArrays(4,0,($74|0));
$75 = HEAP32[$44>>2]|0;
$76 = ($75|0)==(0);
if (!($76)) {
_glActiveTexture(33985);
_glBindTexture(3553,0);
}
$77 = HEAP32[$48>>2]|0;
$78 = ($77|0)==(0);
if (!($78)) {
_glActiveTexture(33986);
_glBindTexture(3553,0);
}
_glActiveTexture(33984);
_glBindTexture(3553,0);
$79 = HEAP32[2264>>2]|0;
$80 = ($79|0)==(0);
if ($80) {
_glBindBuffer(34962,0);
_glUseProgram(0);
STACKTOP = sp;return;
} else {
$81 = HEAP32[2276>>2]|0;
FUNCTION_TABLE_vi[$81 & 31](0);
_glUseProgram(0);
STACKTOP = sp;return;
}
}
function _rlglInitGraphics($offsetX,$offsetY,$width,$height) {
$offsetX = $offsetX|0;
$offsetY = $offsetY|0;
$width = $width|0;
$height = $height|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
HEAP32[2460>>2] = $width;
HEAP32[2464>>2] = $height;
$0 = (($offsetX|0) / 2)&-1;
$1 = (($offsetY|0) / 2)&-1;
$2 = (($width) - ($offsetX))|0;
$3 = (($height) - ($offsetY))|0;
_glViewport(($0|0),($1|0),($2|0),($3|0));
_glClearColor(0.0,0.0,0.0,1.0);
_glClear(16640);
_glEnable(2929);
_glDepthFunc(515);
_glEnable(3042);
_glBlendFunc(770,771);
_rlMatrixMode(0);
_rlLoadIdentity();
$4 = (+($2|0));
$5 = (+($3|0));
_rlOrtho(0.0,$4,$5,0.0,0.0,1.0);
_rlMatrixMode(1);
_rlLoadIdentity();
_glEnable(2884);
_TraceLog(0,13711,$vararg_buffer);
STACKTOP = sp;return;
}
function _LoadShaderProgram($vShaderStr,$fShaderStr) {
$vShaderStr = $vShaderStr|0;
$fShaderStr = $fShaderStr|0;
var $$alloca_mul = 0, $$alloca_mul25 = 0, $$alloca_mul27 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $length = 0, $length2 = 0, $length4 = 0, $maxLength = 0, $maxLength1 = 0, $maxLength3 = 0, $pfs = 0, $program$0 = 0, $pvs = 0, $success = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0;
var $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$vararg_buffer22 = sp + 64|0;
$vararg_buffer19 = sp + 56|0;
$vararg_buffer16 = sp + 48|0;
$vararg_buffer13 = sp + 40|0;
$vararg_buffer10 = sp + 32|0;
$vararg_buffer7 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$pvs = sp + 100|0;
$pfs = sp + 96|0;
$success = sp + 92|0;
$maxLength = sp + 88|0;
$length = sp + 84|0;
$maxLength1 = sp + 80|0;
$length2 = sp + 76|0;
$maxLength3 = sp + 72|0;
$length4 = sp + 68|0;
$0 = (_glCreateShader(35633)|0);
$1 = (_glCreateShader(35632)|0);
HEAP32[$pvs>>2] = $vShaderStr;
HEAP32[$pfs>>2] = $fShaderStr;
_glShaderSource(($0|0),1,($pvs|0),(0|0));
_glShaderSource(($1|0),1,($pfs|0),(0|0));
HEAP32[$success>>2] = 0;
_glCompileShader(($0|0));
_glGetShaderiv(($0|0),35713,($success|0));
$2 = HEAP32[$success>>2]|0;
$3 = ($2|0)==(1);
if ($3) {
HEAP32[$vararg_buffer4>>2] = $0;
_TraceLog(0,13886,$vararg_buffer4);
} else {
HEAP32[$vararg_buffer>>2] = $0;
_TraceLog(2,13834,$vararg_buffer);
HEAP32[$maxLength>>2] = 0;
_glGetShaderiv(($0|0),35716,($maxLength|0));
$4 = HEAP32[$maxLength>>2]|0;
$5 = (_llvm_stacksave()|0);
$$alloca_mul = $4;
$6 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;;
$7 = HEAP32[$maxLength>>2]|0;
_glGetShaderInfoLog(($0|0),($7|0),($length|0),($6|0));
HEAP32[$vararg_buffer1>>2] = $6;
_TraceLog(0,13883,$vararg_buffer1);
_llvm_stackrestore(($5|0));
}
_glCompileShader(($1|0));
_glGetShaderiv(($1|0),35713,($success|0));
$8 = HEAP32[$success>>2]|0;
$9 = ($8|0)==(1);
if ($9) {
HEAP32[$vararg_buffer13>>2] = $1;
_TraceLog(0,13987,$vararg_buffer13);
} else {
HEAP32[$vararg_buffer7>>2] = $1;
_TraceLog(2,13936,$vararg_buffer7);
HEAP32[$maxLength1>>2] = 0;
_glGetShaderiv(($1|0),35716,($maxLength1|0));
$10 = HEAP32[$maxLength1>>2]|0;
$11 = (_llvm_stacksave()|0);
$$alloca_mul25 = $10;
$12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul25)|0)+15)&-16)|0;;
$13 = HEAP32[$maxLength1>>2]|0;
_glGetShaderInfoLog(($1|0),($13|0),($length2|0),($12|0));
HEAP32[$vararg_buffer10>>2] = $12;
_TraceLog(0,13883,$vararg_buffer10);
_llvm_stackrestore(($11|0));
}
$14 = (_glCreateProgram()|0);
_glAttachShader(($14|0),($0|0));
_glAttachShader(($14|0),($1|0));
_glLinkProgram(($14|0));
_glGetProgramiv(($14|0),35714,($success|0));
$15 = HEAP32[$success>>2]|0;
$16 = ($15|0)==(0);
if ($16) {
HEAP32[$vararg_buffer16>>2] = $14;
_TraceLog(2,14039,$vararg_buffer16);
HEAP32[$maxLength3>>2] = 0;
_glGetProgramiv(($14|0),35716,($maxLength3|0));
$17 = HEAP32[$maxLength3>>2]|0;
$18 = (_llvm_stacksave()|0);
$$alloca_mul27 = $17;
$19 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul27)|0)+15)&-16)|0;;
$20 = HEAP32[$maxLength3>>2]|0;
_glGetProgramInfoLog(($14|0),($20|0),($length4|0),($19|0));
HEAP32[$vararg_buffer19>>2] = $19;
_TraceLog(0,13883,$vararg_buffer19);
_glDeleteProgram(($14|0));
_llvm_stackrestore(($18|0));
$program$0 = 0;
_glDeleteShader(($0|0));
_glDeleteShader(($1|0));
STACKTOP = sp;return ($program$0|0);
} else {
HEAP32[$vararg_buffer22>>2] = $14;
_TraceLog(0,14085,$vararg_buffer22);
$program$0 = $14;
_glDeleteShader(($0|0));
_glDeleteShader(($1|0));
STACKTOP = sp;return ($program$0|0);
}
return (0)|0;
}
function _IsPosproShaderEnabled() {
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[2732>>2]|0;
return ($0|0);
}
function _DrawCircle($centerX,$centerY,$radius,$color) {
$centerX = $centerX|0;
$centerY = $centerY|0;
$radius = +$radius;
$color = $color|0;
var $$byval_copy = 0, $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $color$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$color$byval_copy = sp + 16|0;
$$byval_copy = sp + 8|0;
$0 = sp;
$1 = (+($centerX|0));
$2 = (+($centerY|0));
HEAPF32[$0>>2] = $1;
$3 = ((($0)) + 4|0);
HEAPF32[$3>>2] = $2;
;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;
;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0;
_DrawPoly($$byval_copy,36,$radius,0.0,$color$byval_copy);
STACKTOP = sp;return;
}
function _DrawPoly($center,$sides,$radius,$rotation,$color) {
$center = $center|0;
$sides = $sides|0;
$radius = +$radius;
$rotation = +$rotation;
$color = $color|0;
var $$sides = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0;
var $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($sides|0)<(3);
$$sides = $0 ? 3 : $sides;
_rlPushMatrix();
$1 = +HEAPF32[$center>>2];
$2 = ((($center)) + 4|0);
$3 = +HEAPF32[$2>>2];
_rlTranslatef($1,$3,0.0);
_rlRotatef($rotation,0.0,0.0,1.0);
_rlBegin(1);
$4 = HEAP8[$color>>0]|0;
$5 = ((($color)) + 1|0);
$6 = HEAP8[$5>>0]|0;
$7 = ((($color)) + 2|0);
$8 = HEAP8[$7>>0]|0;
$9 = ((($color)) + 3|0);
$10 = HEAP8[$9>>0]|0;
$11 = $radius;
$12 = (360 / ($$sides|0))&-1;
$i$01 = 0;
while(1) {
_rlColor4ub($4,$6,$8,$10);
_rlVertex2i(0,0);
$13 = (+($i$01|0));
$14 = $13 * 0.017453292519943295;
$15 = (+Math_sin((+$14)));
$16 = $11 * $15;
$17 = $16;
$18 = (+Math_cos((+$14)));
$19 = $11 * $18;
$20 = $19;
_rlVertex2f($17,$20);
$21 = (($12) + ($i$01))|0;
$22 = (+($21|0));
$23 = $22 * 0.017453292519943295;
$24 = (+Math_sin((+$23)));
$25 = $11 * $24;
$26 = $25;
$27 = (+Math_cos((+$23)));
$28 = $11 * $27;
$29 = $28;
_rlVertex2f($26,$29);
$30 = ($21|0)<(360);
if ($30) {
$i$01 = $21;
} else {
break;
}
}
_rlEnd();
_rlPopMatrix();
return;
}
function _DrawCircleGradient($centerX,$centerY,$radius,$color1,$color2) {
$centerX = $centerX|0;
$centerY = $centerY|0;
$radius = +$radius;
$color1 = $color1|0;
$color2 = $color2|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
_rlBegin(1);
$0 = HEAP8[$color1>>0]|0;
$1 = ((($color1)) + 1|0);
$2 = HEAP8[$1>>0]|0;
$3 = ((($color1)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color1)) + 3|0);
$6 = HEAP8[$5>>0]|0;
$7 = HEAP8[$color2>>0]|0;
$8 = ((($color2)) + 1|0);
$9 = HEAP8[$8>>0]|0;
$10 = ((($color2)) + 2|0);
$11 = HEAP8[$10>>0]|0;
$12 = ((($color2)) + 3|0);
$13 = HEAP8[$12>>0]|0;
$14 = (+($centerX|0));
$15 = $radius;
$16 = (+($centerY|0));
$17 = HEAP8[$color2>>0]|0;
$18 = HEAP8[$8>>0]|0;
$19 = HEAP8[$10>>0]|0;
$20 = HEAP8[$12>>0]|0;
$i$01 = 0;
while(1) {
_rlColor4ub($0,$2,$4,$6);
_rlVertex2i($centerX,$centerY);
_rlColor4ub($7,$9,$11,$13);
$21 = (+($i$01|0));
$22 = $21 * 0.017453292519943295;
$23 = (+Math_sin((+$22)));
$24 = $15 * $23;
$25 = $14 + $24;
$26 = $25;
$27 = (+Math_cos((+$22)));
$28 = $15 * $27;
$29 = $16 + $28;
$30 = $29;
_rlVertex2f($26,$30);
_rlColor4ub($17,$18,$19,$20);
$31 = (($i$01) + 10)|0;
$32 = (+($31|0));
$33 = $32 * 0.017453292519943295;
$34 = (+Math_sin((+$33)));
$35 = $15 * $34;
$36 = $14 + $35;
$37 = $36;
$38 = (+Math_cos((+$33)));
$39 = $15 * $38;
$40 = $16 + $39;
$41 = $40;
_rlVertex2f($37,$41);
$42 = ($31|0)<(360);
if ($42) {
$i$01 = $31;
} else {
break;
}
}
_rlEnd();
return;
}
function _DrawCircleLines($centerX,$centerY,$radius,$color) {
$centerX = $centerX|0;
$centerY = $centerY|0;
$radius = +$radius;
$color = $color|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
_rlBegin(0);
$0 = HEAP8[$color>>0]|0;
$1 = ((($color)) + 1|0);
$2 = HEAP8[$1>>0]|0;
$3 = ((($color)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color)) + 3|0);
$6 = HEAP8[$5>>0]|0;
_rlColor4ub($0,$2,$4,$6);
$7 = (+($centerX|0));
$8 = $radius;
$9 = (+($centerY|0));
$i$01 = 0;
while(1) {
$10 = (+($i$01|0));
$11 = $10 * 0.017453292519943295;
$12 = (+Math_sin((+$11)));
$13 = $8 * $12;
$14 = $7 + $13;
$15 = $14;
$16 = (+Math_cos((+$11)));
$17 = $8 * $16;
$18 = $9 + $17;
$19 = $18;
_rlVertex2f($15,$19);
$20 = (($i$01) + 10)|0;
$21 = (+($20|0));
$22 = $21 * 0.017453292519943295;
$23 = (+Math_sin((+$22)));
$24 = $8 * $23;
$25 = $7 + $24;
$26 = $25;
$27 = (+Math_cos((+$22)));
$28 = $8 * $27;
$29 = $9 + $28;
$30 = $29;
_rlVertex2f($26,$30);
$31 = ($20|0)<(360);
if ($31) {
$i$01 = $20;
} else {
break;
}
}
_rlEnd();
return;
}
function _DrawRectangle($posX,$posY,$width,$height,$color) {
$posX = $posX|0;
$posY = $posY|0;
$width = $width|0;
$height = $height|0;
$color = $color|0;
var $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0.0, $color$byval_copy = 0, $position = 0, $position$byval_copy = 0, $size = 0, $size$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$color$byval_copy = sp + 32|0;
$size$byval_copy = sp + 24|0;
$position$byval_copy = sp + 16|0;
$position = sp + 8|0;
$size = sp;
$0 = (+($posX|0));
HEAPF32[$position>>2] = $0;
$1 = ((($position)) + 4|0);
$2 = (+($posY|0));
HEAPF32[$1>>2] = $2;
$3 = (+($width|0));
HEAPF32[$size>>2] = $3;
$4 = ((($size)) + 4|0);
$5 = (+($height|0));
HEAPF32[$4>>2] = $5;
;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;
;HEAP32[$size$byval_copy>>2]=HEAP32[$size>>2]|0;HEAP32[$size$byval_copy+4>>2]=HEAP32[$size+4>>2]|0;
;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0;
_DrawRectangleV($position$byval_copy,$size$byval_copy,$color$byval_copy);
STACKTOP = sp;return;
}
function _DrawRectangleV($position,$size,$color) {
$position = $position|0;
$size = $size|0;
$color = $color|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0;
var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0;
var $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0;
var $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_rlGetVersion()|0);
$1 = ($0|0)==(1);
if ($1) {
_rlBegin(1);
$2 = HEAP8[$color>>0]|0;
$3 = ((($color)) + 1|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color)) + 2|0);
$6 = HEAP8[$5>>0]|0;
$7 = ((($color)) + 3|0);
$8 = HEAP8[$7>>0]|0;
_rlColor4ub($2,$4,$6,$8);
$9 = +HEAPF32[$position>>2];
$10 = (~~(($9)));
$11 = ((($position)) + 4|0);
$12 = +HEAPF32[$11>>2];
$13 = (~~(($12)));
_rlVertex2i($10,$13);
$14 = +HEAPF32[$position>>2];
$15 = (~~(($14)));
$16 = +HEAPF32[$11>>2];
$17 = ((($size)) + 4|0);
$18 = +HEAPF32[$17>>2];
$19 = $16 + $18;
$20 = (~~(($19)));
_rlVertex2i($15,$20);
$21 = +HEAPF32[$position>>2];
$22 = +HEAPF32[$size>>2];
$23 = $21 + $22;
$24 = (~~(($23)));
$25 = +HEAPF32[$11>>2];
$26 = +HEAPF32[$17>>2];
$27 = $25 + $26;
$28 = (~~(($27)));
_rlVertex2i($24,$28);
$29 = +HEAPF32[$position>>2];
$30 = (~~(($29)));
$31 = +HEAPF32[$11>>2];
$32 = (~~(($31)));
_rlVertex2i($30,$32);
$33 = +HEAPF32[$position>>2];
$34 = +HEAPF32[$size>>2];
$35 = $33 + $34;
$36 = (~~(($35)));
$37 = +HEAPF32[$11>>2];
$38 = +HEAPF32[$17>>2];
$39 = $37 + $38;
$40 = (~~(($39)));
_rlVertex2i($36,$40);
$41 = +HEAPF32[$position>>2];
$42 = +HEAPF32[$size>>2];
$43 = $41 + $42;
$44 = (~~(($43)));
$45 = +HEAPF32[$11>>2];
$46 = (~~(($45)));
_rlVertex2i($44,$46);
_rlEnd();
return;
}
$47 = (_rlGetVersion()|0);
$48 = ($47|0)==(2);
if (!($48)) {
$49 = (_rlGetVersion()|0);
$50 = ($49|0)==(3);
if (!($50)) {
return;
}
}
$51 = HEAP32[808>>2]|0;
_rlEnableTexture($51);
_rlBegin(2);
$52 = HEAP8[$color>>0]|0;
$53 = ((($color)) + 1|0);
$54 = HEAP8[$53>>0]|0;
$55 = ((($color)) + 2|0);
$56 = HEAP8[$55>>0]|0;
$57 = ((($color)) + 3|0);
$58 = HEAP8[$57>>0]|0;
_rlColor4ub($52,$54,$56,$58);
_rlTexCoord2f(0.0,0.0);
$59 = +HEAPF32[$position>>2];
$60 = ((($position)) + 4|0);
$61 = +HEAPF32[$60>>2];
_rlVertex2f($59,$61);
_rlTexCoord2f(0.0,1.0);
$62 = +HEAPF32[$position>>2];
$63 = +HEAPF32[$60>>2];
$64 = ((($size)) + 4|0);
$65 = +HEAPF32[$64>>2];
$66 = $63 + $65;
_rlVertex2f($62,$66);
_rlTexCoord2f(1.0,1.0);
$67 = +HEAPF32[$position>>2];
$68 = +HEAPF32[$size>>2];
$69 = $67 + $68;
$70 = +HEAPF32[$60>>2];
$71 = +HEAPF32[$64>>2];
$72 = $70 + $71;
_rlVertex2f($69,$72);
_rlTexCoord2f(1.0,0.0);
$73 = +HEAPF32[$position>>2];
$74 = +HEAPF32[$size>>2];
$75 = $73 + $74;
$76 = +HEAPF32[$60>>2];
_rlVertex2f($75,$76);
_rlEnd();
return;
}
function _DrawRectangleGradient($posX,$posY,$width,$height,$color1,$color2) {
$posX = $posX|0;
$posY = $posY|0;
$width = $width|0;
$height = $height|0;
$color1 = $color1|0;
$color2 = $color2|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
_rlBegin(1);
$0 = HEAP8[$color1>>0]|0;
$1 = ((($color1)) + 1|0);
$2 = HEAP8[$1>>0]|0;
$3 = ((($color1)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color1)) + 3|0);
$6 = HEAP8[$5>>0]|0;
_rlColor4ub($0,$2,$4,$6);
_rlVertex2i($posX,$posY);
$7 = HEAP8[$color2>>0]|0;
$8 = ((($color2)) + 1|0);
$9 = HEAP8[$8>>0]|0;
$10 = ((($color2)) + 2|0);
$11 = HEAP8[$10>>0]|0;
$12 = ((($color2)) + 3|0);
$13 = HEAP8[$12>>0]|0;
_rlColor4ub($7,$9,$11,$13);
$14 = (($height) + ($posY))|0;
_rlVertex2i($posX,$14);
$15 = HEAP8[$color2>>0]|0;
$16 = HEAP8[$8>>0]|0;
$17 = HEAP8[$10>>0]|0;
$18 = HEAP8[$12>>0]|0;
_rlColor4ub($15,$16,$17,$18);
$19 = (($width) + ($posX))|0;
_rlVertex2i($19,$14);
$20 = HEAP8[$color1>>0]|0;
$21 = HEAP8[$1>>0]|0;
$22 = HEAP8[$3>>0]|0;
$23 = HEAP8[$5>>0]|0;
_rlColor4ub($20,$21,$22,$23);
_rlVertex2i($posX,$posY);
$24 = HEAP8[$color2>>0]|0;
$25 = HEAP8[$8>>0]|0;
$26 = HEAP8[$10>>0]|0;
$27 = HEAP8[$12>>0]|0;
_rlColor4ub($24,$25,$26,$27);
_rlVertex2i($19,$14);
$28 = HEAP8[$color1>>0]|0;
$29 = HEAP8[$1>>0]|0;
$30 = HEAP8[$3>>0]|0;
$31 = HEAP8[$5>>0]|0;
_rlColor4ub($28,$29,$30,$31);
_rlVertex2i($19,$posY);
_rlEnd();
return;
}
function _DrawRectangleLines($posX,$posY,$width,$height,$color) {
$posX = $posX|0;
$posY = $posY|0;
$width = $width|0;
$height = $height|0;
$color = $color|0;
var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
_rlBegin(0);
$0 = HEAP8[$color>>0]|0;
$1 = ((($color)) + 1|0);
$2 = HEAP8[$1>>0]|0;
$3 = ((($color)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color)) + 3|0);
$6 = HEAP8[$5>>0]|0;
_rlColor4ub($0,$2,$4,$6);
$7 = (($posX) + 1)|0;
$8 = (($posY) + 1)|0;
_rlVertex2i($7,$8);
$9 = (($width) + ($posX))|0;
_rlVertex2i($9,$8);
_rlVertex2i($9,$8);
$10 = (($height) + ($posY))|0;
_rlVertex2i($9,$10);
_rlVertex2i($9,$10);
_rlVertex2i($7,$10);
_rlVertex2i($7,$10);
_rlVertex2i($7,$8);
_rlEnd();
return;
}
function _DrawTriangle($v1,$v2,$v3,$color) {
$v1 = $v1|0;
$v2 = $v2|0;
$v3 = $v3|0;
$color = $color|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
_rlBegin(1);
$0 = HEAP8[$color>>0]|0;
$1 = ((($color)) + 1|0);
$2 = HEAP8[$1>>0]|0;
$3 = ((($color)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = ((($color)) + 3|0);
$6 = HEAP8[$5>>0]|0;
_rlColor4ub($0,$2,$4,$6);
$7 = +HEAPF32[$v1>>2];
$8 = ((($v1)) + 4|0);
$9 = +HEAPF32[$8>>2];
_rlVertex2f($7,$9);
$10 = +HEAPF32[$v2>>2];
$11 = ((($v2)) + 4|0);
$12 = +HEAPF32[$11>>2];
_rlVertex2f($10,$12);
$13 = +HEAPF32[$v3>>2];
$14 = ((($v3)) + 4|0);
$15 = +HEAPF32[$14>>2];
_rlVertex2f($13,$15);
_rlEnd();
return;
}
function _stbtt_InitFont($info,$data2,$fontstart) {
$info = $info|0;
$data2 = $data2|0;
$fontstart = $fontstart|0;
var $$0 = 0, $$pr = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$06 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($info)) + 4|0);
HEAP32[$0>>2] = $data2;
$1 = ((($info)) + 8|0);
HEAP32[$1>>2] = $fontstart;
$2 = (_stbtt__find_table($data2,$fontstart,14133)|0);
$3 = (_stbtt__find_table($data2,$fontstart,14138)|0);
$4 = ((($info)) + 16|0);
HEAP32[$4>>2] = $3;
$5 = (_stbtt__find_table($data2,$fontstart,14143)|0);
$6 = ((($info)) + 20|0);
HEAP32[$6>>2] = $5;
$7 = (_stbtt__find_table($data2,$fontstart,14148)|0);
$8 = ((($info)) + 24|0);
HEAP32[$8>>2] = $7;
$9 = (_stbtt__find_table($data2,$fontstart,14153)|0);
$10 = ((($info)) + 28|0);
HEAP32[$10>>2] = $9;
$11 = (_stbtt__find_table($data2,$fontstart,14158)|0);
$12 = ((($info)) + 32|0);
HEAP32[$12>>2] = $11;
$13 = (_stbtt__find_table($data2,$fontstart,14163)|0);
$14 = ((($info)) + 36|0);
HEAP32[$14>>2] = $13;
$15 = ($2|0)==(0);
if ($15) {
$$0 = 0;
return ($$0|0);
}
$16 = HEAP32[$4>>2]|0;
$17 = ($16|0)==(0);
if ($17) {
$$0 = 0;
return ($$0|0);
}
$18 = HEAP32[$6>>2]|0;
$19 = ($18|0)==(0);
if ($19) {
$$0 = 0;
return ($$0|0);
}
$20 = HEAP32[$8>>2]|0;
$21 = ($20|0)==(0);
if ($21) {
$$0 = 0;
return ($$0|0);
}
$22 = HEAP32[$10>>2]|0;
$23 = ($22|0)==(0);
if ($23) {
$$0 = 0;
return ($$0|0);
}
$24 = HEAP32[$12>>2]|0;
$25 = ($24|0)==(0);
if ($25) {
$$0 = 0;
return ($$0|0);
}
$26 = (_stbtt__find_table($data2,$fontstart,14168)|0);
$27 = ($26|0)==(0);
if ($27) {
$32 = ((($info)) + 12|0);
HEAP32[$32>>2] = 65535;
} else {
$$sum5 = (($26) + 4)|0;
$28 = (($data2) + ($$sum5)|0);
$29 = (_ttUSHORT($28)|0);
$30 = $29&65535;
$31 = ((($info)) + 12|0);
HEAP32[$31>>2] = $30;
}
$$sum = (($2) + 2)|0;
$33 = (($data2) + ($$sum)|0);
$34 = (_ttUSHORT($33)|0);
$35 = ((($info)) + 40|0);
HEAP32[$35>>2] = 0;
$36 = ($34<<16>>16)==(0);
if ($36) {
$$0 = 0;
return ($$0|0);
}
$37 = (($2) + 4)|0;
$38 = $34&65535;
$i$06 = 0;
while(1) {
$39 = $i$06 << 3;
$40 = (($37) + ($39))|0;
$41 = (($data2) + ($40)|0);
$42 = (_ttUSHORT($41)|0);
$43 = $42&65535;
L28: do {
switch ($43|0) {
case 3: {
$$sum3 = (($40) + 2)|0;
$44 = (($data2) + ($$sum3)|0);
$45 = (_ttUSHORT($44)|0);
$46 = $45&65535;
switch ($46|0) {
case 10: case 1: {
break;
}
default: {
break L28;
}
}
$$sum4 = (($40) + 4)|0;
$47 = (($data2) + ($$sum4)|0);
$48 = (_ttULONG($47)|0);
$49 = (($48) + ($2))|0;
HEAP32[$35>>2] = $49;
break;
}
case 0: {
$$sum2 = (($40) + 4)|0;
$50 = (($data2) + ($$sum2)|0);
$51 = (_ttULONG($50)|0);
$52 = (($51) + ($2))|0;
HEAP32[$35>>2] = $52;
break;
}
default: {
}
}
} while(0);
$53 = (($i$06) + 1)|0;
$exitcond = ($53|0)==($38|0);
if ($exitcond) {
break;
} else {
$i$06 = $53;
}
}
$$pr = HEAP32[$35>>2]|0;
$54 = ($$pr|0)==(0);
if ($54) {
$$0 = 0;
return ($$0|0);
}
$55 = HEAP32[$6>>2]|0;
$$sum1 = (($55) + 50)|0;
$56 = (($data2) + ($$sum1)|0);
$57 = (_ttUSHORT($56)|0);
$58 = $57&65535;
$59 = ((($info)) + 44|0);
HEAP32[$59>>2] = $58;
$$0 = 1;
return ($$0|0);
}
function _stbtt_FindGlyphIndex($info,$unicode_codepoint) {
$info = $info|0;
$unicode_codepoint = $unicode_codepoint|0;
var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa50 = 0, $$lcssa50$lcssa = 0, $$neg = 0, $$search$1 = 0, $$sum = 0, $$sum1 = 0, $$sum10 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum19 = 0, $$sum2 = 0, $$sum2$lcssa = 0, $$sum2$lcssa$lcssa = 0;
var $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum32 = 0, $$sum33 = 0, $$sum34 = 0, $$sum4 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0;
var $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0;
var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0;
var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0;
var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $entrySelector$039 = 0, $high$0 = 0, $high$0$lcssa49 = 0, $high$0$ph = 0, $low$0$ph = 0, $search$1$lcssa = 0, $search$138 = 0, $searchRange$040 = 0, $switch = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($info)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($info)) + 40|0);
$3 = HEAP32[$2>>2]|0;
$4 = (($1) + ($3)|0);
$5 = (_ttUSHORT($4)|0);
switch ($5<<16>>16) {
case 0: {
$$sum32 = (($3) + 2)|0;
$6 = (($1) + ($$sum32)|0);
$7 = (_ttUSHORT($6)|0);
$8 = $7&65535;
$9 = (($8) + -6)|0;
$10 = ($9|0)>($unicode_codepoint|0);
if (!($10)) {
$$0 = 0;
return ($$0|0);
}
$$sum33 = (($unicode_codepoint) + 6)|0;
$$sum34 = (($$sum33) + ($3))|0;
$11 = (($1) + ($$sum34)|0);
$12 = HEAP8[$11>>0]|0;
$13 = $12&255;
$$0 = $13;
return ($$0|0);
break;
}
case 6: {
$$sum28 = (($3) + 6)|0;
$14 = (($1) + ($$sum28)|0);
$15 = (_ttUSHORT($14)|0);
$16 = $15&65535;
$17 = ($16>>>0)>($unicode_codepoint>>>0);
if ($17) {
$$0 = 0;
return ($$0|0);
}
$$sum29 = (($3) + 8)|0;
$18 = (($1) + ($$sum29)|0);
$19 = (_ttUSHORT($18)|0);
$20 = $19&65535;
$21 = (($20) + ($16))|0;
$22 = ($21>>>0)>($unicode_codepoint>>>0);
if (!($22)) {
$$0 = 0;
return ($$0|0);
}
$$sum30 = (($3) + 10)|0;
$23 = (($unicode_codepoint) - ($16))|0;
$24 = $23 << 1;
$$sum31 = (($$sum30) + ($24))|0;
$25 = (($1) + ($$sum31)|0);
$26 = (_ttUSHORT($25)|0);
$27 = $26&65535;
$$0 = $27;
return ($$0|0);
break;
}
case 2: {
___assert_fail((19474|0),(14173|0),1094,(14190|0));
// unreachable;
break;
}
case 4: {
$$sum5 = (($3) + 6)|0;
$28 = (($1) + ($$sum5)|0);
$29 = (_ttUSHORT($28)|0);
$30 = ($29&65535) >>> 1;
$31 = (($3) + 14)|0;
$32 = ($unicode_codepoint|0)>(65535);
if ($32) {
$$0 = 0;
return ($$0|0);
}
$$sum8 = (($3) + 12)|0;
$33 = (($1) + ($$sum8)|0);
$34 = (_ttUSHORT($33)|0);
$$sum7 = (($3) + 10)|0;
$35 = (($1) + ($$sum7)|0);
$36 = (_ttUSHORT($35)|0);
$37 = ($34&65535) >>> 1;
$38 = $37&65535;
$39 = $38 << 1;
$$sum9 = (($39) + ($31))|0;
$40 = (($1) + ($$sum9)|0);
$41 = (_ttUSHORT($40)|0);
$42 = $41&65535;
$43 = ($42|0)>($unicode_codepoint|0);
$$ = $43 ? $31 : $$sum9;
$44 = (($$) + -2)|0;
$45 = ($36<<16>>16)==(0);
if ($45) {
$search$1$lcssa = $44;
} else {
$$sum6 = (($3) + 8)|0;
$46 = (($1) + ($$sum6)|0);
$47 = (_ttUSHORT($46)|0);
$48 = ($47&65535) >>> 1;
$entrySelector$039 = $36;$search$138 = $44;$searchRange$040 = $48;
while(1) {
$49 = ($searchRange$040&65535) >>> 1;
$50 = $49&65535;
$51 = $50 << 1;
$$sum27 = (($51) + ($search$138))|0;
$52 = (($1) + ($$sum27)|0);
$53 = (_ttUSHORT($52)|0);
$54 = $53&65535;
$55 = ($54|0)<($unicode_codepoint|0);
$$search$1 = $55 ? $$sum27 : $search$138;
$56 = (($entrySelector$039) + -1)<<16>>16;
$57 = ($56<<16>>16)==(0);
if ($57) {
$search$1$lcssa = $$search$1;
break;
} else {
$entrySelector$039 = $56;$search$138 = $$search$1;$searchRange$040 = $49;
}
}
}
$$neg = (-14 - ($3))|0;
$58 = (($$neg) + 2)|0;
$59 = (($58) + ($search$1$lcssa))|0;
$60 = $59 & 131070;
$$sum10 = (($60) + ($31))|0;
$61 = (($1) + ($$sum10)|0);
$62 = (_ttUSHORT($61)|0);
$63 = $62&65535;
$64 = ($63|0)<($unicode_codepoint|0);
if ($64) {
___assert_fail((14211|0),(14173|0),1130,(14190|0));
// unreachable;
}
$65 = $30&65535;
$66 = $65 << 1;
$$sum12 = (($3) + 16)|0;
$$sum13 = (($$sum12) + ($66))|0;
$$sum14 = (($$sum13) + ($60))|0;
$67 = (($1) + ($$sum14)|0);
$68 = (_ttUSHORT($67)|0);
$69 = $68&65535;
$70 = ($69|0)>($unicode_codepoint|0);
if ($70) {
$$0 = 0;
return ($$0|0);
}
$71 = ($65*6)|0;
$$sum15 = (($3) + 16)|0;
$$sum16 = (($$sum15) + ($71))|0;
$$sum17 = (($$sum16) + ($60))|0;
$72 = (($1) + ($$sum17)|0);
$73 = (_ttUSHORT($72)|0);
$74 = ($73<<16>>16)==(0);
if ($74) {
$75 = $65 << 2;
$$sum24 = (($3) + 16)|0;
$$sum25 = (($$sum24) + ($75))|0;
$$sum26 = (($$sum25) + ($60))|0;
$76 = (($1) + ($$sum26)|0);
$77 = (_ttSHORT($76)|0);
$78 = $77&65535;
$79 = (($78) + ($unicode_codepoint))|0;
$80 = $79 & 65535;
$$0 = $80;
return ($$0|0);
} else {
$81 = $73&65535;
$82 = (($unicode_codepoint) - ($69))|0;
$83 = $82 << 1;
$$sum19 = (($3) + 16)|0;
$$sum20 = (($$sum19) + ($71))|0;
$$sum21 = (($$sum20) + ($60))|0;
$$sum22 = (($$sum21) + ($83))|0;
$$sum23 = (($$sum22) + ($81))|0;
$84 = (($1) + ($$sum23)|0);
$85 = (_ttUSHORT($84)|0);
$86 = $85&65535;
$$0 = $86;
return ($$0|0);
}
break;
}
default: {
$87 = ($5<<16>>16)==(12);
$88 = $5 & -2;
$switch = ($88<<16>>16)==(12);
if (!($switch)) {
___assert_fail((19474|0),(14173|0),1165,(14190|0));
// unreachable;
}
$$sum = (($3) + 12)|0;
$89 = (($1) + ($$sum)|0);
$90 = (_ttULONG($89)|0);
$$sum1 = (($3) + 16)|0;
$high$0$ph = $90;$low$0$ph = 0;
L6: while(1) {
$high$0 = $high$0$ph;
while(1) {
$91 = ($high$0|0)>($low$0$ph|0);
if (!($91)) {
$$0 = 0;
label = 27;
break L6;
}
$92 = (($high$0) - ($low$0$ph))|0;
$93 = $92 >> 1;
$94 = (($93) + ($low$0$ph))|0;
$95 = ($94*12)|0;
$$sum2 = (($$sum1) + ($95))|0;
$96 = (($1) + ($$sum2)|0);
$97 = (_ttULONG($96)|0);
$98 = ($97>>>0)>($unicode_codepoint>>>0);
if ($98) {
$high$0 = $94;
} else {
$$lcssa = $94;$$lcssa50 = $97;$$sum2$lcssa = $$sum2;$high$0$lcssa49 = $high$0;
break;
}
}
$$sum3 = (($$sum2$lcssa) + 4)|0;
$99 = (($1) + ($$sum3)|0);
$100 = (_ttULONG($99)|0);
$101 = ($100>>>0)<($unicode_codepoint>>>0);
$102 = (($$lcssa) + 1)|0;
if ($101) {
$high$0$ph = $high$0$lcssa49;$low$0$ph = $102;
} else {
$$lcssa50$lcssa = $$lcssa50;$$sum2$lcssa$lcssa = $$sum2$lcssa;
break;
}
}
if ((label|0) == 27) {
return ($$0|0);
}
$$sum4 = (($$sum2$lcssa$lcssa) + 8)|0;
$103 = (($1) + ($$sum4)|0);
$104 = (_ttULONG($103)|0);
if (!($87)) {
$$0 = $104;
return ($$0|0);
}
$105 = (($unicode_codepoint) - ($$lcssa50$lcssa))|0;
$106 = (($105) + ($104))|0;
$$0 = $106;
return ($$0|0);
}
}
return (0)|0;
}
function _stbtt_GetGlyphShape($info,$glyph_index,$pvertices) {
$info = $info|0;
$glyph_index = $glyph_index|0;
$pvertices = $pvertices|0;
var $$0 = 0, $$sum = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0.0;
var $163 = 0, $164 = 0, $165 = 0.0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
var $181 = 0, $182 = 0, $183 = 0.0, $184 = 0.0, $185 = 0, $186 = 0, $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0.0, $195 = 0.0, $196 = 0, $197 = 0, $198 = 0.0, $199 = 0.0;
var $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0.0, $203 = 0.0, $204 = 0, $205 = 0, $206 = 0, $207 = 0.0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0, $211 = 0.0, $212 = 0.0, $213 = 0.0, $214 = 0.0, $215 = 0.0, $216 = 0.0;
var $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0.0, $226 = 0.0, $227 = 0.0, $228 = 0.0, $229 = 0.0, $23 = 0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0.0, $234 = 0.0;
var $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0.0, $244 = 0.0, $245 = 0.0, $246 = 0.0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0, $250 = 0, $251 = 0.0, $252 = 0.0;
var $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0;
var $271 = 0, $272 = 0, $273 = 0, $274 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
var $97 = 0, $98 = 0, $99 = 0, $comp$046 = 0, $comp$1 = 0, $comp$2 = 0, $comp_verts = 0, $cx$024 = 0, $cx$1 = 0, $cx$1$lcssa = 0, $cy$025 = 0, $cy$1 = 0, $cy$1$lcssa = 0, $exitcond = 0, $exitcond51 = 0, $exitcond52 = 0, $exitcond53 = 0, $flagcount$043 = 0, $flagcount$1 = 0, $flags$044 = 0;
var $flags$1 = 0, $i$042 = 0, $i$140 = 0, $i$237 = 0, $i$333 = 0, $i$4 = 0, $i$5 = 0, $i2$045 = 0, $j$032 = 0, $j$1 = 0, $mtx$sroa$0$0 = 0.0, $mtx$sroa$15$0 = 0.0, $mtx$sroa$22$0 = 0.0, $mtx$sroa$29$0 = 0.0, $mtx$sroa$33$0 = 0.0, $mtx$sroa$8$0 = 0.0, $next_move$031 = 0, $next_move$1 = 0, $num_vertices$034 = 0, $num_vertices$1 = 0;
var $num_vertices$3 = 0, $num_vertices$3$lcssa = 0, $num_vertices$447 = 0, $num_vertices$5 = 0, $num_vertices$6 = 0, $points$041 = 0, $points$1 = 0, $points$1$lcssa = 0, $points$239 = 0, $points$3 = 0, $points$3$lcssa = 0, $points$436 = 0, $points$5 = 0, $scx$028 = 0, $scx$1 = 0, $scx$2 = 0, $scx$2$lcssa = 0, $scy$029 = 0, $scy$1 = 0, $scy$2 = 0;
var $scy$2$lcssa = 0, $sext = 0, $sext8 = 0, $sqrtf = 0.0, $sqrtf1 = 0.0, $start_off$023 = 0, $start_off$1 = 0, $start_off$1$lcssa = 0, $sx$026 = 0, $sx$1 = 0, $sx$2 = 0, $sx$2$lcssa = 0, $sy$027 = 0, $sy$1 = 0, $sy$2 = 0, $sy$2$lcssa = 0, $vertices$048 = 0, $vertices$048$lcssa60 = 0, $vertices$1 = 0, $vertices$2 = 0;
var $was_off$030 = 0, $was_off$1 = 0, $was_off$1$lcssa = 0, $x$038 = 0, $x$1 = 0, $y$035 = 0, $y$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$comp_verts = sp;
$0 = ((($info)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = (_stbtt__GetGlyfOffset($info,$glyph_index)|0);
HEAP32[$pvertices>>2] = 0;
$3 = ($2|0)<(0);
if ($3) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$4 = (($1) + ($2)|0);
$5 = (_ttSHORT($4)|0);
$6 = ($5<<16>>16)>(0);
L4: do {
if ($6) {
$7 = $5 << 16 >> 16;
$$sum2 = (($2) + 10)|0;
$8 = $7 << 1;
$$sum3 = (($8) + ($$sum2))|0;
$9 = (($1) + ($$sum3)|0);
$10 = (_ttUSHORT($9)|0);
$$sum6 = (($$sum3) + -2)|0;
$11 = (($1) + ($$sum6)|0);
$12 = (_ttUSHORT($11)|0);
$13 = $12&65535;
$14 = (($13) + 1)|0;
$15 = (($14) + ($8))|0;
$16 = ($15*10)|0;
$17 = (_malloc($16)|0);
$18 = ($17|0)==(0|0);
if ($18) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$$sum4 = (($$sum3) + 2)|0;
$19 = $10&65535;
$$sum5 = (($$sum4) + ($19))|0;
$20 = (($1) + ($$sum5)|0);
$21 = $12&65535;
$flagcount$043 = 0;$flags$044 = 0;$i$042 = 0;$points$041 = $20;
while(1) {
$23 = ($flagcount$043<<24>>24)==(0);
if ($23) {
$24 = ((($points$041)) + 1|0);
$25 = HEAP8[$points$041>>0]|0;
$26 = $25 & 8;
$27 = ($26<<24>>24)==(0);
if ($27) {
$flagcount$1 = 0;$flags$1 = $25;$points$1 = $24;
} else {
$28 = ((($points$041)) + 2|0);
$29 = HEAP8[$24>>0]|0;
$flagcount$1 = $29;$flags$1 = $25;$points$1 = $28;
}
} else {
$30 = (($flagcount$043) + -1)<<24>>24;
$flagcount$1 = $30;$flags$1 = $flags$044;$points$1 = $points$041;
}
$31 = (($i$042) + ($8))|0;
$32 = (((($17) + (($31*10)|0)|0)) + 8|0);
HEAP8[$32>>0] = $flags$1;
$33 = (($i$042) + 1)|0;
$exitcond52 = ($i$042|0)==($21|0);
if ($exitcond52) {
$points$1$lcssa = $points$1;
break;
} else {
$flagcount$043 = $flagcount$1;$flags$044 = $flags$1;$i$042 = $33;$points$041 = $points$1;
}
}
$22 = $12&65535;
$i$140 = 0;$points$239 = $points$1$lcssa;$x$038 = 0;
while(1) {
$35 = (($i$140) + ($8))|0;
$36 = (((($17) + (($35*10)|0)|0)) + 8|0);
$37 = HEAP8[$36>>0]|0;
$38 = $37&255;
$39 = $38 & 2;
$40 = ($39|0)==(0);
if ($40) {
$49 = $38 & 16;
$50 = ($49|0)==(0);
if ($50) {
$51 = HEAP8[$points$239>>0]|0;
$52 = $51&255;
$53 = $52 << 8;
$54 = ((($points$239)) + 1|0);
$55 = HEAP8[$54>>0]|0;
$56 = $55&255;
$57 = $53 | $56;
$sext8 = $57 << 16;
$58 = $sext8 >> 16;
$59 = (($58) + ($x$038))|0;
$60 = ((($points$239)) + 2|0);
$points$3 = $60;$x$1 = $59;
} else {
$points$3 = $points$239;$x$1 = $x$038;
}
} else {
$41 = ((($points$239)) + 1|0);
$42 = HEAP8[$points$239>>0]|0;
$43 = $38 & 16;
$44 = ($43|0)!=(0);
$45 = $42&255;
$46 = (0 - ($45))|0;
$47 = $44 ? $45 : $46;
$48 = (($47) + ($x$038))|0;
$points$3 = $41;$x$1 = $48;
}
$61 = $x$1&65535;
$62 = (($17) + (($35*10)|0)|0);
HEAP16[$62>>1] = $61;
$63 = (($i$140) + 1)|0;
$exitcond51 = ($i$140|0)==($22|0);
if ($exitcond51) {
$points$3$lcssa = $points$3;
break;
} else {
$i$140 = $63;$points$239 = $points$3;$x$038 = $x$1;
}
}
$34 = $12&65535;
$i$237 = 0;$points$436 = $points$3$lcssa;$y$035 = 0;
while(1) {
$64 = (($i$237) + ($8))|0;
$65 = (((($17) + (($64*10)|0)|0)) + 8|0);
$66 = HEAP8[$65>>0]|0;
$67 = $66&255;
$68 = $67 & 4;
$69 = ($68|0)==(0);
if ($69) {
$78 = $67 & 32;
$79 = ($78|0)==(0);
if ($79) {
$80 = HEAP8[$points$436>>0]|0;
$81 = $80&255;
$82 = $81 << 8;
$83 = ((($points$436)) + 1|0);
$84 = HEAP8[$83>>0]|0;
$85 = $84&255;
$86 = $82 | $85;
$sext = $86 << 16;
$87 = $sext >> 16;
$88 = (($87) + ($y$035))|0;
$89 = ((($points$436)) + 2|0);
$points$5 = $89;$y$1 = $88;
} else {
$points$5 = $points$436;$y$1 = $y$035;
}
} else {
$70 = ((($points$436)) + 1|0);
$71 = HEAP8[$points$436>>0]|0;
$72 = $67 & 32;
$73 = ($72|0)!=(0);
$74 = $71&255;
$75 = (0 - ($74))|0;
$76 = $73 ? $74 : $75;
$77 = (($76) + ($y$035))|0;
$points$5 = $70;$y$1 = $77;
}
$90 = $y$1&65535;
$91 = (((($17) + (($64*10)|0)|0)) + 2|0);
HEAP16[$91>>1] = $90;
$92 = (($i$237) + 1)|0;
$exitcond = ($i$237|0)==($34|0);
if ($exitcond) {
$cx$024 = 0;$cy$025 = 0;$i$333 = 0;$j$032 = 0;$next_move$031 = 0;$num_vertices$034 = 0;$scx$028 = 0;$scy$029 = 0;$start_off$023 = 0;$sx$026 = 0;$sy$027 = 0;$was_off$030 = 0;
break;
} else {
$i$237 = $92;$points$436 = $points$5;$y$035 = $y$1;
}
}
while(1) {
$93 = (($i$333) + ($8))|0;
$94 = (((($17) + (($93*10)|0)|0)) + 8|0);
$95 = HEAP8[$94>>0]|0;
$96 = (($17) + (($93*10)|0)|0);
$97 = HEAP16[$96>>1]|0;
$98 = $97 << 16 >> 16;
$99 = (((($17) + (($93*10)|0)|0)) + 2|0);
$100 = HEAP16[$99>>1]|0;
$101 = $100 << 16 >> 16;
$102 = ($next_move$031|0)==($i$333|0);
do {
if ($102) {
$103 = ($i$333|0)==(0);
if ($103) {
$num_vertices$1 = $num_vertices$034;
} else {
$104 = (_stbtt__close_shape($17,$num_vertices$034,$was_off$030,$start_off$023,$sx$026,$sy$027,$scx$028,$scy$029,$cx$024,$cy$025)|0);
$num_vertices$1 = $104;
}
$105 = $95 & 1;
$106 = ($105<<24>>24)==(0);
$107 = $105 ^ 1;
$108 = $107&255;
do {
if ($106) {
$109 = (($93) + 1)|0;
$110 = (((($17) + (($109*10)|0)|0)) + 8|0);
$111 = HEAP8[$110>>0]|0;
$112 = $111 & 1;
$113 = ($112<<24>>24)==(0);
$114 = (($17) + (($109*10)|0)|0);
$115 = HEAP16[$114>>1]|0;
$116 = $115 << 16 >> 16;
if ($113) {
$117 = (($116) + ($98))|0;
$118 = $117 >> 1;
$119 = (((($17) + (($109*10)|0)|0)) + 2|0);
$120 = HEAP16[$119>>1]|0;
$121 = $120 << 16 >> 16;
$122 = (($121) + ($101))|0;
$123 = $122 >> 1;
$i$4 = $i$333;$scx$1 = $98;$scy$1 = $101;$sx$1 = $118;$sy$1 = $123;
break;
} else {
$124 = (((($17) + (($109*10)|0)|0)) + 2|0);
$125 = HEAP16[$124>>1]|0;
$126 = $125 << 16 >> 16;
$127 = (($i$333) + 1)|0;
$i$4 = $127;$scx$1 = $98;$scy$1 = $101;$sx$1 = $116;$sy$1 = $126;
break;
}
} else {
$i$4 = $i$333;$scx$1 = $scx$028;$scy$1 = $scy$029;$sx$1 = $98;$sy$1 = $101;
}
} while(0);
$128 = (($num_vertices$1) + 1)|0;
$129 = (($17) + (($num_vertices$1*10)|0)|0);
_stbtt_setvertex($129,1,$sx$1,$sy$1,0,0);
$130 = $j$032 << 1;
$$sum7 = (($130) + ($$sum2))|0;
$131 = (($1) + ($$sum7)|0);
$132 = (_ttUSHORT($131)|0);
$133 = $132&65535;
$134 = (($133) + 1)|0;
$135 = (($j$032) + 1)|0;
$cx$1 = $cx$024;$cy$1 = $cy$025;$i$5 = $i$4;$j$1 = $135;$next_move$1 = $134;$num_vertices$3 = $128;$scx$2 = $scx$1;$scy$2 = $scy$1;$start_off$1 = $108;$sx$2 = $sx$1;$sy$2 = $sy$1;$was_off$1 = 0;
} else {
$136 = $95 & 1;
$137 = ($136<<24>>24)==(0);
$138 = ($was_off$030|0)!=(0);
if ($137) {
if (!($138)) {
$cx$1 = $98;$cy$1 = $101;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $num_vertices$034;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 1;
break;
}
$139 = (($num_vertices$034) + 1)|0;
$140 = (($17) + (($num_vertices$034*10)|0)|0);
$141 = (($98) + ($cx$024))|0;
$142 = $141 >> 1;
$143 = (($101) + ($cy$025))|0;
$144 = $143 >> 1;
_stbtt_setvertex($140,3,$142,$144,$cx$024,$cy$025);
$cx$1 = $98;$cy$1 = $101;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $139;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 1;
break;
}
$145 = (($num_vertices$034) + 1)|0;
$146 = (($17) + (($num_vertices$034*10)|0)|0);
if ($138) {
_stbtt_setvertex($146,3,$98,$101,$cx$024,$cy$025);
$cx$1 = $cx$024;$cy$1 = $cy$025;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $145;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 0;
break;
} else {
_stbtt_setvertex($146,2,$98,$101,0,0);
$cx$1 = $cx$024;$cy$1 = $cy$025;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $145;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 0;
break;
}
}
} while(0);
$147 = (($i$5) + 1)|0;
$148 = ($147|0)<($14|0);
if ($148) {
$cx$024 = $cx$1;$cy$025 = $cy$1;$i$333 = $147;$j$032 = $j$1;$next_move$031 = $next_move$1;$num_vertices$034 = $num_vertices$3;$scx$028 = $scx$2;$scy$029 = $scy$2;$start_off$023 = $start_off$1;$sx$026 = $sx$2;$sy$027 = $sy$2;$was_off$030 = $was_off$1;
} else {
$cx$1$lcssa = $cx$1;$cy$1$lcssa = $cy$1;$num_vertices$3$lcssa = $num_vertices$3;$scx$2$lcssa = $scx$2;$scy$2$lcssa = $scy$2;$start_off$1$lcssa = $start_off$1;$sx$2$lcssa = $sx$2;$sy$2$lcssa = $sy$2;$was_off$1$lcssa = $was_off$1;
break;
}
}
$149 = (_stbtt__close_shape($17,$num_vertices$3$lcssa,$was_off$1$lcssa,$start_off$1$lcssa,$sx$2$lcssa,$sy$2$lcssa,$scx$2$lcssa,$scy$2$lcssa,$cx$1$lcssa,$cy$1$lcssa)|0);
$num_vertices$6 = $149;$vertices$2 = $17;
} else {
$150 = ($5<<16>>16)==(-1);
if (!($150)) {
$274 = ($5<<16>>16)<(0);
if (!($274)) {
$num_vertices$6 = 0;$vertices$2 = 0;
break;
}
___assert_fail((19474|0),(14173|0),1460,(14267|0));
// unreachable;
}
$$sum = (($2) + 10)|0;
$151 = (($1) + ($$sum)|0);
$comp$046 = $151;$num_vertices$447 = 0;$vertices$048 = 0;
while(1) {
HEAP32[$comp_verts>>2] = 0;
$152 = (_ttSHORT($comp$046)|0);
$153 = ((($comp$046)) + 2|0);
$154 = (_ttSHORT($153)|0);
$155 = ((($comp$046)) + 4|0);
$156 = $152&65535;
$157 = $156 & 2;
$158 = ($157|0)==(0);
if ($158) {
label = 44;
break;
}
$159 = $156 & 1;
$160 = ($159|0)==(0);
if ($160) {
$167 = HEAP8[$155>>0]|0;
$168 = (+($167<<24>>24));
$169 = ((($comp$046)) + 5|0);
$170 = HEAP8[$169>>0]|0;
$171 = (+($170<<24>>24));
$172 = ((($comp$046)) + 6|0);
$179 = 8;$190 = 10;$205 = 12;$210 = 14;$comp$1 = $172;$mtx$sroa$29$0 = $168;$mtx$sroa$33$0 = $171;
} else {
$161 = (_ttSHORT($155)|0);
$162 = (+($161<<16>>16));
$163 = ((($comp$046)) + 6|0);
$164 = (_ttSHORT($163)|0);
$165 = (+($164<<16>>16));
$166 = ((($comp$046)) + 8|0);
$179 = 10;$190 = 12;$205 = 14;$210 = 16;$comp$1 = $166;$mtx$sroa$29$0 = $162;$mtx$sroa$33$0 = $165;
}
$173 = $156 & 8;
$174 = ($173|0)==(0);
do {
if ($174) {
$180 = $156 & 64;
$181 = ($180|0)==(0);
if (!($181)) {
$182 = (_ttSHORT($comp$1)|0);
$183 = (+($182<<16>>16));
$184 = $183 * 6.103515625E-5;
$185 = (($comp$046) + ($179)|0);
$186 = (_ttSHORT($185)|0);
$187 = (+($186<<16>>16));
$188 = $187 * 6.103515625E-5;
$189 = (($comp$046) + ($190)|0);
$comp$2 = $189;$mtx$sroa$0$0 = $184;$mtx$sroa$15$0 = 0.0;$mtx$sroa$22$0 = $188;$mtx$sroa$8$0 = 0.0;
break;
}
$191 = $156 & 128;
$192 = ($191|0)==(0);
if ($192) {
$comp$2 = $comp$1;$mtx$sroa$0$0 = 1.0;$mtx$sroa$15$0 = 0.0;$mtx$sroa$22$0 = 1.0;$mtx$sroa$8$0 = 0.0;
} else {
$193 = (_ttSHORT($comp$1)|0);
$194 = (+($193<<16>>16));
$195 = $194 * 6.103515625E-5;
$196 = (($comp$046) + ($179)|0);
$197 = (_ttSHORT($196)|0);
$198 = (+($197<<16>>16));
$199 = $198 * 6.103515625E-5;
$200 = (($comp$046) + ($190)|0);
$201 = (_ttSHORT($200)|0);
$202 = (+($201<<16>>16));
$203 = $202 * 6.103515625E-5;
$204 = (($comp$046) + ($205)|0);
$206 = (_ttSHORT($204)|0);
$207 = (+($206<<16>>16));
$208 = $207 * 6.103515625E-5;
$209 = (($comp$046) + ($210)|0);
$comp$2 = $209;$mtx$sroa$0$0 = $195;$mtx$sroa$15$0 = $203;$mtx$sroa$22$0 = $208;$mtx$sroa$8$0 = $199;
}
} else {
$175 = (_ttSHORT($comp$1)|0);
$176 = (+($175<<16>>16));
$177 = $176 * 6.103515625E-5;
$178 = (($comp$046) + ($179)|0);
$comp$2 = $178;$mtx$sroa$0$0 = $177;$mtx$sroa$15$0 = 0.0;$mtx$sroa$22$0 = $177;$mtx$sroa$8$0 = 0.0;
}
} while(0);
$211 = $mtx$sroa$0$0 * $mtx$sroa$0$0;
$212 = $mtx$sroa$8$0 * $mtx$sroa$8$0;
$213 = $212 + $211;
$sqrtf = (+Math_sqrt((+$213)));
$214 = $mtx$sroa$15$0 * $mtx$sroa$15$0;
$215 = $mtx$sroa$22$0 * $mtx$sroa$22$0;
$216 = $215 + $214;
$sqrtf1 = (+Math_sqrt((+$216)));
$217 = $154&65535;
$218 = (_stbtt_GetGlyphShape($info,$217,$comp_verts)|0);
$219 = ($218|0)>(0);
if ($219) {
$220 = HEAP32[$comp_verts>>2]|0;
$i2$045 = 0;
while(1) {
$221 = (($220) + (($i2$045*10)|0)|0);
$222 = HEAP16[$221>>1]|0;
$223 = (((($220) + (($i2$045*10)|0)|0)) + 2|0);
$224 = HEAP16[$223>>1]|0;
$225 = (+($222<<16>>16));
$226 = $mtx$sroa$0$0 * $225;
$227 = (+($224<<16>>16));
$228 = $mtx$sroa$15$0 * $227;
$229 = $226 + $228;
$230 = $mtx$sroa$29$0 + $229;
$231 = $sqrtf * $230;
$232 = (~~(($231)));
HEAP16[$221>>1] = $232;
$233 = $mtx$sroa$8$0 * $225;
$234 = $mtx$sroa$22$0 * $227;
$235 = $233 + $234;
$236 = $mtx$sroa$33$0 + $235;
$237 = $sqrtf1 * $236;
$238 = (~~(($237)));
HEAP16[$223>>1] = $238;
$239 = (((($220) + (($i2$045*10)|0)|0)) + 4|0);
$240 = HEAP16[$239>>1]|0;
$241 = (((($220) + (($i2$045*10)|0)|0)) + 6|0);
$242 = HEAP16[$241>>1]|0;
$243 = (+($240<<16>>16));
$244 = $mtx$sroa$0$0 * $243;
$245 = (+($242<<16>>16));
$246 = $mtx$sroa$15$0 * $245;
$247 = $244 + $246;
$248 = $mtx$sroa$29$0 + $247;
$249 = $sqrtf * $248;
$250 = (~~(($249)));
HEAP16[$239>>1] = $250;
$251 = $mtx$sroa$8$0 * $243;
$252 = $mtx$sroa$22$0 * $245;
$253 = $251 + $252;
$254 = $mtx$sroa$33$0 + $253;
$255 = $sqrtf1 * $254;
$256 = (~~(($255)));
HEAP16[$241>>1] = $256;
$257 = (($i2$045) + 1)|0;
$exitcond53 = ($257|0)==($218|0);
if ($exitcond53) {
break;
} else {
$i2$045 = $257;
}
}
$258 = (($218) + ($num_vertices$447))|0;
$259 = ($258*10)|0;
$260 = (_malloc($259)|0);
$261 = ($260|0)==(0|0);
if ($261) {
$vertices$048$lcssa60 = $vertices$048;
break;
}
$265 = ($num_vertices$447|0)>(0);
if ($265) {
$266 = ($num_vertices$447*10)|0;
_memcpy(($260|0),($vertices$048|0),($266|0))|0;
}
$267 = (($260) + (($num_vertices$447*10)|0)|0);
$268 = HEAP32[$comp_verts>>2]|0;
$269 = ($218*10)|0;
_memcpy(($267|0),($268|0),($269|0))|0;
$270 = ($vertices$048|0)==(0|0);
if (!($270)) {
_free($vertices$048);
}
$271 = HEAP32[$comp_verts>>2]|0;
_free($271);
$num_vertices$5 = $258;$vertices$1 = $260;
} else {
$num_vertices$5 = $num_vertices$447;$vertices$1 = $vertices$048;
}
$272 = $156 & 32;
$273 = ($272|0)==(0);
if ($273) {
$num_vertices$6 = $num_vertices$5;$vertices$2 = $vertices$1;
break L4;
} else {
$comp$046 = $comp$2;$num_vertices$447 = $num_vertices$5;$vertices$048 = $vertices$1;
}
}
if ((label|0) == 44) {
___assert_fail((19474|0),(14173|0),1407,(14267|0));
// unreachable;
}
$262 = ($vertices$048$lcssa60|0)==(0|0);
if (!($262)) {
_free($vertices$048$lcssa60);
}
$263 = HEAP32[$comp_verts>>2]|0;
$264 = ($263|0)==(0|0);
if ($264) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
_free($263);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
} while(0);
HEAP32[$pvertices>>2] = $vertices$2;
$$0 = $num_vertices$6;
STACKTOP = sp;return ($$0|0);
}
function _stbtt_GetGlyphBox($info,$glyph_index,$x0,$y0,$x1,$y1) {
$info = $info|0;
$glyph_index = $glyph_index|0;
$x0 = $x0|0;
$y0 = $y0|0;
$x1 = $x1|0;
$y1 = $y1|0;
var $$0 = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbtt__GetGlyfOffset($info,$glyph_index)|0);
$1 = ($0|0)<(0);
if ($1) {
$$0 = 0;
return ($$0|0);
}
$2 = ($x0|0)==(0|0);
if (!($2)) {
$3 = ((($info)) + 4|0);
$4 = HEAP32[$3>>2]|0;
$$sum3 = (($0) + 2)|0;
$5 = (($4) + ($$sum3)|0);
$6 = (_ttSHORT($5)|0);
$7 = $6 << 16 >> 16;
HEAP32[$x0>>2] = $7;
}
$8 = ($y0|0)==(0|0);
if (!($8)) {
$9 = ((($info)) + 4|0);
$10 = HEAP32[$9>>2]|0;
$$sum2 = (($0) + 4)|0;
$11 = (($10) + ($$sum2)|0);
$12 = (_ttSHORT($11)|0);
$13 = $12 << 16 >> 16;
HEAP32[$y0>>2] = $13;
}
$14 = ($x1|0)==(0|0);
if (!($14)) {
$15 = ((($info)) + 4|0);
$16 = HEAP32[$15>>2]|0;
$$sum1 = (($0) + 6)|0;
$17 = (($16) + ($$sum1)|0);
$18 = (_ttSHORT($17)|0);
$19 = $18 << 16 >> 16;
HEAP32[$x1>>2] = $19;
}
$20 = ($y1|0)==(0|0);
if ($20) {
$$0 = 1;
return ($$0|0);
}
$21 = ((($info)) + 4|0);
$22 = HEAP32[$21>>2]|0;
$$sum = (($0) + 8)|0;
$23 = (($22) + ($$sum)|0);
$24 = (_ttSHORT($23)|0);
$25 = $24 << 16 >> 16;
HEAP32[$y1>>2] = $25;
$$0 = 1;
return ($$0|0);
}
function _stbtt_GetGlyphHMetrics($info,$glyph_index,$advanceWidth,$leftSideBearing) {
$info = $info|0;
$glyph_index = $glyph_index|0;
$advanceWidth = $advanceWidth|0;
$leftSideBearing = $leftSideBearing|0;
var $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum47 = 0, $$sum5 = 0, $$sum6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
var $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($info)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($info)) + 28|0);
$3 = HEAP32[$2>>2]|0;
$$sum = (($3) + 34)|0;
$4 = (($1) + ($$sum)|0);
$5 = (_ttUSHORT($4)|0);
$6 = $5&65535;
$7 = ($6|0)>($glyph_index|0);
$8 = ($advanceWidth|0)!=(0|0);
if ($7) {
if ($8) {
$9 = ((($info)) + 32|0);
$10 = HEAP32[$9>>2]|0;
$11 = $glyph_index << 2;
$$sum6 = (($10) + ($11))|0;
$12 = (($1) + ($$sum6)|0);
$13 = (_ttSHORT($12)|0);
$14 = $13 << 16 >> 16;
HEAP32[$advanceWidth>>2] = $14;
}
$15 = ($leftSideBearing|0)==(0|0);
if ($15) {
return;
}
$16 = HEAP32[$0>>2]|0;
$17 = ((($info)) + 32|0);
$18 = HEAP32[$17>>2]|0;
$19 = $glyph_index << 2;
$$sum47 = $19 | 2;
$$sum5 = (($$sum47) + ($18))|0;
$20 = (($16) + ($$sum5)|0);
$21 = (_ttSHORT($20)|0);
$22 = $21 << 16 >> 16;
HEAP32[$leftSideBearing>>2] = $22;
return;
} else {
if ($8) {
$23 = ((($info)) + 32|0);
$24 = HEAP32[$23>>2]|0;
$25 = $6 << 2;
$26 = (($25) + -4)|0;
$$sum3 = (($26) + ($24))|0;
$27 = (($1) + ($$sum3)|0);
$28 = (_ttSHORT($27)|0);
$29 = $28 << 16 >> 16;
HEAP32[$advanceWidth>>2] = $29;
}
$30 = ($leftSideBearing|0)==(0|0);
if ($30) {
return;
}
$31 = HEAP32[$0>>2]|0;
$32 = ((($info)) + 32|0);
$33 = HEAP32[$32>>2]|0;
$34 = $6 << 2;
$35 = (($glyph_index) - ($6))|0;
$36 = $35 << 1;
$$sum1 = (($36) + ($34))|0;
$$sum2 = (($$sum1) + ($33))|0;
$37 = (($31) + ($$sum2)|0);
$38 = (_ttSHORT($37)|0);
$39 = $38 << 16 >> 16;
HEAP32[$leftSideBearing>>2] = $39;
return;
}
}
function _stbtt_ScaleForPixelHeight($info,$height) {
$info = $info|0;
$height = +$height;
var $$sum = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($info)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($info)) + 28|0);
$3 = HEAP32[$2>>2]|0;
$$sum = (($3) + 4)|0;
$4 = (($1) + ($$sum)|0);
$5 = (_ttSHORT($4)|0);
$6 = $5 << 16 >> 16;
$$sum1 = (($3) + 6)|0;
$7 = (($1) + ($$sum1)|0);
$8 = (_ttSHORT($7)|0);
$9 = $8 << 16 >> 16;
$10 = (($6) - ($9))|0;
$11 = (+($10|0));
$12 = $height / $11;
return (+$12);
}
function _stbtt_GetGlyphBitmapBoxSubpixel($font,$glyph,$scale_x,$scale_y,$shift_x,$shift_y,$ix0,$iy0,$ix1,$iy1) {
$font = $font|0;
$glyph = $glyph|0;
$scale_x = +$scale_x;
$scale_y = +$scale_y;
$shift_x = +$shift_x;
$shift_y = +$shift_y;
$ix0 = $ix0|0;
$iy0 = $iy0|0;
$ix1 = $ix1|0;
$iy1 = $iy1|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $ceilf = 0.0, $ceilf1 = 0.0, $floorf = 0.0, $floorf2 = 0.0, $x0 = 0, $x1 = 0, $y0 = 0, $y1 = 0, label = 0;
var sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$x0 = sp + 12|0;
$y0 = sp + 8|0;
$x1 = sp + 4|0;
$y1 = sp;
HEAP32[$x0>>2] = 0;
HEAP32[$y0>>2] = 0;
$0 = (_stbtt_GetGlyphBox($font,$glyph,$x0,$y0,$x1,$y1)|0);
$1 = ($0|0)==(0);
$2 = ($ix0|0)!=(0|0);
if ($1) {
if ($2) {
HEAP32[$ix0>>2] = 0;
}
$3 = ($iy0|0)==(0|0);
if (!($3)) {
HEAP32[$iy0>>2] = 0;
}
$4 = ($ix1|0)==(0|0);
if (!($4)) {
HEAP32[$ix1>>2] = 0;
}
$5 = ($iy1|0)==(0|0);
if ($5) {
STACKTOP = sp;return;
}
HEAP32[$iy1>>2] = 0;
STACKTOP = sp;return;
} else {
if ($2) {
$6 = HEAP32[$x0>>2]|0;
$7 = (+($6|0));
$8 = $7 * $scale_x;
$9 = $8 + $shift_x;
$floorf2 = (+Math_floor((+$9)));
$10 = (~~(($floorf2)));
HEAP32[$ix0>>2] = $10;
}
$11 = ($iy0|0)==(0|0);
if (!($11)) {
$12 = HEAP32[$y1>>2]|0;
$13 = (0 - ($12))|0;
$14 = (+($13|0));
$15 = $14 * $scale_y;
$16 = $15 + $shift_y;
$floorf = (+Math_floor((+$16)));
$17 = (~~(($floorf)));
HEAP32[$iy0>>2] = $17;
}
$18 = ($ix1|0)==(0|0);
if (!($18)) {
$19 = HEAP32[$x1>>2]|0;
$20 = (+($19|0));
$21 = $20 * $scale_x;
$22 = $21 + $shift_x;
$ceilf1 = (+Math_ceil((+$22)));
$23 = (~~(($ceilf1)));
HEAP32[$ix1>>2] = $23;
}
$24 = ($iy1|0)==(0|0);
if ($24) {
STACKTOP = sp;return;
}
$25 = HEAP32[$y0>>2]|0;
$26 = (0 - ($25))|0;
$27 = (+($26|0));
$28 = $27 * $scale_y;
$29 = $28 + $shift_y;
$ceilf = (+Math_ceil((+$29)));
$30 = (~~(($ceilf)));
HEAP32[$iy1>>2] = $30;
STACKTOP = sp;return;
}
}
function _stbtt_GetGlyphBitmapBox($font,$glyph,$scale_x,$scale_y,$ix0,$iy0,$ix1,$iy1) {
$font = $font|0;
$glyph = $glyph|0;
$scale_x = +$scale_x;
$scale_y = +$scale_y;
$ix0 = $ix0|0;
$iy0 = $iy0|0;
$ix1 = $ix1|0;
$iy1 = $iy1|0;
var label = 0, sp = 0;
sp = STACKTOP;
_stbtt_GetGlyphBitmapBoxSubpixel($font,$glyph,$scale_x,$scale_y,0.0,0.0,$ix0,$iy0,$ix1,$iy1);
return;
}
function _stbtt_Rasterize($result,$flatness_in_pixels,$vertices,$num_verts,$scale_x,$scale_y,$shift_x,$shift_y,$x_off,$y_off,$invert,$userdata) {
$result = $result|0;
$flatness_in_pixels = +$flatness_in_pixels;
$vertices = $vertices|0;
$num_verts = $num_verts|0;
$scale_x = +$scale_x;
$scale_y = +$scale_y;
$shift_x = +$shift_x;
$shift_y = +$shift_y;
$x_off = $x_off|0;
$y_off = $y_off|0;
$invert = $invert|0;
$userdata = $userdata|0;
var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $winding_count = 0, $winding_lengths = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$winding_count = sp + 4|0;
$winding_lengths = sp;
$0 = $scale_x > $scale_y;
$1 = $0 ? $scale_y : $scale_x;
$2 = $flatness_in_pixels / $1;
$3 = (_stbtt_FlattenCurves($vertices,$num_verts,$2,$winding_lengths,$winding_count)|0);
$4 = ($3|0)==(0|0);
if ($4) {
STACKTOP = sp;return;
}
$5 = HEAP32[$winding_lengths>>2]|0;
$6 = HEAP32[$winding_count>>2]|0;
_stbtt__rasterize($result,$3,$5,$6,$scale_x,$scale_y,$shift_x,$shift_y,$x_off,$y_off,$invert);
$7 = HEAP32[$winding_lengths>>2]|0;
_free($7);
_free($3);
STACKTOP = sp;return;
}
function _stbtt_MakeGlyphBitmapSubpixel($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,$shift_x,$shift_y,$glyph) {
$info = $info|0;
$output = $output|0;
$out_w = $out_w|0;
$out_h = $out_h|0;
$out_stride = $out_stride|0;
$scale_x = +$scale_x;
$scale_y = +$scale_y;
$shift_x = +$shift_x;
$shift_y = +$shift_y;
$glyph = $glyph|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gbm = 0, $ix0 = 0, $iy0 = 0, $or$cond = 0, $vertices = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$ix0 = sp + 24|0;
$iy0 = sp + 20|0;
$vertices = sp + 16|0;
$gbm = sp;
$0 = (_stbtt_GetGlyphShape($info,$glyph,$vertices)|0);
_stbtt_GetGlyphBitmapBoxSubpixel($info,$glyph,$scale_x,$scale_y,$shift_x,$shift_y,$ix0,$iy0,0,0);
$1 = ((($gbm)) + 12|0);
HEAP32[$1>>2] = $output;
HEAP32[$gbm>>2] = $out_w;
$2 = ((($gbm)) + 4|0);
HEAP32[$2>>2] = $out_h;
$3 = ((($gbm)) + 8|0);
HEAP32[$3>>2] = $out_stride;
$4 = HEAP32[$gbm>>2]|0;
$5 = ($4|0)==(0);
$6 = HEAP32[$2>>2]|0;
$7 = ($6|0)==(0);
$or$cond = $5 | $7;
if ($or$cond) {
$11 = HEAP32[$vertices>>2]|0;
_free($11);
STACKTOP = sp;return;
}
$8 = HEAP32[$vertices>>2]|0;
$9 = HEAP32[$ix0>>2]|0;
$10 = HEAP32[$iy0>>2]|0;
_stbtt_Rasterize($gbm,0.34999999403953552,$8,$0,$scale_x,$scale_y,$shift_x,$shift_y,$9,$10,1,0);
$11 = HEAP32[$vertices>>2]|0;
_free($11);
STACKTOP = sp;return;
}
function _stbtt_MakeGlyphBitmap($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,$glyph) {
$info = $info|0;
$output = $output|0;
$out_w = $out_w|0;
$out_h = $out_h|0;
$out_stride = $out_stride|0;
$scale_x = +$scale_x;
$scale_y = +$scale_y;
$glyph = $glyph|0;
var label = 0, sp = 0;
sp = STACKTOP;
_stbtt_MakeGlyphBitmapSubpixel($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,0.0,0.0,$glyph);
return;
}
function _stbtt_BakeFontBitmap($data,$offset,$pixel_height,$pixels,$pw,$ph,$first_char,$num_chars,$chardata) {
$data = $data|0;
$offset = $offset|0;
$pixel_height = +$pixel_height;
$pixels = $pixels|0;
$pw = $pw|0;
$ph = $ph|0;
$first_char = $first_char|0;
$num_chars = $num_chars|0;
$chardata = $chardata|0;
var $$0 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $advance = 0, $bottom_y$0$ = 0, $bottom_y$07 = 0, $f = 0, $i$08 = 0, $i$08$lcssa = 0, $lsb = 0, $x$0$ = 0, $x$010 = 0, $x0 = 0, $x1 = 0;
var $y$0$bottom_y$0 = 0, $y$09 = 0, $y0 = 0, $y1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 80|0;
$f = sp + 24|0;
$advance = sp + 20|0;
$lsb = sp + 16|0;
$x0 = sp + 12|0;
$y0 = sp + 8|0;
$x1 = sp + 4|0;
$y1 = sp;
HEAP32[$f>>2] = 0;
$0 = (_stbtt_InitFont($f,$data,$offset)|0);
$1 = ($0|0)==(0);
if ($1) {
$$0 = -1;
STACKTOP = sp;return ($$0|0);
}
$2 = Math_imul($ph, $pw)|0;
_memset(($pixels|0),0,($2|0))|0;
$3 = (+_stbtt_ScaleForPixelHeight($f,$pixel_height));
$4 = ($num_chars|0)>(0);
if ($4) {
$bottom_y$07 = 1;$i$08 = 0;$x$010 = 1;$y$09 = 1;
} else {
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
while(1) {
$5 = (($i$08) + ($first_char))|0;
$6 = (_stbtt_FindGlyphIndex($f,$5)|0);
_stbtt_GetGlyphHMetrics($f,$6,$advance,$lsb);
_stbtt_GetGlyphBitmapBox($f,$6,$3,$3,$x0,$y0,$x1,$y1);
$7 = HEAP32[$x1>>2]|0;
$8 = HEAP32[$x0>>2]|0;
$9 = (($7) - ($8))|0;
$10 = HEAP32[$y1>>2]|0;
$11 = HEAP32[$y0>>2]|0;
$12 = (($10) - ($11))|0;
$13 = (($x$010) + 1)|0;
$14 = (($13) + ($9))|0;
$15 = ($14|0)<($pw|0);
$y$0$bottom_y$0 = $15 ? $y$09 : $bottom_y$07;
$x$0$ = $15 ? $x$010 : 1;
$16 = (($y$0$bottom_y$0) + ($12))|0;
$17 = (($16) + 1)|0;
$18 = ($17|0)<($ph|0);
if (!($18)) {
$i$08$lcssa = $i$08;
label = 4;
break;
}
$20 = (($x$0$) + ($9))|0;
$21 = ($20|0)<($pw|0);
if (!($21)) {
label = 6;
break;
}
$22 = ($16|0)<($ph|0);
if (!($22)) {
label = 8;
break;
}
$23 = Math_imul($y$0$bottom_y$0, $pw)|0;
$$sum = (($23) + ($x$0$))|0;
$24 = (($pixels) + ($$sum)|0);
_stbtt_MakeGlyphBitmap($f,$24,$9,$12,$pw,$3,$3,$6);
$25 = $x$0$&65535;
$26 = (($chardata) + (($i$08*20)|0)|0);
HEAP16[$26>>1] = $25;
$27 = $y$0$bottom_y$0&65535;
$28 = (((($chardata) + (($i$08*20)|0)|0)) + 2|0);
HEAP16[$28>>1] = $27;
$29 = $20&65535;
$30 = (((($chardata) + (($i$08*20)|0)|0)) + 4|0);
HEAP16[$30>>1] = $29;
$31 = $16&65535;
$32 = (((($chardata) + (($i$08*20)|0)|0)) + 6|0);
HEAP16[$32>>1] = $31;
$33 = HEAP32[$advance>>2]|0;
$34 = (+($33|0));
$35 = $3 * $34;
$36 = (((($chardata) + (($i$08*20)|0)|0)) + 16|0);
HEAPF32[$36>>2] = $35;
$37 = HEAP32[$x0>>2]|0;
$38 = (+($37|0));
$39 = (((($chardata) + (($i$08*20)|0)|0)) + 8|0);
HEAPF32[$39>>2] = $38;
$40 = HEAP32[$y0>>2]|0;
$41 = (+($40|0));
$42 = (((($chardata) + (($i$08*20)|0)|0)) + 12|0);
HEAPF32[$42>>2] = $41;
$43 = (($20) + 1)|0;
$44 = ($16|0)<($bottom_y$07|0);
$bottom_y$0$ = $44 ? $bottom_y$07 : $17;
$45 = (($i$08) + 1)|0;
$46 = ($45|0)<($num_chars|0);
if ($46) {
$bottom_y$07 = $bottom_y$0$;$i$08 = $45;$x$010 = $43;$y$09 = $y$0$bottom_y$0;
} else {
$$0 = $bottom_y$0$;
label = 10;
break;
}
}
if ((label|0) == 4) {
$19 = (0 - ($i$08$lcssa))|0;
$$0 = $19;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 6) {
___assert_fail((14287|0),(14173|0),2545,(14297|0));
// unreachable;
}
else if ((label|0) == 8) {
___assert_fail((14318|0),(14173|0),2546,(14297|0));
// unreachable;
}
else if ((label|0) == 10) {
STACKTOP = sp;return ($$0|0);
}
return (0)|0;
}
function _LoadDefaultFont() {
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $counter$013 = 0, $currentLine$08 = 0, $currentLine$1 = 0, $currentPosX$09 = 0, $currentPosX$1 = 0, $exitcond = 0;
var $i$014 = 0, $i1$012 = 0, $i2$010 = 0, $image = 0, $image$byval_copy1 = 0, $j$011 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$image$byval_copy1 = sp + 44|0;
$vararg_buffer = sp;
$image = sp + 24|0;
$0 = sp + 4|0;
HEAP32[(2760)>>2] = 224;
$1 = (_malloc(65536)|0);
$i$014 = 0;
while(1) {
$2 = (($1) + ($i$014<<2)|0);
$3 = (($i$014) + 1)|0;
$exitcond = ($3|0)==(16384);
HEAP8[$2>>0]=0&255;HEAP8[$2+1>>0]=(0>>8)&255;HEAP8[$2+2>>0]=(0>>16)&255;HEAP8[$2+3>>0]=0>>24;
if ($exitcond) {
$counter$013 = 0;$i1$012 = 0;
break;
} else {
$i$014 = $3;
}
}
while(1) {
$4 = (2780 + ($counter$013<<2)|0);
$5 = HEAP32[$4>>2]|0;
$j$011 = 31;
while(1) {
$6 = 1 << $j$011;
$7 = $5 & $6;
$8 = ($7|0)==(0);
if (!($8)) {
$9 = (($j$011) + ($i1$012))|0;
$10 = (($1) + ($9<<2)|0);
HEAP8[$10>>0]=-1&255;HEAP8[$10+1>>0]=(-1>>8)&255;HEAP8[$10+2>>0]=(-1>>16)&255;HEAP8[$10+3>>0]=-1>>24;
}
$11 = (($j$011) + -1)|0;
$12 = ($j$011|0)>(0);
if ($12) {
$j$011 = $11;
} else {
break;
}
}
$13 = (($counter$013) + 1)|0;
$14 = ($counter$013|0)>(511);
$$ = $14 ? 0 : $13;
$15 = (($i1$012) + 32)|0;
$16 = ($15|0)<(16384);
if ($16) {
$counter$013 = $$;$i1$012 = $15;
} else {
break;
}
}
_LoadImageEx($image,$1,128,128);
_ImageFormat($image,2);
_free($1);
;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
_LoadTextureFromImage($0,$image$byval_copy1);
;HEAP32[2736>>2]=HEAP32[$0>>2]|0;HEAP32[2736+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[2736+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[2736+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[2736+16>>2]=HEAP32[$0+16>>2]|0;
;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
_UnloadImage($image$byval_copy1);
$17 = HEAP32[(2760)>>2]|0;
$18 = $17 << 2;
$19 = (_malloc($18)|0);
HEAP32[(2764)>>2] = $19;
$20 = HEAP32[(2760)>>2]|0;
$21 = $20 << 4;
$22 = (_malloc($21)|0);
HEAP32[(2768)>>2] = $22;
$23 = HEAP32[(2760)>>2]|0;
$24 = $23 << 3;
$25 = (_malloc($24)|0);
HEAP32[(2772)>>2] = $25;
$26 = HEAP32[(2760)>>2]|0;
$27 = $26 << 2;
$28 = (_malloc($27)|0);
HEAP32[(2776)>>2] = $28;
$29 = HEAP32[(2760)>>2]|0;
$30 = ($29|0)>(0);
if ($30) {
$currentLine$08 = 0;$currentPosX$09 = 1;$i2$010 = 0;
} else {
$69 = HEAP32[(2768)>>2]|0;
$70 = ((($69)) + 12|0);
$71 = HEAP32[$70>>2]|0;
HEAP32[(2756)>>2] = $71;
$72 = HEAP32[2736>>2]|0;
HEAP32[$vararg_buffer>>2] = $72;
_TraceLog(0,14328,$vararg_buffer);
STACKTOP = sp;return;
}
while(1) {
$31 = (($i2$010) + 32)|0;
$32 = HEAP32[(2764)>>2]|0;
$33 = (($32) + ($i2$010<<2)|0);
HEAP32[$33>>2] = $31;
$34 = HEAP32[(2768)>>2]|0;
$35 = (($34) + ($i2$010<<4)|0);
HEAP32[$35>>2] = $currentPosX$09;
$36 = ($currentLine$08*11)|0;
$37 = (($36) + 1)|0;
$38 = HEAP32[(2768)>>2]|0;
$39 = (((($38) + ($i2$010<<4)|0)) + 4|0);
HEAP32[$39>>2] = $37;
$40 = (4828 + ($i2$010<<2)|0);
$41 = HEAP32[$40>>2]|0;
$42 = HEAP32[(2768)>>2]|0;
$43 = (((($42) + ($i2$010<<4)|0)) + 8|0);
HEAP32[$43>>2] = $41;
$44 = HEAP32[(2768)>>2]|0;
$45 = (((($44) + ($i2$010<<4)|0)) + 12|0);
HEAP32[$45>>2] = 10;
$46 = HEAP32[(2768)>>2]|0;
$47 = (((($46) + ($i2$010<<4)|0)) + 8|0);
$48 = HEAP32[$47>>2]|0;
$49 = (($currentPosX$09) + 1)|0;
$50 = (($49) + ($48))|0;
$51 = HEAP32[(2740)>>2]|0;
$52 = ($50|0)<($51|0);
if ($52) {
$currentLine$1 = $currentLine$08;$currentPosX$1 = $50;
} else {
$53 = (($currentLine$08) + 1)|0;
$54 = HEAP32[$40>>2]|0;
$55 = (($54) + 2)|0;
$56 = (($46) + ($i2$010<<4)|0);
HEAP32[$56>>2] = 1;
$57 = ($53*11)|0;
$58 = (($57) + 1)|0;
$59 = HEAP32[(2768)>>2]|0;
$60 = (((($59) + ($i2$010<<4)|0)) + 4|0);
HEAP32[$60>>2] = $58;
$currentLine$1 = $53;$currentPosX$1 = $55;
}
$61 = HEAP32[(2772)>>2]|0;
$62 = (($61) + ($i2$010<<3)|0);
HEAPF32[$62>>2] = 0.0;
$63 = (((($61) + ($i2$010<<3)|0)) + 4|0);
HEAPF32[$63>>2] = 0.0;
$64 = HEAP32[(2776)>>2]|0;
$65 = (($64) + ($i2$010<<2)|0);
HEAP32[$65>>2] = 0;
$66 = (($i2$010) + 1)|0;
$67 = HEAP32[(2760)>>2]|0;
$68 = ($66|0)<($67|0);
if ($68) {
$currentLine$08 = $currentLine$1;$currentPosX$09 = $currentPosX$1;$i2$010 = $66;
} else {
break;
}
}
$69 = HEAP32[(2768)>>2]|0;
$70 = ((($69)) + 12|0);
$71 = HEAP32[$70>>2]|0;
HEAP32[(2756)>>2] = $71;
$72 = HEAP32[2736>>2]|0;
HEAP32[$vararg_buffer>>2] = $72;
_TraceLog(0,14328,$vararg_buffer);
STACKTOP = sp;return;
}
function _UnloadDefaultFont() {
var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$$byval_copy = sp;
;HEAP32[$$byval_copy>>2]=HEAP32[2736>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[2736+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[2736+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[2736+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[2736+16>>2]|0;
_UnloadTexture($$byval_copy);
$0 = HEAP32[(2764)>>2]|0;
_free($0);
$1 = HEAP32[(2768)>>2]|0;
_free($1);
$2 = HEAP32[(2772)>>2]|0;
_free($2);
$3 = HEAP32[(2776)>>2]|0;
_free($3);
STACKTOP = sp;return;
}
function _GetDefaultFont($agg$result) {
$agg$result = $agg$result|0;
var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
dest=$agg$result; src=2736; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
return;
}
function _LoadSpriteFont($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
var $i$01 = 0, $image = 0, $image$byval_copy12 = 0, $spriteFont = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer5 = 0, $vararg_buffer8 = 0, $vararg_ptr4 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 144|0;
$image$byval_copy12 = sp + 112|0;
$vararg_buffer8 = sp + 24|0;
$vararg_buffer5 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$spriteFont = sp + 28|0;
$image = sp + 92|0;
$0 = sp + 72|0;
$1 = (_GetExtension($fileName)|0);
$2 = (_strcmp($1,14373)|0);
$3 = ($2|0)==(0);
do {
if ($3) {
_LoadRBMF($spriteFont,$fileName);
} else {
$4 = (_GetExtension($fileName)|0);
$5 = (_strcmp($4,14378)|0);
$6 = ($5|0)==(0);
if ($6) {
_LoadTTF($spriteFont,$fileName);
break;
}
$7 = (_GetExtension($fileName)|0);
$8 = (_strcmp($7,14382)|0);
$9 = ($8|0)==(0);
if ($9) {
_LoadBMFont($spriteFont,$fileName);
break;
}
_LoadImage($image,$fileName);
$10 = HEAP32[$image>>2]|0;
$11 = ($10|0)==(0|0);
if ($11) {
HEAP32[$vararg_buffer5>>2] = $fileName;
_TraceLog(2,14463,$vararg_buffer5);
_GetDefaultFont($spriteFont);
} else {
$12 = ((($spriteFont)) + 28|0);
$13 = ((($spriteFont)) + 32|0);
;HEAP32[$image$byval_copy12>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy12+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy12+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy12+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy12+16>>2]=HEAP32[$image+16>>2]|0;
$14 = (_ParseImageData($image$byval_copy12,$12,$13)|0);
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(3,14386,$vararg_buffer);
HEAP32[$vararg_buffer1>>2] = $fileName;
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
HEAP32[$vararg_ptr4>>2] = $14;
_TraceLog(3,14424,$vararg_buffer1);
$15 = ((($spriteFont)) + 24|0);
HEAP32[$15>>2] = $14;
;HEAP32[$image$byval_copy12>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy12+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy12+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy12+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy12+16>>2]=HEAP32[$image+16>>2]|0;
_LoadTextureFromImage($0,$image$byval_copy12);
;HEAP32[$spriteFont>>2]=HEAP32[$0>>2]|0;HEAP32[$spriteFont+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$spriteFont+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$spriteFont+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$spriteFont+16>>2]=HEAP32[$0+16>>2]|0;
$16 = HEAP32[$13>>2]|0;
$17 = ((($16)) + 12|0);
$18 = HEAP32[$17>>2]|0;
$19 = ((($spriteFont)) + 20|0);
HEAP32[$19>>2] = $18;
$20 = HEAP32[$15>>2]|0;
$21 = $20 << 3;
$22 = (_malloc($21)|0);
$23 = ((($spriteFont)) + 36|0);
HEAP32[$23>>2] = $22;
$24 = HEAP32[$15>>2]|0;
$25 = $24 << 2;
$26 = (_malloc($25)|0);
$27 = ((($spriteFont)) + 40|0);
HEAP32[$27>>2] = $26;
$28 = HEAP32[$15>>2]|0;
$29 = ($28|0)>(0);
if ($29) {
$30 = HEAP32[$23>>2]|0;
$31 = HEAP32[$27>>2]|0;
$32 = HEAP32[$15>>2]|0;
$i$01 = 0;
while(1) {
$33 = (($30) + ($i$01<<3)|0);
HEAPF32[$33>>2] = 0.0;
$34 = (((($30) + ($i$01<<3)|0)) + 4|0);
HEAPF32[$34>>2] = 0.0;
$35 = (($31) + ($i$01<<2)|0);
HEAP32[$35>>2] = 0;
$36 = (($i$01) + 1)|0;
$37 = ($36|0)<($32|0);
if ($37) {
$i$01 = $36;
} else {
break;
}
}
}
}
;HEAP32[$image$byval_copy12>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy12+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy12+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy12+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy12+16>>2]=HEAP32[$image+16>>2]|0;
_UnloadImage($image$byval_copy12);
}
} while(0);
$38 = HEAP32[$spriteFont>>2]|0;
$39 = ($38|0)==(0);
if (!($39)) {
dest=$agg$result; src=$spriteFont; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
HEAP32[$vararg_buffer8>>2] = $fileName;
_TraceLog(2,14463,$vararg_buffer8);
_GetDefaultFont($spriteFont);
dest=$agg$result; src=$spriteFont; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _UnloadSpriteFont($spriteFont) {
$spriteFont = $spriteFont|0;
var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$$byval_copy = sp + 4|0;
$vararg_buffer = sp;
$0 = HEAP32[$spriteFont>>2]|0;
$1 = HEAP32[2736>>2]|0;
$2 = ($0|0)==($1|0);
if ($2) {
STACKTOP = sp;return;
}
;HEAP32[$$byval_copy>>2]=HEAP32[$spriteFont>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$spriteFont+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$spriteFont+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$spriteFont+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$spriteFont+16>>2]|0;
_UnloadTexture($$byval_copy);
$3 = ((($spriteFont)) + 28|0);
$4 = HEAP32[$3>>2]|0;
_free($4);
$5 = ((($spriteFont)) + 32|0);
$6 = HEAP32[$5>>2]|0;
_free($6);
$7 = ((($spriteFont)) + 36|0);
$8 = HEAP32[$7>>2]|0;
_free($8);
$9 = ((($spriteFont)) + 40|0);
$10 = HEAP32[$9>>2]|0;
_free($10);
_TraceLog(0,14519,$vararg_buffer);
STACKTOP = sp;return;
}
function _DrawText($text,$posX,$posY,$fontSize,$color) {
$text = $text|0;
$posX = $posX|0;
$posY = $posY|0;
$fontSize = $fontSize|0;
$color = $color|0;
var $$fontSize = 0, $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0, $color$byval_copy = 0, $defaultFont$byval_copy = 0, $position = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 80|0;
$color$byval_copy = sp + 64|0;
$position$byval_copy = sp + 56|0;
$defaultFont$byval_copy = sp + 8|0;
$position = sp;
$0 = (+($posX|0));
HEAPF32[$position>>2] = $0;
$1 = ((($position)) + 4|0);
$2 = (+($posY|0));
HEAPF32[$1>>2] = $2;
$3 = ($fontSize|0)<(10);
$$fontSize = $3 ? 10 : $fontSize;
$4 = (($$fontSize|0) / 10)&-1;
dest=$defaultFont$byval_copy; src=2736; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;
;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0;
_DrawTextEx($defaultFont$byval_copy,$text,$position$byval_copy,$$fontSize,$4,$color$byval_copy);
STACKTOP = sp;return;
}
function _DrawTextEx($spriteFont,$text,$position,$fontSize,$spacing,$tint) {
$spriteFont = $spriteFont|0;
$text = $text|0;
$position = $position|0;
$fontSize = $fontSize|0;
$spacing = $spacing|0;
$tint = $tint|0;
var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0;
var $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0;
var $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0;
var $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0;
var $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0, $i$03 = 0, $i$1$ph = 0, $i$16 = 0, $rec = 0, $rec$byval_copy = 0, $textOffsetX$05 = 0, $textOffsetX$2 = 0, $textOffsetY$04 = 0, $textOffsetY$17 = 0, $tint$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$tint$byval_copy = sp + 104|0;
$$byval_copy2 = sp + 96|0;
$$byval_copy1 = sp + 80|0;
$rec$byval_copy = sp + 64|0;
$$byval_copy = sp + 40|0;
$rec = sp + 24|0;
$0 = sp + 8|0;
$1 = sp;
$2 = (_strlen($text)|0);
$3 = (+($fontSize|0));
$4 = ((($spriteFont)) + 20|0);
$5 = HEAP32[$4>>2]|0;
$6 = (+($5|0));
$7 = $3 / $6;
$8 = ($2|0)>(0);
if (!($8)) {
STACKTOP = sp;return;
}
$9 = ((($spriteFont)) + 32|0);
$10 = +HEAPF32[$position>>2];
$11 = ((($spriteFont)) + 36|0);
$12 = ((($position)) + 4|0);
$13 = +HEAPF32[$12>>2];
$14 = ((($rec)) + 8|0);
$15 = ((($rec)) + 12|0);
$16 = ((($0)) + 4|0);
$17 = ((($0)) + 8|0);
$18 = ((($0)) + 12|0);
$19 = ((($1)) + 4|0);
$20 = ((($spriteFont)) + 40|0);
$21 = (+($spacing|0));
$22 = (+($spacing|0));
$23 = ((($spriteFont)) + 32|0);
$24 = ((($spriteFont)) + 32|0);
$i$03 = 0;$textOffsetX$05 = 0;$textOffsetY$04 = 0;
while(1) {
$25 = (($text) + ($i$03)|0);
$26 = HEAP8[$25>>0]|0;
switch ($26<<24>>24) {
case -62: {
$27 = (($i$03) + 1)|0;
$28 = (($text) + ($27)|0);
$29 = HEAP8[$28>>0]|0;
$30 = $29&255;
$31 = (($30) + -32)|0;
$32 = HEAP32[$23>>2]|0;
$33 = (($32) + ($31<<4)|0);
;HEAP32[$rec>>2]=HEAP32[$33>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$33+12>>2]|0;
$i$1$ph = $27;
label = 8;
break;
}
case -61: {
$34 = (($i$03) + 1)|0;
$35 = (($text) + ($34)|0);
$36 = HEAP8[$35>>0]|0;
$37 = $36&255;
$38 = (($37) + 32)|0;
$39 = HEAP32[$24>>2]|0;
$40 = (($39) + ($38<<4)|0);
;HEAP32[$rec>>2]=HEAP32[$40>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$40+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$40+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$40+12>>2]|0;
$i$1$ph = $34;
label = 8;
break;
}
case 10: {
$41 = HEAP32[$4>>2]|0;
$42 = (($41|0) / 2)&-1;
$43 = (($42) + ($41))|0;
$44 = (+($43|0));
$45 = $7 * $44;
$46 = (+($textOffsetY$04|0));
$47 = $46 + $45;
$48 = (~~(($47)));
HEAP32[$rec>>2] = -1;
$i$16 = $i$03;$textOffsetX$2 = 0;$textOffsetY$17 = $48;
break;
}
default: {
$49 = $26 << 24 >> 24;
$50 = (($49) + -32)|0;
$51 = HEAP32[$9>>2]|0;
$52 = (($51) + ($50<<4)|0);
;HEAP32[$rec>>2]=HEAP32[$52>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$52+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$52+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$52+12>>2]|0;
$i$1$ph = $i$03;
label = 8;
}
}
do {
if ((label|0) == 8) {
label = 0;
$$pr = HEAP32[$rec>>2]|0;
$53 = ($$pr|0)>(0);
if ($53) {
$54 = (+($textOffsetX$05|0));
$55 = $54 + $10;
$56 = (($text) + ($i$1$ph)|0);
$57 = HEAP8[$56>>0]|0;
$58 = $57 << 24 >> 24;
$59 = (($58) + -32)|0;
$60 = HEAP32[$11>>2]|0;
$61 = (($60) + ($59<<3)|0);
$62 = +HEAPF32[$61>>2];
$63 = $7 * $62;
$64 = $55 + $63;
$65 = (~~(($64)));
$66 = (+($textOffsetY$04|0));
$67 = $66 + $13;
$68 = (((($60) + ($59<<3)|0)) + 4|0);
$69 = +HEAPF32[$68>>2];
$70 = $7 * $69;
$71 = $67 + $70;
$72 = (~~(($71)));
$73 = HEAP32[$14>>2]|0;
$74 = (+($73|0));
$75 = $7 * $74;
$76 = (~~(($75)));
$77 = HEAP32[$15>>2]|0;
$78 = (+($77|0));
$79 = $7 * $78;
$80 = (~~(($79)));
HEAP32[$0>>2] = $65;
HEAP32[$16>>2] = $72;
HEAP32[$17>>2] = $76;
HEAP32[$18>>2] = $80;
HEAPF32[$1>>2] = 0.0;
HEAPF32[$19>>2] = 0.0;
;HEAP32[$$byval_copy>>2]=HEAP32[$spriteFont>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$spriteFont+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$spriteFont+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$spriteFont+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$spriteFont+16>>2]|0;
;HEAP32[$rec$byval_copy>>2]=HEAP32[$rec>>2]|0;HEAP32[$rec$byval_copy+4>>2]=HEAP32[$rec+4>>2]|0;HEAP32[$rec$byval_copy+8>>2]=HEAP32[$rec+8>>2]|0;HEAP32[$rec$byval_copy+12>>2]=HEAP32[$rec+12>>2]|0;
;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;
;HEAP32[$$byval_copy2>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$1+4>>2]|0;
;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
_DrawTexturePro($$byval_copy,$rec$byval_copy,$$byval_copy1,$$byval_copy2,0.0,$tint$byval_copy);
$81 = HEAP8[$56>>0]|0;
$82 = $81 << 24 >> 24;
$83 = (($82) + -32)|0;
$84 = HEAP32[$20>>2]|0;
$85 = (($84) + ($83<<2)|0);
$86 = HEAP32[$85>>2]|0;
$87 = ($86|0)==(0);
if ($87) {
$88 = HEAP32[$14>>2]|0;
$89 = (+($88|0));
$90 = $7 * $89;
$91 = $21 + $90;
$92 = $54 + $91;
$93 = (~~(($92)));
$i$16 = $i$1$ph;$textOffsetX$2 = $93;$textOffsetY$17 = $textOffsetY$04;
break;
} else {
$94 = (+($86|0));
$95 = $7 * $94;
$96 = $22 + $95;
$97 = $54 + $96;
$98 = (~~(($97)));
$i$16 = $i$1$ph;$textOffsetX$2 = $98;$textOffsetY$17 = $textOffsetY$04;
break;
}
} else {
$i$16 = $i$1$ph;$textOffsetX$2 = $textOffsetX$05;$textOffsetY$17 = $textOffsetY$04;
}
}
} while(0);
$99 = (($i$16) + 1)|0;
$100 = ($99|0)<($2|0);
if ($100) {
$i$03 = $99;$textOffsetX$05 = $textOffsetX$2;$textOffsetY$04 = $textOffsetY$17;
} else {
break;
}
}
STACKTOP = sp;return;
}
function _SubText($text,$position,$length) {
$text = $text|0;
$position = $position|0;
$length = $length|0;
var $$03 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$04 = 0, $exitcond = 0, $length$ = 0, $position$ = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = (_strlen($text)|0);
$1 = ($0|0)>($position|0);
$2 = (($0) + -1)|0;
$position$ = $1 ? $position : $2;
$length$ = $1 ? $length : 0;
$3 = ($length$|0)<($0|0);
$$1 = $3 ? $length$ : $0;
$4 = ($$1|0)>(0);
if (!($4)) {
$12 = (14545 + ($$1)|0);
HEAP8[$12>>0] = 0;
return (14545|0);
}
$5 = ($0|0)>($length$|0);
$6 = $5 ? $length$ : $0;
$$03 = $text;$c$04 = 0;
while(1) {
$7 = (($$03) + ($position$)|0);
$8 = HEAP8[$7>>0]|0;
$9 = (14545 + ($c$04)|0);
HEAP8[$9>>0] = $8;
$10 = ((($$03)) + 1|0);
$11 = (($c$04) + 1)|0;
$exitcond = ($11|0)==($6|0);
if ($exitcond) {
break;
} else {
$$03 = $10;$c$04 = $11;
}
}
$12 = (14545 + ($$1)|0);
HEAP8[$12>>0] = 0;
return (14545|0);
}
function _MeasureText($text,$fontSize) {
$text = $text|0;
$fontSize = $fontSize|0;
var $$fontSize = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0.0, $4 = 0, $defaultFont$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$defaultFont$byval_copy = sp + 8|0;
$0 = sp;
$1 = ($fontSize|0)<(10);
$$fontSize = $1 ? 10 : $fontSize;
$2 = (($$fontSize|0) / 10)&-1;
dest=$defaultFont$byval_copy; src=2736; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_MeasureTextEx($0,$defaultFont$byval_copy,$text,$$fontSize,$2);
$3 = +HEAPF32[$0>>2];
$4 = (~~(($3)));
STACKTOP = sp;return ($4|0);
}
function _MeasureTextEx($agg$result,$spriteFont,$text,$fontSize,$spacing) {
$agg$result = $agg$result|0;
$spriteFont = $spriteFont|0;
$text = $text|0;
$fontSize = $fontSize|0;
$spacing = $spacing|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0;
var $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$05 = 0, $lenCounter$06 = 0, $lenCounter$1 = 0, $lenCounter$1$tempLen$0 = 0, $lenCounter$1$tempLen$0$lcssa = 0, $phitmp = 0, $scaleFactor$0 = 0.0, $tempLen$0$lcssa = 0, $tempLen$07 = 0;
var $tempTextWidth$0$lcssa = 0, $tempTextWidth$03 = 0, $tempTextWidth$2 = 0, $tempTextWidth$2$lcssa = 0, $textHeight$0$lcssa = 0, $textHeight$04 = 0, $textHeight$1 = 0, $textHeight$1$lcssa = 0, $textWidth$0$lcssa = 0, $textWidth$0$tempTextWidth$0 = 0, $textWidth$0$tempTextWidth$01 = 0, $textWidth$02 = 0, $textWidth$1 = 0, $textWidth$1$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_strlen($text)|0);
$1 = ((($spriteFont)) + 20|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($0|0)>(0);
if ($3) {
$4 = HEAP32[$1>>2]|0;
$5 = (($4|0) / 2)&-1;
$6 = ((($spriteFont)) + 40|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($spriteFont)) + 32|0);
$9 = HEAP32[$8>>2]|0;
$10 = ((($spriteFont)) + 36|0);
$11 = HEAP32[$10>>2]|0;
$i$05 = 0;$lenCounter$06 = 0;$tempLen$07 = 0;$tempTextWidth$03 = 0;$textHeight$04 = $2;$textWidth$02 = 0;
while(1) {
$12 = (($lenCounter$06) + 1)|0;
$13 = (($text) + ($i$05)|0);
$14 = HEAP8[$13>>0]|0;
$15 = ($14<<24>>24)==(10);
do {
if ($15) {
$31 = ($tempTextWidth$03|0)<($textWidth$02|0);
$textWidth$0$tempTextWidth$0 = $31 ? $textWidth$02 : $tempTextWidth$03;
$32 = (($4) + ($textHeight$04))|0;
$33 = (($32) + ($5))|0;
$lenCounter$1 = 0;$tempTextWidth$2 = $textWidth$0$tempTextWidth$0;$textHeight$1 = $33;$textWidth$1 = 0;
} else {
$16 = $14 << 24 >> 24;
$17 = (($16) + -32)|0;
$18 = (($7) + ($17<<2)|0);
$19 = HEAP32[$18>>2]|0;
$20 = ($19|0)==(0);
if ($20) {
$22 = (((($9) + ($17<<4)|0)) + 8|0);
$23 = HEAP32[$22>>2]|0;
$24 = (+($23|0));
$25 = (($11) + ($17<<3)|0);
$26 = +HEAPF32[$25>>2];
$27 = $24 + $26;
$28 = (+($textWidth$02|0));
$29 = $28 + $27;
$30 = (~~(($29)));
$lenCounter$1 = $12;$tempTextWidth$2 = $tempTextWidth$03;$textHeight$1 = $textHeight$04;$textWidth$1 = $30;
break;
} else {
$21 = (($19) + ($textWidth$02))|0;
$lenCounter$1 = $12;$tempTextWidth$2 = $tempTextWidth$03;$textHeight$1 = $textHeight$04;$textWidth$1 = $21;
break;
}
}
} while(0);
$34 = ($tempLen$07|0)<($lenCounter$1|0);
$lenCounter$1$tempLen$0 = $34 ? $lenCounter$1 : $tempLen$07;
$35 = (($i$05) + 1)|0;
$exitcond = ($35|0)==($0|0);
if ($exitcond) {
$lenCounter$1$tempLen$0$lcssa = $lenCounter$1$tempLen$0;$tempTextWidth$2$lcssa = $tempTextWidth$2;$textHeight$1$lcssa = $textHeight$1;$textWidth$1$lcssa = $textWidth$1;
break;
} else {
$i$05 = $35;$lenCounter$06 = $lenCounter$1;$tempLen$07 = $lenCounter$1$tempLen$0;$tempTextWidth$03 = $tempTextWidth$2;$textHeight$04 = $textHeight$1;$textWidth$02 = $textWidth$1;
}
}
$phitmp = (($lenCounter$1$tempLen$0$lcssa) + -1)|0;
$tempLen$0$lcssa = $phitmp;$tempTextWidth$0$lcssa = $tempTextWidth$2$lcssa;$textHeight$0$lcssa = $textHeight$1$lcssa;$textWidth$0$lcssa = $textWidth$1$lcssa;
} else {
$tempLen$0$lcssa = -1;$tempTextWidth$0$lcssa = 0;$textHeight$0$lcssa = $2;$textWidth$0$lcssa = 0;
}
$36 = ($tempTextWidth$0$lcssa|0)<($textWidth$0$lcssa|0);
$textWidth$0$tempTextWidth$01 = $36 ? $textWidth$0$lcssa : $tempTextWidth$0$lcssa;
$37 = HEAP32[$1>>2]|0;
$38 = ($37|0)<($fontSize|0);
if (!($38)) {
$scaleFactor$0 = 1.0;
$42 = (+($textWidth$0$tempTextWidth$01|0));
$43 = $42 * $scaleFactor$0;
$44 = Math_imul($tempLen$0$lcssa, $spacing)|0;
$45 = (+($44|0));
$46 = $45 + $43;
$47 = (+($textHeight$0$lcssa|0));
$48 = $47 * $scaleFactor$0;
HEAPF32[$agg$result>>2] = $46;
$49 = ((($agg$result)) + 4|0);
HEAPF32[$49>>2] = $48;
return;
}
$39 = (+($fontSize|0));
$40 = (+($37|0));
$41 = $39 / $40;
$scaleFactor$0 = $41;
$42 = (+($textWidth$0$tempTextWidth$01|0));
$43 = $42 * $scaleFactor$0;
$44 = Math_imul($tempLen$0$lcssa, $spacing)|0;
$45 = (+($44|0));
$46 = $45 + $43;
$47 = (+($textHeight$0$lcssa|0));
$48 = $47 * $scaleFactor$0;
HEAPF32[$agg$result>>2] = $46;
$49 = ((($agg$result)) + 4|0);
HEAPF32[$49>>2] = $48;
return;
}
function _stbi_load($filename,$x,$y,$comp,$req_comp) {
$filename = $filename|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__fopen($filename)|0);
$1 = ($0|0)==(0|0);
if ($1) {
_stbi__err(14609);
$$0 = 0;
return ($$0|0);
} else {
$2 = (_stbi_load_from_file($0,$x,$y,$comp,$req_comp)|0);
(_fclose($0)|0);
$$0 = $2;
return ($$0|0);
}
return (0)|0;
}
function _stbi_load_from_file($f,$x,$y,$comp,$req_comp) {
$f = $f|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $s = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 192|0;
$s = sp;
_stbi__start_file($s,$f);
$0 = (_stbi__load_flip($s,$x,$y,$comp,$req_comp)|0);
$1 = ($0|0)==(0|0);
if ($1) {
STACKTOP = sp;return ($0|0);
}
$2 = ((($s)) + 172|0);
$3 = HEAP32[$2>>2]|0;
$4 = ((($s)) + 168|0);
$5 = HEAP32[$4>>2]|0;
$6 = $3;
$7 = $5;
$8 = (($7) - ($6))|0;
(_fseek($f,$8,1)|0);
STACKTOP = sp;return ($0|0);
}
function _stbi_zlib_decode_malloc_guesssize_headerflag($buffer,$len,$initial_size,$outlen,$parse_header) {
$buffer = $buffer|0;
$len = $len|0;
$initial_size = $initial_size|0;
$outlen = $outlen|0;
$parse_header = $parse_header|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a = 0;
var label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 4080|0;
$a = sp;
$0 = (_stbi__malloc($initial_size)|0);
$1 = ($0|0)==(0|0);
if ($1) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
HEAP32[$a>>2] = $buffer;
$2 = (($buffer) + ($len)|0);
$3 = ((($a)) + 4|0);
HEAP32[$3>>2] = $2;
$4 = (_stbi__do_zlib($a,$0,$initial_size,1,$parse_header)|0);
$5 = ($4|0)==(0);
if ($5) {
$16 = ((($a)) + 20|0);
$17 = HEAP32[$16>>2]|0;
_free($17);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$6 = ($outlen|0)==(0|0);
if (!($6)) {
$7 = ((($a)) + 16|0);
$8 = HEAP32[$7>>2]|0;
$9 = ((($a)) + 20|0);
$10 = HEAP32[$9>>2]|0;
$11 = $8;
$12 = $10;
$13 = (($11) - ($12))|0;
HEAP32[$outlen>>2] = $13;
}
$14 = ((($a)) + 20|0);
$15 = HEAP32[$14>>2]|0;
$$0 = $15;
STACKTOP = sp;return ($$0|0);
}
function _stbi__tga_read_rgb16($s,$out) {
$s = $s|0;
$out = $out|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get16le($s)|0);
$1 = $0 >>> 10;
$2 = $1 & 31;
$3 = $0 >>> 5;
$4 = $3 & 31;
$5 = $0 & 31;
$6 = ($2*255)|0;
$7 = (($6>>>0) / 31)&-1;
$8 = $7&255;
HEAP8[$out>>0] = $8;
$9 = ($4*255)|0;
$10 = (($9>>>0) / 31)&-1;
$11 = $10&255;
$12 = ((($out)) + 1|0);
HEAP8[$12>>0] = $11;
$13 = ($5*255)|0;
$14 = (($13>>>0) / 31)&-1;
$15 = $14&255;
$16 = ((($out)) + 2|0);
HEAP8[$16>>0] = $15;
return;
}
function _LoadImage($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $image$sroa$0$0 = 0, $image$sroa$0$09 = 0, $image$sroa$12$0 = 0;
var $image$sroa$12$05 = 0, $image$sroa$12$06 = 0, $image$sroa$15$0 = 0, $image$sroa$15$03 = 0, $image$sroa$15$04 = 0, $image$sroa$17$0 = 0, $image$sroa$17$01 = 0, $image$sroa$17$02 = 0, $image$sroa$9$0 = 0, $image$sroa$9$07 = 0, $image$sroa$9$08 = 0, $imgBpp = 0, $imgHeight = 0, $imgWidth = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 144|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer = sp;
$imgWidth = sp + 128|0;
$imgHeight = sp + 124|0;
$imgBpp = sp + 120|0;
$0 = sp + 100|0;
$1 = sp + 80|0;
$2 = sp + 60|0;
$3 = sp + 40|0;
$4 = sp + 20|0;
$5 = (_GetExtension($fileName)|0);
$6 = (_strcmp($5,14621)|0);
$7 = ($6|0)==(0);
do {
if ($7) {
label = 8;
} else {
$8 = (_GetExtension($fileName)|0);
$9 = (_strcmp($8,14625)|0);
$10 = ($9|0)==(0);
if ($10) {
label = 8;
} else {
$11 = (_GetExtension($fileName)|0);
$12 = (_strcmp($11,14629)|0);
$13 = ($12|0)==(0);
if ($13) {
label = 8;
} else {
$14 = (_GetExtension($fileName)|0);
$15 = (_strcmp($14,14633)|0);
$16 = ($15|0)==(0);
if ($16) {
label = 8;
} else {
$17 = (_GetExtension($fileName)|0);
$18 = (_strcmp($17,14637)|0);
$19 = ($18|0)==(0);
if ($19) {
label = 8;
} else {
$20 = (_GetExtension($fileName)|0);
$21 = (_strcmp($20,14641)|0);
$22 = ($21|0)==(0);
if ($22) {
label = 8;
} else {
$23 = (_GetExtension($fileName)|0);
$24 = (_strcmp($23,14645)|0);
$25 = ($24|0)==(0);
if ($25) {
label = 8;
} else {
$31 = (_GetExtension($fileName)|0);
$32 = (_strcmp($31,14649)|0);
$33 = ($32|0)==(0);
if ($33) {
_LoadDDS($0,$fileName);
$34 = HEAP32[$0>>2]|0;
$35 = ((($0)) + 4|0);
$36 = HEAP32[$35>>2]|0;
$37 = ((($0)) + 8|0);
$38 = HEAP32[$37>>2]|0;
$39 = ((($0)) + 12|0);
$40 = HEAP32[$39>>2]|0;
$41 = ((($0)) + 16|0);
$42 = HEAP32[$41>>2]|0;
$image$sroa$0$0 = $34;$image$sroa$12$0 = $38;$image$sroa$15$0 = $40;$image$sroa$17$0 = $42;$image$sroa$9$0 = $36;
label = 22;
break;
}
$43 = (_GetExtension($fileName)|0);
$44 = (_strcmp($43,14653)|0);
$45 = ($44|0)==(0);
if ($45) {
_LoadPKM($1,$fileName);
$46 = HEAP32[$1>>2]|0;
$47 = ((($1)) + 4|0);
$48 = HEAP32[$47>>2]|0;
$49 = ((($1)) + 8|0);
$50 = HEAP32[$49>>2]|0;
$51 = ((($1)) + 12|0);
$52 = HEAP32[$51>>2]|0;
$53 = ((($1)) + 16|0);
$54 = HEAP32[$53>>2]|0;
$image$sroa$0$0 = $46;$image$sroa$12$0 = $50;$image$sroa$15$0 = $52;$image$sroa$17$0 = $54;$image$sroa$9$0 = $48;
label = 22;
break;
}
$55 = (_GetExtension($fileName)|0);
$56 = (_strcmp($55,14657)|0);
$57 = ($56|0)==(0);
if ($57) {
_LoadKTX($2,$fileName);
$58 = HEAP32[$2>>2]|0;
$59 = ((($2)) + 4|0);
$60 = HEAP32[$59>>2]|0;
$61 = ((($2)) + 8|0);
$62 = HEAP32[$61>>2]|0;
$63 = ((($2)) + 12|0);
$64 = HEAP32[$63>>2]|0;
$65 = ((($2)) + 16|0);
$66 = HEAP32[$65>>2]|0;
$image$sroa$0$0 = $58;$image$sroa$12$0 = $62;$image$sroa$15$0 = $64;$image$sroa$17$0 = $66;$image$sroa$9$0 = $60;
label = 22;
break;
}
$67 = (_GetExtension($fileName)|0);
$68 = (_strcmp($67,14661)|0);
$69 = ($68|0)==(0);
if ($69) {
_LoadPVR($3,$fileName);
$70 = HEAP32[$3>>2]|0;
$71 = ((($3)) + 4|0);
$72 = HEAP32[$71>>2]|0;
$73 = ((($3)) + 8|0);
$74 = HEAP32[$73>>2]|0;
$75 = ((($3)) + 12|0);
$76 = HEAP32[$75>>2]|0;
$77 = ((($3)) + 16|0);
$78 = HEAP32[$77>>2]|0;
$image$sroa$0$0 = $70;$image$sroa$12$0 = $74;$image$sroa$15$0 = $76;$image$sroa$17$0 = $78;$image$sroa$9$0 = $72;
label = 22;
break;
}
$79 = (_GetExtension($fileName)|0);
$80 = (_strcmp($79,14665)|0);
$81 = ($80|0)==(0);
if ($81) {
_LoadASTC($4,$fileName);
$82 = HEAP32[$4>>2]|0;
$83 = ((($4)) + 4|0);
$84 = HEAP32[$83>>2]|0;
$85 = ((($4)) + 8|0);
$86 = HEAP32[$85>>2]|0;
$87 = ((($4)) + 12|0);
$88 = HEAP32[$87>>2]|0;
$89 = ((($4)) + 16|0);
$90 = HEAP32[$89>>2]|0;
$image$sroa$0$0 = $82;$image$sroa$12$0 = $86;$image$sroa$15$0 = $88;$image$sroa$17$0 = $90;$image$sroa$9$0 = $84;
label = 22;
} else {
$image$sroa$12$06 = 0;$image$sroa$15$04 = 0;$image$sroa$17$02 = 0;$image$sroa$9$08 = 0;
}
}
}
}
}
}
}
}
} while(0);
L22: do {
if ((label|0) == 8) {
HEAP32[$imgWidth>>2] = 0;
HEAP32[$imgHeight>>2] = 0;
HEAP32[$imgBpp>>2] = 0;
$26 = (_stbi_load($fileName,$imgWidth,$imgHeight,$imgBpp,0)|0);
$27 = HEAP32[$imgWidth>>2]|0;
$28 = HEAP32[$imgHeight>>2]|0;
$29 = HEAP32[$imgBpp>>2]|0;
switch ($29|0) {
case 1: {
$image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 1;$image$sroa$9$0 = $27;
label = 22;
break L22;
break;
}
case 2: {
$image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 2;$image$sroa$9$0 = $27;
label = 22;
break L22;
break;
}
case 3: {
$image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 4;$image$sroa$9$0 = $27;
label = 22;
break L22;
break;
}
default: {
$30 = ($29|0)==(4);
$$ = $30 ? 7 : 0;
$image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = $$;$image$sroa$9$0 = $27;
label = 22;
break L22;
}
}
}
} while(0);
if ((label|0) == 22) {
$91 = ($image$sroa$0$0|0)==(0|0);
if ($91) {
$image$sroa$12$06 = $image$sroa$12$0;$image$sroa$15$04 = $image$sroa$15$0;$image$sroa$17$02 = $image$sroa$17$0;$image$sroa$9$08 = $image$sroa$9$0;
} else {
HEAP32[$vararg_buffer>>2] = $fileName;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $image$sroa$9$0;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = $image$sroa$12$0;
_TraceLog(0,14670,$vararg_buffer);
$image$sroa$0$09 = $image$sroa$0$0;$image$sroa$12$05 = $image$sroa$12$0;$image$sroa$15$03 = $image$sroa$15$0;$image$sroa$17$01 = $image$sroa$17$0;$image$sroa$9$07 = $image$sroa$9$0;
HEAP32[$agg$result>>2] = $image$sroa$0$09;
$92 = ((($agg$result)) + 4|0);
HEAP32[$92>>2] = $image$sroa$9$07;
$93 = ((($agg$result)) + 8|0);
HEAP32[$93>>2] = $image$sroa$12$05;
$94 = ((($agg$result)) + 12|0);
HEAP32[$94>>2] = $image$sroa$15$03;
$95 = ((($agg$result)) + 16|0);
HEAP32[$95>>2] = $image$sroa$17$01;
STACKTOP = sp;return;
}
}
HEAP32[$vararg_buffer3>>2] = $fileName;
_TraceLog(2,14709,$vararg_buffer3);
$image$sroa$0$09 = 0;$image$sroa$12$05 = $image$sroa$12$06;$image$sroa$15$03 = $image$sroa$15$04;$image$sroa$17$01 = $image$sroa$17$02;$image$sroa$9$07 = $image$sroa$9$08;
HEAP32[$agg$result>>2] = $image$sroa$0$09;
$92 = ((($agg$result)) + 4|0);
HEAP32[$92>>2] = $image$sroa$9$07;
$93 = ((($agg$result)) + 8|0);
HEAP32[$93>>2] = $image$sroa$12$05;
$94 = ((($agg$result)) + 12|0);
HEAP32[$94>>2] = $image$sroa$15$03;
$95 = ((($agg$result)) + 16|0);
HEAP32[$95>>2] = $image$sroa$17$01;
STACKTOP = sp;return;
}
function _LoadImageEx($agg$result,$pixels,$width,$height) {
$agg$result = $agg$result|0;
$pixels = $pixels|0;
$width = $width|0;
$height = $height|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $width << 2;
$1 = Math_imul($0, $height)|0;
$2 = (_malloc($1)|0);
$3 = ($1|0)>(0);
if ($3) {
$4 = Math_imul($height, $width)|0;
$5 = $4 << 2;
$6 = (($5) + -1)|0;
$7 = $6 >>> 2;
$i$02 = 0;$k$01 = 0;
while(1) {
$8 = (($pixels) + ($k$01<<2)|0);
$9 = HEAP8[$8>>0]|0;
$10 = (($2) + ($i$02)|0);
HEAP8[$10>>0] = $9;
$11 = (((($pixels) + ($k$01<<2)|0)) + 1|0);
$12 = HEAP8[$11>>0]|0;
$13 = $i$02 | 1;
$14 = (($2) + ($13)|0);
HEAP8[$14>>0] = $12;
$15 = (((($pixels) + ($k$01<<2)|0)) + 2|0);
$16 = HEAP8[$15>>0]|0;
$17 = $i$02 | 2;
$18 = (($2) + ($17)|0);
HEAP8[$18>>0] = $16;
$19 = (((($pixels) + ($k$01<<2)|0)) + 3|0);
$20 = HEAP8[$19>>0]|0;
$21 = $i$02 | 3;
$22 = (($2) + ($21)|0);
HEAP8[$22>>0] = $20;
$23 = (($k$01) + 1)|0;
$24 = (($i$02) + 4)|0;
$exitcond = ($k$01|0)==($7|0);
if ($exitcond) {
break;
} else {
$i$02 = $24;$k$01 = $23;
}
}
}
HEAP32[$agg$result>>2] = $2;
$25 = ((($agg$result)) + 4|0);
HEAP32[$25>>2] = $width;
$26 = ((($agg$result)) + 8|0);
HEAP32[$26>>2] = $height;
$27 = ((($agg$result)) + 12|0);
HEAP32[$27>>2] = 1;
$28 = ((($agg$result)) + 16|0);
HEAP32[$28>>2] = 7;
return;
}
function _LoadTexture($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $image = 0, $image$byval_copy1 = 0, $texture$sroa$0$0 = 0, $texture$sroa$3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 96|0;
$image$byval_copy1 = sp + 64|0;
$vararg_buffer = sp;
$texture$sroa$3 = sp + 8|0;
$image = sp + 44|0;
$0 = sp + 24|0;
_LoadImage($image,$fileName);
$1 = HEAP32[$image>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
_TraceLog(2,14761,$vararg_buffer);
$texture$sroa$0$0 = 0;
} else {
;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
_LoadTextureFromImage($0,$image$byval_copy1);
$3 = HEAP32[$0>>2]|0;
$4 = ((($0)) + 4|0);
;HEAP32[$texture$sroa$3>>2]=HEAP32[$4>>2]|0;HEAP32[$texture$sroa$3+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$texture$sroa$3+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$texture$sroa$3+12>>2]=HEAP32[$4+12>>2]|0;
;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
_UnloadImage($image$byval_copy1);
$texture$sroa$0$0 = $3;
}
HEAP32[$agg$result>>2] = $texture$sroa$0$0;
$5 = ((($agg$result)) + 4|0);
;HEAP32[$5>>2]=HEAP32[$texture$sroa$3>>2]|0;HEAP32[$5+4>>2]=HEAP32[$texture$sroa$3+4>>2]|0;HEAP32[$5+8>>2]=HEAP32[$texture$sroa$3+8>>2]|0;HEAP32[$5+12>>2]=HEAP32[$texture$sroa$3+12>>2]|0;
STACKTOP = sp;return;
}
function _LoadTextureFromImage($agg$result,$image) {
$agg$result = $agg$result|0;
$image = $image|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$image>>2]|0;
$1 = ((($image)) + 4|0);
$2 = HEAP32[$1>>2]|0;
$3 = ((($image)) + 8|0);
$4 = HEAP32[$3>>2]|0;
$5 = ((($image)) + 16|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($image)) + 12|0);
$8 = HEAP32[$7>>2]|0;
$9 = (_rlglLoadTexture($0,$2,$4,$6,$8)|0);
$10 = HEAP32[$1>>2]|0;
$11 = HEAP32[$3>>2]|0;
$12 = HEAP32[$7>>2]|0;
$13 = HEAP32[$5>>2]|0;
HEAP32[$agg$result>>2] = $9;
$14 = ((($agg$result)) + 4|0);
HEAP32[$14>>2] = $10;
$15 = ((($agg$result)) + 8|0);
HEAP32[$15>>2] = $11;
$16 = ((($agg$result)) + 12|0);
HEAP32[$16>>2] = $12;
$17 = ((($agg$result)) + 16|0);
HEAP32[$17>>2] = $13;
return;
}
function _UnloadImage($image) {
$image = $image|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$image>>2]|0;
_free($0);
return;
}
function _UnloadTexture($texture) {
$texture = $texture|0;
var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$0 = HEAP32[$texture>>2]|0;
$1 = ($0|0)==(0);
if ($1) {
STACKTOP = sp;return;
}
_rlDeleteTextures($0);
$2 = HEAP32[$texture>>2]|0;
HEAP32[$vararg_buffer>>2] = $2;
_TraceLog(0,14790,$vararg_buffer);
STACKTOP = sp;return;
}
function _GetImageData($image) {
$image = $image|0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0;
var $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
var $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0;
var $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$01 = 0, $k$02 = 0, $k$1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$0 = ((($image)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($image)) + 8|0);
$3 = HEAP32[$2>>2]|0;
$4 = $1 << 2;
$5 = Math_imul($4, $3)|0;
$6 = (_malloc($5)|0);
$7 = HEAP32[$0>>2]|0;
$8 = HEAP32[$2>>2]|0;
$9 = Math_imul($8, $7)|0;
$10 = ($9|0)>(0);
if (!($10)) {
STACKTOP = sp;return ($6|0);
}
$11 = ((($image)) + 16|0);
$12 = HEAP32[$11>>2]|0;
$13 = HEAP32[$0>>2]|0;
$14 = HEAP32[$2>>2]|0;
$15 = Math_imul($14, $13)|0;
$16 = HEAP32[$image>>2]|0;
$i$01 = 0;$k$02 = 0;
while(1) {
switch ($12|0) {
case 1: {
$17 = (($16) + ($k$02)|0);
$18 = HEAP8[$17>>0]|0;
$19 = (($6) + ($i$01<<2)|0);
HEAP8[$19>>0] = $18;
$20 = (($16) + ($k$02)|0);
$21 = HEAP8[$20>>0]|0;
$22 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$22>>0] = $21;
$23 = (($16) + ($k$02)|0);
$24 = HEAP8[$23>>0]|0;
$25 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$25>>0] = $24;
$26 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$26>>0] = -1;
$27 = (($k$02) + 1)|0;
$k$1 = $27;
break;
}
case 2: {
$28 = (($16) + ($k$02)|0);
$29 = HEAP8[$28>>0]|0;
$30 = (($6) + ($i$01<<2)|0);
HEAP8[$30>>0] = $29;
$31 = (($16) + ($k$02)|0);
$32 = HEAP8[$31>>0]|0;
$33 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$33>>0] = $32;
$34 = (($16) + ($k$02)|0);
$35 = HEAP8[$34>>0]|0;
$36 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$36>>0] = $35;
$37 = (($k$02) + 1)|0;
$38 = (($16) + ($37)|0);
$39 = HEAP8[$38>>0]|0;
$40 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$40>>0] = $39;
$41 = (($k$02) + 2)|0;
$k$1 = $41;
break;
}
case 5: {
$42 = (($16) + ($k$02<<1)|0);
$43 = HEAP16[$42>>1]|0;
$44 = $43&65535;
$45 = $44 >>> 11;
$46 = (+($45|0));
$47 = $46 * 8.0;
$48 = (~~(($47))&255);
$49 = (($6) + ($i$01<<2)|0);
HEAP8[$49>>0] = $48;
$50 = $44 >>> 6;
$51 = $50 & 31;
$52 = (+($51|0));
$53 = $52 * 8.0;
$54 = (~~(($53))&255);
$55 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$55>>0] = $54;
$56 = $44 >>> 1;
$57 = $56 & 31;
$58 = (+($57|0));
$59 = $58 * 8.0;
$60 = (~~(($59))&255);
$61 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$61>>0] = $60;
$62 = $44 & 1;
$63 = (0 - ($62))|0;
$64 = $63&255;
$65 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$65>>0] = $64;
$66 = (($k$02) + 1)|0;
$k$1 = $66;
break;
}
case 3: {
$67 = (($16) + ($k$02<<1)|0);
$68 = HEAP16[$67>>1]|0;
$69 = $68&65535;
$70 = $69 >>> 11;
$71 = (+($70|0));
$72 = $71 * 8.0;
$73 = (~~(($72))&255);
$74 = (($6) + ($i$01<<2)|0);
HEAP8[$74>>0] = $73;
$75 = $69 >>> 5;
$76 = $75 & 63;
$77 = (+($76|0));
$78 = $77 * 4.0;
$79 = (~~(($78))&255);
$80 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$80>>0] = $79;
$81 = $69 & 31;
$82 = (+($81|0));
$83 = $82 * 8.0;
$84 = (~~(($83))&255);
$85 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$85>>0] = $84;
$86 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$86>>0] = -1;
$87 = (($k$02) + 1)|0;
$k$1 = $87;
break;
}
case 6: {
$88 = (($16) + ($k$02<<1)|0);
$89 = HEAP16[$88>>1]|0;
$90 = $89&65535;
$91 = $90 >>> 12;
$92 = (+($91|0));
$93 = $92 * 17.0;
$94 = (~~(($93))&255);
$95 = (($6) + ($i$01<<2)|0);
HEAP8[$95>>0] = $94;
$96 = $90 >>> 8;
$97 = $96 & 15;
$98 = (+($97|0));
$99 = $98 * 17.0;
$100 = (~~(($99))&255);
$101 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$101>>0] = $100;
$102 = $90 >>> 4;
$103 = $102 & 15;
$104 = (+($103|0));
$105 = $104 * 17.0;
$106 = (~~(($105))&255);
$107 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$107>>0] = $106;
$108 = $90 & 15;
$109 = (+($108|0));
$110 = $109 * 17.0;
$111 = (~~(($110))&255);
$112 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$112>>0] = $111;
$113 = (($k$02) + 1)|0;
$k$1 = $113;
break;
}
case 7: {
$114 = (($16) + ($k$02)|0);
$115 = HEAP8[$114>>0]|0;
$116 = (($6) + ($i$01<<2)|0);
HEAP8[$116>>0] = $115;
$117 = (($k$02) + 1)|0;
$118 = (($16) + ($117)|0);
$119 = HEAP8[$118>>0]|0;
$120 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$120>>0] = $119;
$121 = (($k$02) + 2)|0;
$122 = (($16) + ($121)|0);
$123 = HEAP8[$122>>0]|0;
$124 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$124>>0] = $123;
$125 = (($k$02) + 3)|0;
$126 = (($16) + ($125)|0);
$127 = HEAP8[$126>>0]|0;
$128 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$128>>0] = $127;
$129 = (($k$02) + 4)|0;
$k$1 = $129;
break;
}
case 4: {
$130 = (($16) + ($k$02)|0);
$131 = HEAP8[$130>>0]|0;
$132 = (($6) + ($i$01<<2)|0);
HEAP8[$132>>0] = $131;
$133 = (($k$02) + 1)|0;
$134 = (($16) + ($133)|0);
$135 = HEAP8[$134>>0]|0;
$136 = (((($6) + ($i$01<<2)|0)) + 1|0);
HEAP8[$136>>0] = $135;
$137 = (($k$02) + 2)|0;
$138 = (($16) + ($137)|0);
$139 = HEAP8[$138>>0]|0;
$140 = (((($6) + ($i$01<<2)|0)) + 2|0);
HEAP8[$140>>0] = $139;
$141 = (((($6) + ($i$01<<2)|0)) + 3|0);
HEAP8[$141>>0] = -1;
$142 = (($k$02) + 3)|0;
$k$1 = $142;
break;
}
default: {
_TraceLog(2,14840,$vararg_buffer);
$k$1 = $k$02;
}
}
$143 = (($i$01) + 1)|0;
$144 = ($143|0)<($15|0);
if ($144) {
$i$01 = $143;$k$02 = $k$1;
} else {
break;
}
}
STACKTOP = sp;return ($6|0);
}
function _ImageFormat($image,$newFormat) {
$image = $image|0;
$newFormat = $newFormat|0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
var $170 = 0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0;
var $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0.0;
var $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0.0;
var $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
var $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
var $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0;
var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$017 = 0, $i1$019 = 0, $i12$028 = 0;
var $i13$031 = 0, $i2$021 = 0, $i3$024 = 0, $i7$026 = 0, $image$byval_copy = 0, $k$018 = 0, $k$123 = 0, $k$230 = 0, $or$cond = 0, $roundf = 0.0, $roundf10 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $roundf4 = 0.0, $roundf5 = 0.0, $roundf6 = 0.0, $roundf7 = 0.0, $roundf8 = 0.0, $roundf9 = 0.0, $vararg_buffer = 0;
var label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$image$byval_copy = sp + 4|0;
$vararg_buffer = sp;
$0 = ((($image)) + 16|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==($newFormat|0);
if ($2) {
STACKTOP = sp;return;
}
$3 = ($1|0)<(8);
$4 = ($newFormat|0)<(8);
$or$cond = $4 & $3;
if (!($or$cond)) {
_TraceLog(2,14886,$vararg_buffer);
STACKTOP = sp;return;
}
;HEAP32[$image$byval_copy>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy+16>>2]=HEAP32[$image+16>>2]|0;
$5 = (_GetImageData($image$byval_copy)|0);
$6 = HEAP32[$image>>2]|0;
_free($6);
HEAP32[$0>>2] = $newFormat;
switch ($newFormat|0) {
case 1: {
$7 = ((($image)) + 4|0);
$8 = HEAP32[$7>>2]|0;
$9 = ((($image)) + 8|0);
$10 = HEAP32[$9>>2]|0;
$11 = Math_imul($10, $8)|0;
$12 = (_malloc($11)|0);
HEAP32[$image>>2] = $12;
$13 = HEAP32[$7>>2]|0;
$14 = HEAP32[$9>>2]|0;
$15 = Math_imul($14, $13)|0;
$16 = ($15|0)>(0);
if ($16) {
$i$017 = 0;
while(1) {
$17 = (($5) + ($i$017<<2)|0);
$18 = HEAP8[$17>>0]|0;
$19 = (+($18&255));
$20 = $19 * 0.29899999499320984;
$21 = (((($5) + ($i$017<<2)|0)) + 1|0);
$22 = HEAP8[$21>>0]|0;
$23 = (+($22&255));
$24 = $23 * 0.58700001239776611;
$25 = $20 + $24;
$26 = (((($5) + ($i$017<<2)|0)) + 2|0);
$27 = HEAP8[$26>>0]|0;
$28 = (+($27&255));
$29 = $28 * 0.11400000005960464;
$30 = $25 + $29;
$31 = (~~(($30))&255);
$32 = HEAP32[$image>>2]|0;
$33 = (($32) + ($i$017)|0);
HEAP8[$33>>0] = $31;
$34 = (($i$017) + 1)|0;
$35 = HEAP32[$7>>2]|0;
$36 = HEAP32[$9>>2]|0;
$37 = Math_imul($36, $35)|0;
$38 = ($34|0)<($37|0);
if ($38) {
$i$017 = $34;
} else {
break;
}
}
}
break;
}
case 2: {
$39 = ((($image)) + 4|0);
$40 = HEAP32[$39>>2]|0;
$41 = ((($image)) + 8|0);
$42 = HEAP32[$41>>2]|0;
$43 = $40 << 1;
$44 = Math_imul($43, $42)|0;
$45 = (_malloc($44)|0);
HEAP32[$image>>2] = $45;
$46 = HEAP32[$39>>2]|0;
$47 = HEAP32[$41>>2]|0;
$48 = $46 << 1;
$49 = Math_imul($48, $47)|0;
$50 = ($49|0)>(0);
if ($50) {
$i1$019 = 0;$k$018 = 0;
while(1) {
$51 = (($5) + ($k$018<<2)|0);
$52 = HEAP8[$51>>0]|0;
$53 = (+($52&255));
$54 = $53 * 0.29899999499320984;
$55 = (((($5) + ($k$018<<2)|0)) + 1|0);
$56 = HEAP8[$55>>0]|0;
$57 = (+($56&255));
$58 = $57 * 0.58700001239776611;
$59 = $54 + $58;
$60 = (((($5) + ($k$018<<2)|0)) + 2|0);
$61 = HEAP8[$60>>0]|0;
$62 = (+($61&255));
$63 = $62 * 0.11400000005960464;
$64 = $59 + $63;
$65 = (~~(($64))&255);
$66 = HEAP32[$image>>2]|0;
$67 = (($66) + ($i1$019)|0);
HEAP8[$67>>0] = $65;
$68 = (((($5) + ($k$018<<2)|0)) + 3|0);
$69 = HEAP8[$68>>0]|0;
$70 = $i1$019 | 1;
$71 = HEAP32[$image>>2]|0;
$72 = (($71) + ($70)|0);
HEAP8[$72>>0] = $69;
$73 = (($k$018) + 1)|0;
$74 = (($i1$019) + 2)|0;
$75 = HEAP32[$39>>2]|0;
$76 = HEAP32[$41>>2]|0;
$77 = $75 << 1;
$78 = Math_imul($77, $76)|0;
$79 = ($74|0)<($78|0);
if ($79) {
$i1$019 = $74;$k$018 = $73;
} else {
break;
}
}
}
break;
}
case 3: {
$80 = ((($image)) + 4|0);
$81 = HEAP32[$80>>2]|0;
$82 = ((($image)) + 8|0);
$83 = HEAP32[$82>>2]|0;
$84 = $81 << 1;
$85 = Math_imul($84, $83)|0;
$86 = (_malloc($85)|0);
HEAP32[$image>>2] = $86;
$87 = HEAP32[$80>>2]|0;
$88 = HEAP32[$82>>2]|0;
$89 = Math_imul($88, $87)|0;
$90 = ($89|0)>(0);
if ($90) {
$91 = HEAP8[$5>>0]|0;
$92 = (+($91&255));
$93 = $92 * 31.0;
$94 = $93 / 255.0;
$roundf8 = (+_roundf($94));
$95 = (~~(($roundf8))&255);
$96 = ((($5)) + 1|0);
$97 = HEAP8[$96>>0]|0;
$98 = (+($97&255));
$99 = $98 * 63.0;
$100 = $99 / 255.0;
$roundf9 = (+_roundf($100));
$101 = (~~(($roundf9))&255);
$102 = ((($5)) + 2|0);
$103 = HEAP8[$102>>0]|0;
$104 = (+($103&255));
$105 = $104 * 31.0;
$106 = $105 / 255.0;
$roundf10 = (+_roundf($106));
$107 = (~~(($roundf10))&255);
$108 = $95&255;
$109 = $108 << 11;
$110 = $101&255;
$111 = $110 << 5;
$112 = $111 | $109;
$113 = $107&255;
$114 = $112 | $113;
$115 = $114&65535;
$116 = HEAP32[$image>>2]|0;
$117 = HEAP32[$80>>2]|0;
$118 = HEAP32[$82>>2]|0;
$119 = Math_imul($118, $117)|0;
$i2$021 = 0;
while(1) {
$120 = (($116) + ($i2$021<<1)|0);
HEAP16[$120>>1] = $115;
$121 = (($i2$021) + 1)|0;
$122 = ($121|0)<($119|0);
if ($122) {
$i2$021 = $121;
} else {
break;
}
}
}
break;
}
case 4: {
$123 = ((($image)) + 4|0);
$124 = HEAP32[$123>>2]|0;
$125 = ((($image)) + 8|0);
$126 = HEAP32[$125>>2]|0;
$127 = ($124*3)|0;
$128 = Math_imul($127, $126)|0;
$129 = (_malloc($128)|0);
HEAP32[$image>>2] = $129;
$130 = HEAP32[$123>>2]|0;
$131 = HEAP32[$125>>2]|0;
$132 = ($130*3)|0;
$133 = Math_imul($132, $131)|0;
$134 = ($133|0)>(0);
if ($134) {
$i3$024 = 0;$k$123 = 0;
while(1) {
$135 = (($5) + ($k$123<<2)|0);
$136 = HEAP8[$135>>0]|0;
$137 = HEAP32[$image>>2]|0;
$138 = (($137) + ($i3$024)|0);
HEAP8[$138>>0] = $136;
$139 = (((($5) + ($k$123<<2)|0)) + 1|0);
$140 = HEAP8[$139>>0]|0;
$141 = (($i3$024) + 1)|0;
$142 = HEAP32[$image>>2]|0;
$143 = (($142) + ($141)|0);
HEAP8[$143>>0] = $140;
$144 = (((($5) + ($k$123<<2)|0)) + 2|0);
$145 = HEAP8[$144>>0]|0;
$146 = (($i3$024) + 2)|0;
$147 = HEAP32[$image>>2]|0;
$148 = (($147) + ($146)|0);
HEAP8[$148>>0] = $145;
$149 = (($k$123) + 1)|0;
$150 = (($i3$024) + 3)|0;
$151 = HEAP32[$123>>2]|0;
$152 = HEAP32[$125>>2]|0;
$153 = ($151*3)|0;
$154 = Math_imul($153, $152)|0;
$155 = ($150|0)<($154|0);
if ($155) {
$i3$024 = $150;$k$123 = $149;
} else {
break;
}
}
}
break;
}
case 5: {
$156 = ((($image)) + 4|0);
$157 = HEAP32[$156>>2]|0;
$158 = ((($image)) + 8|0);
$159 = HEAP32[$158>>2]|0;
$160 = $157 << 1;
$161 = Math_imul($160, $159)|0;
$162 = (_malloc($161)|0);
HEAP32[$image>>2] = $162;
$163 = HEAP32[$156>>2]|0;
$164 = HEAP32[$158>>2]|0;
$165 = Math_imul($164, $163)|0;
$166 = ($165|0)>(0);
if ($166) {
$167 = HEAP32[$image>>2]|0;
$168 = HEAP32[$156>>2]|0;
$169 = HEAP32[$158>>2]|0;
$170 = Math_imul($169, $168)|0;
$i7$026 = 0;
while(1) {
$171 = (($5) + ($i7$026<<2)|0);
$172 = HEAP8[$171>>0]|0;
$173 = (+($172&255));
$174 = $173 * 31.0;
$175 = $174 / 255.0;
$roundf5 = (+_roundf($175));
$176 = (~~(($roundf5))&255);
$177 = (((($5) + ($i7$026<<2)|0)) + 1|0);
$178 = HEAP8[$177>>0]|0;
$179 = (+($178&255));
$180 = $179 * 31.0;
$181 = $180 / 255.0;
$roundf6 = (+_roundf($181));
$182 = (~~(($roundf6))&255);
$183 = (((($5) + ($i7$026<<2)|0)) + 2|0);
$184 = HEAP8[$183>>0]|0;
$185 = (+($184&255));
$186 = $185 * 31.0;
$187 = $186 / 255.0;
$roundf7 = (+_roundf($187));
$188 = (~~(($roundf7))&255);
$189 = (((($5) + ($i7$026<<2)|0)) + 3|0);
$190 = HEAP8[$189>>0]|0;
$191 = ($190&255)>(50);
$192 = $176&255;
$193 = $192 << 11;
$194 = $182&255;
$195 = $194 << 6;
$196 = $195 | $193;
$197 = $188&255;
$198 = $197 << 1;
$199 = $196 | $198;
$200 = $191&1;
$201 = $199 | $200;
$202 = $201&65535;
$203 = (($167) + ($i7$026<<1)|0);
HEAP16[$203>>1] = $202;
$204 = (($i7$026) + 1)|0;
$205 = ($204|0)<($170|0);
if ($205) {
$i7$026 = $204;
} else {
break;
}
}
}
break;
}
case 6: {
$206 = ((($image)) + 4|0);
$207 = HEAP32[$206>>2]|0;
$208 = ((($image)) + 8|0);
$209 = HEAP32[$208>>2]|0;
$210 = $207 << 1;
$211 = Math_imul($210, $209)|0;
$212 = (_malloc($211)|0);
HEAP32[$image>>2] = $212;
$213 = HEAP32[$206>>2]|0;
$214 = HEAP32[$208>>2]|0;
$215 = Math_imul($214, $213)|0;
$216 = ($215|0)>(0);
if ($216) {
$217 = HEAP32[$image>>2]|0;
$218 = HEAP32[$206>>2]|0;
$219 = HEAP32[$208>>2]|0;
$220 = Math_imul($219, $218)|0;
$i12$028 = 0;
while(1) {
$221 = (($5) + ($i12$028<<2)|0);
$222 = HEAP8[$221>>0]|0;
$223 = (+($222&255));
$224 = $223 * 15.0;
$225 = $224 / 255.0;
$roundf = (+_roundf($225));
$226 = (~~(($roundf))&255);
$227 = (((($5) + ($i12$028<<2)|0)) + 1|0);
$228 = HEAP8[$227>>0]|0;
$229 = (+($228&255));
$230 = $229 * 15.0;
$231 = $230 / 255.0;
$roundf2 = (+_roundf($231));
$232 = (~~(($roundf2))&255);
$233 = (((($5) + ($i12$028<<2)|0)) + 2|0);
$234 = HEAP8[$233>>0]|0;
$235 = (+($234&255));
$236 = $235 * 15.0;
$237 = $236 / 255.0;
$roundf3 = (+_roundf($237));
$238 = (~~(($roundf3))&255);
$239 = (((($5) + ($i12$028<<2)|0)) + 3|0);
$240 = HEAP8[$239>>0]|0;
$241 = (+($240&255));
$242 = $241 * 15.0;
$243 = $242 / 255.0;
$roundf4 = (+_roundf($243));
$244 = (~~(($roundf4))&255);
$245 = $226&255;
$246 = $245 << 12;
$247 = $232&255;
$248 = $247 << 8;
$249 = $248 | $246;
$250 = $238&255;
$251 = $250 << 4;
$252 = $249 | $251;
$253 = $244&255;
$254 = $252 | $253;
$255 = $254&65535;
$256 = (($217) + ($i12$028<<1)|0);
HEAP16[$256>>1] = $255;
$257 = (($i12$028) + 1)|0;
$258 = ($257|0)<($220|0);
if ($258) {
$i12$028 = $257;
} else {
break;
}
}
}
break;
}
case 7: {
$259 = ((($image)) + 4|0);
$260 = HEAP32[$259>>2]|0;
$261 = ((($image)) + 8|0);
$262 = HEAP32[$261>>2]|0;
$263 = $260 << 2;
$264 = Math_imul($263, $262)|0;
$265 = (_malloc($264)|0);
HEAP32[$image>>2] = $265;
$266 = HEAP32[$259>>2]|0;
$267 = HEAP32[$261>>2]|0;
$268 = $266 << 2;
$269 = Math_imul($268, $267)|0;
$270 = ($269|0)>(0);
if ($270) {
$i13$031 = 0;$k$230 = 0;
while(1) {
$271 = (($5) + ($k$230<<2)|0);
$272 = HEAP8[$271>>0]|0;
$273 = HEAP32[$image>>2]|0;
$274 = (($273) + ($i13$031)|0);
HEAP8[$274>>0] = $272;
$275 = (((($5) + ($k$230<<2)|0)) + 1|0);
$276 = HEAP8[$275>>0]|0;
$277 = $i13$031 | 1;
$278 = HEAP32[$image>>2]|0;
$279 = (($278) + ($277)|0);
HEAP8[$279>>0] = $276;
$280 = (((($5) + ($k$230<<2)|0)) + 2|0);
$281 = HEAP8[$280>>0]|0;
$282 = $i13$031 | 2;
$283 = HEAP32[$image>>2]|0;
$284 = (($283) + ($282)|0);
HEAP8[$284>>0] = $281;
$285 = (((($5) + ($k$230<<2)|0)) + 3|0);
$286 = HEAP8[$285>>0]|0;
$287 = $i13$031 | 3;
$288 = HEAP32[$image>>2]|0;
$289 = (($288) + ($287)|0);
HEAP8[$289>>0] = $286;
$290 = (($k$230) + 1)|0;
$291 = (($i13$031) + 4)|0;
$292 = HEAP32[$259>>2]|0;
$293 = HEAP32[$261>>2]|0;
$294 = $292 << 2;
$295 = Math_imul($294, $293)|0;
$296 = ($291|0)<($295|0);
if ($296) {
$i13$031 = $291;$k$230 = $290;
} else {
break;
}
}
}
break;
}
default: {
}
}
_free($5);
STACKTOP = sp;return;
}
function _DrawTexture($texture,$posX,$posY,$tint) {
$texture = $texture|0;
$posX = $posX|0;
$posY = $posY|0;
$tint = $tint|0;
var $$byval_copy = 0, $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $texture$byval_copy = 0, $tint$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$tint$byval_copy = sp + 40|0;
$$byval_copy = sp + 32|0;
$texture$byval_copy = sp + 8|0;
$0 = sp;
$1 = (+($posX|0));
$2 = (+($posY|0));
HEAPF32[$0>>2] = $1;
$3 = ((($0)) + 4|0);
HEAPF32[$3>>2] = $2;
;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0;HEAP32[$texture$byval_copy+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$texture$byval_copy+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$texture$byval_copy+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$texture$byval_copy+16>>2]=HEAP32[$texture+16>>2]|0;
;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;
;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
_DrawTextureEx($texture$byval_copy,$$byval_copy,0.0,1.0,$tint$byval_copy);
STACKTOP = sp;return;
}
function _DrawTextureEx($texture,$position,$rotation,$scale,$tint) {
$texture = $texture|0;
$position = $position|0;
$rotation = +$rotation;
$scale = +$scale;
$tint = $tint|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0, $destRec = 0, $destRec$byval_copy = 0, $origin = 0, $sourceRec = 0, $sourceRec$byval_copy = 0, $texture$byval_copy = 0, $tint$byval_copy = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$tint$byval_copy = sp + 104|0;
$tmpcast$byval_copy = sp + 96|0;
$destRec$byval_copy = sp + 80|0;
$sourceRec$byval_copy = sp + 64|0;
$texture$byval_copy = sp + 40|0;
$sourceRec = sp + 24|0;
$destRec = sp + 8|0;
$origin = sp;
HEAP32[$sourceRec>>2] = 0;
$0 = ((($sourceRec)) + 4|0);
HEAP32[$0>>2] = 0;
$1 = ((($sourceRec)) + 8|0);
$2 = ((($texture)) + 4|0);
$3 = HEAP32[$2>>2]|0;
HEAP32[$1>>2] = $3;
$4 = ((($sourceRec)) + 12|0);
$5 = ((($texture)) + 8|0);
$6 = HEAP32[$5>>2]|0;
HEAP32[$4>>2] = $6;
$7 = +HEAPF32[$position>>2];
$8 = (~~(($7)));
HEAP32[$destRec>>2] = $8;
$9 = ((($destRec)) + 4|0);
$10 = ((($position)) + 4|0);
$11 = +HEAPF32[$10>>2];
$12 = (~~(($11)));
HEAP32[$9>>2] = $12;
$13 = ((($destRec)) + 8|0);
$14 = HEAP32[$2>>2]|0;
$15 = (+($14|0));
$16 = $15 * $scale;
$17 = (~~(($16)));
HEAP32[$13>>2] = $17;
$18 = ((($destRec)) + 12|0);
$19 = HEAP32[$5>>2]|0;
$20 = (+($19|0));
$21 = $20 * $scale;
$22 = (~~(($21)));
HEAP32[$18>>2] = $22;
$23 = $origin;
$24 = $23;
HEAP32[$24>>2] = 0;
$25 = (($23) + 4)|0;
$26 = $25;
HEAP32[$26>>2] = 0;
;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0;HEAP32[$texture$byval_copy+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$texture$byval_copy+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$texture$byval_copy+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$texture$byval_copy+16>>2]=HEAP32[$texture+16>>2]|0;
;HEAP32[$sourceRec$byval_copy>>2]=HEAP32[$sourceRec>>2]|0;HEAP32[$sourceRec$byval_copy+4>>2]=HEAP32[$sourceRec+4>>2]|0;HEAP32[$sourceRec$byval_copy+8>>2]=HEAP32[$sourceRec+8>>2]|0;HEAP32[$sourceRec$byval_copy+12>>2]=HEAP32[$sourceRec+12>>2]|0;
;HEAP32[$destRec$byval_copy>>2]=HEAP32[$destRec>>2]|0;HEAP32[$destRec$byval_copy+4>>2]=HEAP32[$destRec+4>>2]|0;HEAP32[$destRec$byval_copy+8>>2]=HEAP32[$destRec+8>>2]|0;HEAP32[$destRec$byval_copy+12>>2]=HEAP32[$destRec+12>>2]|0;
;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$origin>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$origin+4>>2]|0;
;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
_DrawTexturePro($texture$byval_copy,$sourceRec$byval_copy,$destRec$byval_copy,$tmpcast$byval_copy,$rotation,$tint$byval_copy);
STACKTOP = sp;return;
}
function _DrawTexturePro($texture,$sourceRec,$destRec,$origin,$rotation,$tint) {
$texture = $texture|0;
$sourceRec = $sourceRec|0;
$destRec = $destRec|0;
$origin = $origin|0;
$rotation = +$rotation;
$tint = $tint|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0.0;
var $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0;
var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0;
var $63 = 0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0.0;
var $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$texture>>2]|0;
_rlEnableTexture($0);
_rlPushMatrix();
$1 = HEAP32[$destRec>>2]|0;
$2 = (+($1|0));
$3 = ((($destRec)) + 4|0);
$4 = HEAP32[$3>>2]|0;
$5 = (+($4|0));
_rlTranslatef($2,$5,0.0);
_rlRotatef($rotation,0.0,0.0,1.0);
$6 = +HEAPF32[$origin>>2];
$7 = -$6;
$8 = ((($origin)) + 4|0);
$9 = +HEAPF32[$8>>2];
$10 = -$9;
_rlTranslatef($7,$10,0.0);
_rlBegin(2);
$11 = HEAP8[$tint>>0]|0;
$12 = ((($tint)) + 1|0);
$13 = HEAP8[$12>>0]|0;
$14 = ((($tint)) + 2|0);
$15 = HEAP8[$14>>0]|0;
$16 = ((($tint)) + 3|0);
$17 = HEAP8[$16>>0]|0;
_rlColor4ub($11,$13,$15,$17);
$18 = HEAP32[$sourceRec>>2]|0;
$19 = (+($18|0));
$20 = ((($texture)) + 4|0);
$21 = HEAP32[$20>>2]|0;
$22 = (+($21|0));
$23 = $19 / $22;
$24 = ((($sourceRec)) + 4|0);
$25 = HEAP32[$24>>2]|0;
$26 = (+($25|0));
$27 = ((($texture)) + 8|0);
$28 = HEAP32[$27>>2]|0;
$29 = (+($28|0));
$30 = $26 / $29;
_rlTexCoord2f($23,$30);
_rlVertex2f(0.0,0.0);
$31 = HEAP32[$sourceRec>>2]|0;
$32 = (+($31|0));
$33 = HEAP32[$20>>2]|0;
$34 = (+($33|0));
$35 = $32 / $34;
$36 = HEAP32[$24>>2]|0;
$37 = ((($sourceRec)) + 12|0);
$38 = HEAP32[$37>>2]|0;
$39 = (($38) + ($36))|0;
$40 = (+($39|0));
$41 = HEAP32[$27>>2]|0;
$42 = (+($41|0));
$43 = $40 / $42;
_rlTexCoord2f($35,$43);
$44 = ((($destRec)) + 12|0);
$45 = HEAP32[$44>>2]|0;
$46 = (+($45|0));
_rlVertex2f(0.0,$46);
$47 = HEAP32[$sourceRec>>2]|0;
$48 = ((($sourceRec)) + 8|0);
$49 = HEAP32[$48>>2]|0;
$50 = (($49) + ($47))|0;
$51 = (+($50|0));
$52 = HEAP32[$20>>2]|0;
$53 = (+($52|0));
$54 = $51 / $53;
$55 = HEAP32[$24>>2]|0;
$56 = HEAP32[$37>>2]|0;
$57 = (($56) + ($55))|0;
$58 = (+($57|0));
$59 = HEAP32[$27>>2]|0;
$60 = (+($59|0));
$61 = $58 / $60;
_rlTexCoord2f($54,$61);
$62 = ((($destRec)) + 8|0);
$63 = HEAP32[$62>>2]|0;
$64 = (+($63|0));
$65 = HEAP32[$44>>2]|0;
$66 = (+($65|0));
_rlVertex2f($64,$66);
$67 = HEAP32[$sourceRec>>2]|0;
$68 = HEAP32[$48>>2]|0;
$69 = (($68) + ($67))|0;
$70 = (+($69|0));
$71 = HEAP32[$20>>2]|0;
$72 = (+($71|0));
$73 = $70 / $72;
$74 = HEAP32[$24>>2]|0;
$75 = (+($74|0));
$76 = HEAP32[$27>>2]|0;
$77 = (+($76|0));
$78 = $75 / $77;
_rlTexCoord2f($73,$78);
$79 = HEAP32[$62>>2]|0;
$80 = (+($79|0));
_rlVertex2f($80,0.0);
_rlEnd();
_rlPopMatrix();
return;
}
function _DrawTextureRec($texture,$sourceRec,$position,$tint) {
$texture = $texture|0;
$sourceRec = $sourceRec|0;
$position = $position|0;
$tint = $tint|0;
var $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $destRec = 0, $destRec$byval_copy = 0;
var $ispos = 0, $ispos1 = 0, $neg = 0, $neg2 = 0, $origin = 0, $sourceRec$byval_copy = 0, $texture$byval_copy = 0, $tint$byval_copy = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 96|0;
$tint$byval_copy = sp + 88|0;
$tmpcast$byval_copy = sp + 80|0;
$destRec$byval_copy = sp + 64|0;
$sourceRec$byval_copy = sp + 48|0;
$texture$byval_copy = sp + 24|0;
$destRec = sp + 8|0;
$origin = sp;
$0 = +HEAPF32[$position>>2];
$1 = (~~(($0)));
HEAP32[$destRec>>2] = $1;
$2 = ((($destRec)) + 4|0);
$3 = ((($position)) + 4|0);
$4 = +HEAPF32[$3>>2];
$5 = (~~(($4)));
HEAP32[$2>>2] = $5;
$6 = ((($destRec)) + 8|0);
$7 = ((($sourceRec)) + 8|0);
$8 = HEAP32[$7>>2]|0;
$ispos = ($8|0)>(-1);
$neg = (0 - ($8))|0;
$9 = $ispos ? $8 : $neg;
HEAP32[$6>>2] = $9;
$10 = ((($destRec)) + 12|0);
$11 = ((($sourceRec)) + 12|0);
$12 = HEAP32[$11>>2]|0;
$ispos1 = ($12|0)>(-1);
$neg2 = (0 - ($12))|0;
$13 = $ispos1 ? $12 : $neg2;
HEAP32[$10>>2] = $13;
$14 = $origin;
$15 = $14;
HEAP32[$15>>2] = 0;
$16 = (($14) + 4)|0;
$17 = $16;
HEAP32[$17>>2] = 0;
;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0;HEAP32[$texture$byval_copy+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$texture$byval_copy+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$texture$byval_copy+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$texture$byval_copy+16>>2]=HEAP32[$texture+16>>2]|0;
;HEAP32[$sourceRec$byval_copy>>2]=HEAP32[$sourceRec>>2]|0;HEAP32[$sourceRec$byval_copy+4>>2]=HEAP32[$sourceRec+4>>2]|0;HEAP32[$sourceRec$byval_copy+8>>2]=HEAP32[$sourceRec+8>>2]|0;HEAP32[$sourceRec$byval_copy+12>>2]=HEAP32[$sourceRec+12>>2]|0;
;HEAP32[$destRec$byval_copy>>2]=HEAP32[$destRec>>2]|0;HEAP32[$destRec$byval_copy+4>>2]=HEAP32[$destRec+4>>2]|0;HEAP32[$destRec$byval_copy+8>>2]=HEAP32[$destRec+8>>2]|0;HEAP32[$destRec$byval_copy+12>>2]=HEAP32[$destRec+12>>2]|0;
;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$origin>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$origin+4>>2]|0;
;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
_DrawTexturePro($texture$byval_copy,$sourceRec$byval_copy,$destRec$byval_copy,$tmpcast$byval_copy,0.0,$tint$byval_copy);
STACKTOP = sp;return;
}
function _LoadModel($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $mesh = 0, $mesh$byval_copy = 0, $model = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 688|0;
$mesh$byval_copy = sp + 608|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$model = sp + 392|0;
$mesh = sp + 312|0;
$0 = sp + 232|0;
$1 = sp + 16|0;
_memset(($model|0),0,216)|0;
dest=$mesh; stop=dest+80|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$2 = (_GetExtension($fileName)|0);
$3 = (_strcmp($2,14940)|0);
$4 = ($3|0)==(0);
if ($4) {
_LoadOBJ($0,$fileName);
dest=$mesh; src=$0; stop=dest+80|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
} else {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,14944,$vararg_buffer);
}
$5 = HEAP32[$mesh>>2]|0;
$6 = ($5|0)==(0);
if ($6) {
_TraceLog(2,15000,$vararg_buffer1);
_memcpy(($agg$result|0),($model|0),216)|0;
STACKTOP = sp;return;
} else {
dest=$mesh$byval_copy; src=$mesh; stop=dest+80|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
_rlglLoadModel($1,$mesh$byval_copy);
_memcpy(($model|0),($1|0),216)|0;
_memcpy(($agg$result|0),($model|0),216)|0;
STACKTOP = sp;return;
}
}
function _UnloadModel($model) {
$model = $model|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_ptr4 = 0, $vararg_ptr5 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$0 = (_rlGetVersion()|0);
$1 = ($0|0)==(1);
if ($1) {
$2 = ((($model)) + 4|0);
$3 = HEAP32[$2>>2]|0;
_free($3);
$4 = ((($model)) + 8|0);
$5 = HEAP32[$4>>2]|0;
_free($5);
$6 = ((($model)) + 16|0);
$7 = HEAP32[$6>>2]|0;
_free($7);
}
$8 = ((($model)) + 56|0);
$9 = HEAP32[$8>>2]|0;
_rlDeleteBuffers($9);
$10 = ((($model)) + 60|0);
$11 = HEAP32[$10>>2]|0;
_rlDeleteBuffers($11);
$12 = ((($model)) + 64|0);
$13 = HEAP32[$12>>2]|0;
_rlDeleteBuffers($13);
$14 = ((($model)) + 52|0);
$15 = HEAP32[$14>>2]|0;
_rlDeleteVertexArrays($15);
$16 = HEAP32[$14>>2]|0;
$17 = ($16|0)==(0);
if ($17) {
$18 = HEAP32[$8>>2]|0;
$19 = HEAP32[$10>>2]|0;
$20 = HEAP32[$12>>2]|0;
HEAP32[$vararg_buffer1>>2] = $18;
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
HEAP32[$vararg_ptr4>>2] = $19;
$vararg_ptr5 = ((($vararg_buffer1)) + 8|0);
HEAP32[$vararg_ptr5>>2] = $20;
_TraceLog(0,15074,$vararg_buffer1);
STACKTOP = sp;return;
} else {
HEAP32[$vararg_buffer>>2] = $16;
_TraceLog(0,15026,$vararg_buffer);
STACKTOP = sp;return;
}
}
function _SetModelTexture($model,$texture) {
$model = $model|0;
$texture = $texture|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$texture>>2]|0;
$1 = ($0|0)==(0);
if ($1) {
$2 = HEAP32[808>>2]|0;
$3 = ((($model)) + 144|0);
HEAP32[$3>>2] = $2;
$4 = HEAP32[808>>2]|0;
$5 = ((($model)) + 168|0);
HEAP32[$5>>2] = $4;
return;
} else {
$6 = ((($model)) + 144|0);
;HEAP32[$6>>2]=HEAP32[$texture>>2]|0;HEAP32[$6+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$6+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$6+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$6+16>>2]=HEAP32[$texture+16>>2]|0;
$7 = HEAP32[$texture>>2]|0;
$8 = ((($model)) + 168|0);
HEAP32[$8>>2] = $7;
return;
}
}
function _DrawModelEx($model,$position,$rotationAxis,$rotationAngle,$scale,$tint) {
$model = $model|0;
$position = $position|0;
$rotationAxis = $rotationAxis|0;
$rotationAngle = +$rotationAngle;
$scale = $scale|0;
$tint = $tint|0;
var $model$byval_copy = 0, $position$byval_copy = 0, $rotationAxis$byval_copy = 0, $scale$byval_copy = 0, $tint$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$tint$byval_copy = sp + 252|0;
$scale$byval_copy = sp + 240|0;
$rotationAxis$byval_copy = sp + 228|0;
$position$byval_copy = sp + 216|0;
$model$byval_copy = sp;
_memcpy(($model$byval_copy|0),($model|0),216)|0;
;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[$position+8>>2]|0;
;HEAP32[$rotationAxis$byval_copy>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$rotationAxis$byval_copy+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$rotationAxis$byval_copy+8>>2]=HEAP32[$rotationAxis+8>>2]|0;
;HEAP32[$scale$byval_copy>>2]=HEAP32[$scale>>2]|0;HEAP32[$scale$byval_copy+4>>2]=HEAP32[$scale+4>>2]|0;HEAP32[$scale$byval_copy+8>>2]=HEAP32[$scale+8>>2]|0;
;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
_rlglDrawModel($model$byval_copy,$position$byval_copy,$rotationAxis$byval_copy,$rotationAngle,$scale$byval_copy,$tint$byval_copy,0);
STACKTOP = sp;return;
}
function _InitAudioDevice() {
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$0 = (_alcOpenDevice((0|0))|0);
$1 = ($0|0)==(0|0);
if ($1) {
_TraceLog(1,15144,$vararg_buffer);
}
$2 = (_alcCreateContext(($0|0),(0|0))|0);
$cond = ($2|0)==(0|0);
if ($cond) {
label = 6;
} else {
$3 = (_alcMakeContextCurrent(($2|0))|0);
$4 = ($3<<24>>24)==(0);
if ($4) {
_alcDestroyContext(($2|0));
label = 6;
}
}
if ((label|0) == 6) {
(_alcCloseDevice(($0|0))|0);
_TraceLog(1,15177,$vararg_buffer1);
}
$5 = (_alcGetString(($0|0),4101)|0);
HEAP32[$vararg_buffer3>>2] = $5;
_TraceLog(0,15207,$vararg_buffer3);
_alListener3f(4100,0.0,0.0,0.0);
_alListener3f(4102,0.0,0.0,0.0);
_alListener3f(4111,0.0,0.0,-1.0);
STACKTOP = sp;return;
}
function _CloseAudioDevice() {
var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
_StopMusicStream();
$0 = (_alcGetCurrentContext()|0);
$1 = ($0|0)==(0|0);
if ($1) {
_TraceLog(2,15261,$vararg_buffer);
}
$2 = (_alcGetContextsDevice(($0|0))|0);
(_alcMakeContextCurrent((0|0))|0);
_alcDestroyContext(($0|0));
(_alcCloseDevice(($2|0))|0);
STACKTOP = sp;return;
}
function _StopMusicStream() {
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[5740>>2]|0;
$1 = ($0|0)==(0);
if ($1) {
HEAP32[5740>>2] = 0;
return;
}
$2 = HEAP32[(5756)>>2]|0;
_alSourceStop(($2|0));
_EmptyMusicStream();
_alDeleteSources(1,((5756)|0));
_alDeleteBuffers(2,((5748)|0));
$3 = HEAP32[5744>>2]|0;
_stb_vorbis_close($3);
HEAP32[5740>>2] = 0;
return;
}
function _PlayMusicStream($fileName) {
$fileName = $fileName|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $info = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer13 = 0, $vararg_buffer5 = 0, $vararg_buffer9 = 0, $vararg_ptr12 = 0, $vararg_ptr4 = 0, $vararg_ptr8 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$vararg_buffer13 = sp + 32|0;
$vararg_buffer9 = sp + 24|0;
$vararg_buffer5 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$info = sp + 40|0;
$0 = (_GetExtension($fileName)|0);
$1 = (_strcmp($0,15309)|0);
$2 = ($1|0)==(0);
if (!($2)) {
HEAP32[$vararg_buffer13>>2] = $fileName;
_TraceLog(2,15430,$vararg_buffer13);
STACKTOP = sp;return;
}
_StopMusicStream();
$3 = (_stb_vorbis_open_filename($fileName,0,0)|0);
HEAP32[5744>>2] = $3;
$4 = ($3|0)==(0|0);
if ($4) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,15313,$vararg_buffer);
STACKTOP = sp;return;
} else {
_stb_vorbis_get_info($info,$3);
$5 = ((($info)) + 4|0);
$6 = HEAP32[$5>>2]|0;
HEAP32[(5764)>>2] = $6;
$7 = HEAP32[$info>>2]|0;
HEAP32[(5768)>>2] = $7;
$8 = HEAP32[$info>>2]|0;
HEAP32[$vararg_buffer1>>2] = $fileName;
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
HEAP32[$vararg_ptr4>>2] = $8;
_TraceLog(0,15353,$vararg_buffer1);
$9 = HEAP32[$5>>2]|0;
HEAP32[$vararg_buffer5>>2] = $fileName;
$vararg_ptr8 = ((($vararg_buffer5)) + 4|0);
HEAP32[$vararg_ptr8>>2] = $9;
_TraceLog(0,15378,$vararg_buffer5);
$10 = ((($info)) + 16|0);
$11 = HEAP32[$10>>2]|0;
HEAP32[$vararg_buffer9>>2] = $fileName;
$vararg_ptr12 = ((($vararg_buffer9)) + 4|0);
HEAP32[$vararg_ptr12>>2] = $11;
_TraceLog(3,15400,$vararg_buffer9);
$12 = HEAP32[$5>>2]|0;
$13 = ($12|0)==(2);
$$ = $13 ? 4355 : 4353;
HEAP32[(5760)>>2] = $$;
HEAP32[(5776)>>2] = 1;
HEAP32[5740>>2] = 1;
_alGenSources(1,((5756)|0));
$14 = HEAP32[(5756)>>2]|0;
_alSourcef(($14|0),4099,1.0);
$15 = HEAP32[(5756)>>2]|0;
_alSourcef(($15|0),4106,1.0);
$16 = HEAP32[(5756)>>2]|0;
_alSource3f(($16|0),4100,0.0,0.0,0.0);
$17 = HEAP32[(5756)>>2]|0;
_alSource3f(($17|0),4102,0.0,0.0,0.0);
_alGenBuffers(2,((5748)|0));
$18 = HEAP32[(5748)>>2]|0;
(_BufferMusicStream($18)|0);
$19 = HEAP32[(5752)>>2]|0;
(_BufferMusicStream($19)|0);
$20 = HEAP32[(5756)>>2]|0;
_alSourceQueueBuffers(($20|0),2,((5748)|0));
$21 = HEAP32[(5756)>>2]|0;
_alSourcePlay(($21|0));
$22 = HEAP32[5744>>2]|0;
$23 = (_stb_vorbis_stream_length_in_samples($22)|0);
$24 = HEAP32[(5764)>>2]|0;
$25 = Math_imul($24, $23)|0;
HEAP32[(5772)>>2] = $25;
STACKTOP = sp;return;
}
}
function _SetMusicVolume($volume) {
$volume = +$volume;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[(5756)>>2]|0;
_alSourcef(($0|0),4106,(+$volume));
return;
}
function _UpdateMusicStream() {
var $$lcssa = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $active$0$lcssa = 0, $active$1 = 0, $buffer = 0, $or$cond = 0, $or$cond3 = 0, $processed = 0, $state = 0, $vararg_buffer = 0, label = 0;
var sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$buffer = sp + 12|0;
$processed = sp + 8|0;
$state = sp + 4|0;
HEAP32[$buffer>>2] = 0;
HEAP32[$processed>>2] = 0;
$0 = HEAP32[5740>>2]|0;
$1 = ($0|0)==(0);
if ($1) {
STACKTOP = sp;return;
}
$2 = HEAP32[(5756)>>2]|0;
_alGetSourcei(($2|0),4118,($processed|0));
$$pr = HEAP32[$processed>>2]|0;
$3 = ($$pr|0)>(0);
$4 = HEAP32[(5756)>>2]|0;
if ($3) {
$5 = $4;
while(1) {
_alSourceUnqueueBuffers(($5|0),1,($buffer|0));
$6 = HEAP32[$buffer>>2]|0;
$7 = (_BufferMusicStream($6)|0);
$8 = ($7|0)==(0);
$9 = HEAP32[(5776)>>2]|0;
$10 = ($9|0)!=(0);
$or$cond = $8 & $10;
if ($or$cond) {
$11 = HEAP32[5744>>2]|0;
_stb_vorbis_seek_start($11);
$12 = HEAP32[5744>>2]|0;
$13 = (_stb_vorbis_stream_length_in_samples($12)|0);
$14 = HEAP32[(5764)>>2]|0;
$15 = Math_imul($14, $13)|0;
HEAP32[(5772)>>2] = $15;
$16 = HEAP32[$buffer>>2]|0;
$17 = (_BufferMusicStream($16)|0);
$active$1 = $17;
} else {
$active$1 = $7;
}
$18 = HEAP32[(5756)>>2]|0;
_alSourceQueueBuffers(($18|0),1,($buffer|0));
$19 = (_alGetError()|0);
$20 = ($19|0)==(0);
if (!($20)) {
_TraceLog(2,15486,$vararg_buffer);
}
$21 = HEAP32[$processed>>2]|0;
$22 = (($21) + -1)|0;
HEAP32[$processed>>2] = $22;
$23 = ($21|0)>(1);
$24 = HEAP32[(5756)>>2]|0;
if ($23) {
$5 = $24;
} else {
$$lcssa = $24;$active$0$lcssa = $active$1;
break;
}
}
} else {
$$lcssa = $4;$active$0$lcssa = 1;
}
_alGetSourcei(($$lcssa|0),4112,($state|0));
$25 = HEAP32[$state>>2]|0;
$26 = ($25|0)!=(4114);
$27 = ($active$0$lcssa|0)!=(0);
$or$cond3 = $27 & $26;
if ($or$cond3) {
$28 = HEAP32[(5756)>>2]|0;
_alSourcePlay(($28|0));
}
if ($27) {
STACKTOP = sp;return;
}
_StopMusicStream();
STACKTOP = sp;return;
}
function _stb_vorbis_close($p) {
$p = $p|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($p|0)==(0|0);
if ($0) {
return;
}
_vorbis_deinit($p);
_setup_free($p,$p);
return;
}
function _stb_vorbis_get_info($agg$result,$f) {
$agg$result = $agg$result|0;
$f = $f|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = HEAP32[$f>>2]|0;
$3 = ((($f)) + 8|0);
$4 = HEAP32[$3>>2]|0;
$5 = ((($f)) + 16|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($f)) + 12|0);
$8 = HEAP32[$7>>2]|0;
$9 = ((($f)) + 116|0);
$10 = HEAP32[$9>>2]|0;
$11 = $10 >> 1;
HEAP32[$agg$result>>2] = $2;
$12 = ((($agg$result)) + 4|0);
HEAP32[$12>>2] = $1;
$13 = ((($agg$result)) + 8|0);
HEAP32[$13>>2] = $4;
$14 = ((($agg$result)) + 12|0);
HEAP32[$14>>2] = $6;
$15 = ((($agg$result)) + 16|0);
HEAP32[$15>>2] = $8;
$16 = ((($agg$result)) + 20|0);
HEAP32[$16>>2] = $11;
return;
}
function _stb_vorbis_get_file_offset($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 48|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if (!($2)) {
$$0 = 0;
return ($$0|0);
}
$3 = ((($f)) + 32|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(0|0);
if ($5) {
$11 = ((($f)) + 20|0);
$12 = HEAP32[$11>>2]|0;
$13 = (_ftell($12)|0);
$14 = ((($f)) + 24|0);
$15 = HEAP32[$14>>2]|0;
$16 = (($13) - ($15))|0;
$$0 = $16;
return ($$0|0);
} else {
$6 = ((($f)) + 36|0);
$7 = HEAP32[$6>>2]|0;
$8 = $4;
$9 = $7;
$10 = (($8) - ($9))|0;
$$0 = $10;
return ($$0|0);
}
return (0)|0;
}
function _stb_vorbis_get_frame_float($f,$channels,$output) {
$f = $f|0;
$channels = $channels|0;
$output = $output|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, $left = 0, $len = 0, $right = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$len = sp + 8|0;
$right = sp + 4|0;
$left = sp;
$0 = ((($f)) + 48|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if (!($2)) {
_error($f,2);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$3 = (_vorbis_decode_packet($f,$len,$left,$right)|0);
$4 = ($3|0)==(0);
if ($4) {
$5 = ((($f)) + 1508|0);
HEAP32[$5>>2] = 0;
$6 = ((($f)) + 1504|0);
HEAP32[$6>>2] = 0;
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$7 = HEAP32[$len>>2]|0;
$8 = HEAP32[$left>>2]|0;
$9 = HEAP32[$right>>2]|0;
$10 = (_vorbis_finish_frame($f,$7,$8,$9)|0);
HEAP32[$len>>2] = $10;
$11 = ((($f)) + 4|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($12|0)>(0);
if ($13) {
$14 = HEAP32[$left>>2]|0;
$i$01 = 0;
while(1) {
$15 = (((($f)) + 800|0) + ($i$01<<2)|0);
$16 = HEAP32[$15>>2]|0;
$17 = (($16) + ($14<<2)|0);
$18 = (((($f)) + 864|0) + ($i$01<<2)|0);
HEAP32[$18>>2] = $17;
$19 = (($i$01) + 1)|0;
$20 = HEAP32[$11>>2]|0;
$21 = ($19|0)<($20|0);
if ($21) {
$i$01 = $19;
} else {
break;
}
}
}
$22 = HEAP32[$left>>2]|0;
$23 = ((($f)) + 1504|0);
HEAP32[$23>>2] = $22;
$24 = HEAP32[$left>>2]|0;
$25 = HEAP32[$len>>2]|0;
$26 = (($25) + ($24))|0;
$27 = ((($f)) + 1508|0);
HEAP32[$27>>2] = $26;
$28 = ($channels|0)==(0|0);
if (!($28)) {
$29 = HEAP32[$11>>2]|0;
HEAP32[$channels>>2] = $29;
}
$30 = ($output|0)==(0|0);
if (!($30)) {
$31 = ((($f)) + 864|0);
HEAP32[$output>>2] = $31;
}
$32 = HEAP32[$len>>2]|0;
$$0 = $32;
STACKTOP = sp;return ($$0|0);
}
function _stb_vorbis_seek_start($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 48|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if ($2) {
$3 = ((($f)) + 52|0);
$4 = HEAP32[$3>>2]|0;
_set_file_offset($f,$4);
$5 = ((($f)) + 992|0);
HEAP32[$5>>2] = 0;
$6 = ((($f)) + 1377|0);
HEAP8[$6>>0] = 1;
$7 = ((($f)) + 1380|0);
HEAP32[$7>>2] = -1;
_vorbis_pump_first_frame($f);
return;
} else {
_error($f,2);
return;
}
}
function _stb_vorbis_stream_length_in_samples($f) {
$f = $f|0;
var $$ = 0, $$0 = 0, $$2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $end = 0, $header = 0, $last = 0, $last_page_loc$0$lcssa = 0, $last_page_loc$03 = 0, $previous_safe$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$end = sp + 4|0;
$last = sp;
$header = sp + 8|0;
$0 = ((($f)) + 48|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if (!($2)) {
_error($f,2);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$3 = ((($f)) + 796|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(0);
if ($5) {
$6 = (_stb_vorbis_get_file_offset($f)|0);
$7 = ((($f)) + 44|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($8>>>0)>(65535);
if ($9) {
$10 = (($8) + -65536)|0;
$11 = ((($f)) + 52|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($10>>>0)<($12>>>0);
if ($13) {
label = 6;
} else {
$previous_safe$0 = $10;
}
} else {
label = 6;
}
if ((label|0) == 6) {
$14 = ((($f)) + 52|0);
$15 = HEAP32[$14>>2]|0;
$previous_safe$0 = $15;
}
_set_file_offset($f,$previous_safe$0);
$16 = (_vorbis_find_page($f,$end,$last)|0);
$17 = ($16|0)==(0);
do {
if ($17) {
$18 = ((($f)) + 100|0);
HEAP32[$18>>2] = 36;
HEAP32[$3>>2] = -1;
} else {
$19 = (_stb_vorbis_get_file_offset($f)|0);
$20 = HEAP32[$last>>2]|0;
$21 = ($20|0)==(0);
L15: do {
if ($21) {
$last_page_loc$03 = $19;
while(1) {
$22 = HEAP32[$end>>2]|0;
_set_file_offset($f,$22);
$23 = (_vorbis_find_page($f,$end,$last)|0);
$24 = ($23|0)==(0);
if ($24) {
$last_page_loc$0$lcssa = $last_page_loc$03;
break L15;
}
$25 = (_stb_vorbis_get_file_offset($f)|0);
$26 = HEAP32[$last>>2]|0;
$27 = ($26|0)==(0);
if ($27) {
$last_page_loc$03 = $25;
} else {
$last_page_loc$0$lcssa = $25;
break;
}
}
} else {
$last_page_loc$0$lcssa = $19;
}
} while(0);
_set_file_offset($f,$last_page_loc$0$lcssa);
(_getn($f,$header,6)|0);
$28 = (_get32($f)|0);
$29 = (_get32($f)|0);
$30 = $29 & $28;
$31 = ($30|0)==(-1);
if ($31) {
$32 = ((($f)) + 100|0);
HEAP32[$32>>2] = 36;
HEAP32[$3>>2] = -1;
break;
} else {
$33 = ($29|0)==(0);
$$ = $33 ? $28 : -2;
HEAP32[$3>>2] = $$;
$34 = ((($f)) + 68|0);
HEAP32[$34>>2] = $last_page_loc$0$lcssa;
$35 = HEAP32[$end>>2]|0;
$36 = ((($f)) + 72|0);
HEAP32[$36>>2] = $35;
$37 = ((($f)) + 76|0);
HEAP32[$37>>2] = $$;
break;
}
}
} while(0);
_set_file_offset($f,$6);
}
$38 = HEAP32[$3>>2]|0;
$39 = ($38|0)==(-1);
$$2 = $39 ? 0 : $38;
$$0 = $$2;
STACKTOP = sp;return ($$0|0);
}
function _stb_vorbis_open_file_section($file,$close_on_free,$error,$alloc,$length) {
$file = $file|0;
$close_on_free = $close_on_free|0;
$error = $error|0;
$alloc = $alloc|0;
$length = $length|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $p = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 1520|0;
$p = sp;
_vorbis_init($p,$alloc);
$0 = ((($p)) + 20|0);
HEAP32[$0>>2] = $file;
$1 = (_ftell($file)|0);
$2 = ((($p)) + 24|0);
HEAP32[$2>>2] = $1;
$3 = ((($p)) + 44|0);
HEAP32[$3>>2] = $length;
$4 = ((($p)) + 28|0);
HEAP32[$4>>2] = $close_on_free;
$5 = (_start_decoder($p)|0);
$6 = ($5|0)==(0);
if (!($6)) {
$7 = (_vorbis_alloc($p)|0);
$8 = ($7|0)==(0|0);
if (!($8)) {
_memcpy(($7|0),($p|0),1512)|0;
_vorbis_pump_first_frame($7);
$$0 = $7;
STACKTOP = sp;return ($$0|0);
}
}
$9 = ($error|0)==(0|0);
if (!($9)) {
$10 = ((($p)) + 100|0);
$11 = HEAP32[$10>>2]|0;
HEAP32[$error>>2] = $11;
}
_vorbis_deinit($p);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
function _stb_vorbis_open_file($file,$close_on_free,$error,$alloc) {
$file = $file|0;
$close_on_free = $close_on_free|0;
$error = $error|0;
$alloc = $alloc|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_ftell($file)|0);
(_fseek($file,0,2)|0);
$1 = (_ftell($file)|0);
$2 = (($1) - ($0))|0;
(_fseek($file,$0,0)|0);
$3 = (_stb_vorbis_open_file_section($file,$close_on_free,$error,$alloc,$2)|0);
return ($3|0);
}
function _stb_vorbis_open_filename($filename,$error,$alloc) {
$filename = $filename|0;
$error = $error|0;
$alloc = $alloc|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_fopen($filename,20392)|0);
$1 = ($0|0)==(0|0);
if (!($1)) {
$2 = (_stb_vorbis_open_file($0,1,$error,$alloc)|0);
$$0 = $2;
return ($$0|0);
}
$3 = ($error|0)==(0|0);
if ($3) {
$$0 = 0;
return ($$0|0);
}
HEAP32[$error>>2] = 6;
$$0 = 0;
return ($$0|0);
}
function _stb_vorbis_get_samples_short_interleaved($f,$channels,$buffer,$num_shorts) {
$f = $f|0;
$channels = $channels|0;
$buffer = $buffer|0;
$num_shorts = $num_shorts|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $n$0 = 0, $n$1 = 0, $outputs = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$outputs = sp;
$0 = (($num_shorts|0) / ($channels|0))&-1;
$1 = ((($f)) + 4|0);
$2 = ((($f)) + 1508|0);
$3 = ((($f)) + 1504|0);
$4 = ((($f)) + 800|0);
$$0 = $buffer;$n$0 = 0;
while(1) {
$5 = ($0|0)>($n$0|0);
if (!($5)) {
$n$1 = $n$0;
label = 7;
break;
}
$6 = HEAP32[$2>>2]|0;
$7 = HEAP32[$3>>2]|0;
$8 = (($6) - ($7))|0;
$9 = (($8) + ($n$0))|0;
$10 = ($9|0)<($0|0);
$11 = (($0) - ($n$0))|0;
$$ = $10 ? $8 : $11;
$12 = ($$|0)==(0);
if (!($12)) {
$13 = HEAP32[$1>>2]|0;
_convert_channels_short_interleaved($channels,$$0,$13,$4,$7,$$);
}
$14 = (($$) + ($n$0))|0;
$15 = HEAP32[$3>>2]|0;
$16 = (($15) + ($$))|0;
HEAP32[$3>>2] = $16;
$17 = ($14|0)==($0|0);
if ($17) {
$n$1 = $14;
label = 7;
break;
}
$18 = Math_imul($$, $channels)|0;
$19 = (($$0) + ($18<<1)|0);
$20 = (_stb_vorbis_get_frame_float($f,0,$outputs)|0);
$21 = ($20|0)==(0);
if ($21) {
$n$1 = $14;
label = 7;
break;
} else {
$$0 = $19;$n$0 = $14;
}
}
if ((label|0) == 7) {
STACKTOP = sp;return ($n$1|0);
}
return (0)|0;
}
function _TraceLog($msgType,$text,$varargs) {
$msgType = $msgType|0;
$text = $text|0;
$varargs = $varargs|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $args = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$args = sp;
switch ($msgType|0) {
case 0: {
$0 = HEAP32[8900>>2]|0;
(_fwrite(15536,6,1,$0)|0);
break;
}
case 1: {
$1 = HEAP32[8900>>2]|0;
(_fwrite(15543,7,1,$1)|0);
break;
}
case 2: {
$2 = HEAP32[8900>>2]|0;
(_fwrite(15551,9,1,$2)|0);
break;
}
case 3: {
STACKTOP = sp;return;
break;
}
default: {
}
}
HEAP32[$args>>2] = $varargs;
$3 = HEAP32[8900>>2]|0;
(_vfprintf($3,$text,$args)|0);
$4 = HEAP32[8900>>2]|0;
(_fputc(10,$4)|0);
$5 = ($msgType|0)==(1);
if ($5) {
_exit(1);
// unreachable;
} else {
STACKTOP = sp;return;
}
}
function _GetExtension($fileName) {
$fileName = $fileName|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_strrchr($fileName,46)|0);
$1 = ($0|0)==(0|0);
$2 = ($0|0)==($fileName|0);
$or$cond = $1 | $2;
$3 = ((($0)) + 1|0);
$$0 = $or$cond ? 17818 : $3;
return ($$0|0);
}
function _ProcessGestureEvent($event) {
$event = $event|0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0, $133 = 0;
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0.0, $183 = 0, $184 = 0.0, $185 = 0.0, $186 = 0.0, $187 = 0, $188 = 0.0;
var $189 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0;
var $54 = 0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $moveDownPosition$byval_copy11 = 0, $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond11 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$moveDownPosition2$byval_copy12 = sp + 8|0;
$moveDownPosition$byval_copy11 = sp;
$0 = ((($event)) + 4|0);
$1 = HEAP32[$0>>2]|0;
HEAP32[5780>>2] = $1;
$2 = ($1|0)<(2);
if (!($2)) {
$102 = HEAP32[$event>>2]|0;
switch ($102|0) {
case 1: {
$103 = ((($event)) + 16|0);
$104 = $103;
$105 = $104;
$106 = HEAP32[$105>>2]|0;
$107 = (($104) + 4)|0;
$108 = $107;
$109 = HEAP32[$108>>2]|0;
$110 = 80;
$111 = $110;
HEAP32[$111>>2] = $106;
$112 = (($110) + 4)|0;
$113 = $112;
HEAP32[$113>>2] = $109;
$114 = ((($event)) + 24|0);
$115 = $114;
$116 = $115;
$117 = HEAP32[$116>>2]|0;
$118 = (($115) + 4)|0;
$119 = $118;
$120 = HEAP32[$119>>2]|0;
$121 = 120;
$122 = $121;
HEAP32[$122>>2] = $117;
$123 = (($121) + 4)|0;
$124 = $123;
HEAP32[$124>>2] = $120;
$125 = +HEAPF32[120>>2];
$126 = +HEAPF32[80>>2];
$127 = $125 - $126;
HEAPF32[128>>2] = $127;
$128 = +HEAPF32[(124)>>2];
$129 = +HEAPF32[(84)>>2];
$130 = $128 - $129;
HEAPF32[(132)>>2] = $130;
HEAP32[5792>>2] = 4;
STACKTOP = sp;return;
break;
}
case 2: {
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
$131 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
HEAPF32[5812>>2] = $131;
$132 = 112;
$133 = $132;
$134 = HEAP32[$133>>2]|0;
$135 = (($132) + 4)|0;
$136 = $135;
$137 = HEAP32[$136>>2]|0;
$138 = 80;
$139 = $138;
HEAP32[$139>>2] = $134;
$140 = (($138) + 4)|0;
$141 = $140;
HEAP32[$141>>2] = $137;
$142 = 136;
$143 = $142;
$144 = HEAP32[$143>>2]|0;
$145 = (($142) + 4)|0;
$146 = $145;
$147 = HEAP32[$146>>2]|0;
$148 = 120;
$149 = $148;
HEAP32[$149>>2] = $144;
$150 = (($148) + 4)|0;
$151 = $150;
HEAP32[$151>>2] = $147;
$152 = ((($event)) + 16|0);
$153 = $152;
$154 = $153;
$155 = HEAP32[$154>>2]|0;
$156 = (($153) + 4)|0;
$157 = $156;
$158 = HEAP32[$157>>2]|0;
$159 = 112;
$160 = $159;
HEAP32[$160>>2] = $155;
$161 = (($159) + 4)|0;
$162 = $161;
HEAP32[$162>>2] = $158;
$163 = ((($event)) + 24|0);
$164 = $163;
$165 = $164;
$166 = HEAP32[$165>>2]|0;
$167 = (($164) + 4)|0;
$168 = $167;
$169 = HEAP32[$168>>2]|0;
$170 = 136;
$171 = $170;
HEAP32[$171>>2] = $166;
$172 = (($170) + 4)|0;
$173 = $172;
HEAP32[$173>>2] = $169;
$174 = +HEAPF32[136>>2];
$175 = +HEAPF32[112>>2];
$176 = $174 - $175;
HEAPF32[128>>2] = $176;
$177 = +HEAPF32[(140)>>2];
$178 = +HEAPF32[(116)>>2];
$179 = $177 - $178;
HEAPF32[(132)>>2] = $179;
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0;
$180 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$181 = !($180 >= 0.004999999888241291);
if ($181) {
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[120>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[120+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
$182 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$183 = !($182 >= 0.004999999888241291);
if ($183) {
HEAP32[5792>>2] = 4;
} else {
label = 34;
}
} else {
label = 34;
}
do {
if ((label|0) == 34) {
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
$184 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$185 = +HEAPF32[5812>>2];
$186 = $184 - $185;
$187 = $186 < 0.0;
if ($187) {
HEAP32[5792>>2] = 256;
break;
} else {
HEAP32[5792>>2] = 512;
break;
}
}
} while(0);
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
$188 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$189 = 360.0 - $188;
HEAPF32[5816>>2] = $189;
STACKTOP = sp;return;
break;
}
case 0: {
HEAPF32[5812>>2] = 0.0;
HEAPF32[5816>>2] = 0.0;
HEAPF32[128>>2] = 0.0;
HEAPF32[(132)>>2] = 0.0;
HEAP32[5792>>2] = 0;
STACKTOP = sp;return;
break;
}
default: {
STACKTOP = sp;return;
}
}
}
$3 = ((($event)) + 8|0);
$4 = HEAP32[$3>>2]|0;
HEAP32[5784>>2] = $4;
$5 = HEAP32[$event>>2]|0;
switch ($5|0) {
case 1: {
$6 = HEAP32[5788>>2]|0;
$7 = (($6) + 1)|0;
HEAP32[5788>>2] = $7;
$8 = HEAP32[5792>>2]|0;
$9 = ($8|0)==(0);
$10 = ($6|0)>(0);
$or$cond = $10 & $9;
if ($or$cond) {
$11 = ((($event)) + 16|0);
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$11>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$11+4>>2]|0;
$12 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$13 = $12 < 0.029999999329447746;
if ($13) {
HEAP32[5792>>2] = 2;
HEAP32[5788>>2] = 0;
} else {
label = 6;
}
} else {
label = 6;
}
if ((label|0) == 6) {
HEAP32[5788>>2] = 1;
HEAP32[5792>>2] = 1;
}
$14 = ((($event)) + 16|0);
$15 = $14;
$16 = $15;
$17 = HEAP32[$16>>2]|0;
$18 = (($15) + 4)|0;
$19 = $18;
$20 = HEAP32[$19>>2]|0;
$21 = 80;
$22 = $21;
HEAP32[$22>>2] = $17;
$23 = (($21) + 4)|0;
$24 = $23;
HEAP32[$24>>2] = $20;
$25 = $14;
$26 = $25;
$27 = HEAP32[$26>>2]|0;
$28 = (($25) + 4)|0;
$29 = $28;
$30 = HEAP32[$29>>2]|0;
$31 = 88;
$32 = $31;
HEAP32[$32>>2] = $27;
$33 = (($31) + 4)|0;
$34 = $33;
HEAP32[$34>>2] = $30;
$35 = 96;
$36 = $35;
HEAP32[$36>>2] = $17;
$37 = (($35) + 4)|0;
$38 = $37;
HEAP32[$38>>2] = $20;
HEAPF32[104>>2] = 0.0;
HEAPF32[(108)>>2] = 0.0;
STACKTOP = sp;return;
break;
}
case 0: {
$39 = HEAP32[5792>>2]|0;
$40 = ($39|0)==(8);
if ($40) {
$41 = ((($event)) + 16|0);
$42 = $41;
$43 = $42;
$44 = HEAP32[$43>>2]|0;
$45 = (($42) + 4)|0;
$46 = $45;
$47 = HEAP32[$46>>2]|0;
$48 = 96;
$49 = $48;
HEAP32[$49>>2] = $44;
$50 = (($48) + 4)|0;
$51 = $50;
HEAP32[$51>>2] = $47;
}
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0;
$52 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$53 = $52 / 0.0;
HEAPF32[5796>>2] = $53;
HEAP32[5800>>2] = 0;
$54 = $53 > 5.0000002374872565E-4;
$55 = HEAP32[5784>>2]|0;
$56 = ($55|0)==(0);
$or$cond3 = $54 & $56;
do {
if ($or$cond3) {
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0;
$57 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$58 = 360.0 - $57;
HEAPF32[5804>>2] = $58;
$59 = $58 < 30.0;
$60 = $58 > 330.0;
$or$cond5 = $59 | $60;
if ($or$cond5) {
HEAP32[5792>>2] = 16;
break;
}
$61 = $58 > 30.0;
$62 = $58 < 120.0;
$or$cond7 = $61 & $62;
if ($or$cond7) {
HEAP32[5792>>2] = 64;
break;
}
$63 = $58 > 120.0;
$64 = $58 < 210.0;
$or$cond9 = $63 & $64;
if ($or$cond9) {
HEAP32[5792>>2] = 32;
break;
}
$65 = $58 > 210.0;
$66 = $58 < 300.0;
$or$cond11 = $65 & $66;
if ($or$cond11) {
HEAP32[5792>>2] = 128;
break;
} else {
HEAP32[5792>>2] = 0;
break;
}
} else {
HEAPF32[5796>>2] = 0.0;
HEAPF32[5804>>2] = 0.0;
HEAP32[5792>>2] = 0;
}
} while(0);
HEAPF32[88>>2] = 0.0;
HEAPF32[(92)>>2] = 0.0;
STACKTOP = sp;return;
break;
}
case 2: {
$67 = HEAP32[5800>>2]|0;
$68 = ($67|0)==(0);
if ($68) {
HEAP32[5800>>2] = 1;
}
$69 = ((($event)) + 16|0);
$70 = $69;
$71 = $70;
$72 = HEAP32[$71>>2]|0;
$73 = (($70) + 4)|0;
$74 = $73;
$75 = HEAP32[$74>>2]|0;
$76 = 112;
$77 = $76;
HEAP32[$77>>2] = $72;
$78 = (($76) + 4)|0;
$79 = $78;
HEAP32[$79>>2] = $75;
$80 = HEAP32[5792>>2]|0;
$81 = ($80|0)==(4);
if ($81) {
$82 = HEAP32[5808>>2]|0;
$83 = ($82|0)==(1);
if ($83) {
$84 = $69;
$85 = $84;
$86 = HEAP32[$85>>2]|0;
$87 = (($84) + 4)|0;
$88 = $87;
$89 = HEAP32[$88>>2]|0;
$90 = 80;
$91 = $90;
HEAP32[$91>>2] = $86;
$92 = (($90) + 4)|0;
$93 = $92;
HEAP32[$93>>2] = $89;
}
HEAP32[5808>>2] = 2;
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0;
$94 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
$95 = !($94 >= 0.014999999664723873);
if (!($95)) {
HEAP32[5792>>2] = 8;
}
}
$96 = +HEAPF32[112>>2];
$97 = +HEAPF32[88>>2];
$98 = $96 - $97;
HEAPF32[104>>2] = $98;
$99 = +HEAPF32[(116)>>2];
$100 = +HEAPF32[(92)>>2];
$101 = $99 - $100;
HEAPF32[(108)>>2] = $101;
STACKTOP = sp;return;
break;
}
default: {
STACKTOP = sp;return;
}
}
}
function _UpdateGestures() {
var $$off = 0, $$pr = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[5792>>2]|0;
$$off = (($0) + -1)|0;
$1 = ($$off>>>0)<(2);
$2 = HEAP32[5780>>2]|0;
$3 = ($2|0)<(2);
$or$cond3 = $1 & $3;
if ($or$cond3) {
HEAP32[5792>>2] = 4;
return;
}
$$pr = HEAP32[5792>>2]|0;
switch ($$pr|0) {
case 16: case 32: case 64: case 128: {
break;
}
default: {
return;
}
}
HEAP32[5792>>2] = 0;
return;
}
function _InitDisplay($width,$height) {
$width = $width|0;
$height = $height|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $count = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr9 = 0, dest = 0, label = 0;
var sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 128|0;
$vararg_buffer18 = sp + 56|0;
$vararg_buffer14 = sp + 48|0;
$vararg_buffer10 = sp + 40|0;
$vararg_buffer7 = sp + 32|0;
$vararg_buffer5 = sp + 24|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$0 = sp + 64|0;
$count = sp + 60|0;
HEAP32[816>>2] = $width;
HEAP32[820>>2] = $height;
_MatrixIdentity($0);
dest=840; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
(_glfwSetErrorCallback((2|0))|0);
$1 = (_glfwInit()|0);
$2 = ($1|0)==(0);
if ($2) {
_TraceLog(1,23369,$vararg_buffer);
}
$3 = HEAP32[816>>2]|0;
HEAP32[980>>2] = $3;
$4 = HEAP32[820>>2]|0;
HEAP32[984>>2] = $4;
_glfwDefaultWindowHints();
_glfwWindowHint(131075,0);
$5 = (_rlGetVersion()|0);
$6 = ($5|0)==(2);
if ($6) {
$7 = HEAP8[10887>>0]|0;
$8 = $7 & 16;
$9 = ($8<<24>>24)==(0);
if (!($9)) {
_glfwWindowHint(135181,4);
_TraceLog(0,23395,$vararg_buffer1);
}
_glfwWindowHint(139266,3);
_glfwWindowHint(139267,3);
_glfwWindowHint(139272,204801);
_glfwWindowHint(139270,0);
}
$10 = HEAP32[968>>2]|0;
$11 = ($10|0)==(0);
if ($11) {
$20 = HEAP32[816>>2]|0;
$21 = HEAP32[820>>2]|0;
$22 = HEAP32[812>>2]|0;
$23 = (_glfwCreateWindow(($20|0),($21|0),($22|0),(0|0),(0|0))|0);
HEAP32[828>>2] = $23;
$24 = HEAP32[816>>2]|0;
HEAP32[996>>2] = $24;
$25 = HEAP32[820>>2]|0;
HEAP32[1000>>2] = $25;
$26 = $23;
} else {
$12 = HEAP32[980>>2]|0;
$13 = HEAP32[984>>2]|0;
_SetupFramebufferSize($12,$13);
$14 = (_glfwGetPrimaryMonitor()|0);
(_glfwGetVideoModes(($14|0),($count|0))|0);
$15 = HEAP32[816>>2]|0;
$16 = HEAP32[820>>2]|0;
$17 = HEAP32[812>>2]|0;
$18 = (_glfwGetPrimaryMonitor()|0);
$19 = (_glfwCreateWindow(($15|0),($16|0),($17|0),($18|0),(0|0))|0);
HEAP32[828>>2] = $19;
$26 = $19;
}
$27 = ($26|0)==(0|0);
if ($27) {
_glfwTerminate();
_TraceLog(1,23420,$vararg_buffer3);
} else {
_TraceLog(0,23453,$vararg_buffer5);
$28 = HEAP32[996>>2]|0;
$29 = HEAP32[1000>>2]|0;
HEAP32[$vararg_buffer7>>2] = $28;
$vararg_ptr9 = ((($vararg_buffer7)) + 4|0);
HEAP32[$vararg_ptr9>>2] = $29;
_TraceLog(0,23493,$vararg_buffer7);
$30 = HEAP32[816>>2]|0;
$31 = HEAP32[820>>2]|0;
HEAP32[$vararg_buffer10>>2] = $30;
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
HEAP32[$vararg_ptr13>>2] = $31;
_TraceLog(0,23514,$vararg_buffer10);
$32 = HEAP32[988>>2]|0;
$33 = HEAP32[992>>2]|0;
HEAP32[$vararg_buffer14>>2] = $32;
$vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
HEAP32[$vararg_ptr17>>2] = $33;
_TraceLog(0,23535,$vararg_buffer14);
}
$34 = HEAP32[828>>2]|0;
(_glfwSetWindowSizeCallback(($34|0),(1|0))|0);
$35 = HEAP32[828>>2]|0;
(_glfwSetCursorEnterCallback(($35|0),(3|0))|0);
$36 = HEAP32[828>>2]|0;
(_glfwSetKeyCallback(($36|0),(1|0))|0);
$37 = HEAP32[828>>2]|0;
(_glfwSetMouseButtonCallback(($37|0),(1|0))|0);
$38 = HEAP32[828>>2]|0;
(_glfwSetCursorPosCallback(($38|0),(1|0))|0);
$39 = HEAP32[828>>2]|0;
(_glfwSetCharCallback(($39|0),(4|0))|0);
$40 = HEAP32[828>>2]|0;
(_glfwSetScrollCallback(($40|0),(2|0))|0);
$41 = HEAP32[828>>2]|0;
(_glfwSetWindowIconifyCallback(($41|0),(5|0))|0);
$42 = HEAP32[828>>2]|0;
_glfwMakeContextCurrent(($42|0));
$43 = HEAP8[10887>>0]|0;
$44 = $43 & 32;
$45 = ($44<<24>>24)==(0);
if ($45) {
STACKTOP = sp;return;
}
_glfwSwapInterval(1);
_TraceLog(0,23560,$vararg_buffer18);
STACKTOP = sp;return;
}
function _InitGraphics() {
var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$$byval_copy = sp + 4|0;
$0 = sp;
_rlglInit();
$1 = HEAP32[988>>2]|0;
$2 = HEAP32[992>>2]|0;
$3 = HEAP32[996>>2]|0;
$4 = HEAP32[1000>>2]|0;
_rlglInitGraphics($1,$2,$3,$4);
HEAP8[$0>>0] = -11;
$5 = ((($0)) + 1|0);
HEAP8[$5>>0] = -11;
$6 = ((($0)) + 2|0);
HEAP8[$6>>0] = -11;
$7 = ((($0)) + 3|0);
HEAP8[$7>>0] = -1;
;HEAP8[$$byval_copy>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$0+3>>0]|0;
_ClearBackground($$byval_copy);
STACKTOP = sp;return;
}
function _InitTimer() {
var $0 = 0, $1 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_time((0|0))|0);
_srand($0);
$1 = (+_GetTime());
HEAPF64[32>>3] = $1;
return;
}
function _EmscriptenFullscreenChangeCallback($eventType,$e,$userData) {
$eventType = $eventType|0;
$e = $e|0;
$userData = $userData|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer = sp;
$0 = HEAP32[$e>>2]|0;
$1 = ($0|0)==(0);
$2 = ((($e)) + 264|0);
$3 = HEAP32[$2>>2]|0;
$4 = ((($e)) + 268|0);
$5 = HEAP32[$4>>2]|0;
$6 = ((($e)) + 272|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($e)) + 276|0);
$9 = HEAP32[$8>>2]|0;
if ($1) {
HEAP32[$vararg_buffer4>>2] = $3;
$vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
HEAP32[$vararg_ptr7>>2] = $5;
$vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
HEAP32[$vararg_ptr8>>2] = $7;
$vararg_ptr9 = ((($vararg_buffer4)) + 12|0);
HEAP32[$vararg_ptr9>>2] = $9;
_TraceLog(0,23302,$vararg_buffer4);
STACKTOP = sp;return 0;
} else {
HEAP32[$vararg_buffer>>2] = $3;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $5;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = $7;
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
HEAP32[$vararg_ptr3>>2] = $9;
_TraceLog(0,23233,$vararg_buffer);
STACKTOP = sp;return 0;
}
return (0)|0;
}
function _EmscriptenInputCallback($eventType,$touchEvent,$userData) {
$eventType = $eventType|0;
$touchEvent = $touchEvent|0;
$userData = $userData|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $7 = 0;
var $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$gestureEvent$byval_copy = sp + 32|0;
$gestureEvent = sp;
switch ($eventType|0) {
case 22: {
HEAP32[$gestureEvent>>2] = 1;
break;
}
case 23: {
HEAP32[$gestureEvent>>2] = 0;
break;
}
case 24: {
HEAP32[$gestureEvent>>2] = 2;
break;
}
default: {
}
}
$0 = HEAP32[$touchEvent>>2]|0;
$1 = ((($gestureEvent)) + 4|0);
HEAP32[$1>>2] = $0;
$2 = ((($touchEvent)) + 20|0);
$3 = HEAP32[$2>>2]|0;
$4 = ((($gestureEvent)) + 8|0);
HEAP32[$4>>2] = $3;
$5 = ((($touchEvent)) + 72|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($gestureEvent)) + 12|0);
HEAP32[$7>>2] = $6;
$8 = ((($touchEvent)) + 56|0);
$9 = HEAP32[$8>>2]|0;
$10 = (+($9|0));
$11 = ((($touchEvent)) + 60|0);
$12 = HEAP32[$11>>2]|0;
$13 = (+($12|0));
$14 = ((($gestureEvent)) + 16|0);
HEAPF32[$14>>2] = $10;
$15 = ((($gestureEvent)) + 20|0);
HEAPF32[$15>>2] = $13;
$16 = ((($touchEvent)) + 108|0);
$17 = HEAP32[$16>>2]|0;
$18 = (+($17|0));
$19 = ((($touchEvent)) + 112|0);
$20 = HEAP32[$19>>2]|0;
$21 = (+($20|0));
$22 = ((($gestureEvent)) + 24|0);
HEAPF32[$22>>2] = $18;
$23 = ((($gestureEvent)) + 28|0);
HEAPF32[$23>>2] = $21;
$24 = ((($gestureEvent)) + 16|0);
$25 = $24;
$26 = $25;
$27 = HEAP32[$26>>2]|0;
$28 = (($25) + 4)|0;
$29 = $28;
$30 = HEAP32[$29>>2]|0;
$31 = 64;
$32 = $31;
HEAP32[$32>>2] = $27;
$33 = (($31) + 4)|0;
$34 = $33;
HEAP32[$34>>2] = $30;
$35 = ((($gestureEvent)) + 24|0);
$36 = $35;
$37 = $36;
$38 = HEAP32[$37>>2]|0;
$39 = (($36) + 4)|0;
$40 = $39;
$41 = HEAP32[$40>>2]|0;
$42 = (72);
$43 = $42;
HEAP32[$43>>2] = $38;
$44 = (($42) + 4)|0;
$45 = $44;
HEAP32[$45>>2] = $41;
$46 = (_GetScreenWidth()|0);
$47 = (+($46|0));
$48 = +HEAPF32[$24>>2];
$49 = $48 / $47;
HEAPF32[$24>>2] = $49;
$50 = (_GetScreenHeight()|0);
$51 = (+($50|0));
$52 = +HEAPF32[$15>>2];
$53 = $52 / $51;
HEAPF32[$15>>2] = $53;
$54 = (_GetScreenWidth()|0);
$55 = (+($54|0));
$56 = +HEAPF32[$35>>2];
$57 = $56 / $55;
HEAPF32[$35>>2] = $57;
$58 = (_GetScreenHeight()|0);
$59 = (+($58|0));
$60 = +HEAPF32[$23>>2];
$61 = $60 / $59;
HEAPF32[$23>>2] = $61;
;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0;
_ProcessGestureEvent($gestureEvent$byval_copy);
STACKTOP = sp;return 1;
}
function _LogoAnimation() {
var label = 0, sp = 0;
sp = STACKTOP;
HEAP32[824>>2] = 0;
return;
}
function _GetTime() {
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+_glfwGetTime());
return (+$0);
}
function _SwapBuffers() {
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[828>>2]|0;
_glfwSwapBuffers(($0|0));
return;
}
function _PollInputEvents() {
var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $mouseX = 0, $mouseY = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$mouseX = sp + 8|0;
$mouseY = sp;
_UpdateGestures();
$0 = HEAP32[828>>2]|0;
_glfwGetCursorPos(($0|0),($mouseX|0),($mouseY|0));
$1 = +HEAPF64[$mouseX>>3];
$2 = $1;
HEAPF32[8>>2] = $2;
$3 = +HEAPF64[$mouseY>>3];
$4 = $3;
HEAPF32[(12)>>2] = $4;
HEAP32[972>>2] = -1;
_memcpy((11400|0),(10888|0),512)|0;
;HEAP8[11915>>0]=HEAP8[11912>>0]|0;HEAP8[11915+1>>0]=HEAP8[11912+1>>0]|0;HEAP8[11915+2>>0]=HEAP8[11912+2>>0]|0;
$5 = HEAP32[8648>>2]|0;
HEAP32[976>>2] = $5;
HEAP32[8648>>2] = 0;
_glfwPollEvents();
STACKTOP = sp;return;
}
function _LoadDefaultShader($agg$result) {
$agg$result = $agg$result|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
var $fShaderStr = 0, $vShaderStr = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 864|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$vShaderStr = sp + 390|0;
$fShaderStr = sp + 12|0;
_memcpy(($vShaderStr|0),(22282|0),466)|0;
_memcpy(($fShaderStr|0),(22748|0),377)|0;
$0 = (_LoadShaderProgram($vShaderStr,$fShaderStr)|0);
$1 = ($0|0)==(0);
if ($1) {
HEAP32[$vararg_buffer1>>2] = $0;
_TraceLog(2,23173,$vararg_buffer1);
} else {
HEAP32[$vararg_buffer>>2] = $0;
_TraceLog(0,23125,$vararg_buffer);
}
$2 = (_glGetAttribLocation(($0|0),(13758|0))|0);
$3 = (_glGetAttribLocation(($0|0),(13773|0))|0);
$4 = (_glGetAttribLocation(($0|0),(23221|0))|0);
$5 = (_glGetUniformLocation(($0|0),(13801|0))|0);
$6 = (_glGetUniformLocation(($0|0),(13825|0))|0);
$7 = HEAP32[808>>2]|0;
HEAP32[$agg$result>>2] = $0;
$8 = ((($agg$result)) + 4|0);
HEAP32[$8>>2] = $7;
$9 = ((($agg$result)) + 8|0);
HEAP32[$9>>2] = 0;
$10 = ((($agg$result)) + 12|0);
HEAP32[$10>>2] = 0;
$11 = ((($agg$result)) + 16|0);
HEAP32[$11>>2] = $2;
$12 = ((($agg$result)) + 20|0);
HEAP32[$12>>2] = $3;
$13 = ((($agg$result)) + 24|0);
HEAP32[$13>>2] = -1;
$14 = ((($agg$result)) + 28|0);
HEAP32[$14>>2] = $4;
$15 = ((($agg$result)) + 32|0);
HEAP32[$15>>2] = $5;
$16 = ((($agg$result)) + 36|0);
HEAP32[$16>>2] = -1;
$17 = ((($agg$result)) + 40|0);
HEAP32[$17>>2] = $6;
$18 = ((($agg$result)) + 44|0);
HEAP32[$18>>2] = -1;
$19 = ((($agg$result)) + 48|0);
HEAP32[$19>>2] = -1;
STACKTOP = sp;return;
}
function _LoadSimpleShader($agg$result) {
$agg$result = $agg$result|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, $fShaderStr = 0, $vShaderStr = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 800|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$vShaderStr = sp + 389|0;
$fShaderStr = sp + 12|0;
_memcpy(($vShaderStr|0),(21410|0),401)|0;
_memcpy(($fShaderStr|0),(21811|0),377)|0;
$0 = (_LoadShaderProgram($vShaderStr,$fShaderStr)|0);
$1 = ($0|0)==(0);
if ($1) {
HEAP32[$vararg_buffer1>>2] = $0;
_TraceLog(2,22235,$vararg_buffer1);
} else {
HEAP32[$vararg_buffer>>2] = $0;
_TraceLog(0,22188,$vararg_buffer);
}
$2 = (_glGetAttribLocation(($0|0),(13758|0))|0);
$3 = (_glGetAttribLocation(($0|0),(13773|0))|0);
$4 = (_glGetAttribLocation(($0|0),(13788|0))|0);
$5 = (_glGetUniformLocation(($0|0),(13801|0))|0);
$6 = (_glGetUniformLocation(($0|0),(13811|0))|0);
$7 = (_glGetUniformLocation(($0|0),(13825|0))|0);
$8 = HEAP32[808>>2]|0;
HEAP32[$agg$result>>2] = $0;
$9 = ((($agg$result)) + 4|0);
HEAP32[$9>>2] = $8;
$10 = ((($agg$result)) + 8|0);
HEAP32[$10>>2] = 0;
$11 = ((($agg$result)) + 12|0);
HEAP32[$11>>2] = 0;
$12 = ((($agg$result)) + 16|0);
HEAP32[$12>>2] = $2;
$13 = ((($agg$result)) + 20|0);
HEAP32[$13>>2] = $3;
$14 = ((($agg$result)) + 24|0);
HEAP32[$14>>2] = $4;
$15 = ((($agg$result)) + 28|0);
HEAP32[$15>>2] = -1;
$16 = ((($agg$result)) + 32|0);
HEAP32[$16>>2] = $5;
$17 = ((($agg$result)) + 36|0);
HEAP32[$17>>2] = $6;
$18 = ((($agg$result)) + 40|0);
HEAP32[$18>>2] = $7;
$19 = ((($agg$result)) + 44|0);
HEAP32[$19>>2] = -1;
$20 = ((($agg$result)) + 48|0);
HEAP32[$20>>2] = -1;
STACKTOP = sp;return;
}
function _InitializeBuffers() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond14 = 0, $exitcond17 = 0, $exitcond19 = 0, $i1$012 = 0, $i3$010 = 0, $i6$07 = 0, $i7$06 = 0, $k$05 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$0 = (_malloc(24576)|0);
HEAP32[2232>>2] = $0;
$1 = (_malloc(8192)|0);
HEAP32[2192>>2] = $1;
$2 = HEAP32[2232>>2]|0;
_memset(($2|0),0,24576)|0;
$i1$012 = 0;
while(1) {
$3 = HEAP32[2192>>2]|0;
$4 = (($3) + ($i1$012)|0);
HEAP8[$4>>0] = 0;
$5 = (($i1$012) + 1)|0;
$exitcond19 = ($5|0)==(8192);
if ($exitcond19) {
break;
} else {
$i1$012 = $5;
}
}
HEAP32[2184>>2] = 0;
HEAP32[2188>>2] = 0;
$6 = (_malloc(73728)|0);
HEAP32[2236>>2] = $6;
$7 = (_malloc(24576)|0);
HEAP32[2204>>2] = $7;
$8 = HEAP32[2236>>2]|0;
_memset(($8|0),0,73728)|0;
$i3$010 = 0;
while(1) {
$9 = HEAP32[2204>>2]|0;
$10 = (($9) + ($i3$010)|0);
HEAP8[$10>>0] = 0;
$11 = (($i3$010) + 1)|0;
$exitcond17 = ($11|0)==(24576);
if ($exitcond17) {
break;
} else {
$i3$010 = $11;
}
}
HEAP32[2196>>2] = 0;
HEAP32[2200>>2] = 0;
$12 = (_malloc(49152)|0);
HEAP32[2240>>2] = $12;
$13 = (_malloc(32768)|0);
HEAP32[2224>>2] = $13;
$14 = (_malloc(16384)|0);
HEAP32[2216>>2] = $14;
$15 = (_malloc(12288)|0);
HEAP32[2728>>2] = $15;
$16 = HEAP32[2240>>2]|0;
_memset(($16|0),0,49152)|0;
$17 = HEAP32[2224>>2]|0;
_memset(($17|0),0,32768)|0;
$i6$07 = 0;
while(1) {
$19 = HEAP32[2216>>2]|0;
$20 = (($19) + ($i6$07)|0);
HEAP8[$20>>0] = 0;
$21 = (($i6$07) + 1)|0;
$exitcond14 = ($21|0)==(16384);
if ($exitcond14) {
break;
} else {
$i6$07 = $21;
}
}
$18 = HEAP32[2728>>2]|0;
$i7$06 = 0;$k$05 = 0;
while(1) {
$22 = $k$05 << 2;
$23 = $22&65535;
$24 = (($18) + ($i7$06<<1)|0);
HEAP16[$24>>1] = $23;
$25 = $22 | 1;
$26 = $25&65535;
$27 = $i7$06 | 1;
$28 = (($18) + ($27<<1)|0);
HEAP16[$28>>1] = $26;
$29 = $22 | 2;
$30 = $29&65535;
$31 = (($i7$06) + 2)|0;
$32 = (($18) + ($31<<1)|0);
HEAP16[$32>>1] = $30;
$33 = (($i7$06) + 3)|0;
$34 = (($18) + ($33<<1)|0);
HEAP16[$34>>1] = $23;
$35 = (($i7$06) + 4)|0;
$36 = (($18) + ($35<<1)|0);
HEAP16[$36>>1] = $30;
$37 = $22 | 3;
$38 = $37&65535;
$39 = (($i7$06) + 5)|0;
$40 = (($18) + ($39<<1)|0);
HEAP16[$40>>1] = $38;
$41 = (($k$05) + 1)|0;
$42 = (($i7$06) + 6)|0;
$exitcond = ($41|0)==(1024);
if ($exitcond) {
break;
} else {
$i7$06 = $42;$k$05 = $41;
}
}
HEAP32[2208>>2] = 0;
HEAP32[2220>>2] = 0;
HEAP32[2212>>2] = 0;
_TraceLog(0,21347,$vararg_buffer);
STACKTOP = sp;return;
}
function _InitializeBuffersGPU() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer12 = 0, $vararg_buffer15 = 0, $vararg_buffer5 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr18 = 0, $vararg_ptr19 = 0, $vararg_ptr20 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$vararg_buffer15 = sp + 40|0;
$vararg_buffer12 = sp + 32|0;
$vararg_buffer8 = sp + 24|0;
$vararg_buffer5 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$0 = HEAP32[2264>>2]|0;
$1 = ($0|0)==(0);
if (!($1)) {
$2 = HEAP32[2272>>2]|0;
FUNCTION_TABLE_vii[$2 & 63](1,2716);
$3 = HEAP32[2276>>2]|0;
$4 = HEAP32[2716>>2]|0;
FUNCTION_TABLE_vi[$3 & 31]($4);
}
_glGenBuffers(2,(2684|0));
$5 = HEAP32[2684>>2]|0;
_glBindBuffer(34962,($5|0));
$6 = HEAP32[2232>>2]|0;
_glBufferData(34962,24576,($6|0),35048);
$7 = HEAP32[(2424)>>2]|0;
_glEnableVertexAttribArray(($7|0));
$8 = HEAP32[(2424)>>2]|0;
_glVertexAttribPointer(($8|0),3,5126,0,0,(0|0));
$9 = HEAP32[(2688)>>2]|0;
_glBindBuffer(34962,($9|0));
$10 = HEAP32[2192>>2]|0;
_glBufferData(34962,8192,($10|0),35048);
$11 = HEAP32[(2436)>>2]|0;
_glEnableVertexAttribArray(($11|0));
$12 = HEAP32[(2436)>>2]|0;
_glVertexAttribPointer(($12|0),4,5121,1,0,(0|0));
$13 = HEAP32[2264>>2]|0;
$14 = ($13|0)==(0);
if ($14) {
$16 = HEAP32[2684>>2]|0;
$17 = HEAP32[(2688)>>2]|0;
HEAP32[$vararg_buffer1>>2] = $16;
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
HEAP32[$vararg_ptr4>>2] = $17;
_TraceLog(0,21046,$vararg_buffer1);
} else {
$15 = HEAP32[2716>>2]|0;
HEAP32[$vararg_buffer>>2] = $15;
_TraceLog(0,20999,$vararg_buffer);
}
$18 = HEAP32[2264>>2]|0;
$19 = ($18|0)==(0);
if (!($19)) {
$20 = HEAP32[2272>>2]|0;
FUNCTION_TABLE_vii[$20 & 63](1,2720);
$21 = HEAP32[2276>>2]|0;
$22 = HEAP32[2720>>2]|0;
FUNCTION_TABLE_vi[$21 & 31]($22);
}
_glGenBuffers(2,(2692|0));
$23 = HEAP32[2692>>2]|0;
_glBindBuffer(34962,($23|0));
$24 = HEAP32[2236>>2]|0;
_glBufferData(34962,73728,($24|0),35048);
$25 = HEAP32[(2424)>>2]|0;
_glEnableVertexAttribArray(($25|0));
$26 = HEAP32[(2424)>>2]|0;
_glVertexAttribPointer(($26|0),3,5126,0,0,(0|0));
$27 = HEAP32[(2696)>>2]|0;
_glBindBuffer(34962,($27|0));
$28 = HEAP32[2204>>2]|0;
_glBufferData(34962,24576,($28|0),35048);
$29 = HEAP32[(2436)>>2]|0;
_glEnableVertexAttribArray(($29|0));
$30 = HEAP32[(2436)>>2]|0;
_glVertexAttribPointer(($30|0),4,5121,1,0,(0|0));
$31 = HEAP32[2264>>2]|0;
$32 = ($31|0)==(0);
if ($32) {
$34 = HEAP32[2692>>2]|0;
$35 = HEAP32[(2696)>>2]|0;
HEAP32[$vararg_buffer8>>2] = $34;
$vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
HEAP32[$vararg_ptr11>>2] = $35;
_TraceLog(0,21156,$vararg_buffer8);
} else {
$33 = HEAP32[2720>>2]|0;
HEAP32[$vararg_buffer5>>2] = $33;
_TraceLog(0,21105,$vararg_buffer5);
}
$36 = HEAP32[2264>>2]|0;
$37 = ($36|0)==(0);
if (!($37)) {
$38 = HEAP32[2272>>2]|0;
FUNCTION_TABLE_vii[$38 & 63](1,2724);
$39 = HEAP32[2276>>2]|0;
$40 = HEAP32[2724>>2]|0;
FUNCTION_TABLE_vi[$39 & 31]($40);
}
_glGenBuffers(4,(2700|0));
$41 = HEAP32[2700>>2]|0;
_glBindBuffer(34962,($41|0));
$42 = HEAP32[2240>>2]|0;
_glBufferData(34962,49152,($42|0),35048);
$43 = HEAP32[(2424)>>2]|0;
_glEnableVertexAttribArray(($43|0));
$44 = HEAP32[(2424)>>2]|0;
_glVertexAttribPointer(($44|0),3,5126,0,0,(0|0));
$45 = HEAP32[(2704)>>2]|0;
_glBindBuffer(34962,($45|0));
$46 = HEAP32[2224>>2]|0;
_glBufferData(34962,32768,($46|0),35048);
$47 = HEAP32[(2428)>>2]|0;
_glEnableVertexAttribArray(($47|0));
$48 = HEAP32[(2428)>>2]|0;
_glVertexAttribPointer(($48|0),2,5126,0,0,(0|0));
$49 = HEAP32[(2708)>>2]|0;
_glBindBuffer(34962,($49|0));
$50 = HEAP32[2216>>2]|0;
_glBufferData(34962,16384,($50|0),35048);
$51 = HEAP32[(2436)>>2]|0;
_glEnableVertexAttribArray(($51|0));
$52 = HEAP32[(2436)>>2]|0;
_glVertexAttribPointer(($52|0),4,5121,1,0,(0|0));
$53 = HEAP32[(2712)>>2]|0;
_glBindBuffer(34963,($53|0));
$54 = HEAP32[2728>>2]|0;
_glBufferData(34963,12288,($54|0),35044);
$55 = HEAP32[2264>>2]|0;
$56 = ($55|0)==(0);
if ($56) {
$58 = HEAP32[2700>>2]|0;
$59 = HEAP32[(2704)>>2]|0;
$60 = HEAP32[(2708)>>2]|0;
$61 = HEAP32[(2712)>>2]|0;
HEAP32[$vararg_buffer15>>2] = $58;
$vararg_ptr18 = ((($vararg_buffer15)) + 4|0);
HEAP32[$vararg_ptr18>>2] = $59;
$vararg_ptr19 = ((($vararg_buffer15)) + 8|0);
HEAP32[$vararg_ptr19>>2] = $60;
$vararg_ptr20 = ((($vararg_buffer15)) + 12|0);
HEAP32[$vararg_ptr20>>2] = $61;
_TraceLog(0,21266,$vararg_buffer15);
} else {
$57 = HEAP32[2724>>2]|0;
HEAP32[$vararg_buffer12>>2] = $57;
_TraceLog(0,21219,$vararg_buffer12);
}
$62 = HEAP32[2264>>2]|0;
$63 = ($62|0)==(0);
if ($63) {
STACKTOP = sp;return;
}
$64 = HEAP32[2276>>2]|0;
FUNCTION_TABLE_vi[$64 & 31](0);
STACKTOP = sp;return;
}
function _LoadCompressedTexture($data,$width,$height,$mipmapCount,$compressedFormat) {
$data = $data|0;
$width = $width|0;
$height = $height|0;
$mipmapCount = $mipmapCount|0;
$compressedFormat = $compressedFormat|0;
var $$ = 0, $$013 = 0, $$0610 = 0, $$17 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $blockSize$0 = 0, $level$012 = 0, $offset$011 = 0, $or$cond = 0, $or$cond9 = 0, label = 0, sp = 0;
sp = STACKTOP;
_glPixelStorei(3317,1);
switch ($compressedFormat|0) {
case 33776: case 33777: case 36196: case 37492: {
$blockSize$0 = 8;
break;
}
default: {
$blockSize$0 = 16;
}
}
$0 = ($mipmapCount|0)<(1);
$1 = $width | $height;
$2 = ($1|0)==(0);
$or$cond9 = $0 | $2;
if ($or$cond9) {
return;
} else {
$$013 = $width;$$0610 = $height;$level$012 = 0;$offset$011 = 0;
}
while(1) {
$3 = (($$013) + 3)|0;
$4 = (($3|0) / 4)&-1;
$5 = (($$0610) + 3)|0;
$6 = (($5|0) / 4)&-1;
$7 = Math_imul($4, $blockSize$0)|0;
$8 = Math_imul($7, $6)|0;
$9 = (($data) + ($offset$011)|0);
_glCompressedTexImage2D(3553,($level$012|0),($compressedFormat|0),($$013|0),($$0610|0),0,($8|0),($9|0));
$10 = (($8) + ($offset$011))|0;
$11 = (($$013|0) / 2)&-1;
$12 = (($$0610|0) / 2)&-1;
$13 = ($$013|0)<(2);
$$ = $13 ? 1 : $11;
$14 = ($$0610|0)<(2);
$$17 = $14 ? 1 : $12;
$15 = (($level$012) + 1)|0;
$16 = ($15|0)>=($mipmapCount|0);
$17 = $$ | $$17;
$18 = ($17|0)==(0);
$or$cond = $16 | $18;
if ($or$cond) {
break;
} else {
$$013 = $$;$$0610 = $$17;$level$012 = $15;$offset$011 = $10;
}
}
return;
}
function _UpdateBuffers() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[2184>>2]|0;
$1 = ($0|0)>(0);
if ($1) {
$2 = HEAP32[2264>>2]|0;
$3 = ($2|0)==(0);
if (!($3)) {
$4 = HEAP32[2276>>2]|0;
$5 = HEAP32[2716>>2]|0;
FUNCTION_TABLE_vi[$4 & 31]($5);
}
$6 = HEAP32[2684>>2]|0;
_glBindBuffer(34962,($6|0));
$7 = HEAP32[2184>>2]|0;
$8 = ($7*12)|0;
$9 = HEAP32[2232>>2]|0;
_glBufferSubData(34962,0,($8|0),($9|0));
$10 = HEAP32[(2688)>>2]|0;
_glBindBuffer(34962,($10|0));
$11 = HEAP32[2188>>2]|0;
$12 = $11 << 2;
$13 = HEAP32[2192>>2]|0;
_glBufferSubData(34962,0,($12|0),($13|0));
}
$14 = HEAP32[2196>>2]|0;
$15 = ($14|0)>(0);
if ($15) {
$16 = HEAP32[2264>>2]|0;
$17 = ($16|0)==(0);
if (!($17)) {
$18 = HEAP32[2276>>2]|0;
$19 = HEAP32[2720>>2]|0;
FUNCTION_TABLE_vi[$18 & 31]($19);
}
$20 = HEAP32[2692>>2]|0;
_glBindBuffer(34962,($20|0));
$21 = HEAP32[2196>>2]|0;
$22 = ($21*12)|0;
$23 = HEAP32[2236>>2]|0;
_glBufferSubData(34962,0,($22|0),($23|0));
$24 = HEAP32[(2696)>>2]|0;
_glBindBuffer(34962,($24|0));
$25 = HEAP32[2200>>2]|0;
$26 = $25 << 2;
$27 = HEAP32[2204>>2]|0;
_glBufferSubData(34962,0,($26|0),($27|0));
}
$28 = HEAP32[2208>>2]|0;
$29 = ($28|0)>(0);
if ($29) {
$30 = HEAP32[2264>>2]|0;
$31 = ($30|0)==(0);
if (!($31)) {
$32 = HEAP32[2276>>2]|0;
$33 = HEAP32[2724>>2]|0;
FUNCTION_TABLE_vi[$32 & 31]($33);
}
$34 = HEAP32[2700>>2]|0;
_glBindBuffer(34962,($34|0));
$35 = HEAP32[2208>>2]|0;
$36 = ($35*12)|0;
$37 = HEAP32[2240>>2]|0;
_glBufferSubData(34962,0,($36|0),($37|0));
$38 = HEAP32[(2704)>>2]|0;
_glBindBuffer(34962,($38|0));
$39 = HEAP32[2208>>2]|0;
$40 = $39 << 3;
$41 = HEAP32[2224>>2]|0;
_glBufferSubData(34962,0,($40|0),($41|0));
$42 = HEAP32[(2708)>>2]|0;
_glBindBuffer(34962,($42|0));
$43 = HEAP32[2208>>2]|0;
$44 = $43 << 2;
$45 = HEAP32[2216>>2]|0;
_glBufferSubData(34962,0,($44|0),($45|0));
}
$46 = HEAP32[2264>>2]|0;
$47 = ($46|0)==(0);
if ($47) {
return;
}
$48 = HEAP32[2276>>2]|0;
FUNCTION_TABLE_vi[$48 & 31](0);
return;
}
function _ttULONG($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP8[$p>>0]|0;
$1 = $0&255;
$2 = $1 << 24;
$3 = ((($p)) + 1|0);
$4 = HEAP8[$3>>0]|0;
$5 = $4&255;
$6 = $5 << 16;
$7 = $6 | $2;
$8 = ((($p)) + 2|0);
$9 = HEAP8[$8>>0]|0;
$10 = $9&255;
$11 = $10 << 8;
$12 = $7 | $11;
$13 = ((($p)) + 3|0);
$14 = HEAP8[$13>>0]|0;
$15 = $14&255;
$16 = $12 | $15;
return ($16|0);
}
function _stbtt__find_table($data,$fontstart,$tag) {
$data = $data|0;
$fontstart = $fontstart|0;
$tag = $tag|0;
var $$0 = 0, $$lcssa = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$05 = 0, label = 0, sp = 0;
sp = STACKTOP;
$$sum = (($fontstart) + 4)|0;
$0 = (($data) + ($$sum)|0);
$1 = (_ttUSHORT($0)|0);
$2 = $1&65535;
$3 = (($fontstart) + 12)|0;
$4 = ($1<<16>>16)==(0);
if ($4) {
$$0 = 0;
return ($$0|0);
}
$5 = HEAP8[$tag>>0]|0;
$6 = $5 << 24 >> 24;
$7 = ((($tag)) + 1|0);
$8 = ((($tag)) + 2|0);
$9 = ((($tag)) + 3|0);
$i$05 = 0;
while(1) {
$10 = $i$05 << 4;
$11 = (($3) + ($10))|0;
$12 = (($data) + ($11)|0);
$13 = HEAP8[$12>>0]|0;
$14 = $13&255;
$15 = ($14|0)==($6|0);
if ($15) {
$$sum1 = (($11) + 1)|0;
$16 = (($data) + ($$sum1)|0);
$17 = HEAP8[$16>>0]|0;
$18 = $17&255;
$19 = HEAP8[$7>>0]|0;
$20 = $19 << 24 >> 24;
$21 = ($18|0)==($20|0);
if ($21) {
$$sum2 = (($11) + 2)|0;
$22 = (($data) + ($$sum2)|0);
$23 = HEAP8[$22>>0]|0;
$24 = $23&255;
$25 = HEAP8[$8>>0]|0;
$26 = $25 << 24 >> 24;
$27 = ($24|0)==($26|0);
if ($27) {
$$sum3 = (($11) + 3)|0;
$28 = (($data) + ($$sum3)|0);
$29 = HEAP8[$28>>0]|0;
$30 = $29&255;
$31 = HEAP8[$9>>0]|0;
$32 = $31 << 24 >> 24;
$33 = ($30|0)==($32|0);
if ($33) {
$$lcssa = $11;
break;
}
}
}
}
$36 = (($i$05) + 1)|0;
$37 = ($36|0)<($2|0);
if ($37) {
$i$05 = $36;
} else {
$$0 = 0;
label = 9;
break;
}
}
if ((label|0) == 9) {
return ($$0|0);
}
$$sum4 = (($$lcssa) + 8)|0;
$34 = (($data) + ($$sum4)|0);
$35 = (_ttULONG($34)|0);
$$0 = $35;
return ($$0|0);
}
function _ttUSHORT($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP8[$p>>0]|0;
$1 = $0&255;
$2 = $1 << 8;
$3 = ((($p)) + 1|0);
$4 = HEAP8[$3>>0]|0;
$5 = $4&255;
$6 = $2 | $5;
$7 = $6&65535;
return ($7|0);
}
function _ttSHORT($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP8[$p>>0]|0;
$1 = $0&255;
$2 = $1 << 8;
$3 = ((($p)) + 1|0);
$4 = HEAP8[$3>>0]|0;
$5 = $4&255;
$6 = $2 | $5;
$7 = $6&65535;
return ($7|0);
}
function _stbtt__GetGlyfOffset($info,$glyph_index) {
$info = $info|0;
$glyph_index = $glyph_index|0;
var $$0 = 0, $$pn = 0, $$sink = 0, $$sum = 0, $$sum2 = 0, $$sum3 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $g1$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($info)) + 12|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>($glyph_index|0);
if (!($2)) {
$$0 = -1;
return ($$0|0);
}
$3 = ((($info)) + 44|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)>(1);
if ($5) {
$$0 = -1;
return ($$0|0);
}
$6 = ($4|0)==(0);
$7 = ((($info)) + 24|0);
$8 = HEAP32[$7>>2]|0;
$9 = ((($info)) + 4|0);
$10 = HEAP32[$9>>2]|0;
$11 = ((($info)) + 16|0);
$12 = HEAP32[$11>>2]|0;
if ($6) {
$13 = $glyph_index << 1;
$$sum3 = (($12) + ($13))|0;
$14 = (($10) + ($$sum3)|0);
$15 = (_ttUSHORT($14)|0);
$16 = $15&65535;
$17 = $16 << 1;
$$sum5 = (($$sum3) + 2)|0;
$18 = (($10) + ($$sum5)|0);
$19 = (_ttUSHORT($18)|0);
$20 = $19&65535;
$21 = $20 << 1;
$$pn = $17;$$sink = $21;
} else {
$22 = $glyph_index << 2;
$$sum = (($12) + ($22))|0;
$23 = (($10) + ($$sum)|0);
$24 = (_ttULONG($23)|0);
$$sum2 = (($$sum) + 4)|0;
$25 = (($10) + ($$sum2)|0);
$26 = (_ttULONG($25)|0);
$$pn = $24;$$sink = $26;
}
$27 = (($$sink) + ($8))|0;
$g1$0 = (($$pn) + ($8))|0;
$28 = ($g1$0|0)==($27|0);
$29 = $28 ? -1 : $g1$0;
$$0 = $29;
return ($$0|0);
}
function _stbtt__close_shape($vertices,$num_vertices,$was_off,$start_off,$sx,$sy,$scx,$scy,$cx,$cy) {
$vertices = $vertices|0;
$num_vertices = $num_vertices|0;
$was_off = $was_off|0;
$start_off = $start_off|0;
$sx = $sx|0;
$sy = $sy|0;
$scx = $scx|0;
$scy = $scy|0;
$cx = $cx|0;
$cy = $cy|0;
var $$0 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($start_off|0)==(0);
$1 = ($was_off|0)!=(0);
if (!($0)) {
if ($1) {
$2 = (($num_vertices) + 1)|0;
$3 = (($vertices) + (($num_vertices*10)|0)|0);
$4 = (($cx) + ($scx))|0;
$5 = $4 >> 1;
$6 = (($cy) + ($scy))|0;
$7 = $6 >> 1;
_stbtt_setvertex($3,3,$5,$7,$cx,$cy);
$$0 = $2;
} else {
$$0 = $num_vertices;
}
$8 = (($$0) + 1)|0;
$9 = (($vertices) + (($$0*10)|0)|0);
_stbtt_setvertex($9,3,$sx,$sy,$scx,$scy);
$$1 = $8;
return ($$1|0);
}
$10 = (($num_vertices) + 1)|0;
$11 = (($vertices) + (($num_vertices*10)|0)|0);
if ($1) {
_stbtt_setvertex($11,3,$sx,$sy,$cx,$cy);
$$1 = $10;
return ($$1|0);
} else {
_stbtt_setvertex($11,2,$sx,$sy,0,0);
$$1 = $10;
return ($$1|0);
}
return (0)|0;
}
function _stbtt_setvertex($v,$type,$x,$y,$cx,$cy) {
$v = $v|0;
$type = $type|0;
$x = $x|0;
$y = $y|0;
$cx = $cx|0;
$cy = $cy|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($v)) + 8|0);
HEAP8[$0>>0] = $type;
$1 = $x&65535;
HEAP16[$v>>1] = $1;
$2 = $y&65535;
$3 = ((($v)) + 2|0);
HEAP16[$3>>1] = $2;
$4 = $cx&65535;
$5 = ((($v)) + 4|0);
HEAP16[$5>>1] = $4;
$6 = $cy&65535;
$7 = ((($v)) + 6|0);
HEAP16[$7>>1] = $6;
return;
}
function _stbtt_FlattenCurves($vertices,$num_verts,$objspace_flatness,$contour_lengths,$num_contours) {
$vertices = $vertices|0;
$num_verts = $num_verts|0;
$objspace_flatness = +$objspace_flatness;
$contour_lengths = $contour_lengths|0;
$num_contours = $num_contours|0;
var $$0 = 0, $$lcssa = 0, $$n$0 = 0, $$n$0$lcssa = 0, $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0;
var $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond18 = 0, $i$012 = 0, $i$12 = 0, $n$013 = 0, $n$2$lcssa = 0, $n$24 = 0, $n$3 = 0, $num_points = 0, $pass$011 = 0, $points$09 = 0, $points$1 = 0;
var $start$010 = 0, $start$1$lcssa = 0, $start$15 = 0, $start$2 = 0, $x$06 = 0.0, $x$1 = 0.0, $y$07 = 0.0, $y$1 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$num_points = sp;
HEAP32[$num_points>>2] = 0;
$0 = $objspace_flatness * $objspace_flatness;
$1 = ($num_verts|0)>(0);
if ($1) {
$i$012 = 0;$n$013 = 0;
} else {
HEAP32[$num_contours>>2] = 0;
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
while(1) {
$2 = (((($vertices) + (($i$012*10)|0)|0)) + 8|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($3<<24>>24)==(1);
$5 = $4&1;
$$n$0 = (($5) + ($n$013))|0;
$6 = (($i$012) + 1)|0;
$exitcond18 = ($6|0)==($num_verts|0);
if ($exitcond18) {
$$n$0$lcssa = $$n$0;
break;
} else {
$i$012 = $6;$n$013 = $$n$0;
}
}
HEAP32[$num_contours>>2] = $$n$0$lcssa;
$7 = ($$n$0$lcssa|0)==(0);
if ($7) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$8 = $$n$0$lcssa << 2;
$9 = (_malloc($8)|0);
HEAP32[$contour_lengths>>2] = $9;
$10 = ($9|0)==(0|0);
if ($10) {
HEAP32[$num_contours>>2] = 0;
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$11 = ($num_verts|0)>(0);
$pass$011 = 0;$points$09 = 0;$start$010 = 0;
while(1) {
$12 = ($pass$011|0)==(1);
if ($12) {
$13 = HEAP32[$num_points>>2]|0;
$14 = $13 << 3;
$15 = (_malloc($14)|0);
$16 = ($15|0)==(0|0);
if ($16) {
$$lcssa = $15;
break;
} else {
$points$1 = $15;
}
} else {
$points$1 = $points$09;
}
HEAP32[$num_points>>2] = 0;
L19: do {
if ($11) {
$i$12 = 0;$n$24 = -1;$start$15 = $start$010;$x$06 = 0.0;$y$07 = 0.0;
while(1) {
$17 = (($vertices) + (($i$12*10)|0)|0);
$18 = (((($vertices) + (($i$12*10)|0)|0)) + 8|0);
$19 = HEAP8[$18>>0]|0;
$20 = $19&255;
switch ($20|0) {
case 1: {
$21 = ($n$24|0)>(-1);
if ($21) {
$22 = HEAP32[$num_points>>2]|0;
$23 = (($22) - ($start$15))|0;
$24 = HEAP32[$contour_lengths>>2]|0;
$25 = (($24) + ($n$24<<2)|0);
HEAP32[$25>>2] = $23;
}
$26 = (($n$24) + 1)|0;
$27 = HEAP32[$num_points>>2]|0;
$28 = HEAP16[$17>>1]|0;
$29 = (+($28<<16>>16));
$30 = (((($vertices) + (($i$12*10)|0)|0)) + 2|0);
$31 = HEAP16[$30>>1]|0;
$32 = (+($31<<16>>16));
$33 = (($27) + 1)|0;
HEAP32[$num_points>>2] = $33;
_stbtt__add_point($points$1,$27,$29,$32);
$n$3 = $26;$start$2 = $27;$x$1 = $29;$y$1 = $32;
break;
}
case 2: {
$34 = HEAP16[$17>>1]|0;
$35 = (+($34<<16>>16));
$36 = (((($vertices) + (($i$12*10)|0)|0)) + 2|0);
$37 = HEAP16[$36>>1]|0;
$38 = (+($37<<16>>16));
$39 = HEAP32[$num_points>>2]|0;
$40 = (($39) + 1)|0;
HEAP32[$num_points>>2] = $40;
_stbtt__add_point($points$1,$39,$35,$38);
$n$3 = $n$24;$start$2 = $start$15;$x$1 = $35;$y$1 = $38;
break;
}
case 3: {
$41 = (((($vertices) + (($i$12*10)|0)|0)) + 4|0);
$42 = HEAP16[$41>>1]|0;
$43 = (+($42<<16>>16));
$44 = (((($vertices) + (($i$12*10)|0)|0)) + 6|0);
$45 = HEAP16[$44>>1]|0;
$46 = (+($45<<16>>16));
$47 = HEAP16[$17>>1]|0;
$48 = (+($47<<16>>16));
$49 = (((($vertices) + (($i$12*10)|0)|0)) + 2|0);
$50 = HEAP16[$49>>1]|0;
$51 = (+($50<<16>>16));
_stbtt__tesselate_curve($points$1,$num_points,$x$06,$y$07,$43,$46,$48,$51,$0,0);
$52 = HEAP16[$17>>1]|0;
$53 = (+($52<<16>>16));
$54 = HEAP16[$49>>1]|0;
$55 = (+($54<<16>>16));
$n$3 = $n$24;$start$2 = $start$15;$x$1 = $53;$y$1 = $55;
break;
}
default: {
$n$3 = $n$24;$start$2 = $start$15;$x$1 = $x$06;$y$1 = $y$07;
}
}
$56 = (($i$12) + 1)|0;
$exitcond = ($56|0)==($num_verts|0);
if ($exitcond) {
$n$2$lcssa = $n$3;$start$1$lcssa = $start$2;
break L19;
} else {
$i$12 = $56;$n$24 = $n$3;$start$15 = $start$2;$x$06 = $x$1;$y$07 = $y$1;
}
}
} else {
$n$2$lcssa = -1;$start$1$lcssa = $start$010;
}
} while(0);
$57 = HEAP32[$num_points>>2]|0;
$58 = (($57) - ($start$1$lcssa))|0;
$59 = HEAP32[$contour_lengths>>2]|0;
$60 = (($59) + ($n$2$lcssa<<2)|0);
HEAP32[$60>>2] = $58;
$61 = (($pass$011) + 1)|0;
$62 = ($61|0)<(2);
if ($62) {
$pass$011 = $61;$points$09 = $points$1;$start$010 = $start$1$lcssa;
} else {
$$0 = $points$1;
label = 20;
break;
}
}
if ((label|0) == 20) {
STACKTOP = sp;return ($$0|0);
}
_free($$lcssa);
$63 = HEAP32[$contour_lengths>>2]|0;
_free($63);
HEAP32[$contour_lengths>>2] = 0;
HEAP32[$num_contours>>2] = 0;
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
function _stbtt__rasterize($result,$pts,$wcount,$windings,$scale_x,$scale_y,$shift_x,$shift_y,$off_x,$off_y,$invert) {
$result = $result|0;
$pts = $pts|0;
$wcount = $wcount|0;
$windings = $windings|0;
$scale_x = +$scale_x;
$scale_y = +$scale_y;
$shift_x = +$shift_x;
$shift_y = +$shift_y;
$off_x = $off_x|0;
$off_y = $off_y|0;
$invert = $invert|0;
var $$lcssa = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0;
var $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0;
var $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a$0 = 0, $b$0 = 0, $exitcond = 0, $exitcond20 = 0;
var $i$013 = 0, $i$18 = 0, $j$04 = 0, $j$04$phi = 0, $k$05 = 0, $m$07 = 0, $n$0$lcssa = 0, $n$014 = 0, $n$1$lcssa = 0, $n$19 = 0, $n$2$lcssa = 0, $n$26 = 0, $n$3 = 0, $phitmp = 0, $phitmp19 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($invert|0)!=(0);
$1 = -$scale_y;
$2 = $0 ? $1 : $scale_y;
$3 = ($windings|0)>(0);
if ($3) {
$i$013 = 0;$n$014 = 0;
while(1) {
$4 = (($wcount) + ($i$013<<2)|0);
$5 = HEAP32[$4>>2]|0;
$6 = (($5) + ($n$014))|0;
$7 = (($i$013) + 1)|0;
$exitcond20 = ($7|0)==($windings|0);
if ($exitcond20) {
$$lcssa = $6;
break;
} else {
$i$013 = $7;$n$014 = $6;
}
}
$phitmp = ($$lcssa*20)|0;
$phitmp19 = (($phitmp) + 20)|0;
$n$0$lcssa = $phitmp19;
} else {
$n$0$lcssa = 20;
}
$8 = (_malloc($n$0$lcssa)|0);
$9 = ($8|0)==(0|0);
if ($9) {
return;
}
$10 = ($windings|0)>(0);
if ($10) {
$i$18 = 0;$m$07 = 0;$n$19 = 0;
while(1) {
$11 = (($wcount) + ($i$18<<2)|0);
$12 = HEAP32[$11>>2]|0;
$13 = (($12) + ($m$07))|0;
$14 = ($12|0)>(0);
if ($14) {
$15 = (($12) + -1)|0;
$16 = HEAP32[$11>>2]|0;
$j$04 = $15;$k$05 = 0;$n$26 = $n$19;
while(1) {
$$sum = (($j$04) + ($m$07))|0;
$17 = (((($pts) + ($$sum<<3)|0)) + 4|0);
$18 = +HEAPF32[$17>>2];
$$sum1 = (($k$05) + ($m$07))|0;
$19 = (((($pts) + ($$sum1<<3)|0)) + 4|0);
$20 = +HEAPF32[$19>>2];
$21 = $18 == $20;
if ($21) {
$n$3 = $n$26;
} else {
$22 = (((($8) + (($n$26*20)|0)|0)) + 16|0);
HEAP32[$22>>2] = 0;
$23 = +HEAPF32[$17>>2];
$24 = +HEAPF32[$19>>2];
if ($0) {
$25 = $23 > $24;
if ($25) {
label = 12;
} else {
$a$0 = $k$05;$b$0 = $j$04;
}
} else {
$26 = $23 < $24;
if ($26) {
label = 12;
} else {
$a$0 = $k$05;$b$0 = $j$04;
}
}
if ((label|0) == 12) {
label = 0;
HEAP32[$22>>2] = 1;
$a$0 = $j$04;$b$0 = $k$05;
}
$$sum2 = (($a$0) + ($m$07))|0;
$27 = (($pts) + ($$sum2<<3)|0);
$28 = +HEAPF32[$27>>2];
$29 = $28 * $scale_x;
$30 = $29 + $shift_x;
$31 = (($8) + (($n$26*20)|0)|0);
HEAPF32[$31>>2] = $30;
$32 = (((($pts) + ($$sum2<<3)|0)) + 4|0);
$33 = +HEAPF32[$32>>2];
$34 = $2 * $33;
$35 = $34 + $shift_y;
$36 = (((($8) + (($n$26*20)|0)|0)) + 4|0);
HEAPF32[$36>>2] = $35;
$$sum3 = (($b$0) + ($m$07))|0;
$37 = (($pts) + ($$sum3<<3)|0);
$38 = +HEAPF32[$37>>2];
$39 = $38 * $scale_x;
$40 = $39 + $shift_x;
$41 = (((($8) + (($n$26*20)|0)|0)) + 8|0);
HEAPF32[$41>>2] = $40;
$42 = (((($pts) + ($$sum3<<3)|0)) + 4|0);
$43 = +HEAPF32[$42>>2];
$44 = $2 * $43;
$45 = $44 + $shift_y;
$46 = (((($8) + (($n$26*20)|0)|0)) + 12|0);
HEAPF32[$46>>2] = $45;
$47 = (($n$26) + 1)|0;
$n$3 = $47;
}
$48 = (($k$05) + 1)|0;
$49 = ($48|0)<($16|0);
if ($49) {
$j$04$phi = $k$05;$k$05 = $48;$n$26 = $n$3;$j$04 = $j$04$phi;
} else {
$n$2$lcssa = $n$3;
break;
}
}
} else {
$n$2$lcssa = $n$19;
}
$50 = (($i$18) + 1)|0;
$exitcond = ($50|0)==($windings|0);
if ($exitcond) {
$n$1$lcssa = $n$2$lcssa;
break;
} else {
$i$18 = $50;$m$07 = $13;$n$19 = $n$2$lcssa;
}
}
} else {
$n$1$lcssa = 0;
}
_stbtt__sort_edges($8,$n$1$lcssa);
_stbtt__rasterize_sorted_edges($result,$8,$n$1$lcssa,$off_x,$off_y);
_free($8);
return;
}
function _LoadRBMF($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$lcssa = 0, $$lcssa9 = 0, $$op = 0, $$op$op = 0, $$op$op$op = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
var $99 = 0, $counter$014 = 0, $currentLine$010 = 0, $currentLine$1 = 0, $currentPosX$011 = 0, $currentPosX$1 = 0, $exitcond = 0, $exitcond29 = 0, $exitcond30 = 0, $i$025 = 0, $i1$021 = 0, $i2$018 = 0, $i3$015 = 0, $i4$012 = 0, $image = 0, $image$byval_copy14 = 0, $j$013 = 0, $rbmfCharWidthData$0 = 0, $rbmfFileData$0 = 0, $rbmfHeader = 0;
var $spriteFont$sroa$0$0 = 0, $spriteFont$sroa$16$0 = 0, $spriteFont$sroa$18$0 = 0, $spriteFont$sroa$27$0 = 0, $spriteFont$sroa$29$0 = 0, $spriteFont$sroa$6$0 = 0, $spriteFont$sroa$7 = 0, $spriteFont$sroa$77$0 = 0, $spriteFont$sroa$8$0 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_ptr4 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 176|0;
$image$byval_copy14 = sp + 56|0;
$vararg_buffer11 = sp + 48|0;
$vararg_buffer1 = sp + 24|0;
$vararg_buffer = sp + 16|0;
$spriteFont$sroa$7 = sp;
$rbmfHeader = sp + 160|0;
$0 = sp + 116|0;
$image = sp + 96|0;
$1 = sp + 76|0;
;HEAP32[$spriteFont$sroa$7>>2]=0|0;HEAP32[$spriteFont$sroa$7+4>>2]=0|0;HEAP32[$spriteFont$sroa$7+8>>2]=0|0;
$2 = (_fopen($fileName,20392)|0);
$3 = ($2|0)==(0|0);
if ($3) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,20395,$vararg_buffer);
_GetDefaultFont($0);
$4 = HEAP32[$0>>2]|0;
$5 = ((($0)) + 4|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($0)) + 8|0);
;HEAP32[$spriteFont$sroa$7>>2]=HEAP32[$7>>2]|0;HEAP32[$spriteFont$sroa$7+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$spriteFont$sroa$7+8>>2]=HEAP32[$7+8>>2]|0;
$8 = ((($0)) + 20|0);
$9 = HEAP32[$8>>2]|0;
$10 = ((($0)) + 24|0);
$11 = HEAP32[$10>>2]|0;
$12 = ((($0)) + 28|0);
$13 = HEAP32[$12>>2]|0;
$14 = ((($0)) + 32|0);
$15 = HEAP32[$14>>2]|0;
$16 = ((($0)) + 36|0);
$17 = HEAP32[$16>>2]|0;
$18 = ((($0)) + 40|0);
$19 = HEAP32[$18>>2]|0;
$rbmfCharWidthData$0 = 0;$rbmfFileData$0 = 0;$spriteFont$sroa$0$0 = $4;$spriteFont$sroa$16$0 = $13;$spriteFont$sroa$18$0 = $15;$spriteFont$sroa$27$0 = $17;$spriteFont$sroa$29$0 = $19;$spriteFont$sroa$6$0 = $6;$spriteFont$sroa$77$0 = $9;$spriteFont$sroa$8$0 = $11;
(_fclose($2)|0);
_free($rbmfFileData$0);
_free($rbmfCharWidthData$0);
HEAP32[$agg$result>>2] = $spriteFont$sroa$0$0;
$148 = ((($agg$result)) + 4|0);
HEAP32[$148>>2] = $spriteFont$sroa$6$0;
$149 = ((($agg$result)) + 8|0);
;HEAP32[$149>>2]=HEAP32[$spriteFont$sroa$7>>2]|0;HEAP32[$149+4>>2]=HEAP32[$spriteFont$sroa$7+4>>2]|0;HEAP32[$149+8>>2]=HEAP32[$spriteFont$sroa$7+8>>2]|0;
$150 = ((($agg$result)) + 20|0);
HEAP32[$150>>2] = $spriteFont$sroa$77$0;
$151 = ((($agg$result)) + 24|0);
HEAP32[$151>>2] = $spriteFont$sroa$8$0;
$152 = ((($agg$result)) + 28|0);
HEAP32[$152>>2] = $spriteFont$sroa$16$0;
$153 = ((($agg$result)) + 32|0);
HEAP32[$153>>2] = $spriteFont$sroa$18$0;
$154 = ((($agg$result)) + 36|0);
HEAP32[$154>>2] = $spriteFont$sroa$27$0;
$155 = ((($agg$result)) + 40|0);
HEAP32[$155>>2] = $spriteFont$sroa$29$0;
STACKTOP = sp;return;
}
(_fread($rbmfHeader,16,1,$2)|0);
$20 = ((($rbmfHeader)) + 6|0);
$21 = HEAP16[$20>>1]|0;
$22 = $21 << 16 >> 16;
$23 = ((($rbmfHeader)) + 8|0);
$24 = HEAP16[$23>>1]|0;
$25 = $24 << 16 >> 16;
$26 = ((($rbmfHeader)) + 10|0);
$27 = HEAP16[$26>>1]|0;
$28 = $27 << 16 >> 16;
$29 = ((($rbmfHeader)) + 12|0);
$30 = HEAP16[$29>>1]|0;
$31 = $30 << 16 >> 16;
HEAP32[$vararg_buffer1>>2] = $fileName;
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
HEAP32[$vararg_ptr4>>2] = $22;
$vararg_ptr5 = ((($vararg_buffer1)) + 8|0);
HEAP32[$vararg_ptr5>>2] = $25;
$vararg_ptr6 = ((($vararg_buffer1)) + 12|0);
HEAP32[$vararg_ptr6>>2] = $28;
$vararg_ptr7 = ((($vararg_buffer1)) + 16|0);
HEAP32[$vararg_ptr7>>2] = $31;
_TraceLog(3,20455,$vararg_buffer1);
$32 = HEAP16[$26>>1]|0;
$33 = $32 << 16 >> 16;
$34 = HEAP16[$20>>1]|0;
$35 = $34 << 16 >> 16;
$36 = HEAP16[$23>>1]|0;
$37 = $36 << 16 >> 16;
$38 = Math_imul($37, $35)|0;
$39 = (($38|0) / 32)&-1;
$40 = $39 << 2;
$41 = (_malloc($40)|0);
$42 = ($38|0)>(31);
if ($42) {
$i$025 = 0;
while(1) {
$43 = (($41) + ($i$025<<2)|0);
(_fread($43,4,1,$2)|0);
$44 = (($i$025) + 1)|0;
$45 = ($44|0)<($39|0);
if ($45) {
$i$025 = $44;
} else {
break;
}
}
}
$46 = (_malloc($33)|0);
$47 = ($32<<16>>16)>(0);
if ($47) {
$48 = $32 << 16 >> 16;
$i1$021 = 0;
while(1) {
$49 = (($46) + ($i1$021)|0);
(_fread($49,1,1,$2)|0);
$50 = (($i1$021) + 1)|0;
$exitcond30 = ($50|0)==($48|0);
if ($exitcond30) {
break;
} else {
$i1$021 = $50;
}
}
}
$51 = HEAP16[$20>>1]|0;
$52 = $51 << 16 >> 16;
$53 = HEAP16[$23>>1]|0;
$54 = $53 << 16 >> 16;
$55 = $52 << 2;
$56 = Math_imul($55, $54)|0;
$57 = (_malloc($56)|0);
$58 = HEAP16[$20>>1]|0;
$59 = $58 << 16 >> 16;
$60 = HEAP16[$23>>1]|0;
$61 = $60 << 16 >> 16;
$62 = Math_imul($61, $59)|0;
$63 = ($62|0)>(0);
if ($63) {
$64 = HEAP16[$20>>1]|0;
$65 = $64 << 16 >> 16;
$66 = HEAP16[$23>>1]|0;
$67 = $66 << 16 >> 16;
$68 = Math_imul($67, $65)|0;
$i2$018 = 0;
while(1) {
$82 = (($57) + ($i2$018<<2)|0);
$83 = (($i2$018) + 1)|0;
$84 = ($83|0)<($68|0);
HEAP8[$82>>0]=0&255;HEAP8[$82+1>>0]=(0>>8)&255;HEAP8[$82+2>>0]=(0>>16)&255;HEAP8[$82+3>>0]=0>>24;
if ($84) {
$i2$018 = $83;
} else {
break;
}
}
}
$69 = HEAP16[$20>>1]|0;
$70 = $69 << 16 >> 16;
$71 = HEAP16[$23>>1]|0;
$72 = $71 << 16 >> 16;
$73 = Math_imul($72, $70)|0;
$74 = ($73|0)>(0);
if ($74) {
$75 = HEAP16[$20>>1]|0;
$76 = HEAP16[$23>>1]|0;
$77 = $76 << 16 >> 16;
$78 = $75 << 16 >> 16;
$79 = Math_imul($77, $78)|0;
$80 = ($79|0)>(32);
$$op = (($79) + -1)|0;
$$op$op = $$op >>> 5;
$$op$op$op = (($$op$op) + 1)|0;
$81 = $80 ? $$op$op$op : 1;
$counter$014 = 0;$i3$015 = 0;
while(1) {
$85 = (($41) + ($counter$014<<2)|0);
$86 = HEAP32[$85>>2]|0;
$j$013 = 31;
while(1) {
$87 = 1 << $j$013;
$88 = $86 & $87;
$89 = ($88|0)==(0);
if (!($89)) {
$90 = (($j$013) + ($i3$015))|0;
$91 = (($57) + ($90<<2)|0);
HEAP8[$91>>0]=-1&255;HEAP8[$91+1>>0]=(-1>>8)&255;HEAP8[$91+2>>0]=(-1>>16)&255;HEAP8[$91+3>>0]=-1>>24;
}
$92 = (($j$013) + -1)|0;
$93 = ($j$013|0)>(0);
if ($93) {
$j$013 = $92;
} else {
break;
}
}
$94 = (($counter$014) + 1)|0;
$95 = (($i3$015) + 32)|0;
$exitcond29 = ($94|0)==($81|0);
if ($exitcond29) {
break;
} else {
$counter$014 = $94;$i3$015 = $95;
}
}
$96 = $75 << 16 >> 16;
$97 = $76 << 16 >> 16;
$$lcssa = $96;$$lcssa9 = $97;
} else {
$$lcssa = $70;$$lcssa9 = $72;
}
_LoadImageEx($image,$57,$$lcssa,$$lcssa9);
_ImageFormat($image,2);
_free($57);
HEAP32[$image$byval_copy14>>2] = $fileName;
_TraceLog(3,20521,$image$byval_copy14);
;HEAP32[$image$byval_copy14>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy14+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy14+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy14+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy14+16>>2]=HEAP32[$image+16>>2]|0;
_LoadTextureFromImage($1,$image$byval_copy14);
$98 = HEAP32[$1>>2]|0;
$99 = ((($1)) + 4|0);
$100 = HEAP32[$99>>2]|0;
$101 = ((($1)) + 8|0);
;HEAP32[$spriteFont$sroa$7>>2]=HEAP32[$101>>2]|0;HEAP32[$spriteFont$sroa$7+4>>2]=HEAP32[$101+4>>2]|0;HEAP32[$spriteFont$sroa$7+8>>2]=HEAP32[$101+8>>2]|0;
;HEAP32[$image$byval_copy14>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy14+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy14+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy14+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy14+16>>2]=HEAP32[$image+16>>2]|0;
_UnloadImage($image$byval_copy14);
$102 = $33 << 2;
$103 = (_malloc($102)|0);
$104 = $33 << 4;
$105 = (_malloc($104)|0);
$106 = $33 << 3;
$107 = (_malloc($106)|0);
$108 = (_malloc($102)|0);
$109 = ($32<<16>>16)>(0);
if ($109) {
$110 = ((($rbmfHeader)) + 5|0);
$111 = HEAP8[$110>>0]|0;
$112 = $111 << 24 >> 24;
$113 = HEAP16[$29>>1]|0;
$114 = $113 << 16 >> 16;
$115 = (($114) + 1)|0;
$116 = $113 << 16 >> 16;
$117 = $113 << 16 >> 16;
$118 = (($117) + 1)|0;
$119 = $32 << 16 >> 16;
$120 = $32 << 16 >> 16;
$121 = $120 << 2;
_memset(($108|0),0,($121|0))|0;
$currentLine$010 = 0;$currentPosX$011 = 1;$i4$012 = 0;
while(1) {
$122 = (($112) + ($i4$012))|0;
$123 = (($103) + ($i4$012<<2)|0);
HEAP32[$123>>2] = $122;
$124 = (($105) + ($i4$012<<4)|0);
HEAP32[$124>>2] = $currentPosX$011;
$125 = Math_imul($115, $currentLine$010)|0;
$126 = (($125) + 1)|0;
$127 = (((($105) + ($i4$012<<4)|0)) + 4|0);
HEAP32[$127>>2] = $126;
$128 = (($46) + ($i4$012)|0);
$129 = HEAP8[$128>>0]|0;
$130 = $129&255;
$131 = (((($105) + ($i4$012<<4)|0)) + 8|0);
HEAP32[$131>>2] = $130;
$132 = (((($105) + ($i4$012<<4)|0)) + 12|0);
HEAP32[$132>>2] = $116;
$133 = (($107) + ($i4$012<<3)|0);
HEAPF32[$133>>2] = 0.0;
$134 = (((($107) + ($i4$012<<3)|0)) + 4|0);
HEAPF32[$134>>2] = 0.0;
$135 = HEAP32[$131>>2]|0;
$136 = (($currentPosX$011) + 1)|0;
$137 = (($136) + ($135))|0;
$138 = ($137|0)>($100|0);
if ($138) {
$139 = (($currentLine$010) + 1)|0;
$140 = HEAP8[$128>>0]|0;
$141 = $140&255;
$142 = (($141) + 2)|0;
HEAP32[$124>>2] = 1;
$143 = Math_imul($118, $139)|0;
$144 = (($143) + 1)|0;
HEAP32[$127>>2] = $144;
$currentLine$1 = $139;$currentPosX$1 = $142;
} else {
$currentLine$1 = $currentLine$010;$currentPosX$1 = $137;
}
$145 = (($i4$012) + 1)|0;
$exitcond = ($145|0)==($119|0);
if ($exitcond) {
break;
} else {
$currentLine$010 = $currentLine$1;$currentPosX$011 = $currentPosX$1;$i4$012 = $145;
}
}
}
$146 = ((($105)) + 12|0);
$147 = HEAP32[$146>>2]|0;
HEAP32[$vararg_buffer11>>2] = $fileName;
_TraceLog(0,20586,$vararg_buffer11);
$rbmfCharWidthData$0 = $46;$rbmfFileData$0 = $41;$spriteFont$sroa$0$0 = $98;$spriteFont$sroa$16$0 = $103;$spriteFont$sroa$18$0 = $105;$spriteFont$sroa$27$0 = $107;$spriteFont$sroa$29$0 = $108;$spriteFont$sroa$6$0 = $100;$spriteFont$sroa$77$0 = $147;$spriteFont$sroa$8$0 = $33;
(_fclose($2)|0);
_free($rbmfFileData$0);
_free($rbmfCharWidthData$0);
HEAP32[$agg$result>>2] = $spriteFont$sroa$0$0;
$148 = ((($agg$result)) + 4|0);
HEAP32[$148>>2] = $spriteFont$sroa$6$0;
$149 = ((($agg$result)) + 8|0);
;HEAP32[$149>>2]=HEAP32[$spriteFont$sroa$7>>2]|0;HEAP32[$149+4>>2]=HEAP32[$spriteFont$sroa$7+4>>2]|0;HEAP32[$149+8>>2]=HEAP32[$spriteFont$sroa$7+8>>2]|0;
$150 = ((($agg$result)) + 20|0);
HEAP32[$150>>2] = $spriteFont$sroa$77$0;
$151 = ((($agg$result)) + 24|0);
HEAP32[$151>>2] = $spriteFont$sroa$8$0;
$152 = ((($agg$result)) + 28|0);
HEAP32[$152>>2] = $spriteFont$sroa$16$0;
$153 = ((($agg$result)) + 32|0);
HEAP32[$153>>2] = $spriteFont$sroa$18$0;
$154 = ((($agg$result)) + 36|0);
HEAP32[$154>>2] = $spriteFont$sroa$27$0;
$155 = ((($agg$result)) + 40|0);
HEAP32[$155>>2] = $spriteFont$sroa$29$0;
STACKTOP = sp;return;
}
function _LoadTTF($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $7 = 0, $8 = 0, $9 = 0, $charData = 0, $exitcond = 0, $exitcond4 = 0, $font$sroa$0 = 0, $i$03 = 0, $i1$01 = 0, $image = 0, $image$byval_copy1 = 0, $k$02 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 2000|0;
$image$byval_copy1 = sp + 1968|0;
$vararg_buffer = sp + 24|0;
$charData = sp + 68|0;
$font$sroa$0 = sp;
$image = sp + 48|0;
$0 = sp + 28|0;
$1 = (_malloc(33554432)|0);
$2 = (_malloc(262144)|0);
;HEAP32[$font$sroa$0>>2]=0|0;HEAP32[$font$sroa$0+4>>2]=0|0;HEAP32[$font$sroa$0+8>>2]=0|0;HEAP32[$font$sroa$0+12>>2]=0|0;HEAP32[$font$sroa$0+16>>2]=0|0;
$3 = (_fopen($fileName,20392)|0);
$4 = ($3|0)==(0|0);
if ($4) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,20019,$vararg_buffer);
;HEAP32[$agg$result>>2]=HEAP32[$font$sroa$0>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$font$sroa$0+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$font$sroa$0+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$font$sroa$0+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$font$sroa$0+16>>2]|0;
$5 = ((($agg$result)) + 20|0);
;HEAP32[$5>>2]=0|0;HEAP32[$5+4>>2]=0|0;HEAP32[$5+8>>2]=0|0;HEAP32[$5+12>>2]=0|0;HEAP32[$5+16>>2]=0|0;HEAP32[$5+20>>2]=0|0;
STACKTOP = sp;return;
}
(_fread($1,1,33554432,$3)|0);
(_stbtt_BakeFontBitmap($1,0,32.0,$2,512,512,32,95,$charData)|0);
_free($1);
$6 = (_malloc(524288)|0);
$i$03 = 0;$k$02 = 0;
while(1) {
$7 = (($6) + ($k$02)|0);
HEAP8[$7>>0] = -1;
$8 = (($2) + ($i$03)|0);
$9 = HEAP8[$8>>0]|0;
$10 = $k$02 | 1;
$11 = (($6) + ($10)|0);
HEAP8[$11>>0] = $9;
$12 = (($k$02) + 2)|0;
$13 = (($i$03) + 1)|0;
$exitcond4 = ($13|0)==(262144);
if ($exitcond4) {
break;
} else {
$i$03 = $13;$k$02 = $12;
}
}
_free($2);
$14 = ((($image)) + 4|0);
HEAP32[$14>>2] = 512;
$15 = ((($image)) + 8|0);
HEAP32[$15>>2] = 512;
$16 = ((($image)) + 12|0);
HEAP32[$16>>2] = 1;
$17 = ((($image)) + 16|0);
HEAP32[$17>>2] = 2;
HEAP32[$image>>2] = $6;
;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
_LoadTextureFromImage($0,$image$byval_copy1);
;HEAP32[$font$sroa$0>>2]=HEAP32[$0>>2]|0;HEAP32[$font$sroa$0+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$font$sroa$0+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$font$sroa$0+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$font$sroa$0+16>>2]=HEAP32[$0+16>>2]|0;
;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
_UnloadImage($image$byval_copy1);
$18 = (_malloc(380)|0);
$19 = (_malloc(1520)|0);
$20 = (_malloc(760)|0);
$21 = (_malloc(380)|0);
$i1$01 = 0;
while(1) {
$22 = (($i1$01) + 32)|0;
$23 = (($18) + ($i1$01<<2)|0);
HEAP32[$23>>2] = $22;
$24 = (($charData) + (($i1$01*20)|0)|0);
$25 = HEAP16[$24>>1]|0;
$26 = $25&65535;
$27 = (($19) + ($i1$01<<4)|0);
HEAP32[$27>>2] = $26;
$28 = (((($charData) + (($i1$01*20)|0)|0)) + 2|0);
$29 = HEAP16[$28>>1]|0;
$30 = $29&65535;
$31 = (((($19) + ($i1$01<<4)|0)) + 4|0);
HEAP32[$31>>2] = $30;
$32 = (((($charData) + (($i1$01*20)|0)|0)) + 4|0);
$33 = HEAP16[$32>>1]|0;
$34 = $33&65535;
$35 = HEAP16[$24>>1]|0;
$36 = $35&65535;
$37 = (($34) - ($36))|0;
$38 = (((($19) + ($i1$01<<4)|0)) + 8|0);
HEAP32[$38>>2] = $37;
$39 = (((($charData) + (($i1$01*20)|0)|0)) + 6|0);
$40 = HEAP16[$39>>1]|0;
$41 = $40&65535;
$42 = HEAP16[$28>>1]|0;
$43 = $42&65535;
$44 = (($41) - ($43))|0;
$45 = (((($19) + ($i1$01<<4)|0)) + 12|0);
HEAP32[$45>>2] = $44;
$46 = (($20) + ($i1$01<<3)|0);
$47 = (((($charData) + (($i1$01*20)|0)|0)) + 8|0);
$48 = HEAP32[$47>>2]|0;
$49 = (((($charData) + (($i1$01*20)|0)|0)) + 12|0);
$50 = HEAP32[$49>>2]|0;
HEAP32[$46>>2] = $48;
$51 = (((($20) + ($i1$01<<3)|0)) + 4|0);
HEAP32[$51>>2] = $50;
$52 = (((($charData) + (($i1$01*20)|0)|0)) + 16|0);
$53 = +HEAPF32[$52>>2];
$54 = (~~(($53)));
$55 = (($21) + ($i1$01<<2)|0);
HEAP32[$55>>2] = $54;
$56 = (($i1$01) + 1)|0;
$exitcond = ($56|0)==(95);
if ($exitcond) {
break;
} else {
$i1$01 = $56;
}
}
;HEAP32[$agg$result>>2]=HEAP32[$font$sroa$0>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$font$sroa$0+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$font$sroa$0+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$font$sroa$0+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$font$sroa$0+16>>2]|0;
$57 = ((($agg$result)) + 20|0);
HEAP32[$57>>2] = 32;
$58 = ((($agg$result)) + 24|0);
HEAP32[$58>>2] = 95;
$59 = ((($agg$result)) + 28|0);
HEAP32[$59>>2] = $18;
$60 = ((($agg$result)) + 32|0);
HEAP32[$60>>2] = $19;
$61 = ((($agg$result)) + 36|0);
HEAP32[$61>>2] = $20;
$62 = ((($agg$result)) + 40|0);
HEAP32[$62>>2] = $21;
STACKTOP = sp;return;
}
function _LoadBMFont($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $7 = 0, $8 = 0, $9 = 0, $base = 0, $buffer = 0, $charAdvanceX = 0, $charHeight = 0, $charId = 0, $charOffsetX = 0, $charOffsetY = 0, $charWidth = 0, $charX = 0, $charY = 0, $endptr = 0, $font$sroa$7 = 0;
var $fontSize = 0, $i$04 = 0, $numChars = 0, $strlen = 0, $texFileName = 0, $texHeight = 0, $texWidth = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer30 = 0, $vararg_buffer34 = 0, $vararg_buffer44 = 0, $vararg_buffer7 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0;
var $vararg_ptr15 = 0, $vararg_ptr22 = 0, $vararg_ptr29 = 0, $vararg_ptr33 = 0, $vararg_ptr37 = 0, $vararg_ptr38 = 0, $vararg_ptr39 = 0, $vararg_ptr4 = 0, $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr42 = 0, $vararg_ptr43 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 608|0;
$vararg_buffer44 = sp + 136|0;
$vararg_buffer34 = sp + 104|0;
$vararg_buffer30 = sp + 96|0;
$vararg_buffer26 = sp + 88|0;
$vararg_buffer23 = sp + 80|0;
$vararg_buffer19 = sp + 72|0;
$vararg_buffer16 = sp + 64|0;
$vararg_buffer11 = sp + 48|0;
$vararg_buffer7 = sp + 40|0;
$vararg_buffer1 = sp + 24|0;
$vararg_buffer = sp + 16|0;
$font$sroa$7 = sp;
$buffer = sp + 344|0;
$fontSize = sp + 208|0;
$texWidth = sp + 204|0;
$texHeight = sp + 200|0;
$texFileName = sp + 216|0;
$numChars = sp + 196|0;
$base = sp + 192|0;
$0 = sp + 172|0;
$charId = sp + 168|0;
$charX = sp + 164|0;
$charY = sp + 160|0;
$charWidth = sp + 156|0;
$charHeight = sp + 152|0;
$charOffsetX = sp + 148|0;
$charOffsetY = sp + 144|0;
$charAdvanceX = sp + 140|0;
;HEAP32[$font$sroa$7>>2]=0|0;HEAP32[$font$sroa$7+4>>2]=0|0;HEAP32[$font$sroa$7+8>>2]=0|0;HEAP32[$font$sroa$7+12>>2]=0|0;
HEAP32[$fontSize>>2] = 0;
HEAP32[$numChars>>2] = 0;
$1 = (_fopen($fileName,20016)|0);
$2 = ($1|0)==(0|0);
if ($2) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,20019,$vararg_buffer);
HEAP32[$agg$result>>2] = 0;
$3 = ((($agg$result)) + 4|0);
;HEAP32[$3>>2]=HEAP32[$font$sroa$7>>2]|0;HEAP32[$3+4>>2]=HEAP32[$font$sroa$7+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$font$sroa$7+8>>2]|0;HEAP32[$3+12>>2]=HEAP32[$font$sroa$7+12>>2]|0;
$4 = ((($agg$result)) + 20|0);
;HEAP32[$4>>2]=0|0;HEAP32[$4+4>>2]=0|0;HEAP32[$4+8>>2]=0|0;HEAP32[$4+12>>2]=0|0;HEAP32[$4+16>>2]=0|0;HEAP32[$4+20>>2]=0|0;
STACKTOP = sp;return;
}
(_fgets($buffer,256,$1)|0);
(_fgets($buffer,256,$1)|0);
$5 = (_strstr($buffer,20053)|0);
HEAP32[$vararg_buffer1>>2] = $fontSize;
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
HEAP32[$vararg_ptr4>>2] = $base;
$vararg_ptr5 = ((($vararg_buffer1)) + 8|0);
HEAP32[$vararg_ptr5>>2] = $texWidth;
$vararg_ptr6 = ((($vararg_buffer1)) + 12|0);
HEAP32[$vararg_ptr6>>2] = $texHeight;
(_sscanf($5,20064,$vararg_buffer1)|0);
$6 = HEAP32[$fontSize>>2]|0;
HEAP32[$vararg_buffer7>>2] = $fileName;
$vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
HEAP32[$vararg_ptr10>>2] = $6;
_TraceLog(3,20106,$vararg_buffer7);
$7 = HEAP32[$texWidth>>2]|0;
$8 = HEAP32[$texHeight>>2]|0;
HEAP32[$vararg_buffer11>>2] = $fileName;
$vararg_ptr14 = ((($vararg_buffer11)) + 4|0);
HEAP32[$vararg_ptr14>>2] = $7;
$vararg_ptr15 = ((($vararg_buffer11)) + 8|0);
HEAP32[$vararg_ptr15>>2] = $8;
_TraceLog(3,20125,$vararg_buffer11);
(_fgets($buffer,256,$1)|0);
$9 = (_strstr($buffer,20156)|0);
HEAP32[$vararg_buffer16>>2] = $texFileName;
(_sscanf($9,20161,$vararg_buffer16)|0);
HEAP32[$vararg_buffer19>>2] = $fileName;
$vararg_ptr22 = ((($vararg_buffer19)) + 4|0);
HEAP32[$vararg_ptr22>>2] = $texFileName;
_TraceLog(3,20177,$vararg_buffer19);
(_fgets($buffer,256,$1)|0);
$10 = (_strstr($buffer,20208)|0);
HEAP32[$vararg_buffer23>>2] = $numChars;
(_sscanf($10,20214,$vararg_buffer23)|0);
$11 = HEAP32[$numChars>>2]|0;
HEAP32[$vararg_buffer26>>2] = $fileName;
$vararg_ptr29 = ((($vararg_buffer26)) + 4|0);
HEAP32[$vararg_ptr29>>2] = $11;
_TraceLog(3,20223,$vararg_buffer26);
$12 = (_strrchr($fileName,47)|0);
$13 = (_strlen($fileName)|0);
$14 = (_strlen($12)|0);
$15 = (_strlen($texFileName)|0);
$16 = (($13) + 2)|0;
$17 = (($16) - ($14))|0;
$18 = (($17) + ($15))|0;
$19 = (_malloc($18)|0);
$20 = (_strlen($fileName)|0);
$21 = (_strlen($12)|0);
$22 = (($20) - ($21))|0;
_memcpy(($19|0),($fileName|0),($22|0))|0;
$strlen = (_strlen($19)|0);
$endptr = (($19) + ($strlen)|0);
HEAP8[$endptr>>0]=47&255;HEAP8[$endptr+1>>0]=47>>8;
(_strcat($19,$texFileName)|0);
HEAP32[$vararg_buffer30>>2] = $fileName;
$vararg_ptr33 = ((($vararg_buffer30)) + 4|0);
HEAP32[$vararg_ptr33>>2] = $19;
_TraceLog(3,20247,$vararg_buffer30);
_LoadTexture($0,$19);
$23 = HEAP32[$0>>2]|0;
$24 = ((($0)) + 4|0);
;HEAP32[$font$sroa$7>>2]=HEAP32[$24>>2]|0;HEAP32[$font$sroa$7+4>>2]=HEAP32[$24+4>>2]|0;HEAP32[$font$sroa$7+8>>2]=HEAP32[$24+8>>2]|0;HEAP32[$font$sroa$7+12>>2]=HEAP32[$24+12>>2]|0;
$25 = HEAP32[$fontSize>>2]|0;
$26 = HEAP32[$numChars>>2]|0;
$27 = $26 << 2;
$28 = (_malloc($27)|0);
$29 = HEAP32[$numChars>>2]|0;
$30 = $29 << 4;
$31 = (_malloc($30)|0);
$32 = HEAP32[$numChars>>2]|0;
$33 = $32 << 3;
$34 = (_malloc($33)|0);
$35 = HEAP32[$numChars>>2]|0;
$36 = $35 << 2;
$37 = (_malloc($36)|0);
_free($19);
$38 = HEAP32[$numChars>>2]|0;
$39 = ($38|0)>(0);
if ($39) {
$i$04 = 0;
while(1) {
(_fgets($buffer,256,$1)|0);
HEAP32[$vararg_buffer34>>2] = $charId;
$vararg_ptr37 = ((($vararg_buffer34)) + 4|0);
HEAP32[$vararg_ptr37>>2] = $charX;
$vararg_ptr38 = ((($vararg_buffer34)) + 8|0);
HEAP32[$vararg_ptr38>>2] = $charY;
$vararg_ptr39 = ((($vararg_buffer34)) + 12|0);
HEAP32[$vararg_ptr39>>2] = $charWidth;
$vararg_ptr40 = ((($vararg_buffer34)) + 16|0);
HEAP32[$vararg_ptr40>>2] = $charHeight;
$vararg_ptr41 = ((($vararg_buffer34)) + 20|0);
HEAP32[$vararg_ptr41>>2] = $charOffsetX;
$vararg_ptr42 = ((($vararg_buffer34)) + 24|0);
HEAP32[$vararg_ptr42>>2] = $charOffsetY;
$vararg_ptr43 = ((($vararg_buffer34)) + 28|0);
HEAP32[$vararg_ptr43>>2] = $charAdvanceX;
(_sscanf($buffer,20282,$vararg_buffer34)|0);
$40 = HEAP32[$charId>>2]|0;
$41 = (($28) + ($i$04<<2)|0);
HEAP32[$41>>2] = $40;
$42 = HEAP32[$charX>>2]|0;
$43 = HEAP32[$charY>>2]|0;
$44 = HEAP32[$charWidth>>2]|0;
$45 = HEAP32[$charHeight>>2]|0;
$46 = (($31) + ($i$04<<4)|0);
HEAP32[$46>>2] = $42;
$47 = (((($31) + ($i$04<<4)|0)) + 4|0);
HEAP32[$47>>2] = $43;
$48 = (((($31) + ($i$04<<4)|0)) + 8|0);
HEAP32[$48>>2] = $44;
$49 = (((($31) + ($i$04<<4)|0)) + 12|0);
HEAP32[$49>>2] = $45;
$50 = HEAP32[$charOffsetX>>2]|0;
$51 = (+($50|0));
$52 = HEAP32[$charOffsetY>>2]|0;
$53 = (+($52|0));
$54 = (($34) + ($i$04<<3)|0);
HEAPF32[$54>>2] = $51;
$55 = (((($34) + ($i$04<<3)|0)) + 4|0);
HEAPF32[$55>>2] = $53;
$56 = HEAP32[$charAdvanceX>>2]|0;
$57 = (($37) + ($i$04<<2)|0);
HEAP32[$57>>2] = $56;
$58 = (($i$04) + 1)|0;
$59 = HEAP32[$numChars>>2]|0;
$60 = ($58|0)<($59|0);
if ($60) {
$i$04 = $58;
} else {
break;
}
}
}
(_fclose($1)|0);
HEAP32[$vararg_buffer44>>2] = $fileName;
_TraceLog(0,20356,$vararg_buffer44);
HEAP32[$agg$result>>2] = $23;
$61 = ((($agg$result)) + 4|0);
;HEAP32[$61>>2]=HEAP32[$font$sroa$7>>2]|0;HEAP32[$61+4>>2]=HEAP32[$font$sroa$7+4>>2]|0;HEAP32[$61+8>>2]=HEAP32[$font$sroa$7+8>>2]|0;HEAP32[$61+12>>2]=HEAP32[$font$sroa$7+12>>2]|0;
$62 = ((($agg$result)) + 20|0);
HEAP32[$62>>2] = $25;
$63 = ((($agg$result)) + 24|0);
HEAP32[$63>>2] = $26;
$64 = ((($agg$result)) + 28|0);
HEAP32[$64>>2] = $28;
$65 = ((($agg$result)) + 32|0);
HEAP32[$65>>2] = $31;
$66 = ((($agg$result)) + 36|0);
HEAP32[$66>>2] = $34;
$67 = ((($agg$result)) + 40|0);
HEAP32[$67>>2] = $37;
STACKTOP = sp;return;
}
function _ParseImageData($image,$charValues,$charRecs) {
$image = $image|0;
$charValues = $charValues|0;
$charRecs = $charRecs|0;
var $$byval_copy4 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $8 = 0, $9 = 0, $charWidth$0 = 0, $charWidth$0$lcssa = 0;
var $exitcond = 0, $i$06 = 0, $index$0$lcssa = 0, $index$012 = 0, $index$1$lcssa = 0, $index$17 = 0, $j$0 = 0, $j$0$lcssa = 0, $lineToRead$013 = 0, $tempCharRecs = 0, $tempCharValues = 0, $x$1$lcssa = 0, $x$116 = 0, $x$2 = 0, $xPosToRead$18 = 0, $y$0$lcssa = 0, $y$024 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 2592|0;
$$byval_copy4 = sp + 2560|0;
$tempCharValues = sp + 2048|0;
$tempCharRecs = sp;
;HEAP32[$$byval_copy4>>2]=HEAP32[$image>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$$byval_copy4+16>>2]=HEAP32[$image+16>>2]|0;
$0 = (_GetImageData($$byval_copy4)|0);
$1 = ((($image)) + 8|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(0);
L1: do {
if ($3) {
$4 = ((($image)) + 4|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)>(0);
$7 = HEAP32[$1>>2]|0;
$y$024 = 0;
while(1) {
L5: do {
if ($6) {
$8 = Math_imul($5, $y$024)|0;
$x$116 = 0;
while(1) {
$9 = (($8) + ($x$116))|0;
$10 = (($0) + ($9<<2)|0);
;HEAP8[$$byval_copy4>>0]=HEAP8[$10>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$10+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$10+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$10+3>>0]|0;
$11 = (_PixelIsMagenta($$byval_copy4)|0);
$12 = ($11|0)==(0);
if ($12) {
$x$1$lcssa = $x$116;
break L5;
}
$13 = (($x$116) + 1)|0;
$14 = ($13|0)<($5|0);
if ($14) {
$x$116 = $13;
} else {
$x$1$lcssa = $13;
break;
}
}
} else {
$x$1$lcssa = 0;
}
} while(0);
$15 = Math_imul($5, $y$024)|0;
$16 = (($15) + ($x$1$lcssa))|0;
$17 = (($0) + ($16<<2)|0);
;HEAP8[$$byval_copy4>>0]=HEAP8[$17>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$17+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$17+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$17+3>>0]|0;
$18 = (_PixelIsMagenta($$byval_copy4)|0);
$19 = ($18|0)==(0);
if ($19) {
$x$2 = $x$1$lcssa;$y$0$lcssa = $y$024;
break L1;
}
$20 = (($y$024) + 1)|0;
$21 = ($20|0)<($7|0);
if ($21) {
$y$024 = $20;
} else {
$x$2 = $x$1$lcssa;$y$0$lcssa = $20;
break;
}
}
} else {
$x$2 = 0;$y$0$lcssa = 0;
}
} while(0);
$22 = ((($image)) + 4|0);
$23 = HEAP32[$22>>2]|0;
$j$0 = 0;
while(1) {
$24 = (($j$0) + ($y$0$lcssa))|0;
$25 = Math_imul($24, $23)|0;
$26 = (($25) + ($x$2))|0;
$27 = (($0) + ($26<<2)|0);
;HEAP8[$$byval_copy4>>0]=HEAP8[$27>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$27+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$27+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$27+3>>0]|0;
$28 = (_PixelIsMagenta($$byval_copy4)|0);
$29 = ($28|0)==(0);
$30 = (($j$0) + 1)|0;
if ($29) {
$j$0 = $30;
} else {
$$lcssa = $24;$j$0$lcssa = $j$0;
break;
}
}
$31 = HEAP32[$1>>2]|0;
$32 = ($y$0$lcssa|0)<($31|0);
if ($32) {
$33 = HEAP32[$22>>2]|0;
$34 = ($x$2|0)<($33|0);
$35 = HEAP32[$1>>2]|0;
$37 = $y$0$lcssa;$index$012 = 0;$lineToRead$013 = 0;
while(1) {
L20: do {
if ($34) {
$36 = Math_imul($33, $37)|0;
$38 = Math_imul($33, $37)|0;
$index$17 = $index$012;$xPosToRead$18 = $x$2;
while(1) {
$39 = (($38) + ($xPosToRead$18))|0;
$40 = (($0) + ($39<<2)|0);
;HEAP8[$$byval_copy4>>0]=HEAP8[$40>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$40+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$40+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$40+3>>0]|0;
$41 = (_PixelIsMagenta($$byval_copy4)|0);
$42 = ($41|0)==(0);
if (!($42)) {
$index$1$lcssa = $index$17;
break L20;
}
$43 = (($index$17) + 32)|0;
$44 = (($tempCharValues) + ($index$17<<2)|0);
HEAP32[$44>>2] = $43;
$45 = (($tempCharRecs) + ($index$17<<4)|0);
HEAP32[$45>>2] = $xPosToRead$18;
$46 = (((($tempCharRecs) + ($index$17<<4)|0)) + 4|0);
HEAP32[$46>>2] = $37;
$47 = (((($tempCharRecs) + ($index$17<<4)|0)) + 12|0);
HEAP32[$47>>2] = $j$0$lcssa;
$charWidth$0 = 0;
while(1) {
$48 = (($charWidth$0) + ($xPosToRead$18))|0;
$49 = (($48) + ($36))|0;
$50 = (($0) + ($49<<2)|0);
;HEAP8[$$byval_copy4>>0]=HEAP8[$50>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$50+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$50+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$50+3>>0]|0;
$51 = (_PixelIsMagenta($$byval_copy4)|0);
$52 = ($51|0)==(0);
$53 = (($charWidth$0) + 1)|0;
if ($52) {
$charWidth$0 = $53;
} else {
$charWidth$0$lcssa = $charWidth$0;
break;
}
}
$54 = (((($tempCharRecs) + ($index$17<<4)|0)) + 8|0);
HEAP32[$54>>2] = $charWidth$0$lcssa;
$55 = (($index$17) + 1)|0;
$56 = (($xPosToRead$18) + ($x$2))|0;
$57 = (($56) + ($charWidth$0$lcssa))|0;
$58 = ($57|0)<($33|0);
if ($58) {
$index$17 = $55;$xPosToRead$18 = $57;
} else {
$index$1$lcssa = $55;
break;
}
}
} else {
$index$1$lcssa = $index$012;
}
} while(0);
$59 = (($lineToRead$013) + 1)|0;
$60 = Math_imul($59, $$lcssa)|0;
$61 = (($60) + ($y$0$lcssa))|0;
$62 = ($61|0)<($35|0);
if ($62) {
$37 = $61;$index$012 = $index$1$lcssa;$lineToRead$013 = $59;
} else {
$index$0$lcssa = $index$1$lcssa;
break;
}
}
} else {
$index$0$lcssa = 0;
}
_free($0);
$63 = $index$0$lcssa << 4;
$64 = (_malloc($63)|0);
HEAP32[$charRecs>>2] = $64;
$65 = $index$0$lcssa << 2;
$66 = (_malloc($65)|0);
HEAP32[$charValues>>2] = $66;
$67 = ($index$0$lcssa|0)>(0);
if ($67) {
$i$06 = 0;
} else {
STACKTOP = sp;return ($index$0$lcssa|0);
}
while(1) {
$68 = (($tempCharValues) + ($i$06<<2)|0);
$69 = HEAP32[$68>>2]|0;
$70 = HEAP32[$charValues>>2]|0;
$71 = (($70) + ($i$06<<2)|0);
HEAP32[$71>>2] = $69;
$72 = HEAP32[$charRecs>>2]|0;
$73 = (($72) + ($i$06<<4)|0);
$74 = (($tempCharRecs) + ($i$06<<4)|0);
;HEAP32[$73>>2]=HEAP32[$74>>2]|0;HEAP32[$73+4>>2]=HEAP32[$74+4>>2]|0;HEAP32[$73+8>>2]=HEAP32[$74+8>>2]|0;HEAP32[$73+12>>2]=HEAP32[$74+12>>2]|0;
$75 = (($i$06) + 1)|0;
$exitcond = ($75|0)==($index$0$lcssa|0);
if ($exitcond) {
break;
} else {
$i$06 = $75;
}
}
STACKTOP = sp;return ($index$0$lcssa|0);
}
function _stbi__fopen($filename) {
$filename = $filename|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_fopen($filename,20392)|0);
return ($0|0);
}
function _stbi__err($str) {
$str = $str|0;
var label = 0, sp = 0;
sp = STACKTOP;
HEAP32[5724>>2] = $str;
return;
}
function _stbi__start_file($s,$f) {
$s = $s|0;
$f = $f|0;
var label = 0, sp = 0;
sp = STACKTOP;
_stbi__start_callbacks($s,8636,$f);
return;
}
function _stbi__load_flip($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$04 = 0, $exitcond = 0, $exitcond7 = 0, $exitcond8 = 0, $or$cond = 0, $row$06 = 0, $z$03 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__load_main($s,$x,$y,$comp,$req_comp)|0);
$1 = HEAP32[5728>>2]|0;
$2 = ($1|0)!=(0);
$3 = ($0|0)!=(0|0);
$or$cond = $3 & $2;
if (!($or$cond)) {
return ($0|0);
}
$4 = HEAP32[$x>>2]|0;
$5 = HEAP32[$y>>2]|0;
$6 = ($req_comp|0)==(0);
if ($6) {
$7 = HEAP32[$comp>>2]|0;
$11 = $7;
} else {
$11 = $req_comp;
}
$8 = $5 >> 1;
$9 = ($8|0)>(0);
if (!($9)) {
return ($0|0);
}
$10 = ($4|0)>(0);
$12 = ($11|0)>(0);
$13 = (($5) + -1)|0;
$row$06 = 0;
while(1) {
if ($10) {
$14 = Math_imul($row$06, $4)|0;
$15 = (($13) - ($row$06))|0;
$16 = Math_imul($15, $4)|0;
$col$04 = 0;
while(1) {
if ($12) {
$17 = (($col$04) + ($14))|0;
$18 = Math_imul($17, $11)|0;
$19 = (($col$04) + ($16))|0;
$20 = Math_imul($19, $11)|0;
$z$03 = 0;
while(1) {
$21 = (($z$03) + ($18))|0;
$22 = (($0) + ($21)|0);
$23 = HEAP8[$22>>0]|0;
$24 = (($z$03) + ($20))|0;
$25 = (($0) + ($24)|0);
$26 = HEAP8[$25>>0]|0;
HEAP8[$22>>0] = $26;
HEAP8[$25>>0] = $23;
$27 = (($z$03) + 1)|0;
$exitcond = ($27|0)==($11|0);
if ($exitcond) {
break;
} else {
$z$03 = $27;
}
}
}
$28 = (($col$04) + 1)|0;
$exitcond7 = ($28|0)==($4|0);
if ($exitcond7) {
break;
} else {
$col$04 = $28;
}
}
}
$29 = (($row$06) + 1)|0;
$exitcond8 = ($29|0)==($8|0);
if ($exitcond8) {
break;
} else {
$row$06 = $29;
}
}
return ($0|0);
}
function _stbi__start_callbacks($s,$c,$user) {
$s = $s|0;
$c = $c|0;
$user = $user|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 16|0);
;HEAP32[$0>>2]=HEAP32[$c>>2]|0;HEAP32[$0+4>>2]=HEAP32[$c+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$c+8>>2]|0;
$1 = ((($s)) + 28|0);
HEAP32[$1>>2] = $user;
$2 = ((($s)) + 36|0);
HEAP32[$2>>2] = 128;
$3 = ((($s)) + 32|0);
HEAP32[$3>>2] = 1;
$4 = ((($s)) + 40|0);
$5 = ((($s)) + 176|0);
HEAP32[$5>>2] = $4;
_stbi__refill_buffer($s);
$6 = ((($s)) + 172|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($s)) + 180|0);
HEAP32[$8>>2] = $7;
return;
}
function _stbi__malloc($size) {
$size = $size|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_malloc($size)|0);
return ($0|0);
}
function _stbi__do_zlib($a,$obuf,$olen,$exp,$parse_header) {
$a = $a|0;
$obuf = $obuf|0;
$olen = $olen|0;
$exp = $exp|0;
$parse_header = $parse_header|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($a)) + 20|0);
HEAP32[$0>>2] = $obuf;
$1 = ((($a)) + 16|0);
HEAP32[$1>>2] = $obuf;
$2 = (($obuf) + ($olen)|0);
$3 = ((($a)) + 24|0);
HEAP32[$3>>2] = $2;
$4 = ((($a)) + 28|0);
HEAP32[$4>>2] = $exp;
$5 = (_stbi__parse_zlib($a,$parse_header)|0);
return ($5|0);
}
function _stbi__get16le($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = $0&255;
$2 = (_stbi__get8($s)|0);
$3 = $2&255;
$4 = $3 << 8;
$5 = $4 | $1;
return ($5|0);
}
function _LoadDDS($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $bufsize$0 = 0, $exitcond = 0, $exitcond13 = 0, $filecode = 0, $header = 0, $i$09 = 0, $i2$011 = 0, $i3$08 = 0, $image$sroa$0$0 = 0;
var $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$0$3 = 0, $image$sroa$26$0 = 0, $image$sroa$26$1 = 0, $image$sroa$41$0 = 0, $image$sroa$41$1 = 0, $image$sroa$56$0 = 0, $image$sroa$56$1 = 0, $image$sroa$56$2 = 0, $image$sroa$59$0 = 0, $image$sroa$59$1 = 0, $image$sroa$59$2 = 0, $image$sroa$59$3 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $switch = 0, $switch$split12D = 0, $switch$split2D = 0;
var $switch$split42D = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer12 = 0, $vararg_buffer16 = 0, $vararg_buffer20 = 0, $vararg_buffer24 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr19 = 0, $vararg_ptr23 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 192|0;
$vararg_buffer24 = sp + 56|0;
$vararg_buffer20 = sp + 48|0;
$vararg_buffer16 = sp + 40|0;
$vararg_buffer12 = sp + 32|0;
$vararg_buffer8 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$filecode = sp + 184|0;
$header = sp + 60|0;
$0 = (_fopen($fileName,20392)|0);
$1 = ($0|0)==(0|0);
if ($1) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,17449,$vararg_buffer);
$image$sroa$0$3 = 0;$image$sroa$26$1 = 0;$image$sroa$41$1 = 0;$image$sroa$56$2 = 0;$image$sroa$59$3 = 0;
HEAP32[$agg$result>>2] = $image$sroa$0$3;
$86 = ((($agg$result)) + 4|0);
HEAP32[$86>>2] = $image$sroa$26$1;
$87 = ((($agg$result)) + 8|0);
HEAP32[$87>>2] = $image$sroa$41$1;
$88 = ((($agg$result)) + 12|0);
HEAP32[$88>>2] = $image$sroa$56$2;
$89 = ((($agg$result)) + 16|0);
HEAP32[$89>>2] = $image$sroa$59$3;
STACKTOP = sp;return;
}
(_fread($filecode,1,4,$0)|0);
$2 = (_strncmp($filecode,17483,4)|0);
$3 = ($2|0)==(0);
if ($3) {
(_fread($header,124,1,$0)|0);
HEAP32[$vararg_buffer4>>2] = $fileName;
$vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
HEAP32[$vararg_ptr7>>2] = 124;
_TraceLog(3,17536,$vararg_buffer4);
$4 = ((($header)) + 72|0);
$5 = HEAP32[$4>>2]|0;
HEAP32[$vararg_buffer8>>2] = $fileName;
$vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
HEAP32[$vararg_ptr11>>2] = $5;
_TraceLog(3,17566,$vararg_buffer8);
$6 = ((($header)) + 76|0);
$7 = HEAP32[$6>>2]|0;
HEAP32[$vararg_buffer12>>2] = $fileName;
$vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
HEAP32[$vararg_ptr15>>2] = $7;
_TraceLog(3,17602,$vararg_buffer12);
$8 = ((($header)) + 80|0);
$9 = HEAP32[$8>>2]|0;
HEAP32[$vararg_buffer16>>2] = $fileName;
$vararg_ptr19 = ((($vararg_buffer16)) + 4|0);
HEAP32[$vararg_ptr19>>2] = $9;
_TraceLog(3,17641,$vararg_buffer16);
$10 = ((($header)) + 84|0);
$11 = HEAP32[$10>>2]|0;
HEAP32[$vararg_buffer20>>2] = $fileName;
$vararg_ptr23 = ((($vararg_buffer20)) + 4|0);
HEAP32[$vararg_ptr23>>2] = $11;
_TraceLog(3,17668,$vararg_buffer20);
$12 = ((($header)) + 12|0);
$13 = HEAP32[$12>>2]|0;
$14 = ((($header)) + 8|0);
$15 = HEAP32[$14>>2]|0;
$16 = HEAP32[$10>>2]|0;
$17 = ($16|0)==(16);
L7: do {
if ($17) {
$18 = HEAP32[$6>>2]|0;
switch ($18|0) {
case 64: {
$19 = $13 << 1;
$20 = Math_imul($19, $15)|0;
$21 = (_malloc($20)|0);
(_fread($21,$20,1,$0)|0);
$image$sroa$0$0 = $21;$image$sroa$59$0 = 3;
break L7;
break;
}
case 65: {
break;
}
default: {
$image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
break L7;
}
}
$22 = ((($header)) + 100|0);
$23 = HEAP32[$22>>2]|0;
$switch$split2D = ($23|0)<(61440);
if ($switch$split2D) {
switch ($23|0) {
case 32768: {
break;
}
default: {
$image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
break L7;
}
}
$24 = Math_imul($15, $13)|0;
$25 = $24 << 1;
$26 = (_malloc($25)|0);
(_fread($26,$25,1,$0)|0);
$27 = ($24|0)>(0);
if (!($27)) {
$image$sroa$0$0 = $26;$image$sroa$59$0 = 5;
break;
}
$28 = Math_imul($15, $13)|0;
$i$09 = 0;
while(1) {
$29 = (($26) + ($i$09<<1)|0);
$30 = HEAP16[$29>>1]|0;
$31 = $30&65535;
$32 = ($30&65535) >>> 15;
$33 = $32&65535;
$34 = $31 << 1;
$35 = $34 | $33;
$36 = $35&65535;
HEAP16[$29>>1] = $36;
$37 = (($i$09) + 1)|0;
$exitcond = ($37|0)==($28|0);
if ($exitcond) {
$image$sroa$0$0 = $26;$image$sroa$59$0 = 5;
break;
} else {
$i$09 = $37;
}
}
} else {
switch ($23|0) {
case 61440: {
break;
}
default: {
$image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
break L7;
}
}
$38 = Math_imul($15, $13)|0;
$39 = $38 << 1;
$40 = (_malloc($39)|0);
(_fread($40,$39,1,$0)|0);
$41 = ($38|0)>(0);
if (!($41)) {
$image$sroa$0$0 = $40;$image$sroa$59$0 = 6;
break;
}
$42 = Math_imul($15, $13)|0;
$i2$011 = 0;
while(1) {
$43 = (($40) + ($i2$011<<1)|0);
$44 = HEAP16[$43>>1]|0;
$45 = $44&65535;
$46 = ($44&65535) >>> 12;
$47 = $46&65535;
$48 = $45 << 4;
$49 = $48 | $47;
$50 = $49&65535;
HEAP16[$43>>1] = $50;
$51 = (($i2$011) + 1)|0;
$exitcond13 = ($51|0)==($42|0);
if ($exitcond13) {
$image$sroa$0$0 = $40;$image$sroa$59$0 = 6;
break;
} else {
$i2$011 = $51;
}
}
}
} else {
$image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
}
} while(0);
$52 = HEAP32[$6>>2]|0;
$53 = ($52|0)==(64);
$54 = HEAP32[$10>>2]|0;
$55 = ($54|0)==(24);
$or$cond = $53 & $55;
L24: do {
if ($or$cond) {
$56 = ($13*3)|0;
$57 = Math_imul($56, $15)|0;
$58 = (_malloc($57)|0);
(_fread($58,$57,1,$0)|0);
$image$sroa$0$1 = $58;$image$sroa$56$0 = 1;$image$sroa$59$1 = 4;
} else {
$59 = ($52|0)==(65);
$60 = ($54|0)==(32);
$or$cond3 = $59 & $60;
if ($or$cond3) {
$61 = $13 << 2;
$62 = Math_imul($61, $15)|0;
$63 = (_malloc($62)|0);
(_fread($63,$62,1,$0)|0);
$64 = ($62|0)>(0);
if ($64) {
$i3$08 = 0;
} else {
$image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7;
break;
}
while(1) {
$65 = (($63) + ($i3$08)|0);
$66 = HEAP8[$65>>0]|0;
$67 = $i3$08 | 2;
$68 = (($63) + ($67)|0);
$69 = HEAP8[$68>>0]|0;
HEAP8[$65>>0] = $69;
HEAP8[$68>>0] = $66;
$70 = (($i3$08) + 4)|0;
$71 = ($70|0)<($62|0);
if ($71) {
$i3$08 = $70;
} else {
$image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7;
break L24;
}
}
}
$72 = $52 & -2;
$switch = ($72|0)!=(4);
$73 = HEAP32[$8>>2]|0;
$74 = ($73|0)==(0);
$or$cond5 = $switch | $74;
if ($or$cond5) {
$image$sroa$0$1 = $image$sroa$0$0;$image$sroa$56$0 = 1;$image$sroa$59$1 = $image$sroa$59$0;
} else {
$75 = ((($header)) + 24|0);
$76 = HEAP32[$75>>2]|0;
$77 = ($76>>>0)>(1);
$78 = ((($header)) + 16|0);
$79 = HEAP32[$78>>2]|0;
$80 = $77&1;
$bufsize$0 = $79 << $80;
HEAP32[$vararg_buffer24>>2] = $79;
_TraceLog(3,17698,$vararg_buffer24);
$81 = (_malloc($bufsize$0)|0);
(_fread($81,1,$bufsize$0,$0)|0);
$82 = HEAP32[$75>>2]|0;
$83 = HEAP32[$8>>2]|0;
$switch$split12D = ($83|0)<(861165636);
if ($switch$split12D) {
switch ($83|0) {
case 827611204: {
break;
}
default: {
$image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0;
break L24;
}
}
$84 = HEAP32[$6>>2]|0;
$85 = ($84|0)==(4);
$$ = $85 ? 8 : 9;
$image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $$;
break;
}
$switch$split42D = ($83|0)<(894720068);
if ($switch$split42D) {
switch ($83|0) {
case 861165636: {
break;
}
default: {
$image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0;
break L24;
}
}
$image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 10;
break;
} else {
switch ($83|0) {
case 894720068: {
break;
}
default: {
$image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0;
break L24;
}
}
$image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 11;
break;
}
}
}
} while(0);
$image$sroa$0$2 = $image$sroa$0$1;$image$sroa$26$0 = $13;$image$sroa$41$0 = $15;$image$sroa$56$1 = $image$sroa$56$0;$image$sroa$59$2 = $image$sroa$59$1;
} else {
HEAP32[$vararg_buffer1>>2] = $fileName;
_TraceLog(2,17488,$vararg_buffer1);
$image$sroa$0$2 = 0;$image$sroa$26$0 = 0;$image$sroa$41$0 = 0;$image$sroa$56$1 = 0;$image$sroa$59$2 = 0;
}
(_fclose($0)|0);
$image$sroa$0$3 = $image$sroa$0$2;$image$sroa$26$1 = $image$sroa$26$0;$image$sroa$41$1 = $image$sroa$41$0;$image$sroa$56$2 = $image$sroa$56$1;$image$sroa$59$3 = $image$sroa$59$2;
HEAP32[$agg$result>>2] = $image$sroa$0$3;
$86 = ((($agg$result)) + 4|0);
HEAP32[$86>>2] = $image$sroa$26$1;
$87 = ((($agg$result)) + 8|0);
HEAP32[$87>>2] = $image$sroa$41$1;
$88 = ((($agg$result)) + 12|0);
HEAP32[$88>>2] = $image$sroa$56$2;
$89 = ((($agg$result)) + 16|0);
HEAP32[$89>>2] = $image$sroa$59$3;
STACKTOP = sp;return;
}
function _LoadPKM($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$ = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0;
var $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$vararg_buffer10 = sp + 32|0;
$vararg_buffer7 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$header = sp + 40|0;
$0 = (_fopen($fileName,20392)|0);
$1 = ($0|0)==(0|0);
if ($1) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,17282,$vararg_buffer);
$image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$1 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0;
HEAP32[$agg$result>>2] = $image$sroa$0$1;
$43 = ((($agg$result)) + 4|0);
HEAP32[$43>>2] = $image$sroa$4$1;
$44 = ((($agg$result)) + 8|0);
HEAP32[$44>>2] = $image$sroa$7$1;
$45 = ((($agg$result)) + 12|0);
HEAP32[$45>>2] = $image$sroa$10$1;
$46 = ((($agg$result)) + 16|0);
HEAP32[$46>>2] = $image$sroa$12$1;
STACKTOP = sp;return;
}
(_fread($header,16,1,$0)|0);
$2 = (_strncmp($header,17316,4)|0);
$3 = ($2|0)==(0);
L5: do {
if ($3) {
$4 = ((($header)) + 6|0);
$5 = HEAP16[$4>>1]|0;
$6 = $5&65535;
$7 = $6 << 8;
$8 = $6 >>> 8;
$9 = $7 | $8;
$10 = $9&65535;
HEAP16[$4>>1] = $10;
$11 = ((($header)) + 8|0);
$12 = HEAP16[$11>>1]|0;
$13 = $12&65535;
$14 = $13 << 8;
$15 = $13 >>> 8;
$16 = $14 | $15;
$17 = $16&65535;
HEAP16[$11>>1] = $17;
$18 = ((($header)) + 10|0);
$19 = HEAP16[$18>>1]|0;
$20 = $19&65535;
$21 = $20 << 8;
$22 = $20 >>> 8;
$23 = $21 | $22;
$24 = $23&65535;
HEAP16[$18>>1] = $24;
$25 = HEAP16[$11>>1]|0;
$26 = $25&65535;
HEAP32[$vararg_buffer4>>2] = $26;
_TraceLog(3,17369,$vararg_buffer4);
$27 = HEAP16[$18>>1]|0;
$28 = $27&65535;
HEAP32[$vararg_buffer7>>2] = $28;
_TraceLog(3,17395,$vararg_buffer7);
$29 = HEAP16[$4>>1]|0;
$30 = $29&65535;
HEAP32[$vararg_buffer10>>2] = $30;
_TraceLog(3,17422,$vararg_buffer10);
$31 = HEAP16[$11>>1]|0;
$32 = $31&65535;
$33 = HEAP16[$18>>1]|0;
$34 = $33&65535;
$35 = HEAP16[$4>>1]|0;
$36 = ($35<<16>>16)==(3);
$$ = $36 ? 8 : 4;
$37 = Math_imul($34, $32)|0;
$38 = Math_imul($37, $$)|0;
$39 = $38 >>> 3;
$40 = (_malloc($39)|0);
(_fread($40,1,$39,$0)|0);
$41 = HEAP16[$4>>1]|0;
switch ($41<<16>>16) {
case 0: {
$image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 12;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34;
break L5;
break;
}
case 1: {
$image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 13;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34;
break L5;
break;
}
default: {
$42 = ($41<<16>>16)==(3);
$$1 = $42 ? 14 : 0;
$image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = $$1;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34;
break L5;
}
}
} else {
HEAP32[$vararg_buffer1>>2] = $fileName;
_TraceLog(2,17321,$vararg_buffer1);
$image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$0 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0;
}
} while(0);
(_fclose($0)|0);
$image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0;
HEAP32[$agg$result>>2] = $image$sroa$0$1;
$43 = ((($agg$result)) + 4|0);
HEAP32[$43>>2] = $image$sroa$4$1;
$44 = ((($agg$result)) + 8|0);
HEAP32[$44>>2] = $image$sroa$7$1;
$45 = ((($agg$result)) + 12|0);
HEAP32[$45>>2] = $image$sroa$10$1;
$46 = ((($agg$result)) + 16|0);
HEAP32[$46>>2] = $image$sroa$12$1;
STACKTOP = sp;return;
}
function _LoadKTX($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dataSize = 0, $header = 0, $i$01 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$3$0 = 0, $image$sroa$3$1 = 0, $image$sroa$5$0 = 0, $image$sroa$5$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$9$0 = 0, $image$sroa$9$1 = 0, $unused = 0, $vararg_buffer = 0;
var $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$vararg_buffer10 = sp + 32|0;
$vararg_buffer7 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$header = sp + 40|0;
$unused = sp + 104|0;
$dataSize = sp + 36|0;
$0 = (_fopen($fileName,20392)|0);
$1 = ($0|0)==(0|0);
if ($1) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,17113,$vararg_buffer);
$image$sroa$0$1 = 0;$image$sroa$3$1 = 0;$image$sroa$5$1 = 0;$image$sroa$7$1 = 0;$image$sroa$9$1 = 0;
HEAP32[$agg$result>>2] = $image$sroa$0$1;
$40 = ((($agg$result)) + 4|0);
HEAP32[$40>>2] = $image$sroa$3$1;
$41 = ((($agg$result)) + 8|0);
HEAP32[$41>>2] = $image$sroa$5$1;
$42 = ((($agg$result)) + 12|0);
HEAP32[$42>>2] = $image$sroa$7$1;
$43 = ((($agg$result)) + 16|0);
HEAP32[$43>>2] = $image$sroa$9$1;
STACKTOP = sp;return;
}
(_fread($header,64,1,$0)|0);
$2 = ((($header)) + 1|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($3<<24>>24)==(75);
L5: do {
if ($4) {
$5 = ((($header)) + 2|0);
$6 = HEAP8[$5>>0]|0;
$7 = ($6<<24>>24)==(84);
if ($7) {
$8 = ((($header)) + 3|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(88);
if ($10) {
$11 = ((($header)) + 4|0);
$12 = HEAP8[$11>>0]|0;
$13 = ($12<<24>>24)==(32);
if ($13) {
$14 = ((($header)) + 5|0);
$15 = HEAP8[$14>>0]|0;
$16 = ($15<<24>>24)==(49);
if ($16) {
$17 = ((($header)) + 6|0);
$18 = HEAP8[$17>>0]|0;
$19 = ($18<<24>>24)==(49);
if ($19) {
$20 = ((($header)) + 36|0);
$21 = HEAP32[$20>>2]|0;
$22 = ((($header)) + 40|0);
$23 = HEAP32[$22>>2]|0;
$24 = ((($header)) + 56|0);
$25 = HEAP32[$24>>2]|0;
HEAP32[$vararg_buffer4>>2] = $21;
_TraceLog(3,17200,$vararg_buffer4);
$26 = HEAP32[$22>>2]|0;
HEAP32[$vararg_buffer7>>2] = $26;
_TraceLog(3,17226,$vararg_buffer7);
$27 = ((($header)) + 28|0);
$28 = HEAP32[$27>>2]|0;
HEAP32[$vararg_buffer10>>2] = $28;
_TraceLog(3,17253,$vararg_buffer10);
$29 = ((($header)) + 60|0);
$30 = HEAP32[$29>>2]|0;
$31 = ($30|0)==(0);
if (!($31)) {
$32 = HEAP32[$29>>2]|0;
$i$01 = 0;
while(1) {
(_fread($unused,1,1,$0)|0);
$33 = (($i$01) + 1)|0;
$34 = ($33>>>0)<($32>>>0);
if ($34) {
$i$01 = $33;
} else {
break;
}
}
}
(_fread($dataSize,4,1,$0)|0);
$35 = HEAP32[$dataSize>>2]|0;
$36 = (_malloc($35)|0);
$37 = HEAP32[$dataSize>>2]|0;
(_fread($36,1,$37,$0)|0);
$38 = HEAP32[$27>>2]|0;
switch ($38|0) {
case 36196: {
$image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 12;
break L5;
break;
}
case 37492: {
$image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 13;
break L5;
break;
}
default: {
$39 = ($38|0)==(37496);
$$ = $39 ? 14 : 0;
$image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = $$;
break L5;
}
}
} else {
label = 9;
}
} else {
label = 9;
}
} else {
label = 9;
}
} else {
label = 9;
}
} else {
label = 9;
}
} else {
label = 9;
}
} while(0);
if ((label|0) == 9) {
HEAP32[$vararg_buffer1>>2] = $fileName;
_TraceLog(2,17153,$vararg_buffer1);
$image$sroa$0$0 = 0;$image$sroa$3$0 = 0;$image$sroa$5$0 = 0;$image$sroa$7$0 = 0;$image$sroa$9$0 = 0;
}
(_fclose($0)|0);
$image$sroa$0$1 = $image$sroa$0$0;$image$sroa$3$1 = $image$sroa$3$0;$image$sroa$5$1 = $image$sroa$5$0;$image$sroa$7$1 = $image$sroa$7$0;$image$sroa$9$1 = $image$sroa$9$0;
HEAP32[$agg$result>>2] = $image$sroa$0$1;
$40 = ((($agg$result)) + 4|0);
HEAP32[$40>>2] = $image$sroa$3$1;
$41 = ((($agg$result)) + 8|0);
HEAP32[$41>>2] = $image$sroa$5$1;
$42 = ((($agg$result)) + 12|0);
HEAP32[$42>>2] = $image$sroa$7$1;
$43 = ((($agg$result)) + 16|0);
HEAP32[$43>>2] = $image$sroa$9$1;
STACKTOP = sp;return;
}
function _LoadPVR($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$ = 0, $$1 = 0, $$2 = 0, $$pr = 0, $$pr3 = 0, $$pr5 = 0, $$pr7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $bpp$0 = 0, $header = 0, $i$08 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$10$2 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$12$2 = 0, $image$sroa$12$3 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$4$2 = 0;
var $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$7$2 = 0, $pvrVersion = 0, $unused = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 80|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$pvrVersion = sp + 73|0;
$header = sp + 20|0;
$unused = sp + 72|0;
$0 = (_fopen($fileName,20392)|0);
$1 = ($0|0)==(0|0);
if ($1) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,16981,$vararg_buffer);
$image$sroa$0$2 = 0;$image$sroa$10$2 = 0;$image$sroa$12$3 = 0;$image$sroa$4$2 = 0;$image$sroa$7$2 = 0;
HEAP32[$agg$result>>2] = $image$sroa$0$2;
$113 = ((($agg$result)) + 4|0);
HEAP32[$113>>2] = $image$sroa$4$2;
$114 = ((($agg$result)) + 8|0);
HEAP32[$114>>2] = $image$sroa$7$2;
$115 = ((($agg$result)) + 12|0);
HEAP32[$115>>2] = $image$sroa$10$2;
$116 = ((($agg$result)) + 16|0);
HEAP32[$116>>2] = $image$sroa$12$3;
STACKTOP = sp;return;
}
HEAP8[$pvrVersion>>0] = 0;
(_fread($pvrVersion,1,1,$0)|0);
(_fseek($0,0,0)|0);
$2 = HEAP8[$pvrVersion>>0]|0;
switch ($2<<24>>24) {
case 80: {
(_fread($header,52,1,$0)|0);
$3 = HEAP8[$header>>0]|0;
$4 = ($3<<24>>24)==(80);
if ($4) {
$5 = ((($header)) + 1|0);
$6 = HEAP8[$5>>0]|0;
$7 = ($6<<24>>24)==(86);
if ($7) {
$8 = ((($header)) + 2|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(82);
if ($10) {
$11 = ((($header)) + 3|0);
$12 = HEAP8[$11>>0]|0;
$13 = ($12<<24>>24)==(3);
if ($13) {
$14 = ((($header)) + 28|0);
$15 = HEAP32[$14>>2]|0;
$16 = ((($header)) + 24|0);
$17 = HEAP32[$16>>2]|0;
$18 = ((($header)) + 44|0);
$19 = HEAP32[$18>>2]|0;
$20 = ((($header)) + 8|0);
$21 = HEAP8[$20>>0]|0;
$22 = ($21<<24>>24)==(108);
do {
if ($22) {
$23 = ((($header)) + 9|0);
$24 = HEAP8[$23>>0]|0;
$25 = ($24<<24>>24)==(0);
if ($25) {
$26 = ((($header)) + 12|0);
$27 = HEAP8[$26>>0]|0;
$28 = ($27<<24>>24)==(8);
if ($28) {
$image$sroa$12$0 = 1;
break;
}
}
$$pr = HEAP8[$20>>0]|0;
$29 = ($$pr<<24>>24)==(108);
if ($29) {
$30 = ((($header)) + 9|0);
$31 = HEAP8[$30>>0]|0;
$32 = ($31<<24>>24)==(97);
if ($32) {
$33 = ((($header)) + 12|0);
$34 = HEAP8[$33>>0]|0;
$35 = ($34<<24>>24)==(8);
if ($35) {
$36 = ((($header)) + 13|0);
$37 = HEAP8[$36>>0]|0;
$38 = ($37<<24>>24)==(8);
if ($38) {
$image$sroa$12$0 = 2;
} else {
label = 16;
}
} else {
label = 16;
}
} else {
label = 16;
}
} else {
$39 = $$pr;
label = 17;
}
} else {
label = 16;
}
} while(0);
if ((label|0) == 16) {
$$pr3 = HEAP8[$20>>0]|0;
$39 = $$pr3;
label = 17;
}
L22: do {
if ((label|0) == 17) {
$40 = ($39<<24>>24)==(114);
if ($40) {
$41 = ((($header)) + 9|0);
$42 = HEAP8[$41>>0]|0;
$43 = ($42<<24>>24)==(103);
if ($43) {
$44 = ((($header)) + 10|0);
$45 = HEAP8[$44>>0]|0;
$46 = ($45<<24>>24)==(98);
if ($46) {
$47 = ((($header)) + 11|0);
$48 = HEAP8[$47>>0]|0;
switch ($48<<24>>24) {
case 97: {
break;
}
case 0: {
$83 = ((($header)) + 12|0);
$84 = HEAP8[$83>>0]|0;
$85 = ($84<<24>>24)==(5);
if ($85) {
$86 = ((($header)) + 13|0);
$87 = HEAP8[$86>>0]|0;
$88 = ($87<<24>>24)==(6);
if ($88) {
$89 = ((($header)) + 14|0);
$90 = HEAP8[$89>>0]|0;
$91 = ($90<<24>>24)==(5);
if ($91) {
$image$sroa$12$0 = 3;
break L22;
}
}
$$pr7 = HEAP8[$83>>0]|0;
$92 = $$pr7;
} else {
$92 = $84;
}
$93 = ($92<<24>>24)==(8);
if (!($93)) {
$image$sroa$12$0 = 0;
break L22;
}
$94 = ((($header)) + 13|0);
$95 = HEAP8[$94>>0]|0;
$96 = ($95<<24>>24)==(8);
if (!($96)) {
$image$sroa$12$0 = 0;
break L22;
}
$97 = ((($header)) + 14|0);
$98 = HEAP8[$97>>0]|0;
$99 = ($98<<24>>24)==(8);
$$1 = $99 ? 4 : 0;
$image$sroa$12$0 = $$1;
break L22;
break;
}
default: {
$image$sroa$12$0 = 0;
break L22;
}
}
$49 = ((($header)) + 12|0);
$50 = HEAP8[$49>>0]|0;
$51 = ($50<<24>>24)==(5);
if ($51) {
$52 = ((($header)) + 13|0);
$53 = HEAP8[$52>>0]|0;
$54 = ($53<<24>>24)==(5);
if ($54) {
$55 = ((($header)) + 14|0);
$56 = HEAP8[$55>>0]|0;
$57 = ($56<<24>>24)==(5);
if ($57) {
$58 = ((($header)) + 15|0);
$59 = HEAP8[$58>>0]|0;
$60 = ($59<<24>>24)==(1);
if ($60) {
$image$sroa$12$0 = 5;
break;
}
}
}
$$pr5 = HEAP8[$49>>0]|0;
$61 = $$pr5;
} else {
$61 = $50;
}
$62 = ($61<<24>>24)==(4);
if ($62) {
$63 = ((($header)) + 13|0);
$64 = HEAP8[$63>>0]|0;
$65 = ($64<<24>>24)==(4);
if ($65) {
$66 = ((($header)) + 14|0);
$67 = HEAP8[$66>>0]|0;
$68 = ($67<<24>>24)==(4);
if ($68) {
$69 = ((($header)) + 15|0);
$70 = HEAP8[$69>>0]|0;
$71 = ($70<<24>>24)==(4);
if ($71) {
$image$sroa$12$0 = 6;
break;
}
}
}
}
$72 = HEAP8[$49>>0]|0;
$73 = ($72<<24>>24)==(8);
if (!($73)) {
$image$sroa$12$0 = 0;
break;
}
$74 = ((($header)) + 13|0);
$75 = HEAP8[$74>>0]|0;
$76 = ($75<<24>>24)==(8);
if (!($76)) {
$image$sroa$12$0 = 0;
break;
}
$77 = ((($header)) + 14|0);
$78 = HEAP8[$77>>0]|0;
$79 = ($78<<24>>24)==(8);
if (!($79)) {
$image$sroa$12$0 = 0;
break;
}
$80 = ((($header)) + 15|0);
$81 = HEAP8[$80>>0]|0;
$82 = ($81<<24>>24)==(8);
$$ = $82 ? 7 : 0;
$image$sroa$12$0 = $$;
break;
}
}
}
$100 = HEAP8[$20>>0]|0;
$101 = ($100<<24>>24)==(2);
if ($101) {
$image$sroa$12$0 = 15;
} else {
$102 = ($100<<24>>24)==(3);
$$2 = $102 ? 16 : 0;
$image$sroa$12$0 = $$2;
}
}
} while(0);
HEAP8[$unused>>0] = 0;
$103 = ((($header)) + 48|0);
$104 = HEAP32[$103>>2]|0;
$105 = ($104|0)==(0);
if (!($105)) {
$i$08 = 0;
while(1) {
(_fread($unused,1,1,$0)|0);
$106 = (($i$08) + 1)|0;
$107 = HEAP32[$103>>2]|0;
$108 = ($106>>>0)<($107>>>0);
if ($108) {
$i$08 = $106;
} else {
break;
}
}
}
switch ($image$sroa$12$0|0) {
case 1: {
$bpp$0 = 8;
break;
}
case 6: case 3: case 5: case 2: {
$bpp$0 = 16;
break;
}
case 7: {
$bpp$0 = 32;
break;
}
case 4: {
$bpp$0 = 24;
break;
}
case 16: case 15: {
$bpp$0 = 4;
break;
}
default: {
$bpp$0 = 0;
}
}
$109 = Math_imul($17, $15)|0;
$110 = Math_imul($109, $bpp$0)|0;
$111 = (($110|0) / 8)&-1;
$112 = (_malloc($111)|0);
(_fread($112,$111,1,$0)|0);
$image$sroa$0$0 = $112;$image$sroa$10$0 = $19;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$0 = $15;$image$sroa$7$0 = $17;
} else {
label = 8;
}
} else {
label = 8;
}
} else {
label = 8;
}
} else {
label = 8;
}
if ((label|0) == 8) {
HEAP32[$vararg_buffer1>>2] = $fileName;
_TraceLog(2,17015,$vararg_buffer1);
$image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$1 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0;
}
$image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$2 = $image$sroa$12$1;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0;
break;
}
case 52: {
_TraceLog(0,17063,$vararg_buffer4);
$image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0;
break;
}
default: {
$image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0;
}
}
(_fclose($0)|0);
$image$sroa$0$2 = $image$sroa$0$1;$image$sroa$10$2 = $image$sroa$10$1;$image$sroa$12$3 = $image$sroa$12$2;$image$sroa$4$2 = $image$sroa$4$1;$image$sroa$7$2 = $image$sroa$7$1;
HEAP32[$agg$result>>2] = $image$sroa$0$2;
$113 = ((($agg$result)) + 4|0);
HEAP32[$113>>2] = $image$sroa$4$2;
$114 = ((($agg$result)) + 8|0);
HEAP32[$114>>2] = $image$sroa$7$2;
$115 = ((($agg$result)) + 12|0);
HEAP32[$115>>2] = $image$sroa$10$2;
$116 = ((($agg$result)) + 16|0);
HEAP32[$116>>2] = $image$sroa$12$3;
STACKTOP = sp;return;
}
function _LoadASTC($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$14$0 = 0, $image$sroa$14$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$8$0 = 0, $image$sroa$8$1 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer4 = 0;
var $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$vararg_buffer14 = sp + 40|0;
$vararg_buffer10 = sp + 32|0;
$vararg_buffer7 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer1 = sp + 8|0;
$vararg_buffer = sp;
$header = sp + 48|0;
$0 = (_fopen($fileName,20392)|0);
$1 = ($0|0)==(0|0);
if ($1) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,16780,$vararg_buffer);
$image$sroa$0$1 = 0;$image$sroa$12$1 = 0;$image$sroa$14$1 = 0;$image$sroa$4$1 = 0;$image$sroa$8$1 = 0;
HEAP32[$agg$result>>2] = $image$sroa$0$1;
$58 = ((($agg$result)) + 4|0);
HEAP32[$58>>2] = $image$sroa$4$1;
$59 = ((($agg$result)) + 8|0);
HEAP32[$59>>2] = $image$sroa$8$1;
$60 = ((($agg$result)) + 12|0);
HEAP32[$60>>2] = $image$sroa$12$1;
$61 = ((($agg$result)) + 16|0);
HEAP32[$61>>2] = $image$sroa$14$1;
STACKTOP = sp;return;
}
(_fread($header,16,1,$0)|0);
$2 = ((($header)) + 3|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($3<<24>>24)==(92);
L5: do {
if ($4) {
$5 = ((($header)) + 2|0);
$6 = HEAP8[$5>>0]|0;
$7 = ($6<<24>>24)==(-95);
if ($7) {
$8 = ((($header)) + 1|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(-85);
$11 = HEAP8[$header>>0]|0;
$12 = ($11<<24>>24)==(19);
$or$cond = $10 & $12;
if ($or$cond) {
$13 = ((($header)) + 9|0);
$14 = HEAP8[$13>>0]|0;
$15 = $14&255;
$16 = $15 << 16;
$17 = ((($header)) + 8|0);
$18 = HEAP8[$17>>0]|0;
$19 = $18&255;
$20 = $19 << 8;
$21 = $20 | $16;
$22 = ((($header)) + 7|0);
$23 = HEAP8[$22>>0]|0;
$24 = $23&255;
$25 = $21 | $24;
$26 = ((($header)) + 12|0);
$27 = HEAP8[$26>>0]|0;
$28 = $27&255;
$29 = $28 << 16;
$30 = ((($header)) + 11|0);
$31 = HEAP8[$30>>0]|0;
$32 = $31&255;
$33 = $32 << 8;
$34 = $33 | $29;
$35 = ((($header)) + 10|0);
$36 = HEAP8[$35>>0]|0;
$37 = $36&255;
$38 = $34 | $37;
HEAP32[$vararg_buffer4>>2] = $25;
_TraceLog(3,16864,$vararg_buffer4);
HEAP32[$vararg_buffer7>>2] = $38;
_TraceLog(3,16885,$vararg_buffer7);
$39 = ((($header)) + 4|0);
$40 = HEAP8[$39>>0]|0;
$41 = $40&255;
$42 = ((($header)) + 5|0);
$43 = HEAP8[$42>>0]|0;
$44 = $43&255;
HEAP32[$vararg_buffer10>>2] = $41;
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
HEAP32[$vararg_ptr13>>2] = $44;
_TraceLog(3,16907,$vararg_buffer10);
$45 = HEAP8[$39>>0]|0;
$46 = $45&255;
$47 = HEAP8[$42>>0]|0;
$48 = $47&255;
$49 = Math_imul($48, $46)|0;
$50 = (128 / ($49>>>0))&-1;
$51 = ($50|0)==(8);
$52 = ($50|0)==(2);
switch ($50|0) {
case 2: case 8: {
$53 = Math_imul($38, $25)|0;
$54 = Math_imul($53, $50)|0;
$55 = $54 >>> 3;
$56 = (_malloc($55)|0);
(_fread($56,$55,1,$0)|0);
$57 = $51 | $52;
$$$ = $57 ? 17 : 0;
$image$sroa$0$0 = $56;$image$sroa$12$0 = 1;$image$sroa$14$0 = $$$;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38;
break L5;
break;
}
default: {
HEAP32[$vararg_buffer14>>2] = $fileName;
_TraceLog(2,16932,$vararg_buffer14);
$image$sroa$0$0 = 0;$image$sroa$12$0 = 1;$image$sroa$14$0 = 0;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38;
break L5;
}
}
} else {
label = 6;
}
} else {
label = 6;
}
} else {
label = 6;
}
} while(0);
if ((label|0) == 6) {
HEAP32[$vararg_buffer1>>2] = $fileName;
_TraceLog(2,16815,$vararg_buffer1);
$image$sroa$0$0 = 0;$image$sroa$12$0 = 0;$image$sroa$14$0 = 0;$image$sroa$4$0 = 0;$image$sroa$8$0 = 0;
}
(_fclose($0)|0);
$image$sroa$0$1 = $image$sroa$0$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$14$1 = $image$sroa$14$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$8$1 = $image$sroa$8$0;
HEAP32[$agg$result>>2] = $image$sroa$0$1;
$58 = ((($agg$result)) + 4|0);
HEAP32[$58>>2] = $image$sroa$4$1;
$59 = ((($agg$result)) + 8|0);
HEAP32[$59>>2] = $image$sroa$8$1;
$60 = ((($agg$result)) + 12|0);
HEAP32[$60>>2] = $image$sroa$12$1;
$61 = ((($agg$result)) + 16|0);
HEAP32[$61>>2] = $image$sroa$14$1;
STACKTOP = sp;return;
}
function _LoadOBJ($agg$result,$fileName) {
$agg$result = $agg$result|0;
$fileName = $fileName|0;
var $$byval_copy89 = 0, $$byval_copy90 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0;
var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0;
var $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0;
var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0;
var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0;
var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0.0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0;
var $258 = 0, $259 = 0, $26 = 0, $260 = 0.0, $261 = 0.0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0.0, $274 = 0.0, $275 = 0;
var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0;
var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0;
var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $comments = 0, $countNormals$0$ph44 = 0, $countNormals$0$ph841 = 0, $countNormals$0$ph841$lcssa = 0, $countTexCoords$0$ph1140 = 0, $countTexCoords$0$ph1140$lcssa = 0, $countTexCoords$0$ph1140$lcssa221 = 0;
var $countTexCoords$0$ph45 = 0, $countTexCoords$0$ph942 = 0, $countVertex$0$ph43 = 0, $dataType = 0, $mesh$sroa$51 = 0, $midNormals$0 = 0, $midTexCoords$0 = 0, $nCounter$0$ph = 0, $nCounter$0$ph$ph = 0, $nCounter$1 = 0, $nCounter$1$lcssa = 0, $norm = 0, $numNormals$0$ph16$lcssa32 = 0, $numNormals$0$ph1674 = 0, $numNormals$0$ph1674$lcssa237 = 0, $numNormals$0$ph86 = 0, $numTexCoords$0$ph1775 = 0, $numTexCoords$0$ph20$lcssa31 = 0, $numTexCoords$0$ph2064 = 0, $numTexCoords$0$ph2064$lcssa232 = 0;
var $numTexCoords$0$ph2064$lcssa233 = 0, $numTexCoords$0$ph87 = 0, $numTriangles$0$ph1876 = 0, $numTriangles$0$ph2165 = 0, $numTriangles$0$ph23$lcssa28 = 0, $numTriangles$0$ph2355 = 0, $numTriangles$0$ph2355$lcssa = 0, $numTriangles$0$ph2355$lcssa$lcssa = 0, $numTriangles$0$ph2355$lcssa$lcssa229 = 0, $numTriangles$0$ph88 = 0, $numVertex$0$ph$lcssa = 0, $numVertex$0$ph85 = 0, $or$cond = 0, $tcCounter$0$ph$ph = 0, $useless = 0, $vCounter$0$ph = 0, $vCounter$0$ph$ph = 0, $vNum = 0, $vararg_buffer = 0, $vararg_buffer1 = 0;
var $vararg_buffer11 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer29 = 0, $vararg_buffer34 = 0, $vararg_buffer37 = 0, $vararg_buffer4 = 0, $vararg_buffer42 = 0, $vararg_buffer45 = 0, $vararg_buffer50 = 0, $vararg_buffer53 = 0, $vararg_buffer56 = 0, $vararg_buffer59 = 0, $vararg_buffer64 = 0, $vararg_buffer7 = 0, $vararg_buffer72 = 0, $vararg_buffer83 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0, $vararg_ptr18 = 0;
var $vararg_ptr22 = 0, $vararg_ptr32 = 0, $vararg_ptr33 = 0, $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr48 = 0, $vararg_ptr49 = 0, $vararg_ptr62 = 0, $vararg_ptr63 = 0, $vararg_ptr67 = 0, $vararg_ptr68 = 0, $vararg_ptr69 = 0, $vararg_ptr70 = 0, $vararg_ptr71 = 0, $vararg_ptr75 = 0, $vararg_ptr76 = 0, $vararg_ptr77 = 0, $vararg_ptr78 = 0, $vararg_ptr79 = 0, $vararg_ptr80 = 0;
var $vararg_ptr81 = 0, $vararg_ptr82 = 0, $vnNum = 0, $vtNum = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 608|0;
$$byval_copy90 = sp + 304|0;
$$byval_copy89 = sp + 288|0;
$vararg_buffer83 = sp + 280|0;
$vararg_buffer72 = sp + 240|0;
$vararg_buffer64 = sp + 216|0;
$vararg_buffer59 = sp + 200|0;
$vararg_buffer56 = sp + 192|0;
$vararg_buffer53 = sp + 184|0;
$vararg_buffer50 = sp + 176|0;
$vararg_buffer45 = sp + 160|0;
$vararg_buffer42 = sp + 152|0;
$vararg_buffer37 = sp + 136|0;
$vararg_buffer34 = sp + 128|0;
$vararg_buffer29 = sp + 112|0;
$vararg_buffer26 = sp + 104|0;
$vararg_buffer23 = sp + 96|0;
$vararg_buffer11 = sp + 88|0;
$vararg_buffer7 = sp + 80|0;
$vararg_buffer4 = sp + 72|0;
$vararg_buffer1 = sp + 64|0;
$vararg_buffer = sp + 56|0;
$mesh$sroa$51 = sp;
$dataType = sp + 592|0;
$comments = sp + 392|0;
$useless = sp + 388|0;
$vNum = sp + 376|0;
$vtNum = sp + 364|0;
$vnNum = sp + 352|0;
$norm = sp + 340|0;
$0 = sp + 328|0;
$1 = sp + 316|0;
dest=$mesh$sroa$51; stop=dest+52|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$2 = (_fopen($fileName,20016)|0);
$3 = ($2|0)==(0|0);
if ($3) {
HEAP32[$vararg_buffer>>2] = $fileName;
_TraceLog(2,16452,$vararg_buffer);
$6 = ((($agg$result)) + 28|0);
;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0;HEAP32[$agg$result+12>>2]=0|0;HEAP32[$agg$result+16>>2]=0|0;HEAP32[$agg$result+20>>2]=0|0;HEAP32[$agg$result+24>>2]=0|0;
dest=$6; src=$mesh$sroa$51; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
$4 = (_feof($2)|0);
$5 = ($4|0)==(0);
L5: do {
if ($5) {
$numNormals$0$ph86 = 0;$numTexCoords$0$ph87 = 0;$numTriangles$0$ph88 = 0;$numVertex$0$ph85 = 0;
while(1) {
$numNormals$0$ph1674 = $numNormals$0$ph86;$numTexCoords$0$ph1775 = $numTexCoords$0$ph87;$numTriangles$0$ph1876 = $numTriangles$0$ph88;
L8: while(1) {
$numTexCoords$0$ph2064 = $numTexCoords$0$ph1775;$numTriangles$0$ph2165 = $numTriangles$0$ph1876;
L10: while(1) {
$numTriangles$0$ph2355 = $numTriangles$0$ph2165;
L12: while(1) {
L14: while(1) {
HEAP32[$vararg_buffer1>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer1)|0);
$7 = HEAP8[$dataType>>0]|0;
$8 = $7 << 24 >> 24;
switch ($8|0) {
case 118: {
$numTriangles$0$ph2355$lcssa = $numTriangles$0$ph2355;
break L12;
break;
}
case 102: {
break L14;
break;
}
case 117: case 109: case 115: case 103: case 111: case 35: {
(_fgets($comments,200,$2)|0);
break;
}
default: {
}
}
$9 = (_feof($2)|0);
$10 = ($9|0)==(0);
if (!($10)) {
$numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355;$numVertex$0$ph$lcssa = $numVertex$0$ph85;
break L5;
}
}
$21 = (($numTriangles$0$ph2355) + 1)|0;
(_fgets($comments,200,$2)|0);
$22 = (_feof($2)|0);
$23 = ($22|0)==(0);
if ($23) {
$numTriangles$0$ph2355 = $21;
} else {
$numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064;$numTriangles$0$ph23$lcssa28 = $21;$numVertex$0$ph$lcssa = $numVertex$0$ph85;
break L5;
}
}
HEAP32[$vararg_buffer4>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer4)|0);
$11 = HEAP8[$dataType>>0]|0;
switch ($11<<24>>24) {
case 110: {
$numTexCoords$0$ph2064$lcssa233 = $numTexCoords$0$ph2064;$numTriangles$0$ph2355$lcssa$lcssa229 = $numTriangles$0$ph2355$lcssa;
break L10;
break;
}
case 116: {
break;
}
default: {
$numNormals$0$ph1674$lcssa237 = $numNormals$0$ph1674;$numTexCoords$0$ph2064$lcssa232 = $numTexCoords$0$ph2064;$numTriangles$0$ph2355$lcssa$lcssa = $numTriangles$0$ph2355$lcssa;
break L8;
}
}
$12 = (($numTexCoords$0$ph2064) + 1)|0;
(_fgets($comments,200,$2)|0);
$13 = (_feof($2)|0);
$14 = ($13|0)==(0);
if ($14) {
$numTexCoords$0$ph2064 = $12;$numTriangles$0$ph2165 = $numTriangles$0$ph2355$lcssa;
} else {
$numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674;$numTexCoords$0$ph20$lcssa31 = $12;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355$lcssa;$numVertex$0$ph$lcssa = $numVertex$0$ph85;
break L5;
}
}
$15 = (($numNormals$0$ph1674) + 1)|0;
(_fgets($comments,200,$2)|0);
$16 = (_feof($2)|0);
$17 = ($16|0)==(0);
if ($17) {
$numNormals$0$ph1674 = $15;$numTexCoords$0$ph1775 = $numTexCoords$0$ph2064$lcssa233;$numTriangles$0$ph1876 = $numTriangles$0$ph2355$lcssa$lcssa229;
} else {
$numNormals$0$ph16$lcssa32 = $15;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064$lcssa233;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355$lcssa$lcssa229;$numVertex$0$ph$lcssa = $numVertex$0$ph85;
break L5;
}
}
$18 = (($numVertex$0$ph85) + 1)|0;
(_fgets($comments,200,$2)|0);
$19 = (_feof($2)|0);
$20 = ($19|0)==(0);
if ($20) {
$numNormals$0$ph86 = $numNormals$0$ph1674$lcssa237;$numTexCoords$0$ph87 = $numTexCoords$0$ph2064$lcssa232;$numTriangles$0$ph88 = $numTriangles$0$ph2355$lcssa$lcssa;$numVertex$0$ph85 = $18;
} else {
$numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674$lcssa237;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064$lcssa232;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355$lcssa$lcssa;$numVertex$0$ph$lcssa = $18;
break;
}
}
} else {
$numNormals$0$ph16$lcssa32 = 0;$numTexCoords$0$ph20$lcssa31 = 0;$numTriangles$0$ph23$lcssa28 = 0;$numVertex$0$ph$lcssa = 0;
}
} while(0);
HEAP32[$vararg_buffer7>>2] = $fileName;
$vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
HEAP32[$vararg_ptr10>>2] = $numVertex$0$ph$lcssa;
_TraceLog(3,16489,$vararg_buffer7);
HEAP32[$vararg_buffer11>>2] = $fileName;
$vararg_ptr14 = ((($vararg_buffer11)) + 4|0);
HEAP32[$vararg_ptr14>>2] = $numTexCoords$0$ph20$lcssa31;
_TraceLog(3,16517,$vararg_buffer11);
HEAP32[$$byval_copy89>>2] = $fileName;
$vararg_ptr18 = ((($$byval_copy89)) + 4|0);
HEAP32[$vararg_ptr18>>2] = $numNormals$0$ph16$lcssa32;
_TraceLog(3,16546,$$byval_copy89);
HEAP32[$$byval_copy90>>2] = $fileName;
$vararg_ptr22 = ((($$byval_copy90)) + 4|0);
HEAP32[$vararg_ptr22>>2] = $numTriangles$0$ph23$lcssa28;
_TraceLog(3,16573,$$byval_copy90);
$24 = ($numVertex$0$ph$lcssa*12)|0;
$25 = (_malloc($24)|0);
$26 = ($numNormals$0$ph16$lcssa32|0)>(0);
if ($26) {
$27 = ($numNormals$0$ph16$lcssa32*12)|0;
$28 = (_malloc($27)|0);
$midNormals$0 = $28;
} else {
$midNormals$0 = 0;
}
$29 = ($numTexCoords$0$ph20$lcssa31|0)>(0);
if ($29) {
$30 = $numTexCoords$0$ph20$lcssa31 << 3;
$31 = (_malloc($30)|0);
$midTexCoords$0 = $31;
} else {
$midTexCoords$0 = 0;
}
_rewind($2);
$32 = (_feof($2)|0);
$33 = ($32|0)==(0);
L31: do {
if ($33) {
$countNormals$0$ph44 = 0;$countTexCoords$0$ph45 = 0;$countVertex$0$ph43 = 0;
while(1) {
$countNormals$0$ph841 = $countNormals$0$ph44;$countTexCoords$0$ph942 = $countTexCoords$0$ph45;
L34: while(1) {
$countTexCoords$0$ph1140 = $countTexCoords$0$ph942;
L36: while(1) {
L38: while(1) {
HEAP32[$vararg_buffer23>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer23)|0);
$34 = HEAP8[$dataType>>0]|0;
$35 = $34 << 24 >> 24;
switch ($35|0) {
case 118: {
break L38;
break;
}
case 102: case 117: case 109: case 115: case 103: case 111: case 35: {
(_fgets($comments,200,$2)|0);
break;
}
default: {
}
}
$36 = (_feof($2)|0);
$37 = ($36|0)==(0);
if (!($37)) {
break L31;
}
}
HEAP32[$vararg_buffer26>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer26)|0);
$38 = HEAP8[$dataType>>0]|0;
switch ($38<<24>>24) {
case 110: {
$countTexCoords$0$ph1140$lcssa221 = $countTexCoords$0$ph1140;
break L36;
break;
}
case 116: {
break;
}
default: {
$countNormals$0$ph841$lcssa = $countNormals$0$ph841;$countTexCoords$0$ph1140$lcssa = $countTexCoords$0$ph1140;
break L34;
}
}
HEAPF32[$useless>>2] = 0.0;
$39 = (($midTexCoords$0) + ($countTexCoords$0$ph1140<<3)|0);
$40 = (((($midTexCoords$0) + ($countTexCoords$0$ph1140<<3)|0)) + 4|0);
HEAP32[$vararg_buffer29>>2] = $39;
$vararg_ptr32 = ((($vararg_buffer29)) + 4|0);
HEAP32[$vararg_ptr32>>2] = $40;
$vararg_ptr33 = ((($vararg_buffer29)) + 8|0);
HEAP32[$vararg_ptr33>>2] = $useless;
(_fscanf($2,16602,$vararg_buffer29)|0);
$41 = (($countTexCoords$0$ph1140) + 1)|0;
HEAP32[$vararg_buffer34>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer34)|0);
$42 = (_feof($2)|0);
$43 = ($42|0)==(0);
if ($43) {
$countTexCoords$0$ph1140 = $41;
} else {
break L31;
}
}
$44 = (($midNormals$0) + (($countNormals$0$ph841*12)|0)|0);
$45 = (((($midNormals$0) + (($countNormals$0$ph841*12)|0)|0)) + 4|0);
$46 = (((($midNormals$0) + (($countNormals$0$ph841*12)|0)|0)) + 8|0);
HEAP32[$vararg_buffer37>>2] = $44;
$vararg_ptr40 = ((($vararg_buffer37)) + 4|0);
HEAP32[$vararg_ptr40>>2] = $45;
$vararg_ptr41 = ((($vararg_buffer37)) + 8|0);
HEAP32[$vararg_ptr41>>2] = $46;
(_fscanf($2,16602,$vararg_buffer37)|0);
$47 = (($countNormals$0$ph841) + 1)|0;
HEAP32[$vararg_buffer42>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer42)|0);
$48 = (_feof($2)|0);
$49 = ($48|0)==(0);
if ($49) {
$countNormals$0$ph841 = $47;$countTexCoords$0$ph942 = $countTexCoords$0$ph1140$lcssa221;
} else {
break L31;
}
}
$50 = (($25) + (($countVertex$0$ph43*12)|0)|0);
$51 = (((($25) + (($countVertex$0$ph43*12)|0)|0)) + 4|0);
$52 = (((($25) + (($countVertex$0$ph43*12)|0)|0)) + 8|0);
HEAP32[$vararg_buffer45>>2] = $50;
$vararg_ptr48 = ((($vararg_buffer45)) + 4|0);
HEAP32[$vararg_ptr48>>2] = $51;
$vararg_ptr49 = ((($vararg_buffer45)) + 8|0);
HEAP32[$vararg_ptr49>>2] = $52;
(_fscanf($2,16602,$vararg_buffer45)|0);
$53 = (($countVertex$0$ph43) + 1)|0;
HEAP32[$vararg_buffer50>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer50)|0);
$54 = (_feof($2)|0);
$55 = ($54|0)==(0);
if ($55) {
$countNormals$0$ph44 = $countNormals$0$ph841$lcssa;$countTexCoords$0$ph45 = $countTexCoords$0$ph1140$lcssa;$countVertex$0$ph43 = $53;
} else {
break;
}
}
}
} while(0);
$56 = ($numTriangles$0$ph23$lcssa28*3)|0;
$57 = ($numTriangles$0$ph23$lcssa28*36)|0;
$58 = (_malloc($57)|0);
$59 = ($numTriangles$0$ph23$lcssa28*6)|0;
$60 = ($numTriangles$0$ph23$lcssa28*24)|0;
$61 = (_malloc($60)|0);
$62 = (_malloc($57)|0);
$63 = ($numTriangles$0$ph23$lcssa28*12)|0;
$64 = (_malloc($63)|0);
_rewind($2);
$65 = ($numNormals$0$ph16$lcssa32|0)==(0);
if ($65) {
HEAP32[$vararg_buffer53>>2] = $fileName;
_TraceLog(0,16611,$vararg_buffer53);
}
$66 = $numTexCoords$0$ph20$lcssa31 | $numNormals$0$ph16$lcssa32;
$67 = ($66|0)==(0);
$68 = ((($vNum)) + 4|0);
$69 = ((($vNum)) + 8|0);
$70 = ((($vNum)) + 4|0);
$71 = ((($vNum)) + 8|0);
$72 = ((($vnNum)) + 4|0);
$73 = ((($vnNum)) + 8|0);
$74 = ((($norm)) + 4|0);
$75 = ((($norm)) + 8|0);
$76 = ((($vNum)) + 4|0);
$77 = ((($vtNum)) + 4|0);
$78 = ((($vNum)) + 8|0);
$79 = ((($vtNum)) + 8|0);
$80 = ((($vNum)) + 4|0);
$81 = ((($vtNum)) + 4|0);
$82 = ((($vnNum)) + 4|0);
$83 = ((($vNum)) + 8|0);
$84 = ((($vtNum)) + 8|0);
$85 = ((($vnNum)) + 8|0);
$86 = ((($vtNum)) + 4|0);
$87 = ((($vtNum)) + 8|0);
$nCounter$0$ph$ph = 0;$tcCounter$0$ph$ph = 0;$vCounter$0$ph$ph = 0;
L51: while(1) {
$nCounter$0$ph = $nCounter$0$ph$ph;$vCounter$0$ph = $vCounter$0$ph$ph;
while(1) {
$88 = (_feof($2)|0);
$89 = ($88|0)==(0);
if (!($89)) {
break L51;
}
L55: while(1) {
HEAP32[$vararg_buffer56>>2] = $dataType;
(_fscanf($2,16486,$vararg_buffer56)|0);
$90 = HEAP8[$dataType>>0]|0;
$91 = $90 << 24 >> 24;
switch ($91|0) {
case 102: {
break L55;
break;
}
case 118: case 117: case 109: case 115: case 103: case 111: case 35: {
(_fgets($comments,200,$2)|0);
break;
}
default: {
}
}
$92 = (_feof($2)|0);
$93 = ($92|0)==(0);
if (!($93)) {
break L51;
}
}
do {
if ($67) {
HEAP32[$vararg_buffer59>>2] = $vNum;
$vararg_ptr62 = ((($vararg_buffer59)) + 4|0);
HEAP32[$vararg_ptr62>>2] = $68;
$vararg_ptr63 = ((($vararg_buffer59)) + 8|0);
HEAP32[$vararg_ptr63>>2] = $69;
(_fscanf($2,16682,$vararg_buffer59)|0);
} else {
if ($65) {
HEAP32[$vararg_buffer64>>2] = $vNum;
$vararg_ptr67 = ((($vararg_buffer64)) + 4|0);
HEAP32[$vararg_ptr67>>2] = $vtNum;
$vararg_ptr68 = ((($vararg_buffer64)) + 8|0);
HEAP32[$vararg_ptr68>>2] = $76;
$vararg_ptr69 = ((($vararg_buffer64)) + 12|0);
HEAP32[$vararg_ptr69>>2] = $77;
$vararg_ptr70 = ((($vararg_buffer64)) + 16|0);
HEAP32[$vararg_ptr70>>2] = $78;
$vararg_ptr71 = ((($vararg_buffer64)) + 20|0);
HEAP32[$vararg_ptr71>>2] = $79;
(_fscanf($2,16691,$vararg_buffer64)|0);
break;
} else {
HEAP32[$vararg_buffer72>>2] = $vNum;
$vararg_ptr75 = ((($vararg_buffer72)) + 4|0);
HEAP32[$vararg_ptr75>>2] = $vtNum;
$vararg_ptr76 = ((($vararg_buffer72)) + 8|0);
HEAP32[$vararg_ptr76>>2] = $vnNum;
$vararg_ptr77 = ((($vararg_buffer72)) + 12|0);
HEAP32[$vararg_ptr77>>2] = $80;
$vararg_ptr78 = ((($vararg_buffer72)) + 16|0);
HEAP32[$vararg_ptr78>>2] = $81;
$vararg_ptr79 = ((($vararg_buffer72)) + 20|0);
HEAP32[$vararg_ptr79>>2] = $82;
$vararg_ptr80 = ((($vararg_buffer72)) + 24|0);
HEAP32[$vararg_ptr80>>2] = $83;
$vararg_ptr81 = ((($vararg_buffer72)) + 28|0);
HEAP32[$vararg_ptr81>>2] = $84;
$vararg_ptr82 = ((($vararg_buffer72)) + 32|0);
HEAP32[$vararg_ptr82>>2] = $85;
(_fscanf($2,16709,$vararg_buffer72)|0);
break;
}
}
} while(0);
$94 = HEAP32[$vNum>>2]|0;
$95 = (($94) + -1)|0;
$96 = (($25) + (($95*12)|0)|0);
$97 = HEAP32[$96>>2]|0;
$98 = (($58) + ($vCounter$0$ph<<2)|0);
HEAP32[$98>>2] = $97;
$99 = HEAP32[$vNum>>2]|0;
$100 = (($99) + -1)|0;
$101 = (((($25) + (($100*12)|0)|0)) + 4|0);
$102 = HEAP32[$101>>2]|0;
$103 = (($vCounter$0$ph) + 1)|0;
$104 = (($58) + ($103<<2)|0);
HEAP32[$104>>2] = $102;
$105 = HEAP32[$vNum>>2]|0;
$106 = (($105) + -1)|0;
$107 = (((($25) + (($106*12)|0)|0)) + 8|0);
$108 = HEAP32[$107>>2]|0;
$109 = (($vCounter$0$ph) + 2)|0;
$110 = (($58) + ($109<<2)|0);
HEAP32[$110>>2] = $108;
$111 = (($vCounter$0$ph) + 3)|0;
$112 = HEAP32[$70>>2]|0;
$113 = (($112) + -1)|0;
$114 = (($25) + (($113*12)|0)|0);
$115 = HEAP32[$114>>2]|0;
$116 = (($58) + ($111<<2)|0);
HEAP32[$116>>2] = $115;
$117 = HEAP32[$70>>2]|0;
$118 = (($117) + -1)|0;
$119 = (((($25) + (($118*12)|0)|0)) + 4|0);
$120 = HEAP32[$119>>2]|0;
$121 = (($vCounter$0$ph) + 4)|0;
$122 = (($58) + ($121<<2)|0);
HEAP32[$122>>2] = $120;
$123 = HEAP32[$70>>2]|0;
$124 = (($123) + -1)|0;
$125 = (((($25) + (($124*12)|0)|0)) + 8|0);
$126 = HEAP32[$125>>2]|0;
$127 = (($vCounter$0$ph) + 5)|0;
$128 = (($58) + ($127<<2)|0);
HEAP32[$128>>2] = $126;
$129 = (($vCounter$0$ph) + 6)|0;
$130 = HEAP32[$71>>2]|0;
$131 = (($130) + -1)|0;
$132 = (($25) + (($131*12)|0)|0);
$133 = HEAP32[$132>>2]|0;
$134 = (($58) + ($129<<2)|0);
HEAP32[$134>>2] = $133;
$135 = HEAP32[$71>>2]|0;
$136 = (($135) + -1)|0;
$137 = (((($25) + (($136*12)|0)|0)) + 4|0);
$138 = HEAP32[$137>>2]|0;
$139 = (($vCounter$0$ph) + 7)|0;
$140 = (($58) + ($139<<2)|0);
HEAP32[$140>>2] = $138;
$141 = HEAP32[$71>>2]|0;
$142 = (($141) + -1)|0;
$143 = (((($25) + (($142*12)|0)|0)) + 8|0);
$144 = HEAP32[$143>>2]|0;
$145 = (($vCounter$0$ph) + 8)|0;
$146 = (($58) + ($145<<2)|0);
HEAP32[$146>>2] = $144;
$147 = (($vCounter$0$ph) + 9)|0;
if ($26) {
$148 = HEAP32[$vnNum>>2]|0;
$149 = (($148) + -1)|0;
$150 = (($midNormals$0) + (($149*12)|0)|0);
$151 = HEAP32[$150>>2]|0;
$152 = (($62) + ($nCounter$0$ph<<2)|0);
HEAP32[$152>>2] = $151;
$153 = HEAP32[$vnNum>>2]|0;
$154 = (($153) + -1)|0;
$155 = (((($midNormals$0) + (($154*12)|0)|0)) + 4|0);
$156 = HEAP32[$155>>2]|0;
$157 = (($nCounter$0$ph) + 1)|0;
$158 = (($62) + ($157<<2)|0);
HEAP32[$158>>2] = $156;
$159 = HEAP32[$vnNum>>2]|0;
$160 = (($159) + -1)|0;
$161 = (((($midNormals$0) + (($160*12)|0)|0)) + 8|0);
$162 = HEAP32[$161>>2]|0;
$163 = (($nCounter$0$ph) + 2)|0;
$164 = (($62) + ($163<<2)|0);
HEAP32[$164>>2] = $162;
$165 = (($nCounter$0$ph) + 3)|0;
$166 = HEAP32[$72>>2]|0;
$167 = (($166) + -1)|0;
$168 = (($midNormals$0) + (($167*12)|0)|0);
$169 = HEAP32[$168>>2]|0;
$170 = (($62) + ($165<<2)|0);
HEAP32[$170>>2] = $169;
$171 = HEAP32[$72>>2]|0;
$172 = (($171) + -1)|0;
$173 = (((($midNormals$0) + (($172*12)|0)|0)) + 4|0);
$174 = HEAP32[$173>>2]|0;
$175 = (($nCounter$0$ph) + 4)|0;
$176 = (($62) + ($175<<2)|0);
HEAP32[$176>>2] = $174;
$177 = HEAP32[$72>>2]|0;
$178 = (($177) + -1)|0;
$179 = (((($midNormals$0) + (($178*12)|0)|0)) + 8|0);
$180 = HEAP32[$179>>2]|0;
$181 = (($nCounter$0$ph) + 5)|0;
$182 = (($62) + ($181<<2)|0);
HEAP32[$182>>2] = $180;
$183 = (($nCounter$0$ph) + 6)|0;
$184 = HEAP32[$73>>2]|0;
$185 = (($184) + -1)|0;
$186 = (($midNormals$0) + (($185*12)|0)|0);
$187 = HEAP32[$186>>2]|0;
$188 = (($62) + ($183<<2)|0);
HEAP32[$188>>2] = $187;
$189 = HEAP32[$73>>2]|0;
$190 = (($189) + -1)|0;
$191 = (((($midNormals$0) + (($190*12)|0)|0)) + 4|0);
$192 = HEAP32[$191>>2]|0;
$193 = (($nCounter$0$ph) + 7)|0;
$194 = (($62) + ($193<<2)|0);
HEAP32[$194>>2] = $192;
$195 = HEAP32[$73>>2]|0;
$196 = (($195) + -1)|0;
$197 = (((($midNormals$0) + (($196*12)|0)|0)) + 8|0);
$198 = HEAP32[$197>>2]|0;
$199 = (($nCounter$0$ph) + 8)|0;
$200 = (($62) + ($199<<2)|0);
HEAP32[$200>>2] = $198;
} else {
$201 = HEAP32[$70>>2]|0;
$202 = (($201) + -1)|0;
$203 = (($25) + (($202*12)|0)|0);
$204 = HEAP32[$vNum>>2]|0;
$205 = (($204) + -1)|0;
$206 = (($25) + (($205*12)|0)|0);
;HEAP32[$$byval_copy89>>2]=HEAP32[$203>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$203+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$203+8>>2]|0;
;HEAP32[$$byval_copy90>>2]=HEAP32[$206>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$206+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$206+8>>2]|0;
_VectorSubtract($0,$$byval_copy89,$$byval_copy90);
$207 = HEAP32[$71>>2]|0;
$208 = (($207) + -1)|0;
$209 = (($25) + (($208*12)|0)|0);
$210 = HEAP32[$vNum>>2]|0;
$211 = (($210) + -1)|0;
$212 = (($25) + (($211*12)|0)|0);
;HEAP32[$$byval_copy89>>2]=HEAP32[$209>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$209+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$209+8>>2]|0;
;HEAP32[$$byval_copy90>>2]=HEAP32[$212>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$212+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$212+8>>2]|0;
_VectorSubtract($1,$$byval_copy89,$$byval_copy90);
;HEAP32[$$byval_copy89>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$0+8>>2]|0;
;HEAP32[$$byval_copy90>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$1+8>>2]|0;
_VectorCrossProduct($norm,$$byval_copy89,$$byval_copy90);
_VectorNormalize($norm);
$213 = HEAP32[$norm>>2]|0;
$214 = (($62) + ($nCounter$0$ph<<2)|0);
HEAP32[$214>>2] = $213;
$215 = HEAP32[$74>>2]|0;
$216 = (($nCounter$0$ph) + 1)|0;
$217 = (($62) + ($216<<2)|0);
HEAP32[$217>>2] = $215;
$218 = HEAP32[$75>>2]|0;
$219 = (($nCounter$0$ph) + 2)|0;
$220 = (($62) + ($219<<2)|0);
HEAP32[$220>>2] = $218;
$221 = (($nCounter$0$ph) + 3)|0;
$222 = HEAP32[$norm>>2]|0;
$223 = (($62) + ($221<<2)|0);
HEAP32[$223>>2] = $222;
$224 = HEAP32[$74>>2]|0;
$225 = (($nCounter$0$ph) + 4)|0;
$226 = (($62) + ($225<<2)|0);
HEAP32[$226>>2] = $224;
$227 = HEAP32[$75>>2]|0;
$228 = (($nCounter$0$ph) + 5)|0;
$229 = (($62) + ($228<<2)|0);
HEAP32[$229>>2] = $227;
$230 = (($nCounter$0$ph) + 6)|0;
$231 = HEAP32[$norm>>2]|0;
$232 = (($62) + ($230<<2)|0);
HEAP32[$232>>2] = $231;
$233 = HEAP32[$74>>2]|0;
$234 = (($nCounter$0$ph) + 7)|0;
$235 = (($62) + ($234<<2)|0);
HEAP32[$235>>2] = $233;
$236 = HEAP32[$75>>2]|0;
$237 = (($nCounter$0$ph) + 8)|0;
$238 = (($62) + ($237<<2)|0);
HEAP32[$238>>2] = $236;
}
$nCounter$1 = (($nCounter$0$ph) + 9)|0;
if ($29) {
$$lcssa = $147;$nCounter$1$lcssa = $nCounter$1;
break;
} else {
$nCounter$0$ph = $nCounter$1;$vCounter$0$ph = $147;
}
}
$239 = HEAP32[$vtNum>>2]|0;
$240 = (($239) + -1)|0;
$241 = (($midTexCoords$0) + ($240<<3)|0);
$242 = HEAP32[$241>>2]|0;
$243 = (($61) + ($tcCounter$0$ph$ph<<2)|0);
HEAP32[$243>>2] = $242;
$244 = HEAP32[$vtNum>>2]|0;
$245 = (($244) + -1)|0;
$246 = (((($midTexCoords$0) + ($245<<3)|0)) + 4|0);
$247 = +HEAPF32[$246>>2];
$248 = 1.0 - $247;
$249 = $tcCounter$0$ph$ph | 1;
$250 = (($61) + ($249<<2)|0);
HEAPF32[$250>>2] = $248;
$251 = (($tcCounter$0$ph$ph) + 2)|0;
$252 = HEAP32[$86>>2]|0;
$253 = (($252) + -1)|0;
$254 = (($midTexCoords$0) + ($253<<3)|0);
$255 = HEAP32[$254>>2]|0;
$256 = (($61) + ($251<<2)|0);
HEAP32[$256>>2] = $255;
$257 = HEAP32[$86>>2]|0;
$258 = (($257) + -1)|0;
$259 = (((($midTexCoords$0) + ($258<<3)|0)) + 4|0);
$260 = +HEAPF32[$259>>2];
$261 = 1.0 - $260;
$262 = (($tcCounter$0$ph$ph) + 3)|0;
$263 = (($61) + ($262<<2)|0);
HEAPF32[$263>>2] = $261;
$264 = (($tcCounter$0$ph$ph) + 4)|0;
$265 = HEAP32[$87>>2]|0;
$266 = (($265) + -1)|0;
$267 = (($midTexCoords$0) + ($266<<3)|0);
$268 = HEAP32[$267>>2]|0;
$269 = (($61) + ($264<<2)|0);
HEAP32[$269>>2] = $268;
$270 = HEAP32[$87>>2]|0;
$271 = (($270) + -1)|0;
$272 = (((($midTexCoords$0) + ($271<<3)|0)) + 4|0);
$273 = +HEAPF32[$272>>2];
$274 = 1.0 - $273;
$275 = (($tcCounter$0$ph$ph) + 5)|0;
$276 = (($61) + ($275<<2)|0);
HEAPF32[$276>>2] = $274;
$277 = (($tcCounter$0$ph$ph) + 6)|0;
$nCounter$0$ph$ph = $nCounter$1$lcssa;$tcCounter$0$ph$ph = $277;$vCounter$0$ph$ph = $$lcssa;
}
(_fclose($2)|0);
$278 = ($numTexCoords$0$ph20$lcssa31|0)==(0);
$279 = ($59|0)>(0);
$or$cond = $278 & $279;
if ($or$cond) {
$280 = ($numTriangles$0$ph23$lcssa28*24)|0;
_memset(($61|0),0,($280|0))|0;
}
$281 = ($63|0)>(0);
if ($281) {
$282 = ($numTriangles$0$ph23$lcssa28*12)|0;
_memset(($64|0),-1,($282|0))|0;
}
_free($25);
_free($midNormals$0);
_free($midTexCoords$0);
HEAP32[$vararg_buffer83>>2] = $fileName;
_TraceLog(0,16736,$vararg_buffer83);
HEAP32[$agg$result>>2] = $56;
$283 = ((($agg$result)) + 4|0);
HEAP32[$283>>2] = $58;
$284 = ((($agg$result)) + 8|0);
HEAP32[$284>>2] = $61;
$285 = ((($agg$result)) + 12|0);
HEAP32[$285>>2] = 0;
$286 = ((($agg$result)) + 16|0);
HEAP32[$286>>2] = $62;
$287 = ((($agg$result)) + 20|0);
HEAP32[$287>>2] = 0;
$288 = ((($agg$result)) + 24|0);
HEAP32[$288>>2] = $64;
$289 = ((($agg$result)) + 28|0);
dest=$289; src=$mesh$sroa$51; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
STACKTOP = sp;return;
}
function _EmptyMusicStream() {
var $$pr = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $buffer = 0, $queued = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$buffer = sp + 4|0;
$queued = sp;
HEAP32[$buffer>>2] = 0;
HEAP32[$queued>>2] = 0;
$0 = HEAP32[(5756)>>2]|0;
_alGetSourcei(($0|0),4117,($queued|0));
$$pr = HEAP32[$queued>>2]|0;
$1 = ($$pr|0)>(0);
if (!($1)) {
STACKTOP = sp;return;
}
while(1) {
$2 = HEAP32[(5756)>>2]|0;
_alSourceUnqueueBuffers(($2|0),1,($buffer|0));
$3 = HEAP32[$queued>>2]|0;
$4 = (($3) + -1)|0;
HEAP32[$queued>>2] = $4;
$5 = ($3|0)>(1);
if (!($5)) {
break;
}
}
STACKTOP = sp;return;
}
function _BufferMusicStream($buffer) {
$buffer = $buffer|0;
var $$old1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $active$0 = 0, $pcm = 0;
var $size$0 = 0, $size$0$lcssa = 0, $size$12 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 65552|0;
$vararg_buffer = sp;
$pcm = sp + 8|0;
$0 = HEAP32[5740>>2]|0;
$1 = ($0|0)==(0);
do {
if (!($1)) {
$size$0 = 0;
while(1) {
$2 = HEAP32[5744>>2]|0;
$3 = HEAP32[(5764)>>2]|0;
$4 = (($pcm) + ($size$0<<1)|0);
$5 = (32768 - ($size$0))|0;
$6 = (_stb_vorbis_get_samples_short_interleaved($2,$3,$4,$5)|0);
$7 = ($6|0)>(0);
if (!($7)) {
$size$0$lcssa = $size$0;
label = 4;
break;
}
$8 = HEAP32[(5764)>>2]|0;
$9 = Math_imul($8, $6)|0;
$10 = (($9) + ($size$0))|0;
$$old1 = ($10|0)<(32768);
if ($$old1) {
$size$0 = $10;
} else {
$size$12 = $10;
break;
}
}
if ((label|0) == 4) {
$11 = ($size$0$lcssa|0)>(0);
if ($11) {
$size$12 = $size$0$lcssa;
} else {
break;
}
}
$12 = HEAP32[(5760)>>2]|0;
$13 = $size$12 << 1;
$14 = HEAP32[(5768)>>2]|0;
_alBufferData(($buffer|0),($12|0),($pcm|0),($13|0),($14|0));
$15 = HEAP32[(5772)>>2]|0;
$16 = (($15) - ($size$12))|0;
HEAP32[(5772)>>2] = $16;
$active$0 = 1;
STACKTOP = sp;return ($active$0|0);
}
} while(0);
_TraceLog(2,16418,$vararg_buffer);
$active$0 = 0;
STACKTOP = sp;return ($active$0|0);
}
function _vorbis_deinit($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $12 = 0, $13 = 0, $14 = 0;
var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0;
var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0;
var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i$016 = 0, $i$110 = 0, $i$28 = 0, $i$37 = 0, $j$013 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($p)) + 396|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if (!($2)) {
$3 = ((($p)) + 264|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)>(0);
if ($5) {
$6 = ((($p)) + 124|0);
$i$016 = 0;
while(1) {
$7 = HEAP32[$0>>2]|0;
$8 = (((($7) + (($i$016*24)|0)|0)) + 16|0);
$9 = HEAP32[$8>>2]|0;
$10 = ($9|0)==(0|0);
if (!($10)) {
$11 = (((($7) + (($i$016*24)|0)|0)) + 13|0);
$12 = HEAP8[$11>>0]|0;
$13 = $12&255;
$14 = HEAP32[$6>>2]|0;
$15 = (((($14) + (($13*2096)|0)|0)) + 4|0);
$16 = HEAP32[$15>>2]|0;
$17 = ($16|0)>(0);
if ($17) {
$j$013 = 0;
while(1) {
$18 = HEAP32[$8>>2]|0;
$19 = (($18) + ($j$013<<2)|0);
$20 = HEAP32[$19>>2]|0;
_setup_free($p,$20);
$21 = (($j$013) + 1)|0;
$22 = HEAP8[$11>>0]|0;
$23 = $22&255;
$24 = HEAP32[$6>>2]|0;
$25 = (((($24) + (($23*2096)|0)|0)) + 4|0);
$26 = HEAP32[$25>>2]|0;
$27 = ($21|0)<($26|0);
if ($27) {
$j$013 = $21;
} else {
break;
}
}
}
$28 = HEAP32[$8>>2]|0;
_setup_free($p,$28);
}
$29 = (((($7) + (($i$016*24)|0)|0)) + 20|0);
$30 = HEAP32[$29>>2]|0;
_setup_free($p,$30);
$31 = (($i$016) + 1)|0;
$32 = HEAP32[$3>>2]|0;
$33 = ($31|0)<($32|0);
if ($33) {
$i$016 = $31;
} else {
break;
}
}
}
}
$34 = ((($p)) + 124|0);
$35 = HEAP32[$34>>2]|0;
$36 = ($35|0)==(0|0);
if (!($36)) {
$37 = ((($p)) + 120|0);
$38 = HEAP32[$37>>2]|0;
$39 = ($38|0)>(0);
if ($39) {
$i$110 = 0;
while(1) {
$40 = HEAP32[$34>>2]|0;
$41 = (((($40) + (($i$110*2096)|0)|0)) + 8|0);
$42 = HEAP32[$41>>2]|0;
_setup_free($p,$42);
$43 = (((($40) + (($i$110*2096)|0)|0)) + 28|0);
$44 = HEAP32[$43>>2]|0;
_setup_free($p,$44);
$45 = (((($40) + (($i$110*2096)|0)|0)) + 32|0);
$46 = HEAP32[$45>>2]|0;
_setup_free($p,$46);
$47 = (((($40) + (($i$110*2096)|0)|0)) + 2084|0);
$48 = HEAP32[$47>>2]|0;
_setup_free($p,$48);
$49 = (((($40) + (($i$110*2096)|0)|0)) + 2088|0);
$50 = HEAP32[$49>>2]|0;
$51 = ($50|0)==(0|0);
$52 = ((($50)) + -4|0);
$53 = $51 ? 0 : $52;
_setup_free($p,$53);
$54 = (($i$110) + 1)|0;
$55 = HEAP32[$37>>2]|0;
$56 = ($54|0)<($55|0);
if ($56) {
$i$110 = $54;
} else {
break;
}
}
}
$57 = HEAP32[$34>>2]|0;
_setup_free($p,$57);
}
$58 = ((($p)) + 260|0);
$59 = HEAP32[$58>>2]|0;
_setup_free($p,$59);
$60 = HEAP32[$0>>2]|0;
_setup_free($p,$60);
$61 = ((($p)) + 404|0);
$62 = HEAP32[$61>>2]|0;
$63 = ($62|0)==(0|0);
if (!($63)) {
$64 = ((($p)) + 400|0);
$65 = HEAP32[$64>>2]|0;
$66 = ($65|0)>(0);
if ($66) {
$i$28 = 0;
while(1) {
$67 = HEAP32[$61>>2]|0;
$68 = (((($67) + (($i$28*40)|0)|0)) + 4|0);
$69 = HEAP32[$68>>2]|0;
_setup_free($p,$69);
$70 = (($i$28) + 1)|0;
$71 = HEAP32[$64>>2]|0;
$72 = ($70|0)<($71|0);
if ($72) {
$i$28 = $70;
} else {
break;
}
}
}
$73 = HEAP32[$61>>2]|0;
_setup_free($p,$73);
}
$74 = ((($p)) + 4|0);
$75 = HEAP32[$74>>2]|0;
$76 = ($75|0)>(0);
if ($76) {
$i$37 = 0;
while(1) {
$77 = (((($p)) + 800|0) + ($i$37<<2)|0);
$78 = HEAP32[$77>>2]|0;
_setup_free($p,$78);
$79 = (((($p)) + 928|0) + ($i$37<<2)|0);
$80 = HEAP32[$79>>2]|0;
_setup_free($p,$80);
$81 = (((($p)) + 996|0) + ($i$37<<2)|0);
$82 = HEAP32[$81>>2]|0;
_setup_free($p,$82);
$83 = (($i$37) + 1)|0;
$84 = HEAP32[$74>>2]|0;
$85 = ($83|0)<($84|0);
$86 = ($83|0)<(16);
$87 = $86 & $85;
if ($87) {
$i$37 = $83;
} else {
break;
}
}
}
$88 = ((($p)) + 1068|0);
$89 = HEAP32[$88>>2]|0;
_setup_free($p,$89);
$90 = ((($p)) + 1076|0);
$91 = HEAP32[$90>>2]|0;
_setup_free($p,$91);
$92 = ((($p)) + 1084|0);
$93 = HEAP32[$92>>2]|0;
_setup_free($p,$93);
$94 = ((($p)) + 1092|0);
$95 = HEAP32[$94>>2]|0;
_setup_free($p,$95);
$96 = ((($p)) + 1100|0);
$97 = HEAP32[$96>>2]|0;
_setup_free($p,$97);
$98 = ((($p)) + 1072|0);
$99 = HEAP32[$98>>2]|0;
_setup_free($p,$99);
$100 = ((($p)) + 1080|0);
$101 = HEAP32[$100>>2]|0;
_setup_free($p,$101);
$102 = ((($p)) + 1088|0);
$103 = HEAP32[$102>>2]|0;
_setup_free($p,$103);
$104 = ((($p)) + 1096|0);
$105 = HEAP32[$104>>2]|0;
_setup_free($p,$105);
$106 = ((($p)) + 1104|0);
$107 = HEAP32[$106>>2]|0;
_setup_free($p,$107);
$108 = ((($p)) + 28|0);
$109 = HEAP32[$108>>2]|0;
$110 = ($109|0)==(0);
if ($110) {
return;
}
$111 = ((($p)) + 20|0);
$112 = HEAP32[$111>>2]|0;
(_fclose($112)|0);
return;
}
function _setup_free($f,$p) {
$f = $f|0;
$p = $p|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 80|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if (!($2)) {
return;
}
_free($p);
return;
}
function _error($f,$e) {
$f = $f|0;
$e = $e|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 100|0);
HEAP32[$0>>2] = $e;
return;
}
function _is_whole_packet_present($f,$end_page) {
$f = $f|0;
$end_page = $end_page|0;
var $$0 = 0, $$s$0 = 0, $$s$3 = 0, $$sum = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, $first$0 = 0, $first$0$ph = 0, $or$cond = 0, $p$011 = 0, $p$1 = 0, $p$2 = 0, $p$2$ph = 0, $p$35 = 0, $p$4 = 0;
var $s$0$lcssa = 0, $s$012 = 0, $s$2 = 0, $s$2$ph = 0, $s$3$lcssa = 0, $s$36 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1380|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($f)) + 32|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($1|0)==(-1);
if ($4) {
$first$0$ph = 1;$p$2$ph = $3;$s$2$ph = -1;
} else {
$5 = ((($f)) + 1116|0);
$6 = HEAP32[$5>>2]|0;
$7 = ($1|0)<($6|0);
L3: do {
if ($7) {
$p$011 = $3;$s$012 = $1;
while(1) {
$8 = (((($f)) + 1120|0) + ($s$012)|0);
$9 = HEAP8[$8>>0]|0;
$10 = $9&255;
$11 = (($p$011) + ($10)|0);
$12 = ($9<<24>>24)==(-1);
if (!($12)) {
$p$1 = $11;$s$0$lcssa = $s$012;
break L3;
}
$13 = (($s$012) + 1)|0;
$14 = HEAP32[$5>>2]|0;
$15 = ($13|0)<($14|0);
if ($15) {
$p$011 = $11;$s$012 = $13;
} else {
$p$1 = $11;$s$0$lcssa = $13;
break;
}
}
} else {
$p$1 = $3;$s$0$lcssa = $1;
}
} while(0);
$16 = ($end_page|0)==(0);
if (!($16)) {
$17 = HEAP32[$5>>2]|0;
$18 = (($17) + -1)|0;
$19 = ($s$0$lcssa|0)<($18|0);
if ($19) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
}
$20 = HEAP32[$5>>2]|0;
$21 = ($s$0$lcssa|0)==($20|0);
$$s$0 = $21 ? -1 : $s$0$lcssa;
$22 = ((($f)) + 40|0);
$23 = HEAP32[$22>>2]|0;
$24 = ($p$1>>>0)>($23>>>0);
if ($24) {
_error($f,1);
$$0 = 0;
return ($$0|0);
} else {
$first$0$ph = 0;$p$2$ph = $p$1;$s$2$ph = $$s$0;
}
}
$25 = ((($f)) + 40|0);
$26 = ($end_page|0)!=(0);
$27 = ((($f)) + 992|0);
$first$0 = $first$0$ph;$p$2 = $p$2$ph;$s$2 = $s$2$ph;
while(1) {
$28 = ($s$2|0)==(-1);
if (!($28)) {
$$0 = 1;
label = 33;
break;
}
$29 = ((($p$2)) + 26|0);
$30 = HEAP32[$25>>2]|0;
$31 = ($29>>>0)<($30>>>0);
if (!($31)) {
label = 13;
break;
}
$32 = (_memcmp($p$2,5820,4)|0);
$33 = ($32|0)==(0);
if (!($33)) {
label = 15;
break;
}
$34 = ((($p$2)) + 4|0);
$35 = HEAP8[$34>>0]|0;
$36 = ($35<<24>>24)==(0);
if (!($36)) {
label = 17;
break;
}
$37 = ($first$0|0)==(0);
if ($37) {
$44 = ((($p$2)) + 5|0);
$45 = HEAP8[$44>>0]|0;
$46 = $45 & 1;
$47 = ($46<<24>>24)==(0);
if ($47) {
label = 23;
break;
}
} else {
$38 = HEAP32[$27>>2]|0;
$39 = ($38|0)==(0);
if (!($39)) {
$40 = ((($p$2)) + 5|0);
$41 = HEAP8[$40>>0]|0;
$42 = $41 & 1;
$43 = ($42<<24>>24)==(0);
if (!($43)) {
label = 21;
break;
}
}
}
$48 = HEAP8[$29>>0]|0;
$49 = $48&255;
$$sum = (($49) + 27)|0;
$50 = (($p$2) + ($$sum)|0);
$51 = HEAP32[$25>>2]|0;
$52 = ($50>>>0)>($51>>>0);
if ($52) {
label = 26;
break;
}
$53 = ($48<<24>>24)==(0);
L28: do {
if ($53) {
$p$4 = $50;$s$3$lcssa = 0;
} else {
$p$35 = $50;$s$36 = 0;
while(1) {
$$sum1 = (($s$36) + 27)|0;
$54 = (($p$2) + ($$sum1)|0);
$55 = HEAP8[$54>>0]|0;
$56 = $55&255;
$57 = (($p$35) + ($56)|0);
$58 = ($55<<24>>24)==(-1);
if (!($58)) {
$p$4 = $57;$s$3$lcssa = $s$36;
break L28;
}
$59 = (($s$36) + 1)|0;
$60 = ($59|0)<($49|0);
if ($60) {
$p$35 = $57;$s$36 = $59;
} else {
$p$4 = $57;$s$3$lcssa = $59;
break;
}
}
}
} while(0);
$61 = (($49) + -1)|0;
$62 = ($s$3$lcssa|0)<($61|0);
$or$cond = $26 & $62;
if ($or$cond) {
label = 30;
break;
}
$63 = ($s$3$lcssa|0)==($49|0);
$$s$3 = $63 ? -1 : $s$3$lcssa;
$64 = HEAP32[$25>>2]|0;
$65 = ($p$4>>>0)>($64>>>0);
if ($65) {
label = 32;
break;
} else {
$first$0 = 0;$p$2 = $p$4;$s$2 = $$s$3;
}
}
if ((label|0) == 13) {
_error($f,1);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 15) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 17) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 21) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 23) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 26) {
_error($f,1);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 30) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 32) {
_error($f,1);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 33) {
return ($$0|0);
}
return (0)|0;
}
function _vorbis_decode_packet($f,$len,$p_left,$p_right) {
$f = $f|0;
$len = $len|0;
$p_left = $p_left|0;
$p_right = $p_right|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $left_end = 0, $mode = 0, $right_end = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$mode = sp + 8|0;
$left_end = sp + 4|0;
$right_end = sp;
$0 = (_vorbis_decode_initial($f,$p_left,$left_end,$p_right,$right_end,$mode)|0);
$1 = ($0|0)==(0);
if ($1) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$2 = HEAP32[$mode>>2]|0;
$3 = (((($f)) + 412|0) + (($2*6)|0)|0);
$4 = HEAP32[$p_left>>2]|0;
$5 = HEAP32[$p_right>>2]|0;
$6 = HEAP32[$right_end>>2]|0;
$7 = (_vorbis_decode_packet_rest($f,$len,$3,$4,$5,$6,$p_left)|0);
$$0 = $7;
STACKTOP = sp;return ($$0|0);
}
function _get8_packet($f) {
$f = $f|0;
var $0 = 0, $1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_get8_packet_raw($f)|0);
$1 = ((($f)) + 1396|0);
HEAP32[$1>>2] = 0;
return ($0|0);
}
function _vorbis_finish_frame($f,$len,$left,$right) {
$f = $f|0;
$len = $len|0;
$left = $left|0;
$right = $right|0;
var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0;
var $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond10 = 0;
var $i$04 = 0, $i1$09 = 0, $j$03 = 0, $j2$06 = 0, $len$right = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 992|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
$49 = 0;
} else {
$3 = (_get_window($f,$1)|0);
$4 = ((($f)) + 4|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)>(0);
if ($6) {
$7 = ($1|0)>(0);
$8 = HEAP32[$4>>2]|0;
$9 = (($1) + -1)|0;
$i1$09 = 0;
while(1) {
if ($7) {
$10 = (((($f)) + 800|0) + ($i1$09<<2)|0);
$11 = HEAP32[$10>>2]|0;
$12 = (((($f)) + 928|0) + ($i1$09<<2)|0);
$13 = HEAP32[$12>>2]|0;
$j2$06 = 0;
while(1) {
$14 = (($j2$06) + ($left))|0;
$15 = (($11) + ($14<<2)|0);
$16 = +HEAPF32[$15>>2];
$17 = (($3) + ($j2$06<<2)|0);
$18 = +HEAPF32[$17>>2];
$19 = $16 * $18;
$20 = (($13) + ($j2$06<<2)|0);
$21 = +HEAPF32[$20>>2];
$22 = (($9) - ($j2$06))|0;
$23 = (($3) + ($22<<2)|0);
$24 = +HEAPF32[$23>>2];
$25 = $21 * $24;
$26 = $19 + $25;
HEAPF32[$15>>2] = $26;
$27 = (($j2$06) + 1)|0;
$exitcond10 = ($27|0)==($1|0);
if ($exitcond10) {
break;
} else {
$j2$06 = $27;
}
}
}
$28 = (($i1$09) + 1)|0;
$29 = ($28|0)<($8|0);
if ($29) {
$i1$09 = $28;
} else {
break;
}
}
}
$$pr = HEAP32[$0>>2]|0;
$49 = $$pr;
}
$30 = (($len) - ($right))|0;
HEAP32[$0>>2] = $30;
$31 = ((($f)) + 4|0);
$32 = HEAP32[$31>>2]|0;
$33 = ($32|0)>(0);
if ($33) {
$34 = ($len|0)>($right|0);
$35 = HEAP32[$31>>2]|0;
$36 = (($len) - ($right))|0;
$i$04 = 0;
while(1) {
if ($34) {
$37 = (((($f)) + 800|0) + ($i$04<<2)|0);
$38 = HEAP32[$37>>2]|0;
$39 = (((($f)) + 928|0) + ($i$04<<2)|0);
$40 = HEAP32[$39>>2]|0;
$42 = $right;$j$03 = 0;
while(1) {
$41 = (($38) + ($42<<2)|0);
$43 = HEAP32[$41>>2]|0;
$44 = (($40) + ($j$03<<2)|0);
HEAP32[$44>>2] = $43;
$45 = (($j$03) + 1)|0;
$46 = (($45) + ($right))|0;
$exitcond = ($45|0)==($36|0);
if ($exitcond) {
break;
} else {
$42 = $46;$j$03 = $45;
}
}
}
$47 = (($i$04) + 1)|0;
$48 = ($47|0)<($35|0);
if ($48) {
$i$04 = $47;
} else {
break;
}
}
}
$50 = ($49|0)==(0);
if ($50) {
$$0 = 0;
return ($$0|0);
}
$51 = ($len|0)<($right|0);
$len$right = $51 ? $len : $right;
$52 = (($len$right) - ($left))|0;
$53 = ((($f)) + 1416|0);
$54 = HEAP32[$53>>2]|0;
$55 = (($54) + ($52))|0;
HEAP32[$53>>2] = $55;
$$0 = $52;
return ($$0|0);
}
function _vorbis_init($p,$z) {
$p = $p|0;
$z = $z|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
_memset(($p|0),0,1512)|0;
$0 = ($z|0)==(0|0);
if (!($0)) {
$1 = ((($p)) + 80|0);
$2 = $z;
$3 = $2;
$4 = HEAP32[$3>>2]|0;
$5 = (($2) + 4)|0;
$6 = $5;
$7 = HEAP32[$6>>2]|0;
$8 = $1;
$9 = $8;
HEAP32[$9>>2] = $4;
$10 = (($8) + 4)|0;
$11 = $10;
HEAP32[$11>>2] = $7;
$12 = ((($p)) + 84|0);
$13 = HEAP32[$12>>2]|0;
$14 = (($13) + 3)|0;
$15 = $14 & -4;
HEAP32[$12>>2] = $15;
$16 = ((($p)) + 92|0);
HEAP32[$16>>2] = $15;
}
$17 = ((($p)) + 96|0);
HEAP32[$17>>2] = 0;
$18 = ((($p)) + 100|0);
HEAP32[$18>>2] = 0;
$19 = ((($p)) + 32|0);
HEAP32[$19>>2] = 0;
$20 = ((($p)) + 124|0);
HEAP32[$20>>2] = 0;
$21 = ((($p)) + 1420|0);
HEAP32[$21>>2] = -1;
$22 = ((($p)) + 28|0);
HEAP32[$22>>2] = 0;
$23 = ((($p)) + 20|0);
HEAP32[$23>>2] = 0;
return;
}
function _start_decoder($f) {
$f = $f|0;
var $$ = 0, $$15 = 0, $$4 = 0, $$lcssa = 0, $$lcssa457 = 0, $$lcssa465 = 0, $$lcssa466 = 0, $$lcssa476 = 0, $$lcssa499 = 0, $$lcssa50 = 0, $$lcssa501 = 0, $$lcssa504 = 0, $$lcssa505 = 0, $$lcssa506 = 0, $$lcssa507 = 0, $$lcssa508 = 0, $$lcssa51 = 0, $$lcssa63 = 0, $$lcssa65 = 0, $$longest_floorlist$0 = 0;
var $$longest_floorlist$0$lcssa = 0, $$max_class$0 = 0, $$max_class$0$lcssa = 0, $$max_part_read$0 = 0, $$max_part_read$0$lcssa = 0, $$off = 0, $$off7 = 0, $$pr = 0, $$pr17 = 0, $$pr287 = 0, $$pr288 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0;
var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0;
var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0;
var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0;
var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0;
var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0;
var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0;
var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0;
var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0;
var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0, $262 = 0.0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0;
var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0;
var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0.0, $337 = 0.0, $338 = 0.0, $339 = 0.0;
var $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
var $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0.0, $374 = 0.0, $375 = 0.0;
var $376 = 0.0, $377 = 0.0, $378 = 0.0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0;
var $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0;
var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0;
var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0;
var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0;
var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0;
var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0;
var $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0;
var $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0;
var $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0;
var $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0;
var $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0;
var $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0;
var $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0;
var $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0;
var $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0;
var $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0;
var $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0;
var $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0;
var $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0;
var $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0;
var $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0;
var $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0;
var $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0;
var $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0;
var $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0;
var $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0;
var $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0;
var $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0;
var $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $current_entry$0203 = 0, $current_length$0204 = 0, $current_length$0204$in = 0, $div$0$ph = 0, $header = 0, $hi = 0, $high_bits$0 = 0, $i$1225 = 0, $i$2194 = 0, $i$3189 = 0, $i$3189$lcssa459 = 0, $i$4154 = 0, $i$5133 = 0;
var $i$6118 = 0, $i$7114 = 0, $i9$0109 = 0, $j$0199 = 0, $j$10181 = 0, $j$11184 = 0, $j$1208 = 0, $j$12138 = 0, $j$13143 = 0, $j$14150 = 0, $j$15127 = 0, $j$16125 = 0, $j$17129 = 0, $j$2211 = 0, $j$3221 = 0, $j$4216 = 0, $j$5108 = 0, $j$6159 = 0, $j$7166 = 0, $j$8174 = 0;
var $j$9177 = 0, $k$0 = 0, $k$0$ph = 0, $k$1163 = 0, $k$2170 = 0, $k$3142 = 0, $k$4147 = 0, $k$4147$in = 0, $k$5122 = 0, $last$0220 = 0.0, $last$1 = 0.0, $last$1$ = 0.0, $last$1$$lcssa = 0.0, $last$1$lcssa = 0.0, $last$1$ph = 0.0, $last2$0$ = 0.0, $last2$0215 = 0.0, $lengths$0 = 0, $lengths$119 = 0, $lengths$120$ph = 0;
var $longest_floorlist$0$lcssa = 0, $longest_floorlist$0188 = 0, $low = 0, $max_class$0158 = 0, $max_part_read$0$lcssa = 0, $max_part_read$0110 = 0, $or$cond = 0, $or$cond14 = 0, $p = 0, $phitmp = 0, $phitmp233 = 0, $phitmp234 = 0, $sext = 0, $sorted_count$0207 = 0, $sorted_count$1 = 0, $sorted_count$2 = 0, $temp$0146 = 0, $total$0198 = 0, $total$1 = 0, $total$2 = 0;
var $values$0 = 0, $values$1 = 0, $values$1$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 1024|0;
$header = sp + 1008|0;
$p = sp + 8|0;
$low = sp + 4|0;
$hi = sp;
$0 = (_start_page($f)|0);
$1 = ($0|0)==(0);
if ($1) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$2 = ((($f)) + 1375|0);
$3 = HEAP8[$2>>0]|0;
$4 = $3&255;
$5 = $4 & 2;
$6 = ($5|0)==(0);
if ($6) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$7 = $4 & 4;
$8 = ($7|0)==(0);
if (!($8)) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$9 = $4 & 1;
$10 = ($9|0)==(0);
if (!($10)) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$11 = ((($f)) + 1116|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($12|0)==(1);
if (!($13)) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$14 = ((($f)) + 1120|0);
$15 = HEAP8[$14>>0]|0;
$16 = ($15<<24>>24)==(30);
if (!($16)) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$17 = (_get8($f)|0);
$18 = ($17<<24>>24)==(1);
if (!($18)) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$19 = (_getn($f,$header,6)|0);
$20 = ($19|0)==(0);
if ($20) {
_error($f,10);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$21 = (_vorbis_validate($header)|0);
$22 = ($21|0)==(0);
if ($22) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$23 = (_get32($f)|0);
$24 = ($23|0)==(0);
if (!($24)) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$25 = (_get8($f)|0);
$26 = $25&255;
$27 = ((($f)) + 4|0);
HEAP32[$27>>2] = $26;
$28 = ($25<<24>>24)==(0);
if ($28) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$29 = ($25&255)>(16);
if ($29) {
_error($f,5);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$30 = (_get32($f)|0);
HEAP32[$f>>2] = $30;
$31 = ($30|0)==(0);
if ($31) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
(_get32($f)|0);
(_get32($f)|0);
(_get32($f)|0);
$32 = (_get8($f)|0);
$33 = $32&255;
$34 = $33 & 15;
$35 = $33 >>> 4;
$36 = 1 << $34;
$37 = ((($f)) + 112|0);
HEAP32[$37>>2] = $36;
$38 = 1 << $35;
$39 = ((($f)) + 116|0);
HEAP32[$39>>2] = $38;
$$off = (($34) + -6)|0;
$40 = ($$off>>>0)>(7);
if ($40) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$$off7 = (($32) + -96)<<24>>24;
$41 = ($$off7<<24>>24)<(0);
if ($41) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$42 = ($34>>>0)>($35>>>0);
if ($42) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$43 = (_get8($f)|0);
$44 = $43 & 1;
$45 = ($44<<24>>24)==(0);
if ($45) {
_error($f,34);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$46 = (_start_page($f)|0);
$47 = ($46|0)==(0);
if ($47) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$48 = (_start_packet($f)|0);
$49 = ($48|0)==(0);
if ($49) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$50 = ((($f)) + 1376|0);
while(1) {
$51 = (_next_segment($f)|0);
_skip($f,$51);
HEAP8[$50>>0] = 0;
$52 = ($51|0)==(0);
if ($52) {
break;
}
}
$53 = (_start_packet($f)|0);
$54 = ($53|0)==(0);
if ($54) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$55 = ((($f)) + 48|0);
$56 = HEAP8[$55>>0]|0;
$57 = ($56<<24>>24)==(0);
do {
if (!($57)) {
$58 = (_is_whole_packet_present($f,1)|0);
$59 = ($58|0)==(0);
if (!($59)) {
break;
}
$60 = ((($f)) + 100|0);
$61 = HEAP32[$60>>2]|0;
$62 = ($61|0)==(21);
if (!($62)) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
HEAP32[$60>>2] = 20;
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
} while(0);
_crc32_init();
$63 = (_get8_packet($f)|0);
$64 = ($63|0)==(5);
if (!($64)) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$65 = (_get8_packet($f)|0);
$66 = $65&255;
HEAP8[$header>>0] = $66;
$67 = (_get8_packet($f)|0);
$68 = $67&255;
$69 = ((($header)) + 1|0);
HEAP8[$69>>0] = $68;
$70 = (_get8_packet($f)|0);
$71 = $70&255;
$72 = ((($header)) + 2|0);
HEAP8[$72>>0] = $71;
$73 = (_get8_packet($f)|0);
$74 = $73&255;
$75 = ((($header)) + 3|0);
HEAP8[$75>>0] = $74;
$76 = (_get8_packet($f)|0);
$77 = $76&255;
$78 = ((($header)) + 4|0);
HEAP8[$78>>0] = $77;
$79 = (_get8_packet($f)|0);
$80 = $79&255;
$81 = ((($header)) + 5|0);
HEAP8[$81>>0] = $80;
$82 = (_vorbis_validate($header)|0);
$83 = ($82|0)==(0);
if ($83) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$84 = (_get_bits($f,8)|0);
$85 = (($84) + 1)|0;
$86 = ((($f)) + 120|0);
HEAP32[$86>>2] = $85;
$87 = ($85*2096)|0;
$88 = (_setup_malloc($f,$87)|0);
$89 = ((($f)) + 124|0);
HEAP32[$89>>2] = $88;
$90 = ($88|0)==(0|0);
if ($90) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$91 = HEAP32[$86>>2]|0;
$92 = ($91*2096)|0;
_memset(($88|0),0,($92|0))|0;
$93 = HEAP32[$86>>2]|0;
$94 = ($93|0)>(0);
L100: do {
if ($94) {
$95 = ((($f)) + 16|0);
$96 = ((($f)) + 16|0);
$i$1225 = 0;
L102: while(1) {
$97 = HEAP32[$89>>2]|0;
$98 = (($97) + (($i$1225*2096)|0)|0);
$99 = (_get_bits($f,8)|0);
$100 = $99 & 255;
$101 = ($100|0)==(66);
if (!($101)) {
label = 52;
break;
}
$102 = (_get_bits($f,8)|0);
$103 = $102 & 255;
$104 = ($103|0)==(67);
if (!($104)) {
label = 54;
break;
}
$105 = (_get_bits($f,8)|0);
$106 = $105 & 255;
$107 = ($106|0)==(86);
if (!($107)) {
label = 56;
break;
}
$108 = (_get_bits($f,8)|0);
$109 = (_get_bits($f,8)|0);
$110 = $109 << 8;
$111 = $108 & 255;
$112 = $110 | $111;
HEAP32[$98>>2] = $112;
$113 = (_get_bits($f,8)|0);
$114 = (_get_bits($f,8)|0);
$115 = (_get_bits($f,8)|0);
$116 = $115 << 16;
$117 = $114 << 8;
$118 = $117 & 65280;
$119 = $113 & 255;
$120 = $118 | $119;
$121 = $120 | $116;
$122 = (((($97) + (($i$1225*2096)|0)|0)) + 4|0);
HEAP32[$122>>2] = $121;
$123 = (_get_bits($f,1)|0);
$124 = ($123|0)!=(0);
if ($124) {
$127 = 0;
} else {
$125 = (_get_bits($f,1)|0);
$127 = $125;
}
$126 = $127&255;
$128 = (((($97) + (($i$1225*2096)|0)|0)) + 23|0);
HEAP8[$128>>0] = $126;
$129 = HEAP32[$98>>2]|0;
$130 = ($129|0)==(0);
if ($130) {
$131 = HEAP32[$122>>2]|0;
$132 = ($131|0)==(0);
if (!($132)) {
label = 61;
break;
}
$$pr = HEAP8[$128>>0]|0;
$133 = $$pr;
} else {
$133 = $126;
}
$134 = ($133<<24>>24)==(0);
$135 = HEAP32[$122>>2]|0;
if ($134) {
$137 = (_setup_malloc($f,$135)|0);
$138 = (((($97) + (($i$1225*2096)|0)|0)) + 8|0);
HEAP32[$138>>2] = $137;
$lengths$0 = $137;
} else {
$136 = (_setup_temp_malloc($f,$135)|0);
$lengths$0 = $136;
}
$139 = ($lengths$0|0)==(0|0);
if ($139) {
label = 67;
break;
}
do {
if ($124) {
$142 = (_get_bits($f,5)|0);
$143 = HEAP32[$122>>2]|0;
$144 = ($143|0)>(0);
if ($144) {
$146 = $143;$current_entry$0203 = 0;$current_length$0204$in = $142;
} else {
$total$2 = 0;
break;
}
while(1) {
$current_length$0204 = (($current_length$0204$in) + 1)|0;
$145 = (($146) - ($current_entry$0203))|0;
$147 = (_ilog($145)|0);
$148 = (_get_bits($f,$147)|0);
$149 = (($148) + ($current_entry$0203))|0;
$150 = HEAP32[$122>>2]|0;
$151 = ($149|0)>($150|0);
if ($151) {
label = 72;
break L102;
}
$152 = (($lengths$0) + ($current_entry$0203)|0);
$153 = $current_length$0204&255;
_memset(($152|0),($153|0),($148|0))|0;
$154 = HEAP32[$122>>2]|0;
$155 = ($154|0)>($149|0);
if ($155) {
$146 = $154;$current_entry$0203 = $149;$current_length$0204$in = $current_length$0204;
} else {
$total$2 = 0;
break;
}
}
} else {
$140 = HEAP32[$122>>2]|0;
$141 = ($140|0)>(0);
if ($141) {
$j$0199 = 0;$total$0198 = 0;
} else {
$total$2 = 0;
break;
}
while(1) {
$156 = HEAP8[$128>>0]|0;
$157 = ($156<<24>>24)==(0);
do {
if ($157) {
label = 76;
} else {
$158 = (_get_bits($f,1)|0);
$159 = ($158|0)==(0);
if (!($159)) {
label = 76;
break;
}
$167 = (($lengths$0) + ($j$0199)|0);
HEAP8[$167>>0] = -1;
$total$1 = $total$0198;
}
} while(0);
if ((label|0) == 76) {
label = 0;
$160 = (_get_bits($f,5)|0);
$161 = (($160) + 1)|0;
$162 = $161&255;
$163 = (($lengths$0) + ($j$0199)|0);
HEAP8[$163>>0] = $162;
$164 = (($total$0198) + 1)|0;
$165 = $161 & 255;
$166 = ($165|0)==(32);
if ($166) {
label = 77;
break L102;
} else {
$total$1 = $164;
}
}
$168 = (($j$0199) + 1)|0;
$169 = HEAP32[$122>>2]|0;
$170 = ($168|0)<($169|0);
if ($170) {
$j$0199 = $168;$total$0198 = $total$1;
} else {
$total$2 = $total$1;
break;
}
}
}
} while(0);
$171 = HEAP8[$128>>0]|0;
$172 = ($171<<24>>24)==(0);
do {
if ($172) {
$lengths$120$ph = $lengths$0;
label = 88;
} else {
$173 = HEAP32[$122>>2]|0;
$174 = $173 >> 2;
$175 = ($total$2|0)<($174|0);
if ($175) {
$$pr17 = HEAP8[$128>>0]|0;
$185 = ($$pr17<<24>>24)==(0);
if ($185) {
$lengths$120$ph = $lengths$0;
label = 88;
break;
} else {
$lengths$119 = $lengths$0;$sorted_count$2 = $total$2;
break;
}
}
$176 = HEAP32[$96>>2]|0;
$177 = ($173|0)>($176|0);
if ($177) {
HEAP32[$96>>2] = $173;
}
$178 = HEAP32[$122>>2]|0;
$179 = (_setup_malloc($f,$178)|0);
$180 = (((($97) + (($i$1225*2096)|0)|0)) + 8|0);
HEAP32[$180>>2] = $179;
$181 = ($179|0)==(0|0);
if ($181) {
label = 85;
break L102;
}
$182 = HEAP32[$122>>2]|0;
_memcpy(($179|0),($lengths$0|0),($182|0))|0;
$183 = HEAP32[$122>>2]|0;
_setup_temp_free($f,$lengths$0,$183);
$184 = HEAP32[$180>>2]|0;
HEAP8[$128>>0] = 0;
$lengths$120$ph = $184;
label = 88;
}
} while(0);
do {
if ((label|0) == 88) {
label = 0;
$186 = HEAP32[$122>>2]|0;
$187 = ($186|0)>(0);
if (!($187)) {
$lengths$119 = $lengths$120$ph;$sorted_count$2 = 0;
break;
}
$188 = HEAP32[$122>>2]|0;
$j$1208 = 0;$sorted_count$0207 = 0;
while(1) {
$189 = (($lengths$120$ph) + ($j$1208)|0);
$190 = HEAP8[$189>>0]|0;
$191 = ($190&255)<(11);
$192 = ($190<<24>>24)==(-1);
$or$cond = $191 | $192;
$193 = $or$cond&1;
$194 = $193 ^ 1;
$sorted_count$1 = (($194) + ($sorted_count$0207))|0;
$195 = (($j$1208) + 1)|0;
$196 = ($195|0)<($188|0);
if ($196) {
$j$1208 = $195;$sorted_count$0207 = $sorted_count$1;
} else {
$lengths$119 = $lengths$120$ph;$sorted_count$2 = $sorted_count$1;
break;
}
}
}
} while(0);
$197 = (((($97) + (($i$1225*2096)|0)|0)) + 2092|0);
HEAP32[$197>>2] = $sorted_count$2;
$198 = HEAP8[$128>>0]|0;
$199 = ($198<<24>>24)==(0);
do {
if ($199) {
$200 = HEAP32[$122>>2]|0;
$201 = $200 << 2;
$202 = (_setup_malloc($f,$201)|0);
$203 = (((($97) + (($i$1225*2096)|0)|0)) + 32|0);
HEAP32[$203>>2] = $202;
$204 = ($202|0)==(0|0);
if ($204) {
label = 93;
break L102;
} else {
$values$1 = 0;
}
} else {
$205 = ($sorted_count$2|0)==(0);
if ($205) {
$values$0 = 0;
} else {
$206 = (_setup_malloc($f,$sorted_count$2)|0);
$207 = (((($97) + (($i$1225*2096)|0)|0)) + 8|0);
HEAP32[$207>>2] = $206;
$208 = ($206|0)==(0|0);
if ($208) {
label = 96;
break L102;
}
$209 = HEAP32[$197>>2]|0;
$210 = $209 << 2;
$211 = (_setup_temp_malloc($f,$210)|0);
$212 = (((($97) + (($i$1225*2096)|0)|0)) + 32|0);
HEAP32[$212>>2] = $211;
$213 = ($211|0)==(0|0);
if ($213) {
label = 98;
break L102;
}
$214 = HEAP32[$197>>2]|0;
$215 = $214 << 2;
$216 = (_setup_temp_malloc($f,$215)|0);
$217 = ($216|0)==(0|0);
if ($217) {
label = 100;
break L102;
} else {
$values$0 = $216;
}
}
$218 = HEAP32[$122>>2]|0;
$219 = HEAP32[$197>>2]|0;
$220 = $219 << 3;
$221 = (($220) + ($218))|0;
$222 = HEAP32[$95>>2]|0;
$223 = ($221>>>0)>($222>>>0);
if (!($223)) {
$values$1 = $values$0;
break;
}
HEAP32[$95>>2] = $221;
$values$1 = $values$0;
}
} while(0);
$224 = HEAP32[$122>>2]|0;
$225 = (_compute_codewords($98,$lengths$119,$224,$values$1)|0);
$226 = ($225|0)==(0);
if ($226) {
$$lcssa476 = $128;$values$1$lcssa = $values$1;
label = 104;
break;
}
$229 = HEAP32[$197>>2]|0;
$230 = ($229|0)==(0);
if (!($230)) {
$231 = $229 << 2;
$232 = (($231) + 4)|0;
$233 = (_setup_malloc($f,$232)|0);
$234 = (((($97) + (($i$1225*2096)|0)|0)) + 2084|0);
HEAP32[$234>>2] = $233;
$235 = ($233|0)==(0|0);
if ($235) {
label = 109;
break;
}
$236 = HEAP32[$197>>2]|0;
$237 = $236 << 2;
$238 = (($237) + 4)|0;
$239 = (_setup_malloc($f,$238)|0);
$240 = (((($97) + (($i$1225*2096)|0)|0)) + 2088|0);
HEAP32[$240>>2] = $239;
$241 = ($239|0)==(0|0);
if ($241) {
label = 111;
break;
}
$242 = ((($239)) + 4|0);
HEAP32[$240>>2] = $242;
HEAP32[$239>>2] = -1;
_compute_sorted_huffman($98,$lengths$119,$values$1);
}
$243 = HEAP8[$128>>0]|0;
$244 = ($243<<24>>24)==(0);
if (!($244)) {
$245 = HEAP32[$197>>2]|0;
$246 = $245 << 2;
_setup_temp_free($f,$values$1,$246);
$247 = (((($97) + (($i$1225*2096)|0)|0)) + 32|0);
$248 = HEAP32[$247>>2]|0;
$249 = HEAP32[$197>>2]|0;
$250 = $249 << 2;
_setup_temp_free($f,$248,$250);
$251 = HEAP32[$122>>2]|0;
_setup_temp_free($f,$lengths$119,$251);
HEAP32[$247>>2] = 0;
}
_compute_accelerated_huffman($98);
$252 = (_get_bits($f,4)|0);
$253 = $252&255;
$254 = (((($97) + (($i$1225*2096)|0)|0)) + 21|0);
HEAP8[$254>>0] = $253;
$255 = $252 & 255;
$256 = ($255>>>0)>(2);
if ($256) {
label = 116;
break;
}
$257 = ($255|0)==(0);
do {
if (!($257)) {
$258 = (_get_bits($f,32)|0);
$259 = (+_float32_unpack($258));
$260 = (((($97) + (($i$1225*2096)|0)|0)) + 12|0);
HEAPF32[$260>>2] = $259;
$261 = (_get_bits($f,32)|0);
$262 = (+_float32_unpack($261));
$263 = (((($97) + (($i$1225*2096)|0)|0)) + 16|0);
HEAPF32[$263>>2] = $262;
$264 = (_get_bits($f,4)|0);
$265 = (($264) + 1)|0;
$266 = $265&255;
$267 = (((($97) + (($i$1225*2096)|0)|0)) + 20|0);
HEAP8[$267>>0] = $266;
$268 = (_get_bits($f,1)|0);
$269 = $268&255;
$270 = (((($97) + (($i$1225*2096)|0)|0)) + 22|0);
HEAP8[$270>>0] = $269;
$271 = HEAP8[$254>>0]|0;
$272 = ($271<<24>>24)==(1);
$273 = HEAP32[$122>>2]|0;
$274 = HEAP32[$98>>2]|0;
if ($272) {
$275 = (_lookup1_values($273,$274)|0);
$276 = (((($97) + (($i$1225*2096)|0)|0)) + 24|0);
HEAP32[$276>>2] = $275;
} else {
$277 = Math_imul($274, $273)|0;
$278 = (((($97) + (($i$1225*2096)|0)|0)) + 24|0);
HEAP32[$278>>2] = $277;
}
$279 = (((($97) + (($i$1225*2096)|0)|0)) + 24|0);
$280 = HEAP32[$279>>2]|0;
$281 = ($280|0)==(0);
if ($281) {
label = 122;
break L102;
}
$282 = $280 << 1;
$283 = (_setup_temp_malloc($f,$282)|0);
$284 = ($283|0)==(0|0);
if ($284) {
label = 125;
break L102;
}
$285 = HEAP32[$279>>2]|0;
$286 = ($285|0)>(0);
if ($286) {
$j$2211 = 0;
while(1) {
$287 = HEAP8[$267>>0]|0;
$288 = $287&255;
$289 = (_get_bits($f,$288)|0);
$290 = ($289|0)==(-1);
if ($290) {
$$lcssa499 = $279;$$lcssa504 = $283;
label = 127;
break L102;
}
$293 = $289&65535;
$294 = (($283) + ($j$2211<<1)|0);
HEAP16[$294>>1] = $293;
$295 = (($j$2211) + 1)|0;
$296 = HEAP32[$279>>2]|0;
$297 = ($295|0)<($296|0);
if ($297) {
$j$2211 = $295;
} else {
$$lcssa63 = $296;
break;
}
}
} else {
$$lcssa63 = $285;
}
$298 = HEAP8[$254>>0]|0;
$299 = ($298<<24>>24)==(1);
if (!($299)) {
$359 = $$lcssa63 << 2;
$360 = (_setup_malloc($f,$359)|0);
$361 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0);
HEAP32[$361>>2] = $360;
$362 = ($360|0)==(0|0);
$363 = HEAP32[$279>>2]|0;
if ($362) {
$$lcssa505 = $283;$$lcssa508 = $363;
label = 152;
break L102;
}
$364 = ($363|0)>(0);
if ($364) {
$365 = HEAP32[$361>>2]|0;
$366 = HEAP8[$270>>0]|0;
$367 = ($366<<24>>24)==(0);
$368 = HEAP32[$279>>2]|0;
$j$4216 = 0;$last2$0215 = 0.0;
while(1) {
$370 = (($283) + ($j$4216<<1)|0);
$371 = HEAP16[$370>>1]|0;
$372 = $371&65535;
$373 = (+($372|0));
$374 = +HEAPF32[$263>>2];
$375 = $374 * $373;
$376 = +HEAPF32[$260>>2];
$377 = $376 + $375;
$378 = $last2$0215 + $377;
$379 = (($365) + ($j$4216<<2)|0);
HEAPF32[$379>>2] = $378;
$last2$0$ = $367 ? $last2$0215 : $378;
$380 = (($j$4216) + 1)|0;
$381 = ($380|0)<($368|0);
if ($381) {
$j$4216 = $380;$last2$0215 = $last2$0$;
} else {
$$lcssa65 = $368;
break;
}
}
} else {
$$lcssa65 = $363;
}
$382 = $$lcssa65 << 1;
_setup_temp_free($f,$283,$382);
break;
}
$300 = HEAP8[$128>>0]|0;
$301 = ($300<<24>>24)!=(0);
if ($301) {
$302 = HEAP32[$197>>2]|0;
$303 = ($302|0)==(0);
if ($303) {
break;
}
$304 = $302 << 2;
$305 = HEAP32[$98>>2]|0;
$306 = Math_imul($304, $305)|0;
$307 = (_setup_malloc($f,$306)|0);
$308 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0);
HEAP32[$308>>2] = $307;
} else {
$309 = HEAP32[$122>>2]|0;
$310 = $309 << 2;
$311 = HEAP32[$98>>2]|0;
$312 = Math_imul($310, $311)|0;
$313 = (_setup_malloc($f,$312)|0);
$314 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0);
HEAP32[$314>>2] = $313;
}
$315 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0);
$316 = HEAP32[$315>>2]|0;
$317 = ($316|0)==(0|0);
if ($317) {
$$lcssa501 = $279;$$lcssa506 = $283;
label = 135;
break L102;
}
$$ = $301 ? $197 : $122;
$320 = HEAP32[$$>>2]|0;
$321 = ($320|0)>(0);
if ($321) {
$322 = (((($97) + (($i$1225*2096)|0)|0)) + 2088|0);
$323 = HEAP32[$98>>2]|0;
$j$3221 = 0;$last$0220 = 0.0;
while(1) {
if ($301) {
$324 = HEAP32[$322>>2]|0;
$325 = (($324) + ($j$3221<<2)|0);
$326 = HEAP32[$325>>2]|0;
$330 = $326;
} else {
$330 = $j$3221;
}
$327 = Math_imul($323, $j$3221)|0;
$div$0$ph = 1;$k$0$ph = 0;$last$1$ph = $last$0220;
L204: while(1) {
$k$0 = $k$0$ph;$last$1 = $last$1$ph;
while(1) {
$328 = ($k$0|0)<($323|0);
if (!($328)) {
$last$1$lcssa = $last$1;
break L204;
}
$329 = (($330>>>0) / ($div$0$ph>>>0))&-1;
$331 = HEAP32[$279>>2]|0;
$332 = (($329>>>0) % ($331>>>0))&-1;
$333 = (($283) + ($332<<1)|0);
$334 = HEAP16[$333>>1]|0;
$335 = $334&65535;
$336 = (+($335|0));
$337 = +HEAPF32[$263>>2];
$338 = $337 * $336;
$339 = +HEAPF32[$260>>2];
$340 = $339 + $338;
$341 = $last$1 + $340;
$342 = (($327) + ($k$0))|0;
$343 = HEAP32[$315>>2]|0;
$344 = (($343) + ($342<<2)|0);
HEAPF32[$344>>2] = $341;
$345 = HEAP8[$270>>0]|0;
$346 = ($345<<24>>24)==(0);
$last$1$ = $346 ? $last$1 : $341;
$347 = (($k$0) + 1)|0;
$348 = HEAP32[$98>>2]|0;
$349 = ($347|0)<($348|0);
if ($349) {
$$lcssa465 = $347;$last$1$$lcssa = $last$1$;
break;
} else {
$k$0 = $347;$last$1 = $last$1$;
}
}
$350 = HEAP32[$279>>2]|0;
$351 = (4294967295 / ($350>>>0))&-1;
$352 = ($div$0$ph>>>0)>($351>>>0);
if ($352) {
$$lcssa466 = $350;$$lcssa507 = $283;
label = 145;
break L102;
}
$354 = Math_imul($350, $div$0$ph)|0;
$div$0$ph = $354;$k$0$ph = $$lcssa465;$last$1$ph = $last$1$$lcssa;
}
$355 = (($j$3221) + 1)|0;
$356 = ($355|0)<($320|0);
if ($356) {
$j$3221 = $355;$last$0220 = $last$1$lcssa;
} else {
break;
}
}
}
$357 = HEAP32[$279>>2]|0;
$358 = $357 << 1;
_setup_temp_free($f,$283,$358);
HEAP8[$254>>0] = 2;
}
} while(0);
$383 = (($i$1225) + 1)|0;
$384 = HEAP32[$86>>2]|0;
$385 = ($383|0)<($384|0);
if ($385) {
$i$1225 = $383;
} else {
break L100;
}
}
switch (label|0) {
case 52: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 54: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 56: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 61: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 67: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 72: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 77: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 85: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 93: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 96: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 98: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 100: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 104: {
$227 = HEAP8[$$lcssa476>>0]|0;
$228 = ($227<<24>>24)==(0);
if (!($228)) {
_setup_temp_free($f,$values$1$lcssa,0);
}
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 109: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 111: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 116: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 122: {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 125: {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 127: {
$291 = HEAP32[$$lcssa499>>2]|0;
$292 = $291 << 1;
_setup_temp_free($f,$$lcssa504,$292);
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 135: {
$318 = HEAP32[$$lcssa501>>2]|0;
$319 = $318 << 1;
_setup_temp_free($f,$$lcssa506,$319);
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 145: {
$353 = $$lcssa466 << 1;
_setup_temp_free($f,$$lcssa507,$353);
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
case 152: {
$369 = $$lcssa508 << 1;
_setup_temp_free($f,$$lcssa505,$369);
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
break;
}
}
}
} while(0);
$386 = (_get_bits($f,6)|0);
$387 = (($386) + 1)|0;
$388 = $387 & 255;
$389 = ($388|0)==(0);
L263: do {
if (!($389)) {
$i$2194 = 0;
while(1) {
$392 = (_get_bits($f,16)|0);
$393 = ($392|0)==(0);
$390 = (($i$2194) + 1)|0;
if (!($393)) {
break;
}
$391 = ($390|0)<($388|0);
if ($391) {
$i$2194 = $390;
} else {
break L263;
}
}
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
} while(0);
$394 = (_get_bits($f,6)|0);
$395 = (($394) + 1)|0;
$396 = ((($f)) + 128|0);
HEAP32[$396>>2] = $395;
$397 = ($395*1596)|0;
$398 = (_setup_malloc($f,$397)|0);
$399 = ((($f)) + 260|0);
HEAP32[$399>>2] = $398;
$400 = ($398|0)==(0|0);
if ($400) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$401 = HEAP32[$396>>2]|0;
$402 = ($401|0)>(0);
do {
if ($402) {
$i$3189 = 0;$longest_floorlist$0188 = 0;
L276: while(1) {
$403 = (_get_bits($f,16)|0);
$404 = $403&65535;
$405 = (((($f)) + 132|0) + ($i$3189<<1)|0);
HEAP16[$405>>1] = $404;
$406 = $403 & 65535;
$407 = ($406>>>0)>(1);
if ($407) {
label = 165;
break;
}
$408 = ($406|0)==(0);
if ($408) {
$i$3189$lcssa459 = $i$3189;
label = 167;
break;
}
$438 = HEAP32[$399>>2]|0;
$439 = (_get_bits($f,5)|0);
$440 = $439&255;
$441 = (($438) + (($i$3189*1596)|0)|0);
HEAP8[$441>>0] = $440;
$442 = $439 & 255;
$443 = ($442|0)==(0);
do {
if (!($443)) {
$j$6159 = 0;$max_class$0158 = -1;
while(1) {
$445 = (_get_bits($f,4)|0);
$446 = $445&255;
$447 = ((((($438) + (($i$3189*1596)|0)|0)) + 1|0) + ($j$6159)|0);
HEAP8[$447>>0] = $446;
$448 = $445 & 255;
$449 = ($448|0)>($max_class$0158|0);
$$max_class$0 = $449 ? $448 : $max_class$0158;
$450 = (($j$6159) + 1)|0;
$451 = HEAP8[$441>>0]|0;
$452 = $451&255;
$453 = ($450|0)<($452|0);
if ($453) {
$j$6159 = $450;$max_class$0158 = $$max_class$0;
} else {
$$max_class$0$lcssa = $$max_class$0;
break;
}
}
$444 = ($$max_class$0$lcssa|0)<(0);
if ($444) {
break;
} else {
$j$7166 = 0;
}
while(1) {
$454 = (_get_bits($f,3)|0);
$455 = (($454) + 1)|0;
$456 = $455&255;
$457 = ((((($438) + (($i$3189*1596)|0)|0)) + 33|0) + ($j$7166)|0);
HEAP8[$457>>0] = $456;
$458 = (_get_bits($f,2)|0);
$459 = $458&255;
$460 = ((((($438) + (($i$3189*1596)|0)|0)) + 49|0) + ($j$7166)|0);
HEAP8[$460>>0] = $459;
$461 = ($459<<24>>24)==(0);
if ($461) {
$k$1163 = 0;
label = 178;
} else {
$463 = (_get_bits($f,8)|0);
$464 = $463&255;
$465 = ((((($438) + (($i$3189*1596)|0)|0)) + 65|0) + ($j$7166)|0);
HEAP8[$465>>0] = $464;
$466 = $463 & 255;
$467 = HEAP32[$86>>2]|0;
$468 = ($466|0)<($467|0);
if (!($468)) {
label = 176;
break L276;
}
$$pr287 = HEAP8[$460>>0]|0;
$462 = ($$pr287<<24>>24)==(31);
if (!($462)) {
$k$1163 = 0;
label = 178;
}
}
if ((label|0) == 178) {
while(1) {
label = 0;
$474 = (_get_bits($f,8)|0);
$475 = (($474) + 65535)|0;
$476 = $475&65535;
$477 = (((((($438) + (($i$3189*1596)|0)|0)) + 82|0) + ($j$7166<<4)|0) + ($k$1163<<1)|0);
HEAP16[$477>>1] = $476;
$sext = $475 << 16;
$478 = $sext >> 16;
$479 = HEAP32[$86>>2]|0;
$480 = ($478|0)<($479|0);
$472 = (($k$1163) + 1)|0;
if (!($480)) {
label = 179;
break L276;
}
$469 = HEAP8[$460>>0]|0;
$470 = $469&255;
$471 = 1 << $470;
$473 = ($472|0)<($471|0);
if ($473) {
$k$1163 = $472;
label = 178;
} else {
break;
}
}
}
$481 = (($j$7166) + 1)|0;
$482 = ($j$7166|0)<($$max_class$0$lcssa|0);
if ($482) {
$j$7166 = $481;
} else {
break;
}
}
}
} while(0);
$483 = (_get_bits($f,2)|0);
$484 = (($483) + 1)|0;
$485 = $484&255;
$486 = (((($438) + (($i$3189*1596)|0)|0)) + 1588|0);
HEAP8[$486>>0] = $485;
$487 = (_get_bits($f,4)|0);
$488 = $487&255;
$489 = (((($438) + (($i$3189*1596)|0)|0)) + 1589|0);
HEAP8[$489>>0] = $488;
$490 = (((($438) + (($i$3189*1596)|0)|0)) + 338|0);
HEAP16[$490>>1] = 0;
$491 = HEAP8[$489>>0]|0;
$492 = $491&255;
$493 = 1 << $492;
$494 = $493&65535;
$495 = (((($438) + (($i$3189*1596)|0)|0)) + 340|0);
HEAP16[$495>>1] = $494;
$496 = (((($438) + (($i$3189*1596)|0)|0)) + 1592|0);
HEAP32[$496>>2] = 2;
$497 = HEAP8[$441>>0]|0;
$498 = ($497<<24>>24)==(0);
if ($498) {
$j$9177 = 0;
label = 186;
} else {
$j$8174 = 0;
while(1) {
$500 = ((((($438) + (($i$3189*1596)|0)|0)) + 1|0) + ($j$8174)|0);
$501 = HEAP8[$500>>0]|0;
$502 = $501&255;
$503 = ((((($438) + (($i$3189*1596)|0)|0)) + 33|0) + ($502)|0);
$504 = HEAP8[$503>>0]|0;
$505 = ($504<<24>>24)==(0);
if (!($505)) {
$k$2170 = 0;
while(1) {
$506 = HEAP8[$489>>0]|0;
$507 = $506&255;
$508 = (_get_bits($f,$507)|0);
$509 = $508&65535;
$510 = HEAP32[$496>>2]|0;
$511 = ((((($438) + (($i$3189*1596)|0)|0)) + 338|0) + ($510<<1)|0);
HEAP16[$511>>1] = $509;
$512 = HEAP32[$496>>2]|0;
$513 = (($512) + 1)|0;
HEAP32[$496>>2] = $513;
$514 = (($k$2170) + 1)|0;
$515 = HEAP8[$503>>0]|0;
$516 = $515&255;
$517 = ($514|0)<($516|0);
if ($517) {
$k$2170 = $514;
} else {
break;
}
}
}
$518 = (($j$8174) + 1)|0;
$519 = HEAP8[$441>>0]|0;
$520 = $519&255;
$521 = ($518|0)<($520|0);
if ($521) {
$j$8174 = $518;
} else {
break;
}
}
$$pr288 = HEAP32[$496>>2]|0;
$499 = ($$pr288|0)>(0);
if ($499) {
$j$9177 = 0;
label = 186;
} else {
$$lcssa50 = $$pr288;
}
}
if ((label|0) == 186) {
while(1) {
label = 0;
$522 = ((((($438) + (($i$3189*1596)|0)|0)) + 338|0) + ($j$9177<<1)|0);
$523 = HEAP16[$522>>1]|0;
$524 = (($p) + ($j$9177<<2)|0);
HEAP16[$524>>1] = $523;
$525 = $j$9177&65535;
$526 = (((($p) + ($j$9177<<2)|0)) + 2|0);
HEAP16[$526>>1] = $525;
$527 = (($j$9177) + 1)|0;
$528 = HEAP32[$496>>2]|0;
$529 = ($527|0)<($528|0);
if ($529) {
$j$9177 = $527;
label = 186;
} else {
$$lcssa50 = $528;
break;
}
}
}
_qsort($p,$$lcssa50,4,1);
$530 = HEAP32[$496>>2]|0;
$531 = ($530|0)>(0);
do {
if ($531) {
$j$10181 = 0;
while(1) {
$533 = (((($p) + ($j$10181<<2)|0)) + 2|0);
$534 = HEAP16[$533>>1]|0;
$535 = $534&255;
$536 = ((((($438) + (($i$3189*1596)|0)|0)) + 838|0) + ($j$10181)|0);
HEAP8[$536>>0] = $535;
$537 = (($j$10181) + 1)|0;
$538 = HEAP32[$496>>2]|0;
$539 = ($537|0)<($538|0);
if ($539) {
$j$10181 = $537;
} else {
$$lcssa457 = $538;
break;
}
}
$532 = ($$lcssa457|0)>(2);
if ($532) {
$j$11184 = 2;
} else {
$$lcssa51 = $$lcssa457;
break;
}
while(1) {
_neighbors($490,$j$11184,$low,$hi);
$540 = HEAP32[$low>>2]|0;
$541 = $540&255;
$542 = ((((($438) + (($i$3189*1596)|0)|0)) + 1088|0) + ($j$11184<<1)|0);
HEAP8[$542>>0] = $541;
$543 = HEAP32[$hi>>2]|0;
$544 = $543&255;
$545 = ((((((($438) + (($i$3189*1596)|0)|0)) + 1088|0) + ($j$11184<<1)|0)) + 1|0);
HEAP8[$545>>0] = $544;
$546 = (($j$11184) + 1)|0;
$547 = HEAP32[$496>>2]|0;
$548 = ($546|0)<($547|0);
if ($548) {
$j$11184 = $546;
} else {
$$lcssa51 = $547;
break;
}
}
} else {
$$lcssa51 = $530;
}
} while(0);
$549 = ($$lcssa51|0)>($longest_floorlist$0188|0);
$$longest_floorlist$0 = $549 ? $$lcssa51 : $longest_floorlist$0188;
$550 = (($i$3189) + 1)|0;
$551 = HEAP32[$396>>2]|0;
$552 = ($550|0)<($551|0);
if ($552) {
$i$3189 = $550;$longest_floorlist$0188 = $$longest_floorlist$0;
} else {
$$longest_floorlist$0$lcssa = $$longest_floorlist$0;
label = 193;
break;
}
}
if ((label|0) == 165) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 167) {
$409 = HEAP32[$399>>2]|0;
$410 = (_get_bits($f,8)|0);
$411 = $410&255;
$412 = (($409) + (($i$3189$lcssa459*1596)|0)|0);
HEAP8[$412>>0] = $411;
$413 = (_get_bits($f,16)|0);
$414 = $413&65535;
$415 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 2|0);
HEAP16[$415>>1] = $414;
$416 = (_get_bits($f,16)|0);
$417 = $416&65535;
$418 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 4|0);
HEAP16[$418>>1] = $417;
$419 = (_get_bits($f,6)|0);
$420 = $419&255;
$421 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 6|0);
HEAP8[$421>>0] = $420;
$422 = (_get_bits($f,8)|0);
$423 = $422&255;
$424 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 7|0);
HEAP8[$424>>0] = $423;
$425 = (_get_bits($f,4)|0);
$426 = (($425) + 1)|0;
$427 = $426&255;
$428 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 8|0);
HEAP8[$428>>0] = $427;
$429 = $426 & 255;
$430 = ($429|0)==(0);
if (!($430)) {
$j$5108 = 0;
while(1) {
$431 = (_get_bits($f,8)|0);
$432 = $431&255;
$$sum = (($j$5108) + 8)|0;
$433 = ((((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 1|0) + ($$sum)|0);
HEAP8[$433>>0] = $432;
$434 = (($j$5108) + 1)|0;
$435 = HEAP8[$428>>0]|0;
$436 = $435&255;
$437 = ($434|0)<($436|0);
if ($437) {
$j$5108 = $434;
} else {
break;
}
}
}
_error($f,4);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 176) {
_error($f,20);
}
else if ((label|0) == 179) {
_error($f,20);
}
else if ((label|0) == 193) {
$phitmp234 = $$longest_floorlist$0$lcssa << 1;
$longest_floorlist$0$lcssa = $phitmp234;
break;
}
$$4 = 0;
STACKTOP = sp;return ($$4|0);
} else {
$longest_floorlist$0$lcssa = 0;
}
} while(0);
$553 = (_get_bits($f,6)|0);
$554 = (($553) + 1)|0;
$555 = ((($f)) + 264|0);
HEAP32[$555>>2] = $554;
$556 = ($554*24)|0;
$557 = (_setup_malloc($f,$556)|0);
$558 = ((($f)) + 396|0);
HEAP32[$558>>2] = $557;
$559 = ($557|0)==(0|0);
if ($559) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$560 = HEAP32[$555>>2]|0;
$561 = ($560*24)|0;
_memset(($557|0),0,($561|0))|0;
$562 = HEAP32[$555>>2]|0;
$563 = ($562|0)>(0);
L333: do {
if ($563) {
$i$4154 = 0;
L335: while(1) {
$564 = HEAP32[$558>>2]|0;
$565 = (_get_bits($f,16)|0);
$566 = $565&65535;
$567 = (((($f)) + 268|0) + ($i$4154<<1)|0);
HEAP16[$567>>1] = $566;
$568 = $565 & 65535;
$569 = ($568>>>0)>(2);
if ($569) {
label = 199;
break;
}
$570 = (_get_bits($f,24)|0);
$571 = (($564) + (($i$4154*24)|0)|0);
HEAP32[$571>>2] = $570;
$572 = (_get_bits($f,24)|0);
$573 = (((($564) + (($i$4154*24)|0)|0)) + 4|0);
HEAP32[$573>>2] = $572;
$574 = HEAP32[$571>>2]|0;
$575 = ($572>>>0)<($574>>>0);
if ($575) {
label = 201;
break;
}
$576 = (_get_bits($f,24)|0);
$577 = (($576) + 1)|0;
$578 = (((($564) + (($i$4154*24)|0)|0)) + 8|0);
HEAP32[$578>>2] = $577;
$579 = (_get_bits($f,6)|0);
$580 = (($579) + 1)|0;
$581 = $580&255;
$582 = (((($564) + (($i$4154*24)|0)|0)) + 12|0);
HEAP8[$582>>0] = $581;
$583 = (_get_bits($f,8)|0);
$584 = $583&255;
$585 = (((($564) + (($i$4154*24)|0)|0)) + 13|0);
HEAP8[$585>>0] = $584;
$586 = $583 & 255;
$587 = HEAP32[$86>>2]|0;
$588 = ($586|0)<($587|0);
if (!($588)) {
label = 204;
break;
}
$589 = HEAP8[$582>>0]|0;
$590 = $589&255;
$591 = ($589<<24>>24)==(0);
if ($591) {
$$lcssa = $590;
} else {
$j$12138 = 0;
while(1) {
$592 = (_get_bits($f,3)|0);
$593 = (_get_bits($f,1)|0);
$594 = ($593|0)==(0);
if ($594) {
$high_bits$0 = 0;
} else {
$595 = (_get_bits($f,5)|0);
$high_bits$0 = $595;
}
$596 = $high_bits$0 << 3;
$597 = (($596) + ($592))|0;
$598 = $597&255;
$599 = (($p) + ($j$12138)|0);
HEAP8[$599>>0] = $598;
$600 = (($j$12138) + 1)|0;
$601 = HEAP8[$582>>0]|0;
$602 = $601&255;
$603 = ($600|0)<($602|0);
if ($603) {
$j$12138 = $600;
} else {
$$lcssa = $602;
break;
}
}
}
$604 = $$lcssa << 4;
$605 = (_setup_malloc($f,$604)|0);
$606 = (((($564) + (($i$4154*24)|0)|0)) + 20|0);
HEAP32[$606>>2] = $605;
$607 = ($605|0)==(0|0);
if ($607) {
label = 210;
break;
}
$608 = HEAP8[$582>>0]|0;
$609 = ($608<<24>>24)==(0);
if (!($609)) {
$j$13143 = 0;
while(1) {
$610 = (($p) + ($j$13143)|0);
$611 = HEAP8[$610>>0]|0;
$612 = $611&255;
$k$3142 = 0;
while(1) {
$613 = 1 << $k$3142;
$614 = $612 & $613;
$615 = ($614|0)==(0);
if ($615) {
$626 = HEAP32[$606>>2]|0;
$627 = ((($626) + ($j$13143<<4)|0) + ($k$3142<<1)|0);
HEAP16[$627>>1] = -1;
} else {
$616 = (_get_bits($f,8)|0);
$617 = $616&65535;
$618 = HEAP32[$606>>2]|0;
$619 = ((($618) + ($j$13143<<4)|0) + ($k$3142<<1)|0);
HEAP16[$619>>1] = $617;
$620 = HEAP32[$606>>2]|0;
$621 = ((($620) + ($j$13143<<4)|0) + ($k$3142<<1)|0);
$622 = HEAP16[$621>>1]|0;
$623 = $622 << 16 >> 16;
$624 = HEAP32[$86>>2]|0;
$625 = ($623|0)<($624|0);
if (!($625)) {
label = 214;
break L335;
}
}
$628 = (($k$3142) + 1)|0;
$629 = ($628|0)<(8);
if ($629) {
$k$3142 = $628;
} else {
break;
}
}
$630 = (($j$13143) + 1)|0;
$631 = HEAP8[$582>>0]|0;
$632 = $631&255;
$633 = ($630|0)<($632|0);
if ($633) {
$j$13143 = $630;
} else {
break;
}
}
}
$634 = HEAP8[$585>>0]|0;
$635 = $634&255;
$636 = HEAP32[$89>>2]|0;
$637 = (((($636) + (($635*2096)|0)|0)) + 4|0);
$638 = HEAP32[$637>>2]|0;
$639 = $638 << 2;
$640 = (_setup_malloc($f,$639)|0);
$641 = (((($564) + (($i$4154*24)|0)|0)) + 16|0);
HEAP32[$641>>2] = $640;
$642 = ($640|0)==(0|0);
if ($642) {
label = 219;
break;
}
$643 = HEAP8[$585>>0]|0;
$644 = $643&255;
$645 = HEAP32[$89>>2]|0;
$646 = (((($645) + (($644*2096)|0)|0)) + 4|0);
$647 = HEAP32[$646>>2]|0;
$648 = $647 << 2;
_memset(($640|0),0,($648|0))|0;
$649 = HEAP8[$585>>0]|0;
$650 = $649&255;
$651 = HEAP32[$89>>2]|0;
$652 = (((($651) + (($650*2096)|0)|0)) + 4|0);
$653 = HEAP32[$652>>2]|0;
$654 = ($653|0)>(0);
if ($654) {
$656 = $651;$657 = $650;$j$14150 = 0;
while(1) {
$655 = (($656) + (($657*2096)|0)|0);
$658 = HEAP32[$655>>2]|0;
$659 = (_setup_malloc($f,$658)|0);
$660 = HEAP32[$641>>2]|0;
$661 = (($660) + ($j$14150<<2)|0);
HEAP32[$661>>2] = $659;
$662 = HEAP32[$641>>2]|0;
$663 = (($662) + ($j$14150<<2)|0);
$664 = HEAP32[$663>>2]|0;
$665 = ($664|0)==(0|0);
if ($665) {
label = 223;
break L335;
}
$666 = ($658|0)>(0);
if ($666) {
$k$4147$in = $658;$temp$0146 = $j$14150;
while(1) {
$k$4147 = (($k$4147$in) + -1)|0;
$667 = HEAP8[$582>>0]|0;
$668 = $667&255;
$669 = (($temp$0146|0) % ($668|0))&-1;
$670 = $669&255;
$671 = HEAP32[$641>>2]|0;
$672 = (($671) + ($j$14150<<2)|0);
$673 = HEAP32[$672>>2]|0;
$674 = (($673) + ($k$4147)|0);
HEAP8[$674>>0] = $670;
$675 = HEAP8[$582>>0]|0;
$676 = $675&255;
$677 = (($temp$0146|0) / ($676|0))&-1;
$678 = ($k$4147$in|0)>(1);
if ($678) {
$k$4147$in = $k$4147;$temp$0146 = $677;
} else {
break;
}
}
}
$679 = (($j$14150) + 1)|0;
$680 = HEAP8[$585>>0]|0;
$681 = $680&255;
$682 = HEAP32[$89>>2]|0;
$683 = (((($682) + (($681*2096)|0)|0)) + 4|0);
$684 = HEAP32[$683>>2]|0;
$685 = ($679|0)<($684|0);
if ($685) {
$656 = $682;$657 = $681;$j$14150 = $679;
} else {
break;
}
}
}
$686 = (($i$4154) + 1)|0;
$687 = HEAP32[$555>>2]|0;
$688 = ($686|0)<($687|0);
if ($688) {
$i$4154 = $686;
} else {
break L333;
}
}
if ((label|0) == 199) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 201) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 204) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 210) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 214) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 219) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 223) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
}
} while(0);
$689 = (_get_bits($f,6)|0);
$690 = (($689) + 1)|0;
$691 = ((($f)) + 400|0);
HEAP32[$691>>2] = $690;
$692 = ($690*40)|0;
$693 = (_setup_malloc($f,$692)|0);
$694 = ((($f)) + 404|0);
HEAP32[$694>>2] = $693;
$695 = ($693|0)==(0|0);
if ($695) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$696 = HEAP32[$691>>2]|0;
$697 = ($696*40)|0;
_memset(($693|0),0,($697|0))|0;
$698 = HEAP32[$691>>2]|0;
$699 = ($698|0)>(0);
L389: do {
if ($699) {
$i$5133 = 0;
L390: while(1) {
$700 = HEAP32[$694>>2]|0;
$701 = (($700) + (($i$5133*40)|0)|0);
$702 = (_get_bits($f,16)|0);
$703 = ($702|0)==(0);
if (!($703)) {
label = 231;
break;
}
$704 = HEAP32[$27>>2]|0;
$705 = ($704*3)|0;
$706 = (_setup_malloc($f,$705)|0);
$707 = (((($700) + (($i$5133*40)|0)|0)) + 4|0);
HEAP32[$707>>2] = $706;
$708 = ($706|0)==(0|0);
if ($708) {
label = 233;
break;
}
$709 = (_get_bits($f,1)|0);
$710 = ($709|0)==(0);
if ($710) {
$715 = (((($700) + (($i$5133*40)|0)|0)) + 8|0);
HEAP8[$715>>0] = 1;
} else {
$711 = (_get_bits($f,4)|0);
$712 = (($711) + 1)|0;
$713 = $712&255;
$714 = (((($700) + (($i$5133*40)|0)|0)) + 8|0);
HEAP8[$714>>0] = $713;
}
$716 = (((($700) + (($i$5133*40)|0)|0)) + 8|0);
$717 = (_get_bits($f,1)|0);
$718 = ($717|0)==(0);
do {
if ($718) {
HEAP16[$701>>1] = 0;
} else {
$719 = (_get_bits($f,8)|0);
$720 = (($719) + 1)|0;
$721 = $720&65535;
HEAP16[$701>>1] = $721;
$722 = $720 & 65535;
$723 = ($722|0)==(0);
if ($723) {
break;
} else {
$k$5122 = 0;
}
while(1) {
$728 = HEAP32[$27>>2]|0;
$729 = (($728) + -1)|0;
$730 = (_ilog($729)|0);
$731 = (_get_bits($f,$730)|0);
$732 = $731&255;
$733 = HEAP32[$707>>2]|0;
$734 = (($733) + (($k$5122*3)|0)|0);
HEAP8[$734>>0] = $732;
$735 = HEAP32[$27>>2]|0;
$736 = (($735) + -1)|0;
$737 = (_ilog($736)|0);
$738 = (_get_bits($f,$737)|0);
$739 = $738&255;
$740 = HEAP32[$707>>2]|0;
$741 = (((($740) + (($k$5122*3)|0)|0)) + 1|0);
HEAP8[$741>>0] = $739;
$742 = HEAP32[$707>>2]|0;
$743 = (($742) + (($k$5122*3)|0)|0);
$744 = HEAP8[$743>>0]|0;
$745 = $744&255;
$746 = HEAP32[$27>>2]|0;
$747 = ($745|0)<($746|0);
if (!($747)) {
label = 241;
break L390;
}
$748 = (((($742) + (($k$5122*3)|0)|0)) + 1|0);
$749 = HEAP8[$748>>0]|0;
$750 = $749&255;
$751 = ($750|0)<($746|0);
if (!($751)) {
label = 243;
break L390;
}
$752 = ($744<<24>>24)==($749<<24>>24);
$726 = (($k$5122) + 1)|0;
if ($752) {
label = 245;
break L390;
}
$724 = HEAP16[$701>>1]|0;
$725 = $724&65535;
$727 = ($726|0)<($725|0);
if ($727) {
$k$5122 = $726;
} else {
break;
}
}
}
} while(0);
$753 = (_get_bits($f,2)|0);
$754 = ($753|0)==(0);
if (!($754)) {
label = 248;
break;
}
$755 = HEAP8[$716>>0]|0;
$756 = ($755&255)>(1);
$757 = HEAP32[$27>>2]|0;
$758 = ($757|0)>(0);
do {
if ($756) {
if ($758) {
$j$15127 = 0;
} else {
break;
}
while(1) {
$766 = (_get_bits($f,4)|0);
$767 = $766&255;
$768 = HEAP32[$707>>2]|0;
$769 = (((($768) + (($j$15127*3)|0)|0)) + 2|0);
HEAP8[$769>>0] = $767;
$770 = HEAP32[$707>>2]|0;
$771 = (((($770) + (($j$15127*3)|0)|0)) + 2|0);
$772 = HEAP8[$771>>0]|0;
$773 = HEAP8[$716>>0]|0;
$774 = ($772&255)<($773&255);
$762 = (($j$15127) + 1)|0;
if (!($774)) {
label = 256;
break L390;
}
$761 = HEAP32[$27>>2]|0;
$763 = ($762|0)<($761|0);
if ($763) {
$j$15127 = $762;
} else {
break;
}
}
} else {
if (!($758)) {
break;
}
$759 = HEAP32[$707>>2]|0;
$760 = HEAP32[$27>>2]|0;
$j$16125 = 0;
while(1) {
$775 = (((($759) + (($j$16125*3)|0)|0)) + 2|0);
HEAP8[$775>>0] = 0;
$776 = (($j$16125) + 1)|0;
$777 = ($776|0)<($760|0);
if ($777) {
$j$16125 = $776;
} else {
break;
}
}
}
} while(0);
$764 = HEAP8[$716>>0]|0;
$765 = ($764<<24>>24)==(0);
if (!($765)) {
$j$17129 = 0;
while(1) {
(_get_bits($f,8)|0);
$782 = (_get_bits($f,8)|0);
$783 = $782&255;
$784 = ((((($700) + (($i$5133*40)|0)|0)) + 9|0) + ($j$17129)|0);
HEAP8[$784>>0] = $783;
$785 = (_get_bits($f,8)|0);
$786 = $785&255;
$787 = ((((($700) + (($i$5133*40)|0)|0)) + 24|0) + ($j$17129)|0);
HEAP8[$787>>0] = $786;
$788 = HEAP8[$784>>0]|0;
$789 = $788&255;
$790 = HEAP32[$396>>2]|0;
$791 = ($789|0)<($790|0);
if (!($791)) {
label = 260;
break L390;
}
$792 = $785 & 255;
$793 = HEAP32[$555>>2]|0;
$794 = ($792|0)<($793|0);
$780 = (($j$17129) + 1)|0;
if (!($794)) {
label = 262;
break L390;
}
$778 = HEAP8[$716>>0]|0;
$779 = $778&255;
$781 = ($780|0)<($779|0);
if ($781) {
$j$17129 = $780;
} else {
break;
}
}
}
$795 = (($i$5133) + 1)|0;
$796 = HEAP32[$691>>2]|0;
$797 = ($795|0)<($796|0);
if ($797) {
$i$5133 = $795;
} else {
break L389;
}
}
if ((label|0) == 231) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 233) {
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 241) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 243) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 245) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 248) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 256) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 260) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 262) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
}
} while(0);
$798 = (_get_bits($f,6)|0);
$799 = (($798) + 1)|0;
$800 = ((($f)) + 408|0);
HEAP32[$800>>2] = $799;
$801 = ($799|0)>(0);
L444: do {
if ($801) {
$i$6118 = 0;
while(1) {
$805 = (_get_bits($f,1)|0);
$806 = $805&255;
$807 = (((($f)) + 412|0) + (($i$6118*6)|0)|0);
HEAP8[$807>>0] = $806;
$808 = (_get_bits($f,16)|0);
$809 = $808&65535;
$810 = (((((($f)) + 412|0) + (($i$6118*6)|0)|0)) + 2|0);
HEAP16[$810>>1] = $809;
$811 = (_get_bits($f,16)|0);
$812 = $811&65535;
$813 = (((((($f)) + 412|0) + (($i$6118*6)|0)|0)) + 4|0);
HEAP16[$813>>1] = $812;
$814 = (_get_bits($f,8)|0);
$815 = $814&255;
$816 = (((((($f)) + 412|0) + (($i$6118*6)|0)|0)) + 1|0);
HEAP8[$816>>0] = $815;
$817 = HEAP16[$810>>1]|0;
$818 = ($817<<16>>16)==(0);
if (!($818)) {
label = 267;
break;
}
$819 = HEAP16[$813>>1]|0;
$820 = ($819<<16>>16)==(0);
if (!($820)) {
label = 269;
break;
}
$821 = $814 & 255;
$822 = HEAP32[$691>>2]|0;
$823 = ($821|0)<($822|0);
$803 = (($i$6118) + 1)|0;
if (!($823)) {
label = 271;
break;
}
$802 = HEAP32[$800>>2]|0;
$804 = ($803|0)<($802|0);
if ($804) {
$i$6118 = $803;
} else {
break L444;
}
}
if ((label|0) == 267) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 269) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
else if ((label|0) == 271) {
_error($f,20);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
}
} while(0);
_flush_packet($f);
$824 = ((($f)) + 992|0);
HEAP32[$824>>2] = 0;
$825 = HEAP32[$27>>2]|0;
$826 = ($825|0)>(0);
L458: do {
if ($826) {
$i$7114 = 0;
while(1) {
$830 = HEAP32[$39>>2]|0;
$831 = $830 << 2;
$832 = (_setup_malloc($f,$831)|0);
$833 = (((($f)) + 800|0) + ($i$7114<<2)|0);
HEAP32[$833>>2] = $832;
$834 = HEAP32[$39>>2]|0;
$835 = $834 << 1;
$836 = $835 & 2147483646;
$837 = (_setup_malloc($f,$836)|0);
$838 = (((($f)) + 928|0) + ($i$7114<<2)|0);
HEAP32[$838>>2] = $837;
$839 = (_setup_malloc($f,$longest_floorlist$0$lcssa)|0);
$840 = (((($f)) + 996|0) + ($i$7114<<2)|0);
HEAP32[$840>>2] = $839;
$841 = HEAP32[$833>>2]|0;
$842 = ($841|0)==(0|0);
if ($842) {
break;
}
$843 = HEAP32[$838>>2]|0;
$844 = ($843|0)==(0|0);
$845 = ($839|0)==(0|0);
$or$cond14 = $845 | $844;
$828 = (($i$7114) + 1)|0;
if ($or$cond14) {
break;
}
$827 = HEAP32[$27>>2]|0;
$829 = ($828|0)<($827|0);
if ($829) {
$i$7114 = $828;
} else {
break L458;
}
}
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
} while(0);
$846 = HEAP32[$37>>2]|0;
$847 = (_init_blocksize($f,0,$846)|0);
$848 = ($847|0)==(0);
if ($848) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$849 = HEAP32[$39>>2]|0;
$850 = (_init_blocksize($f,1,$849)|0);
$851 = ($850|0)==(0);
if ($851) {
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
$852 = HEAP32[$37>>2]|0;
$853 = ((($f)) + 104|0);
HEAP32[$853>>2] = $852;
$854 = HEAP32[$39>>2]|0;
$855 = ((($f)) + 108|0);
HEAP32[$855>>2] = $854;
$856 = HEAP32[$39>>2]|0;
$857 = $856 << 1;
$858 = $857 & 2147483646;
$859 = HEAP32[$555>>2]|0;
$860 = ($859|0)>(0);
if ($860) {
$861 = HEAP32[$558>>2]|0;
$862 = HEAP32[$555>>2]|0;
$i9$0109 = 0;$max_part_read$0110 = 0;
while(1) {
$863 = (((($861) + (($i9$0109*24)|0)|0)) + 4|0);
$864 = HEAP32[$863>>2]|0;
$865 = (($861) + (($i9$0109*24)|0)|0);
$866 = HEAP32[$865>>2]|0;
$867 = (($864) - ($866))|0;
$868 = (((($861) + (($i9$0109*24)|0)|0)) + 8|0);
$869 = HEAP32[$868>>2]|0;
$870 = (($867>>>0) / ($869>>>0))&-1;
$871 = ($870|0)>($max_part_read$0110|0);
$$max_part_read$0 = $871 ? $870 : $max_part_read$0110;
$872 = (($i9$0109) + 1)|0;
$873 = ($872|0)<($862|0);
if ($873) {
$i9$0109 = $872;$max_part_read$0110 = $$max_part_read$0;
} else {
$$max_part_read$0$lcssa = $$max_part_read$0;
break;
}
}
$phitmp = $$max_part_read$0$lcssa << 2;
$phitmp233 = (($phitmp) + 4)|0;
$max_part_read$0$lcssa = $phitmp233;
} else {
$max_part_read$0$lcssa = 4;
}
$874 = HEAP32[$27>>2]|0;
$875 = Math_imul($874, $max_part_read$0$lcssa)|0;
$876 = ((($f)) + 12|0);
$877 = ($858>>>0)>($875>>>0);
$$15 = $877 ? $858 : $875;
HEAP32[$876>>2] = $$15;
$878 = ((($f)) + 1377|0);
HEAP8[$878>>0] = 1;
$879 = ((($f)) + 80|0);
$880 = HEAP32[$879>>2]|0;
$881 = ($880|0)==(0|0);
do {
if (!($881)) {
$882 = ((($f)) + 92|0);
$883 = HEAP32[$882>>2]|0;
$884 = ((($f)) + 84|0);
$885 = HEAP32[$884>>2]|0;
$886 = ($883|0)==($885|0);
if (!($886)) {
___assert_fail((15813|0),(15523|0),3780,(15869|0));
// unreachable;
}
$887 = ((($f)) + 88|0);
$888 = HEAP32[$887>>2]|0;
$889 = (($888) + 1512)|0;
$890 = HEAP32[$876>>2]|0;
$891 = (($889) + ($890))|0;
$892 = ($891>>>0)>($883>>>0);
if (!($892)) {
break;
}
_error($f,3);
$$4 = 0;
STACKTOP = sp;return ($$4|0);
}
} while(0);
$893 = (_stb_vorbis_get_file_offset($f)|0);
$894 = ((($f)) + 52|0);
HEAP32[$894>>2] = $893;
$$4 = 1;
STACKTOP = sp;return ($$4|0);
}
function _vorbis_alloc($f) {
$f = $f|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_setup_malloc($f,1512)|0);
return ($0|0);
}
function _vorbis_pump_first_frame($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $left = 0, $len = 0, $right = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$len = sp + 8|0;
$right = sp + 4|0;
$left = sp;
$0 = (_vorbis_decode_packet($f,$len,$left,$right)|0);
$1 = ($0|0)==(0);
if ($1) {
STACKTOP = sp;return;
}
$2 = HEAP32[$len>>2]|0;
$3 = HEAP32[$left>>2]|0;
$4 = HEAP32[$right>>2]|0;
(_vorbis_finish_frame($f,$2,$3,$4)|0);
STACKTOP = sp;return;
}
function _maybe_start_packet($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1380|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(-1);
if ($2) {
$3 = (_get8($f)|0);
$4 = ((($f)) + 96|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)==(0);
if (!($6)) {
$$0 = 0;
return ($$0|0);
}
$7 = ($3<<24>>24)==(79);
if (!($7)) {
_error($f,30);
$$0 = 0;
return ($$0|0);
}
$8 = (_get8($f)|0);
$9 = ($8<<24>>24)==(103);
if (!($9)) {
_error($f,30);
$$0 = 0;
return ($$0|0);
}
$10 = (_get8($f)|0);
$11 = ($10<<24>>24)==(103);
if (!($11)) {
_error($f,30);
$$0 = 0;
return ($$0|0);
}
$12 = (_get8($f)|0);
$13 = ($12<<24>>24)==(83);
if (!($13)) {
_error($f,30);
$$0 = 0;
return ($$0|0);
}
$14 = (_start_page_no_capturepattern($f)|0);
$15 = ($14|0)==(0);
if ($15) {
$$0 = 0;
return ($$0|0);
}
$16 = ((($f)) + 1375|0);
$17 = HEAP8[$16>>0]|0;
$18 = $17 & 1;
$19 = ($18<<24>>24)==(0);
if (!($19)) {
$20 = ((($f)) + 1384|0);
HEAP32[$20>>2] = 0;
$21 = ((($f)) + 1376|0);
HEAP8[$21>>0] = 0;
_error($f,32);
$$0 = 0;
return ($$0|0);
}
}
$22 = (_start_packet($f)|0);
$$0 = $22;
return ($$0|0);
}
function _flush_packet($f) {
$f = $f|0;
var $0 = 0, $1 = 0, label = 0, sp = 0;
sp = STACKTOP;
while(1) {
$0 = (_get8_packet_raw($f)|0);
$1 = ($0|0)==(-1);
if ($1) {
break;
}
}
return;
}
function _set_file_offset($f,$loc) {
$f = $f|0;
$loc = $loc|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 48|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if (!($2)) {
return;
}
$3 = ((($f)) + 96|0);
HEAP32[$3>>2] = 0;
$4 = ((($f)) + 32|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)==(0|0);
if (!($6)) {
$7 = ((($f)) + 36|0);
$8 = HEAP32[$7>>2]|0;
$9 = (($8) + ($loc)|0);
$10 = ((($f)) + 40|0);
$11 = HEAP32[$10>>2]|0;
$12 = ($9>>>0)>=($11>>>0);
$13 = ($loc|0)<(0);
$or$cond1 = $13 | $12;
if ($or$cond1) {
$14 = HEAP32[$10>>2]|0;
HEAP32[$4>>2] = $14;
HEAP32[$3>>2] = 1;
return;
} else {
HEAP32[$4>>2] = $9;
return;
}
}
$15 = ((($f)) + 24|0);
$16 = HEAP32[$15>>2]|0;
$17 = (($16) + ($loc))|0;
$18 = ($17>>>0)<($loc>>>0);
$19 = ($loc|0)<(0);
$or$cond = $19 | $18;
if ($or$cond) {
HEAP32[$3>>2] = 1;
$$0 = 2147483647;
} else {
$$0 = $17;
}
$20 = ((($f)) + 20|0);
$21 = HEAP32[$20>>2]|0;
$22 = (_fseek($21,$$0,0)|0);
$23 = ($22|0)==(0);
if ($23) {
return;
}
HEAP32[$3>>2] = 1;
$24 = HEAP32[$20>>2]|0;
$25 = HEAP32[$15>>2]|0;
(_fseek($24,$25,2)|0);
return;
}
function _vorbis_find_page($f,$end,$last) {
$f = $f|0;
$end = $end|0;
$last = $last|0;
var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa58 = 0, $$lcssa59 = 0, $$lcssa61 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0;
var $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0;
var $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $crc$011 = 0, $crc$113 = 0, $crc$2$lcssa = 0, $crc$219 = 0, $exitcond = 0, $exitcond40 = 0, $header = 0, $i$0$lcssa = 0, $i1$310 = 0, $i1$412 = 0;
var $i1$518 = 0, $len$014 = 0, $scevgep = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$header = sp;
$0 = ((($f)) + 96|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if (!($2)) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$3 = ((($f)) + 44|0);
$4 = ((($header)) + 4|0);
$5 = ((($header)) + 22|0);
$6 = ((($header)) + 23|0);
$7 = ((($header)) + 24|0);
$8 = ((($header)) + 25|0);
$9 = ((($header)) + 26|0);
$scevgep = ((($header)) + 22|0);
$10 = ((($header)) + 4|0);
$11 = ((($header)) + 5|0);
$12 = ((($header)) + 6|0);
$13 = ((($header)) + 7|0);
$14 = ((($header)) + 8|0);
$15 = ((($header)) + 9|0);
$16 = ((($header)) + 10|0);
$17 = ((($header)) + 11|0);
$18 = ((($header)) + 12|0);
$19 = ((($header)) + 13|0);
$20 = ((($header)) + 14|0);
$21 = ((($header)) + 15|0);
$22 = ((($header)) + 16|0);
$23 = ((($header)) + 17|0);
$24 = ((($header)) + 18|0);
$25 = ((($header)) + 19|0);
$26 = ((($header)) + 20|0);
$27 = ((($header)) + 21|0);
$28 = ((($header)) + 22|0);
$29 = ((($header)) + 23|0);
$30 = ((($header)) + 24|0);
$31 = ((($header)) + 25|0);
$32 = ((($header)) + 26|0);
while(1) {
$33 = (_get8($f)|0);
$34 = ($33<<24>>24)==(79);
if ($34) {
$35 = (_stb_vorbis_get_file_offset($f)|0);
$36 = (($35) + -25)|0;
$37 = HEAP32[$3>>2]|0;
$38 = ($36>>>0)>($37>>>0);
if ($38) {
$$0 = 0;
label = 29;
break;
}
$39 = (_get8($f)|0);
$40 = HEAP8[(5821)>>0]|0;
$41 = ($39<<24>>24)==($40<<24>>24);
if ($41) {
$42 = (_get8($f)|0);
$43 = HEAP8[(5822)>>0]|0;
$44 = ($42<<24>>24)==($43<<24>>24);
if ($44) {
$121 = (_get8($f)|0);
$122 = HEAP8[(5823)>>0]|0;
$123 = ($121<<24>>24)==($122<<24>>24);
$$ = $123 ? 4 : 3;
$i$0$lcssa = $$;
} else {
$i$0$lcssa = 2;
}
} else {
$i$0$lcssa = 1;
}
$45 = HEAP32[$0>>2]|0;
$46 = ($45|0)==(0);
if (!($46)) {
$$0 = 0;
label = 29;
break;
}
$47 = ($i$0$lcssa|0)==(4);
if ($47) {
$48 = HEAP32[5820>>2]|0;
HEAP32[$header>>2] = $48;
$49 = (_get8($f)|0);
HEAP8[$10>>0] = $49;
$50 = (_get8($f)|0);
HEAP8[$11>>0] = $50;
$51 = (_get8($f)|0);
HEAP8[$12>>0] = $51;
$52 = (_get8($f)|0);
HEAP8[$13>>0] = $52;
$53 = (_get8($f)|0);
HEAP8[$14>>0] = $53;
$54 = (_get8($f)|0);
HEAP8[$15>>0] = $54;
$55 = (_get8($f)|0);
HEAP8[$16>>0] = $55;
$56 = (_get8($f)|0);
HEAP8[$17>>0] = $56;
$57 = (_get8($f)|0);
HEAP8[$18>>0] = $57;
$58 = (_get8($f)|0);
HEAP8[$19>>0] = $58;
$59 = (_get8($f)|0);
HEAP8[$20>>0] = $59;
$60 = (_get8($f)|0);
HEAP8[$21>>0] = $60;
$61 = (_get8($f)|0);
HEAP8[$22>>0] = $61;
$62 = (_get8($f)|0);
HEAP8[$23>>0] = $62;
$63 = (_get8($f)|0);
HEAP8[$24>>0] = $63;
$64 = (_get8($f)|0);
HEAP8[$25>>0] = $64;
$65 = (_get8($f)|0);
HEAP8[$26>>0] = $65;
$66 = (_get8($f)|0);
HEAP8[$27>>0] = $66;
$67 = (_get8($f)|0);
HEAP8[$28>>0] = $67;
$68 = (_get8($f)|0);
HEAP8[$29>>0] = $68;
$69 = (_get8($f)|0);
HEAP8[$30>>0] = $69;
$70 = (_get8($f)|0);
HEAP8[$31>>0] = $70;
$71 = (_get8($f)|0);
HEAP8[$32>>0] = $71;
$72 = HEAP32[$0>>2]|0;
$73 = ($72|0)==(0);
if (!($73)) {
$$0 = 0;
label = 29;
break;
}
$74 = HEAP8[$4>>0]|0;
$75 = ($74<<24>>24)==(0);
if ($75) {
$76 = HEAP8[$5>>0]|0;
$77 = HEAP8[$6>>0]|0;
$78 = HEAP8[$7>>0]|0;
$79 = HEAP8[$8>>0]|0;
$80 = $79&255;
$81 = $80 << 24;
HEAP16[$scevgep>>1]=0&65535;HEAP16[$scevgep+2>>1]=0>>>16;
$82 = $78&255;
$83 = $82 << 16;
$84 = $77&255;
$85 = $84 << 8;
$86 = $76&255;
$87 = $85 | $86;
$88 = $87 | $83;
$crc$011 = 0;$i1$310 = 0;
while(1) {
$94 = (($header) + ($i1$310)|0);
$95 = HEAP8[$94>>0]|0;
$96 = (_crc32_update($crc$011,$95)|0);
$97 = (($i1$310) + 1)|0;
$exitcond = ($97|0)==(27);
if ($exitcond) {
$$lcssa = $96;
break;
} else {
$crc$011 = $96;$i1$310 = $97;
}
}
$89 = $88 | $81;
$90 = HEAP8[$9>>0]|0;
$91 = ($90<<24>>24)==(0);
if ($91) {
$crc$2$lcssa = $$lcssa;
} else {
$92 = HEAP8[$9>>0]|0;
$93 = $92&255;
$crc$113 = $$lcssa;$i1$412 = 0;$len$014 = 0;
while(1) {
$98 = (_get8($f)|0);
$99 = $98&255;
$100 = (_crc32_update($crc$113,$98)|0);
$101 = (($99) + ($len$014))|0;
$102 = (($i1$412) + 1)|0;
$103 = ($102>>>0)<($93>>>0);
if ($103) {
$crc$113 = $100;$i1$412 = $102;$len$014 = $101;
} else {
$$lcssa58 = $100;$$lcssa59 = $101;
break;
}
}
$104 = ($$lcssa59|0)==(0);
if ($104) {
$crc$2$lcssa = $$lcssa58;
} else {
$105 = HEAP32[$0>>2]|0;
$106 = ($105|0)==(0);
if ($106) {
$crc$219 = $$lcssa58;$i1$518 = 0;
} else {
$$0 = 0;
label = 29;
break;
}
while(1) {
$107 = (_get8($f)|0);
$108 = (_crc32_update($crc$219,$107)|0);
$109 = (($i1$518) + 1)|0;
$exitcond40 = ($109|0)==($$lcssa59|0);
if ($exitcond40) {
$crc$2$lcssa = $108;
break;
} else {
$crc$219 = $108;$i1$518 = $109;
}
}
}
}
$110 = ($crc$2$lcssa|0)==($89|0);
if ($110) {
$$lcssa61 = $35;
label = 20;
break;
}
}
}
_set_file_offset($f,$35);
}
$119 = HEAP32[$0>>2]|0;
$120 = ($119|0)==(0);
if (!($120)) {
$$0 = 0;
label = 29;
break;
}
}
if ((label|0) == 20) {
$111 = ($end|0)==(0|0);
if (!($111)) {
$112 = (_stb_vorbis_get_file_offset($f)|0);
HEAP32[$end>>2] = $112;
}
$113 = ($last|0)==(0|0);
do {
if (!($113)) {
$114 = ((($header)) + 5|0);
$115 = HEAP8[$114>>0]|0;
$116 = $115 & 4;
$117 = ($116<<24>>24)==(0);
if ($117) {
HEAP32[$last>>2] = 0;
break;
} else {
HEAP32[$last>>2] = 1;
break;
}
}
} while(0);
$118 = (($$lcssa61) + -1)|0;
_set_file_offset($f,$118);
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 29) {
STACKTOP = sp;return ($$0|0);
}
return (0)|0;
}
function _getn($z,$data,$n) {
$z = $z|0;
$data = $data|0;
$n = $n|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 32|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$10 = ((($z)) + 20|0);
$11 = HEAP32[$10>>2]|0;
$12 = (_fread($data,$n,1,$11)|0);
$13 = ($12|0)==(1);
if ($13) {
$$0 = 1;
return ($$0|0);
}
$14 = ((($z)) + 96|0);
HEAP32[$14>>2] = 1;
$$0 = 0;
return ($$0|0);
}
$3 = (($1) + ($n)|0);
$4 = ((($z)) + 40|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($3>>>0)>($5>>>0);
if ($6) {
$7 = ((($z)) + 96|0);
HEAP32[$7>>2] = 1;
$$0 = 0;
return ($$0|0);
} else {
_memcpy(($data|0),($1|0),($n|0))|0;
$8 = HEAP32[$0>>2]|0;
$9 = (($8) + ($n)|0);
HEAP32[$0>>2] = $9;
$$0 = 1;
return ($$0|0);
}
return (0)|0;
}
function _get32($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_get8($f)|0);
$1 = $0&255;
$2 = (_get8($f)|0);
$3 = $2&255;
$4 = $3 << 8;
$5 = $4 | $1;
$6 = (_get8($f)|0);
$7 = $6&255;
$8 = $7 << 16;
$9 = $5 | $8;
$10 = (_get8($f)|0);
$11 = $10&255;
$12 = $11 << 24;
$13 = $9 | $12;
return ($13|0);
}
function _convert_channels_short_interleaved($buf_c,$buffer,$data_c,$data,$d_offset,$len) {
$buf_c = $buf_c|0;
$buffer = $buffer|0;
$data_c = $data_c|0;
$data = $data|0;
$d_offset = $d_offset|0;
$len = $len|0;
var $$017 = 0, $$1$lcssa = 0, $$19 = 0, $$2$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond20 = 0, $exitcond25 = 0, $i$07 = 0, $i$1$lcssa = 0, $i$18 = 0, $j$016 = 0;
var $or$cond = 0, $or$cond3 = 0, $scevgep = 0, $scevgep21$sum = 0, $scevgep22 = 0, $v$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($buf_c|0)!=($data_c|0);
$1 = ($buf_c|0)<(3);
$or$cond = $1 & $0;
$2 = ($data_c|0)<(7);
$or$cond3 = $2 & $or$cond;
if ($or$cond3) {
$3 = ($buf_c|0)==(2);
if ($3) {
$i$07 = 0;
} else {
___assert_fail((15561|0),(15523|0),4820,(15572|0));
// unreachable;
}
while(1) {
_compute_stereo_samples($buffer,$data_c,$data,$d_offset,$len);
$4 = (($i$07) + 1)|0;
$exitcond = ($4|0)==($buf_c|0);
if ($exitcond) {
break;
} else {
$i$07 = $4;
}
}
return;
}
$5 = ($len|0)>(0);
if (!($5)) {
return;
}
$6 = ($buf_c|0)<($data_c|0);
$7 = $6 ? $buf_c : $data_c;
$8 = ($7|0)>(0);
$9 = ($data_c|0)<($buf_c|0);
$10 = $9 ? $data_c : $buf_c;
$$017 = $buffer;$j$016 = 0;
while(1) {
if ($8) {
$11 = (($j$016) + ($d_offset))|0;
$$19 = $$017;$i$18 = 0;
while(1) {
$13 = (($data) + ($i$18<<2)|0);
$14 = HEAP32[$13>>2]|0;
$15 = (($14) + ($11<<2)|0);
$16 = +HEAPF32[$15>>2];
$17 = $16 + 384.0;
$18 = (HEAPF32[tempDoublePtr>>2]=$17,HEAP32[tempDoublePtr>>2]|0);
$19 = (($18) + -1136623616)|0;
$20 = ($19>>>0)>(65535);
$21 = ($18|0)<(1136656384);
$22 = $21 ? 32768 : 32767;
$v$0 = $20 ? $22 : $18;
$23 = $v$0&65535;
$24 = ((($$19)) + 2|0);
HEAP16[$$19>>1] = $23;
$25 = (($i$18) + 1)|0;
$exitcond20 = ($25|0)==($10|0);
if ($exitcond20) {
break;
} else {
$$19 = $24;$i$18 = $25;
}
}
$scevgep = (($$017) + ($10<<1)|0);
$$1$lcssa = $scevgep;$i$1$lcssa = $10;
} else {
$$1$lcssa = $$017;$i$1$lcssa = 0;
}
$12 = ($i$1$lcssa|0)<($buf_c|0);
if ($12) {
$26 = (($buf_c) - ($i$1$lcssa))|0;
$27 = $26 << 1;
_memset(($$1$lcssa|0),0,($27|0))|0;
$scevgep21$sum = (($buf_c) - ($i$1$lcssa))|0;
$scevgep22 = (($$1$lcssa) + ($scevgep21$sum<<1)|0);
$$2$lcssa = $scevgep22;
} else {
$$2$lcssa = $$1$lcssa;
}
$28 = (($j$016) + 1)|0;
$exitcond25 = ($28|0)==($len|0);
if ($exitcond25) {
break;
} else {
$$017 = $$2$lcssa;$j$016 = $28;
}
}
return;
}
function _Vector2Distance($v1,$v2) {
$v1 = $v1|0;
$v2 = $v2|0;
var $0 = 0.0, $1 = 0.0, $10 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$v2>>2];
$1 = +HEAPF32[$v1>>2];
$2 = $0 - $1;
$3 = ((($v2)) + 4|0);
$4 = +HEAPF32[$3>>2];
$5 = ((($v1)) + 4|0);
$6 = +HEAPF32[$5>>2];
$7 = $4 - $6;
$8 = $2 * $2;
$9 = $7 * $7;
$10 = $8 + $9;
$sqrtf = (+Math_sqrt((+$10)));
return (+$sqrtf);
}
function _Vector2Angle($initialPosition,$finalPosition) {
$initialPosition = $initialPosition|0;
$finalPosition = $finalPosition|0;
var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $angle$0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($finalPosition)) + 4|0);
$1 = +HEAPF32[$0>>2];
$2 = ((($initialPosition)) + 4|0);
$3 = +HEAPF32[$2>>2];
$4 = $1 - $3;
$5 = $4;
$6 = +HEAPF32[$finalPosition>>2];
$7 = +HEAPF32[$initialPosition>>2];
$8 = $6 - $7;
$9 = $8;
$10 = (+Math_atan2((+$5),(+$9)));
$11 = $10;
$12 = $11;
$13 = $12 * 57.295779513082323;
$14 = $13;
$15 = $14 < 0.0;
$16 = $14 + 360.0;
$angle$0 = $15 ? $16 : $14;
return (+$angle$0);
}
function _compute_stereo_samples($output,$num_c,$data,$d_offset,$len) {
$output = $output|0;
$num_c = $num_c|0;
$data = $data|0;
$d_offset = $d_offset|0;
$len = $len|0;
var $$n$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0;
var $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0.0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $9 = 0, $buffer = 0, $exitcond = 0, $exitcond23 = 0, $exitcond27 = 0, $exitcond28 = 0, $exitcond34 = 0, $i$09 = 0, $i$17 = 0, $i$26 = 0, $i$313 = 0, $indvars$iv$next30 = 0, $indvars$iv$next32 = 0, $indvars$iv29 = 0, $indvars$iv31 = 0, $j$011 = 0;
var $n$015 = 0, $o$016 = 0, $smax = 0, $smax22 = 0, $smax26 = 0, $smax33 = 0, $v$0 = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 128|0;
$buffer = sp;
$0 = ($len|0)>(0);
if (!($0)) {
STACKTOP = sp;return;
}
$1 = ($num_c|0)>(0);
$2 = $len ^ -1;
$indvars$iv29 = -2;$indvars$iv31 = -1;$n$015 = 16;$o$016 = 0;
while(1) {
$3 = $o$016 << 1;
dest=$buffer; stop=dest+128|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$4 = (($o$016) + ($n$015))|0;
$5 = ($4|0)>($len|0);
$6 = (($len) - ($o$016))|0;
$$n$0 = $5 ? $6 : $n$015;
L6: do {
if ($1) {
$7 = ($$n$0|0)>(0);
$8 = (($o$016) + ($d_offset))|0;
$9 = ($$n$0|0)>(0);
$10 = (($o$016) + ($d_offset))|0;
$11 = ($$n$0|0)>(0);
$12 = (($o$016) + ($d_offset))|0;
$13 = (($indvars$iv31) - ($n$015))|0;
$14 = ($13|0)>($2|0);
$smax = $14 ? $13 : $2;
$15 = (($indvars$iv31) - ($smax))|0;
$16 = (($indvars$iv31) - ($n$015))|0;
$17 = ($16|0)>($2|0);
$smax22 = $17 ? $16 : $2;
$18 = (($indvars$iv31) - ($smax22))|0;
$19 = (($indvars$iv31) - ($n$015))|0;
$20 = ($19|0)>($2|0);
$smax26 = $20 ? $19 : $2;
$21 = (($indvars$iv31) - ($smax26))|0;
$j$011 = 0;
while(1) {
$28 = ((15607 + (($num_c*6)|0)|0) + ($j$011)|0);
$29 = HEAP8[$28>>0]|0;
$30 = $29&255;
$31 = $30 & 6;
switch ($31|0) {
case 6: {
if ($7) {
$36 = (($data) + ($j$011<<2)|0);
$37 = HEAP32[$36>>2]|0;
$i$09 = 0;
while(1) {
$38 = (($8) + ($i$09))|0;
$39 = (($37) + ($38<<2)|0);
$40 = +HEAPF32[$39>>2];
$41 = $i$09 << 1;
$42 = (($buffer) + ($41<<2)|0);
$43 = +HEAPF32[$42>>2];
$44 = $40 + $43;
HEAPF32[$42>>2] = $44;
$45 = (($37) + ($38<<2)|0);
$46 = +HEAPF32[$45>>2];
$47 = $41 | 1;
$48 = (($buffer) + ($47<<2)|0);
$49 = +HEAPF32[$48>>2];
$50 = $46 + $49;
HEAPF32[$48>>2] = $50;
$51 = (($i$09) + 1)|0;
$exitcond27 = ($51|0)==($21|0);
if ($exitcond27) {
break;
} else {
$i$09 = $51;
}
}
}
break;
}
case 2: {
if ($9) {
$34 = (($data) + ($j$011<<2)|0);
$35 = HEAP32[$34>>2]|0;
$i$17 = 0;
while(1) {
$52 = (($10) + ($i$17))|0;
$53 = (($35) + ($52<<2)|0);
$54 = +HEAPF32[$53>>2];
$55 = $i$17 << 1;
$56 = (($buffer) + ($55<<2)|0);
$57 = +HEAPF32[$56>>2];
$58 = $54 + $57;
HEAPF32[$56>>2] = $58;
$59 = (($i$17) + 1)|0;
$exitcond23 = ($59|0)==($18|0);
if ($exitcond23) {
break;
} else {
$i$17 = $59;
}
}
}
break;
}
case 4: {
if ($11) {
$32 = (($data) + ($j$011<<2)|0);
$33 = HEAP32[$32>>2]|0;
$i$26 = 0;
while(1) {
$60 = (($12) + ($i$26))|0;
$61 = (($33) + ($60<<2)|0);
$62 = +HEAPF32[$61>>2];
$63 = $i$26 << 1;
$64 = $63 | 1;
$65 = (($buffer) + ($64<<2)|0);
$66 = +HEAPF32[$65>>2];
$67 = $62 + $66;
HEAPF32[$65>>2] = $67;
$68 = (($i$26) + 1)|0;
$exitcond = ($68|0)==($15|0);
if ($exitcond) {
break;
} else {
$i$26 = $68;
}
}
}
break;
}
default: {
}
}
$69 = (($j$011) + 1)|0;
$exitcond28 = ($69|0)==($num_c|0);
if ($exitcond28) {
break L6;
} else {
$j$011 = $69;
}
}
}
} while(0);
$22 = $$n$0 << 1;
$23 = ($22|0)>(0);
if ($23) {
$24 = (($indvars$iv31) - ($n$015))|0;
$25 = ($24|0)>($2|0);
$smax33 = $25 ? $24 : $2;
$26 = $smax33 << 1;
$27 = (($indvars$iv29) - ($26))|0;
$i$313 = 0;
while(1) {
$70 = (($buffer) + ($i$313<<2)|0);
$71 = +HEAPF32[$70>>2];
$72 = $71 + 384.0;
$73 = (HEAPF32[tempDoublePtr>>2]=$72,HEAP32[tempDoublePtr>>2]|0);
$74 = (($73) + -1136623616)|0;
$75 = ($74>>>0)>(65535);
$76 = ($73|0)<(1136656384);
$77 = $76 ? 32768 : 32767;
$v$0 = $75 ? $77 : $73;
$78 = $v$0&65535;
$79 = (($i$313) + ($3))|0;
$80 = (($output) + ($79<<1)|0);
HEAP16[$80>>1] = $78;
$81 = (($i$313) + 1)|0;
$exitcond34 = ($81|0)==($27|0);
if ($exitcond34) {
break;
} else {
$i$313 = $81;
}
}
}
$82 = (($o$016) + 16)|0;
$83 = ($82|0)<($len|0);
$indvars$iv$next32 = (($indvars$iv31) + -16)|0;
$indvars$iv$next30 = (($indvars$iv29) + -32)|0;
if ($83) {
$indvars$iv29 = $indvars$iv$next30;$indvars$iv31 = $indvars$iv$next32;$n$015 = $$n$0;$o$016 = $82;
} else {
break;
}
}
STACKTOP = sp;return;
}
function _get8($z) {
$z = $z|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 32|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$9 = ((($z)) + 20|0);
$10 = HEAP32[$9>>2]|0;
$11 = (_fgetc($10)|0);
$12 = ($11|0)==(-1);
if ($12) {
$13 = ((($z)) + 96|0);
HEAP32[$13>>2] = 1;
$$0 = 0;
return ($$0|0);
} else {
$14 = $11&255;
$$0 = $14;
return ($$0|0);
}
} else {
$3 = ((($z)) + 40|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($1>>>0)<($4>>>0);
if ($5) {
$7 = ((($1)) + 1|0);
HEAP32[$0>>2] = $7;
$8 = HEAP8[$1>>0]|0;
$$0 = $8;
return ($$0|0);
} else {
$6 = ((($z)) + 96|0);
HEAP32[$6>>2] = 1;
$$0 = 0;
return ($$0|0);
}
}
return (0)|0;
}
function _crc32_update($crc,$byte) {
$crc = $crc|0;
$byte = $byte|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $crc << 8;
$1 = $byte&255;
$2 = $crc >>> 24;
$3 = $1 ^ $2;
$4 = (5824 + ($3<<2)|0);
$5 = HEAP32[$4>>2]|0;
$6 = $5 ^ $0;
return ($6|0);
}
function _get8_packet_raw($f) {
$f = $f|0;
var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1376|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if ($2) {
$3 = ((($f)) + 1384|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(0);
if (!($5)) {
$$0 = -1;
return ($$0|0);
}
$6 = (_next_segment($f)|0);
$7 = ($6|0)==(0);
if ($7) {
$$0 = -1;
return ($$0|0);
}
$$pr = HEAP8[$0>>0]|0;
$8 = ($$pr<<24>>24)==(0);
if ($8) {
___assert_fail((15649|0),(15523|0),1132,(15669|0));
// unreachable;
} else {
$10 = $$pr;
}
} else {
$10 = $1;
}
$9 = (($10) + -1)<<24>>24;
HEAP8[$0>>0] = $9;
$11 = ((($f)) + 1400|0);
$12 = HEAP32[$11>>2]|0;
$13 = (($12) + 1)|0;
HEAP32[$11>>2] = $13;
$14 = (_get8($f)|0);
$15 = $14&255;
$$0 = $15;
return ($$0|0);
}
function _next_segment($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1384|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if (!($2)) {
$$0 = 0;
return ($$0|0);
}
$3 = ((($f)) + 1380|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(-1);
if ($5) {
$6 = ((($f)) + 1116|0);
$7 = HEAP32[$6>>2]|0;
$8 = (($7) + -1)|0;
$9 = ((($f)) + 1388|0);
HEAP32[$9>>2] = $8;
$10 = (_start_page($f)|0);
$11 = ($10|0)==(0);
if ($11) {
HEAP32[$0>>2] = 1;
$$0 = 0;
return ($$0|0);
}
$12 = ((($f)) + 1375|0);
$13 = HEAP8[$12>>0]|0;
$14 = $13 & 1;
$15 = ($14<<24>>24)==(0);
if ($15) {
_error($f,32);
$$0 = 0;
return ($$0|0);
}
}
$16 = HEAP32[$3>>2]|0;
$17 = (($16) + 1)|0;
HEAP32[$3>>2] = $17;
$18 = (((($f)) + 1120|0) + ($16)|0);
$19 = HEAP8[$18>>0]|0;
$20 = $19&255;
$21 = ($19<<24>>24)==(-1);
if (!($21)) {
HEAP32[$0>>2] = 1;
$22 = HEAP32[$3>>2]|0;
$23 = (($22) + -1)|0;
$24 = ((($f)) + 1388|0);
HEAP32[$24>>2] = $23;
}
$25 = HEAP32[$3>>2]|0;
$26 = ((($f)) + 1116|0);
$27 = HEAP32[$26>>2]|0;
$28 = ($25|0)<($27|0);
if (!($28)) {
HEAP32[$3>>2] = -1;
}
$29 = ((($f)) + 1376|0);
$30 = HEAP8[$29>>0]|0;
$31 = ($30<<24>>24)==(0);
if (!($31)) {
___assert_fail((15685|0),(15523|0),1118,(15706|0));
// unreachable;
}
HEAP8[$29>>0] = $19;
$$0 = $20;
return ($$0|0);
}
function _start_page($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_capture_pattern($f)|0);
$1 = ($0|0)==(0);
if ($1) {
_error($f,30);
$$0 = 0;
return ($$0|0);
} else {
$2 = (_start_page_no_capturepattern($f)|0);
$$0 = $2;
return ($$0|0);
}
return (0)|0;
}
function _capture_pattern($f) {
$f = $f|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_get8($f)|0);
$1 = ($0<<24>>24)==(79);
if ($1) {
$2 = (_get8($f)|0);
$3 = ($2<<24>>24)==(103);
if ($3) {
$4 = (_get8($f)|0);
$5 = ($4<<24>>24)==(103);
if ($5) {
$6 = (_get8($f)|0);
$7 = ($6<<24>>24)==(83);
$$ = $7&1;
$$0 = $$;
} else {
$$0 = 0;
}
} else {
$$0 = 0;
}
} else {
$$0 = 0;
}
return ($$0|0);
}
function _start_page_no_capturepattern($f) {
$f = $f|0;
var $$0 = 0, $$lcssa = 0, $$lcssa14 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$in = 0, $i$0$lcssa15 = 0, $i1$04 = 0, $len$0$lcssa = 0, $len$03 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_get8($f)|0);
$1 = ($0<<24>>24)==(0);
if (!($1)) {
_error($f,31);
$$0 = 0;
return ($$0|0);
}
$2 = (_get8($f)|0);
$3 = ((($f)) + 1375|0);
HEAP8[$3>>0] = $2;
$4 = (_get32($f)|0);
$5 = (_get32($f)|0);
(_get32($f)|0);
$6 = (_get32($f)|0);
$7 = ((($f)) + 1112|0);
HEAP32[$7>>2] = $6;
(_get32($f)|0);
$8 = (_get8($f)|0);
$9 = $8&255;
$10 = ((($f)) + 1116|0);
HEAP32[$10>>2] = $9;
$11 = ((($f)) + 1120|0);
$12 = (_getn($f,$11,$9)|0);
$13 = ($12|0)==(0);
if ($13) {
_error($f,10);
$$0 = 0;
return ($$0|0);
}
$14 = ((($f)) + 1404|0);
HEAP32[$14>>2] = -2;
$15 = $5 & $4;
$16 = ($15|0)==(-1);
L9: do {
if (!($16)) {
$17 = HEAP32[$10>>2]|0;
$i$0$in = $17;
while(1) {
$i$0 = (($i$0$in) + -1)|0;
$18 = ($i$0$in|0)>(0);
if (!($18)) {
break L9;
}
$19 = (((($f)) + 1120|0) + ($i$0)|0);
$20 = HEAP8[$19>>0]|0;
$21 = ($20<<24>>24)==(-1);
if ($21) {
$i$0$in = $i$0;
} else {
$i$0$lcssa15 = $i$0;
break;
}
}
HEAP32[$14>>2] = $i$0$lcssa15;
$22 = ((($f)) + 1408|0);
HEAP32[$22>>2] = $4;
}
} while(0);
$23 = ((($f)) + 1377|0);
$24 = HEAP8[$23>>0]|0;
$25 = ($24<<24>>24)==(0);
if (!($25)) {
$26 = HEAP32[$10>>2]|0;
$27 = ($26|0)>(0);
if ($27) {
$28 = HEAP32[$10>>2]|0;
$i1$04 = 0;$len$03 = 0;
while(1) {
$29 = (((($f)) + 1120|0) + ($i1$04)|0);
$30 = HEAP8[$29>>0]|0;
$31 = $30&255;
$32 = (($31) + ($len$03))|0;
$33 = (($i1$04) + 1)|0;
$34 = ($33|0)<($28|0);
if ($34) {
$i1$04 = $33;$len$03 = $32;
} else {
$$lcssa14 = $32;
break;
}
}
$phitmp = (($$lcssa14) + 27)|0;
$$lcssa = $28;$len$0$lcssa = $phitmp;
} else {
$$lcssa = $26;$len$0$lcssa = 27;
}
$35 = ((($f)) + 52|0);
$36 = HEAP32[$35>>2]|0;
$37 = (($len$0$lcssa) + ($$lcssa))|0;
$38 = (($37) + ($36))|0;
$39 = ((($f)) + 56|0);
HEAP32[$39>>2] = $36;
$40 = ((($f)) + 60|0);
HEAP32[$40>>2] = $38;
$41 = ((($f)) + 64|0);
HEAP32[$41>>2] = $4;
}
$42 = ((($f)) + 1380|0);
HEAP32[$42>>2] = 0;
$$0 = 1;
return ($$0|0);
}
function _start_packet($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1380|0);
$1 = ((($f)) + 1375|0);
while(1) {
$2 = HEAP32[$0>>2]|0;
$3 = ($2|0)==(-1);
if (!($3)) {
label = 6;
break;
}
$4 = (_start_page($f)|0);
$5 = ($4|0)==(0);
if ($5) {
$$0 = 0;
label = 7;
break;
}
$6 = HEAP8[$1>>0]|0;
$7 = $6 & 1;
$8 = ($7<<24>>24)==(0);
if (!($8)) {
label = 5;
break;
}
}
if ((label|0) == 5) {
_error($f,32);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 6) {
$9 = ((($f)) + 1384|0);
HEAP32[$9>>2] = 0;
$10 = ((($f)) + 1396|0);
HEAP32[$10>>2] = 0;
$11 = ((($f)) + 1400|0);
HEAP32[$11>>2] = 0;
$12 = ((($f)) + 1376|0);
HEAP8[$12>>0] = 0;
$$0 = 1;
return ($$0|0);
}
else if ((label|0) == 7) {
return ($$0|0);
}
return (0)|0;
}
function _vorbis_decode_initial($f,$p_left_start,$p_left_end,$p_right_start,$p_right_end,$mode) {
$f = $f|0;
$p_left_start = $p_left_start|0;
$p_left_end = $p_left_end|0;
$p_right_start = $p_right_start|0;
$p_right_end = $p_right_end|0;
$mode = $mode|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $7 = 0, $8 = 0, $9 = 0, $n$0 = 0, $next$0 = 0, $or$cond = 0, $or$cond3 = 0, $phitmp = 0, $prev$0 = 0, $storemerge = 0, $storemerge4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1508|0);
HEAP32[$0>>2] = 0;
$1 = ((($f)) + 1504|0);
HEAP32[$1>>2] = 0;
$2 = ((($f)) + 96|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($3|0)==(0);
if (!($4)) {
$$0 = 0;
return ($$0|0);
}
$5 = ((($f)) + 48|0);
while(1) {
$8 = (_maybe_start_packet($f)|0);
$9 = ($8|0)==(0);
if ($9) {
$$0 = 0;
label = 24;
break;
}
$10 = (_get_bits($f,1)|0);
$11 = ($10|0)==(0);
if ($11) {
label = 9;
break;
}
$12 = HEAP8[$5>>0]|0;
$13 = ($12<<24>>24)==(0);
if (!($13)) {
label = 7;
break;
}
while(1) {
$14 = (_get8_packet($f)|0);
$15 = ($14|0)==(-1);
if ($15) {
break;
}
}
$6 = HEAP32[$2>>2]|0;
$7 = ($6|0)==(0);
if (!($7)) {
$$0 = 0;
label = 24;
break;
}
}
if ((label|0) == 7) {
_error($f,35);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 9) {
$16 = ((($f)) + 80|0);
$17 = HEAP32[$16>>2]|0;
$18 = ($17|0)==(0|0);
if (!($18)) {
$19 = ((($f)) + 84|0);
$20 = HEAP32[$19>>2]|0;
$21 = ((($f)) + 92|0);
$22 = HEAP32[$21>>2]|0;
$23 = ($20|0)==($22|0);
if (!($23)) {
___assert_fail((15735|0),(15523|0),2804,(15791|0));
// unreachable;
}
}
$24 = ((($f)) + 408|0);
$25 = HEAP32[$24>>2]|0;
$26 = (($25) + -1)|0;
$27 = (_ilog($26)|0);
$28 = (_get_bits($f,$27)|0);
$29 = ($28|0)==(-1);
if ($29) {
$$0 = 0;
return ($$0|0);
}
$30 = HEAP32[$24>>2]|0;
$31 = ($28|0)<($30|0);
if (!($31)) {
$$0 = 0;
return ($$0|0);
}
HEAP32[$mode>>2] = $28;
$32 = (((($f)) + 412|0) + (($28*6)|0)|0);
$33 = HEAP8[$32>>0]|0;
$34 = ($33<<24>>24)==(0);
if ($34) {
$39 = ((($f)) + 112|0);
$40 = HEAP32[$39>>2]|0;
$n$0 = $40;$next$0 = 0;$prev$0 = 0;
} else {
$35 = ((($f)) + 116|0);
$36 = HEAP32[$35>>2]|0;
$37 = (_get_bits($f,1)|0);
$38 = (_get_bits($f,1)|0);
$phitmp = ($37|0)!=(0);
$n$0 = $36;$next$0 = $38;$prev$0 = $phitmp;
}
$41 = $n$0 >> 1;
$42 = HEAP8[$32>>0]|0;
$43 = ($42<<24>>24)==(0);
$or$cond = $prev$0 | $43;
if ($or$cond) {
HEAP32[$p_left_start>>2] = 0;
$storemerge = $41;
} else {
$44 = ((($f)) + 112|0);
$45 = HEAP32[$44>>2]|0;
$46 = (($n$0) - ($45))|0;
$47 = $46 >> 2;
HEAP32[$p_left_start>>2] = $47;
$48 = HEAP32[$44>>2]|0;
$49 = (($48) + ($n$0))|0;
$50 = $49 >> 2;
$storemerge = $50;
}
HEAP32[$p_left_end>>2] = $storemerge;
$51 = HEAP8[$32>>0]|0;
$52 = ($51<<24>>24)==(0);
$53 = ($next$0|0)!=(0);
$or$cond3 = $53 | $52;
if ($or$cond3) {
HEAP32[$p_right_start>>2] = $41;
$storemerge4 = $n$0;
} else {
$54 = ($n$0*3)|0;
$55 = ((($f)) + 112|0);
$56 = HEAP32[$55>>2]|0;
$57 = (($54) - ($56))|0;
$58 = $57 >> 2;
HEAP32[$p_right_start>>2] = $58;
$59 = HEAP32[$55>>2]|0;
$60 = (($59) + ($54))|0;
$61 = $60 >> 2;
$storemerge4 = $61;
}
HEAP32[$p_right_end>>2] = $storemerge4;
$$0 = 1;
return ($$0|0);
}
else if ((label|0) == 24) {
return ($$0|0);
}
return (0)|0;
}
function _ilog($n) {
$n = $n|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($n|0)<(16384);
if ($0) {
$1 = ($n|0)<(16);
if ($1) {
$2 = (15719 + ($n)|0);
$3 = HEAP8[$2>>0]|0;
$4 = $3 << 24 >> 24;
$$0 = $4;
return ($$0|0);
}
$5 = ($n|0)<(512);
if ($5) {
$6 = $n >> 5;
$7 = (15719 + ($6)|0);
$8 = HEAP8[$7>>0]|0;
$9 = $8 << 24 >> 24;
$10 = (($9) + 5)|0;
$$0 = $10;
return ($$0|0);
} else {
$11 = $n >> 10;
$12 = (15719 + ($11)|0);
$13 = HEAP8[$12>>0]|0;
$14 = $13 << 24 >> 24;
$15 = (($14) + 10)|0;
$$0 = $15;
return ($$0|0);
}
}
$16 = ($n|0)<(16777216);
if (!($16)) {
$28 = ($n|0)<(536870912);
if (!($28)) {
$$0 = 0;
return ($$0|0);
}
$29 = $n >> 25;
$30 = (15719 + ($29)|0);
$31 = HEAP8[$30>>0]|0;
$32 = $31 << 24 >> 24;
$33 = (($32) + 25)|0;
$$0 = $33;
return ($$0|0);
}
$17 = ($n|0)<(524288);
if ($17) {
$18 = $n >> 15;
$19 = (15719 + ($18)|0);
$20 = HEAP8[$19>>0]|0;
$21 = $20 << 24 >> 24;
$22 = (($21) + 15)|0;
$$0 = $22;
return ($$0|0);
} else {
$23 = $n >> 20;
$24 = (15719 + ($23)|0);
$25 = HEAP8[$24>>0]|0;
$26 = $25 << 24 >> 24;
$27 = (($26) + 20)|0;
$$0 = $27;
return ($$0|0);
}
return (0)|0;
}
function _skip($z,$n) {
$z = $z|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 32|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$8 = ((($z)) + 20|0);
$9 = HEAP32[$8>>2]|0;
$10 = (_ftell($9)|0);
$11 = HEAP32[$8>>2]|0;
$12 = (($10) + ($n))|0;
(_fseek($11,$12,0)|0);
return;
}
$3 = (($1) + ($n)|0);
HEAP32[$0>>2] = $3;
$4 = ((($z)) + 40|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($3>>>0)<($5>>>0);
if ($6) {
return;
}
$7 = ((($z)) + 96|0);
HEAP32[$7>>2] = 1;
return;
}
function _get_bits($f,$n) {
$f = $f|0;
$n = $n|0;
var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1396|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(0);
if ($2) {
$$0 = 0;
return ($$0|0);
}
$3 = ($1|0)<($n|0);
L4: do {
if ($3) {
$4 = ($n|0)>(24);
if ($4) {
$5 = (_get_bits($f,24)|0);
$6 = (($n) + -24)|0;
$7 = (_get_bits($f,$6)|0);
$8 = $7 << 24;
$9 = (($8) + ($5))|0;
return ($9|0);
}
$10 = ($1|0)==(0);
if ($10) {
$11 = ((($f)) + 1392|0);
HEAP32[$11>>2] = 0;
}
$12 = HEAP32[$0>>2]|0;
$13 = ($12|0)<($n|0);
if ($13) {
$14 = ((($f)) + 1392|0);
while(1) {
$15 = (_get8_packet_raw($f)|0);
$16 = ($15|0)==(-1);
if ($16) {
break;
}
$17 = HEAP32[$0>>2]|0;
$18 = $15 << $17;
$19 = HEAP32[$14>>2]|0;
$20 = (($19) + ($18))|0;
HEAP32[$14>>2] = $20;
$21 = HEAP32[$0>>2]|0;
$22 = (($21) + 8)|0;
HEAP32[$0>>2] = $22;
$23 = ($22|0)<($n|0);
if (!($23)) {
$24 = $22;
break L4;
}
}
HEAP32[$0>>2] = -1;
$$0 = 0;
return ($$0|0);
} else {
$24 = $12;
}
} else {
$$pr = HEAP32[$0>>2]|0;
$24 = $$pr;
}
} while(0);
$25 = ($24|0)<(0);
if ($25) {
$$0 = 0;
return ($$0|0);
}
$26 = ((($f)) + 1392|0);
$27 = HEAP32[$26>>2]|0;
$28 = 1 << $n;
$29 = (($28) + -1)|0;
$30 = $27 & $29;
$31 = $27 >>> $n;
HEAP32[$26>>2] = $31;
$32 = HEAP32[$0>>2]|0;
$33 = (($32) - ($n))|0;
HEAP32[$0>>2] = $33;
$$0 = $30;
return ($$0|0);
}
function _setup_malloc($f,$sz) {
$f = $f|0;
$sz = $sz|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (($sz) + 3)|0;
$1 = $0 & -4;
$2 = ((($f)) + 8|0);
$3 = HEAP32[$2>>2]|0;
$4 = (($3) + ($1))|0;
HEAP32[$2>>2] = $4;
$5 = ((($f)) + 80|0);
$6 = HEAP32[$5>>2]|0;
$7 = ($6|0)==(0|0);
if ($7) {
$15 = ($1|0)==(0);
if ($15) {
$$0 = 0;
return ($$0|0);
}
$16 = (_malloc($1)|0);
$$0 = $16;
return ($$0|0);
} else {
$8 = ((($f)) + 88|0);
$9 = HEAP32[$8>>2]|0;
$10 = (($9) + ($1))|0;
$11 = ((($f)) + 92|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($10|0)>($12|0);
if ($13) {
$$0 = 0;
return ($$0|0);
}
$14 = (($6) + ($9)|0);
HEAP32[$8>>2] = $10;
$$0 = $14;
return ($$0|0);
}
return (0)|0;
}
function _vorbis_validate($data) {
$data = $data|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_memcmp($data,16185,6)|0);
$1 = ($0|0)==(0);
$2 = $1&1;
return ($2|0);
}
function _crc32_init() {
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$03 = 0, label = 0, sp = 0;
sp = STACKTOP;
$i$03 = 0;
while(1) {
$0 = $i$03 << 24;
$1 = $i$03 << 25;
$2 = $0 >> 31;
$3 = $2 & 79764919;
$4 = $3 ^ $1;
$5 = $4 << 1;
$6 = $1 >> 31;
$7 = $6 & 79764919;
$8 = $7 ^ $5;
$9 = $8 << 1;
$10 = $5 >> 31;
$11 = $10 & 79764919;
$12 = $11 ^ $9;
$13 = $12 << 1;
$14 = $9 >> 31;
$15 = $14 & 79764919;
$16 = $15 ^ $13;
$17 = $16 << 1;
$18 = $13 >> 31;
$19 = $18 & 79764919;
$20 = $19 ^ $17;
$21 = $20 << 1;
$22 = $17 >> 31;
$23 = $22 & 79764919;
$24 = $23 ^ $21;
$25 = $24 << 1;
$26 = $21 >> 31;
$27 = $26 & 79764919;
$28 = $27 ^ $25;
$29 = $28 << 1;
$30 = $25 >> 31;
$31 = $30 & 79764919;
$32 = $31 ^ $29;
$33 = (5824 + ($i$03<<2)|0);
HEAP32[$33>>2] = $32;
$34 = (($i$03) + 1)|0;
$exitcond = ($34|0)==(256);
if ($exitcond) {
break;
} else {
$i$03 = $34;
}
}
return;
}
function _setup_temp_malloc($f,$sz) {
$f = $f|0;
$sz = $sz|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (($sz) + 3)|0;
$1 = $0 & -4;
$2 = ((($f)) + 80|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($3|0)==(0|0);
if ($4) {
$13 = (_malloc($1)|0);
$$0 = $13;
return ($$0|0);
}
$5 = ((($f)) + 92|0);
$6 = HEAP32[$5>>2]|0;
$7 = (($6) - ($1))|0;
$8 = ((($f)) + 88|0);
$9 = HEAP32[$8>>2]|0;
$10 = ($7|0)<($9|0);
if ($10) {
$$0 = 0;
return ($$0|0);
}
HEAP32[$5>>2] = $7;
$11 = HEAP32[$2>>2]|0;
$12 = (($11) + ($7)|0);
$$0 = $12;
return ($$0|0);
}
function _setup_temp_free($f,$p,$sz) {
$f = $f|0;
$p = $p|0;
$sz = $sz|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 80|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
_free($p);
return;
} else {
$3 = (($sz) + 3)|0;
$4 = $3 & -4;
$5 = ((($f)) + 92|0);
$6 = HEAP32[$5>>2]|0;
$7 = (($6) + ($4))|0;
HEAP32[$5>>2] = $7;
return;
}
}
function _compute_codewords($c,$len,$n,$values) {
$c = $c|0;
$len = $len|0;
$n = $n|0;
$values = $values|0;
var $$0 = 0, $$lcssa = 0, $$lcssa37 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $available = 0, $i$014 = 0, $i$1 = 0;
var $i$1$in = 0, $i$1$in$ph = 0, $i$1$lcssa36 = 0, $k$0$lcssa = 0, $k$016 = 0, $m$0$ph = 0, $y$012 = 0, $z$0$lcssa = 0, $z$09 = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 128|0;
$available = sp;
dest=$available; stop=dest+128|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$0 = ($n|0)>(0);
L1: do {
if ($0) {
$k$016 = 0;
while(1) {
$1 = (($len) + ($k$016)|0);
$2 = HEAP8[$1>>0]|0;
$3 = ($2<<24>>24)==(-1);
if (!($3)) {
$k$0$lcssa = $k$016;
break L1;
}
$4 = (($k$016) + 1)|0;
$5 = ($4|0)<($n|0);
if ($5) {
$k$016 = $4;
} else {
$k$0$lcssa = $4;
break;
}
}
} else {
$k$0$lcssa = 0;
}
} while(0);
$6 = ($k$0$lcssa|0)==($n|0);
if ($6) {
$7 = ((($c)) + 2092|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($8|0)==(0);
if ($9) {
$$0 = 1;
STACKTOP = sp;return ($$0|0);
} else {
___assert_fail((16082|0),(15523|0),659,(16105|0));
// unreachable;
}
}
$10 = (($len) + ($k$0$lcssa)|0);
$11 = HEAP8[$10>>0]|0;
$12 = $11&255;
_add_entry($c,0,$k$0$lcssa,0,$12,$values);
$13 = HEAP8[$10>>0]|0;
$14 = ($13<<24>>24)==(0);
if ($14) {
$i$1$in$ph = $k$0$lcssa;$m$0$ph = 1;
} else {
$15 = HEAP8[$10>>0]|0;
$16 = $15&255;
$i$014 = 1;
while(1) {
$17 = (32 - ($i$014))|0;
$18 = 1 << $17;
$19 = (($available) + ($i$014<<2)|0);
HEAP32[$19>>2] = $18;
$20 = (($i$014) + 1)|0;
$21 = ($i$014|0)<($16|0);
if ($21) {
$i$014 = $20;
} else {
$i$1$in$ph = $k$0$lcssa;$m$0$ph = 1;
break;
}
}
}
L16: while(1) {
$i$1$in = $i$1$in$ph;
while(1) {
$i$1 = (($i$1$in) + 1)|0;
$22 = ($i$1|0)<($n|0);
if (!($22)) {
$$0 = 1;
label = 26;
break L16;
}
$23 = (($len) + ($i$1)|0);
$24 = HEAP8[$23>>0]|0;
$25 = ($24<<24>>24)==(-1);
if ($25) {
$i$1$in = $i$1;
} else {
$$lcssa = $23;$$lcssa37 = $24;$i$1$lcssa36 = $i$1;
break;
}
}
$26 = $$lcssa37&255;
$27 = ($$lcssa37<<24>>24)==(0);
L22: do {
if ($27) {
$z$0$lcssa = $26;
} else {
$z$09 = $26;
while(1) {
$28 = (($available) + ($z$09<<2)|0);
$29 = HEAP32[$28>>2]|0;
$30 = ($29|0)==(0);
if (!($30)) {
$z$0$lcssa = $z$09;
break L22;
}
$31 = (($z$09) + -1)|0;
$32 = ($z$09|0)>(1);
if ($32) {
$z$09 = $31;
} else {
$z$0$lcssa = $31;
break;
}
}
}
} while(0);
$33 = ($z$0$lcssa|0)==(0);
if ($33) {
$$0 = 0;
label = 26;
break;
}
$34 = (($available) + ($z$0$lcssa<<2)|0);
$35 = HEAP32[$34>>2]|0;
$36 = ($z$0$lcssa>>>0)<(32);
if (!($36)) {
label = 18;
break;
}
HEAP32[$34>>2] = 0;
$37 = (_bit_reverse($35)|0);
$38 = (($m$0$ph) + 1)|0;
$39 = HEAP8[$$lcssa>>0]|0;
$40 = $39&255;
_add_entry($c,$37,$i$1$lcssa36,$m$0$ph,$40,$values);
$41 = HEAP8[$$lcssa>>0]|0;
$42 = $41&255;
$43 = ($z$0$lcssa|0)==($42|0);
if ($43) {
$i$1$in$ph = $i$1$lcssa36;$m$0$ph = $38;
continue;
}
$44 = ($41&255)<(32);
if (!($44)) {
label = 22;
break;
}
$45 = ($42|0)>($z$0$lcssa|0);
if ($45) {
$y$012 = $42;
} else {
$i$1$in$ph = $i$1$lcssa36;$m$0$ph = $38;
continue;
}
while(1) {
$46 = (($available) + ($y$012<<2)|0);
$47 = HEAP32[$46>>2]|0;
$48 = ($47|0)==(0);
if (!($48)) {
label = 24;
break L16;
}
$49 = (32 - ($y$012))|0;
$50 = 1 << $49;
$51 = (($50) + ($35))|0;
HEAP32[$46>>2] = $51;
$52 = (($y$012) + -1)|0;
$53 = ($52|0)>($z$0$lcssa|0);
if ($53) {
$y$012 = $52;
} else {
$i$1$in$ph = $i$1$lcssa36;$m$0$ph = $38;
continue L16;
}
}
}
if ((label|0) == 18) {
___assert_fail((16123|0),(15523|0),682,(16105|0));
// unreachable;
}
else if ((label|0) == 22) {
___assert_fail((16140|0),(15523|0),687,(16105|0));
// unreachable;
}
else if ((label|0) == 24) {
___assert_fail((16167|0),(15523|0),689,(16105|0));
// unreachable;
}
else if ((label|0) == 26) {
STACKTOP = sp;return ($$0|0);
}
return (0)|0;
}
function _compute_sorted_huffman($c,$lengths,$values) {
$c = $c|0;
$lengths = $lengths|0;
$values = $values|0;
var $$ = 0, $$in = 0, $$pn = 0, $$sink$in = 0, $$sink1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $i$010 = 0, $i$114 = 0, $i$25 = 0, $k$0$lcssa = 0;
var $k$09 = 0, $k$1 = 0, $n$04 = 0, $x$0$ = 0, $x$0$lcssa = 0, $x$03 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($c)) + 23|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if ($2) {
$10 = ((($c)) + 4|0);
$11 = HEAP32[$10>>2]|0;
$12 = ($11|0)>(0);
if ($12) {
$13 = ((($c)) + 32|0);
$14 = ((($c)) + 2084|0);
$i$010 = 0;$k$09 = 0;
while(1) {
$15 = (($lengths) + ($i$010)|0);
$16 = HEAP8[$15>>0]|0;
$17 = (_include_in_sort($c,$16)|0);
$18 = ($17|0)==(0);
if ($18) {
$k$1 = $k$09;
} else {
$19 = HEAP32[$13>>2]|0;
$20 = (($19) + ($i$010<<2)|0);
$21 = HEAP32[$20>>2]|0;
$22 = (_bit_reverse($21)|0);
$23 = (($k$09) + 1)|0;
$24 = HEAP32[$14>>2]|0;
$25 = (($24) + ($k$09<<2)|0);
HEAP32[$25>>2] = $22;
$k$1 = $23;
}
$26 = (($i$010) + 1)|0;
$27 = HEAP32[$10>>2]|0;
$28 = ($26|0)<($27|0);
if ($28) {
$i$010 = $26;$k$09 = $k$1;
} else {
$k$0$lcssa = $k$1;
break;
}
}
} else {
$k$0$lcssa = 0;
}
$29 = ((($c)) + 2092|0);
$30 = HEAP32[$29>>2]|0;
$31 = ($k$0$lcssa|0)==($30|0);
if (!($31)) {
___assert_fail((15974|0),(15523|0),756,(15997|0));
// unreachable;
}
} else {
$3 = ((($c)) + 2092|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)>(0);
if ($5) {
$6 = ((($c)) + 32|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($c)) + 2084|0);
$9 = HEAP32[$8>>2]|0;
$i$114 = 0;
while(1) {
$32 = (($7) + ($i$114<<2)|0);
$33 = HEAP32[$32>>2]|0;
$34 = (_bit_reverse($33)|0);
$35 = (($9) + ($i$114<<2)|0);
HEAP32[$35>>2] = $34;
$36 = (($i$114) + 1)|0;
$37 = HEAP32[$3>>2]|0;
$38 = ($36|0)<($37|0);
if ($38) {
$i$114 = $36;
} else {
break;
}
}
}
}
$39 = ((($c)) + 2084|0);
$40 = HEAP32[$39>>2]|0;
$41 = ((($c)) + 2092|0);
$42 = HEAP32[$41>>2]|0;
_qsort($40,$42,4,2);
$43 = HEAP32[$41>>2]|0;
$44 = HEAP32[$39>>2]|0;
$45 = (($44) + ($43<<2)|0);
HEAP32[$45>>2] = -1;
$46 = HEAP8[$0>>0]|0;
$47 = ($46<<24>>24)==(0);
$48 = ((($c)) + 4|0);
$$in = $47 ? $48 : $41;
$49 = HEAP32[$$in>>2]|0;
$50 = ($49|0)>(0);
if (!($50)) {
return;
}
$51 = ((($c)) + 32|0);
$52 = ((($c)) + 2088|0);
$53 = ((($c)) + 2088|0);
$54 = ((($c)) + 8|0);
$i$25 = 0;
L20: while(1) {
$55 = HEAP8[$0>>0]|0;
$56 = ($55<<24>>24)==(0);
if ($56) {
$$pn = $i$25;
} else {
$57 = (($values) + ($i$25<<2)|0);
$58 = HEAP32[$57>>2]|0;
$$pn = $58;
}
$$sink$in = (($lengths) + ($$pn)|0);
$$sink1 = HEAP8[$$sink$in>>0]|0;
$59 = (_include_in_sort($c,$$sink1)|0);
$60 = ($59|0)==(0);
do {
if (!($60)) {
$61 = HEAP32[$51>>2]|0;
$62 = (($61) + ($i$25<<2)|0);
$63 = HEAP32[$62>>2]|0;
$64 = (_bit_reverse($63)|0);
$65 = HEAP32[$41>>2]|0;
$66 = ($65|0)>(1);
if ($66) {
$67 = HEAP32[$39>>2]|0;
$n$04 = $65;$x$03 = 0;
while(1) {
$68 = $n$04 >> 1;
$69 = (($68) + ($x$03))|0;
$70 = (($67) + ($69<<2)|0);
$71 = HEAP32[$70>>2]|0;
$72 = ($71>>>0)>($64>>>0);
$73 = (($n$04) - ($68))|0;
$x$0$ = $72 ? $x$03 : $69;
$$ = $72 ? $68 : $73;
$74 = ($$|0)>(1);
if ($74) {
$n$04 = $$;$x$03 = $x$0$;
} else {
$x$0$lcssa = $x$0$;
break;
}
}
} else {
$x$0$lcssa = 0;
}
$75 = HEAP32[$39>>2]|0;
$76 = (($75) + ($x$0$lcssa<<2)|0);
$77 = HEAP32[$76>>2]|0;
$78 = ($77|0)==($64|0);
if (!($78)) {
label = 21;
break L20;
}
$79 = HEAP8[$0>>0]|0;
$80 = ($79<<24>>24)==(0);
if ($80) {
$87 = HEAP32[$52>>2]|0;
$88 = (($87) + ($x$0$lcssa<<2)|0);
HEAP32[$88>>2] = $i$25;
break;
} else {
$81 = (($values) + ($i$25<<2)|0);
$82 = HEAP32[$81>>2]|0;
$83 = HEAP32[$53>>2]|0;
$84 = (($83) + ($x$0$lcssa<<2)|0);
HEAP32[$84>>2] = $82;
$85 = HEAP32[$54>>2]|0;
$86 = (($85) + ($x$0$lcssa)|0);
HEAP8[$86>>0] = $$sink1;
break;
}
}
} while(0);
$89 = (($i$25) + 1)|0;
$90 = ($89|0)<($49|0);
if ($90) {
$i$25 = $89;
} else {
label = 26;
break;
}
}
if ((label|0) == 21) {
___assert_fail((16020|0),(15523|0),786,(15997|0));
// unreachable;
}
else if ((label|0) == 26) {
return;
}
}
function _compute_accelerated_huffman($c) {
$c = $c|0;
var $$in = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$12 = 0, $scevgep = 0;
var $z$0$ph = 0, $z$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$scevgep = ((($c)) + 36|0);
_memset(($scevgep|0),-1,2048)|0;
$0 = ((($c)) + 23|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
$3 = ((($c)) + 2092|0);
$4 = ((($c)) + 4|0);
$$in = $2 ? $4 : $3;
$5 = HEAP32[$$in>>2]|0;
$6 = ($5|0)>(0);
if (!($6)) {
return;
}
$7 = ((($c)) + 8|0);
$8 = ((($c)) + 32|0);
$9 = ((($c)) + 2084|0);
$10 = ($5|0)<(32767);
$11 = $10 ? $5 : 32767;
$i$12 = 0;
while(1) {
$12 = HEAP32[$7>>2]|0;
$13 = (($12) + ($i$12)|0);
$14 = HEAP8[$13>>0]|0;
$15 = ($14&255)<(11);
if ($15) {
$16 = HEAP8[$0>>0]|0;
$17 = ($16<<24>>24)==(0);
if ($17) {
$22 = HEAP32[$8>>2]|0;
$23 = (($22) + ($i$12<<2)|0);
$24 = HEAP32[$23>>2]|0;
$z$0$ph = $24;
} else {
$18 = HEAP32[$9>>2]|0;
$19 = (($18) + ($i$12<<2)|0);
$20 = HEAP32[$19>>2]|0;
$21 = (_bit_reverse($20)|0);
$z$0$ph = $21;
}
$25 = ($z$0$ph>>>0)<(1024);
if ($25) {
$26 = $i$12&65535;
$z$01 = $z$0$ph;
while(1) {
$27 = (((($c)) + 36|0) + ($z$01<<1)|0);
HEAP16[$27>>1] = $26;
$28 = HEAP32[$7>>2]|0;
$29 = (($28) + ($i$12)|0);
$30 = HEAP8[$29>>0]|0;
$31 = $30&255;
$32 = 1 << $31;
$33 = (($32) + ($z$01))|0;
$34 = ($33>>>0)<(1024);
if ($34) {
$z$01 = $33;
} else {
break;
}
}
}
}
$35 = (($i$12) + 1)|0;
$exitcond = ($35|0)==($11|0);
if ($exitcond) {
break;
} else {
$i$12 = $35;
}
}
return;
}
function _float32_unpack($x) {
$x = $x|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $x & 2097151;
$1 = $x >>> 21;
$2 = $1 & 1023;
$3 = ($x|0)<(0);
$4 = (+($0>>>0));
$5 = -$4;
$6 = $3 ? $5 : $4;
$7 = $6;
$8 = $7;
$9 = (($2) + -788)|0;
$10 = (+_ldexp($8,$9));
$11 = $10;
return (+$11);
}
function _lookup1_values($entries,$dim) {
$entries = $entries|0;
$dim = $dim|0;
var $$ = 0, $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0;
var $26 = 0.0, $27 = 0, $28 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+($entries|0));
$1 = $0;
$2 = (+Math_log((+$1)));
$3 = $2;
$4 = (+($dim|0));
$5 = $3 / $4;
$6 = $5;
$7 = (+Math_exp((+$6)));
$8 = (+Math_floor((+$7)));
$9 = (~~(($8)));
$10 = (+($9|0));
$11 = $10 + 1.0;
$12 = $11;
$13 = (+($dim|0));
$14 = (+Math_pow((+$12),(+$13)));
$15 = (+Math_floor((+$14)));
$16 = (~~(($15)));
$not$ = ($16|0)<=($entries|0);
$17 = $not$&1;
$$ = (($17) + ($9))|0;
$18 = (+($$|0));
$19 = $18 + 1.0;
$20 = $19;
$21 = (+Math_pow((+$20),(+$13)));
$22 = (+($entries|0));
$23 = $21 > $22;
if (!($23)) {
___assert_fail((15883|0),(15523|0),811,(15915|0));
// unreachable;
}
$24 = $18;
$25 = (+Math_pow((+$24),(+$13)));
$26 = (+Math_floor((+$25)));
$27 = (~~(($26)));
$28 = ($27|0)>($entries|0);
if ($28) {
___assert_fail((15930|0),(15523|0),812,(15915|0));
// unreachable;
} else {
return ($$|0);
}
return (0)|0;
}
function _point_compare($p,$q) {
$p = $p|0;
$q = $q|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP16[$p>>1]|0;
$1 = HEAP16[$q>>1]|0;
$2 = ($0&65535)<($1&65535);
$3 = ($0&65535)>($1&65535);
$4 = $3&1;
$5 = $2 ? -1 : $4;
return ($5|0);
}
function _neighbors($x,$n,$plow,$phigh) {
$x = $x|0;
$n = $n|0;
$plow = $plow|0;
$phigh = $phigh|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0;
var $high$02 = 0, $high$1 = 0, $i$03 = 0, $low$01 = 0, $low$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($n|0)>(0);
if (!($0)) {
return;
}
$1 = (($x) + ($n<<1)|0);
$2 = (($x) + ($n<<1)|0);
$high$02 = 65536;$i$03 = 0;$low$01 = -1;
while(1) {
$3 = (($x) + ($i$03<<1)|0);
$4 = HEAP16[$3>>1]|0;
$5 = $4&65535;
$6 = ($5|0)>($low$01|0);
if ($6) {
$7 = HEAP16[$1>>1]|0;
$8 = ($4&65535)<($7&65535);
if ($8) {
HEAP32[$plow>>2] = $i$03;
$9 = HEAP16[$3>>1]|0;
$10 = $9&65535;
$low$1 = $10;
} else {
$low$1 = $low$01;
}
} else {
$low$1 = $low$01;
}
$11 = HEAP16[$3>>1]|0;
$12 = $11&65535;
$13 = ($12|0)<($high$02|0);
if ($13) {
$14 = HEAP16[$2>>1]|0;
$15 = ($11&65535)>($14&65535);
if ($15) {
HEAP32[$phigh>>2] = $i$03;
$16 = HEAP16[$3>>1]|0;
$17 = $16&65535;
$high$1 = $17;
} else {
$high$1 = $high$02;
}
} else {
$high$1 = $high$02;
}
$18 = (($i$03) + 1)|0;
$exitcond = ($18|0)==($n|0);
if ($exitcond) {
break;
} else {
$high$02 = $high$1;$i$03 = $18;$low$01 = $low$1;
}
}
return;
}
function _init_blocksize($f,$b,$n) {
$f = $f|0;
$b = $b|0;
$n = $n|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n >>> 1;
$1 = $n & -4;
$2 = $n >> 3;
$3 = $0 << 2;
$4 = (_setup_malloc($f,$3)|0);
$5 = (((($f)) + 1068|0) + ($b<<2)|0);
HEAP32[$5>>2] = $4;
$6 = (_setup_malloc($f,$3)|0);
$7 = (((($f)) + 1076|0) + ($b<<2)|0);
HEAP32[$7>>2] = $6;
$8 = (_setup_malloc($f,$1)|0);
$9 = (((($f)) + 1084|0) + ($b<<2)|0);
HEAP32[$9>>2] = $8;
$10 = HEAP32[$5>>2]|0;
$11 = ($10|0)==(0|0);
if (!($11)) {
$12 = HEAP32[$7>>2]|0;
$13 = ($12|0)==(0|0);
$14 = ($8|0)==(0|0);
$or$cond = $14 | $13;
if (!($or$cond)) {
_compute_twiddle_factors($n,$10,$12,$8);
$15 = (_setup_malloc($f,$3)|0);
$16 = (((($f)) + 1092|0) + ($b<<2)|0);
HEAP32[$16>>2] = $15;
$17 = ($15|0)==(0|0);
if ($17) {
_error($f,3);
$$0 = 0;
return ($$0|0);
}
_compute_window($n,$15);
$18 = $2 << 1;
$19 = (_setup_malloc($f,$18)|0);
$20 = (((($f)) + 1100|0) + ($b<<2)|0);
HEAP32[$20>>2] = $19;
$21 = ($19|0)==(0|0);
if ($21) {
_error($f,3);
$$0 = 0;
return ($$0|0);
} else {
_compute_bitreverse($n,$19);
$$0 = 1;
return ($$0|0);
}
}
}
_error($f,3);
$$0 = 0;
return ($$0|0);
}
function _compute_twiddle_factors($n,$A,$B,$C) {
$n = $n|0;
$A = $A|0;
$B = $B|0;
$C = $C|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0;
var $45 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $exitcond = 0, $exitcond7 = 0, $k$03 = 0, $k$11 = 0, $k2$04 = 0, $k2$12 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n >> 2;
$1 = $n >> 3;
$2 = ($0|0)>(0);
if ($2) {
$3 = (+($n|0));
$k$03 = 0;$k2$04 = 0;
while(1) {
$6 = $k$03 << 2;
$7 = (+($6|0));
$8 = $7 * 3.1415926535897931;
$9 = $8 / $3;
$10 = (+Math_cos((+$9)));
$11 = $10;
$12 = (($A) + ($k2$04<<2)|0);
HEAPF32[$12>>2] = $11;
$13 = (+Math_sin((+$9)));
$14 = $13;
$15 = -$14;
$16 = $k2$04 | 1;
$17 = (($A) + ($16<<2)|0);
HEAPF32[$17>>2] = $15;
$18 = (+($16|0));
$19 = $18 * 3.1415926535897931;
$20 = $19 / $3;
$21 = $20 * 0.5;
$22 = (+Math_cos((+$21)));
$23 = $22;
$24 = $23 * 0.5;
$25 = (($B) + ($k2$04<<2)|0);
HEAPF32[$25>>2] = $24;
$26 = (+Math_sin((+$21)));
$27 = $26;
$28 = $27 * 0.5;
$29 = (($B) + ($16<<2)|0);
HEAPF32[$29>>2] = $28;
$30 = (($k$03) + 1)|0;
$31 = (($k2$04) + 2)|0;
$exitcond7 = ($30|0)==($0|0);
if ($exitcond7) {
break;
} else {
$k$03 = $30;$k2$04 = $31;
}
}
}
$4 = ($1|0)>(0);
if (!($4)) {
return;
}
$5 = (+($n|0));
$k$11 = 0;$k2$12 = 0;
while(1) {
$32 = $k2$12 | 1;
$33 = $32 << 1;
$34 = (+($33|0));
$35 = $34 * 3.1415926535897931;
$36 = $35 / $5;
$37 = (+Math_cos((+$36)));
$38 = $37;
$39 = (($C) + ($k2$12<<2)|0);
HEAPF32[$39>>2] = $38;
$40 = (+Math_sin((+$36)));
$41 = $40;
$42 = -$41;
$43 = (($C) + ($32<<2)|0);
HEAPF32[$43>>2] = $42;
$44 = (($k$11) + 1)|0;
$45 = (($k2$12) + 2)|0;
$exitcond = ($44|0)==($1|0);
if ($exitcond) {
break;
} else {
$k$11 = $44;$k2$12 = $45;
}
}
return;
}
function _compute_window($n,$window) {
$n = $n|0;
$window = $window|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $exitcond = 0, $i$01 = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = $n >> 1;
$1 = ($0|0)>(0);
if (!($1)) {
return;
}
$2 = (+($0|0));
$i$01 = 0;
while(1) {
$3 = (+($i$01|0));
$4 = $3 + 0.5;
$5 = $4 / $2;
$6 = $5 * 0.5;
$7 = $6 * 3.1415926535897931;
$8 = (+Math_sin((+$7)));
$9 = $8;
$10 = (+_square($9));
$11 = $10;
$12 = $11 * 1.5707963267948966;
$13 = (+Math_sin((+$12)));
$14 = $13;
$15 = (($window) + ($i$01<<2)|0);
HEAPF32[$15>>2] = $14;
$16 = (($i$01) + 1)|0;
$exitcond = ($16|0)==($0|0);
if ($exitcond) {
break;
} else {
$i$01 = $16;
}
}
return;
}
function _compute_bitreverse($n,$rev) {
$n = $n|0;
$rev = $rev|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n >> 3;
$1 = ($0|0)>(0);
if (!($1)) {
return;
}
$2 = (_ilog($n)|0);
$3 = (36 - ($2))|0;
$i$01 = 0;
while(1) {
$4 = (_bit_reverse($i$01)|0);
$5 = $4 >>> $3;
$6 = $5 << 2;
$7 = $6&65535;
$8 = (($rev) + ($i$01<<1)|0);
HEAP16[$8>>1] = $7;
$9 = (($i$01) + 1)|0;
$exitcond = ($9|0)==($0|0);
if ($exitcond) {
break;
} else {
$i$01 = $9;
}
}
return;
}
function _bit_reverse($n) {
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n >>> 1;
$1 = $0 & 1431655765;
$2 = $n << 1;
$3 = $2 & -1431655766;
$4 = $1 | $3;
$5 = $4 >>> 2;
$6 = $5 & 858993459;
$7 = $4 << 2;
$8 = $7 & -858993460;
$9 = $6 | $8;
$10 = $9 >>> 4;
$11 = $10 & 252645135;
$12 = $9 << 4;
$13 = $12 & -252645136;
$14 = $11 | $13;
$15 = $14 >>> 8;
$16 = $15 & 16711935;
$17 = $14 << 8;
$18 = $17 & -16711936;
$19 = $16 | $18;
$20 = $19 >>> 16;
$21 = $19 << 16;
$22 = $20 | $21;
return ($22|0);
}
function _square($x) {
$x = +$x;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $x * $x;
return (+$0);
}
function _include_in_sort($c,$len) {
$c = $c|0;
$len = $len|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($c)) + 23|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
$3 = ($len<<24>>24)==(-1);
if (!($2)) {
if ($3) {
___assert_fail((16051|0),(15523|0),736,(16066|0));
// unreachable;
} else {
$$0 = 1;
return ($$0|0);
}
}
if ($3) {
$$0 = 0;
return ($$0|0);
}
$4 = ($len&255)>(10);
$$ = $4&1;
$$0 = $$;
return ($$0|0);
}
function _uint32_compare($p,$q) {
$p = $p|0;
$q = $q|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$p>>2]|0;
$1 = HEAP32[$q>>2]|0;
$2 = ($0>>>0)<($1>>>0);
$3 = ($0>>>0)>($1>>>0);
$4 = $3&1;
$5 = $2 ? -1 : $4;
return ($5|0);
}
function _add_entry($c,$huff_code,$symbol,$count,$len,$values) {
$c = $c|0;
$huff_code = $huff_code|0;
$symbol = $symbol|0;
$count = $count|0;
$len = $len|0;
$values = $values|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($c)) + 23|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
$3 = ((($c)) + 32|0);
$4 = HEAP32[$3>>2]|0;
if ($2) {
$5 = (($4) + ($symbol<<2)|0);
HEAP32[$5>>2] = $huff_code;
return;
} else {
$6 = (($4) + ($count<<2)|0);
HEAP32[$6>>2] = $huff_code;
$7 = $len&255;
$8 = ((($c)) + 8|0);
$9 = HEAP32[$8>>2]|0;
$10 = (($9) + ($count)|0);
HEAP8[$10>>0] = $7;
$11 = (($values) + ($count<<2)|0);
HEAP32[$11>>2] = $symbol;
return;
}
}
function _get_window($f,$len) {
$f = $f|0;
$len = $len|0;
var $$0 = 0, $$0$in = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $len << 1;
$1 = ((($f)) + 112|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($0|0)==($2|0);
if ($3) {
$4 = ((($f)) + 1092|0);
$$0$in = $4;
$$0 = HEAP32[$$0$in>>2]|0;
return ($$0|0);
}
$5 = ((($f)) + 116|0);
$6 = HEAP32[$5>>2]|0;
$7 = ($0|0)==($6|0);
if (!($7)) {
___assert_fail((19474|0),(15523|0),2725,(16191|0));
// unreachable;
}
$8 = ((($f)) + 1096|0);
$$0$in = $8;
$$0 = HEAP32[$$0$in>>2]|0;
return ($$0|0);
}
function _vorbis_decode_packet_rest($f,$len,$m,$left_start,$right_start,$right_end,$p_left) {
$f = $f|0;
$len = $len|0;
$m = $m|0;
$left_start = $left_start|0;
$right_start = $right_start|0;
$right_end = $right_end|0;
$p_left = $p_left|0;
var $$ = 0, $$0 = 0, $$01 = 0, $$2 = 0, $$3 = 0, $$4 = 0, $$5 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0;
var $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0;
var $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0;
var $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0;
var $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0;
var $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0;
var $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0;
var $307 = 0.0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0.0, $313 = 0.0, $314 = 0.0, $315 = 0.0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0;
var $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0;
var $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0;
var $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0;
var $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $4 = 0, $40 = 0;
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $a2$0 = 0.0, $ch$0$lcssa = 0, $ch$023 = 0, $ch$1 = 0, $cval$0 = 0, $cval$2$ph = 0, $cval$236 = 0, $do_not_decode = 0, $exitcond = 0, $exitcond58 = 0, $i$053 = 0, $i$131 = 0, $i$228 = 0, $i$320 = 0, $i$320$in = 0, $i$414 = 0;
var $i$513 = 0, $j$043 = 0, $j$147 = 0, $j$251 = 0, $j$324 = 0, $j$416 = 0, $k$038 = 0, $m2$0 = 0.0, $offset$042 = 0, $offset$1$lcssa = 0, $offset$137 = 0, $offset$2 = 0, $really_zero_channel = 0, $right_end$ = 0, $room$0 = 0, $step2_flag = 0, $storemerge = 0, $temp$0 = 0, $temp$1 = 0, $zero_channel = 0;
var label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 2560|0;
$zero_channel = sp + 1280|0;
$really_zero_channel = sp + 256|0;
$step2_flag = sp;
$do_not_decode = sp + 2304|0;
$0 = HEAP8[$m>>0]|0;
$1 = $0&255;
$2 = (((($f)) + 104|0) + ($1<<2)|0);
$3 = HEAP32[$2>>2]|0;
$4 = ((($m)) + 1|0);
$5 = HEAP8[$4>>0]|0;
$6 = $5&255;
$7 = ((($f)) + 404|0);
$8 = HEAP32[$7>>2]|0;
$9 = (($8) + (($6*40)|0)|0);
$10 = $3 >> 1;
$11 = (0 - ($10))|0;
$12 = ((($f)) + 4|0);
$13 = HEAP32[$12>>2]|0;
$14 = ($13|0)>(0);
L1: do {
if ($14) {
$15 = (((($8) + (($6*40)|0)|0)) + 4|0);
$16 = ((($f)) + 260|0);
$17 = ((($f)) + 1396|0);
$18 = ((($step2_flag)) + 1|0);
$19 = ((($f)) + 124|0);
$20 = ((($f)) + 1396|0);
$21 = ((($f)) + 1392|0);
$22 = ((($f)) + 124|0);
$23 = ((($f)) + 1396|0);
$24 = ((($f)) + 1392|0);
$i$053 = 0;
while(1) {
$25 = HEAP32[$15>>2]|0;
$26 = (((($25) + (($i$053*3)|0)|0)) + 2|0);
$27 = HEAP8[$26>>0]|0;
$28 = $27&255;
$29 = (($zero_channel) + ($i$053<<2)|0);
HEAP32[$29>>2] = 0;
$30 = ((((($8) + (($6*40)|0)|0)) + 9|0) + ($28)|0);
$31 = HEAP8[$30>>0]|0;
$32 = $31&255;
$33 = (((($f)) + 132|0) + ($32<<1)|0);
$34 = HEAP16[$33>>1]|0;
$35 = ($34<<16>>16)==(0);
if ($35) {
break;
}
$36 = HEAP32[$16>>2]|0;
$37 = (_get_bits($f,1)|0);
$38 = ($37|0)==(0);
do {
if ($38) {
label = 50;
} else {
$39 = (((($36) + (($32*1596)|0)|0)) + 1588|0);
$40 = HEAP8[$39>>0]|0;
$41 = $40&255;
$42 = (($41) + -1)|0;
$43 = (6848 + ($42<<2)|0);
$44 = HEAP32[$43>>2]|0;
$45 = (((($f)) + 996|0) + ($i$053<<2)|0);
$46 = HEAP32[$45>>2]|0;
$47 = (_ilog($44)|0);
$48 = (($47) + -1)|0;
$49 = (_get_bits($f,$48)|0);
$50 = $49&65535;
HEAP16[$46>>1] = $50;
$51 = (_get_bits($f,$48)|0);
$52 = $51&65535;
$53 = ((($46)) + 2|0);
HEAP16[$53>>1] = $52;
$54 = (($36) + (($32*1596)|0)|0);
$55 = HEAP8[$54>>0]|0;
$56 = ($55<<24>>24)==(0);
if (!($56)) {
$j$043 = 0;$offset$042 = 2;
while(1) {
$57 = ((((($36) + (($32*1596)|0)|0)) + 1|0) + ($j$043)|0);
$58 = HEAP8[$57>>0]|0;
$59 = $58&255;
$60 = ((((($36) + (($32*1596)|0)|0)) + 33|0) + ($59)|0);
$61 = HEAP8[$60>>0]|0;
$62 = ((((($36) + (($32*1596)|0)|0)) + 49|0) + ($59)|0);
$63 = HEAP8[$62>>0]|0;
$64 = $63&255;
$65 = 1 << $64;
$66 = (($65) + -1)|0;
$67 = ($63<<24>>24)==(0);
if ($67) {
$cval$2$ph = 0;
} else {
$68 = HEAP32[$19>>2]|0;
$69 = ((((($36) + (($32*1596)|0)|0)) + 65|0) + ($59)|0);
$70 = HEAP8[$69>>0]|0;
$71 = $70&255;
$72 = (($68) + (($71*2096)|0)|0);
$73 = HEAP32[$20>>2]|0;
$74 = ($73|0)<(10);
if ($74) {
_prep_huffman($f);
}
$75 = HEAP32[$21>>2]|0;
$76 = $75 & 1023;
$77 = ((((($68) + (($71*2096)|0)|0)) + 36|0) + ($76<<1)|0);
$78 = HEAP16[$77>>1]|0;
$79 = $78 << 16 >> 16;
$80 = ($78<<16>>16)>(-1);
if ($80) {
$81 = (((($68) + (($71*2096)|0)|0)) + 8|0);
$82 = HEAP32[$81>>2]|0;
$83 = (($82) + ($79)|0);
$84 = HEAP8[$83>>0]|0;
$85 = $84&255;
$86 = $75 >>> $85;
HEAP32[$21>>2] = $86;
$87 = HEAP32[$20>>2]|0;
$88 = (($87) - ($85))|0;
$89 = ($88|0)<(0);
$$ = $89 ? 0 : $88;
HEAP32[$20>>2] = $$;
$$2 = $89 ? -1 : $79;
$cval$0 = $$2;
} else {
$90 = (_codebook_decode_scalar_raw($f,$72)|0);
$cval$0 = $90;
}
$91 = (((($68) + (($71*2096)|0)|0)) + 23|0);
$92 = HEAP8[$91>>0]|0;
$93 = ($92<<24>>24)==(0);
if ($93) {
$cval$2$ph = $cval$0;
} else {
$94 = (((($68) + (($71*2096)|0)|0)) + 2088|0);
$95 = HEAP32[$94>>2]|0;
$96 = (($95) + ($cval$0<<2)|0);
$97 = HEAP32[$96>>2]|0;
$cval$2$ph = $97;
}
}
$98 = ($61<<24>>24)==(0);
if ($98) {
$offset$1$lcssa = $offset$042;
} else {
$99 = $61&255;
$cval$236 = $cval$2$ph;$k$038 = 0;$offset$137 = $offset$042;
while(1) {
$100 = $cval$236 & $66;
$101 = (((((($36) + (($32*1596)|0)|0)) + 82|0) + ($59<<4)|0) + ($100<<1)|0);
$102 = HEAP16[$101>>1]|0;
$103 = $cval$236 >> $64;
$104 = ($102<<16>>16)>(-1);
if ($104) {
$105 = $102 << 16 >> 16;
$106 = HEAP32[$22>>2]|0;
$107 = (($106) + (($105*2096)|0)|0);
$108 = HEAP32[$23>>2]|0;
$109 = ($108|0)<(10);
if ($109) {
_prep_huffman($f);
}
$110 = HEAP32[$24>>2]|0;
$111 = $110 & 1023;
$112 = ((((($106) + (($105*2096)|0)|0)) + 36|0) + ($111<<1)|0);
$113 = HEAP16[$112>>1]|0;
$114 = $113 << 16 >> 16;
$115 = ($113<<16>>16)>(-1);
if ($115) {
$116 = (((($106) + (($105*2096)|0)|0)) + 8|0);
$117 = HEAP32[$116>>2]|0;
$118 = (($117) + ($114)|0);
$119 = HEAP8[$118>>0]|0;
$120 = $119&255;
$121 = $110 >>> $120;
HEAP32[$24>>2] = $121;
$122 = HEAP32[$23>>2]|0;
$123 = (($122) - ($120))|0;
$124 = ($123|0)<(0);
$$3 = $124 ? 0 : $123;
HEAP32[$23>>2] = $$3;
$$4 = $124 ? -1 : $114;
$temp$0 = $$4;
} else {
$125 = (_codebook_decode_scalar_raw($f,$107)|0);
$temp$0 = $125;
}
$126 = (((($106) + (($105*2096)|0)|0)) + 23|0);
$127 = HEAP8[$126>>0]|0;
$128 = ($127<<24>>24)==(0);
if ($128) {
$temp$1 = $temp$0;
} else {
$129 = (((($106) + (($105*2096)|0)|0)) + 2088|0);
$130 = HEAP32[$129>>2]|0;
$131 = (($130) + ($temp$0<<2)|0);
$132 = HEAP32[$131>>2]|0;
$temp$1 = $132;
}
$133 = $temp$1&65535;
$134 = (($46) + ($offset$137<<1)|0);
HEAP16[$134>>1] = $133;
} else {
$135 = (($46) + ($offset$137<<1)|0);
HEAP16[$135>>1] = 0;
}
$offset$2 = (($offset$137) + 1)|0;
$136 = (($k$038) + 1)|0;
$exitcond58 = ($136|0)==($99|0);
if ($exitcond58) {
break;
} else {
$cval$236 = $103;$k$038 = $136;$offset$137 = $offset$2;
}
}
$137 = (($offset$042) + ($99))|0;
$offset$1$lcssa = $137;
}
$138 = (($j$043) + 1)|0;
$139 = HEAP8[$54>>0]|0;
$140 = $139&255;
$141 = ($138|0)<($140|0);
if ($141) {
$j$043 = $138;$offset$042 = $offset$1$lcssa;
} else {
break;
}
}
}
$142 = HEAP32[$17>>2]|0;
$143 = ($142|0)==(-1);
if ($143) {
label = 50;
break;
}
HEAP8[$18>>0] = 1;
HEAP8[$step2_flag>>0] = 1;
$144 = (((($36) + (($32*1596)|0)|0)) + 1592|0);
$145 = HEAP32[$144>>2]|0;
$146 = ($145|0)>(2);
if ($146) {
$147 = (($44) + 65535)|0;
$j$147 = 2;
while(1) {
$151 = ((((($36) + (($32*1596)|0)|0)) + 1088|0) + ($j$147<<1)|0);
$152 = HEAP8[$151>>0]|0;
$153 = $152&255;
$154 = ((((((($36) + (($32*1596)|0)|0)) + 1088|0) + ($j$147<<1)|0)) + 1|0);
$155 = HEAP8[$154>>0]|0;
$156 = $155&255;
$157 = ((((($36) + (($32*1596)|0)|0)) + 338|0) + ($j$147<<1)|0);
$158 = HEAP16[$157>>1]|0;
$159 = $158&65535;
$160 = ((((($36) + (($32*1596)|0)|0)) + 338|0) + ($153<<1)|0);
$161 = HEAP16[$160>>1]|0;
$162 = $161&65535;
$163 = ((((($36) + (($32*1596)|0)|0)) + 338|0) + ($156<<1)|0);
$164 = HEAP16[$163>>1]|0;
$165 = $164&65535;
$166 = (($46) + ($153<<1)|0);
$167 = HEAP16[$166>>1]|0;
$168 = $167 << 16 >> 16;
$169 = (($46) + ($156<<1)|0);
$170 = HEAP16[$169>>1]|0;
$171 = $170 << 16 >> 16;
$172 = (_predict_point($159,$162,$165,$168,$171)|0);
$173 = (($46) + ($j$147<<1)|0);
$174 = HEAP16[$173>>1]|0;
$175 = $174 << 16 >> 16;
$176 = (($44) - ($172))|0;
$177 = ($174<<16>>16)==(0);
do {
if ($177) {
$195 = (($step2_flag) + ($j$147)|0);
HEAP8[$195>>0] = 0;
$196 = $172&65535;
HEAP16[$173>>1] = $196;
} else {
$178 = ($176|0)<($172|0);
$$5 = $178 ? $176 : $172;
$room$0 = $$5 << 1;
$179 = (($step2_flag) + ($156)|0);
HEAP8[$179>>0] = 1;
$180 = (($step2_flag) + ($153)|0);
HEAP8[$180>>0] = 1;
$181 = (($step2_flag) + ($j$147)|0);
HEAP8[$181>>0] = 1;
$182 = ($175|0)<($room$0|0);
if ($182) {
$186 = $175 & 1;
$187 = ($186|0)==(0);
if ($187) {
$192 = $175 >>> 1;
$193 = (($192) + ($172))|0;
$194 = $193&65535;
HEAP16[$173>>1] = $194;
break;
} else {
$188 = (($175) + 1)|0;
$189 = $188 >>> 1;
$190 = (($172) - ($189))|0;
$191 = $190&65535;
HEAP16[$173>>1] = $191;
break;
}
} else {
$183 = ($176|0)>($172|0);
if ($183) {
HEAP16[$173>>1] = $174;
break;
} else {
$184 = (($147) - ($175))|0;
$185 = $184&65535;
HEAP16[$173>>1] = $185;
break;
}
}
}
} while(0);
$197 = (($j$147) + 1)|0;
$198 = HEAP32[$144>>2]|0;
$199 = ($197|0)<($198|0);
if ($199) {
$j$147 = $197;
} else {
$148 = $198;
break;
}
}
} else {
$148 = $145;
}
$149 = ($148|0)>(0);
if ($149) {
$150 = HEAP32[$144>>2]|0;
$j$251 = 0;
while(1) {
$200 = (($step2_flag) + ($j$251)|0);
$201 = HEAP8[$200>>0]|0;
$202 = ($201<<24>>24)==(0);
if ($202) {
$203 = (($46) + ($j$251<<1)|0);
HEAP16[$203>>1] = -1;
}
$204 = (($j$251) + 1)|0;
$205 = ($204|0)<($150|0);
if ($205) {
$j$251 = $204;
} else {
break;
}
}
}
}
} while(0);
if ((label|0) == 50) {
label = 0;
HEAP32[$29>>2] = 1;
}
$206 = (($i$053) + 1)|0;
$207 = HEAP32[$12>>2]|0;
$208 = ($206|0)<($207|0);
if ($208) {
$i$053 = $206;
} else {
break L1;
}
}
_error($f,21);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
} while(0);
$209 = ((($f)) + 80|0);
$210 = HEAP32[$209>>2]|0;
$211 = ($210|0)==(0|0);
if (!($211)) {
$212 = ((($f)) + 84|0);
$213 = HEAP32[$212>>2]|0;
$214 = ((($f)) + 92|0);
$215 = HEAP32[$214>>2]|0;
$216 = ($213|0)==($215|0);
if (!($216)) {
___assert_fail((15735|0),(15523|0),2953,(16202|0));
// unreachable;
}
}
$217 = HEAP32[$12>>2]|0;
$218 = $217 << 2;
_memcpy(($really_zero_channel|0),($zero_channel|0),($218|0))|0;
$219 = HEAP16[$9>>1]|0;
$220 = ($219<<16>>16)==(0);
if (!($220)) {
$221 = (((($8) + (($6*40)|0)|0)) + 4|0);
$222 = HEAP32[$221>>2]|0;
$223 = HEAP16[$9>>1]|0;
$224 = $223&65535;
$i$131 = 0;
while(1) {
$229 = (($222) + (($i$131*3)|0)|0);
$230 = HEAP8[$229>>0]|0;
$231 = $230&255;
$232 = (($zero_channel) + ($231<<2)|0);
$233 = HEAP32[$232>>2]|0;
$234 = ($233|0)==(0);
if ($234) {
label = 61;
} else {
$235 = (((($222) + (($i$131*3)|0)|0)) + 1|0);
$236 = HEAP8[$235>>0]|0;
$237 = $236&255;
$238 = (($zero_channel) + ($237<<2)|0);
$239 = HEAP32[$238>>2]|0;
$240 = ($239|0)==(0);
if ($240) {
label = 61;
}
}
if ((label|0) == 61) {
label = 0;
$241 = HEAP32[$221>>2]|0;
$242 = (((($241) + (($i$131*3)|0)|0)) + 1|0);
$243 = HEAP8[$242>>0]|0;
$244 = $243&255;
$245 = (($zero_channel) + ($244<<2)|0);
HEAP32[$245>>2] = 0;
$246 = HEAP32[$221>>2]|0;
$247 = (($246) + (($i$131*3)|0)|0);
$248 = HEAP8[$247>>0]|0;
$249 = $248&255;
$250 = (($zero_channel) + ($249<<2)|0);
HEAP32[$250>>2] = 0;
}
$251 = (($i$131) + 1)|0;
$252 = ($251|0)<($224|0);
if ($252) {
$i$131 = $251;
} else {
break;
}
}
}
$225 = (((($8) + (($6*40)|0)|0)) + 8|0);
$226 = HEAP8[$225>>0]|0;
$227 = ($226<<24>>24)==(0);
if (!($227)) {
$228 = (((($8) + (($6*40)|0)|0)) + 4|0);
$i$228 = 0;
while(1) {
$253 = HEAP32[$12>>2]|0;
$254 = ($253|0)>(0);
if ($254) {
$255 = HEAP32[$228>>2]|0;
$256 = HEAP32[$12>>2]|0;
$ch$023 = 0;$j$324 = 0;
while(1) {
$257 = (((($255) + (($j$324*3)|0)|0)) + 2|0);
$258 = HEAP8[$257>>0]|0;
$259 = $258&255;
$260 = ($259|0)==($i$228|0);
if ($260) {
$261 = (($zero_channel) + ($j$324<<2)|0);
$262 = HEAP32[$261>>2]|0;
$263 = ($262|0)==(0);
$264 = (($do_not_decode) + ($ch$023)|0);
if ($263) {
HEAP8[$264>>0] = 0;
$266 = (((($f)) + 800|0) + ($j$324<<2)|0);
$267 = HEAP32[$266>>2]|0;
$268 = (($step2_flag) + ($ch$023<<2)|0);
HEAP32[$268>>2] = $267;
} else {
HEAP8[$264>>0] = 1;
$265 = (($step2_flag) + ($ch$023<<2)|0);
HEAP32[$265>>2] = 0;
}
$269 = (($ch$023) + 1)|0;
$ch$1 = $269;
} else {
$ch$1 = $ch$023;
}
$270 = (($j$324) + 1)|0;
$271 = ($270|0)<($256|0);
if ($271) {
$ch$023 = $ch$1;$j$324 = $270;
} else {
$ch$0$lcssa = $ch$1;
break;
}
}
} else {
$ch$0$lcssa = 0;
}
$272 = ((((($8) + (($6*40)|0)|0)) + 24|0) + ($i$228)|0);
$273 = HEAP8[$272>>0]|0;
$274 = $273&255;
_decode_residue($f,$step2_flag,$ch$0$lcssa,$10,$274,$do_not_decode);
$275 = (($i$228) + 1)|0;
$276 = HEAP8[$225>>0]|0;
$277 = $276&255;
$278 = ($275|0)<($277|0);
if ($278) {
$i$228 = $275;
} else {
break;
}
}
}
$279 = HEAP32[$209>>2]|0;
$280 = ($279|0)==(0|0);
if (!($280)) {
$281 = ((($f)) + 84|0);
$282 = HEAP32[$281>>2]|0;
$283 = ((($f)) + 92|0);
$284 = HEAP32[$283>>2]|0;
$285 = ($282|0)==($284|0);
if (!($285)) {
___assert_fail((15735|0),(15523|0),2986,(16202|0));
// unreachable;
}
}
$286 = HEAP16[$9>>1]|0;
$287 = ($286<<16>>16)==(0);
if (!($287)) {
$288 = $286&65535;
$289 = (((($8) + (($6*40)|0)|0)) + 4|0);
$290 = HEAP32[$289>>2]|0;
$291 = ($10|0)>(0);
$i$320$in = $288;
while(1) {
$i$320 = (($i$320$in) + -1)|0;
$296 = (($290) + (($i$320*3)|0)|0);
$297 = HEAP8[$296>>0]|0;
$298 = $297&255;
$299 = (((($f)) + 800|0) + ($298<<2)|0);
$300 = HEAP32[$299>>2]|0;
$301 = (((($290) + (($i$320*3)|0)|0)) + 1|0);
$302 = HEAP8[$301>>0]|0;
$303 = $302&255;
$304 = (((($f)) + 800|0) + ($303<<2)|0);
$305 = HEAP32[$304>>2]|0;
if ($291) {
$j$416 = 0;
while(1) {
$306 = (($300) + ($j$416<<2)|0);
$307 = +HEAPF32[$306>>2];
$308 = $307 > 0.0;
$309 = (($305) + ($j$416<<2)|0);
$310 = +HEAPF32[$309>>2];
$311 = $310 > 0.0;
do {
if ($308) {
if ($311) {
$312 = $307 - $310;
$a2$0 = $312;$m2$0 = $307;
break;
} else {
$313 = $307 + $310;
$a2$0 = $307;$m2$0 = $313;
break;
}
} else {
if ($311) {
$314 = $307 + $310;
$a2$0 = $314;$m2$0 = $307;
break;
} else {
$315 = $307 - $310;
$a2$0 = $307;$m2$0 = $315;
break;
}
}
} while(0);
HEAPF32[$306>>2] = $m2$0;
HEAPF32[$309>>2] = $a2$0;
$316 = (($j$416) + 1)|0;
$exitcond = ($316|0)==($10|0);
if ($exitcond) {
break;
} else {
$j$416 = $316;
}
}
}
$292 = ($i$320$in|0)>(1);
if ($292) {
$i$320$in = $i$320;
} else {
break;
}
}
}
$293 = HEAP32[$12>>2]|0;
$294 = ($293|0)>(0);
if ($294) {
$295 = $10 << 2;
$i$414 = 0;
while(1) {
$318 = (($really_zero_channel) + ($i$414<<2)|0);
$319 = HEAP32[$318>>2]|0;
$320 = ($319|0)==(0);
$321 = (((($f)) + 800|0) + ($i$414<<2)|0);
if ($320) {
$323 = HEAP32[$321>>2]|0;
$324 = (((($f)) + 996|0) + ($i$414<<2)|0);
$325 = HEAP32[$324>>2]|0;
_do_floor($f,$9,$i$414,$3,$323,$325);
} else {
$322 = HEAP32[$321>>2]|0;
_memset(($322|0),0,($295|0))|0;
}
$326 = (($i$414) + 1)|0;
$327 = HEAP32[$12>>2]|0;
$328 = ($326|0)<($327|0);
if ($328) {
$i$414 = $326;
} else {
$$lcssa = $327;
break;
}
}
$317 = ($$lcssa|0)>(0);
if ($317) {
$i$513 = 0;
while(1) {
$329 = (((($f)) + 800|0) + ($i$513<<2)|0);
$330 = HEAP32[$329>>2]|0;
$331 = HEAP8[$m>>0]|0;
$332 = $331&255;
_inverse_mdct($330,$3,$f,$332);
$333 = (($i$513) + 1)|0;
$334 = HEAP32[$12>>2]|0;
$335 = ($333|0)<($334|0);
if ($335) {
$i$513 = $333;
} else {
break;
}
}
}
}
_flush_packet($f);
$336 = ((($f)) + 1377|0);
$337 = HEAP8[$336>>0]|0;
$338 = ($337<<24>>24)==(0);
do {
if ($338) {
$343 = ((($f)) + 1412|0);
$344 = HEAP32[$343>>2]|0;
$345 = ($344|0)==(0);
if ($345) {
$$01 = $left_start;
} else {
$346 = (($right_start) - ($left_start))|0;
$347 = ($344|0)<($346|0);
if ($347) {
$349 = (($344) + ($left_start))|0;
HEAP32[$p_left>>2] = $349;
HEAP32[$343>>2] = 0;
$$01 = $349;
break;
} else {
$348 = (($344) - ($346))|0;
HEAP32[$343>>2] = $348;
HEAP32[$p_left>>2] = $right_start;
$$01 = $right_start;
break;
}
}
} else {
$339 = ((($f)) + 1060|0);
HEAP32[$339>>2] = $11;
$340 = (($3) - ($right_end))|0;
$341 = ((($f)) + 1412|0);
HEAP32[$341>>2] = $340;
$342 = ((($f)) + 1064|0);
HEAP32[$342>>2] = 1;
HEAP8[$336>>0] = 0;
$$01 = $left_start;
}
} while(0);
$350 = ((($f)) + 1388|0);
$351 = HEAP32[$350>>2]|0;
$352 = ((($f)) + 1404|0);
$353 = HEAP32[$352>>2]|0;
$354 = ($351|0)==($353|0);
if ($354) {
$355 = ((($f)) + 1064|0);
$356 = HEAP32[$355>>2]|0;
$357 = ($356|0)==(0);
if (!($357)) {
$358 = ((($f)) + 1375|0);
$359 = HEAP8[$358>>0]|0;
$360 = $359 & 4;
$361 = ($360<<24>>24)==(0);
if (!($361)) {
$362 = ((($f)) + 1408|0);
$363 = HEAP32[$362>>2]|0;
$364 = (($right_end) - ($3))|0;
$365 = (($363) + ($364))|0;
$366 = ((($f)) + 1060|0);
$367 = HEAP32[$366>>2]|0;
$368 = (($right_end) - ($$01))|0;
$369 = (($368) + ($367))|0;
$370 = ($365>>>0)<($369>>>0);
if ($370) {
$371 = ($365>>>0)<($367>>>0);
$372 = (($365) - ($367))|0;
$storemerge = $371 ? 0 : $372;
$373 = (($storemerge) + ($$01))|0;
$374 = ($373|0)>($right_end|0);
$right_end$ = $374 ? $right_end : $373;
HEAP32[$len>>2] = $right_end$;
$375 = HEAP32[$366>>2]|0;
$376 = (($375) + ($right_end$))|0;
HEAP32[$366>>2] = $376;
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
}
}
$377 = ((($f)) + 1408|0);
$378 = HEAP32[$377>>2]|0;
$379 = (($$01) - ($10))|0;
$380 = (($379) + ($378))|0;
$381 = ((($f)) + 1060|0);
HEAP32[$381>>2] = $380;
HEAP32[$355>>2] = 1;
}
$382 = ((($f)) + 1064|0);
$383 = HEAP32[$382>>2]|0;
$384 = ($383|0)==(0);
if (!($384)) {
$385 = (($right_start) - ($$01))|0;
$386 = ((($f)) + 1060|0);
$387 = HEAP32[$386>>2]|0;
$388 = (($385) + ($387))|0;
HEAP32[$386>>2] = $388;
}
$389 = HEAP32[$209>>2]|0;
$390 = ($389|0)==(0|0);
if (!($390)) {
$391 = ((($f)) + 84|0);
$392 = HEAP32[$391>>2]|0;
$393 = ((($f)) + 92|0);
$394 = HEAP32[$393>>2]|0;
$395 = ($392|0)==($394|0);
if (!($395)) {
___assert_fail((15735|0),(15523|0),3102,(16202|0));
// unreachable;
}
}
HEAP32[$len>>2] = $right_end;
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
function _prep_huffman($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 1396|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(25);
if (!($2)) {
return;
}
$3 = ($1|0)==(0);
if ($3) {
$4 = ((($f)) + 1392|0);
HEAP32[$4>>2] = 0;
}
$5 = ((($f)) + 1376|0);
$6 = ((($f)) + 1384|0);
$7 = ((($f)) + 1392|0);
while(1) {
$8 = HEAP32[$6>>2]|0;
$9 = ($8|0)==(0);
if (!($9)) {
$10 = HEAP8[$5>>0]|0;
$11 = ($10<<24>>24)==(0);
if ($11) {
label = 9;
break;
}
}
$12 = (_get8_packet_raw($f)|0);
$13 = ($12|0)==(-1);
if ($13) {
label = 9;
break;
}
$14 = HEAP32[$0>>2]|0;
$15 = $12 << $14;
$16 = HEAP32[$7>>2]|0;
$17 = (($16) + ($15))|0;
HEAP32[$7>>2] = $17;
$18 = HEAP32[$0>>2]|0;
$19 = (($18) + 8)|0;
HEAP32[$0>>2] = $19;
$20 = ($19|0)<(25);
if (!($20)) {
label = 9;
break;
}
}
if ((label|0) == 9) {
return;
}
}
function _codebook_decode_scalar_raw($f,$c) {
$f = $f|0;
$c = $c|0;
var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa25 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $9 = 0, $i$05 = 0, $i$05$lcssa = 0, $n$07 = 0, $x$0$ = 0, $x$0$lcssa = 0, $x$06 = 0, $x$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
_prep_huffman($f);
$0 = ((($c)) + 32|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$3 = ((($c)) + 2084|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(0|0);
if ($5) {
$$0 = -1;
return ($$0|0);
}
}
$6 = ((($c)) + 4|0);
$7 = HEAP32[$6>>2]|0;
$8 = ($7|0)>(8);
if ($8) {
$9 = ((($c)) + 2084|0);
$10 = HEAP32[$9>>2]|0;
$11 = ($10|0)==(0|0);
if (!($11)) {
label = 6;
}
} else {
$12 = HEAP32[$0>>2]|0;
$13 = ($12|0)==(0|0);
if ($13) {
label = 6;
}
}
if ((label|0) == 6) {
$14 = ((($f)) + 1392|0);
$15 = HEAP32[$14>>2]|0;
$16 = (_bit_reverse($15)|0);
$17 = ((($c)) + 2092|0);
$18 = HEAP32[$17>>2]|0;
$19 = ($18|0)>(1);
if ($19) {
$20 = ((($c)) + 2084|0);
$21 = HEAP32[$20>>2]|0;
$n$07 = $18;$x$06 = 0;
while(1) {
$22 = $n$07 >> 1;
$23 = (($22) + ($x$06))|0;
$24 = (($21) + ($23<<2)|0);
$25 = HEAP32[$24>>2]|0;
$26 = ($25>>>0)>($16>>>0);
$27 = (($n$07) - ($22))|0;
$x$0$ = $26 ? $x$06 : $23;
$$ = $26 ? $22 : $27;
$28 = ($$|0)>(1);
if ($28) {
$n$07 = $$;$x$06 = $x$0$;
} else {
$x$0$lcssa = $x$0$;
break;
}
}
} else {
$x$0$lcssa = 0;
}
$29 = ((($c)) + 23|0);
$30 = HEAP8[$29>>0]|0;
$31 = ($30<<24>>24)==(0);
if ($31) {
$32 = ((($c)) + 2088|0);
$33 = HEAP32[$32>>2]|0;
$34 = (($33) + ($x$0$lcssa<<2)|0);
$35 = HEAP32[$34>>2]|0;
$x$1 = $35;
} else {
$x$1 = $x$0$lcssa;
}
$36 = ((($c)) + 8|0);
$37 = HEAP32[$36>>2]|0;
$38 = (($37) + ($x$1)|0);
$39 = HEAP8[$38>>0]|0;
$40 = $39&255;
$41 = ((($f)) + 1396|0);
$42 = HEAP32[$41>>2]|0;
$43 = ($42|0)<($40|0);
if ($43) {
HEAP32[$41>>2] = 0;
$$0 = -1;
return ($$0|0);
} else {
$44 = HEAP32[$14>>2]|0;
$45 = $44 >>> $40;
HEAP32[$14>>2] = $45;
$46 = HEAP32[$41>>2]|0;
$47 = (($46) - ($40))|0;
HEAP32[$41>>2] = $47;
$$0 = $x$1;
return ($$0|0);
}
}
$48 = ((($c)) + 23|0);
$49 = HEAP8[$48>>0]|0;
$50 = ($49<<24>>24)==(0);
if (!($50)) {
___assert_fail((16380|0),(15523|0),1248,(16391|0));
// unreachable;
}
$51 = HEAP32[$6>>2]|0;
$52 = ($51|0)>(0);
L27: do {
if ($52) {
$53 = ((($c)) + 8|0);
$54 = HEAP32[$53>>2]|0;
$55 = ((($f)) + 1392|0);
$i$05 = 0;
while(1) {
$56 = (($54) + ($i$05)|0);
$57 = HEAP8[$56>>0]|0;
$58 = $57&255;
$59 = ($57<<24>>24)==(-1);
if (!($59)) {
$60 = HEAP32[$0>>2]|0;
$61 = (($60) + ($i$05<<2)|0);
$62 = HEAP32[$61>>2]|0;
$63 = HEAP32[$55>>2]|0;
$64 = 1 << $58;
$65 = (($64) + -1)|0;
$66 = $63 & $65;
$67 = ($62|0)==($66|0);
if ($67) {
$$lcssa = $58;$$lcssa25 = $63;$i$05$lcssa = $i$05;
break;
}
}
$78 = (($i$05) + 1)|0;
$79 = HEAP32[$6>>2]|0;
$80 = ($78|0)<($79|0);
if ($80) {
$i$05 = $78;
} else {
break L27;
}
}
$68 = ((($f)) + 1396|0);
$69 = HEAP32[$68>>2]|0;
$70 = ($69|0)<($$lcssa|0);
if ($70) {
HEAP32[$68>>2] = 0;
$$0 = -1;
return ($$0|0);
} else {
$71 = $$lcssa25 >>> $$lcssa;
HEAP32[$55>>2] = $71;
$72 = HEAP32[$53>>2]|0;
$73 = (($72) + ($i$05$lcssa)|0);
$74 = HEAP8[$73>>0]|0;
$75 = $74&255;
$76 = HEAP32[$68>>2]|0;
$77 = (($76) - ($75))|0;
HEAP32[$68>>2] = $77;
$$0 = $i$05$lcssa;
return ($$0|0);
}
}
} while(0);
_error($f,21);
$81 = ((($f)) + 1396|0);
HEAP32[$81>>2] = 0;
$$0 = -1;
return ($$0|0);
}
function _predict_point($x,$x0,$x1,$y0,$y1) {
$x = $x|0;
$x0 = $x0|0;
$x1 = $x1|0;
$y0 = $y0|0;
$y1 = $y1|0;
var $$p = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $ispos = 0, $neg = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (($y1) - ($y0))|0;
$1 = (($x1) - ($x0))|0;
$ispos = ($0|0)>(-1);
$neg = (0 - ($0))|0;
$2 = $ispos ? $0 : $neg;
$3 = (($x) - ($x0))|0;
$4 = Math_imul($2, $3)|0;
$5 = (($4|0) / ($1|0))&-1;
$6 = ($0|0)<(0);
$7 = (0 - ($5))|0;
$$p = $6 ? $7 : $5;
$8 = (($$p) + ($y0))|0;
return ($8|0);
}
function _decode_residue($f,$residue_buffers,$ch,$n,$rn,$do_not_decode) {
$f = $f|0;
$residue_buffers = $residue_buffers|0;
$ch = $ch|0;
$n = $n|0;
$rn = $rn|0;
$do_not_decode = $do_not_decode|0;
var $$ = 0, $$10 = 0, $$11 = 0, $$13 = 0, $$14 = 0, $$5 = 0, $$7 = 0, $$8 = 0, $$alloca_mul = 0, $$not = 0, $$not115 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
var $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0;
var $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0;
var $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0;
var $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0;
var $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0;
var $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0;
var $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0;
var $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0;
var $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0;
var $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $c_inter = 0, $c_inter16 = 0, $c_inter6 = 0;
var $class_set$055 = 0, $class_set$147 = 0, $class_set$263 = 0, $class_set26$087 = 0, $exitcond = 0, $i$092 = 0, $i$152 = 0, $i$246 = 0, $i$360 = 0, $i$484 = 0, $j$0$lcssa = 0, $j$070 = 0, $j$175 = 0, $j$278 = 0, $or$cond = 0, $or$cond12 = 0, $or$cond1258 = 0, $or$cond15 = 0, $or$cond1581 = 0, $or$cond6 = 0;
var $or$cond650 = 0, $or$cond9 = 0, $or$cond944 = 0, $p_inter = 0, $p_inter17 = 0, $p_inter7 = 0, $pass$066 = 0, $pass$190 = 0, $pcount$056 = 0, $pcount$1$lcssa = 0, $pcount$151 = 0, $pcount$248 = 0, $pcount$3$lcssa = 0, $pcount$345 = 0, $pcount$464 = 0, $pcount$5$lcssa = 0, $pcount$559 = 0, $pcount25$086 = 0, $pcount25$1$lcssa = 0, $pcount25$182 = 0;
var $q$0 = 0, $q$1 = 0, $q19$0 = 0, $q19$1 = 0, $q9$0 = 0, $q9$1 = 0, $temp$0 = 0, $temp$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$c_inter = sp + 20|0;
$p_inter = sp + 16|0;
$c_inter6 = sp + 12|0;
$p_inter7 = sp + 8|0;
$c_inter16 = sp + 4|0;
$p_inter17 = sp;
$0 = ((($f)) + 396|0);
$1 = HEAP32[$0>>2]|0;
$2 = (((($f)) + 268|0) + ($rn<<1)|0);
$3 = HEAP16[$2>>1]|0;
$4 = $3&65535;
$5 = (((($1) + (($rn*24)|0)|0)) + 13|0);
$6 = HEAP8[$5>>0]|0;
$7 = $6&255;
$8 = ((($f)) + 124|0);
$9 = HEAP32[$8>>2]|0;
$10 = (($9) + (($7*2096)|0)|0);
$11 = HEAP32[$10>>2]|0;
$12 = (((($1) + (($rn*24)|0)|0)) + 4|0);
$13 = HEAP32[$12>>2]|0;
$14 = (($1) + (($rn*24)|0)|0);
$15 = HEAP32[$14>>2]|0;
$16 = (($13) - ($15))|0;
$17 = (((($1) + (($rn*24)|0)|0)) + 8|0);
$18 = HEAP32[$17>>2]|0;
$19 = (($16>>>0) / ($18>>>0))&-1;
$20 = ((($f)) + 92|0);
$21 = HEAP32[$20>>2]|0;
$22 = ((($f)) + 80|0);
$23 = HEAP32[$22>>2]|0;
$24 = ($23|0)==(0|0);
$25 = ((($f)) + 4|0);
$26 = HEAP32[$25>>2]|0;
$27 = $19 << 2;
$28 = (($27) + 4)|0;
$29 = Math_imul($26, $28)|0;
if ($24) {
$$alloca_mul = $29;
$31 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;;
$33 = $31;
} else {
$30 = (_setup_temp_malloc($f,$29)|0);
$33 = $30;
}
$32 = HEAP32[$25>>2]|0;
$34 = (_make_block_array($33,$32,$27)|0);
$35 = ($ch|0)>(0);
if ($35) {
$36 = $n << 2;
$i$092 = 0;
while(1) {
$37 = (($do_not_decode) + ($i$092)|0);
$38 = HEAP8[$37>>0]|0;
$39 = ($38<<24>>24)==(0);
if ($39) {
$40 = (($residue_buffers) + ($i$092<<2)|0);
$41 = HEAP32[$40>>2]|0;
_memset(($41|0),0,($36|0))|0;
}
$42 = (($i$092) + 1)|0;
$exitcond = ($42|0)==($ch|0);
if ($exitcond) {
break;
} else {
$i$092 = $42;
}
}
}
$43 = ($3<<16>>16)==(2);
$44 = ($ch|0)!=(1);
$or$cond = $44 & $43;
if (!($or$cond)) {
$45 = ($19|0)>(0);
$46 = ($11|0)>(0);
$47 = ($ch|0)>(0);
$48 = (((($1) + (($rn*24)|0)|0)) + 20|0);
$49 = ((($f)) + 1396|0);
$50 = ((($f)) + 1392|0);
$51 = (((($1) + (($rn*24)|0)|0)) + 16|0);
$$not115 = ($ch|0)<(1);
$pass$190 = 0;
L15: while(1) {
if ($45) {
$$not = ($pass$190|0)!=(0);
$brmerge = $$not | $$not115;
$class_set26$087 = 0;$pcount25$086 = 0;
while(1) {
if (!($brmerge)) {
$j$175 = 0;
while(1) {
$289 = (($do_not_decode) + ($j$175)|0);
$290 = HEAP8[$289>>0]|0;
$291 = ($290<<24>>24)==(0);
if ($291) {
$292 = HEAP32[$8>>2]|0;
$293 = HEAP8[$5>>0]|0;
$294 = $293&255;
$295 = (($292) + (($294*2096)|0)|0);
$296 = HEAP32[$49>>2]|0;
$297 = ($296|0)<(10);
if ($297) {
_prep_huffman($f);
}
$298 = HEAP32[$50>>2]|0;
$299 = $298 & 1023;
$300 = ((((($292) + (($294*2096)|0)|0)) + 36|0) + ($299<<1)|0);
$301 = HEAP16[$300>>1]|0;
$302 = $301 << 16 >> 16;
$303 = ($301<<16>>16)>(-1);
if ($303) {
$304 = (((($292) + (($294*2096)|0)|0)) + 8|0);
$305 = HEAP32[$304>>2]|0;
$306 = (($305) + ($302)|0);
$307 = HEAP8[$306>>0]|0;
$308 = $307&255;
$309 = $298 >>> $308;
HEAP32[$50>>2] = $309;
$310 = HEAP32[$49>>2]|0;
$311 = (($310) - ($308))|0;
$312 = ($311|0)<(0);
$$13 = $312 ? 0 : $311;
HEAP32[$49>>2] = $$13;
$$14 = $312 ? -1 : $302;
$temp$0 = $$14;
} else {
$313 = (_codebook_decode_scalar_raw($f,$295)|0);
$temp$0 = $313;
}
$314 = (((($292) + (($294*2096)|0)|0)) + 23|0);
$315 = HEAP8[$314>>0]|0;
$316 = ($315<<24>>24)==(0);
if ($316) {
$temp$1 = $temp$0;
} else {
$317 = (((($292) + (($294*2096)|0)|0)) + 2088|0);
$318 = HEAP32[$317>>2]|0;
$319 = (($318) + ($temp$0<<2)|0);
$320 = HEAP32[$319>>2]|0;
$temp$1 = $320;
}
$321 = ($temp$1|0)==(-1);
if ($321) {
label = 95;
break L15;
}
$322 = HEAP32[$51>>2]|0;
$323 = (($322) + ($temp$1<<2)|0);
$324 = HEAP32[$323>>2]|0;
$325 = (($34) + ($j$175<<2)|0);
$326 = HEAP32[$325>>2]|0;
$327 = (($326) + ($class_set26$087<<2)|0);
HEAP32[$327>>2] = $324;
}
$328 = (($j$175) + 1)|0;
$329 = ($328|0)<($ch|0);
if ($329) {
$j$175 = $328;
} else {
break;
}
}
}
$288 = ($pcount25$086|0)<($19|0);
$or$cond1581 = $288 & $46;
if ($or$cond1581) {
$i$484 = 0;$pcount25$182 = $pcount25$086;
while(1) {
if ($47) {
$j$278 = 0;
while(1) {
$330 = (($do_not_decode) + ($j$278)|0);
$331 = HEAP8[$330>>0]|0;
$332 = ($331<<24>>24)==(0);
if ($332) {
$333 = (($34) + ($j$278<<2)|0);
$334 = HEAP32[$333>>2]|0;
$335 = (($334) + ($class_set26$087<<2)|0);
$336 = HEAP32[$335>>2]|0;
$337 = (($336) + ($i$484)|0);
$338 = HEAP8[$337>>0]|0;
$339 = $338&255;
$340 = HEAP32[$48>>2]|0;
$341 = ((($340) + ($339<<4)|0) + ($pass$190<<1)|0);
$342 = HEAP16[$341>>1]|0;
$343 = ($342<<16>>16)>(-1);
if ($343) {
$344 = $342 << 16 >> 16;
$345 = (($residue_buffers) + ($j$278<<2)|0);
$346 = HEAP32[$345>>2]|0;
$347 = HEAP32[$14>>2]|0;
$348 = HEAP32[$17>>2]|0;
$349 = Math_imul($348, $pcount25$182)|0;
$350 = (($349) + ($347))|0;
$351 = HEAP32[$8>>2]|0;
$352 = (($351) + (($344*2096)|0)|0);
$353 = (_residue_decode($f,$352,$346,$350,$348,$4)|0);
$354 = ($353|0)==(0);
if ($354) {
label = 95;
break L15;
}
}
}
$355 = (($j$278) + 1)|0;
$356 = ($355|0)<($ch|0);
if ($356) {
$j$278 = $355;
} else {
break;
}
}
}
$357 = (($i$484) + 1)|0;
$358 = (($pcount25$182) + 1)|0;
$359 = ($357|0)<($11|0);
$360 = ($358|0)<($19|0);
$or$cond15 = $360 & $359;
if ($or$cond15) {
$i$484 = $357;$pcount25$182 = $358;
} else {
$pcount25$1$lcssa = $358;
break;
}
}
} else {
$pcount25$1$lcssa = $pcount25$086;
}
$361 = (($class_set26$087) + 1)|0;
$362 = ($pcount25$1$lcssa|0)<($19|0);
if ($362) {
$class_set26$087 = $361;$pcount25$086 = $pcount25$1$lcssa;
} else {
break;
}
}
}
$363 = (($pass$190) + 1)|0;
$364 = ($363|0)<(8);
if ($364) {
$pass$190 = $363;
} else {
label = 95;
break;
}
}
if ((label|0) == 95) {
HEAP32[$20>>2] = $21;
STACKTOP = sp;return;
}
}
$52 = ($ch|0)>(0);
L57: do {
if ($52) {
$j$070 = 0;
while(1) {
$53 = (($do_not_decode) + ($j$070)|0);
$54 = HEAP8[$53>>0]|0;
$55 = ($54<<24>>24)==(0);
if ($55) {
$j$0$lcssa = $j$070;
break L57;
}
$56 = (($j$070) + 1)|0;
$57 = ($56|0)<($ch|0);
if ($57) {
$j$070 = $56;
} else {
$j$0$lcssa = $56;
break;
}
}
} else {
$j$0$lcssa = 0;
}
} while(0);
$58 = ($j$0$lcssa|0)==($ch|0);
if ($58) {
HEAP32[$20>>2] = $21;
STACKTOP = sp;return;
}
$59 = ($19|0)>(0);
$60 = ((($f)) + 1396|0);
$61 = ((($f)) + 1392|0);
$62 = (((($1) + (($rn*24)|0)|0)) + 16|0);
$63 = ($11|0)>(0);
$64 = (((($1) + (($rn*24)|0)|0)) + 20|0);
$65 = ($19|0)>(0);
$66 = ((($f)) + 1396|0);
$67 = ((($f)) + 1392|0);
$68 = (((($1) + (($rn*24)|0)|0)) + 16|0);
$69 = ($11|0)>(0);
$70 = (((($1) + (($rn*24)|0)|0)) + 20|0);
$71 = ($19|0)>(0);
$72 = ((($f)) + 1396|0);
$73 = ((($f)) + 1392|0);
$74 = (((($1) + (($rn*24)|0)|0)) + 16|0);
$75 = ($11|0)>(0);
$76 = (((($1) + (($rn*24)|0)|0)) + 20|0);
$pass$066 = 0;
L65: while(1) {
switch ($ch|0) {
case 2: {
if ($65) {
$78 = ($pass$066|0)==(0);
$class_set$055 = 0;$pcount$056 = 0;
while(1) {
$80 = HEAP32[$14>>2]|0;
$81 = HEAP32[$17>>2]|0;
$82 = Math_imul($81, $pcount$056)|0;
$83 = (($82) + ($80))|0;
$84 = $83 & 1;
HEAP32[$c_inter>>2] = $84;
$85 = $83 >> 1;
HEAP32[$p_inter>>2] = $85;
if ($78) {
$86 = HEAP32[$8>>2]|0;
$87 = HEAP8[$5>>0]|0;
$88 = $87&255;
$89 = (($86) + (($88*2096)|0)|0);
$90 = HEAP32[$66>>2]|0;
$91 = ($90|0)<(10);
if ($91) {
_prep_huffman($f);
}
$92 = HEAP32[$67>>2]|0;
$93 = $92 & 1023;
$94 = ((((($86) + (($88*2096)|0)|0)) + 36|0) + ($93<<1)|0);
$95 = HEAP16[$94>>1]|0;
$96 = $95 << 16 >> 16;
$97 = ($95<<16>>16)>(-1);
if ($97) {
$98 = (((($86) + (($88*2096)|0)|0)) + 8|0);
$99 = HEAP32[$98>>2]|0;
$100 = (($99) + ($96)|0);
$101 = HEAP8[$100>>0]|0;
$102 = $101&255;
$103 = $92 >>> $102;
HEAP32[$67>>2] = $103;
$104 = HEAP32[$66>>2]|0;
$105 = (($104) - ($102))|0;
$106 = ($105|0)<(0);
$$ = $106 ? 0 : $105;
HEAP32[$66>>2] = $$;
$$5 = $106 ? -1 : $96;
$q$0 = $$5;
} else {
$107 = (_codebook_decode_scalar_raw($f,$89)|0);
$q$0 = $107;
}
$108 = (((($86) + (($88*2096)|0)|0)) + 23|0);
$109 = HEAP8[$108>>0]|0;
$110 = ($109<<24>>24)==(0);
if ($110) {
$q$1 = $q$0;
} else {
$111 = (((($86) + (($88*2096)|0)|0)) + 2088|0);
$112 = HEAP32[$111>>2]|0;
$113 = (($112) + ($q$0<<2)|0);
$114 = HEAP32[$113>>2]|0;
$q$1 = $114;
}
$115 = ($q$1|0)==(-1);
if ($115) {
label = 95;
break L65;
}
$116 = HEAP32[$68>>2]|0;
$117 = (($116) + ($q$1<<2)|0);
$118 = HEAP32[$117>>2]|0;
$119 = HEAP32[$34>>2]|0;
$120 = (($119) + ($class_set$055<<2)|0);
HEAP32[$120>>2] = $118;
}
$121 = ($pcount$056|0)<($19|0);
$or$cond650 = $121 & $69;
if ($or$cond650) {
$i$152 = 0;$pcount$151 = $pcount$056;
while(1) {
$122 = HEAP32[$17>>2]|0;
$123 = HEAP32[$34>>2]|0;
$124 = (($123) + ($class_set$055<<2)|0);
$125 = HEAP32[$124>>2]|0;
$126 = (($125) + ($i$152)|0);
$127 = HEAP8[$126>>0]|0;
$128 = $127&255;
$129 = HEAP32[$70>>2]|0;
$130 = ((($129) + ($128<<4)|0) + ($pass$066<<1)|0);
$131 = HEAP16[$130>>1]|0;
$132 = ($131<<16>>16)>(-1);
if ($132) {
$133 = $131 << 16 >> 16;
$134 = HEAP32[$8>>2]|0;
$135 = (($134) + (($133*2096)|0)|0);
$136 = (_codebook_decode_deinterleave_repeat($f,$135,$residue_buffers,$ch,$c_inter,$p_inter,$n,$122)|0);
$137 = ($136|0)==(0);
if ($137) {
label = 95;
break L65;
}
} else {
$138 = HEAP32[$14>>2]|0;
$139 = Math_imul($122, $pcount$151)|0;
$140 = (($139) + ($122))|0;
$141 = (($140) + ($138))|0;
$142 = $141 & 1;
HEAP32[$c_inter>>2] = $142;
$143 = $141 >> 1;
HEAP32[$p_inter>>2] = $143;
}
$144 = (($i$152) + 1)|0;
$145 = (($pcount$151) + 1)|0;
$146 = ($144|0)<($11|0);
$147 = ($145|0)<($19|0);
$or$cond6 = $147 & $146;
if ($or$cond6) {
$i$152 = $144;$pcount$151 = $145;
} else {
$pcount$1$lcssa = $145;
break;
}
}
} else {
$pcount$1$lcssa = $pcount$056;
}
$148 = (($class_set$055) + 1)|0;
$149 = ($pcount$1$lcssa|0)<($19|0);
if ($149) {
$class_set$055 = $148;$pcount$056 = $pcount$1$lcssa;
} else {
break;
}
}
}
break;
}
case 1: {
if ($71) {
$77 = ($pass$066|0)==(0);
$class_set$147 = 0;$pcount$248 = 0;
while(1) {
$150 = HEAP32[$14>>2]|0;
$151 = HEAP32[$17>>2]|0;
$152 = Math_imul($151, $pcount$248)|0;
$153 = (($152) + ($150))|0;
HEAP32[$c_inter6>>2] = 0;
HEAP32[$p_inter7>>2] = $153;
if ($77) {
$154 = HEAP32[$8>>2]|0;
$155 = HEAP8[$5>>0]|0;
$156 = $155&255;
$157 = (($154) + (($156*2096)|0)|0);
$158 = HEAP32[$72>>2]|0;
$159 = ($158|0)<(10);
if ($159) {
_prep_huffman($f);
}
$160 = HEAP32[$73>>2]|0;
$161 = $160 & 1023;
$162 = ((((($154) + (($156*2096)|0)|0)) + 36|0) + ($161<<1)|0);
$163 = HEAP16[$162>>1]|0;
$164 = $163 << 16 >> 16;
$165 = ($163<<16>>16)>(-1);
if ($165) {
$166 = (((($154) + (($156*2096)|0)|0)) + 8|0);
$167 = HEAP32[$166>>2]|0;
$168 = (($167) + ($164)|0);
$169 = HEAP8[$168>>0]|0;
$170 = $169&255;
$171 = $160 >>> $170;
HEAP32[$73>>2] = $171;
$172 = HEAP32[$72>>2]|0;
$173 = (($172) - ($170))|0;
$174 = ($173|0)<(0);
$$7 = $174 ? 0 : $173;
HEAP32[$72>>2] = $$7;
$$8 = $174 ? -1 : $164;
$q9$0 = $$8;
} else {
$175 = (_codebook_decode_scalar_raw($f,$157)|0);
$q9$0 = $175;
}
$176 = (((($154) + (($156*2096)|0)|0)) + 23|0);
$177 = HEAP8[$176>>0]|0;
$178 = ($177<<24>>24)==(0);
if ($178) {
$q9$1 = $q9$0;
} else {
$179 = (((($154) + (($156*2096)|0)|0)) + 2088|0);
$180 = HEAP32[$179>>2]|0;
$181 = (($180) + ($q9$0<<2)|0);
$182 = HEAP32[$181>>2]|0;
$q9$1 = $182;
}
$183 = ($q9$1|0)==(-1);
if ($183) {
label = 95;
break L65;
}
$184 = HEAP32[$74>>2]|0;
$185 = (($184) + ($q9$1<<2)|0);
$186 = HEAP32[$185>>2]|0;
$187 = HEAP32[$34>>2]|0;
$188 = (($187) + ($class_set$147<<2)|0);
HEAP32[$188>>2] = $186;
}
$189 = ($pcount$248|0)<($19|0);
$or$cond944 = $189 & $75;
if ($or$cond944) {
$i$246 = 0;$pcount$345 = $pcount$248;
while(1) {
$190 = HEAP32[$17>>2]|0;
$191 = HEAP32[$34>>2]|0;
$192 = (($191) + ($class_set$147<<2)|0);
$193 = HEAP32[$192>>2]|0;
$194 = (($193) + ($i$246)|0);
$195 = HEAP8[$194>>0]|0;
$196 = $195&255;
$197 = HEAP32[$76>>2]|0;
$198 = ((($197) + ($196<<4)|0) + ($pass$066<<1)|0);
$199 = HEAP16[$198>>1]|0;
$200 = ($199<<16>>16)>(-1);
if ($200) {
$201 = $199 << 16 >> 16;
$202 = HEAP32[$8>>2]|0;
$203 = (($202) + (($201*2096)|0)|0);
$204 = (_codebook_decode_deinterleave_repeat($f,$203,$residue_buffers,$ch,$c_inter6,$p_inter7,$n,$190)|0);
$205 = ($204|0)==(0);
if ($205) {
label = 95;
break L65;
}
} else {
$206 = HEAP32[$14>>2]|0;
$207 = Math_imul($190, $pcount$345)|0;
$208 = (($207) + ($190))|0;
$209 = (($208) + ($206))|0;
HEAP32[$c_inter6>>2] = 0;
HEAP32[$p_inter7>>2] = $209;
}
$210 = (($i$246) + 1)|0;
$211 = (($pcount$345) + 1)|0;
$212 = ($210|0)<($11|0);
$213 = ($211|0)<($19|0);
$or$cond9 = $213 & $212;
if ($or$cond9) {
$i$246 = $210;$pcount$345 = $211;
} else {
$pcount$3$lcssa = $211;
break;
}
}
} else {
$pcount$3$lcssa = $pcount$248;
}
$214 = (($class_set$147) + 1)|0;
$215 = ($pcount$3$lcssa|0)<($19|0);
if ($215) {
$class_set$147 = $214;$pcount$248 = $pcount$3$lcssa;
} else {
break;
}
}
}
break;
}
default: {
if ($59) {
$79 = ($pass$066|0)==(0);
$class_set$263 = 0;$pcount$464 = 0;
while(1) {
$216 = HEAP32[$14>>2]|0;
$217 = HEAP32[$17>>2]|0;
$218 = Math_imul($217, $pcount$464)|0;
$219 = (($218) + ($216))|0;
$220 = (($219|0) % ($ch|0))&-1;
HEAP32[$c_inter16>>2] = $220;
$221 = (($219|0) / ($ch|0))&-1;
HEAP32[$p_inter17>>2] = $221;
if ($79) {
$222 = HEAP32[$8>>2]|0;
$223 = HEAP8[$5>>0]|0;
$224 = $223&255;
$225 = (($222) + (($224*2096)|0)|0);
$226 = HEAP32[$60>>2]|0;
$227 = ($226|0)<(10);
if ($227) {
_prep_huffman($f);
}
$228 = HEAP32[$61>>2]|0;
$229 = $228 & 1023;
$230 = ((((($222) + (($224*2096)|0)|0)) + 36|0) + ($229<<1)|0);
$231 = HEAP16[$230>>1]|0;
$232 = $231 << 16 >> 16;
$233 = ($231<<16>>16)>(-1);
if ($233) {
$234 = (((($222) + (($224*2096)|0)|0)) + 8|0);
$235 = HEAP32[$234>>2]|0;
$236 = (($235) + ($232)|0);
$237 = HEAP8[$236>>0]|0;
$238 = $237&255;
$239 = $228 >>> $238;
HEAP32[$61>>2] = $239;
$240 = HEAP32[$60>>2]|0;
$241 = (($240) - ($238))|0;
$242 = ($241|0)<(0);
$$10 = $242 ? 0 : $241;
HEAP32[$60>>2] = $$10;
$$11 = $242 ? -1 : $232;
$q19$0 = $$11;
} else {
$243 = (_codebook_decode_scalar_raw($f,$225)|0);
$q19$0 = $243;
}
$244 = (((($222) + (($224*2096)|0)|0)) + 23|0);
$245 = HEAP8[$244>>0]|0;
$246 = ($245<<24>>24)==(0);
if ($246) {
$q19$1 = $q19$0;
} else {
$247 = (((($222) + (($224*2096)|0)|0)) + 2088|0);
$248 = HEAP32[$247>>2]|0;
$249 = (($248) + ($q19$0<<2)|0);
$250 = HEAP32[$249>>2]|0;
$q19$1 = $250;
}
$251 = ($q19$1|0)==(-1);
if ($251) {
label = 95;
break L65;
}
$252 = HEAP32[$62>>2]|0;
$253 = (($252) + ($q19$1<<2)|0);
$254 = HEAP32[$253>>2]|0;
$255 = HEAP32[$34>>2]|0;
$256 = (($255) + ($class_set$263<<2)|0);
HEAP32[$256>>2] = $254;
}
$257 = ($pcount$464|0)<($19|0);
$or$cond1258 = $257 & $63;
if ($or$cond1258) {
$i$360 = 0;$pcount$559 = $pcount$464;
while(1) {
$258 = HEAP32[$17>>2]|0;
$259 = HEAP32[$34>>2]|0;
$260 = (($259) + ($class_set$263<<2)|0);
$261 = HEAP32[$260>>2]|0;
$262 = (($261) + ($i$360)|0);
$263 = HEAP8[$262>>0]|0;
$264 = $263&255;
$265 = HEAP32[$64>>2]|0;
$266 = ((($265) + ($264<<4)|0) + ($pass$066<<1)|0);
$267 = HEAP16[$266>>1]|0;
$268 = ($267<<16>>16)>(-1);
if ($268) {
$269 = $267 << 16 >> 16;
$270 = HEAP32[$8>>2]|0;
$271 = (($270) + (($269*2096)|0)|0);
$272 = (_codebook_decode_deinterleave_repeat($f,$271,$residue_buffers,$ch,$c_inter16,$p_inter17,$n,$258)|0);
$273 = ($272|0)==(0);
if ($273) {
label = 95;
break L65;
}
} else {
$274 = HEAP32[$14>>2]|0;
$275 = Math_imul($258, $pcount$559)|0;
$276 = (($275) + ($258))|0;
$277 = (($276) + ($274))|0;
$278 = (($277|0) % ($ch|0))&-1;
HEAP32[$c_inter16>>2] = $278;
$279 = (($277|0) / ($ch|0))&-1;
HEAP32[$p_inter17>>2] = $279;
}
$280 = (($i$360) + 1)|0;
$281 = (($pcount$559) + 1)|0;
$282 = ($280|0)<($11|0);
$283 = ($281|0)<($19|0);
$or$cond12 = $283 & $282;
if ($or$cond12) {
$i$360 = $280;$pcount$559 = $281;
} else {
$pcount$5$lcssa = $281;
break;
}
}
} else {
$pcount$5$lcssa = $pcount$464;
}
$284 = (($class_set$263) + 1)|0;
$285 = ($pcount$5$lcssa|0)<($19|0);
if ($285) {
$class_set$263 = $284;$pcount$464 = $pcount$5$lcssa;
} else {
break;
}
}
}
}
}
$286 = (($pass$066) + 1)|0;
$287 = ($286|0)<(8);
if ($287) {
$pass$066 = $286;
} else {
label = 95;
break;
}
}
if ((label|0) == 95) {
HEAP32[$20>>2] = $21;
STACKTOP = sp;return;
}
}
function _do_floor($f,$map,$i,$n,$target,$finalY) {
$f = $f|0;
$map = $map|0;
$i = $i|0;
$n = $n|0;
$target = $target|0;
$finalY = $finalY|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0;
var $45 = 0.0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $j$01 = 0, $lx$0$lcssa = 0, $lx$03 = 0, $lx$1 = 0, $ly$0$lcssa = 0, $ly$04 = 0, $ly$1 = 0, $q$02 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n >> 1;
$1 = ((($map)) + 4|0);
$2 = HEAP32[$1>>2]|0;
$3 = (((($2) + (($i*3)|0)|0)) + 2|0);
$4 = HEAP8[$3>>0]|0;
$5 = $4&255;
$6 = (((($map)) + 9|0) + ($5)|0);
$7 = HEAP8[$6>>0]|0;
$8 = $7&255;
$9 = (((($f)) + 132|0) + ($8<<1)|0);
$10 = HEAP16[$9>>1]|0;
$11 = ($10<<16>>16)==(0);
if ($11) {
_error($f,21);
return;
}
$12 = ((($f)) + 260|0);
$13 = HEAP32[$12>>2]|0;
$14 = HEAP16[$finalY>>1]|0;
$15 = $14 << 16 >> 16;
$16 = (((($13) + (($8*1596)|0)|0)) + 1588|0);
$17 = HEAP8[$16>>0]|0;
$18 = $17&255;
$19 = Math_imul($18, $15)|0;
$20 = (((($13) + (($8*1596)|0)|0)) + 1592|0);
$21 = HEAP32[$20>>2]|0;
$22 = ($21|0)>(1);
if ($22) {
$lx$03 = 0;$ly$04 = $19;$q$02 = 1;
while(1) {
$23 = ((((($13) + (($8*1596)|0)|0)) + 838|0) + ($q$02)|0);
$24 = HEAP8[$23>>0]|0;
$25 = $24&255;
$26 = (($finalY) + ($25<<1)|0);
$27 = HEAP16[$26>>1]|0;
$28 = ($27<<16>>16)>(-1);
if ($28) {
$29 = $27 << 16 >> 16;
$30 = HEAP8[$16>>0]|0;
$31 = $30&255;
$32 = Math_imul($31, $29)|0;
$33 = ((((($13) + (($8*1596)|0)|0)) + 338|0) + ($25<<1)|0);
$34 = HEAP16[$33>>1]|0;
$35 = $34&65535;
$36 = ($lx$03|0)==($35|0);
if ($36) {
$lx$1 = $35;$ly$1 = $32;
} else {
_draw_line($target,$lx$03,$ly$04,$35,$32,$0);
$lx$1 = $35;$ly$1 = $32;
}
} else {
$lx$1 = $lx$03;$ly$1 = $ly$04;
}
$37 = (($q$02) + 1)|0;
$38 = HEAP32[$20>>2]|0;
$39 = ($37|0)<($38|0);
if ($39) {
$lx$03 = $lx$1;$ly$04 = $ly$1;$q$02 = $37;
} else {
$lx$0$lcssa = $lx$1;$ly$0$lcssa = $ly$1;
break;
}
}
} else {
$lx$0$lcssa = 0;$ly$0$lcssa = $19;
}
$40 = ($lx$0$lcssa|0)<($0|0);
if (!($40)) {
return;
}
$41 = (6864 + ($ly$0$lcssa<<2)|0);
$42 = +HEAPF32[$41>>2];
$j$01 = $lx$0$lcssa;
while(1) {
$43 = (($target) + ($j$01<<2)|0);
$44 = +HEAPF32[$43>>2];
$45 = $42 * $44;
HEAPF32[$43>>2] = $45;
$46 = (($j$01) + 1)|0;
$exitcond = ($46|0)==($0|0);
if ($exitcond) {
break;
} else {
$j$01 = $46;
}
}
return;
}
function _inverse_mdct($buffer,$n,$f,$blocktype) {
$buffer = $buffer|0;
$n = $n|0;
$f = $f|0;
$blocktype = $blocktype|0;
var $$alloca_mul = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0;
var $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0;
var $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0;
var $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0;
var $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0.0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0.0;
var $241 = 0.0, $242 = 0, $243 = 0.0, $244 = 0.0, $245 = 0.0, $246 = 0.0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0.0, $250 = 0.0, $251 = 0.0, $252 = 0.0, $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0.0, $257 = 0, $258 = 0.0, $259 = 0.0;
var $26 = 0.0, $260 = 0.0, $261 = 0, $262 = 0.0, $263 = 0, $264 = 0.0, $265 = 0.0, $266 = 0, $267 = 0.0, $268 = 0.0, $269 = 0, $27 = 0.0, $270 = 0.0, $271 = 0.0, $272 = 0.0, $273 = 0.0, $274 = 0.0, $275 = 0.0, $276 = 0.0, $277 = 0.0;
var $278 = 0.0, $279 = 0.0, $28 = 0, $280 = 0.0, $281 = 0.0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0.0;
var $296 = 0, $297 = 0.0, $298 = 0.0, $299 = 0, $3 = 0, $30 = 0, $300 = 0.0, $301 = 0, $302 = 0.0, $303 = 0.0, $304 = 0.0, $305 = 0.0, $306 = 0.0, $307 = 0.0, $308 = 0.0, $309 = 0.0, $31 = 0.0, $310 = 0, $311 = 0, $312 = 0;
var $313 = 0.0, $314 = 0, $315 = 0.0, $316 = 0.0, $317 = 0, $318 = 0.0, $319 = 0, $32 = 0.0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0.0, $325 = 0.0, $326 = 0.0, $327 = 0, $328 = 0.0, $329 = 0, $33 = 0.0, $330 = 0;
var $331 = 0, $332 = 0, $333 = 0.0, $334 = 0, $335 = 0.0, $336 = 0.0, $337 = 0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0.0, $347 = 0, $348 = 0.0, $349 = 0;
var $35 = 0.0, $350 = 0, $351 = 0, $352 = 0.0, $353 = 0, $354 = 0.0, $355 = 0.0, $356 = 0, $357 = 0.0, $358 = 0.0, $359 = 0.0, $36 = 0.0, $360 = 0.0, $361 = 0.0, $362 = 0.0, $363 = 0.0, $364 = 0.0, $365 = 0, $366 = 0.0, $367 = 0;
var $368 = 0, $369 = 0, $37 = 0.0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
var $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0;
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0;
var $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $A0$024 = 0, $AA$0$lcssa = 0, $AA$050 = 0, $AA$144 = 0;
var $AA1$040 = 0, $B$08 = 0, $C$010 = 0, $bitrev$016 = 0, $d$0$lcssa = 0, $d$052 = 0, $d$146 = 0, $d0$039 = 0, $d05$017 = 0, $d09$04 = 0, $d1$038 = 0, $d110$05 = 0, $d16$018 = 0, $d2$06 = 0, $d3$07 = 0, $d7$011 = 0, $e$051 = 0, $e$145 = 0, $e0$037 = 0, $e1$036 = 0;
var $e11$09 = 0, $e8$012 = 0, $exitcond = 0, $exitcond60 = 0, $i$030 = 0, $i_off$023 = 0, $l$0$lcssa = 0, $l$033 = 0, $l$127 = 0, $r$022 = 0, $scevgep = 0, $scevgep61 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n >> 1;
$1 = $n >> 2;
$2 = $n >> 3;
$3 = ((($f)) + 92|0);
$4 = HEAP32[$3>>2]|0;
$5 = ((($f)) + 80|0);
$6 = HEAP32[$5>>2]|0;
$7 = ($6|0)==(0|0);
$8 = $0 << 2;
if ($7) {
$$alloca_mul = $8;
$10 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;;
$15 = $10;
} else {
$9 = (_setup_temp_malloc($f,$8)|0);
$15 = $9;
}
$11 = (((($f)) + 1068|0) + ($blocktype<<2)|0);
$12 = HEAP32[$11>>2]|0;
$13 = (($0) + -2)|0;
$14 = (($15) + ($13<<2)|0);
$16 = (($buffer) + ($0<<2)|0);
$17 = ($0|0)==(0);
if ($17) {
$AA$0$lcssa = $12;$d$0$lcssa = $14;
} else {
$18 = $0 << 2;
$19 = (($18) + -16)|0;
$20 = $19 >>> 4;
$21 = $20 << 1;
$22 = (($21) + 2)|0;
$23 = $20 << 3;
$24 = (($19) - ($23))|0;
$scevgep61 = (($15) + ($24)|0);
$AA$050 = $12;$d$052 = $14;$e$051 = $buffer;
while(1) {
$25 = +HEAPF32[$e$051>>2];
$26 = +HEAPF32[$AA$050>>2];
$27 = $25 * $26;
$28 = ((($e$051)) + 8|0);
$29 = +HEAPF32[$28>>2];
$30 = ((($AA$050)) + 4|0);
$31 = +HEAPF32[$30>>2];
$32 = $29 * $31;
$33 = $27 - $32;
$34 = ((($d$052)) + 4|0);
HEAPF32[$34>>2] = $33;
$35 = +HEAPF32[$e$051>>2];
$36 = +HEAPF32[$30>>2];
$37 = $35 * $36;
$38 = +HEAPF32[$28>>2];
$39 = +HEAPF32[$AA$050>>2];
$40 = $38 * $39;
$41 = $37 + $40;
HEAPF32[$d$052>>2] = $41;
$42 = ((($d$052)) + -8|0);
$43 = ((($AA$050)) + 8|0);
$44 = ((($e$051)) + 16|0);
$45 = ($44|0)==($16|0);
if ($45) {
break;
} else {
$AA$050 = $43;$d$052 = $42;$e$051 = $44;
}
}
$scevgep = (($12) + ($22<<2)|0);
$AA$0$lcssa = $scevgep;$d$0$lcssa = $scevgep61;
}
$46 = ($d$0$lcssa>>>0)<($15>>>0);
if (!($46)) {
$47 = (($0) + -3)|0;
$48 = (($buffer) + ($47<<2)|0);
$AA$144 = $AA$0$lcssa;$d$146 = $d$0$lcssa;$e$145 = $48;
while(1) {
$49 = ((($e$145)) + 8|0);
$50 = +HEAPF32[$49>>2];
$51 = +HEAPF32[$AA$144>>2];
$52 = $50 * $51;
$53 = +HEAPF32[$e$145>>2];
$54 = ((($AA$144)) + 4|0);
$55 = +HEAPF32[$54>>2];
$56 = $53 * $55;
$57 = $56 - $52;
$58 = ((($d$146)) + 4|0);
HEAPF32[$58>>2] = $57;
$59 = +HEAPF32[$49>>2];
$60 = +HEAPF32[$54>>2];
$61 = $59 * $60;
$62 = +HEAPF32[$e$145>>2];
$63 = +HEAPF32[$AA$144>>2];
$64 = $62 * $63;
$65 = -$64;
$66 = $65 - $61;
HEAPF32[$d$146>>2] = $66;
$67 = ((($d$146)) + -8|0);
$68 = ((($AA$144)) + 8|0);
$69 = ((($e$145)) + -16|0);
$70 = ($67>>>0)<($15>>>0);
if ($70) {
break;
} else {
$AA$144 = $68;$d$146 = $67;$e$145 = $69;
}
}
}
$71 = (($0) + -8)|0;
$72 = ($0|0)<(8);
if (!($72)) {
$73 = (($12) + ($71<<2)|0);
$74 = (($buffer) + ($1<<2)|0);
$75 = (($15) + ($1<<2)|0);
$AA1$040 = $73;$d0$039 = $74;$d1$038 = $buffer;$e0$037 = $75;$e1$036 = $15;
while(1) {
$76 = ((($e0$037)) + 4|0);
$77 = +HEAPF32[$76>>2];
$78 = ((($e1$036)) + 4|0);
$79 = +HEAPF32[$78>>2];
$80 = $77 - $79;
$81 = +HEAPF32[$e0$037>>2];
$82 = +HEAPF32[$e1$036>>2];
$83 = $81 - $82;
$84 = $77 + $79;
$85 = ((($d0$039)) + 4|0);
HEAPF32[$85>>2] = $84;
$86 = +HEAPF32[$e0$037>>2];
$87 = +HEAPF32[$e1$036>>2];
$88 = $86 + $87;
HEAPF32[$d0$039>>2] = $88;
$89 = ((($AA1$040)) + 16|0);
$90 = +HEAPF32[$89>>2];
$91 = $80 * $90;
$92 = ((($AA1$040)) + 20|0);
$93 = +HEAPF32[$92>>2];
$94 = $83 * $93;
$95 = $91 - $94;
$96 = ((($d1$038)) + 4|0);
HEAPF32[$96>>2] = $95;
$97 = +HEAPF32[$89>>2];
$98 = $83 * $97;
$99 = +HEAPF32[$92>>2];
$100 = $80 * $99;
$101 = $98 + $100;
HEAPF32[$d1$038>>2] = $101;
$102 = ((($e0$037)) + 12|0);
$103 = +HEAPF32[$102>>2];
$104 = ((($e1$036)) + 12|0);
$105 = +HEAPF32[$104>>2];
$106 = $103 - $105;
$107 = ((($e0$037)) + 8|0);
$108 = +HEAPF32[$107>>2];
$109 = ((($e1$036)) + 8|0);
$110 = +HEAPF32[$109>>2];
$111 = $108 - $110;
$112 = $103 + $105;
$113 = ((($d0$039)) + 12|0);
HEAPF32[$113>>2] = $112;
$114 = +HEAPF32[$107>>2];
$115 = +HEAPF32[$109>>2];
$116 = $114 + $115;
$117 = ((($d0$039)) + 8|0);
HEAPF32[$117>>2] = $116;
$118 = +HEAPF32[$AA1$040>>2];
$119 = $106 * $118;
$120 = ((($AA1$040)) + 4|0);
$121 = +HEAPF32[$120>>2];
$122 = $111 * $121;
$123 = $119 - $122;
$124 = ((($d1$038)) + 12|0);
HEAPF32[$124>>2] = $123;
$125 = +HEAPF32[$AA1$040>>2];
$126 = $111 * $125;
$127 = +HEAPF32[$120>>2];
$128 = $106 * $127;
$129 = $126 + $128;
$130 = ((($d1$038)) + 8|0);
HEAPF32[$130>>2] = $129;
$131 = ((($AA1$040)) + -32|0);
$132 = ((($d0$039)) + 16|0);
$133 = ((($d1$038)) + 16|0);
$134 = ((($e0$037)) + 16|0);
$135 = ((($e1$036)) + 16|0);
$136 = ($131>>>0)<($12>>>0);
if ($136) {
break;
} else {
$AA1$040 = $131;$d0$039 = $132;$d1$038 = $133;$e0$037 = $134;$e1$036 = $135;
}
}
}
$137 = (_ilog($n)|0);
$138 = $n >> 4;
$139 = (($0) + -1)|0;
$140 = (0 - ($2))|0;
_imdct_step3_iter0_loop($138,$buffer,$139,$140,$12);
$141 = (($139) - ($1))|0;
_imdct_step3_iter0_loop($138,$buffer,$141,$140,$12);
$142 = $n >> 5;
$143 = (0 - ($138))|0;
_imdct_step3_inner_r_loop($142,$buffer,$139,$143,$12,16);
$144 = (($139) - ($2))|0;
_imdct_step3_inner_r_loop($142,$buffer,$144,$143,$12,16);
$145 = $2 << 1;
$146 = (($139) - ($145))|0;
_imdct_step3_inner_r_loop($142,$buffer,$146,$143,$12,16);
$147 = Math_imul($2, -3)|0;
$148 = (($139) + ($147))|0;
_imdct_step3_inner_r_loop($142,$buffer,$148,$143,$12,16);
$149 = (($137) + -4)|0;
$150 = $149 >> 1;
$151 = ($150|0)>(2);
if ($151) {
$l$033 = 2;
while(1) {
$156 = (($l$033) + 2)|0;
$157 = $n >> $156;
$152 = (($l$033) + 1)|0;
$158 = 1 << $152;
$159 = ($152|0)==(31);
if (!($159)) {
$160 = $157 >> 1;
$161 = (($l$033) + 4)|0;
$162 = $n >> $161;
$163 = (0 - ($160))|0;
$164 = (($l$033) + 3)|0;
$165 = 1 << $164;
$i$030 = 0;
while(1) {
$166 = Math_imul($i$030, $157)|0;
$167 = (($139) - ($166))|0;
_imdct_step3_inner_r_loop($162,$buffer,$167,$163,$12,$165);
$168 = (($i$030) + 1)|0;
$169 = ($168|0)<($158|0);
if ($169) {
$i$030 = $168;
} else {
break;
}
}
}
$exitcond60 = ($152|0)==($150|0);
if ($exitcond60) {
$l$0$lcssa = $150;
break;
} else {
$l$033 = $152;
}
}
} else {
$l$0$lcssa = 2;
}
$153 = (($137) + -7)|0;
$154 = ($l$0$lcssa|0)<($153|0);
if ($154) {
$155 = (($137) + -7)|0;
$l$127 = $l$0$lcssa;
while(1) {
$171 = (($l$127) + 2)|0;
$172 = $n >> $171;
$173 = (($l$127) + 3)|0;
$174 = 1 << $173;
$175 = (($l$127) + 6)|0;
$176 = $n >> $175;
$170 = (($l$127) + 1)|0;
$177 = 1 << $170;
$178 = ($176|0)>(0);
if ($178) {
$179 = $172 >> 1;
$180 = (0 - ($179))|0;
$181 = $174 << 2;
$A0$024 = $12;$i_off$023 = $139;$r$022 = $176;
while(1) {
_imdct_step3_inner_s_loop($177,$buffer,$i_off$023,$180,$A0$024,$174,$172);
$182 = (($A0$024) + ($181<<2)|0);
$183 = (($i_off$023) + -8)|0;
$184 = (($r$022) + -1)|0;
$185 = ($r$022|0)>(1);
if ($185) {
$A0$024 = $182;$i_off$023 = $183;$r$022 = $184;
} else {
break;
}
}
}
$exitcond = ($170|0)==($155|0);
if ($exitcond) {
break;
} else {
$l$127 = $170;
}
}
}
_imdct_step3_inner_s_loop_ld654($142,$buffer,$139,$12,$n);
$186 = (($1) + -4)|0;
$187 = (($15) + ($186<<2)|0);
$188 = (($0) + -4)|0;
$189 = (($15) + ($188<<2)|0);
$190 = ($187>>>0)<($15>>>0);
if (!($190)) {
$191 = (((($f)) + 1100|0) + ($blocktype<<2)|0);
$192 = HEAP32[$191>>2]|0;
$bitrev$016 = $192;$d05$017 = $187;$d16$018 = $189;
while(1) {
$193 = HEAP16[$bitrev$016>>1]|0;
$194 = $193&65535;
$195 = (($buffer) + ($194<<2)|0);
$196 = HEAP32[$195>>2]|0;
$197 = ((($d16$018)) + 12|0);
HEAP32[$197>>2] = $196;
$198 = (($194) + 1)|0;
$199 = (($buffer) + ($198<<2)|0);
$200 = HEAP32[$199>>2]|0;
$201 = ((($d16$018)) + 8|0);
HEAP32[$201>>2] = $200;
$202 = (($194) + 2)|0;
$203 = (($buffer) + ($202<<2)|0);
$204 = HEAP32[$203>>2]|0;
$205 = ((($d05$017)) + 12|0);
HEAP32[$205>>2] = $204;
$206 = (($194) + 3)|0;
$207 = (($buffer) + ($206<<2)|0);
$208 = HEAP32[$207>>2]|0;
$209 = ((($d05$017)) + 8|0);
HEAP32[$209>>2] = $208;
$210 = ((($bitrev$016)) + 2|0);
$211 = HEAP16[$210>>1]|0;
$212 = $211&65535;
$213 = (($buffer) + ($212<<2)|0);
$214 = HEAP32[$213>>2]|0;
$215 = ((($d16$018)) + 4|0);
HEAP32[$215>>2] = $214;
$216 = (($212) + 1)|0;
$217 = (($buffer) + ($216<<2)|0);
$218 = HEAP32[$217>>2]|0;
HEAP32[$d16$018>>2] = $218;
$219 = (($212) + 2)|0;
$220 = (($buffer) + ($219<<2)|0);
$221 = HEAP32[$220>>2]|0;
$222 = ((($d05$017)) + 4|0);
HEAP32[$222>>2] = $221;
$223 = (($212) + 3)|0;
$224 = (($buffer) + ($223<<2)|0);
$225 = HEAP32[$224>>2]|0;
HEAP32[$d05$017>>2] = $225;
$226 = ((($d05$017)) + -16|0);
$227 = ((($d16$018)) + -16|0);
$228 = ((($bitrev$016)) + 4|0);
$229 = ($226>>>0)<($15>>>0);
if ($229) {
break;
} else {
$bitrev$016 = $228;$d05$017 = $226;$d16$018 = $227;
}
}
}
$230 = ($15>>>0)<($189>>>0);
if ($230) {
$231 = (((($f)) + 1084|0) + ($blocktype<<2)|0);
$232 = HEAP32[$231>>2]|0;
$C$010 = $232;$d7$011 = $15;$e8$012 = $189;
while(1) {
$233 = +HEAPF32[$d7$011>>2];
$234 = ((($e8$012)) + 8|0);
$235 = +HEAPF32[$234>>2];
$236 = $233 - $235;
$237 = ((($d7$011)) + 4|0);
$238 = +HEAPF32[$237>>2];
$239 = ((($e8$012)) + 12|0);
$240 = +HEAPF32[$239>>2];
$241 = $238 + $240;
$242 = ((($C$010)) + 4|0);
$243 = +HEAPF32[$242>>2];
$244 = $236 * $243;
$245 = +HEAPF32[$C$010>>2];
$246 = $241 * $245;
$247 = $244 + $246;
$248 = $243 * $241;
$249 = $236 * $245;
$250 = $248 - $249;
$251 = $233 + $235;
$252 = $238 - $240;
$253 = $251 + $247;
HEAPF32[$d7$011>>2] = $253;
$254 = $252 + $250;
HEAPF32[$237>>2] = $254;
$255 = $251 - $247;
HEAPF32[$234>>2] = $255;
$256 = $250 - $252;
HEAPF32[$239>>2] = $256;
$257 = ((($d7$011)) + 8|0);
$258 = +HEAPF32[$257>>2];
$259 = +HEAPF32[$e8$012>>2];
$260 = $258 - $259;
$261 = ((($d7$011)) + 12|0);
$262 = +HEAPF32[$261>>2];
$263 = ((($e8$012)) + 4|0);
$264 = +HEAPF32[$263>>2];
$265 = $262 + $264;
$266 = ((($C$010)) + 12|0);
$267 = +HEAPF32[$266>>2];
$268 = $260 * $267;
$269 = ((($C$010)) + 8|0);
$270 = +HEAPF32[$269>>2];
$271 = $265 * $270;
$272 = $268 + $271;
$273 = $267 * $265;
$274 = $260 * $270;
$275 = $273 - $274;
$276 = $258 + $259;
$277 = $262 - $264;
$278 = $276 + $272;
HEAPF32[$257>>2] = $278;
$279 = $277 + $275;
HEAPF32[$261>>2] = $279;
$280 = $276 - $272;
HEAPF32[$e8$012>>2] = $280;
$281 = $275 - $277;
HEAPF32[$263>>2] = $281;
$282 = ((($C$010)) + 16|0);
$283 = ((($d7$011)) + 16|0);
$284 = ((($e8$012)) + -16|0);
$285 = ($283>>>0)<($284>>>0);
if ($285) {
$C$010 = $282;$d7$011 = $283;$e8$012 = $284;
} else {
break;
}
}
}
$286 = (($15) + ($71<<2)|0);
$287 = ($286>>>0)<($15>>>0);
if ($287) {
HEAP32[$3>>2] = $4;
STACKTOP = sp;return;
}
$288 = (($n) + -4)|0;
$289 = (($buffer) + ($288<<2)|0);
$290 = (($buffer) + ($188<<2)|0);
$291 = (((($f)) + 1076|0) + ($blocktype<<2)|0);
$292 = HEAP32[$291>>2]|0;
$293 = (($292) + ($71<<2)|0);
$B$08 = $293;$d09$04 = $buffer;$d110$05 = $290;$d2$06 = $16;$d3$07 = $289;$e11$09 = $286;
while(1) {
$294 = ((($e11$09)) + 24|0);
$295 = +HEAPF32[$294>>2];
$296 = ((($B$08)) + 28|0);
$297 = +HEAPF32[$296>>2];
$298 = $295 * $297;
$299 = ((($e11$09)) + 28|0);
$300 = +HEAPF32[$299>>2];
$301 = ((($B$08)) + 24|0);
$302 = +HEAPF32[$301>>2];
$303 = $300 * $302;
$304 = $298 - $303;
$305 = $295 * $302;
$306 = -$305;
$307 = $297 * $300;
$308 = $306 - $307;
HEAPF32[$d09$04>>2] = $304;
$309 = -$304;
$310 = ((($d110$05)) + 12|0);
HEAPF32[$310>>2] = $309;
HEAPF32[$d2$06>>2] = $308;
$311 = ((($d3$07)) + 12|0);
HEAPF32[$311>>2] = $308;
$312 = ((($e11$09)) + 16|0);
$313 = +HEAPF32[$312>>2];
$314 = ((($B$08)) + 20|0);
$315 = +HEAPF32[$314>>2];
$316 = $313 * $315;
$317 = ((($e11$09)) + 20|0);
$318 = +HEAPF32[$317>>2];
$319 = ((($B$08)) + 16|0);
$320 = +HEAPF32[$319>>2];
$321 = $318 * $320;
$322 = $316 - $321;
$323 = $313 * $320;
$324 = -$323;
$325 = $315 * $318;
$326 = $324 - $325;
$327 = ((($d09$04)) + 4|0);
HEAPF32[$327>>2] = $322;
$328 = -$322;
$329 = ((($d110$05)) + 8|0);
HEAPF32[$329>>2] = $328;
$330 = ((($d2$06)) + 4|0);
HEAPF32[$330>>2] = $326;
$331 = ((($d3$07)) + 8|0);
HEAPF32[$331>>2] = $326;
$332 = ((($e11$09)) + 8|0);
$333 = +HEAPF32[$332>>2];
$334 = ((($B$08)) + 12|0);
$335 = +HEAPF32[$334>>2];
$336 = $333 * $335;
$337 = ((($e11$09)) + 12|0);
$338 = +HEAPF32[$337>>2];
$339 = ((($B$08)) + 8|0);
$340 = +HEAPF32[$339>>2];
$341 = $338 * $340;
$342 = $336 - $341;
$343 = $333 * $340;
$344 = -$343;
$345 = $335 * $338;
$346 = $344 - $345;
$347 = ((($d09$04)) + 8|0);
HEAPF32[$347>>2] = $342;
$348 = -$342;
$349 = ((($d110$05)) + 4|0);
HEAPF32[$349>>2] = $348;
$350 = ((($d2$06)) + 8|0);
HEAPF32[$350>>2] = $346;
$351 = ((($d3$07)) + 4|0);
HEAPF32[$351>>2] = $346;
$352 = +HEAPF32[$e11$09>>2];
$353 = ((($B$08)) + 4|0);
$354 = +HEAPF32[$353>>2];
$355 = $352 * $354;
$356 = ((($e11$09)) + 4|0);
$357 = +HEAPF32[$356>>2];
$358 = +HEAPF32[$B$08>>2];
$359 = $357 * $358;
$360 = $355 - $359;
$361 = $352 * $358;
$362 = -$361;
$363 = $354 * $357;
$364 = $362 - $363;
$365 = ((($d09$04)) + 12|0);
HEAPF32[$365>>2] = $360;
$366 = -$360;
HEAPF32[$d110$05>>2] = $366;
$367 = ((($d2$06)) + 12|0);
HEAPF32[$367>>2] = $364;
HEAPF32[$d3$07>>2] = $364;
$368 = ((($B$08)) + -32|0);
$369 = ((($e11$09)) + -32|0);
$370 = ((($d09$04)) + 16|0);
$371 = ((($d2$06)) + 16|0);
$372 = ((($d110$05)) + -16|0);
$373 = ((($d3$07)) + -16|0);
$374 = ($369>>>0)<($15>>>0);
if ($374) {
break;
} else {
$B$08 = $368;$d09$04 = $370;$d110$05 = $372;$d2$06 = $371;$d3$07 = $373;$e11$09 = $369;
}
}
HEAP32[$3>>2] = $4;
STACKTOP = sp;return;
}
function _imdct_step3_iter0_loop($n,$e,$i_off,$k_off,$A) {
$n = $n|0;
$e = $e|0;
$i_off = $i_off|0;
$k_off = $k_off|0;
$A = $A|0;
var $$04 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $12 = 0.0, $13 = 0.0;
var $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0;
var $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0;
var $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0;
var $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0.0;
var $87 = 0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0.0, $ee0$03 = 0, $ee2$01 = 0, $i$02 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $n & 3;
$1 = ($0|0)==(0);
if (!($1)) {
___assert_fail((16228|0),(15523|0),2075,(16241|0));
// unreachable;
}
$2 = $n >> 2;
$3 = ($2|0)>(0);
if (!($3)) {
return;
}
$$sum = (($k_off) + ($i_off))|0;
$4 = (($e) + ($$sum<<2)|0);
$5 = (($e) + ($i_off<<2)|0);
$$04 = $A;$ee0$03 = $5;$ee2$01 = $4;$i$02 = $2;
while(1) {
$6 = +HEAPF32[$ee0$03>>2];
$7 = +HEAPF32[$ee2$01>>2];
$8 = $6 - $7;
$9 = ((($ee0$03)) + -4|0);
$10 = +HEAPF32[$9>>2];
$11 = ((($ee2$01)) + -4|0);
$12 = +HEAPF32[$11>>2];
$13 = $10 - $12;
$14 = $6 + $7;
HEAPF32[$ee0$03>>2] = $14;
$15 = +HEAPF32[$11>>2];
$16 = +HEAPF32[$9>>2];
$17 = $15 + $16;
HEAPF32[$9>>2] = $17;
$18 = +HEAPF32[$$04>>2];
$19 = $8 * $18;
$20 = ((($$04)) + 4|0);
$21 = +HEAPF32[$20>>2];
$22 = $13 * $21;
$23 = $19 - $22;
HEAPF32[$ee2$01>>2] = $23;
$24 = +HEAPF32[$$04>>2];
$25 = $13 * $24;
$26 = +HEAPF32[$20>>2];
$27 = $8 * $26;
$28 = $25 + $27;
HEAPF32[$11>>2] = $28;
$29 = ((($$04)) + 32|0);
$30 = ((($ee0$03)) + -8|0);
$31 = +HEAPF32[$30>>2];
$32 = ((($ee2$01)) + -8|0);
$33 = +HEAPF32[$32>>2];
$34 = $31 - $33;
$35 = ((($ee0$03)) + -12|0);
$36 = +HEAPF32[$35>>2];
$37 = ((($ee2$01)) + -12|0);
$38 = +HEAPF32[$37>>2];
$39 = $36 - $38;
$40 = $31 + $33;
HEAPF32[$30>>2] = $40;
$41 = +HEAPF32[$37>>2];
$42 = +HEAPF32[$35>>2];
$43 = $41 + $42;
HEAPF32[$35>>2] = $43;
$44 = +HEAPF32[$29>>2];
$45 = $34 * $44;
$46 = ((($$04)) + 36|0);
$47 = +HEAPF32[$46>>2];
$48 = $39 * $47;
$49 = $45 - $48;
HEAPF32[$32>>2] = $49;
$50 = +HEAPF32[$29>>2];
$51 = $39 * $50;
$52 = +HEAPF32[$46>>2];
$53 = $34 * $52;
$54 = $51 + $53;
HEAPF32[$37>>2] = $54;
$55 = ((($$04)) + 64|0);
$56 = ((($ee0$03)) + -16|0);
$57 = +HEAPF32[$56>>2];
$58 = ((($ee2$01)) + -16|0);
$59 = +HEAPF32[$58>>2];
$60 = $57 - $59;
$61 = ((($ee0$03)) + -20|0);
$62 = +HEAPF32[$61>>2];
$63 = ((($ee2$01)) + -20|0);
$64 = +HEAPF32[$63>>2];
$65 = $62 - $64;
$66 = $57 + $59;
HEAPF32[$56>>2] = $66;
$67 = +HEAPF32[$63>>2];
$68 = +HEAPF32[$61>>2];
$69 = $67 + $68;
HEAPF32[$61>>2] = $69;
$70 = +HEAPF32[$55>>2];
$71 = $60 * $70;
$72 = ((($$04)) + 68|0);
$73 = +HEAPF32[$72>>2];
$74 = $65 * $73;
$75 = $71 - $74;
HEAPF32[$58>>2] = $75;
$76 = +HEAPF32[$55>>2];
$77 = $65 * $76;
$78 = +HEAPF32[$72>>2];
$79 = $60 * $78;
$80 = $77 + $79;
HEAPF32[$63>>2] = $80;
$81 = ((($$04)) + 96|0);
$82 = ((($ee0$03)) + -24|0);
$83 = +HEAPF32[$82>>2];
$84 = ((($ee2$01)) + -24|0);
$85 = +HEAPF32[$84>>2];
$86 = $83 - $85;
$87 = ((($ee0$03)) + -28|0);
$88 = +HEAPF32[$87>>2];
$89 = ((($ee2$01)) + -28|0);
$90 = +HEAPF32[$89>>2];
$91 = $88 - $90;
$92 = $83 + $85;
HEAPF32[$82>>2] = $92;
$93 = +HEAPF32[$89>>2];
$94 = +HEAPF32[$87>>2];
$95 = $93 + $94;
HEAPF32[$87>>2] = $95;
$96 = +HEAPF32[$81>>2];
$97 = $86 * $96;
$98 = ((($$04)) + 100|0);
$99 = +HEAPF32[$98>>2];
$100 = $91 * $99;
$101 = $97 - $100;
HEAPF32[$84>>2] = $101;
$102 = +HEAPF32[$81>>2];
$103 = $91 * $102;
$104 = +HEAPF32[$98>>2];
$105 = $86 * $104;
$106 = $103 + $105;
HEAPF32[$89>>2] = $106;
$107 = ((($$04)) + 128|0);
$108 = ((($ee0$03)) + -32|0);
$109 = ((($ee2$01)) + -32|0);
$110 = (($i$02) + -1)|0;
$111 = ($i$02|0)>(1);
if ($111) {
$$04 = $107;$ee0$03 = $108;$ee2$01 = $109;$i$02 = $110;
} else {
break;
}
}
return;
}
function _imdct_step3_inner_r_loop($lim,$e,$d0,$k_off,$A,$k1) {
$lim = $lim|0;
$e = $e|0;
$d0 = $d0|0;
$k_off = $k_off|0;
$A = $A|0;
$k1 = $k1|0;
var $$09 = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum34 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
var $109 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0;
var $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0.0;
var $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0;
var $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0.0, $80 = 0, $81 = 0.0, $82 = 0;
var $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $e0$010 = 0, $e2$011 = 0;
var $i$08 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $lim >> 2;
$1 = ($0|0)>(0);
if (!($1)) {
return;
}
$$sum = (($k_off) + ($d0))|0;
$2 = (($e) + ($$sum<<2)|0);
$3 = (($e) + ($d0<<2)|0);
$$sum1 = (($k1) + 1)|0;
$$sum2 = $k1 << 1;
$$sum34 = $$sum2 | 1;
$$sum5 = ($k1*3)|0;
$$sum6 = (($$sum5) + 1)|0;
$$sum7 = $k1 << 2;
$$09 = $A;$e0$010 = $3;$e2$011 = $2;$i$08 = $0;
while(1) {
$4 = +HEAPF32[$e0$010>>2];
$5 = +HEAPF32[$e2$011>>2];
$6 = $4 - $5;
$7 = ((($e0$010)) + -4|0);
$8 = +HEAPF32[$7>>2];
$9 = ((($e2$011)) + -4|0);
$10 = +HEAPF32[$9>>2];
$11 = $8 - $10;
$12 = $4 + $5;
HEAPF32[$e0$010>>2] = $12;
$13 = +HEAPF32[$9>>2];
$14 = +HEAPF32[$7>>2];
$15 = $13 + $14;
HEAPF32[$7>>2] = $15;
$16 = +HEAPF32[$$09>>2];
$17 = $6 * $16;
$18 = ((($$09)) + 4|0);
$19 = +HEAPF32[$18>>2];
$20 = $11 * $19;
$21 = $17 - $20;
HEAPF32[$e2$011>>2] = $21;
$22 = +HEAPF32[$$09>>2];
$23 = $11 * $22;
$24 = +HEAPF32[$18>>2];
$25 = $6 * $24;
$26 = $23 + $25;
HEAPF32[$9>>2] = $26;
$27 = (($$09) + ($k1<<2)|0);
$28 = ((($e0$010)) + -8|0);
$29 = +HEAPF32[$28>>2];
$30 = ((($e2$011)) + -8|0);
$31 = +HEAPF32[$30>>2];
$32 = $29 - $31;
$33 = ((($e0$010)) + -12|0);
$34 = +HEAPF32[$33>>2];
$35 = ((($e2$011)) + -12|0);
$36 = +HEAPF32[$35>>2];
$37 = $34 - $36;
$38 = $29 + $31;
HEAPF32[$28>>2] = $38;
$39 = +HEAPF32[$35>>2];
$40 = +HEAPF32[$33>>2];
$41 = $39 + $40;
HEAPF32[$33>>2] = $41;
$42 = +HEAPF32[$27>>2];
$43 = $32 * $42;
$44 = (($$09) + ($$sum1<<2)|0);
$45 = +HEAPF32[$44>>2];
$46 = $37 * $45;
$47 = $43 - $46;
HEAPF32[$30>>2] = $47;
$48 = +HEAPF32[$27>>2];
$49 = $37 * $48;
$50 = +HEAPF32[$44>>2];
$51 = $32 * $50;
$52 = $49 + $51;
HEAPF32[$35>>2] = $52;
$53 = (($$09) + ($$sum2<<2)|0);
$54 = ((($e0$010)) + -16|0);
$55 = +HEAPF32[$54>>2];
$56 = ((($e2$011)) + -16|0);
$57 = +HEAPF32[$56>>2];
$58 = $55 - $57;
$59 = ((($e0$010)) + -20|0);
$60 = +HEAPF32[$59>>2];
$61 = ((($e2$011)) + -20|0);
$62 = +HEAPF32[$61>>2];
$63 = $60 - $62;
$64 = $55 + $57;
HEAPF32[$54>>2] = $64;
$65 = +HEAPF32[$61>>2];
$66 = +HEAPF32[$59>>2];
$67 = $65 + $66;
HEAPF32[$59>>2] = $67;
$68 = +HEAPF32[$53>>2];
$69 = $58 * $68;
$70 = (($$09) + ($$sum34<<2)|0);
$71 = +HEAPF32[$70>>2];
$72 = $63 * $71;
$73 = $69 - $72;
HEAPF32[$56>>2] = $73;
$74 = +HEAPF32[$53>>2];
$75 = $63 * $74;
$76 = +HEAPF32[$70>>2];
$77 = $58 * $76;
$78 = $75 + $77;
HEAPF32[$61>>2] = $78;
$79 = (($$09) + ($$sum5<<2)|0);
$80 = ((($e0$010)) + -24|0);
$81 = +HEAPF32[$80>>2];
$82 = ((($e2$011)) + -24|0);
$83 = +HEAPF32[$82>>2];
$84 = $81 - $83;
$85 = ((($e0$010)) + -28|0);
$86 = +HEAPF32[$85>>2];
$87 = ((($e2$011)) + -28|0);
$88 = +HEAPF32[$87>>2];
$89 = $86 - $88;
$90 = $81 + $83;
HEAPF32[$80>>2] = $90;
$91 = +HEAPF32[$87>>2];
$92 = +HEAPF32[$85>>2];
$93 = $91 + $92;
HEAPF32[$85>>2] = $93;
$94 = +HEAPF32[$79>>2];
$95 = $84 * $94;
$96 = (($$09) + ($$sum6<<2)|0);
$97 = +HEAPF32[$96>>2];
$98 = $89 * $97;
$99 = $95 - $98;
HEAPF32[$82>>2] = $99;
$100 = +HEAPF32[$79>>2];
$101 = $89 * $100;
$102 = +HEAPF32[$96>>2];
$103 = $84 * $102;
$104 = $101 + $103;
HEAPF32[$87>>2] = $104;
$105 = ((($e0$010)) + -32|0);
$106 = ((($e2$011)) + -32|0);
$107 = (($$09) + ($$sum7<<2)|0);
$108 = (($i$08) + -1)|0;
$109 = ($i$08|0)>(1);
if ($109) {
$$09 = $107;$e0$010 = $105;$e2$011 = $106;$i$08 = $108;
} else {
break;
}
}
return;
}
function _imdct_step3_inner_s_loop($n,$e,$i_off,$k_off,$A,$a_off,$k0) {
$n = $n|0;
$e = $e|0;
$i_off = $i_off|0;
$k_off = $k_off|0;
$A = $A|0;
$a_off = $a_off|0;
$k0 = $k0|0;
var $$sum = 0, $0 = 0.0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0;
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0;
var $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0;
var $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0;
var $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0;
var $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $ee0$02 = 0, $ee2$03 = 0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$A>>2];
$1 = ((($A)) + 4|0);
$2 = +HEAPF32[$1>>2];
$3 = (($A) + ($a_off<<2)|0);
$4 = +HEAPF32[$3>>2];
$5 = (($a_off) + 1)|0;
$6 = (($A) + ($5<<2)|0);
$7 = +HEAPF32[$6>>2];
$8 = $a_off << 1;
$9 = (($A) + ($8<<2)|0);
$10 = +HEAPF32[$9>>2];
$11 = $8 | 1;
$12 = (($A) + ($11<<2)|0);
$13 = +HEAPF32[$12>>2];
$14 = ($a_off*3)|0;
$15 = (($A) + ($14<<2)|0);
$16 = +HEAPF32[$15>>2];
$17 = (($14) + 1)|0;
$18 = (($A) + ($17<<2)|0);
$19 = +HEAPF32[$18>>2];
$20 = ($n|0)>(0);
if (!($20)) {
return;
}
$$sum = (($k_off) + ($i_off))|0;
$21 = (($e) + ($$sum<<2)|0);
$22 = (($e) + ($i_off<<2)|0);
$23 = (0 - ($k0))|0;
$ee0$02 = $22;$ee2$03 = $21;$i$01 = $n;
while(1) {
$24 = +HEAPF32[$ee0$02>>2];
$25 = +HEAPF32[$ee2$03>>2];
$26 = $24 - $25;
$27 = ((($ee0$02)) + -4|0);
$28 = +HEAPF32[$27>>2];
$29 = ((($ee2$03)) + -4|0);
$30 = +HEAPF32[$29>>2];
$31 = $28 - $30;
$32 = $24 + $25;
HEAPF32[$ee0$02>>2] = $32;
$33 = +HEAPF32[$27>>2];
$34 = +HEAPF32[$29>>2];
$35 = $33 + $34;
HEAPF32[$27>>2] = $35;
$36 = $0 * $26;
$37 = $2 * $31;
$38 = $36 - $37;
HEAPF32[$ee2$03>>2] = $38;
$39 = $0 * $31;
$40 = $2 * $26;
$41 = $40 + $39;
HEAPF32[$29>>2] = $41;
$42 = ((($ee0$02)) + -8|0);
$43 = +HEAPF32[$42>>2];
$44 = ((($ee2$03)) + -8|0);
$45 = +HEAPF32[$44>>2];
$46 = $43 - $45;
$47 = ((($ee0$02)) + -12|0);
$48 = +HEAPF32[$47>>2];
$49 = ((($ee2$03)) + -12|0);
$50 = +HEAPF32[$49>>2];
$51 = $48 - $50;
$52 = $43 + $45;
HEAPF32[$42>>2] = $52;
$53 = +HEAPF32[$47>>2];
$54 = +HEAPF32[$49>>2];
$55 = $53 + $54;
HEAPF32[$47>>2] = $55;
$56 = $4 * $46;
$57 = $7 * $51;
$58 = $56 - $57;
HEAPF32[$44>>2] = $58;
$59 = $4 * $51;
$60 = $7 * $46;
$61 = $60 + $59;
HEAPF32[$49>>2] = $61;
$62 = ((($ee0$02)) + -16|0);
$63 = +HEAPF32[$62>>2];
$64 = ((($ee2$03)) + -16|0);
$65 = +HEAPF32[$64>>2];
$66 = $63 - $65;
$67 = ((($ee0$02)) + -20|0);
$68 = +HEAPF32[$67>>2];
$69 = ((($ee2$03)) + -20|0);
$70 = +HEAPF32[$69>>2];
$71 = $68 - $70;
$72 = $63 + $65;
HEAPF32[$62>>2] = $72;
$73 = +HEAPF32[$67>>2];
$74 = +HEAPF32[$69>>2];
$75 = $73 + $74;
HEAPF32[$67>>2] = $75;
$76 = $10 * $66;
$77 = $13 * $71;
$78 = $76 - $77;
HEAPF32[$64>>2] = $78;
$79 = $10 * $71;
$80 = $13 * $66;
$81 = $80 + $79;
HEAPF32[$69>>2] = $81;
$82 = ((($ee0$02)) + -24|0);
$83 = +HEAPF32[$82>>2];
$84 = ((($ee2$03)) + -24|0);
$85 = +HEAPF32[$84>>2];
$86 = $83 - $85;
$87 = ((($ee0$02)) + -28|0);
$88 = +HEAPF32[$87>>2];
$89 = ((($ee2$03)) + -28|0);
$90 = +HEAPF32[$89>>2];
$91 = $88 - $90;
$92 = $83 + $85;
HEAPF32[$82>>2] = $92;
$93 = +HEAPF32[$87>>2];
$94 = +HEAPF32[$89>>2];
$95 = $93 + $94;
HEAPF32[$87>>2] = $95;
$96 = $16 * $86;
$97 = $19 * $91;
$98 = $96 - $97;
HEAPF32[$84>>2] = $98;
$99 = $16 * $91;
$100 = $19 * $86;
$101 = $100 + $99;
HEAPF32[$89>>2] = $101;
$102 = (($ee0$02) + ($23<<2)|0);
$103 = (($ee2$03) + ($23<<2)|0);
$104 = (($i$01) + -1)|0;
$105 = ($i$01|0)>(1);
if ($105) {
$ee0$02 = $102;$ee2$03 = $103;$i$01 = $104;
} else {
break;
}
}
return;
}
function _imdct_step3_inner_s_loop_ld654($n,$e,$i_off,$A,$base_n) {
$n = $n|0;
$e = $e|0;
$i_off = $i_off|0;
$A = $A|0;
$base_n = $base_n|0;
var $$sum = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0;
var $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0;
var $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0;
var $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0, $71 = 0, $8 = 0, $9 = 0.0, $z$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $base_n >> 3;
$1 = (($A) + ($0<<2)|0);
$2 = +HEAPF32[$1>>2];
$3 = $n << 4;
$$sum = (($i_off) - ($3))|0;
$4 = (($e) + ($$sum<<2)|0);
$5 = ($$sum|0)<($i_off|0);
if (!($5)) {
return;
}
$6 = (($e) + ($i_off<<2)|0);
$z$01 = $6;
while(1) {
$7 = +HEAPF32[$z$01>>2];
$8 = ((($z$01)) + -32|0);
$9 = +HEAPF32[$8>>2];
$10 = $7 - $9;
$11 = ((($z$01)) + -4|0);
$12 = +HEAPF32[$11>>2];
$13 = ((($z$01)) + -36|0);
$14 = +HEAPF32[$13>>2];
$15 = $12 - $14;
$16 = $7 + $9;
HEAPF32[$z$01>>2] = $16;
$17 = +HEAPF32[$11>>2];
$18 = +HEAPF32[$13>>2];
$19 = $17 + $18;
HEAPF32[$11>>2] = $19;
HEAPF32[$8>>2] = $10;
HEAPF32[$13>>2] = $15;
$20 = ((($z$01)) + -8|0);
$21 = +HEAPF32[$20>>2];
$22 = ((($z$01)) + -40|0);
$23 = +HEAPF32[$22>>2];
$24 = $21 - $23;
$25 = ((($z$01)) + -12|0);
$26 = +HEAPF32[$25>>2];
$27 = ((($z$01)) + -44|0);
$28 = +HEAPF32[$27>>2];
$29 = $26 - $28;
$30 = $21 + $23;
HEAPF32[$20>>2] = $30;
$31 = +HEAPF32[$25>>2];
$32 = +HEAPF32[$27>>2];
$33 = $31 + $32;
HEAPF32[$25>>2] = $33;
$34 = $24 + $29;
$35 = $2 * $34;
HEAPF32[$22>>2] = $35;
$36 = $29 - $24;
$37 = $2 * $36;
HEAPF32[$27>>2] = $37;
$38 = ((($z$01)) + -48|0);
$39 = +HEAPF32[$38>>2];
$40 = ((($z$01)) + -16|0);
$41 = +HEAPF32[$40>>2];
$42 = $39 - $41;
$43 = ((($z$01)) + -20|0);
$44 = +HEAPF32[$43>>2];
$45 = ((($z$01)) + -52|0);
$46 = +HEAPF32[$45>>2];
$47 = $44 - $46;
$48 = $39 + $41;
HEAPF32[$40>>2] = $48;
$49 = +HEAPF32[$43>>2];
$50 = +HEAPF32[$45>>2];
$51 = $49 + $50;
HEAPF32[$43>>2] = $51;
HEAPF32[$38>>2] = $47;
HEAPF32[$45>>2] = $42;
$52 = ((($z$01)) + -56|0);
$53 = +HEAPF32[$52>>2];
$54 = ((($z$01)) + -24|0);
$55 = +HEAPF32[$54>>2];
$56 = $53 - $55;
$57 = ((($z$01)) + -28|0);
$58 = +HEAPF32[$57>>2];
$59 = ((($z$01)) + -60|0);
$60 = +HEAPF32[$59>>2];
$61 = $58 - $60;
$62 = $53 + $55;
HEAPF32[$54>>2] = $62;
$63 = +HEAPF32[$57>>2];
$64 = +HEAPF32[$59>>2];
$65 = $63 + $64;
HEAPF32[$57>>2] = $65;
$66 = $56 + $61;
$67 = $2 * $66;
HEAPF32[$52>>2] = $67;
$68 = $56 - $61;
$69 = $2 * $68;
HEAPF32[$59>>2] = $69;
_iter_54($z$01);
_iter_54($8);
$70 = ((($z$01)) + -64|0);
$71 = ($70>>>0)>($4>>>0);
if ($71) {
$z$01 = $70;
} else {
break;
}
}
return;
}
function _iter_54($z) {
$z = $z|0;
var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = +HEAPF32[$z>>2];
$1 = ((($z)) + -16|0);
$2 = +HEAPF32[$1>>2];
$3 = $0 - $2;
$4 = $0 + $2;
$5 = ((($z)) + -8|0);
$6 = +HEAPF32[$5>>2];
$7 = ((($z)) + -24|0);
$8 = +HEAPF32[$7>>2];
$9 = $6 + $8;
$10 = $6 - $8;
$11 = $4 + $9;
HEAPF32[$z>>2] = $11;
$12 = $4 - $9;
HEAPF32[$5>>2] = $12;
$13 = ((($z)) + -12|0);
$14 = +HEAPF32[$13>>2];
$15 = ((($z)) + -28|0);
$16 = +HEAPF32[$15>>2];
$17 = $14 - $16;
$18 = $3 + $17;
HEAPF32[$1>>2] = $18;
$19 = $3 - $17;
HEAPF32[$7>>2] = $19;
$20 = ((($z)) + -4|0);
$21 = +HEAPF32[$20>>2];
$22 = ((($z)) + -20|0);
$23 = +HEAPF32[$22>>2];
$24 = $21 - $23;
$25 = $21 + $23;
$26 = +HEAPF32[$13>>2];
$27 = +HEAPF32[$15>>2];
$28 = $26 + $27;
$29 = $25 + $28;
HEAPF32[$20>>2] = $29;
$30 = $25 - $28;
HEAPF32[$13>>2] = $30;
$31 = $24 - $10;
HEAPF32[$22>>2] = $31;
$32 = $10 + $24;
HEAPF32[$15>>2] = $32;
return;
}
function _draw_line($output,$x0,$y0,$x1,$y1,$n) {
$output = $output|0;
$x0 = $x0|0;
$y0 = $y0|0;
$x1 = $x1|0;
$y1 = $y1|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0;
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $err$05 = 0, $err$1 = 0, $exitcond = 0, $ispos = 0, $ispos1 = 0, $n$x1 = 0, $neg = 0, $neg2 = 0, $sy$0 = 0, $sy$0$pn = 0, $x$0 = 0, $x$03 = 0, $x$06 = 0;
var $y$04 = 0, $y$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (($y1) - ($y0))|0;
$1 = (($x1) - ($x0))|0;
$ispos = ($0|0)>(-1);
$neg = (0 - ($0))|0;
$2 = $ispos ? $0 : $neg;
$3 = (($0|0) / ($1|0))&-1;
$4 = $0 >> 31;
$5 = $4 | 1;
$ispos1 = ($3|0)>(-1);
$neg2 = (0 - ($3))|0;
$6 = $ispos1 ? $3 : $neg2;
$7 = Math_imul($6, $1)|0;
$8 = (($2) - ($7))|0;
$9 = ($x1|0)>($n|0);
$n$x1 = $9 ? $n : $x1;
$10 = ($n$x1|0)>($x0|0);
if (!($10)) {
return;
}
$11 = (6864 + ($y0<<2)|0);
$12 = +HEAPF32[$11>>2];
$13 = (($output) + ($x0<<2)|0);
$14 = +HEAPF32[$13>>2];
$15 = $12 * $14;
HEAPF32[$13>>2] = $15;
$x$03 = (($x0) + 1)|0;
$16 = ($x$03|0)<($n$x1|0);
if (!($16)) {
return;
}
$17 = ($n|0)<($x1|0);
$18 = $17 ? $n : $x1;
$err$05 = 0;$x$06 = $x$03;$y$04 = $y0;
while(1) {
$19 = (($err$05) + ($8))|0;
$20 = ($19|0)<($1|0);
$sy$0 = $20 ? 0 : $5;
$21 = $20 ? 0 : $1;
$err$1 = (($19) - ($21))|0;
$sy$0$pn = (($y$04) + ($3))|0;
$y$1 = (($sy$0$pn) + ($sy$0))|0;
$22 = (6864 + ($y$1<<2)|0);
$23 = +HEAPF32[$22>>2];
$24 = (($output) + ($x$06<<2)|0);
$25 = +HEAPF32[$24>>2];
$26 = $23 * $25;
HEAPF32[$24>>2] = $26;
$x$0 = (($x$06) + 1)|0;
$exitcond = ($x$0|0)==($18|0);
if ($exitcond) {
break;
} else {
$err$05 = $err$1;$x$06 = $x$0;$y$04 = $y$1;
}
}
return;
}
function _make_block_array($mem,$count,$size) {
$mem = $mem|0;
$count = $count|0;
$size = $size|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $exitcond = 0, $i$01 = 0, $q$02 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($count|0)>(0);
if (!($0)) {
return ($mem|0);
}
$1 = (($mem) + ($count<<2)|0);
$i$01 = 0;$q$02 = $1;
while(1) {
$2 = (($mem) + ($i$01<<2)|0);
HEAP32[$2>>2] = $q$02;
$3 = (($q$02) + ($size)|0);
$4 = (($i$01) + 1)|0;
$exitcond = ($4|0)==($count|0);
if ($exitcond) {
break;
} else {
$i$01 = $4;$q$02 = $3;
}
}
return ($mem|0);
}
function _codebook_decode_deinterleave_repeat($f,$c,$outputs,$ch,$c_inter_p,$p_inter_p,$len,$total_decode) {
$f = $f|0;
$c = $c|0;
$outputs = $outputs|0;
$ch = $ch|0;
$c_inter_p = $c_inter_p|0;
$p_inter_p = $p_inter_p|0;
$len = $len|0;
$total_decode = $total_decode|0;
var $$ = 0, $$0 = 0, $$0126 = 0, $$2 = 0, $$3 = 0, $$4 = 0, $$p_inter$1 = 0, $$p_inter$3 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
var $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
var $74 = 0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $c_inter$0$lcssa = 0, $c_inter$025 = 0, $c_inter$115 = 0, $c_inter$319 = 0, $c_inter$5 = 0;
var $effective$024 = 0, $effective$1 = 0, $exitcond = 0, $exitcond30 = 0, $i$013 = 0, $i$118 = 0, $last$014 = 0.0, $p_inter$0$lcssa = 0, $p_inter$023 = 0, $p_inter$112 = 0, $p_inter$317 = 0, $p_inter$5 = 0, $z$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$c_inter_p>>2]|0;
$1 = HEAP32[$p_inter_p>>2]|0;
$2 = HEAP32[$c>>2]|0;
$3 = ((($c)) + 21|0);
$4 = HEAP8[$3>>0]|0;
$5 = ($4<<24>>24)==(0);
if ($5) {
_error($f,21);
$$0 = 0;
return ($$0|0);
}
$6 = ($total_decode|0)>(0);
L5: do {
if ($6) {
$7 = ((($f)) + 1396|0);
$8 = ((($f)) + 1392|0);
$9 = ((($c)) + 8|0);
$10 = ((($c)) + 23|0);
$11 = Math_imul($len, $ch)|0;
$12 = ((($c)) + 22|0);
$13 = ((($c)) + 28|0);
$14 = ((($c)) + 28|0);
$15 = ((($c)) + 2092|0);
$$0126 = $total_decode;$c_inter$025 = $0;$effective$024 = $2;$p_inter$023 = $1;
while(1) {
$16 = HEAP32[$7>>2]|0;
$17 = ($16|0)<(10);
if ($17) {
_prep_huffman($f);
}
$18 = HEAP32[$8>>2]|0;
$19 = $18 & 1023;
$20 = (((($c)) + 36|0) + ($19<<1)|0);
$21 = HEAP16[$20>>1]|0;
$22 = $21 << 16 >> 16;
$23 = ($21<<16>>16)>(-1);
if ($23) {
$24 = HEAP32[$9>>2]|0;
$25 = (($24) + ($22)|0);
$26 = HEAP8[$25>>0]|0;
$27 = $26&255;
$28 = $18 >>> $27;
HEAP32[$8>>2] = $28;
$29 = HEAP32[$7>>2]|0;
$30 = (($29) - ($27))|0;
$31 = ($30|0)<(0);
$$ = $31 ? 0 : $30;
HEAP32[$7>>2] = $$;
$$2 = $31 ? -1 : $22;
$z$0 = $$2;
} else {
$32 = (_codebook_decode_scalar_raw($f,$c)|0);
$z$0 = $32;
}
$33 = HEAP8[$10>>0]|0;
$34 = ($33<<24>>24)==(0);
if (!($34)) {
$35 = HEAP32[$15>>2]|0;
$36 = ($z$0|0)<($35|0);
if (!($36)) {
label = 12;
break;
}
}
$37 = ($z$0|0)<(0);
if ($37) {
break;
}
$44 = Math_imul($p_inter$023, $ch)|0;
$45 = (($effective$024) + ($44))|0;
$46 = (($45) + ($c_inter$025))|0;
$47 = ($46|0)>($11|0);
$48 = (($11) - ($44))|0;
$49 = (($48) + ($c_inter$025))|0;
$effective$1 = $47 ? $49 : $effective$024;
$50 = HEAP32[$c>>2]|0;
$51 = Math_imul($50, $z$0)|0;
$52 = HEAP8[$12>>0]|0;
$53 = ($52<<24>>24)==(0);
$54 = ($effective$1|0)>(0);
if ($53) {
if ($54) {
$c_inter$319 = $c_inter$025;$i$118 = 0;$p_inter$317 = $p_inter$023;
while(1) {
$70 = (($outputs) + ($c_inter$319<<2)|0);
$71 = HEAP32[$70>>2]|0;
$72 = ($71|0)==(0|0);
if (!($72)) {
$73 = HEAP32[$13>>2]|0;
$74 = (($i$118) + ($51))|0;
$75 = (($73) + ($74<<2)|0);
$76 = +HEAPF32[$75>>2];
$77 = $76 + 0.0;
$78 = (($71) + ($p_inter$317<<2)|0);
$79 = +HEAPF32[$78>>2];
$80 = $79 + $77;
HEAPF32[$78>>2] = $80;
}
$81 = (($c_inter$319) + 1)|0;
$82 = ($81|0)==($ch|0);
$83 = $82&1;
$$p_inter$3 = (($83) + ($p_inter$317))|0;
$$4 = $82 ? 0 : $81;
$84 = (($i$118) + 1)|0;
$exitcond30 = ($84|0)==($effective$1|0);
if ($exitcond30) {
$c_inter$5 = $$4;$p_inter$5 = $$p_inter$3;
break;
} else {
$c_inter$319 = $$4;$i$118 = $84;$p_inter$317 = $$p_inter$3;
}
}
} else {
$c_inter$5 = $c_inter$025;$p_inter$5 = $p_inter$023;
}
} else {
if ($54) {
$55 = HEAP32[$14>>2]|0;
$c_inter$115 = $c_inter$025;$i$013 = 0;$last$014 = 0.0;$p_inter$112 = $p_inter$023;
while(1) {
$56 = (($i$013) + ($51))|0;
$57 = (($55) + ($56<<2)|0);
$58 = +HEAPF32[$57>>2];
$59 = $last$014 + $58;
$60 = (($outputs) + ($c_inter$115<<2)|0);
$61 = HEAP32[$60>>2]|0;
$62 = ($61|0)==(0|0);
if (!($62)) {
$63 = (($61) + ($p_inter$112<<2)|0);
$64 = +HEAPF32[$63>>2];
$65 = $59 + $64;
HEAPF32[$63>>2] = $65;
}
$66 = (($c_inter$115) + 1)|0;
$67 = ($66|0)==($ch|0);
$68 = $67&1;
$$p_inter$1 = (($68) + ($p_inter$112))|0;
$$3 = $67 ? 0 : $66;
$69 = (($i$013) + 1)|0;
$exitcond = ($69|0)==($effective$1|0);
if ($exitcond) {
$c_inter$5 = $$3;$p_inter$5 = $$p_inter$1;
break;
} else {
$c_inter$115 = $$3;$i$013 = $69;$last$014 = $59;$p_inter$112 = $$p_inter$1;
}
}
} else {
$c_inter$5 = $c_inter$025;$p_inter$5 = $p_inter$023;
}
}
$85 = (($$0126) - ($effective$1))|0;
$86 = ($85|0)>(0);
if ($86) {
$$0126 = $85;$c_inter$025 = $c_inter$5;$effective$024 = $effective$1;$p_inter$023 = $p_inter$5;
} else {
$c_inter$0$lcssa = $c_inter$5;$p_inter$0$lcssa = $p_inter$5;
break L5;
}
}
if ((label|0) == 12) {
___assert_fail((16308|0),(15523|0),1430,(16344|0));
// unreachable;
}
$38 = ((($f)) + 1376|0);
$39 = HEAP8[$38>>0]|0;
$40 = ($39<<24>>24)==(0);
if ($40) {
$41 = ((($f)) + 1384|0);
$42 = HEAP32[$41>>2]|0;
$43 = ($42|0)==(0);
if (!($43)) {
$$0 = 0;
return ($$0|0);
}
}
_error($f,21);
$$0 = 0;
return ($$0|0);
} else {
$c_inter$0$lcssa = $0;$p_inter$0$lcssa = $1;
}
} while(0);
HEAP32[$c_inter_p>>2] = $c_inter$0$lcssa;
HEAP32[$p_inter_p>>2] = $p_inter$0$lcssa;
$$0 = 1;
return ($$0|0);
}
function _residue_decode($f,$book,$target,$offset,$n,$rtype) {
$f = $f|0;
$book = $book|0;
$target = $target|0;
$offset = $offset|0;
$n = $n|0;
$rtype = $rtype|0;
var $$0 = 0, $$017 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $k$04 = 0, $k$18 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($rtype|0)==(0);
if ($0) {
$2 = HEAP32[$book>>2]|0;
$3 = (($n|0) / ($2|0))&-1;
$4 = ($3|0)>(0);
if (!($4)) {
$$0 = 1;
return ($$0|0);
}
$5 = (($n) - ($offset))|0;
$k$04 = 0;
while(1) {
$$sum = (($k$04) + ($offset))|0;
$8 = (($target) + ($$sum<<2)|0);
$9 = (($5) - ($k$04))|0;
$10 = (_codebook_decode_step($f,$book,$8,$9,$3)|0);
$11 = ($10|0)==(0);
$6 = (($k$04) + 1)|0;
if ($11) {
$$0 = 0;
label = 10;
break;
}
$7 = ($6|0)<($3|0);
if ($7) {
$k$04 = $6;
} else {
$$0 = 1;
label = 10;
break;
}
}
if ((label|0) == 10) {
return ($$0|0);
}
} else {
$1 = ($n|0)>(0);
if (!($1)) {
$$0 = 1;
return ($$0|0);
}
$$017 = $offset;$k$18 = 0;
while(1) {
$12 = (($target) + ($$017<<2)|0);
$13 = (($n) - ($k$18))|0;
$14 = (_codebook_decode($f,$book,$12,$13)|0);
$15 = ($14|0)==(0);
if ($15) {
$$0 = 0;
label = 10;
break;
}
$16 = HEAP32[$book>>2]|0;
$17 = (($16) + ($k$18))|0;
$18 = (($16) + ($$017))|0;
$19 = ($17|0)<($n|0);
if ($19) {
$$017 = $18;$k$18 = $17;
} else {
$$0 = 1;
label = 10;
break;
}
}
if ((label|0) == 10) {
return ($$0|0);
}
}
return (0)|0;
}
function _codebook_decode_step($f,$c,$output,$len,$step) {
$f = $f|0;
$c = $c|0;
$output = $output|0;
$len = $len|0;
$step = $step|0;
var $$0 = 0, $$len = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $last$0$ = 0.0, $last$03 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_codebook_decode_start($f,$c)|0);
$1 = ($0|0)<(0);
if ($1) {
$$0 = 0;
return ($$0|0);
}
$2 = HEAP32[$c>>2]|0;
$3 = ($2|0)<($len|0);
$$len = $3 ? $2 : $len;
$4 = Math_imul($2, $0)|0;
$5 = ($$len|0)>(0);
if (!($5)) {
$$0 = 1;
return ($$0|0);
}
$6 = ((($c)) + 28|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($c)) + 22|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(0);
$11 = ($2|0)<($len|0);
$12 = $11 ? $2 : $len;
$i$02 = 0;$last$03 = 0.0;
while(1) {
$13 = (($i$02) + ($4))|0;
$14 = (($7) + ($13<<2)|0);
$15 = +HEAPF32[$14>>2];
$16 = $last$03 + $15;
$17 = Math_imul($i$02, $step)|0;
$18 = (($output) + ($17<<2)|0);
$19 = +HEAPF32[$18>>2];
$20 = $19 + $16;
HEAPF32[$18>>2] = $20;
$last$0$ = $10 ? $last$03 : $16;
$21 = (($i$02) + 1)|0;
$exitcond = ($21|0)==($12|0);
if ($exitcond) {
$$0 = 1;
break;
} else {
$i$02 = $21;$last$03 = $last$0$;
}
}
return ($$0|0);
}
function _codebook_decode($f,$c,$output,$len) {
$f = $f|0;
$c = $c|0;
$output = $output|0;
$len = $len|0;
var $$0 = 0, $$len = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0;
var $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0;
var $i$05 = 0, $i$14 = 0, $last$06 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_codebook_decode_start($f,$c)|0);
$1 = ($0|0)<(0);
if ($1) {
$$0 = 0;
return ($$0|0);
}
$2 = HEAP32[$c>>2]|0;
$3 = ($2|0)<($len|0);
$$len = $3 ? $2 : $len;
$4 = Math_imul($2, $0)|0;
$5 = ((($c)) + 22|0);
$6 = HEAP8[$5>>0]|0;
$7 = ($6<<24>>24)==(0);
$8 = ($$len|0)>(0);
if ($7) {
if (!($8)) {
$$0 = 1;
return ($$0|0);
}
$14 = ((($c)) + 28|0);
$15 = HEAP32[$14>>2]|0;
$16 = ($2|0)<($len|0);
$17 = $16 ? $2 : $len;
$i$14 = 0;
while(1) {
$28 = (($i$14) + ($4))|0;
$29 = (($15) + ($28<<2)|0);
$30 = +HEAPF32[$29>>2];
$31 = $30 + 0.0;
$32 = (($output) + ($i$14<<2)|0);
$33 = +HEAPF32[$32>>2];
$34 = $33 + $31;
HEAPF32[$32>>2] = $34;
$35 = (($i$14) + 1)|0;
$exitcond = ($35|0)==($17|0);
if ($exitcond) {
$$0 = 1;
break;
} else {
$i$14 = $35;
}
}
return ($$0|0);
} else {
if (!($8)) {
$$0 = 1;
return ($$0|0);
}
$9 = ((($c)) + 28|0);
$10 = HEAP32[$9>>2]|0;
$11 = ((($c)) + 12|0);
$12 = ($2|0)<($len|0);
$13 = $12 ? $2 : $len;
$i$05 = 0;$last$06 = 0.0;
while(1) {
$18 = (($i$05) + ($4))|0;
$19 = (($10) + ($18<<2)|0);
$20 = +HEAPF32[$19>>2];
$21 = $last$06 + $20;
$22 = (($output) + ($i$05<<2)|0);
$23 = +HEAPF32[$22>>2];
$24 = $23 + $21;
HEAPF32[$22>>2] = $24;
$25 = +HEAPF32[$11>>2];
$26 = $21 + $25;
$27 = (($i$05) + 1)|0;
$exitcond9 = ($27|0)==($13|0);
if ($exitcond9) {
$$0 = 1;
break;
} else {
$i$05 = $27;$last$06 = $26;
}
}
return ($$0|0);
}
return (0)|0;
}
function _codebook_decode_start($f,$c) {
$f = $f|0;
$c = $c|0;
var $$ = 0, $$0 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $z$0 = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($c)) + 21|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(0);
if ($2) {
_error($f,21);
$$0 = -1;
return ($$0|0);
}
$3 = ((($f)) + 1396|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)<(10);
if ($5) {
_prep_huffman($f);
}
$6 = ((($f)) + 1392|0);
$7 = HEAP32[$6>>2]|0;
$8 = $7 & 1023;
$9 = (((($c)) + 36|0) + ($8<<1)|0);
$10 = HEAP16[$9>>1]|0;
$11 = $10 << 16 >> 16;
$12 = ($10<<16>>16)>(-1);
if ($12) {
$13 = ((($c)) + 8|0);
$14 = HEAP32[$13>>2]|0;
$15 = (($14) + ($11)|0);
$16 = HEAP8[$15>>0]|0;
$17 = $16&255;
$18 = $7 >>> $17;
HEAP32[$6>>2] = $18;
$19 = HEAP32[$3>>2]|0;
$20 = (($19) - ($17))|0;
$21 = ($20|0)<(0);
$$ = $21 ? 0 : $20;
HEAP32[$3>>2] = $$;
$$1 = $21 ? -1 : $11;
$z$0 = $$1;
} else {
$22 = (_codebook_decode_scalar_raw($f,$c)|0);
$z$0 = $22;
}
$23 = ((($c)) + 23|0);
$24 = HEAP8[$23>>0]|0;
$25 = ($24<<24>>24)==(0);
if (!($25)) {
$26 = ((($c)) + 2092|0);
$27 = HEAP32[$26>>2]|0;
$28 = ($z$0|0)<($27|0);
if (!($28)) {
___assert_fail((16264|0),(15523|0),1336,(16286|0));
// unreachable;
}
}
$29 = ($z$0|0)<(0);
if (!($29)) {
$$0 = $z$0;
return ($$0|0);
}
$30 = ((($f)) + 1376|0);
$31 = HEAP8[$30>>0]|0;
$32 = ($31<<24>>24)==(0);
if ($32) {
$33 = ((($f)) + 1384|0);
$34 = HEAP32[$33>>2]|0;
$35 = ($34|0)==(0);
if (!($35)) {
$$0 = $z$0;
return ($$0|0);
}
}
_error($f,21);
$$0 = $z$0;
return ($$0|0);
}
function _stbi__pnm_info($s,$x,$y,$comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$c = sp;
_stbi__rewind($s);
$0 = (_stbi__get8($s)|0);
$1 = (_stbi__get8($s)|0);
$2 = ($0<<24>>24)==(80);
$$off = (($1) + -53)<<24>>24;
$switch = ($$off&255)<(2);
$or$cond = $2 & $switch;
if (!($or$cond)) {
_stbi__rewind($s);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$3 = ($1<<24>>24)==(54);
$4 = $3 ? 3 : 1;
HEAP32[$comp>>2] = $4;
$5 = (_stbi__get8($s)|0);
HEAP8[$c>>0] = $5;
_stbi__pnm_skip_whitespace($s,$c);
$6 = (_stbi__pnm_getinteger($s,$c)|0);
HEAP32[$x>>2] = $6;
_stbi__pnm_skip_whitespace($s,$c);
$7 = (_stbi__pnm_getinteger($s,$c)|0);
HEAP32[$y>>2] = $7;
_stbi__pnm_skip_whitespace($s,$c);
$8 = (_stbi__pnm_getinteger($s,$c)|0);
$9 = ($8|0)>(255);
if (!($9)) {
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
_stbi__err(17742);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
function _stbi__get8($s) {
$s = $s|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 168|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($s)) + 172|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($1>>>0)<($3>>>0);
if ($4) {
$5 = ((($1)) + 1|0);
HEAP32[$0>>2] = $5;
$6 = HEAP8[$1>>0]|0;
$$0 = $6;
return ($$0|0);
}
$7 = ((($s)) + 32|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($8|0)==(0);
if ($9) {
$$0 = 0;
return ($$0|0);
}
_stbi__refill_buffer($s);
$10 = HEAP32[$0>>2]|0;
$11 = ((($10)) + 1|0);
HEAP32[$0>>2] = $11;
$12 = HEAP8[$10>>0]|0;
$$0 = $12;
return ($$0|0);
}
function _stbi__rewind($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 176|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($s)) + 168|0);
HEAP32[$2>>2] = $1;
$3 = ((($s)) + 180|0);
$4 = HEAP32[$3>>2]|0;
$5 = ((($s)) + 172|0);
HEAP32[$5>>2] = $4;
return;
}
function _stbi__skip($s,$n) {
$s = $s|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($n|0)<(0);
if ($0) {
$1 = ((($s)) + 172|0);
$2 = HEAP32[$1>>2]|0;
$3 = ((($s)) + 168|0);
HEAP32[$3>>2] = $2;
return;
}
$4 = ((($s)) + 16|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)==(0|0);
if (!($6)) {
$7 = ((($s)) + 172|0);
$8 = HEAP32[$7>>2]|0;
$9 = ((($s)) + 168|0);
$10 = HEAP32[$9>>2]|0;
$11 = $8;
$12 = $10;
$13 = (($11) - ($12))|0;
$14 = ($13|0)<($n|0);
if ($14) {
HEAP32[$9>>2] = $8;
$15 = ((($s)) + 20|0);
$16 = HEAP32[$15>>2]|0;
$17 = ((($s)) + 28|0);
$18 = HEAP32[$17>>2]|0;
$19 = (($n) - ($13))|0;
FUNCTION_TABLE_vii[$16 & 63]($18,$19);
return;
}
}
$20 = ((($s)) + 168|0);
$21 = HEAP32[$20>>2]|0;
$22 = (($21) + ($n)|0);
HEAP32[$20>>2] = $22;
return;
}
function _stbi__tga_get_comp($bits_per_pixel,$is_grey,$is_rgb16) {
$bits_per_pixel = $bits_per_pixel|0;
$is_grey = $is_grey|0;
$is_rgb16 = $is_rgb16|0;
var $$0 = 0, $$mux = 0, $$not = 0, $$not1 = 0, $0 = 0, $1 = 0, $brmerge = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($is_rgb16|0)!=(0|0);
if ($0) {
HEAP32[$is_rgb16>>2] = 0;
}
switch ($bits_per_pixel|0) {
case 8: {
$$0 = 1;
break;
}
case 16: {
$$not = ($is_grey|0)!=(0);
$$not1 = $0 ^ 1;
$brmerge = $$not | $$not1;
$$mux = $$not ? 2 : 3;
if ($brmerge) {
$$0 = $$mux;
} else {
label = 6;
}
break;
}
case 15: {
if ($0) {
label = 6;
} else {
$$0 = 3;
}
break;
}
case 32: case 24: {
$1 = (($bits_per_pixel|0) / 8)&-1;
$$0 = $1;
break;
}
default: {
$$0 = 0;
}
}
if ((label|0) == 6) {
HEAP32[$is_rgb16>>2] = 1;
$$0 = 3;
}
return ($$0|0);
}
function _stbi__refill_buffer($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 16|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($s)) + 28|0);
$3 = HEAP32[$2>>2]|0;
$4 = ((($s)) + 40|0);
$5 = ((($s)) + 36|0);
$6 = HEAP32[$5>>2]|0;
$7 = (FUNCTION_TABLE_iiii[$1 & 15]($3,$4,$6)|0);
$8 = ($7|0)==(0);
if ($8) {
$9 = ((($s)) + 32|0);
HEAP32[$9>>2] = 0;
$10 = ((($s)) + 168|0);
HEAP32[$10>>2] = $4;
$11 = ((($s)) + 41|0);
$12 = ((($s)) + 172|0);
HEAP32[$12>>2] = $11;
$13 = HEAP32[$10>>2]|0;
HEAP8[$13>>0] = 0;
return;
} else {
$14 = ((($s)) + 168|0);
HEAP32[$14>>2] = $4;
$15 = (((($s)) + 40|0) + ($7)|0);
$16 = ((($s)) + 172|0);
HEAP32[$16>>2] = $15;
return;
}
}
function _stbi__pnm_skip_whitespace($s,$c) {
$s = $s|0;
$c = $c|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
L1: while(1) {
$0 = (_stbi__at_eof($s)|0);
$1 = ($0|0)==(0);
if ($1) {
$2 = HEAP8[$c>>0]|0;
$3 = (_stbi__pnm_isspace($2)|0);
$4 = ($3|0)==(0);
if (!($4)) {
$5 = (_stbi__get8($s)|0);
HEAP8[$c>>0] = $5;
continue;
}
}
$6 = (_stbi__at_eof($s)|0);
$7 = ($6|0)==(0);
if (!($7)) {
label = 10;
break;
}
$8 = HEAP8[$c>>0]|0;
$9 = ($8<<24>>24)==(35);
if (!($9)) {
label = 10;
break;
}
$10 = (_stbi__at_eof($s)|0);
$11 = ($10|0)==(0);
if (!($11)) {
continue;
}
while(1) {
$12 = HEAP8[$c>>0]|0;
switch ($12<<24>>24) {
case 13: case 10: {
continue L1;
break;
}
default: {
}
}
$13 = (_stbi__get8($s)|0);
HEAP8[$c>>0] = $13;
$14 = (_stbi__at_eof($s)|0);
$15 = ($14|0)==(0);
if (!($15)) {
continue L1;
}
}
}
if ((label|0) == 10) {
return;
}
}
function _stbi__pnm_getinteger($s,$c) {
$s = $s|0;
$c = $c|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $value$0$lcssa = 0, $value$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__at_eof($s)|0);
$1 = ($0|0)==(0);
if ($1) {
$value$01 = 0;
} else {
$value$0$lcssa = 0;
return ($value$0$lcssa|0);
}
while(1) {
$2 = HEAP8[$c>>0]|0;
$3 = (_stbi__pnm_isdigit($2)|0);
$4 = ($3|0)==(0);
if ($4) {
$value$0$lcssa = $value$01;
label = 4;
break;
}
$5 = ($value$01*10)|0;
$6 = $2 << 24 >> 24;
$7 = (($5) + -48)|0;
$8 = (($7) + ($6))|0;
$9 = (_stbi__get8($s)|0);
HEAP8[$c>>0] = $9;
$10 = (_stbi__at_eof($s)|0);
$11 = ($10|0)==(0);
if ($11) {
$value$01 = $8;
} else {
$value$0$lcssa = $8;
label = 4;
break;
}
}
if ((label|0) == 4) {
return ($value$0$lcssa|0);
}
return (0)|0;
}
function _stbi__at_eof($s) {
$s = $s|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 16|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if (!($2)) {
$3 = ((($s)) + 24|0);
$4 = HEAP32[$3>>2]|0;
$5 = ((($s)) + 28|0);
$6 = HEAP32[$5>>2]|0;
$7 = (FUNCTION_TABLE_ii[$4 & 15]($6)|0);
$8 = ($7|0)==(0);
if ($8) {
$$0 = 0;
return ($$0|0);
}
$9 = ((($s)) + 32|0);
$10 = HEAP32[$9>>2]|0;
$11 = ($10|0)==(0);
if ($11) {
$$0 = 1;
return ($$0|0);
}
}
$12 = ((($s)) + 168|0);
$13 = HEAP32[$12>>2]|0;
$14 = ((($s)) + 172|0);
$15 = HEAP32[$14>>2]|0;
$16 = ($13>>>0)>=($15>>>0);
$17 = $16&1;
$$0 = $17;
return ($$0|0);
}
function _stbi__pnm_isdigit($c) {
$c = $c|0;
var $0 = 0, $1 = 0, $c$off = 0, label = 0, sp = 0;
sp = STACKTOP;
$c$off = (($c) + -48)<<24>>24;
$0 = ($c$off&255)<(10);
$1 = $0&1;
return ($1|0);
}
function _stbi__pnm_isspace($c) {
$c = $c|0;
var $0 = 0, $1 = 0, $phitmp = 0, $switch$cast = 0, $switch$cast$clear = 0, $switch$downshift = 0, $switch$masked = 0, $switch$tableidx = 0, label = 0, sp = 0;
sp = STACKTOP;
$switch$tableidx = (($c) + -9)<<24>>24;
$0 = ($switch$tableidx&255)<(24);
if (!($0)) {
$1 = 0;
return ($1|0);
}
$switch$cast = $switch$tableidx&255;
$switch$cast$clear = $switch$cast & 16777215;
$switch$downshift = 8388639 >>> $switch$cast$clear;
$switch$masked = $switch$downshift & 16777215;
$phitmp = $switch$masked & 1;
$1 = $phitmp;
return ($1|0);
}
function _stbi__pic_is4($s,$str) {
$s = $s|0;
$str = $str|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = HEAP8[$str>>0]|0;
$2 = ($0<<24>>24)==($1<<24>>24);
if (!($2)) {
return 0;
}
$3 = (_stbi__get8($s)|0);
$4 = ((($str)) + 1|0);
$5 = HEAP8[$4>>0]|0;
$6 = ($3<<24>>24)==($5<<24>>24);
if (!($6)) {
return 0;
}
$7 = (_stbi__get8($s)|0);
$8 = ((($str)) + 2|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($7<<24>>24)==($9<<24>>24);
if ($10) {
$11 = (_stbi__get8($s)|0);
$12 = ((($str)) + 3|0);
$13 = HEAP8[$12>>0]|0;
$14 = ($11<<24>>24)==($13<<24>>24);
$$ = $14&1;
return ($$|0);
} else {
return 0;
}
return (0)|0;
}
function _stbi__get16be($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = $0&255;
$2 = $1 << 8;
$3 = (_stbi__get8($s)|0);
$4 = $3&255;
$5 = $2 | $4;
return ($5|0);
}
function _stbi__get32be($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get16be($s)|0);
$1 = $0 << 16;
$2 = (_stbi__get16be($s)|0);
$3 = (($1) + ($2))|0;
return ($3|0);
}
function _stbi__bmp_parse_header($s,$info) {
$s = $s|0;
$info = $info|0;
var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = ($0<<24>>24)==(66);
if ($1) {
$2 = (_stbi__get8($s)|0);
$3 = ($2<<24>>24)==(77);
if ($3) {
(_stbi__get32le($s)|0);
(_stbi__get16le($s)|0);
(_stbi__get16le($s)|0);
$4 = (_stbi__get32le($s)|0);
$5 = ((($info)) + 4|0);
HEAP32[$5>>2] = $4;
$6 = (_stbi__get32le($s)|0);
$7 = ((($info)) + 8|0);
HEAP32[$7>>2] = $6;
$8 = ($6|0)==(12);
switch ($6|0) {
case 12: {
$9 = (_stbi__get16le($s)|0);
HEAP32[$s>>2] = $9;
$10 = (_stbi__get16le($s)|0);
$11 = ((($s)) + 4|0);
HEAP32[$11>>2] = $10;
break;
}
case 124: case 108: case 56: case 40: {
$12 = (_stbi__get32le($s)|0);
HEAP32[$s>>2] = $12;
$13 = (_stbi__get32le($s)|0);
$14 = ((($s)) + 4|0);
HEAP32[$14>>2] = $13;
break;
}
default: {
_stbi__err(17771);
$$0 = 0;
return ($$0|0);
}
}
$15 = (_stbi__get16le($s)|0);
$16 = ($15|0)==(1);
if (!($16)) {
_stbi__err(17783);
$$0 = 0;
return ($$0|0);
}
$17 = (_stbi__get16le($s)|0);
HEAP32[$info>>2] = $17;
$18 = ($17|0)==(1);
if ($18) {
_stbi__err(17791);
$$0 = 0;
return ($$0|0);
}
if ($8) {
$$0 = (1);
return ($$0|0);
}
$19 = (_stbi__get32le($s)|0);
$$off = (($19) + -1)|0;
$20 = ($$off>>>0)<(2);
if ($20) {
_stbi__err(17802);
$$0 = 0;
return ($$0|0);
}
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
$21 = $6 & -17;
$22 = ($21|0)==(40);
if (!($22)) {
switch ($6|0) {
case 108: case 124: {
break;
}
default: {
_stbi__err(17783);
$$0 = 0;
return ($$0|0);
}
}
$39 = (_stbi__get32le($s)|0);
$40 = ((($info)) + 12|0);
HEAP32[$40>>2] = $39;
$41 = (_stbi__get32le($s)|0);
$42 = ((($info)) + 16|0);
HEAP32[$42>>2] = $41;
$43 = (_stbi__get32le($s)|0);
$44 = ((($info)) + 20|0);
HEAP32[$44>>2] = $43;
$45 = (_stbi__get32le($s)|0);
$46 = ((($info)) + 24|0);
HEAP32[$46>>2] = $45;
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
$47 = ($6|0)==(124);
if (!($47)) {
$$0 = (1);
return ($$0|0);
}
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
$$0 = (1);
return ($$0|0);
}
$23 = ($6|0)==(56);
if ($23) {
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
(_stbi__get32le($s)|0);
}
$24 = HEAP32[$info>>2]|0;
switch ($24|0) {
case 32: case 16: {
break;
}
default: {
$$0 = (1);
return ($$0|0);
}
}
$25 = ((($info)) + 20|0);
HEAP32[$25>>2] = 0;
$26 = ((($info)) + 16|0);
HEAP32[$26>>2] = 0;
$27 = ((($info)) + 12|0);
HEAP32[$27>>2] = 0;
switch ($19|0) {
case 0: {
$28 = HEAP32[$info>>2]|0;
$29 = ($28|0)==(32);
if ($29) {
HEAP32[$27>>2] = 16711680;
HEAP32[$26>>2] = 65280;
HEAP32[$25>>2] = 255;
$30 = ((($info)) + 24|0);
HEAP32[$30>>2] = -16777216;
$31 = ((($info)) + 28|0);
HEAP32[$31>>2] = 0;
$$0 = (1);
return ($$0|0);
} else {
HEAP32[$27>>2] = 31744;
HEAP32[$26>>2] = 992;
HEAP32[$25>>2] = 31;
$$0 = (1);
return ($$0|0);
}
break;
}
case 3: {
$32 = (_stbi__get32le($s)|0);
HEAP32[$27>>2] = $32;
$33 = (_stbi__get32le($s)|0);
HEAP32[$26>>2] = $33;
$34 = (_stbi__get32le($s)|0);
HEAP32[$25>>2] = $34;
$35 = HEAP32[$27>>2]|0;
$36 = HEAP32[$26>>2]|0;
$37 = ($35|0)==($36|0);
$38 = ($36|0)==($34|0);
$or$cond = $37 & $38;
if (!($or$cond)) {
$$0 = (1);
return ($$0|0);
}
_stbi__err(17783);
$$0 = 0;
return ($$0|0);
break;
}
default: {
_stbi__err(17783);
$$0 = 0;
return ($$0|0);
}
}
}
}
_stbi__err(17763);
$$0 = 0;
return ($$0|0);
}
function _stbi__get32le($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get16le($s)|0);
$1 = (_stbi__get16le($s)|0);
$2 = $1 << 16;
$3 = (($2) + ($0))|0;
return ($3|0);
}
function _stbi__gif_header($s,$g,$comp,$is_info) {
$s = $s|0;
$g = $g|0;
$comp = $comp|0;
$is_info = $is_info|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = ($0<<24>>24)==(71);
if ($1) {
$2 = (_stbi__get8($s)|0);
$3 = ($2<<24>>24)==(73);
if ($3) {
$4 = (_stbi__get8($s)|0);
$5 = ($4<<24>>24)==(70);
if ($5) {
$6 = (_stbi__get8($s)|0);
$7 = ($6<<24>>24)==(56);
if ($7) {
$8 = (_stbi__get8($s)|0);
switch ($8<<24>>24) {
case 57: case 55: {
break;
}
default: {
_stbi__err(17810);
$$0 = 0;
return ($$0|0);
}
}
$9 = (_stbi__get8($s)|0);
$10 = ($9<<24>>24)==(97);
if (!($10)) {
_stbi__err(17810);
$$0 = 0;
return ($$0|0);
}
HEAP32[5724>>2] = 17818;
$11 = (_stbi__get16le($s)|0);
HEAP32[$g>>2] = $11;
$12 = (_stbi__get16le($s)|0);
$13 = ((($g)) + 4|0);
HEAP32[$13>>2] = $12;
$14 = (_stbi__get8($s)|0);
$15 = $14&255;
$16 = ((($g)) + 16|0);
HEAP32[$16>>2] = $15;
$17 = (_stbi__get8($s)|0);
$18 = $17&255;
$19 = ((($g)) + 20|0);
HEAP32[$19>>2] = $18;
$20 = (_stbi__get8($s)|0);
$21 = $20&255;
$22 = ((($g)) + 24|0);
HEAP32[$22>>2] = $21;
$23 = ((($g)) + 28|0);
HEAP32[$23>>2] = -1;
$24 = ($comp|0)==(0|0);
if (!($24)) {
HEAP32[$comp>>2] = 4;
}
$25 = ($is_info|0)==(0);
if (!($25)) {
$$0 = 1;
return ($$0|0);
}
$26 = HEAP32[$16>>2]|0;
$27 = $26 & 128;
$28 = ($27|0)==(0);
if ($28) {
$$0 = 1;
return ($$0|0);
}
$29 = ((($g)) + 40|0);
$30 = $26 & 7;
$31 = 2 << $30;
_stbi__gif_parse_colortable($s,$29,$31,-1);
$$0 = 1;
return ($$0|0);
}
}
}
}
_stbi__err(17810);
$$0 = 0;
return ($$0|0);
}
function _stbi__gif_parse_colortable($s,$pal,$num_entries,$transp) {
$s = $s|0;
$pal = $pal|0;
$num_entries = $num_entries|0;
$transp = $transp|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($num_entries|0)>(0);
if ($0) {
$i$01 = 0;
} else {
return;
}
while(1) {
$1 = (_stbi__get8($s)|0);
$2 = (((($pal) + ($i$01<<2)|0)) + 2|0);
HEAP8[$2>>0] = $1;
$3 = (_stbi__get8($s)|0);
$4 = (((($pal) + ($i$01<<2)|0)) + 1|0);
HEAP8[$4>>0] = $3;
$5 = (_stbi__get8($s)|0);
$6 = (($pal) + ($i$01<<2)|0);
HEAP8[$6>>0] = $5;
$not$ = ($i$01|0)!=($transp|0);
$7 = $not$ << 31 >> 31;
$8 = (((($pal) + ($i$01<<2)|0)) + 3|0);
HEAP8[$8>>0] = $7;
$9 = (($i$01) + 1)|0;
$exitcond = ($9|0)==($num_entries|0);
if ($exitcond) {
break;
} else {
$i$01 = $9;
}
}
return;
}
function _stbi__parse_png_file($z,$scan,$req_comp) {
$z = $z|0;
$scan = $scan|0;
$req_comp = $req_comp|0;
var $$ = 0, $$0 = 0, $$lcssa1740 = 0, $$lobit = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
var $c = 0, $color$0 = 0, $color$0$lcssa = 0, $color$1 = 0, $depth$0 = 0, $depth$0$lcssa = 0, $depth$1 = 0, $first$0 = 0, $first$0$lcssa = 0, $first$1 = 0, $has_trans$0 = 0, $has_trans$0$lcssa = 0, $has_trans$1 = 0, $i$0337 = 0, $i$1334 = 0, $idata_limit$0 = 0, $idata_limit$1 = 0, $idata_limit$1$lcssa = 0, $idata_limit$1$ph = 0, $idata_limit$2 = 0;
var $idata_limit$3 = 0, $interlace$0 = 0, $interlace$0$lcssa = 0, $interlace$1 = 0, $ioff$0 = 0, $ioff$0$lcssa = 0, $ioff$1 = 0, $is_iphone$0 = 0, $is_iphone$0$lcssa = 0, $is_iphone$1 = 0, $k$0335 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond7 = 0, $or$cond9$not = 0, $pal_img_n$0 = 0, $pal_img_n$0$lcssa = 0;
var $pal_img_n$0$lcssa1681 = 0, $pal_img_n$1 = 0, $pal_img_n$2 = 0, $pal_len$0 = 0, $pal_len$1 = 0, $palette = 0, $raw_len = 0, $req_comp$ = 0, $switch$split102D = 0, $switch$split12D = 0, $switch$split2D = 0, $switch$split42D = 0, $switch$split72D = 0, $tc = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 1056|0;
$palette = sp + 24|0;
$tc = sp + 16|0;
$c = sp + 8|0;
$raw_len = sp;
$0 = HEAP32[$z>>2]|0;
$1 = ((($z)) + 8|0);
HEAP32[$1>>2] = 0;
$2 = ((($z)) + 4|0);
HEAP32[$2>>2] = 0;
$3 = ((($z)) + 12|0);
HEAP32[$3>>2] = 0;
$4 = (_stbi__check_png_header($0)|0);
$5 = ($4|0)==(0);
if ($5) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$6 = ($scan|0)==(1);
if ($6) {
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
$7 = ((($c)) + 4|0);
$8 = ((($0)) + 4|0);
$9 = ((($0)) + 8|0);
$10 = ($scan|0)==(2);
$11 = ((($0)) + 8|0);
$12 = ((($0)) + 8|0);
$13 = ($scan|0)==(2);
$14 = ($scan|0)==(2);
$color$0 = 0;$depth$0 = 0;$first$0 = 1;$has_trans$0 = 0;$idata_limit$0 = 0;$interlace$0 = 0;$ioff$0 = 0;$is_iphone$0 = 0;$pal_img_n$0 = 0;$pal_len$0 = 0;
L7: while(1) {
_stbi__get_chunk_header($c,$0);
$15 = HEAP32[$7>>2]|0;
$switch$split2D = ($15|0)<(1229472850);
L9: do {
if ($switch$split2D) {
$switch$split12D = ($15|0)<(1229209940);
if ($switch$split12D) {
switch ($15|0) {
case 1130840649: {
break;
}
default: {
label = 96;
break L9;
}
}
$16 = HEAP32[$c>>2]|0;
_stbi__skip($0,$16);
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = 1;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
break;
}
$switch$split72D = ($15|0)<(1229278788);
if (!($switch$split72D)) {
switch ($15|0) {
case 1229278788: {
$color$0$lcssa = $color$0;$depth$0$lcssa = $depth$0;$first$0$lcssa = $first$0;$has_trans$0$lcssa = $has_trans$0;$interlace$0$lcssa = $interlace$0;$ioff$0$lcssa = $ioff$0;$is_iphone$0$lcssa = $is_iphone$0;$pal_img_n$0$lcssa = $pal_img_n$0;
label = 81;
break L7;
break;
}
default: {
label = 96;
break L9;
}
}
}
switch ($15|0) {
case 1229209940: {
break;
}
default: {
label = 96;
break L9;
}
}
$114 = ($first$0|0)==(0);
if (!($114)) {
label = 66;
break L7;
}
$115 = ($pal_img_n$0<<24>>24)==(0);
$116 = ($pal_len$0|0)!=(0);
$or$cond7 = $116 | $115;
if (!($or$cond7)) {
label = 68;
break L7;
}
if ($14) {
$pal_img_n$0$lcssa1681 = $pal_img_n$0;
label = 70;
break L7;
}
$119 = HEAP32[$c>>2]|0;
$120 = (($119) + ($ioff$0))|0;
$121 = ($120|0)<($ioff$0|0);
if ($121) {
$$0 = 0;
label = 102;
break L7;
}
$122 = ($120>>>0)>($idata_limit$0>>>0);
if ($122) {
$123 = ($idata_limit$0|0)==(0);
$124 = ($119>>>0)>(4096);
$125 = $124 ? $119 : 4096;
$idata_limit$1$ph = $123 ? $125 : $idata_limit$0;
$126 = HEAP32[$c>>2]|0;
$127 = (($126) + ($ioff$0))|0;
$idata_limit$1 = $idata_limit$1$ph;
while(1) {
$128 = ($127>>>0)>($idata_limit$1>>>0);
$129 = $idata_limit$1 << 1;
if ($128) {
$idata_limit$1 = $129;
} else {
$idata_limit$1$lcssa = $idata_limit$1;
break;
}
}
$130 = HEAP32[$2>>2]|0;
$131 = (_realloc($130,$idata_limit$1$lcssa)|0);
$132 = ($131|0)==(0|0);
if ($132) {
label = 76;
break L7;
}
HEAP32[$2>>2] = $131;
$idata_limit$2 = $idata_limit$1$lcssa;
} else {
$idata_limit$2 = $idata_limit$0;
}
$133 = HEAP32[$2>>2]|0;
$134 = (($133) + ($ioff$0)|0);
$135 = HEAP32[$c>>2]|0;
$136 = (_stbi__getn($0,$134,$135)|0);
$137 = ($136|0)==(0);
if ($137) {
label = 79;
break L7;
}
$138 = HEAP32[$c>>2]|0;
$139 = (($138) + ($ioff$0))|0;
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$2;$interlace$1 = $interlace$0;$ioff$1 = $139;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
} else {
$switch$split42D = ($15|0)<(1347179589);
if ($switch$split42D) {
switch ($15|0) {
case 1229472850: {
break;
}
default: {
label = 96;
break L9;
}
}
$17 = ($first$0|0)==(0);
if ($17) {
label = 7;
break L7;
}
$18 = HEAP32[$c>>2]|0;
$19 = ($18|0)==(13);
if (!($19)) {
label = 9;
break L7;
}
$20 = (_stbi__get32be($0)|0);
HEAP32[$0>>2] = $20;
$21 = ($20>>>0)>(16777216);
if ($21) {
label = 11;
break L7;
}
$22 = (_stbi__get32be($0)|0);
HEAP32[$8>>2] = $22;
$23 = ($22>>>0)>(16777216);
if ($23) {
label = 13;
break L7;
}
$24 = (_stbi__get8($0)|0);
$25 = $24&255;
switch ($24<<24>>24) {
case 1: case 2: case 4: case 8: {
break;
}
default: {
label = 15;
break L7;
}
}
$26 = (_stbi__get8($0)|0);
$27 = $26&255;
$28 = ($26&255)>(6);
if ($28) {
label = 17;
break L7;
}
$29 = ($26<<24>>24)==(3);
if ($29) {
$pal_img_n$1 = 3;
} else {
$30 = $27 & 1;
$31 = ($30|0)==(0);
if ($31) {
$pal_img_n$1 = $pal_img_n$0;
} else {
label = 20;
break L7;
}
}
$32 = (_stbi__get8($0)|0);
$33 = ($32<<24>>24)==(0);
if (!($33)) {
label = 22;
break L7;
}
$34 = (_stbi__get8($0)|0);
$35 = ($34<<24>>24)==(0);
if (!($35)) {
label = 24;
break L7;
}
$36 = (_stbi__get8($0)|0);
$37 = $36&255;
$38 = ($36&255)>(1);
if ($38) {
label = 26;
break L7;
}
$39 = HEAP32[$0>>2]|0;
$40 = ($39|0)==(0);
if ($40) {
label = 29;
break L7;
}
$41 = HEAP32[$8>>2]|0;
$42 = ($41|0)==(0);
if ($42) {
label = 29;
break L7;
}
$43 = ($pal_img_n$1<<24>>24)==(0);
if (!($43)) {
HEAP32[$11>>2] = 1;
$53 = HEAP32[$0>>2]|0;
$54 = (1073741824 / ($53>>>0))&-1;
$55 = $54 >>> 2;
$56 = HEAP32[$8>>2]|0;
$57 = ($55>>>0)<($56>>>0);
if ($57) {
label = 35;
break L7;
} else {
$color$1 = $27;$depth$1 = $25;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $37;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$1;$pal_len$1 = $pal_len$0;
break;
}
}
$44 = $27 & 2;
$45 = $44 | 1;
$46 = $27 >>> 2;
$$lobit = $46 & 1;
$47 = (($45) + ($$lobit))|0;
HEAP32[$9>>2] = $47;
$48 = HEAP32[$0>>2]|0;
$49 = (1073741824 / ($48>>>0))&-1;
$50 = (($49>>>0) / ($47>>>0))&-1;
$51 = HEAP32[$8>>2]|0;
$52 = ($50>>>0)<($51>>>0);
if ($52) {
label = 32;
break L7;
}
if ($10) {
$$0 = 1;
label = 102;
break L7;
} else {
$color$1 = $27;$depth$1 = $25;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $37;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0;
break;
}
}
$switch$split102D = ($15|0)<(1951551059);
if ($switch$split102D) {
switch ($15|0) {
case 1347179589: {
break;
}
default: {
label = 96;
break L9;
}
}
$58 = ($first$0|0)==(0);
if (!($58)) {
label = 37;
break L7;
}
$59 = HEAP32[$c>>2]|0;
$60 = ($59>>>0)>(768);
if ($60) {
label = 39;
break L7;
}
$61 = (($59>>>0) / 3)&-1;
$62 = ($61*3)|0;
$63 = ($62|0)==($59|0);
if (!($63)) {
label = 42;
break L7;
}
$64 = ($59>>>0)>(2);
if ($64) {
$i$0337 = 0;
} else {
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $61;
break;
}
while(1) {
$65 = (_stbi__get8($0)|0);
$66 = $i$0337 << 2;
$67 = (($palette) + ($66)|0);
HEAP8[$67>>0] = $65;
$68 = (_stbi__get8($0)|0);
$69 = $66 | 1;
$70 = (($palette) + ($69)|0);
HEAP8[$70>>0] = $68;
$71 = (_stbi__get8($0)|0);
$72 = $66 | 2;
$73 = (($palette) + ($72)|0);
HEAP8[$73>>0] = $71;
$74 = $66 | 3;
$75 = (($palette) + ($74)|0);
HEAP8[$75>>0] = -1;
$76 = (($i$0337) + 1)|0;
$77 = ($76>>>0)<($61>>>0);
if ($77) {
$i$0337 = $76;
} else {
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $61;
break L9;
}
}
}
switch ($15|0) {
case 1951551059: {
break;
}
default: {
label = 96;
break L9;
}
}
$78 = ($first$0|0)==(0);
if (!($78)) {
label = 45;
break L7;
}
$79 = HEAP32[$2>>2]|0;
$80 = ($79|0)==(0|0);
if (!($80)) {
label = 47;
break L7;
}
$81 = ($pal_img_n$0<<24>>24)==(0);
if ($81) {
$95 = HEAP32[$12>>2]|0;
$96 = $95 & 1;
$97 = ($96|0)==(0);
if ($97) {
label = 59;
break L7;
}
$98 = HEAP32[$c>>2]|0;
$99 = $95 << 1;
$100 = ($98|0)==($99|0);
if (!($100)) {
label = 63;
break L7;
}
$101 = HEAP32[$12>>2]|0;
$102 = ($101|0)>(0);
if (!($102)) {
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0;
break;
}
$103 = (18042 + ($depth$0)|0);
$104 = HEAP8[$103>>0]|0;
$105 = $104&255;
$k$0335 = 0;
while(1) {
$106 = (_stbi__get16be($0)|0);
$107 = $106 & 255;
$108 = Math_imul($105, $107)|0;
$109 = $108&255;
$110 = (($tc) + ($k$0335)|0);
HEAP8[$110>>0] = $109;
$111 = (($k$0335) + 1)|0;
$112 = HEAP32[$12>>2]|0;
$113 = ($111|0)<($112|0);
if ($113) {
$k$0335 = $111;
} else {
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
break L9;
}
}
}
if ($13) {
label = 50;
break L7;
}
$83 = ($pal_len$0|0)==(0);
if ($83) {
label = 52;
break L7;
}
$84 = HEAP32[$c>>2]|0;
$85 = ($84>>>0)>($pal_len$0>>>0);
if ($85) {
label = 56;
break L7;
}
$86 = HEAP32[$c>>2]|0;
$87 = ($86|0)==(0);
if ($87) {
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0;
} else {
$88 = HEAP32[$c>>2]|0;
$i$1334 = 0;
while(1) {
$89 = (_stbi__get8($0)|0);
$90 = $i$1334 << 2;
$91 = $90 | 3;
$92 = (($palette) + ($91)|0);
HEAP8[$92>>0] = $89;
$93 = (($i$1334) + 1)|0;
$94 = ($93>>>0)<($88>>>0);
if ($94) {
$i$1334 = $93;
} else {
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0;
break;
}
}
}
}
} while(0);
if ((label|0) == 96) {
label = 0;
$182 = ($first$0|0)==(0);
if (!($182)) {
label = 97;
break;
}
$183 = $15 & 536870912;
$184 = ($183|0)==(0);
if ($184) {
$$lcssa1740 = $15;
label = 99;
break;
}
$195 = HEAP32[$c>>2]|0;
_stbi__skip($0,$195);
$color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
}
(_stbi__get32be($0)|0);
$color$0 = $color$1;$depth$0 = $depth$1;$first$0 = $first$1;$has_trans$0 = $has_trans$1;$idata_limit$0 = $idata_limit$3;$interlace$0 = $interlace$1;$ioff$0 = $ioff$1;$is_iphone$0 = $is_iphone$1;$pal_img_n$0 = $pal_img_n$2;$pal_len$0 = $pal_len$1;
}
switch (label|0) {
case 7: {
_stbi__err(17819);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 9: {
_stbi__err(17833);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 11: {
_stbi__err(17846);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 13: {
_stbi__err(17846);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 15: {
_stbi__err(17856);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 17: {
_stbi__err(17873);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 20: {
_stbi__err(17873);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 22: {
_stbi__err(17883);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 24: {
_stbi__err(17899);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 26: {
_stbi__err(17917);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 29: {
_stbi__err(17938);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 32: {
_stbi__err(17846);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 35: {
_stbi__err(17846);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 37: {
_stbi__err(17952);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 39: {
_stbi__err(17967);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 42: {
_stbi__err(17967);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 45: {
_stbi__err(17952);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 47: {
_stbi__err(17980);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 50: {
$82 = ((($0)) + 8|0);
HEAP32[$82>>2] = 4;
$$0 = 1;
STACKTOP = sp;return ($$0|0);
break;
}
case 52: {
_stbi__err(17996);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 56: {
_stbi__err(18013);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 59: {
_stbi__err(18026);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 63: {
_stbi__err(18013);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 66: {
_stbi__err(17952);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 68: {
_stbi__err(18051);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 70: {
$117 = $pal_img_n$0$lcssa1681&255;
$118 = ((($0)) + 8|0);
HEAP32[$118>>2] = $117;
$$0 = 1;
STACKTOP = sp;return ($$0|0);
break;
}
case 76: {
_stbi__err(18059);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 79: {
_stbi__err(18068);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 81: {
$140 = ($first$0$lcssa|0)==(0);
if (!($140)) {
_stbi__err(17952);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$141 = ($scan|0)==(0);
if (!($141)) {
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
$142 = HEAP32[$2>>2]|0;
$143 = ($142|0)==(0|0);
if ($143) {
_stbi__err(18078);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$144 = HEAP32[$0>>2]|0;
$145 = Math_imul($144, $depth$0$lcssa)|0;
$146 = (($145) + 7)|0;
$147 = $146 >>> 3;
$148 = ((($0)) + 4|0);
$149 = HEAP32[$148>>2]|0;
$150 = ((($0)) + 8|0);
$151 = HEAP32[$150>>2]|0;
$152 = Math_imul($151, $149)|0;
$153 = Math_imul($152, $147)|0;
$154 = (($153) + ($149))|0;
HEAP32[$raw_len>>2] = $154;
$155 = HEAP32[$2>>2]|0;
$156 = ($is_iphone$0$lcssa|0)!=(0);
$157 = $156&1;
$158 = $157 ^ 1;
$159 = (_stbi_zlib_decode_malloc_guesssize_headerflag($155,$ioff$0$lcssa,$154,$raw_len,$158)|0);
HEAP32[$1>>2] = $159;
$160 = ($159|0)==(0|0);
if ($160) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$161 = HEAP32[$2>>2]|0;
_free($161);
HEAP32[$2>>2] = 0;
$162 = HEAP32[$150>>2]|0;
$163 = (($162) + 1)|0;
$notlhs = ($163|0)!=($req_comp|0);
$notrhs = ($req_comp|0)==(3);
$or$cond9$not = $notrhs | $notlhs;
$164 = ($pal_img_n$0$lcssa<<24>>24)!=(0);
$or$cond11 = $164 | $or$cond9$not;
$165 = ($has_trans$0$lcssa<<24>>24)==(0);
$or$cond = $165 & $or$cond11;
$166 = ((($0)) + 12|0);
$$ = $or$cond ? $162 : $163;
HEAP32[$166>>2] = $$;
$167 = HEAP32[$1>>2]|0;
$168 = HEAP32[$raw_len>>2]|0;
$169 = ((($0)) + 12|0);
$170 = (_stbi__create_png_image($z,$167,$168,$$,$depth$0$lcssa,$color$0$lcssa,$interlace$0$lcssa)|0);
$171 = ($170|0)==(0);
if ($171) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
if (!($165)) {
$172 = HEAP32[$169>>2]|0;
_stbi__compute_transparency($z,$tc,$172);
}
$173 = HEAP32[5736>>2]|0;
$174 = ($173|0)!=(0);
$or$cond13 = $156 & $174;
if ($or$cond13) {
$175 = HEAP32[$169>>2]|0;
$176 = ($175|0)>(2);
if ($176) {
_stbi__de_iphone($z);
}
}
if ($164) {
$177 = $pal_img_n$0$lcssa&255;
HEAP32[$150>>2] = $177;
$178 = ($req_comp|0)>(2);
$req_comp$ = $178 ? $req_comp : $177;
HEAP32[$169>>2] = $req_comp$;
$179 = (_stbi__expand_png_palette($z,$palette,$req_comp$)|0);
$180 = ($179|0)==(0);
if ($180) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
}
$181 = HEAP32[$1>>2]|0;
_free($181);
HEAP32[$1>>2] = 0;
$$0 = 1;
STACKTOP = sp;return ($$0|0);
break;
}
case 97: {
_stbi__err(17952);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 99: {
$185 = $$lcssa1740 >>> 24;
$186 = $185&255;
HEAP8[18086>>0] = $186;
$187 = HEAP32[$7>>2]|0;
$188 = $187 >>> 16;
$189 = $188&255;
HEAP8[(18087)>>0] = $189;
$190 = HEAP32[$7>>2]|0;
$191 = $190 >>> 8;
$192 = $191&255;
HEAP8[(18088)>>0] = $192;
$193 = HEAP32[$7>>2]|0;
$194 = $193&255;
HEAP8[(18089)>>0] = $194;
_stbi__err(18086);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
break;
}
case 102: {
STACKTOP = sp;return ($$0|0);
break;
}
}
return (0)|0;
}
function _stbi__check_png_header($s) {
$s = $s|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = ($0<<24>>24)==(-119);
if ($1) {
$2 = (_stbi__get8($s)|0);
$3 = ($2<<24>>24)==(80);
if ($3) {
$4 = (_stbi__get8($s)|0);
$5 = ($4<<24>>24)==(78);
if ($5) {
$6 = (_stbi__get8($s)|0);
$7 = ($6<<24>>24)==(71);
if ($7) {
$8 = (_stbi__get8($s)|0);
$9 = ($8<<24>>24)==(13);
if ($9) {
$10 = (_stbi__get8($s)|0);
$11 = ($10<<24>>24)==(10);
if ($11) {
$12 = (_stbi__get8($s)|0);
$13 = ($12<<24>>24)==(26);
if ($13) {
$14 = (_stbi__get8($s)|0);
$15 = ($14<<24>>24)==(10);
if ($15) {
$$0 = 1;
return ($$0|0);
}
}
}
}
}
}
}
}
_stbi__err(18366);
$$0 = 0;
return ($$0|0);
}
function _stbi__get_chunk_header($agg$result,$s) {
$agg$result = $agg$result|0;
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get32be($s)|0);
$1 = (_stbi__get32be($s)|0);
HEAP32[$agg$result>>2] = $0;
$2 = ((($agg$result)) + 4|0);
HEAP32[$2>>2] = $1;
return;
}
function _stbi__getn($s,$buffer,$n) {
$s = $s|0;
$buffer = $buffer|0;
$n = $n|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 16|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if (!($2)) {
$3 = ((($s)) + 172|0);
$4 = HEAP32[$3>>2]|0;
$5 = ((($s)) + 168|0);
$6 = HEAP32[$5>>2]|0;
$7 = $4;
$8 = $6;
$9 = (($7) - ($8))|0;
$10 = ($9|0)<($n|0);
if ($10) {
_memcpy(($buffer|0),($6|0),($9|0))|0;
$11 = HEAP32[$0>>2]|0;
$12 = ((($s)) + 28|0);
$13 = HEAP32[$12>>2]|0;
$14 = (($buffer) + ($9)|0);
$15 = (($n) - ($9))|0;
$16 = (FUNCTION_TABLE_iiii[$11 & 15]($13,$14,$15)|0);
$17 = ($16|0)==($15|0);
$18 = $17&1;
$19 = HEAP32[$3>>2]|0;
HEAP32[$5>>2] = $19;
$$0 = $18;
return ($$0|0);
}
}
$20 = ((($s)) + 168|0);
$21 = HEAP32[$20>>2]|0;
$22 = (($21) + ($n)|0);
$23 = ((($s)) + 172|0);
$24 = HEAP32[$23>>2]|0;
$25 = ($22>>>0)>($24>>>0);
if ($25) {
$$0 = 0;
return ($$0|0);
}
_memcpy(($buffer|0),($21|0),($n|0))|0;
$26 = HEAP32[$20>>2]|0;
$27 = (($26) + ($n)|0);
HEAP32[$20>>2] = $27;
$$0 = 1;
return ($$0|0);
}
function _stbi__create_png_image($a,$image_data,$image_data_len,$out_n,$depth,$color,$interlaced) {
$a = $a|0;
$image_data = $image_data|0;
$image_data_len = $image_data_len|0;
$out_n = $out_n|0;
$depth = $depth|0;
$color = $color|0;
$interlaced = $interlaced|0;
var $$0 = 0, $$0212 = 0, $$0311 = 0, $$1 = 0, $$14 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $i$07 = 0;
var $j$08 = 0, $or$cond = 0, $p$010 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($interlaced|0)==(0);
$1 = HEAP32[$a>>2]|0;
$2 = HEAP32[$1>>2]|0;
$3 = ((($1)) + 4|0);
$4 = HEAP32[$3>>2]|0;
if ($0) {
$5 = (_stbi__create_png_image_raw($a,$image_data,$image_data_len,$out_n,$2,$4,$depth,$color)|0);
$$0 = $5;
return ($$0|0);
}
$6 = Math_imul($2, $out_n)|0;
$7 = Math_imul($6, $4)|0;
$8 = (_stbi__malloc($7)|0);
$9 = ((($a)) + 12|0);
$10 = ((($a)) + 12|0);
$$0212 = $image_data;$$0311 = $image_data_len;$p$010 = 0;
while(1) {
$11 = HEAP32[$a>>2]|0;
$12 = HEAP32[$11>>2]|0;
$13 = (7888 + ($p$010<<2)|0);
$14 = HEAP32[$13>>2]|0;
$15 = (7916 + ($p$010<<2)|0);
$16 = HEAP32[$15>>2]|0;
$17 = (($12) + -1)|0;
$18 = (($17) - ($14))|0;
$19 = (($18) + ($16))|0;
$20 = (($19>>>0) / ($16>>>0))&-1;
$21 = ((($11)) + 4|0);
$22 = HEAP32[$21>>2]|0;
$23 = (7944 + ($p$010<<2)|0);
$24 = HEAP32[$23>>2]|0;
$25 = (7972 + ($p$010<<2)|0);
$26 = HEAP32[$25>>2]|0;
$27 = (($22) + -1)|0;
$28 = (($27) - ($24))|0;
$29 = (($28) + ($26))|0;
$30 = (($29>>>0) / ($26>>>0))&-1;
$31 = ($20|0)!=(0);
$32 = ($30|0)!=(0);
$or$cond = $31 & $32;
if ($or$cond) {
$33 = ((($11)) + 8|0);
$34 = HEAP32[$33>>2]|0;
$35 = Math_imul($20, $depth)|0;
$36 = Math_imul($35, $34)|0;
$37 = (($36) + 7)|0;
$38 = $37 >> 3;
$39 = (($38) + 1)|0;
$40 = Math_imul($39, $30)|0;
$41 = (_stbi__create_png_image_raw($a,$$0212,$$0311,$out_n,$20,$30,$depth,$color)|0);
$42 = ($41|0)==(0);
if ($42) {
label = 8;
break;
}
$43 = ($30|0)>(0);
if ($43) {
$44 = ($20|0)>(0);
$j$08 = 0;
while(1) {
if ($44) {
$45 = HEAP32[$25>>2]|0;
$46 = Math_imul($45, $j$08)|0;
$47 = HEAP32[$23>>2]|0;
$48 = (($46) + ($47))|0;
$49 = HEAP32[$15>>2]|0;
$50 = HEAP32[$13>>2]|0;
$51 = Math_imul($j$08, $20)|0;
$i$07 = 0;
while(1) {
$52 = Math_imul($49, $i$07)|0;
$53 = (($52) + ($50))|0;
$54 = HEAP32[$a>>2]|0;
$55 = HEAP32[$54>>2]|0;
$56 = Math_imul($55, $48)|0;
$57 = (($53) + ($56))|0;
$$sum = Math_imul($57, $out_n)|0;
$58 = (($8) + ($$sum)|0);
$59 = HEAP32[$10>>2]|0;
$60 = (($i$07) + ($51))|0;
$61 = Math_imul($60, $out_n)|0;
$62 = (($59) + ($61)|0);
_memcpy(($58|0),($62|0),($out_n|0))|0;
$63 = (($i$07) + 1)|0;
$64 = ($63|0)<($20|0);
if ($64) {
$i$07 = $63;
} else {
break;
}
}
}
$65 = (($j$08) + 1)|0;
$66 = ($65|0)<($30|0);
if ($66) {
$j$08 = $65;
} else {
break;
}
}
}
$67 = HEAP32[$9>>2]|0;
_free($67);
$68 = (($$0212) + ($40)|0);
$69 = (($$0311) - ($40))|0;
$$1 = $68;$$14 = $69;
} else {
$$1 = $$0212;$$14 = $$0311;
}
$70 = (($p$010) + 1)|0;
$71 = ($70|0)<(7);
if ($71) {
$$0212 = $$1;$$0311 = $$14;$p$010 = $70;
} else {
label = 15;
break;
}
}
if ((label|0) == 8) {
_free($8);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 15) {
$72 = ((($a)) + 12|0);
HEAP32[$72>>2] = $8;
$$0 = 1;
return ($$0|0);
}
return (0)|0;
}
function _stbi__compute_transparency($z,$tc,$out_n) {
$z = $z|0;
$tc = $tc|0;
$out_n = $out_n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$03 = 0, $i$15 = 0, $not$ = 0, $p$04 = 0, $p$16 = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$z>>2]|0;
$1 = HEAP32[$0>>2]|0;
$2 = ((($0)) + 4|0);
$3 = HEAP32[$2>>2]|0;
$4 = Math_imul($3, $1)|0;
$5 = ((($z)) + 12|0);
$6 = HEAP32[$5>>2]|0;
switch ($out_n|0) {
case 2: {
$11 = ($4|0)==(0);
if ($11) {
return;
}
$12 = Math_imul($3, $1)|0;
$i$03 = 0;$p$04 = $6;
while(1) {
$13 = HEAP8[$p$04>>0]|0;
$14 = HEAP8[$tc>>0]|0;
$not$ = ($13<<24>>24)!=($14<<24>>24);
$15 = $not$ << 31 >> 31;
$16 = ((($p$04)) + 1|0);
HEAP8[$16>>0] = $15;
$17 = ((($p$04)) + 2|0);
$18 = (($i$03) + 1)|0;
$exitcond = ($18|0)==($12|0);
if ($exitcond) {
break;
} else {
$i$03 = $18;$p$04 = $17;
}
}
return;
break;
}
case 4: {
$7 = ($4|0)==(0);
if ($7) {
return;
}
$8 = ((($tc)) + 1|0);
$9 = ((($tc)) + 2|0);
$10 = Math_imul($3, $1)|0;
$i$15 = 0;$p$16 = $6;
while(1) {
$19 = HEAP8[$p$16>>0]|0;
$20 = HEAP8[$tc>>0]|0;
$21 = ($19<<24>>24)==($20<<24>>24);
if ($21) {
$22 = ((($p$16)) + 1|0);
$23 = HEAP8[$22>>0]|0;
$24 = HEAP8[$8>>0]|0;
$25 = ($23<<24>>24)==($24<<24>>24);
if ($25) {
$26 = ((($p$16)) + 2|0);
$27 = HEAP8[$26>>0]|0;
$28 = HEAP8[$9>>0]|0;
$29 = ($27<<24>>24)==($28<<24>>24);
if ($29) {
$30 = ((($p$16)) + 3|0);
HEAP8[$30>>0] = 0;
}
}
}
$31 = ((($p$16)) + 4|0);
$32 = (($i$15) + 1)|0;
$exitcond8 = ($32|0)==($10|0);
if ($exitcond8) {
break;
} else {
$i$15 = $32;$p$16 = $31;
}
}
return;
break;
}
default: {
___assert_fail((18159|0),(18129|0),4214,(18184|0));
// unreachable;
}
}
}
function _stbi__de_iphone($z) {
$z = $z|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $exitcond14 = 0, $i$06 = 0, $i$111 = 0, $i$28 = 0, $p$05 = 0, $p$110 = 0, $p$27 = 0, $storemerge = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = HEAP32[$z>>2]|0;
$1 = HEAP32[$0>>2]|0;
$2 = ((($0)) + 4|0);
$3 = HEAP32[$2>>2]|0;
$4 = Math_imul($3, $1)|0;
$5 = ((($z)) + 12|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($0)) + 12|0);
$8 = HEAP32[$7>>2]|0;
switch ($8|0) {
case 3: {
$9 = ($4|0)==(0);
if ($9) {
return;
}
$10 = Math_imul($3, $1)|0;
$i$06 = 0;$p$05 = $6;
while(1) {
$11 = HEAP8[$p$05>>0]|0;
$12 = ((($p$05)) + 2|0);
$13 = HEAP8[$12>>0]|0;
HEAP8[$p$05>>0] = $13;
HEAP8[$12>>0] = $11;
$14 = ((($p$05)) + 3|0);
$15 = (($i$06) + 1)|0;
$exitcond = ($15|0)==($10|0);
if ($exitcond) {
break;
} else {
$i$06 = $15;$p$05 = $14;
}
}
return;
break;
}
case 4: {
$16 = HEAP32[5732>>2]|0;
$17 = ($16|0)==(0);
$18 = ($4|0)==(0);
if ($17) {
if ($18) {
return;
}
$20 = Math_imul($3, $1)|0;
$i$28 = 0;$p$27 = $6;
while(1) {
$44 = HEAP8[$p$27>>0]|0;
$45 = ((($p$27)) + 2|0);
$46 = HEAP8[$45>>0]|0;
HEAP8[$p$27>>0] = $46;
HEAP8[$45>>0] = $44;
$47 = ((($p$27)) + 4|0);
$48 = (($i$28) + 1)|0;
$exitcond13 = ($48|0)==($20|0);
if ($exitcond13) {
break;
} else {
$i$28 = $48;$p$27 = $47;
}
}
return;
}
if ($18) {
return;
}
$19 = Math_imul($3, $1)|0;
$i$111 = 0;$p$110 = $6;
while(1) {
$21 = ((($p$110)) + 3|0);
$22 = HEAP8[$21>>0]|0;
$23 = HEAP8[$p$110>>0]|0;
$24 = ($22<<24>>24)==(0);
$25 = ((($p$110)) + 2|0);
$26 = HEAP8[$25>>0]|0;
if ($24) {
HEAP8[$p$110>>0] = $26;
$storemerge = $23;
} else {
$27 = $26&255;
$28 = ($27*255)|0;
$29 = $22&255;
$30 = (($28>>>0) / ($29>>>0))&-1;
$31 = $30&255;
HEAP8[$p$110>>0] = $31;
$32 = ((($p$110)) + 1|0);
$33 = HEAP8[$32>>0]|0;
$34 = $33&255;
$35 = ($34*255)|0;
$36 = (($35>>>0) / ($29>>>0))&-1;
$37 = $36&255;
HEAP8[$32>>0] = $37;
$38 = $23&255;
$39 = ($38*255)|0;
$40 = (($39>>>0) / ($29>>>0))&-1;
$41 = $40&255;
$storemerge = $41;
}
HEAP8[$25>>0] = $storemerge;
$42 = ((($p$110)) + 4|0);
$43 = (($i$111) + 1)|0;
$exitcond14 = ($43|0)==($19|0);
if ($exitcond14) {
break;
} else {
$i$111 = $43;$p$110 = $42;
}
}
return;
break;
}
default: {
___assert_fail((18111|0),(18129|0),4295,(18143|0));
// unreachable;
}
}
}
function _stbi__expand_png_palette($a,$palette,$pal_img_n) {
$a = $a|0;
$palette = $palette|0;
$pal_img_n = $pal_img_n|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$04 = 0, $i$16 = 0, $p$03 = 0, $p$15 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$a>>2]|0;
$1 = HEAP32[$0>>2]|0;
$2 = ((($0)) + 4|0);
$3 = HEAP32[$2>>2]|0;
$4 = Math_imul($3, $1)|0;
$5 = ((($a)) + 12|0);
$6 = HEAP32[$5>>2]|0;
$7 = Math_imul($4, $pal_img_n)|0;
$8 = (_stbi__malloc($7)|0);
$9 = ($8|0)==(0|0);
if ($9) {
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
$10 = ($pal_img_n|0)==(3);
$11 = ($4|0)==(0);
if ($10) {
if (!($11)) {
$13 = Math_imul($3, $1)|0;
$i$04 = 0;$p$03 = $8;
while(1) {
$14 = (($6) + ($i$04)|0);
$15 = HEAP8[$14>>0]|0;
$16 = $15&255;
$17 = $16 << 2;
$18 = (($palette) + ($17)|0);
$19 = HEAP8[$18>>0]|0;
HEAP8[$p$03>>0] = $19;
$20 = $17 | 1;
$21 = (($palette) + ($20)|0);
$22 = HEAP8[$21>>0]|0;
$23 = ((($p$03)) + 1|0);
HEAP8[$23>>0] = $22;
$24 = $17 | 2;
$25 = (($palette) + ($24)|0);
$26 = HEAP8[$25>>0]|0;
$27 = ((($p$03)) + 2|0);
HEAP8[$27>>0] = $26;
$28 = ((($p$03)) + 3|0);
$29 = (($i$04) + 1)|0;
$exitcond = ($29|0)==($13|0);
if ($exitcond) {
break;
} else {
$i$04 = $29;$p$03 = $28;
}
}
}
} else {
if (!($11)) {
$12 = Math_imul($3, $1)|0;
$i$16 = 0;$p$15 = $8;
while(1) {
$30 = (($6) + ($i$16)|0);
$31 = HEAP8[$30>>0]|0;
$32 = $31&255;
$33 = $32 << 2;
$34 = (($palette) + ($33)|0);
$35 = HEAP8[$34>>0]|0;
HEAP8[$p$15>>0] = $35;
$36 = $33 | 1;
$37 = (($palette) + ($36)|0);
$38 = HEAP8[$37>>0]|0;
$39 = ((($p$15)) + 1|0);
HEAP8[$39>>0] = $38;
$40 = $33 | 2;
$41 = (($palette) + ($40)|0);
$42 = HEAP8[$41>>0]|0;
$43 = ((($p$15)) + 2|0);
HEAP8[$43>>0] = $42;
$44 = $33 | 3;
$45 = (($palette) + ($44)|0);
$46 = HEAP8[$45>>0]|0;
$47 = ((($p$15)) + 3|0);
HEAP8[$47>>0] = $46;
$48 = ((($p$15)) + 4|0);
$49 = (($i$16) + 1)|0;
$exitcond8 = ($49|0)==($12|0);
if ($exitcond8) {
break;
} else {
$i$16 = $49;$p$15 = $48;
}
}
}
}
$50 = HEAP32[$5>>2]|0;
_free($50);
HEAP32[$5>>2] = $8;
$$0 = 1;
return ($$0|0);
}
function _stbi__create_png_image_raw($a,$raw,$raw_len,$out_n,$x,$y,$depth,$color) {
$a = $a|0;
$raw = $raw|0;
$raw_len = $raw_len|0;
$out_n = $out_n|0;
$x = $x|0;
$y = $y|0;
$depth = $depth|0;
$color = $color|0;
var $$0 = 0, $$01229 = 0, $$1 = 0, $$2213 = 0, $$3205 = 0, $$4197 = 0, $$5188 = 0, $$6179 = 0, $$7170 = 0, $$8162 = 0, $$9 = 0, $$sum = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0;
var $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum26 = 0, $$sum27$pn = 0, $$sum290 = 0, $$sum291 = 0, $$sum292 = 0, $$sum293 = 0, $$sum294 = 0, $$sum295 = 0, $$sum296 = 0, $$sum297 = 0, $$sum298 = 0, $$sum299 = 0;
var $$sum3 = 0, $$sum300 = 0, $$sum301 = 0, $$sum302 = 0, $$sum303 = 0, $$sum304 = 0, $$sum31 = 0, $$sum32 = 0, $$sum33 = 0, $$sum34 = 0, $$sum35 = 0, $$sum36 = 0, $$sum37 = 0, $$sum38 = 0, $$sum39 = 0, $$sum4 = 0, $$sum40 = 0, $$sum41 = 0, $$sum41$pn = 0, $$sum5 = 0;
var $$sum6 = 0, $$sum63 = 0, $$sum64 = 0, $$sum65 = 0, $$sum66 = 0, $$sum67 = 0, $$sum68 = 0, $$sum69 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
var $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0;
var $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0;
var $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0;
var $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0;
var $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0;
var $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0;
var $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0;
var $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0;
var $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0;
var $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0;
var $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0;
var $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0;
var $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0;
var $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0;
var $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0;
var $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0;
var $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0;
var $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0;
var $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0;
var $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0;
var $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0;
var $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0;
var $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $cur$0$sum = 0;
var $cur$0$sum42 = 0, $cur$0$sum43 = 0, $cur$0$sum44 = 0, $cur$0$sum45 = 0, $cur$0$sum46 = 0, $cur$0$sum47 = 0, $cur$0$sum48 = 0, $cur$0$sum49 = 0, $cur$0$sum50 = 0, $cur$0$sum51 = 0, $cur$0$sum53$pn = 0, $cur$0$sum54 = 0, $cur$0$sum55 = 0, $cur$0$sum56 = 0, $cur$0$sum57 = 0, $cur$0$sum58 = 0, $cur$0$sum59 = 0, $cur$0$sum60 = 0, $cur$0$sum61 = 0, $cur$1 = 0;
var $cur$2212 = 0, $cur$3204 = 0, $cur$4195 = 0, $cur$5186 = 0, $cur$6177 = 0, $cur$7169 = 0, $cur$8161 = 0, $cur1$0$lcssa = 0, $cur1$0138 = 0, $cur1$1$lcssa = 0, $cur1$1130 = 0, $cur1$4$lcssa = 0, $cur1$4125 = 0, $exitcond = 0, $exitcond269 = 0, $exitcond271 = 0, $exitcond273 = 0, $exitcond275 = 0, $exitcond277 = 0, $exitcond279 = 0;
var $exitcond281 = 0, $exitcond284 = 0, $exitcond285 = 0, $exitcond286 = 0, $exitcond287 = 0, $exitcond288 = 0, $exitcond289 = 0, $filter$0 = 0, $filter_bytes$0 = 0, $i$0 = 0, $i$0211 = 0, $i$0214 = 0, $i$1 = 0, $i$1203 = 0, $i$1206 = 0, $i$2 = 0, $i$2194 = 0, $i$2198 = 0, $i$3 = 0, $i$3185 = 0;
var $i$3189 = 0, $i$4 = 0, $i$4176 = 0, $i$4180 = 0, $i$5 = 0, $i$5168 = 0, $i$5171 = 0, $i$6 = 0, $i$6160 = 0, $i$6163 = 0, $in$0$lcssa = 0, $in$0139 = 0, $in$1$lcssa = 0, $in$1131 = 0, $in$2$lcssa = 0, $in$2126 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next255 = 0, $indvars$iv$next258 = 0;
var $indvars$iv$next261 = 0, $indvars$iv$next264 = 0, $indvars$iv$next267 = 0, $indvars$iv254 = 0, $indvars$iv257 = 0, $indvars$iv260 = 0, $indvars$iv263 = 0, $indvars$iv266 = 0, $j$0228 = 0, $j$1151 = 0, $k$0153 = 0, $k$10182 = 0, $k$11173 = 0, $k$12165 = 0, $k$1226 = 0, $k$13157 = 0, $k$14$lcssa = 0, $k$14137 = 0, $k$15$lcssa = 0, $k$15129 = 0;
var $k$16$lcssa = 0, $k$16124 = 0, $k$2224 = 0, $k$3222 = 0, $k$4220 = 0, $k$5218 = 0, $k$6216 = 0, $k$7208 = 0, $k$8200 = 0, $k$9191 = 0, $or$cond = 0, $or$cond311 = 0, $prior$0 = 0, $prior$0$sum = 0, $prior$0$sum28 = 0, $prior$0$sum29 = 0, $prior$0$sum30 = 0, $prior$3196 = 0, $prior$4187 = 0, $prior$5178 = 0;
var $q$0 = 0, $q$0148 = 0, $q$0149 = 0, $q$1 = 0, $q$1145 = 0, $q$1146 = 0, $scevgep = 0, $scevgep256 = 0, $scevgep259 = 0, $scevgep262 = 0, $scevgep265 = 0, $scevgep268 = 0, $scevgep270 = 0, $scevgep272 = 0, $scevgep274 = 0, $scevgep276 = 0, $scevgep278 = 0, $scevgep280 = 0, $scevgep283 = 0, $width$0 = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$a>>2]|0;
$1 = Math_imul($x, $out_n)|0;
$2 = ((($0)) + 8|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($3|0)==($out_n|0);
$5 = (($3) + 1)|0;
$6 = ($5|0)==($out_n|0);
$or$cond = $4 | $6;
if (!($or$cond)) {
___assert_fail((18211|0),(18129|0),3994,(18252|0));
// unreachable;
}
$7 = Math_imul($x, $out_n)|0;
$8 = Math_imul($7, $y)|0;
$9 = (_stbi__malloc($8)|0);
$10 = ((($a)) + 12|0);
HEAP32[$10>>2] = $9;
$11 = ($9|0)==(0|0);
if ($11) {
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
$12 = Math_imul($3, $x)|0;
$13 = Math_imul($12, $depth)|0;
$14 = (($13) + 7)|0;
$15 = $14 >>> 3;
$16 = (($15) + 1)|0;
$17 = Math_imul($16, $y)|0;
$18 = HEAP32[$0>>2]|0;
$19 = ($18|0)==($x|0);
if ($19) {
$20 = ((($0)) + 4|0);
$21 = HEAP32[$20>>2]|0;
$22 = ($21|0)==($y|0);
if ($22) {
$23 = ($17|0)==($raw_len|0);
if (!($23)) {
_stbi__err(18279);
$$0 = 0;
return ($$0|0);
}
} else {
label = 9;
}
} else {
label = 9;
}
if ((label|0) == 9) {
$24 = ($17>>>0)>($raw_len>>>0);
if ($24) {
_stbi__err(18279);
$$0 = 0;
return ($$0|0);
}
}
$25 = ($y|0)==(0);
L18: do {
if (!($25)) {
$26 = ($depth|0)<(8);
$27 = ($15>>>0)>($x>>>0);
$28 = (($1) - ($15))|0;
$29 = ($depth|0)==(8);
$$sum26 = (($3) + 1)|0;
$brmerge = $26 | $4;
$i$0211 = (($x) + -1)|0;
$30 = ($i$0211|0)==(0);
$31 = ($3|0)>(0);
$i$1203 = (($x) + -1)|0;
$32 = ($i$1203|0)==(0);
$33 = ($3|0)>(0);
$i$2194 = (($x) + -1)|0;
$34 = ($i$2194|0)==(0);
$35 = ($3|0)>(0);
$i$3185 = (($x) + -1)|0;
$36 = ($i$3185|0)==(0);
$37 = ($3|0)>(0);
$i$4176 = (($x) + -1)|0;
$38 = ($i$4176|0)==(0);
$39 = ($3|0)>(0);
$i$5168 = (($x) + -1)|0;
$40 = ($i$5168|0)==(0);
$41 = ($3|0)>(0);
$i$6160 = (($x) + -1)|0;
$42 = ($i$6160|0)==(0);
$43 = ($3|0)>(0);
$44 = Math_imul($3, $i$6160)|0;
$$01229 = $raw;$j$0228 = 0;
L20: while(1) {
$45 = HEAP32[$10>>2]|0;
$46 = Math_imul($j$0228, $1)|0;
$$sum13 = (($46) - ($1))|0;
$47 = HEAP8[$$01229>>0]|0;
$48 = $47&255;
$49 = ($47&255)>(4);
if ($49) {
label = 14;
break;
}
if ($26) {
if ($27) {
label = 17;
break;
}
$$sum41 = (($28) + ($46))|0;
$$sum41$pn = $$sum41;$filter_bytes$0 = 1;$width$0 = $15;
} else {
$$sum41$pn = $46;$filter_bytes$0 = $3;$width$0 = $x;
}
$50 = ($j$0228|0)==(0);
if ($50) {
$51 = (18333 + ($48)|0);
$52 = HEAP8[$51>>0]|0;
$53 = $52&255;
$filter$0 = $53;
} else {
$filter$0 = $48;
}
$54 = ($filter_bytes$0|0)>(0);
L30: do {
if ($54) {
$k$0153 = 0;
while(1) {
switch ($filter$0|0) {
case 0: {
$$sum40 = (($k$0153) + 1)|0;
$55 = (($$01229) + ($$sum40)|0);
$56 = HEAP8[$55>>0]|0;
$cur$0$sum55 = (($k$0153) + ($$sum41$pn))|0;
$57 = (($45) + ($cur$0$sum55)|0);
HEAP8[$57>>0] = $56;
break;
}
case 1: {
$$sum39 = (($k$0153) + 1)|0;
$58 = (($$01229) + ($$sum39)|0);
$59 = HEAP8[$58>>0]|0;
$cur$0$sum56 = (($k$0153) + ($$sum41$pn))|0;
$60 = (($45) + ($cur$0$sum56)|0);
HEAP8[$60>>0] = $59;
break;
}
case 2: {
$$sum37 = (($k$0153) + 1)|0;
$61 = (($$01229) + ($$sum37)|0);
$62 = HEAP8[$61>>0]|0;
$63 = $62&255;
$$sum38 = (($k$0153) + ($$sum13))|0;
$64 = (($45) + ($$sum38)|0);
$65 = HEAP8[$64>>0]|0;
$66 = $65&255;
$67 = (($66) + ($63))|0;
$68 = $67&255;
$cur$0$sum57 = (($k$0153) + ($$sum41$pn))|0;
$69 = (($45) + ($cur$0$sum57)|0);
HEAP8[$69>>0] = $68;
break;
}
case 3: {
$$sum35 = (($k$0153) + 1)|0;
$70 = (($$01229) + ($$sum35)|0);
$71 = HEAP8[$70>>0]|0;
$72 = $71&255;
$$sum36 = (($k$0153) + ($$sum13))|0;
$73 = (($45) + ($$sum36)|0);
$74 = HEAP8[$73>>0]|0;
$75 = $74&255;
$76 = $75 >>> 1;
$77 = (($76) + ($72))|0;
$78 = $77&255;
$cur$0$sum58 = (($k$0153) + ($$sum41$pn))|0;
$79 = (($45) + ($cur$0$sum58)|0);
HEAP8[$79>>0] = $78;
break;
}
case 4: {
$$sum33 = (($k$0153) + 1)|0;
$80 = (($$01229) + ($$sum33)|0);
$81 = HEAP8[$80>>0]|0;
$82 = $81&255;
$$sum34 = (($k$0153) + ($$sum13))|0;
$83 = (($45) + ($$sum34)|0);
$84 = HEAP8[$83>>0]|0;
$85 = $84&255;
$86 = (_stbi__paeth(0,$85,0)|0);
$87 = (($86) + ($82))|0;
$88 = $87&255;
$cur$0$sum59 = (($k$0153) + ($$sum41$pn))|0;
$89 = (($45) + ($cur$0$sum59)|0);
HEAP8[$89>>0] = $88;
break;
}
case 5: {
$$sum32 = (($k$0153) + 1)|0;
$90 = (($$01229) + ($$sum32)|0);
$91 = HEAP8[$90>>0]|0;
$cur$0$sum60 = (($k$0153) + ($$sum41$pn))|0;
$92 = (($45) + ($cur$0$sum60)|0);
HEAP8[$92>>0] = $91;
break;
}
case 6: {
$$sum31 = (($k$0153) + 1)|0;
$93 = (($$01229) + ($$sum31)|0);
$94 = HEAP8[$93>>0]|0;
$cur$0$sum61 = (($k$0153) + ($$sum41$pn))|0;
$95 = (($45) + ($cur$0$sum61)|0);
HEAP8[$95>>0] = $94;
break;
}
default: {
}
}
$96 = (($k$0153) + 1)|0;
$exitcond = ($96|0)==($filter_bytes$0|0);
if ($exitcond) {
break L30;
} else {
$k$0153 = $96;
}
}
}
} while(0);
if ($29) {
if (!($4)) {
$cur$0$sum54 = (($$sum41$pn) + ($3))|0;
$97 = (($45) + ($cur$0$sum54)|0);
HEAP8[$97>>0] = -1;
}
$98 = (($$01229) + ($$sum26)|0);
$$1 = $98;$100 = $out_n;$125 = $$sum26;
} else {
$99 = ((($$01229)) + 2|0);
$$1 = $99;$100 = 1;$125 = 2;
}
$$sum27$pn = (($100) + ($$sum13))|0;
$cur$0$sum53$pn = (($100) + ($$sum41$pn))|0;
$cur$1 = (($45) + ($cur$0$sum53$pn)|0);
$prior$0 = (($45) + ($$sum27$pn)|0);
L50: do {
if ($brmerge) {
$101 = (($width$0) + -1)|0;
$102 = Math_imul($101, $3)|0;
switch ($filter$0|0) {
case 0: {
_memcpy(($cur$1|0),($$1|0),($102|0))|0;
break;
}
case 1: {
$121 = ($102|0)>(0);
if ($121) {
$122 = (($$sum41$pn) - ($filter_bytes$0))|0;
$$sum24 = (($122) + ($100))|0;
$$sum25 = (($100) + ($$sum41$pn))|0;
$123 = (($width$0) + -1)|0;
$124 = Math_imul($3, $123)|0;
$k$1226 = 0;
while(1) {
$$sum69 = (($k$1226) + ($125))|0;
$126 = (($$01229) + ($$sum69)|0);
$127 = HEAP8[$126>>0]|0;
$128 = $127&255;
$cur$0$sum42 = (($$sum24) + ($k$1226))|0;
$129 = (($45) + ($cur$0$sum42)|0);
$130 = HEAP8[$129>>0]|0;
$131 = $130&255;
$132 = (($131) + ($128))|0;
$133 = $132&255;
$cur$0$sum = (($$sum25) + ($k$1226))|0;
$134 = (($45) + ($cur$0$sum)|0);
HEAP8[$134>>0] = $133;
$135 = (($k$1226) + 1)|0;
$exitcond289 = ($135|0)==($124|0);
if ($exitcond289) {
break;
} else {
$k$1226 = $135;
}
}
}
break;
}
case 2: {
$118 = ($102|0)>(0);
if ($118) {
$$sum23 = (($100) + ($$sum41$pn))|0;
$119 = (($width$0) + -1)|0;
$120 = Math_imul($3, $119)|0;
$k$2224 = 0;
while(1) {
$$sum68 = (($k$2224) + ($125))|0;
$136 = (($$01229) + ($$sum68)|0);
$137 = HEAP8[$136>>0]|0;
$138 = $137&255;
$prior$0$sum = (($k$2224) + ($$sum27$pn))|0;
$139 = (($45) + ($prior$0$sum)|0);
$140 = HEAP8[$139>>0]|0;
$141 = $140&255;
$142 = (($141) + ($138))|0;
$143 = $142&255;
$cur$0$sum43 = (($$sum23) + ($k$2224))|0;
$144 = (($45) + ($cur$0$sum43)|0);
HEAP8[$144>>0] = $143;
$145 = (($k$2224) + 1)|0;
$exitcond288 = ($145|0)==($120|0);
if ($exitcond288) {
break;
} else {
$k$2224 = $145;
}
}
}
break;
}
case 3: {
$114 = ($102|0)>(0);
if ($114) {
$115 = (($$sum41$pn) - ($filter_bytes$0))|0;
$$sum21 = (($115) + ($100))|0;
$$sum22 = (($100) + ($$sum41$pn))|0;
$116 = (($width$0) + -1)|0;
$117 = Math_imul($3, $116)|0;
$k$3222 = 0;
while(1) {
$$sum67 = (($k$3222) + ($125))|0;
$146 = (($$01229) + ($$sum67)|0);
$147 = HEAP8[$146>>0]|0;
$148 = $147&255;
$prior$0$sum28 = (($k$3222) + ($$sum27$pn))|0;
$149 = (($45) + ($prior$0$sum28)|0);
$150 = HEAP8[$149>>0]|0;
$151 = $150&255;
$cur$0$sum45 = (($$sum21) + ($k$3222))|0;
$152 = (($45) + ($cur$0$sum45)|0);
$153 = HEAP8[$152>>0]|0;
$154 = $153&255;
$155 = (($154) + ($151))|0;
$156 = $155 >>> 1;
$157 = (($156) + ($148))|0;
$158 = $157&255;
$cur$0$sum44 = (($$sum22) + ($k$3222))|0;
$159 = (($45) + ($cur$0$sum44)|0);
HEAP8[$159>>0] = $158;
$160 = (($k$3222) + 1)|0;
$exitcond287 = ($160|0)==($117|0);
if ($exitcond287) {
break;
} else {
$k$3222 = $160;
}
}
}
break;
}
case 4: {
$111 = ($102|0)>(0);
if ($111) {
$$sum19 = (($100) + ($$sum41$pn))|0;
$$sum20 = (($100) + ($$sum41$pn))|0;
$112 = (($width$0) + -1)|0;
$113 = Math_imul($3, $112)|0;
$k$4220 = 0;
while(1) {
$$sum66 = (($k$4220) + ($125))|0;
$161 = (($$01229) + ($$sum66)|0);
$162 = HEAP8[$161>>0]|0;
$163 = $162&255;
$164 = (($k$4220) - ($filter_bytes$0))|0;
$cur$0$sum47 = (($$sum19) + ($164))|0;
$165 = (($45) + ($cur$0$sum47)|0);
$166 = HEAP8[$165>>0]|0;
$167 = $166&255;
$prior$0$sum30 = (($k$4220) + ($$sum27$pn))|0;
$168 = (($45) + ($prior$0$sum30)|0);
$169 = HEAP8[$168>>0]|0;
$170 = $169&255;
$prior$0$sum29 = (($164) + ($$sum27$pn))|0;
$171 = (($45) + ($prior$0$sum29)|0);
$172 = HEAP8[$171>>0]|0;
$173 = $172&255;
$174 = (_stbi__paeth($167,$170,$173)|0);
$175 = (($174) + ($163))|0;
$176 = $175&255;
$cur$0$sum46 = (($$sum20) + ($k$4220))|0;
$177 = (($45) + ($cur$0$sum46)|0);
HEAP8[$177>>0] = $176;
$178 = (($k$4220) + 1)|0;
$exitcond286 = ($178|0)==($113|0);
if ($exitcond286) {
break;
} else {
$k$4220 = $178;
}
}
}
break;
}
case 5: {
$107 = ($102|0)>(0);
if ($107) {
$108 = (($$sum41$pn) - ($filter_bytes$0))|0;
$$sum17 = (($108) + ($100))|0;
$$sum18 = (($100) + ($$sum41$pn))|0;
$109 = (($width$0) + -1)|0;
$110 = Math_imul($3, $109)|0;
$k$5218 = 0;
while(1) {
$$sum65 = (($k$5218) + ($125))|0;
$179 = (($$01229) + ($$sum65)|0);
$180 = HEAP8[$179>>0]|0;
$181 = $180&255;
$cur$0$sum49 = (($$sum17) + ($k$5218))|0;
$182 = (($45) + ($cur$0$sum49)|0);
$183 = HEAP8[$182>>0]|0;
$184 = $183&255;
$185 = $184 >>> 1;
$186 = (($185) + ($181))|0;
$187 = $186&255;
$cur$0$sum48 = (($$sum18) + ($k$5218))|0;
$188 = (($45) + ($cur$0$sum48)|0);
HEAP8[$188>>0] = $187;
$189 = (($k$5218) + 1)|0;
$exitcond285 = ($189|0)==($110|0);
if ($exitcond285) {
break;
} else {
$k$5218 = $189;
}
}
}
break;
}
case 6: {
$103 = ($102|0)>(0);
if ($103) {
$104 = (($$sum41$pn) - ($filter_bytes$0))|0;
$$sum15 = (($104) + ($100))|0;
$$sum16 = (($100) + ($$sum41$pn))|0;
$105 = (($width$0) + -1)|0;
$106 = Math_imul($3, $105)|0;
$k$6216 = 0;
while(1) {
$$sum64 = (($k$6216) + ($125))|0;
$190 = (($$01229) + ($$sum64)|0);
$191 = HEAP8[$190>>0]|0;
$192 = $191&255;
$cur$0$sum51 = (($$sum15) + ($k$6216))|0;
$193 = (($45) + ($cur$0$sum51)|0);
$194 = HEAP8[$193>>0]|0;
$195 = $194&255;
$196 = (_stbi__paeth($195,0,0)|0);
$197 = (($196) + ($192))|0;
$198 = $197&255;
$cur$0$sum50 = (($$sum16) + ($k$6216))|0;
$199 = (($45) + ($cur$0$sum50)|0);
HEAP8[$199>>0] = $198;
$200 = (($k$6216) + 1)|0;
$exitcond284 = ($200|0)==($106|0);
if ($exitcond284) {
break;
} else {
$k$6216 = $200;
}
}
}
break;
}
default: {
}
}
$$sum63 = (($125) + ($102))|0;
$201 = (($$01229) + ($$sum63)|0);
$$9 = $201;
} else {
if (!($6)) {
label = 59;
break L20;
}
switch ($filter$0|0) {
case 0: {
if ($30) {
$$9 = $$1;
break L50;
} else {
$$2213 = $$1;$cur$2212 = $cur$1;$i$0214 = $i$0211;
}
while(1) {
if ($31) {
$k$7208 = 0;
while(1) {
$202 = (($$2213) + ($k$7208)|0);
$203 = HEAP8[$202>>0]|0;
$204 = (($cur$2212) + ($k$7208)|0);
HEAP8[$204>>0] = $203;
$205 = (($k$7208) + 1)|0;
$exitcond281 = ($205|0)==($3|0);
if ($exitcond281) {
break;
} else {
$k$7208 = $205;
}
}
}
$206 = (($cur$2212) + ($3)|0);
HEAP8[$206>>0] = -1;
$207 = (($$2213) + ($3)|0);
$208 = (($cur$2212) + ($out_n)|0);
$i$0 = (($i$0214) + -1)|0;
$209 = ($i$0|0)==(0);
if ($209) {
break;
} else {
$$2213 = $207;$cur$2212 = $208;$i$0214 = $i$0;
}
}
$$sum304 = (($125) + ($44))|0;
$scevgep283 = (($$01229) + ($$sum304)|0);
$$9 = $scevgep283;
break L50;
break;
}
case 1: {
if ($32) {
$$9 = $$1;
break L50;
} else {
$$3205 = $$1;$cur$3204 = $cur$1;$i$1206 = $i$1203;
}
while(1) {
if ($33) {
$k$8200 = 0;
while(1) {
$210 = (($$3205) + ($k$8200)|0);
$211 = HEAP8[$210>>0]|0;
$212 = $211&255;
$213 = (($k$8200) - ($out_n))|0;
$214 = (($cur$3204) + ($213)|0);
$215 = HEAP8[$214>>0]|0;
$216 = $215&255;
$217 = (($216) + ($212))|0;
$218 = $217&255;
$219 = (($cur$3204) + ($k$8200)|0);
HEAP8[$219>>0] = $218;
$220 = (($k$8200) + 1)|0;
$exitcond279 = ($220|0)==($3|0);
if ($exitcond279) {
break;
} else {
$k$8200 = $220;
}
}
}
$221 = (($cur$3204) + ($3)|0);
HEAP8[$221>>0] = -1;
$222 = (($$3205) + ($3)|0);
$223 = (($cur$3204) + ($out_n)|0);
$i$1 = (($i$1206) + -1)|0;
$224 = ($i$1|0)==(0);
if ($224) {
break;
} else {
$$3205 = $222;$cur$3204 = $223;$i$1206 = $i$1;
}
}
$$sum303 = (($125) + ($44))|0;
$scevgep280 = (($$01229) + ($$sum303)|0);
$$9 = $scevgep280;
break L50;
break;
}
case 2: {
if ($34) {
$$9 = $$1;
break L50;
} else {
$$4197 = $$1;$cur$4195 = $cur$1;$i$2198 = $i$2194;$prior$3196 = $prior$0;
}
while(1) {
if ($35) {
$k$9191 = 0;
while(1) {
$225 = (($$4197) + ($k$9191)|0);
$226 = HEAP8[$225>>0]|0;
$227 = $226&255;
$228 = (($prior$3196) + ($k$9191)|0);
$229 = HEAP8[$228>>0]|0;
$230 = $229&255;
$231 = (($230) + ($227))|0;
$232 = $231&255;
$233 = (($cur$4195) + ($k$9191)|0);
HEAP8[$233>>0] = $232;
$234 = (($k$9191) + 1)|0;
$exitcond277 = ($234|0)==($3|0);
if ($exitcond277) {
break;
} else {
$k$9191 = $234;
}
}
}
$235 = (($cur$4195) + ($3)|0);
HEAP8[$235>>0] = -1;
$236 = (($$4197) + ($3)|0);
$237 = (($cur$4195) + ($out_n)|0);
$238 = (($prior$3196) + ($out_n)|0);
$i$2 = (($i$2198) + -1)|0;
$239 = ($i$2|0)==(0);
if ($239) {
break;
} else {
$$4197 = $236;$cur$4195 = $237;$i$2198 = $i$2;$prior$3196 = $238;
}
}
$$sum302 = (($125) + ($44))|0;
$scevgep278 = (($$01229) + ($$sum302)|0);
$$9 = $scevgep278;
break L50;
break;
}
case 3: {
if ($36) {
$$9 = $$1;
break L50;
} else {
$$5188 = $$1;$cur$5186 = $cur$1;$i$3189 = $i$3185;$prior$4187 = $prior$0;
}
while(1) {
if ($37) {
$k$10182 = 0;
while(1) {
$240 = (($$5188) + ($k$10182)|0);
$241 = HEAP8[$240>>0]|0;
$242 = $241&255;
$243 = (($prior$4187) + ($k$10182)|0);
$244 = HEAP8[$243>>0]|0;
$245 = $244&255;
$246 = (($k$10182) - ($out_n))|0;
$247 = (($cur$5186) + ($246)|0);
$248 = HEAP8[$247>>0]|0;
$249 = $248&255;
$250 = (($249) + ($245))|0;
$251 = $250 >>> 1;
$252 = (($251) + ($242))|0;
$253 = $252&255;
$254 = (($cur$5186) + ($k$10182)|0);
HEAP8[$254>>0] = $253;
$255 = (($k$10182) + 1)|0;
$exitcond275 = ($255|0)==($3|0);
if ($exitcond275) {
break;
} else {
$k$10182 = $255;
}
}
}
$256 = (($cur$5186) + ($3)|0);
HEAP8[$256>>0] = -1;
$257 = (($$5188) + ($3)|0);
$258 = (($cur$5186) + ($out_n)|0);
$259 = (($prior$4187) + ($out_n)|0);
$i$3 = (($i$3189) + -1)|0;
$260 = ($i$3|0)==(0);
if ($260) {
break;
} else {
$$5188 = $257;$cur$5186 = $258;$i$3189 = $i$3;$prior$4187 = $259;
}
}
$$sum301 = (($125) + ($44))|0;
$scevgep276 = (($$01229) + ($$sum301)|0);
$$9 = $scevgep276;
break L50;
break;
}
case 4: {
if ($38) {
$$9 = $$1;
break L50;
} else {
$$6179 = $$1;$cur$6177 = $cur$1;$i$4180 = $i$4176;$prior$5178 = $prior$0;
}
while(1) {
if ($39) {
$k$11173 = 0;
while(1) {
$261 = (($$6179) + ($k$11173)|0);
$262 = HEAP8[$261>>0]|0;
$263 = $262&255;
$264 = (($k$11173) - ($out_n))|0;
$265 = (($cur$6177) + ($264)|0);
$266 = HEAP8[$265>>0]|0;
$267 = $266&255;
$268 = (($prior$5178) + ($k$11173)|0);
$269 = HEAP8[$268>>0]|0;
$270 = $269&255;
$271 = (($prior$5178) + ($264)|0);
$272 = HEAP8[$271>>0]|0;
$273 = $272&255;
$274 = (_stbi__paeth($267,$270,$273)|0);
$275 = (($274) + ($263))|0;
$276 = $275&255;
$277 = (($cur$6177) + ($k$11173)|0);
HEAP8[$277>>0] = $276;
$278 = (($k$11173) + 1)|0;
$exitcond273 = ($278|0)==($3|0);
if ($exitcond273) {
break;
} else {
$k$11173 = $278;
}
}
}
$279 = (($cur$6177) + ($3)|0);
HEAP8[$279>>0] = -1;
$280 = (($$6179) + ($3)|0);
$281 = (($cur$6177) + ($out_n)|0);
$282 = (($prior$5178) + ($out_n)|0);
$i$4 = (($i$4180) + -1)|0;
$283 = ($i$4|0)==(0);
if ($283) {
break;
} else {
$$6179 = $280;$cur$6177 = $281;$i$4180 = $i$4;$prior$5178 = $282;
}
}
$$sum300 = (($125) + ($44))|0;
$scevgep274 = (($$01229) + ($$sum300)|0);
$$9 = $scevgep274;
break L50;
break;
}
case 5: {
if ($40) {
$$9 = $$1;
break L50;
} else {
$$7170 = $$1;$cur$7169 = $cur$1;$i$5171 = $i$5168;
}
while(1) {
if ($41) {
$k$12165 = 0;
while(1) {
$284 = (($$7170) + ($k$12165)|0);
$285 = HEAP8[$284>>0]|0;
$286 = $285&255;
$287 = (($k$12165) - ($out_n))|0;
$288 = (($cur$7169) + ($287)|0);
$289 = HEAP8[$288>>0]|0;
$290 = $289&255;
$291 = $290 >>> 1;
$292 = (($291) + ($286))|0;
$293 = $292&255;
$294 = (($cur$7169) + ($k$12165)|0);
HEAP8[$294>>0] = $293;
$295 = (($k$12165) + 1)|0;
$exitcond271 = ($295|0)==($3|0);
if ($exitcond271) {
break;
} else {
$k$12165 = $295;
}
}
}
$296 = (($cur$7169) + ($3)|0);
HEAP8[$296>>0] = -1;
$297 = (($$7170) + ($3)|0);
$298 = (($cur$7169) + ($out_n)|0);
$i$5 = (($i$5171) + -1)|0;
$299 = ($i$5|0)==(0);
if ($299) {
break;
} else {
$$7170 = $297;$cur$7169 = $298;$i$5171 = $i$5;
}
}
$$sum299 = (($125) + ($44))|0;
$scevgep272 = (($$01229) + ($$sum299)|0);
$$9 = $scevgep272;
break L50;
break;
}
case 6: {
if ($42) {
$$9 = $$1;
break L50;
} else {
$$8162 = $$1;$cur$8161 = $cur$1;$i$6163 = $i$6160;
}
while(1) {
if ($43) {
$k$13157 = 0;
while(1) {
$300 = (($$8162) + ($k$13157)|0);
$301 = HEAP8[$300>>0]|0;
$302 = $301&255;
$303 = (($k$13157) - ($out_n))|0;
$304 = (($cur$8161) + ($303)|0);
$305 = HEAP8[$304>>0]|0;
$306 = $305&255;
$307 = (_stbi__paeth($306,0,0)|0);
$308 = (($307) + ($302))|0;
$309 = $308&255;
$310 = (($cur$8161) + ($k$13157)|0);
HEAP8[$310>>0] = $309;
$311 = (($k$13157) + 1)|0;
$exitcond269 = ($311|0)==($3|0);
if ($exitcond269) {
break;
} else {
$k$13157 = $311;
}
}
}
$312 = (($cur$8161) + ($3)|0);
HEAP8[$312>>0] = -1;
$313 = (($$8162) + ($3)|0);
$314 = (($cur$8161) + ($out_n)|0);
$i$6 = (($i$6163) + -1)|0;
$315 = ($i$6|0)==(0);
if ($315) {
break;
} else {
$$8162 = $313;$cur$8161 = $314;$i$6163 = $i$6;
}
}
$$sum290 = (($125) + ($44))|0;
$scevgep270 = (($$01229) + ($$sum290)|0);
$$9 = $scevgep270;
break L50;
break;
}
default: {
$$9 = $$1;
break L50;
}
}
}
} while(0);
$316 = (($j$0228) + 1)|0;
$317 = ($316>>>0)<($y>>>0);
if ($317) {
$$01229 = $$9;$j$0228 = $316;
} else {
break L18;
}
}
if ((label|0) == 14) {
_stbi__err(18297);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 17) {
___assert_fail((18312|0),(18129|0),4016,(18252|0));
// unreachable;
}
else if ((label|0) == 59) {
___assert_fail((18338|0),(18129|0),4069,(18252|0));
// unreachable;
}
}
} while(0);
$318 = ($depth|0)>(7);
$319 = ($y|0)==(0);
$or$cond311 = $318 | $319;
if ($or$cond311) {
$$0 = 1;
return ($$0|0);
}
$$sum = (($1) - ($15))|0;
$320 = ($color|0)==(0);
$321 = (18042 + ($depth)|0);
$q$0148 = (($x) + -1)|0;
$322 = ($q$0148|0)>(-1);
$q$1145 = (($x) + -1)|0;
$323 = ($q$1145|0)>(-1);
$324 = ($12|0)>(1);
$325 = ($12|0)>(3);
$326 = ($12|0)>(7);
$327 = Math_imul($3, $x)|0;
$328 = (($327) + -8)|0;
$329 = $328 >>> 3;
$330 = Math_imul($x, $out_n)|0;
$331 = (($329) + ($330))|0;
$332 = (($331) + 1)|0;
$333 = Math_imul($3, $depth)|0;
$334 = Math_imul($333, $x)|0;
$335 = (($334) + 7)|0;
$336 = $335 >>> 3;
$337 = (($332) - ($336))|0;
$338 = (($327) + -8)|0;
$339 = $329 << 3;
$340 = (($338) - ($339))|0;
$341 = (($339) + 8)|0;
$342 = Math_imul($3, $x)|0;
$343 = (($342) + -4)|0;
$344 = $343 >>> 2;
$345 = Math_imul($x, $out_n)|0;
$346 = (($344) + ($345))|0;
$347 = (($346) + 1)|0;
$348 = Math_imul($3, $depth)|0;
$349 = Math_imul($348, $x)|0;
$350 = (($349) + 7)|0;
$351 = $350 >>> 3;
$352 = (($347) - ($351))|0;
$353 = (($342) + -4)|0;
$354 = $344 << 2;
$355 = (($353) - ($354))|0;
$356 = (($354) + 4)|0;
$357 = Math_imul($3, $x)|0;
$358 = (($357) + -2)|0;
$359 = $358 >>> 1;
$360 = Math_imul($x, $out_n)|0;
$361 = (($359) + ($360))|0;
$362 = (($361) + 1)|0;
$363 = Math_imul($3, $depth)|0;
$364 = Math_imul($363, $x)|0;
$365 = (($364) + 7)|0;
$366 = $365 >>> 3;
$367 = (($362) - ($366))|0;
$368 = (($357) + -2)|0;
$369 = $359 << 1;
$370 = (($368) - ($369))|0;
$371 = (($369) + 2)|0;
$indvars$iv = $337;$indvars$iv254 = $341;$indvars$iv257 = $352;$indvars$iv260 = $356;$indvars$iv263 = $367;$indvars$iv266 = $371;$j$1151 = 0;
L148: while(1) {
$372 = HEAP32[$10>>2]|0;
$373 = Math_imul($j$1151, $1)|0;
$374 = (($372) + ($373)|0);
$$sum2 = (($$sum) + ($373))|0;
$375 = (($372) + ($$sum2)|0);
if ($320) {
$376 = HEAP8[$321>>0]|0;
$377 = $376&255;
$382 = $377;
} else {
$382 = 1;
}
switch ($depth|0) {
case 4: {
if ($324) {
$scevgep265 = (($372) + ($indvars$iv263)|0);
$cur1$0138 = $374;$in$0139 = $375;$k$14137 = $12;
while(1) {
$378 = HEAP8[$in$0139>>0]|0;
$379 = $378&255;
$380 = $379 >>> 4;
$381 = Math_imul($380, $382)|0;
$383 = $381&255;
$384 = ((($cur1$0138)) + 1|0);
HEAP8[$cur1$0138>>0] = $383;
$385 = HEAP8[$in$0139>>0]|0;
$386 = $385&255;
$387 = $386 & 15;
$388 = Math_imul($387, $382)|0;
$389 = $388&255;
$390 = ((($cur1$0138)) + 2|0);
HEAP8[$384>>0] = $389;
$391 = (($k$14137) + -2)|0;
$392 = ((($in$0139)) + 1|0);
$393 = ($391|0)>(1);
if ($393) {
$cur1$0138 = $390;$in$0139 = $392;$k$14137 = $391;
} else {
break;
}
}
$scevgep268 = (($372) + ($indvars$iv266)|0);
$cur1$0$lcssa = $scevgep268;$in$0$lcssa = $scevgep265;$k$14$lcssa = $370;
} else {
$cur1$0$lcssa = $374;$in$0$lcssa = $375;$k$14$lcssa = $12;
}
$394 = ($k$14$lcssa|0)>(0);
if ($394) {
$395 = HEAP8[$in$0$lcssa>>0]|0;
$396 = $395&255;
$397 = $396 >>> 4;
$398 = Math_imul($397, $382)|0;
$399 = $398&255;
HEAP8[$cur1$0$lcssa>>0] = $399;
}
break;
}
case 2: {
if ($325) {
$scevgep259 = (($372) + ($indvars$iv257)|0);
$cur1$1130 = $374;$in$1131 = $375;$k$15129 = $12;
while(1) {
$400 = HEAP8[$in$1131>>0]|0;
$401 = $400&255;
$402 = $401 >>> 6;
$403 = Math_imul($402, $382)|0;
$404 = $403&255;
$405 = ((($cur1$1130)) + 1|0);
HEAP8[$cur1$1130>>0] = $404;
$406 = HEAP8[$in$1131>>0]|0;
$407 = $406&255;
$408 = $407 >>> 4;
$409 = $408 & 3;
$410 = Math_imul($409, $382)|0;
$411 = $410&255;
$412 = ((($cur1$1130)) + 2|0);
HEAP8[$405>>0] = $411;
$413 = HEAP8[$in$1131>>0]|0;
$414 = $413&255;
$415 = $414 >>> 2;
$416 = $415 & 3;
$417 = Math_imul($416, $382)|0;
$418 = $417&255;
$419 = ((($cur1$1130)) + 3|0);
HEAP8[$412>>0] = $418;
$420 = HEAP8[$in$1131>>0]|0;
$421 = $420&255;
$422 = $421 & 3;
$423 = Math_imul($422, $382)|0;
$424 = $423&255;
$425 = ((($cur1$1130)) + 4|0);
HEAP8[$419>>0] = $424;
$426 = (($k$15129) + -4)|0;
$427 = ((($in$1131)) + 1|0);
$428 = ($426|0)>(3);
if ($428) {
$cur1$1130 = $425;$in$1131 = $427;$k$15129 = $426;
} else {
break;
}
}
$scevgep262 = (($372) + ($indvars$iv260)|0);
$436 = $indvars$iv260;$cur1$1$lcssa = $scevgep262;$in$1$lcssa = $scevgep259;$k$15$lcssa = $355;
} else {
$436 = $373;$cur1$1$lcssa = $374;$in$1$lcssa = $375;$k$15$lcssa = $12;
}
$429 = ($k$15$lcssa|0)>(0);
if ($429) {
$430 = HEAP8[$in$1$lcssa>>0]|0;
$431 = $430&255;
$432 = $431 >>> 6;
$433 = Math_imul($432, $382)|0;
$434 = $433&255;
HEAP8[$cur1$1$lcssa>>0] = $434;
$435 = ($k$15$lcssa|0)>(1);
if ($435) {
$$sum297 = (($436) + 1)|0;
$437 = (($372) + ($$sum297)|0);
$438 = HEAP8[$in$1$lcssa>>0]|0;
$439 = $438&255;
$440 = $439 >>> 4;
$441 = $440 & 3;
$442 = Math_imul($441, $382)|0;
$443 = $442&255;
HEAP8[$437>>0] = $443;
$444 = ($k$15$lcssa|0)>(2);
if ($444) {
$$sum298 = (($436) + 2)|0;
$445 = (($372) + ($$sum298)|0);
$446 = HEAP8[$in$1$lcssa>>0]|0;
$447 = $446&255;
$448 = $447 >>> 2;
$449 = $448 & 3;
$450 = Math_imul($449, $382)|0;
$451 = $450&255;
HEAP8[$445>>0] = $451;
}
}
}
break;
}
case 1: {
if ($326) {
$scevgep = (($372) + ($indvars$iv)|0);
$cur1$4125 = $374;$in$2126 = $375;$k$16124 = $12;
while(1) {
$452 = HEAP8[$in$2126>>0]|0;
$453 = $452&255;
$454 = $453 >>> 7;
$455 = (0 - ($454))|0;
$456 = $382 & $455;
$457 = $456&255;
$458 = ((($cur1$4125)) + 1|0);
HEAP8[$cur1$4125>>0] = $457;
$459 = HEAP8[$in$2126>>0]|0;
$460 = $459&255;
$461 = $460 >>> 6;
$462 = $461 & 1;
$463 = (0 - ($462))|0;
$464 = $382 & $463;
$465 = $464&255;
$466 = ((($cur1$4125)) + 2|0);
HEAP8[$458>>0] = $465;
$467 = HEAP8[$in$2126>>0]|0;
$468 = $467&255;
$469 = $468 >>> 5;
$470 = $469 & 1;
$471 = (0 - ($470))|0;
$472 = $382 & $471;
$473 = $472&255;
$474 = ((($cur1$4125)) + 3|0);
HEAP8[$466>>0] = $473;
$475 = HEAP8[$in$2126>>0]|0;
$476 = $475&255;
$477 = $476 >>> 4;
$478 = $477 & 1;
$479 = (0 - ($478))|0;
$480 = $382 & $479;
$481 = $480&255;
$482 = ((($cur1$4125)) + 4|0);
HEAP8[$474>>0] = $481;
$483 = HEAP8[$in$2126>>0]|0;
$484 = $483&255;
$485 = $484 >>> 3;
$486 = $485 & 1;
$487 = (0 - ($486))|0;
$488 = $382 & $487;
$489 = $488&255;
$490 = ((($cur1$4125)) + 5|0);
HEAP8[$482>>0] = $489;
$491 = HEAP8[$in$2126>>0]|0;
$492 = $491&255;
$493 = $492 >>> 2;
$494 = $493 & 1;
$495 = (0 - ($494))|0;
$496 = $382 & $495;
$497 = $496&255;
$498 = ((($cur1$4125)) + 6|0);
HEAP8[$490>>0] = $497;
$499 = HEAP8[$in$2126>>0]|0;
$500 = $499&255;
$501 = $500 >>> 1;
$502 = $501 & 1;
$503 = (0 - ($502))|0;
$504 = $382 & $503;
$505 = $504&255;
$506 = ((($cur1$4125)) + 7|0);
HEAP8[$498>>0] = $505;
$507 = HEAP8[$in$2126>>0]|0;
$508 = $507&255;
$509 = $508 & 1;
$510 = (0 - ($509))|0;
$511 = $382 & $510;
$512 = $511&255;
$513 = ((($cur1$4125)) + 8|0);
HEAP8[$506>>0] = $512;
$514 = (($k$16124) + -8)|0;
$515 = ((($in$2126)) + 1|0);
$516 = ($514|0)>(7);
if ($516) {
$cur1$4125 = $513;$in$2126 = $515;$k$16124 = $514;
} else {
break;
}
}
$scevgep256 = (($372) + ($indvars$iv254)|0);
$525 = $indvars$iv254;$cur1$4$lcssa = $scevgep256;$in$2$lcssa = $scevgep;$k$16$lcssa = $340;
} else {
$525 = $373;$cur1$4$lcssa = $374;$in$2$lcssa = $375;$k$16$lcssa = $12;
}
$517 = ($k$16$lcssa|0)>(0);
if ($517) {
$518 = HEAP8[$in$2$lcssa>>0]|0;
$519 = $518&255;
$520 = $519 >>> 7;
$521 = (0 - ($520))|0;
$522 = $382 & $521;
$523 = $522&255;
HEAP8[$cur1$4$lcssa>>0] = $523;
$524 = ($k$16$lcssa|0)>(1);
if ($524) {
$$sum291 = (($525) + 1)|0;
$526 = (($372) + ($$sum291)|0);
$527 = HEAP8[$in$2$lcssa>>0]|0;
$528 = $527&255;
$529 = $528 >>> 6;
$530 = $529 & 1;
$531 = (0 - ($530))|0;
$532 = $382 & $531;
$533 = $532&255;
HEAP8[$526>>0] = $533;
$534 = ($k$16$lcssa|0)>(2);
if ($534) {
$$sum292 = (($525) + 2)|0;
$535 = (($372) + ($$sum292)|0);
$536 = HEAP8[$in$2$lcssa>>0]|0;
$537 = $536&255;
$538 = $537 >>> 5;
$539 = $538 & 1;
$540 = (0 - ($539))|0;
$541 = $382 & $540;
$542 = $541&255;
HEAP8[$535>>0] = $542;
$543 = ($k$16$lcssa|0)>(3);
if ($543) {
$$sum293 = (($525) + 3)|0;
$544 = (($372) + ($$sum293)|0);
$545 = HEAP8[$in$2$lcssa>>0]|0;
$546 = $545&255;
$547 = $546 >>> 4;
$548 = $547 & 1;
$549 = (0 - ($548))|0;
$550 = $382 & $549;
$551 = $550&255;
HEAP8[$544>>0] = $551;
$552 = ($k$16$lcssa|0)>(4);
if ($552) {
$$sum294 = (($525) + 4)|0;
$553 = (($372) + ($$sum294)|0);
$554 = HEAP8[$in$2$lcssa>>0]|0;
$555 = $554&255;
$556 = $555 >>> 3;
$557 = $556 & 1;
$558 = (0 - ($557))|0;
$559 = $382 & $558;
$560 = $559&255;
HEAP8[$553>>0] = $560;
$561 = ($k$16$lcssa|0)>(5);
if ($561) {
$$sum295 = (($525) + 5)|0;
$562 = (($372) + ($$sum295)|0);
$563 = HEAP8[$in$2$lcssa>>0]|0;
$564 = $563&255;
$565 = $564 >>> 2;
$566 = $565 & 1;
$567 = (0 - ($566))|0;
$568 = $382 & $567;
$569 = $568&255;
HEAP8[$562>>0] = $569;
$570 = ($k$16$lcssa|0)>(6);
if ($570) {
$$sum296 = (($525) + 6)|0;
$571 = (($372) + ($$sum296)|0);
$572 = HEAP8[$in$2$lcssa>>0]|0;
$573 = $572&255;
$574 = $573 >>> 1;
$575 = $574 & 1;
$576 = (0 - ($575))|0;
$577 = $382 & $576;
$578 = $577&255;
HEAP8[$571>>0] = $578;
}
}
}
}
}
}
}
break;
}
default: {
}
}
L187: do {
if (!($4)) {
$579 = HEAP32[$10>>2]|0;
switch ($3|0) {
case 1: {
if ($322) {
$q$0149 = $q$0148;
} else {
break L187;
}
while(1) {
$582 = $q$0149 << 1;
$583 = $582 | 1;
$$sum10 = (($583) + ($373))|0;
$584 = (($579) + ($$sum10)|0);
HEAP8[$584>>0] = -1;
$$sum11 = (($q$0149) + ($373))|0;
$585 = (($579) + ($$sum11)|0);
$586 = HEAP8[$585>>0]|0;
$$sum12 = (($582) + ($373))|0;
$587 = (($579) + ($$sum12)|0);
HEAP8[$587>>0] = $586;
$q$0 = (($q$0149) + -1)|0;
$588 = ($q$0|0)>(-1);
if ($588) {
$q$0149 = $q$0;
} else {
break L187;
}
}
break;
}
case 3: {
break;
}
default: {
label = 134;
break L148;
}
}
if ($323) {
$580 = (($373) + 2)|0;
$581 = (($373) + 1)|0;
$q$1146 = $q$1145;
while(1) {
$589 = $q$1146 << 2;
$590 = $589 | 3;
$$sum3 = (($590) + ($373))|0;
$591 = (($579) + ($$sum3)|0);
HEAP8[$591>>0] = -1;
$592 = ($q$1146*3)|0;
$$sum4 = (($580) + ($592))|0;
$593 = (($579) + ($$sum4)|0);
$594 = HEAP8[$593>>0]|0;
$595 = $589 | 2;
$$sum5 = (($595) + ($373))|0;
$596 = (($579) + ($$sum5)|0);
HEAP8[$596>>0] = $594;
$$sum6 = (($581) + ($592))|0;
$597 = (($579) + ($$sum6)|0);
$598 = HEAP8[$597>>0]|0;
$599 = $589 | 1;
$$sum7 = (($599) + ($373))|0;
$600 = (($579) + ($$sum7)|0);
HEAP8[$600>>0] = $598;
$$sum8 = (($592) + ($373))|0;
$601 = (($579) + ($$sum8)|0);
$602 = HEAP8[$601>>0]|0;
$$sum9 = (($589) + ($373))|0;
$603 = (($579) + ($$sum9)|0);
HEAP8[$603>>0] = $602;
$q$1 = (($q$1146) + -1)|0;
$604 = ($q$1|0)>(-1);
if ($604) {
$q$1146 = $q$1;
} else {
break;
}
}
}
}
} while(0);
$605 = (($j$1151) + 1)|0;
$606 = ($605>>>0)<($y>>>0);
$indvars$iv$next = (($indvars$iv) + ($330))|0;
$indvars$iv$next255 = (($indvars$iv254) + ($330))|0;
$indvars$iv$next258 = (($indvars$iv257) + ($345))|0;
$indvars$iv$next261 = (($indvars$iv260) + ($345))|0;
$indvars$iv$next264 = (($indvars$iv263) + ($360))|0;
$indvars$iv$next267 = (($indvars$iv266) + ($360))|0;
if ($606) {
$indvars$iv = $indvars$iv$next;$indvars$iv254 = $indvars$iv$next255;$indvars$iv257 = $indvars$iv$next258;$indvars$iv260 = $indvars$iv$next261;$indvars$iv263 = $indvars$iv$next264;$indvars$iv266 = $indvars$iv$next267;$j$1151 = $605;
} else {
$$0 = 1;
label = 137;
break;
}
}
if ((label|0) == 134) {
___assert_fail((18355|0),(18129|0),4149,(18252|0));
// unreachable;
}
else if ((label|0) == 137) {
return ($$0|0);
}
return (0)|0;
}
function _stbi__paeth($a,$b,$c) {
$a = $a|0;
$b = $b|0;
$c = $c|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$b = 0, $ispos = 0, $ispos1 = 0, $ispos3 = 0, $neg = 0, $neg2 = 0, $neg4 = 0, $or$cond = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = (($b) + ($a))|0;
$1 = (($0) - ($c))|0;
$2 = (($1) - ($a))|0;
$ispos = ($2|0)>(-1);
$neg = (0 - ($2))|0;
$3 = $ispos ? $2 : $neg;
$4 = (($1) - ($b))|0;
$ispos1 = ($4|0)>(-1);
$neg2 = (0 - ($4))|0;
$5 = $ispos1 ? $4 : $neg2;
$6 = (($1) - ($c))|0;
$ispos3 = ($6|0)>(-1);
$neg4 = (0 - ($6))|0;
$7 = $ispos3 ? $6 : $neg4;
$8 = ($3|0)>($5|0);
$9 = ($3|0)>($7|0);
$or$cond = $8 | $9;
$10 = ($5|0)>($7|0);
$c$b = $10 ? $c : $b;
$$0 = $or$cond ? $c$b : $a;
return ($$0|0);
}
function _stbi__decode_jpeg_header($z,$scan) {
$z = $z|0;
$scan = $scan|0;
var $$ = 0, $$0 = 0, $$2 = 0, $$9 = 0, $$lcssa = 0, $$lcssa20 = 0, $$lcssa5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $m$010 = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 18116|0);
HEAP8[$0>>0] = -1;
$1 = (_stbi__get_marker($z)|0);
$2 = ($1<<24>>24)==(-40);
if (!($2)) {
_stbi__err(18378);
$$0 = 0;
return ($$0|0);
}
$3 = ($scan|0)==(1);
if ($3) {
$$0 = 1;
return ($$0|0);
}
$4 = (_stbi__get_marker($z)|0);
$5 = $4&255;
$6 = $5 & 254;
$7 = ($6|0)==(192);
$8 = ($4<<24>>24)==(-62);
$$9 = $8 | $7;
L8: do {
if ($$9) {
$$lcssa5 = $8;
} else {
$m$010 = $5;
L10: while(1) {
$13 = (_stbi__process_marker($z,$m$010)|0);
$14 = ($13|0)==(0);
if ($14) {
$$0 = 0;
label = 14;
break;
}
$15 = (_stbi__get_marker($z)|0);
$16 = $15&255;
$17 = ($15<<24>>24)==(-1);
if ($17) {
while(1) {
$18 = HEAP32[$z>>2]|0;
$19 = (_stbi__at_eof($18)|0);
$20 = ($19|0)==(0);
if (!($20)) {
break L10;
}
$21 = (_stbi__get_marker($z)|0);
$22 = ($21<<24>>24)==(-1);
if (!($22)) {
$$lcssa20 = $21;
break;
}
}
$9 = $$lcssa20&255;
$$lcssa = $9;
} else {
$$lcssa = $16;
}
$10 = $$lcssa & 254;
$11 = ($10|0)==(192);
$12 = ($$lcssa|0)==(194);
$$ = $12 | $11;
if ($$) {
$$lcssa5 = $12;
break L8;
} else {
$m$010 = $$lcssa;
}
}
if ((label|0) == 14) {
return ($$0|0);
}
_stbi__err(18385);
$$0 = 0;
return ($$0|0);
}
} while(0);
$23 = $$lcssa5&1;
$24 = ((($z)) + 18124|0);
HEAP32[$24>>2] = $23;
$25 = (_stbi__process_frame_header($z,$scan)|0);
$not$ = ($25|0)!=(0);
$$2 = $not$&1;
$$0 = $$2;
return ($$0|0);
}
function _stbi__get_marker($j) {
$j = $j|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18116|0);
$1 = HEAP8[$0>>0]|0;
$2 = ($1<<24>>24)==(-1);
if (!($2)) {
HEAP8[$0>>0] = -1;
$$0 = $1;
return ($$0|0);
}
$3 = HEAP32[$j>>2]|0;
$4 = (_stbi__get8($3)|0);
$5 = ($4<<24>>24)==(-1);
if (!($5)) {
$$0 = -1;
return ($$0|0);
}
while(1) {
$6 = HEAP32[$j>>2]|0;
$7 = (_stbi__get8($6)|0);
$8 = ($7<<24>>24)==(-1);
if (!($8)) {
$$0 = $7;
break;
}
}
return ($$0|0);
}
function _stbi__process_marker($z,$m) {
$z = $z|0;
$m = $m|0;
var $$2 = 0, $$mask = 0, $$mask7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0;
var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $L$0$lcssa = 0, $L$015 = 0, $L$1$lcssa = 0, $L$122 = 0;
var $exitcond = 0, $exitcond30 = 0, $i$014 = 0, $i1$118 = 0, $or$cond = 0, $or$cond5 = 0, $sizes = 0, $v$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$sizes = sp;
switch ($m|0) {
case 255: {
_stbi__err(18496);
$$2 = 0;
STACKTOP = sp;return ($$2|0);
break;
}
case 221: {
$0 = HEAP32[$z>>2]|0;
$1 = (_stbi__get16be($0)|0);
$2 = ($1|0)==(4);
if ($2) {
$3 = HEAP32[$z>>2]|0;
$4 = (_stbi__get16be($3)|0);
$5 = ((($z)) + 18168|0);
HEAP32[$5>>2] = $4;
$$2 = 1;
STACKTOP = sp;return ($$2|0);
} else {
_stbi__err(18512);
$$2 = 0;
STACKTOP = sp;return ($$2|0);
}
break;
}
case 219: {
$6 = HEAP32[$z>>2]|0;
$7 = (_stbi__get16be($6)|0);
$8 = (($7) + -2)|0;
$9 = ($7|0)>(2);
L16: do {
if ($9) {
$L$015 = $8;
while(1) {
$10 = HEAP32[$z>>2]|0;
$11 = (_stbi__get8($10)|0);
$12 = $11&255;
$13 = $12 & 15;
$$mask = $12 & 240;
$14 = ($$mask|0)==(0);
if (!($14)) {
label = 8;
break;
}
$15 = ($13>>>0)>(3);
if ($15) {
label = 10;
break;
} else {
$i$014 = 0;
}
while(1) {
$16 = HEAP32[$z>>2]|0;
$17 = (_stbi__get8($16)|0);
$18 = (18551 + ($i$014)|0);
$19 = HEAP8[$18>>0]|0;
$20 = $19&255;
$21 = ((((($z)) + 13444|0) + ($13<<6)|0) + ($20)|0);
HEAP8[$21>>0] = $17;
$22 = (($i$014) + 1)|0;
$exitcond = ($22|0)==(64);
if ($exitcond) {
break;
} else {
$i$014 = $22;
}
}
$23 = (($L$015) + -65)|0;
$24 = ($L$015|0)>(65);
if ($24) {
$L$015 = $23;
} else {
$L$0$lcssa = $23;
break L16;
}
}
if ((label|0) == 8) {
_stbi__err(18524);
$$2 = 0;
STACKTOP = sp;return ($$2|0);
}
else if ((label|0) == 10) {
_stbi__err(18537);
$$2 = 0;
STACKTOP = sp;return ($$2|0);
}
} else {
$L$0$lcssa = $8;
}
} while(0);
$25 = ($L$0$lcssa|0)==(0);
$26 = $25&1;
$$2 = $26;
STACKTOP = sp;return ($$2|0);
break;
}
case 196: {
$27 = HEAP32[$z>>2]|0;
$28 = (_stbi__get16be($27)|0);
$29 = (($28) + -2)|0;
$30 = ($28|0)>(2);
L31: do {
if ($30) {
$31 = ((($sizes)) + 4|0);
$32 = ((($sizes)) + 8|0);
$33 = ((($sizes)) + 12|0);
$34 = ((($sizes)) + 16|0);
$35 = ((($sizes)) + 20|0);
$36 = ((($sizes)) + 24|0);
$37 = ((($sizes)) + 28|0);
$38 = ((($sizes)) + 32|0);
$39 = ((($sizes)) + 36|0);
$40 = ((($sizes)) + 40|0);
$41 = ((($sizes)) + 44|0);
$42 = ((($sizes)) + 48|0);
$43 = ((($sizes)) + 52|0);
$44 = ((($sizes)) + 56|0);
$45 = ((($sizes)) + 60|0);
$L$122 = $29;
while(1) {
$46 = HEAP32[$z>>2]|0;
$47 = (_stbi__get8($46)|0);
$48 = $47&255;
$49 = $48 & 15;
$50 = ($47&255)>(31);
$51 = ($49>>>0)>(3);
$or$cond = $50 | $51;
if ($or$cond) {
label = 17;
break;
}
$52 = HEAP32[$z>>2]|0;
$53 = (_stbi__get8($52)|0);
$54 = $53&255;
HEAP32[$sizes>>2] = $54;
$55 = HEAP32[$z>>2]|0;
$56 = (_stbi__get8($55)|0);
$57 = $56&255;
HEAP32[$31>>2] = $57;
$58 = (($57) + ($54))|0;
$59 = HEAP32[$z>>2]|0;
$60 = (_stbi__get8($59)|0);
$61 = $60&255;
HEAP32[$32>>2] = $61;
$62 = (($61) + ($58))|0;
$63 = HEAP32[$z>>2]|0;
$64 = (_stbi__get8($63)|0);
$65 = $64&255;
HEAP32[$33>>2] = $65;
$66 = (($65) + ($62))|0;
$67 = HEAP32[$z>>2]|0;
$68 = (_stbi__get8($67)|0);
$69 = $68&255;
HEAP32[$34>>2] = $69;
$70 = (($69) + ($66))|0;
$71 = HEAP32[$z>>2]|0;
$72 = (_stbi__get8($71)|0);
$73 = $72&255;
HEAP32[$35>>2] = $73;
$74 = (($73) + ($70))|0;
$75 = HEAP32[$z>>2]|0;
$76 = (_stbi__get8($75)|0);
$77 = $76&255;
HEAP32[$36>>2] = $77;
$78 = (($77) + ($74))|0;
$79 = HEAP32[$z>>2]|0;
$80 = (_stbi__get8($79)|0);
$81 = $80&255;
HEAP32[$37>>2] = $81;
$82 = (($81) + ($78))|0;
$83 = HEAP32[$z>>2]|0;
$84 = (_stbi__get8($83)|0);
$85 = $84&255;
HEAP32[$38>>2] = $85;
$86 = (($85) + ($82))|0;
$87 = HEAP32[$z>>2]|0;
$88 = (_stbi__get8($87)|0);
$89 = $88&255;
HEAP32[$39>>2] = $89;
$90 = (($89) + ($86))|0;
$91 = HEAP32[$z>>2]|0;
$92 = (_stbi__get8($91)|0);
$93 = $92&255;
HEAP32[$40>>2] = $93;
$94 = (($93) + ($90))|0;
$95 = HEAP32[$z>>2]|0;
$96 = (_stbi__get8($95)|0);
$97 = $96&255;
HEAP32[$41>>2] = $97;
$98 = (($97) + ($94))|0;
$99 = HEAP32[$z>>2]|0;
$100 = (_stbi__get8($99)|0);
$101 = $100&255;
HEAP32[$42>>2] = $101;
$102 = (($101) + ($98))|0;
$103 = HEAP32[$z>>2]|0;
$104 = (_stbi__get8($103)|0);
$105 = $104&255;
HEAP32[$43>>2] = $105;
$106 = (($105) + ($102))|0;
$107 = HEAP32[$z>>2]|0;
$108 = (_stbi__get8($107)|0);
$109 = $108&255;
HEAP32[$44>>2] = $109;
$110 = (($109) + ($106))|0;
$111 = HEAP32[$z>>2]|0;
$112 = (_stbi__get8($111)|0);
$113 = $112&255;
HEAP32[$45>>2] = $113;
$114 = (($113) + ($110))|0;
$115 = (($L$122) + -17)|0;
$$mask7 = $48 & 240;
$116 = ($$mask7|0)==(0);
if ($116) {
$117 = (((($z)) + 4|0) + (($49*1680)|0)|0);
$118 = (_stbi__build_huffman($117,$sizes)|0);
$119 = ($118|0)==(0);
if ($119) {
break;
}
$120 = (((((($z)) + 4|0) + (($49*1680)|0)|0)) + 1024|0);
$v$0 = $120;
} else {
$121 = (((($z)) + 6724|0) + (($49*1680)|0)|0);
$122 = (_stbi__build_huffman($121,$sizes)|0);
$123 = ($122|0)==(0);
if ($123) {
break;
}
$124 = (((((($z)) + 6724|0) + (($49*1680)|0)|0)) + 1024|0);
$v$0 = $124;
}
$125 = ($114|0)>(0);
if ($125) {
$126 = $56&255;
$127 = $53&255;
$128 = (($126) + ($127))|0;
$129 = $60&255;
$130 = (($128) + ($129))|0;
$131 = $64&255;
$132 = (($130) + ($131))|0;
$133 = $68&255;
$134 = (($132) + ($133))|0;
$135 = $72&255;
$136 = (($134) + ($135))|0;
$137 = $76&255;
$138 = (($136) + ($137))|0;
$139 = $80&255;
$140 = (($138) + ($139))|0;
$141 = $84&255;
$142 = (($140) + ($141))|0;
$143 = $88&255;
$144 = (($142) + ($143))|0;
$145 = $92&255;
$146 = (($144) + ($145))|0;
$147 = $96&255;
$148 = (($146) + ($147))|0;
$149 = $100&255;
$150 = (($148) + ($149))|0;
$151 = $104&255;
$152 = (($150) + ($151))|0;
$153 = $108&255;
$154 = (($152) + ($153))|0;
$155 = $112&255;
$156 = (($154) + ($155))|0;
$i1$118 = 0;
while(1) {
$157 = HEAP32[$z>>2]|0;
$158 = (_stbi__get8($157)|0);
$159 = (($v$0) + ($i1$118)|0);
HEAP8[$159>>0] = $158;
$160 = (($i1$118) + 1)|0;
$exitcond30 = ($160|0)==($156|0);
if ($exitcond30) {
break;
} else {
$i1$118 = $160;
}
}
}
if (!($116)) {
$161 = (((($z)) + 13700|0) + ($49<<10)|0);
$162 = (((($z)) + 6724|0) + (($49*1680)|0)|0);
_stbi__build_fast_ac($161,$162);
}
$163 = (($115) - ($114))|0;
$164 = ($163|0)>(0);
if ($164) {
$L$122 = $163;
} else {
$L$1$lcssa = $163;
break L31;
}
}
if ((label|0) == 17) {
_stbi__err(18630);
}
$$2 = 0;
STACKTOP = sp;return ($$2|0);
} else {
$L$1$lcssa = $29;
}
} while(0);
$165 = ($L$1$lcssa|0)==(0);
$166 = $165&1;
$$2 = $166;
STACKTOP = sp;return ($$2|0);
break;
}
default: {
$167 = $m & -16;
$168 = ($167|0)==(224);
$169 = ($m|0)==(254);
$or$cond5 = $169 | $168;
if (!($or$cond5)) {
$$2 = 0;
STACKTOP = sp;return ($$2|0);
}
$170 = HEAP32[$z>>2]|0;
$171 = (_stbi__get16be($170)|0);
$172 = (($171) + -2)|0;
_stbi__skip($170,$172);
$$2 = 1;
STACKTOP = sp;return ($$2|0);
}
}
return (0)|0;
}
function _stbi__process_frame_header($z,$scan) {
$z = $z|0;
$scan = $scan|0;
var $$0 = 0, $$h_max$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $15 = 0;
var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $h_max$0$lcssa = 0, $h_max$017 = 0, $i$022 = 0, $i$1 = 0, $i$216 = 0, $i$313 = 0, $i$313$lcssa = 0;
var $i$412 = 0, $i$412$in = 0, $or$cond = 0, $or$cond2 = 0, $v_max$0$lcssa = 0, $v_max$018 = 0, $v_max$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$z>>2]|0;
$1 = (_stbi__get16be($0)|0);
$2 = ($1|0)<(11);
if ($2) {
_stbi__err(18392);
$$0 = 0;
return ($$0|0);
}
$3 = (_stbi__get8($0)|0);
$4 = ($3<<24>>24)==(8);
if (!($4)) {
_stbi__err(18404);
$$0 = 0;
return ($$0|0);
}
$5 = (_stbi__get16be($0)|0);
$6 = ((($0)) + 4|0);
HEAP32[$6>>2] = $5;
$7 = ($5|0)==(0);
if ($7) {
_stbi__err(18415);
$$0 = 0;
return ($$0|0);
}
$8 = (_stbi__get16be($0)|0);
HEAP32[$0>>2] = $8;
$9 = ($8|0)==(0);
if ($9) {
_stbi__err(18432);
$$0 = 0;
return ($$0|0);
}
$10 = (_stbi__get8($0)|0);
$11 = $10&255;
switch ($10<<24>>24) {
case 1: case 3: {
break;
}
default: {
_stbi__err(18440);
$$0 = 0;
return ($$0|0);
}
}
$12 = ((($0)) + 8|0);
HEAP32[$12>>2] = $11;
$13 = $10&255;
$i$022 = 0;
while(1) {
$14 = (((((($z)) + 17820|0) + (($i$022*72)|0)|0)) + 44|0);
HEAP32[$14>>2] = 0;
$15 = (((((($z)) + 17820|0) + (($i$022*72)|0)|0)) + 56|0);
HEAP32[$15>>2] = 0;
$16 = (($i$022) + 1)|0;
$exitcond = ($16|0)==($13|0);
if ($exitcond) {
break;
} else {
$i$022 = $16;
}
}
$17 = HEAP32[$12>>2]|0;
$18 = ($17*3)|0;
$19 = (($18) + 8)|0;
$20 = ($1|0)==($19|0);
if ($20) {
$i$1 = 0;
} else {
_stbi__err(18392);
$$0 = 0;
return ($$0|0);
}
while(1) {
$21 = HEAP32[$12>>2]|0;
$22 = ($i$1|0)<($21|0);
if (!($22)) {
$$lcssa = $21;
label = 24;
break;
}
$23 = (_stbi__get8($0)|0);
$24 = $23&255;
$25 = (((($z)) + 17820|0) + (($i$1*72)|0)|0);
HEAP32[$25>>2] = $24;
$26 = (($i$1) + 1)|0;
$27 = ($24|0)==($26|0);
$28 = ($24|0)==($i$1|0);
$or$cond = $27 | $28;
if (!($or$cond)) {
label = 17;
break;
}
$29 = (_stbi__get8($0)|0);
$30 = $29&255;
$31 = $30 >>> 4;
$32 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 4|0);
HEAP32[$32>>2] = $31;
$33 = ($31|0)==(0);
$34 = ($29&255)>(79);
$or$cond2 = $34 | $33;
if ($or$cond2) {
label = 19;
break;
}
$35 = $30 & 15;
$36 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 8|0);
HEAP32[$36>>2] = $35;
$37 = (($35) + -1)|0;
$38 = ($37>>>0)>(3);
if ($38) {
label = 21;
break;
}
$39 = (_stbi__get8($0)|0);
$40 = $39&255;
$41 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 12|0);
HEAP32[$41>>2] = $40;
$42 = ($39&255)>(3);
if ($42) {
label = 23;
break;
} else {
$i$1 = $26;
}
}
if ((label|0) == 17) {
_stbi__err(18460);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 19) {
_stbi__err(18477);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 21) {
_stbi__err(18483);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 23) {
_stbi__err(18489);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 24) {
$43 = ($scan|0)==(0);
if (!($43)) {
$$0 = 1;
return ($$0|0);
}
$44 = HEAP32[$0>>2]|0;
$45 = (1073741824 / ($44>>>0))&-1;
$46 = (($45>>>0) / ($$lcssa>>>0))&-1;
$47 = HEAP32[$6>>2]|0;
$48 = ($46>>>0)<($47>>>0);
if ($48) {
_stbi__err(17846);
$$0 = 0;
return ($$0|0);
}
$49 = HEAP32[$12>>2]|0;
$50 = ($49|0)>(0);
if ($50) {
$51 = HEAP32[$12>>2]|0;
$h_max$017 = 1;$i$216 = 0;$v_max$018 = 1;
while(1) {
$52 = (((((($z)) + 17820|0) + (($i$216*72)|0)|0)) + 4|0);
$53 = HEAP32[$52>>2]|0;
$54 = ($53|0)>($h_max$017|0);
$$h_max$0 = $54 ? $53 : $h_max$017;
$55 = (((((($z)) + 17820|0) + (($i$216*72)|0)|0)) + 8|0);
$56 = HEAP32[$55>>2]|0;
$57 = ($56|0)>($v_max$018|0);
$v_max$1 = $57 ? $56 : $v_max$018;
$58 = (($i$216) + 1)|0;
$59 = ($58|0)<($51|0);
if ($59) {
$h_max$017 = $$h_max$0;$i$216 = $58;$v_max$018 = $v_max$1;
} else {
$h_max$0$lcssa = $$h_max$0;$v_max$0$lcssa = $v_max$1;
break;
}
}
} else {
$h_max$0$lcssa = 1;$v_max$0$lcssa = 1;
}
$60 = ((($z)) + 17796|0);
HEAP32[$60>>2] = $h_max$0$lcssa;
$61 = ((($z)) + 17800|0);
HEAP32[$61>>2] = $v_max$0$lcssa;
$62 = $h_max$0$lcssa << 3;
$63 = ((($z)) + 17812|0);
HEAP32[$63>>2] = $62;
$64 = $v_max$0$lcssa << 3;
$65 = ((($z)) + 17816|0);
HEAP32[$65>>2] = $64;
$66 = HEAP32[$0>>2]|0;
$67 = HEAP32[$63>>2]|0;
$68 = (($66) + -1)|0;
$69 = (($68) + ($67))|0;
$70 = (($69>>>0) / ($67>>>0))&-1;
$71 = ((($z)) + 17804|0);
HEAP32[$71>>2] = $70;
$72 = HEAP32[$6>>2]|0;
$73 = HEAP32[$65>>2]|0;
$74 = (($72) + -1)|0;
$75 = (($74) + ($73))|0;
$76 = (($75>>>0) / ($73>>>0))&-1;
$77 = ((($z)) + 17808|0);
HEAP32[$77>>2] = $76;
$78 = HEAP32[$12>>2]|0;
$79 = ($78|0)>(0);
if (!($79)) {
$$0 = 1;
return ($$0|0);
}
$80 = (($h_max$0$lcssa) + -1)|0;
$81 = (($v_max$0$lcssa) + -1)|0;
$82 = ((($z)) + 18124|0);
$i$313 = 0;
while(1) {
$83 = HEAP32[$0>>2]|0;
$84 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 4|0);
$85 = HEAP32[$84>>2]|0;
$86 = Math_imul($85, $83)|0;
$87 = (($80) + ($86))|0;
$88 = (($87>>>0) / ($h_max$0$lcssa>>>0))&-1;
$89 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 28|0);
HEAP32[$89>>2] = $88;
$90 = HEAP32[$6>>2]|0;
$91 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 8|0);
$92 = HEAP32[$91>>2]|0;
$93 = Math_imul($92, $90)|0;
$94 = (($81) + ($93))|0;
$95 = (($94>>>0) / ($v_max$0$lcssa>>>0))&-1;
$96 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 32|0);
HEAP32[$96>>2] = $95;
$97 = HEAP32[$71>>2]|0;
$98 = HEAP32[$84>>2]|0;
$99 = $97 << 3;
$100 = Math_imul($99, $98)|0;
$101 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 36|0);
HEAP32[$101>>2] = $100;
$102 = HEAP32[$77>>2]|0;
$103 = HEAP32[$91>>2]|0;
$104 = $102 << 3;
$105 = Math_imul($104, $103)|0;
$106 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 40|0);
HEAP32[$106>>2] = $105;
$107 = HEAP32[$101>>2]|0;
$108 = Math_imul($105, $107)|0;
$109 = (($108) + 15)|0;
$110 = (_stbi__malloc($109)|0);
$111 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 48|0);
HEAP32[$111>>2] = $110;
$112 = ($110|0)==(0|0);
if ($112) {
$i$313$lcssa = $i$313;
break;
}
$117 = $110;
$118 = (($117) + 15)|0;
$119 = $118 & -16;
$120 = $119;
$121 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 44|0);
HEAP32[$121>>2] = $120;
$122 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 56|0);
HEAP32[$122>>2] = 0;
$123 = HEAP32[$82>>2]|0;
$124 = ($123|0)==(0);
if ($124) {
$144 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 60|0);
HEAP32[$144>>2] = 0;
$145 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 52|0);
HEAP32[$145>>2] = 0;
} else {
$125 = HEAP32[$101>>2]|0;
$126 = (($125) + 7)|0;
$127 = $126 >> 3;
$128 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 64|0);
HEAP32[$128>>2] = $127;
$129 = HEAP32[$106>>2]|0;
$130 = (($129) + 7)|0;
$131 = $130 >> 3;
$132 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 68|0);
HEAP32[$132>>2] = $131;
$133 = HEAP32[$128>>2]|0;
$134 = $133 << 7;
$135 = Math_imul($134, $131)|0;
$136 = $135 | 15;
$137 = (_malloc($136)|0);
$138 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 52|0);
HEAP32[$138>>2] = $137;
$139 = $137;
$140 = (($139) + 15)|0;
$141 = $140 & -16;
$142 = $141;
$143 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 60|0);
HEAP32[$143>>2] = $142;
}
$146 = (($i$313) + 1)|0;
$147 = HEAP32[$12>>2]|0;
$148 = ($146|0)<($147|0);
if ($148) {
$i$313 = $146;
} else {
$$0 = 1;
label = 40;
break;
}
}
if ((label|0) == 40) {
return ($$0|0);
}
$113 = ($i$313$lcssa|0)>(0);
if ($113) {
$i$412$in = $i$313$lcssa;
while(1) {
$i$412 = (($i$412$in) + -1)|0;
$114 = (((((($z)) + 17820|0) + (($i$412*72)|0)|0)) + 48|0);
$115 = HEAP32[$114>>2]|0;
_free($115);
HEAP32[$114>>2] = 0;
$116 = ($i$412$in|0)>(1);
if ($116) {
$i$412$in = $i$412;
} else {
break;
}
}
}
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
return (0)|0;
}
function _stbi__build_huffman($h,$count) {
$h = $h|0;
$count = $count|0;
var $$0 = 0, $$lcssa37 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $code$014 = 0, $code$1$lcssa = 0, $code$110 = 0, $code$2 = 0, $exitcond = 0;
var $exitcond26 = 0, $i$022 = 0, $i$17 = 0, $j$017 = 0, $j$115 = 0, $k$021 = 0, $k$1$lcssa = 0, $k$1$lcssa$lcssa = 0, $k$116 = 0, $k$213 = 0, $k$3$lcssa = 0, $k$39 = 0, $k$4 = 0, $k$4$lcssa = 0, $scevgep = 0, $smax = 0, label = 0, sp = 0;
sp = STACKTOP;
$i$022 = 0;$k$021 = 0;
while(1) {
$1 = (($count) + ($i$022<<2)|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(0);
$0 = (($i$022) + 1)|0;
if ($3) {
$4 = $0&255;
$j$017 = 0;$k$116 = $k$021;
while(1) {
$5 = (($k$116) + 1)|0;
$6 = (((($h)) + 1280|0) + ($k$116)|0);
HEAP8[$6>>0] = $4;
$7 = (($j$017) + 1)|0;
$8 = HEAP32[$1>>2]|0;
$9 = ($7|0)<($8|0);
if ($9) {
$j$017 = $7;$k$116 = $5;
} else {
$k$1$lcssa = $5;
break;
}
}
} else {
$k$1$lcssa = $k$021;
}
$exitcond26 = ($0|0)==(16);
if ($exitcond26) {
$k$1$lcssa$lcssa = $k$1$lcssa;
break;
} else {
$i$022 = $0;$k$021 = $k$1$lcssa;
}
}
$10 = (((($h)) + 1280|0) + ($k$1$lcssa$lcssa)|0);
HEAP8[$10>>0] = 0;
$code$014 = 0;$j$115 = 1;$k$213 = 0;
while(1) {
$11 = (($k$213) - ($code$014))|0;
$12 = (((($h)) + 1612|0) + ($j$115<<2)|0);
HEAP32[$12>>2] = $11;
$13 = (((($h)) + 1280|0) + ($k$213)|0);
$14 = HEAP8[$13>>0]|0;
$15 = $14&255;
$16 = ($15|0)==($j$115|0);
if ($16) {
$17 = (((($h)) + 1280|0) + ($k$213)|0);
$18 = HEAP8[$17>>0]|0;
$19 = $18&255;
$20 = ($19|0)==($j$115|0);
if ($20) {
$code$110 = $code$014;$k$39 = $k$213;
while(1) {
$21 = (($code$110) + 1)|0;
$22 = $code$110&65535;
$23 = (($k$39) + 1)|0;
$24 = (((($h)) + 512|0) + ($k$39<<1)|0);
HEAP16[$24>>1] = $22;
$25 = (((($h)) + 1280|0) + ($23)|0);
$26 = HEAP8[$25>>0]|0;
$27 = $26&255;
$28 = ($27|0)==($j$115|0);
if ($28) {
$code$110 = $21;$k$39 = $23;
} else {
$code$1$lcssa = $21;$k$3$lcssa = $23;
break;
}
}
} else {
$code$1$lcssa = $code$014;$k$3$lcssa = $k$213;
}
$29 = 1 << $j$115;
$30 = ($code$1$lcssa|0)>($29|0);
if ($30) {
label = 11;
break;
} else {
$code$2 = $code$1$lcssa;$k$4 = $k$3$lcssa;
}
} else {
$code$2 = $code$014;$k$4 = $k$213;
}
$31 = (16 - ($j$115))|0;
$32 = $code$2 << $31;
$33 = (((($h)) + 1540|0) + ($j$115<<2)|0);
HEAP32[$33>>2] = $32;
$34 = $code$2 << 1;
$35 = (($j$115) + 1)|0;
$36 = ($35|0)<(17);
if ($36) {
$code$014 = $34;$j$115 = $35;$k$213 = $k$4;
} else {
$$lcssa37 = $35;$k$4$lcssa = $k$4;
break;
}
}
if ((label|0) == 11) {
_stbi__err(18645);
$$0 = 0;
return ($$0|0);
}
$37 = (((($h)) + 1540|0) + ($$lcssa37<<2)|0);
HEAP32[$37>>2] = -1;
_memset(($h|0),-1,512)|0;
$38 = ($k$4$lcssa|0)>(0);
if ($38) {
$i$17 = 0;
} else {
$$0 = 1;
return ($$0|0);
}
while(1) {
$39 = (((($h)) + 1280|0) + ($i$17)|0);
$40 = HEAP8[$39>>0]|0;
$41 = ($40&255)<(10);
if ($41) {
$42 = $40&255;
$43 = (9 - ($42))|0;
$44 = 1 << $43;
$45 = ($43|0)==(31);
if (!($45)) {
$46 = (((($h)) + 512|0) + ($i$17<<1)|0);
$47 = HEAP16[$46>>1]|0;
$48 = $47&65535;
$49 = $48 << $43;
$50 = $i$17&255;
$scevgep = (($h) + ($49)|0);
$51 = ($44|0)>(1);
$smax = $51 ? $44 : 1;
_memset(($scevgep|0),($50|0),($smax|0))|0;
}
}
$52 = (($i$17) + 1)|0;
$exitcond = ($52|0)==($k$4$lcssa|0);
if ($exitcond) {
$$0 = 1;
break;
} else {
$i$17 = $52;
}
}
return ($$0|0);
}
function _stbi__build_fast_ac($fast_ac,$h) {
$fast_ac = $fast_ac|0;
$h = $h|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$0 = 0, $k$0$off = 0, label = 0, sp = 0;
sp = STACKTOP;
$i$02 = 0;
while(1) {
$0 = (($h) + ($i$02)|0);
$1 = HEAP8[$0>>0]|0;
$2 = (($fast_ac) + ($i$02<<1)|0);
HEAP16[$2>>1] = 0;
$3 = $1&255;
$4 = ($1<<24>>24)==(-1);
if (!($4)) {
$5 = (((($h)) + 1024|0) + ($3)|0);
$6 = HEAP8[$5>>0]|0;
$7 = $6&255;
$8 = $7 & 240;
$9 = $7 & 15;
$10 = (((($h)) + 1280|0) + ($3)|0);
$11 = HEAP8[$10>>0]|0;
$12 = $11&255;
$13 = ($9|0)==(0);
if (!($13)) {
$14 = (($12) + ($9))|0;
$15 = ($14|0)<(10);
if ($15) {
$16 = $i$02 << $12;
$17 = $16 & 511;
$18 = (9 - ($9))|0;
$19 = $17 >>> $18;
$20 = (($9) + -1)|0;
$21 = 1 << $20;
$22 = ($19|0)<($21|0);
if ($22) {
$23 = -1 << $9;
$24 = (($23) + 1)|0;
$25 = (($24) + ($19))|0;
$k$0 = $25;
} else {
$k$0 = $19;
}
$k$0$off = (($k$0) + 128)|0;
$26 = ($k$0$off>>>0)<(256);
if ($26) {
$27 = $k$0 << 8;
$28 = $27 | $8;
$29 = (($28) + ($14))|0;
$30 = $29&65535;
HEAP16[$2>>1] = $30;
}
}
}
}
$31 = (($i$02) + 1)|0;
$exitcond = ($31|0)==(512);
if ($exitcond) {
break;
} else {
$i$02 = $31;
}
}
return;
}
function _stbi__parse_zlib($a,$parse_header) {
$a = $a|0;
$parse_header = $parse_header|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($parse_header|0)==(0);
if (!($0)) {
$1 = (_stbi__parse_zlib_header($a)|0);
$2 = ($1|0)==(0);
if ($2) {
$$0 = 0;
return ($$0|0);
}
}
$3 = ((($a)) + 8|0);
HEAP32[$3>>2] = 0;
$4 = ((($a)) + 12|0);
HEAP32[$4>>2] = 0;
$5 = ((($a)) + 2052|0);
$6 = ((($a)) + 32|0);
L5: while(1) {
$7 = (_stbi__zreceive($a,1)|0);
$8 = (_stbi__zreceive($a,2)|0);
switch ($8|0) {
case 3: {
$$0 = 0;
label = 13;
break L5;
break;
}
case 0: {
$9 = (_stbi__parse_uncomperssed_block($a)|0);
$10 = ($9|0)==(0);
if ($10) {
$$0 = 0;
label = 13;
break L5;
}
break;
}
case 1: {
$11 = HEAP8[(18693)>>0]|0;
$12 = ($11<<24>>24)==(0);
if ($12) {
_stbi__init_zdefaults();
}
$13 = (_stbi__zbuild_huffman($6,18694,288)|0);
$14 = ($13|0)==(0);
if ($14) {
$$0 = 0;
label = 13;
break L5;
}
$15 = (_stbi__zbuild_huffman($5,18662,32)|0);
$16 = ($15|0)==(0);
if ($16) {
$$0 = 0;
label = 13;
break L5;
} else {
label = 11;
}
break;
}
default: {
$17 = (_stbi__compute_huffman_codes($a)|0);
$18 = ($17|0)==(0);
if ($18) {
$$0 = 0;
label = 13;
break L5;
} else {
label = 11;
}
}
}
if ((label|0) == 11) {
label = 0;
$19 = (_stbi__parse_huffman_block($a)|0);
$20 = ($19|0)==(0);
if ($20) {
$$0 = 0;
label = 13;
break;
}
}
$21 = ($7|0)==(0);
if (!($21)) {
$$0 = 1;
label = 13;
break;
}
}
if ((label|0) == 13) {
return ($$0|0);
}
return (0)|0;
}
function _stbi__parse_zlib_header($a) {
$a = $a|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__zget8($a)|0);
$1 = $0&255;
$2 = $1 & 15;
$3 = (_stbi__zget8($a)|0);
$4 = $3&255;
$5 = $1 << 8;
$6 = $5 | $4;
$7 = (($6>>>0) % 31)&-1;
$8 = ($7|0)==(0);
if (!($8)) {
_stbi__err(19316);
$$0 = 0;
return ($$0|0);
}
$9 = $4 & 32;
$10 = ($9|0)==(0);
if (!($10)) {
_stbi__err(19332);
$$0 = 0;
return ($$0|0);
}
$11 = ($2|0)==(8);
if ($11) {
$$0 = 1;
return ($$0|0);
}
_stbi__err(19347);
$$0 = 0;
return ($$0|0);
}
function _stbi__zreceive($z,$n) {
$z = $z|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 8|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<($n|0);
if ($2) {
_stbi__fill_bits($z);
}
$3 = ((($z)) + 12|0);
$4 = HEAP32[$3>>2]|0;
$5 = 1 << $n;
$6 = (($5) + -1)|0;
$7 = $4 & $6;
$8 = $4 >>> $n;
HEAP32[$3>>2] = $8;
$9 = HEAP32[$0>>2]|0;
$10 = (($9) - ($n))|0;
HEAP32[$0>>2] = $10;
return ($7|0);
}
function _stbi__parse_uncomperssed_block($a) {
$a = $a|0;
var $$0 = 0, $$lcssa = 0, $$lcssa17 = 0, $$op = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $$promoted8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $header = 0, $k$0$lcssa = 0, $k$03 = 0, $k$12 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$header = sp;
$0 = ((($a)) + 8|0);
$1 = HEAP32[$0>>2]|0;
$2 = $1 & 7;
$3 = ($2|0)==(0);
if ($3) {
$$ph = $1;
} else {
(_stbi__zreceive($a,$2)|0);
$$pr = HEAP32[$0>>2]|0;
$$ph = $$pr;
}
$4 = ($$ph|0)>(0);
if ($4) {
$5 = ((($a)) + 12|0);
$$promoted = HEAP32[$5>>2]|0;
$$promoted8 = HEAP32[$0>>2]|0;
$6 = ($$promoted8|0)<(8);
$$op = $$promoted8 ^ -1;
$7 = $6 ? $$op : -9;
$8 = (($$promoted8) + ($7))|0;
$9 = (($8) + 8)|0;
$10 = $9 >>> 3;
$11 = $10 << 3;
$12 = (($10) + 1)|0;
$14 = $$promoted;$k$03 = 0;
while(1) {
$13 = $14&255;
$15 = (($k$03) + 1)|0;
$16 = (($header) + ($k$03)|0);
HEAP8[$16>>0] = $13;
$17 = $14 >>> 8;
$exitcond13 = ($15|0)==($12|0);
if ($exitcond13) {
$$lcssa17 = $17;
break;
} else {
$14 = $17;$k$03 = $15;
}
}
$18 = (($$promoted8) + -8)|0;
$19 = (($18) - ($11))|0;
HEAP32[$5>>2] = $$lcssa17;
HEAP32[$0>>2] = $19;
$$lcssa = $19;$k$0$lcssa = $12;
} else {
$$lcssa = $$ph;$k$0$lcssa = 0;
}
$20 = ($$lcssa|0)==(0);
if (!($20)) {
___assert_fail((19238|0),(18129|0),3754,(19255|0));
// unreachable;
}
$21 = ($k$0$lcssa|0)<(4);
if ($21) {
$k$12 = $k$0$lcssa;
while(1) {
$22 = (_stbi__zget8($a)|0);
$23 = (($k$12) + 1)|0;
$24 = (($header) + ($k$12)|0);
HEAP8[$24>>0] = $22;
$exitcond = ($23|0)==(4);
if ($exitcond) {
break;
} else {
$k$12 = $23;
}
}
}
$25 = ((($header)) + 1|0);
$26 = HEAP8[$25>>0]|0;
$27 = $26&255;
$28 = $27 << 8;
$29 = HEAP8[$header>>0]|0;
$30 = $29&255;
$31 = $28 | $30;
$32 = ((($header)) + 3|0);
$33 = HEAP8[$32>>0]|0;
$34 = $33&255;
$35 = $34 << 8;
$36 = ((($header)) + 2|0);
$37 = HEAP8[$36>>0]|0;
$38 = $37&255;
$39 = $35 | $38;
$40 = $31 ^ 65535;
$41 = ($39|0)==($40|0);
if (!($41)) {
_stbi__err(19286);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$42 = HEAP32[$a>>2]|0;
$43 = (($42) + ($31)|0);
$44 = ((($a)) + 4|0);
$45 = HEAP32[$44>>2]|0;
$46 = ($43>>>0)>($45>>>0);
if ($46) {
_stbi__err(19299);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$47 = ((($a)) + 16|0);
$48 = HEAP32[$47>>2]|0;
$49 = (($48) + ($31)|0);
$50 = ((($a)) + 24|0);
$51 = HEAP32[$50>>2]|0;
$52 = ($49>>>0)>($51>>>0);
if ($52) {
$53 = (_stbi__zexpand($a,$48,$31)|0);
$54 = ($53|0)==(0);
if ($54) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
}
$55 = HEAP32[$47>>2]|0;
$56 = HEAP32[$a>>2]|0;
_memcpy(($55|0),($56|0),($31|0))|0;
$57 = HEAP32[$a>>2]|0;
$58 = (($57) + ($31)|0);
HEAP32[$a>>2] = $58;
$59 = HEAP32[$47>>2]|0;
$60 = (($59) + ($31)|0);
HEAP32[$47>>2] = $60;
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
function _stbi__init_zdefaults() {
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
_memset((18694|0),8,144)|0;
dest=(18838); stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
dest=(18950); stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
$0 = (18974);
$1 = $0;
HEAP8[$1>>0]=134744072&255;HEAP8[$1+1>>0]=(134744072>>8)&255;HEAP8[$1+2>>0]=(134744072>>16)&255;HEAP8[$1+3>>0]=134744072>>24;
$2 = (($0) + 4)|0;
$3 = $2;
HEAP8[$3>>0]=134744072&255;HEAP8[$3+1>>0]=(134744072>>8)&255;HEAP8[$3+2>>0]=(134744072>>16)&255;HEAP8[$3+3>>0]=134744072>>24;
dest=18662; stop=dest+32|0; do { HEAP8[dest>>0]=5|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
return;
}
function _stbi__zbuild_huffman($z,$sizelist,$num) {
$z = $z|0;
$sizelist = $sizelist|0;
$num = $num|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $code$06 = 0, $exitcond = 0, $exitcond13 = 0, $i$010 = 0, $i$28 = 0, $i$34 = 0, $j$03 = 0, $k$07 = 0, $next_code = 0, $or$cond = 0, $sizes = 0, dest = 0, label = 0, sp = 0;
var stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 144|0;
$next_code = sp + 72|0;
$sizes = sp;
dest=$sizes; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
_memset(($z|0),0,1024)|0;
$0 = ($num|0)>(0);
if ($0) {
$i$010 = 0;
while(1) {
$1 = (($sizelist) + ($i$010)|0);
$2 = HEAP8[$1>>0]|0;
$3 = $2&255;
$4 = (($sizes) + ($3<<2)|0);
$5 = HEAP32[$4>>2]|0;
$6 = (($5) + 1)|0;
HEAP32[$4>>2] = $6;
$7 = (($i$010) + 1)|0;
$exitcond13 = ($7|0)==($num|0);
if ($exitcond13) {
break;
} else {
$i$010 = $7;
}
}
}
HEAP32[$sizes>>2] = 0;
$11 = ((($sizes)) + 4|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($12|0)>(2);
if (!($13)) {
$8 = ((($sizes)) + 8|0);
$9 = HEAP32[$8>>2]|0;
$10 = ($9|0)>(4);
if (!($10)) {
$66 = ((($sizes)) + 12|0);
$67 = HEAP32[$66>>2]|0;
$68 = ($67|0)>(8);
if (!($68)) {
$69 = ((($sizes)) + 16|0);
$70 = HEAP32[$69>>2]|0;
$71 = ($70|0)>(16);
if (!($71)) {
$72 = ((($sizes)) + 20|0);
$73 = HEAP32[$72>>2]|0;
$74 = ($73|0)>(32);
if (!($74)) {
$75 = ((($sizes)) + 24|0);
$76 = HEAP32[$75>>2]|0;
$77 = ($76|0)>(64);
if (!($77)) {
$78 = ((($sizes)) + 28|0);
$79 = HEAP32[$78>>2]|0;
$80 = ($79|0)>(128);
if (!($80)) {
$81 = ((($sizes)) + 32|0);
$82 = HEAP32[$81>>2]|0;
$83 = ($82|0)>(256);
if (!($83)) {
$84 = ((($sizes)) + 36|0);
$85 = HEAP32[$84>>2]|0;
$86 = ($85|0)>(512);
if (!($86)) {
$87 = ((($sizes)) + 40|0);
$88 = HEAP32[$87>>2]|0;
$89 = ($88|0)>(1024);
if (!($89)) {
$90 = ((($sizes)) + 44|0);
$91 = HEAP32[$90>>2]|0;
$92 = ($91|0)>(2048);
if (!($92)) {
$93 = ((($sizes)) + 48|0);
$94 = HEAP32[$93>>2]|0;
$95 = ($94|0)>(4096);
if (!($95)) {
$96 = ((($sizes)) + 52|0);
$97 = HEAP32[$96>>2]|0;
$98 = ($97|0)>(8192);
if (!($98)) {
$99 = ((($sizes)) + 56|0);
$100 = HEAP32[$99>>2]|0;
$101 = ($100|0)>(16384);
if (!($101)) {
$102 = ((($sizes)) + 60|0);
$103 = HEAP32[$102>>2]|0;
$104 = ($103|0)>(32768);
if (!($104)) {
$code$06 = 0;$i$28 = 1;$k$07 = 0;
while(1) {
$14 = (($next_code) + ($i$28<<2)|0);
HEAP32[$14>>2] = $code$06;
$15 = $code$06&65535;
$16 = (((($z)) + 1024|0) + ($i$28<<1)|0);
HEAP16[$16>>1] = $15;
$17 = $k$07&65535;
$18 = (((($z)) + 1124|0) + ($i$28<<1)|0);
HEAP16[$18>>1] = $17;
$19 = (($sizes) + ($i$28<<2)|0);
$20 = HEAP32[$19>>2]|0;
$21 = (($20) + ($code$06))|0;
$22 = ($20|0)!=(0);
$23 = 1 << $i$28;
$24 = ($21|0)>($23|0);
$or$cond = $22 & $24;
if ($or$cond) {
label = 7;
break;
}
$25 = (16 - ($i$28))|0;
$26 = $21 << $25;
$27 = (((($z)) + 1056|0) + ($i$28<<2)|0);
HEAP32[$27>>2] = $26;
$28 = $21 << 1;
$29 = HEAP32[$19>>2]|0;
$30 = (($29) + ($k$07))|0;
$31 = (($i$28) + 1)|0;
$32 = ($31|0)<(16);
if ($32) {
$code$06 = $28;$i$28 = $31;$k$07 = $30;
} else {
break;
}
}
if ((label|0) == 7) {
_stbi__err(19176);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$33 = ((($z)) + 1120|0);
HEAP32[$33>>2] = 65536;
$34 = ($num|0)>(0);
if ($34) {
$i$34 = 0;
} else {
$$0 = 1;
STACKTOP = sp;return ($$0|0);
}
while(1) {
$35 = (($sizelist) + ($i$34)|0);
$36 = HEAP8[$35>>0]|0;
$37 = $36&255;
$38 = ($36<<24>>24)==(0);
if (!($38)) {
$39 = (($next_code) + ($37<<2)|0);
$40 = HEAP32[$39>>2]|0;
$41 = (((($z)) + 1024|0) + ($37<<1)|0);
$42 = HEAP16[$41>>1]|0;
$43 = $42&65535;
$44 = (($40) - ($43))|0;
$45 = (((($z)) + 1124|0) + ($37<<1)|0);
$46 = HEAP16[$45>>1]|0;
$47 = $46&65535;
$48 = (($44) + ($47))|0;
$49 = $37 << 9;
$50 = $49 | $i$34;
$51 = $50&65535;
$52 = (((($z)) + 1156|0) + ($48)|0);
HEAP8[$52>>0] = $36;
$53 = $i$34&65535;
$54 = (((($z)) + 1444|0) + ($48<<1)|0);
HEAP16[$54>>1] = $53;
$55 = ($36&255)<(10);
do {
if ($55) {
$56 = HEAP32[$39>>2]|0;
$57 = (_stbi__bit_reverse($56,$37)|0);
$58 = ($57|0)<(512);
if (!($58)) {
break;
}
$59 = 1 << $37;
$j$03 = $57;
while(1) {
$60 = (($z) + ($j$03<<1)|0);
HEAP16[$60>>1] = $51;
$61 = (($j$03) + ($59))|0;
$62 = ($61|0)<(512);
if ($62) {
$j$03 = $61;
} else {
break;
}
}
}
} while(0);
$63 = HEAP32[$39>>2]|0;
$64 = (($63) + 1)|0;
HEAP32[$39>>2] = $64;
}
$65 = (($i$34) + 1)|0;
$exitcond = ($65|0)==($num|0);
if ($exitcond) {
$$0 = 1;
break;
} else {
$i$34 = $65;
}
}
STACKTOP = sp;return ($$0|0);
}
}
}
}
}
}
}
}
}
}
}
}
}
}
}
_stbi__err(19228);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
function _stbi__compute_huffman_codes($a) {
$a = $a|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $codelength_sizes = 0, $exitcond = 0, $i$08 = 0, $lencodes = 0, $n$0$be = 0, $n$0$lcssa = 0, $n$06 = 0, $not$ = 0, $z_codelength = 0, dest = 0;
var label = 0, sp = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 2496|0;
$z_codelength = sp;
$lencodes = sp + 2039|0;
$codelength_sizes = sp + 2020|0;
$0 = (_stbi__zreceive($a,5)|0);
$1 = (($0) + 257)|0;
$2 = (_stbi__zreceive($a,5)|0);
$3 = (($2) + 1)|0;
$4 = (_stbi__zreceive($a,4)|0);
$5 = (($4) + 4)|0;
dest=$codelength_sizes; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
$6 = ($5|0)>(0);
if ($6) {
$7 = (($4) + 3)|0;
$i$08 = 0;
while(1) {
$8 = (_stbi__zreceive($a,3)|0);
$9 = $8&255;
$10 = (19157 + ($i$08)|0);
$11 = HEAP8[$10>>0]|0;
$12 = $11&255;
$13 = (($codelength_sizes) + ($12)|0);
HEAP8[$13>>0] = $9;
$14 = (($i$08) + 1)|0;
$exitcond = ($i$08|0)==($7|0);
if ($exitcond) {
break;
} else {
$i$08 = $14;
}
}
}
$15 = (_stbi__zbuild_huffman($z_codelength,$codelength_sizes,19)|0);
$16 = ($15|0)==(0);
if ($16) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$17 = (($3) + ($1))|0;
$18 = ($17|0)>(0);
L9: do {
if ($18) {
$n$06 = 0;
L10: while(1) {
$19 = (_stbi__zhuffman_decode($a,$z_codelength)|0);
$20 = ($19>>>0)>(18);
if ($20) {
break;
}
$21 = ($19|0)<(16);
L13: do {
if ($21) {
$22 = $19&255;
$23 = (($n$06) + 1)|0;
$24 = (($lencodes) + ($n$06)|0);
HEAP8[$24>>0] = $22;
$n$0$be = $23;
} else {
switch ($19|0) {
case 16: {
$25 = (_stbi__zreceive($a,2)|0);
$26 = (($25) + 3)|0;
$27 = (($lencodes) + ($n$06)|0);
$28 = (($n$06) + -1)|0;
$29 = (($lencodes) + ($28)|0);
$30 = HEAP8[$29>>0]|0;
_memset(($27|0),($30|0),($26|0))|0;
$31 = (($26) + ($n$06))|0;
$n$0$be = $31;
break L13;
break;
}
case 17: {
$33 = (_stbi__zreceive($a,3)|0);
$34 = (($33) + 3)|0;
$35 = (($lencodes) + ($n$06)|0);
_memset(($35|0),0,($34|0))|0;
$36 = (($34) + ($n$06))|0;
$n$0$be = $36;
break L13;
break;
}
case 18: {
$37 = (_stbi__zreceive($a,7)|0);
$38 = (($37) + 11)|0;
$39 = (($lencodes) + ($n$06)|0);
_memset(($39|0),0,($38|0))|0;
$40 = (($38) + ($n$06))|0;
$n$0$be = $40;
break L13;
break;
}
default: {
label = 14;
break L10;
}
}
}
} while(0);
$32 = ($n$0$be|0)<($17|0);
if ($32) {
$n$06 = $n$0$be;
} else {
$n$0$lcssa = $n$0$be;
break L9;
}
}
if ((label|0) == 14) {
___assert_fail((19192|0),(18129|0),3729,(19200|0));
// unreachable;
}
_stbi__err(19176);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
} else {
$n$0$lcssa = 0;
}
} while(0);
$41 = ($n$0$lcssa|0)==($17|0);
if (!($41)) {
_stbi__err(19176);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$42 = ((($a)) + 32|0);
$43 = (_stbi__zbuild_huffman($42,$lencodes,$1)|0);
$44 = ($43|0)==(0);
if ($44) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$45 = ((($a)) + 2052|0);
$46 = (($lencodes) + ($1)|0);
$47 = (_stbi__zbuild_huffman($45,$46,$3)|0);
$not$ = ($47|0)!=(0);
$$ = $not$&1;
$$0 = $$;
STACKTOP = sp;return ($$0|0);
}
function _stbi__parse_huffman_block($a) {
$a = $a|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dist$0 = 0;
var $len$0 = 0, $len$2 = 0, $p$0 = 0, $scevgep = 0, $scevgep14 = 0, $zout$0 = 0, $zout$0$lcssa = 0, $zout$1 = 0, $zout$2 = 0, $zout$4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($a)) + 16|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($a)) + 32|0);
$3 = ((($a)) + 24|0);
$4 = ((($a)) + 2052|0);
$5 = ((($a)) + 20|0);
$6 = ((($a)) + 24|0);
$zout$0 = $1;
while(1) {
$9 = (_stbi__zhuffman_decode($a,$2)|0);
$10 = ($9|0)<(256);
if ($10) {
$11 = ($9|0)<(0);
if ($11) {
label = 6;
break;
}
$12 = HEAP32[$3>>2]|0;
$13 = ($zout$0>>>0)<($12>>>0);
if ($13) {
$zout$1 = $zout$0;
} else {
$14 = (_stbi__zexpand($a,$zout$0,1)|0);
$15 = ($14|0)==(0);
if ($15) {
$$0 = 0;
label = 28;
break;
}
$16 = HEAP32[$0>>2]|0;
$zout$1 = $16;
}
$17 = $9&255;
$18 = ((($zout$1)) + 1|0);
HEAP8[$zout$1>>0] = $17;
$zout$0 = $18;
continue;
}
$19 = ($9|0)==(256);
if ($19) {
$zout$0$lcssa = $zout$0;
label = 12;
break;
}
$20 = (($9) + -257)|0;
$21 = (8000 + ($20<<2)|0);
$22 = HEAP32[$21>>2]|0;
$23 = (($9) + -265)|0;
$24 = ($23>>>0)<(20);
if ($24) {
$25 = (8124 + ($20<<2)|0);
$26 = HEAP32[$25>>2]|0;
$27 = (_stbi__zreceive($a,$26)|0);
$28 = (($27) + ($22))|0;
$len$0 = $28;
} else {
$len$0 = $22;
}
$29 = (_stbi__zhuffman_decode($a,$4)|0);
$30 = ($29|0)<(0);
if ($30) {
label = 16;
break;
}
$31 = (8248 + ($29<<2)|0);
$32 = HEAP32[$31>>2]|0;
$33 = (($29) + -4)|0;
$34 = ($33>>>0)<(26);
if ($34) {
$35 = (8376 + ($29<<2)|0);
$36 = HEAP32[$35>>2]|0;
$37 = (_stbi__zreceive($a,$36)|0);
$38 = (($37) + ($32))|0;
$dist$0 = $38;
} else {
$dist$0 = $32;
}
$39 = HEAP32[$5>>2]|0;
$40 = $zout$0;
$41 = $39;
$42 = (($40) - ($41))|0;
$43 = ($42|0)<($dist$0|0);
if ($43) {
label = 20;
break;
}
$44 = (($zout$0) + ($len$0)|0);
$45 = HEAP32[$6>>2]|0;
$46 = ($44>>>0)>($45>>>0);
if ($46) {
$47 = (_stbi__zexpand($a,$zout$0,$len$0)|0);
$48 = ($47|0)==(0);
if ($48) {
$$0 = 0;
label = 28;
break;
}
$49 = HEAP32[$0>>2]|0;
$zout$2 = $49;
} else {
$zout$2 = $zout$0;
}
$50 = (0 - ($dist$0))|0;
$8 = (($zout$2) + ($50)|0);
$51 = ($dist$0|0)==(1);
$52 = ($len$0|0)==(0);
if ($51) {
if ($52) {
$zout$0 = $zout$2;
continue;
}
$7 = HEAP8[$8>>0]|0;
_memset(($zout$2|0),($7|0),($len$0|0))|0;
$scevgep14 = (($zout$2) + ($len$0)|0);
$zout$0 = $scevgep14;
continue;
}
if ($52) {
$zout$0 = $zout$2;
continue;
} else {
$len$2 = $len$0;$p$0 = $8;$zout$4 = $zout$2;
}
while(1) {
$53 = ((($p$0)) + 1|0);
$54 = HEAP8[$p$0>>0]|0;
$55 = ((($zout$4)) + 1|0);
HEAP8[$zout$4>>0] = $54;
$56 = (($len$2) + -1)|0;
$57 = ($56|0)==(0);
if ($57) {
break;
} else {
$len$2 = $56;$p$0 = $53;$zout$4 = $55;
}
}
$scevgep = (($zout$2) + ($len$0)|0);
$zout$0 = $scevgep;
}
if ((label|0) == 6) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 12) {
HEAP32[$0>>2] = $zout$0$lcssa;
$$0 = 1;
return ($$0|0);
}
else if ((label|0) == 16) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 20) {
_stbi__err(18999);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 28) {
return ($$0|0);
}
return (0)|0;
}
function _stbi__zhuffman_decode($a,$z) {
$a = $a|0;
$z = $z|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($a)) + 8|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(16);
if ($2) {
_stbi__fill_bits($a);
}
$3 = ((($a)) + 12|0);
$4 = HEAP32[$3>>2]|0;
$5 = $4 & 511;
$6 = (($z) + ($5<<1)|0);
$7 = HEAP16[$6>>1]|0;
$8 = $7&65535;
$9 = ($7<<16>>16)==(0);
if ($9) {
$15 = (_stbi__zhuffman_decode_slowpath($a,$z)|0);
$$0 = $15;
return ($$0|0);
} else {
$10 = $8 >>> 9;
$11 = $4 >>> $10;
HEAP32[$3>>2] = $11;
$12 = HEAP32[$0>>2]|0;
$13 = (($12) - ($10))|0;
HEAP32[$0>>2] = $13;
$14 = $8 & 511;
$$0 = $14;
return ($$0|0);
}
return (0)|0;
}
function _stbi__zexpand($z,$zout,$n) {
$z = $z|0;
$zout = $zout|0;
$n = $n|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0, $9 = 0, $limit$0 = 0, $limit$0$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 16|0);
HEAP32[$0>>2] = $zout;
$1 = ((($z)) + 28|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)==(0);
if ($3) {
_stbi__err(19008);
$$0 = 0;
return ($$0|0);
}
$4 = ((($z)) + 20|0);
$5 = HEAP32[$4>>2]|0;
$6 = $zout;
$7 = $5;
$8 = (($6) - ($7))|0;
$9 = ((($z)) + 24|0);
$10 = HEAP32[$9>>2]|0;
$11 = $10;
$12 = (($11) - ($7))|0;
$13 = (($8) + ($n))|0;
$limit$0 = $12;
while(1) {
$14 = ($13|0)>($limit$0|0);
$15 = $limit$0 << 1;
if ($14) {
$limit$0 = $15;
} else {
$limit$0$lcssa = $limit$0;
break;
}
}
$16 = HEAP32[$4>>2]|0;
$17 = (_realloc($16,$limit$0$lcssa)|0);
$18 = ($17|0)==(0|0);
if ($18) {
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
} else {
HEAP32[$4>>2] = $17;
$19 = (($17) + ($8)|0);
HEAP32[$0>>2] = $19;
$20 = (($17) + ($limit$0$lcssa)|0);
HEAP32[$9>>2] = $20;
$$0 = 1;
return ($$0|0);
}
return (0)|0;
}
function _stbi__fill_bits($z) {
$z = $z|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 12|0);
$1 = ((($z)) + 8|0);
while(1) {
$2 = HEAP32[$0>>2]|0;
$3 = HEAP32[$1>>2]|0;
$4 = 1 << $3;
$5 = ($2>>>0)<($4>>>0);
if (!($5)) {
label = 3;
break;
}
$6 = (_stbi__zget8($z)|0);
$7 = $6&255;
$8 = HEAP32[$1>>2]|0;
$9 = $7 << $8;
$10 = HEAP32[$0>>2]|0;
$11 = $10 | $9;
HEAP32[$0>>2] = $11;
$12 = HEAP32[$1>>2]|0;
$13 = (($12) + 8)|0;
HEAP32[$1>>2] = $13;
$14 = ($13|0)<(25);
if (!($14)) {
label = 5;
break;
}
}
if ((label|0) == 3) {
___assert_fail((19104|0),(18129|0),3573,(19141|0));
// unreachable;
}
else if ((label|0) == 5) {
return;
}
}
function _stbi__zhuffman_decode_slowpath($a,$z) {
$a = $a|0;
$z = $z|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $s$0 = 0, $s$0$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($a)) + 12|0);
$1 = HEAP32[$0>>2]|0;
$2 = (_stbi__bit_reverse($1,16)|0);
$s$0 = 10;
while(1) {
$3 = (((($z)) + 1056|0) + ($s$0<<2)|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($2|0)<($4|0);
$6 = (($s$0) + 1)|0;
if ($5) {
$s$0$lcssa = $s$0;
break;
} else {
$s$0 = $6;
}
}
$7 = ($s$0$lcssa|0)==(16);
if ($7) {
$$0 = -1;
return ($$0|0);
}
$8 = (16 - ($s$0$lcssa))|0;
$9 = $2 >> $8;
$10 = (((($z)) + 1024|0) + ($s$0$lcssa<<1)|0);
$11 = HEAP16[$10>>1]|0;
$12 = $11&65535;
$13 = (($9) - ($12))|0;
$14 = (((($z)) + 1124|0) + ($s$0$lcssa<<1)|0);
$15 = HEAP16[$14>>1]|0;
$16 = $15&65535;
$17 = (($13) + ($16))|0;
$18 = (((($z)) + 1156|0) + ($17)|0);
$19 = HEAP8[$18>>0]|0;
$20 = $19&255;
$21 = ($20|0)==($s$0$lcssa|0);
if (!($21)) {
___assert_fail((19028|0),(18129|0),3601,(19044|0));
// unreachable;
}
$22 = HEAP32[$0>>2]|0;
$23 = $22 >>> $s$0$lcssa;
HEAP32[$0>>2] = $23;
$24 = ((($a)) + 8|0);
$25 = HEAP32[$24>>2]|0;
$26 = (($25) - ($s$0$lcssa))|0;
HEAP32[$24>>2] = $26;
$27 = (((($z)) + 1444|0) + ($17<<1)|0);
$28 = HEAP16[$27>>1]|0;
$29 = $28&65535;
$$0 = $29;
return ($$0|0);
}
function _stbi__bit_reverse($v,$bits) {
$v = $v|0;
$bits = $bits|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($bits|0)<(17);
if ($0) {
$1 = (_stbi__bitreverse16($v)|0);
$2 = (16 - ($bits))|0;
$3 = $1 >> $2;
return ($3|0);
} else {
___assert_fail((19075|0),(18129|0),3491,(19086|0));
// unreachable;
}
return (0)|0;
}
function _stbi__bitreverse16($n) {
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = $n >>> 1;
$1 = $0 & 21845;
$2 = $n << 1;
$3 = $2 & 43690;
$4 = $1 | $3;
$5 = $4 >>> 2;
$6 = $5 & 13107;
$7 = $4 << 2;
$8 = $7 & 52428;
$9 = $6 | $8;
$10 = $9 >>> 4;
$11 = $10 & 3855;
$12 = $9 << 4;
$13 = $12 & 61680;
$14 = $11 | $13;
$15 = $14 >>> 8;
$16 = $14 << 8;
$17 = $16 & 65280;
$18 = $17 | $15;
return ($18|0);
}
function _stbi__zget8($z) {
$z = $z|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$z>>2]|0;
$1 = ((($z)) + 4|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($0>>>0)<($2>>>0);
if (!($3)) {
$$0 = 0;
return ($$0|0);
}
$4 = ((($0)) + 1|0);
HEAP32[$z>>2] = $4;
$5 = HEAP8[$0>>0]|0;
$$0 = $5;
return ($$0|0);
}
function _stbi__load_main($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__jpeg_test($s)|0);
$1 = ($0|0)==(0);
if (!($1)) {
$2 = (_stbi__jpeg_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $2;
return ($$0|0);
}
$3 = (_stbi__png_test($s)|0);
$4 = ($3|0)==(0);
if (!($4)) {
$5 = (_stbi__png_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $5;
return ($$0|0);
}
$6 = (_stbi__bmp_test($s)|0);
$7 = ($6|0)==(0);
if (!($7)) {
$8 = (_stbi__bmp_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $8;
return ($$0|0);
}
$9 = (_stbi__gif_test($s)|0);
$10 = ($9|0)==(0);
if (!($10)) {
$11 = (_stbi__gif_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $11;
return ($$0|0);
}
$12 = (_stbi__psd_test($s)|0);
$13 = ($12|0)==(0);
if (!($13)) {
$14 = (_stbi__psd_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $14;
return ($$0|0);
}
$15 = (_stbi__pic_test($s)|0);
$16 = ($15|0)==(0);
if (!($16)) {
$17 = (_stbi__pic_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $17;
return ($$0|0);
}
$18 = (_stbi__pnm_test($s)|0);
$19 = ($18|0)==(0);
if (!($19)) {
$20 = (_stbi__pnm_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $20;
return ($$0|0);
}
$21 = (_stbi__tga_test($s)|0);
$22 = ($21|0)==(0);
if ($22) {
_stbi__err(17723);
$$0 = 0;
return ($$0|0);
} else {
$23 = (_stbi__tga_load($s,$x,$y,$comp,$req_comp)|0);
$$0 = $23;
return ($$0|0);
}
return (0)|0;
}
function _stbi__jpeg_test($s) {
$s = $s|0;
var $0 = 0, $j = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 18192|0;
$j = sp;
HEAP32[$j>>2] = $s;
_stbi__setup_jpeg($j);
$0 = (_stbi__decode_jpeg_header($j,1)|0);
_stbi__rewind($s);
STACKTOP = sp;return ($0|0);
}
function _stbi__jpeg_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $0 = 0, $j = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 18192|0;
$j = sp;
HEAP32[$j>>2] = $s;
_stbi__setup_jpeg($j);
$0 = (_load_jpeg_image($j,$x,$y,$comp,$req_comp)|0);
STACKTOP = sp;return ($0|0);
}
function _stbi__png_test($s) {
$s = $s|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__check_png_header($s)|0);
_stbi__rewind($s);
return ($0|0);
}
function _stbi__png_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $0 = 0, $p = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$p = sp;
HEAP32[$p>>2] = $s;
$0 = (_stbi__do_png($p,$x,$y,$comp,$req_comp)|0);
STACKTOP = sp;return ($0|0);
}
function _stbi__bmp_test($s) {
$s = $s|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__bmp_test_raw($s)|0);
_stbi__rewind($s);
return ($0|0);
}
function _stbi__bmp_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$0 = 0, $$pr = 0, $$sum = 0, $$sum16 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0;
var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0;
var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0;
var $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0;
var $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $acount$0 = 0, $all_a$064 = 0, $all_a$158 = 0, $all_a$251 = 0, $all_a$3 = 0, $all_a$4 = 0, $ashift$0 = 0, $bcount$0 = 0, $bshift$0 = 0, $easy$017 = 0, $exitcond = 0, $gcount$0 = 0, $gshift$0 = 0, $i$046 = 0;
var $i$138 = 0, $i$256 = 0, $i$349 = 0, $i$435 = 0, $i$532 = 0, $info = 0, $ispos = 0, $j$044 = 0, $j$162 = 0, $j$233 = 0, $neg = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $out$0 = 0;
var $pal = 0, $psize$0 = 0, $rcount$0 = 0, $req_comp$ = 0, $rshift$0 = 0, $v$0 = 0, $v2$0 = 0, $width$0 = 0, $width$1 = 0, $width$1$ph = 0, $z$045 = 0, $z$139 = 0, $z$2 = 0, $z$3 = 0, $z$4 = 0, $z1$063 = 0, $z1$157 = 0, $z1$2 = 0, $z1$350 = 0, $z1$4 = 0;
var $z1$5 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 1056|0;
$pal = sp + 32|0;
$info = sp;
$0 = ((($info)) + 28|0);
HEAP32[$0>>2] = 255;
$1 = (_stbi__bmp_parse_header($s,$info)|0);
$2 = ($1|0)==(0|0);
if ($2) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$3 = ((($s)) + 4|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)>(0);
$ispos = ($4|0)>(-1);
$neg = (0 - ($4))|0;
$6 = $ispos ? $4 : $neg;
HEAP32[$3>>2] = $6;
$7 = ((($info)) + 12|0);
$8 = HEAP32[$7>>2]|0;
$9 = ((($info)) + 16|0);
$10 = HEAP32[$9>>2]|0;
$11 = ((($info)) + 20|0);
$12 = HEAP32[$11>>2]|0;
$13 = ((($info)) + 24|0);
$14 = HEAP32[$13>>2]|0;
$15 = HEAP32[$0>>2]|0;
$16 = ((($info)) + 8|0);
$17 = HEAP32[$16>>2]|0;
$18 = ($17|0)==(12);
$19 = HEAP32[$info>>2]|0;
if ($18) {
$20 = ($19|0)<(24);
if ($20) {
$21 = ((($info)) + 4|0);
$22 = HEAP32[$21>>2]|0;
$23 = (($22) + -38)|0;
$24 = (($23|0) / 3)&-1;
$psize$0 = $24;
} else {
$psize$0 = 0;
}
} else {
$25 = ($19|0)<(16);
if ($25) {
$26 = ((($info)) + 4|0);
$27 = HEAP32[$26>>2]|0;
$28 = (-14 - ($17))|0;
$29 = (($28) + ($27))|0;
$30 = $29 >> 2;
$psize$0 = $30;
} else {
$psize$0 = 0;
}
}
$31 = ($14|0)!=(0);
$32 = $31 ? 4 : 3;
$33 = ((($s)) + 8|0);
HEAP32[$33>>2] = $32;
$34 = ($req_comp|0)==(0);
$35 = ($req_comp|0)>(2);
$req_comp$ = $35 ? $req_comp : $32;
$36 = HEAP32[$s>>2]|0;
$37 = Math_imul($36, $req_comp$)|0;
$38 = HEAP32[$3>>2]|0;
$39 = Math_imul($37, $38)|0;
$40 = (_stbi__malloc($39)|0);
$41 = ($40|0)==(0|0);
if ($41) {
_stbi__err(18059);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$42 = HEAP32[$info>>2]|0;
$43 = ($42|0)<(16);
if ($43) {
$44 = ($psize$0|0)==(0);
$45 = ($psize$0|0)>(256);
$or$cond3 = $44 | $45;
if ($or$cond3) {
_free($40);
_stbi__err(19679);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$46 = ($psize$0|0)>(0);
if ($46) {
$47 = HEAP32[$16>>2]|0;
$48 = ($47|0)==(12);
$i$046 = 0;
while(1) {
$49 = (_stbi__get8($s)|0);
$50 = (((($pal) + ($i$046<<2)|0)) + 2|0);
HEAP8[$50>>0] = $49;
$51 = (_stbi__get8($s)|0);
$52 = (((($pal) + ($i$046<<2)|0)) + 1|0);
HEAP8[$52>>0] = $51;
$53 = (_stbi__get8($s)|0);
$54 = (($pal) + ($i$046<<2)|0);
HEAP8[$54>>0] = $53;
if (!($48)) {
(_stbi__get8($s)|0);
}
$55 = (((($pal) + ($i$046<<2)|0)) + 3|0);
HEAP8[$55>>0] = -1;
$56 = (($i$046) + 1)|0;
$exitcond = ($56|0)==($psize$0|0);
if ($exitcond) {
break;
} else {
$i$046 = $56;
}
}
}
$57 = ((($info)) + 4|0);
$58 = HEAP32[$57>>2]|0;
$59 = (($58) + -14)|0;
$60 = HEAP32[$16>>2]|0;
$61 = (($59) - ($60))|0;
$62 = ($60|0)==(12);
$63 = $62 ? 3 : 4;
$64 = Math_imul($63, $psize$0)|0;
$65 = (($61) - ($64))|0;
_stbi__skip($s,$65);
$66 = HEAP32[$info>>2]|0;
switch ($66|0) {
case 4: {
$67 = HEAP32[$s>>2]|0;
$68 = (($67) + 1)|0;
$69 = $68 >>> 1;
$width$0 = $69;
break;
}
case 8: {
$70 = HEAP32[$s>>2]|0;
$width$0 = $70;
break;
}
default: {
_free($40);
_stbi__err(19687);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
}
$71 = (0 - ($width$0))|0;
$72 = $71 & 3;
$73 = HEAP32[$3>>2]|0;
$74 = ($73|0)>(0);
if ($74) {
$75 = HEAP32[$info>>2]|0;
$76 = ($75|0)==(4);
$77 = ($req_comp$|0)==(4);
$78 = ($75|0)==(8);
$j$044 = 0;$z$045 = 0;
while(1) {
$79 = HEAP32[$s>>2]|0;
$80 = ($79|0)>(0);
L37: do {
if ($80) {
$i$138 = 0;$z$139 = $z$045;
while(1) {
$81 = (_stbi__get8($s)|0);
$82 = $81&255;
$83 = $82 & 15;
$84 = $82 >>> 4;
$v$0 = $76 ? $84 : $82;
$v2$0 = $76 ? $83 : 0;
$85 = (($pal) + ($v$0<<2)|0);
$86 = HEAP8[$85>>0]|0;
$87 = (($z$139) + 1)|0;
$88 = (($40) + ($z$139)|0);
HEAP8[$88>>0] = $86;
$89 = (((($pal) + ($v$0<<2)|0)) + 1|0);
$90 = HEAP8[$89>>0]|0;
$91 = (($z$139) + 2)|0;
$92 = (($40) + ($87)|0);
HEAP8[$92>>0] = $90;
$93 = (((($pal) + ($v$0<<2)|0)) + 2|0);
$94 = HEAP8[$93>>0]|0;
$95 = (($z$139) + 3)|0;
$96 = (($40) + ($91)|0);
HEAP8[$96>>0] = $94;
if ($77) {
$97 = (($z$139) + 4)|0;
$98 = (($40) + ($95)|0);
HEAP8[$98>>0] = -1;
$z$2 = $97;
} else {
$z$2 = $95;
}
$99 = $i$138 | 1;
$100 = HEAP32[$s>>2]|0;
$101 = ($99|0)==($100|0);
if ($101) {
$z$4 = $z$2;
break L37;
}
if ($78) {
$102 = (_stbi__get8($s)|0);
$103 = $102&255;
$105 = $103;
} else {
$105 = $v2$0;
}
$104 = (($pal) + ($105<<2)|0);
$106 = HEAP8[$104>>0]|0;
$107 = (($z$2) + 1)|0;
$108 = (($40) + ($z$2)|0);
HEAP8[$108>>0] = $106;
$109 = (((($pal) + ($105<<2)|0)) + 1|0);
$110 = HEAP8[$109>>0]|0;
$111 = (($z$2) + 2)|0;
$112 = (($40) + ($107)|0);
HEAP8[$112>>0] = $110;
$113 = (((($pal) + ($105<<2)|0)) + 2|0);
$114 = HEAP8[$113>>0]|0;
$115 = (($z$2) + 3)|0;
$116 = (($40) + ($111)|0);
HEAP8[$116>>0] = $114;
if ($77) {
$117 = (($z$2) + 4)|0;
$118 = (($40) + ($115)|0);
HEAP8[$118>>0] = -1;
$z$3 = $117;
} else {
$z$3 = $115;
}
$119 = (($i$138) + 2)|0;
$120 = HEAP32[$s>>2]|0;
$121 = ($119|0)<($120|0);
if ($121) {
$i$138 = $119;$z$139 = $z$3;
} else {
$z$4 = $z$3;
break;
}
}
} else {
$z$4 = $z$045;
}
} while(0);
_stbi__skip($s,$72);
$122 = (($j$044) + 1)|0;
$123 = HEAP32[$3>>2]|0;
$124 = ($122|0)<($123|0);
if ($124) {
$j$044 = $122;$z$045 = $z$4;
} else {
$all_a$4 = $15;
break;
}
}
} else {
$all_a$4 = $15;
}
} else {
$125 = ((($info)) + 4|0);
$126 = HEAP32[$125>>2]|0;
$127 = (($126) + -14)|0;
$128 = HEAP32[$16>>2]|0;
$129 = (($127) - ($128))|0;
_stbi__skip($s,$129);
$130 = HEAP32[$info>>2]|0;
switch ($130|0) {
case 24: {
$131 = HEAP32[$s>>2]|0;
$132 = ($131*3)|0;
$width$1$ph = $132;
label = 36;
break;
}
case 16: {
$133 = HEAP32[$s>>2]|0;
$134 = $133 << 1;
$width$1$ph = $134;
label = 36;
break;
}
default: {
$137 = $130;$width$1 = 0;
}
}
if ((label|0) == 36) {
$$pr = HEAP32[$info>>2]|0;
$137 = $$pr;$width$1 = $width$1$ph;
}
$135 = (0 - ($width$1))|0;
$136 = $135 & 3;
switch ($137|0) {
case 24: {
$261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 1;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0;
break;
}
case 32: {
$138 = ($12|0)==(255);
$139 = ($10|0)==(65280);
$or$cond5 = $139 & $138;
$140 = ($8|0)==(16711680);
$or$cond7 = $140 & $or$cond5;
$141 = ($14|0)==(-16777216);
$or$cond9 = $141 & $or$cond7;
if ($or$cond9) {
$261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 2;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0;
} else {
label = 39;
}
break;
}
default: {
label = 39;
}
}
do {
if ((label|0) == 39) {
$142 = ($8|0)!=(0);
$143 = ($10|0)!=(0);
$or$cond11 = $142 & $143;
$144 = ($12|0)!=(0);
$or$cond13 = $or$cond11 & $144;
if ($or$cond13) {
$145 = (_stbi__high_bit($8)|0);
$146 = (($145) + -7)|0;
$147 = (_stbi__bitcount($8)|0);
$148 = (_stbi__high_bit($10)|0);
$149 = (($148) + -7)|0;
$150 = (_stbi__bitcount($10)|0);
$151 = (_stbi__high_bit($12)|0);
$152 = (($151) + -7)|0;
$153 = (_stbi__bitcount($12)|0);
$154 = (_stbi__high_bit($14)|0);
$155 = (($154) + -7)|0;
$156 = (_stbi__bitcount($14)|0);
$261 = 0;$acount$0 = $156;$ashift$0 = $155;$bcount$0 = $153;$bshift$0 = $152;$easy$017 = 0;$gcount$0 = $150;$gshift$0 = $149;$rcount$0 = $147;$rshift$0 = $146;
break;
}
_free($40);
_stbi__err(19695);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
} while(0);
$157 = HEAP32[$3>>2]|0;
$158 = ($157|0)>(0);
if ($158) {
$159 = HEAP32[$info>>2]|0;
$160 = ($159|0)==(16);
$161 = ($req_comp$|0)==(4);
$162 = ($easy$017|0)==(2);
$163 = ($req_comp$|0)==(4);
$all_a$064 = $15;$j$162 = 0;$z1$063 = 0;
while(1) {
$164 = HEAP32[$s>>2]|0;
$165 = ($164|0)>(0);
if ($261) {
if ($165) {
$all_a$158 = $all_a$064;$i$256 = 0;$z1$157 = $z1$063;
while(1) {
$166 = (_stbi__get8($s)|0);
$167 = (($z1$157) + 2)|0;
$168 = (($40) + ($167)|0);
HEAP8[$168>>0] = $166;
$169 = (_stbi__get8($s)|0);
$170 = (($z1$157) + 1)|0;
$171 = (($40) + ($170)|0);
HEAP8[$171>>0] = $169;
$172 = (_stbi__get8($s)|0);
$173 = (($40) + ($z1$157)|0);
HEAP8[$173>>0] = $172;
$174 = (($z1$157) + 3)|0;
if ($162) {
$175 = (_stbi__get8($s)|0);
$176 = $175&255;
$178 = $176;
} else {
$178 = 255;
}
$177 = $178 | $all_a$158;
if ($163) {
$179 = $178&255;
$180 = (($z1$157) + 4)|0;
$181 = (($40) + ($174)|0);
HEAP8[$181>>0] = $179;
$z1$2 = $180;
} else {
$z1$2 = $174;
}
$182 = (($i$256) + 1)|0;
$183 = HEAP32[$s>>2]|0;
$184 = ($182|0)<($183|0);
if ($184) {
$all_a$158 = $177;$i$256 = $182;$z1$157 = $z1$2;
} else {
$all_a$3 = $177;$z1$5 = $z1$2;
break;
}
}
} else {
$all_a$3 = $all_a$064;$z1$5 = $z1$063;
}
} else {
if ($165) {
$all_a$251 = $all_a$064;$i$349 = 0;$z1$350 = $z1$063;
while(1) {
if ($160) {
$185 = (_stbi__get16le($s)|0);
$188 = $185;
} else {
$186 = (_stbi__get32le($s)|0);
$188 = $186;
}
$187 = $188 & $8;
$189 = (_stbi__shiftsigned($187,$rshift$0,$rcount$0)|0);
$190 = $189&255;
$191 = (($z1$350) + 1)|0;
$192 = (($40) + ($z1$350)|0);
HEAP8[$192>>0] = $190;
$193 = $188 & $10;
$194 = (_stbi__shiftsigned($193,$gshift$0,$gcount$0)|0);
$195 = $194&255;
$196 = (($z1$350) + 2)|0;
$197 = (($40) + ($191)|0);
HEAP8[$197>>0] = $195;
$198 = $188 & $12;
$199 = (_stbi__shiftsigned($198,$bshift$0,$bcount$0)|0);
$200 = $199&255;
$201 = (($z1$350) + 3)|0;
$202 = (($40) + ($196)|0);
HEAP8[$202>>0] = $200;
if ($31) {
$203 = $188 & $14;
$204 = (_stbi__shiftsigned($203,$ashift$0,$acount$0)|0);
$206 = $204;
} else {
$206 = 255;
}
$205 = $206 | $all_a$251;
if ($161) {
$207 = $206&255;
$208 = (($z1$350) + 4)|0;
$209 = (($40) + ($201)|0);
HEAP8[$209>>0] = $207;
$z1$4 = $208;
} else {
$z1$4 = $201;
}
$210 = (($i$349) + 1)|0;
$211 = HEAP32[$s>>2]|0;
$212 = ($210|0)<($211|0);
if ($212) {
$all_a$251 = $205;$i$349 = $210;$z1$350 = $z1$4;
} else {
$all_a$3 = $205;$z1$5 = $z1$4;
break;
}
}
} else {
$all_a$3 = $all_a$064;$z1$5 = $z1$063;
}
}
_stbi__skip($s,$136);
$213 = (($j$162) + 1)|0;
$214 = HEAP32[$3>>2]|0;
$215 = ($213|0)<($214|0);
if ($215) {
$all_a$064 = $all_a$3;$j$162 = $213;$z1$063 = $z1$5;
} else {
$all_a$4 = $all_a$3;
break;
}
}
} else {
$all_a$4 = $15;
}
}
$216 = ($req_comp$|0)==(4);
$217 = ($all_a$4|0)==(0);
$or$cond15 = $216 & $217;
if ($or$cond15) {
$218 = HEAP32[$s>>2]|0;
$219 = $218 << 2;
$220 = HEAP32[$3>>2]|0;
$221 = Math_imul($219, $220)|0;
$222 = (($221) + -1)|0;
$223 = ($222|0)>(-1);
if ($223) {
$i$435 = $222;
while(1) {
$224 = (($40) + ($i$435)|0);
HEAP8[$224>>0] = -1;
$225 = (($i$435) + -4)|0;
$226 = ($225|0)>(-1);
if ($226) {
$i$435 = $225;
} else {
break;
}
}
}
}
if ($5) {
$227 = HEAP32[$3>>2]|0;
$228 = $227 >> 1;
$229 = ($228|0)>(0);
if ($229) {
$230 = HEAP32[$s>>2]|0;
$231 = Math_imul($230, $req_comp$)|0;
$232 = ($231|0)>(0);
$233 = HEAP32[$3>>2]|0;
$234 = $233 >> 1;
$239 = $227;$j$233 = 0;
while(1) {
$235 = Math_imul($j$233, $req_comp$)|0;
$236 = Math_imul($235, $230)|0;
$237 = $j$233 ^ -1;
$238 = (($239) + ($237))|0;
$240 = Math_imul($238, $req_comp$)|0;
$241 = Math_imul($240, $230)|0;
if ($232) {
$242 = HEAP32[$s>>2]|0;
$243 = Math_imul($242, $req_comp$)|0;
$i$532 = 0;
while(1) {
$$sum = (($i$532) + ($236))|0;
$244 = (($40) + ($$sum)|0);
$245 = HEAP8[$244>>0]|0;
$$sum16 = (($i$532) + ($241))|0;
$246 = (($40) + ($$sum16)|0);
$247 = HEAP8[$246>>0]|0;
HEAP8[$244>>0] = $247;
HEAP8[$246>>0] = $245;
$248 = (($i$532) + 1)|0;
$249 = ($248|0)<($243|0);
if ($249) {
$i$532 = $248;
} else {
break;
}
}
}
$250 = (($j$233) + 1)|0;
$251 = ($250|0)<($234|0);
if ($251) {
$239 = $233;$j$233 = $250;
} else {
break;
}
}
}
}
$252 = ($req_comp$|0)==($req_comp|0);
$or$cond = $34 | $252;
if ($or$cond) {
$out$0 = $40;
} else {
$253 = HEAP32[$s>>2]|0;
$254 = HEAP32[$3>>2]|0;
$255 = (_stbi__convert_format($40,$req_comp$,$req_comp,$253,$254)|0);
$256 = ($255|0)==(0|0);
if ($256) {
$$0 = 0;
STACKTOP = sp;return ($$0|0);
} else {
$out$0 = $255;
}
}
$257 = HEAP32[$s>>2]|0;
HEAP32[$x>>2] = $257;
$258 = HEAP32[$3>>2]|0;
HEAP32[$y>>2] = $258;
$259 = ($comp|0)==(0|0);
if ($259) {
$$0 = $out$0;
STACKTOP = sp;return ($$0|0);
}
$260 = HEAP32[$33>>2]|0;
HEAP32[$comp>>2] = $260;
$$0 = $out$0;
STACKTOP = sp;return ($$0|0);
}
function _stbi__gif_test($s) {
$s = $s|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__gif_test_raw($s)|0);
_stbi__rewind($s);
return ($0|0);
}
function _stbi__gif_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $g = 0, $u$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 18528|0;
$g = sp;
_memset(($g|0),0,18516)|0;
$0 = (_stbi__gif_load_next($s,$g,$comp)|0);
$1 = ($0|0)==($s|0);
$$ = $1 ? 0 : $0;
$2 = ($$|0)==(0|0);
L1: do {
if ($2) {
$9 = ((($g)) + 8|0);
$10 = HEAP32[$9>>2]|0;
$11 = ($10|0)==(0|0);
if ($11) {
$u$0 = 0;
} else {
_free($10);
$u$0 = 0;
}
} else {
$3 = HEAP32[$g>>2]|0;
HEAP32[$x>>2] = $3;
$4 = ((($g)) + 4|0);
$5 = HEAP32[$4>>2]|0;
HEAP32[$y>>2] = $5;
switch ($req_comp|0) {
case 0: case 4: {
$u$0 = $$;
break L1;
break;
}
default: {
}
}
$6 = HEAP32[$g>>2]|0;
$7 = HEAP32[$4>>2]|0;
$8 = (_stbi__convert_format($$,4,$req_comp,$6,$7)|0);
$u$0 = $8;
}
} while(0);
STACKTOP = sp;return ($u$0|0);
}
function _stbi__psd_test($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get32be($s)|0);
$1 = ($0|0)==(943870035);
$2 = $1&1;
_stbi__rewind($s);
return ($2|0);
}
function _stbi__psd_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$0 = 0, $$lcssa = 0, $$pn = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $channel$039 = 0, $count$0$ph$be = 0, $count$0$ph37 = 0, $exitcond = 0, $exitcond$1 = 0, $exitcond$2 = 0, $exitcond$3 = 0, $exitcond42 = 0;
var $exitcond42$1 = 0, $exitcond42$2 = 0, $exitcond42$3 = 0, $exitcond43 = 0, $exitcond43$1 = 0, $exitcond43$2 = 0, $exitcond43$3 = 0, $exitcond46 = 0, $exitcond50 = 0, $i$028 = 0, $i$119 = 0, $i$119$1 = 0, $i$119$2 = 0, $i$119$3 = 0, $i$224 = 0, $i$224$1 = 0, $i$224$2 = 0, $i$224$3 = 0, $i$321 = 0, $i$321$1 = 0;
var $i$321$2 = 0, $i$321$3 = 0, $len$035 = 0, $len$132 = 0, $out$0 = 0, $p$029 = 0, $p$1$ph$be = 0, $p$1$ph38 = 0, $p$236 = 0, $p$333 = 0, $p1$020 = 0, $p1$020$1 = 0, $p1$020$2 = 0, $p1$020$3 = 0, $p1$125 = 0, $p1$125$1 = 0, $p1$125$2 = 0, $p1$125$3 = 0, $p1$222 = 0, $p1$222$1 = 0;
var $p1$222$2 = 0, $p1$222$3 = 0, $scevgep$sum = 0, $scevgep47 = 0, $scevgep48$sum = 0, $scevgep49 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get32be($s)|0);
$1 = ($0|0)==(943870035);
if (!($1)) {
_stbi__err(19490);
$$0 = 0;
return ($$0|0);
}
$2 = (_stbi__get16be($s)|0);
$3 = ($2|0)==(1);
if (!($3)) {
_stbi__err(19498);
$$0 = 0;
return ($$0|0);
}
_stbi__skip($s,6);
$4 = (_stbi__get16be($s)|0);
$5 = ($4>>>0)>(16);
if ($5) {
_stbi__err(19512);
$$0 = 0;
return ($$0|0);
}
$6 = (_stbi__get32be($s)|0);
$7 = (_stbi__get32be($s)|0);
$8 = (_stbi__get16be($s)|0);
switch ($8|0) {
case 8: case 16: {
break;
}
default: {
_stbi__err(19532);
$$0 = 0;
return ($$0|0);
}
}
$9 = (_stbi__get16be($s)|0);
$10 = ($9|0)==(3);
if (!($10)) {
_stbi__err(19554);
$$0 = 0;
return ($$0|0);
}
$11 = (_stbi__get32be($s)|0);
_stbi__skip($s,$11);
$12 = (_stbi__get32be($s)|0);
_stbi__skip($s,$12);
$13 = (_stbi__get32be($s)|0);
_stbi__skip($s,$13);
$14 = (_stbi__get16be($s)|0);
$15 = ($14|0)>(1);
if ($15) {
_stbi__err(19347);
$$0 = 0;
return ($$0|0);
}
$16 = $6 << 2;
$17 = Math_imul($16, $7)|0;
$18 = (_stbi__malloc($17)|0);
$19 = ($18|0)==(0|0);
if ($19) {
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
$20 = Math_imul($7, $6)|0;
$21 = ($14|0)==(0);
L29: do {
if ($21) {
$54 = ($8|0)==(16);
$55 = ($20|0)>(0);
$56 = ($20|0)>(0);
$57 = ($20|0)>(0);
$58 = Math_imul($7, $6)|0;
$59 = ($4|0)>(0);
do {
if ($59) {
if ($54) {
if ($55) {
$i$224 = 0;$p1$125 = $18;
} else {
break;
}
while(1) {
$62 = (_stbi__get16be($s)|0);
$63 = $62 >>> 8;
$64 = $63&255;
HEAP8[$p1$125>>0] = $64;
$65 = (($i$224) + 1)|0;
$66 = ((($p1$125)) + 4|0);
$exitcond43 = ($65|0)==($58|0);
if ($exitcond43) {
break;
} else {
$i$224 = $65;$p1$125 = $66;
}
}
} else {
if ($56) {
$i$321 = 0;$p1$222 = $18;
} else {
break;
}
while(1) {
$67 = (_stbi__get8($s)|0);
HEAP8[$p1$222>>0] = $67;
$68 = (($i$321) + 1)|0;
$69 = ((($p1$222)) + 4|0);
$exitcond42 = ($68|0)==($58|0);
if ($exitcond42) {
break;
} else {
$i$321 = $68;$p1$222 = $69;
}
}
}
} else {
if ($57) {
$i$119 = 0;$p1$020 = $18;
} else {
break L29;
}
while(1) {
HEAP8[$p1$020>>0] = 0;
$60 = (($i$119) + 1)|0;
$61 = ((($p1$020)) + 4|0);
$exitcond = ($60|0)==($58|0);
if ($exitcond) {
break;
} else {
$i$119 = $60;$p1$020 = $61;
}
}
}
} while(0);
$70 = ((($18)) + 1|0);
$71 = ($4|0)>(1);
do {
if ($71) {
if ($54) {
if ($55) {
$i$224$1 = 0;$p1$125$1 = $70;
} else {
break;
}
while(1) {
$80 = (_stbi__get16be($s)|0);
$81 = $80 >>> 8;
$82 = $81&255;
HEAP8[$p1$125$1>>0] = $82;
$83 = (($i$224$1) + 1)|0;
$84 = ((($p1$125$1)) + 4|0);
$exitcond43$1 = ($83|0)==($58|0);
if ($exitcond43$1) {
break;
} else {
$i$224$1 = $83;$p1$125$1 = $84;
}
}
} else {
if ($56) {
$i$321$1 = 0;$p1$222$1 = $70;
} else {
break;
}
while(1) {
$77 = (_stbi__get8($s)|0);
HEAP8[$p1$222$1>>0] = $77;
$78 = (($i$321$1) + 1)|0;
$79 = ((($p1$222$1)) + 4|0);
$exitcond42$1 = ($78|0)==($58|0);
if ($exitcond42$1) {
break;
} else {
$i$321$1 = $78;$p1$222$1 = $79;
}
}
}
} else {
if ($57) {
$i$119$1 = 0;$p1$020$1 = $70;
} else {
break L29;
}
while(1) {
HEAP8[$p1$020$1>>0] = 0;
$75 = (($i$119$1) + 1)|0;
$76 = ((($p1$020$1)) + 4|0);
$exitcond$1 = ($75|0)==($58|0);
if ($exitcond$1) {
break;
} else {
$i$119$1 = $75;$p1$020$1 = $76;
}
}
}
} while(0);
$85 = ((($18)) + 2|0);
$86 = ($4|0)>(2);
do {
if ($86) {
if ($54) {
if ($55) {
$i$224$2 = 0;$p1$125$2 = $85;
} else {
break;
}
while(1) {
$92 = (_stbi__get16be($s)|0);
$93 = $92 >>> 8;
$94 = $93&255;
HEAP8[$p1$125$2>>0] = $94;
$95 = (($i$224$2) + 1)|0;
$96 = ((($p1$125$2)) + 4|0);
$exitcond43$2 = ($95|0)==($58|0);
if ($exitcond43$2) {
break;
} else {
$i$224$2 = $95;$p1$125$2 = $96;
}
}
} else {
if ($56) {
$i$321$2 = 0;$p1$222$2 = $85;
} else {
break;
}
while(1) {
$89 = (_stbi__get8($s)|0);
HEAP8[$p1$222$2>>0] = $89;
$90 = (($i$321$2) + 1)|0;
$91 = ((($p1$222$2)) + 4|0);
$exitcond42$2 = ($90|0)==($58|0);
if ($exitcond42$2) {
break;
} else {
$i$321$2 = $90;$p1$222$2 = $91;
}
}
}
} else {
if ($57) {
$i$119$2 = 0;$p1$020$2 = $85;
} else {
break L29;
}
while(1) {
HEAP8[$p1$020$2>>0] = 0;
$87 = (($i$119$2) + 1)|0;
$88 = ((($p1$020$2)) + 4|0);
$exitcond$2 = ($87|0)==($58|0);
if ($exitcond$2) {
break;
} else {
$i$119$2 = $87;$p1$020$2 = $88;
}
}
}
} while(0);
$97 = ((($18)) + 3|0);
$98 = ($4|0)>(3);
if (!($98)) {
if ($57) {
$i$119$3 = 0;$p1$020$3 = $97;
} else {
break;
}
while(1) {
HEAP8[$p1$020$3>>0] = -1;
$99 = (($i$119$3) + 1)|0;
$100 = ((($p1$020$3)) + 4|0);
$exitcond$3 = ($99|0)==($58|0);
if ($exitcond$3) {
break L29;
} else {
$i$119$3 = $99;$p1$020$3 = $100;
}
}
}
if ($54) {
if ($55) {
$i$224$3 = 0;$p1$125$3 = $97;
} else {
break;
}
while(1) {
$104 = (_stbi__get16be($s)|0);
$105 = $104 >>> 8;
$106 = $105&255;
HEAP8[$p1$125$3>>0] = $106;
$107 = (($i$224$3) + 1)|0;
$108 = ((($p1$125$3)) + 4|0);
$exitcond43$3 = ($107|0)==($58|0);
if ($exitcond43$3) {
break;
} else {
$i$224$3 = $107;$p1$125$3 = $108;
}
}
} else {
if ($56) {
$i$321$3 = 0;$p1$222$3 = $97;
} else {
break;
}
while(1) {
$101 = (_stbi__get8($s)|0);
HEAP8[$p1$222$3>>0] = $101;
$102 = (($i$321$3) + 1)|0;
$103 = ((($p1$222$3)) + 4|0);
$exitcond42$3 = ($102|0)==($58|0);
if ($exitcond42$3) {
break;
} else {
$i$321$3 = $102;$p1$222$3 = $103;
}
}
}
} else {
$22 = $4 << 1;
$23 = Math_imul($22, $6)|0;
_stbi__skip($s,$23);
$24 = ($20|0)>(0);
$25 = ($20|0)>(0);
$26 = Math_imul($7, $6)|0;
$channel$039 = 0;
while(1) {
$27 = (($18) + ($channel$039)|0);
$28 = ($channel$039|0)<($4|0);
if ($28) {
if ($24) {
$count$0$ph37 = 0;$p$1$ph38 = $27;
while(1) {
while(1) {
$36 = (_stbi__get8($s)|0);
$37 = ($36<<24>>24)==(-128);
if (!($37)) {
$$lcssa = $36;
break;
}
}
$38 = $$lcssa&255;
$39 = ($$lcssa<<24>>24)>(-1);
if ($39) {
$40 = (($38) + 1)|0;
$41 = $$lcssa&255;
$33 = $41 << 2;
$len$035 = $40;$p$236 = $p$1$ph38;
while(1) {
$42 = (_stbi__get8($s)|0);
HEAP8[$p$236>>0] = $42;
$43 = ((($p$236)) + 4|0);
$44 = (($len$035) + -1)|0;
$45 = ($44|0)==(0);
if ($45) {
break;
} else {
$len$035 = $44;$p$236 = $43;
}
}
$scevgep48$sum = (($33) + 4)|0;
$scevgep49 = (($p$1$ph38) + ($scevgep48$sum)|0);
$$pn = $40;$p$1$ph$be = $scevgep49;
} else {
$46 = (257 - ($38))|0;
$47 = (_stbi__get8($s)|0);
$48 = ($46|0)==(0);
if ($48) {
$$pn = 0;$p$1$ph$be = $p$1$ph38;
} else {
$49 = $$lcssa&255;
$35 = Math_imul($49, -4)|0;
$len$132 = $46;$p$333 = $p$1$ph38;
while(1) {
HEAP8[$p$333>>0] = $47;
$50 = ((($p$333)) + 4|0);
$51 = (($len$132) + -1)|0;
$52 = ($51|0)==(0);
if ($52) {
break;
} else {
$len$132 = $51;$p$333 = $50;
}
}
$scevgep$sum = (($35) + 1028)|0;
$scevgep47 = (($p$1$ph38) + ($scevgep$sum)|0);
$$pn = $46;$p$1$ph$be = $scevgep47;
}
}
$count$0$ph$be = (($$pn) + ($count$0$ph37))|0;
$34 = ($count$0$ph$be|0)<($20|0);
if ($34) {
$count$0$ph37 = $count$0$ph$be;$p$1$ph38 = $p$1$ph$be;
} else {
break;
}
}
}
} else {
if ($25) {
$29 = ($channel$039|0)==(3);
$30 = $29 << 31 >> 31;
$i$028 = 0;$p$029 = $27;
while(1) {
HEAP8[$p$029>>0] = $30;
$31 = (($i$028) + 1)|0;
$32 = ((($p$029)) + 4|0);
$exitcond46 = ($31|0)==($26|0);
if ($exitcond46) {
break;
} else {
$i$028 = $31;$p$029 = $32;
}
}
}
}
$53 = (($channel$039) + 1)|0;
$exitcond50 = ($53|0)==(4);
if ($exitcond50) {
break;
} else {
$channel$039 = $53;
}
}
}
} while(0);
switch ($req_comp|0) {
case 0: case 4: {
$out$0 = $18;
break;
}
default: {
$72 = (_stbi__convert_format($18,4,$req_comp,$7,$6)|0);
$73 = ($72|0)==(0|0);
if ($73) {
$$0 = 0;
return ($$0|0);
} else {
$out$0 = $72;
}
}
}
$74 = ($comp|0)==(0|0);
if (!($74)) {
HEAP32[$comp>>2] = 4;
}
HEAP32[$y>>2] = $6;
HEAP32[$x>>2] = $7;
$$0 = $out$0;
return ($$0|0);
}
function _stbi__pic_test($s) {
$s = $s|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__pic_test_core($s)|0);
_stbi__rewind($s);
return ($0|0);
}
function _stbi__pic_load($s,$px,$py,$comp,$req_comp) {
$s = $s|0;
$px = $px|0;
$py = $py|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $result$0 = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$i$02 = 0;
while(1) {
(_stbi__get8($s)|0);
$0 = (($i$02) + 1)|0;
$exitcond = ($0|0)==(92);
if ($exitcond) {
break;
} else {
$i$02 = $0;
}
}
$1 = (_stbi__get16be($s)|0);
$2 = (_stbi__get16be($s)|0);
$3 = (_stbi__at_eof($s)|0);
$4 = ($3|0)==(0);
if (!($4)) {
_stbi__err(19476);
$$0 = 0;
return ($$0|0);
}
$5 = (268435456 / ($1|0))&-1;
$6 = ($5|0)<($2|0);
if ($6) {
_stbi__err(17846);
$$0 = 0;
return ($$0|0);
}
(_stbi__get32be($s)|0);
(_stbi__get16be($s)|0);
(_stbi__get16be($s)|0);
$7 = $1 << 2;
$8 = Math_imul($7, $2)|0;
$9 = (_stbi__malloc($8)|0);
_memset(($9|0),-1,($8|0))|0;
$10 = (_stbi__pic_load_core($s,$1,$2,$comp,$9)|0);
$11 = ($10|0)==(0|0);
if ($11) {
_free($9);
$result$0 = 0;
} else {
$result$0 = $9;
}
HEAP32[$px>>2] = $1;
HEAP32[$py>>2] = $2;
$12 = ($req_comp|0)==(0);
if ($12) {
$13 = HEAP32[$comp>>2]|0;
$$01 = $13;
} else {
$$01 = $req_comp;
}
$14 = (_stbi__convert_format($result$0,4,$$01,$1,$2)|0);
$$0 = $14;
return ($$0|0);
}
function _stbi__pnm_test($s) {
$s = $s|0;
var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = (_stbi__get8($s)|0);
$2 = ($0<<24>>24)==(80);
$$off = (($1) + -53)<<24>>24;
$switch = ($$off&255)<(2);
$or$cond = $2 & $switch;
if ($or$cond) {
$$0 = 1;
return ($$0|0);
}
_stbi__rewind($s);
$$0 = 0;
return ($$0|0);
}
function _stbi__pnm_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0;
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($s)) + 4|0);
$1 = ((($s)) + 8|0);
$2 = (_stbi__pnm_info($s,$s,$0,$1)|0);
$3 = ($2|0)==(0);
if ($3) {
$$0 = 0;
return ($$0|0);
}
$4 = HEAP32[$s>>2]|0;
HEAP32[$x>>2] = $4;
$5 = HEAP32[$0>>2]|0;
HEAP32[$y>>2] = $5;
$6 = HEAP32[$1>>2]|0;
HEAP32[$comp>>2] = $6;
$7 = HEAP32[$1>>2]|0;
$8 = HEAP32[$s>>2]|0;
$9 = Math_imul($8, $7)|0;
$10 = HEAP32[$0>>2]|0;
$11 = Math_imul($9, $10)|0;
$12 = (_stbi__malloc($11)|0);
$13 = ($12|0)==(0|0);
if ($13) {
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
$14 = HEAP32[$1>>2]|0;
$15 = HEAP32[$s>>2]|0;
$16 = Math_imul($15, $14)|0;
$17 = HEAP32[$0>>2]|0;
$18 = Math_imul($16, $17)|0;
(_stbi__getn($s,$12,$18)|0);
$19 = ($req_comp|0)==(0);
if ($19) {
$$0 = $12;
return ($$0|0);
}
$20 = HEAP32[$1>>2]|0;
$21 = ($20|0)==($req_comp|0);
if ($21) {
$$0 = $12;
return ($$0|0);
} else {
$22 = HEAP32[$s>>2]|0;
$23 = HEAP32[$0>>2]|0;
$24 = (_stbi__convert_format($12,$20,$req_comp,$22,$23)|0);
return ($24|0);
}
return (0)|0;
}
function _stbi__tga_test($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $res$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
(_stbi__get8($s)|0);
$0 = (_stbi__get8($s)|0);
$1 = ($0&255)>(1);
L1: do {
if ($1) {
$res$0 = 0;
} else {
$2 = (_stbi__get8($s)|0);
$3 = ($0<<24>>24)==(1);
if ($3) {
switch ($2<<24>>24) {
case 1: case 9: {
break;
}
default: {
$res$0 = 0;
break L1;
}
}
_stbi__skip($s,4);
$4 = (_stbi__get8($s)|0);
switch ($4<<24>>24) {
case 8: case 15: case 16: case 24: case 32: {
break;
}
default: {
$res$0 = 0;
break L1;
}
}
_stbi__skip($s,4);
} else {
switch ($2<<24>>24) {
case 2: case 3: case 10: case 11: {
break;
}
default: {
$res$0 = 0;
break L1;
}
}
_stbi__skip($s,9);
}
$5 = (_stbi__get16le($s)|0);
$6 = ($5|0)<(1);
if ($6) {
$res$0 = 0;
} else {
$7 = (_stbi__get16le($s)|0);
$8 = ($7|0)<(1);
if ($8) {
$res$0 = 0;
} else {
$9 = (_stbi__get8($s)|0);
if ($3) {
switch ($9<<24>>24) {
case 8: case 16: {
break;
}
default: {
$res$0 = 0;
break L1;
}
}
} else {
switch ($9<<24>>24) {
case 8: case 15: case 16: case 24: case 32: {
break;
}
default: {
$res$0 = 0;
break L1;
}
}
}
$res$0 = 1;
}
}
}
} while(0);
_stbi__rewind($s);
return ($res$0|0);
}
function _stbi__tga_load($s,$x,$y,$comp,$req_comp) {
$s = $s|0;
$x = $x|0;
$y = $y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$ = 0, $$0 = 0, $$6 = 0, $$7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
var $97 = 0, $98 = 0, $99 = 0, $RLE_count$039 = 0, $RLE_count$18 = 0, $RLE_count$19 = 0, $RLE_repeating$040 = 0, $RLE_repeating$110 = 0, $RLE_repeating$111 = 0, $exitcond = 0, $exitcond50 = 0, $exitcond55 = 0, $exitcond56 = 0, $i$048 = 0, $i$145 = 0, $i$238 = 0, $i$323 = 0, $i$421 = 0, $index1$024 = 0, $index2$025 = 0;
var $j$129 = 0, $j$327 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond5$not = 0, $or$cond57 = 0, $or$cond59 = 0, $pal_entry$046 = 0, $raw_data = 0, $read_next_pixel$041 = 0, $scevgep = 0, $scevgep54 = 0, $tga_comp$0 = 0, $tga_palette$0 = 0, $tga_pixel$022 = 0, $tga_rgb16 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$tga_rgb16 = sp;
$raw_data = sp + 4|0;
$0 = (_stbi__get8($s)|0);
$1 = $0&255;
$2 = (_stbi__get8($s)|0);
$3 = (_stbi__get8($s)|0);
$4 = $3&255;
$5 = (_stbi__get16le($s)|0);
$6 = (_stbi__get16le($s)|0);
$7 = (_stbi__get8($s)|0);
(_stbi__get16le($s)|0);
(_stbi__get16le($s)|0);
$8 = (_stbi__get16le($s)|0);
$9 = (_stbi__get16le($s)|0);
$10 = (_stbi__get8($s)|0);
HEAP32[$tga_rgb16>>2] = 0;
$11 = (_stbi__get8($s)|0);
$12 = $11&255;
$13 = ($3&255)>(7);
$$6 = $13&1;
$14 = $12 >>> 5;
$15 = $14 & 1;
$16 = ($2<<24>>24)!=(0);
if ($16) {
$17 = $7&255;
$18 = (_stbi__tga_get_comp($17,0,$tga_rgb16)|0);
$tga_comp$0 = $18;
} else {
$19 = (($4) + -8)|0;
$$7 = $13 ? $19 : $4;
$20 = $10&255;
$21 = ($$7|0)==(3);
$22 = $21&1;
$23 = (_stbi__tga_get_comp($20,$22,$tga_rgb16)|0);
$tga_comp$0 = $23;
}
$24 = ($tga_comp$0|0)==(0);
if ($24) {
_stbi__err(19363);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
HEAP32[$x>>2] = $8;
HEAP32[$y>>2] = $9;
$25 = ($comp|0)==(0|0);
if (!($25)) {
HEAP32[$comp>>2] = $tga_comp$0;
}
$26 = Math_imul($9, $8)|0;
$27 = Math_imul($26, $tga_comp$0)|0;
$28 = (_stbi__malloc($27)|0);
$29 = ($28|0)==(0|0);
if ($29) {
_stbi__err(18059);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
_stbi__skip($s,$1);
$30 = HEAP32[$tga_rgb16>>2]|0;
$31 = $30 | $$6;
$32 = ($31|0)!=(0);
$33 = $16 | $32;
if ($33) {
do {
if ($16) {
_stbi__skip($s,$5);
$44 = Math_imul($tga_comp$0, $6)|0;
$45 = (_stbi__malloc($44)|0);
$46 = ($45|0)==(0|0);
if ($46) {
_free($28);
_stbi__err(18059);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$47 = HEAP32[$tga_rgb16>>2]|0;
$48 = ($47|0)==(0);
if ($48) {
$53 = (_stbi__getn($s,$45,$44)|0);
$54 = ($53|0)==(0);
if (!($54)) {
$tga_palette$0 = $45;
break;
}
_free($28);
_free($45);
_stbi__err(19410);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
$49 = ($tga_comp$0|0)==(3);
if (!($49)) {
___assert_fail((19374|0),(18129|0),5060,(19395|0));
// unreachable;
}
$50 = ($6|0)>(0);
if ($50) {
$i$145 = 0;$pal_entry$046 = $45;
while(1) {
_stbi__tga_read_rgb16($s,$pal_entry$046);
$51 = (($pal_entry$046) + ($tga_comp$0)|0);
$52 = (($i$145) + 1)|0;
$exitcond55 = ($52|0)==($6|0);
if ($exitcond55) {
$tga_palette$0 = $45;
break;
} else {
$i$145 = $52;$pal_entry$046 = $51;
}
}
} else {
$tga_palette$0 = $45;
}
} else {
$tga_palette$0 = 0;
}
} while(0);
$55 = Math_imul($9, $8)|0;
$56 = ($55|0)>(0);
L35: do {
if ($56) {
$57 = ($10<<24>>24)==(8);
$58 = ($tga_comp$0|0)>(0);
$59 = ($tga_comp$0|0)==(3);
$60 = ($tga_comp$0|0)>(0);
$61 = ($tga_comp$0|0)>(0);
$RLE_count$039 = 0;$RLE_repeating$040 = 0;$i$238 = 0;$read_next_pixel$041 = 1;
L37: while(1) {
$62 = Math_imul($tga_comp$0, $i$238)|0;
$scevgep54 = (($28) + ($62)|0);
do {
if ($13) {
$63 = ($RLE_count$039|0)==(0);
if ($63) {
$64 = (_stbi__get8($s)|0);
$65 = $64&255;
$66 = $65 & 127;
$67 = (($66) + 1)|0;
$68 = $65 >>> 7;
$RLE_count$18 = $67;$RLE_repeating$110 = $68;
label = 31;
break;
}
$69 = ($RLE_repeating$040|0)==(0);
if ($69) {
$RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = 0;
label = 31;
} else {
$70 = ($read_next_pixel$041|0)==(0);
if ($70) {
$RLE_count$19 = $RLE_count$039;$RLE_repeating$111 = $RLE_repeating$040;
} else {
$RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040;
label = 31;
}
}
} else {
$RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040;
label = 31;
}
} while(0);
do {
if ((label|0) == 31) {
label = 0;
if ($16) {
if ($57) {
$71 = (_stbi__get8($s)|0);
$72 = $71&255;
$79 = $72;
} else {
$73 = (_stbi__get16le($s)|0);
$79 = $73;
}
if (!($58)) {
$RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
break;
}
$80 = ($79|0)>=($6|0);
$$ = $80 ? 0 : $79;
$81 = Math_imul($tga_comp$0, $$)|0;
$scevgep = (($tga_palette$0) + ($81)|0);
_memcpy(($raw_data|0),($scevgep|0),($tga_comp$0|0))|0;
$RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
break;
} else {
$74 = HEAP32[$tga_rgb16>>2]|0;
$75 = ($74|0)==(0);
if ($75) {
if ($60) {
$j$129 = 0;
} else {
$RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
break;
}
while(1) {
$76 = (_stbi__get8($s)|0);
$77 = (($raw_data) + ($j$129)|0);
HEAP8[$77>>0] = $76;
$78 = (($j$129) + 1)|0;
$exitcond50 = ($78|0)==($tga_comp$0|0);
if ($exitcond50) {
$RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
break;
} else {
$j$129 = $78;
}
}
} else {
if (!($59)) {
break L37;
}
_stbi__tga_read_rgb16($s,$raw_data);
$RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
break;
}
}
}
} while(0);
if ($61) {
_memcpy(($scevgep54|0),($raw_data|0),($tga_comp$0|0))|0;
}
$82 = (($RLE_count$19) + -1)|0;
$83 = (($i$238) + 1)|0;
$84 = ($83|0)<($55|0);
if ($84) {
$RLE_count$039 = $82;$RLE_repeating$040 = $RLE_repeating$111;$i$238 = $83;$read_next_pixel$041 = 0;
} else {
break L35;
}
}
___assert_fail((19374|0),(18129|0),5109,(19395|0));
// unreachable;
}
} while(0);
$85 = ($15|0)==(0);
$86 = ($9|0)>(0);
$or$cond57 = $85 & $86;
if ($or$cond57) {
$87 = Math_imul($tga_comp$0, $8)|0;
$88 = (($9) + -1)|0;
$89 = Math_imul($tga_comp$0, $8)|0;
$90 = Math_imul($tga_comp$0, $8)|0;
$91 = ($90|0)>(0);
$j$327 = 0;
while(1) {
if ($91) {
$92 = (($88) - ($j$327))|0;
$93 = Math_imul($89, $92)|0;
$94 = Math_imul($87, $j$327)|0;
$i$323 = $90;$index1$024 = $94;$index2$025 = $93;
while(1) {
$95 = (($28) + ($index1$024)|0);
$96 = HEAP8[$95>>0]|0;
$97 = (($28) + ($index2$025)|0);
$98 = HEAP8[$97>>0]|0;
HEAP8[$95>>0] = $98;
HEAP8[$97>>0] = $96;
$99 = (($index1$024) + 1)|0;
$100 = (($index2$025) + 1)|0;
$101 = (($i$323) + -1)|0;
$102 = ($i$323|0)>(1);
if ($102) {
$i$323 = $101;$index1$024 = $99;$index2$025 = $100;
} else {
break;
}
}
}
$103 = (($j$327) + 1)|0;
$104 = $103 << 1;
$105 = ($104|0)<($9|0);
if ($105) {
$j$327 = $103;
} else {
break;
}
}
}
$106 = ($tga_palette$0|0)==(0|0);
if (!($106)) {
_free($tga_palette$0);
}
} else {
$34 = ($9|0)>(0);
if ($34) {
$35 = ($15|0)==(0);
$36 = (($9) + -1)|0;
$37 = Math_imul($tga_comp$0, $8)|0;
$38 = Math_imul($tga_comp$0, $8)|0;
$i$048 = 0;
while(1) {
$39 = (($36) - ($i$048))|0;
$40 = $35 ? $39 : $i$048;
$41 = Math_imul($37, $40)|0;
$42 = (($28) + ($41)|0);
(_stbi__getn($s,$42,$38)|0);
$43 = (($i$048) + 1)|0;
$exitcond56 = ($43|0)==($9|0);
if ($exitcond56) {
break;
} else {
$i$048 = $43;
}
}
}
}
$107 = HEAP32[$tga_rgb16>>2]|0;
$notlhs = ($tga_comp$0|0)>(2);
$notrhs = ($107|0)==(0);
$or$cond5$not = $notrhs & $notlhs;
$108 = Math_imul($9, $8)|0;
$109 = ($108|0)>(0);
$or$cond59 = $or$cond5$not & $109;
if ($or$cond59) {
$110 = Math_imul($9, $8)|0;
$i$421 = 0;$tga_pixel$022 = $28;
while(1) {
$111 = HEAP8[$tga_pixel$022>>0]|0;
$112 = ((($tga_pixel$022)) + 2|0);
$113 = HEAP8[$112>>0]|0;
HEAP8[$tga_pixel$022>>0] = $113;
HEAP8[$112>>0] = $111;
$114 = (($tga_pixel$022) + ($tga_comp$0)|0);
$115 = (($i$421) + 1)|0;
$exitcond = ($115|0)==($110|0);
if ($exitcond) {
break;
} else {
$i$421 = $115;$tga_pixel$022 = $114;
}
}
}
$116 = ($req_comp|0)==(0);
$117 = ($tga_comp$0|0)==($req_comp|0);
$or$cond = $116 | $117;
if ($or$cond) {
$$0 = $28;
STACKTOP = sp;return ($$0|0);
}
$118 = (_stbi__convert_format($28,$tga_comp$0,$req_comp,$8,$9)|0);
$$0 = $118;
STACKTOP = sp;return ($$0|0);
}
function _stbi__convert_format($data,$img_n,$req_comp,$x,$y) {
$data = $data|0;
$img_n = $img_n|0;
$req_comp = $req_comp|0;
$x = $x|0;
$y = $y|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dest$081 = 0;
var $dest$1031 = 0, $dest$1127 = 0, $dest$176 = 0, $dest$271 = 0, $dest$366 = 0, $dest$461 = 0, $dest$556 = 0, $dest$651 = 0, $dest$746 = 0, $dest$841 = 0, $dest$936 = 0, $i$0 = 0, $i$079 = 0, $i$082 = 0, $i$1 = 0, $i$10 = 0, $i$1029 = 0, $i$1032 = 0, $i$11 = 0, $i$1125 = 0;
var $i$1128 = 0, $i$174 = 0, $i$177 = 0, $i$2 = 0, $i$269 = 0, $i$272 = 0, $i$3 = 0, $i$364 = 0, $i$367 = 0, $i$4 = 0, $i$459 = 0, $i$462 = 0, $i$5 = 0, $i$554 = 0, $i$557 = 0, $i$6 = 0, $i$649 = 0, $i$652 = 0, $i$7 = 0, $i$744 = 0;
var $i$747 = 0, $i$8 = 0, $i$839 = 0, $i$842 = 0, $i$9 = 0, $i$934 = 0, $i$937 = 0, $j$084 = 0, $req_comp$off = 0, $src$080 = 0, $src$1030 = 0, $src$1126 = 0, $src$175 = 0, $src$270 = 0, $src$365 = 0, $src$460 = 0, $src$555 = 0, $src$650 = 0, $src$745 = 0, $src$840 = 0;
var $src$935 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($req_comp|0)==($img_n|0);
if ($0) {
$$0 = $data;
return ($$0|0);
}
$req_comp$off = (($req_comp) + -1)|0;
$1 = ($req_comp$off>>>0)<(4);
if (!($1)) {
___assert_fail((19422|0),(18129|0),1353,(19453|0));
// unreachable;
}
$2 = Math_imul($x, $req_comp)|0;
$3 = Math_imul($2, $y)|0;
$4 = (_stbi__malloc($3)|0);
$5 = ($4|0)==(0|0);
if ($5) {
_free($data);
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
$6 = ($y|0)>(0);
L11: do {
if ($6) {
$7 = $img_n << 3;
$8 = (($7) + ($req_comp))|0;
$i$079 = (($x) + -1)|0;
$9 = ($i$079|0)>(-1);
$i$174 = (($x) + -1)|0;
$10 = ($i$174|0)>(-1);
$i$269 = (($x) + -1)|0;
$11 = ($i$269|0)>(-1);
$i$364 = (($x) + -1)|0;
$12 = ($i$364|0)>(-1);
$i$459 = (($x) + -1)|0;
$13 = ($i$459|0)>(-1);
$i$554 = (($x) + -1)|0;
$14 = ($i$554|0)>(-1);
$i$649 = (($x) + -1)|0;
$15 = ($i$649|0)>(-1);
$i$744 = (($x) + -1)|0;
$16 = ($i$744|0)>(-1);
$i$839 = (($x) + -1)|0;
$17 = ($i$839|0)>(-1);
$i$934 = (($x) + -1)|0;
$18 = ($i$934|0)>(-1);
$i$1029 = (($x) + -1)|0;
$19 = ($i$1029|0)>(-1);
$i$1125 = (($x) + -1)|0;
$20 = ($i$1125|0)>(-1);
$j$084 = 0;
L13: while(1) {
$21 = Math_imul($j$084, $x)|0;
$22 = Math_imul($21, $img_n)|0;
$23 = (($data) + ($22)|0);
$24 = Math_imul($21, $req_comp)|0;
$25 = (($4) + ($24)|0);
do {
switch ($8|0) {
case 10: {
if ($9) {
$dest$081 = $25;$i$082 = $i$079;$src$080 = $23;
while(1) {
$26 = HEAP8[$src$080>>0]|0;
HEAP8[$dest$081>>0] = $26;
$27 = ((($dest$081)) + 1|0);
HEAP8[$27>>0] = -1;
$28 = ((($src$080)) + 1|0);
$29 = ((($dest$081)) + 2|0);
$i$0 = (($i$082) + -1)|0;
$30 = ($i$0|0)>(-1);
if ($30) {
$dest$081 = $29;$i$082 = $i$0;$src$080 = $28;
} else {
break;
}
}
}
break;
}
case 11: {
if ($10) {
$dest$176 = $25;$i$177 = $i$174;$src$175 = $23;
while(1) {
$31 = HEAP8[$src$175>>0]|0;
$32 = ((($dest$176)) + 2|0);
HEAP8[$32>>0] = $31;
$33 = ((($dest$176)) + 1|0);
HEAP8[$33>>0] = $31;
HEAP8[$dest$176>>0] = $31;
$34 = ((($src$175)) + 1|0);
$35 = ((($dest$176)) + 3|0);
$i$1 = (($i$177) + -1)|0;
$36 = ($i$1|0)>(-1);
if ($36) {
$dest$176 = $35;$i$177 = $i$1;$src$175 = $34;
} else {
break;
}
}
}
break;
}
case 12: {
if ($11) {
$dest$271 = $25;$i$272 = $i$269;$src$270 = $23;
while(1) {
$37 = HEAP8[$src$270>>0]|0;
$38 = ((($dest$271)) + 2|0);
HEAP8[$38>>0] = $37;
$39 = ((($dest$271)) + 1|0);
HEAP8[$39>>0] = $37;
HEAP8[$dest$271>>0] = $37;
$40 = ((($dest$271)) + 3|0);
HEAP8[$40>>0] = -1;
$41 = ((($src$270)) + 1|0);
$42 = ((($dest$271)) + 4|0);
$i$2 = (($i$272) + -1)|0;
$43 = ($i$2|0)>(-1);
if ($43) {
$dest$271 = $42;$i$272 = $i$2;$src$270 = $41;
} else {
break;
}
}
}
break;
}
case 17: {
if ($12) {
$dest$366 = $25;$i$367 = $i$364;$src$365 = $23;
while(1) {
$44 = HEAP8[$src$365>>0]|0;
HEAP8[$dest$366>>0] = $44;
$45 = ((($src$365)) + 2|0);
$46 = ((($dest$366)) + 1|0);
$i$3 = (($i$367) + -1)|0;
$47 = ($i$3|0)>(-1);
if ($47) {
$dest$366 = $46;$i$367 = $i$3;$src$365 = $45;
} else {
break;
}
}
}
break;
}
case 19: {
if ($13) {
$dest$461 = $25;$i$462 = $i$459;$src$460 = $23;
while(1) {
$48 = HEAP8[$src$460>>0]|0;
$49 = ((($dest$461)) + 2|0);
HEAP8[$49>>0] = $48;
$50 = ((($dest$461)) + 1|0);
HEAP8[$50>>0] = $48;
HEAP8[$dest$461>>0] = $48;
$51 = ((($src$460)) + 2|0);
$52 = ((($dest$461)) + 3|0);
$i$4 = (($i$462) + -1)|0;
$53 = ($i$4|0)>(-1);
if ($53) {
$dest$461 = $52;$i$462 = $i$4;$src$460 = $51;
} else {
break;
}
}
}
break;
}
case 20: {
if ($14) {
$dest$556 = $25;$i$557 = $i$554;$src$555 = $23;
while(1) {
$54 = HEAP8[$src$555>>0]|0;
$55 = ((($dest$556)) + 2|0);
HEAP8[$55>>0] = $54;
$56 = ((($dest$556)) + 1|0);
HEAP8[$56>>0] = $54;
HEAP8[$dest$556>>0] = $54;
$57 = ((($src$555)) + 1|0);
$58 = HEAP8[$57>>0]|0;
$59 = ((($dest$556)) + 3|0);
HEAP8[$59>>0] = $58;
$60 = ((($src$555)) + 2|0);
$61 = ((($dest$556)) + 4|0);
$i$5 = (($i$557) + -1)|0;
$62 = ($i$5|0)>(-1);
if ($62) {
$dest$556 = $61;$i$557 = $i$5;$src$555 = $60;
} else {
break;
}
}
}
break;
}
case 28: {
if ($15) {
$dest$651 = $25;$i$652 = $i$649;$src$650 = $23;
while(1) {
$63 = HEAP8[$src$650>>0]|0;
HEAP8[$dest$651>>0] = $63;
$64 = ((($src$650)) + 1|0);
$65 = HEAP8[$64>>0]|0;
$66 = ((($dest$651)) + 1|0);
HEAP8[$66>>0] = $65;
$67 = ((($src$650)) + 2|0);
$68 = HEAP8[$67>>0]|0;
$69 = ((($dest$651)) + 2|0);
HEAP8[$69>>0] = $68;
$70 = ((($dest$651)) + 3|0);
HEAP8[$70>>0] = -1;
$71 = ((($src$650)) + 3|0);
$72 = ((($dest$651)) + 4|0);
$i$6 = (($i$652) + -1)|0;
$73 = ($i$6|0)>(-1);
if ($73) {
$dest$651 = $72;$i$652 = $i$6;$src$650 = $71;
} else {
break;
}
}
}
break;
}
case 25: {
if ($16) {
$dest$746 = $25;$i$747 = $i$744;$src$745 = $23;
while(1) {
$74 = HEAP8[$src$745>>0]|0;
$75 = $74&255;
$76 = ((($src$745)) + 1|0);
$77 = HEAP8[$76>>0]|0;
$78 = $77&255;
$79 = ((($src$745)) + 2|0);
$80 = HEAP8[$79>>0]|0;
$81 = $80&255;
$82 = (_stbi__compute_y($75,$78,$81)|0);
HEAP8[$dest$746>>0] = $82;
$83 = ((($src$745)) + 3|0);
$84 = ((($dest$746)) + 1|0);
$i$7 = (($i$747) + -1)|0;
$85 = ($i$7|0)>(-1);
if ($85) {
$dest$746 = $84;$i$747 = $i$7;$src$745 = $83;
} else {
break;
}
}
}
break;
}
case 26: {
if ($17) {
$dest$841 = $25;$i$842 = $i$839;$src$840 = $23;
while(1) {
$86 = HEAP8[$src$840>>0]|0;
$87 = $86&255;
$88 = ((($src$840)) + 1|0);
$89 = HEAP8[$88>>0]|0;
$90 = $89&255;
$91 = ((($src$840)) + 2|0);
$92 = HEAP8[$91>>0]|0;
$93 = $92&255;
$94 = (_stbi__compute_y($87,$90,$93)|0);
HEAP8[$dest$841>>0] = $94;
$95 = ((($dest$841)) + 1|0);
HEAP8[$95>>0] = -1;
$96 = ((($src$840)) + 3|0);
$97 = ((($dest$841)) + 2|0);
$i$8 = (($i$842) + -1)|0;
$98 = ($i$8|0)>(-1);
if ($98) {
$dest$841 = $97;$i$842 = $i$8;$src$840 = $96;
} else {
break;
}
}
}
break;
}
case 33: {
if ($18) {
$dest$936 = $25;$i$937 = $i$934;$src$935 = $23;
while(1) {
$99 = HEAP8[$src$935>>0]|0;
$100 = $99&255;
$101 = ((($src$935)) + 1|0);
$102 = HEAP8[$101>>0]|0;
$103 = $102&255;
$104 = ((($src$935)) + 2|0);
$105 = HEAP8[$104>>0]|0;
$106 = $105&255;
$107 = (_stbi__compute_y($100,$103,$106)|0);
HEAP8[$dest$936>>0] = $107;
$108 = ((($src$935)) + 4|0);
$109 = ((($dest$936)) + 1|0);
$i$9 = (($i$937) + -1)|0;
$110 = ($i$9|0)>(-1);
if ($110) {
$dest$936 = $109;$i$937 = $i$9;$src$935 = $108;
} else {
break;
}
}
}
break;
}
case 34: {
if ($19) {
$dest$1031 = $25;$i$1032 = $i$1029;$src$1030 = $23;
while(1) {
$111 = HEAP8[$src$1030>>0]|0;
$112 = $111&255;
$113 = ((($src$1030)) + 1|0);
$114 = HEAP8[$113>>0]|0;
$115 = $114&255;
$116 = ((($src$1030)) + 2|0);
$117 = HEAP8[$116>>0]|0;
$118 = $117&255;
$119 = (_stbi__compute_y($112,$115,$118)|0);
HEAP8[$dest$1031>>0] = $119;
$120 = ((($src$1030)) + 3|0);
$121 = HEAP8[$120>>0]|0;
$122 = ((($dest$1031)) + 1|0);
HEAP8[$122>>0] = $121;
$123 = ((($src$1030)) + 4|0);
$124 = ((($dest$1031)) + 2|0);
$i$10 = (($i$1032) + -1)|0;
$125 = ($i$10|0)>(-1);
if ($125) {
$dest$1031 = $124;$i$1032 = $i$10;$src$1030 = $123;
} else {
break;
}
}
}
break;
}
case 35: {
if ($20) {
$dest$1127 = $25;$i$1128 = $i$1125;$src$1126 = $23;
while(1) {
$126 = HEAP8[$src$1126>>0]|0;
HEAP8[$dest$1127>>0] = $126;
$127 = ((($src$1126)) + 1|0);
$128 = HEAP8[$127>>0]|0;
$129 = ((($dest$1127)) + 1|0);
HEAP8[$129>>0] = $128;
$130 = ((($src$1126)) + 2|0);
$131 = HEAP8[$130>>0]|0;
$132 = ((($dest$1127)) + 2|0);
HEAP8[$132>>0] = $131;
$133 = ((($src$1126)) + 4|0);
$134 = ((($dest$1127)) + 3|0);
$i$11 = (($i$1128) + -1)|0;
$135 = ($i$11|0)>(-1);
if ($135) {
$dest$1127 = $134;$i$1128 = $i$11;$src$1126 = $133;
} else {
break;
}
}
}
break;
}
default: {
break L13;
}
}
} while(0);
$136 = (($j$084) + 1)|0;
$137 = ($136|0)<($y|0);
if ($137) {
$j$084 = $136;
} else {
break L11;
}
}
___assert_fail((19474|0),(18129|0),1382,(19453|0));
// unreachable;
}
} while(0);
_free($data);
$$0 = $4;
return ($$0|0);
}
function _stbi__compute_y($r,$g,$b) {
$r = $r|0;
$g = $g|0;
$b = $b|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($r*77)|0;
$1 = ($g*150)|0;
$2 = (($1) + ($0))|0;
$3 = ($b*29)|0;
$4 = (($2) + ($3))|0;
$5 = $4 >>> 8;
$6 = $5&255;
return ($6|0);
}
function _stbi__pic_load_core($s,$width,$height,$comp,$result) {
$s = $s|0;
$width = $width|0;
$height = $height|0;
$comp = $comp|0;
$result = $result|0;
var $$ = 0, $$0 = 0, $$lcssa108 = 0, $$lcssa111 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $act_comp$0 = 0;
var $count3$0 = 0, $count3$1 = 0, $dest$038 = 0, $dest$135 = 0, $dest$2$lcssa = 0, $dest$230 = 0, $dest$327 = 0, $dest$425 = 0, $dest$523 = 0, $dest$6 = 0, $exitcond = 0, $exitcond57 = 0, $i$031 = 0, $i4$026 = 0, $i4$124 = 0, $left$036 = 0, $left2$028 = 0, $num_packets$0 = 0, $num_packets$0$lcssa105 = 0, $packet_idx$041 = 0;
var $packets = 0, $scevgep = 0, $scevgep56 = 0, $value = 0, $value5 = 0, $x$039 = 0, $y$044 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$packets = sp + 8|0;
$value = sp + 4|0;
$value5 = sp;
$act_comp$0 = 0;$num_packets$0 = 0;
while(1) {
$0 = ($num_packets$0|0)==(10);
if ($0) {
label = 3;
break;
}
$1 = (($num_packets$0) + 1)|0;
$2 = (_stbi__get8($s)|0);
$3 = (_stbi__get8($s)|0);
$4 = (($packets) + (($num_packets$0*3)|0)|0);
HEAP8[$4>>0] = $3;
$5 = (_stbi__get8($s)|0);
$6 = (((($packets) + (($num_packets$0*3)|0)|0)) + 1|0);
HEAP8[$6>>0] = $5;
$7 = (_stbi__get8($s)|0);
$8 = (((($packets) + (($num_packets$0*3)|0)|0)) + 2|0);
HEAP8[$8>>0] = $7;
$9 = $7&255;
$10 = $9 | $act_comp$0;
$11 = (_stbi__at_eof($s)|0);
$12 = ($11|0)==(0);
if (!($12)) {
label = 5;
break;
}
$13 = HEAP8[$4>>0]|0;
$14 = ($13<<24>>24)==(8);
if (!($14)) {
label = 7;
break;
}
$15 = ($2<<24>>24)==(0);
if ($15) {
$$lcssa108 = $1;$$lcssa111 = $10;$num_packets$0$lcssa105 = $num_packets$0;
label = 9;
break;
} else {
$act_comp$0 = $10;$num_packets$0 = $1;
}
}
if ((label|0) == 3) {
_stbi__err(19363);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 5) {
_stbi__err(19476);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 7) {
_stbi__err(19363);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 9) {
$16 = $$lcssa111 >>> 4;
$17 = $16 & 1;
$18 = (($17) + 3)|0;
HEAP32[$comp>>2] = $18;
$19 = ($height|0)>(0);
if (!($19)) {
$$0 = $result;
STACKTOP = sp;return ($$0|0);
}
$20 = ($num_packets$0$lcssa105|0)>(-1);
$21 = $width << 2;
$22 = ($width|0)>(0);
$23 = ($width|0)>(0);
$24 = ($width|0)>(0);
$y$044 = 0;
L13: while(1) {
L15: do {
if ($20) {
$25 = Math_imul($21, $y$044)|0;
$26 = (($result) + ($25)|0);
$packet_idx$041 = 0;
while(1) {
$27 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 1|0);
$28 = HEAP8[$27>>0]|0;
$29 = $28&255;
switch ($29|0) {
case 0: {
if ($22) {
$33 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
$34 = HEAP8[$33>>0]|0;
$35 = $34&255;
$dest$038 = $26;$x$039 = 0;
while(1) {
$36 = (_stbi__readval($s,$35,$dest$038)|0);
$37 = ($36|0)==(0|0);
if ($37) {
$$0 = 0;
label = 52;
break L13;
}
$38 = (($x$039) + 1)|0;
$39 = ((($dest$038)) + 4|0);
$40 = ($38|0)<($width|0);
if ($40) {
$dest$038 = $39;$x$039 = $38;
} else {
break;
}
}
}
break;
}
case 1: {
if ($23) {
$32 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
$dest$135 = $26;$left$036 = $width;
while(1) {
$41 = (_stbi__get8($s)|0);
$42 = (_stbi__at_eof($s)|0);
$43 = ($42|0)==(0);
if (!($43)) {
label = 24;
break L13;
}
$44 = HEAP8[$32>>0]|0;
$45 = $44&255;
$46 = (_stbi__readval($s,$45,$value)|0);
$47 = ($46|0)==(0|0);
if ($47) {
$$0 = 0;
label = 52;
break L13;
}
$48 = $41&255;
$49 = ($48|0)>($left$036|0);
$50 = $left$036&255;
$$ = $49 ? $50 : $41;
$51 = $$&255;
$52 = ($$<<24>>24)==(0);
if ($52) {
$dest$2$lcssa = $dest$135;
} else {
$53 = $$&255;
$54 = $53 << 2;
$dest$230 = $dest$135;$i$031 = 0;
while(1) {
$55 = HEAP8[$32>>0]|0;
$56 = $55&255;
_stbi__copyval($56,$dest$230,$value);
$57 = (($i$031) + 1)|0;
$58 = ((($dest$230)) + 4|0);
$exitcond57 = ($57|0)==($53|0);
if ($exitcond57) {
break;
} else {
$dest$230 = $58;$i$031 = $57;
}
}
$scevgep56 = (($dest$135) + ($54)|0);
$dest$2$lcssa = $scevgep56;
}
$59 = (($left$036) - ($51))|0;
$60 = ($59|0)>(0);
if ($60) {
$dest$135 = $dest$2$lcssa;$left$036 = $59;
} else {
break;
}
}
}
break;
}
case 2: {
if ($24) {
$30 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
$31 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
$dest$327 = $26;$left2$028 = $width;
while(1) {
$61 = (_stbi__get8($s)|0);
$62 = $61&255;
$63 = (_stbi__at_eof($s)|0);
$64 = ($63|0)==(0);
if (!($64)) {
label = 32;
break L13;
}
$65 = ($61<<24>>24)<(0);
if ($65) {
$66 = ($61<<24>>24)==(-128);
if ($66) {
$67 = (_stbi__get16be($s)|0);
$count3$0 = $67;
} else {
$68 = (($62) + -127)|0;
$count3$0 = $68;
}
$69 = ($count3$0|0)>($left2$028|0);
if ($69) {
label = 38;
break L13;
}
$70 = HEAP8[$30>>0]|0;
$71 = $70&255;
$72 = (_stbi__readval($s,$71,$value5)|0);
$73 = ($72|0)==(0|0);
if ($73) {
$$0 = 0;
label = 52;
break L13;
}
$74 = ($count3$0|0)>(0);
if ($74) {
$75 = $count3$0 << 2;
$dest$425 = $dest$327;$i4$026 = 0;
while(1) {
$76 = HEAP8[$30>>0]|0;
$77 = $76&255;
_stbi__copyval($77,$dest$425,$value5);
$78 = (($i4$026) + 1)|0;
$79 = ((($dest$425)) + 4|0);
$exitcond = ($78|0)==($count3$0|0);
if ($exitcond) {
break;
} else {
$dest$425 = $79;$i4$026 = $78;
}
}
$scevgep = (($dest$327) + ($75)|0);
$count3$1 = $count3$0;$dest$6 = $scevgep;
} else {
$count3$1 = $count3$0;$dest$6 = $dest$327;
}
} else {
$80 = (($62) + 1)|0;
$81 = ($62|0)<($left2$028|0);
if (!($81)) {
label = 45;
break L13;
}
$82 = HEAP8[$31>>0]|0;
$83 = $82&255;
$dest$523 = $dest$327;$i4$124 = 0;
while(1) {
$84 = (_stbi__readval($s,$83,$dest$523)|0);
$85 = ($84|0)==(0|0);
if ($85) {
$$0 = 0;
label = 52;
break L13;
}
$86 = (($i4$124) + 1)|0;
$87 = ((($dest$523)) + 4|0);
$88 = ($86|0)<($80|0);
if ($88) {
$dest$523 = $87;$i4$124 = $86;
} else {
$count3$1 = $80;$dest$6 = $87;
break;
}
}
}
$89 = (($left2$028) - ($count3$1))|0;
$90 = ($89|0)>(0);
if ($90) {
$dest$327 = $dest$6;$left2$028 = $89;
} else {
break;
}
}
}
break;
}
default: {
label = 20;
break L13;
}
}
$91 = (($packet_idx$041) + 1)|0;
$92 = ($91|0)<($$lcssa108|0);
if ($92) {
$packet_idx$041 = $91;
} else {
break L15;
}
}
}
} while(0);
$93 = (($y$044) + 1)|0;
$94 = ($93|0)<($height|0);
if ($94) {
$y$044 = $93;
} else {
$$0 = $result;
label = 52;
break;
}
}
if ((label|0) == 20) {
_stbi__err(19363);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 24) {
_stbi__err(19476);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 32) {
_stbi__err(19476);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 38) {
_stbi__err(19476);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 45) {
_stbi__err(19476);
$$0 = 0;
STACKTOP = sp;return ($$0|0);
}
else if ((label|0) == 52) {
STACKTOP = sp;return ($$0|0);
}
}
return (0)|0;
}
function _stbi__readval($s,$channel,$dest) {
$s = $s|0;
$channel = $channel|0;
$dest = $dest|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $channel & 128;
$1 = ($0|0)==(0);
if ($1) {
label = 5;
} else {
$2 = (_stbi__at_eof($s)|0);
$3 = ($2|0)==(0);
if ($3) {
$4 = (_stbi__get8($s)|0);
HEAP8[$dest>>0] = $4;
label = 5;
}
}
do {
if ((label|0) == 5) {
$5 = $channel & 64;
$6 = ($5|0)==(0);
if (!($6)) {
$7 = (_stbi__at_eof($s)|0);
$8 = ($7|0)==(0);
if (!($8)) {
break;
}
$9 = (_stbi__get8($s)|0);
$10 = ((($dest)) + 1|0);
HEAP8[$10>>0] = $9;
}
$11 = $channel & 32;
$12 = ($11|0)==(0);
if (!($12)) {
$13 = (_stbi__at_eof($s)|0);
$14 = ($13|0)==(0);
if (!($14)) {
break;
}
$15 = (_stbi__get8($s)|0);
$16 = ((($dest)) + 2|0);
HEAP8[$16>>0] = $15;
}
$17 = $channel & 16;
$18 = ($17|0)==(0);
if ($18) {
$$0 = $dest;
return ($$0|0);
}
$19 = (_stbi__at_eof($s)|0);
$20 = ($19|0)==(0);
if ($20) {
$21 = (_stbi__get8($s)|0);
$22 = ((($dest)) + 3|0);
HEAP8[$22>>0] = $21;
$$0 = $dest;
return ($$0|0);
}
}
} while(0);
_stbi__err(19476);
$$0 = 0;
return ($$0|0);
}
function _stbi__copyval($channel,$dest,$src) {
$channel = $channel|0;
$dest = $dest|0;
$src = $src|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $channel & 128;
$1 = ($0|0)==(0);
if (!($1)) {
$2 = HEAP8[$src>>0]|0;
HEAP8[$dest>>0] = $2;
}
$3 = $channel & 64;
$4 = ($3|0)==(0);
if (!($4)) {
$5 = ((($src)) + 1|0);
$6 = HEAP8[$5>>0]|0;
$7 = ((($dest)) + 1|0);
HEAP8[$7>>0] = $6;
}
$8 = $channel & 32;
$9 = ($8|0)==(0);
if (!($9)) {
$10 = ((($src)) + 2|0);
$11 = HEAP8[$10>>0]|0;
$12 = ((($dest)) + 2|0);
HEAP8[$12>>0] = $11;
}
$13 = $channel & 16;
$14 = ($13|0)==(0);
if ($14) {
return;
}
$15 = ((($src)) + 3|0);
$16 = HEAP8[$15>>0]|0;
$17 = ((($dest)) + 3|0);
HEAP8[$17>>0] = $16;
return;
}
function _stbi__pic_test_core($s) {
$s = $s|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__pic_is4($s,17758)|0);
$1 = ($0|0)==(0);
if ($1) {
$$0 = 0;
return ($$0|0);
} else {
$i$01 = 0;
}
while(1) {
(_stbi__get8($s)|0);
$2 = (($i$01) + 1)|0;
$exitcond = ($2|0)==(84);
if ($exitcond) {
break;
} else {
$i$01 = $2;
}
}
$3 = (_stbi__pic_is4($s,19485)|0);
$not$ = ($3|0)!=(0);
$$ = $not$&1;
$$0 = $$;
return ($$0|0);
}
function _stbi__gif_load_next($s,$g,$comp) {
$s = $s|0;
$g = $g|0;
$comp = $comp|0;
var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
var $99 = 0, $i$02 = 0, $prev_trans$0 = 0, $prev_trans$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($g)) + 8|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
do {
if ($2) {
$3 = (_stbi__gif_header($s,$g,$comp,0)|0);
$4 = ($3|0)==(0);
if ($4) {
$$0 = 0;
return ($$0|0);
} else {
$$pr = HEAP32[$0>>2]|0;
$20 = $$pr;
break;
}
} else {
$20 = $1;
}
} while(0);
$5 = HEAP32[$g>>2]|0;
$6 = $5 << 2;
$7 = ((($g)) + 4|0);
$8 = HEAP32[$7>>2]|0;
$9 = Math_imul($6, $8)|0;
$10 = (_stbi__malloc($9)|0);
HEAP32[$0>>2] = $10;
$11 = ($10|0)==(0|0);
if ($11) {
_stbi__err(18059);
$$0 = 0;
return ($$0|0);
}
$12 = ((($g)) + 32|0);
$13 = HEAP32[$12>>2]|0;
$14 = $13 >>> 2;
$15 = $14 & 7;
switch ($15|0) {
case 0: {
$16 = HEAP32[$g>>2]|0;
$17 = $16 << 2;
$18 = HEAP32[$7>>2]|0;
$19 = Math_imul($17, $18)|0;
_stbi__fill_gif_background($g,0,0,$17,$19);
break;
}
case 1: {
$21 = ($20|0)==(0|0);
if (!($21)) {
$22 = HEAP32[$g>>2]|0;
$23 = $22 << 2;
$24 = HEAP32[$7>>2]|0;
$25 = Math_imul($23, $24)|0;
_memcpy(($10|0),($20|0),($25|0))|0;
}
$26 = ((($g)) + 12|0);
HEAP32[$26>>2] = $20;
break;
}
case 2: {
$27 = ($20|0)==(0|0);
if (!($27)) {
$28 = HEAP32[$g>>2]|0;
$29 = $28 << 2;
$30 = HEAP32[$7>>2]|0;
$31 = Math_imul($29, $30)|0;
_memcpy(($10|0),($20|0),($31|0))|0;
}
$32 = ((($g)) + 18488|0);
$33 = HEAP32[$32>>2]|0;
$34 = ((($g)) + 18492|0);
$35 = HEAP32[$34>>2]|0;
$36 = ((($g)) + 18496|0);
$37 = HEAP32[$36>>2]|0;
$38 = ((($g)) + 18500|0);
$39 = HEAP32[$38>>2]|0;
_stbi__fill_gif_background($g,$33,$35,$37,$39);
break;
}
case 3: {
$40 = ((($g)) + 12|0);
$41 = HEAP32[$40>>2]|0;
$42 = ($41|0)==(0|0);
if (!($42)) {
$45 = ((($g)) + 18492|0);
$46 = HEAP32[$45>>2]|0;
$47 = ((($g)) + 18500|0);
$48 = HEAP32[$47>>2]|0;
$49 = ($46|0)<($48|0);
if ($49) {
$50 = ((($g)) + 18488|0);
$51 = ((($g)) + 18496|0);
$i$02 = $46;
while(1) {
$52 = HEAP32[$50>>2]|0;
$53 = (($52) + ($i$02))|0;
$54 = HEAP32[$0>>2]|0;
$55 = (($54) + ($53)|0);
$56 = HEAP32[$40>>2]|0;
$57 = (($56) + ($53)|0);
$58 = HEAP32[$51>>2]|0;
$59 = (($58) - ($52))|0;
_memcpy(($55|0),($57|0),($59|0))|0;
$60 = HEAP32[$g>>2]|0;
$61 = $60 << 2;
$62 = (($61) + ($i$02))|0;
$63 = HEAP32[$47>>2]|0;
$64 = ($62|0)<($63|0);
if ($64) {
$i$02 = $62;
} else {
break;
}
}
}
}
break;
}
default: {
}
}
$43 = ((($g)) + 36|0);
$44 = ((($g)) + 28|0);
L27: while(1) {
$65 = (_stbi__get8($s)|0);
$66 = $65&255;
switch ($66|0) {
case 44: {
label = 20;
break L27;
break;
}
case 59: {
label = 45;
break L27;
break;
}
case 33: {
break;
}
default: {
label = 46;
break L27;
}
}
$143 = (_stbi__get8($s)|0);
$144 = ($143<<24>>24)==(-7);
do {
if ($144) {
$147 = (_stbi__get8($s)|0);
$148 = ($147<<24>>24)==(4);
if ($148) {
$149 = (_stbi__get8($s)|0);
$150 = $149&255;
HEAP32[$12>>2] = $150;
$151 = (_stbi__get16le($s)|0);
HEAP32[$43>>2] = $151;
$152 = (_stbi__get8($s)|0);
$153 = $152&255;
HEAP32[$44>>2] = $153;
break;
} else {
$154 = $147&255;
_stbi__skip($s,$154);
continue L27;
}
}
} while(0);
$145 = (_stbi__get8($s)|0);
$146 = ($145<<24>>24)==(0);
if ($146) {
continue;
} else {
$156 = $145;
}
while(1) {
$155 = $156&255;
_stbi__skip($s,$155);
$157 = (_stbi__get8($s)|0);
$158 = ($157<<24>>24)==(0);
if ($158) {
continue L27;
} else {
$156 = $157;
}
}
}
if ((label|0) == 20) {
$67 = (_stbi__get16le($s)|0);
$68 = (_stbi__get16le($s)|0);
$69 = (_stbi__get16le($s)|0);
$70 = (_stbi__get16le($s)|0);
$71 = (($69) + ($67))|0;
$72 = HEAP32[$g>>2]|0;
$73 = ($71|0)>($72|0);
if (!($73)) {
$74 = (($70) + ($68))|0;
$75 = HEAP32[$7>>2]|0;
$76 = ($74|0)>($75|0);
if (!($76)) {
$77 = $72 << 2;
$78 = ((($g)) + 18512|0);
HEAP32[$78>>2] = $77;
$79 = $67 << 2;
$80 = ((($g)) + 18488|0);
HEAP32[$80>>2] = $79;
$81 = HEAP32[$78>>2]|0;
$82 = Math_imul($81, $68)|0;
$83 = ((($g)) + 18492|0);
HEAP32[$83>>2] = $82;
$84 = HEAP32[$80>>2]|0;
$85 = $69 << 2;
$86 = (($84) + ($85))|0;
$87 = ((($g)) + 18496|0);
HEAP32[$87>>2] = $86;
$88 = HEAP32[$83>>2]|0;
$89 = HEAP32[$78>>2]|0;
$90 = Math_imul($89, $70)|0;
$91 = (($90) + ($88))|0;
$92 = ((($g)) + 18500|0);
HEAP32[$92>>2] = $91;
$93 = HEAP32[$80>>2]|0;
$94 = ((($g)) + 18504|0);
HEAP32[$94>>2] = $93;
$95 = HEAP32[$83>>2]|0;
$96 = ((($g)) + 18508|0);
HEAP32[$96>>2] = $95;
$97 = (_stbi__get8($s)|0);
$98 = $97&255;
$99 = ((($g)) + 18484|0);
HEAP32[$99>>2] = $98;
$100 = $98 & 64;
$101 = ($100|0)==(0);
$102 = HEAP32[$78>>2]|0;
if ($101) {
$106 = ((($g)) + 18480|0);
HEAP32[$106>>2] = $102;
$107 = ((($g)) + 18476|0);
HEAP32[$107>>2] = 0;
} else {
$103 = $102 << 3;
$104 = ((($g)) + 18480|0);
HEAP32[$104>>2] = $103;
$105 = ((($g)) + 18476|0);
HEAP32[$105>>2] = 3;
}
$108 = HEAP32[$99>>2]|0;
$109 = $108 & 128;
$110 = ($109|0)==(0);
if ($110) {
$121 = ((($g)) + 16|0);
$122 = HEAP32[$121>>2]|0;
$123 = $122 & 128;
$124 = ($123|0)==(0);
if ($124) {
_stbi__err(19594);
$$0 = 0;
return ($$0|0);
}
$125 = ((($g)) + 28|0);
$126 = HEAP32[$125>>2]|0;
$127 = ($126|0)>(-1);
if ($127) {
$128 = HEAP32[$12>>2]|0;
$129 = $128 & 1;
$130 = ($129|0)==(0);
if ($130) {
$prev_trans$0 = -1;
} else {
$131 = (((((($g)) + 40|0) + ($126<<2)|0)) + 3|0);
$132 = HEAP8[$131>>0]|0;
$133 = $132&255;
HEAP8[$131>>0] = 0;
$prev_trans$0 = $133;
}
} else {
$prev_trans$0 = -1;
}
$134 = ((($g)) + 40|0);
$135 = ((($g)) + 18472|0);
HEAP32[$135>>2] = $134;
$prev_trans$1 = $prev_trans$0;
} else {
$111 = ((($g)) + 1064|0);
$112 = $108 & 7;
$113 = 2 << $112;
$114 = HEAP32[$12>>2]|0;
$115 = $114 & 1;
$116 = ($115|0)==(0);
if ($116) {
$119 = -1;
} else {
$117 = ((($g)) + 28|0);
$118 = HEAP32[$117>>2]|0;
$119 = $118;
}
_stbi__gif_parse_colortable($s,$111,$113,$119);
$120 = ((($g)) + 18472|0);
HEAP32[$120>>2] = $111;
$prev_trans$1 = -1;
}
$136 = (_stbi__process_gif_raster($s,$g)|0);
$137 = ($136|0)==(0|0);
if ($137) {
$$0 = 0;
return ($$0|0);
}
$138 = ($prev_trans$1|0)==(-1);
if ($138) {
$$0 = $136;
return ($$0|0);
}
$139 = $prev_trans$1&255;
$140 = ((($g)) + 28|0);
$141 = HEAP32[$140>>2]|0;
$142 = (((((($g)) + 40|0) + ($141<<2)|0)) + 3|0);
HEAP8[$142>>0] = $139;
$$0 = $136;
return ($$0|0);
}
}
_stbi__err(19573);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 45) {
$$0 = $s;
return ($$0|0);
}
else if ((label|0) == 46) {
_stbi__err(19614);
$$0 = 0;
return ($$0|0);
}
return (0)|0;
}
function _stbi__fill_gif_background($g,$x0,$y0,$x1,$y1) {
$g = $g|0;
$x0 = $x0|0;
$y0 = $y0|0;
$x1 = $x1|0;
$y1 = $y1|0;
var $$sum = 0, $$sum1 = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0;
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $x$03 = 0, $y$04 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($g)) + 20|0);
$1 = HEAP32[$0>>2]|0;
$2 = (((($g)) + 40|0) + ($1<<2)|0);
$3 = ($y0|0)<($y1|0);
if (!($3)) {
return;
}
$4 = ($x0|0)<($x1|0);
$5 = ((($g)) + 8|0);
$6 = (((((($g)) + 40|0) + ($1<<2)|0)) + 2|0);
$7 = (((((($g)) + 40|0) + ($1<<2)|0)) + 1|0);
$y$04 = $y0;
while(1) {
if ($4) {
$x$03 = $x0;
while(1) {
$8 = (($x$03) + ($y$04))|0;
$9 = HEAP32[$5>>2]|0;
$10 = (($9) + ($8)|0);
$11 = HEAP8[$6>>0]|0;
HEAP8[$10>>0] = $11;
$12 = HEAP8[$7>>0]|0;
$$sum = (($8) + 1)|0;
$13 = (($9) + ($$sum)|0);
HEAP8[$13>>0] = $12;
$14 = HEAP8[$2>>0]|0;
$$sum1 = (($8) + 2)|0;
$15 = (($9) + ($$sum1)|0);
HEAP8[$15>>0] = $14;
$$sum2 = (($8) + 3)|0;
$16 = (($9) + ($$sum2)|0);
HEAP8[$16>>0] = 0;
$17 = (($x$03) + 4)|0;
$18 = ($17|0)<($x1|0);
if ($18) {
$x$03 = $17;
} else {
break;
}
}
}
$19 = HEAP32[$g>>2]|0;
$20 = $19 << 2;
$21 = (($20) + ($y$04))|0;
$22 = ($21|0)<($y1|0);
if ($22) {
$y$04 = $21;
} else {
break;
}
}
return;
}
function _stbi__process_gif_raster($s,$g) {
$s = $s|0;
$g = $g|0;
var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $avail$0$ph = 0;
var $avail$0$ph7 = 0, $avail$1 = 0, $bits$0$lcssa = 0, $bits$0$ph = 0, $bits$0$ph3 = 0, $bits$0$ph9 = 0, $bits$040 = 0, $codemask$0$ph = 0, $codemask$0$ph$in = 0, $codesize$0$ph = 0, $codesize$0$ph$in = 0, $first$0$ph = 0, $init_code$047 = 0, $len$0$lcssa = 0, $len$0$lcssa$lcssa169 = 0, $len$0$ph = 0, $len$0$ph11 = 0, $len$0$ph5 = 0, $len$042 = 0, $len$1 = 0;
var $oldcode$0$ph = 0, $oldcode$0$ph8 = 0, $or$cond = 0, $valid_bits$0$lcssa = 0, $valid_bits$0$ph = 0, $valid_bits$0$ph10 = 0, $valid_bits$0$ph4 = 0, $valid_bits$041 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = $0&255;
$2 = ($0&255)>(12);
if ($2) {
$$0 = 0;
return ($$0|0);
}
$3 = 1 << $1;
$init_code$047 = 0;
while(1) {
$4 = (((($g)) + 2088|0) + ($init_code$047<<2)|0);
HEAP16[$4>>1] = -1;
$5 = $init_code$047&255;
$6 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 2|0);
HEAP8[$6>>0] = $5;
$7 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 3|0);
HEAP8[$7>>0] = $5;
$8 = (($init_code$047) + 1)|0;
$9 = ($8|0)<($3|0);
if ($9) {
$init_code$047 = $8;
} else {
break;
}
}
$10 = (($3) + 2)|0;
$11 = (($3) + 1)|0;
$bits$0$ph = 0;$first$0$ph = 0;$len$0$ph = 0;$valid_bits$0$ph = 0;
L7: while(1) {
$avail$0$ph = $10;$bits$0$ph3 = $bits$0$ph;$codesize$0$ph$in = $1;$len$0$ph5 = $len$0$ph;$oldcode$0$ph = -1;$valid_bits$0$ph4 = $valid_bits$0$ph;
L9: while(1) {
$codesize$0$ph = (($codesize$0$ph$in) + 1)|0;
$codemask$0$ph$in = 1 << $codesize$0$ph;
$codemask$0$ph = (($codemask$0$ph$in) + -1)|0;
$avail$0$ph7 = $avail$0$ph;$bits$0$ph9 = $bits$0$ph3;$len$0$ph11 = $len$0$ph5;$oldcode$0$ph8 = $oldcode$0$ph;$valid_bits$0$ph10 = $valid_bits$0$ph4;
while(1) {
$12 = ($valid_bits$0$ph10|0)<($codesize$0$ph|0);
if ($12) {
$bits$040 = $bits$0$ph9;$len$042 = $len$0$ph11;$valid_bits$041 = $valid_bits$0$ph10;
while(1) {
$13 = ($len$042|0)==(0);
if ($13) {
$14 = (_stbi__get8($s)|0);
$15 = $14&255;
$16 = ($14<<24>>24)==(0);
if ($16) {
label = 10;
break L7;
} else {
$len$1 = $15;
}
} else {
$len$1 = $len$042;
}
$19 = (($len$1) + -1)|0;
$20 = (_stbi__get8($s)|0);
$21 = $20&255;
$22 = $21 << $valid_bits$041;
$23 = $22 | $bits$040;
$24 = (($valid_bits$041) + 8)|0;
$25 = ($24|0)<($codesize$0$ph|0);
if ($25) {
$bits$040 = $23;$len$042 = $19;$valid_bits$041 = $24;
} else {
$bits$0$lcssa = $23;$len$0$lcssa = $19;$valid_bits$0$lcssa = $24;
break;
}
}
} else {
$bits$0$lcssa = $bits$0$ph9;$len$0$lcssa = $len$0$ph11;$valid_bits$0$lcssa = $valid_bits$0$ph10;
}
$26 = $bits$0$lcssa & $codemask$0$ph;
$27 = $bits$0$lcssa >> $codesize$0$ph;
$28 = (($valid_bits$0$lcssa) - ($codesize$0$ph))|0;
$29 = ($26|0)==($3|0);
if ($29) {
$bits$0$ph = $27;$first$0$ph = 1;$len$0$ph = $len$0$lcssa;$valid_bits$0$ph = $28;
continue L7;
}
$30 = ($26|0)==($11|0);
if ($30) {
$len$0$lcssa$lcssa169 = $len$0$lcssa;
label = 14;
break L7;
}
$39 = ($26|0)>($avail$0$ph7|0);
if ($39) {
label = 29;
break L7;
}
if (!($first$0$ph)) {
label = 19;
break L7;
}
$40 = ($oldcode$0$ph8|0)>(-1);
if ($40) {
$41 = (($avail$0$ph7) + 1)|0;
$42 = ($avail$0$ph7|0)>(4095);
if ($42) {
label = 22;
break L7;
}
$43 = $oldcode$0$ph8&65535;
$44 = (((($g)) + 2088|0) + ($avail$0$ph7<<2)|0);
HEAP16[$44>>1] = $43;
$45 = (((((($g)) + 2088|0) + ($oldcode$0$ph8<<2)|0)) + 2|0);
$46 = HEAP8[$45>>0]|0;
$47 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 2|0);
HEAP8[$47>>0] = $46;
$48 = ($26|0)==($41|0);
if ($48) {
$$sink = $46;
} else {
$49 = (((((($g)) + 2088|0) + ($26<<2)|0)) + 2|0);
$50 = HEAP8[$49>>0]|0;
$$sink = $50;
}
$51 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 3|0);
HEAP8[$51>>0] = $$sink;
$avail$1 = $41;
} else {
$52 = ($26|0)==($avail$0$ph7|0);
if ($52) {
label = 27;
break L7;
} else {
$avail$1 = $avail$0$ph7;
}
}
$53 = $26&65535;
_stbi__out_gif_code($g,$53);
$54 = $avail$1 & $codemask$0$ph;
$55 = ($54|0)==(0);
$56 = ($avail$1|0)<(4096);
$or$cond = $56 & $55;
if ($or$cond) {
$avail$0$ph = $avail$1;$bits$0$ph3 = $27;$codesize$0$ph$in = $codesize$0$ph;$len$0$ph5 = $len$0$lcssa;$oldcode$0$ph = $26;$valid_bits$0$ph4 = $28;
continue L9;
} else {
$avail$0$ph7 = $avail$1;$bits$0$ph9 = $27;$len$0$ph11 = $len$0$lcssa;$oldcode$0$ph8 = $26;$valid_bits$0$ph10 = $28;
}
}
}
}
if ((label|0) == 10) {
$17 = ((($g)) + 8|0);
$18 = HEAP32[$17>>2]|0;
$$0 = $18;
return ($$0|0);
}
else if ((label|0) == 14) {
_stbi__skip($s,$len$0$lcssa$lcssa169);
$31 = (_stbi__get8($s)|0);
$32 = ($31<<24>>24)==(0);
if (!($32)) {
$34 = $31;
while(1) {
$33 = $34&255;
_stbi__skip($s,$33);
$35 = (_stbi__get8($s)|0);
$36 = ($35<<24>>24)==(0);
if ($36) {
break;
} else {
$34 = $35;
}
}
}
$37 = ((($g)) + 8|0);
$38 = HEAP32[$37>>2]|0;
$$0 = $38;
return ($$0|0);
}
else if ((label|0) == 19) {
_stbi__err(19627);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 22) {
_stbi__err(19641);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 27) {
_stbi__err(19656);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 29) {
_stbi__err(19656);
$$0 = 0;
return ($$0|0);
}
return (0)|0;
}
function _stbi__out_gif_code($g,$code) {
$g = $g|0;
$code = $code|0;
var $$pr = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0;
var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $code&65535;
$1 = (((($g)) + 2088|0) + ($0<<2)|0);
$2 = HEAP16[$1>>1]|0;
$3 = ($2<<16>>16)>(-1);
if ($3) {
_stbi__out_gif_code($g,$2);
}
$4 = ((($g)) + 18508|0);
$5 = HEAP32[$4>>2]|0;
$6 = ((($g)) + 18500|0);
$7 = HEAP32[$6>>2]|0;
$8 = ($5|0)<($7|0);
if (!($8)) {
return;
}
$9 = ((($g)) + 18504|0);
$10 = HEAP32[$9>>2]|0;
$11 = (($10) + ($5))|0;
$12 = ((($g)) + 8|0);
$13 = HEAP32[$12>>2]|0;
$14 = (((((($g)) + 2088|0) + ($0<<2)|0)) + 3|0);
$15 = HEAP8[$14>>0]|0;
$16 = $15&255;
$17 = $16 << 2;
$18 = ((($g)) + 18472|0);
$19 = HEAP32[$18>>2]|0;
$$sum1 = $17 | 3;
$20 = (($19) + ($$sum1)|0);
$21 = HEAP8[$20>>0]|0;
$22 = ($21<<24>>24)<(0);
if ($22) {
$23 = (($19) + ($17)|0);
$24 = (($13) + ($11)|0);
$$sum2 = $17 | 2;
$25 = (($19) + ($$sum2)|0);
$26 = HEAP8[$25>>0]|0;
HEAP8[$24>>0] = $26;
$$sum3 = $17 | 1;
$27 = (($19) + ($$sum3)|0);
$28 = HEAP8[$27>>0]|0;
$$sum = (($11) + 1)|0;
$29 = (($13) + ($$sum)|0);
HEAP8[$29>>0] = $28;
$30 = HEAP8[$23>>0]|0;
$$sum4 = (($11) + 2)|0;
$31 = (($13) + ($$sum4)|0);
HEAP8[$31>>0] = $30;
$32 = HEAP8[$20>>0]|0;
$$sum5 = (($11) + 3)|0;
$33 = (($13) + ($$sum5)|0);
HEAP8[$33>>0] = $32;
}
$34 = HEAP32[$9>>2]|0;
$35 = (($34) + 4)|0;
HEAP32[$9>>2] = $35;
$36 = ((($g)) + 18496|0);
$37 = HEAP32[$36>>2]|0;
$38 = ($35|0)<($37|0);
if ($38) {
return;
}
$39 = ((($g)) + 18488|0);
$40 = HEAP32[$39>>2]|0;
HEAP32[$9>>2] = $40;
$41 = ((($g)) + 18480|0);
$42 = HEAP32[$41>>2]|0;
$43 = HEAP32[$4>>2]|0;
$44 = (($43) + ($42))|0;
HEAP32[$4>>2] = $44;
$45 = ((($g)) + 18476|0);
$46 = HEAP32[$6>>2]|0;
$47 = ($44|0)<($46|0);
if ($47) {
return;
}
$48 = ((($g)) + 18512|0);
$49 = ((($g)) + 18492|0);
$$pr = HEAP32[$45>>2]|0;
$50 = $$pr;
while(1) {
$51 = ($50|0)>(0);
if (!($51)) {
label = 11;
break;
}
$52 = HEAP32[$48>>2]|0;
$53 = $52 << $50;
HEAP32[$41>>2] = $53;
$54 = HEAP32[$49>>2]|0;
$55 = $53 >> 1;
$56 = (($55) + ($54))|0;
HEAP32[$4>>2] = $56;
$57 = HEAP32[$45>>2]|0;
$58 = (($57) + -1)|0;
HEAP32[$45>>2] = $58;
$59 = HEAP32[$4>>2]|0;
$60 = HEAP32[$6>>2]|0;
$61 = ($59|0)<($60|0);
if ($61) {
label = 11;
break;
} else {
$50 = $58;
}
}
if ((label|0) == 11) {
return;
}
}
function _stbi__gif_test_raw($s) {
$s = $s|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = ($0<<24>>24)==(71);
L1: do {
if ($1) {
$2 = (_stbi__get8($s)|0);
$3 = ($2<<24>>24)==(73);
if ($3) {
$4 = (_stbi__get8($s)|0);
$5 = ($4<<24>>24)==(70);
if ($5) {
$6 = (_stbi__get8($s)|0);
$7 = ($6<<24>>24)==(56);
if ($7) {
$8 = (_stbi__get8($s)|0);
switch ($8<<24>>24) {
case 55: case 57: {
break;
}
default: {
$$0 = 0;
break L1;
}
}
$9 = (_stbi__get8($s)|0);
$10 = ($9<<24>>24)==(97);
$$ = $10&1;
$$0 = $$;
} else {
$$0 = 0;
}
} else {
$$0 = 0;
}
} else {
$$0 = 0;
}
} else {
$$0 = 0;
}
} while(0);
return ($$0|0);
}
function _stbi__high_bit($z) {
$z = $z|0;
var $$ = 0, $$01 = 0, $$1 = 0, $$2 = 0, $$3 = 0, $$n$3 = 0, $$z = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, $n$1 = 0, $n$2 = 0, $n$3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($z|0)==(0);
if ($0) {
$$01 = -1;
return ($$01|0);
}
$1 = ($z>>>0)>(65535);
$2 = $z >>> 16;
$$z = $1 ? $2 : $z;
$$ = $1 ? 16 : 0;
$3 = ($$z>>>0)>(255);
$4 = $$ | 8;
$5 = $$z >>> 8;
$$1 = $3 ? $5 : $$z;
$n$1 = $3 ? $4 : $$;
$6 = ($$1>>>0)>(15);
$7 = $n$1 | 4;
$8 = $$1 >>> 4;
$$2 = $6 ? $8 : $$1;
$n$2 = $6 ? $7 : $n$1;
$9 = ($$2>>>0)>(3);
$10 = $n$2 | 2;
$11 = $$2 >>> 2;
$$3 = $9 ? $11 : $$2;
$n$3 = $9 ? $10 : $n$2;
$12 = ($$3>>>0)>(1);
$13 = $12&1;
$$n$3 = (($13) + ($n$3))|0;
$$01 = $$n$3;
return ($$01|0);
}
function _stbi__bitcount($a) {
$a = $a|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $a & 1431655765;
$1 = $a >>> 1;
$2 = $1 & 1431655765;
$3 = (($2) + ($0))|0;
$4 = $3 & 858993459;
$5 = $3 >>> 2;
$6 = $5 & 858993459;
$7 = (($6) + ($4))|0;
$8 = $7 >>> 4;
$9 = (($8) + ($7))|0;
$10 = $9 & 252645135;
$11 = $10 >>> 8;
$12 = (($11) + ($10))|0;
$13 = $12 >>> 16;
$14 = (($13) + ($12))|0;
$15 = $14 & 255;
return ($15|0);
}
function _stbi__shiftsigned($v,$shift,$bits) {
$v = $v|0;
$shift = $shift|0;
$bits = $bits|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $result$0$lcssa = 0, $result$01 = 0, $z$02 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($shift|0)<(0);
$1 = (0 - ($shift))|0;
$2 = $v << $1;
$3 = $v >> $shift;
$$0 = $0 ? $2 : $3;
$4 = ($bits|0)<(8);
if ($4) {
$result$01 = $$0;$z$02 = $bits;
} else {
$result$0$lcssa = $$0;
return ($result$0$lcssa|0);
}
while(1) {
$5 = $$0 >> $z$02;
$6 = (($5) + ($result$01))|0;
$7 = (($z$02) + ($bits))|0;
$8 = ($7|0)<(8);
if ($8) {
$result$01 = $6;$z$02 = $7;
} else {
$result$0$lcssa = $6;
break;
}
}
return ($result$0$lcssa|0);
}
function _stbi__bmp_test_raw($s) {
$s = $s|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbi__get8($s)|0);
$1 = ($0<<24>>24)==(66);
if (!($1)) {
$$0 = 0;
return ($$0|0);
}
$2 = (_stbi__get8($s)|0);
$3 = ($2<<24>>24)==(77);
if (!($3)) {
$$0 = 0;
return ($$0|0);
}
(_stbi__get32le($s)|0);
(_stbi__get16le($s)|0);
(_stbi__get16le($s)|0);
(_stbi__get32le($s)|0);
$4 = (_stbi__get32le($s)|0);
switch ($4|0) {
case 124: case 12: case 40: case 56: case 108: {
$$0 = 1;
return ($$0|0);
break;
}
default: {
}
}
$$0 = 0;
return ($$0|0);
}
function _stbi__do_png($p,$x,$y,$n,$req_comp) {
$p = $p|0;
$x = $x|0;
$y = $y|0;
$n = $n|0;
$req_comp = $req_comp|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $result$0 = 0, $result$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($req_comp>>>0)>(4);
if ($0) {
_stbi__err(19705);
$$0 = 0;
return ($$0|0);
}
$1 = (_stbi__parse_png_file($p,0,$req_comp)|0);
$2 = ($1|0)==(0);
if ($2) {
$result$1 = 0;
} else {
$3 = ((($p)) + 12|0);
$4 = HEAP32[$3>>2]|0;
HEAP32[$3>>2] = 0;
$5 = ($req_comp|0)==(0);
if ($5) {
$result$0 = $4;
} else {
$6 = HEAP32[$p>>2]|0;
$7 = ((($6)) + 12|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($8|0)==($req_comp|0);
if ($9) {
$result$0 = $4;
} else {
$10 = HEAP32[$6>>2]|0;
$11 = ((($6)) + 4|0);
$12 = HEAP32[$11>>2]|0;
$13 = (_stbi__convert_format($4,$8,$req_comp,$10,$12)|0);
$14 = HEAP32[$p>>2]|0;
$15 = ((($14)) + 12|0);
HEAP32[$15>>2] = $req_comp;
$16 = ($13|0)==(0|0);
if ($16) {
$$0 = 0;
return ($$0|0);
} else {
$result$0 = $13;
}
}
}
$17 = HEAP32[$p>>2]|0;
$18 = HEAP32[$17>>2]|0;
HEAP32[$x>>2] = $18;
$19 = HEAP32[$p>>2]|0;
$20 = ((($19)) + 4|0);
$21 = HEAP32[$20>>2]|0;
HEAP32[$y>>2] = $21;
$22 = ($n|0)==(0|0);
if ($22) {
$result$1 = $result$0;
} else {
$23 = HEAP32[$p>>2]|0;
$24 = ((($23)) + 12|0);
$25 = HEAP32[$24>>2]|0;
HEAP32[$n>>2] = $25;
$result$1 = $result$0;
}
}
$26 = ((($p)) + 12|0);
$27 = HEAP32[$26>>2]|0;
_free($27);
HEAP32[$26>>2] = 0;
$28 = ((($p)) + 8|0);
$29 = HEAP32[$28>>2]|0;
_free($29);
HEAP32[$28>>2] = 0;
$30 = ((($p)) + 4|0);
$31 = HEAP32[$30>>2]|0;
_free($31);
HEAP32[$30>>2] = 0;
$$0 = $result$1;
return ($$0|0);
}
function _stbi__setup_jpeg($j) {
$j = $j|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18176|0);
HEAP32[$0>>2] = 2;
$1 = ((($j)) + 18180|0);
HEAP32[$1>>2] = 1;
$2 = ((($j)) + 18184|0);
HEAP32[$2>>2] = 1;
return;
}
function _load_jpeg_image($z,$out_x,$out_y,$comp,$req_comp) {
$z = $z|0;
$out_x = $out_x|0;
$out_y = $out_y|0;
$comp = $comp|0;
$req_comp = $req_comp|0;
var $$ = 0, $$0 = 0, $$1 = 0, $$in = 0, $$in4 = 0, $$pr = 0, $$pr5 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0;
var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0;
var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0;
var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $coutput = 0, $exitcond = 0, $i$018 = 0, $i$115 = 0, $i$213 = 0, $j$020 = 0, $k$023 = 0, $k$111 = 0, $or$cond3 = 0, $out$017 = 0, $out$112 = 0;
var $res_comp = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 144|0;
$coutput = sp + 128|0;
$res_comp = sp;
$0 = HEAP32[$z>>2]|0;
$1 = ((($0)) + 8|0);
HEAP32[$1>>2] = 0;
$2 = ($req_comp>>>0)>(4);
if ($2) {
_stbi__err(19705);
$$1 = 0;
STACKTOP = sp;return ($$1|0);
}
$3 = (_stbi__decode_jpeg_image($z)|0);
$4 = ($3|0)==(0);
if ($4) {
_stbi__cleanup_jpeg($z);
$$1 = 0;
STACKTOP = sp;return ($$1|0);
}
$5 = ($req_comp|0)==(0);
if ($5) {
$6 = HEAP32[$z>>2]|0;
$7 = ((($6)) + 8|0);
$8 = HEAP32[$7>>2]|0;
$13 = $8;
} else {
$13 = $req_comp;
}
$9 = HEAP32[$z>>2]|0;
$10 = ((($9)) + 8|0);
$11 = HEAP32[$10>>2]|0;
$12 = ($11|0)==(3);
$14 = ($13|0)<(3);
$or$cond3 = $14 & $12;
$$ = $or$cond3 ? 1 : $11;
$15 = ($$|0)>(0);
L12: do {
if ($15) {
$16 = ((($z)) + 17796|0);
$17 = ((($z)) + 17800|0);
$18 = ((($z)) + 18184|0);
$k$023 = 0;
while(1) {
$19 = (($res_comp) + ($k$023<<5)|0);
$20 = HEAP32[$z>>2]|0;
$21 = HEAP32[$20>>2]|0;
$22 = (($21) + 3)|0;
$23 = (_stbi__malloc($22)|0);
$24 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 56|0);
HEAP32[$24>>2] = $23;
$25 = ($23|0)==(0|0);
if ($25) {
break;
}
$26 = HEAP32[$16>>2]|0;
$27 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 4|0);
$28 = HEAP32[$27>>2]|0;
$29 = (($26|0) / ($28|0))&-1;
$30 = (((($res_comp) + ($k$023<<5)|0)) + 12|0);
HEAP32[$30>>2] = $29;
$31 = HEAP32[$17>>2]|0;
$32 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 8|0);
$33 = HEAP32[$32>>2]|0;
$34 = (($31|0) / ($33|0))&-1;
$35 = (((($res_comp) + ($k$023<<5)|0)) + 16|0);
HEAP32[$35>>2] = $34;
$36 = $34 >> 1;
$37 = (((($res_comp) + ($k$023<<5)|0)) + 24|0);
HEAP32[$37>>2] = $36;
$38 = HEAP32[$z>>2]|0;
$39 = HEAP32[$38>>2]|0;
$40 = HEAP32[$30>>2]|0;
$41 = (($39) + -1)|0;
$42 = (($41) + ($40))|0;
$43 = (($42>>>0) / ($40>>>0))&-1;
$44 = (((($res_comp) + ($k$023<<5)|0)) + 20|0);
HEAP32[$44>>2] = $43;
$45 = (((($res_comp) + ($k$023<<5)|0)) + 28|0);
HEAP32[$45>>2] = 0;
$46 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 44|0);
$47 = HEAP32[$46>>2]|0;
$48 = (((($res_comp) + ($k$023<<5)|0)) + 8|0);
HEAP32[$48>>2] = $47;
$49 = (((($res_comp) + ($k$023<<5)|0)) + 4|0);
HEAP32[$49>>2] = $47;
$50 = HEAP32[$30>>2]|0;
$51 = ($50|0)==(1);
do {
if ($51) {
$52 = HEAP32[$35>>2]|0;
$53 = ($52|0)==(1);
if ($53) {
HEAP32[$19>>2] = 2;
break;
}
$$pr = HEAP32[$30>>2]|0;
$54 = ($$pr|0)==(1);
if ($54) {
$55 = HEAP32[$35>>2]|0;
$56 = ($55|0)==(2);
if ($56) {
HEAP32[$19>>2] = 3;
} else {
label = 17;
}
} else {
$57 = $$pr;
label = 18;
}
} else {
label = 17;
}
} while(0);
if ((label|0) == 17) {
label = 0;
$$pr5 = HEAP32[$30>>2]|0;
$57 = $$pr5;
label = 18;
}
do {
if ((label|0) == 18) {
label = 0;
$58 = ($57|0)==(2);
if ($58) {
$59 = HEAP32[$35>>2]|0;
$60 = ($59|0)==(1);
if ($60) {
HEAP32[$19>>2] = 4;
break;
}
}
$61 = HEAP32[$30>>2]|0;
$62 = ($61|0)==(2);
if ($62) {
$63 = HEAP32[$35>>2]|0;
$64 = ($63|0)==(2);
if ($64) {
$65 = HEAP32[$18>>2]|0;
HEAP32[$19>>2] = $65;
break;
}
}
HEAP32[$19>>2] = 5;
}
} while(0);
$66 = (($k$023) + 1)|0;
$67 = ($66|0)<($$|0);
if ($67) {
$k$023 = $66;
} else {
label = 26;
break L12;
}
}
_stbi__cleanup_jpeg($z);
_stbi__err(18059);
$$0 = 0;
} else {
label = 26;
}
} while(0);
do {
if ((label|0) == 26) {
$68 = HEAP32[$z>>2]|0;
$69 = HEAP32[$68>>2]|0;
$70 = Math_imul($69, $13)|0;
$71 = ((($68)) + 4|0);
$72 = HEAP32[$71>>2]|0;
$73 = Math_imul($70, $72)|0;
$74 = (($73) + 1)|0;
$75 = (_stbi__malloc($74)|0);
$76 = ($75|0)==(0|0);
if ($76) {
_stbi__cleanup_jpeg($z);
_stbi__err(18059);
$$0 = 0;
break;
}
$77 = HEAP32[$z>>2]|0;
$78 = ((($77)) + 4|0);
$79 = HEAP32[$78>>2]|0;
$80 = ($79|0)==(0);
if (!($80)) {
$81 = ($$|0)>(0);
$82 = ($13|0)>(2);
$83 = ((($z)) + 18180|0);
$84 = ((($coutput)) + 4|0);
$85 = ((($coutput)) + 8|0);
$86 = ($13|0)==(1);
$88 = $77;$j$020 = 0;
while(1) {
$87 = HEAP32[$88>>2]|0;
$89 = Math_imul($j$020, $13)|0;
$90 = Math_imul($89, $87)|0;
$91 = (($75) + ($90)|0);
if ($81) {
$k$111 = 0;
while(1) {
$92 = (((($res_comp) + ($k$111<<5)|0)) + 24|0);
$93 = HEAP32[$92>>2]|0;
$94 = (((($res_comp) + ($k$111<<5)|0)) + 16|0);
$95 = HEAP32[$94>>2]|0;
$96 = $95 >> 1;
$97 = ($93|0)>=($96|0);
$98 = (($res_comp) + ($k$111<<5)|0);
$99 = HEAP32[$98>>2]|0;
$100 = (((((($z)) + 17820|0) + (($k$111*72)|0)|0)) + 56|0);
$101 = HEAP32[$100>>2]|0;
$102 = (((($res_comp) + ($k$111<<5)|0)) + 8|0);
$103 = (((($res_comp) + ($k$111<<5)|0)) + 4|0);
$$in = $97 ? $102 : $103;
$104 = HEAP32[$$in>>2]|0;
$$in4 = $97 ? $103 : $102;
$105 = HEAP32[$$in4>>2]|0;
$106 = (((($res_comp) + ($k$111<<5)|0)) + 20|0);
$107 = HEAP32[$106>>2]|0;
$108 = (((($res_comp) + ($k$111<<5)|0)) + 12|0);
$109 = HEAP32[$108>>2]|0;
$110 = (FUNCTION_TABLE_iiiiii[$99 & 7]($101,$104,$105,$107,$109)|0);
$111 = (($coutput) + ($k$111<<2)|0);
HEAP32[$111>>2] = $110;
$112 = HEAP32[$92>>2]|0;
$113 = (($112) + 1)|0;
HEAP32[$92>>2] = $113;
$114 = HEAP32[$94>>2]|0;
$115 = ($113|0)<($114|0);
if (!($115)) {
HEAP32[$92>>2] = 0;
$116 = HEAP32[$102>>2]|0;
HEAP32[$103>>2] = $116;
$117 = (((($res_comp) + ($k$111<<5)|0)) + 28|0);
$118 = HEAP32[$117>>2]|0;
$119 = (($118) + 1)|0;
HEAP32[$117>>2] = $119;
$120 = (((((($z)) + 17820|0) + (($k$111*72)|0)|0)) + 32|0);
$121 = HEAP32[$120>>2]|0;
$122 = ($119|0)<($121|0);
if ($122) {
$123 = (((((($z)) + 17820|0) + (($k$111*72)|0)|0)) + 36|0);
$124 = HEAP32[$123>>2]|0;
$125 = HEAP32[$102>>2]|0;
$126 = (($125) + ($124)|0);
HEAP32[$102>>2] = $126;
}
}
$127 = (($k$111) + 1)|0;
$exitcond = ($127|0)==($$|0);
if ($exitcond) {
break;
} else {
$k$111 = $127;
}
}
}
$128 = HEAP32[$coutput>>2]|0;
$129 = HEAP32[$z>>2]|0;
do {
if ($82) {
$130 = ((($129)) + 8|0);
$131 = HEAP32[$130>>2]|0;
$132 = ($131|0)==(3);
if ($132) {
$136 = HEAP32[$83>>2]|0;
$137 = HEAP32[$84>>2]|0;
$138 = HEAP32[$85>>2]|0;
$139 = HEAP32[$129>>2]|0;
FUNCTION_TABLE_viiiiii[$136 & 3]($91,$128,$137,$138,$139,$13);
break;
}
$133 = HEAP32[$z>>2]|0;
$134 = HEAP32[$133>>2]|0;
$135 = ($134|0)==(0);
if (!($135)) {
$i$018 = 0;$out$017 = $91;
while(1) {
$140 = (($128) + ($i$018)|0);
$141 = HEAP8[$140>>0]|0;
$142 = ((($out$017)) + 2|0);
HEAP8[$142>>0] = $141;
$143 = ((($out$017)) + 1|0);
HEAP8[$143>>0] = $141;
HEAP8[$out$017>>0] = $141;
$144 = ((($out$017)) + 3|0);
HEAP8[$144>>0] = -1;
$145 = (($out$017) + ($13)|0);
$146 = (($i$018) + 1)|0;
$147 = HEAP32[$z>>2]|0;
$148 = HEAP32[$147>>2]|0;
$149 = ($146>>>0)<($148>>>0);
if ($149) {
$i$018 = $146;$out$017 = $145;
} else {
break;
}
}
}
} else {
$150 = HEAP32[$129>>2]|0;
$151 = ($150|0)==(0);
if ($86) {
if ($151) {
break;
} else {
$i$115 = 0;
}
while(1) {
$152 = (($128) + ($i$115)|0);
$153 = HEAP8[$152>>0]|0;
$$sum = (($i$115) + ($90))|0;
$154 = (($75) + ($$sum)|0);
HEAP8[$154>>0] = $153;
$155 = (($i$115) + 1)|0;
$156 = HEAP32[$z>>2]|0;
$157 = HEAP32[$156>>2]|0;
$158 = ($155>>>0)<($157>>>0);
if ($158) {
$i$115 = $155;
} else {
break;
}
}
} else {
if ($151) {
break;
} else {
$i$213 = 0;$out$112 = $91;
}
while(1) {
$159 = (($128) + ($i$213)|0);
$160 = HEAP8[$159>>0]|0;
$161 = ((($out$112)) + 1|0);
HEAP8[$out$112>>0] = $160;
$162 = ((($out$112)) + 2|0);
HEAP8[$161>>0] = -1;
$163 = (($i$213) + 1)|0;
$164 = HEAP32[$z>>2]|0;
$165 = HEAP32[$164>>2]|0;
$166 = ($163>>>0)<($165>>>0);
if ($166) {
$i$213 = $163;$out$112 = $162;
} else {
break;
}
}
}
}
} while(0);
$167 = (($j$020) + 1)|0;
$168 = HEAP32[$z>>2]|0;
$169 = ((($168)) + 4|0);
$170 = HEAP32[$169>>2]|0;
$171 = ($167>>>0)<($170>>>0);
if ($171) {
$88 = $168;$j$020 = $167;
} else {
break;
}
}
}
_stbi__cleanup_jpeg($z);
$172 = HEAP32[$z>>2]|0;
$173 = HEAP32[$172>>2]|0;
HEAP32[$out_x>>2] = $173;
$174 = HEAP32[$z>>2]|0;
$175 = ((($174)) + 4|0);
$176 = HEAP32[$175>>2]|0;
HEAP32[$out_y>>2] = $176;
$177 = ($comp|0)==(0|0);
if ($177) {
$$0 = $75;
} else {
$178 = HEAP32[$z>>2]|0;
$179 = ((($178)) + 8|0);
$180 = HEAP32[$179>>2]|0;
HEAP32[$comp>>2] = $180;
$$0 = $75;
}
}
} while(0);
$$1 = $$0;
STACKTOP = sp;return ($$1|0);
}
function _stbi__decode_jpeg_image($j) {
$j = $j|0;
var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 17868|0);
HEAP32[$0>>2] = 0;
$1 = ((($j)) + 17872|0);
HEAP32[$1>>2] = 0;
$2 = ((($j)) + 17940|0);
HEAP32[$2>>2] = 0;
$3 = ((($j)) + 17944|0);
HEAP32[$3>>2] = 0;
$4 = ((($j)) + 18012|0);
HEAP32[$4>>2] = 0;
$5 = ((($j)) + 18016|0);
HEAP32[$5>>2] = 0;
$6 = ((($j)) + 18084|0);
HEAP32[$6>>2] = 0;
$7 = ((($j)) + 18088|0);
HEAP32[$7>>2] = 0;
$8 = ((($j)) + 18168|0);
HEAP32[$8>>2] = 0;
$9 = (_stbi__decode_jpeg_header($j,0)|0);
$10 = ($9|0)==(0);
if ($10) {
$$0 = 0;
return ($$0|0);
}
$11 = (_stbi__get_marker($j)|0);
$12 = ((($j)) + 18116|0);
$$sink = $11;
L4: while(1) {
$13 = $$sink&255;
L6: do {
switch ($13|0) {
case 217: {
label = 13;
break L4;
break;
}
case 218: {
$14 = (_stbi__process_scan_header($j)|0);
$15 = ($14|0)==(0);
if ($15) {
$$0 = 0;
label = 15;
break L4;
}
$16 = (_stbi__parse_entropy_coded_data($j)|0);
$17 = ($16|0)==(0);
if ($17) {
$$0 = 0;
label = 15;
break L4;
}
$18 = HEAP8[$12>>0]|0;
$19 = ($18<<24>>24)==(-1);
if ($19) {
L11: while(1) {
$20 = HEAP32[$j>>2]|0;
$21 = (_stbi__at_eof($20)|0);
$22 = ($21|0)==(0);
if (!($22)) {
break L6;
}
$23 = HEAP32[$j>>2]|0;
$24 = (_stbi__get8($23)|0);
switch ($24<<24>>24) {
case 0: {
break;
}
case -1: {
break L11;
break;
}
default: {
label = 10;
break L4;
}
}
}
$25 = HEAP32[$j>>2]|0;
$26 = (_stbi__get8($25)|0);
HEAP8[$12>>0] = $26;
}
break;
}
default: {
$27 = (_stbi__process_marker($j,$13)|0);
$28 = ($27|0)==(0);
if ($28) {
$$0 = 0;
label = 15;
break L4;
}
}
}
} while(0);
$29 = (_stbi__get_marker($j)|0);
$$sink = $29;
}
if ((label|0) == 10) {
_stbi__err(19718);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 13) {
$30 = ((($j)) + 18124|0);
$31 = HEAP32[$30>>2]|0;
$32 = ($31|0)==(0);
if ($32) {
$$0 = 1;
return ($$0|0);
}
_stbi__jpeg_finish($j);
$$0 = 1;
return ($$0|0);
}
else if ((label|0) == 15) {
return ($$0|0);
}
return (0)|0;
}
function _stbi__cleanup_jpeg($j) {
$j = $j|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
var $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$j>>2]|0;
$1 = ((($0)) + 8|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(0);
if ($3) {
$i$01 = 0;
} else {
return;
}
while(1) {
$4 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 48|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)==(0|0);
if (!($6)) {
_free($5);
HEAP32[$4>>2] = 0;
$7 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 44|0);
HEAP32[$7>>2] = 0;
}
$8 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 52|0);
$9 = HEAP32[$8>>2]|0;
$10 = ($9|0)==(0|0);
if (!($10)) {
_free($9);
HEAP32[$8>>2] = 0;
$11 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 60|0);
HEAP32[$11>>2] = 0;
}
$12 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 56|0);
$13 = HEAP32[$12>>2]|0;
$14 = ($13|0)==(0|0);
if (!($14)) {
_free($13);
HEAP32[$12>>2] = 0;
}
$15 = (($i$01) + 1)|0;
$16 = HEAP32[$j>>2]|0;
$17 = ((($16)) + 8|0);
$18 = HEAP32[$17>>2]|0;
$19 = ($15|0)<($18|0);
if ($19) {
$i$01 = $15;
} else {
break;
}
}
return;
}
function _resample_row_1($out,$in_near,$in_far,$w,$hs) {
$out = $out|0;
$in_near = $in_near|0;
$in_far = $in_far|0;
$w = $w|0;
$hs = $hs|0;
var label = 0, sp = 0;
sp = STACKTOP;
return ($in_near|0);
}
function _stbi__resample_row_v_2($out,$in_near,$in_far,$w,$hs) {
$out = $out|0;
$in_near = $in_near|0;
$in_far = $in_far|0;
$w = $w|0;
$hs = $hs|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($w|0)>(0);
if ($0) {
$i$01 = 0;
} else {
return ($out|0);
}
while(1) {
$1 = (($in_near) + ($i$01)|0);
$2 = HEAP8[$1>>0]|0;
$3 = $2&255;
$4 = ($3*3)|0;
$5 = (($in_far) + ($i$01)|0);
$6 = HEAP8[$5>>0]|0;
$7 = $6&255;
$8 = (($7) + 2)|0;
$9 = (($8) + ($4))|0;
$10 = $9 >>> 2;
$11 = $10&255;
$12 = (($out) + ($i$01)|0);
HEAP8[$12>>0] = $11;
$13 = (($i$01) + 1)|0;
$exitcond = ($13|0)==($w|0);
if ($exitcond) {
break;
} else {
$i$01 = $13;
}
}
return ($out|0);
}
function _stbi__resample_row_h_2($out,$in_near,$in_far,$w,$hs) {
$out = $out|0;
$in_near = $in_near|0;
$in_far = $in_far|0;
$w = $w|0;
$hs = $hs|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$0$lcssa = 0, $i$01 = 0, $phitmp = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = ($w|0)==(1);
$1 = HEAP8[$in_near>>0]|0;
if ($0) {
$2 = ((($out)) + 1|0);
HEAP8[$2>>0] = $1;
HEAP8[$out>>0] = $1;
return ($out|0);
}
HEAP8[$out>>0] = $1;
$3 = HEAP8[$in_near>>0]|0;
$4 = $3&255;
$5 = ($4*3)|0;
$6 = ((($in_near)) + 1|0);
$7 = HEAP8[$6>>0]|0;
$8 = $7&255;
$9 = (($8) + 2)|0;
$10 = (($9) + ($5))|0;
$11 = $10 >>> 2;
$12 = $11&255;
$13 = ((($out)) + 1|0);
HEAP8[$13>>0] = $12;
$14 = (($w) + -1)|0;
$15 = ($14|0)>(1);
if ($15) {
$16 = (($w) + -1)|0;
$i$01 = 1;
while(1) {
$17 = (($in_near) + ($i$01)|0);
$18 = HEAP8[$17>>0]|0;
$19 = $18&255;
$20 = ($19*3)|0;
$21 = (($20) + 2)|0;
$22 = (($i$01) + -1)|0;
$23 = (($in_near) + ($22)|0);
$24 = HEAP8[$23>>0]|0;
$25 = $24&255;
$26 = (($21) + ($25))|0;
$27 = $26 >>> 2;
$28 = $27&255;
$29 = $i$01 << 1;
$30 = (($out) + ($29)|0);
HEAP8[$30>>0] = $28;
$31 = (($i$01) + 1)|0;
$32 = (($in_near) + ($31)|0);
$33 = HEAP8[$32>>0]|0;
$34 = $33&255;
$35 = (($21) + ($34))|0;
$36 = $35 >>> 2;
$37 = $36&255;
$38 = $29 | 1;
$39 = (($out) + ($38)|0);
HEAP8[$39>>0] = $37;
$exitcond = ($31|0)==($16|0);
if ($exitcond) {
break;
} else {
$i$01 = $31;
}
}
$phitmp = $16 << 1;
$i$0$lcssa = $phitmp;
} else {
$i$0$lcssa = 2;
}
$40 = (($w) + -2)|0;
$41 = (($in_near) + ($40)|0);
$42 = HEAP8[$41>>0]|0;
$43 = $42&255;
$44 = ($43*3)|0;
$45 = (($in_near) + ($14)|0);
$46 = HEAP8[$45>>0]|0;
$47 = $46&255;
$48 = (($47) + 2)|0;
$49 = (($48) + ($44))|0;
$50 = $49 >>> 2;
$51 = $50&255;
$52 = (($out) + ($i$0$lcssa)|0);
HEAP8[$52>>0] = $51;
$53 = HEAP8[$45>>0]|0;
$54 = $i$0$lcssa | 1;
$55 = (($out) + ($54)|0);
HEAP8[$55>>0] = $53;
return ($out|0);
}
function _stbi__resample_row_generic($out,$in_near,$in_far,$w,$hs) {
$out = $out|0;
$in_near = $in_near|0;
$in_far = $in_far|0;
$w = $w|0;
$hs = $hs|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $exitcond4 = 0, $i$02 = 0, $j$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($w|0)>(0);
if (!($0)) {
return ($out|0);
}
$1 = ($hs|0)>(0);
$i$02 = 0;
while(1) {
if ($1) {
$2 = (($in_near) + ($i$02)|0);
$3 = Math_imul($i$02, $hs)|0;
$j$01 = 0;
while(1) {
$4 = HEAP8[$2>>0]|0;
$5 = (($j$01) + ($3))|0;
$6 = (($out) + ($5)|0);
HEAP8[$6>>0] = $4;
$7 = (($j$01) + 1)|0;
$exitcond = ($7|0)==($hs|0);
if ($exitcond) {
break;
} else {
$j$01 = $7;
}
}
}
$8 = (($i$02) + 1)|0;
$exitcond4 = ($8|0)==($w|0);
if ($exitcond4) {
break;
} else {
$i$02 = $8;
}
}
return ($out|0);
}
function _stbi__process_scan_header($z) {
$z = $z|0;
var $$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
var $8 = 0, $9 = 0, $i$010 = 0, $or$cond1 = 0, $or$cond2 = 0, $which$0$lcssa = 0, $which$07 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$z>>2]|0;
$1 = (_stbi__get16be($0)|0);
$2 = HEAP32[$z>>2]|0;
$3 = (_stbi__get8($2)|0);
$4 = $3&255;
$5 = ((($z)) + 18148|0);
HEAP32[$5>>2] = $4;
$6 = (($3) + -1)<<24>>24;
$7 = ($6&255)>(3);
if (!($7)) {
$8 = HEAP32[$z>>2]|0;
$9 = ((($8)) + 8|0);
$10 = HEAP32[$9>>2]|0;
$11 = ($4|0)>($10|0);
if (!($11)) {
$12 = $4 << 1;
$13 = (($12) + 6)|0;
$14 = ($1|0)==($13|0);
if (!($14)) {
_stbi__err(19972);
$$0 = 0;
return ($$0|0);
}
$15 = HEAP32[$5>>2]|0;
$16 = ($15|0)>(0);
$17 = HEAP32[$z>>2]|0;
$18 = (_stbi__get8($17)|0);
$19 = $18&255;
L8: do {
if ($16) {
$30 = $19;$i$010 = 0;
while(1) {
$20 = HEAP32[$z>>2]|0;
$21 = (_stbi__get8($20)|0);
$22 = $21&255;
$23 = HEAP32[$z>>2]|0;
$24 = ((($23)) + 8|0);
$25 = HEAP32[$24>>2]|0;
$26 = ($25|0)>(0);
L11: do {
if ($26) {
$which$07 = 0;
while(1) {
$27 = (((($z)) + 17820|0) + (($which$07*72)|0)|0);
$28 = HEAP32[$27>>2]|0;
$29 = ($28|0)==($30|0);
if ($29) {
$which$0$lcssa = $which$07;
break L11;
}
$31 = (($which$07) + 1)|0;
$32 = HEAP32[$z>>2]|0;
$33 = ((($32)) + 8|0);
$34 = HEAP32[$33>>2]|0;
$35 = ($31|0)<($34|0);
if ($35) {
$which$07 = $31;
} else {
$which$0$lcssa = $31;
break;
}
}
} else {
$which$0$lcssa = 0;
}
} while(0);
$36 = HEAP32[$z>>2]|0;
$37 = ((($36)) + 8|0);
$38 = HEAP32[$37>>2]|0;
$39 = ($which$0$lcssa|0)==($38|0);
if ($39) {
$$0 = 0;
label = 26;
break;
}
$40 = $22 >>> 4;
$41 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 16|0);
HEAP32[$41>>2] = $40;
$42 = ($21&255)>(63);
if ($42) {
label = 12;
break;
}
$43 = $22 & 15;
$44 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 20|0);
HEAP32[$44>>2] = $43;
$45 = ($43>>>0)>(3);
if ($45) {
label = 14;
break;
}
$46 = (((($z)) + 18152|0) + ($i$010<<2)|0);
HEAP32[$46>>2] = $which$0$lcssa;
$47 = (($i$010) + 1)|0;
$48 = HEAP32[$5>>2]|0;
$49 = ($47|0)<($48|0);
$50 = HEAP32[$z>>2]|0;
$51 = (_stbi__get8($50)|0);
$52 = $51&255;
if ($49) {
$30 = $52;$i$010 = $47;
} else {
$$lcssa = $52;
break L8;
}
}
if ((label|0) == 12) {
_stbi__err(19984);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 14) {
_stbi__err(19996);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 26) {
return ($$0|0);
}
} else {
$$lcssa = $19;
}
} while(0);
$53 = ((($z)) + 18128|0);
HEAP32[$53>>2] = $$lcssa;
$54 = HEAP32[$z>>2]|0;
$55 = (_stbi__get8($54)|0);
$56 = $55&255;
$57 = ((($z)) + 18132|0);
HEAP32[$57>>2] = $56;
$58 = HEAP32[$z>>2]|0;
$59 = (_stbi__get8($58)|0);
$60 = $59&255;
$61 = $60 >>> 4;
$62 = ((($z)) + 18136|0);
HEAP32[$62>>2] = $61;
$63 = $60 & 15;
$64 = ((($z)) + 18140|0);
HEAP32[$64>>2] = $63;
$65 = ((($z)) + 18124|0);
$66 = HEAP32[$65>>2]|0;
$67 = ($66|0)==(0);
$68 = HEAP32[$53>>2]|0;
if (!($67)) {
$69 = ($68|0)>(63);
if (!($69)) {
$70 = HEAP32[$57>>2]|0;
$71 = ($70|0)>(63);
$72 = ($68|0)>($70|0);
$or$cond1 = $71 | $72;
if (!($or$cond1)) {
$73 = HEAP32[$62>>2]|0;
$74 = ($73|0)>(13);
$75 = ($63>>>0)>(13);
$or$cond2 = $75 | $74;
if (!($or$cond2)) {
$$0 = 1;
return ($$0|0);
}
}
}
_stbi__err(20008);
$$0 = 0;
return ($$0|0);
}
$76 = ($68|0)==(0);
if (!($76)) {
_stbi__err(20008);
$$0 = 0;
return ($$0|0);
}
$77 = HEAP32[$62>>2]|0;
$78 = $77 | $63;
$79 = ($78|0)==(0);
if ($79) {
HEAP32[$57>>2] = 63;
$$0 = 1;
return ($$0|0);
} else {
_stbi__err(20008);
$$0 = 0;
return ($$0|0);
}
}
}
_stbi__err(19948);
$$0 = 0;
return ($$0|0);
}
function _stbi__parse_entropy_coded_data($z) {
$z = $z|0;
var $$0 = 0, $$1 = 0, $$2 = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0;
var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0;
var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $data = 0, $i$023 = 0, $i1$035 = 0, $i13$054 = 0;
var $i6$040 = 0, $j$024 = 0, $j14$057 = 0, $j2$038 = 0, $j7$043 = 0, $k$032 = 0, $k15$051 = 0, $tmp = 0, $tmp5 = 0, $x$026 = 0, $x16$045 = 0, $y$029 = 0, $y17$048 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 128|0;
$data = sp;
_stbi__jpeg_reset($z);
$0 = ((($z)) + 18124|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
$3 = ((($z)) + 18148|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(1);
if ($2) {
if ($5) {
$6 = ((($z)) + 18152|0);
$7 = HEAP32[$6>>2]|0;
$8 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 28|0);
$9 = HEAP32[$8>>2]|0;
$10 = (($9) + 7)|0;
$11 = $10 >> 3;
$12 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 32|0);
$13 = HEAP32[$12>>2]|0;
$14 = (($13) + 7)|0;
$15 = $14 >> 3;
$16 = ($15|0)>(0);
L5: do {
if ($16) {
$17 = ($11|0)>(0);
$18 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 20|0);
$19 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 16|0);
$20 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 12|0);
$21 = ((($z)) + 18176|0);
$22 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 44|0);
$23 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 36|0);
$24 = ((($z)) + 18172|0);
$25 = ((($z)) + 18112|0);
$26 = ((($z)) + 18116|0);
$j$024 = 0;
while(1) {
if ($17) {
$i$023 = 0;
while(1) {
$27 = HEAP32[$18>>2]|0;
$28 = HEAP32[$19>>2]|0;
$29 = (((($z)) + 4|0) + (($28*1680)|0)|0);
$30 = (((($z)) + 6724|0) + (($27*1680)|0)|0);
$31 = (((($z)) + 13700|0) + ($27<<10)|0);
$32 = HEAP32[$20>>2]|0;
$33 = (((($z)) + 13444|0) + ($32<<6)|0);
$34 = (_stbi__jpeg_decode_block($z,$data,$29,$30,$31,$7,$33)|0);
$35 = ($34|0)==(0);
if ($35) {
$$0 = 0;
break L5;
}
$36 = HEAP32[$21>>2]|0;
$37 = HEAP32[$22>>2]|0;
$38 = HEAP32[$23>>2]|0;
$39 = Math_imul($38, $j$024)|0;
$40 = (($39) + ($i$023))|0;
$$sum1 = $40 << 3;
$41 = (($37) + ($$sum1)|0);
FUNCTION_TABLE_viii[$36 & 31]($41,$38,$data);
$42 = HEAP32[$24>>2]|0;
$43 = (($42) + -1)|0;
HEAP32[$24>>2] = $43;
$44 = ($42|0)<(2);
if ($44) {
$45 = HEAP32[$25>>2]|0;
$46 = ($45|0)<(24);
if ($46) {
_stbi__grow_buffer_unsafe($z);
}
$47 = HEAP8[$26>>0]|0;
$48 = $47 & -8;
$49 = ($48<<24>>24)==(-48);
if (!($49)) {
$$0 = 1;
break L5;
}
_stbi__jpeg_reset($z);
}
$50 = (($i$023) + 1)|0;
$51 = ($50|0)<($11|0);
if ($51) {
$i$023 = $50;
} else {
break;
}
}
}
$52 = (($j$024) + 1)|0;
$53 = ($52|0)<($15|0);
if ($53) {
$j$024 = $52;
} else {
$$0 = 1;
break;
}
}
} else {
$$0 = 1;
}
} while(0);
$$2 = $$0;
STACKTOP = sp;return ($$2|0);
}
$54 = ((($z)) + 17808|0);
$55 = HEAP32[$54>>2]|0;
$56 = ($55|0)>(0);
L24: do {
if ($56) {
$57 = ((($z)) + 17804|0);
$58 = ((($z)) + 18172|0);
$59 = ((($z)) + 18112|0);
$60 = ((($z)) + 18116|0);
$61 = ((($z)) + 18176|0);
$j2$038 = 0;
while(1) {
$62 = HEAP32[$57>>2]|0;
$63 = ($62|0)>(0);
if ($63) {
$i1$035 = 0;
while(1) {
$64 = HEAP32[$3>>2]|0;
$65 = ($64|0)>(0);
if ($65) {
$k$032 = 0;
while(1) {
$66 = (((($z)) + 18152|0) + ($k$032<<2)|0);
$67 = HEAP32[$66>>2]|0;
$68 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 8|0);
$69 = HEAP32[$68>>2]|0;
$70 = ($69|0)>(0);
if ($70) {
$71 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 4|0);
$72 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 20|0);
$73 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 16|0);
$74 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 12|0);
$75 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 44|0);
$76 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 36|0);
$y$029 = 0;
while(1) {
$77 = HEAP32[$71>>2]|0;
$78 = ($77|0)>(0);
if ($78) {
$92 = $77;$x$026 = 0;
while(1) {
$79 = HEAP32[$68>>2]|0;
$80 = HEAP32[$72>>2]|0;
$81 = HEAP32[$73>>2]|0;
$82 = (((($z)) + 4|0) + (($81*1680)|0)|0);
$83 = (((($z)) + 6724|0) + (($80*1680)|0)|0);
$84 = (((($z)) + 13700|0) + ($80<<10)|0);
$85 = HEAP32[$74>>2]|0;
$86 = (((($z)) + 13444|0) + ($85<<6)|0);
$87 = (_stbi__jpeg_decode_block($z,$data,$82,$83,$84,$67,$86)|0);
$88 = ($87|0)==(0);
if ($88) {
$$1 = 0;
break L24;
}
$89 = Math_imul($79, $j2$038)|0;
$90 = (($89) + ($y$029))|0;
$91 = Math_imul($92, $i1$035)|0;
$93 = (($91) + ($x$026))|0;
$94 = HEAP32[$61>>2]|0;
$95 = HEAP32[$75>>2]|0;
$96 = HEAP32[$76>>2]|0;
$97 = Math_imul($96, $90)|0;
$tmp = (($93) + ($97))|0;
$tmp5 = $tmp << 3;
$98 = (($95) + ($tmp5)|0);
FUNCTION_TABLE_viii[$94 & 31]($98,$96,$data);
$99 = (($x$026) + 1)|0;
$100 = HEAP32[$71>>2]|0;
$101 = ($99|0)<($100|0);
if ($101) {
$92 = $100;$x$026 = $99;
} else {
break;
}
}
}
$102 = (($y$029) + 1)|0;
$103 = HEAP32[$68>>2]|0;
$104 = ($102|0)<($103|0);
if ($104) {
$y$029 = $102;
} else {
break;
}
}
}
$105 = (($k$032) + 1)|0;
$106 = HEAP32[$3>>2]|0;
$107 = ($105|0)<($106|0);
if ($107) {
$k$032 = $105;
} else {
break;
}
}
}
$108 = HEAP32[$58>>2]|0;
$109 = (($108) + -1)|0;
HEAP32[$58>>2] = $109;
$110 = ($108|0)<(2);
if ($110) {
$111 = HEAP32[$59>>2]|0;
$112 = ($111|0)<(24);
if ($112) {
_stbi__grow_buffer_unsafe($z);
}
$113 = HEAP8[$60>>0]|0;
$114 = $113 & -8;
$115 = ($114<<24>>24)==(-48);
if (!($115)) {
$$1 = 1;
break L24;
}
_stbi__jpeg_reset($z);
}
$116 = (($i1$035) + 1)|0;
$117 = HEAP32[$57>>2]|0;
$118 = ($116|0)<($117|0);
if ($118) {
$i1$035 = $116;
} else {
break;
}
}
}
$119 = (($j2$038) + 1)|0;
$120 = HEAP32[$54>>2]|0;
$121 = ($119|0)<($120|0);
if ($121) {
$j2$038 = $119;
} else {
$$1 = 1;
break;
}
}
} else {
$$1 = 1;
}
} while(0);
$$2 = $$1;
STACKTOP = sp;return ($$2|0);
}
if ($5) {
$129 = ((($z)) + 18152|0);
$130 = HEAP32[$129>>2]|0;
$131 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 28|0);
$132 = HEAP32[$131>>2]|0;
$133 = (($132) + 7)|0;
$134 = $133 >> 3;
$135 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 32|0);
$136 = HEAP32[$135>>2]|0;
$137 = (($136) + 7)|0;
$138 = $137 >> 3;
$139 = ($138|0)>(0);
if (!($139)) {
$$2 = 1;
STACKTOP = sp;return ($$2|0);
}
$140 = ($134|0)>(0);
$141 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 60|0);
$142 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 64|0);
$143 = ((($z)) + 18128|0);
$144 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 16|0);
$145 = ((($z)) + 18172|0);
$146 = ((($z)) + 18112|0);
$147 = ((($z)) + 18116|0);
$148 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 20|0);
$j7$043 = 0;
L61: while(1) {
if ($140) {
$i6$040 = 0;
while(1) {
$149 = HEAP32[$141>>2]|0;
$150 = HEAP32[$142>>2]|0;
$151 = Math_imul($150, $j7$043)|0;
$152 = (($151) + ($i6$040))|0;
$153 = $152 << 6;
$154 = (($149) + ($153<<1)|0);
$155 = HEAP32[$143>>2]|0;
$156 = ($155|0)==(0);
if ($156) {
$157 = HEAP32[$144>>2]|0;
$158 = (((($z)) + 4|0) + (($157*1680)|0)|0);
$159 = (_stbi__jpeg_decode_block_prog_dc($z,$154,$158,$130)|0);
$160 = ($159|0)==(0);
if ($160) {
$$2 = 0;
label = 66;
break L61;
}
} else {
$161 = HEAP32[$148>>2]|0;
$162 = (((($z)) + 6724|0) + (($161*1680)|0)|0);
$163 = (((($z)) + 13700|0) + ($161<<10)|0);
$164 = (_stbi__jpeg_decode_block_prog_ac($z,$154,$162,$163)|0);
$165 = ($164|0)==(0);
if ($165) {
$$2 = 0;
label = 66;
break L61;
}
}
$166 = HEAP32[$145>>2]|0;
$167 = (($166) + -1)|0;
HEAP32[$145>>2] = $167;
$168 = ($166|0)<(2);
if ($168) {
$169 = HEAP32[$146>>2]|0;
$170 = ($169|0)<(24);
if ($170) {
_stbi__grow_buffer_unsafe($z);
}
$171 = HEAP8[$147>>0]|0;
$172 = $171 & -8;
$173 = ($172<<24>>24)==(-48);
if (!($173)) {
$$2 = 1;
label = 66;
break L61;
}
_stbi__jpeg_reset($z);
}
$174 = (($i6$040) + 1)|0;
$175 = ($174|0)<($134|0);
if ($175) {
$i6$040 = $174;
} else {
break;
}
}
}
$176 = (($j7$043) + 1)|0;
$177 = ($176|0)<($138|0);
if ($177) {
$j7$043 = $176;
} else {
$$2 = 1;
label = 66;
break;
}
}
if ((label|0) == 66) {
STACKTOP = sp;return ($$2|0);
}
}
$122 = ((($z)) + 17808|0);
$123 = HEAP32[$122>>2]|0;
$124 = ($123|0)>(0);
if (!($124)) {
$$2 = 1;
STACKTOP = sp;return ($$2|0);
}
$125 = ((($z)) + 17804|0);
$126 = ((($z)) + 18172|0);
$127 = ((($z)) + 18112|0);
$128 = ((($z)) + 18116|0);
$j14$057 = 0;
L87: while(1) {
$178 = HEAP32[$125>>2]|0;
$179 = ($178|0)>(0);
if ($179) {
$i13$054 = 0;
while(1) {
$180 = HEAP32[$3>>2]|0;
$181 = ($180|0)>(0);
if ($181) {
$k15$051 = 0;
while(1) {
$182 = (((($z)) + 18152|0) + ($k15$051<<2)|0);
$183 = HEAP32[$182>>2]|0;
$184 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 8|0);
$185 = HEAP32[$184>>2]|0;
$186 = ($185|0)>(0);
if ($186) {
$187 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 4|0);
$188 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 60|0);
$189 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 64|0);
$190 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 16|0);
$y17$048 = 0;
while(1) {
$191 = HEAP32[$187>>2]|0;
$192 = ($191|0)>(0);
if ($192) {
$197 = $191;$x16$045 = 0;
while(1) {
$196 = Math_imul($197, $i13$054)|0;
$198 = (($196) + ($x16$045))|0;
$199 = HEAP32[$184>>2]|0;
$200 = Math_imul($199, $j14$057)|0;
$201 = (($200) + ($y17$048))|0;
$202 = HEAP32[$188>>2]|0;
$203 = HEAP32[$189>>2]|0;
$204 = Math_imul($201, $203)|0;
$205 = (($198) + ($204))|0;
$206 = $205 << 6;
$207 = (($202) + ($206<<1)|0);
$208 = HEAP32[$190>>2]|0;
$209 = (((($z)) + 4|0) + (($208*1680)|0)|0);
$210 = (_stbi__jpeg_decode_block_prog_dc($z,$207,$209,$183)|0);
$211 = ($210|0)==(0);
$194 = (($x16$045) + 1)|0;
if ($211) {
$$2 = 0;
label = 66;
break L87;
}
$193 = HEAP32[$187>>2]|0;
$195 = ($194|0)<($193|0);
if ($195) {
$197 = $193;$x16$045 = $194;
} else {
break;
}
}
}
$212 = (($y17$048) + 1)|0;
$213 = HEAP32[$184>>2]|0;
$214 = ($212|0)<($213|0);
if ($214) {
$y17$048 = $212;
} else {
break;
}
}
}
$215 = (($k15$051) + 1)|0;
$216 = HEAP32[$3>>2]|0;
$217 = ($215|0)<($216|0);
if ($217) {
$k15$051 = $215;
} else {
break;
}
}
}
$218 = HEAP32[$126>>2]|0;
$219 = (($218) + -1)|0;
HEAP32[$126>>2] = $219;
$220 = ($218|0)<(2);
if ($220) {
$221 = HEAP32[$127>>2]|0;
$222 = ($221|0)<(24);
if ($222) {
_stbi__grow_buffer_unsafe($z);
}
$223 = HEAP8[$128>>0]|0;
$224 = $223 & -8;
$225 = ($224<<24>>24)==(-48);
if (!($225)) {
$$2 = 1;
label = 66;
break L87;
}
_stbi__jpeg_reset($z);
}
$226 = (($i13$054) + 1)|0;
$227 = HEAP32[$125>>2]|0;
$228 = ($226|0)<($227|0);
if ($228) {
$i13$054 = $226;
} else {
break;
}
}
}
$229 = (($j14$057) + 1)|0;
$230 = HEAP32[$122>>2]|0;
$231 = ($229|0)<($230|0);
if ($231) {
$j14$057 = $229;
} else {
$$2 = 1;
label = 66;
break;
}
}
if ((label|0) == 66) {
STACKTOP = sp;return ($$2|0);
}
return (0)|0;
}
function _stbi__jpeg_finish($z) {
$z = $z|0;
var $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$02 = 0, $j$03 = 0, $n$06 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($z)) + 18124|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
return;
}
$3 = HEAP32[$z>>2]|0;
$4 = ((($3)) + 8|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)>(0);
if (!($6)) {
return;
}
$7 = ((($z)) + 18176|0);
$n$06 = 0;
while(1) {
$8 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 28|0);
$9 = HEAP32[$8>>2]|0;
$10 = (($9) + 7)|0;
$11 = $10 >> 3;
$12 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 32|0);
$13 = HEAP32[$12>>2]|0;
$14 = (($13) + 7)|0;
$15 = $14 >> 3;
$16 = ($15|0)>(0);
if ($16) {
$17 = ($11|0)>(0);
$18 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 60|0);
$19 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 64|0);
$20 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 12|0);
$21 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 44|0);
$22 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 36|0);
$j$03 = 0;
while(1) {
if ($17) {
$i$02 = 0;
while(1) {
$23 = HEAP32[$18>>2]|0;
$24 = HEAP32[$19>>2]|0;
$25 = Math_imul($24, $j$03)|0;
$26 = (($25) + ($i$02))|0;
$27 = $26 << 6;
$28 = (($23) + ($27<<1)|0);
$29 = HEAP32[$20>>2]|0;
$30 = (((($z)) + 13444|0) + ($29<<6)|0);
_stbi__jpeg_dequantize($28,$30);
$31 = HEAP32[$7>>2]|0;
$32 = HEAP32[$21>>2]|0;
$33 = HEAP32[$22>>2]|0;
$34 = Math_imul($33, $j$03)|0;
$35 = (($34) + ($i$02))|0;
$$sum = $35 << 3;
$36 = (($32) + ($$sum)|0);
FUNCTION_TABLE_viii[$31 & 31]($36,$33,$28);
$37 = (($i$02) + 1)|0;
$exitcond = ($37|0)==($11|0);
if ($exitcond) {
break;
} else {
$i$02 = $37;
}
}
}
$38 = (($j$03) + 1)|0;
$exitcond8 = ($38|0)==($15|0);
if ($exitcond8) {
break;
} else {
$j$03 = $38;
}
}
}
$39 = (($n$06) + 1)|0;
$40 = HEAP32[$z>>2]|0;
$41 = ((($40)) + 8|0);
$42 = HEAP32[$41>>2]|0;
$43 = ($39|0)<($42|0);
if ($43) {
$n$06 = $39;
} else {
break;
}
}
return;
}
function _stbi__jpeg_dequantize($data,$dequant) {
$data = $data|0;
$dequant = $dequant|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$i$01 = 0;
while(1) {
$0 = (($dequant) + ($i$01)|0);
$1 = HEAP8[$0>>0]|0;
$2 = $1&255;
$3 = (($data) + ($i$01<<1)|0);
$4 = HEAP16[$3>>1]|0;
$5 = $4 << 16 >> 16;
$6 = Math_imul($5, $2)|0;
$7 = $6&65535;
HEAP16[$3>>1] = $7;
$8 = (($i$01) + 1)|0;
$exitcond = ($8|0)==(64);
if ($exitcond) {
break;
} else {
$i$01 = $8;
}
}
return;
}
function _stbi__jpeg_reset($j) {
$j = $j|0;
var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18112|0);
HEAP32[$0>>2] = 0;
$1 = ((($j)) + 18108|0);
HEAP32[$1>>2] = 0;
$2 = ((($j)) + 18120|0);
HEAP32[$2>>2] = 0;
$3 = ((($j)) + 17988|0);
HEAP32[$3>>2] = 0;
$4 = ((($j)) + 17916|0);
HEAP32[$4>>2] = 0;
$5 = ((($j)) + 17844|0);
HEAP32[$5>>2] = 0;
$6 = ((($j)) + 18116|0);
HEAP8[$6>>0] = -1;
$7 = ((($j)) + 18168|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($8|0)==(0);
$$ = $9 ? 2147483647 : $8;
$10 = ((($j)) + 18172|0);
HEAP32[$10>>2] = $$;
$11 = ((($j)) + 18144|0);
HEAP32[$11>>2] = 0;
return;
}
function _stbi__jpeg_decode_block($j,$data,$hdc,$hac,$fac,$b,$dequant) {
$j = $j|0;
$data = $data|0;
$hdc = $hdc|0;
$hac = $hac|0;
$fac = $fac|0;
$b = $b|0;
$dequant = $dequant|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$1 = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
$0 = ((($j)) + 18112|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(16);
if ($2) {
_stbi__grow_buffer_unsafe($j);
}
$3 = (_stbi__jpeg_huff_decode($j,$hdc)|0);
$4 = ($3|0)<(0);
if ($4) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0));
$5 = ($3|0)==(0);
if ($5) {
$10 = 0;
} else {
$6 = (_stbi__extend_receive($j,$3)|0);
$10 = $6;
}
$7 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0);
$8 = HEAP32[$7>>2]|0;
$9 = (($8) + ($10))|0;
HEAP32[$7>>2] = $9;
$11 = HEAP8[$dequant>>0]|0;
$12 = $11&255;
$13 = Math_imul($12, $9)|0;
$14 = $13&65535;
HEAP16[$data>>1] = $14;
$15 = ((($j)) + 18108|0);
$k$0 = 1;
L11: while(1) {
$16 = HEAP32[$0>>2]|0;
$17 = ($16|0)<(16);
if ($17) {
_stbi__grow_buffer_unsafe($j);
}
$18 = HEAP32[$15>>2]|0;
$19 = $18 >>> 23;
$20 = (($fac) + ($19<<1)|0);
$21 = HEAP16[$20>>1]|0;
$22 = $21 << 16 >> 16;
$23 = ($21<<16>>16)==(0);
do {
if ($23) {
$42 = (_stbi__jpeg_huff_decode($j,$hac)|0);
$43 = ($42|0)<(0);
if ($43) {
label = 13;
break L11;
}
$44 = $42 & 15;
$45 = ($44|0)==(0);
if (!($45)) {
$48 = $42 >> 4;
$49 = (($48) + ($k$0))|0;
$50 = (($49) + 1)|0;
$51 = (18551 + ($49)|0);
$52 = HEAP8[$51>>0]|0;
$53 = $52&255;
$54 = (_stbi__extend_receive($j,$44)|0);
$55 = (($dequant) + ($53)|0);
$56 = HEAP8[$55>>0]|0;
$57 = $56&255;
$58 = Math_imul($57, $54)|0;
$59 = $58&65535;
$60 = (($data) + ($53<<1)|0);
HEAP16[$60>>1] = $59;
$k$1 = $50;
break;
}
$46 = ($42|0)==(240);
if (!($46)) {
$$0 = 1;
label = 19;
break L11;
}
$47 = (($k$0) + 16)|0;
$k$1 = $47;
} else {
$24 = $22 >>> 4;
$25 = $24 & 15;
$26 = (($25) + ($k$0))|0;
$27 = $22 & 15;
$28 = $18 << $27;
HEAP32[$15>>2] = $28;
$29 = HEAP32[$0>>2]|0;
$30 = (($29) - ($27))|0;
HEAP32[$0>>2] = $30;
$31 = (($26) + 1)|0;
$32 = (18551 + ($26)|0);
$33 = HEAP8[$32>>0]|0;
$34 = $33&255;
$35 = $22 >> 8;
$36 = (($dequant) + ($34)|0);
$37 = HEAP8[$36>>0]|0;
$38 = $37&255;
$39 = Math_imul($38, $35)|0;
$40 = $39&65535;
$41 = (($data) + ($34<<1)|0);
HEAP16[$41>>1] = $40;
$k$1 = $31;
}
} while(0);
$61 = ($k$1|0)<(64);
if ($61) {
$k$0 = $k$1;
} else {
$$0 = 1;
label = 19;
break;
}
}
if ((label|0) == 13) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 19) {
return ($$0|0);
}
return (0)|0;
}
function _stbi__grow_buffer_unsafe($j) {
$j = $j|0;
var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18120|0);
$1 = ((($j)) + 18112|0);
$2 = ((($j)) + 18108|0);
while(1) {
$3 = HEAP32[$0>>2]|0;
$4 = ($3|0)==(0);
if ($4) {
$5 = HEAP32[$j>>2]|0;
$6 = (_stbi__get8($5)|0);
$7 = $6&255;
$8 = ($6<<24>>24)==(-1);
if ($8) {
$9 = HEAP32[$j>>2]|0;
$10 = (_stbi__get8($9)|0);
$11 = ($10<<24>>24)==(0);
if ($11) {
$16 = 255;
} else {
$$lcssa = $10;
break;
}
} else {
$16 = $7;
}
} else {
$16 = 0;
}
$13 = HEAP32[$1>>2]|0;
$14 = (24 - ($13))|0;
$15 = $16 << $14;
$17 = HEAP32[$2>>2]|0;
$18 = $15 | $17;
HEAP32[$2>>2] = $18;
$19 = HEAP32[$1>>2]|0;
$20 = (($19) + 8)|0;
HEAP32[$1>>2] = $20;
$21 = ($20|0)<(25);
if (!($21)) {
label = 7;
break;
}
}
if ((label|0) == 7) {
return;
}
$12 = ((($j)) + 18116|0);
HEAP8[$12>>0] = $$lcssa;
HEAP32[$0>>2] = 1;
return;
}
function _stbi__jpeg_decode_block_prog_dc($j,$data,$hdc,$b) {
$j = $j|0;
$data = $data|0;
$hdc = $hdc|0;
$b = $b|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
$0 = ((($j)) + 18132|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if (!($2)) {
_stbi__err(19737);
$$0 = 0;
return ($$0|0);
}
$3 = ((($j)) + 18112|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)<(16);
if ($5) {
_stbi__grow_buffer_unsafe($j);
}
$6 = ((($j)) + 18136|0);
$7 = HEAP32[$6>>2]|0;
$8 = ($7|0)==(0);
if ($8) {
dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0));
$9 = (_stbi__jpeg_huff_decode($j,$hdc)|0);
$10 = ($9|0)==(0);
if ($10) {
$15 = 0;
} else {
$11 = (_stbi__extend_receive($j,$9)|0);
$15 = $11;
}
$12 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0);
$13 = HEAP32[$12>>2]|0;
$14 = (($13) + ($15))|0;
HEAP32[$12>>2] = $14;
$16 = ((($j)) + 18140|0);
$17 = HEAP32[$16>>2]|0;
$18 = $14 << $17;
$19 = $18&65535;
HEAP16[$data>>1] = $19;
$$0 = 1;
return ($$0|0);
} else {
$20 = (_stbi__jpeg_get_bit($j)|0);
$21 = ($20|0)==(0);
if ($21) {
$$0 = 1;
return ($$0|0);
}
$22 = ((($j)) + 18140|0);
$23 = HEAP32[$22>>2]|0;
$sext = 65536 << $23;
$24 = $sext >>> 16;
$25 = HEAP16[$data>>1]|0;
$26 = $25&65535;
$27 = (($26) + ($24))|0;
$28 = $27&65535;
HEAP16[$data>>1] = $28;
$$0 = 1;
return ($$0|0);
}
return (0)|0;
}
function _stbi__jpeg_decode_block_prog_ac($j,$data,$hac,$fac) {
$j = $j|0;
$data = $data|0;
$hac = $hac|0;
$fac = $fac|0;
var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa63 = 0, $$lcssa63$lcssa = 0, $$lcssa66 = 0, $$lcssa66$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0;
var $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $k$0 = 0, $k$1 = 0, $k$223 = 0, $k$3 = 0, $k$4$ph20 = 0, $k$415 = 0, $k$415$lcssa = 0, $k$5 = 0, $r1$0$ph = 0, $r1$0$ph519 = 0, $s2$0$ph = 0, $sext = 0, $sext1 = 0, $sext2 = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18128|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
_stbi__err(19737);
$$0 = 0;
return ($$0|0);
}
$3 = ((($j)) + 18136|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)==(0);
$6 = ((($j)) + 18140|0);
$7 = HEAP32[$6>>2]|0;
if ($5) {
$8 = ((($j)) + 18144|0);
$9 = HEAP32[$8>>2]|0;
$10 = ($9|0)==(0);
if (!($10)) {
$14 = (($9) + -1)|0;
HEAP32[$8>>2] = $14;
$$0 = 1;
return ($$0|0);
}
$11 = ((($j)) + 18112|0);
$12 = ((($j)) + 18108|0);
$13 = ((($j)) + 18132|0);
$k$0 = $1;
L11: while(1) {
$15 = HEAP32[$11>>2]|0;
$16 = ($15|0)<(16);
if ($16) {
_stbi__grow_buffer_unsafe($j);
}
$17 = HEAP32[$12>>2]|0;
$18 = $17 >>> 23;
$19 = (($fac) + ($18<<1)|0);
$20 = HEAP16[$19>>1]|0;
$21 = $20 << 16 >> 16;
$22 = ($20<<16>>16)==(0);
do {
if ($22) {
$38 = (_stbi__jpeg_huff_decode($j,$hac)|0);
$39 = ($38|0)<(0);
if ($39) {
label = 12;
break L11;
}
$40 = $38 & 15;
$41 = $38 >> 4;
$42 = ($40|0)==(0);
if (!($42)) {
$52 = (($41) + ($k$0))|0;
$53 = (($52) + 1)|0;
$54 = (18551 + ($52)|0);
$55 = HEAP8[$54>>0]|0;
$56 = $55&255;
$57 = (_stbi__extend_receive($j,$40)|0);
$58 = $57 << $7;
$59 = $58&65535;
$60 = (($data) + ($56<<1)|0);
HEAP16[$60>>1] = $59;
$k$1 = $53;
break;
}
$43 = ($41|0)<(15);
if ($43) {
$$lcssa = $41;
label = 15;
break L11;
}
$51 = (($k$0) + 16)|0;
$k$1 = $51;
} else {
$23 = $21 >>> 4;
$24 = $23 & 15;
$25 = (($24) + ($k$0))|0;
$26 = $21 & 15;
$27 = $17 << $26;
HEAP32[$12>>2] = $27;
$28 = HEAP32[$11>>2]|0;
$29 = (($28) - ($26))|0;
HEAP32[$11>>2] = $29;
$30 = (($25) + 1)|0;
$31 = (18551 + ($25)|0);
$32 = HEAP8[$31>>0]|0;
$33 = $32&255;
$34 = $21 >> 8;
$35 = $34 << $7;
$36 = $35&65535;
$37 = (($data) + ($33<<1)|0);
HEAP16[$37>>1] = $36;
$k$1 = $30;
}
} while(0);
$61 = HEAP32[$13>>2]|0;
$62 = ($k$1|0)>($61|0);
if ($62) {
$$0 = 1;
label = 53;
break;
} else {
$k$0 = $k$1;
}
}
if ((label|0) == 12) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 15) {
$44 = 1 << $$lcssa;
HEAP32[$8>>2] = $44;
$45 = ($$lcssa|0)==(0);
if (!($45)) {
$46 = (_stbi__jpeg_get_bits($j,$$lcssa)|0);
$47 = HEAP32[$8>>2]|0;
$48 = (($47) + ($46))|0;
HEAP32[$8>>2] = $48;
}
$49 = HEAP32[$8>>2]|0;
$50 = (($49) + -1)|0;
HEAP32[$8>>2] = $50;
$$0 = 1;
return ($$0|0);
}
else if ((label|0) == 53) {
return ($$0|0);
}
}
$63 = 1 << $7;
$64 = ((($j)) + 18144|0);
$65 = HEAP32[$64>>2]|0;
$66 = ($65|0)==(0);
if (!($66)) {
$71 = (($65) + -1)|0;
HEAP32[$64>>2] = $71;
$72 = HEAP32[$0>>2]|0;
$73 = ((($j)) + 18132|0);
$74 = HEAP32[$73>>2]|0;
$75 = ($72|0)>($74|0);
if ($75) {
$$0 = 1;
return ($$0|0);
}
$sext2 = $63 << 16;
$76 = $sext2 >> 16;
$k$223 = $72;
while(1) {
$77 = (18551 + ($k$223)|0);
$78 = HEAP8[$77>>0]|0;
$79 = $78&255;
$80 = (($data) + ($79<<1)|0);
$81 = HEAP16[$80>>1]|0;
$82 = ($81<<16>>16)==(0);
do {
if (!($82)) {
$83 = (_stbi__jpeg_get_bit($j)|0);
$84 = ($83|0)==(0);
if (!($84)) {
$85 = HEAP16[$80>>1]|0;
$86 = $85 << 16 >> 16;
$87 = $86 & $76;
$88 = ($87|0)==(0);
if ($88) {
$89 = ($85<<16>>16)>(0);
if ($89) {
$90 = (($86) + ($76))|0;
$91 = $90&65535;
HEAP16[$80>>1] = $91;
break;
} else {
$92 = (($86) - ($76))|0;
$93 = $92&65535;
HEAP16[$80>>1] = $93;
break;
}
}
}
}
} while(0);
$94 = (($k$223) + 1)|0;
$95 = HEAP32[$73>>2]|0;
$96 = ($k$223|0)<($95|0);
if ($96) {
$k$223 = $94;
} else {
$$0 = 1;
break;
}
}
return ($$0|0);
}
$sext = $63 << 16;
$67 = $sext >> 16;
$68 = (0 - ($67))|0;
$69 = ((($j)) + 18132|0);
$sext1 = $63 << 16;
$70 = $sext1 >> 16;
$k$3 = $1;
L52: while(1) {
$97 = (_stbi__jpeg_huff_decode($j,$hac)|0);
$98 = ($97|0)<(0);
if ($98) {
label = 33;
break;
}
$99 = $97 & 15;
$100 = $97 >> 4;
switch ($99|0) {
case 0: {
$101 = ($100|0)<(15);
if ($101) {
$102 = 1 << $100;
$103 = (($102) + -1)|0;
HEAP32[$64>>2] = $103;
$104 = ($100|0)==(0);
if ($104) {
$r1$0$ph = 64;$s2$0$ph = 0;
} else {
$105 = (_stbi__jpeg_get_bits($j,$100)|0);
$106 = HEAP32[$64>>2]|0;
$107 = (($106) + ($105))|0;
HEAP32[$64>>2] = $107;
$r1$0$ph = 64;$s2$0$ph = 0;
}
} else {
$r1$0$ph = $100;$s2$0$ph = 0;
}
break;
}
case 1: {
$108 = (_stbi__jpeg_get_bit($j)|0);
$109 = ($108|0)==(0);
$$ = $109 ? $68 : $67;
$r1$0$ph = $100;$s2$0$ph = $$;
break;
}
default: {
label = 38;
break L52;
}
}
$110 = HEAP32[$69>>2]|0;
$111 = ($k$3|0)>($110|0);
L61: do {
if ($111) {
$k$5 = $k$3;
} else {
$k$4$ph20 = $k$3;$r1$0$ph519 = $r1$0$ph;
while(1) {
$k$415 = $k$4$ph20;
while(1) {
$115 = (($k$415) + 1)|0;
$116 = (18551 + ($k$415)|0);
$117 = HEAP8[$116>>0]|0;
$118 = $117&255;
$119 = (($data) + ($118<<1)|0);
$120 = HEAP16[$119>>1]|0;
$121 = ($120<<16>>16)==(0);
if ($121) {
$$lcssa63 = $115;$$lcssa66 = $119;$k$415$lcssa = $k$415;
break;
}
$122 = (_stbi__jpeg_get_bit($j)|0);
$123 = ($122|0)==(0);
do {
if (!($123)) {
$124 = HEAP16[$119>>1]|0;
$125 = $124 << 16 >> 16;
$126 = $125 & $70;
$127 = ($126|0)==(0);
if ($127) {
$128 = ($124<<16>>16)>(0);
if ($128) {
$129 = (($125) + ($70))|0;
$130 = $129&65535;
HEAP16[$119>>1] = $130;
break;
} else {
$133 = (($125) - ($70))|0;
$134 = $133&65535;
HEAP16[$119>>1] = $134;
break;
}
}
}
} while(0);
$131 = HEAP32[$69>>2]|0;
$132 = ($k$415|0)<($131|0);
if ($132) {
$k$415 = $115;
} else {
$k$5 = $115;
break L61;
}
}
$135 = ($r1$0$ph519|0)==(0);
if ($135) {
$$lcssa63$lcssa = $$lcssa63;$$lcssa66$lcssa = $$lcssa66;
break;
}
$112 = (($r1$0$ph519) + -1)|0;
$113 = HEAP32[$69>>2]|0;
$114 = ($k$415$lcssa|0)<($113|0);
if ($114) {
$k$4$ph20 = $$lcssa63;$r1$0$ph519 = $112;
} else {
$k$5 = $$lcssa63;
break L61;
}
}
$136 = $s2$0$ph&65535;
HEAP16[$$lcssa66$lcssa>>1] = $136;
$k$5 = $$lcssa63$lcssa;
}
} while(0);
$137 = HEAP32[$69>>2]|0;
$138 = ($k$5|0)>($137|0);
if ($138) {
$$0 = 1;
label = 53;
break;
} else {
$k$3 = $k$5;
}
}
if ((label|0) == 33) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 38) {
_stbi__err(18982);
$$0 = 0;
return ($$0|0);
}
else if ((label|0) == 53) {
return ($$0|0);
}
return (0)|0;
}
function _stbi__jpeg_huff_decode($j,$h) {
$j = $j|0;
$h = $h|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$0$lcssa = 0;
var label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18112|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(16);
if ($2) {
_stbi__grow_buffer_unsafe($j);
}
$3 = ((($j)) + 18108|0);
$4 = HEAP32[$3>>2]|0;
$5 = $4 >>> 23;
$6 = (($h) + ($5)|0);
$7 = HEAP8[$6>>0]|0;
$8 = $7&255;
$9 = ($7<<24>>24)==(-1);
if (!($9)) {
$10 = (((($h)) + 1280|0) + ($8)|0);
$11 = HEAP8[$10>>0]|0;
$12 = $11&255;
$13 = HEAP32[$0>>2]|0;
$14 = ($12|0)>($13|0);
if ($14) {
$$0 = -1;
return ($$0|0);
}
$15 = $4 << $12;
HEAP32[$3>>2] = $15;
$16 = HEAP32[$0>>2]|0;
$17 = (($16) - ($12))|0;
HEAP32[$0>>2] = $17;
$18 = (((($h)) + 1024|0) + ($8)|0);
$19 = HEAP8[$18>>0]|0;
$20 = $19&255;
$$0 = $20;
return ($$0|0);
}
$21 = $4 >>> 16;
$k$0 = 10;
while(1) {
$22 = (((($h)) + 1540|0) + ($k$0<<2)|0);
$23 = HEAP32[$22>>2]|0;
$24 = ($21>>>0)<($23>>>0);
$25 = (($k$0) + 1)|0;
if ($24) {
$k$0$lcssa = $k$0;
break;
} else {
$k$0 = $25;
}
}
$26 = ($k$0$lcssa|0)==(17);
$27 = HEAP32[$0>>2]|0;
if ($26) {
$28 = (($27) + -16)|0;
HEAP32[$0>>2] = $28;
$$0 = -1;
return ($$0|0);
}
$29 = ($27|0)<($k$0$lcssa|0);
if ($29) {
$$0 = -1;
return ($$0|0);
}
$30 = HEAP32[$3>>2]|0;
$31 = (32 - ($k$0$lcssa))|0;
$32 = $30 >>> $31;
$33 = (8504 + ($k$0$lcssa<<2)|0);
$34 = HEAP32[$33>>2]|0;
$35 = $32 & $34;
$36 = (((($h)) + 1612|0) + ($k$0$lcssa<<2)|0);
$37 = HEAP32[$36>>2]|0;
$38 = (($35) + ($37))|0;
$39 = (((($h)) + 1280|0) + ($38)|0);
$40 = HEAP8[$39>>0]|0;
$41 = $40&255;
$42 = (32 - ($41))|0;
$43 = $30 >>> $42;
$44 = (8504 + ($41<<2)|0);
$45 = HEAP32[$44>>2]|0;
$46 = $43 & $45;
$47 = (((($h)) + 512|0) + ($38<<1)|0);
$48 = HEAP16[$47>>1]|0;
$49 = $48&65535;
$50 = ($46|0)==($49|0);
if (!($50)) {
___assert_fail((19843|0),(18129|0),1656,(19925|0));
// unreachable;
}
$51 = (($27) - ($k$0$lcssa))|0;
HEAP32[$0>>2] = $51;
$52 = HEAP32[$3>>2]|0;
$53 = $52 << $k$0$lcssa;
HEAP32[$3>>2] = $53;
$54 = (((($h)) + 1024|0) + ($38)|0);
$55 = HEAP8[$54>>0]|0;
$56 = $55&255;
$$0 = $56;
return ($$0|0);
}
function _stbi__jpeg_get_bits($j,$n) {
$j = $j|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18112|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<($n|0);
if ($2) {
_stbi__grow_buffer_unsafe($j);
}
$3 = ((($j)) + 18108|0);
$4 = HEAP32[$3>>2]|0;
$5 = $4 << $n;
$6 = (32 - ($n))|0;
$7 = $4 >>> $6;
$8 = $5 | $7;
$9 = (8504 + ($n<<2)|0);
$10 = HEAP32[$9>>2]|0;
$11 = $10 ^ -1;
$12 = $8 & $11;
HEAP32[$3>>2] = $12;
$13 = HEAP32[$9>>2]|0;
$14 = $8 & $13;
$15 = HEAP32[$0>>2]|0;
$16 = (($15) - ($n))|0;
HEAP32[$0>>2] = $16;
return ($14|0);
}
function _stbi__extend_receive($j,$n) {
$j = $j|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18112|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<($n|0);
if ($2) {
_stbi__grow_buffer_unsafe($j);
}
$3 = ((($j)) + 18108|0);
$4 = HEAP32[$3>>2]|0;
$5 = $4 << $n;
$6 = (32 - ($n))|0;
$7 = $4 >>> $6;
$8 = $5 | $7;
$9 = ($n>>>0)<(17);
if ($9) {
$10 = $4 >> 31;
$11 = (8504 + ($n<<2)|0);
$12 = HEAP32[$11>>2]|0;
$13 = $12 ^ -1;
$14 = $8 & $13;
HEAP32[$3>>2] = $14;
$15 = HEAP32[$11>>2]|0;
$16 = $15 & $8;
$17 = HEAP32[$0>>2]|0;
$18 = (($17) - ($n))|0;
HEAP32[$0>>2] = $18;
$19 = (8572 + ($n<<2)|0);
$20 = HEAP32[$19>>2]|0;
$21 = $10 ^ -1;
$22 = $20 & $21;
$23 = (($22) + ($16))|0;
return ($23|0);
} else {
___assert_fail((19759|0),(18129|0),1677,(19822|0));
// unreachable;
}
return (0)|0;
}
function _stbi__jpeg_get_bit($j) {
$j = $j|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($j)) + 18112|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(1);
if ($2) {
_stbi__grow_buffer_unsafe($j);
}
$3 = ((($j)) + 18108|0);
$4 = HEAP32[$3>>2]|0;
$5 = $4 << 1;
HEAP32[$3>>2] = $5;
$6 = HEAP32[$0>>2]|0;
$7 = (($6) + -1)|0;
HEAP32[$0>>2] = $7;
$8 = $4 & -2147483648;
return ($8|0);
}
function _stbi__idct_block($out,$out_stride,$data) {
$out = $out|0;
$out_stride = $out_stride|0;
$data = $data|0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $d$04 = 0, $exitcond = 0, $exitcond9 = 0, $i$08 = 0, $i$13 = 0, $o$01 = 0, $v$06 = 0, $v$12 = 0;
var $val = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$val = sp;
$d$04 = $data;$i$08 = 0;$v$06 = $val;
while(1) {
$0 = ((($d$04)) + 16|0);
$1 = HEAP16[$0>>1]|0;
$2 = ($1<<16>>16)==(0);
if ($2) {
$3 = ((($d$04)) + 32|0);
$4 = HEAP16[$3>>1]|0;
$5 = ($4<<16>>16)==(0);
if ($5) {
$6 = ((($d$04)) + 48|0);
$7 = HEAP16[$6>>1]|0;
$8 = ($7<<16>>16)==(0);
if ($8) {
$9 = ((($d$04)) + 64|0);
$10 = HEAP16[$9>>1]|0;
$11 = ($10<<16>>16)==(0);
if ($11) {
$12 = ((($d$04)) + 80|0);
$13 = HEAP16[$12>>1]|0;
$14 = ($13<<16>>16)==(0);
if ($14) {
$15 = ((($d$04)) + 96|0);
$16 = HEAP16[$15>>1]|0;
$17 = ($16<<16>>16)==(0);
if ($17) {
$18 = ((($d$04)) + 112|0);
$19 = HEAP16[$18>>1]|0;
$20 = ($19<<16>>16)==(0);
if ($20) {
$21 = HEAP16[$d$04>>1]|0;
$22 = $21 << 16 >> 16;
$23 = $22 << 2;
$24 = ((($v$06)) + 224|0);
HEAP32[$24>>2] = $23;
$25 = ((($v$06)) + 192|0);
HEAP32[$25>>2] = $23;
$26 = ((($v$06)) + 160|0);
HEAP32[$26>>2] = $23;
$27 = ((($v$06)) + 128|0);
HEAP32[$27>>2] = $23;
$28 = ((($v$06)) + 96|0);
HEAP32[$28>>2] = $23;
$29 = ((($v$06)) + 64|0);
HEAP32[$29>>2] = $23;
$30 = ((($v$06)) + 32|0);
HEAP32[$30>>2] = $23;
HEAP32[$v$06>>2] = $23;
} else {
label = 10;
}
} else {
label = 10;
}
} else {
label = 10;
}
} else {
label = 10;
}
} else {
label = 10;
}
} else {
label = 10;
}
} else {
label = 10;
}
if ((label|0) == 10) {
label = 0;
$31 = ((($d$04)) + 32|0);
$32 = HEAP16[$31>>1]|0;
$33 = $32 << 16 >> 16;
$34 = ((($d$04)) + 96|0);
$35 = HEAP16[$34>>1]|0;
$36 = $35 << 16 >> 16;
$37 = (($36) + ($33))|0;
$38 = ($37*2217)|0;
$39 = Math_imul($36, -7567)|0;
$40 = (($38) + ($39))|0;
$41 = ($33*3135)|0;
$42 = (($38) + ($41))|0;
$43 = HEAP16[$d$04>>1]|0;
$44 = $43 << 16 >> 16;
$45 = ((($d$04)) + 64|0);
$46 = HEAP16[$45>>1]|0;
$47 = $46 << 16 >> 16;
$48 = (($47) + ($44))|0;
$49 = $48 << 12;
$50 = (($44) - ($47))|0;
$51 = $50 << 12;
$52 = (($49) - ($42))|0;
$53 = (($51) - ($40))|0;
$54 = ((($d$04)) + 112|0);
$55 = HEAP16[$54>>1]|0;
$56 = $55 << 16 >> 16;
$57 = ((($d$04)) + 80|0);
$58 = HEAP16[$57>>1]|0;
$59 = $58 << 16 >> 16;
$60 = ((($d$04)) + 48|0);
$61 = HEAP16[$60>>1]|0;
$62 = $61 << 16 >> 16;
$63 = HEAP16[$0>>1]|0;
$64 = $63 << 16 >> 16;
$65 = (($62) + ($56))|0;
$66 = (($64) + ($59))|0;
$67 = (($64) + ($56))|0;
$68 = (($62) + ($59))|0;
$69 = (($66) + ($65))|0;
$70 = ($69*4816)|0;
$71 = ($56*1223)|0;
$72 = ($59*8410)|0;
$73 = ($62*12586)|0;
$74 = ($64*6149)|0;
$75 = Math_imul($67, -3685)|0;
$76 = (($70) + ($75))|0;
$77 = Math_imul($68, -10497)|0;
$78 = (($70) + ($77))|0;
$79 = Math_imul($65, -8034)|0;
$80 = Math_imul($66, -1597)|0;
$81 = (($80) + ($74))|0;
$82 = (($81) + ($76))|0;
$83 = (($79) + ($73))|0;
$84 = (($83) + ($78))|0;
$85 = (($80) + ($72))|0;
$86 = (($85) + ($78))|0;
$87 = (($79) + ($71))|0;
$88 = (($87) + ($76))|0;
$89 = (($42) + 512)|0;
$90 = (($89) + ($49))|0;
$91 = (($40) + 512)|0;
$92 = (($91) + ($51))|0;
$93 = (($53) + 512)|0;
$94 = (($52) + 512)|0;
$95 = (($82) + ($90))|0;
$96 = $95 >> 10;
HEAP32[$v$06>>2] = $96;
$97 = (($90) - ($82))|0;
$98 = $97 >> 10;
$99 = ((($v$06)) + 224|0);
HEAP32[$99>>2] = $98;
$100 = (($84) + ($92))|0;
$101 = $100 >> 10;
$102 = ((($v$06)) + 32|0);
HEAP32[$102>>2] = $101;
$103 = (($92) - ($84))|0;
$104 = $103 >> 10;
$105 = ((($v$06)) + 192|0);
HEAP32[$105>>2] = $104;
$106 = (($86) + ($93))|0;
$107 = $106 >> 10;
$108 = ((($v$06)) + 64|0);
HEAP32[$108>>2] = $107;
$109 = (($93) - ($86))|0;
$110 = $109 >> 10;
$111 = ((($v$06)) + 160|0);
HEAP32[$111>>2] = $110;
$112 = (($88) + ($94))|0;
$113 = $112 >> 10;
$114 = ((($v$06)) + 96|0);
HEAP32[$114>>2] = $113;
$115 = (($94) - ($88))|0;
$116 = $115 >> 10;
$117 = ((($v$06)) + 128|0);
HEAP32[$117>>2] = $116;
}
$118 = (($i$08) + 1)|0;
$119 = ((($d$04)) + 2|0);
$120 = ((($v$06)) + 4|0);
$exitcond9 = ($118|0)==(8);
if ($exitcond9) {
$i$13 = 0;$o$01 = $out;$v$12 = $val;
break;
} else {
$d$04 = $119;$i$08 = $118;$v$06 = $120;
}
}
while(1) {
$121 = ((($v$12)) + 8|0);
$122 = HEAP32[$121>>2]|0;
$123 = ((($v$12)) + 24|0);
$124 = HEAP32[$123>>2]|0;
$125 = (($124) + ($122))|0;
$126 = ($125*2217)|0;
$127 = Math_imul($124, -7567)|0;
$128 = (($126) + ($127))|0;
$129 = ($122*3135)|0;
$130 = (($126) + ($129))|0;
$131 = HEAP32[$v$12>>2]|0;
$132 = ((($v$12)) + 16|0);
$133 = HEAP32[$132>>2]|0;
$134 = (($133) + ($131))|0;
$135 = $134 << 12;
$136 = (($131) - ($133))|0;
$137 = $136 << 12;
$138 = (($135) - ($130))|0;
$139 = (($137) - ($128))|0;
$140 = ((($v$12)) + 28|0);
$141 = HEAP32[$140>>2]|0;
$142 = ((($v$12)) + 20|0);
$143 = HEAP32[$142>>2]|0;
$144 = ((($v$12)) + 12|0);
$145 = HEAP32[$144>>2]|0;
$146 = ((($v$12)) + 4|0);
$147 = HEAP32[$146>>2]|0;
$148 = (($145) + ($141))|0;
$149 = (($147) + ($143))|0;
$150 = (($147) + ($141))|0;
$151 = (($145) + ($143))|0;
$152 = (($149) + ($148))|0;
$153 = ($152*4816)|0;
$154 = ($141*1223)|0;
$155 = ($143*8410)|0;
$156 = ($145*12586)|0;
$157 = ($147*6149)|0;
$158 = Math_imul($150, -3685)|0;
$159 = (($153) + ($158))|0;
$160 = Math_imul($151, -10497)|0;
$161 = (($153) + ($160))|0;
$162 = Math_imul($148, -8034)|0;
$163 = Math_imul($149, -1597)|0;
$164 = (($163) + ($157))|0;
$165 = (($164) + ($159))|0;
$166 = (($162) + ($156))|0;
$167 = (($166) + ($161))|0;
$168 = (($163) + ($155))|0;
$169 = (($168) + ($161))|0;
$170 = (($162) + ($154))|0;
$171 = (($170) + ($159))|0;
$172 = (($130) + 16842752)|0;
$173 = (($172) + ($135))|0;
$174 = (($128) + 16842752)|0;
$175 = (($174) + ($137))|0;
$176 = (($139) + 16842752)|0;
$177 = (($138) + 16842752)|0;
$178 = (($165) + ($173))|0;
$179 = $178 >> 17;
$180 = (_stbi__clamp($179)|0);
HEAP8[$o$01>>0] = $180;
$181 = (($173) - ($165))|0;
$182 = $181 >> 17;
$183 = (_stbi__clamp($182)|0);
$184 = ((($o$01)) + 7|0);
HEAP8[$184>>0] = $183;
$185 = (($167) + ($175))|0;
$186 = $185 >> 17;
$187 = (_stbi__clamp($186)|0);
$188 = ((($o$01)) + 1|0);
HEAP8[$188>>0] = $187;
$189 = (($175) - ($167))|0;
$190 = $189 >> 17;
$191 = (_stbi__clamp($190)|0);
$192 = ((($o$01)) + 6|0);
HEAP8[$192>>0] = $191;
$193 = (($169) + ($176))|0;
$194 = $193 >> 17;
$195 = (_stbi__clamp($194)|0);
$196 = ((($o$01)) + 2|0);
HEAP8[$196>>0] = $195;
$197 = (($176) - ($169))|0;
$198 = $197 >> 17;
$199 = (_stbi__clamp($198)|0);
$200 = ((($o$01)) + 5|0);
HEAP8[$200>>0] = $199;
$201 = (($171) + ($177))|0;
$202 = $201 >> 17;
$203 = (_stbi__clamp($202)|0);
$204 = ((($o$01)) + 3|0);
HEAP8[$204>>0] = $203;
$205 = (($177) - ($171))|0;
$206 = $205 >> 17;
$207 = (_stbi__clamp($206)|0);
$208 = ((($o$01)) + 4|0);
HEAP8[$208>>0] = $207;
$209 = (($i$13) + 1)|0;
$210 = ((($v$12)) + 32|0);
$211 = (($o$01) + ($out_stride)|0);
$exitcond = ($209|0)==(8);
if ($exitcond) {
break;
} else {
$i$13 = $209;$o$01 = $211;$v$12 = $210;
}
}
STACKTOP = sp;return;
}
function _stbi__YCbCr_to_RGB_row($out,$y,$pcb,$pcr,$count,$step) {
$out = $out|0;
$y = $y|0;
$pcb = $pcb|0;
$pcr = $pcr|0;
$count = $count|0;
$step = $step|0;
var $$04 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b$0 = 0, $exitcond = 0, $g$0 = 0, $i$03 = 0, $r$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($count|0)>(0);
if ($0) {
$$04 = $out;$i$03 = 0;
} else {
return;
}
while(1) {
$1 = (($y) + ($i$03)|0);
$2 = HEAP8[$1>>0]|0;
$3 = $2&255;
$4 = $3 << 20;
$5 = $4 | 524288;
$6 = (($pcr) + ($i$03)|0);
$7 = HEAP8[$6>>0]|0;
$8 = $7&255;
$9 = (($8) + -128)|0;
$10 = (($pcb) + ($i$03)|0);
$11 = HEAP8[$10>>0]|0;
$12 = $11&255;
$13 = (($12) + -128)|0;
$14 = Math_imul($9, 1470208)|0;
$15 = (($14) + ($5))|0;
$16 = Math_imul($9, -748800)|0;
$17 = (($5) + ($16))|0;
$18 = Math_imul($13, -360960)|0;
$19 = $18 & -65536;
$20 = (($19) + ($17))|0;
$21 = Math_imul($13, 1858048)|0;
$22 = (($21) + ($5))|0;
$23 = $15 >> 20;
$24 = $20 >> 20;
$25 = $22 >> 20;
$26 = ($23>>>0)>(255);
$27 = $15 >>> 31;
$28 = (($27) + 255)|0;
$r$0 = $26 ? $28 : $23;
$29 = ($24>>>0)>(255);
$30 = $20 >>> 31;
$31 = (($30) + 255)|0;
$g$0 = $29 ? $31 : $24;
$32 = ($25>>>0)>(255);
$33 = $22 >>> 31;
$34 = (($33) + 255)|0;
$b$0 = $32 ? $34 : $25;
$35 = $r$0&255;
HEAP8[$$04>>0] = $35;
$36 = $g$0&255;
$37 = ((($$04)) + 1|0);
HEAP8[$37>>0] = $36;
$38 = $b$0&255;
$39 = ((($$04)) + 2|0);
HEAP8[$39>>0] = $38;
$40 = ((($$04)) + 3|0);
HEAP8[$40>>0] = -1;
$41 = (($$04) + ($step)|0);
$42 = (($i$03) + 1)|0;
$exitcond = ($42|0)==($count|0);
if ($exitcond) {
break;
} else {
$$04 = $41;$i$03 = $42;
}
}
return;
}
function _stbi__resample_row_hv_2($out,$in_near,$in_far,$w,$hs) {
$out = $out|0;
$in_near = $in_near|0;
$in_far = $in_far|0;
$w = $w|0;
$hs = $hs|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, $exitcond = 0, $i$01 = 0, $t1$0$lcssa = 0, $t1$02 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($w|0)==(1);
$1 = HEAP8[$in_near>>0]|0;
$2 = $1&255;
$3 = ($2*3)|0;
$4 = HEAP8[$in_far>>0]|0;
$5 = $4&255;
$6 = (($3) + ($5))|0;
$7 = (($6) + 2)|0;
$8 = $7 >>> 2;
$9 = $8&255;
if ($0) {
$10 = ((($out)) + 1|0);
HEAP8[$10>>0] = $9;
HEAP8[$out>>0] = $9;
return ($out|0);
}
HEAP8[$out>>0] = $9;
$11 = ($w|0)>(1);
if ($11) {
$i$01 = 1;$t1$02 = $6;
while(1) {
$12 = (($in_near) + ($i$01)|0);
$13 = HEAP8[$12>>0]|0;
$14 = $13&255;
$15 = ($14*3)|0;
$16 = (($in_far) + ($i$01)|0);
$17 = HEAP8[$16>>0]|0;
$18 = $17&255;
$19 = (($15) + ($18))|0;
$20 = ($t1$02*3)|0;
$21 = (($20) + 8)|0;
$22 = (($21) + ($19))|0;
$23 = $22 >>> 4;
$24 = $23&255;
$25 = $i$01 << 1;
$26 = (($25) + -1)|0;
$27 = (($out) + ($26)|0);
HEAP8[$27>>0] = $24;
$28 = ($19*3)|0;
$29 = (($t1$02) + 8)|0;
$30 = (($29) + ($28))|0;
$31 = $30 >>> 4;
$32 = $31&255;
$33 = (($out) + ($25)|0);
HEAP8[$33>>0] = $32;
$34 = (($i$01) + 1)|0;
$exitcond = ($34|0)==($w|0);
if ($exitcond) {
$t1$0$lcssa = $19;
break;
} else {
$i$01 = $34;$t1$02 = $19;
}
}
} else {
$t1$0$lcssa = $6;
}
$35 = (($t1$0$lcssa) + 2)|0;
$36 = $35 >>> 2;
$37 = $36&255;
$38 = $w << 1;
$39 = (($38) + -1)|0;
$40 = (($out) + ($39)|0);
HEAP8[$40>>0] = $37;
return ($out|0);
}
function _stbi__clamp($x) {
$x = $x|0;
var $$not = 0, $0 = 0, $1 = 0, $2 = 0, $x$lobit = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($x>>>0)>(255);
if ($0) {
$x$lobit = $x >> 31;
$1 = $x$lobit&255;
$$not = $1 ^ -1;
return ($$not|0);
} else {
$2 = $x&255;
return ($2|0);
}
return (0)|0;
}
function _stbi__stdio_read($user,$data,$size) {
$user = $user|0;
$data = $data|0;
$size = $size|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_fread($data,1,$size,$user)|0);
return ($0|0);
}
function _stbi__stdio_skip($user,$n) {
$user = $user|0;
$n = $n|0;
var label = 0, sp = 0;
sp = STACKTOP;
(_fseek($user,$n,1)|0);
return;
}
function _stbi__stdio_eof($user) {
$user = $user|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_feof($user)|0);
return ($0|0);
}
function _PixelIsMagenta($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP8[$p>>0]|0;
$1 = ($0<<24>>24)==(-1);
if ($1) {
$2 = ((($p)) + 1|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($3<<24>>24)==(0);
if ($4) {
$5 = ((($p)) + 2|0);
$6 = HEAP8[$5>>0]|0;
$7 = ($6<<24>>24)==(-1);
if ($7) {
$8 = ((($p)) + 3|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(-1);
$12 = $10;
} else {
$12 = 0;
}
} else {
$12 = 0;
}
} else {
$12 = 0;
}
$11 = $12&1;
return ($11|0);
}
function _stbtt__sort_edges($p,$n) {
$p = $p|0;
$n = $n|0;
var label = 0, sp = 0;
sp = STACKTOP;
_stbtt__sort_edges_quicksort($p,$n);
_stbtt__sort_edges_ins_sort($p,$n);
return;
}
function _stbtt__rasterize_sorted_edges($result,$e,$n,$off_x,$off_y) {
$result = $result|0;
$e = $e|0;
$n = $n|0;
$off_x = $off_x|0;
$off_y = $off_y|0;
var $$019 = 0, $$1$lcssa = 0, $$18 = 0, $$lcssa = 0, $$sum = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0;
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0;
var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0;
var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0;
var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0, $92 = 0, $93 = 0;
var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $active$sroa$0 = 0, $fabsf = 0.0, $hh = 0, $i$010 = 0, $j$016 = 0, $scanline$0 = 0, $scanline_data = 0, $step$0$ph7 = 0, $step$113 = 0, $sum$011 = 0.0, $y$018 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 544|0;
$hh = sp + 520|0;
$active$sroa$0 = sp;
$scanline_data = sp + 4|0;
;HEAP32[$hh>>2]=0|0;HEAP32[$hh+4>>2]=0|0;HEAP32[$hh+8>>2]=0|0;
HEAP32[$active$sroa$0>>2] = 0;
$0 = HEAP32[$result>>2]|0;
$1 = ($0|0)>(64);
if ($1) {
$2 = $0 << 3;
$3 = $2 | 4;
$4 = (_malloc($3)|0);
$scanline$0 = $4;
} else {
$scanline$0 = $scanline_data;
}
$5 = HEAP32[$result>>2]|0;
$6 = ((($result)) + 4|0);
$7 = HEAP32[$6>>2]|0;
$8 = (($7) + ($off_y))|0;
$9 = (+($8|0));
$10 = $9 + 1.0;
$11 = (((($e) + (($n*20)|0)|0)) + 4|0);
HEAPF32[$11>>2] = $10;
$12 = HEAP32[$6>>2]|0;
$13 = ($12|0)>(0);
L5: do {
if ($13) {
$14 = (($scanline$0) + ($5<<2)|0);
$$sum1 = (($5) + 1)|0;
$15 = (($scanline$0) + ($$sum1<<2)|0);
$16 = ((($result)) + 8|0);
$17 = ((($result)) + 12|0);
$$019 = $e;$j$016 = 0;$y$018 = $off_y;
L7: while(1) {
$18 = (+($y$018|0));
$19 = $18 + 1.0;
$20 = HEAP32[$result>>2]|0;
$21 = $20 << 2;
_memset(($scanline$0|0),0,($21|0))|0;
$22 = HEAP32[$result>>2]|0;
$23 = $22 << 2;
$24 = (($23) + 4)|0;
_memset(($14|0),0,($24|0))|0;
$25 = HEAP32[$active$sroa$0>>2]|0;
$26 = ($25|0)==(0|0);
L9: do {
if (!($26)) {
$99 = $25;$step$0$ph7 = $active$sroa$0;
while(1) {
$31 = $99;
while(1) {
$30 = ((($31)) + 24|0);
$32 = +HEAPF32[$30>>2];
$33 = !($32 <= $18);
if ($33) {
$$lcssa = $31;
break;
}
$34 = HEAP32[$31>>2]|0;
HEAP32[$step$0$ph7>>2] = $34;
$35 = ((($31)) + 16|0);
$36 = +HEAPF32[$35>>2];
$37 = $36 != 0.0;
if (!($37)) {
label = 11;
break L7;
}
HEAPF32[$35>>2] = 0.0;
_stbtt__hheap_free($hh,$31);
$38 = HEAP32[$step$0$ph7>>2]|0;
$39 = ($38|0)==(0|0);
if ($39) {
break L9;
} else {
$31 = $38;
}
}
$40 = HEAP32[$$lcssa>>2]|0;
$41 = ($40|0)==(0|0);
if ($41) {
break;
} else {
$99 = $40;$step$0$ph7 = $$lcssa;
}
}
}
} while(0);
$27 = ((($$019)) + 4|0);
$28 = +HEAPF32[$27>>2];
$29 = !($28 <= $19);
if ($29) {
$$1$lcssa = $$019;
} else {
$$18 = $$019;$45 = $28;
while(1) {
$42 = ((($$18)) + 12|0);
$43 = +HEAPF32[$42>>2];
$44 = $45 != $43;
if ($44) {
$46 = (_stbtt__new_active($hh,$$18,$off_x,$18)|0);
$47 = ($46|0)==(0|0);
if (!($47)) {
$48 = ((($46)) + 24|0);
$49 = +HEAPF32[$48>>2];
$50 = !($49 >= $18);
if ($50) {
label = 17;
break L7;
}
$51 = HEAP32[$active$sroa$0>>2]|0;
HEAP32[$46>>2] = $51;
$52 = $46;
HEAP32[$active$sroa$0>>2] = $52;
}
}
$53 = ((($$18)) + 20|0);
$54 = ((($$18)) + 24|0);
$55 = +HEAPF32[$54>>2];
$56 = !($55 <= $19);
if ($56) {
$$1$lcssa = $53;
break;
} else {
$$18 = $53;$45 = $55;
}
}
}
$57 = HEAP32[$active$sroa$0>>2]|0;
$58 = ($57|0)==(0);
if (!($58)) {
$59 = $57;
$60 = HEAP32[$result>>2]|0;
_stbtt__fill_active_edges_new($scanline$0,$15,$60,$59,$18);
}
$61 = HEAP32[$result>>2]|0;
$62 = ($61|0)>(0);
if ($62) {
$i$010 = 0;$sum$011 = 0.0;
while(1) {
$$sum = (($i$010) + ($5))|0;
$65 = (($scanline$0) + ($$sum<<2)|0);
$66 = +HEAPF32[$65>>2];
$67 = $sum$011 + $66;
$68 = (($scanline$0) + ($i$010<<2)|0);
$69 = +HEAPF32[$68>>2];
$70 = $69 + $67;
$fabsf = (+Math_abs((+$70)));
$71 = $fabsf * 255.0;
$72 = $71 + 0.5;
$73 = (~~(($72)));
$74 = ($73|0)>(255);
$75 = $73&255;
$76 = $74 ? -1 : $75;
$77 = HEAP32[$16>>2]|0;
$78 = Math_imul($77, $j$016)|0;
$79 = (($78) + ($i$010))|0;
$80 = HEAP32[$17>>2]|0;
$81 = (($80) + ($79)|0);
HEAP8[$81>>0] = $76;
$82 = (($i$010) + 1)|0;
$83 = HEAP32[$result>>2]|0;
$84 = ($82|0)<($83|0);
if ($84) {
$i$010 = $82;$sum$011 = $67;
} else {
break;
}
}
}
$63 = HEAP32[$active$sroa$0>>2]|0;
$64 = ($63|0)==(0|0);
if (!($64)) {
$86 = $63;$step$113 = $active$sroa$0;
while(1) {
$85 = ((($86)) + 8|0);
$87 = +HEAPF32[$85>>2];
$88 = ((($86)) + 4|0);
$89 = +HEAPF32[$88>>2];
$90 = $87 + $89;
HEAPF32[$88>>2] = $90;
$91 = HEAP32[$step$113>>2]|0;
$92 = HEAP32[$91>>2]|0;
$93 = ($92|0)==(0|0);
if ($93) {
break;
} else {
$86 = $92;$step$113 = $91;
}
}
}
$94 = (($y$018) + 1)|0;
$95 = (($j$016) + 1)|0;
$96 = HEAP32[$6>>2]|0;
$97 = ($95|0)<($96|0);
if ($97) {
$$019 = $$1$lcssa;$j$016 = $95;$y$018 = $94;
} else {
break L5;
}
}
if ((label|0) == 11) {
___assert_fail((20632|0),(14173|0),2099,(20645|0));
// unreachable;
}
else if ((label|0) == 17) {
___assert_fail((20675|0),(14173|0),2112,(20645|0));
// unreachable;
}
}
} while(0);
_stbtt__hheap_cleanup($hh);
$98 = ($scanline$0|0)==($scanline_data|0);
if ($98) {
STACKTOP = sp;return;
}
_free($scanline$0);
STACKTOP = sp;return;
}
function _stbtt__hheap_free($hh,$p) {
$hh = $hh|0;
$p = $p|0;
var $0 = 0, $1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($hh)) + 4|0);
$1 = HEAP32[$0>>2]|0;
HEAP32[$p>>2] = $1;
HEAP32[$0>>2] = $p;
return;
}
function _stbtt__new_active($hh,$e,$off_x,$start_point) {
$hh = $hh|0;
$e = $e|0;
$off_x = $off_x|0;
$start_point = +$start_point;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_stbtt__hheap_alloc($hh)|0);
$1 = ((($e)) + 8|0);
$2 = +HEAPF32[$1>>2];
$3 = +HEAPF32[$e>>2];
$4 = $2 - $3;
$5 = ((($e)) + 12|0);
$6 = +HEAPF32[$5>>2];
$7 = ((($e)) + 4|0);
$8 = +HEAPF32[$7>>2];
$9 = $6 - $8;
$10 = $4 / $9;
$11 = ($0|0)==(0|0);
if ($11) {
___assert_fail((20965|0),(14173|0),1700,(20981|0));
// unreachable;
} else {
$12 = ((($0)) + 8|0);
HEAPF32[$12>>2] = $10;
$13 = $10 != 0.0;
$14 = 1.0 / $10;
$15 = $13 ? $14 : 0.0;
$16 = ((($0)) + 12|0);
HEAPF32[$16>>2] = $15;
$17 = +HEAPF32[$e>>2];
$18 = +HEAPF32[$7>>2];
$19 = $start_point - $18;
$20 = $10 * $19;
$21 = $17 + $20;
$22 = ((($0)) + 4|0);
$23 = (+($off_x|0));
$24 = $21 - $23;
HEAPF32[$22>>2] = $24;
$25 = ((($e)) + 16|0);
$26 = HEAP32[$25>>2]|0;
$27 = ($26|0)!=(0);
$28 = $27 ? 1.0 : -1.0;
$29 = ((($0)) + 16|0);
HEAPF32[$29>>2] = $28;
$30 = HEAP32[$7>>2]|0;
$31 = ((($0)) + 20|0);
HEAP32[$31>>2] = $30;
$32 = HEAP32[$5>>2]|0;
$33 = ((($0)) + 24|0);
HEAP32[$33>>2] = $32;
HEAP32[$0>>2] = 0;
return ($0|0);
}
return (0)|0;
}
function _stbtt__fill_active_edges_new($scanline,$scanline_fill,$len,$e,$y_top) {
$scanline = $scanline|0;
$scanline_fill = $scanline_fill|0;
$len = $len|0;
$e = $e|0;
$y_top = +$y_top;
var $$014 = 0, $$not = 0, $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0.0;
var $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0;
var $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0;
var $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0;
var $area$0$lcssa = 0.0, $area$012 = 0.0, $brmerge = 0, $dy$0 = 0.0, $exitcond = 0, $exitcond20 = 0, $fabsf = 0.0, $or$cond = 0, $or$cond2 = 0, $or$cond3 = 0, $or$cond4 = 0, $or$cond5 = 0, $or$cond6 = 0, $or$cond7 = 0, $or$cond8 = 0, $or$cond9 = 0, $sy0$0 = 0.0, $sy0$1 = 0.0, $sy1$0 = 0.0, $sy1$1 = 0.0;
var $x01$0 = 0.0, $x2$011 = 0, $x4$010 = 0, $x_bottom$0 = 0.0, $x_bottom$1 = 0.0, $x_top$0 = 0.0, $x_top$1 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $y_top + 1.0;
$1 = ($e|0)==(0|0);
if ($1) {
return;
}
$2 = (+($len|0));
$3 = ((($scanline_fill)) + -4|0);
$4 = ((($scanline_fill)) + -4|0);
$5 = (+($len|0));
$6 = ($len|0)>(0);
$$014 = $e;
L4: while(1) {
$7 = ((($$014)) + 24|0);
$8 = +HEAPF32[$7>>2];
$9 = $8 >= $y_top;
if (!($9)) {
label = 4;
break;
}
$10 = ((($$014)) + 8|0);
$11 = +HEAPF32[$10>>2];
$12 = $11 == 0.0;
$13 = ((($$014)) + 4|0);
$14 = +HEAPF32[$13>>2];
do {
if ($12) {
$15 = $14 < $2;
if ($15) {
$16 = !($14 >= 0.0);
if ($16) {
_stbtt__handle_clipped_edge($3,0,$$014,$14,$y_top,$14,$0);
break;
} else {
$17 = (~~(($14)));
_stbtt__handle_clipped_edge($scanline,$17,$$014,$14,$y_top,$14,$0);
$18 = (($17) + 1)|0;
_stbtt__handle_clipped_edge($4,$18,$$014,$14,$y_top,$14,$0);
break;
}
}
} else {
$19 = $11 + $14;
$20 = ((($$014)) + 12|0);
$21 = +HEAPF32[$20>>2];
$22 = ((($$014)) + 20|0);
$23 = +HEAPF32[$22>>2];
$24 = !($23 <= $0);
$$not = $9 ^ 1;
$brmerge = $24 | $$not;
if ($brmerge) {
label = 11;
break L4;
}
$25 = $23 > $y_top;
if ($25) {
$26 = $23 - $y_top;
$27 = $11 * $26;
$28 = $14 + $27;
$sy0$0 = $23;$x_top$0 = $28;
} else {
$sy0$0 = $y_top;$x_top$0 = $14;
}
$29 = +HEAPF32[$7>>2];
$30 = $29 < $0;
if ($30) {
$31 = $29 - $y_top;
$32 = $11 * $31;
$33 = $14 + $32;
$sy1$0 = $29;$x_bottom$0 = $33;
} else {
$sy1$0 = $0;$x_bottom$0 = $19;
}
$34 = $x_top$0 >= 0.0;
$35 = $x_bottom$0 >= 0.0;
$or$cond = $34 & $35;
if ($or$cond) {
$36 = $x_top$0 < $5;
$37 = $x_bottom$0 < $5;
$or$cond2 = $36 & $37;
if ($or$cond2) {
$38 = (~~(($x_top$0)));
$39 = (~~(($x_bottom$0)));
$40 = ($38|0)==($39|0);
if ($40) {
$41 = $sy1$0 - $sy0$0;
$42 = ($38|0)>(-1);
$43 = ($38|0)<($len|0);
$or$cond3 = $42 & $43;
if (!($or$cond3)) {
label = 21;
break L4;
}
$44 = ((($$014)) + 16|0);
$45 = +HEAPF32[$44>>2];
$46 = (+($38|0));
$47 = $x_top$0 - $46;
$48 = $x_bottom$0 - $46;
$49 = $47 + $48;
$50 = $49 * 0.5;
$51 = 1.0 - $50;
$52 = $51 * $45;
$53 = $41 * $52;
$54 = (($scanline) + ($38<<2)|0);
$55 = +HEAPF32[$54>>2];
$56 = $55 + $53;
HEAPF32[$54>>2] = $56;
$57 = +HEAPF32[$44>>2];
$58 = $41 * $57;
$59 = (($scanline_fill) + ($38<<2)|0);
$60 = +HEAPF32[$59>>2];
$61 = $60 + $58;
HEAPF32[$59>>2] = $61;
break;
}
$62 = $x_top$0 > $x_bottom$0;
if ($62) {
$63 = $sy0$0 - $y_top;
$64 = $0 - $63;
$65 = $sy1$0 - $y_top;
$66 = $0 - $65;
$67 = -$21;
$dy$0 = $67;$sy0$1 = $66;$sy1$1 = $64;$x01$0 = $19;$x_bottom$1 = $x_top$0;$x_top$1 = $x_bottom$0;
} else {
$dy$0 = $21;$sy0$1 = $sy0$0;$sy1$1 = $sy1$0;$x01$0 = $14;$x_bottom$1 = $x_bottom$0;$x_top$1 = $x_top$0;
}
$68 = (~~(($x_top$1)));
$69 = (~~(($x_bottom$1)));
$70 = (($68) + 1)|0;
$71 = (+($70|0));
$72 = $71 - $x01$0;
$73 = $dy$0 * $72;
$74 = $73 + $y_top;
$75 = ((($$014)) + 16|0);
$76 = +HEAPF32[$75>>2];
$77 = $74 - $sy0$1;
$78 = $76 * $77;
$79 = (+($68|0));
$80 = $x_top$1 - $79;
$81 = $80 + 1.0;
$82 = $81 * 0.5;
$83 = 1.0 - $82;
$84 = $83 * $78;
$85 = (($scanline) + ($68<<2)|0);
$86 = +HEAPF32[$85>>2];
$87 = $86 + $84;
HEAPF32[$85>>2] = $87;
$88 = $dy$0 * $76;
$89 = ($69|0)>($70|0);
if ($89) {
$90 = $88 * 0.5;
$area$012 = $78;$x2$011 = $70;
while(1) {
$91 = $90 + $area$012;
$92 = (($scanline) + ($x2$011<<2)|0);
$93 = +HEAPF32[$92>>2];
$94 = $91 + $93;
HEAPF32[$92>>2] = $94;
$95 = $88 + $area$012;
$96 = (($x2$011) + 1)|0;
$exitcond20 = ($96|0)==($69|0);
if ($exitcond20) {
$area$0$lcssa = $95;
break;
} else {
$area$012 = $95;$x2$011 = $96;
}
}
} else {
$area$0$lcssa = $78;
}
$fabsf = (+Math_abs((+$area$0$lcssa)));
$97 = !($fabsf <= 1.0099999904632568);
if ($97) {
label = 29;
break L4;
}
$98 = (($69) - ($70))|0;
$99 = (+($98|0));
$100 = $dy$0 * $99;
$101 = $100 + $74;
$102 = (+($69|0));
$103 = $x_bottom$1 - $102;
$104 = $103 + 0.0;
$105 = $104 * 0.5;
$106 = 1.0 - $105;
$107 = $76 * $106;
$108 = $sy1$1 - $101;
$109 = $107 * $108;
$110 = $109 + $area$0$lcssa;
$111 = (($scanline) + ($69<<2)|0);
$112 = +HEAPF32[$111>>2];
$113 = $110 + $112;
HEAPF32[$111>>2] = $113;
$114 = $sy1$1 - $sy0$1;
$115 = $114 * $76;
$116 = (($scanline_fill) + ($69<<2)|0);
$117 = +HEAPF32[$116>>2];
$118 = $115 + $117;
HEAPF32[$116>>2] = $118;
break;
}
}
if ($6) {
$x4$010 = 0;
while(1) {
$119 = (+($x4$010|0));
$120 = (($x4$010) + 1)|0;
$121 = (+($120|0));
$122 = $119 - $14;
$123 = $122 / $11;
$124 = $123 + $y_top;
$125 = $121 - $14;
$126 = $125 / $11;
$127 = $126 + $y_top;
$128 = $14 < $119;
$129 = $19 > $121;
$or$cond4 = $128 & $129;
do {
if ($or$cond4) {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$119,$124);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$121,$127);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$19,$0);
} else {
$130 = $19 < $119;
$131 = $14 > $121;
$or$cond5 = $130 & $131;
if ($or$cond5) {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$121,$127);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$119,$124);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$19,$0);
break;
}
$132 = $19 > $119;
$or$cond6 = $128 & $132;
if ($or$cond6) {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$119,$124);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$19,$0);
break;
}
$133 = $14 > $119;
$or$cond7 = $130 & $133;
if ($or$cond7) {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$119,$124);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$19,$0);
break;
}
$134 = $14 < $121;
$or$cond8 = $134 & $129;
if ($or$cond8) {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$121,$127);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$19,$0);
break;
}
$135 = $19 < $121;
$or$cond9 = $135 & $131;
if ($or$cond9) {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$121,$127);
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$19,$0);
break;
} else {
_stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$19,$0);
break;
}
}
} while(0);
$exitcond = ($120|0)==($len|0);
if ($exitcond) {
break;
} else {
$x4$010 = $120;
}
}
}
}
} while(0);
$136 = HEAP32[$$014>>2]|0;
$137 = ($136|0)==(0|0);
if ($137) {
label = 46;
break;
} else {
$$014 = $136;
}
}
if ((label|0) == 4) {
___assert_fail((20695|0),(14173|0),1912,(20710|0));
// unreachable;
}
else if ((label|0) == 11) {
___assert_fail((20739|0),(14173|0),1931,(20710|0));
// unreachable;
}
else if ((label|0) == 21) {
___assert_fail((20775|0),(14173|0),1959,(20710|0));
// unreachable;
}
else if ((label|0) == 29) {
___assert_fail((20793|0),(14173|0),1996,(20710|0));
// unreachable;
}
else if ((label|0) == 46) {
return;
}
}
function _stbtt__hheap_cleanup($hh) {
$hh = $hh|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $c$01 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[$hh>>2]|0;
$1 = ($0|0)==(0|0);
if ($1) {
return;
} else {
$c$01 = $0;
}
while(1) {
$2 = HEAP32[$c$01>>2]|0;
_free($c$01);
$3 = ($2|0)==(0|0);
if ($3) {
break;
} else {
$c$01 = $2;
}
}
return;
}
function _stbtt__handle_clipped_edge($scanline,$x,$e,$x0,$y0,$x1,$y1) {
$scanline = $scanline|0;
$x = $x|0;
$e = $e|0;
$x0 = +$x0;
$y0 = +$y0;
$x1 = +$x1;
$y1 = +$y1;
var $$0 = 0.0, $$01 = 0.0, $$02 = 0.0, $$03 = 0.0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0;
var $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0;
var $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0;
var $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond4 = 0, $or$cond5 = 0, $or$cond6 = 0, $or$cond7 = 0, $or$cond8 = 0, $or$cond9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $y0 == $y1;
if ($0) {
return;
}
$1 = $y0 < $y1;
if (!($1)) {
___assert_fail((20813|0),(14173|0),1870,(20821|0));
// unreachable;
}
$2 = ((($e)) + 20|0);
$3 = +HEAPF32[$2>>2];
$4 = ((($e)) + 24|0);
$5 = +HEAPF32[$4>>2];
$6 = !($3 <= $5);
if ($6) {
___assert_fail((20848|0),(14173|0),1871,(20821|0));
// unreachable;
}
$7 = $5 < $y0;
$8 = $3 > $y1;
$or$cond = $8 | $7;
if ($or$cond) {
return;
}
$9 = $3 > $y0;
if ($9) {
$10 = $x1 - $x0;
$11 = $3 - $y0;
$12 = $10 * $11;
$13 = $y1 - $y0;
$14 = $12 / $13;
$15 = $14 + $x0;
$$02 = $3;$$03 = $15;
} else {
$$02 = $y0;$$03 = $x0;
}
$16 = +HEAPF32[$4>>2];
$17 = $16 < $y1;
if ($17) {
$18 = $x1 - $$03;
$19 = $16 - $y1;
$20 = $18 * $19;
$21 = $y1 - $$02;
$22 = $20 / $21;
$23 = $22 + $x1;
$$0 = $16;$$01 = $23;
} else {
$$0 = $y1;$$01 = $x1;
}
$24 = (+($x|0));
$25 = $$03 == $24;
$26 = (($x) + 1)|0;
$27 = (+($26|0));
do {
if ($25) {
$28 = !($$01 <= $27);
if ($28) {
___assert_fail((20863|0),(14173|0),1884,(20821|0));
// unreachable;
}
} else {
$29 = $$03 == $27;
if ($29) {
$30 = !($$01 >= $24);
if (!($30)) {
break;
}
___assert_fail((20873|0),(14173|0),1886,(20821|0));
// unreachable;
}
$31 = !($$03 <= $24);
if (!($31)) {
$32 = !($$01 <= $24);
if (!($32)) {
break;
}
___assert_fail((20881|0),(14173|0),1888,(20821|0));
// unreachable;
}
$33 = !($$03 >= $27);
if ($33) {
$35 = !($$01 >= $24);
$36 = !($$01 <= $27);
$or$cond4 = $35 | $36;
if (!($or$cond4)) {
break;
}
___assert_fail((20899|0),(14173|0),1892,(20821|0));
// unreachable;
} else {
$34 = !($$01 >= $27);
if (!($34)) {
break;
}
___assert_fail((20889|0),(14173|0),1890,(20821|0));
// unreachable;
}
}
} while(0);
$37 = !($$03 <= $24);
$38 = !($$01 <= $24);
$or$cond5 = $37 | $38;
if (!($or$cond5)) {
$39 = ((($e)) + 16|0);
$40 = +HEAPF32[$39>>2];
$41 = $$0 - $$02;
$42 = $41 * $40;
$43 = (($scanline) + ($x<<2)|0);
$44 = +HEAPF32[$43>>2];
$45 = $44 + $42;
HEAPF32[$43>>2] = $45;
return;
}
$46 = !($$03 >= $27);
$47 = !($$01 >= $27);
$or$cond6 = $46 | $47;
if (!($or$cond6)) {
return;
}
$48 = !($$03 >= $24);
$49 = !($$03 <= $27);
$or$cond7 = $48 | $49;
$50 = !($$01 >= $24);
$or$cond8 = $or$cond7 | $50;
$51 = !($$01 <= $27);
$or$cond9 = $51 | $or$cond8;
if ($or$cond9) {
___assert_fail((20920|0),(14173|0),1899,(20821|0));
// unreachable;
}
$52 = ((($e)) + 16|0);
$53 = +HEAPF32[$52>>2];
$54 = $$0 - $$02;
$55 = $54 * $53;
$56 = $$03 - $24;
$57 = $$01 - $24;
$58 = $56 + $57;
$59 = $58 * 0.5;
$60 = 1.0 - $59;
$61 = $60 * $55;
$62 = (($scanline) + ($x<<2)|0);
$63 = +HEAPF32[$62>>2];
$64 = $63 + $61;
HEAPF32[$62>>2] = $64;
return;
}
function _stbtt__hheap_alloc($hh) {
$hh = $hh|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($hh)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if (!($2)) {
$3 = HEAP32[$1>>2]|0;
HEAP32[$0>>2] = $3;
$$0 = $1;
return ($$0|0);
}
$4 = ((($hh)) + 8|0);
$5 = HEAP32[$4>>2]|0;
$6 = ($5|0)==(0);
do {
if ($6) {
$7 = (_malloc(56004)|0);
$8 = ($7|0)==(0|0);
if ($8) {
$$0 = 0;
return ($$0|0);
} else {
$9 = HEAP32[$hh>>2]|0;
HEAP32[$7>>2] = $9;
HEAP32[$hh>>2] = $7;
HEAP32[$4>>2] = 2000;
break;
}
}
} while(0);
$10 = HEAP32[$4>>2]|0;
$11 = (($10) + -1)|0;
HEAP32[$4>>2] = $11;
$12 = HEAP32[$hh>>2]|0;
$13 = ($11*28)|0;
$14 = (($12) + ($13)|0);
$$0 = $14;
return ($$0|0);
}
function _stbtt__sort_edges_quicksort($p,$n) {
$p = $p|0;
$n = $n|0;
var $$0$ph9 = 0, $$01$ph8 = 0, $$017 = 0, $$lcssa = 0, $$lcssa$lcssa = 0, $$lcssa31 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0;
var $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0;
var $9 = 0, $i$0 = 0, $i$0$lcssa = 0, $i$0$lcssa$lcssa = 0, $i$0$ph = 0, $j$0$ph = 0, $j$1 = 0, $j$1$lcssa = 0, $j$1$lcssa$lcssa = 0, $j$1$lcssa$lcssa$lcssa = 0, $t = 0, $tmp = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$t = sp;
$0 = ($n|0)>(12);
if (!($0)) {
STACKTOP = sp;return;
}
$$0$ph9 = $p;$$01$ph8 = $n;
L4: while(1) {
$1 = ((($$0$ph9)) + 4|0);
$$017 = $$01$ph8;
while(1) {
$2 = $$017 >> 1;
$3 = +HEAPF32[$1>>2];
$4 = (($$0$ph9) + (($2*20)|0)|0);
$5 = (((($$0$ph9) + (($2*20)|0)|0)) + 4|0);
$6 = +HEAPF32[$5>>2];
$7 = $3 < $6;
$8 = (($$017) + -1)|0;
$9 = (((($$0$ph9) + (($8*20)|0)|0)) + 4|0);
$10 = +HEAPF32[$9>>2];
$11 = $6 < $10;
$12 = $7 ^ $11;
if ($12) {
$13 = $3 < $10;
$tmp = $13 ^ $11;
$14 = $tmp ? $8 : 0;
$15 = (($$0$ph9) + (($14*20)|0)|0);
;HEAP32[$t>>2]=HEAP32[$15>>2]|0;HEAP32[$t+4>>2]=HEAP32[$15+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$15+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$15+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$15+16>>2]|0;
;HEAP32[$15>>2]=HEAP32[$4>>2]|0;HEAP32[$15+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$15+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$15+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$15+16>>2]=HEAP32[$4+16>>2]|0;
;HEAP32[$4>>2]=HEAP32[$t>>2]|0;HEAP32[$4+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$4+16>>2]=HEAP32[$t+16>>2]|0;
}
;HEAP32[$t>>2]=HEAP32[$$0$ph9>>2]|0;HEAP32[$t+4>>2]=HEAP32[$$0$ph9+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$$0$ph9+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$$0$ph9+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$$0$ph9+16>>2]|0;
;HEAP32[$$0$ph9>>2]=HEAP32[$4>>2]|0;HEAP32[$$0$ph9+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$0$ph9+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$0$ph9+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$$0$ph9+16>>2]=HEAP32[$4+16>>2]|0;
;HEAP32[$4>>2]=HEAP32[$t>>2]|0;HEAP32[$4+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$4+16>>2]=HEAP32[$t+16>>2]|0;
$i$0$ph = 1;$j$0$ph = $8;
while(1) {
$16 = +HEAPF32[$1>>2];
$i$0 = $i$0$ph;
while(1) {
$17 = (((($$0$ph9) + (($i$0*20)|0)|0)) + 4|0);
$18 = +HEAPF32[$17>>2];
$19 = $18 < $16;
$20 = (($i$0) + 1)|0;
if ($19) {
$i$0 = $20;
} else {
$i$0$lcssa = $i$0;
break;
}
}
$21 = +HEAPF32[$1>>2];
$j$1 = $j$0$ph;
while(1) {
$22 = (((($$0$ph9) + (($j$1*20)|0)|0)) + 4|0);
$23 = +HEAPF32[$22>>2];
$24 = $21 < $23;
$25 = (($j$1) + -1)|0;
if ($24) {
$j$1 = $25;
} else {
$j$1$lcssa = $j$1;
break;
}
}
$26 = (($$0$ph9) + (($i$0$lcssa*20)|0)|0);
$27 = ($i$0$lcssa|0)<($j$1$lcssa|0);
if (!($27)) {
$$lcssa = $26;$i$0$lcssa$lcssa = $i$0$lcssa;$j$1$lcssa$lcssa = $j$1$lcssa;
break;
}
$28 = (($$0$ph9) + (($j$1$lcssa*20)|0)|0);
;HEAP32[$t>>2]=HEAP32[$26>>2]|0;HEAP32[$t+4>>2]=HEAP32[$26+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$26+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$26+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$26+16>>2]|0;
;HEAP32[$26>>2]=HEAP32[$28>>2]|0;HEAP32[$26+4>>2]=HEAP32[$28+4>>2]|0;HEAP32[$26+8>>2]=HEAP32[$28+8>>2]|0;HEAP32[$26+12>>2]=HEAP32[$28+12>>2]|0;HEAP32[$26+16>>2]=HEAP32[$28+16>>2]|0;
;HEAP32[$28>>2]=HEAP32[$t>>2]|0;HEAP32[$28+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$28+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$28+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$28+16>>2]=HEAP32[$t+16>>2]|0;
$29 = (($i$0$lcssa) + 1)|0;
$30 = (($j$1$lcssa) + -1)|0;
$i$0$ph = $29;$j$0$ph = $30;
}
$31 = (($$017) - ($i$0$lcssa$lcssa))|0;
$32 = ($j$1$lcssa$lcssa|0)<($31|0);
if ($32) {
$$lcssa$lcssa = $$lcssa;$$lcssa31 = $31;$j$1$lcssa$lcssa$lcssa = $j$1$lcssa$lcssa;
break;
}
_stbtt__sort_edges_quicksort($$lcssa,$31);
$34 = ($j$1$lcssa$lcssa|0)>(12);
if ($34) {
$$017 = $j$1$lcssa$lcssa;
} else {
label = 16;
break L4;
}
}
_stbtt__sort_edges_quicksort($$0$ph9,$j$1$lcssa$lcssa$lcssa);
$33 = ($$lcssa31|0)>(12);
if ($33) {
$$0$ph9 = $$lcssa$lcssa;$$01$ph8 = $$lcssa31;
} else {
label = 16;
break;
}
}
if ((label|0) == 16) {
STACKTOP = sp;return;
}
}
function _stbtt__sort_edges_ins_sort($p,$n) {
$p = $p|0;
$n = $n|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, $exitcond = 0, $i$04 = 0;
var $j$0$lcssa = 0, $j$01 = 0, $t$sroa$3 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$t$sroa$3 = sp;
$0 = ($n|0)>(1);
if (!($0)) {
STACKTOP = sp;return;
}
$i$04 = 1;
while(1) {
$1 = (($p) + (($i$04*20)|0)|0);
$2 = HEAP32[$1>>2]|0;
$3 = (((($p) + (($i$04*20)|0)|0)) + 4|0);
$4 = +HEAPF32[$3>>2];
$5 = (((($p) + (($i$04*20)|0)|0)) + 8|0);
;HEAP32[$t$sroa$3>>2]=HEAP32[$5>>2]|0;HEAP32[$t$sroa$3+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$t$sroa$3+8>>2]=HEAP32[$5+8>>2]|0;
$j$01 = $i$04;
while(1) {
$6 = (($j$01) + -1)|0;
$7 = (((($p) + (($6*20)|0)|0)) + 4|0);
$8 = +HEAPF32[$7>>2];
$9 = $4 < $8;
if (!($9)) {
$j$0$lcssa = $j$01;
break;
}
$10 = (($p) + (($6*20)|0)|0);
$11 = (($p) + (($j$01*20)|0)|0);
;HEAP32[$11>>2]=HEAP32[$10>>2]|0;HEAP32[$11+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[$11+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[$11+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[$11+16>>2]=HEAP32[$10+16>>2]|0;
$12 = ($j$01|0)>(1);
if ($12) {
$j$01 = $6;
} else {
$j$0$lcssa = $6;
break;
}
}
$13 = ($i$04|0)==($j$0$lcssa|0);
if (!($13)) {
$14 = (($p) + (($j$0$lcssa*20)|0)|0);
HEAP32[$14>>2] = $2;
$15 = (((($p) + (($j$0$lcssa*20)|0)|0)) + 4|0);
HEAPF32[$15>>2] = $4;
$16 = (((($p) + (($j$0$lcssa*20)|0)|0)) + 8|0);
;HEAP32[$16>>2]=HEAP32[$t$sroa$3>>2]|0;HEAP32[$16+4>>2]=HEAP32[$t$sroa$3+4>>2]|0;HEAP32[$16+8>>2]=HEAP32[$t$sroa$3+8>>2]|0;
}
$17 = (($i$04) + 1)|0;
$exitcond = ($17|0)==($n|0);
if ($exitcond) {
break;
} else {
$i$04 = $17;
}
}
STACKTOP = sp;return;
}
function _stbtt__add_point($points,$n,$x,$y) {
$points = $points|0;
$n = $n|0;
$x = +$x;
$y = +$y;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($points|0)==(0|0);
if ($0) {
return;
}
$1 = (($points) + ($n<<3)|0);
HEAPF32[$1>>2] = $x;
$2 = (((($points) + ($n<<3)|0)) + 4|0);
HEAPF32[$2>>2] = $y;
return;
}
function _stbtt__tesselate_curve($points,$num_points,$x0,$y0,$x1,$y1,$x2,$y2,$objspace_flatness_squared,$n) {
$points = $points|0;
$num_points = $num_points|0;
$x0 = +$x0;
$y0 = +$y0;
$x1 = +$x1;
$y1 = +$y1;
$x2 = +$x2;
$y2 = +$y2;
$objspace_flatness_squared = +$objspace_flatness_squared;
$n = $n|0;
var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0;
var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0;
var $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $n$tr5 = 0, $x0$tr1 = 0.0, $x0$tr1$phi = 0.0, $x1$tr3 = 0.0, $y0$tr2 = 0.0, $y0$tr2$phi = 0.0, $y1$tr4 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $x1 * 2.0;
$1 = $0 + $x0;
$2 = $1 + $x2;
$3 = $2 * 0.25;
$4 = $y1 * 2.0;
$5 = $4 + $y0;
$6 = $5 + $y2;
$7 = $6 * 0.25;
$8 = ($n|0)>(16);
if ($8) {
return;
}
$9 = $y2 + $y0;
$10 = $9 * 0.5;
$11 = $10 - $7;
$12 = $x2 + $x0;
$13 = $12 * 0.5;
$14 = $13 - $3;
$16 = $14;$18 = $11;$26 = $3;$27 = $7;$n$tr5 = $n;$x0$tr1 = $x0;$x1$tr3 = $x1;$y0$tr2 = $y0;$y1$tr4 = $y1;
while(1) {
$15 = $16 * $16;
$17 = $18 * $18;
$19 = $15 + $17;
$20 = $19 > $objspace_flatness_squared;
if (!($20)) {
break;
}
$21 = $x0$tr1 + $x1$tr3;
$22 = $21 * 0.5;
$23 = $y0$tr2 + $y1$tr4;
$24 = $23 * 0.5;
$25 = (($n$tr5) + 1)|0;
_stbtt__tesselate_curve($points,$num_points,$x0$tr1,$y0$tr2,$22,$24,$26,$27,$objspace_flatness_squared,$25);
$28 = $x1$tr3 + $x2;
$29 = $28 * 0.5;
$30 = $y1$tr4 + $y2;
$31 = $30 * 0.5;
$32 = $29 * 2.0;
$33 = $26 + $32;
$34 = $33 + $x2;
$35 = $34 * 0.25;
$36 = $31 * 2.0;
$37 = $27 + $36;
$38 = $37 + $y2;
$39 = $38 * 0.25;
$40 = $26 + $x2;
$41 = $40 * 0.5;
$42 = $41 - $35;
$43 = $27 + $y2;
$44 = $43 * 0.5;
$45 = $44 - $39;
$46 = ($n$tr5|0)>(15);
if ($46) {
label = 6;
break;
} else {
$y0$tr2$phi = $27;$x0$tr1$phi = $26;$16 = $42;$18 = $45;$26 = $35;$27 = $39;$n$tr5 = $25;$x1$tr3 = $29;$y1$tr4 = $31;$y0$tr2 = $y0$tr2$phi;$x0$tr1 = $x0$tr1$phi;
}
}
if ((label|0) == 6) {
return;
}
$47 = HEAP32[$num_points>>2]|0;
_stbtt__add_point($points,$47,$x2,$y2);
$48 = HEAP32[$num_points>>2]|0;
$49 = (($48) + 1)|0;
HEAP32[$num_points>>2] = $49;
return;
}
function _ErrorCallback($error,$description) {
$error = $error|0;
$description = $description|0;
var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
HEAP32[$vararg_buffer>>2] = $error;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $description;
_TraceLog(2,23792,$vararg_buffer);
STACKTOP = sp;return;
}
function _SetupFramebufferSize($displayWidth,$displayHeight) {
$displayWidth = $displayWidth|0;
$displayHeight = $displayHeight|0;
var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0;
var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, $or$cond = 0, $roundf = 0.0, $roundf1 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $storemerge = 0, $vararg_buffer = 0, $vararg_buffer4 = 0;
var $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$vararg_buffer8 = sp + 24|0;
$vararg_buffer4 = sp + 16|0;
$vararg_buffer = sp;
$0 = sp + 40|0;
$1 = HEAP32[816>>2]|0;
$2 = ($1|0)>($displayWidth|0);
if (!($2)) {
$3 = HEAP32[820>>2]|0;
$4 = ($3|0)>($displayHeight|0);
if (!($4)) {
$29 = ($1|0)<($displayWidth|0);
$30 = ($3|0)<($displayHeight|0);
$or$cond = $29 | $30;
if (!($or$cond)) {
HEAP32[996>>2] = $1;
$51 = HEAP32[820>>2]|0;
HEAP32[1000>>2] = $51;
HEAP32[988>>2] = 0;
HEAP32[992>>2] = 0;
STACKTOP = sp;return;
}
HEAP32[$vararg_buffer8>>2] = $1;
$vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
HEAP32[$vararg_ptr11>>2] = $3;
$vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
HEAP32[$vararg_ptr12>>2] = $displayWidth;
$vararg_ptr13 = ((($vararg_buffer8)) + 12|0);
HEAP32[$vararg_ptr13>>2] = $displayHeight;
_TraceLog(0,23726,$vararg_buffer8);
$31 = (+($displayWidth|0));
$32 = (+($displayHeight|0));
$33 = $31 / $32;
$34 = HEAP32[816>>2]|0;
$35 = (+($34|0));
$36 = HEAP32[820>>2]|0;
$37 = (+($36|0));
$38 = $35 / $37;
$39 = !($33 <= $38);
if ($39) {
$46 = $33 * $37;
$roundf = (+_roundf($46));
$47 = (~~(($roundf)));
HEAP32[996>>2] = $47;
$48 = HEAP32[820>>2]|0;
HEAP32[1000>>2] = $48;
$49 = HEAP32[816>>2]|0;
$50 = (($47) - ($49))|0;
HEAP32[988>>2] = $50;
HEAP32[992>>2] = 0;
STACKTOP = sp;return;
} else {
HEAP32[996>>2] = $34;
$40 = HEAP32[816>>2]|0;
$41 = (+($40|0));
$42 = $41 / $33;
$roundf1 = (+_roundf($42));
$43 = (~~(($roundf1)));
HEAP32[1000>>2] = $43;
HEAP32[988>>2] = 0;
$44 = HEAP32[820>>2]|0;
$45 = (($43) - ($44))|0;
HEAP32[992>>2] = $45;
STACKTOP = sp;return;
}
}
}
$5 = HEAP32[816>>2]|0;
$6 = HEAP32[820>>2]|0;
HEAP32[$vararg_buffer>>2] = $5;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $6;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = $displayWidth;
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
HEAP32[$vararg_ptr3>>2] = $displayHeight;
_TraceLog(2,23583,$vararg_buffer);
$7 = (+($displayWidth|0));
$8 = HEAP32[816>>2]|0;
$9 = (+($8|0));
$10 = $7 / $9;
$11 = (+($displayHeight|0));
$12 = HEAP32[820>>2]|0;
$13 = (+($12|0));
$14 = $11 / $13;
$15 = !($10 <= $14);
if ($15) {
$21 = $9 * $14;
$roundf2 = (+_roundf($21));
$22 = (~~(($roundf2)));
HEAP32[996>>2] = $22;
HEAP32[1000>>2] = $displayHeight;
$23 = (($displayWidth) - ($22))|0;
HEAP32[988>>2] = $23;
$storemerge = 0;
} else {
HEAP32[996>>2] = $displayWidth;
$16 = HEAP32[820>>2]|0;
$17 = (+($16|0));
$18 = $10 * $17;
$roundf3 = (+_roundf($18));
$19 = (~~(($roundf3)));
HEAP32[1000>>2] = $19;
HEAP32[988>>2] = 0;
$20 = (($displayHeight) - ($19))|0;
$storemerge = $20;
}
HEAP32[992>>2] = $storemerge;
$24 = HEAP32[996>>2]|0;
$25 = (+($24|0));
$26 = HEAP32[816>>2]|0;
$27 = (+($26|0));
$28 = $25 / $27;
_MatrixScale($0,$28,$28,$28);
dest=840; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
HEAP32[996>>2] = $displayWidth;
HEAP32[1000>>2] = $displayHeight;
HEAP32[$vararg_buffer4>>2] = $displayWidth;
$vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
HEAP32[$vararg_ptr7>>2] = $displayHeight;
_TraceLog(2,23661,$vararg_buffer4);
STACKTOP = sp;return;
}
function _WindowSizeCallback($window,$width,$height) {
$window = $window|0;
$width = $width|0;
$height = $height|0;
var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$$byval_copy = sp + 4|0;
$0 = sp;
$1 = HEAP32[988>>2]|0;
$2 = HEAP32[992>>2]|0;
$3 = HEAP32[996>>2]|0;
$4 = HEAP32[1000>>2]|0;
_rlglInitGraphics($1,$2,$3,$4);
HEAP8[$0>>0] = -11;
$5 = ((($0)) + 1|0);
HEAP8[$5>>0] = -11;
$6 = ((($0)) + 2|0);
HEAP8[$6>>0] = -11;
$7 = ((($0)) + 3|0);
HEAP8[$7>>0] = -1;
;HEAP8[$$byval_copy>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$0+3>>0]|0;
_ClearBackground($$byval_copy);
STACKTOP = sp;return;
}
function _CursorEnterCallback($window,$enter) {
$window = $window|0;
$enter = $enter|0;
var label = 0, sp = 0;
sp = STACKTOP;
return;
}
function _KeyCallback($window,$key,$scancode,$action,$mods) {
$window = $window|0;
$key = $key|0;
$scancode = $scancode|0;
$action = $action|0;
$mods = $mods|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[836>>2]|0;
$1 = ($0|0)==($key|0);
$2 = ($action|0)==(1);
$or$cond = $2 & $1;
if ($or$cond) {
_glfwSetWindowShouldClose(($window|0),1);
} else {
$3 = $action&255;
$4 = (10888 + ($key)|0);
HEAP8[$4>>0] = $3;
}
$5 = ($key|0)==(259);
$or$cond3 = $5 & $2;
if (!($or$cond3)) {
return;
}
HEAP32[972>>2] = 3;
return;
}
function _MouseButtonCallback($window,$button,$action,$mods) {
$window = $window|0;
$button = $button|0;
$action = $action|0;
$mods = $mods|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0;
var $27 = 0.0, $28 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 80|0;
$gestureEvent$byval_copy = sp + 40|0;
$gestureEvent = sp + 8|0;
$0 = sp;
$1 = $action&255;
$2 = (11912 + ($button)|0);
HEAP8[$2>>0] = $1;
$3 = (_IsMouseButtonPressed(0)|0);
$4 = ($3|0)==(0);
if ($4) {
$5 = (_IsMouseButtonReleased(0)|0);
$6 = ($5|0)==(0);
if (!($6)) {
HEAP32[$gestureEvent>>2] = 0;
}
} else {
HEAP32[$gestureEvent>>2] = 1;
}
$7 = ((($gestureEvent)) + 8|0);
HEAP32[$7>>2] = 0;
$8 = ((($gestureEvent)) + 4|0);
HEAP32[$8>>2] = 1;
$9 = ((($gestureEvent)) + 16|0);
_GetMousePosition($0);
$10 = $0;
$11 = $10;
$12 = HEAP32[$11>>2]|0;
$13 = (($10) + 4)|0;
$14 = $13;
$15 = HEAP32[$14>>2]|0;
$16 = $9;
$17 = $16;
HEAP32[$17>>2] = $12;
$18 = (($16) + 4)|0;
$19 = $18;
HEAP32[$19>>2] = $15;
$20 = (_GetScreenWidth()|0);
$21 = (+($20|0));
$22 = +HEAPF32[$9>>2];
$23 = $22 / $21;
HEAPF32[$9>>2] = $23;
$24 = (_GetScreenHeight()|0);
$25 = (+($24|0));
$26 = ((($gestureEvent)) + 20|0);
$27 = +HEAPF32[$26>>2];
$28 = $27 / $25;
HEAPF32[$26>>2] = $28;
;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0;
_ProcessGestureEvent($gestureEvent$byval_copy);
STACKTOP = sp;return;
}
function _MouseCursorPosCallback($window,$x,$y) {
$window = $window|0;
$x = +$x;
$y = +$y;
var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 64|0;
$gestureEvent$byval_copy = sp + 32|0;
$gestureEvent = sp;
HEAP32[$gestureEvent>>2] = 2;
$0 = ((($gestureEvent)) + 4|0);
HEAP32[$0>>2] = 1;
$1 = $x;
$2 = $y;
$3 = ((($gestureEvent)) + 16|0);
HEAPF32[$3>>2] = $1;
$4 = ((($gestureEvent)) + 20|0);
HEAPF32[$4>>2] = $2;
$5 = (_GetScreenWidth()|0);
$6 = (+($5|0));
$7 = +HEAPF32[$3>>2];
$8 = $7 / $6;
HEAPF32[$3>>2] = $8;
$9 = (_GetScreenHeight()|0);
$10 = (+($9|0));
$11 = +HEAPF32[$4>>2];
$12 = $11 / $10;
HEAPF32[$4>>2] = $12;
;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0;
_ProcessGestureEvent($gestureEvent$byval_copy);
STACKTOP = sp;return;
}
function _CharCallback($window,$key) {
$window = $window|0;
$key = $key|0;
var label = 0, sp = 0;
sp = STACKTOP;
HEAP32[972>>2] = $key;
return;
}
function _ScrollCallback($window,$xoffset,$yoffset) {
$window = $window|0;
$xoffset = +$xoffset;
$yoffset = +$yoffset;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (~~(($yoffset)));
HEAP32[8648>>2] = $0;
return;
}
function _WindowIconifyCallback($window,$iconified) {
$window = $window|0;
$iconified = $iconified|0;
var $$ = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$not$ = ($iconified|0)!=(0);
$$ = $not$&1;
HEAP32[832>>2] = $$;
return;
}
function _emscripten_GetProcAddress($name_) {
$name_ = $name_|0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0;
var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0;
var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0;
var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0;
var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0;
var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0;
var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0;
var $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0;
var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0;
var $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0;
var $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0;
var $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0;
var $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0;
var $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0;
var $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0;
var $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0;
var $549 = 0, $55 = 0, $550 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $end = 0, $name = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$0 = sp + 12|0;
$1 = sp + 8|0;
$name = sp + 4|0;
$end = sp;
HEAP32[$1>>2] = $name_;
$2 = HEAP32[$1>>2]|0;
$3 = (_strlen($2)|0);
$4 = (($3) + 1)|0;
$5 = (_malloc($4)|0);
HEAP32[$name>>2] = $5;
$6 = HEAP32[$name>>2]|0;
$7 = HEAP32[$1>>2]|0;
(_strcpy($6,$7)|0);
$8 = HEAP32[$name>>2]|0;
$9 = (_strstr($8,23830)|0);
HEAP32[$end>>2] = $9;
$10 = HEAP32[$end>>2]|0;
$11 = ($10|0)!=(0|0);
if ($11) {
$12 = HEAP32[$end>>2]|0;
HEAP8[$12>>0] = 0;
}
$13 = HEAP32[$name>>2]|0;
$14 = (_strstr($13,23834)|0);
HEAP32[$end>>2] = $14;
$15 = HEAP32[$end>>2]|0;
$16 = ($15|0)!=(0|0);
if ($16) {
$17 = HEAP32[$end>>2]|0;
HEAP8[$17>>0] = 0;
}
$18 = HEAP32[$name>>2]|0;
$19 = (_strstr($18,23838)|0);
HEAP32[$end>>2] = $19;
$20 = HEAP32[$end>>2]|0;
$21 = ($20|0)!=(0|0);
if ($21) {
$22 = HEAP32[$end>>2]|0;
HEAP8[$22>>0] = 0;
}
$23 = HEAP32[$name>>2]|0;
$24 = (_strstr($23,23842)|0);
HEAP32[$end>>2] = $24;
$25 = HEAP32[$end>>2]|0;
$26 = ($25|0)!=(0|0);
if ($26) {
$27 = HEAP32[$end>>2]|0;
HEAP8[$27>>0] = 0;
}
$28 = HEAP32[$name>>2]|0;
$29 = (_strcmp($28,23848)|0);
$30 = ($29|0)!=(0);
do {
if ($30) {
$31 = HEAP32[$name>>2]|0;
$32 = (_strcmp($31,23886)|0);
$33 = ($32|0)!=(0);
if (!($33)) {
HEAP32[$name>>2] = 23905;
break;
}
$34 = HEAP32[$name>>2]|0;
$35 = (_strcmp($34,23918)|0);
$36 = ($35|0)!=(0);
if (!($36)) {
HEAP32[$name>>2] = 23939;
break;
}
$37 = HEAP32[$name>>2]|0;
$38 = (_strcmp($37,23954)|0);
$39 = ($38|0)!=(0);
if (!($39)) {
HEAP32[$name>>2] = 23969;
break;
}
$40 = HEAP32[$name>>2]|0;
$41 = (_strcmp($40,23984)|0);
$42 = ($41|0)!=(0);
if (!($42)) {
HEAP32[$name>>2] = 23999;
}
} else {
HEAP32[$name>>2] = 23870;
}
} while(0);
$43 = HEAP32[$name>>2]|0;
$44 = (_strcmp($43,24014)|0);
$45 = ($44|0)!=(0);
do {
if ($45) {
$46 = HEAP32[$name>>2]|0;
$47 = (_strcmp($46,24028)|0);
$48 = ($47|0)!=(0);
if (!($48)) {
HEAP32[$0>>2] = 3;
break;
}
$49 = HEAP32[$name>>2]|0;
$50 = (_strcmp($49,24040)|0);
$51 = ($50|0)!=(0);
if (!($51)) {
HEAP32[$0>>2] = 7;
break;
}
$52 = HEAP32[$name>>2]|0;
$53 = (_strcmp($52,24054)|0);
$54 = ($53|0)!=(0);
if (!($54)) {
HEAP32[$0>>2] = 8;
break;
}
$55 = HEAP32[$name>>2]|0;
$56 = (_strcmp($55,24066)|0);
$57 = ($56|0)!=(0);
if (!($57)) {
HEAP32[$0>>2] = 9;
break;
}
$58 = HEAP32[$name>>2]|0;
$59 = (_strcmp($58,24080)|0);
$60 = ($59|0)!=(0);
if (!($60)) {
HEAP32[$0>>2] = 10;
break;
}
$61 = HEAP32[$name>>2]|0;
$62 = (_strcmp($61,24094)|0);
$63 = ($62|0)!=(0);
if (!($63)) {
HEAP32[$0>>2] = 11;
break;
}
$64 = HEAP32[$name>>2]|0;
$65 = (_strcmp($64,24111)|0);
$66 = ($65|0)!=(0);
if (!($66)) {
HEAP32[$0>>2] = 1;
break;
}
$67 = HEAP32[$name>>2]|0;
$68 = (_strcmp($67,24134)|0);
$69 = ($68|0)!=(0);
if (!($69)) {
HEAP32[$0>>2] = 1;
break;
}
$70 = HEAP32[$name>>2]|0;
$71 = (_strcmp($70,24160)|0);
$72 = ($71|0)!=(0);
if (!($72)) {
HEAP32[$0>>2] = 2;
break;
}
$73 = HEAP32[$name>>2]|0;
$74 = (_strcmp($73,24173)|0);
$75 = ($74|0)!=(0);
if (!($75)) {
HEAP32[$0>>2] = 3;
break;
}
$76 = HEAP32[$name>>2]|0;
$77 = (_strcmp($76,24189)|0);
$78 = ($77|0)!=(0);
if (!($78)) {
HEAP32[$0>>2] = 1;
break;
}
$79 = HEAP32[$name>>2]|0;
$80 = (_strcmp($79,24202)|0);
$81 = ($80|0)!=(0);
if (!($81)) {
HEAP32[$0>>2] = 12;
break;
}
$82 = HEAP32[$name>>2]|0;
$83 = (_strcmp($82,24216)|0);
$84 = ($83|0)!=(0);
if (!($84)) {
HEAP32[$0>>2] = 3;
break;
}
$85 = HEAP32[$name>>2]|0;
$86 = (_strcmp($85,24236)|0);
$87 = ($86|0)!=(0);
if (!($87)) {
HEAP32[$0>>2] = 4;
break;
}
$88 = HEAP32[$name>>2]|0;
$89 = (_strcmp($88,24256)|0);
$90 = ($89|0)!=(0);
if (!($90)) {
HEAP32[$0>>2] = 5;
break;
}
$91 = HEAP32[$name>>2]|0;
$92 = (_strcmp($91,24273)|0);
$93 = ($92|0)!=(0);
if (!($93)) {
HEAP32[$0>>2] = 6;
break;
}
$94 = HEAP32[$name>>2]|0;
$95 = (_strcmp($94,24290)|0);
$96 = ($95|0)!=(0);
if (!($96)) {
HEAP32[$0>>2] = 4;
break;
}
$97 = HEAP32[$name>>2]|0;
$98 = (_strcmp($97,24302)|0);
$99 = ($98|0)!=(0);
if (!($99)) {
HEAP32[$0>>2] = 13;
break;
}
$100 = HEAP32[$name>>2]|0;
$101 = (_strcmp($100,24315)|0);
$102 = ($101|0)!=(0);
if (!($102)) {
HEAP32[$0>>2] = 14;
break;
}
$103 = HEAP32[$name>>2]|0;
$104 = (_strcmp($103,24331)|0);
$105 = ($104|0)!=(0);
if (!($105)) {
HEAP32[$0>>2] = 7;
break;
}
$106 = HEAP32[$name>>2]|0;
$107 = (_strcmp($106,24354)|0);
$108 = ($107|0)!=(0);
if (!($108)) {
HEAP32[$0>>2] = 2;
break;
}
$109 = HEAP32[$name>>2]|0;
$110 = (_strcmp($109,24367)|0);
$111 = ($110|0)!=(0);
if (!($111)) {
HEAP32[$0>>2] = 3;
break;
}
$112 = HEAP32[$name>>2]|0;
$113 = (_strcmp($112,24383)|0);
$114 = ($113|0)!=(0);
if (!($114)) {
HEAP32[$0>>2] = 5;
break;
}
$115 = HEAP32[$name>>2]|0;
$116 = (_strcmp($115,24394)|0);
$117 = ($116|0)!=(0);
if (!($117)) {
HEAP32[$0>>2] = 15;
break;
}
$118 = HEAP32[$name>>2]|0;
$119 = (_strcmp($118,24413)|0);
$120 = ($119|0)!=(0);
if (!($120)) {
HEAP32[$0>>2] = 16;
break;
}
$121 = HEAP32[$name>>2]|0;
$122 = (_strcmp($121,24435)|0);
$123 = ($122|0)!=(0);
if (!($123)) {
HEAP32[$0>>2] = 17;
break;
}
$124 = HEAP32[$name>>2]|0;
$125 = (_strcmp($124,24454)|0);
$126 = ($125|0)!=(0);
if (!($126)) {
HEAP32[$0>>2] = 8;
break;
}
$127 = HEAP32[$name>>2]|0;
$128 = (_strcmp($127,24483)|0);
$129 = ($128|0)!=(0);
if (!($129)) {
HEAP32[$0>>2] = 6;
break;
}
$130 = HEAP32[$name>>2]|0;
$131 = (_strcmp($130,24500)|0);
$132 = ($131|0)!=(0);
if (!($132)) {
HEAP32[$0>>2] = 9;
break;
}
$133 = HEAP32[$name>>2]|0;
$134 = (_strcmp($133,24515)|0);
$135 = ($134|0)!=(0);
if (!($135)) {
HEAP32[$0>>2] = 10;
break;
}
$136 = HEAP32[$name>>2]|0;
$137 = (_strcmp($136,24530)|0);
$138 = ($137|0)!=(0);
if (!($138)) {
HEAP32[$0>>2] = 3;
break;
}
$139 = HEAP32[$name>>2]|0;
$140 = (_strcmp($139,24551)|0);
$141 = ($140|0)!=(0);
if (!($141)) {
HEAP32[$0>>2] = 11;
break;
}
$142 = HEAP32[$name>>2]|0;
$143 = (_strcmp($142,24571)|0);
$144 = ($143|0)!=(0);
if (!($144)) {
HEAP32[$0>>2] = 12;
break;
}
$145 = HEAP32[$name>>2]|0;
$146 = (_strcmp($145,24591)|0);
$147 = ($146|0)!=(0);
if (!($147)) {
HEAP32[$0>>2] = 13;
break;
}
$148 = HEAP32[$name>>2]|0;
$149 = (_strcmp($148,24617)|0);
$150 = ($149|0)!=(0);
if (!($150)) {
HEAP32[$0>>2] = 2;
break;
}
$151 = HEAP32[$name>>2]|0;
$152 = (_strcmp($151,24636)|0);
$153 = ($152|0)!=(0);
if (!($153)) {
HEAP32[$0>>2] = 1;
break;
}
$154 = HEAP32[$name>>2]|0;
$155 = (_strcmp($154,24648)|0);
$156 = ($155|0)!=(0);
if (!($156)) {
HEAP32[$0>>2] = 3;
break;
}
$157 = HEAP32[$name>>2]|0;
$158 = (_strcmp($157,24660)|0);
$159 = ($158|0)!=(0);
if (!($159)) {
HEAP32[$0>>2] = 1;
break;
}
$160 = HEAP32[$name>>2]|0;
$161 = (_strcmp($160,24672)|0);
$162 = ($161|0)!=(0);
if (!($162)) {
HEAP32[$0>>2] = 1;
break;
}
$163 = HEAP32[$name>>2]|0;
$164 = (_strcmp($163,24684)|0);
$165 = ($164|0)!=(0);
if (!($165)) {
HEAP32[$0>>2] = 18;
break;
}
$166 = HEAP32[$name>>2]|0;
$167 = (_strcmp($166,24696)|0);
$168 = ($167|0)!=(0);
if (!($168)) {
HEAP32[$0>>2] = 14;
break;
}
$169 = HEAP32[$name>>2]|0;
$170 = (_strcmp($169,24708)|0);
$171 = ($170|0)!=(0);
if (!($171)) {
HEAP32[$0>>2] = 4;
break;
}
$172 = HEAP32[$name>>2]|0;
$173 = (_strcmp($172,24720)|0);
$174 = ($173|0)!=(0);
if (!($174)) {
HEAP32[$0>>2] = 2;
break;
}
$175 = HEAP32[$name>>2]|0;
$176 = (_strcmp($175,24732)|0);
$177 = ($176|0)!=(0);
if (!($177)) {
HEAP32[$0>>2] = 15;
break;
}
$178 = HEAP32[$name>>2]|0;
$179 = (_strcmp($178,24745)|0);
$180 = ($179|0)!=(0);
if (!($180)) {
HEAP32[$0>>2] = 16;
break;
}
$181 = HEAP32[$name>>2]|0;
$182 = (_strcmp($181,24758)|0);
$183 = ($182|0)!=(0);
if (!($183)) {
HEAP32[$0>>2] = 17;
break;
}
$184 = HEAP32[$name>>2]|0;
$185 = (_strcmp($184,24771)|0);
$186 = ($185|0)!=(0);
if (!($186)) {
HEAP32[$0>>2] = 18;
break;
}
$187 = HEAP32[$name>>2]|0;
$188 = (_strcmp($187,24784)|0);
$189 = ($188|0)!=(0);
if (!($189)) {
HEAP32[$0>>2] = 19;
break;
}
$190 = HEAP32[$name>>2]|0;
$191 = (_strcmp($190,24797)|0);
$192 = ($191|0)!=(0);
if (!($192)) {
HEAP32[$0>>2] = 20;
break;
}
$193 = HEAP32[$name>>2]|0;
$194 = (_strcmp($193,24810)|0);
$195 = ($194|0)!=(0);
if (!($195)) {
HEAP32[$0>>2] = 21;
break;
}
$196 = HEAP32[$name>>2]|0;
$197 = (_strcmp($196,24823)|0);
$198 = ($197|0)!=(0);
if (!($198)) {
HEAP32[$0>>2] = 22;
break;
}
$199 = HEAP32[$name>>2]|0;
$200 = (_strcmp($199,24836)|0);
$201 = ($200|0)!=(0);
if (!($201)) {
HEAP32[$0>>2] = 5;
break;
}
$202 = HEAP32[$name>>2]|0;
$203 = (_strcmp($202,24855)|0);
$204 = ($203|0)!=(0);
if (!($204)) {
HEAP32[$0>>2] = 6;
break;
}
$205 = HEAP32[$name>>2]|0;
$206 = (_strcmp($205,24874)|0);
$207 = ($206|0)!=(0);
if (!($207)) {
HEAP32[$0>>2] = 7;
break;
}
$208 = HEAP32[$name>>2]|0;
$209 = (_strcmp($208,24893)|0);
$210 = ($209|0)!=(0);
if (!($210)) {
HEAP32[$0>>2] = 19;
break;
}
$211 = HEAP32[$name>>2]|0;
$212 = (_strcmp($211,24906)|0);
$213 = ($212|0)!=(0);
if (!($213)) {
HEAP32[$0>>2] = 20;
break;
}
$214 = HEAP32[$name>>2]|0;
$215 = (_strcmp($214,24924)|0);
$216 = ($215|0)!=(0);
if (!($216)) {
HEAP32[$0>>2] = 21;
break;
}
$217 = HEAP32[$name>>2]|0;
$218 = (_strcmp($217,24942)|0);
$219 = ($218|0)!=(0);
if (!($219)) {
HEAP32[$0>>2] = 22;
break;
}
$220 = HEAP32[$name>>2]|0;
$221 = (_strcmp($220,24960)|0);
$222 = ($221|0)!=(0);
if (!($222)) {
HEAP32[$0>>2] = 23;
break;
}
$223 = HEAP32[$name>>2]|0;
$224 = (_strcmp($223,24978)|0);
$225 = ($224|0)!=(0);
if (!($225)) {
HEAP32[$0>>2] = 4;
break;
}
$226 = HEAP32[$name>>2]|0;
$227 = (_strcmp($226,24998)|0);
$228 = ($227|0)!=(0);
if (!($228)) {
HEAP32[$0>>2] = 3;
break;
}
$229 = HEAP32[$name>>2]|0;
$230 = (_strcmp($229,23939)|0);
$231 = ($230|0)!=(0);
if (!($231)) {
HEAP32[$0>>2] = 7;
break;
}
$232 = HEAP32[$name>>2]|0;
$233 = (_strcmp($232,25016)|0);
$234 = ($233|0)!=(0);
if (!($234)) {
HEAP32[$0>>2] = 1;
break;
}
$235 = HEAP32[$name>>2]|0;
$236 = (_strcmp($235,25031)|0);
$237 = ($236|0)!=(0);
if (!($237)) {
HEAP32[$0>>2] = 8;
break;
}
$238 = HEAP32[$name>>2]|0;
$239 = (_strcmp($238,25052)|0);
$240 = ($239|0)!=(0);
if (!($240)) {
HEAP32[$0>>2] = 9;
break;
}
$241 = HEAP32[$name>>2]|0;
$242 = (_strcmp($241,25067)|0);
$243 = ($242|0)!=(0);
if (!($243)) {
HEAP32[$0>>2] = 10;
break;
}
$244 = HEAP32[$name>>2]|0;
$245 = (_strcmp($244,25085)|0);
$246 = ($245|0)!=(0);
if (!($246)) {
HEAP32[$0>>2] = 2;
break;
}
$247 = HEAP32[$name>>2]|0;
$248 = (_strcmp($247,25101)|0);
$249 = ($248|0)!=(0);
if (!($249)) {
HEAP32[$0>>2] = 11;
break;
}
$250 = HEAP32[$name>>2]|0;
$251 = (_strcmp($250,25120)|0);
$252 = ($251|0)!=(0);
if (!($252)) {
HEAP32[$0>>2] = 23;
break;
}
$253 = HEAP32[$name>>2]|0;
$254 = (_strcmp($253,25134)|0);
$255 = ($254|0)!=(0);
if (!($255)) {
HEAP32[$0>>2] = 24;
break;
}
$256 = HEAP32[$name>>2]|0;
$257 = (_strcmp($256,25149)|0);
$258 = ($257|0)!=(0);
if (!($258)) {
HEAP32[$0>>2] = 8;
break;
}
$259 = HEAP32[$name>>2]|0;
$260 = (_strcmp($259,23870)|0);
$261 = ($260|0)!=(0);
if (!($261)) {
HEAP32[$0>>2] = 1;
break;
}
$262 = HEAP32[$name>>2]|0;
$263 = (_strcmp($262,25160)|0);
$264 = ($263|0)!=(0);
if (!($264)) {
HEAP32[$0>>2] = 3;
break;
}
$265 = HEAP32[$name>>2]|0;
$266 = (_strcmp($265,23969)|0);
$267 = ($266|0)!=(0);
if (!($267)) {
HEAP32[$0>>2] = 24;
break;
}
$268 = HEAP32[$name>>2]|0;
$269 = (_strcmp($268,23999)|0);
$270 = ($269|0)!=(0);
if (!($270)) {
HEAP32[$0>>2] = 25;
break;
}
$271 = HEAP32[$name>>2]|0;
$272 = (_strcmp($271,25176)|0);
$273 = ($272|0)!=(0);
if (!($273)) {
HEAP32[$0>>2] = 12;
break;
}
$274 = HEAP32[$name>>2]|0;
$275 = (_strcmp($274,25203)|0);
$276 = ($275|0)!=(0);
if (!($276)) {
HEAP32[$0>>2] = 4;
break;
}
$277 = HEAP32[$name>>2]|0;
$278 = (_strcmp($277,25217)|0);
$279 = ($278|0)!=(0);
if (!($279)) {
HEAP32[$0>>2] = 13;
break;
}
$280 = HEAP32[$name>>2]|0;
$281 = (_strcmp($280,23905)|0);
$282 = ($281|0)!=(0);
if (!($282)) {
HEAP32[$0>>2] = 5;
break;
}
$283 = HEAP32[$name>>2]|0;
$284 = (_strcmp($283,25237)|0);
$285 = ($284|0)!=(0);
if (!($285)) {
HEAP32[$0>>2] = 6;
break;
}
$286 = HEAP32[$name>>2]|0;
$287 = (_strcmp($286,25255)|0);
$288 = ($287|0)!=(0);
if (!($288)) {
HEAP32[$0>>2] = 9;
break;
}
$289 = HEAP32[$name>>2]|0;
$290 = (_strcmp($289,25267)|0);
$291 = ($290|0)!=(0);
if (!($291)) {
HEAP32[$0>>2] = 25;
break;
}
$292 = HEAP32[$name>>2]|0;
$293 = (_strcmp($292,25288)|0);
$294 = ($293|0)!=(0);
if (!($294)) {
HEAP32[$0>>2] = 26;
break;
}
$295 = HEAP32[$name>>2]|0;
$296 = (_strcmp($295,25306)|0);
$297 = ($296|0)!=(0);
if (!($297)) {
HEAP32[$0>>2] = 27;
break;
}
$298 = HEAP32[$name>>2]|0;
$299 = (_strcmp($298,25324)|0);
$300 = ($299|0)!=(0);
if (!($300)) {
HEAP32[$0>>2] = 28;
break;
}
$301 = HEAP32[$name>>2]|0;
$302 = (_strcmp($301,25345)|0);
$303 = ($302|0)!=(0);
if (!($303)) {
HEAP32[$0>>2] = 14;
break;
}
$304 = HEAP32[$name>>2]|0;
$305 = (_strcmp($304,25371)|0);
$306 = ($305|0)!=(0);
if (!($306)) {
HEAP32[$0>>2] = 3;
break;
}
$307 = HEAP32[$name>>2]|0;
$308 = (_strcmp($307,25394)|0);
$309 = ($308|0)!=(0);
if (!($309)) {
HEAP32[$0>>2] = 15;
break;
}
$310 = HEAP32[$name>>2]|0;
$311 = (_strcmp($310,25432)|0);
$312 = ($311|0)!=(0);
if (!($312)) {
HEAP32[$0>>2] = 10;
break;
}
$313 = HEAP32[$name>>2]|0;
$314 = (_strcmp($313,25448)|0);
$315 = ($314|0)!=(0);
if (!($315)) {
HEAP32[$0>>2] = 7;
break;
}
$316 = HEAP32[$name>>2]|0;
$317 = (_strcmp($316,25463)|0);
$318 = ($317|0)!=(0);
if (!($318)) {
HEAP32[$0>>2] = 26;
break;
}
$319 = HEAP32[$name>>2]|0;
$320 = (_strcmp($319,25486)|0);
$321 = ($320|0)!=(0);
if (!($321)) {
HEAP32[$0>>2] = 16;
break;
}
$322 = HEAP32[$name>>2]|0;
$323 = (_strcmp($322,25499)|0);
$324 = ($323|0)!=(0);
if (!($324)) {
HEAP32[$0>>2] = 29;
break;
}
$325 = HEAP32[$name>>2]|0;
$326 = (_strcmp($325,25513)|0);
$327 = ($326|0)!=(0);
if (!($327)) {
HEAP32[$0>>2] = 30;
break;
}
$328 = HEAP32[$name>>2]|0;
$329 = (_strcmp($328,25527)|0);
$330 = ($329|0)!=(0);
if (!($330)) {
HEAP32[$0>>2] = 2;
break;
}
$331 = HEAP32[$name>>2]|0;
$332 = (_strcmp($331,25547)|0);
$333 = ($332|0)!=(0);
if (!($333)) {
HEAP32[$0>>2] = 8;
break;
}
$334 = HEAP32[$name>>2]|0;
$335 = (_strcmp($334,25567)|0);
$336 = ($335|0)!=(0);
if (!($336)) {
HEAP32[$0>>2] = 17;
break;
}
$337 = HEAP32[$name>>2]|0;
$338 = (_strcmp($337,25583)|0);
$339 = ($338|0)!=(0);
if (!($339)) {
HEAP32[$0>>2] = 18;
break;
}
$340 = HEAP32[$name>>2]|0;
$341 = (_strcmp($340,25601)|0);
$342 = ($341|0)!=(0);
if (!($342)) {
HEAP32[$0>>2] = 27;
break;
}
$343 = HEAP32[$name>>2]|0;
$344 = (_strcmp($343,25617)|0);
$345 = ($344|0)!=(0);
if (!($345)) {
HEAP32[$0>>2] = 19;
break;
}
$346 = HEAP32[$name>>2]|0;
$347 = (_strcmp($346,25632)|0);
$348 = ($347|0)!=(0);
if (!($348)) {
HEAP32[$0>>2] = 9;
break;
}
$349 = HEAP32[$name>>2]|0;
$350 = (_strcmp($349,25654)|0);
$351 = ($350|0)!=(0);
if (!($351)) {
HEAP32[$0>>2] = 31;
break;
}
$352 = HEAP32[$name>>2]|0;
$353 = (_strcmp($352,25672)|0);
$354 = ($353|0)!=(0);
if (!($354)) {
HEAP32[$0>>2] = 32;
break;
}
$355 = HEAP32[$name>>2]|0;
$356 = (_strcmp($355,25693)|0);
$357 = ($356|0)!=(0);
if (!($357)) {
HEAP32[$0>>2] = 10;
break;
}
$358 = HEAP32[$name>>2]|0;
$359 = (_strcmp($358,25711)|0);
$360 = ($359|0)!=(0);
if (!($360)) {
HEAP32[$0>>2] = 11;
break;
}
$361 = HEAP32[$name>>2]|0;
$362 = (_strcmp($361,25724)|0);
$363 = ($362|0)!=(0);
if (!($363)) {
HEAP32[$0>>2] = 2;
break;
}
$364 = HEAP32[$name>>2]|0;
$365 = (_strcmp($364,25739)|0);
$366 = ($365|0)!=(0);
if (!($366)) {
HEAP32[$0>>2] = 12;
break;
}
$367 = HEAP32[$name>>2]|0;
$368 = (_strcmp($367,25753)|0);
$369 = ($368|0)!=(0);
if (!($369)) {
HEAP32[$0>>2] = 1;
break;
}
$370 = HEAP32[$name>>2]|0;
$371 = (_strcmp($370,25763)|0);
$372 = ($371|0)!=(0);
if (!($372)) {
HEAP32[$0>>2] = 1;
break;
}
$373 = HEAP32[$name>>2]|0;
$374 = (_strcmp($373,25773)|0);
$375 = ($374|0)!=(0);
if (!($375)) {
HEAP32[$0>>2] = 3;
break;
}
$376 = HEAP32[$name>>2]|0;
$377 = (_strcmp($376,25795)|0);
$378 = ($377|0)!=(0);
if (!($378)) {
HEAP32[$0>>2] = 13;
break;
}
$379 = HEAP32[$name>>2]|0;
$380 = (_strcmp($379,25821)|0);
$381 = ($380|0)!=(0);
if (!($381)) {
HEAP32[$0>>2] = 14;
break;
}
$382 = HEAP32[$name>>2]|0;
$383 = (_strcmp($382,25848)|0);
$384 = ($383|0)!=(0);
if (!($384)) {
HEAP32[$0>>2] = 28;
break;
}
$385 = HEAP32[$name>>2]|0;
$386 = (_strcmp($385,25861)|0);
$387 = ($386|0)!=(0);
if (!($387)) {
HEAP32[$0>>2] = 20;
break;
}
$388 = HEAP32[$name>>2]|0;
$389 = (_strcmp($388,25876)|0);
$390 = ($389|0)!=(0);
if (!($390)) {
HEAP32[$0>>2] = 4;
break;
}
$391 = HEAP32[$name>>2]|0;
$392 = (_strcmp($391,25891)|0);
$393 = ($392|0)!=(0);
if (!($393)) {
HEAP32[$0>>2] = 3;
break;
}
$394 = HEAP32[$name>>2]|0;
$395 = (_strcmp($394,25915)|0);
$396 = ($395|0)!=(0);
if (!($396)) {
HEAP32[$0>>2] = 2;
break;
}
$397 = HEAP32[$name>>2]|0;
$398 = (_strcmp($397,25926)|0);
$399 = ($398|0)!=(0);
if (!($399)) {
HEAP32[$0>>2] = 33;
break;
}
$400 = HEAP32[$name>>2]|0;
$401 = (_strcmp($400,25948)|0);
$402 = ($401|0)!=(0);
if (!($402)) {
HEAP32[$0>>2] = 21;
break;
}
$403 = HEAP32[$name>>2]|0;
$404 = (_strcmp($403,25970)|0);
$405 = ($404|0)!=(0);
if (!($405)) {
HEAP32[$0>>2] = 5;
break;
}
$406 = HEAP32[$name>>2]|0;
$407 = (_strcmp($406,25994)|0);
$408 = ($407|0)!=(0);
if (!($408)) {
HEAP32[$0>>2] = 4;
break;
}
$409 = HEAP32[$name>>2]|0;
$410 = (_strcmp($409,26003)|0);
$411 = ($410|0)!=(0);
if (!($411)) {
HEAP32[$0>>2] = 5;
break;
}
$412 = HEAP32[$name>>2]|0;
$413 = (_strcmp($412,26011)|0);
$414 = ($413|0)!=(0);
if (!($414)) {
HEAP32[$0>>2] = 1;
break;
}
$415 = HEAP32[$name>>2]|0;
$416 = (_strcmp($415,26024)|0);
$417 = ($416|0)!=(0);
if (!($417)) {
HEAP32[$0>>2] = 2;
break;
}
$418 = HEAP32[$name>>2]|0;
$419 = (_strcmp($418,26038)|0);
$420 = ($419|0)!=(0);
if (!($420)) {
HEAP32[$0>>2] = 15;
break;
}
$421 = HEAP32[$name>>2]|0;
$422 = (_strcmp($421,26050)|0);
$423 = ($422|0)!=(0);
if (!($423)) {
HEAP32[$0>>2] = 16;
break;
}
$424 = HEAP32[$name>>2]|0;
$425 = (_strcmp($424,26059)|0);
$426 = ($425|0)!=(0);
if (!($426)) {
HEAP32[$0>>2] = 17;
break;
}
$427 = HEAP32[$name>>2]|0;
$428 = (_strcmp($427,26069)|0);
$429 = ($428|0)!=(0);
if (!($429)) {
HEAP32[$0>>2] = 18;
break;
}
$430 = HEAP32[$name>>2]|0;
$431 = (_strcmp($430,26081)|0);
$432 = ($431|0)!=(0);
if (!($432)) {
HEAP32[$0>>2] = 19;
break;
}
$433 = HEAP32[$name>>2]|0;
$434 = (_strcmp($433,26092)|0);
$435 = ($434|0)!=(0);
if (!($435)) {
HEAP32[$0>>2] = 20;
break;
}
$436 = HEAP32[$name>>2]|0;
$437 = (_strcmp($436,26100)|0);
$438 = ($437|0)!=(0);
if (!($438)) {
HEAP32[$0>>2] = 3;
break;
}
$439 = HEAP32[$name>>2]|0;
$440 = (_strcmp($439,26112)|0);
$441 = ($440|0)!=(0);
if (!($441)) {
HEAP32[$0>>2] = 21;
break;
}
$442 = HEAP32[$name>>2]|0;
$443 = (_strcmp($442,26127)|0);
$444 = ($443|0)!=(0);
if (!($444)) {
HEAP32[$0>>2] = 22;
break;
}
$445 = HEAP32[$name>>2]|0;
$446 = (_strcmp($445,26139)|0);
$447 = ($446|0)!=(0);
if (!($447)) {
HEAP32[$0>>2] = 23;
break;
}
$448 = HEAP32[$name>>2]|0;
$449 = (_strcmp($448,26153)|0);
$450 = ($449|0)!=(0);
if (!($450)) {
HEAP32[$0>>2] = 11;
break;
}
$451 = HEAP32[$name>>2]|0;
$452 = (_strcmp($451,26178)|0);
$453 = ($452|0)!=(0);
if (!($453)) {
HEAP32[$0>>2] = 24;
break;
}
$454 = HEAP32[$name>>2]|0;
$455 = (_strcmp($454,26195)|0);
$456 = ($455|0)!=(0);
if (!($456)) {
HEAP32[$0>>2] = 25;
break;
}
$457 = HEAP32[$name>>2]|0;
$458 = (_strcmp($457,26211)|0);
$459 = ($458|0)!=(0);
if (!($459)) {
HEAP32[$0>>2] = 26;
break;
}
$460 = HEAP32[$name>>2]|0;
$461 = (_strcmp($460,26227)|0);
$462 = ($461|0)!=(0);
if (!($462)) {
HEAP32[$0>>2] = 12;
break;
}
$463 = HEAP32[$name>>2]|0;
$464 = (_strcmp($463,26239)|0);
$465 = ($464|0)!=(0);
if (!($465)) {
HEAP32[$0>>2] = 34;
break;
}
$466 = HEAP32[$name>>2]|0;
$467 = (_strcmp($466,26251)|0);
$468 = ($467|0)!=(0);
if (!($468)) {
HEAP32[$0>>2] = 35;
break;
}
$469 = HEAP32[$name>>2]|0;
$470 = (_strcmp($469,26275)|0);
$471 = ($470|0)!=(0);
if (!($471)) {
HEAP32[$0>>2] = 1;
break;
}
$472 = HEAP32[$name>>2]|0;
$473 = (_strcmp($472,26288)|0);
$474 = ($473|0)!=(0);
if (!($474)) {
HEAP32[$0>>2] = 2;
break;
}
$475 = HEAP32[$name>>2]|0;
$476 = (_strcmp($475,26302)|0);
$477 = ($476|0)!=(0);
if (!($477)) {
HEAP32[$0>>2] = 36;
break;
}
$478 = HEAP32[$name>>2]|0;
$479 = (_strcmp($478,26324)|0);
$480 = ($479|0)!=(0);
if (!($480)) {
HEAP32[$0>>2] = 37;
break;
}
$481 = HEAP32[$name>>2]|0;
$482 = (_strcmp($481,26331)|0);
$483 = ($482|0)!=(0);
if (!($483)) {
HEAP32[$0>>2] = 3;
break;
}
$484 = HEAP32[$name>>2]|0;
$485 = (_strcmp($484,26347)|0);
$486 = ($485|0)!=(0);
if (!($486)) {
HEAP32[$0>>2] = 2;
break;
}
$487 = HEAP32[$name>>2]|0;
$488 = (_strcmp($487,26364)|0);
$489 = ($488|0)!=(0);
if (!($489)) {
HEAP32[$0>>2] = 1;
break;
}
$490 = HEAP32[$name>>2]|0;
$491 = (_strcmp($490,26381)|0);
$492 = ($491|0)!=(0);
if (!($492)) {
HEAP32[$0>>2] = 29;
break;
}
$493 = HEAP32[$name>>2]|0;
$494 = (_strcmp($493,26397)|0);
$495 = ($494|0)!=(0);
if (!($495)) {
HEAP32[$0>>2] = 1;
break;
}
$496 = HEAP32[$name>>2]|0;
$497 = (_strcmp($496,26413)|0);
$498 = ($497|0)!=(0);
if (!($498)) {
HEAP32[$0>>2] = 4;
break;
}
$499 = HEAP32[$name>>2]|0;
$500 = (_strcmp($499,26430)|0);
$501 = ($500|0)!=(0);
if (!($501)) {
HEAP32[$0>>2] = 30;
break;
}
$502 = HEAP32[$name>>2]|0;
$503 = (_strcmp($502,26444)|0);
$504 = ($503|0)!=(0);
if (!($504)) {
HEAP32[$0>>2] = 31;
break;
}
$505 = HEAP32[$name>>2]|0;
$506 = (_strcmp($505,26456)|0);
$507 = ($506|0)!=(0);
if (!($507)) {
HEAP32[$0>>2] = 22;
break;
}
$508 = HEAP32[$name>>2]|0;
$509 = (_strcmp($508,26467)|0);
$510 = ($509|0)!=(0);
if (!($510)) {
HEAP32[$0>>2] = 2;
break;
}
$511 = HEAP32[$name>>2]|0;
$512 = (_strcmp($511,26480)|0);
$513 = ($512|0)!=(0);
if (!($513)) {
HEAP32[$0>>2] = 23;
break;
}
$514 = HEAP32[$name>>2]|0;
$515 = (_strcmp($514,26490)|0);
$516 = ($515|0)!=(0);
if (!($516)) {
HEAP32[$0>>2] = 2;
break;
}
$517 = HEAP32[$name>>2]|0;
$518 = (_strcmp($517,26507)|0);
$519 = ($518|0)!=(0);
if (!($519)) {
HEAP32[$0>>2] = 24;
break;
}
$520 = HEAP32[$name>>2]|0;
$521 = (_strcmp($520,26519)|0);
$522 = ($521|0)!=(0);
if (!($522)) {
HEAP32[$0>>2] = 25;
break;
}
$523 = HEAP32[$name>>2]|0;
$524 = (_strcmp($523,26541)|0);
$525 = ($524|0)!=(0);
if (!($525)) {
HEAP32[$0>>2] = 26;
break;
}
$526 = HEAP32[$name>>2]|0;
$527 = (_strcmp($526,26561)|0);
$528 = ($527|0)!=(0);
if (!($528)) {
HEAP32[$0>>2] = 3;
break;
}
$529 = HEAP32[$name>>2]|0;
$530 = (_strcmp($529,26574)|0);
$531 = ($530|0)!=(0);
if (!($531)) {
HEAP32[$0>>2] = 27;
break;
}
$532 = HEAP32[$name>>2]|0;
$533 = (_strcmp($532,26596)|0);
$534 = ($533|0)!=(0);
if (!($534)) {
HEAP32[$0>>2] = 28;
break;
}
$535 = HEAP32[$name>>2]|0;
$536 = (_strcmp($535,26616)|0);
$537 = ($536|0)!=(0);
if (!($537)) {
HEAP32[$0>>2] = 2;
break;
}
$538 = HEAP32[$name>>2]|0;
$539 = (_strcmp($538,26633)|0);
$540 = ($539|0)!=(0);
if (!($540)) {
HEAP32[$0>>2] = 2;
break;
}
$541 = HEAP32[$name>>2]|0;
$542 = (_strcmp($541,26650)|0);
$543 = ($542|0)!=(0);
if (!($543)) {
HEAP32[$0>>2] = 3;
break;
}
$544 = HEAP32[$name>>2]|0;
$545 = (_strcmp($544,26670)|0);
$546 = ($545|0)!=(0);
if ($546) {
$547 = HEAP32[$1>>2]|0;
$548 = HEAP32[$name>>2]|0;
$549 = _emscripten_asm_const_2(0, ($547|0), ($548|0))|0;
HEAP32[$0>>2] = 0;
break;
} else {
HEAP32[$0>>2] = 38;
break;
}
} else {
HEAP32[$0>>2] = 6;
}
} while(0);
$550 = HEAP32[$0>>2]|0;
STACKTOP = sp;return ($550|0);
}
function _isspace($c) {
$c = $c|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($c|0)==(32);
$1 = (($c) + -9)|0;
$2 = ($1>>>0)<(5);
$3 = $0 | $2;
$4 = $3&1;
return ($4|0);
}
function _strerror($e) {
$e = $e|0;
var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$03 = 0, $i$03$lcssa = 0, $i$12 = 0, $s$0$lcssa = 0, $s$01 = 0, $s$1 = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$i$03 = 0;
while(1) {
$1 = (26786 + ($i$03)|0);
$2 = HEAP8[$1>>0]|0;
$3 = $2&255;
$4 = ($3|0)==($e|0);
if ($4) {
$i$03$lcssa = $i$03;
label = 2;
break;
}
$5 = (($i$03) + 1)|0;
$6 = ($5|0)==(87);
if ($6) {
$i$12 = 87;$s$01 = 26874;
label = 5;
break;
} else {
$i$03 = $5;
}
}
if ((label|0) == 2) {
$0 = ($i$03$lcssa|0)==(0);
if ($0) {
$s$0$lcssa = 26874;
} else {
$i$12 = $i$03$lcssa;$s$01 = 26874;
label = 5;
}
}
if ((label|0) == 5) {
while(1) {
label = 0;
$s$1 = $s$01;
while(1) {
$7 = HEAP8[$s$1>>0]|0;
$8 = ($7<<24>>24)==(0);
$9 = ((($s$1)) + 1|0);
if ($8) {
$$lcssa = $9;
break;
} else {
$s$1 = $9;
}
}
$10 = (($i$12) + -1)|0;
$11 = ($10|0)==(0);
if ($11) {
$s$0$lcssa = $$lcssa;
break;
} else {
$i$12 = $10;$s$01 = $$lcssa;
label = 5;
}
}
}
return ($s$0$lcssa|0);
}
function ___errno_location() {
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = HEAP32[8652>>2]|0;
$1 = ($0|0)==(0|0);
if ($1) {
$$0 = 8908;
} else {
$2 = (_pthread_self()|0);
$3 = ((($2)) + 60|0);
$4 = HEAP32[$3>>2]|0;
$$0 = $4;
}
return ($$0|0);
}
function ___floatscan($f,$prec,$pok) {
$f = $f|0;
$prec = $prec|0;
$pok = $pok|0;
var $$$i = 0, $$0 = 0.0, $$0$i27 = 0.0, $$010$i = 0, $$07$i = 0, $$0710$i = 0, $$0711$i = 0, $$09$i = 0, $$1$be$i = 0, $$1$ph$i = 0, $$11$i = 0, $$18$i = 0, $$2$i = 0, $$3$be$i = 0, $$3$lcssa$i = 0, $$3105$i = 0, $$in = 0, $$k$0$i = 0, $$lcssa = 0, $$lcssa256 = 0;
var $$lcssa256$lcssa = 0, $$lcssa257 = 0, $$lcssa257$lcssa = 0, $$lcssa263 = 0, $$lcssa264 = 0, $$lcssa265 = 0, $$lcssa275 = 0, $$lnz$0$i = 0, $$neg32$i = 0, $$not$i = 0, $$old8 = 0, $$pn$i = 0.0, $$pre$i = 0, $$pre$i17 = 0, $$pre$phi42$iZ2D = 0.0, $$pre41$i = 0.0, $$promoted$i = 0, $$sink$off0$i = 0, $0 = 0, $1 = 0;
var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0, $187 = 0, $188 = 0.0, $189 = 0.0, $19 = 0;
var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0;
var $208 = 0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0;
var $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0;
var $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0;
var $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0.0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0;
var $280 = 0.0, $281 = 0.0, $282 = 0.0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0;
var $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0.0, $312 = 0, $313 = 0, $314 = 0, $315 = 0;
var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0.0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0, $324 = 0, $325 = 0.0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0;
var $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0;
var $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0;
var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0;
var $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0;
var $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0;
var $424 = 0.0, $425 = 0.0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0.0;
var $442 = 0.0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0.0, $454 = 0.0, $455 = 0.0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0;
var $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0.0, $466 = 0.0, $467 = 0.0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0;
var $479 = 0.0, $48 = 0, $480 = 0, $481 = 0.0, $482 = 0.0, $483 = 0, $484 = 0.0, $485 = 0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0.0, $492 = 0.0, $493 = 0, $494 = 0, $495 = 0, $496 = 0;
var $497 = 0, $498 = 0.0, $499 = 0.0, $5 = 0, $50 = 0.0, $500 = 0.0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0.0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0.0, $510 = 0, $511 = 0, $512 = 0, $513 = 0;
var $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0.0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0;
var $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0;
var $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0;
var $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0;
var $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0;
var $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0.0, $62 = 0, $620 = 0, $621 = 0;
var $622 = 0, $623 = 0, $624 = 0.0, $625 = 0.0, $626 = 0.0, $627 = 0, $628 = 0.0, $629 = 0.0, $63 = 0, $630 = 0.0, $631 = 0.0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0;
var $640 = 0, $641 = 0, $642 = 0.0, $643 = 0.0, $644 = 0.0, $645 = 0, $646 = 0.0, $647 = 0.0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0.0, $652 = 0.0, $653 = 0.0, $654 = 0.0, $655 = 0, $656 = 0, $657 = 0.0, $658 = 0;
var $659 = 0.0, $66 = 0, $660 = 0.0, $661 = 0.0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0.0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0.0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0;
var $677 = 0, $678 = 0.0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0.0, $684 = 0, $685 = 0, $686 = 0.0, $687 = 0.0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0;
var $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0;
var $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
var $98 = 0, $99 = 0, $a$0$lcssa151$i = 0, $a$085$i = 0, $a$1$i = 0, $a$1$i$lcssa = 0, $a$2$ph38$i = 0, $a$3$i = 0, $a$3$i$lcssa248 = 0, $a$3$i249 = 0, $a$3$ph$i = 0, $a$3$ph157$i = 0, $a$478$i = 0, $a$5$i = 0, $a$5$i$lcssa = 0, $a$5$i$lcssa$lcssa = 0, $bias$0$i = 0.0, $bias$0$i25 = 0.0, $bits$0$ph = 0, $brmerge$i28 = 0;
var $c$0 = 0, $c$0$i = 0, $c$1$lcssa = 0, $c$1$ph$i = 0, $c$179 = 0, $c$2 = 0, $c$2$i = 0, $c$2$lcssa$i = 0, $c$377 = 0, $c$4 = 0, $c$5 = 0, $c$6 = 0, $carry$087$i = 0, $carry1$0$i = 0, $carry1$1$i = 0, $carry1$1$i$lcssa = 0, $carry1$1$i$lcssa$lcssa = 0, $carry3$081$i = 0, $cond$i = 0, $d$0$i = 0;
var $denormal$0$i = 0, $denormal$1$i = 0, $denormal$2$i = 0, $e2$0$i19 = 0, $e2$0$ph$i = 0, $e2$1$i = 0, $e2$1$i246 = 0, $e2$1$ph$i = 0, $e2$1$ph156$i = 0, $e2$2$i = 0, $e2$3$i = 0, $emin$0$ph = 0, $exitcond$i = 0, $frac$0$i = 0.0, $frac$1$i = 0.0, $frac$2$i = 0.0, $gotdig$0$i = 0, $gotdig$0$i$lcssa242 = 0, $gotdig$0$i12 = 0, $gotdig$0$i12$lcssa273 = 0;
var $gotdig$2$i = 0, $gotdig$2$i$lcssa = 0, $gotdig$2$i13 = 0, $gotdig$3$i = 0, $gotdig$3$lcssa$i = 0, $gotdig$3101$i = 0, $gotdig$3101$i$lcssa = 0, $gotdig$4$i = 0, $gotrad$0$i = 0, $gotrad$0$i$lcssa = 0, $gotrad$0$i14 = 0, $gotrad$1$i = 0, $gotrad$1$lcssa$i = 0, $gotrad$1102$i = 0, $gotrad$2$i = 0, $gottail$0$i = 0, $gottail$1$i = 0, $gottail$2$i = 0, $i$0$lcssa = 0, $i$078 = 0;
var $i$1 = 0, $i$276 = 0, $i$3 = 0, $i$4 = 0, $i$4$lcssa = 0, $j$0$lcssa$i = 0, $j$0104$i = 0, $j$0104$i$lcssa = 0, $j$067$i = 0, $j$068$i = 0, $j$069$i = 0, $j$2$i = 0, $j$394$i = 0, $k$0$lcssa$i = 0, $k$0103$i = 0, $k$0103$i$lcssa = 0, $k$063$i = 0, $k$064$i = 0, $k$065$i = 0, $k$2$i = 0;
var $k$3$i = 0, $k$486$i = 0, $k$5$i = 0, $k$5$in$i = 0, $k$5$z$2$i = 0, $k$679$i = 0, $lnz$0$lcssa$i = 0, $lnz$0100$i = 0, $lnz$0100$i$lcssa = 0, $lnz$057$i = 0, $lnz$058$i = 0, $lnz$059$i = 0, $lnz$2$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond$i16 = 0, $or$cond13$i = 0, $or$cond15$i = 0, $or$cond16$i = 0, $or$cond17$i = 0;
var $or$cond182$i = 0, $or$cond19$i = 0, $or$cond20$i = 0, $or$cond3$i = 0, $or$cond4$i = 0, $or$cond5 = 0, $or$cond6$i = 0, $or$cond7 = 0, $or$cond8$i = 0, $or$cond9 = 0, $or$cond9$i = 0, $rp$0$lcssa152$i = 0, $rp$084$i = 0, $rp$1$i18 = 0, $rp$1$i18$lcssa = 0, $rp$2$ph36$i = 0, $rp$3$ph$i = 0, $rp$3$ph34$i = 0, $rp$477$i = 0, $rp$5$i = 0;
var $rp$5$i$lcssa = 0, $rp$5$i$lcssa$lcssa = 0, $scale$0$i = 0.0, $scale$1$i = 0.0, $scale$2$i = 0.0, $sign$0 = 0, $storemerge$i = 0, $sum$i = 0, $x$0$i = 0, $x$0$i$lcssa = 0, $x$1$i = 0, $x$2$i = 0, $x$3$lcssa$i = 0, $x$324$i = 0, $x$4$lcssa$i = 0, $x$419$i = 0, $x$5$i = 0, $x$6$i = 0, $x$i = 0, $y$0$i = 0.0;
var $y$0$i$lcssa = 0.0, $y$1$i = 0.0, $y$1$i24 = 0.0, $y$2$i = 0.0, $y$2$i26 = 0.0, $y$3$i = 0.0, $y$3$lcssa$i = 0.0, $y$320$i = 0.0, $y$4$i = 0.0, $y$5$i = 0.0, $z$0$i = 0, $z$1$i = 0, $z$1$ph37$i = 0, $z$2$i = 0, $z$3$i = 0, $z$3$i$lcssa = 0, $z$3$i$lcssa$lcssa = 0, $z$4$i = 0, $z$5$ph$i = 0, $z$7$1$i = 0;
var $z$7$i = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 512|0;
$x$i = sp;
switch ($prec|0) {
case 0: {
$bits$0$ph = 24;$emin$0$ph = -149;
label = 4;
break;
}
case 1: {
$bits$0$ph = 53;$emin$0$ph = -1074;
label = 4;
break;
}
case 2: {
$bits$0$ph = 53;$emin$0$ph = -1074;
label = 4;
break;
}
default: {
$$0 = 0.0;
}
}
L4: do {
if ((label|0) == 4) {
$0 = ((($f)) + 4|0);
$1 = ((($f)) + 100|0);
while(1) {
$2 = HEAP32[$0>>2]|0;
$3 = HEAP32[$1>>2]|0;
$4 = ($2>>>0)<($3>>>0);
if ($4) {
$5 = ((($2)) + 1|0);
HEAP32[$0>>2] = $5;
$6 = HEAP8[$2>>0]|0;
$7 = $6&255;
$9 = $7;
} else {
$8 = (___shgetc($f)|0);
$9 = $8;
}
$10 = (_isspace($9)|0);
$11 = ($10|0)==(0);
if ($11) {
$$lcssa275 = $9;
break;
}
}
$12 = ($$lcssa275|0)==(45);
L13: do {
switch ($$lcssa275|0) {
case 43: case 45: {
$13 = $12&1;
$14 = $13 << 1;
$15 = (1 - ($14))|0;
$16 = HEAP32[$0>>2]|0;
$17 = HEAP32[$1>>2]|0;
$18 = ($16>>>0)<($17>>>0);
if ($18) {
$19 = ((($16)) + 1|0);
HEAP32[$0>>2] = $19;
$20 = HEAP8[$16>>0]|0;
$21 = $20&255;
$c$0 = $21;$sign$0 = $15;
break L13;
} else {
$22 = (___shgetc($f)|0);
$c$0 = $22;$sign$0 = $15;
break L13;
}
break;
}
default: {
$c$0 = $$lcssa275;$sign$0 = 1;
}
}
} while(0);
$c$179 = $c$0;$i$078 = 0;
while(1) {
$23 = $c$179 | 32;
$24 = (28678 + ($i$078)|0);
$25 = HEAP8[$24>>0]|0;
$26 = $25 << 24 >> 24;
$27 = ($23|0)==($26|0);
if (!($27)) {
$c$1$lcssa = $c$179;$i$0$lcssa = $i$078;
break;
}
$28 = ($i$078>>>0)<(7);
do {
if ($28) {
$29 = HEAP32[$0>>2]|0;
$30 = HEAP32[$1>>2]|0;
$31 = ($29>>>0)<($30>>>0);
if ($31) {
$32 = ((($29)) + 1|0);
HEAP32[$0>>2] = $32;
$33 = HEAP8[$29>>0]|0;
$34 = $33&255;
$c$2 = $34;
break;
} else {
$35 = (___shgetc($f)|0);
$c$2 = $35;
break;
}
} else {
$c$2 = $c$179;
}
} while(0);
$36 = (($i$078) + 1)|0;
$37 = ($36>>>0)<(8);
if ($37) {
$c$179 = $c$2;$i$078 = $36;
} else {
$c$1$lcssa = $c$2;$i$0$lcssa = $36;
break;
}
}
L29: do {
switch ($i$0$lcssa|0) {
case 8: {
break;
}
case 3: {
label = 23;
break;
}
default: {
$38 = ($i$0$lcssa>>>0)>(3);
$39 = ($pok|0)!=(0);
$or$cond5 = $39 & $38;
if ($or$cond5) {
$40 = ($i$0$lcssa|0)==(8);
if ($40) {
break L29;
} else {
label = 23;
break L29;
}
}
$53 = ($i$0$lcssa|0)==(0);
L34: do {
if ($53) {
$c$377 = $c$1$lcssa;$i$276 = 0;
while(1) {
$54 = $c$377 | 32;
$55 = (30513 + ($i$276)|0);
$56 = HEAP8[$55>>0]|0;
$57 = $56 << 24 >> 24;
$58 = ($54|0)==($57|0);
if (!($58)) {
$c$5 = $c$377;$i$3 = $i$276;
break L34;
}
$59 = ($i$276>>>0)<(2);
do {
if ($59) {
$60 = HEAP32[$0>>2]|0;
$61 = HEAP32[$1>>2]|0;
$62 = ($60>>>0)<($61>>>0);
if ($62) {
$63 = ((($60)) + 1|0);
HEAP32[$0>>2] = $63;
$64 = HEAP8[$60>>0]|0;
$65 = $64&255;
$c$4 = $65;
break;
} else {
$66 = (___shgetc($f)|0);
$c$4 = $66;
break;
}
} else {
$c$4 = $c$377;
}
} while(0);
$67 = (($i$276) + 1)|0;
$68 = ($67>>>0)<(3);
if ($68) {
$c$377 = $c$4;$i$276 = $67;
} else {
$c$5 = $c$4;$i$3 = $67;
break;
}
}
} else {
$c$5 = $c$1$lcssa;$i$3 = $i$0$lcssa;
}
} while(0);
switch ($i$3|0) {
case 3: {
$69 = HEAP32[$0>>2]|0;
$70 = HEAP32[$1>>2]|0;
$71 = ($69>>>0)<($70>>>0);
if ($71) {
$72 = ((($69)) + 1|0);
HEAP32[$0>>2] = $72;
$73 = HEAP8[$69>>0]|0;
$74 = $73&255;
$76 = $74;
} else {
$75 = (___shgetc($f)|0);
$76 = $75;
}
$77 = ($76|0)==(40);
if ($77) {
$i$4 = 1;
} else {
$78 = HEAP32[$1>>2]|0;
$79 = ($78|0)==(0|0);
if ($79) {
$$0 = nan;
break L4;
}
$80 = HEAP32[$0>>2]|0;
$81 = ((($80)) + -1|0);
HEAP32[$0>>2] = $81;
$$0 = nan;
break L4;
}
while(1) {
$82 = HEAP32[$0>>2]|0;
$83 = HEAP32[$1>>2]|0;
$84 = ($82>>>0)<($83>>>0);
if ($84) {
$85 = ((($82)) + 1|0);
HEAP32[$0>>2] = $85;
$86 = HEAP8[$82>>0]|0;
$87 = $86&255;
$90 = $87;
} else {
$88 = (___shgetc($f)|0);
$90 = $88;
}
$89 = (($90) + -48)|0;
$91 = ($89>>>0)<(10);
$92 = (($90) + -65)|0;
$93 = ($92>>>0)<(26);
$or$cond = $91 | $93;
if (!($or$cond)) {
$94 = (($90) + -97)|0;
$95 = ($94>>>0)<(26);
$96 = ($90|0)==(95);
$or$cond7 = $96 | $95;
if (!($or$cond7)) {
$$lcssa = $90;$i$4$lcssa = $i$4;
break;
}
}
$108 = (($i$4) + 1)|0;
$i$4 = $108;
}
$97 = ($$lcssa|0)==(41);
if ($97) {
$$0 = nan;
break L4;
}
$98 = HEAP32[$1>>2]|0;
$99 = ($98|0)==(0|0);
if (!($99)) {
$100 = HEAP32[$0>>2]|0;
$101 = ((($100)) + -1|0);
HEAP32[$0>>2] = $101;
}
if (!($39)) {
$103 = (___errno_location()|0);
HEAP32[$103>>2] = 22;
___shlim($f,0);
$$0 = 0.0;
break L4;
}
$102 = ($i$4$lcssa|0)==(0);
if ($102) {
$$0 = nan;
break L4;
} else {
$$in = $i$4$lcssa;
}
while(1) {
$104 = (($$in) + -1)|0;
if (!($99)) {
$105 = HEAP32[$0>>2]|0;
$106 = ((($105)) + -1|0);
HEAP32[$0>>2] = $106;
}
$107 = ($104|0)==(0);
if ($107) {
$$0 = nan;
break L4;
} else {
$$in = $104;
}
}
break;
}
case 0: {
$114 = ($c$5|0)==(48);
do {
if ($114) {
$115 = HEAP32[$0>>2]|0;
$116 = HEAP32[$1>>2]|0;
$117 = ($115>>>0)<($116>>>0);
if ($117) {
$118 = ((($115)) + 1|0);
HEAP32[$0>>2] = $118;
$119 = HEAP8[$115>>0]|0;
$120 = $119&255;
$123 = $120;
} else {
$121 = (___shgetc($f)|0);
$123 = $121;
}
$122 = $123 | 32;
$124 = ($122|0)==(120);
if (!($124)) {
$326 = HEAP32[$1>>2]|0;
$327 = ($326|0)==(0|0);
if ($327) {
$c$6 = 48;
break;
}
$328 = HEAP32[$0>>2]|0;
$329 = ((($328)) + -1|0);
HEAP32[$0>>2] = $329;
$c$6 = 48;
break;
}
$125 = HEAP32[$0>>2]|0;
$126 = HEAP32[$1>>2]|0;
$127 = ($125>>>0)<($126>>>0);
if ($127) {
$128 = ((($125)) + 1|0);
HEAP32[$0>>2] = $128;
$129 = HEAP8[$125>>0]|0;
$130 = $129&255;
$c$0$i = $130;$gotdig$0$i = 0;
} else {
$131 = (___shgetc($f)|0);
$c$0$i = $131;$gotdig$0$i = 0;
}
L94: while(1) {
switch ($c$0$i|0) {
case 46: {
$gotdig$0$i$lcssa242 = $gotdig$0$i;
label = 74;
break L94;
break;
}
case 48: {
break;
}
default: {
$168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$0$i;$gotdig$2$i = $gotdig$0$i;$gotrad$0$i = 0;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0;
break L94;
}
}
$132 = HEAP32[$0>>2]|0;
$133 = HEAP32[$1>>2]|0;
$134 = ($132>>>0)<($133>>>0);
if ($134) {
$135 = ((($132)) + 1|0);
HEAP32[$0>>2] = $135;
$136 = HEAP8[$132>>0]|0;
$137 = $136&255;
$c$0$i = $137;$gotdig$0$i = 1;
continue;
} else {
$138 = (___shgetc($f)|0);
$c$0$i = $138;$gotdig$0$i = 1;
continue;
}
}
if ((label|0) == 74) {
$139 = HEAP32[$0>>2]|0;
$140 = HEAP32[$1>>2]|0;
$141 = ($139>>>0)<($140>>>0);
if ($141) {
$142 = ((($139)) + 1|0);
HEAP32[$0>>2] = $142;
$143 = HEAP8[$139>>0]|0;
$144 = $143&255;
$c$1$ph$i = $144;
} else {
$145 = (___shgetc($f)|0);
$c$1$ph$i = $145;
}
$146 = ($c$1$ph$i|0)==(48);
if ($146) {
$154 = 0;$155 = 0;
while(1) {
$147 = HEAP32[$0>>2]|0;
$148 = HEAP32[$1>>2]|0;
$149 = ($147>>>0)<($148>>>0);
if ($149) {
$150 = ((($147)) + 1|0);
HEAP32[$0>>2] = $150;
$151 = HEAP8[$147>>0]|0;
$152 = $151&255;
$158 = $152;
} else {
$153 = (___shgetc($f)|0);
$158 = $153;
}
$156 = (_i64Add(($154|0),($155|0),-1,-1)|0);
$157 = tempRet0;
$159 = ($158|0)==(48);
if ($159) {
$154 = $156;$155 = $157;
} else {
$168 = 0;$170 = 0;$694 = $156;$695 = $157;$c$2$i = $158;$gotdig$2$i = 1;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0;
break;
}
}
} else {
$168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$1$ph$i;$gotdig$2$i = $gotdig$0$i$lcssa242;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0;
}
}
while(1) {
$160 = (($c$2$i) + -48)|0;
$161 = ($160>>>0)<(10);
$$pre$i = $c$2$i | 32;
if ($161) {
label = 86;
} else {
$162 = (($$pre$i) + -97)|0;
$163 = ($162>>>0)<(6);
$164 = ($c$2$i|0)==(46);
$or$cond6$i = $164 | $163;
if (!($or$cond6$i)) {
$212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = $c$2$i;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i;
break;
}
if ($164) {
$165 = ($gotrad$0$i|0)==(0);
if ($165) {
$696 = $170;$697 = $168;$698 = $170;$699 = $168;$gotdig$3$i = $gotdig$2$i;$gotrad$1$i = 1;$gottail$2$i = $gottail$0$i;$scale$2$i = $scale$0$i;$x$2$i = $x$0$i;$y$2$i = $y$0$i;
} else {
$212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = 46;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i;
break;
}
} else {
label = 86;
}
}
if ((label|0) == 86) {
label = 0;
$166 = ($c$2$i|0)>(57);
$167 = (($$pre$i) + -87)|0;
$d$0$i = $166 ? $167 : $160;
$169 = ($168|0)<(0);
$171 = ($170>>>0)<(8);
$172 = ($168|0)==(0);
$173 = $172 & $171;
$174 = $169 | $173;
do {
if ($174) {
$175 = $x$0$i << 4;
$176 = (($d$0$i) + ($175))|0;
$gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $176;$y$1$i = $y$0$i;
} else {
$177 = ($168|0)<(0);
$178 = ($170>>>0)<(14);
$179 = ($168|0)==(0);
$180 = $179 & $178;
$181 = $177 | $180;
if ($181) {
$182 = (+($d$0$i|0));
$183 = $scale$0$i * 0.0625;
$184 = $183 * $182;
$185 = $y$0$i + $184;
$gottail$1$i = $gottail$0$i;$scale$1$i = $183;$x$1$i = $x$0$i;$y$1$i = $185;
break;
}
$186 = ($d$0$i|0)==(0);
$187 = ($gottail$0$i|0)!=(0);
$or$cond$i = $187 | $186;
if ($or$cond$i) {
$gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $y$0$i;
} else {
$188 = $scale$0$i * 0.5;
$189 = $y$0$i + $188;
$gottail$1$i = 1;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $189;
}
}
} while(0);
$190 = (_i64Add(($170|0),($168|0),1,0)|0);
$191 = tempRet0;
$696 = $694;$697 = $695;$698 = $190;$699 = $191;$gotdig$3$i = 1;$gotrad$1$i = $gotrad$0$i;$gottail$2$i = $gottail$1$i;$scale$2$i = $scale$1$i;$x$2$i = $x$1$i;$y$2$i = $y$1$i;
}
$192 = HEAP32[$0>>2]|0;
$193 = HEAP32[$1>>2]|0;
$194 = ($192>>>0)<($193>>>0);
if ($194) {
$195 = ((($192)) + 1|0);
HEAP32[$0>>2] = $195;
$196 = HEAP8[$192>>0]|0;
$197 = $196&255;
$168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $197;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i;
continue;
} else {
$198 = (___shgetc($f)|0);
$168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $198;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i;
continue;
}
}
$199 = ($gotdig$2$i$lcssa|0)==(0);
if ($199) {
$200 = HEAP32[$1>>2]|0;
$201 = ($200|0)==(0|0);
if (!($201)) {
$202 = HEAP32[$0>>2]|0;
$203 = ((($202)) + -1|0);
HEAP32[$0>>2] = $203;
}
$204 = ($pok|0)==(0);
if ($204) {
___shlim($f,0);
} else {
if (!($201)) {
$205 = HEAP32[$0>>2]|0;
$206 = ((($205)) + -1|0);
HEAP32[$0>>2] = $206;
$207 = ($gotrad$0$i$lcssa|0)==(0);
if (!($207)) {
$208 = ((($205)) + -2|0);
HEAP32[$0>>2] = $208;
}
}
}
$209 = (+($sign$0|0));
$210 = $209 * 0.0;
$$0 = $210;
break L4;
}
$211 = ($gotrad$0$i$lcssa|0)==(0);
$214 = $211 ? $213 : $212;
$217 = $211 ? $216 : $215;
$218 = ($216|0)<(0);
$219 = ($213>>>0)<(8);
$220 = ($216|0)==(0);
$221 = $220 & $219;
$222 = $218 | $221;
if ($222) {
$224 = $213;$225 = $216;$x$324$i = $x$0$i$lcssa;
while(1) {
$223 = $x$324$i << 4;
$226 = (_i64Add(($224|0),($225|0),1,0)|0);
$227 = tempRet0;
$228 = ($227|0)<(0);
$229 = ($226>>>0)<(8);
$230 = ($227|0)==(0);
$231 = $230 & $229;
$232 = $228 | $231;
if ($232) {
$224 = $226;$225 = $227;$x$324$i = $223;
} else {
$x$3$lcssa$i = $223;
break;
}
}
} else {
$x$3$lcssa$i = $x$0$i$lcssa;
}
$233 = $c$2$lcssa$i | 32;
$234 = ($233|0)==(112);
if ($234) {
$235 = (_scanexp($f,$pok)|0);
$236 = tempRet0;
$237 = ($235|0)==(0);
$238 = ($236|0)==(-2147483648);
$239 = $237 & $238;
if ($239) {
$240 = ($pok|0)==(0);
if ($240) {
___shlim($f,0);
$$0 = 0.0;
break L4;
}
$241 = HEAP32[$1>>2]|0;
$242 = ($241|0)==(0|0);
if ($242) {
$253 = 0;$254 = 0;
} else {
$243 = HEAP32[$0>>2]|0;
$244 = ((($243)) + -1|0);
HEAP32[$0>>2] = $244;
$253 = 0;$254 = 0;
}
} else {
$253 = $235;$254 = $236;
}
} else {
$245 = HEAP32[$1>>2]|0;
$246 = ($245|0)==(0|0);
if ($246) {
$253 = 0;$254 = 0;
} else {
$247 = HEAP32[$0>>2]|0;
$248 = ((($247)) + -1|0);
HEAP32[$0>>2] = $248;
$253 = 0;$254 = 0;
}
}
$249 = (_bitshift64Shl(($214|0),($217|0),2)|0);
$250 = tempRet0;
$251 = (_i64Add(($249|0),($250|0),-32,-1)|0);
$252 = tempRet0;
$255 = (_i64Add(($251|0),($252|0),($253|0),($254|0))|0);
$256 = tempRet0;
$257 = ($x$3$lcssa$i|0)==(0);
if ($257) {
$258 = (+($sign$0|0));
$259 = $258 * 0.0;
$$0 = $259;
break L4;
}
$260 = (0 - ($emin$0$ph))|0;
$261 = ($256|0)>(0);
$262 = ($255>>>0)>($260>>>0);
$263 = ($256|0)==(0);
$264 = $263 & $262;
$265 = $261 | $264;
if ($265) {
$266 = (___errno_location()|0);
HEAP32[$266>>2] = 34;
$267 = (+($sign$0|0));
$268 = $267 * 1.7976931348623157E+308;
$269 = $268 * 1.7976931348623157E+308;
$$0 = $269;
break L4;
}
$270 = (($emin$0$ph) + -106)|0;
$271 = ($270|0)<(0);
$272 = $271 << 31 >> 31;
$273 = ($256|0)<($272|0);
$274 = ($255>>>0)<($270>>>0);
$275 = ($256|0)==($272|0);
$276 = $275 & $274;
$277 = $273 | $276;
if ($277) {
$279 = (___errno_location()|0);
HEAP32[$279>>2] = 34;
$280 = (+($sign$0|0));
$281 = $280 * 2.2250738585072014E-308;
$282 = $281 * 2.2250738585072014E-308;
$$0 = $282;
break L4;
}
$278 = ($x$3$lcssa$i|0)>(-1);
if ($278) {
$288 = $255;$289 = $256;$x$419$i = $x$3$lcssa$i;$y$320$i = $y$0$i$lcssa;
while(1) {
$283 = !($y$320$i >= 0.5);
$284 = $x$419$i << 1;
$285 = $y$320$i + -1.0;
$286 = $283&1;
$287 = $286 | $284;
$x$5$i = $287 ^ 1;
$$pn$i = $283 ? $y$320$i : $285;
$y$4$i = $y$320$i + $$pn$i;
$290 = (_i64Add(($288|0),($289|0),-1,-1)|0);
$291 = tempRet0;
$292 = ($287|0)>(-1);
if ($292) {
$288 = $290;$289 = $291;$x$419$i = $x$5$i;$y$320$i = $y$4$i;
} else {
$297 = $290;$298 = $291;$x$4$lcssa$i = $x$5$i;$y$3$lcssa$i = $y$4$i;
break;
}
}
} else {
$297 = $255;$298 = $256;$x$4$lcssa$i = $x$3$lcssa$i;$y$3$lcssa$i = $y$0$i$lcssa;
}
$293 = ($emin$0$ph|0)<(0);
$294 = $293 << 31 >> 31;
$295 = (_i64Subtract(32,0,($emin$0$ph|0),($294|0))|0);
$296 = tempRet0;
$299 = (_i64Add(($297|0),($298|0),($295|0),($296|0))|0);
$300 = tempRet0;
$301 = (0)>($300|0);
$302 = ($bits$0$ph>>>0)>($299>>>0);
$303 = (0)==($300|0);
$304 = $303 & $302;
$305 = $301 | $304;
if ($305) {
$306 = ($299|0)<(0);
if ($306) {
$$0710$i = 0;
label = 127;
} else {
$$07$i = $299;
label = 125;
}
} else {
$$07$i = $bits$0$ph;
label = 125;
}
if ((label|0) == 125) {
$307 = ($$07$i|0)<(53);
if ($307) {
$$0710$i = $$07$i;
label = 127;
} else {
$$pre41$i = (+($sign$0|0));
$$0711$i = $$07$i;$$pre$phi42$iZ2D = $$pre41$i;$bias$0$i = 0.0;
}
}
if ((label|0) == 127) {
$308 = (84 - ($$0710$i))|0;
$309 = (+_scalbn(1.0,$308));
$310 = (+($sign$0|0));
$311 = (+_copysignl($309,$310));
$$0711$i = $$0710$i;$$pre$phi42$iZ2D = $310;$bias$0$i = $311;
}
$312 = ($$0711$i|0)<(32);
$313 = $y$3$lcssa$i != 0.0;
$or$cond4$i = $313 & $312;
$314 = $x$4$lcssa$i & 1;
$315 = ($314|0)==(0);
$or$cond9$i = $315 & $or$cond4$i;
$316 = $or$cond9$i&1;
$x$6$i = (($316) + ($x$4$lcssa$i))|0;
$y$5$i = $or$cond9$i ? 0.0 : $y$3$lcssa$i;
$317 = (+($x$6$i>>>0));
$318 = $$pre$phi42$iZ2D * $317;
$319 = $bias$0$i + $318;
$320 = $$pre$phi42$iZ2D * $y$5$i;
$321 = $320 + $319;
$322 = $321 - $bias$0$i;
$323 = $322 != 0.0;
if (!($323)) {
$324 = (___errno_location()|0);
HEAP32[$324>>2] = 34;
}
$325 = (+_scalbnl($322,$297));
$$0 = $325;
break L4;
} else {
$c$6 = $c$5;
}
} while(0);
$sum$i = (($emin$0$ph) + ($bits$0$ph))|0;
$330 = (0 - ($sum$i))|0;
$$09$i = $c$6;$gotdig$0$i12 = 0;
L184: while(1) {
switch ($$09$i|0) {
case 46: {
$gotdig$0$i12$lcssa273 = $gotdig$0$i12;
label = 138;
break L184;
break;
}
case 48: {
break;
}
default: {
$$2$i = $$09$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12;$gotrad$0$i14 = 0;
break L184;
}
}
$331 = HEAP32[$0>>2]|0;
$332 = HEAP32[$1>>2]|0;
$333 = ($331>>>0)<($332>>>0);
if ($333) {
$334 = ((($331)) + 1|0);
HEAP32[$0>>2] = $334;
$335 = HEAP8[$331>>0]|0;
$336 = $335&255;
$$09$i = $336;$gotdig$0$i12 = 1;
continue;
} else {
$337 = (___shgetc($f)|0);
$$09$i = $337;$gotdig$0$i12 = 1;
continue;
}
}
if ((label|0) == 138) {
$338 = HEAP32[$0>>2]|0;
$339 = HEAP32[$1>>2]|0;
$340 = ($338>>>0)<($339>>>0);
if ($340) {
$341 = ((($338)) + 1|0);
HEAP32[$0>>2] = $341;
$342 = HEAP8[$338>>0]|0;
$343 = $342&255;
$$1$ph$i = $343;
} else {
$344 = (___shgetc($f)|0);
$$1$ph$i = $344;
}
$345 = ($$1$ph$i|0)==(48);
if ($345) {
$346 = 0;$347 = 0;
while(1) {
$348 = (_i64Add(($346|0),($347|0),-1,-1)|0);
$349 = tempRet0;
$350 = HEAP32[$0>>2]|0;
$351 = HEAP32[$1>>2]|0;
$352 = ($350>>>0)<($351>>>0);
if ($352) {
$353 = ((($350)) + 1|0);
HEAP32[$0>>2] = $353;
$354 = HEAP8[$350>>0]|0;
$355 = $354&255;
$$1$be$i = $355;
} else {
$356 = (___shgetc($f)|0);
$$1$be$i = $356;
}
$357 = ($$1$be$i|0)==(48);
if ($357) {
$346 = $348;$347 = $349;
} else {
$$2$i = $$1$be$i;$700 = $348;$701 = $349;$gotdig$2$i13 = 1;$gotrad$0$i14 = 1;
break;
}
}
} else {
$$2$i = $$1$ph$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12$lcssa273;$gotrad$0$i14 = 1;
}
}
HEAP32[$x$i>>2] = 0;
$358 = (($$2$i) + -48)|0;
$359 = ($358>>>0)<(10);
$360 = ($$2$i|0)==(46);
$361 = $360 | $359;
L203: do {
if ($361) {
$362 = ((($x$i)) + 496|0);
$$3105$i = $$2$i;$365 = 0;$366 = 0;$702 = $360;$703 = $358;$704 = $700;$705 = $701;$gotdig$3101$i = $gotdig$2$i13;$gotrad$1102$i = $gotrad$0$i14;$j$0104$i = 0;$k$0103$i = 0;$lnz$0100$i = 0;
L205: while(1) {
do {
if ($702) {
$cond$i = ($gotrad$1102$i|0)==(0);
if ($cond$i) {
$706 = $365;$707 = $366;$708 = $365;$709 = $366;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = 1;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i;
} else {
$710 = $704;$711 = $705;$712 = $365;$713 = $366;$gotdig$3101$i$lcssa = $gotdig$3101$i;$j$0104$i$lcssa = $j$0104$i;$k$0103$i$lcssa = $k$0103$i;$lnz$0100$i$lcssa = $lnz$0100$i;
break L205;
}
} else {
$364 = ($k$0103$i|0)<(125);
$367 = (_i64Add(($365|0),($366|0),1,0)|0);
$368 = tempRet0;
$369 = ($$3105$i|0)!=(48);
if (!($364)) {
if (!($369)) {
$706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i;
break;
}
$379 = HEAP32[$362>>2]|0;
$380 = $379 | 1;
HEAP32[$362>>2] = $380;
$706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i;
break;
}
$$lnz$0$i = $369 ? $367 : $lnz$0100$i;
$370 = ($j$0104$i|0)==(0);
$371 = (($x$i) + ($k$0103$i<<2)|0);
if ($370) {
$storemerge$i = $703;
} else {
$372 = HEAP32[$371>>2]|0;
$373 = ($372*10)|0;
$374 = (($$3105$i) + -48)|0;
$375 = (($374) + ($373))|0;
$storemerge$i = $375;
}
HEAP32[$371>>2] = $storemerge$i;
$376 = (($j$0104$i) + 1)|0;
$377 = ($376|0)==(9);
$378 = $377&1;
$$k$0$i = (($378) + ($k$0103$i))|0;
$$11$i = $377 ? 0 : $376;
$706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = 1;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $$11$i;$k$2$i = $$k$0$i;$lnz$2$i = $$lnz$0$i;
}
} while(0);
$381 = HEAP32[$0>>2]|0;
$382 = HEAP32[$1>>2]|0;
$383 = ($381>>>0)<($382>>>0);
if ($383) {
$384 = ((($381)) + 1|0);
HEAP32[$0>>2] = $384;
$385 = HEAP8[$381>>0]|0;
$386 = $385&255;
$$3$be$i = $386;
} else {
$387 = (___shgetc($f)|0);
$$3$be$i = $387;
}
$388 = (($$3$be$i) + -48)|0;
$389 = ($388>>>0)<(10);
$390 = ($$3$be$i|0)==(46);
$391 = $390 | $389;
if ($391) {
$$3105$i = $$3$be$i;$365 = $708;$366 = $709;$702 = $390;$703 = $388;$704 = $706;$705 = $707;$gotdig$3101$i = $gotdig$4$i;$gotrad$1102$i = $gotrad$2$i;$j$0104$i = $j$2$i;$k$0103$i = $k$2$i;$lnz$0100$i = $lnz$2$i;
} else {
$$3$lcssa$i = $$3$be$i;$393 = $706;$394 = $708;$396 = $707;$397 = $709;$gotdig$3$lcssa$i = $gotdig$4$i;$gotrad$1$lcssa$i = $gotrad$2$i;$j$0$lcssa$i = $j$2$i;$k$0$lcssa$i = $k$2$i;$lnz$0$lcssa$i = $lnz$2$i;
label = 161;
break L203;
}
}
$363 = ($gotdig$3101$i$lcssa|0)!=(0);
$714 = $712;$715 = $713;$716 = $710;$717 = $711;$718 = $363;$j$069$i = $j$0104$i$lcssa;$k$065$i = $k$0103$i$lcssa;$lnz$059$i = $lnz$0100$i$lcssa;
label = 169;
} else {
$$3$lcssa$i = $$2$i;$393 = $700;$394 = 0;$396 = $701;$397 = 0;$gotdig$3$lcssa$i = $gotdig$2$i13;$gotrad$1$lcssa$i = $gotrad$0$i14;$j$0$lcssa$i = 0;$k$0$lcssa$i = 0;$lnz$0$lcssa$i = 0;
label = 161;
}
} while(0);
do {
if ((label|0) == 161) {
$392 = ($gotrad$1$lcssa$i|0)==(0);
$395 = $392 ? $394 : $393;
$398 = $392 ? $397 : $396;
$399 = ($gotdig$3$lcssa$i|0)!=(0);
$400 = $$3$lcssa$i | 32;
$401 = ($400|0)==(101);
$or$cond13$i = $401 & $399;
if (!($or$cond13$i)) {
$416 = ($$3$lcssa$i|0)>(-1);
if ($416) {
$714 = $394;$715 = $397;$716 = $395;$717 = $398;$718 = $399;$j$069$i = $j$0$lcssa$i;$k$065$i = $k$0$lcssa$i;$lnz$059$i = $lnz$0$lcssa$i;
label = 169;
break;
} else {
$719 = $394;$720 = $397;$721 = $399;$722 = $395;$723 = $398;$j$068$i = $j$0$lcssa$i;$k$064$i = $k$0$lcssa$i;$lnz$058$i = $lnz$0$lcssa$i;
label = 171;
break;
}
}
$402 = (_scanexp($f,$pok)|0);
$403 = tempRet0;
$404 = ($402|0)==(0);
$405 = ($403|0)==(-2147483648);
$406 = $404 & $405;
if ($406) {
$407 = ($pok|0)==(0);
if ($407) {
___shlim($f,0);
$$0$i27 = 0.0;
break;
}
$408 = HEAP32[$1>>2]|0;
$409 = ($408|0)==(0|0);
if ($409) {
$412 = 0;$413 = 0;
} else {
$410 = HEAP32[$0>>2]|0;
$411 = ((($410)) + -1|0);
HEAP32[$0>>2] = $411;
$412 = 0;$413 = 0;
}
} else {
$412 = $402;$413 = $403;
}
$414 = (_i64Add(($412|0),($413|0),($395|0),($398|0))|0);
$415 = tempRet0;
$426 = $414;$428 = $394;$429 = $415;$431 = $397;$j$067$i = $j$0$lcssa$i;$k$063$i = $k$0$lcssa$i;$lnz$057$i = $lnz$0$lcssa$i;
label = 173;
}
} while(0);
if ((label|0) == 169) {
$417 = HEAP32[$1>>2]|0;
$418 = ($417|0)==(0|0);
if ($418) {
$719 = $714;$720 = $715;$721 = $718;$722 = $716;$723 = $717;$j$068$i = $j$069$i;$k$064$i = $k$065$i;$lnz$058$i = $lnz$059$i;
label = 171;
} else {
$419 = HEAP32[$0>>2]|0;
$420 = ((($419)) + -1|0);
HEAP32[$0>>2] = $420;
if ($718) {
$426 = $716;$428 = $714;$429 = $717;$431 = $715;$j$067$i = $j$069$i;$k$063$i = $k$065$i;$lnz$057$i = $lnz$059$i;
label = 173;
} else {
label = 172;
}
}
}
if ((label|0) == 171) {
if ($721) {
$426 = $722;$428 = $719;$429 = $723;$431 = $720;$j$067$i = $j$068$i;$k$063$i = $k$064$i;$lnz$057$i = $lnz$058$i;
label = 173;
} else {
label = 172;
}
}
do {
if ((label|0) == 172) {
$421 = (___errno_location()|0);
HEAP32[$421>>2] = 22;
___shlim($f,0);
$$0$i27 = 0.0;
}
else if ((label|0) == 173) {
$422 = HEAP32[$x$i>>2]|0;
$423 = ($422|0)==(0);
if ($423) {
$424 = (+($sign$0|0));
$425 = $424 * 0.0;
$$0$i27 = $425;
break;
}
$427 = ($426|0)==($428|0);
$430 = ($429|0)==($431|0);
$432 = $427 & $430;
$433 = ($431|0)<(0);
$434 = ($428>>>0)<(10);
$435 = ($431|0)==(0);
$436 = $435 & $434;
$437 = $433 | $436;
$or$cond$i16 = $437 & $432;
if ($or$cond$i16) {
$438 = ($bits$0$ph>>>0)>(30);
$439 = $422 >>> $bits$0$ph;
$440 = ($439|0)==(0);
$or$cond15$i = $438 | $440;
if ($or$cond15$i) {
$441 = (+($sign$0|0));
$442 = (+($422>>>0));
$443 = $441 * $442;
$$0$i27 = $443;
break;
}
}
$444 = (($emin$0$ph|0) / -2)&-1;
$445 = ($444|0)<(0);
$446 = $445 << 31 >> 31;
$447 = ($429|0)>($446|0);
$448 = ($426>>>0)>($444>>>0);
$449 = ($429|0)==($446|0);
$450 = $449 & $448;
$451 = $447 | $450;
if ($451) {
$452 = (___errno_location()|0);
HEAP32[$452>>2] = 34;
$453 = (+($sign$0|0));
$454 = $453 * 1.7976931348623157E+308;
$455 = $454 * 1.7976931348623157E+308;
$$0$i27 = $455;
break;
}
$456 = (($emin$0$ph) + -106)|0;
$457 = ($456|0)<(0);
$458 = $457 << 31 >> 31;
$459 = ($429|0)<($458|0);
$460 = ($426>>>0)<($456>>>0);
$461 = ($429|0)==($458|0);
$462 = $461 & $460;
$463 = $459 | $462;
if ($463) {
$464 = (___errno_location()|0);
HEAP32[$464>>2] = 34;
$465 = (+($sign$0|0));
$466 = $465 * 2.2250738585072014E-308;
$467 = $466 * 2.2250738585072014E-308;
$$0$i27 = $467;
break;
}
$468 = ($j$067$i|0)==(0);
if ($468) {
$k$3$i = $k$063$i;
} else {
$469 = ($j$067$i|0)<(9);
if ($469) {
$470 = (($x$i) + ($k$063$i<<2)|0);
$$promoted$i = HEAP32[$470>>2]|0;
$472 = $$promoted$i;$j$394$i = $j$067$i;
while(1) {
$471 = ($472*10)|0;
$473 = (($j$394$i) + 1)|0;
$exitcond$i = ($473|0)==(9);
if ($exitcond$i) {
$$lcssa265 = $471;
break;
} else {
$472 = $471;$j$394$i = $473;
}
}
HEAP32[$470>>2] = $$lcssa265;
}
$474 = (($k$063$i) + 1)|0;
$k$3$i = $474;
}
$475 = ($lnz$057$i|0)<(9);
if ($475) {
$476 = ($lnz$057$i|0)<=($426|0);
$477 = ($426|0)<(18);
$or$cond3$i = $476 & $477;
if ($or$cond3$i) {
$478 = ($426|0)==(9);
if ($478) {
$479 = (+($sign$0|0));
$480 = HEAP32[$x$i>>2]|0;
$481 = (+($480>>>0));
$482 = $479 * $481;
$$0$i27 = $482;
break;
}
$483 = ($426|0)<(9);
if ($483) {
$484 = (+($sign$0|0));
$485 = HEAP32[$x$i>>2]|0;
$486 = (+($485>>>0));
$487 = $484 * $486;
$488 = (8 - ($426))|0;
$489 = (8912 + ($488<<2)|0);
$490 = HEAP32[$489>>2]|0;
$491 = (+($490|0));
$492 = $487 / $491;
$$0$i27 = $492;
break;
}
$$neg32$i = (($bits$0$ph) + 27)|0;
$493 = Math_imul($426, -3)|0;
$494 = (($$neg32$i) + ($493))|0;
$495 = ($494|0)>(30);
$$pre$i17 = HEAP32[$x$i>>2]|0;
$496 = $$pre$i17 >>> $494;
$497 = ($496|0)==(0);
$or$cond182$i = $495 | $497;
if ($or$cond182$i) {
$498 = (+($sign$0|0));
$499 = (+($$pre$i17>>>0));
$500 = $498 * $499;
$501 = (($426) + -10)|0;
$502 = (8912 + ($501<<2)|0);
$503 = HEAP32[$502>>2]|0;
$504 = (+($503|0));
$505 = $500 * $504;
$$0$i27 = $505;
break;
}
}
}
$506 = (($426|0) % 9)&-1;
$507 = ($506|0)==(0);
if ($507) {
$a$2$ph38$i = 0;$e2$0$ph$i = 0;$rp$2$ph36$i = $426;$z$1$ph37$i = $k$3$i;
} else {
$508 = ($426|0)>(-1);
$509 = (($506) + 9)|0;
$510 = $508 ? $506 : $509;
$511 = (8 - ($510))|0;
$512 = (8912 + ($511<<2)|0);
$513 = HEAP32[$512>>2]|0;
$514 = ($k$3$i|0)==(0);
if ($514) {
$a$0$lcssa151$i = 0;$rp$0$lcssa152$i = $426;$z$0$i = 0;
} else {
$515 = (1000000000 / ($513|0))&-1;
$a$085$i = 0;$carry$087$i = 0;$k$486$i = 0;$rp$084$i = $426;
while(1) {
$516 = (($x$i) + ($k$486$i<<2)|0);
$517 = HEAP32[$516>>2]|0;
$518 = (($517>>>0) % ($513>>>0))&-1;
$519 = (($517>>>0) / ($513>>>0))&-1;
$520 = (($519) + ($carry$087$i))|0;
HEAP32[$516>>2] = $520;
$521 = Math_imul($518, $515)|0;
$522 = ($k$486$i|0)==($a$085$i|0);
$523 = ($520|0)==(0);
$or$cond16$i = $522 & $523;
$524 = (($k$486$i) + 1)|0;
$525 = $524 & 127;
$526 = (($rp$084$i) + -9)|0;
$rp$1$i18 = $or$cond16$i ? $526 : $rp$084$i;
$a$1$i = $or$cond16$i ? $525 : $a$085$i;
$527 = ($524|0)==($k$3$i|0);
if ($527) {
$$lcssa264 = $521;$a$1$i$lcssa = $a$1$i;$rp$1$i18$lcssa = $rp$1$i18;
break;
} else {
$a$085$i = $a$1$i;$carry$087$i = $521;$k$486$i = $524;$rp$084$i = $rp$1$i18;
}
}
$528 = ($$lcssa264|0)==(0);
if ($528) {
$a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $k$3$i;
} else {
$529 = (($k$3$i) + 1)|0;
$530 = (($x$i) + ($k$3$i<<2)|0);
HEAP32[$530>>2] = $$lcssa264;
$a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $529;
}
}
$531 = (9 - ($510))|0;
$532 = (($531) + ($rp$0$lcssa152$i))|0;
$a$2$ph38$i = $a$0$lcssa151$i;$e2$0$ph$i = 0;$rp$2$ph36$i = $532;$z$1$ph37$i = $z$0$i;
}
L284: while(1) {
$533 = ($rp$2$ph36$i|0)<(18);
$534 = ($rp$2$ph36$i|0)==(18);
$535 = (($x$i) + ($a$2$ph38$i<<2)|0);
$e2$0$i19 = $e2$0$ph$i;$z$1$i = $z$1$ph37$i;
while(1) {
if (!($533)) {
if (!($534)) {
$a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = $rp$2$ph36$i;$z$5$ph$i = $z$1$i;
break L284;
}
$536 = HEAP32[$535>>2]|0;
$537 = ($536>>>0)<(9007199);
if (!($537)) {
$a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = 18;$z$5$ph$i = $z$1$i;
break L284;
}
}
$538 = (($z$1$i) + 127)|0;
$carry1$0$i = 0;$k$5$in$i = $538;$z$2$i = $z$1$i;
while(1) {
$k$5$i = $k$5$in$i & 127;
$539 = (($x$i) + ($k$5$i<<2)|0);
$540 = HEAP32[$539>>2]|0;
$541 = (_bitshift64Shl(($540|0),0,29)|0);
$542 = tempRet0;
$543 = (_i64Add(($541|0),($542|0),($carry1$0$i|0),0)|0);
$544 = tempRet0;
$545 = ($544>>>0)>(0);
$546 = ($543>>>0)>(1000000000);
$547 = ($544|0)==(0);
$548 = $547 & $546;
$549 = $545 | $548;
if ($549) {
$550 = (___udivdi3(($543|0),($544|0),1000000000,0)|0);
$551 = tempRet0;
$552 = (___uremdi3(($543|0),($544|0),1000000000,0)|0);
$553 = tempRet0;
$$sink$off0$i = $552;$carry1$1$i = $550;
} else {
$$sink$off0$i = $543;$carry1$1$i = 0;
}
HEAP32[$539>>2] = $$sink$off0$i;
$554 = (($z$2$i) + 127)|0;
$555 = $554 & 127;
$556 = ($k$5$i|0)!=($555|0);
$557 = ($k$5$i|0)==($a$2$ph38$i|0);
$or$cond17$i = $556 | $557;
$558 = ($$sink$off0$i|0)==(0);
$k$5$z$2$i = $558 ? $k$5$i : $z$2$i;
$z$3$i = $or$cond17$i ? $z$2$i : $k$5$z$2$i;
$559 = (($k$5$i) + -1)|0;
if ($557) {
$carry1$1$i$lcssa = $carry1$1$i;$z$3$i$lcssa = $z$3$i;
break;
} else {
$carry1$0$i = $carry1$1$i;$k$5$in$i = $559;$z$2$i = $z$3$i;
}
}
$560 = (($e2$0$i19) + -29)|0;
$561 = ($carry1$1$i$lcssa|0)==(0);
if ($561) {
$e2$0$i19 = $560;$z$1$i = $z$3$i$lcssa;
} else {
$$lcssa263 = $560;$carry1$1$i$lcssa$lcssa = $carry1$1$i$lcssa;$z$3$i$lcssa$lcssa = $z$3$i$lcssa;
break;
}
}
$562 = (($rp$2$ph36$i) + 9)|0;
$563 = (($a$2$ph38$i) + 127)|0;
$564 = $563 & 127;
$565 = ($564|0)==($z$3$i$lcssa$lcssa|0);
if ($565) {
$566 = (($z$3$i$lcssa$lcssa) + 127)|0;
$567 = $566 & 127;
$568 = (($x$i) + ($567<<2)|0);
$569 = HEAP32[$568>>2]|0;
$570 = (($z$3$i$lcssa$lcssa) + 126)|0;
$571 = $570 & 127;
$572 = (($x$i) + ($571<<2)|0);
$573 = HEAP32[$572>>2]|0;
$574 = $573 | $569;
HEAP32[$572>>2] = $574;
$z$4$i = $567;
} else {
$z$4$i = $z$3$i$lcssa$lcssa;
}
$575 = (($x$i) + ($564<<2)|0);
HEAP32[$575>>2] = $carry1$1$i$lcssa$lcssa;
$a$2$ph38$i = $564;$e2$0$ph$i = $$lcssa263;$rp$2$ph36$i = $562;$z$1$ph37$i = $z$4$i;
}
L302: while(1) {
$606 = (($z$5$ph$i) + 1)|0;
$603 = $606 & 127;
$607 = (($z$5$ph$i) + 127)|0;
$608 = $607 & 127;
$609 = (($x$i) + ($608<<2)|0);
$a$3$ph157$i = $a$3$ph$i;$e2$1$ph156$i = $e2$1$ph$i;$rp$3$ph$i = $rp$3$ph34$i;
while(1) {
$610 = ($rp$3$ph$i|0)==(18);
$611 = ($rp$3$ph$i|0)>(27);
$$18$i = $611 ? 9 : 1;
$$not$i = $610 ^ 1;
$a$3$i = $a$3$ph157$i;$e2$1$i = $e2$1$ph156$i;
while(1) {
$576 = $a$3$i & 127;
$577 = ($576|0)==($z$5$ph$i|0);
do {
if ($577) {
label = 219;
} else {
$578 = (($x$i) + ($576<<2)|0);
$579 = HEAP32[$578>>2]|0;
$580 = ($579>>>0)<(9007199);
if ($580) {
label = 219;
break;
}
$581 = ($579>>>0)>(9007199);
if ($581) {
break;
}
$582 = (($a$3$i) + 1)|0;
$583 = $582 & 127;
$584 = ($583|0)==($z$5$ph$i|0);
if ($584) {
label = 219;
break;
}
$690 = (($x$i) + ($583<<2)|0);
$691 = HEAP32[$690>>2]|0;
$692 = ($691>>>0)<(254740991);
if ($692) {
label = 219;
break;
}
$693 = ($691>>>0)>(254740991);
$brmerge$i28 = $693 | $$not$i;
if (!($brmerge$i28)) {
$617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i;
break L302;
}
}
} while(0);
if ((label|0) == 219) {
label = 0;
if ($610) {
label = 220;
break L302;
}
}
$585 = (($e2$1$i) + ($$18$i))|0;
$586 = ($a$3$i|0)==($z$5$ph$i|0);
if ($586) {
$a$3$i = $z$5$ph$i;$e2$1$i = $585;
} else {
$$lcssa256 = $585;$a$3$i$lcssa248 = $a$3$i;
break;
}
}
$587 = 1 << $$18$i;
$588 = (($587) + -1)|0;
$589 = 1000000000 >>> $$18$i;
$a$478$i = $a$3$i$lcssa248;$carry3$081$i = 0;$k$679$i = $a$3$i$lcssa248;$rp$477$i = $rp$3$ph$i;
while(1) {
$590 = (($x$i) + ($k$679$i<<2)|0);
$591 = HEAP32[$590>>2]|0;
$592 = $591 & $588;
$593 = $591 >>> $$18$i;
$594 = (($593) + ($carry3$081$i))|0;
HEAP32[$590>>2] = $594;
$595 = Math_imul($592, $589)|0;
$596 = ($k$679$i|0)==($a$478$i|0);
$597 = ($594|0)==(0);
$or$cond19$i = $596 & $597;
$598 = (($k$679$i) + 1)|0;
$599 = $598 & 127;
$600 = (($rp$477$i) + -9)|0;
$rp$5$i = $or$cond19$i ? $600 : $rp$477$i;
$a$5$i = $or$cond19$i ? $599 : $a$478$i;
$601 = ($599|0)==($z$5$ph$i|0);
if ($601) {
$$lcssa257 = $595;$a$5$i$lcssa = $a$5$i;$rp$5$i$lcssa = $rp$5$i;
break;
} else {
$a$478$i = $a$5$i;$carry3$081$i = $595;$k$679$i = $599;$rp$477$i = $rp$5$i;
}
}
$602 = ($$lcssa257|0)==(0);
if ($602) {
$a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa;
continue;
}
$604 = ($603|0)==($a$5$i$lcssa|0);
if (!($604)) {
$$lcssa256$lcssa = $$lcssa256;$$lcssa257$lcssa = $$lcssa257;$a$5$i$lcssa$lcssa = $a$5$i$lcssa;$rp$5$i$lcssa$lcssa = $rp$5$i$lcssa;
break;
}
$612 = HEAP32[$609>>2]|0;
$613 = $612 | 1;
HEAP32[$609>>2] = $613;
$a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa;
}
$605 = (($x$i) + ($z$5$ph$i<<2)|0);
HEAP32[$605>>2] = $$lcssa257$lcssa;
$a$3$ph$i = $a$5$i$lcssa$lcssa;$e2$1$ph$i = $$lcssa256$lcssa;$rp$3$ph34$i = $rp$5$i$lcssa$lcssa;$z$5$ph$i = $603;
}
if ((label|0) == 220) {
if ($577) {
$614 = (($603) + -1)|0;
$615 = (($x$i) + ($614<<2)|0);
HEAP32[$615>>2] = 0;
$617 = $z$5$ph$i;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $603;
} else {
$617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i;
}
}
$616 = (($x$i) + ($617<<2)|0);
$618 = HEAP32[$616>>2]|0;
$619 = (+($618>>>0));
$620 = (($a$3$i249) + 1)|0;
$621 = $620 & 127;
$622 = ($621|0)==($z$7$i|0);
if ($622) {
$679 = (($a$3$i249) + 2)|0;
$680 = $679 & 127;
$681 = (($680) + -1)|0;
$682 = (($x$i) + ($681<<2)|0);
HEAP32[$682>>2] = 0;
$z$7$1$i = $680;
} else {
$z$7$1$i = $z$7$i;
}
$683 = $619 * 1.0E+9;
$684 = (($x$i) + ($621<<2)|0);
$685 = HEAP32[$684>>2]|0;
$686 = (+($685>>>0));
$687 = $683 + $686;
$643 = (+($sign$0|0));
$625 = $643 * $687;
$663 = (($e2$1$i246) + 53)|0;
$669 = (($663) - ($emin$0$ph))|0;
$670 = ($669|0)<($bits$0$ph|0);
$688 = ($669|0)<(0);
$$$i = $688 ? 0 : $669;
$denormal$0$i = $670&1;
$$010$i = $670 ? $$$i : $bits$0$ph;
$689 = ($$010$i|0)<(53);
if ($689) {
$623 = (105 - ($$010$i))|0;
$624 = (+_scalbn(1.0,$623));
$626 = (+_copysignl($624,$625));
$627 = (53 - ($$010$i))|0;
$628 = (+_scalbn(1.0,$627));
$629 = (+_fmodl($625,$628));
$630 = $625 - $629;
$631 = $626 + $630;
$bias$0$i25 = $626;$frac$0$i = $629;$y$1$i24 = $631;
} else {
$bias$0$i25 = 0.0;$frac$0$i = 0.0;$y$1$i24 = $625;
}
$632 = (($a$3$i249) + 2)|0;
$633 = $632 & 127;
$634 = ($633|0)==($z$7$1$i|0);
do {
if ($634) {
$frac$2$i = $frac$0$i;
} else {
$635 = (($x$i) + ($633<<2)|0);
$636 = HEAP32[$635>>2]|0;
$637 = ($636>>>0)<(500000000);
do {
if ($637) {
$638 = ($636|0)==(0);
if ($638) {
$639 = (($a$3$i249) + 3)|0;
$640 = $639 & 127;
$641 = ($640|0)==($z$7$1$i|0);
if ($641) {
$frac$1$i = $frac$0$i;
break;
}
}
$642 = $643 * 0.25;
$644 = $642 + $frac$0$i;
$frac$1$i = $644;
} else {
$645 = ($636>>>0)>(500000000);
if ($645) {
$646 = $643 * 0.75;
$647 = $646 + $frac$0$i;
$frac$1$i = $647;
break;
}
$648 = (($a$3$i249) + 3)|0;
$649 = $648 & 127;
$650 = ($649|0)==($z$7$1$i|0);
if ($650) {
$651 = $643 * 0.5;
$652 = $651 + $frac$0$i;
$frac$1$i = $652;
break;
} else {
$653 = $643 * 0.75;
$654 = $653 + $frac$0$i;
$frac$1$i = $654;
break;
}
}
} while(0);
$655 = (53 - ($$010$i))|0;
$656 = ($655|0)>(1);
if (!($656)) {
$frac$2$i = $frac$1$i;
break;
}
$657 = (+_fmodl($frac$1$i,1.0));
$658 = $657 != 0.0;
if ($658) {
$frac$2$i = $frac$1$i;
break;
}
$659 = $frac$1$i + 1.0;
$frac$2$i = $659;
}
} while(0);
$660 = $y$1$i24 + $frac$2$i;
$661 = $660 - $bias$0$i25;
$662 = $663 & 2147483647;
$664 = (-2 - ($sum$i))|0;
$665 = ($662|0)>($664|0);
do {
if ($665) {
$666 = (+Math_abs((+$661)));
$667 = !($666 >= 9007199254740992.0);
if ($667) {
$denormal$2$i = $denormal$0$i;$e2$2$i = $e2$1$i246;$y$2$i26 = $661;
} else {
$668 = ($$010$i|0)==($669|0);
$or$cond20$i = $670 & $668;
$denormal$1$i = $or$cond20$i ? 0 : $denormal$0$i;
$671 = $661 * 0.5;
$672 = (($e2$1$i246) + 1)|0;
$denormal$2$i = $denormal$1$i;$e2$2$i = $672;$y$2$i26 = $671;
}
$673 = (($e2$2$i) + 50)|0;
$674 = ($673|0)>($330|0);
if (!($674)) {
$675 = ($denormal$2$i|0)!=(0);
$676 = $frac$2$i != 0.0;
$or$cond8$i = $676 & $675;
if (!($or$cond8$i)) {
$e2$3$i = $e2$2$i;$y$3$i = $y$2$i26;
break;
}
}
$677 = (___errno_location()|0);
HEAP32[$677>>2] = 34;
$e2$3$i = $e2$2$i;$y$3$i = $y$2$i26;
} else {
$e2$3$i = $e2$1$i246;$y$3$i = $661;
}
} while(0);
$678 = (+_scalbnl($y$3$i,$e2$3$i));
$$0$i27 = $678;
}
} while(0);
$$0 = $$0$i27;
break L4;
break;
}
default: {
$109 = HEAP32[$1>>2]|0;
$110 = ($109|0)==(0|0);
if (!($110)) {
$111 = HEAP32[$0>>2]|0;
$112 = ((($111)) + -1|0);
HEAP32[$0>>2] = $112;
}
$113 = (___errno_location()|0);
HEAP32[$113>>2] = 22;
___shlim($f,0);
$$0 = 0.0;
break L4;
}
}
}
}
} while(0);
if ((label|0) == 23) {
$41 = HEAP32[$1>>2]|0;
$42 = ($41|0)==(0|0);
if (!($42)) {
$43 = HEAP32[$0>>2]|0;
$44 = ((($43)) + -1|0);
HEAP32[$0>>2] = $44;
}
$45 = ($pok|0)!=(0);
$46 = ($i$0$lcssa>>>0)>(3);
$or$cond9 = $45 & $46;
if ($or$cond9) {
$i$1 = $i$0$lcssa;
while(1) {
if (!($42)) {
$47 = HEAP32[$0>>2]|0;
$48 = ((($47)) + -1|0);
HEAP32[$0>>2] = $48;
}
$49 = (($i$1) + -1)|0;
$$old8 = ($49>>>0)>(3);
if ($$old8) {
$i$1 = $49;
} else {
break;
}
}
}
}
$50 = (+($sign$0|0));
$51 = $50 * inf;
$52 = $51;
$$0 = $52;
}
} while(0);
STACKTOP = sp;return (+$$0);
}
function ___intscan($f,$base,$pok,$0,$1) {
$f = $f|0;
$base = $base|0;
$pok = $pok|0;
$0 = $0|0;
$1 = $1|0;
var $$1 = 0, $$122 = 0, $$123 = 0, $$base21 = 0, $$lcssa = 0, $$lcssa130 = 0, $$lcssa131 = 0, $$lcssa132 = 0, $$lcssa133 = 0, $$lcssa134 = 0, $$lcssa135 = 0, $$sum = 0, $$sum14 = 0, $$sum1445 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0, $$sum1865 = 0, $$sum19 = 0;
var $$sum20 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $3 = 0, $30 = 0;
var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0;
var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c$0 = 0, $c$1 = 0, $c$124 = 0, $c$2$be = 0, $c$2$be$lcssa = 0;
var $c$2$lcssa = 0, $c$3$be = 0, $c$3$lcssa = 0, $c$371 = 0, $c$4$be = 0, $c$4$be$lcssa = 0, $c$4$lcssa = 0, $c$5$be = 0, $c$6$be = 0, $c$6$be$lcssa = 0, $c$6$lcssa = 0, $c$7$be = 0, $c$753 = 0, $c$8 = 0, $c$9$be = 0, $neg$0 = 0, $neg$0$ = 0, $neg$1 = 0, $or$cond = 0, $or$cond12 = 0;
var $or$cond40 = 0, $or$cond5 = 0, $or$cond7 = 0, $x$082 = 0, $x$146 = 0, $x$266 = 0, label = 0, sp = 0;
sp = STACKTOP;
$2 = ($base>>>0)>(36);
L1: do {
if ($2) {
$5 = (___errno_location()|0);
HEAP32[$5>>2] = 22;
$286 = 0;$287 = 0;
} else {
$3 = ((($f)) + 4|0);
$4 = ((($f)) + 100|0);
while(1) {
$6 = HEAP32[$3>>2]|0;
$7 = HEAP32[$4>>2]|0;
$8 = ($6>>>0)<($7>>>0);
if ($8) {
$9 = ((($6)) + 1|0);
HEAP32[$3>>2] = $9;
$10 = HEAP8[$6>>0]|0;
$11 = $10&255;
$13 = $11;
} else {
$12 = (___shgetc($f)|0);
$13 = $12;
}
$14 = (_isspace($13)|0);
$15 = ($14|0)==(0);
if ($15) {
$$lcssa135 = $13;
break;
}
}
$16 = ($$lcssa135|0)==(45);
L11: do {
switch ($$lcssa135|0) {
case 43: case 45: {
$17 = $16 << 31 >> 31;
$18 = HEAP32[$3>>2]|0;
$19 = HEAP32[$4>>2]|0;
$20 = ($18>>>0)<($19>>>0);
if ($20) {
$21 = ((($18)) + 1|0);
HEAP32[$3>>2] = $21;
$22 = HEAP8[$18>>0]|0;
$23 = $22&255;
$c$0 = $23;$neg$0 = $17;
break L11;
} else {
$24 = (___shgetc($f)|0);
$c$0 = $24;$neg$0 = $17;
break L11;
}
break;
}
default: {
$c$0 = $$lcssa135;$neg$0 = 0;
}
}
} while(0);
$25 = ($base|0)==(0);
$26 = $base & -17;
$27 = ($26|0)==(0);
$28 = ($c$0|0)==(48);
$or$cond5 = $27 & $28;
do {
if ($or$cond5) {
$29 = HEAP32[$3>>2]|0;
$30 = HEAP32[$4>>2]|0;
$31 = ($29>>>0)<($30>>>0);
if ($31) {
$32 = ((($29)) + 1|0);
HEAP32[$3>>2] = $32;
$33 = HEAP8[$29>>0]|0;
$34 = $33&255;
$37 = $34;
} else {
$35 = (___shgetc($f)|0);
$37 = $35;
}
$36 = $37 | 32;
$38 = ($36|0)==(120);
if (!($38)) {
if ($25) {
$$123 = 8;$c$124 = $37;
label = 46;
break;
} else {
$$1 = $base;$c$1 = $37;
label = 32;
break;
}
}
$39 = HEAP32[$3>>2]|0;
$40 = HEAP32[$4>>2]|0;
$41 = ($39>>>0)<($40>>>0);
if ($41) {
$42 = ((($39)) + 1|0);
HEAP32[$3>>2] = $42;
$43 = HEAP8[$39>>0]|0;
$44 = $43&255;
$46 = $44;
} else {
$45 = (___shgetc($f)|0);
$46 = $45;
}
$$sum20 = (($46) + 1)|0;
$47 = (28687 + ($$sum20)|0);
$48 = HEAP8[$47>>0]|0;
$49 = ($48&255)>(15);
if ($49) {
$50 = HEAP32[$4>>2]|0;
$51 = ($50|0)==(0|0);
if (!($51)) {
$52 = HEAP32[$3>>2]|0;
$53 = ((($52)) + -1|0);
HEAP32[$3>>2] = $53;
}
$54 = ($pok|0)==(0);
if ($54) {
___shlim($f,0);
$286 = 0;$287 = 0;
break L1;
}
if ($51) {
$286 = 0;$287 = 0;
break L1;
}
$55 = HEAP32[$3>>2]|0;
$56 = ((($55)) + -1|0);
HEAP32[$3>>2] = $56;
$286 = 0;$287 = 0;
break L1;
} else {
$$123 = 16;$c$124 = $46;
label = 46;
}
} else {
$$base21 = $25 ? 10 : $base;
$$sum = (($c$0) + 1)|0;
$57 = (28687 + ($$sum)|0);
$58 = HEAP8[$57>>0]|0;
$59 = $58&255;
$60 = ($59>>>0)<($$base21>>>0);
if ($60) {
$$1 = $$base21;$c$1 = $c$0;
label = 32;
} else {
$61 = HEAP32[$4>>2]|0;
$62 = ($61|0)==(0|0);
if (!($62)) {
$63 = HEAP32[$3>>2]|0;
$64 = ((($63)) + -1|0);
HEAP32[$3>>2] = $64;
}
___shlim($f,0);
$65 = (___errno_location()|0);
HEAP32[$65>>2] = 22;
$286 = 0;$287 = 0;
break L1;
}
}
} while(0);
if ((label|0) == 32) {
$66 = ($$1|0)==(10);
if ($66) {
$67 = (($c$1) + -48)|0;
$68 = ($67>>>0)<(10);
if ($68) {
$71 = $67;$x$082 = 0;
while(1) {
$69 = ($x$082*10)|0;
$70 = (($69) + ($71))|0;
$72 = HEAP32[$3>>2]|0;
$73 = HEAP32[$4>>2]|0;
$74 = ($72>>>0)<($73>>>0);
if ($74) {
$75 = ((($72)) + 1|0);
HEAP32[$3>>2] = $75;
$76 = HEAP8[$72>>0]|0;
$77 = $76&255;
$c$2$be = $77;
} else {
$78 = (___shgetc($f)|0);
$c$2$be = $78;
}
$79 = (($c$2$be) + -48)|0;
$80 = ($79>>>0)<(10);
$81 = ($70>>>0)<(429496729);
$82 = $80 & $81;
if ($82) {
$71 = $79;$x$082 = $70;
} else {
$$lcssa134 = $70;$c$2$be$lcssa = $c$2$be;
break;
}
}
$288 = $$lcssa134;$289 = 0;$c$2$lcssa = $c$2$be$lcssa;
} else {
$288 = 0;$289 = 0;$c$2$lcssa = $c$1;
}
$83 = (($c$2$lcssa) + -48)|0;
$84 = ($83>>>0)<(10);
if ($84) {
$85 = $288;$86 = $289;$89 = $83;$c$371 = $c$2$lcssa;
while(1) {
$87 = (___muldi3(($85|0),($86|0),10,0)|0);
$88 = tempRet0;
$90 = ($89|0)<(0);
$91 = $90 << 31 >> 31;
$92 = $89 ^ -1;
$93 = $91 ^ -1;
$94 = ($88>>>0)>($93>>>0);
$95 = ($87>>>0)>($92>>>0);
$96 = ($88|0)==($93|0);
$97 = $96 & $95;
$98 = $94 | $97;
if ($98) {
$$lcssa = $89;$290 = $85;$291 = $86;$c$3$lcssa = $c$371;
break;
}
$99 = (_i64Add(($87|0),($88|0),($89|0),($91|0))|0);
$100 = tempRet0;
$101 = HEAP32[$3>>2]|0;
$102 = HEAP32[$4>>2]|0;
$103 = ($101>>>0)<($102>>>0);
if ($103) {
$104 = ((($101)) + 1|0);
HEAP32[$3>>2] = $104;
$105 = HEAP8[$101>>0]|0;
$106 = $105&255;
$c$3$be = $106;
} else {
$107 = (___shgetc($f)|0);
$c$3$be = $107;
}
$108 = (($c$3$be) + -48)|0;
$109 = ($108>>>0)<(10);
$110 = ($100>>>0)<(429496729);
$111 = ($99>>>0)<(2576980378);
$112 = ($100|0)==(429496729);
$113 = $112 & $111;
$114 = $110 | $113;
$or$cond7 = $109 & $114;
if ($or$cond7) {
$85 = $99;$86 = $100;$89 = $108;$c$371 = $c$3$be;
} else {
$$lcssa = $108;$290 = $99;$291 = $100;$c$3$lcssa = $c$3$be;
break;
}
}
$115 = ($$lcssa>>>0)>(9);
if ($115) {
$259 = $291;$261 = $290;$neg$1 = $neg$0;
} else {
$$122 = 10;$292 = $290;$293 = $291;$c$8 = $c$3$lcssa;
label = 72;
}
} else {
$259 = $289;$261 = $288;$neg$1 = $neg$0;
}
} else {
$$123 = $$1;$c$124 = $c$1;
label = 46;
}
}
L63: do {
if ((label|0) == 46) {
$116 = (($$123) + -1)|0;
$117 = $116 & $$123;
$118 = ($117|0)==(0);
if ($118) {
$123 = ($$123*23)|0;
$124 = $123 >>> 5;
$125 = $124 & 7;
$126 = (28944 + ($125)|0);
$127 = HEAP8[$126>>0]|0;
$128 = $127 << 24 >> 24;
$$sum1445 = (($c$124) + 1)|0;
$129 = (28687 + ($$sum1445)|0);
$130 = HEAP8[$129>>0]|0;
$131 = $130&255;
$132 = ($131>>>0)<($$123>>>0);
if ($132) {
$135 = $131;$x$146 = 0;
while(1) {
$133 = $x$146 << $128;
$134 = $135 | $133;
$136 = HEAP32[$3>>2]|0;
$137 = HEAP32[$4>>2]|0;
$138 = ($136>>>0)<($137>>>0);
if ($138) {
$139 = ((($136)) + 1|0);
HEAP32[$3>>2] = $139;
$140 = HEAP8[$136>>0]|0;
$141 = $140&255;
$c$4$be = $141;
} else {
$142 = (___shgetc($f)|0);
$c$4$be = $142;
}
$$sum14 = (($c$4$be) + 1)|0;
$143 = (28687 + ($$sum14)|0);
$144 = HEAP8[$143>>0]|0;
$145 = $144&255;
$146 = ($145>>>0)<($$123>>>0);
$147 = ($134>>>0)<(134217728);
$148 = $147 & $146;
if ($148) {
$135 = $145;$x$146 = $134;
} else {
$$lcssa130 = $134;$$lcssa131 = $144;$c$4$be$lcssa = $c$4$be;
break;
}
}
$152 = $$lcssa131;$154 = 0;$156 = $$lcssa130;$c$4$lcssa = $c$4$be$lcssa;
} else {
$152 = $130;$154 = 0;$156 = 0;$c$4$lcssa = $c$124;
}
$149 = (_bitshift64Lshr(-1,-1,($128|0))|0);
$150 = tempRet0;
$151 = $152&255;
$153 = ($151>>>0)>=($$123>>>0);
$155 = ($154>>>0)>($150>>>0);
$157 = ($156>>>0)>($149>>>0);
$158 = ($154|0)==($150|0);
$159 = $158 & $157;
$160 = $155 | $159;
$or$cond40 = $153 | $160;
if ($or$cond40) {
$$122 = $$123;$292 = $156;$293 = $154;$c$8 = $c$4$lcssa;
label = 72;
break;
} else {
$161 = $156;$162 = $154;$166 = $152;
}
while(1) {
$163 = (_bitshift64Shl(($161|0),($162|0),($128|0))|0);
$164 = tempRet0;
$165 = $166&255;
$167 = $165 | $163;
$168 = HEAP32[$3>>2]|0;
$169 = HEAP32[$4>>2]|0;
$170 = ($168>>>0)<($169>>>0);
if ($170) {
$171 = ((($168)) + 1|0);
HEAP32[$3>>2] = $171;
$172 = HEAP8[$168>>0]|0;
$173 = $172&255;
$c$5$be = $173;
} else {
$174 = (___shgetc($f)|0);
$c$5$be = $174;
}
$$sum15 = (($c$5$be) + 1)|0;
$175 = (28687 + ($$sum15)|0);
$176 = HEAP8[$175>>0]|0;
$177 = $176&255;
$178 = ($177>>>0)>=($$123>>>0);
$179 = ($164>>>0)>($150>>>0);
$180 = ($167>>>0)>($149>>>0);
$181 = ($164|0)==($150|0);
$182 = $181 & $180;
$183 = $179 | $182;
$or$cond = $178 | $183;
if ($or$cond) {
$$122 = $$123;$292 = $167;$293 = $164;$c$8 = $c$5$be;
label = 72;
break L63;
} else {
$161 = $167;$162 = $164;$166 = $176;
}
}
}
$$sum1865 = (($c$124) + 1)|0;
$119 = (28687 + ($$sum1865)|0);
$120 = HEAP8[$119>>0]|0;
$121 = $120&255;
$122 = ($121>>>0)<($$123>>>0);
if ($122) {
$186 = $121;$x$266 = 0;
while(1) {
$184 = Math_imul($x$266, $$123)|0;
$185 = (($186) + ($184))|0;
$187 = HEAP32[$3>>2]|0;
$188 = HEAP32[$4>>2]|0;
$189 = ($187>>>0)<($188>>>0);
if ($189) {
$190 = ((($187)) + 1|0);
HEAP32[$3>>2] = $190;
$191 = HEAP8[$187>>0]|0;
$192 = $191&255;
$c$6$be = $192;
} else {
$193 = (___shgetc($f)|0);
$c$6$be = $193;
}
$$sum18 = (($c$6$be) + 1)|0;
$194 = (28687 + ($$sum18)|0);
$195 = HEAP8[$194>>0]|0;
$196 = $195&255;
$197 = ($196>>>0)<($$123>>>0);
$198 = ($185>>>0)<(119304647);
$199 = $198 & $197;
if ($199) {
$186 = $196;$x$266 = $185;
} else {
$$lcssa132 = $185;$$lcssa133 = $195;$c$6$be$lcssa = $c$6$be;
break;
}
}
$201 = $$lcssa133;$294 = $$lcssa132;$295 = 0;$c$6$lcssa = $c$6$be$lcssa;
} else {
$201 = $120;$294 = 0;$295 = 0;$c$6$lcssa = $c$124;
}
$200 = $201&255;
$202 = ($200>>>0)<($$123>>>0);
if ($202) {
$203 = (___udivdi3(-1,-1,($$123|0),0)|0);
$204 = tempRet0;
$205 = $295;$207 = $294;$215 = $201;$c$753 = $c$6$lcssa;
while(1) {
$206 = ($205>>>0)>($204>>>0);
$208 = ($207>>>0)>($203>>>0);
$209 = ($205|0)==($204|0);
$210 = $209 & $208;
$211 = $206 | $210;
if ($211) {
$$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753;
label = 72;
break L63;
}
$212 = (___muldi3(($207|0),($205|0),($$123|0),0)|0);
$213 = tempRet0;
$214 = $215&255;
$216 = $214 ^ -1;
$217 = ($213>>>0)>(4294967295);
$218 = ($212>>>0)>($216>>>0);
$219 = ($213|0)==(-1);
$220 = $219 & $218;
$221 = $217 | $220;
if ($221) {
$$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753;
label = 72;
break L63;
}
$222 = (_i64Add(($214|0),0,($212|0),($213|0))|0);
$223 = tempRet0;
$224 = HEAP32[$3>>2]|0;
$225 = HEAP32[$4>>2]|0;
$226 = ($224>>>0)<($225>>>0);
if ($226) {
$227 = ((($224)) + 1|0);
HEAP32[$3>>2] = $227;
$228 = HEAP8[$224>>0]|0;
$229 = $228&255;
$c$7$be = $229;
} else {
$230 = (___shgetc($f)|0);
$c$7$be = $230;
}
$$sum19 = (($c$7$be) + 1)|0;
$231 = (28687 + ($$sum19)|0);
$232 = HEAP8[$231>>0]|0;
$233 = $232&255;
$234 = ($233>>>0)<($$123>>>0);
if ($234) {
$205 = $223;$207 = $222;$215 = $232;$c$753 = $c$7$be;
} else {
$$122 = $$123;$292 = $222;$293 = $223;$c$8 = $c$7$be;
label = 72;
break;
}
}
} else {
$$122 = $$123;$292 = $294;$293 = $295;$c$8 = $c$6$lcssa;
label = 72;
}
}
} while(0);
if ((label|0) == 72) {
$$sum16 = (($c$8) + 1)|0;
$235 = (28687 + ($$sum16)|0);
$236 = HEAP8[$235>>0]|0;
$237 = $236&255;
$238 = ($237>>>0)<($$122>>>0);
if ($238) {
while(1) {
$239 = HEAP32[$3>>2]|0;
$240 = HEAP32[$4>>2]|0;
$241 = ($239>>>0)<($240>>>0);
if ($241) {
$242 = ((($239)) + 1|0);
HEAP32[$3>>2] = $242;
$243 = HEAP8[$239>>0]|0;
$244 = $243&255;
$c$9$be = $244;
} else {
$245 = (___shgetc($f)|0);
$c$9$be = $245;
}
$$sum17 = (($c$9$be) + 1)|0;
$246 = (28687 + ($$sum17)|0);
$247 = HEAP8[$246>>0]|0;
$248 = $247&255;
$249 = ($248>>>0)<($$122>>>0);
if (!($249)) {
break;
}
}
$250 = (___errno_location()|0);
HEAP32[$250>>2] = 34;
$251 = $0 & 1;
$252 = ($251|0)==(0);
$253 = (0)==(0);
$254 = $252 & $253;
$neg$0$ = $254 ? $neg$0 : 0;
$259 = $1;$261 = $0;$neg$1 = $neg$0$;
} else {
$259 = $293;$261 = $292;$neg$1 = $neg$0;
}
}
$255 = HEAP32[$4>>2]|0;
$256 = ($255|0)==(0|0);
if (!($256)) {
$257 = HEAP32[$3>>2]|0;
$258 = ((($257)) + -1|0);
HEAP32[$3>>2] = $258;
}
$260 = ($259>>>0)<($1>>>0);
$262 = ($261>>>0)<($0>>>0);
$263 = ($259|0)==($1|0);
$264 = $263 & $262;
$265 = $260 | $264;
if (!($265)) {
$266 = $0 & 1;
$267 = ($266|0)!=(0);
$268 = (0)!=(0);
$269 = $267 | $268;
$270 = ($neg$1|0)!=(0);
$or$cond12 = $269 | $270;
if (!($or$cond12)) {
$271 = (___errno_location()|0);
HEAP32[$271>>2] = 34;
$272 = (_i64Add(($0|0),($1|0),-1,-1)|0);
$273 = tempRet0;
$286 = $273;$287 = $272;
break;
}
$274 = ($259>>>0)>($1>>>0);
$275 = ($261>>>0)>($0>>>0);
$276 = ($259|0)==($1|0);
$277 = $276 & $275;
$278 = $274 | $277;
if ($278) {
$279 = (___errno_location()|0);
HEAP32[$279>>2] = 34;
$286 = $1;$287 = $0;
break;
}
}
$280 = ($neg$1|0)<(0);
$281 = $280 << 31 >> 31;
$282 = $261 ^ $neg$1;
$283 = $259 ^ $281;
$284 = (_i64Subtract(($282|0),($283|0),($neg$1|0),($281|0))|0);
$285 = tempRet0;
$286 = $285;$287 = $284;
}
} while(0);
tempRet0 = ($286);
return ($287|0);
}
function ___shlim($f,$lim) {
$f = $f|0;
$lim = $lim|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 104|0);
HEAP32[$0>>2] = $lim;
$1 = ((($f)) + 8|0);
$2 = HEAP32[$1>>2]|0;
$3 = ((($f)) + 4|0);
$4 = HEAP32[$3>>2]|0;
$5 = $2;
$6 = $4;
$7 = (($5) - ($6))|0;
$8 = ((($f)) + 108|0);
HEAP32[$8>>2] = $7;
$9 = ($lim|0)!=(0);
$10 = ($7|0)>($lim|0);
$or$cond = $9 & $10;
if ($or$cond) {
$11 = (($4) + ($lim)|0);
$12 = ((($f)) + 100|0);
HEAP32[$12>>2] = $11;
} else {
$13 = ((($f)) + 100|0);
HEAP32[$13>>2] = $5;
}
return;
}
function ___shgetc($f) {
$f = $f|0;
var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert3 = 0, $$pre = 0, $$pre4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
var $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 104|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
label = 3;
} else {
$3 = ((($f)) + 108|0);
$4 = HEAP32[$3>>2]|0;
$5 = ($4|0)<($1|0);
if ($5) {
label = 3;
} else {
label = 4;
}
}
if ((label|0) == 3) {
$6 = (___uflow($f)|0);
$7 = ($6|0)<(0);
if ($7) {
label = 4;
} else {
$9 = HEAP32[$0>>2]|0;
$10 = ($9|0)==(0);
$$phi$trans$insert = ((($f)) + 8|0);
if ($10) {
$$pre = HEAP32[$$phi$trans$insert>>2]|0;
$11 = $$pre;
$26 = $$pre;$41 = $11;
label = 9;
} else {
$12 = HEAP32[$$phi$trans$insert>>2]|0;
$13 = ((($f)) + 4|0);
$14 = HEAP32[$13>>2]|0;
$15 = $12;
$16 = $14;
$17 = (($15) - ($16))|0;
$18 = ((($f)) + 108|0);
$19 = HEAP32[$18>>2]|0;
$20 = (($9) - ($19))|0;
$21 = (($20) + -1)|0;
$22 = ($17|0)>($21|0);
if ($22) {
$23 = (($14) + ($21)|0);
$24 = ((($f)) + 100|0);
HEAP32[$24>>2] = $23;
$27 = $12;
} else {
$26 = $15;$41 = $12;
label = 9;
}
}
if ((label|0) == 9) {
$25 = ((($f)) + 100|0);
HEAP32[$25>>2] = $26;
$27 = $41;
}
$28 = ($27|0)==(0|0);
$$phi$trans$insert3 = ((($f)) + 4|0);
$$pre4 = HEAP32[$$phi$trans$insert3>>2]|0;
if (!($28)) {
$29 = $27;
$30 = $$pre4;
$31 = ((($f)) + 108|0);
$32 = HEAP32[$31>>2]|0;
$33 = (($29) + 1)|0;
$34 = (($33) - ($30))|0;
$35 = (($34) + ($32))|0;
HEAP32[$31>>2] = $35;
}
$36 = ((($$pre4)) + -1|0);
$37 = HEAP8[$36>>0]|0;
$38 = $37&255;
$39 = ($38|0)==($6|0);
if ($39) {
$$0 = $6;
} else {
$40 = $6&255;
HEAP8[$36>>0] = $40;
$$0 = $6;
}
}
}
if ((label|0) == 4) {
$8 = ((($f)) + 100|0);
HEAP32[$8>>2] = 0;
$$0 = -1;
}
return ($$0|0);
}
function ___syscall_ret($r) {
$r = $r|0;
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($r>>>0)>(4294963200);
if ($0) {
$1 = (0 - ($r))|0;
$2 = (___errno_location()|0);
HEAP32[$2>>2] = $1;
$$0 = -1;
} else {
$$0 = $r;
}
return ($$0|0);
}
function _copysign($x,$y) {
$x = +$x;
$y = +$y;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0;
$1 = HEAP32[tempDoublePtr+4>>2]|0;
HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0;
$3 = HEAP32[tempDoublePtr+4>>2]|0;
$4 = $1 & 2147483647;
$5 = $3 & -2147483648;
$6 = $5 | $4;
HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $6;$7 = +HEAPF64[tempDoublePtr>>3];
return (+$7);
}
function _copysignl($x,$y) {
$x = +$x;
$y = +$y;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+_copysign($x,$y));
return (+$0);
}
function _fmod($x,$y) {
$x = +$x;
$y = +$y;
var $$0 = 0.0, $$lcssa7 = 0, $$x = 0.0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
var $15 = 0, $150 = 0.0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0;
var $ex$0$lcssa = 0, $ex$026 = 0, $ex$1 = 0, $ex$2$lcssa = 0, $ex$212 = 0, $ex$3$lcssa = 0, $ex$39 = 0, $ey$0$lcssa = 0, $ey$020 = 0, $ey$1$ph = 0, $or$cond = 0, label = 0, sp = 0;
sp = STACKTOP;
HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0;
$1 = HEAP32[tempDoublePtr+4>>2]|0;
HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0;
$3 = HEAP32[tempDoublePtr+4>>2]|0;
$4 = (_bitshift64Lshr(($0|0),($1|0),52)|0);
$5 = tempRet0;
$6 = $4 & 2047;
$7 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
$8 = tempRet0;
$9 = $7 & 2047;
$10 = $1 & -2147483648;
$11 = (_bitshift64Shl(($2|0),($3|0),1)|0);
$12 = tempRet0;
$13 = ($11|0)==(0);
$14 = ($12|0)==(0);
$15 = $13 & $14;
L1: do {
if ($15) {
label = 3;
} else {
$16 = $3 & 2147483647;
$17 = ($16>>>0)>(2146435072);
$18 = ($2>>>0)>(0);
$19 = ($16|0)==(2146435072);
$20 = $19 & $18;
$21 = $17 | $20;
$22 = ($6|0)==(2047);
$or$cond = $21 | $22;
if ($or$cond) {
label = 3;
} else {
$25 = (_bitshift64Shl(($0|0),($1|0),1)|0);
$26 = tempRet0;
$27 = ($26>>>0)>($12>>>0);
$28 = ($25>>>0)>($11>>>0);
$29 = ($26|0)==($12|0);
$30 = $29 & $28;
$31 = $27 | $30;
if (!($31)) {
$32 = ($25|0)==($11|0);
$33 = ($26|0)==($12|0);
$34 = $32 & $33;
$35 = $x * 0.0;
$$x = $34 ? $35 : $x;
return (+$$x);
}
$36 = ($6|0)==(0);
if ($36) {
$37 = (_bitshift64Shl(($0|0),($1|0),12)|0);
$38 = tempRet0;
$39 = ($38|0)>(-1);
$40 = ($37>>>0)>(4294967295);
$41 = ($38|0)==(-1);
$42 = $41 & $40;
$43 = $39 | $42;
if ($43) {
$45 = $37;$46 = $38;$ex$026 = 0;
while(1) {
$44 = (($ex$026) + -1)|0;
$47 = (_bitshift64Shl(($45|0),($46|0),1)|0);
$48 = tempRet0;
$49 = ($48|0)>(-1);
$50 = ($47>>>0)>(4294967295);
$51 = ($48|0)==(-1);
$52 = $51 & $50;
$53 = $49 | $52;
if ($53) {
$45 = $47;$46 = $48;$ex$026 = $44;
} else {
$ex$0$lcssa = $44;
break;
}
}
} else {
$ex$0$lcssa = 0;
}
$54 = (1 - ($ex$0$lcssa))|0;
$55 = (_bitshift64Shl(($0|0),($1|0),($54|0))|0);
$56 = tempRet0;
$83 = $55;$84 = $56;$ex$1 = $ex$0$lcssa;
} else {
$57 = $1 & 1048575;
$58 = $57 | 1048576;
$83 = $0;$84 = $58;$ex$1 = $6;
}
$59 = ($9|0)==(0);
if ($59) {
$60 = (_bitshift64Shl(($2|0),($3|0),12)|0);
$61 = tempRet0;
$62 = ($61|0)>(-1);
$63 = ($60>>>0)>(4294967295);
$64 = ($61|0)==(-1);
$65 = $64 & $63;
$66 = $62 | $65;
if ($66) {
$68 = $60;$69 = $61;$ey$020 = 0;
while(1) {
$67 = (($ey$020) + -1)|0;
$70 = (_bitshift64Shl(($68|0),($69|0),1)|0);
$71 = tempRet0;
$72 = ($71|0)>(-1);
$73 = ($70>>>0)>(4294967295);
$74 = ($71|0)==(-1);
$75 = $74 & $73;
$76 = $72 | $75;
if ($76) {
$68 = $70;$69 = $71;$ey$020 = $67;
} else {
$ey$0$lcssa = $67;
break;
}
}
} else {
$ey$0$lcssa = 0;
}
$77 = (1 - ($ey$0$lcssa))|0;
$78 = (_bitshift64Shl(($2|0),($3|0),($77|0))|0);
$79 = tempRet0;
$85 = $78;$86 = $79;$ey$1$ph = $ey$0$lcssa;
} else {
$80 = $3 & 1048575;
$81 = $80 | 1048576;
$85 = $2;$86 = $81;$ey$1$ph = $9;
}
$82 = ($ex$1|0)>($ey$1$ph|0);
$87 = (_i64Subtract(($83|0),($84|0),($85|0),($86|0))|0);
$88 = tempRet0;
$89 = ($88|0)>(-1);
$90 = ($87>>>0)>(4294967295);
$91 = ($88|0)==(-1);
$92 = $91 & $90;
$93 = $89 | $92;
L23: do {
if ($82) {
$152 = $93;$153 = $87;$154 = $88;$94 = $83;$96 = $84;$ex$212 = $ex$1;
while(1) {
if ($152) {
$95 = ($94|0)==($85|0);
$97 = ($96|0)==($86|0);
$98 = $95 & $97;
if ($98) {
break;
} else {
$100 = $153;$101 = $154;
}
} else {
$100 = $94;$101 = $96;
}
$102 = (_bitshift64Shl(($100|0),($101|0),1)|0);
$103 = tempRet0;
$104 = (($ex$212) + -1)|0;
$105 = ($104|0)>($ey$1$ph|0);
$106 = (_i64Subtract(($102|0),($103|0),($85|0),($86|0))|0);
$107 = tempRet0;
$108 = ($107|0)>(-1);
$109 = ($106>>>0)>(4294967295);
$110 = ($107|0)==(-1);
$111 = $110 & $109;
$112 = $108 | $111;
if ($105) {
$152 = $112;$153 = $106;$154 = $107;$94 = $102;$96 = $103;$ex$212 = $104;
} else {
$$lcssa7 = $112;$113 = $102;$115 = $103;$155 = $106;$156 = $107;$ex$2$lcssa = $104;
break L23;
}
}
$99 = $x * 0.0;
$$0 = $99;
break L1;
} else {
$$lcssa7 = $93;$113 = $83;$115 = $84;$155 = $87;$156 = $88;$ex$2$lcssa = $ex$1;
}
} while(0);
if ($$lcssa7) {
$114 = ($113|0)==($85|0);
$116 = ($115|0)==($86|0);
$117 = $114 & $116;
if ($117) {
$125 = $x * 0.0;
$$0 = $125;
break;
} else {
$118 = $156;$120 = $155;
}
} else {
$118 = $115;$120 = $113;
}
$119 = ($118>>>0)<(1048576);
$121 = ($120>>>0)<(0);
$122 = ($118|0)==(1048576);
$123 = $122 & $121;
$124 = $119 | $123;
if ($124) {
$126 = $120;$127 = $118;$ex$39 = $ex$2$lcssa;
while(1) {
$128 = (_bitshift64Shl(($126|0),($127|0),1)|0);
$129 = tempRet0;
$130 = (($ex$39) + -1)|0;
$131 = ($129>>>0)<(1048576);
$132 = ($128>>>0)<(0);
$133 = ($129|0)==(1048576);
$134 = $133 & $132;
$135 = $131 | $134;
if ($135) {
$126 = $128;$127 = $129;$ex$39 = $130;
} else {
$137 = $128;$138 = $129;$ex$3$lcssa = $130;
break;
}
}
} else {
$137 = $120;$138 = $118;$ex$3$lcssa = $ex$2$lcssa;
}
$136 = ($ex$3$lcssa|0)>(0);
if ($136) {
$139 = (_i64Add(($137|0),($138|0),0,-1048576)|0);
$140 = tempRet0;
$141 = (_bitshift64Shl(($ex$3$lcssa|0),0,52)|0);
$142 = tempRet0;
$143 = $139 | $141;
$144 = $140 | $142;
$149 = $144;$151 = $143;
} else {
$145 = (1 - ($ex$3$lcssa))|0;
$146 = (_bitshift64Lshr(($137|0),($138|0),($145|0))|0);
$147 = tempRet0;
$149 = $147;$151 = $146;
}
$148 = $149 | $10;
HEAP32[tempDoublePtr>>2] = $151;HEAP32[tempDoublePtr+4>>2] = $148;$150 = +HEAPF64[tempDoublePtr>>3];
$$0 = $150;
}
}
} while(0);
if ((label|0) == 3) {
$23 = $x * $y;
$24 = $23 / $23;
$$0 = $24;
}
return (+$$0);
}
function _fmodl($x,$y) {
$x = +$x;
$y = +$y;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+_fmod($x,$y));
return (+$0);
}
function _frexp($x,$e) {
$x = +$x;
$e = $e|0;
var $$0 = 0.0, $$01 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $storemerge = 0, label = 0, sp = 0;
sp = STACKTOP;
HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0;
$1 = HEAP32[tempDoublePtr+4>>2]|0;
$2 = (_bitshift64Lshr(($0|0),($1|0),52)|0);
$3 = tempRet0;
$4 = $2 & 2047;
switch ($4|0) {
case 0: {
$5 = $x != 0.0;
if ($5) {
$6 = $x * 1.8446744073709552E+19;
$7 = (+_frexp($6,$e));
$8 = HEAP32[$e>>2]|0;
$9 = (($8) + -64)|0;
$$01 = $7;$storemerge = $9;
} else {
$$01 = $x;$storemerge = 0;
}
HEAP32[$e>>2] = $storemerge;
$$0 = $$01;
break;
}
case 2047: {
$$0 = $x;
break;
}
default: {
$10 = (($4) + -1022)|0;
HEAP32[$e>>2] = $10;
$11 = $1 & -2146435073;
$12 = $11 | 1071644672;
HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $12;$13 = +HEAPF64[tempDoublePtr>>3];
$$0 = $13;
}
}
return (+$$0);
}
function _frexpl($x,$e) {
$x = +$x;
$e = $e|0;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+_frexp($x,$e));
return (+$0);
}
function _ldexp($x,$n) {
$x = +$x;
$n = $n|0;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+_scalbn($x,$n));
return (+$0);
}
function _roundf($x) {
$x = +$x;
var $$0 = 0.0, $$x = 0.0, $$y$0 = 0.0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0;
var $9 = 0.0, $y$0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (HEAPF32[tempDoublePtr>>2]=$x,HEAP32[tempDoublePtr>>2]|0);
$1 = $0 >>> 23;
$2 = $1 & 255;
$3 = ($2>>>0)>(149);
do {
if ($3) {
$$0 = $x;
} else {
$4 = ($0|0)<(0);
$5 = -$x;
$$x = $4 ? $5 : $x;
$6 = ($2>>>0)<(126);
if ($6) {
$7 = $x * 0.0;
$$0 = $7;
break;
}
$8 = $$x + 8388608.0;
$9 = $8 + -8388608.0;
$10 = $9 - $$x;
$11 = $10 > 0.5;
if ($11) {
$12 = $$x + $10;
$13 = $12 + -1.0;
$y$0 = $13;
} else {
$14 = !($10 <= -0.5);
$15 = $$x + $10;
if ($14) {
$y$0 = $15;
} else {
$16 = $15 + 1.0;
$y$0 = $16;
}
}
$17 = -$y$0;
$$y$0 = $4 ? $17 : $y$0;
$$0 = $$y$0;
}
} while(0);
return (+$$0);
}
function _scalbn($x,$n) {
$x = +$x;
$n = $n|0;
var $$ = 0, $$0 = 0, $$1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0.0, $9 = 0, $y$0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($n|0)>(1023);
if ($0) {
$1 = $x * 8.9884656743115795E+307;
$2 = (($n) + -1023)|0;
$3 = ($2|0)>(1023);
if ($3) {
$4 = $1 * 8.9884656743115795E+307;
$5 = (($n) + -2046)|0;
$6 = ($5|0)>(1023);
$$ = $6 ? 1023 : $5;
$$0 = $$;$y$0 = $4;
} else {
$$0 = $2;$y$0 = $1;
}
} else {
$7 = ($n|0)<(-1022);
if ($7) {
$8 = $x * 2.2250738585072014E-308;
$9 = (($n) + 1022)|0;
$10 = ($9|0)<(-1022);
if ($10) {
$11 = $8 * 2.2250738585072014E-308;
$12 = (($n) + 2044)|0;
$13 = ($12|0)<(-1022);
$$1 = $13 ? -1022 : $12;
$$0 = $$1;$y$0 = $11;
} else {
$$0 = $9;$y$0 = $8;
}
} else {
$$0 = $n;$y$0 = $x;
}
}
$14 = (($$0) + 1023)|0;
$15 = (_bitshift64Shl(($14|0),0,52)|0);
$16 = tempRet0;
HEAP32[tempDoublePtr>>2] = $15;HEAP32[tempDoublePtr+4>>2] = $16;$17 = +HEAPF64[tempDoublePtr>>3];
$18 = $y$0 * $17;
return (+$18);
}
function _scalbnl($x,$n) {
$x = +$x;
$n = $n|0;
var $0 = 0.0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (+_scalbn($x,$n));
return (+$0);
}
function _mbrtowc($wc,$src,$n,$st) {
$wc = $wc|0;
$src = $src|0;
$n = $n|0;
$st = $st|0;
var $$0 = 0, $$024 = 0, $$1 = 0, $$lcssa = 0, $$lcssa35 = 0, $$st = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
var $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$05 = 0, $c$1 = 0, $c$2 = 0, $dummy = 0, $dummy$wc = 0, $s$06 = 0, $s$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$dummy = sp;
$0 = ($st|0)==(0|0);
$$st = $0 ? 8944 : $st;
$1 = HEAP32[$$st>>2]|0;
$2 = ($src|0)==(0|0);
L1: do {
if ($2) {
$3 = ($1|0)==(0);
if ($3) {
$$0 = 0;
} else {
label = 15;
}
} else {
$4 = ($wc|0)==(0|0);
$dummy$wc = $4 ? $dummy : $wc;
$5 = ($n|0)==(0);
if ($5) {
$$0 = -2;
} else {
$6 = ($1|0)==(0);
if ($6) {
$7 = HEAP8[$src>>0]|0;
$8 = $7&255;
$9 = ($7<<24>>24)>(-1);
if ($9) {
HEAP32[$dummy$wc>>2] = $8;
$10 = ($7<<24>>24)!=(0);
$11 = $10&1;
$$0 = $11;
break;
}
$12 = (($8) + -194)|0;
$13 = ($12>>>0)>(50);
if ($13) {
label = 15;
break;
}
$14 = ((($src)) + 1|0);
$15 = (8696 + ($12<<2)|0);
$16 = HEAP32[$15>>2]|0;
$17 = (($n) + -1)|0;
$18 = ($17|0)==(0);
if ($18) {
$c$2 = $16;
} else {
$$024 = $17;$c$05 = $16;$s$06 = $14;
label = 9;
}
} else {
$$024 = $n;$c$05 = $1;$s$06 = $src;
label = 9;
}
L11: do {
if ((label|0) == 9) {
$19 = HEAP8[$s$06>>0]|0;
$20 = $19&255;
$21 = $20 >>> 3;
$22 = (($21) + -16)|0;
$23 = $c$05 >> 26;
$24 = (($21) + ($23))|0;
$25 = $22 | $24;
$26 = ($25>>>0)>(7);
if ($26) {
label = 15;
break L1;
} else {
$$1 = $$024;$30 = $19;$c$1 = $c$05;$s$1 = $s$06;
}
while(1) {
$27 = $c$1 << 6;
$28 = ((($s$1)) + 1|0);
$29 = $30&255;
$31 = (($29) + -128)|0;
$32 = $31 | $27;
$33 = (($$1) + -1)|0;
$34 = ($32|0)<(0);
if (!($34)) {
$$lcssa = $32;$$lcssa35 = $33;
break;
}
$36 = ($33|0)==(0);
if ($36) {
$c$2 = $32;
break L11;
}
$37 = HEAP8[$28>>0]|0;
$38 = $37 & -64;
$39 = ($38<<24>>24)==(-128);
if ($39) {
$$1 = $33;$30 = $37;$c$1 = $32;$s$1 = $28;
} else {
label = 15;
break L1;
}
}
HEAP32[$$st>>2] = 0;
HEAP32[$dummy$wc>>2] = $$lcssa;
$35 = (($n) - ($$lcssa35))|0;
$$0 = $35;
break L1;
}
} while(0);
HEAP32[$$st>>2] = $c$2;
$$0 = -2;
}
}
} while(0);
if ((label|0) == 15) {
HEAP32[$$st>>2] = 0;
$40 = (___errno_location()|0);
HEAP32[$40>>2] = 84;
$$0 = -1;
}
STACKTOP = sp;return ($$0|0);
}
function _mbsinit($st) {
$st = $st|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($st|0)==(0|0);
if ($0) {
$4 = 1;
} else {
$1 = HEAP32[$st>>2]|0;
$2 = ($1|0)==(0);
$4 = $2;
}
$3 = $4&1;
return ($3|0);
}
function _wcrtomb($s,$wc,$st) {
$s = $s|0;
$wc = $wc|0;
$st = $st|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($s|0)==(0|0);
do {
if ($0) {
$$0 = 1;
} else {
$1 = ($wc>>>0)<(128);
if ($1) {
$2 = $wc&255;
HEAP8[$s>>0] = $2;
$$0 = 1;
break;
}
$3 = ($wc>>>0)<(2048);
if ($3) {
$4 = $wc >>> 6;
$5 = $4 | 192;
$6 = $5&255;
$7 = ((($s)) + 1|0);
HEAP8[$s>>0] = $6;
$8 = $wc & 63;
$9 = $8 | 128;
$10 = $9&255;
HEAP8[$7>>0] = $10;
$$0 = 2;
break;
}
$11 = ($wc>>>0)<(55296);
$12 = $wc & -8192;
$13 = ($12|0)==(57344);
$or$cond = $11 | $13;
if ($or$cond) {
$14 = $wc >>> 12;
$15 = $14 | 224;
$16 = $15&255;
$17 = ((($s)) + 1|0);
HEAP8[$s>>0] = $16;
$18 = $wc >>> 6;
$19 = $18 & 63;
$20 = $19 | 128;
$21 = $20&255;
$22 = ((($s)) + 2|0);
HEAP8[$17>>0] = $21;
$23 = $wc & 63;
$24 = $23 | 128;
$25 = $24&255;
HEAP8[$22>>0] = $25;
$$0 = 3;
break;
}
$26 = (($wc) + -65536)|0;
$27 = ($26>>>0)<(1048576);
if ($27) {
$28 = $wc >>> 18;
$29 = $28 | 240;
$30 = $29&255;
$31 = ((($s)) + 1|0);
HEAP8[$s>>0] = $30;
$32 = $wc >>> 12;
$33 = $32 & 63;
$34 = $33 | 128;
$35 = $34&255;
$36 = ((($s)) + 2|0);
HEAP8[$31>>0] = $35;
$37 = $wc >>> 6;
$38 = $37 & 63;
$39 = $38 | 128;
$40 = $39&255;
$41 = ((($s)) + 3|0);
HEAP8[$36>>0] = $40;
$42 = $wc & 63;
$43 = $42 | 128;
$44 = $43&255;
HEAP8[$41>>0] = $44;
$$0 = 4;
break;
} else {
$45 = (___errno_location()|0);
HEAP32[$45>>2] = 84;
$$0 = -1;
break;
}
}
} while(0);
return ($$0|0);
}
function _wctomb($s,$wc) {
$s = $s|0;
$wc = $wc|0;
var $$0 = 0, $0 = 0, $1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($s|0)==(0|0);
if ($0) {
$$0 = 0;
} else {
$1 = (_wcrtomb($s,$wc,0)|0);
$$0 = $1;
}
return ($$0|0);
}
function _srand($s) {
$s = $s|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (($s) + -1)|0;
$1 = 144;
$2 = $1;
HEAP32[$2>>2] = $0;
$3 = (($1) + 4)|0;
$4 = $3;
HEAP32[$4>>2] = 0;
return;
}
function _fclose($f) {
$f = $f|0;
var $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>(-1);
if ($2) {
(___lockfile($f)|0);
}
$3 = HEAP32[$f>>2]|0;
$4 = $3 & 1;
$5 = ($4|0)!=(0);
if (!($5)) {
___lock(((8680)|0));
$6 = ((($f)) + 52|0);
$7 = HEAP32[$6>>2]|0;
$8 = ($7|0)==(0|0);
$9 = $7;
$$pre = ((($f)) + 56|0);
if (!($8)) {
$10 = HEAP32[$$pre>>2]|0;
$11 = ((($7)) + 56|0);
HEAP32[$11>>2] = $10;
}
$12 = HEAP32[$$pre>>2]|0;
$13 = ($12|0)==(0|0);
$14 = $12;
if (!($13)) {
$15 = ((($12)) + 52|0);
HEAP32[$15>>2] = $9;
}
$16 = HEAP32[(8676)>>2]|0;
$17 = ($16|0)==($f|0);
if ($17) {
HEAP32[(8676)>>2] = $14;
}
___unlock(((8680)|0));
}
$18 = (_fflush($f)|0);
$19 = ((($f)) + 12|0);
$20 = HEAP32[$19>>2]|0;
$21 = (FUNCTION_TABLE_ii[$20 & 15]($f)|0);
$22 = $21 | $18;
$23 = ((($f)) + 92|0);
$24 = HEAP32[$23>>2]|0;
$25 = ($24|0)==(0|0);
if (!($25)) {
_free($24);
}
if (!($5)) {
_free($f);
}
return ($22|0);
}
function _feof($f) {
$f = $f|0;
var $$lobit = 0, $$lobit1 = 0, $$lobit2 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>(-1);
if ($2) {
$5 = (___lockfile($f)|0);
$phitmp = ($5|0)==(0);
$6 = HEAP32[$f>>2]|0;
$7 = $6 >>> 4;
$$lobit = $7 & 1;
if ($phitmp) {
$$lobit2 = $$lobit;
} else {
___unlockfile($f);
$$lobit2 = $$lobit;
}
} else {
$3 = HEAP32[$f>>2]|0;
$4 = $3 >>> 4;
$$lobit1 = $4 & 1;
$$lobit2 = $$lobit1;
}
return ($$lobit2|0);
}
function _fflush($f) {
$f = $f|0;
var $$0 = 0, $$01 = 0, $$012 = 0, $$014 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, $r$0$lcssa = 0, $r$03 = 0, $r$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($f|0)==(0|0);
do {
if ($0) {
$7 = HEAP32[8904>>2]|0;
$8 = ($7|0)==(0|0);
if ($8) {
$27 = 0;
} else {
$9 = HEAP32[8904>>2]|0;
$10 = (_fflush($9)|0);
$27 = $10;
}
___lock(((8680)|0));
$$012 = HEAP32[(8676)>>2]|0;
$11 = ($$012|0)==(0|0);
if ($11) {
$r$0$lcssa = $27;
} else {
$$014 = $$012;$r$03 = $27;
while(1) {
$12 = ((($$014)) + 76|0);
$13 = HEAP32[$12>>2]|0;
$14 = ($13|0)>(-1);
if ($14) {
$15 = (___lockfile($$014)|0);
$23 = $15;
} else {
$23 = 0;
}
$16 = ((($$014)) + 20|0);
$17 = HEAP32[$16>>2]|0;
$18 = ((($$014)) + 28|0);
$19 = HEAP32[$18>>2]|0;
$20 = ($17>>>0)>($19>>>0);
if ($20) {
$21 = (___fflush_unlocked($$014)|0);
$22 = $21 | $r$03;
$r$1 = $22;
} else {
$r$1 = $r$03;
}
$24 = ($23|0)==(0);
if (!($24)) {
___unlockfile($$014);
}
$25 = ((($$014)) + 56|0);
$$01 = HEAP32[$25>>2]|0;
$26 = ($$01|0)==(0|0);
if ($26) {
$r$0$lcssa = $r$1;
break;
} else {
$$014 = $$01;$r$03 = $r$1;
}
}
}
___unlock(((8680)|0));
$$0 = $r$0$lcssa;
} else {
$1 = ((($f)) + 76|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(-1);
if (!($3)) {
$4 = (___fflush_unlocked($f)|0);
$$0 = $4;
break;
}
$5 = (___lockfile($f)|0);
$phitmp = ($5|0)==(0);
$6 = (___fflush_unlocked($f)|0);
if ($phitmp) {
$$0 = $6;
} else {
___unlockfile($f);
$$0 = $6;
}
}
} while(0);
return ($$0|0);
}
function _fgetc($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(0);
if ($2) {
label = 3;
} else {
$3 = (___lockfile($f)|0);
$4 = ($3|0)==(0);
if ($4) {
label = 3;
} else {
$14 = ((($f)) + 4|0);
$15 = HEAP32[$14>>2]|0;
$16 = ((($f)) + 8|0);
$17 = HEAP32[$16>>2]|0;
$18 = ($15>>>0)<($17>>>0);
if ($18) {
$19 = ((($15)) + 1|0);
HEAP32[$14>>2] = $19;
$20 = HEAP8[$15>>0]|0;
$21 = $20&255;
$23 = $21;
} else {
$22 = (___uflow($f)|0);
$23 = $22;
}
___unlockfile($f);
$$0 = $23;
}
}
do {
if ((label|0) == 3) {
$5 = ((($f)) + 4|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($f)) + 8|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($6>>>0)<($8>>>0);
if ($9) {
$10 = ((($6)) + 1|0);
HEAP32[$5>>2] = $10;
$11 = HEAP8[$6>>0]|0;
$12 = $11&255;
$$0 = $12;
break;
} else {
$13 = (___uflow($f)|0);
$$0 = $13;
break;
}
}
} while(0);
return ($$0|0);
}
function _fgets($s,$n,$f) {
$s = $s|0;
$n = $n|0;
$f = $f|0;
var $$0 = 0, $$048 = 0, $$05 = 0, $$lcssa14 = 0, $$old2 = 0, $$pre = 0, $$sum$pre$phiZZ2D = 0, $$sum6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, $or$cond = 0, $or$cond3 = 0, $p$0 = 0, $p$1 = 0, $sext$mask = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>(-1);
if ($2) {
$3 = (___lockfile($f)|0);
$12 = $3;
} else {
$12 = 0;
}
$4 = (($n) + -1)|0;
$5 = ($n|0)<(2);
if ($5) {
$6 = ((($f)) + 74|0);
$7 = HEAP8[$6>>0]|0;
$8 = $7 << 24 >> 24;
$9 = (($8) + 255)|0;
$10 = $9 | $8;
$11 = $10&255;
HEAP8[$6>>0] = $11;
$13 = ($12|0)==(0);
if (!($13)) {
___unlockfile($f);
}
$14 = ($4|0)==(0);
if ($14) {
HEAP8[$s>>0] = 0;
$$0 = $s;
} else {
$$0 = 0;
}
} else {
$$old2 = ($4|0)==(0);
L11: do {
if ($$old2) {
$p$1 = $s;
label = 18;
} else {
$15 = ((($f)) + 4|0);
$16 = ((($f)) + 8|0);
$$05 = $4;$p$0 = $s;
while(1) {
$17 = HEAP32[$15>>2]|0;
$18 = HEAP32[$16>>2]|0;
$19 = $18;
$20 = $17;
$21 = (($19) - ($20))|0;
$22 = (_memchr($17,10,$21)|0);
$23 = ($22|0)==(0|0);
$24 = $22;
$25 = (1 - ($20))|0;
$26 = (($25) + ($24))|0;
$27 = $23 ? $21 : $26;
$28 = ($27>>>0)<($$05>>>0);
$29 = $28 ? $27 : $$05;
_memcpy(($p$0|0),($17|0),($29|0))|0;
$30 = HEAP32[$15>>2]|0;
$31 = (($30) + ($29)|0);
HEAP32[$15>>2] = $31;
$32 = (($p$0) + ($29)|0);
$33 = (($$05) - ($29))|0;
$or$cond = $23 & $28;
if (!($or$cond)) {
$p$1 = $32;
label = 18;
break L11;
}
$34 = HEAP32[$16>>2]|0;
$35 = ($31>>>0)<($34>>>0);
if ($35) {
$$sum6 = (($29) + 1)|0;
$36 = (($30) + ($$sum6)|0);
HEAP32[$15>>2] = $36;
$37 = HEAP8[$31>>0]|0;
$38 = $37&255;
$$sum$pre$phiZZ2D = $$sum6;$47 = $38;
} else {
$39 = (___uflow($f)|0);
$40 = ($39|0)<(0);
if ($40) {
$$lcssa14 = $32;
break;
}
$$pre = (($29) + 1)|0;
$$sum$pre$phiZZ2D = $$pre;$47 = $39;
}
$45 = (($33) + -1)|0;
$46 = $47&255;
$48 = (($p$0) + ($$sum$pre$phiZZ2D)|0);
HEAP8[$32>>0] = $46;
$sext$mask = $47 & 255;
$49 = ($sext$mask|0)!=(10);
$50 = ($45|0)!=(0);
$or$cond3 = $50 & $49;
if ($or$cond3) {
$$05 = $45;$p$0 = $48;
} else {
$p$1 = $48;
label = 18;
break L11;
}
}
$41 = ($$lcssa14|0)==($s|0);
if ($41) {
$$048 = 0;
} else {
$42 = HEAP32[$f>>2]|0;
$43 = $42 & 16;
$44 = ($43|0)==(0);
if ($44) {
$$048 = 0;
} else {
$p$1 = $$lcssa14;
label = 18;
}
}
}
} while(0);
if ((label|0) == 18) {
$51 = ($s|0)==(0|0);
if ($51) {
$$048 = 0;
} else {
HEAP8[$p$1>>0] = 0;
$$048 = $s;
}
}
$52 = ($12|0)==(0);
if ($52) {
$$0 = $$048;
} else {
___unlockfile($f);
$$0 = $$048;
}
}
return ($$0|0);
}
function _fopen($filename,$mode) {
$filename = $filename|0;
$mode = $mode|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer = sp;
$0 = HEAP8[$mode>>0]|0;
$1 = $0 << 24 >> 24;
$memchr = (_memchr(28953,$1,4)|0);
$2 = ($memchr|0)==(0|0);
if ($2) {
$3 = (___errno_location()|0);
HEAP32[$3>>2] = 22;
$$0 = 0;
} else {
$4 = (___fmodeflags($mode)|0);
$5 = $4 | 32768;
HEAP32[$vararg_buffer>>2] = $filename;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $5;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = 438;
$6 = (___syscall5(5,($vararg_buffer|0))|0);
$7 = (___syscall_ret($6)|0);
$8 = ($7|0)<(0);
if ($8) {
$$0 = 0;
} else {
$9 = (___fdopen($7,$mode)|0);
$10 = ($9|0)==(0|0);
if ($10) {
HEAP32[$vararg_buffer3>>2] = $7;
(___syscall6(6,($vararg_buffer3|0))|0);
$$0 = 0;
} else {
$$0 = $9;
}
}
}
STACKTOP = sp;return ($$0|0);
}
function _fputc($c,$f) {
$c = $c|0;
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)<(0);
if ($2) {
label = 3;
} else {
$3 = (___lockfile($f)|0);
$4 = ($3|0)==(0);
if ($4) {
label = 3;
} else {
$18 = ((($f)) + 75|0);
$19 = HEAP8[$18>>0]|0;
$20 = $19 << 24 >> 24;
$21 = ($20|0)==($c|0);
if ($21) {
label = 10;
} else {
$22 = ((($f)) + 20|0);
$23 = HEAP32[$22>>2]|0;
$24 = ((($f)) + 16|0);
$25 = HEAP32[$24>>2]|0;
$26 = ($23>>>0)<($25>>>0);
if ($26) {
$27 = $c&255;
$28 = ((($23)) + 1|0);
HEAP32[$22>>2] = $28;
HEAP8[$23>>0] = $27;
$29 = $c & 255;
$31 = $29;
} else {
label = 10;
}
}
if ((label|0) == 10) {
$30 = (___overflow($f,$c)|0);
$31 = $30;
}
___unlockfile($f);
$$0 = $31;
}
}
do {
if ((label|0) == 3) {
$5 = ((($f)) + 75|0);
$6 = HEAP8[$5>>0]|0;
$7 = $6 << 24 >> 24;
$8 = ($7|0)==($c|0);
if (!($8)) {
$9 = ((($f)) + 20|0);
$10 = HEAP32[$9>>2]|0;
$11 = ((($f)) + 16|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($10>>>0)<($12>>>0);
if ($13) {
$14 = $c&255;
$15 = ((($10)) + 1|0);
HEAP32[$9>>2] = $15;
HEAP8[$10>>0] = $14;
$16 = $c & 255;
$$0 = $16;
break;
}
}
$17 = (___overflow($f,$c)|0);
$$0 = $17;
}
} while(0);
return ($$0|0);
}
function _fread($destv,$size,$nmemb,$f) {
$destv = $destv|0;
$size = $size|0;
$nmemb = $nmemb|0;
$f = $f|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, $dest$0$ph = 0, $dest$02 = 0, $l$0$ph = 0, $l$03 = 0, $l$03$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = Math_imul($nmemb, $size)|0;
$1 = ((($f)) + 76|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(-1);
if ($3) {
$4 = (___lockfile($f)|0);
$31 = $4;
} else {
$31 = 0;
}
$5 = ((($f)) + 74|0);
$6 = HEAP8[$5>>0]|0;
$7 = $6 << 24 >> 24;
$8 = (($7) + 255)|0;
$9 = $8 | $7;
$10 = $9&255;
HEAP8[$5>>0] = $10;
$11 = ((($f)) + 8|0);
$12 = HEAP32[$11>>2]|0;
$13 = ((($f)) + 4|0);
$14 = HEAP32[$13>>2]|0;
$15 = $12;
$16 = $14;
$17 = (($15) - ($16))|0;
$18 = ($17|0)>(0);
if ($18) {
$19 = ($17>>>0)<($0>>>0);
$$ = $19 ? $17 : $0;
_memcpy(($destv|0),($14|0),($$|0))|0;
$20 = (($14) + ($$)|0);
HEAP32[$13>>2] = $20;
$21 = (($destv) + ($$)|0);
$22 = (($0) - ($$))|0;
$dest$0$ph = $21;$l$0$ph = $22;
} else {
$dest$0$ph = $destv;$l$0$ph = $0;
}
$23 = ($l$0$ph|0)==(0);
L7: do {
if ($23) {
label = 13;
} else {
$24 = ((($f)) + 32|0);
$dest$02 = $dest$0$ph;$l$03 = $l$0$ph;
while(1) {
$25 = (___toread($f)|0);
$26 = ($25|0)==(0);
if (!($26)) {
$l$03$lcssa = $l$03;
break;
}
$27 = HEAP32[$24>>2]|0;
$28 = (FUNCTION_TABLE_iiii[$27 & 15]($f,$dest$02,$l$03)|0);
$29 = (($28) + 1)|0;
$30 = ($29>>>0)<(2);
if ($30) {
$l$03$lcssa = $l$03;
break;
}
$35 = (($l$03) - ($28))|0;
$36 = (($dest$02) + ($28)|0);
$37 = ($l$03|0)==($28|0);
if ($37) {
label = 13;
break L7;
} else {
$dest$02 = $36;$l$03 = $35;
}
}
$32 = ($31|0)==(0);
if (!($32)) {
___unlockfile($f);
}
$33 = (($0) - ($l$03$lcssa))|0;
$34 = (($33>>>0) / ($size>>>0))&-1;
$$0 = $34;
}
} while(0);
if ((label|0) == 13) {
$38 = ($31|0)==(0);
if ($38) {
$$0 = $nmemb;
} else {
___unlockfile($f);
$$0 = $nmemb;
}
}
return ($$0|0);
}
function _fscanf($f,$fmt,$varargs) {
$f = $f|0;
$fmt = $fmt|0;
$varargs = $varargs|0;
var $0 = 0, $ap = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$ap = sp;
HEAP32[$ap>>2] = $varargs;
$0 = (_vfscanf($f,$fmt,$ap)|0);
STACKTOP = sp;return ($0|0);
}
function ___fseeko_unlocked($f,$off,$whence) {
$f = $f|0;
$off = $off|0;
$whence = $whence|0;
var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($whence|0)==(1);
if ($0) {
$1 = ((($f)) + 8|0);
$2 = HEAP32[$1>>2]|0;
$3 = ((($f)) + 4|0);
$4 = HEAP32[$3>>2]|0;
$5 = $2;
$6 = $4;
$7 = (($off) - ($5))|0;
$8 = (($7) + ($6))|0;
$$01 = $8;
} else {
$$01 = $off;
}
$9 = ((($f)) + 20|0);
$10 = HEAP32[$9>>2]|0;
$11 = ((($f)) + 28|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($10>>>0)>($12>>>0);
if ($13) {
$14 = ((($f)) + 36|0);
$15 = HEAP32[$14>>2]|0;
(FUNCTION_TABLE_iiii[$15 & 15]($f,0,0)|0);
$16 = HEAP32[$9>>2]|0;
$17 = ($16|0)==(0|0);
if ($17) {
$$0 = -1;
} else {
label = 5;
}
} else {
label = 5;
}
if ((label|0) == 5) {
$18 = ((($f)) + 16|0);
HEAP32[$18>>2] = 0;
HEAP32[$11>>2] = 0;
HEAP32[$9>>2] = 0;
$19 = ((($f)) + 40|0);
$20 = HEAP32[$19>>2]|0;
$21 = (FUNCTION_TABLE_iiii[$20 & 15]($f,$$01,$whence)|0);
$22 = ($21|0)<(0);
if ($22) {
$$0 = -1;
} else {
$23 = ((($f)) + 8|0);
HEAP32[$23>>2] = 0;
$24 = ((($f)) + 4|0);
HEAP32[$24>>2] = 0;
$25 = HEAP32[$f>>2]|0;
$26 = $25 & -17;
HEAP32[$f>>2] = $26;
$$0 = 0;
}
}
return ($$0|0);
}
function ___fseeko($f,$off,$whence) {
$f = $f|0;
$off = $off|0;
$whence = $whence|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>(-1);
if ($2) {
$4 = (___lockfile($f)|0);
$phitmp = ($4|0)==(0);
$5 = (___fseeko_unlocked($f,$off,$whence)|0);
if ($phitmp) {
$6 = $5;
} else {
___unlockfile($f);
$6 = $5;
}
} else {
$3 = (___fseeko_unlocked($f,$off,$whence)|0);
$6 = $3;
}
return ($6|0);
}
function _fseek($f,$off,$whence) {
$f = $f|0;
$off = $off|0;
$whence = $whence|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (___fseeko($f,$off,$whence)|0);
return ($0|0);
}
function ___ftello_unlocked($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 40|0);
$1 = HEAP32[$0>>2]|0;
$2 = HEAP32[$f>>2]|0;
$3 = $2 & 128;
$4 = ($3|0)==(0);
if ($4) {
$10 = 1;
} else {
$5 = ((($f)) + 20|0);
$6 = HEAP32[$5>>2]|0;
$7 = ((($f)) + 28|0);
$8 = HEAP32[$7>>2]|0;
$9 = ($6>>>0)>($8>>>0);
$phitmp = $9 ? 2 : 1;
$10 = $phitmp;
}
$11 = (FUNCTION_TABLE_iiii[$1 & 15]($f,0,$10)|0);
$12 = ($11|0)<(0);
if ($12) {
$$0 = $11;
} else {
$13 = ((($f)) + 8|0);
$14 = HEAP32[$13>>2]|0;
$15 = ((($f)) + 4|0);
$16 = HEAP32[$15>>2]|0;
$17 = $14;
$18 = $16;
$19 = ((($f)) + 20|0);
$20 = HEAP32[$19>>2]|0;
$21 = ((($f)) + 28|0);
$22 = HEAP32[$21>>2]|0;
$23 = $20;
$24 = $22;
$25 = (($11) - ($17))|0;
$26 = (($25) + ($18))|0;
$27 = (($26) + ($23))|0;
$28 = (($27) - ($24))|0;
$$0 = $28;
}
return ($$0|0);
}
function ___ftello($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>(-1);
if ($2) {
$4 = (___lockfile($f)|0);
$phitmp = ($4|0)==(0);
$5 = (___ftello_unlocked($f)|0);
if ($phitmp) {
$6 = $5;
} else {
___unlockfile($f);
$6 = $5;
}
} else {
$3 = (___ftello_unlocked($f)|0);
$6 = $3;
}
return ($6|0);
}
function _ftell($f) {
$f = $f|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (___ftello($f)|0);
return ($0|0);
}
function ___fwritex($s,$l,$f) {
$s = $s|0;
$l = $l|0;
$f = $f|0;
var $$0 = 0, $$01 = 0, $$02 = 0, $$pre = 0, $$pre6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$lcssa10 = 0;
var $i$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 16|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$3 = (___towrite($f)|0);
$4 = ($3|0)==(0);
if ($4) {
$$pre = HEAP32[$0>>2]|0;
$7 = $$pre;
label = 4;
} else {
$$0 = 0;
}
} else {
$7 = $1;
label = 4;
}
L4: do {
if ((label|0) == 4) {
$5 = ((($f)) + 20|0);
$6 = HEAP32[$5>>2]|0;
$8 = $7;
$9 = $6;
$10 = (($8) - ($9))|0;
$11 = ($10>>>0)<($l>>>0);
if ($11) {
$12 = ((($f)) + 36|0);
$13 = HEAP32[$12>>2]|0;
$14 = (FUNCTION_TABLE_iiii[$13 & 15]($f,$s,$l)|0);
$$0 = $14;
break;
}
$15 = ((($f)) + 75|0);
$16 = HEAP8[$15>>0]|0;
$17 = ($16<<24>>24)>(-1);
L9: do {
if ($17) {
$i$0 = $l;
while(1) {
$18 = ($i$0|0)==(0);
if ($18) {
$$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0;
break L9;
}
$19 = (($i$0) + -1)|0;
$20 = (($s) + ($19)|0);
$21 = HEAP8[$20>>0]|0;
$22 = ($21<<24>>24)==(10);
if ($22) {
$i$0$lcssa10 = $i$0;
break;
} else {
$i$0 = $19;
}
}
$23 = ((($f)) + 36|0);
$24 = HEAP32[$23>>2]|0;
$25 = (FUNCTION_TABLE_iiii[$24 & 15]($f,$s,$i$0$lcssa10)|0);
$26 = ($25>>>0)<($i$0$lcssa10>>>0);
if ($26) {
$$0 = $i$0$lcssa10;
break L4;
}
$27 = (($s) + ($i$0$lcssa10)|0);
$28 = (($l) - ($i$0$lcssa10))|0;
$$pre6 = HEAP32[$5>>2]|0;
$$01 = $28;$$02 = $27;$29 = $$pre6;$i$1 = $i$0$lcssa10;
} else {
$$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0;
}
} while(0);
_memcpy(($29|0),($$02|0),($$01|0))|0;
$30 = HEAP32[$5>>2]|0;
$31 = (($30) + ($$01)|0);
HEAP32[$5>>2] = $31;
$32 = (($i$1) + ($$01))|0;
$$0 = $32;
}
} while(0);
return ($$0|0);
}
function _fwrite($src,$size,$nmemb,$f) {
$src = $src|0;
$size = $size|0;
$nmemb = $nmemb|0;
$f = $f|0;
var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = Math_imul($nmemb, $size)|0;
$1 = ((($f)) + 76|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(-1);
if ($3) {
$5 = (___lockfile($f)|0);
$phitmp = ($5|0)==(0);
$6 = (___fwritex($src,$0,$f)|0);
if ($phitmp) {
$7 = $6;
} else {
___unlockfile($f);
$7 = $6;
}
} else {
$4 = (___fwritex($src,$0,$f)|0);
$7 = $4;
}
$8 = ($7|0)==($0|0);
if ($8) {
$10 = $nmemb;
} else {
$9 = (($7>>>0) / ($size>>>0))&-1;
$10 = $9;
}
return ($10|0);
}
function _rewind($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 76|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)>(-1);
if ($2) {
$3 = (___lockfile($f)|0);
$phitmp = ($3|0)==(0);
(___fseeko_unlocked($f,0,0)|0);
$4 = HEAP32[$f>>2]|0;
$5 = $4 & -33;
HEAP32[$f>>2] = $5;
if (!($phitmp)) {
___unlockfile($f);
}
} else {
(___fseeko_unlocked($f,0,0)|0);
$6 = HEAP32[$f>>2]|0;
$7 = $6 & -33;
HEAP32[$f>>2] = $7;
}
return;
}
function _sscanf($s,$fmt,$varargs) {
$s = $s|0;
$fmt = $fmt|0;
$varargs = $varargs|0;
var $0 = 0, $ap = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$ap = sp;
HEAP32[$ap>>2] = $varargs;
$0 = (_vsscanf($s,$fmt,$ap)|0);
STACKTOP = sp;return ($0|0);
}
function _vfprintf($f,$fmt,$ap) {
$f = $f|0;
$fmt = $fmt|0;
$ap = $ap|0;
var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ap2 = 0, $internal_buf = 0, $nl_arg = 0, $nl_type = 0;
var $ret$1 = 0, $ret$1$ = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 224|0;
$ap2 = sp + 120|0;
$nl_type = sp + 80|0;
$nl_arg = sp;
$internal_buf = sp + 136|0;
dest=$nl_type; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$vacopy_currentptr = HEAP32[$ap>>2]|0;
HEAP32[$ap2>>2] = $vacopy_currentptr;
$0 = (_printf_core(0,$fmt,$ap2,$nl_arg,$nl_type)|0);
$1 = ($0|0)<(0);
if ($1) {
$$0 = -1;
} else {
$2 = ((($f)) + 76|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($3|0)>(-1);
if ($4) {
$5 = (___lockfile($f)|0);
$32 = $5;
} else {
$32 = 0;
}
$6 = HEAP32[$f>>2]|0;
$7 = $6 & 32;
$8 = ((($f)) + 74|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)<(1);
if ($10) {
$11 = $6 & -33;
HEAP32[$f>>2] = $11;
}
$12 = ((($f)) + 48|0);
$13 = HEAP32[$12>>2]|0;
$14 = ($13|0)==(0);
if ($14) {
$16 = ((($f)) + 44|0);
$17 = HEAP32[$16>>2]|0;
HEAP32[$16>>2] = $internal_buf;
$18 = ((($f)) + 28|0);
HEAP32[$18>>2] = $internal_buf;
$19 = ((($f)) + 20|0);
HEAP32[$19>>2] = $internal_buf;
HEAP32[$12>>2] = 80;
$20 = ((($internal_buf)) + 80|0);
$21 = ((($f)) + 16|0);
HEAP32[$21>>2] = $20;
$22 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0);
$23 = ($17|0)==(0|0);
if ($23) {
$ret$1 = $22;
} else {
$24 = ((($f)) + 36|0);
$25 = HEAP32[$24>>2]|0;
(FUNCTION_TABLE_iiii[$25 & 15]($f,0,0)|0);
$26 = HEAP32[$19>>2]|0;
$27 = ($26|0)==(0|0);
$$ = $27 ? -1 : $22;
HEAP32[$16>>2] = $17;
HEAP32[$12>>2] = 0;
HEAP32[$21>>2] = 0;
HEAP32[$18>>2] = 0;
HEAP32[$19>>2] = 0;
$ret$1 = $$;
}
} else {
$15 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0);
$ret$1 = $15;
}
$28 = HEAP32[$f>>2]|0;
$29 = $28 & 32;
$30 = ($29|0)==(0);
$ret$1$ = $30 ? $ret$1 : -1;
$31 = $28 | $7;
HEAP32[$f>>2] = $31;
$33 = ($32|0)==(0);
if (!($33)) {
___unlockfile($f);
}
$$0 = $ret$1$;
}
STACKTOP = sp;return ($$0|0);
}
function _vfscanf($f,$fmt,$ap) {
$f = $f|0;
$fmt = $fmt|0;
$ap = $ap|0;
var $$ = 0, $$10 = 0, $$11 = 0, $$12 = 0, $$9 = 0, $$lcssa = 0, $$lcssa38 = 0, $$lcssa384 = 0, $$not = 0, $$old4 = 0, $$pre = 0, $$pre$phi182Z2D = 0, $$pre168 = 0, $$pre170 = 0, $$pre172 = 0, $$pre174 = 0, $$pre176 = 0, $$pre178 = 0, $$pre180 = 0, $$pre181 = 0;
var $$size$0 = 0, $$width$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0;
var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0;
var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0;
var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0;
var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0;
var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0;
var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0;
var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0;
var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0;
var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0;
var $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $alloc$0 = 0, $alloc$0400 = 0, $alloc$1 = 0;
var $alloc$2 = 0, $ap2$i = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $base$0 = 0, $c$0100 = 0, $dest$0 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $factor = 0;
var $factor16 = 0, $i$0$i = 0, $i$0$ph = 0, $i$0$ph$phi = 0, $i$0$ph20 = 0, $i$0$ph20$lcssa = 0, $i$1 = 0, $i$2 = 0, $i$2$ph = 0, $i$2$ph$phi = 0, $i$3 = 0, $i$4 = 0, $invert$0 = 0, $isdigit = 0, $isdigit7 = 0, $isdigit795 = 0, $isdigittmp = 0, $isdigittmp6 = 0, $isdigittmp694 = 0, $k$0$ph = 0;
var $k$1$ph = 0, $matches$0$ = 0, $matches$0104 = 0, $matches$0104$lcssa = 0, $matches$0104376 = 0, $matches$1 = 0, $matches$2 = 0, $matches$3 = 0, $not$ = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond8 = 0, $p$0109 = 0, $p$1 = 0, $p$1$lcssa = 0, $p$10 = 0, $p$11 = 0, $p$2 = 0, $p$3$lcssa = 0;
var $p$396 = 0, $p$4 = 0, $p$5 = 0, $p$6 = 0, $p$7 = 0, $p$7$ph = 0, $p$8 = 0, $p$9 = 0, $pos$0108 = 0, $pos$1 = 0, $pos$2 = 0, $s$0107 = 0, $s$0107$lcssa = 0, $s$1 = 0, $s$2$ph = 0, $s$3 = 0, $s$4 = 0, $s$5 = 0, $s$6 = 0, $s$7 = 0;
var $s$8 = 0, $scanset = 0, $size$0 = 0, $st = 0, $vacopy_currentptr = 0, $wc = 0, $wcs$0103 = 0, $wcs$0103$lcssa = 0, $wcs$1 = 0, $wcs$2 = 0, $wcs$3$ph = 0, $wcs$3$ph$lcssa = 0, $wcs$4 = 0, $wcs$5 = 0, $wcs$6 = 0, $wcs$7 = 0, $wcs$8 = 0, $wcs$9 = 0, $width$0$lcssa = 0, $width$097 = 0;
var $width$1 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 304|0;
$ap2$i = sp + 16|0;
$st = sp + 8|0;
$scanset = sp + 33|0;
$wc = sp;
$0 = sp + 32|0;
$1 = ((($f)) + 76|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)>(-1);
if ($3) {
$4 = (___lockfile($f)|0);
$333 = $4;
} else {
$333 = 0;
}
$5 = HEAP8[$fmt>>0]|0;
$6 = ($5<<24>>24)==(0);
L4: do {
if ($6) {
$matches$3 = 0;
} else {
$7 = ((($f)) + 4|0);
$8 = ((($f)) + 100|0);
$9 = ((($f)) + 108|0);
$10 = ((($f)) + 8|0);
$11 = ((($scanset)) + 10|0);
$12 = ((($scanset)) + 33|0);
$13 = ((($st)) + 4|0);
$14 = ((($scanset)) + 46|0);
$15 = ((($scanset)) + 94|0);
$17 = $5;$matches$0104 = 0;$p$0109 = $fmt;$pos$0108 = 0;$s$0107 = 0;$wcs$0103 = 0;
L6: while(1) {
$16 = $17&255;
$18 = (_isspace($16)|0);
$19 = ($18|0)==(0);
L8: do {
if ($19) {
$46 = HEAP8[$p$0109>>0]|0;
$47 = ($46<<24>>24)==(37);
L10: do {
if ($47) {
$48 = ((($p$0109)) + 1|0);
$49 = HEAP8[$48>>0]|0;
L12: do {
switch ($49<<24>>24) {
case 37: {
break L10;
break;
}
case 42: {
$70 = ((($p$0109)) + 2|0);
$dest$0 = 0;$p$2 = $70;
break;
}
default: {
$71 = $49&255;
$isdigittmp = (($71) + -48)|0;
$isdigit = ($isdigittmp>>>0)<(10);
if ($isdigit) {
$72 = ((($p$0109)) + 2|0);
$73 = HEAP8[$72>>0]|0;
$74 = ($73<<24>>24)==(36);
if ($74) {
$vacopy_currentptr = HEAP32[$ap>>2]|0;
HEAP32[$ap2$i>>2] = $vacopy_currentptr;
$i$0$i = $isdigittmp;
while(1) {
$75 = ($i$0$i>>>0)>(1);
$arglist_current = HEAP32[$ap2$i>>2]|0;
$76 = $arglist_current;
$77 = ((0) + 4|0);
$expanded4 = $77;
$expanded = (($expanded4) - 1)|0;
$78 = (($76) + ($expanded))|0;
$79 = ((0) + 4|0);
$expanded8 = $79;
$expanded7 = (($expanded8) - 1)|0;
$expanded6 = $expanded7 ^ -1;
$80 = $78 & $expanded6;
$81 = $80;
$82 = HEAP32[$81>>2]|0;
$arglist_next = ((($81)) + 4|0);
HEAP32[$ap2$i>>2] = $arglist_next;
$83 = (($i$0$i) + -1)|0;
if ($75) {
$i$0$i = $83;
} else {
$$lcssa = $82;
break;
}
}
$84 = ((($p$0109)) + 3|0);
$dest$0 = $$lcssa;$p$2 = $84;
break L12;
}
}
$arglist_current2 = HEAP32[$ap>>2]|0;
$85 = $arglist_current2;
$86 = ((0) + 4|0);
$expanded11 = $86;
$expanded10 = (($expanded11) - 1)|0;
$87 = (($85) + ($expanded10))|0;
$88 = ((0) + 4|0);
$expanded15 = $88;
$expanded14 = (($expanded15) - 1)|0;
$expanded13 = $expanded14 ^ -1;
$89 = $87 & $expanded13;
$90 = $89;
$91 = HEAP32[$90>>2]|0;
$arglist_next3 = ((($90)) + 4|0);
HEAP32[$ap>>2] = $arglist_next3;
$dest$0 = $91;$p$2 = $48;
}
}
} while(0);
$92 = HEAP8[$p$2>>0]|0;
$93 = $92&255;
$isdigittmp694 = (($93) + -48)|0;
$isdigit795 = ($isdigittmp694>>>0)<(10);
if ($isdigit795) {
$97 = $93;$p$396 = $p$2;$width$097 = 0;
while(1) {
$94 = ($width$097*10)|0;
$95 = (($94) + -48)|0;
$96 = (($95) + ($97))|0;
$98 = ((($p$396)) + 1|0);
$99 = HEAP8[$98>>0]|0;
$100 = $99&255;
$isdigittmp6 = (($100) + -48)|0;
$isdigit7 = ($isdigittmp6>>>0)<(10);
if ($isdigit7) {
$97 = $100;$p$396 = $98;$width$097 = $96;
} else {
$$lcssa38 = $99;$p$3$lcssa = $98;$width$0$lcssa = $96;
break;
}
}
} else {
$$lcssa38 = $92;$p$3$lcssa = $p$2;$width$0$lcssa = 0;
}
$101 = ($$lcssa38<<24>>24)==(109);
if ($101) {
$102 = ($dest$0|0)!=(0|0);
$103 = $102&1;
$104 = ((($p$3$lcssa)) + 1|0);
$$pre168 = HEAP8[$104>>0]|0;
$107 = $$pre168;$alloc$0 = $103;$p$4 = $104;$s$1 = 0;$wcs$1 = 0;
} else {
$107 = $$lcssa38;$alloc$0 = 0;$p$4 = $p$3$lcssa;$s$1 = $s$0107;$wcs$1 = $wcs$0103;
}
$105 = ((($p$4)) + 1|0);
$106 = $107&255;
switch ($106|0) {
case 104: {
$108 = HEAP8[$105>>0]|0;
$109 = ($108<<24>>24)==(104);
$110 = ((($p$4)) + 2|0);
$$9 = $109 ? $110 : $105;
$$10 = $109 ? -2 : -1;
$p$5 = $$9;$size$0 = $$10;
break;
}
case 108: {
$111 = HEAP8[$105>>0]|0;
$112 = ($111<<24>>24)==(108);
$113 = ((($p$4)) + 2|0);
$$11 = $112 ? $113 : $105;
$$12 = $112 ? 3 : 1;
$p$5 = $$11;$size$0 = $$12;
break;
}
case 106: {
$p$5 = $105;$size$0 = 3;
break;
}
case 116: case 122: {
$p$5 = $105;$size$0 = 1;
break;
}
case 76: {
$p$5 = $105;$size$0 = 2;
break;
}
case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100: {
$p$5 = $p$4;$size$0 = 0;
break;
}
default: {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1;
label = 152;
break L6;
}
}
$114 = HEAP8[$p$5>>0]|0;
$115 = $114&255;
$116 = $115 & 47;
$117 = ($116|0)==(3);
$118 = $115 | 32;
$$ = $117 ? $118 : $115;
$$size$0 = $117 ? 1 : $size$0;
switch ($$|0) {
case 99: {
$119 = ($width$0$lcssa|0)<(1);
$$width$0 = $119 ? 1 : $width$0$lcssa;
$pos$1 = $pos$0108;$width$1 = $$width$0;
break;
}
case 91: {
$pos$1 = $pos$0108;$width$1 = $width$0$lcssa;
break;
}
case 110: {
$120 = ($pos$0108|0)<(0);
$121 = $120 << 31 >> 31;
$122 = ($dest$0|0)==(0|0);
if ($122) {
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
}
switch ($$size$0|0) {
case -2: {
$123 = $pos$0108&255;
HEAP8[$dest$0>>0] = $123;
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
break;
}
case -1: {
$124 = $pos$0108&65535;
HEAP16[$dest$0>>1] = $124;
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
break;
}
case 0: {
HEAP32[$dest$0>>2] = $pos$0108;
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
break;
}
case 1: {
HEAP32[$dest$0>>2] = $pos$0108;
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
break;
}
case 3: {
$125 = $dest$0;
$126 = $125;
HEAP32[$126>>2] = $pos$0108;
$127 = (($125) + 4)|0;
$128 = $127;
HEAP32[$128>>2] = $121;
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
break;
}
default: {
$matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
break L8;
}
}
break;
}
default: {
___shlim($f,0);
while(1) {
$129 = HEAP32[$7>>2]|0;
$130 = HEAP32[$8>>2]|0;
$131 = ($129>>>0)<($130>>>0);
if ($131) {
$132 = ((($129)) + 1|0);
HEAP32[$7>>2] = $132;
$133 = HEAP8[$129>>0]|0;
$134 = $133&255;
$136 = $134;
} else {
$135 = (___shgetc($f)|0);
$136 = $135;
}
$137 = (_isspace($136)|0);
$138 = ($137|0)==(0);
if ($138) {
break;
}
}
$139 = HEAP32[$8>>2]|0;
$140 = ($139|0)==(0|0);
$$pre170 = HEAP32[$7>>2]|0;
if ($140) {
$144 = $$pre170;
} else {
$141 = ((($$pre170)) + -1|0);
HEAP32[$7>>2] = $141;
$144 = $141;
}
$142 = HEAP32[$9>>2]|0;
$143 = HEAP32[$10>>2]|0;
$145 = $144;
$146 = $143;
$147 = (($142) + ($pos$0108))|0;
$148 = (($147) + ($145))|0;
$149 = (($148) - ($146))|0;
$pos$1 = $149;$width$1 = $width$0$lcssa;
}
}
___shlim($f,$width$1);
$150 = HEAP32[$7>>2]|0;
$151 = HEAP32[$8>>2]|0;
$152 = ($150>>>0)<($151>>>0);
if ($152) {
$153 = ((($150)) + 1|0);
HEAP32[$7>>2] = $153;
$156 = $151;
} else {
$154 = (___shgetc($f)|0);
$155 = ($154|0)<(0);
if ($155) {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1;
label = 152;
break L6;
}
$$pre172 = HEAP32[$8>>2]|0;
$156 = $$pre172;
}
$157 = ($156|0)==(0|0);
if (!($157)) {
$158 = HEAP32[$7>>2]|0;
$159 = ((($158)) + -1|0);
HEAP32[$7>>2] = $159;
}
L67: do {
switch ($$|0) {
case 91: case 99: case 115: {
$160 = ($$|0)==(99);
$161 = $$ & 239;
$162 = ($161|0)==(99);
L69: do {
if ($162) {
$163 = ($$|0)==(115);
_memset(($scanset|0),-1,257)|0;
HEAP8[$scanset>>0] = 0;
if ($163) {
HEAP8[$12>>0] = 0;
;HEAP8[$11>>0]=0|0;HEAP8[$11+1>>0]=0|0;HEAP8[$11+2>>0]=0|0;HEAP8[$11+3>>0]=0|0;HEAP8[$11+4>>0]=0|0;
$p$9 = $p$5;
} else {
$p$9 = $p$5;
}
} else {
$164 = ((($p$5)) + 1|0);
$165 = HEAP8[$164>>0]|0;
$166 = ($165<<24>>24)==(94);
$167 = ((($p$5)) + 2|0);
$invert$0 = $166&1;
$168 = $166 ? $164 : $p$5;
$p$6 = $166 ? $167 : $164;
$169 = $166&1;
_memset(($scanset|0),($169|0),257)|0;
HEAP8[$scanset>>0] = 0;
$170 = HEAP8[$p$6>>0]|0;
switch ($170<<24>>24) {
case 45: {
$171 = ((($168)) + 2|0);
$172 = $invert$0 ^ 1;
$173 = $172&255;
HEAP8[$14>>0] = $173;
$$pre$phi182Z2D = $173;$p$7$ph = $171;
break;
}
case 93: {
$174 = ((($168)) + 2|0);
$175 = $invert$0 ^ 1;
$176 = $175&255;
HEAP8[$15>>0] = $176;
$$pre$phi182Z2D = $176;$p$7$ph = $174;
break;
}
default: {
$$pre180 = $invert$0 ^ 1;
$$pre181 = $$pre180&255;
$$pre$phi182Z2D = $$pre181;$p$7$ph = $p$6;
}
}
$p$7 = $p$7$ph;
while(1) {
$177 = HEAP8[$p$7>>0]|0;
L80: do {
switch ($177<<24>>24) {
case 0: {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1;
label = 152;
break L6;
break;
}
case 93: {
$p$9 = $p$7;
break L69;
break;
}
case 45: {
$178 = ((($p$7)) + 1|0);
$179 = HEAP8[$178>>0]|0;
switch ($179<<24>>24) {
case 93: case 0: {
$190 = 45;$p$8 = $p$7;
break L80;
break;
}
default: {
}
}
$180 = ((($p$7)) + -1|0);
$181 = HEAP8[$180>>0]|0;
$182 = ($181&255)<($179&255);
if ($182) {
$183 = $181&255;
$c$0100 = $183;
while(1) {
$184 = (($c$0100) + 1)|0;
$185 = (($scanset) + ($184)|0);
HEAP8[$185>>0] = $$pre$phi182Z2D;
$186 = HEAP8[$178>>0]|0;
$187 = $186&255;
$188 = ($184|0)<($187|0);
if ($188) {
$c$0100 = $184;
} else {
$190 = $186;$p$8 = $178;
break;
}
}
} else {
$190 = $179;$p$8 = $178;
}
break;
}
default: {
$190 = $177;$p$8 = $p$7;
}
}
} while(0);
$189 = $190&255;
$191 = (($189) + 1)|0;
$192 = (($scanset) + ($191)|0);
HEAP8[$192>>0] = $$pre$phi182Z2D;
$193 = ((($p$8)) + 1|0);
$p$7 = $193;
}
}
} while(0);
$194 = (($width$1) + 1)|0;
$195 = $160 ? $194 : 31;
$196 = ($$size$0|0)==(1);
$197 = ($alloc$0|0)!=(0);
L88: do {
if ($196) {
if ($197) {
$198 = $195 << 2;
$199 = (_malloc($198)|0);
$200 = ($199|0)==(0|0);
if ($200) {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $199;
label = 152;
break L6;
} else {
$wcs$2 = $199;
}
} else {
$wcs$2 = $dest$0;
}
HEAP32[$st>>2] = 0;
HEAP32[$13>>2] = 0;
$i$0$ph = 0;$k$0$ph = $195;$wcs$3$ph = $wcs$2;
L94: while(1) {
$201 = ($wcs$3$ph|0)==(0|0);
$i$0$ph20 = $i$0$ph;
while(1) {
L98: while(1) {
$202 = HEAP32[$7>>2]|0;
$203 = HEAP32[$8>>2]|0;
$204 = ($202>>>0)<($203>>>0);
if ($204) {
$205 = ((($202)) + 1|0);
HEAP32[$7>>2] = $205;
$206 = HEAP8[$202>>0]|0;
$207 = $206&255;
$210 = $207;
} else {
$208 = (___shgetc($f)|0);
$210 = $208;
}
$209 = (($210) + 1)|0;
$211 = (($scanset) + ($209)|0);
$212 = HEAP8[$211>>0]|0;
$213 = ($212<<24>>24)==(0);
if ($213) {
$i$0$ph20$lcssa = $i$0$ph20;$wcs$3$ph$lcssa = $wcs$3$ph;
break L94;
}
$214 = $210&255;
HEAP8[$0>>0] = $214;
$215 = (_mbrtowc($wc,$0,1,$st)|0);
switch ($215|0) {
case -1: {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph;
label = 152;
break L6;
break;
}
case -2: {
break;
}
default: {
break L98;
}
}
}
if ($201) {
$i$1 = $i$0$ph20;
} else {
$216 = HEAP32[$wc>>2]|0;
$217 = (($i$0$ph20) + 1)|0;
$218 = (($wcs$3$ph) + ($i$0$ph20<<2)|0);
HEAP32[$218>>2] = $216;
$i$1 = $217;
}
$219 = ($i$1|0)==($k$0$ph|0);
$or$cond = $197 & $219;
if ($or$cond) {
break;
} else {
$i$0$ph20 = $i$1;
}
}
$factor = $k$0$ph << 1;
$220 = $factor | 1;
$221 = $220 << 2;
$222 = (_realloc($wcs$3$ph,$221)|0);
$223 = ($222|0)==(0|0);
if ($223) {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph;
label = 152;
break L6;
}
$i$0$ph$phi = $k$0$ph;$k$0$ph = $220;$wcs$3$ph = $222;$i$0$ph = $i$0$ph$phi;
}
$224 = (_mbsinit($st)|0);
$225 = ($224|0)==(0);
if ($225) {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph$lcssa;
label = 152;
break L6;
} else {
$i$4 = $i$0$ph20$lcssa;$s$3 = 0;$wcs$4 = $wcs$3$ph$lcssa;
}
} else {
if ($197) {
$226 = (_malloc($195)|0);
$227 = ($226|0)==(0|0);
if ($227) {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = 0;
label = 152;
break L6;
} else {
$i$2$ph = 0;$k$1$ph = $195;$s$2$ph = $226;
}
while(1) {
$i$2 = $i$2$ph;
while(1) {
$228 = HEAP32[$7>>2]|0;
$229 = HEAP32[$8>>2]|0;
$230 = ($228>>>0)<($229>>>0);
if ($230) {
$231 = ((($228)) + 1|0);
HEAP32[$7>>2] = $231;
$232 = HEAP8[$228>>0]|0;
$233 = $232&255;
$236 = $233;
} else {
$234 = (___shgetc($f)|0);
$236 = $234;
}
$235 = (($236) + 1)|0;
$237 = (($scanset) + ($235)|0);
$238 = HEAP8[$237>>0]|0;
$239 = ($238<<24>>24)==(0);
if ($239) {
$i$4 = $i$2;$s$3 = $s$2$ph;$wcs$4 = 0;
break L88;
}
$240 = $236&255;
$241 = (($i$2) + 1)|0;
$242 = (($s$2$ph) + ($i$2)|0);
HEAP8[$242>>0] = $240;
$243 = ($241|0)==($k$1$ph|0);
if ($243) {
break;
} else {
$i$2 = $241;
}
}
$factor16 = $k$1$ph << 1;
$244 = $factor16 | 1;
$245 = (_realloc($s$2$ph,$244)|0);
$246 = ($245|0)==(0|0);
if ($246) {
$alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$2$ph;$wcs$7 = 0;
label = 152;
break L6;
} else {
$i$2$ph$phi = $k$1$ph;$k$1$ph = $244;$s$2$ph = $245;$i$2$ph = $i$2$ph$phi;
}
}
}
$247 = ($dest$0|0)==(0|0);
if ($247) {
$265 = $156;
while(1) {
$263 = HEAP32[$7>>2]|0;
$264 = ($263>>>0)<($265>>>0);
if ($264) {
$266 = ((($263)) + 1|0);
HEAP32[$7>>2] = $266;
$267 = HEAP8[$263>>0]|0;
$268 = $267&255;
$271 = $268;
} else {
$269 = (___shgetc($f)|0);
$271 = $269;
}
$270 = (($271) + 1)|0;
$272 = (($scanset) + ($270)|0);
$273 = HEAP8[$272>>0]|0;
$274 = ($273<<24>>24)==(0);
if ($274) {
$i$4 = 0;$s$3 = 0;$wcs$4 = 0;
break L88;
}
$$pre176 = HEAP32[$8>>2]|0;
$265 = $$pre176;
}
} else {
$250 = $156;$i$3 = 0;
while(1) {
$248 = HEAP32[$7>>2]|0;
$249 = ($248>>>0)<($250>>>0);
if ($249) {
$251 = ((($248)) + 1|0);
HEAP32[$7>>2] = $251;
$252 = HEAP8[$248>>0]|0;
$253 = $252&255;
$256 = $253;
} else {
$254 = (___shgetc($f)|0);
$256 = $254;
}
$255 = (($256) + 1)|0;
$257 = (($scanset) + ($255)|0);
$258 = HEAP8[$257>>0]|0;
$259 = ($258<<24>>24)==(0);
if ($259) {
$i$4 = $i$3;$s$3 = $dest$0;$wcs$4 = 0;
break L88;
}
$260 = $256&255;
$261 = (($i$3) + 1)|0;
$262 = (($dest$0) + ($i$3)|0);
HEAP8[$262>>0] = $260;
$$pre174 = HEAP32[$8>>2]|0;
$250 = $$pre174;$i$3 = $261;
}
}
}
} while(0);
$275 = HEAP32[$8>>2]|0;
$276 = ($275|0)==(0|0);
$$pre178 = HEAP32[$7>>2]|0;
if ($276) {
$280 = $$pre178;
} else {
$277 = ((($$pre178)) + -1|0);
HEAP32[$7>>2] = $277;
$280 = $277;
}
$278 = HEAP32[$9>>2]|0;
$279 = HEAP32[$10>>2]|0;
$281 = $280;
$282 = $279;
$283 = (($281) - ($282))|0;
$284 = (($283) + ($278))|0;
$285 = ($284|0)==(0);
if ($285) {
$alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4;
break L6;
}
$$not = $160 ^ 1;
$286 = ($284|0)==($width$1|0);
$or$cond8 = $286 | $$not;
if (!($or$cond8)) {
$alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4;
break L6;
}
do {
if ($197) {
if ($196) {
HEAP32[$dest$0>>2] = $wcs$4;
break;
} else {
HEAP32[$dest$0>>2] = $s$3;
break;
}
}
} while(0);
if ($160) {
$p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4;
} else {
$287 = ($wcs$4|0)==(0|0);
if (!($287)) {
$288 = (($wcs$4) + ($i$4<<2)|0);
HEAP32[$288>>2] = 0;
}
$289 = ($s$3|0)==(0|0);
if ($289) {
$p$10 = $p$9;$s$4 = 0;$wcs$5 = $wcs$4;
break L67;
}
$290 = (($s$3) + ($i$4)|0);
HEAP8[$290>>0] = 0;
$p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4;
}
break;
}
case 120: case 88: case 112: {
$base$0 = 16;
label = 134;
break;
}
case 111: {
$base$0 = 8;
label = 134;
break;
}
case 117: case 100: {
$base$0 = 10;
label = 134;
break;
}
case 105: {
$base$0 = 0;
label = 134;
break;
}
case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97: {
$310 = (+___floatscan($f,$$size$0,0));
$311 = HEAP32[$9>>2]|0;
$312 = HEAP32[$7>>2]|0;
$313 = HEAP32[$10>>2]|0;
$314 = $312;
$315 = $313;
$316 = (($315) - ($314))|0;
$317 = ($311|0)==($316|0);
if ($317) {
$alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1;
break L6;
}
$318 = ($dest$0|0)==(0|0);
if ($318) {
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
} else {
switch ($$size$0|0) {
case 0: {
$319 = $310;
HEAPF32[$dest$0>>2] = $319;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L67;
break;
}
case 1: {
HEAPF64[$dest$0>>3] = $310;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L67;
break;
}
case 2: {
HEAPF64[$dest$0>>3] = $310;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L67;
break;
}
default: {
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L67;
}
}
}
break;
}
default: {
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
}
}
} while(0);
L168: do {
if ((label|0) == 134) {
label = 0;
$291 = (___intscan($f,$base$0,0,-1,-1)|0);
$292 = tempRet0;
$293 = HEAP32[$9>>2]|0;
$294 = HEAP32[$7>>2]|0;
$295 = HEAP32[$10>>2]|0;
$296 = $294;
$297 = $295;
$298 = (($297) - ($296))|0;
$299 = ($293|0)==($298|0);
if ($299) {
$alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1;
break L6;
}
$300 = ($$|0)==(112);
$301 = ($dest$0|0)!=(0|0);
$or$cond3 = $301 & $300;
if ($or$cond3) {
$302 = $291;
HEAP32[$dest$0>>2] = $302;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break;
}
$303 = ($dest$0|0)==(0|0);
if ($303) {
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
} else {
switch ($$size$0|0) {
case -2: {
$304 = $291&255;
HEAP8[$dest$0>>0] = $304;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L168;
break;
}
case -1: {
$305 = $291&65535;
HEAP16[$dest$0>>1] = $305;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L168;
break;
}
case 0: {
HEAP32[$dest$0>>2] = $291;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L168;
break;
}
case 1: {
HEAP32[$dest$0>>2] = $291;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L168;
break;
}
case 3: {
$306 = $dest$0;
$307 = $306;
HEAP32[$307>>2] = $291;
$308 = (($306) + 4)|0;
$309 = $308;
HEAP32[$309>>2] = $292;
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L168;
break;
}
default: {
$p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
break L168;
}
}
}
}
} while(0);
$320 = HEAP32[$9>>2]|0;
$321 = HEAP32[$7>>2]|0;
$322 = HEAP32[$10>>2]|0;
$323 = $321;
$324 = $322;
$325 = (($320) + ($pos$1))|0;
$326 = (($325) + ($323))|0;
$327 = (($326) - ($324))|0;
$not$ = ($dest$0|0)!=(0|0);
$328 = $not$&1;
$matches$0$ = (($328) + ($matches$0104))|0;
$matches$1 = $matches$0$;$p$11 = $p$10;$pos$2 = $327;$s$5 = $s$4;$wcs$6 = $wcs$5;
break L8;
}
} while(0);
$50 = $47&1;
$51 = (($p$0109) + ($50)|0);
___shlim($f,0);
$52 = HEAP32[$7>>2]|0;
$53 = HEAP32[$8>>2]|0;
$54 = ($52>>>0)<($53>>>0);
if ($54) {
$55 = ((($52)) + 1|0);
HEAP32[$7>>2] = $55;
$56 = HEAP8[$52>>0]|0;
$57 = $56&255;
$61 = $57;
} else {
$58 = (___shgetc($f)|0);
$61 = $58;
}
$59 = HEAP8[$51>>0]|0;
$60 = $59&255;
$62 = ($61|0)==($60|0);
if (!($62)) {
$$lcssa384 = $61;$matches$0104$lcssa = $matches$0104;$s$0107$lcssa = $s$0107;$wcs$0103$lcssa = $wcs$0103;
label = 21;
break L6;
}
$69 = (($pos$0108) + 1)|0;
$matches$1 = $matches$0104;$p$11 = $51;$pos$2 = $69;$s$5 = $s$0107;$wcs$6 = $wcs$0103;
} else {
$p$1 = $p$0109;
while(1) {
$20 = ((($p$1)) + 1|0);
$21 = HEAP8[$20>>0]|0;
$22 = $21&255;
$23 = (_isspace($22)|0);
$24 = ($23|0)==(0);
if ($24) {
$p$1$lcssa = $p$1;
break;
} else {
$p$1 = $20;
}
}
___shlim($f,0);
while(1) {
$25 = HEAP32[$7>>2]|0;
$26 = HEAP32[$8>>2]|0;
$27 = ($25>>>0)<($26>>>0);
if ($27) {
$28 = ((($25)) + 1|0);
HEAP32[$7>>2] = $28;
$29 = HEAP8[$25>>0]|0;
$30 = $29&255;
$32 = $30;
} else {
$31 = (___shgetc($f)|0);
$32 = $31;
}
$33 = (_isspace($32)|0);
$34 = ($33|0)==(0);
if ($34) {
break;
}
}
$35 = HEAP32[$8>>2]|0;
$36 = ($35|0)==(0|0);
$$pre = HEAP32[$7>>2]|0;
if ($36) {
$40 = $$pre;
} else {
$37 = ((($$pre)) + -1|0);
HEAP32[$7>>2] = $37;
$40 = $37;
}
$38 = HEAP32[$9>>2]|0;
$39 = HEAP32[$10>>2]|0;
$41 = $40;
$42 = $39;
$43 = (($38) + ($pos$0108))|0;
$44 = (($43) + ($41))|0;
$45 = (($44) - ($42))|0;
$matches$1 = $matches$0104;$p$11 = $p$1$lcssa;$pos$2 = $45;$s$5 = $s$0107;$wcs$6 = $wcs$0103;
}
} while(0);
$329 = ((($p$11)) + 1|0);
$330 = HEAP8[$329>>0]|0;
$331 = ($330<<24>>24)==(0);
if ($331) {
$matches$3 = $matches$1;
break L4;
} else {
$17 = $330;$matches$0104 = $matches$1;$p$0109 = $329;$pos$0108 = $pos$2;$s$0107 = $s$5;$wcs$0103 = $wcs$6;
}
}
if ((label|0) == 21) {
$63 = HEAP32[$8>>2]|0;
$64 = ($63|0)==(0|0);
if (!($64)) {
$65 = HEAP32[$7>>2]|0;
$66 = ((($65)) + -1|0);
HEAP32[$7>>2] = $66;
}
$67 = ($$lcssa384|0)>(-1);
$68 = ($matches$0104$lcssa|0)!=(0);
$or$cond5 = $68 | $67;
if ($or$cond5) {
$matches$3 = $matches$0104$lcssa;
break;
} else {
$alloc$1 = 0;$s$7 = $s$0107$lcssa;$wcs$8 = $wcs$0103$lcssa;
label = 153;
}
}
else if ((label|0) == 152) {
$$old4 = ($matches$0104376|0)==(0);
if ($$old4) {
$alloc$1 = $alloc$0400;$s$7 = $s$6;$wcs$8 = $wcs$7;
label = 153;
} else {
$alloc$2 = $alloc$0400;$matches$2 = $matches$0104376;$s$8 = $s$6;$wcs$9 = $wcs$7;
}
}
if ((label|0) == 153) {
$alloc$2 = $alloc$1;$matches$2 = -1;$s$8 = $s$7;$wcs$9 = $wcs$8;
}
$332 = ($alloc$2|0)==(0);
if ($332) {
$matches$3 = $matches$2;
} else {
_free($s$8);
_free($wcs$9);
$matches$3 = $matches$2;
}
}
} while(0);
$334 = ($333|0)==(0);
if (!($334)) {
___unlockfile($f);
}
STACKTOP = sp;return ($matches$3|0);
}
function _vsscanf($s,$fmt,$ap) {
$s = $s|0;
$fmt = $fmt|0;
$ap = $ap|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $f = 0, dest = 0, label = 0, sp = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$f = sp;
dest=$f; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$0 = ((($f)) + 32|0);
HEAP32[$0>>2] = 6;
$1 = ((($f)) + 44|0);
HEAP32[$1>>2] = $s;
$2 = ((($f)) + 76|0);
HEAP32[$2>>2] = -1;
$3 = ((($f)) + 84|0);
HEAP32[$3>>2] = $s;
$4 = (_vfscanf($f,$fmt,$ap)|0);
STACKTOP = sp;return ($4|0);
}
function ___fdopen($fd,$mode) {
$fd = $fd|0;
$mode = $mode|0;
var $$0 = 0, $$pre = 0, $$pre1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $tio = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0;
var sp = 0, stop = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 112|0;
$vararg_buffer12 = sp + 40|0;
$vararg_buffer7 = sp + 24|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer = sp;
$tio = sp + 52|0;
$0 = HEAP8[$mode>>0]|0;
$1 = $0 << 24 >> 24;
$memchr = (_memchr(28953,$1,4)|0);
$2 = ($memchr|0)==(0|0);
if ($2) {
$3 = (___errno_location()|0);
HEAP32[$3>>2] = 22;
$$0 = 0;
} else {
$4 = (_malloc(1144)|0);
$5 = ($4|0)==(0|0);
if ($5) {
$$0 = 0;
} else {
dest=$4; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
$6 = (_strchr($mode,43)|0);
$7 = ($6|0)==(0|0);
if ($7) {
$8 = ($0<<24>>24)==(114);
$9 = $8 ? 8 : 4;
HEAP32[$4>>2] = $9;
}
$10 = (_strchr($mode,101)|0);
$11 = ($10|0)==(0|0);
if ($11) {
$12 = $0;
} else {
HEAP32[$vararg_buffer>>2] = $fd;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = 2;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = 1;
(___syscall221(221,($vararg_buffer|0))|0);
$$pre = HEAP8[$mode>>0]|0;
$12 = $$pre;
}
$13 = ($12<<24>>24)==(97);
if ($13) {
HEAP32[$vararg_buffer3>>2] = $fd;
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
HEAP32[$vararg_ptr6>>2] = 3;
$14 = (___syscall221(221,($vararg_buffer3|0))|0);
$15 = $14 & 1024;
$16 = ($15|0)==(0);
if ($16) {
$17 = $14 | 1024;
HEAP32[$vararg_buffer7>>2] = $fd;
$vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
HEAP32[$vararg_ptr10>>2] = 4;
$vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
HEAP32[$vararg_ptr11>>2] = $17;
(___syscall221(221,($vararg_buffer7|0))|0);
}
$18 = HEAP32[$4>>2]|0;
$19 = $18 | 128;
HEAP32[$4>>2] = $19;
$26 = $19;
} else {
$$pre1 = HEAP32[$4>>2]|0;
$26 = $$pre1;
}
$20 = ((($4)) + 60|0);
HEAP32[$20>>2] = $fd;
$21 = ((($4)) + 120|0);
$22 = ((($4)) + 44|0);
HEAP32[$22>>2] = $21;
$23 = ((($4)) + 48|0);
HEAP32[$23>>2] = 1024;
$24 = ((($4)) + 75|0);
HEAP8[$24>>0] = -1;
$25 = $26 & 8;
$27 = ($25|0)==(0);
if ($27) {
HEAP32[$vararg_buffer12>>2] = $fd;
$vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
HEAP32[$vararg_ptr15>>2] = 21505;
$vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
HEAP32[$vararg_ptr16>>2] = $tio;
$28 = (___syscall54(54,($vararg_buffer12|0))|0);
$29 = ($28|0)==(0);
if ($29) {
HEAP8[$24>>0] = 10;
}
}
$30 = ((($4)) + 32|0);
HEAP32[$30>>2] = 7;
$31 = ((($4)) + 36|0);
HEAP32[$31>>2] = 8;
$32 = ((($4)) + 40|0);
HEAP32[$32>>2] = 3;
$33 = ((($4)) + 12|0);
HEAP32[$33>>2] = 2;
$34 = HEAP32[(8656)>>2]|0;
$35 = ($34|0)==(0);
if ($35) {
$36 = ((($4)) + 76|0);
HEAP32[$36>>2] = -1;
}
___lock(((8680)|0));
$37 = HEAP32[(8676)>>2]|0;
$38 = ((($4)) + 56|0);
HEAP32[$38>>2] = $37;
$39 = ($37|0)==(0);
if (!($39)) {
$40 = $37;
$41 = ((($40)) + 52|0);
HEAP32[$41>>2] = $4;
}
HEAP32[(8676)>>2] = $4;
___unlock(((8680)|0));
$$0 = $4;
}
}
STACKTOP = sp;return ($$0|0);
}
function ___fmodeflags($mode) {
$mode = $mode|0;
var $$ = 0, $$flags$4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $flags$0 = 0, $flags$0$ = 0, $flags$2 = 0;
var $flags$2$ = 0, $flags$4 = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_strchr($mode,43)|0);
$1 = ($0|0)==(0|0);
$2 = HEAP8[$mode>>0]|0;
$not$ = ($2<<24>>24)!=(114);
$$ = $not$&1;
$flags$0 = $1 ? $$ : 2;
$3 = (_strchr($mode,120)|0);
$4 = ($3|0)==(0|0);
$5 = $flags$0 | 128;
$flags$0$ = $4 ? $flags$0 : $5;
$6 = (_strchr($mode,101)|0);
$7 = ($6|0)==(0|0);
$8 = $flags$0$ | 524288;
$flags$2 = $7 ? $flags$0$ : $8;
$9 = ($2<<24>>24)==(114);
$10 = $flags$2 | 64;
$flags$2$ = $9 ? $flags$2 : $10;
$11 = ($2<<24>>24)==(119);
$12 = $flags$2$ | 512;
$flags$4 = $11 ? $12 : $flags$2$;
$13 = ($2<<24>>24)==(97);
$14 = $flags$4 | 1024;
$$flags$4 = $13 ? $14 : $flags$4;
return ($$flags$4|0);
}
function ___lockfile($f) {
$f = $f|0;
var label = 0, sp = 0;
sp = STACKTOP;
return 0;
}
function ___unlockfile($f) {
$f = $f|0;
var label = 0, sp = 0;
sp = STACKTOP;
return;
}
function ___overflow($f,$_c) {
$f = $f|0;
$_c = $_c|0;
var $$0 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$c = sp;
$0 = $_c&255;
HEAP8[$c>>0] = $0;
$1 = ((($f)) + 16|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)==(0|0);
if ($3) {
$4 = (___towrite($f)|0);
$5 = ($4|0)==(0);
if ($5) {
$$pre = HEAP32[$1>>2]|0;
$9 = $$pre;
label = 4;
} else {
$$0 = -1;
}
} else {
$9 = $2;
label = 4;
}
do {
if ((label|0) == 4) {
$6 = ((($f)) + 20|0);
$7 = HEAP32[$6>>2]|0;
$8 = ($7>>>0)<($9>>>0);
if ($8) {
$10 = $_c & 255;
$11 = ((($f)) + 75|0);
$12 = HEAP8[$11>>0]|0;
$13 = $12 << 24 >> 24;
$14 = ($10|0)==($13|0);
if (!($14)) {
$15 = ((($7)) + 1|0);
HEAP32[$6>>2] = $15;
HEAP8[$7>>0] = $0;
$$0 = $10;
break;
}
}
$16 = ((($f)) + 36|0);
$17 = HEAP32[$16>>2]|0;
$18 = (FUNCTION_TABLE_iiii[$17 & 15]($f,$c,1)|0);
$19 = ($18|0)==(1);
if ($19) {
$20 = HEAP8[$c>>0]|0;
$21 = $20&255;
$$0 = $21;
} else {
$$0 = -1;
}
}
} while(0);
STACKTOP = sp;return ($$0|0);
}
function ___stdio_close($f) {
$f = $f|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$vararg_buffer = sp;
$0 = ((($f)) + 60|0);
$1 = HEAP32[$0>>2]|0;
HEAP32[$vararg_buffer>>2] = $1;
$2 = (___syscall6(6,($vararg_buffer|0))|0);
$3 = (___syscall_ret($2)|0);
STACKTOP = sp;return ($3|0);
}
function ___stdio_read($f,$buf,$len) {
$f = $f|0;
$buf = $buf|0;
$len = $len|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0, $9 = 0, $cnt$0 = 0, $iov = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer = sp;
$iov = sp + 32|0;
HEAP32[$iov>>2] = $buf;
$0 = ((($iov)) + 4|0);
$1 = ((($f)) + 48|0);
$2 = HEAP32[$1>>2]|0;
$3 = ($2|0)!=(0);
$4 = $3&1;
$5 = (($len) - ($4))|0;
HEAP32[$0>>2] = $5;
$6 = ((($iov)) + 8|0);
$7 = ((($f)) + 44|0);
$8 = HEAP32[$7>>2]|0;
HEAP32[$6>>2] = $8;
$9 = ((($iov)) + 12|0);
HEAP32[$9>>2] = $2;
$10 = HEAP32[8652>>2]|0;
$11 = ($10|0)==(0|0);
if ($11) {
$16 = ((($f)) + 60|0);
$17 = HEAP32[$16>>2]|0;
HEAP32[$vararg_buffer3>>2] = $17;
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
HEAP32[$vararg_ptr6>>2] = $iov;
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
HEAP32[$vararg_ptr7>>2] = 2;
$18 = (___syscall145(145,($vararg_buffer3|0))|0);
$19 = (___syscall_ret($18)|0);
$cnt$0 = $19;
} else {
_pthread_cleanup_push((27|0),($f|0));
$12 = ((($f)) + 60|0);
$13 = HEAP32[$12>>2]|0;
HEAP32[$vararg_buffer>>2] = $13;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $iov;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = 2;
$14 = (___syscall145(145,($vararg_buffer|0))|0);
$15 = (___syscall_ret($14)|0);
_pthread_cleanup_pop(0);
$cnt$0 = $15;
}
$20 = ($cnt$0|0)<(1);
if ($20) {
$21 = $cnt$0 & 48;
$22 = $21 ^ 16;
$23 = HEAP32[$f>>2]|0;
$24 = $23 | $22;
HEAP32[$f>>2] = $24;
$25 = ((($f)) + 8|0);
HEAP32[$25>>2] = 0;
$26 = ((($f)) + 4|0);
HEAP32[$26>>2] = 0;
$$0 = $cnt$0;
} else {
$27 = HEAP32[$0>>2]|0;
$28 = ($cnt$0>>>0)>($27>>>0);
if ($28) {
$29 = (($cnt$0) - ($27))|0;
$30 = HEAP32[$7>>2]|0;
$31 = ((($f)) + 4|0);
HEAP32[$31>>2] = $30;
$32 = $30;
$33 = (($32) + ($29)|0);
$34 = ((($f)) + 8|0);
HEAP32[$34>>2] = $33;
$35 = HEAP32[$1>>2]|0;
$36 = ($35|0)==(0);
if ($36) {
$$0 = $len;
} else {
$37 = ((($32)) + 1|0);
HEAP32[$31>>2] = $37;
$38 = HEAP8[$32>>0]|0;
$39 = (($len) + -1)|0;
$40 = (($buf) + ($39)|0);
HEAP8[$40>>0] = $38;
$$0 = $len;
}
} else {
$$0 = $cnt$0;
}
}
STACKTOP = sp;return ($$0|0);
}
function ___stdio_seek($f,$off,$whence) {
$f = $f|0;
$off = $off|0;
$whence = $whence|0;
var $$pre = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $ret = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$vararg_buffer = sp;
$ret = sp + 20|0;
$0 = ((($f)) + 60|0);
$1 = HEAP32[$0>>2]|0;
HEAP32[$vararg_buffer>>2] = $1;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = 0;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = $off;
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
HEAP32[$vararg_ptr3>>2] = $ret;
$vararg_ptr4 = ((($vararg_buffer)) + 16|0);
HEAP32[$vararg_ptr4>>2] = $whence;
$2 = (___syscall140(140,($vararg_buffer|0))|0);
$3 = (___syscall_ret($2)|0);
$4 = ($3|0)<(0);
if ($4) {
HEAP32[$ret>>2] = -1;
$5 = -1;
} else {
$$pre = HEAP32[$ret>>2]|0;
$5 = $$pre;
}
STACKTOP = sp;return ($5|0);
}
function ___stdio_write($f,$buf,$len) {
$f = $f|0;
$buf = $buf|0;
$len = $len|0;
var $$0 = 0, $$phi$trans$insert = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cnt$0 = 0, $cnt$1 = 0, $iov$0 = 0, $iov$0$lcssa11 = 0, $iov$1 = 0, $iovcnt$0 = 0;
var $iovcnt$0$lcssa12 = 0, $iovcnt$1 = 0, $iovs = 0, $rem$0 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 48|0;
$vararg_buffer3 = sp + 16|0;
$vararg_buffer = sp;
$iovs = sp + 32|0;
$0 = ((($f)) + 28|0);
$1 = HEAP32[$0>>2]|0;
HEAP32[$iovs>>2] = $1;
$2 = ((($iovs)) + 4|0);
$3 = ((($f)) + 20|0);
$4 = HEAP32[$3>>2]|0;
$5 = $4;
$6 = (($5) - ($1))|0;
HEAP32[$2>>2] = $6;
$7 = ((($iovs)) + 8|0);
HEAP32[$7>>2] = $buf;
$8 = ((($iovs)) + 12|0);
HEAP32[$8>>2] = $len;
$9 = (($6) + ($len))|0;
$10 = ((($f)) + 60|0);
$11 = ((($f)) + 44|0);
$iov$0 = $iovs;$iovcnt$0 = 2;$rem$0 = $9;
while(1) {
$12 = HEAP32[8652>>2]|0;
$13 = ($12|0)==(0|0);
if ($13) {
$17 = HEAP32[$10>>2]|0;
HEAP32[$vararg_buffer3>>2] = $17;
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
HEAP32[$vararg_ptr6>>2] = $iov$0;
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
HEAP32[$vararg_ptr7>>2] = $iovcnt$0;
$18 = (___syscall146(146,($vararg_buffer3|0))|0);
$19 = (___syscall_ret($18)|0);
$cnt$0 = $19;
} else {
_pthread_cleanup_push((28|0),($f|0));
$14 = HEAP32[$10>>2]|0;
HEAP32[$vararg_buffer>>2] = $14;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = $iov$0;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = $iovcnt$0;
$15 = (___syscall146(146,($vararg_buffer|0))|0);
$16 = (___syscall_ret($15)|0);
_pthread_cleanup_pop(0);
$cnt$0 = $16;
}
$20 = ($rem$0|0)==($cnt$0|0);
if ($20) {
label = 6;
break;
}
$27 = ($cnt$0|0)<(0);
if ($27) {
$iov$0$lcssa11 = $iov$0;$iovcnt$0$lcssa12 = $iovcnt$0;
label = 8;
break;
}
$35 = (($rem$0) - ($cnt$0))|0;
$36 = ((($iov$0)) + 4|0);
$37 = HEAP32[$36>>2]|0;
$38 = ($cnt$0>>>0)>($37>>>0);
if ($38) {
$39 = HEAP32[$11>>2]|0;
HEAP32[$0>>2] = $39;
HEAP32[$3>>2] = $39;
$40 = (($cnt$0) - ($37))|0;
$41 = ((($iov$0)) + 8|0);
$42 = (($iovcnt$0) + -1)|0;
$$phi$trans$insert = ((($iov$0)) + 12|0);
$$pre = HEAP32[$$phi$trans$insert>>2]|0;
$50 = $$pre;$cnt$1 = $40;$iov$1 = $41;$iovcnt$1 = $42;
} else {
$43 = ($iovcnt$0|0)==(2);
if ($43) {
$44 = HEAP32[$0>>2]|0;
$45 = (($44) + ($cnt$0)|0);
HEAP32[$0>>2] = $45;
$50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = 2;
} else {
$50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = $iovcnt$0;
}
}
$46 = HEAP32[$iov$1>>2]|0;
$47 = (($46) + ($cnt$1)|0);
HEAP32[$iov$1>>2] = $47;
$48 = ((($iov$1)) + 4|0);
$49 = (($50) - ($cnt$1))|0;
HEAP32[$48>>2] = $49;
$iov$0 = $iov$1;$iovcnt$0 = $iovcnt$1;$rem$0 = $35;
}
if ((label|0) == 6) {
$21 = HEAP32[$11>>2]|0;
$22 = ((($f)) + 48|0);
$23 = HEAP32[$22>>2]|0;
$24 = (($21) + ($23)|0);
$25 = ((($f)) + 16|0);
HEAP32[$25>>2] = $24;
$26 = $21;
HEAP32[$0>>2] = $26;
HEAP32[$3>>2] = $26;
$$0 = $len;
}
else if ((label|0) == 8) {
$28 = ((($f)) + 16|0);
HEAP32[$28>>2] = 0;
HEAP32[$0>>2] = 0;
HEAP32[$3>>2] = 0;
$29 = HEAP32[$f>>2]|0;
$30 = $29 | 32;
HEAP32[$f>>2] = $30;
$31 = ($iovcnt$0$lcssa12|0)==(2);
if ($31) {
$$0 = 0;
} else {
$32 = ((($iov$0$lcssa11)) + 4|0);
$33 = HEAP32[$32>>2]|0;
$34 = (($len) - ($33))|0;
$$0 = $34;
}
}
STACKTOP = sp;return ($$0|0);
}
function ___stdout_write($f,$buf,$len) {
$f = $f|0;
$buf = $buf|0;
$len = $len|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tio = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 80|0;
$vararg_buffer = sp;
$tio = sp + 12|0;
$0 = ((($f)) + 36|0);
HEAP32[$0>>2] = 8;
$1 = HEAP32[$f>>2]|0;
$2 = $1 & 64;
$3 = ($2|0)==(0);
if ($3) {
$4 = ((($f)) + 60|0);
$5 = HEAP32[$4>>2]|0;
HEAP32[$vararg_buffer>>2] = $5;
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
HEAP32[$vararg_ptr1>>2] = 21505;
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
HEAP32[$vararg_ptr2>>2] = $tio;
$6 = (___syscall54(54,($vararg_buffer|0))|0);
$7 = ($6|0)==(0);
if (!($7)) {
$8 = ((($f)) + 75|0);
HEAP8[$8>>0] = -1;
}
}
$9 = (___stdio_write($f,$buf,$len)|0);
STACKTOP = sp;return ($9|0);
}
function ___string_read($f,$buf,$len) {
$f = $f|0;
$buf = $buf|0;
$len = $len|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$0$len = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 84|0);
$1 = HEAP32[$0>>2]|0;
$2 = (($len) + 256)|0;
$3 = (_memchr($1,0,$2)|0);
$4 = ($3|0)==(0|0);
$5 = $3;
$6 = $1;
$7 = (($5) - ($6))|0;
$k$0 = $4 ? $2 : $7;
$8 = ($k$0>>>0)<($len>>>0);
$k$0$len = $8 ? $k$0 : $len;
_memcpy(($buf|0),($1|0),($k$0$len|0))|0;
$9 = (($1) + ($k$0$len)|0);
$10 = ((($f)) + 4|0);
HEAP32[$10>>2] = $9;
$11 = (($1) + ($k$0)|0);
$12 = ((($f)) + 8|0);
HEAP32[$12>>2] = $11;
HEAP32[$0>>2] = $11;
return ($k$0$len|0);
}
function ___toread($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 74|0);
$1 = HEAP8[$0>>0]|0;
$2 = $1 << 24 >> 24;
$3 = (($2) + 255)|0;
$4 = $3 | $2;
$5 = $4&255;
HEAP8[$0>>0] = $5;
$6 = ((($f)) + 20|0);
$7 = HEAP32[$6>>2]|0;
$8 = ((($f)) + 44|0);
$9 = HEAP32[$8>>2]|0;
$10 = ($7>>>0)>($9>>>0);
if ($10) {
$11 = ((($f)) + 36|0);
$12 = HEAP32[$11>>2]|0;
(FUNCTION_TABLE_iiii[$12 & 15]($f,0,0)|0);
}
$13 = ((($f)) + 16|0);
HEAP32[$13>>2] = 0;
$14 = ((($f)) + 28|0);
HEAP32[$14>>2] = 0;
HEAP32[$6>>2] = 0;
$15 = HEAP32[$f>>2]|0;
$16 = $15 & 20;
$17 = ($16|0)==(0);
if ($17) {
$21 = HEAP32[$8>>2]|0;
$22 = ((($f)) + 8|0);
HEAP32[$22>>2] = $21;
$23 = ((($f)) + 4|0);
HEAP32[$23>>2] = $21;
$$0 = 0;
} else {
$18 = $15 & 4;
$19 = ($18|0)==(0);
if ($19) {
$$0 = -1;
} else {
$20 = $15 | 32;
HEAP32[$f>>2] = $20;
$$0 = -1;
}
}
return ($$0|0);
}
function ___towrite($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 74|0);
$1 = HEAP8[$0>>0]|0;
$2 = $1 << 24 >> 24;
$3 = (($2) + 255)|0;
$4 = $3 | $2;
$5 = $4&255;
HEAP8[$0>>0] = $5;
$6 = HEAP32[$f>>2]|0;
$7 = $6 & 8;
$8 = ($7|0)==(0);
if ($8) {
$10 = ((($f)) + 8|0);
HEAP32[$10>>2] = 0;
$11 = ((($f)) + 4|0);
HEAP32[$11>>2] = 0;
$12 = ((($f)) + 44|0);
$13 = HEAP32[$12>>2]|0;
$14 = ((($f)) + 28|0);
HEAP32[$14>>2] = $13;
$15 = ((($f)) + 20|0);
HEAP32[$15>>2] = $13;
$16 = $13;
$17 = ((($f)) + 48|0);
$18 = HEAP32[$17>>2]|0;
$19 = (($16) + ($18)|0);
$20 = ((($f)) + 16|0);
HEAP32[$20>>2] = $19;
$$0 = 0;
} else {
$9 = $6 | 32;
HEAP32[$f>>2] = $9;
$$0 = -1;
}
return ($$0|0);
}
function ___uflow($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 16|0;
$c = sp;
$0 = ((($f)) + 8|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$3 = (___toread($f)|0);
$4 = ($3|0)==(0);
if ($4) {
label = 3;
} else {
$$0 = -1;
}
} else {
label = 3;
}
if ((label|0) == 3) {
$5 = ((($f)) + 32|0);
$6 = HEAP32[$5>>2]|0;
$7 = (FUNCTION_TABLE_iiii[$6 & 15]($f,$c,1)|0);
$8 = ($7|0)==(1);
if ($8) {
$9 = HEAP8[$c>>0]|0;
$10 = $9&255;
$$0 = $10;
} else {
$$0 = -1;
}
}
STACKTOP = sp;return ($$0|0);
}
function _qsort($base,$nel,$width,$cmp) {
$base = $base|0;
$nel = $nel|0;
$width = $width|0;
$cmp = $cmp|0;
var $$0$i = 0, $$0$i30 = 0, $$02$i$i = 0, $$02$i3$i = 0, $$lcssa = 0, $$lcssa57 = 0, $$phi$trans$insert$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i11 = 0, $$pre$i20 = 0, $$pre$i5 = 0, $$pre$i8 = 0, $$pre1$i = 0, $$pre1$i12 = 0, $$pre1$i27$pre = 0, $$pre1$i6 = 0, $$pre1$i9 = 0, $$sum = 0, $$sum2 = 0;
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
var $116 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $8$phi = 0, $80 = 0, $81 = 0, $82 = 0;
var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $head$0$lcssa = 0, $head$036 = 0;
var $head$1$be = 0, $head$153 = 0, $i$0 = 0, $lp = 0, $nTrailingZeros$03$i$i = 0, $nTrailingZeros$03$i2$i = 0, $nTrailingZeros$03$i2$i$lcssa = 0, $or$cond = 0, $or$cond48 = 0, $or$cond4852 = 0, $or$cond51 = 0, $p = 0, $pshift$0$lcssa = 0, $pshift$037 = 0, $pshift$1 = 0, $pshift$2$be = 0, $pshift$254 = 0, $sum = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 208|0;
$lp = sp + 8|0;
$p = sp;
$0 = Math_imul($width, $nel)|0;
$1 = $p;
$2 = $1;
HEAP32[$2>>2] = 1;
$3 = (($1) + 4)|0;
$4 = $3;
HEAP32[$4>>2] = 0;
$5 = ($0|0)==(0);
if (!($5)) {
$$sum = (($0) - ($width))|0;
$6 = ((($lp)) + 4|0);
HEAP32[$6>>2] = $width;
HEAP32[$lp>>2] = $width;
$10 = $width;$8 = $width;$i$0 = 2;
while(1) {
$7 = (($8) + ($width))|0;
$9 = (($7) + ($10))|0;
$11 = (($lp) + ($i$0<<2)|0);
HEAP32[$11>>2] = $9;
$12 = ($9>>>0)<($0>>>0);
$13 = (($i$0) + 1)|0;
if ($12) {
$8$phi = $10;$10 = $9;$i$0 = $13;$8 = $8$phi;
} else {
break;
}
}
$14 = (0 - ($width))|0;
$15 = (($base) + ($$sum)|0);
$16 = ($$sum|0)>(0);
$$phi$trans$insert$i = ((($p)) + 4|0);
if ($16) {
$17 = $15;
$19 = 1;$head$036 = $base;$pshift$037 = 1;
while(1) {
$18 = $19 & 3;
$20 = ($18|0)==(3);
do {
if ($20) {
_sift($head$036,$width,$cmp,$pshift$037,$lp);
$$pre$i = HEAP32[$p>>2]|0;
$$pre1$i = HEAP32[$$phi$trans$insert$i>>2]|0;
$21 = $$pre$i >>> 2;
$22 = $$pre1$i << 30;
$23 = $22 | $21;
HEAP32[$p>>2] = $23;
$24 = $$pre1$i >>> 2;
HEAP32[$$phi$trans$insert$i>>2] = $24;
$25 = (($pshift$037) + 2)|0;
$48 = $23;$pshift$1 = $25;
} else {
$26 = (($pshift$037) + -1)|0;
$27 = (($lp) + ($26<<2)|0);
$28 = HEAP32[$27>>2]|0;
$29 = $head$036;
$30 = (($17) - ($29))|0;
$31 = ($28>>>0)<($30>>>0);
if ($31) {
_sift($head$036,$width,$cmp,$pshift$037,$lp);
} else {
_trinkle($head$036,$width,$cmp,$p,$pshift$037,0,$lp);
}
$32 = ($pshift$037|0)==(1);
if ($32) {
$$pre$i5 = HEAP32[$$phi$trans$insert$i>>2]|0;
$$pre1$i6 = HEAP32[$p>>2]|0;
$33 = $$pre$i5 << 1;
$34 = $$pre1$i6 >>> 31;
$35 = $34 | $33;
HEAP32[$$phi$trans$insert$i>>2] = $35;
$36 = $$pre1$i6 << 1;
HEAP32[$p>>2] = $36;
$48 = $36;$pshift$1 = 0;
break;
}
$37 = ($26>>>0)>(31);
if ($37) {
$38 = (($pshift$037) + -33)|0;
$39 = HEAP32[$p>>2]|0;
HEAP32[$$phi$trans$insert$i>>2] = $39;
HEAP32[$p>>2] = 0;
$$0$i = $38;$41 = $39;$44 = 0;
} else {
$$pre$i11 = HEAP32[$$phi$trans$insert$i>>2]|0;
$$pre1$i12 = HEAP32[$p>>2]|0;
$$0$i = $26;$41 = $$pre$i11;$44 = $$pre1$i12;
}
$40 = $41 << $$0$i;
$42 = (32 - ($$0$i))|0;
$43 = $44 >>> $42;
$45 = $43 | $40;
HEAP32[$$phi$trans$insert$i>>2] = $45;
$46 = $44 << $$0$i;
HEAP32[$p>>2] = $46;
$48 = $46;$pshift$1 = 1;
}
} while(0);
$47 = $48 | 1;
HEAP32[$p>>2] = $47;
$49 = (($head$036) + ($width)|0);
$50 = ($49>>>0)<($15>>>0);
if ($50) {
$19 = $47;$head$036 = $49;$pshift$037 = $pshift$1;
} else {
$head$0$lcssa = $49;$pshift$0$lcssa = $pshift$1;
break;
}
}
} else {
$head$0$lcssa = $base;$pshift$0$lcssa = 1;
}
_trinkle($head$0$lcssa,$width,$cmp,$p,$pshift$0$lcssa,0,$lp);
$51 = ((($p)) + 4|0);
$52 = ($pshift$0$lcssa|0)==(1);
$53 = HEAP32[$p>>2]|0;
$54 = ($53|0)==(1);
$or$cond51 = $52 & $54;
$55 = HEAP32[$51>>2]|0;
$56 = ($55|0)==(0);
$or$cond4852 = $or$cond51 & $56;
if (!($or$cond4852)) {
$59 = $53;$head$153 = $head$0$lcssa;$pshift$254 = $pshift$0$lcssa;
while(1) {
$57 = ($pshift$254|0)<(2);
if ($57) {
$58 = (($59) + -1)|0;
$60 = ($58|0)==(0);
do {
if ($60) {
$81 = 32;
label = 30;
} else {
$61 = $58 & 1;
$62 = ($61|0)==(0);
if ($62) {
$$02$i$i = $58;$nTrailingZeros$03$i$i = 0;
while(1) {
$63 = (($nTrailingZeros$03$i$i) + 1)|0;
$64 = $$02$i$i >>> 1;
$65 = $64 & 1;
$66 = ($65|0)==(0);
if ($66) {
$$02$i$i = $64;$nTrailingZeros$03$i$i = $63;
} else {
$$lcssa = $63;
break;
}
}
$67 = ($$lcssa|0)==(0);
if ($67) {
label = 24;
} else {
$78 = $$lcssa;
}
} else {
label = 24;
}
if ((label|0) == 24) {
label = 0;
$68 = HEAP32[$$phi$trans$insert$i>>2]|0;
$69 = ($68|0)==(0);
if ($69) {
$81 = 64;
label = 30;
break;
}
$70 = $68 & 1;
$71 = ($70|0)==(0);
if ($71) {
$$02$i3$i = $68;$nTrailingZeros$03$i2$i = 0;
} else {
$$0$i30 = 0;$84 = $59;$87 = $68;$91 = 0;
break;
}
while(1) {
$72 = (($nTrailingZeros$03$i2$i) + 1)|0;
$73 = $$02$i3$i >>> 1;
$74 = $73 & 1;
$75 = ($74|0)==(0);
if ($75) {
$$02$i3$i = $73;$nTrailingZeros$03$i2$i = $72;
} else {
$$lcssa57 = $72;$nTrailingZeros$03$i2$i$lcssa = $nTrailingZeros$03$i2$i;
break;
}
}
$76 = (($nTrailingZeros$03$i2$i$lcssa) + 33)|0;
$77 = ($$lcssa57|0)==(0);
if ($77) {
$$0$i30 = 0;$84 = $59;$87 = $68;$91 = 0;
break;
} else {
$78 = $76;
}
}
$79 = ($78>>>0)>(31);
if ($79) {
$81 = $78;
label = 30;
} else {
$$pre1$i27$pre = HEAP32[$$phi$trans$insert$i>>2]|0;
$$0$i30 = $78;$84 = $59;$87 = $$pre1$i27$pre;$91 = $78;
}
}
} while(0);
if ((label|0) == 30) {
label = 0;
$80 = (($81) + -32)|0;
$82 = HEAP32[$$phi$trans$insert$i>>2]|0;
HEAP32[$p>>2] = $82;
HEAP32[$$phi$trans$insert$i>>2] = 0;
$$0$i30 = $80;$84 = $82;$87 = 0;$91 = $81;
}
$83 = $84 >>> $$0$i30;
$85 = (32 - ($$0$i30))|0;
$86 = $87 << $85;
$88 = $86 | $83;
HEAP32[$p>>2] = $88;
$89 = $87 >>> $$0$i30;
HEAP32[$$phi$trans$insert$i>>2] = $89;
$90 = (($91) + ($pshift$254))|0;
$$pre = (($head$153) + ($14)|0);
$head$1$be = $$pre;$pshift$2$be = $90;
} else {
$$pre$i20 = HEAP32[$$phi$trans$insert$i>>2]|0;
$92 = $$pre$i20 << 2;
$93 = $59 >>> 30;
$94 = $93 | $92;
$95 = (($pshift$254) + -2)|0;
$96 = $59 << 1;
$97 = $96 & 2147483646;
$98 = $93 << 31;
$99 = $97 | $98;
$100 = $99 ^ 3;
HEAP32[$p>>2] = $100;
$101 = $94 >>> 1;
HEAP32[$$phi$trans$insert$i>>2] = $101;
$102 = (($lp) + ($95<<2)|0);
$103 = HEAP32[$102>>2]|0;
$sum = (($103) + ($width))|0;
$$sum2 = (0 - ($sum))|0;
$104 = (($head$153) + ($$sum2)|0);
$105 = (($pshift$254) + -1)|0;
_trinkle($104,$width,$cmp,$p,$105,1,$lp);
$$pre$i8 = HEAP32[$$phi$trans$insert$i>>2]|0;
$$pre1$i9 = HEAP32[$p>>2]|0;
$106 = $$pre$i8 << 1;
$107 = $$pre1$i9 >>> 31;
$108 = $107 | $106;
HEAP32[$$phi$trans$insert$i>>2] = $108;
$109 = $$pre1$i9 << 1;
$110 = $109 | 1;
HEAP32[$p>>2] = $110;
$111 = (($head$153) + ($14)|0);
_trinkle($111,$width,$cmp,$p,$95,1,$lp);
$head$1$be = $111;$pshift$2$be = $95;
}
$112 = ($pshift$2$be|0)==(1);
$113 = HEAP32[$p>>2]|0;
$114 = ($113|0)==(1);
$or$cond = $112 & $114;
$115 = HEAP32[$51>>2]|0;
$116 = ($115|0)==(0);
$or$cond48 = $or$cond & $116;
if ($or$cond48) {
break;
} else {
$59 = $113;$head$153 = $head$1$be;$pshift$254 = $pshift$2$be;
}
}
}
}
STACKTOP = sp;return;
}
function _memchr($src,$c,$n) {
$src = $src|0;
$c = $c|0;
$n = $n|0;
var $$0$lcssa = 0, $$0$lcssa44 = 0, $$019 = 0, $$1$lcssa = 0, $$110 = 0, $$110$lcssa = 0, $$24 = 0, $$3 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, $s$0$lcssa = 0, $s$0$lcssa43 = 0, $s$020 = 0, $s$15 = 0, $s$2 = 0, $w$0$lcssa = 0, $w$011 = 0, $w$011$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $c & 255;
$1 = $src;
$2 = $1 & 3;
$3 = ($2|0)!=(0);
$4 = ($n|0)!=(0);
$or$cond18 = $4 & $3;
L1: do {
if ($or$cond18) {
$5 = $c&255;
$$019 = $n;$s$020 = $src;
while(1) {
$6 = HEAP8[$s$020>>0]|0;
$7 = ($6<<24>>24)==($5<<24>>24);
if ($7) {
$$0$lcssa44 = $$019;$s$0$lcssa43 = $s$020;
label = 6;
break L1;
}
$8 = ((($s$020)) + 1|0);
$9 = (($$019) + -1)|0;
$10 = $8;
$11 = $10 & 3;
$12 = ($11|0)!=(0);
$13 = ($9|0)!=(0);
$or$cond = $13 & $12;
if ($or$cond) {
$$019 = $9;$s$020 = $8;
} else {
$$0$lcssa = $9;$$lcssa = $13;$s$0$lcssa = $8;
label = 5;
break;
}
}
} else {
$$0$lcssa = $n;$$lcssa = $4;$s$0$lcssa = $src;
label = 5;
}
} while(0);
if ((label|0) == 5) {
if ($$lcssa) {
$$0$lcssa44 = $$0$lcssa;$s$0$lcssa43 = $s$0$lcssa;
label = 6;
} else {
$$3 = 0;$s$2 = $s$0$lcssa;
}
}
L8: do {
if ((label|0) == 6) {
$14 = HEAP8[$s$0$lcssa43>>0]|0;
$15 = $c&255;
$16 = ($14<<24>>24)==($15<<24>>24);
if ($16) {
$$3 = $$0$lcssa44;$s$2 = $s$0$lcssa43;
} else {
$17 = Math_imul($0, 16843009)|0;
$18 = ($$0$lcssa44>>>0)>(3);
L11: do {
if ($18) {
$$110 = $$0$lcssa44;$w$011 = $s$0$lcssa43;
while(1) {
$19 = HEAP32[$w$011>>2]|0;
$20 = $19 ^ $17;
$21 = (($20) + -16843009)|0;
$22 = $20 & -2139062144;
$23 = $22 ^ -2139062144;
$24 = $23 & $21;
$25 = ($24|0)==(0);
if (!($25)) {
$$110$lcssa = $$110;$w$011$lcssa = $w$011;
break;
}
$26 = ((($w$011)) + 4|0);
$27 = (($$110) + -4)|0;
$28 = ($27>>>0)>(3);
if ($28) {
$$110 = $27;$w$011 = $26;
} else {
$$1$lcssa = $27;$w$0$lcssa = $26;
label = 11;
break L11;
}
}
$$24 = $$110$lcssa;$s$15 = $w$011$lcssa;
} else {
$$1$lcssa = $$0$lcssa44;$w$0$lcssa = $s$0$lcssa43;
label = 11;
}
} while(0);
if ((label|0) == 11) {
$29 = ($$1$lcssa|0)==(0);
if ($29) {
$$3 = 0;$s$2 = $w$0$lcssa;
break;
} else {
$$24 = $$1$lcssa;$s$15 = $w$0$lcssa;
}
}
while(1) {
$30 = HEAP8[$s$15>>0]|0;
$31 = ($30<<24>>24)==($15<<24>>24);
if ($31) {
$$3 = $$24;$s$2 = $s$15;
break L8;
}
$32 = ((($s$15)) + 1|0);
$33 = (($$24) + -1)|0;
$34 = ($33|0)==(0);
if ($34) {
$$3 = 0;$s$2 = $32;
break;
} else {
$$24 = $33;$s$15 = $32;
}
}
}
}
} while(0);
$35 = ($$3|0)!=(0);
$36 = $35 ? $s$2 : 0;
return ($36|0);
}
function _memcmp($vl,$vr,$n) {
$vl = $vl|0;
$vr = $vr|0;
$n = $n|0;
var $$03 = 0, $$lcssa = 0, $$lcssa19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $l$04 = 0, $r$05 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($n|0)==(0);
L1: do {
if ($0) {
$11 = 0;
} else {
$$03 = $n;$l$04 = $vl;$r$05 = $vr;
while(1) {
$1 = HEAP8[$l$04>>0]|0;
$2 = HEAP8[$r$05>>0]|0;
$3 = ($1<<24>>24)==($2<<24>>24);
if (!($3)) {
$$lcssa = $1;$$lcssa19 = $2;
break;
}
$4 = (($$03) + -1)|0;
$5 = ((($l$04)) + 1|0);
$6 = ((($r$05)) + 1|0);
$7 = ($4|0)==(0);
if ($7) {
$11 = 0;
break L1;
} else {
$$03 = $4;$l$04 = $5;$r$05 = $6;
}
}
$8 = $$lcssa&255;
$9 = $$lcssa19&255;
$10 = (($8) - ($9))|0;
$11 = $10;
}
} while(0);
return ($11|0);
}
function ___memrchr($m,$c,$n) {
$m = $m|0;
$c = $c|0;
$n = $n|0;
var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $c&255;
$$01 = $n;
while(1) {
$1 = (($$01) + -1)|0;
$2 = ($$01|0)==(0);
if ($2) {
$$0 = 0;
break;
}
$3 = (($m) + ($1)|0);
$4 = HEAP8[$3>>0]|0;
$5 = ($4<<24>>24)==($0<<24>>24);
if ($5) {
$$0 = $3;
break;
} else {
$$01 = $1;
}
}
return ($$0|0);
}
function ___stpcpy($d,$s) {
$d = $d|0;
$s = $s|0;
var $$0$lcssa = 0, $$01$lcssa = 0, $$0115 = 0, $$016 = 0, $$03 = 0, $$1$ph = 0, $$12$ph = 0, $$128 = 0, $$19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $wd$0$lcssa = 0, $wd$010 = 0, $ws$0$lcssa = 0, $ws$011 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $s;
$1 = $d;
$2 = $0 ^ $1;
$3 = $2 & 3;
$4 = ($3|0)==(0);
L1: do {
if ($4) {
$5 = $0 & 3;
$6 = ($5|0)==(0);
if ($6) {
$$0$lcssa = $s;$$01$lcssa = $d;
} else {
$$0115 = $d;$$016 = $s;
while(1) {
$7 = HEAP8[$$016>>0]|0;
HEAP8[$$0115>>0] = $7;
$8 = ($7<<24>>24)==(0);
if ($8) {
$$03 = $$0115;
break L1;
}
$9 = ((($$016)) + 1|0);
$10 = ((($$0115)) + 1|0);
$11 = $9;
$12 = $11 & 3;
$13 = ($12|0)==(0);
if ($13) {
$$0$lcssa = $9;$$01$lcssa = $10;
break;
} else {
$$0115 = $10;$$016 = $9;
}
}
}
$14 = HEAP32[$$0$lcssa>>2]|0;
$15 = (($14) + -16843009)|0;
$16 = $14 & -2139062144;
$17 = $16 ^ -2139062144;
$18 = $17 & $15;
$19 = ($18|0)==(0);
if ($19) {
$22 = $14;$wd$010 = $$01$lcssa;$ws$011 = $$0$lcssa;
while(1) {
$20 = ((($ws$011)) + 4|0);
$21 = ((($wd$010)) + 4|0);
HEAP32[$wd$010>>2] = $22;
$23 = HEAP32[$20>>2]|0;
$24 = (($23) + -16843009)|0;
$25 = $23 & -2139062144;
$26 = $25 ^ -2139062144;
$27 = $26 & $24;
$28 = ($27|0)==(0);
if ($28) {
$22 = $23;$wd$010 = $21;$ws$011 = $20;
} else {
$wd$0$lcssa = $21;$ws$0$lcssa = $20;
break;
}
}
} else {
$wd$0$lcssa = $$01$lcssa;$ws$0$lcssa = $$0$lcssa;
}
$$1$ph = $ws$0$lcssa;$$12$ph = $wd$0$lcssa;
label = 8;
} else {
$$1$ph = $s;$$12$ph = $d;
label = 8;
}
} while(0);
if ((label|0) == 8) {
$29 = HEAP8[$$1$ph>>0]|0;
HEAP8[$$12$ph>>0] = $29;
$30 = ($29<<24>>24)==(0);
if ($30) {
$$03 = $$12$ph;
} else {
$$128 = $$12$ph;$$19 = $$1$ph;
while(1) {
$31 = ((($$19)) + 1|0);
$32 = ((($$128)) + 1|0);
$33 = HEAP8[$31>>0]|0;
HEAP8[$32>>0] = $33;
$34 = ($33<<24>>24)==(0);
if ($34) {
$$03 = $32;
break;
} else {
$$128 = $32;$$19 = $31;
}
}
}
}
return ($$03|0);
}
function _strcat($dest,$src) {
$dest = $dest|0;
$src = $src|0;
var $0 = 0, $1 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_strlen($dest)|0);
$1 = (($dest) + ($0)|0);
(_strcpy($1,$src)|0);
return ($dest|0);
}
function _strchr($s,$c) {
$s = $s|0;
$c = $c|0;
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (___strchrnul($s,$c)|0);
$1 = HEAP8[$0>>0]|0;
$2 = $c&255;
$3 = ($1<<24>>24)==($2<<24>>24);
$4 = $3 ? $0 : 0;
return ($4|0);
}
function ___strchrnul($s,$c) {
$s = $s|0;
$c = $c|0;
var $$0 = 0, $$02$lcssa = 0, $$0211 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond5 = 0, $w$0$lcssa = 0, $w$08 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $c & 255;
$1 = ($0|0)==(0);
L1: do {
if ($1) {
$6 = (_strlen($s)|0);
$7 = (($s) + ($6)|0);
$$0 = $7;
} else {
$2 = $s;
$3 = $2 & 3;
$4 = ($3|0)==(0);
if ($4) {
$$02$lcssa = $s;
} else {
$5 = $c&255;
$$0211 = $s;
while(1) {
$8 = HEAP8[$$0211>>0]|0;
$9 = ($8<<24>>24)==(0);
$10 = ($8<<24>>24)==($5<<24>>24);
$or$cond = $9 | $10;
if ($or$cond) {
$$0 = $$0211;
break L1;
}
$11 = ((($$0211)) + 1|0);
$12 = $11;
$13 = $12 & 3;
$14 = ($13|0)==(0);
if ($14) {
$$02$lcssa = $11;
break;
} else {
$$0211 = $11;
}
}
}
$15 = Math_imul($0, 16843009)|0;
$16 = HEAP32[$$02$lcssa>>2]|0;
$17 = (($16) + -16843009)|0;
$18 = $16 & -2139062144;
$19 = $18 ^ -2139062144;
$20 = $19 & $17;
$21 = ($20|0)==(0);
L10: do {
if ($21) {
$23 = $16;$w$08 = $$02$lcssa;
while(1) {
$22 = $23 ^ $15;
$24 = (($22) + -16843009)|0;
$25 = $22 & -2139062144;
$26 = $25 ^ -2139062144;
$27 = $26 & $24;
$28 = ($27|0)==(0);
if (!($28)) {
$w$0$lcssa = $w$08;
break L10;
}
$29 = ((($w$08)) + 4|0);
$30 = HEAP32[$29>>2]|0;
$31 = (($30) + -16843009)|0;
$32 = $30 & -2139062144;
$33 = $32 ^ -2139062144;
$34 = $33 & $31;
$35 = ($34|0)==(0);
if ($35) {
$23 = $30;$w$08 = $29;
} else {
$w$0$lcssa = $29;
break;
}
}
} else {
$w$0$lcssa = $$02$lcssa;
}
} while(0);
$36 = $c&255;
$$1 = $w$0$lcssa;
while(1) {
$37 = HEAP8[$$1>>0]|0;
$38 = ($37<<24>>24)==(0);
$39 = ($37<<24>>24)==($36<<24>>24);
$or$cond5 = $38 | $39;
$40 = ((($$1)) + 1|0);
if ($or$cond5) {
$$0 = $$1;
break;
} else {
$$1 = $40;
}
}
}
} while(0);
return ($$0|0);
}
function _strcmp($l,$r) {
$l = $l|0;
$r = $r|0;
var $$014 = 0, $$05 = 0, $$lcssa = 0, $$lcssa2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0;
var sp = 0;
sp = STACKTOP;
$0 = HEAP8[$l>>0]|0;
$1 = HEAP8[$r>>0]|0;
$2 = ($0<<24>>24)!=($1<<24>>24);
$3 = ($0<<24>>24)==(0);
$or$cond3 = $3 | $2;
if ($or$cond3) {
$$lcssa = $0;$$lcssa2 = $1;
} else {
$$014 = $l;$$05 = $r;
while(1) {
$4 = ((($$014)) + 1|0);
$5 = ((($$05)) + 1|0);
$6 = HEAP8[$4>>0]|0;
$7 = HEAP8[$5>>0]|0;
$8 = ($6<<24>>24)!=($7<<24>>24);
$9 = ($6<<24>>24)==(0);
$or$cond = $9 | $8;
if ($or$cond) {
$$lcssa = $6;$$lcssa2 = $7;
break;
} else {
$$014 = $4;$$05 = $5;
}
}
}
$10 = $$lcssa&255;
$11 = $$lcssa2&255;
$12 = (($10) - ($11))|0;
return ($12|0);
}
function _strcpy($dest,$src) {
$dest = $dest|0;
$src = $src|0;
var label = 0, sp = 0;
sp = STACKTOP;
(___stpcpy($dest,$src)|0);
return ($dest|0);
}
function _strcspn($s,$c) {
$s = $s|0;
$c = $c|0;
var $$0 = 0, $$027 = 0, $$03$lcssa = 0, $$035 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$byteset = sp;
$0 = HEAP8[$c>>0]|0;
$1 = ($0<<24>>24)==(0);
if ($1) {
label = 3;
} else {
$2 = ((($c)) + 1|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($3<<24>>24)==(0);
if ($4) {
label = 3;
} else {
;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0;
$$027 = $c;$13 = $0;
while(1) {
$12 = $13 & 31;
$14 = $12&255;
$15 = 1 << $14;
$div4 = ($13&255) >>> 5;
$16 = $div4&255;
$17 = (($byteset) + ($16<<2)|0);
$18 = HEAP32[$17>>2]|0;
$19 = $18 | $15;
HEAP32[$17>>2] = $19;
$20 = ((($$027)) + 1|0);
$21 = HEAP8[$20>>0]|0;
$22 = ($21<<24>>24)==(0);
if ($22) {
break;
} else {
$$027 = $20;$13 = $21;
}
}
$10 = HEAP8[$s>>0]|0;
$11 = ($10<<24>>24)==(0);
L7: do {
if ($11) {
$$03$lcssa = $s;
} else {
$$035 = $s;$23 = $10;
while(1) {
$div = ($23&255) >>> 5;
$24 = $div&255;
$25 = (($byteset) + ($24<<2)|0);
$26 = HEAP32[$25>>2]|0;
$27 = $23 & 31;
$28 = $27&255;
$29 = 1 << $28;
$30 = $26 & $29;
$31 = ($30|0)==(0);
if (!($31)) {
$$03$lcssa = $$035;
break L7;
}
$32 = ((($$035)) + 1|0);
$33 = HEAP8[$32>>0]|0;
$34 = ($33<<24>>24)==(0);
if ($34) {
$$03$lcssa = $32;
break;
} else {
$$035 = $32;$23 = $33;
}
}
}
} while(0);
$35 = $$03$lcssa;
$36 = $s;
$37 = (($35) - ($36))|0;
$$0 = $37;
}
}
if ((label|0) == 3) {
$5 = $0 << 24 >> 24;
$6 = (___strchrnul($s,$5)|0);
$7 = $6;
$8 = $s;
$9 = (($7) - ($8))|0;
$$0 = $9;
}
STACKTOP = sp;return ($$0|0);
}
function _strlen($s) {
$s = $s|0;
var $$0 = 0, $$01$lcssa = 0, $$014 = 0, $$1$lcssa = 0, $$lcssa20 = 0, $$pn = 0, $$pn15 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
var $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $w$0 = 0, $w$0$lcssa = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = $s;
$1 = $0 & 3;
$2 = ($1|0)==(0);
L1: do {
if ($2) {
$$01$lcssa = $s;
label = 4;
} else {
$$014 = $s;$21 = $0;
while(1) {
$3 = HEAP8[$$014>>0]|0;
$4 = ($3<<24>>24)==(0);
if ($4) {
$$pn = $21;
break L1;
}
$5 = ((($$014)) + 1|0);
$6 = $5;
$7 = $6 & 3;
$8 = ($7|0)==(0);
if ($8) {
$$01$lcssa = $5;
label = 4;
break;
} else {
$$014 = $5;$21 = $6;
}
}
}
} while(0);
if ((label|0) == 4) {
$w$0 = $$01$lcssa;
while(1) {
$9 = HEAP32[$w$0>>2]|0;
$10 = (($9) + -16843009)|0;
$11 = $9 & -2139062144;
$12 = $11 ^ -2139062144;
$13 = $12 & $10;
$14 = ($13|0)==(0);
$15 = ((($w$0)) + 4|0);
if ($14) {
$w$0 = $15;
} else {
$$lcssa20 = $9;$w$0$lcssa = $w$0;
break;
}
}
$16 = $$lcssa20&255;
$17 = ($16<<24>>24)==(0);
if ($17) {
$$1$lcssa = $w$0$lcssa;
} else {
$$pn15 = $w$0$lcssa;
while(1) {
$18 = ((($$pn15)) + 1|0);
$$pre = HEAP8[$18>>0]|0;
$19 = ($$pre<<24>>24)==(0);
if ($19) {
$$1$lcssa = $18;
break;
} else {
$$pn15 = $18;
}
}
}
$20 = $$1$lcssa;
$$pn = $20;
}
$$0 = (($$pn) - ($0))|0;
return ($$0|0);
}
function _strncmp($_l,$_r,$n) {
$_l = $_l|0;
$_r = $_r|0;
$n = $n|0;
var $$03 = 0, $$08 = 0, $$08$in = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
var $l$06 = 0, $or$cond = 0, $or$cond4 = 0, $r$0$lcssa = 0, $r$07 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($n|0)==(0);
if ($0) {
$$03 = 0;
} else {
$1 = HEAP8[$_l>>0]|0;
$2 = ($1<<24>>24)==(0);
L3: do {
if ($2) {
$13 = 0;$r$0$lcssa = $_r;
} else {
$$08$in = $n;$6 = $1;$l$06 = $_l;$r$07 = $_r;
while(1) {
$$08 = (($$08$in) + -1)|0;
$3 = HEAP8[$r$07>>0]|0;
$4 = ($3<<24>>24)!=(0);
$5 = ($$08|0)!=(0);
$or$cond = $5 & $4;
$7 = ($6<<24>>24)==($3<<24>>24);
$or$cond4 = $7 & $or$cond;
if (!($or$cond4)) {
$13 = $6;$r$0$lcssa = $r$07;
break L3;
}
$8 = ((($l$06)) + 1|0);
$9 = ((($r$07)) + 1|0);
$10 = HEAP8[$8>>0]|0;
$11 = ($10<<24>>24)==(0);
if ($11) {
$13 = 0;$r$0$lcssa = $9;
break;
} else {
$$08$in = $$08;$6 = $10;$l$06 = $8;$r$07 = $9;
}
}
}
} while(0);
$12 = $13&255;
$14 = HEAP8[$r$0$lcssa>>0]|0;
$15 = $14&255;
$16 = (($12) - ($15))|0;
$$03 = $16;
}
return ($$03|0);
}
function _strrchr($s,$c) {
$s = $s|0;
$c = $c|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (_strlen($s)|0);
$1 = (($0) + 1)|0;
$2 = (___memrchr($s,$c,$1)|0);
return ($2|0);
}
function _strspn($s,$c) {
$s = $s|0;
$c = $c|0;
var $$0 = 0, $$028 = 0, $$03 = 0, $$03$lcssa = 0, $$1$lcssa = 0, $$16 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0;
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 32|0;
$byteset = sp;
;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0;
$0 = HEAP8[$c>>0]|0;
$1 = ($0<<24>>24)==(0);
do {
if ($1) {
$$0 = 0;
} else {
$2 = ((($c)) + 1|0);
$3 = HEAP8[$2>>0]|0;
$4 = ($3<<24>>24)==(0);
if ($4) {
$$03 = $s;
while(1) {
$5 = HEAP8[$$03>>0]|0;
$6 = ($5<<24>>24)==($0<<24>>24);
$7 = ((($$03)) + 1|0);
if ($6) {
$$03 = $7;
} else {
$$03$lcssa = $$03;
break;
}
}
$8 = $$03$lcssa;
$9 = $s;
$10 = (($8) - ($9))|0;
$$0 = $10;
break;
} else {
$$028 = $c;$14 = $0;
}
while(1) {
$13 = $14 & 31;
$15 = $13&255;
$16 = 1 << $15;
$div4 = ($14&255) >>> 5;
$17 = $div4&255;
$18 = (($byteset) + ($17<<2)|0);
$19 = HEAP32[$18>>2]|0;
$20 = $19 | $16;
HEAP32[$18>>2] = $20;
$21 = ((($$028)) + 1|0);
$22 = HEAP8[$21>>0]|0;
$23 = ($22<<24>>24)==(0);
if ($23) {
break;
} else {
$$028 = $21;$14 = $22;
}
}
$11 = HEAP8[$s>>0]|0;
$12 = ($11<<24>>24)==(0);
L10: do {
if ($12) {
$$1$lcssa = $s;
} else {
$$16 = $s;$24 = $11;
while(1) {
$div = ($24&255) >>> 5;
$25 = $div&255;
$26 = (($byteset) + ($25<<2)|0);
$27 = HEAP32[$26>>2]|0;
$28 = $24 & 31;
$29 = $28&255;
$30 = 1 << $29;
$31 = $27 & $30;
$32 = ($31|0)==(0);
if ($32) {
$$1$lcssa = $$16;
break L10;
}
$33 = ((($$16)) + 1|0);
$34 = HEAP8[$33>>0]|0;
$35 = ($34<<24>>24)==(0);
if ($35) {
$$1$lcssa = $33;
break;
} else {
$$16 = $33;$24 = $34;
}
}
}
} while(0);
$36 = $$1$lcssa;
$37 = $s;
$38 = (($36) - ($37))|0;
$$0 = $38;
}
} while(0);
STACKTOP = sp;return ($$0|0);
}
function _strstr($h,$n) {
$h = $h|0;
$n = $n|0;
var $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$0$lcssa$i11 = 0, $$01$i = 0, $$02$i = 0, $$02$i7 = 0, $$03$i = 0, $$lcssa$i = 0, $$lcssa$i10 = 0, $$lcssa$i4 = 0, $$lcssa281 = 0, $$lcssa284 = 0, $$lcssa287 = 0, $$lcssa301 = 0, $$lcssa304 = 0, $$lcssa307 = 0, $$lcssa322 = 0, $$pr$i = 0, $0 = 0;
var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $233$phi = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $25 = 0, $26 = 0;
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
var $byteset$i = 0, $div$i = 0, $div4$i = 0, $hw$0$in2$i = 0, $hw$03$i = 0, $hw$03$i6 = 0, $ip$0$ph$lcssa$i = 0, $ip$0$ph$lcssa143$i = 0, $ip$0$ph76$i = 0, $ip$1$ip$0$$i = 0, $ip$1$ip$0$i = 0, $ip$1$ph$lcssa$i = 0, $ip$1$ph55$i = 0, $jp$0$ph13$ph70$i = 0, $jp$0$ph1365$i = 0, $jp$0$ph1365$i$lcssa = 0, $jp$0$ph1365$i$lcssa$lcssa = 0, $jp$0$ph77$i = 0, $jp$1$ph56$i = 0, $jp$1$ph9$ph49$i = 0;
var $jp$1$ph944$i = 0, $jp$1$ph944$i$lcssa = 0, $jp$1$ph944$i$lcssa$lcssa = 0, $k$059$i = 0, $k$139$i = 0, $k$2$i = 0, $k$338$i = 0, $k$338$i$lcssa = 0, $k$4$i = 0, $l$080$i = 0, $l$080$i$lcssa321 = 0, $mem$0$i = 0, $mem0$0$i = 0, $or$cond$i = 0, $or$cond$i2 = 0, $or$cond$i8 = 0, $or$cond5$i = 0, $p$0$ph$ph$lcssa32$i = 0, $p$0$ph$ph$lcssa32147$i = 0, $p$0$ph$ph71$i = 0;
var $p$1$p$0$i = 0, $p$1$ph$ph$lcssa23$i = 0, $p$1$ph$ph50$i = 0, $p$3$i = 0, $shift$i = 0, $z$0$i = 0, $z$1$i = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 1056|0;
$byteset$i = sp + 1024|0;
$shift$i = sp;
$0 = HEAP8[$n>>0]|0;
$1 = ($0<<24>>24)==(0);
do {
if ($1) {
$$0 = $h;
} else {
$2 = $0 << 24 >> 24;
$3 = (_strchr($h,$2)|0);
$4 = ($3|0)==(0|0);
if ($4) {
$$0 = 0;
} else {
$5 = ((($n)) + 1|0);
$6 = HEAP8[$5>>0]|0;
$7 = ($6<<24>>24)==(0);
if ($7) {
$$0 = $3;
} else {
$8 = ((($3)) + 1|0);
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(0);
if ($10) {
$$0 = 0;
} else {
$11 = ((($n)) + 2|0);
$12 = HEAP8[$11>>0]|0;
$13 = ($12<<24>>24)==(0);
if ($13) {
$14 = $0&255;
$15 = $14 << 8;
$16 = $6&255;
$17 = $16 | $15;
$18 = HEAP8[$3>>0]|0;
$19 = $18&255;
$20 = $19 << 8;
$21 = $9&255;
$22 = $20 | $21;
$$01$i = $8;$232 = $9;$233 = $3;$hw$0$in2$i = $22;
while(1) {
$23 = $hw$0$in2$i & 65535;
$24 = ($23|0)==($17|0);
if ($24) {
$$lcssa$i = $233;$31 = $232;
break;
}
$25 = $23 << 8;
$26 = ((($$01$i)) + 1|0);
$27 = HEAP8[$26>>0]|0;
$28 = $27&255;
$29 = $28 | $25;
$30 = ($27<<24>>24)==(0);
if ($30) {
$$lcssa$i = $$01$i;$31 = 0;
break;
} else {
$233$phi = $$01$i;$$01$i = $26;$232 = $27;$hw$0$in2$i = $29;$233 = $233$phi;
}
}
$32 = ($31<<24>>24)!=(0);
$33 = $32 ? $$lcssa$i : 0;
$$0 = $33;
break;
}
$34 = ((($3)) + 2|0);
$35 = HEAP8[$34>>0]|0;
$36 = ($35<<24>>24)==(0);
if ($36) {
$$0 = 0;
} else {
$37 = ((($n)) + 3|0);
$38 = HEAP8[$37>>0]|0;
$39 = ($38<<24>>24)==(0);
if ($39) {
$40 = $0&255;
$41 = $40 << 24;
$42 = $6&255;
$43 = $42 << 16;
$44 = $43 | $41;
$45 = $12&255;
$46 = $45 << 8;
$47 = $44 | $46;
$48 = HEAP8[$3>>0]|0;
$49 = $48&255;
$50 = $49 << 24;
$51 = $9&255;
$52 = $51 << 16;
$53 = $35&255;
$54 = $53 << 8;
$55 = $54 | $52;
$56 = $55 | $50;
$57 = ($56|0)==($47|0);
if ($57) {
$$0$lcssa$i = $34;$$lcssa$i4 = $35;
} else {
$$02$i = $34;$hw$03$i = $56;
while(1) {
$58 = ((($$02$i)) + 1|0);
$59 = HEAP8[$58>>0]|0;
$60 = $59&255;
$61 = $60 | $hw$03$i;
$62 = $61 << 8;
$63 = ($59<<24>>24)==(0);
$64 = ($62|0)==($47|0);
$or$cond$i2 = $63 | $64;
if ($or$cond$i2) {
$$0$lcssa$i = $58;$$lcssa$i4 = $59;
break;
} else {
$$02$i = $58;$hw$03$i = $62;
}
}
}
$65 = ($$lcssa$i4<<24>>24)!=(0);
$66 = ((($$0$lcssa$i)) + -2|0);
$67 = $65 ? $66 : 0;
$$0 = $67;
break;
}
$68 = ((($3)) + 3|0);
$69 = HEAP8[$68>>0]|0;
$70 = ($69<<24>>24)==(0);
if ($70) {
$$0 = 0;
} else {
$71 = ((($n)) + 4|0);
$72 = HEAP8[$71>>0]|0;
$73 = ($72<<24>>24)==(0);
if ($73) {
$74 = $0&255;
$75 = $74 << 24;
$76 = $6&255;
$77 = $76 << 16;
$78 = $77 | $75;
$79 = $12&255;
$80 = $79 << 8;
$81 = $78 | $80;
$82 = $38&255;
$83 = $81 | $82;
$84 = HEAP8[$3>>0]|0;
$85 = $84&255;
$86 = $85 << 24;
$87 = $9&255;
$88 = $87 << 16;
$89 = $35&255;
$90 = $89 << 8;
$91 = $69&255;
$92 = $90 | $88;
$93 = $92 | $91;
$94 = $93 | $86;
$95 = ($94|0)==($83|0);
if ($95) {
$$0$lcssa$i11 = $68;$$lcssa$i10 = $69;
} else {
$$02$i7 = $68;$hw$03$i6 = $94;
while(1) {
$96 = $hw$03$i6 << 8;
$97 = ((($$02$i7)) + 1|0);
$98 = HEAP8[$97>>0]|0;
$99 = $98&255;
$100 = $99 | $96;
$101 = ($98<<24>>24)==(0);
$102 = ($100|0)==($83|0);
$or$cond$i8 = $101 | $102;
if ($or$cond$i8) {
$$0$lcssa$i11 = $97;$$lcssa$i10 = $98;
break;
} else {
$$02$i7 = $97;$hw$03$i6 = $100;
}
}
}
$103 = ($$lcssa$i10<<24>>24)!=(0);
$104 = ((($$0$lcssa$i11)) + -3|0);
$105 = $103 ? $104 : 0;
$$0 = $105;
break;
}
;HEAP32[$byteset$i>>2]=0|0;HEAP32[$byteset$i+4>>2]=0|0;HEAP32[$byteset$i+8>>2]=0|0;HEAP32[$byteset$i+12>>2]=0|0;HEAP32[$byteset$i+16>>2]=0|0;HEAP32[$byteset$i+20>>2]=0|0;HEAP32[$byteset$i+24>>2]=0|0;HEAP32[$byteset$i+28>>2]=0|0;
$110 = $0;$l$080$i = 0;
while(1) {
$106 = (($3) + ($l$080$i)|0);
$107 = HEAP8[$106>>0]|0;
$108 = ($107<<24>>24)==(0);
if ($108) {
$$0$i = 0;
break;
}
$109 = $110 & 31;
$111 = $109&255;
$112 = 1 << $111;
$div4$i = ($110&255) >>> 5;
$113 = $div4$i&255;
$114 = (($byteset$i) + ($113<<2)|0);
$115 = HEAP32[$114>>2]|0;
$116 = $115 | $112;
HEAP32[$114>>2] = $116;
$117 = (($l$080$i) + 1)|0;
$118 = $110&255;
$119 = (($shift$i) + ($118<<2)|0);
HEAP32[$119>>2] = $117;
$120 = (($n) + ($117)|0);
$121 = HEAP8[$120>>0]|0;
$122 = ($121<<24>>24)==(0);
if ($122) {
$$lcssa322 = $117;$l$080$i$lcssa321 = $l$080$i;
label = 23;
break;
} else {
$110 = $121;$l$080$i = $117;
}
}
L32: do {
if ((label|0) == 23) {
$123 = ($$lcssa322>>>0)>(1);
L34: do {
if ($123) {
$234 = 1;$ip$0$ph76$i = -1;$jp$0$ph77$i = 0;
L35: while(1) {
$235 = $234;$jp$0$ph13$ph70$i = $jp$0$ph77$i;$p$0$ph$ph71$i = 1;
while(1) {
$236 = $235;$jp$0$ph1365$i = $jp$0$ph13$ph70$i;
L39: while(1) {
$133 = $236;$k$059$i = 1;
while(1) {
$129 = (($k$059$i) + ($ip$0$ph76$i))|0;
$130 = (($n) + ($129)|0);
$131 = HEAP8[$130>>0]|0;
$132 = (($n) + ($133)|0);
$134 = HEAP8[$132>>0]|0;
$135 = ($131<<24>>24)==($134<<24>>24);
if (!($135)) {
$$lcssa301 = $133;$$lcssa304 = $131;$$lcssa307 = $134;$jp$0$ph1365$i$lcssa = $jp$0$ph1365$i;
break L39;
}
$136 = ($k$059$i|0)==($p$0$ph$ph71$i|0);
$127 = (($k$059$i) + 1)|0;
if ($136) {
break;
}
$126 = (($127) + ($jp$0$ph1365$i))|0;
$128 = ($126>>>0)<($$lcssa322>>>0);
if ($128) {
$133 = $126;$k$059$i = $127;
} else {
$ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i;
break L35;
}
}
$137 = (($jp$0$ph1365$i) + ($p$0$ph$ph71$i))|0;
$138 = (($137) + 1)|0;
$139 = ($138>>>0)<($$lcssa322>>>0);
if ($139) {
$236 = $138;$jp$0$ph1365$i = $137;
} else {
$ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i;
break L35;
}
}
$140 = ($$lcssa304&255)>($$lcssa307&255);
$141 = (($$lcssa301) - ($ip$0$ph76$i))|0;
if (!($140)) {
$jp$0$ph1365$i$lcssa$lcssa = $jp$0$ph1365$i$lcssa;
break;
}
$124 = (($$lcssa301) + 1)|0;
$125 = ($124>>>0)<($$lcssa322>>>0);
if ($125) {
$235 = $124;$jp$0$ph13$ph70$i = $$lcssa301;$p$0$ph$ph71$i = $141;
} else {
$ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $141;
break L35;
}
}
$142 = (($jp$0$ph1365$i$lcssa$lcssa) + 1)|0;
$143 = (($jp$0$ph1365$i$lcssa$lcssa) + 2)|0;
$144 = ($143>>>0)<($$lcssa322>>>0);
if ($144) {
$234 = $143;$ip$0$ph76$i = $jp$0$ph1365$i$lcssa$lcssa;$jp$0$ph77$i = $142;
} else {
$ip$0$ph$lcssa$i = $jp$0$ph1365$i$lcssa$lcssa;$p$0$ph$ph$lcssa32$i = 1;
break;
}
}
$237 = 1;$ip$1$ph55$i = -1;$jp$1$ph56$i = 0;
while(1) {
$239 = $237;$jp$1$ph9$ph49$i = $jp$1$ph56$i;$p$1$ph$ph50$i = 1;
while(1) {
$238 = $239;$jp$1$ph944$i = $jp$1$ph9$ph49$i;
L54: while(1) {
$152 = $238;$k$139$i = 1;
while(1) {
$148 = (($k$139$i) + ($ip$1$ph55$i))|0;
$149 = (($n) + ($148)|0);
$150 = HEAP8[$149>>0]|0;
$151 = (($n) + ($152)|0);
$153 = HEAP8[$151>>0]|0;
$154 = ($150<<24>>24)==($153<<24>>24);
if (!($154)) {
$$lcssa281 = $152;$$lcssa284 = $150;$$lcssa287 = $153;$jp$1$ph944$i$lcssa = $jp$1$ph944$i;
break L54;
}
$155 = ($k$139$i|0)==($p$1$ph$ph50$i|0);
$146 = (($k$139$i) + 1)|0;
if ($155) {
break;
}
$145 = (($146) + ($jp$1$ph944$i))|0;
$147 = ($145>>>0)<($$lcssa322>>>0);
if ($147) {
$152 = $145;$k$139$i = $146;
} else {
$ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i;
break L34;
}
}
$156 = (($jp$1$ph944$i) + ($p$1$ph$ph50$i))|0;
$157 = (($156) + 1)|0;
$158 = ($157>>>0)<($$lcssa322>>>0);
if ($158) {
$238 = $157;$jp$1$ph944$i = $156;
} else {
$ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i;
break L34;
}
}
$159 = ($$lcssa284&255)<($$lcssa287&255);
$160 = (($$lcssa281) - ($ip$1$ph55$i))|0;
if (!($159)) {
$jp$1$ph944$i$lcssa$lcssa = $jp$1$ph944$i$lcssa;
break;
}
$164 = (($$lcssa281) + 1)|0;
$165 = ($164>>>0)<($$lcssa322>>>0);
if ($165) {
$239 = $164;$jp$1$ph9$ph49$i = $$lcssa281;$p$1$ph$ph50$i = $160;
} else {
$ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $160;
break L34;
}
}
$161 = (($jp$1$ph944$i$lcssa$lcssa) + 1)|0;
$162 = (($jp$1$ph944$i$lcssa$lcssa) + 2)|0;
$163 = ($162>>>0)<($$lcssa322>>>0);
if ($163) {
$237 = $162;$ip$1$ph55$i = $jp$1$ph944$i$lcssa$lcssa;$jp$1$ph56$i = $161;
} else {
$ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $jp$1$ph944$i$lcssa$lcssa;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = 1;
break;
}
}
} else {
$ip$0$ph$lcssa143$i = -1;$ip$1$ph$lcssa$i = -1;$p$0$ph$ph$lcssa32147$i = 1;$p$1$ph$ph$lcssa23$i = 1;
}
} while(0);
$166 = (($ip$1$ph$lcssa$i) + 1)|0;
$167 = (($ip$0$ph$lcssa143$i) + 1)|0;
$168 = ($166>>>0)>($167>>>0);
$p$1$p$0$i = $168 ? $p$1$ph$ph$lcssa23$i : $p$0$ph$ph$lcssa32147$i;
$ip$1$ip$0$i = $168 ? $ip$1$ph$lcssa$i : $ip$0$ph$lcssa143$i;
$169 = (($n) + ($p$1$p$0$i)|0);
$170 = (($ip$1$ip$0$i) + 1)|0;
$171 = (_memcmp($n,$169,$170)|0);
$172 = ($171|0)==(0);
if ($172) {
$177 = (($$lcssa322) - ($p$1$p$0$i))|0;
$mem0$0$i = $177;$p$3$i = $p$1$p$0$i;
} else {
$173 = (($$lcssa322) - ($ip$1$ip$0$i))|0;
$174 = (($173) + -1)|0;
$175 = ($ip$1$ip$0$i>>>0)>($174>>>0);
$ip$1$ip$0$$i = $175 ? $ip$1$ip$0$i : $174;
$176 = (($ip$1$ip$0$$i) + 1)|0;
$mem0$0$i = 0;$p$3$i = $176;
}
$178 = $$lcssa322 | 63;
$179 = ($mem0$0$i|0)!=(0);
$180 = (($$lcssa322) - ($p$3$i))|0;
$$03$i = $3;$mem$0$i = 0;$z$0$i = $3;
L69: while(1) {
$181 = $z$0$i;
$182 = $$03$i;
$183 = (($181) - ($182))|0;
$184 = ($183>>>0)<($$lcssa322>>>0);
do {
if ($184) {
$185 = (_memchr($z$0$i,0,$178)|0);
$186 = ($185|0)==(0|0);
if ($186) {
$190 = (($z$0$i) + ($178)|0);
$z$1$i = $190;
break;
} else {
$187 = $185;
$188 = (($187) - ($182))|0;
$189 = ($188>>>0)<($$lcssa322>>>0);
if ($189) {
$$0$i = 0;
break L32;
} else {
$z$1$i = $185;
break;
}
}
} else {
$z$1$i = $z$0$i;
}
} while(0);
$191 = (($$03$i) + ($l$080$i$lcssa321)|0);
$192 = HEAP8[$191>>0]|0;
$div$i = ($192&255) >>> 5;
$193 = $div$i&255;
$194 = (($byteset$i) + ($193<<2)|0);
$195 = HEAP32[$194>>2]|0;
$196 = $192 & 31;
$197 = $196&255;
$198 = 1 << $197;
$199 = $198 & $195;
$200 = ($199|0)==(0);
if ($200) {
$209 = (($$03$i) + ($$lcssa322)|0);
$$03$i = $209;$mem$0$i = 0;$z$0$i = $z$1$i;
continue;
}
$201 = $192&255;
$202 = (($shift$i) + ($201<<2)|0);
$203 = HEAP32[$202>>2]|0;
$204 = (($$lcssa322) - ($203))|0;
$205 = ($$lcssa322|0)==($203|0);
if (!($205)) {
$206 = ($mem$0$i|0)!=(0);
$or$cond$i = $179 & $206;
$207 = ($204>>>0)<($p$3$i>>>0);
$or$cond5$i = $or$cond$i & $207;
$k$2$i = $or$cond5$i ? $180 : $204;
$208 = (($$03$i) + ($k$2$i)|0);
$$03$i = $208;$mem$0$i = 0;$z$0$i = $z$1$i;
continue;
}
$210 = ($170>>>0)>($mem$0$i>>>0);
$211 = $210 ? $170 : $mem$0$i;
$212 = (($n) + ($211)|0);
$213 = HEAP8[$212>>0]|0;
$214 = ($213<<24>>24)==(0);
L83: do {
if ($214) {
$k$4$i = $170;
} else {
$$pr$i = $213;$k$338$i = $211;
while(1) {
$215 = (($$03$i) + ($k$338$i)|0);
$216 = HEAP8[$215>>0]|0;
$217 = ($$pr$i<<24>>24)==($216<<24>>24);
if (!($217)) {
$k$338$i$lcssa = $k$338$i;
break;
}
$218 = (($k$338$i) + 1)|0;
$219 = (($n) + ($218)|0);
$220 = HEAP8[$219>>0]|0;
$221 = ($220<<24>>24)==(0);
if ($221) {
$k$4$i = $170;
break L83;
} else {
$$pr$i = $220;$k$338$i = $218;
}
}
$222 = (($k$338$i$lcssa) - ($ip$1$ip$0$i))|0;
$223 = (($$03$i) + ($222)|0);
$$03$i = $223;$mem$0$i = 0;$z$0$i = $z$1$i;
continue L69;
}
} while(0);
while(1) {
$224 = ($k$4$i>>>0)>($mem$0$i>>>0);
if (!($224)) {
$$0$i = $$03$i;
break L32;
}
$225 = (($k$4$i) + -1)|0;
$226 = (($n) + ($225)|0);
$227 = HEAP8[$226>>0]|0;
$228 = (($$03$i) + ($225)|0);
$229 = HEAP8[$228>>0]|0;
$230 = ($227<<24>>24)==($229<<24>>24);
if ($230) {
$k$4$i = $225;
} else {
break;
}
}
$231 = (($$03$i) + ($p$3$i)|0);
$$03$i = $231;$mem$0$i = $mem0$0$i;$z$0$i = $z$1$i;
}
}
} while(0);
$$0 = $$0$i;
}
}
}
}
}
}
} while(0);
STACKTOP = sp;return ($$0|0);
}
function _strtok($s,$sep) {
$s = $s|0;
$sep = $sep|0;
var $$0 = 0, $$01 = 0, $$sum = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($s|0)==(0|0);
if ($0) {
$1 = HEAP32[8948>>2]|0;
$2 = ($1|0)==(0|0);
if ($2) {
$$0 = 0;
} else {
$$01 = $1;
label = 3;
}
} else {
$$01 = $s;
label = 3;
}
do {
if ((label|0) == 3) {
$3 = (_strspn($$01,$sep)|0);
$4 = (($$01) + ($3)|0);
$5 = HEAP8[$4>>0]|0;
$6 = ($5<<24>>24)==(0);
if ($6) {
HEAP32[8948>>2] = 0;
$$0 = 0;
break;
}
$7 = (_strcspn($4,$sep)|0);
$$sum = (($7) + ($3))|0;
$8 = (($$01) + ($$sum)|0);
HEAP32[8948>>2] = $8;
$9 = HEAP8[$8>>0]|0;
$10 = ($9<<24>>24)==(0);
if ($10) {
HEAP32[8948>>2] = 0;
$$0 = $4;
break;
} else {
$$sum2 = (($$sum) + 1)|0;
$11 = (($$01) + ($$sum2)|0);
HEAP32[8948>>2] = $11;
HEAP8[$8>>0] = 0;
$$0 = $4;
break;
}
}
} while(0);
return ($$0|0);
}
function _scanexp($f,$pok) {
$f = $f|0;
$pok = $pok|0;
var $$lcssa22 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
var $99 = 0, $c$0 = 0, $c$1$be = 0, $c$1$be$lcssa = 0, $c$112 = 0, $c$2$be = 0, $c$2$lcssa = 0, $c$27 = 0, $c$3$be = 0, $neg$0 = 0, $or$cond3 = 0, $x$013 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($f)) + 100|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($1>>>0)<($3>>>0);
if ($4) {
$5 = ((($1)) + 1|0);
HEAP32[$0>>2] = $5;
$6 = HEAP8[$1>>0]|0;
$7 = $6&255;
$9 = $7;
} else {
$8 = (___shgetc($f)|0);
$9 = $8;
}
$10 = ($9|0)==(45);
switch ($9|0) {
case 43: case 45: {
$11 = $10&1;
$12 = HEAP32[$0>>2]|0;
$13 = HEAP32[$2>>2]|0;
$14 = ($12>>>0)<($13>>>0);
if ($14) {
$15 = ((($12)) + 1|0);
HEAP32[$0>>2] = $15;
$16 = HEAP8[$12>>0]|0;
$17 = $16&255;
$20 = $17;
} else {
$18 = (___shgetc($f)|0);
$20 = $18;
}
$19 = (($20) + -48)|0;
$21 = ($19>>>0)>(9);
$22 = ($pok|0)!=(0);
$or$cond3 = $22 & $21;
if ($or$cond3) {
$23 = HEAP32[$2>>2]|0;
$24 = ($23|0)==(0|0);
if ($24) {
$c$0 = $20;$neg$0 = $11;
} else {
$25 = HEAP32[$0>>2]|0;
$26 = ((($25)) + -1|0);
HEAP32[$0>>2] = $26;
$c$0 = $20;$neg$0 = $11;
}
} else {
$c$0 = $20;$neg$0 = $11;
}
break;
}
default: {
$c$0 = $9;$neg$0 = 0;
}
}
$27 = (($c$0) + -48)|0;
$28 = ($27>>>0)>(9);
if ($28) {
$29 = HEAP32[$2>>2]|0;
$30 = ($29|0)==(0|0);
if ($30) {
$98 = -2147483648;$99 = 0;
} else {
$31 = HEAP32[$0>>2]|0;
$32 = ((($31)) + -1|0);
HEAP32[$0>>2] = $32;
$98 = -2147483648;$99 = 0;
}
} else {
$c$112 = $c$0;$x$013 = 0;
while(1) {
$33 = ($x$013*10)|0;
$34 = (($c$112) + -48)|0;
$35 = (($34) + ($33))|0;
$36 = HEAP32[$0>>2]|0;
$37 = HEAP32[$2>>2]|0;
$38 = ($36>>>0)<($37>>>0);
if ($38) {
$39 = ((($36)) + 1|0);
HEAP32[$0>>2] = $39;
$40 = HEAP8[$36>>0]|0;
$41 = $40&255;
$c$1$be = $41;
} else {
$42 = (___shgetc($f)|0);
$c$1$be = $42;
}
$43 = (($c$1$be) + -48)|0;
$44 = ($43>>>0)<(10);
$45 = ($35|0)<(214748364);
$46 = $44 & $45;
if ($46) {
$c$112 = $c$1$be;$x$013 = $35;
} else {
$$lcssa22 = $35;$c$1$be$lcssa = $c$1$be;
break;
}
}
$47 = ($$lcssa22|0)<(0);
$48 = $47 << 31 >> 31;
$49 = (($c$1$be$lcssa) + -48)|0;
$50 = ($49>>>0)<(10);
if ($50) {
$53 = $$lcssa22;$54 = $48;$c$27 = $c$1$be$lcssa;
while(1) {
$55 = (___muldi3(($53|0),($54|0),10,0)|0);
$56 = tempRet0;
$57 = ($c$27|0)<(0);
$58 = $57 << 31 >> 31;
$59 = (_i64Add(($c$27|0),($58|0),-48,-1)|0);
$60 = tempRet0;
$61 = (_i64Add(($59|0),($60|0),($55|0),($56|0))|0);
$62 = tempRet0;
$63 = HEAP32[$0>>2]|0;
$64 = HEAP32[$2>>2]|0;
$65 = ($63>>>0)<($64>>>0);
if ($65) {
$66 = ((($63)) + 1|0);
HEAP32[$0>>2] = $66;
$67 = HEAP8[$63>>0]|0;
$68 = $67&255;
$c$2$be = $68;
} else {
$69 = (___shgetc($f)|0);
$c$2$be = $69;
}
$70 = (($c$2$be) + -48)|0;
$71 = ($70>>>0)<(10);
$72 = ($62|0)<(21474836);
$73 = ($61>>>0)<(2061584302);
$74 = ($62|0)==(21474836);
$75 = $74 & $73;
$76 = $72 | $75;
$77 = $71 & $76;
if ($77) {
$53 = $61;$54 = $62;$c$27 = $c$2$be;
} else {
$92 = $61;$93 = $62;$c$2$lcssa = $c$2$be;
break;
}
}
} else {
$92 = $$lcssa22;$93 = $48;$c$2$lcssa = $c$1$be$lcssa;
}
$51 = (($c$2$lcssa) + -48)|0;
$52 = ($51>>>0)<(10);
if ($52) {
while(1) {
$78 = HEAP32[$0>>2]|0;
$79 = HEAP32[$2>>2]|0;
$80 = ($78>>>0)<($79>>>0);
if ($80) {
$81 = ((($78)) + 1|0);
HEAP32[$0>>2] = $81;
$82 = HEAP8[$78>>0]|0;
$83 = $82&255;
$c$3$be = $83;
} else {
$84 = (___shgetc($f)|0);
$c$3$be = $84;
}
$85 = (($c$3$be) + -48)|0;
$86 = ($85>>>0)<(10);
if (!($86)) {
break;
}
}
}
$87 = HEAP32[$2>>2]|0;
$88 = ($87|0)==(0|0);
if (!($88)) {
$89 = HEAP32[$0>>2]|0;
$90 = ((($89)) + -1|0);
HEAP32[$0>>2] = $90;
}
$91 = ($neg$0|0)!=(0);
$94 = (_i64Subtract(0,0,($92|0),($93|0))|0);
$95 = tempRet0;
$96 = $91 ? $94 : $92;
$97 = $91 ? $95 : $93;
$98 = $97;$99 = $96;
}
tempRet0 = ($98);
return ($99|0);
}
function ___fflush_unlocked($f) {
$f = $f|0;
var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
var $9 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($f)) + 20|0);
$1 = HEAP32[$0>>2]|0;
$2 = ((($f)) + 28|0);
$3 = HEAP32[$2>>2]|0;
$4 = ($1>>>0)>($3>>>0);
if ($4) {
$5 = ((($f)) + 36|0);
$6 = HEAP32[$5>>2]|0;
(FUNCTION_TABLE_iiii[$6 & 15]($f,0,0)|0);
$7 = HEAP32[$0>>2]|0;
$8 = ($7|0)==(0|0);
if ($8) {
$$0 = -1;
} else {
label = 3;
}
} else {
label = 3;
}
if ((label|0) == 3) {
$9 = ((($f)) + 4|0);
$10 = HEAP32[$9>>2]|0;
$11 = ((($f)) + 8|0);
$12 = HEAP32[$11>>2]|0;
$13 = ($10>>>0)<($12>>>0);
if ($13) {
$14 = ((($f)) + 40|0);
$15 = HEAP32[$14>>2]|0;
$16 = $10;
$17 = $12;
$18 = (($16) - ($17))|0;
(FUNCTION_TABLE_iiii[$15 & 15]($f,$18,1)|0);
}
$19 = ((($f)) + 16|0);
HEAP32[$19>>2] = 0;
HEAP32[$2>>2] = 0;
HEAP32[$0>>2] = 0;
HEAP32[$11>>2] = 0;
HEAP32[$9>>2] = 0;
$$0 = 0;
}
return ($$0|0);
}
function _printf_core($f,$fmt,$ap,$nl_arg,$nl_type) {
$f = $f|0;
$fmt = $fmt|0;
$ap = $ap|0;
$nl_arg = $nl_arg|0;
$nl_type = $nl_type|0;
var $$ = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$012$i = 0, $$013$i = 0, $$03$i33 = 0, $$07$i = 0.0, $$1$i = 0.0, $$114$i = 0, $$2$i = 0.0, $$20$i = 0.0, $$21$i = 0, $$210$$22$i = 0, $$210$$24$i = 0, $$210$i = 0, $$23$i = 0, $$3$i = 0.0, $$31$i = 0;
var $$311$i = 0, $$4$i = 0.0, $$412$lcssa$i = 0, $$41276$i = 0, $$5$lcssa$i = 0, $$51 = 0, $$587$i = 0, $$a$3$i = 0, $$a$3185$i = 0, $$a$3186$i = 0, $$fl$4 = 0, $$l10n$0 = 0, $$lcssa = 0, $$lcssa159$i = 0, $$lcssa318 = 0, $$lcssa323 = 0, $$lcssa324 = 0, $$lcssa325 = 0, $$lcssa326 = 0, $$lcssa327 = 0;
var $$lcssa329 = 0, $$lcssa339 = 0, $$lcssa342 = 0.0, $$lcssa344 = 0, $$neg52$i = 0, $$neg53$i = 0, $$p$$i = 0, $$p$0 = 0, $$p$5 = 0, $$p$i = 0, $$pn$i = 0, $$pr$i = 0, $$pr47$i = 0, $$pre = 0, $$pre$i = 0, $$pre$phi184$iZ2D = 0, $$pre179$i = 0, $$pre182$i = 0, $$pre183$i = 0, $$pre193 = 0;
var $$sum$i = 0, $$sum15$i = 0, $$sum16$i = 0, $$z$3$i = 0, $$z$4$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0;
var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0;
var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0;
var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0;
var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0;
var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0;
var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0;
var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0;
var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0;
var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0;
var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0.0;
var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0;
var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0.0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0;
var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0.0, $413 = 0.0, $414 = 0.0, $415 = 0.0, $416 = 0.0, $417 = 0;
var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0.0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0.0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0.0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0;
var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0;
var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0;
var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0;
var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0;
var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0;
var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0.0, $597 = 0.0, $598 = 0;
var $599 = 0.0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0;
var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0;
var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0;
var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0;
var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0;
var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0;
var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0;
var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0;
var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0;
var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0;
var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0;
var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
var $98 = 0, $99 = 0, $a$0 = 0, $a$1 = 0, $a$1$lcssa$i = 0, $a$1147$i = 0, $a$2 = 0, $a$2$ph$i = 0, $a$3$lcssa$i = 0, $a$3134$i = 0, $a$5$lcssa$i = 0, $a$5109$i = 0, $a$6$i = 0, $a$7$i = 0, $a$8$ph$i = 0, $arg = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0;
var $argpos$0 = 0, $big$i = 0, $buf = 0, $buf$i = 0, $carry$0140$i = 0, $carry3$0128$i = 0, $cnt$0 = 0, $cnt$1 = 0, $cnt$1$lcssa = 0, $d$0$i = 0, $d$0139$i = 0, $d$0141$i = 0, $d$1127$i = 0, $d$2$lcssa$i = 0, $d$2108$i = 0, $d$3$i = 0, $d$482$i = 0, $d$575$i = 0, $d$686$i = 0, $e$0123$i = 0;
var $e$1$i = 0, $e$2104$i = 0, $e$3$i = 0, $e$4$ph$i = 0, $e2$i = 0, $ebuf0$i = 0, $estr$0$i = 0, $estr$1$lcssa$i = 0, $estr$193$i = 0, $estr$2$i = 0, $exitcond$i = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0;
var $expanded8 = 0, $fl$0109 = 0, $fl$062 = 0, $fl$1 = 0, $fl$1$ = 0, $fl$3 = 0, $fl$4 = 0, $fl$6 = 0, $fmt39$lcssa = 0, $fmt39101 = 0, $fmt40 = 0, $fmt41 = 0, $fmt42 = 0, $fmt44 = 0, $fmt44$lcssa321 = 0, $fmt45 = 0, $i$0$lcssa = 0, $i$0$lcssa200 = 0, $i$0114 = 0, $i$0122$i = 0;
var $i$03$i = 0, $i$03$i25 = 0, $i$1$lcssa$i = 0, $i$1116$i = 0, $i$1125 = 0, $i$2100 = 0, $i$2100$lcssa = 0, $i$2103$i = 0, $i$398 = 0, $i$399$i = 0, $isdigit = 0, $isdigit$i = 0, $isdigit$i27 = 0, $isdigit10 = 0, $isdigit12 = 0, $isdigit2$i = 0, $isdigit2$i23 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp$i = 0;
var $isdigittmp$i26 = 0, $isdigittmp1$i = 0, $isdigittmp1$i22 = 0, $isdigittmp11 = 0, $isdigittmp4$i = 0, $isdigittmp4$i24 = 0, $isdigittmp9 = 0, $j$0$i = 0, $j$0115$i = 0, $j$0117$i = 0, $j$1100$i = 0, $j$2$i = 0, $l$0 = 0, $l$0$i = 0, $l$1$i = 0, $l$1113 = 0, $l$2 = 0, $l10n$0 = 0, $l10n$0$lcssa = 0, $l10n$0$phi = 0;
var $l10n$1 = 0, $l10n$2 = 0, $l10n$3 = 0, $mb = 0, $notlhs$i = 0, $notrhs$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond15 = 0, $or$cond17 = 0, $or$cond20 = 0, $or$cond240 = 0, $or$cond29$i = 0, $or$cond3$not$i = 0, $or$cond6$i = 0, $p$0 = 0, $p$1 = 0, $p$2 = 0, $p$2$ = 0, $p$3 = 0;
var $p$4198 = 0, $p$5 = 0, $pl$0 = 0, $pl$0$i = 0, $pl$1 = 0, $pl$1$i = 0, $pl$2 = 0, $prefix$0 = 0, $prefix$0$$i = 0, $prefix$0$i = 0, $prefix$1 = 0, $prefix$2 = 0, $r$0$a$8$i = 0, $re$169$i = 0, $round$068$i = 0.0, $round6$1$i = 0.0, $s$0$i = 0, $s$1$i = 0, $s$1$i$lcssa = 0, $s1$0$i = 0;
var $s7$079$i = 0, $s7$1$i = 0, $s8$0$lcssa$i = 0, $s8$070$i = 0, $s9$0$i = 0, $s9$183$i = 0, $s9$2$i = 0, $small$0$i = 0.0, $small$1$i = 0.0, $st$0 = 0, $st$0$lcssa322 = 0, $storemerge = 0, $storemerge13 = 0, $storemerge8108 = 0, $storemerge860 = 0, $sum = 0, $t$0 = 0, $t$1 = 0, $w$$i = 0, $w$0 = 0;
var $w$1 = 0, $w$2 = 0, $w$30$i = 0, $wc = 0, $ws$0115 = 0, $ws$1126 = 0, $z$0$i = 0, $z$0$lcssa = 0, $z$0102 = 0, $z$1 = 0, $z$1$lcssa$i = 0, $z$1146$i = 0, $z$2 = 0, $z$2$i = 0, $z$2$i$lcssa = 0, $z$3$lcssa$i = 0, $z$3133$i = 0, $z$4$i = 0, $z$6$$i = 0, $z$6$i = 0;
var $z$6$i$lcssa = 0, $z$6$ph$i = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 624|0;
$big$i = sp + 24|0;
$e2$i = sp + 16|0;
$buf$i = sp + 588|0;
$ebuf0$i = sp + 576|0;
$arg = sp;
$buf = sp + 536|0;
$wc = sp + 8|0;
$mb = sp + 528|0;
$0 = ($f|0)!=(0|0);
$1 = ((($buf)) + 40|0);
$2 = $1;
$3 = ((($buf)) + 39|0);
$4 = ((($wc)) + 4|0);
$5 = ((($ebuf0$i)) + 12|0);
$6 = ((($ebuf0$i)) + 11|0);
$7 = $buf$i;
$8 = $5;
$9 = (($8) - ($7))|0;
$10 = (-2 - ($7))|0;
$11 = (($8) + 2)|0;
$12 = ((($big$i)) + 288|0);
$13 = ((($buf$i)) + 9|0);
$14 = $13;
$15 = ((($buf$i)) + 8|0);
$cnt$0 = 0;$fmt41 = $fmt;$l$0 = 0;$l10n$0 = 0;
L1: while(1) {
$16 = ($cnt$0|0)>(-1);
do {
if ($16) {
$17 = (2147483647 - ($cnt$0))|0;
$18 = ($l$0|0)>($17|0);
if ($18) {
$19 = (___errno_location()|0);
HEAP32[$19>>2] = 75;
$cnt$1 = -1;
break;
} else {
$20 = (($l$0) + ($cnt$0))|0;
$cnt$1 = $20;
break;
}
} else {
$cnt$1 = $cnt$0;
}
} while(0);
$21 = HEAP8[$fmt41>>0]|0;
$22 = ($21<<24>>24)==(0);
if ($22) {
$cnt$1$lcssa = $cnt$1;$l10n$0$lcssa = $l10n$0;
label = 245;
break;
} else {
$23 = $21;$fmt40 = $fmt41;
}
L9: while(1) {
switch ($23<<24>>24) {
case 37: {
$fmt39101 = $fmt40;$z$0102 = $fmt40;
label = 9;
break L9;
break;
}
case 0: {
$fmt39$lcssa = $fmt40;$z$0$lcssa = $fmt40;
break L9;
break;
}
default: {
}
}
$24 = ((($fmt40)) + 1|0);
$$pre = HEAP8[$24>>0]|0;
$23 = $$pre;$fmt40 = $24;
}
L12: do {
if ((label|0) == 9) {
while(1) {
label = 0;
$25 = ((($fmt39101)) + 1|0);
$26 = HEAP8[$25>>0]|0;
$27 = ($26<<24>>24)==(37);
if (!($27)) {
$fmt39$lcssa = $fmt39101;$z$0$lcssa = $z$0102;
break L12;
}
$28 = ((($z$0102)) + 1|0);
$29 = ((($fmt39101)) + 2|0);
$30 = HEAP8[$29>>0]|0;
$31 = ($30<<24>>24)==(37);
if ($31) {
$fmt39101 = $29;$z$0102 = $28;
label = 9;
} else {
$fmt39$lcssa = $29;$z$0$lcssa = $28;
break;
}
}
}
} while(0);
$32 = $z$0$lcssa;
$33 = $fmt41;
$34 = (($32) - ($33))|0;
if ($0) {
$35 = HEAP32[$f>>2]|0;
$36 = $35 & 32;
$37 = ($36|0)==(0);
if ($37) {
(___fwritex($fmt41,$34,$f)|0);
}
}
$38 = ($z$0$lcssa|0)==($fmt41|0);
if (!($38)) {
$l10n$0$phi = $l10n$0;$cnt$0 = $cnt$1;$fmt41 = $fmt39$lcssa;$l$0 = $34;$l10n$0 = $l10n$0$phi;
continue;
}
$39 = ((($fmt39$lcssa)) + 1|0);
$40 = HEAP8[$39>>0]|0;
$41 = $40 << 24 >> 24;
$isdigittmp = (($41) + -48)|0;
$isdigit = ($isdigittmp>>>0)<(10);
if ($isdigit) {
$42 = ((($fmt39$lcssa)) + 2|0);
$43 = HEAP8[$42>>0]|0;
$44 = ($43<<24>>24)==(36);
$45 = ((($fmt39$lcssa)) + 3|0);
$$51 = $44 ? $45 : $39;
$$l10n$0 = $44 ? 1 : $l10n$0;
$isdigittmp$ = $44 ? $isdigittmp : -1;
$$pre193 = HEAP8[$$51>>0]|0;
$47 = $$pre193;$argpos$0 = $isdigittmp$;$l10n$1 = $$l10n$0;$storemerge = $$51;
} else {
$47 = $40;$argpos$0 = -1;$l10n$1 = $l10n$0;$storemerge = $39;
}
$46 = $47 << 24 >> 24;
$48 = $46 & -32;
$49 = ($48|0)==(32);
L25: do {
if ($49) {
$51 = $46;$56 = $47;$fl$0109 = 0;$storemerge8108 = $storemerge;
while(1) {
$50 = (($51) + -32)|0;
$52 = 1 << $50;
$53 = $52 & 75913;
$54 = ($53|0)==(0);
if ($54) {
$65 = $56;$fl$062 = $fl$0109;$storemerge860 = $storemerge8108;
break L25;
}
$55 = $56 << 24 >> 24;
$57 = (($55) + -32)|0;
$58 = 1 << $57;
$59 = $58 | $fl$0109;
$60 = ((($storemerge8108)) + 1|0);
$61 = HEAP8[$60>>0]|0;
$62 = $61 << 24 >> 24;
$63 = $62 & -32;
$64 = ($63|0)==(32);
if ($64) {
$51 = $62;$56 = $61;$fl$0109 = $59;$storemerge8108 = $60;
} else {
$65 = $61;$fl$062 = $59;$storemerge860 = $60;
break;
}
}
} else {
$65 = $47;$fl$062 = 0;$storemerge860 = $storemerge;
}
} while(0);
$66 = ($65<<24>>24)==(42);
do {
if ($66) {
$67 = ((($storemerge860)) + 1|0);
$68 = HEAP8[$67>>0]|0;
$69 = $68 << 24 >> 24;
$isdigittmp11 = (($69) + -48)|0;
$isdigit12 = ($isdigittmp11>>>0)<(10);
if ($isdigit12) {
$70 = ((($storemerge860)) + 2|0);
$71 = HEAP8[$70>>0]|0;
$72 = ($71<<24>>24)==(36);
if ($72) {
$73 = (($nl_type) + ($isdigittmp11<<2)|0);
HEAP32[$73>>2] = 10;
$74 = HEAP8[$67>>0]|0;
$75 = $74 << 24 >> 24;
$76 = (($75) + -48)|0;
$77 = (($nl_arg) + ($76<<3)|0);
$78 = $77;
$79 = $78;
$80 = HEAP32[$79>>2]|0;
$81 = (($78) + 4)|0;
$82 = $81;
$83 = HEAP32[$82>>2]|0;
$84 = ((($storemerge860)) + 3|0);
$l10n$2 = 1;$storemerge13 = $84;$w$0 = $80;
} else {
label = 24;
}
} else {
label = 24;
}
if ((label|0) == 24) {
label = 0;
$85 = ($l10n$1|0)==(0);
if (!($85)) {
$$0 = -1;
break L1;
}
if (!($0)) {
$fl$1 = $fl$062;$fmt42 = $67;$l10n$3 = 0;$w$1 = 0;
break;
}
$arglist_current = HEAP32[$ap>>2]|0;
$86 = $arglist_current;
$87 = ((0) + 4|0);
$expanded4 = $87;
$expanded = (($expanded4) - 1)|0;
$88 = (($86) + ($expanded))|0;
$89 = ((0) + 4|0);
$expanded8 = $89;
$expanded7 = (($expanded8) - 1)|0;
$expanded6 = $expanded7 ^ -1;
$90 = $88 & $expanded6;
$91 = $90;
$92 = HEAP32[$91>>2]|0;
$arglist_next = ((($91)) + 4|0);
HEAP32[$ap>>2] = $arglist_next;
$l10n$2 = 0;$storemerge13 = $67;$w$0 = $92;
}
$93 = ($w$0|0)<(0);
if ($93) {
$94 = $fl$062 | 8192;
$95 = (0 - ($w$0))|0;
$fl$1 = $94;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $95;
} else {
$fl$1 = $fl$062;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $w$0;
}
} else {
$96 = $65 << 24 >> 24;
$isdigittmp1$i = (($96) + -48)|0;
$isdigit2$i = ($isdigittmp1$i>>>0)<(10);
if ($isdigit2$i) {
$100 = $storemerge860;$i$03$i = 0;$isdigittmp4$i = $isdigittmp1$i;
while(1) {
$97 = ($i$03$i*10)|0;
$98 = (($97) + ($isdigittmp4$i))|0;
$99 = ((($100)) + 1|0);
$101 = HEAP8[$99>>0]|0;
$102 = $101 << 24 >> 24;
$isdigittmp$i = (($102) + -48)|0;
$isdigit$i = ($isdigittmp$i>>>0)<(10);
if ($isdigit$i) {
$100 = $99;$i$03$i = $98;$isdigittmp4$i = $isdigittmp$i;
} else {
$$lcssa = $98;$$lcssa318 = $99;
break;
}
}
$103 = ($$lcssa|0)<(0);
if ($103) {
$$0 = -1;
break L1;
} else {
$fl$1 = $fl$062;$fmt42 = $$lcssa318;$l10n$3 = $l10n$1;$w$1 = $$lcssa;
}
} else {
$fl$1 = $fl$062;$fmt42 = $storemerge860;$l10n$3 = $l10n$1;$w$1 = 0;
}
}
} while(0);
$104 = HEAP8[$fmt42>>0]|0;
$105 = ($104<<24>>24)==(46);
L46: do {
if ($105) {
$106 = ((($fmt42)) + 1|0);
$107 = HEAP8[$106>>0]|0;
$108 = ($107<<24>>24)==(42);
if (!($108)) {
$135 = $107 << 24 >> 24;
$isdigittmp1$i22 = (($135) + -48)|0;
$isdigit2$i23 = ($isdigittmp1$i22>>>0)<(10);
if ($isdigit2$i23) {
$139 = $106;$i$03$i25 = 0;$isdigittmp4$i24 = $isdigittmp1$i22;
} else {
$fmt45 = $106;$p$0 = 0;
break;
}
while(1) {
$136 = ($i$03$i25*10)|0;
$137 = (($136) + ($isdigittmp4$i24))|0;
$138 = ((($139)) + 1|0);
$140 = HEAP8[$138>>0]|0;
$141 = $140 << 24 >> 24;
$isdigittmp$i26 = (($141) + -48)|0;
$isdigit$i27 = ($isdigittmp$i26>>>0)<(10);
if ($isdigit$i27) {
$139 = $138;$i$03$i25 = $137;$isdigittmp4$i24 = $isdigittmp$i26;
} else {
$fmt45 = $138;$p$0 = $137;
break L46;
}
}
}
$109 = ((($fmt42)) + 2|0);
$110 = HEAP8[$109>>0]|0;
$111 = $110 << 24 >> 24;
$isdigittmp9 = (($111) + -48)|0;
$isdigit10 = ($isdigittmp9>>>0)<(10);
if ($isdigit10) {
$112 = ((($fmt42)) + 3|0);
$113 = HEAP8[$112>>0]|0;
$114 = ($113<<24>>24)==(36);
if ($114) {
$115 = (($nl_type) + ($isdigittmp9<<2)|0);
HEAP32[$115>>2] = 10;
$116 = HEAP8[$109>>0]|0;
$117 = $116 << 24 >> 24;
$118 = (($117) + -48)|0;
$119 = (($nl_arg) + ($118<<3)|0);
$120 = $119;
$121 = $120;
$122 = HEAP32[$121>>2]|0;
$123 = (($120) + 4)|0;
$124 = $123;
$125 = HEAP32[$124>>2]|0;
$126 = ((($fmt42)) + 4|0);
$fmt45 = $126;$p$0 = $122;
break;
}
}
$127 = ($l10n$3|0)==(0);
if (!($127)) {
$$0 = -1;
break L1;
}
if ($0) {
$arglist_current2 = HEAP32[$ap>>2]|0;
$128 = $arglist_current2;
$129 = ((0) + 4|0);
$expanded11 = $129;
$expanded10 = (($expanded11) - 1)|0;
$130 = (($128) + ($expanded10))|0;
$131 = ((0) + 4|0);
$expanded15 = $131;
$expanded14 = (($expanded15) - 1)|0;
$expanded13 = $expanded14 ^ -1;
$132 = $130 & $expanded13;
$133 = $132;
$134 = HEAP32[$133>>2]|0;
$arglist_next3 = ((($133)) + 4|0);
HEAP32[$ap>>2] = $arglist_next3;
$fmt45 = $109;$p$0 = $134;
} else {
$fmt45 = $109;$p$0 = 0;
}
} else {
$fmt45 = $fmt42;$p$0 = -1;
}
} while(0);
$fmt44 = $fmt45;$st$0 = 0;
while(1) {
$142 = HEAP8[$fmt44>>0]|0;
$143 = $142 << 24 >> 24;
$144 = (($143) + -65)|0;
$145 = ($144>>>0)>(57);
if ($145) {
$$0 = -1;
break L1;
}
$146 = ((($fmt44)) + 1|0);
$147 = ((29989 + (($st$0*58)|0)|0) + ($144)|0);
$148 = HEAP8[$147>>0]|0;
$149 = $148&255;
$150 = (($149) + -1)|0;
$151 = ($150>>>0)<(8);
if ($151) {
$fmt44 = $146;$st$0 = $149;
} else {
$$lcssa323 = $146;$$lcssa324 = $148;$$lcssa325 = $149;$fmt44$lcssa321 = $fmt44;$st$0$lcssa322 = $st$0;
break;
}
}
$152 = ($$lcssa324<<24>>24)==(0);
if ($152) {
$$0 = -1;
break;
}
$153 = ($$lcssa324<<24>>24)==(19);
$154 = ($argpos$0|0)>(-1);
do {
if ($153) {
if ($154) {
$$0 = -1;
break L1;
} else {
label = 52;
}
} else {
if ($154) {
$155 = (($nl_type) + ($argpos$0<<2)|0);
HEAP32[$155>>2] = $$lcssa325;
$156 = (($nl_arg) + ($argpos$0<<3)|0);
$157 = $156;
$158 = $157;
$159 = HEAP32[$158>>2]|0;
$160 = (($157) + 4)|0;
$161 = $160;
$162 = HEAP32[$161>>2]|0;
$163 = $arg;
$164 = $163;
HEAP32[$164>>2] = $159;
$165 = (($163) + 4)|0;
$166 = $165;
HEAP32[$166>>2] = $162;
label = 52;
break;
}
if (!($0)) {
$$0 = 0;
break L1;
}
_pop_arg($arg,$$lcssa325,$ap);
}
} while(0);
if ((label|0) == 52) {
label = 0;
if (!($0)) {
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue;
}
}
$167 = HEAP8[$fmt44$lcssa321>>0]|0;
$168 = $167 << 24 >> 24;
$169 = ($st$0$lcssa322|0)!=(0);
$170 = $168 & 15;
$171 = ($170|0)==(3);
$or$cond15 = $169 & $171;
$172 = $168 & -33;
$t$0 = $or$cond15 ? $172 : $168;
$173 = $fl$1 & 8192;
$174 = ($173|0)==(0);
$175 = $fl$1 & -65537;
$fl$1$ = $174 ? $fl$1 : $175;
L75: do {
switch ($t$0|0) {
case 110: {
switch ($st$0$lcssa322|0) {
case 0: {
$182 = HEAP32[$arg>>2]|0;
HEAP32[$182>>2] = $cnt$1;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
case 1: {
$183 = HEAP32[$arg>>2]|0;
HEAP32[$183>>2] = $cnt$1;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
case 2: {
$184 = ($cnt$1|0)<(0);
$185 = $184 << 31 >> 31;
$186 = HEAP32[$arg>>2]|0;
$187 = $186;
$188 = $187;
HEAP32[$188>>2] = $cnt$1;
$189 = (($187) + 4)|0;
$190 = $189;
HEAP32[$190>>2] = $185;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
case 3: {
$191 = $cnt$1&65535;
$192 = HEAP32[$arg>>2]|0;
HEAP16[$192>>1] = $191;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
case 4: {
$193 = $cnt$1&255;
$194 = HEAP32[$arg>>2]|0;
HEAP8[$194>>0] = $193;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
case 6: {
$195 = HEAP32[$arg>>2]|0;
HEAP32[$195>>2] = $cnt$1;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
case 7: {
$196 = ($cnt$1|0)<(0);
$197 = $196 << 31 >> 31;
$198 = HEAP32[$arg>>2]|0;
$199 = $198;
$200 = $199;
HEAP32[$200>>2] = $cnt$1;
$201 = (($199) + 4)|0;
$202 = $201;
HEAP32[$202>>2] = $197;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
break;
}
default: {
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
continue L1;
}
}
break;
}
case 112: {
$203 = ($p$0>>>0)>(8);
$204 = $203 ? $p$0 : 8;
$205 = $fl$1$ | 8;
$fl$3 = $205;$p$1 = $204;$t$1 = 120;
label = 64;
break;
}
case 88: case 120: {
$fl$3 = $fl$1$;$p$1 = $p$0;$t$1 = $t$0;
label = 64;
break;
}
case 111: {
$243 = $arg;
$244 = $243;
$245 = HEAP32[$244>>2]|0;
$246 = (($243) + 4)|0;
$247 = $246;
$248 = HEAP32[$247>>2]|0;
$249 = ($245|0)==(0);
$250 = ($248|0)==(0);
$251 = $249 & $250;
if ($251) {
$$0$lcssa$i = $1;
} else {
$$03$i33 = $1;$253 = $245;$257 = $248;
while(1) {
$252 = $253 & 7;
$254 = $252 | 48;
$255 = $254&255;
$256 = ((($$03$i33)) + -1|0);
HEAP8[$256>>0] = $255;
$258 = (_bitshift64Lshr(($253|0),($257|0),3)|0);
$259 = tempRet0;
$260 = ($258|0)==(0);
$261 = ($259|0)==(0);
$262 = $260 & $261;
if ($262) {
$$0$lcssa$i = $256;
break;
} else {
$$03$i33 = $256;$253 = $258;$257 = $259;
}
}
}
$263 = $fl$1$ & 8;
$264 = ($263|0)==(0);
if ($264) {
$a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = 0;$prefix$1 = 30469;
label = 77;
} else {
$265 = $$0$lcssa$i;
$266 = (($2) - ($265))|0;
$267 = (($266) + 1)|0;
$268 = ($p$0|0)<($267|0);
$$p$0 = $268 ? $267 : $p$0;
$a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $$p$0;$pl$1 = 0;$prefix$1 = 30469;
label = 77;
}
break;
}
case 105: case 100: {
$269 = $arg;
$270 = $269;
$271 = HEAP32[$270>>2]|0;
$272 = (($269) + 4)|0;
$273 = $272;
$274 = HEAP32[$273>>2]|0;
$275 = ($274|0)<(0);
if ($275) {
$276 = (_i64Subtract(0,0,($271|0),($274|0))|0);
$277 = tempRet0;
$278 = $arg;
$279 = $278;
HEAP32[$279>>2] = $276;
$280 = (($278) + 4)|0;
$281 = $280;
HEAP32[$281>>2] = $277;
$286 = $276;$287 = $277;$pl$0 = 1;$prefix$0 = 30469;
label = 76;
break L75;
}
$282 = $fl$1$ & 2048;
$283 = ($282|0)==(0);
if ($283) {
$284 = $fl$1$ & 1;
$285 = ($284|0)==(0);
$$ = $285 ? 30469 : (30471);
$286 = $271;$287 = $274;$pl$0 = $284;$prefix$0 = $$;
label = 76;
} else {
$286 = $271;$287 = $274;$pl$0 = 1;$prefix$0 = (30470);
label = 76;
}
break;
}
case 117: {
$176 = $arg;
$177 = $176;
$178 = HEAP32[$177>>2]|0;
$179 = (($176) + 4)|0;
$180 = $179;
$181 = HEAP32[$180>>2]|0;
$286 = $178;$287 = $181;$pl$0 = 0;$prefix$0 = 30469;
label = 76;
break;
}
case 99: {
$307 = $arg;
$308 = $307;
$309 = HEAP32[$308>>2]|0;
$310 = (($307) + 4)|0;
$311 = $310;
$312 = HEAP32[$311>>2]|0;
$313 = $309&255;
HEAP8[$3>>0] = $313;
$a$2 = $3;$fl$6 = $175;$p$5 = 1;$pl$2 = 0;$prefix$2 = 30469;$z$2 = $1;
break;
}
case 109: {
$314 = (___errno_location()|0);
$315 = HEAP32[$314>>2]|0;
$316 = (_strerror($315)|0);
$a$1 = $316;
label = 82;
break;
}
case 115: {
$317 = HEAP32[$arg>>2]|0;
$318 = ($317|0)!=(0|0);
$319 = $318 ? $317 : 30479;
$a$1 = $319;
label = 82;
break;
}
case 67: {
$326 = $arg;
$327 = $326;
$328 = HEAP32[$327>>2]|0;
$329 = (($326) + 4)|0;
$330 = $329;
$331 = HEAP32[$330>>2]|0;
HEAP32[$wc>>2] = $328;
HEAP32[$4>>2] = 0;
HEAP32[$arg>>2] = $wc;
$p$4198 = -1;
label = 86;
break;
}
case 83: {
$332 = ($p$0|0)==(0);
if ($332) {
_pad($f,32,$w$1,0,$fl$1$);
$i$0$lcssa200 = 0;
label = 98;
} else {
$p$4198 = $p$0;
label = 86;
}
break;
}
case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: {
$359 = +HEAPF64[$arg>>3];
HEAP32[$e2$i>>2] = 0;
HEAPF64[tempDoublePtr>>3] = $359;$360 = HEAP32[tempDoublePtr>>2]|0;
$361 = HEAP32[tempDoublePtr+4>>2]|0;
$362 = ($361|0)<(0);
if ($362) {
$363 = -$359;
$$07$i = $363;$pl$0$i = 1;$prefix$0$i = 30486;
} else {
$364 = $fl$1$ & 2048;
$365 = ($364|0)==(0);
if ($365) {
$366 = $fl$1$ & 1;
$367 = ($366|0)==(0);
$$$i = $367 ? (30487) : (30492);
$$07$i = $359;$pl$0$i = $366;$prefix$0$i = $$$i;
} else {
$$07$i = $359;$pl$0$i = 1;$prefix$0$i = (30489);
}
}
HEAPF64[tempDoublePtr>>3] = $$07$i;$368 = HEAP32[tempDoublePtr>>2]|0;
$369 = HEAP32[tempDoublePtr+4>>2]|0;
$370 = $369 & 2146435072;
$371 = ($370>>>0)<(2146435072);
$372 = (0)<(0);
$373 = ($370|0)==(2146435072);
$374 = $373 & $372;
$375 = $371 | $374;
do {
if ($375) {
$391 = (+_frexpl($$07$i,$e2$i));
$392 = $391 * 2.0;
$393 = $392 != 0.0;
if ($393) {
$394 = HEAP32[$e2$i>>2]|0;
$395 = (($394) + -1)|0;
HEAP32[$e2$i>>2] = $395;
}
$396 = $t$0 | 32;
$397 = ($396|0)==(97);
if ($397) {
$398 = $t$0 & 32;
$399 = ($398|0)==(0);
$400 = ((($prefix$0$i)) + 9|0);
$prefix$0$$i = $399 ? $prefix$0$i : $400;
$401 = $pl$0$i | 2;
$402 = ($p$0>>>0)>(11);
$403 = (12 - ($p$0))|0;
$404 = ($403|0)==(0);
$405 = $402 | $404;
do {
if ($405) {
$$1$i = $392;
} else {
$re$169$i = $403;$round$068$i = 8.0;
while(1) {
$406 = (($re$169$i) + -1)|0;
$407 = $round$068$i * 16.0;
$408 = ($406|0)==(0);
if ($408) {
$$lcssa342 = $407;
break;
} else {
$re$169$i = $406;$round$068$i = $407;
}
}
$409 = HEAP8[$prefix$0$$i>>0]|0;
$410 = ($409<<24>>24)==(45);
if ($410) {
$411 = -$392;
$412 = $411 - $$lcssa342;
$413 = $$lcssa342 + $412;
$414 = -$413;
$$1$i = $414;
break;
} else {
$415 = $392 + $$lcssa342;
$416 = $415 - $$lcssa342;
$$1$i = $416;
break;
}
}
} while(0);
$417 = HEAP32[$e2$i>>2]|0;
$418 = ($417|0)<(0);
$419 = (0 - ($417))|0;
$420 = $418 ? $419 : $417;
$421 = ($420|0)<(0);
$422 = $421 << 31 >> 31;
$423 = (_fmt_u($420,$422,$5)|0);
$424 = ($423|0)==($5|0);
if ($424) {
HEAP8[$6>>0] = 48;
$estr$0$i = $6;
} else {
$estr$0$i = $423;
}
$425 = $417 >> 31;
$426 = $425 & 2;
$427 = (($426) + 43)|0;
$428 = $427&255;
$429 = ((($estr$0$i)) + -1|0);
HEAP8[$429>>0] = $428;
$430 = (($t$0) + 15)|0;
$431 = $430&255;
$432 = ((($estr$0$i)) + -2|0);
HEAP8[$432>>0] = $431;
$notrhs$i = ($p$0|0)<(1);
$433 = $fl$1$ & 8;
$434 = ($433|0)==(0);
$$2$i = $$1$i;$s$0$i = $buf$i;
while(1) {
$435 = (~~(($$2$i)));
$436 = (30453 + ($435)|0);
$437 = HEAP8[$436>>0]|0;
$438 = $437&255;
$439 = $438 | $398;
$440 = $439&255;
$441 = ((($s$0$i)) + 1|0);
HEAP8[$s$0$i>>0] = $440;
$442 = (+($435|0));
$443 = $$2$i - $442;
$444 = $443 * 16.0;
$445 = $441;
$446 = (($445) - ($7))|0;
$447 = ($446|0)==(1);
do {
if ($447) {
$notlhs$i = $444 == 0.0;
$or$cond3$not$i = $notrhs$i & $notlhs$i;
$or$cond$i = $434 & $or$cond3$not$i;
if ($or$cond$i) {
$s$1$i = $441;
break;
}
$448 = ((($s$0$i)) + 2|0);
HEAP8[$441>>0] = 46;
$s$1$i = $448;
} else {
$s$1$i = $441;
}
} while(0);
$449 = $444 != 0.0;
if ($449) {
$$2$i = $444;$s$0$i = $s$1$i;
} else {
$s$1$i$lcssa = $s$1$i;
break;
}
}
$450 = ($p$0|0)!=(0);
$$pre182$i = $s$1$i$lcssa;
$451 = (($10) + ($$pre182$i))|0;
$452 = ($451|0)<($p$0|0);
$or$cond240 = $450 & $452;
$453 = $432;
$454 = (($11) + ($p$0))|0;
$455 = (($454) - ($453))|0;
$456 = $432;
$457 = (($9) - ($456))|0;
$458 = (($457) + ($$pre182$i))|0;
$l$0$i = $or$cond240 ? $455 : $458;
$459 = (($l$0$i) + ($401))|0;
_pad($f,32,$w$1,$459,$fl$1$);
$460 = HEAP32[$f>>2]|0;
$461 = $460 & 32;
$462 = ($461|0)==(0);
if ($462) {
(___fwritex($prefix$0$$i,$401,$f)|0);
}
$463 = $fl$1$ ^ 65536;
_pad($f,48,$w$1,$459,$463);
$464 = (($$pre182$i) - ($7))|0;
$465 = HEAP32[$f>>2]|0;
$466 = $465 & 32;
$467 = ($466|0)==(0);
if ($467) {
(___fwritex($buf$i,$464,$f)|0);
}
$468 = $432;
$469 = (($8) - ($468))|0;
$sum = (($464) + ($469))|0;
$470 = (($l$0$i) - ($sum))|0;
_pad($f,48,$470,0,0);
$471 = HEAP32[$f>>2]|0;
$472 = $471 & 32;
$473 = ($472|0)==(0);
if ($473) {
(___fwritex($432,$469,$f)|0);
}
$474 = $fl$1$ ^ 8192;
_pad($f,32,$w$1,$459,$474);
$475 = ($459|0)<($w$1|0);
$w$$i = $475 ? $w$1 : $459;
$$0$i = $w$$i;
break;
}
$476 = ($p$0|0)<(0);
$$p$i = $476 ? 6 : $p$0;
if ($393) {
$477 = $392 * 268435456.0;
$478 = HEAP32[$e2$i>>2]|0;
$479 = (($478) + -28)|0;
HEAP32[$e2$i>>2] = $479;
$$3$i = $477;$480 = $479;
} else {
$$pre179$i = HEAP32[$e2$i>>2]|0;
$$3$i = $392;$480 = $$pre179$i;
}
$481 = ($480|0)<(0);
$$31$i = $481 ? $big$i : $12;
$482 = $$31$i;
$$4$i = $$3$i;$z$0$i = $$31$i;
while(1) {
$483 = (~~(($$4$i))>>>0);
HEAP32[$z$0$i>>2] = $483;
$484 = ((($z$0$i)) + 4|0);
$485 = (+($483>>>0));
$486 = $$4$i - $485;
$487 = $486 * 1.0E+9;
$488 = $487 != 0.0;
if ($488) {
$$4$i = $487;$z$0$i = $484;
} else {
$$lcssa326 = $484;
break;
}
}
$$pr$i = HEAP32[$e2$i>>2]|0;
$489 = ($$pr$i|0)>(0);
if ($489) {
$490 = $$pr$i;$a$1147$i = $$31$i;$z$1146$i = $$lcssa326;
while(1) {
$491 = ($490|0)>(29);
$492 = $491 ? 29 : $490;
$d$0139$i = ((($z$1146$i)) + -4|0);
$493 = ($d$0139$i>>>0)<($a$1147$i>>>0);
do {
if ($493) {
$a$2$ph$i = $a$1147$i;
} else {
$carry$0140$i = 0;$d$0141$i = $d$0139$i;
while(1) {
$494 = HEAP32[$d$0141$i>>2]|0;
$495 = (_bitshift64Shl(($494|0),0,($492|0))|0);
$496 = tempRet0;
$497 = (_i64Add(($495|0),($496|0),($carry$0140$i|0),0)|0);
$498 = tempRet0;
$499 = (___uremdi3(($497|0),($498|0),1000000000,0)|0);
$500 = tempRet0;
HEAP32[$d$0141$i>>2] = $499;
$501 = (___udivdi3(($497|0),($498|0),1000000000,0)|0);
$502 = tempRet0;
$d$0$i = ((($d$0141$i)) + -4|0);
$503 = ($d$0$i>>>0)<($a$1147$i>>>0);
if ($503) {
$$lcssa327 = $501;
break;
} else {
$carry$0140$i = $501;$d$0141$i = $d$0$i;
}
}
$504 = ($$lcssa327|0)==(0);
if ($504) {
$a$2$ph$i = $a$1147$i;
break;
}
$505 = ((($a$1147$i)) + -4|0);
HEAP32[$505>>2] = $$lcssa327;
$a$2$ph$i = $505;
}
} while(0);
$z$2$i = $z$1146$i;
while(1) {
$506 = ($z$2$i>>>0)>($a$2$ph$i>>>0);
if (!($506)) {
$z$2$i$lcssa = $z$2$i;
break;
}
$507 = ((($z$2$i)) + -4|0);
$508 = HEAP32[$507>>2]|0;
$509 = ($508|0)==(0);
if ($509) {
$z$2$i = $507;
} else {
$z$2$i$lcssa = $z$2$i;
break;
}
}
$510 = HEAP32[$e2$i>>2]|0;
$511 = (($510) - ($492))|0;
HEAP32[$e2$i>>2] = $511;
$512 = ($511|0)>(0);
if ($512) {
$490 = $511;$a$1147$i = $a$2$ph$i;$z$1146$i = $z$2$i$lcssa;
} else {
$$pr47$i = $511;$a$1$lcssa$i = $a$2$ph$i;$z$1$lcssa$i = $z$2$i$lcssa;
break;
}
}
} else {
$$pr47$i = $$pr$i;$a$1$lcssa$i = $$31$i;$z$1$lcssa$i = $$lcssa326;
}
$513 = ($$pr47$i|0)<(0);
if ($513) {
$514 = (($$p$i) + 25)|0;
$515 = (($514|0) / 9)&-1;
$516 = (($515) + 1)|0;
$517 = ($396|0)==(102);
$519 = $$pr47$i;$a$3134$i = $a$1$lcssa$i;$z$3133$i = $z$1$lcssa$i;
while(1) {
$518 = (0 - ($519))|0;
$520 = ($518|0)>(9);
$521 = $520 ? 9 : $518;
$522 = ($a$3134$i>>>0)<($z$3133$i>>>0);
do {
if ($522) {
$526 = 1 << $521;
$527 = (($526) + -1)|0;
$528 = 1000000000 >>> $521;
$carry3$0128$i = 0;$d$1127$i = $a$3134$i;
while(1) {
$529 = HEAP32[$d$1127$i>>2]|0;
$530 = $529 & $527;
$531 = $529 >>> $521;
$532 = (($531) + ($carry3$0128$i))|0;
HEAP32[$d$1127$i>>2] = $532;
$533 = Math_imul($530, $528)|0;
$534 = ((($d$1127$i)) + 4|0);
$535 = ($534>>>0)<($z$3133$i>>>0);
if ($535) {
$carry3$0128$i = $533;$d$1127$i = $534;
} else {
$$lcssa329 = $533;
break;
}
}
$536 = HEAP32[$a$3134$i>>2]|0;
$537 = ($536|0)==(0);
$538 = ((($a$3134$i)) + 4|0);
$$a$3$i = $537 ? $538 : $a$3134$i;
$539 = ($$lcssa329|0)==(0);
if ($539) {
$$a$3186$i = $$a$3$i;$z$4$i = $z$3133$i;
break;
}
$540 = ((($z$3133$i)) + 4|0);
HEAP32[$z$3133$i>>2] = $$lcssa329;
$$a$3186$i = $$a$3$i;$z$4$i = $540;
} else {
$523 = HEAP32[$a$3134$i>>2]|0;
$524 = ($523|0)==(0);
$525 = ((($a$3134$i)) + 4|0);
$$a$3185$i = $524 ? $525 : $a$3134$i;
$$a$3186$i = $$a$3185$i;$z$4$i = $z$3133$i;
}
} while(0);
$541 = $517 ? $$31$i : $$a$3186$i;
$542 = $z$4$i;
$543 = $541;
$544 = (($542) - ($543))|0;
$545 = $544 >> 2;
$546 = ($545|0)>($516|0);
$547 = (($541) + ($516<<2)|0);
$$z$4$i = $546 ? $547 : $z$4$i;
$548 = HEAP32[$e2$i>>2]|0;
$549 = (($548) + ($521))|0;
HEAP32[$e2$i>>2] = $549;
$550 = ($549|0)<(0);
if ($550) {
$519 = $549;$a$3134$i = $$a$3186$i;$z$3133$i = $$z$4$i;
} else {
$a$3$lcssa$i = $$a$3186$i;$z$3$lcssa$i = $$z$4$i;
break;
}
}
} else {
$a$3$lcssa$i = $a$1$lcssa$i;$z$3$lcssa$i = $z$1$lcssa$i;
}
$551 = ($a$3$lcssa$i>>>0)<($z$3$lcssa$i>>>0);
do {
if ($551) {
$552 = $a$3$lcssa$i;
$553 = (($482) - ($552))|0;
$554 = $553 >> 2;
$555 = ($554*9)|0;
$556 = HEAP32[$a$3$lcssa$i>>2]|0;
$557 = ($556>>>0)<(10);
if ($557) {
$e$1$i = $555;
break;
} else {
$e$0123$i = $555;$i$0122$i = 10;
}
while(1) {
$558 = ($i$0122$i*10)|0;
$559 = (($e$0123$i) + 1)|0;
$560 = ($556>>>0)<($558>>>0);
if ($560) {
$e$1$i = $559;
break;
} else {
$e$0123$i = $559;$i$0122$i = $558;
}
}
} else {
$e$1$i = 0;
}
} while(0);
$561 = ($396|0)!=(102);
$562 = $561 ? $e$1$i : 0;
$563 = (($$p$i) - ($562))|0;
$564 = ($396|0)==(103);
$565 = ($$p$i|0)!=(0);
$566 = $565 & $564;
$$neg52$i = $566 << 31 >> 31;
$567 = (($563) + ($$neg52$i))|0;
$568 = $z$3$lcssa$i;
$569 = (($568) - ($482))|0;
$570 = $569 >> 2;
$571 = ($570*9)|0;
$572 = (($571) + -9)|0;
$573 = ($567|0)<($572|0);
if ($573) {
$574 = (($567) + 9216)|0;
$575 = (($574|0) / 9)&-1;
$$sum$i = (($575) + -1023)|0;
$576 = (($$31$i) + ($$sum$i<<2)|0);
$577 = (($574|0) % 9)&-1;
$j$0115$i = (($577) + 1)|0;
$578 = ($j$0115$i|0)<(9);
if ($578) {
$i$1116$i = 10;$j$0117$i = $j$0115$i;
while(1) {
$579 = ($i$1116$i*10)|0;
$j$0$i = (($j$0117$i) + 1)|0;
$exitcond$i = ($j$0$i|0)==(9);
if ($exitcond$i) {
$i$1$lcssa$i = $579;
break;
} else {
$i$1116$i = $579;$j$0117$i = $j$0$i;
}
}
} else {
$i$1$lcssa$i = 10;
}
$580 = HEAP32[$576>>2]|0;
$581 = (($580>>>0) % ($i$1$lcssa$i>>>0))&-1;
$582 = ($581|0)==(0);
if ($582) {
$$sum15$i = (($575) + -1022)|0;
$583 = (($$31$i) + ($$sum15$i<<2)|0);
$584 = ($583|0)==($z$3$lcssa$i|0);
if ($584) {
$a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i;
} else {
label = 163;
}
} else {
label = 163;
}
do {
if ((label|0) == 163) {
label = 0;
$585 = (($580>>>0) / ($i$1$lcssa$i>>>0))&-1;
$586 = $585 & 1;
$587 = ($586|0)==(0);
$$20$i = $587 ? 9007199254740992.0 : 9007199254740994.0;
$588 = (($i$1$lcssa$i|0) / 2)&-1;
$589 = ($581>>>0)<($588>>>0);
do {
if ($589) {
$small$0$i = 0.5;
} else {
$590 = ($581|0)==($588|0);
if ($590) {
$$sum16$i = (($575) + -1022)|0;
$591 = (($$31$i) + ($$sum16$i<<2)|0);
$592 = ($591|0)==($z$3$lcssa$i|0);
if ($592) {
$small$0$i = 1.0;
break;
}
}
$small$0$i = 1.5;
}
} while(0);
$593 = ($pl$0$i|0)==(0);
do {
if ($593) {
$round6$1$i = $$20$i;$small$1$i = $small$0$i;
} else {
$594 = HEAP8[$prefix$0$i>>0]|0;
$595 = ($594<<24>>24)==(45);
if (!($595)) {
$round6$1$i = $$20$i;$small$1$i = $small$0$i;
break;
}
$596 = -$$20$i;
$597 = -$small$0$i;
$round6$1$i = $596;$small$1$i = $597;
}
} while(0);
$598 = (($580) - ($581))|0;
HEAP32[$576>>2] = $598;
$599 = $round6$1$i + $small$1$i;
$600 = $599 != $round6$1$i;
if (!($600)) {
$a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i;
break;
}
$601 = (($598) + ($i$1$lcssa$i))|0;
HEAP32[$576>>2] = $601;
$602 = ($601>>>0)>(999999999);
if ($602) {
$a$5109$i = $a$3$lcssa$i;$d$2108$i = $576;
while(1) {
$603 = ((($d$2108$i)) + -4|0);
HEAP32[$d$2108$i>>2] = 0;
$604 = ($603>>>0)<($a$5109$i>>>0);
if ($604) {
$605 = ((($a$5109$i)) + -4|0);
HEAP32[$605>>2] = 0;
$a$6$i = $605;
} else {
$a$6$i = $a$5109$i;
}
$606 = HEAP32[$603>>2]|0;
$607 = (($606) + 1)|0;
HEAP32[$603>>2] = $607;
$608 = ($607>>>0)>(999999999);
if ($608) {
$a$5109$i = $a$6$i;$d$2108$i = $603;
} else {
$a$5$lcssa$i = $a$6$i;$d$2$lcssa$i = $603;
break;
}
}
} else {
$a$5$lcssa$i = $a$3$lcssa$i;$d$2$lcssa$i = $576;
}
$609 = $a$5$lcssa$i;
$610 = (($482) - ($609))|0;
$611 = $610 >> 2;
$612 = ($611*9)|0;
$613 = HEAP32[$a$5$lcssa$i>>2]|0;
$614 = ($613>>>0)<(10);
if ($614) {
$a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $612;
break;
} else {
$e$2104$i = $612;$i$2103$i = 10;
}
while(1) {
$615 = ($i$2103$i*10)|0;
$616 = (($e$2104$i) + 1)|0;
$617 = ($613>>>0)<($615>>>0);
if ($617) {
$a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $616;
break;
} else {
$e$2104$i = $616;$i$2103$i = $615;
}
}
}
} while(0);
$618 = ((($d$3$i)) + 4|0);
$619 = ($z$3$lcssa$i>>>0)>($618>>>0);
$$z$3$i = $619 ? $618 : $z$3$lcssa$i;
$a$8$ph$i = $a$7$i;$e$4$ph$i = $e$3$i;$z$6$ph$i = $$z$3$i;
} else {
$a$8$ph$i = $a$3$lcssa$i;$e$4$ph$i = $e$1$i;$z$6$ph$i = $z$3$lcssa$i;
}
$620 = (0 - ($e$4$ph$i))|0;
$z$6$i = $z$6$ph$i;
while(1) {
$621 = ($z$6$i>>>0)>($a$8$ph$i>>>0);
if (!($621)) {
$$lcssa159$i = 0;$z$6$i$lcssa = $z$6$i;
break;
}
$622 = ((($z$6$i)) + -4|0);
$623 = HEAP32[$622>>2]|0;
$624 = ($623|0)==(0);
if ($624) {
$z$6$i = $622;
} else {
$$lcssa159$i = 1;$z$6$i$lcssa = $z$6$i;
break;
}
}
do {
if ($564) {
$625 = $565&1;
$626 = $625 ^ 1;
$$p$$i = (($626) + ($$p$i))|0;
$627 = ($$p$$i|0)>($e$4$ph$i|0);
$628 = ($e$4$ph$i|0)>(-5);
$or$cond6$i = $627 & $628;
if ($or$cond6$i) {
$629 = (($t$0) + -1)|0;
$$neg53$i = (($$p$$i) + -1)|0;
$630 = (($$neg53$i) - ($e$4$ph$i))|0;
$$013$i = $629;$$210$i = $630;
} else {
$631 = (($t$0) + -2)|0;
$632 = (($$p$$i) + -1)|0;
$$013$i = $631;$$210$i = $632;
}
$633 = $fl$1$ & 8;
$634 = ($633|0)==(0);
if (!($634)) {
$$114$i = $$013$i;$$311$i = $$210$i;$$pre$phi184$iZ2D = $633;
break;
}
do {
if ($$lcssa159$i) {
$635 = ((($z$6$i$lcssa)) + -4|0);
$636 = HEAP32[$635>>2]|0;
$637 = ($636|0)==(0);
if ($637) {
$j$2$i = 9;
break;
}
$638 = (($636>>>0) % 10)&-1;
$639 = ($638|0)==(0);
if ($639) {
$i$399$i = 10;$j$1100$i = 0;
} else {
$j$2$i = 0;
break;
}
while(1) {
$640 = ($i$399$i*10)|0;
$641 = (($j$1100$i) + 1)|0;
$642 = (($636>>>0) % ($640>>>0))&-1;
$643 = ($642|0)==(0);
if ($643) {
$i$399$i = $640;$j$1100$i = $641;
} else {
$j$2$i = $641;
break;
}
}
} else {
$j$2$i = 9;
}
} while(0);
$644 = $$013$i | 32;
$645 = ($644|0)==(102);
$646 = $z$6$i$lcssa;
$647 = (($646) - ($482))|0;
$648 = $647 >> 2;
$649 = ($648*9)|0;
$650 = (($649) + -9)|0;
if ($645) {
$651 = (($650) - ($j$2$i))|0;
$652 = ($651|0)<(0);
$$21$i = $652 ? 0 : $651;
$653 = ($$210$i|0)<($$21$i|0);
$$210$$22$i = $653 ? $$210$i : $$21$i;
$$114$i = $$013$i;$$311$i = $$210$$22$i;$$pre$phi184$iZ2D = 0;
break;
} else {
$654 = (($650) + ($e$4$ph$i))|0;
$655 = (($654) - ($j$2$i))|0;
$656 = ($655|0)<(0);
$$23$i = $656 ? 0 : $655;
$657 = ($$210$i|0)<($$23$i|0);
$$210$$24$i = $657 ? $$210$i : $$23$i;
$$114$i = $$013$i;$$311$i = $$210$$24$i;$$pre$phi184$iZ2D = 0;
break;
}
} else {
$$pre183$i = $fl$1$ & 8;
$$114$i = $t$0;$$311$i = $$p$i;$$pre$phi184$iZ2D = $$pre183$i;
}
} while(0);
$658 = $$311$i | $$pre$phi184$iZ2D;
$659 = ($658|0)!=(0);
$660 = $659&1;
$661 = $$114$i | 32;
$662 = ($661|0)==(102);
if ($662) {
$663 = ($e$4$ph$i|0)>(0);
$664 = $663 ? $e$4$ph$i : 0;
$$pn$i = $664;$estr$2$i = 0;
} else {
$665 = ($e$4$ph$i|0)<(0);
$666 = $665 ? $620 : $e$4$ph$i;
$667 = ($666|0)<(0);
$668 = $667 << 31 >> 31;
$669 = (_fmt_u($666,$668,$5)|0);
$670 = $669;
$671 = (($8) - ($670))|0;
$672 = ($671|0)<(2);
if ($672) {
$estr$193$i = $669;
while(1) {
$673 = ((($estr$193$i)) + -1|0);
HEAP8[$673>>0] = 48;
$674 = $673;
$675 = (($8) - ($674))|0;
$676 = ($675|0)<(2);
if ($676) {
$estr$193$i = $673;
} else {
$estr$1$lcssa$i = $673;
break;
}
}
} else {
$estr$1$lcssa$i = $669;
}
$677 = $e$4$ph$i >> 31;
$678 = $677 & 2;
$679 = (($678) + 43)|0;
$680 = $679&255;
$681 = ((($estr$1$lcssa$i)) + -1|0);
HEAP8[$681>>0] = $680;
$682 = $$114$i&255;
$683 = ((($estr$1$lcssa$i)) + -2|0);
HEAP8[$683>>0] = $682;
$684 = $683;
$685 = (($8) - ($684))|0;
$$pn$i = $685;$estr$2$i = $683;
}
$686 = (($pl$0$i) + 1)|0;
$687 = (($686) + ($$311$i))|0;
$l$1$i = (($687) + ($660))|0;
$688 = (($l$1$i) + ($$pn$i))|0;
_pad($f,32,$w$1,$688,$fl$1$);
$689 = HEAP32[$f>>2]|0;
$690 = $689 & 32;
$691 = ($690|0)==(0);
if ($691) {
(___fwritex($prefix$0$i,$pl$0$i,$f)|0);
}
$692 = $fl$1$ ^ 65536;
_pad($f,48,$w$1,$688,$692);
do {
if ($662) {
$693 = ($a$8$ph$i>>>0)>($$31$i>>>0);
$r$0$a$8$i = $693 ? $$31$i : $a$8$ph$i;
$d$482$i = $r$0$a$8$i;
while(1) {
$694 = HEAP32[$d$482$i>>2]|0;
$695 = (_fmt_u($694,0,$13)|0);
$696 = ($d$482$i|0)==($r$0$a$8$i|0);
do {
if ($696) {
$700 = ($695|0)==($13|0);
if (!($700)) {
$s7$1$i = $695;
break;
}
HEAP8[$15>>0] = 48;
$s7$1$i = $15;
} else {
$697 = ($695>>>0)>($buf$i>>>0);
if ($697) {
$s7$079$i = $695;
} else {
$s7$1$i = $695;
break;
}
while(1) {
$698 = ((($s7$079$i)) + -1|0);
HEAP8[$698>>0] = 48;
$699 = ($698>>>0)>($buf$i>>>0);
if ($699) {
$s7$079$i = $698;
} else {
$s7$1$i = $698;
break;
}
}
}
} while(0);
$701 = HEAP32[$f>>2]|0;
$702 = $701 & 32;
$703 = ($702|0)==(0);
if ($703) {
$704 = $s7$1$i;
$705 = (($14) - ($704))|0;
(___fwritex($s7$1$i,$705,$f)|0);
}
$706 = ((($d$482$i)) + 4|0);
$707 = ($706>>>0)>($$31$i>>>0);
if ($707) {
$$lcssa339 = $706;
break;
} else {
$d$482$i = $706;
}
}
$708 = ($658|0)==(0);
do {
if (!($708)) {
$709 = HEAP32[$f>>2]|0;
$710 = $709 & 32;
$711 = ($710|0)==(0);
if (!($711)) {
break;
}
(___fwritex(30521,1,$f)|0);
}
} while(0);
$712 = ($$lcssa339>>>0)<($z$6$i$lcssa>>>0);
$713 = ($$311$i|0)>(0);
$714 = $713 & $712;
if ($714) {
$$41276$i = $$311$i;$d$575$i = $$lcssa339;
while(1) {
$715 = HEAP32[$d$575$i>>2]|0;
$716 = (_fmt_u($715,0,$13)|0);
$717 = ($716>>>0)>($buf$i>>>0);
if ($717) {
$s8$070$i = $716;
while(1) {
$718 = ((($s8$070$i)) + -1|0);
HEAP8[$718>>0] = 48;
$719 = ($718>>>0)>($buf$i>>>0);
if ($719) {
$s8$070$i = $718;
} else {
$s8$0$lcssa$i = $718;
break;
}
}
} else {
$s8$0$lcssa$i = $716;
}
$720 = HEAP32[$f>>2]|0;
$721 = $720 & 32;
$722 = ($721|0)==(0);
if ($722) {
$723 = ($$41276$i|0)>(9);
$724 = $723 ? 9 : $$41276$i;
(___fwritex($s8$0$lcssa$i,$724,$f)|0);
}
$725 = ((($d$575$i)) + 4|0);
$726 = (($$41276$i) + -9)|0;
$727 = ($725>>>0)<($z$6$i$lcssa>>>0);
$728 = ($$41276$i|0)>(9);
$729 = $728 & $727;
if ($729) {
$$41276$i = $726;$d$575$i = $725;
} else {
$$412$lcssa$i = $726;
break;
}
}
} else {
$$412$lcssa$i = $$311$i;
}
$730 = (($$412$lcssa$i) + 9)|0;
_pad($f,48,$730,9,0);
} else {
$731 = ((($a$8$ph$i)) + 4|0);
$z$6$$i = $$lcssa159$i ? $z$6$i$lcssa : $731;
$732 = ($$311$i|0)>(-1);
if ($732) {
$733 = ($$pre$phi184$iZ2D|0)==(0);
$$587$i = $$311$i;$d$686$i = $a$8$ph$i;
while(1) {
$734 = HEAP32[$d$686$i>>2]|0;
$735 = (_fmt_u($734,0,$13)|0);
$736 = ($735|0)==($13|0);
if ($736) {
HEAP8[$15>>0] = 48;
$s9$0$i = $15;
} else {
$s9$0$i = $735;
}
$737 = ($d$686$i|0)==($a$8$ph$i|0);
do {
if ($737) {
$741 = ((($s9$0$i)) + 1|0);
$742 = HEAP32[$f>>2]|0;
$743 = $742 & 32;
$744 = ($743|0)==(0);
if ($744) {
(___fwritex($s9$0$i,1,$f)|0);
}
$745 = ($$587$i|0)<(1);
$or$cond29$i = $733 & $745;
if ($or$cond29$i) {
$s9$2$i = $741;
break;
}
$746 = HEAP32[$f>>2]|0;
$747 = $746 & 32;
$748 = ($747|0)==(0);
if (!($748)) {
$s9$2$i = $741;
break;
}
(___fwritex(30521,1,$f)|0);
$s9$2$i = $741;
} else {
$738 = ($s9$0$i>>>0)>($buf$i>>>0);
if ($738) {
$s9$183$i = $s9$0$i;
} else {
$s9$2$i = $s9$0$i;
break;
}
while(1) {
$739 = ((($s9$183$i)) + -1|0);
HEAP8[$739>>0] = 48;
$740 = ($739>>>0)>($buf$i>>>0);
if ($740) {
$s9$183$i = $739;
} else {
$s9$2$i = $739;
break;
}
}
}
} while(0);
$749 = $s9$2$i;
$750 = (($14) - ($749))|0;
$751 = HEAP32[$f>>2]|0;
$752 = $751 & 32;
$753 = ($752|0)==(0);
if ($753) {
$754 = ($$587$i|0)>($750|0);
$755 = $754 ? $750 : $$587$i;
(___fwritex($s9$2$i,$755,$f)|0);
}
$756 = (($$587$i) - ($750))|0;
$757 = ((($d$686$i)) + 4|0);
$758 = ($757>>>0)<($z$6$$i>>>0);
$759 = ($756|0)>(-1);
$760 = $758 & $759;
if ($760) {
$$587$i = $756;$d$686$i = $757;
} else {
$$5$lcssa$i = $756;
break;
}
}
} else {
$$5$lcssa$i = $$311$i;
}
$761 = (($$5$lcssa$i) + 18)|0;
_pad($f,48,$761,18,0);
$762 = HEAP32[$f>>2]|0;
$763 = $762 & 32;
$764 = ($763|0)==(0);
if (!($764)) {
break;
}
$765 = $estr$2$i;
$766 = (($8) - ($765))|0;
(___fwritex($estr$2$i,$766,$f)|0);
}
} while(0);
$767 = $fl$1$ ^ 8192;
_pad($f,32,$w$1,$688,$767);
$768 = ($688|0)<($w$1|0);
$w$30$i = $768 ? $w$1 : $688;
$$0$i = $w$30$i;
} else {
$376 = $t$0 & 32;
$377 = ($376|0)!=(0);
$378 = $377 ? 30505 : 30509;
$379 = ($$07$i != $$07$i) | (0.0 != 0.0);
$380 = $377 ? 30513 : 30517;
$pl$1$i = $379 ? 0 : $pl$0$i;
$s1$0$i = $379 ? $380 : $378;
$381 = (($pl$1$i) + 3)|0;
_pad($f,32,$w$1,$381,$175);
$382 = HEAP32[$f>>2]|0;
$383 = $382 & 32;
$384 = ($383|0)==(0);
if ($384) {
(___fwritex($prefix$0$i,$pl$1$i,$f)|0);
$$pre$i = HEAP32[$f>>2]|0;
$386 = $$pre$i;
} else {
$386 = $382;
}
$385 = $386 & 32;
$387 = ($385|0)==(0);
if ($387) {
(___fwritex($s1$0$i,3,$f)|0);
}
$388 = $fl$1$ ^ 8192;
_pad($f,32,$w$1,$381,$388);
$389 = ($381|0)<($w$1|0);
$390 = $389 ? $w$1 : $381;
$$0$i = $390;
}
} while(0);
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $$0$i;$l10n$0 = $l10n$3;
continue L1;
break;
}
default: {
$a$2 = $fmt41;$fl$6 = $fl$1$;$p$5 = $p$0;$pl$2 = 0;$prefix$2 = 30469;$z$2 = $1;
}
}
} while(0);
L313: do {
if ((label|0) == 64) {
label = 0;
$206 = $arg;
$207 = $206;
$208 = HEAP32[$207>>2]|0;
$209 = (($206) + 4)|0;
$210 = $209;
$211 = HEAP32[$210>>2]|0;
$212 = $t$1 & 32;
$213 = ($208|0)==(0);
$214 = ($211|0)==(0);
$215 = $213 & $214;
if ($215) {
$a$0 = $1;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 30469;
label = 77;
} else {
$$012$i = $1;$217 = $208;$224 = $211;
while(1) {
$216 = $217 & 15;
$218 = (30453 + ($216)|0);
$219 = HEAP8[$218>>0]|0;
$220 = $219&255;
$221 = $220 | $212;
$222 = $221&255;
$223 = ((($$012$i)) + -1|0);
HEAP8[$223>>0] = $222;
$225 = (_bitshift64Lshr(($217|0),($224|0),4)|0);
$226 = tempRet0;
$227 = ($225|0)==(0);
$228 = ($226|0)==(0);
$229 = $227 & $228;
if ($229) {
$$lcssa344 = $223;
break;
} else {
$$012$i = $223;$217 = $225;$224 = $226;
}
}
$230 = $arg;
$231 = $230;
$232 = HEAP32[$231>>2]|0;
$233 = (($230) + 4)|0;
$234 = $233;
$235 = HEAP32[$234>>2]|0;
$236 = ($232|0)==(0);
$237 = ($235|0)==(0);
$238 = $236 & $237;
$239 = $fl$3 & 8;
$240 = ($239|0)==(0);
$or$cond17 = $240 | $238;
if ($or$cond17) {
$a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 30469;
label = 77;
} else {
$241 = $t$1 >> 4;
$242 = (30469 + ($241)|0);
$a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 2;$prefix$1 = $242;
label = 77;
}
}
}
else if ((label|0) == 76) {
label = 0;
$288 = (_fmt_u($286,$287,$1)|0);
$a$0 = $288;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = $pl$0;$prefix$1 = $prefix$0;
label = 77;
}
else if ((label|0) == 82) {
label = 0;
$320 = (_memchr($a$1,0,$p$0)|0);
$321 = ($320|0)==(0|0);
$322 = $320;
$323 = $a$1;
$324 = (($322) - ($323))|0;
$325 = (($a$1) + ($p$0)|0);
$z$1 = $321 ? $325 : $320;
$p$3 = $321 ? $p$0 : $324;
$a$2 = $a$1;$fl$6 = $175;$p$5 = $p$3;$pl$2 = 0;$prefix$2 = 30469;$z$2 = $z$1;
}
else if ((label|0) == 86) {
label = 0;
$333 = HEAP32[$arg>>2]|0;
$i$0114 = 0;$l$1113 = 0;$ws$0115 = $333;
while(1) {
$334 = HEAP32[$ws$0115>>2]|0;
$335 = ($334|0)==(0);
if ($335) {
$i$0$lcssa = $i$0114;$l$2 = $l$1113;
break;
}
$336 = (_wctomb($mb,$334)|0);
$337 = ($336|0)<(0);
$338 = (($p$4198) - ($i$0114))|0;
$339 = ($336>>>0)>($338>>>0);
$or$cond20 = $337 | $339;
if ($or$cond20) {
$i$0$lcssa = $i$0114;$l$2 = $336;
break;
}
$340 = ((($ws$0115)) + 4|0);
$341 = (($336) + ($i$0114))|0;
$342 = ($p$4198>>>0)>($341>>>0);
if ($342) {
$i$0114 = $341;$l$1113 = $336;$ws$0115 = $340;
} else {
$i$0$lcssa = $341;$l$2 = $336;
break;
}
}
$343 = ($l$2|0)<(0);
if ($343) {
$$0 = -1;
break L1;
}
_pad($f,32,$w$1,$i$0$lcssa,$fl$1$);
$344 = ($i$0$lcssa|0)==(0);
if ($344) {
$i$0$lcssa200 = 0;
label = 98;
} else {
$345 = HEAP32[$arg>>2]|0;
$i$1125 = 0;$ws$1126 = $345;
while(1) {
$346 = HEAP32[$ws$1126>>2]|0;
$347 = ($346|0)==(0);
if ($347) {
$i$0$lcssa200 = $i$0$lcssa;
label = 98;
break L313;
}
$348 = ((($ws$1126)) + 4|0);
$349 = (_wctomb($mb,$346)|0);
$350 = (($349) + ($i$1125))|0;
$351 = ($350|0)>($i$0$lcssa|0);
if ($351) {
$i$0$lcssa200 = $i$0$lcssa;
label = 98;
break L313;
}
$352 = HEAP32[$f>>2]|0;
$353 = $352 & 32;
$354 = ($353|0)==(0);
if ($354) {
(___fwritex($mb,$349,$f)|0);
}
$355 = ($350>>>0)<($i$0$lcssa>>>0);
if ($355) {
$i$1125 = $350;$ws$1126 = $348;
} else {
$i$0$lcssa200 = $i$0$lcssa;
label = 98;
break;
}
}
}
}
} while(0);
if ((label|0) == 98) {
label = 0;
$356 = $fl$1$ ^ 8192;
_pad($f,32,$w$1,$i$0$lcssa200,$356);
$357 = ($w$1|0)>($i$0$lcssa200|0);
$358 = $357 ? $w$1 : $i$0$lcssa200;
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $358;$l10n$0 = $l10n$3;
continue;
}
if ((label|0) == 77) {
label = 0;
$289 = ($p$2|0)>(-1);
$290 = $fl$4 & -65537;
$$fl$4 = $289 ? $290 : $fl$4;
$291 = $arg;
$292 = $291;
$293 = HEAP32[$292>>2]|0;
$294 = (($291) + 4)|0;
$295 = $294;
$296 = HEAP32[$295>>2]|0;
$297 = ($293|0)!=(0);
$298 = ($296|0)!=(0);
$299 = $297 | $298;
$300 = ($p$2|0)!=(0);
$or$cond = $300 | $299;
if ($or$cond) {
$301 = $a$0;
$302 = (($2) - ($301))|0;
$303 = $299&1;
$304 = $303 ^ 1;
$305 = (($304) + ($302))|0;
$306 = ($p$2|0)>($305|0);
$p$2$ = $306 ? $p$2 : $305;
$a$2 = $a$0;$fl$6 = $$fl$4;$p$5 = $p$2$;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1;
} else {
$a$2 = $1;$fl$6 = $$fl$4;$p$5 = 0;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1;
}
}
$769 = $z$2;
$770 = $a$2;
$771 = (($769) - ($770))|0;
$772 = ($p$5|0)<($771|0);
$$p$5 = $772 ? $771 : $p$5;
$773 = (($pl$2) + ($$p$5))|0;
$774 = ($w$1|0)<($773|0);
$w$2 = $774 ? $773 : $w$1;
_pad($f,32,$w$2,$773,$fl$6);
$775 = HEAP32[$f>>2]|0;
$776 = $775 & 32;
$777 = ($776|0)==(0);
if ($777) {
(___fwritex($prefix$2,$pl$2,$f)|0);
}
$778 = $fl$6 ^ 65536;
_pad($f,48,$w$2,$773,$778);
_pad($f,48,$$p$5,$771,0);
$779 = HEAP32[$f>>2]|0;
$780 = $779 & 32;
$781 = ($780|0)==(0);
if ($781) {
(___fwritex($a$2,$771,$f)|0);
}
$782 = $fl$6 ^ 8192;
_pad($f,32,$w$2,$773,$782);
$cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $w$2;$l10n$0 = $l10n$3;
}
L348: do {
if ((label|0) == 245) {
$783 = ($f|0)==(0|0);
if ($783) {
$784 = ($l10n$0$lcssa|0)==(0);
if ($784) {
$$0 = 0;
} else {
$i$2100 = 1;
while(1) {
$785 = (($nl_type) + ($i$2100<<2)|0);
$786 = HEAP32[$785>>2]|0;
$787 = ($786|0)==(0);
if ($787) {
$i$2100$lcssa = $i$2100;
break;
}
$789 = (($nl_arg) + ($i$2100<<3)|0);
_pop_arg($789,$786,$ap);
$790 = (($i$2100) + 1)|0;
$791 = ($790|0)<(10);
if ($791) {
$i$2100 = $790;
} else {
$$0 = 1;
break L348;
}
}
$788 = ($i$2100$lcssa|0)<(10);
if ($788) {
$i$398 = $i$2100$lcssa;
while(1) {
$794 = (($nl_type) + ($i$398<<2)|0);
$795 = HEAP32[$794>>2]|0;
$796 = ($795|0)==(0);
$792 = (($i$398) + 1)|0;
if (!($796)) {
$$0 = -1;
break L348;
}
$793 = ($792|0)<(10);
if ($793) {
$i$398 = $792;
} else {
$$0 = 1;
break;
}
}
} else {
$$0 = 1;
}
}
} else {
$$0 = $cnt$1$lcssa;
}
}
} while(0);
STACKTOP = sp;return ($$0|0);
}
function _do_read($f,$buf,$len) {
$f = $f|0;
$buf = $buf|0;
$len = $len|0;
var $0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (___string_read($f,$buf,$len)|0);
return ($0|0);
}
function _cleanup521($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($p)) + 68|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
___unlockfile($p);
}
return;
}
function _cleanup526($p) {
$p = $p|0;
var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($p)) + 68|0);
$1 = HEAP32[$0>>2]|0;
$2 = ($1|0)==(0);
if ($2) {
___unlockfile($p);
}
return;
}
function _sift($head,$width,$cmp,$pshift,$lp) {
$head = $head|0;
$width = $width|0;
$cmp = $cmp|0;
$pshift = $pshift|0;
$lp = $lp|0;
var $$0$be = 0, $$01$be = 0, $$012 = 0, $$03 = 0, $$pre = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0;
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ar = 0, $i$0$lcssa = 0, $i$04 = 0, $sum = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 240|0;
$ar = sp;
HEAP32[$ar>>2] = $head;
$0 = ($pshift|0)>(1);
L1: do {
if ($0) {
$1 = (0 - ($width))|0;
$$012 = $pshift;$$03 = $head;$7 = $head;$i$04 = 1;
while(1) {
$2 = (($$03) + ($1)|0);
$3 = (($$012) + -2)|0;
$4 = (($lp) + ($3<<2)|0);
$5 = HEAP32[$4>>2]|0;
$sum = (($5) + ($width))|0;
$$sum = (0 - ($sum))|0;
$6 = (($$03) + ($$sum)|0);
$8 = (FUNCTION_TABLE_iii[$cmp & 7]($7,$6)|0);
$9 = ($8|0)>(-1);
if ($9) {
$10 = (FUNCTION_TABLE_iii[$cmp & 7]($7,$2)|0);
$11 = ($10|0)>(-1);
if ($11) {
$i$0$lcssa = $i$04;
break L1;
}
}
$12 = (FUNCTION_TABLE_iii[$cmp & 7]($6,$2)|0);
$13 = ($12|0)>(-1);
$14 = (($i$04) + 1)|0;
$15 = (($ar) + ($i$04<<2)|0);
if ($13) {
HEAP32[$15>>2] = $6;
$16 = (($$012) + -1)|0;
$$0$be = $6;$$01$be = $16;
} else {
HEAP32[$15>>2] = $2;
$$0$be = $2;$$01$be = $3;
}
$17 = ($$01$be|0)>(1);
if (!($17)) {
$i$0$lcssa = $14;
break L1;
}
$$pre = HEAP32[$ar>>2]|0;
$$012 = $$01$be;$$03 = $$0$be;$7 = $$pre;$i$04 = $14;
}
} else {
$i$0$lcssa = 1;
}
} while(0);
_cycle($width,$ar,$i$0$lcssa);
STACKTOP = sp;return;
}
function _trinkle($head,$width,$cmp,$pp,$pshift,$trusty,$lp) {
$head = $head|0;
$width = $width|0;
$cmp = $cmp|0;
$pp = $pp|0;
$pshift = $pshift|0;
$trusty = $trusty|0;
$lp = $lp|0;
var $$0$i = 0, $$0$lcssa = 0, $$0$lcssa49 = 0, $$01162 = 0, $$01162$phi = 0, $$02$i$i = 0, $$02$i3$i = 0, $$02$lcssa = 0, $$02$lcssa51 = 0, $$02964 = 0, $$03$lcssa = 0, $$03865 = 0, $$lcssa = 0, $$lcssa75 = 0, $$pre = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0;
var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
var $67 = 0, $68 = 0, $7 = 0, $8 = 0, $9 = 0, $ar = 0, $i$0$lcssa = 0, $i$0$lcssa50 = 0, $i$01063 = 0, $nTrailingZeros$03$i$i = 0, $nTrailingZeros$03$i2$i = 0, $nTrailingZeros$03$i2$i$lcssa = 0, $or$cond = 0, $phitmp = 0, $sum = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 240|0;
$ar = sp;
$0 = HEAP32[$pp>>2]|0;
$1 = ((($pp)) + 4|0);
$2 = HEAP32[$1>>2]|0;
HEAP32[$ar>>2] = $head;
$3 = (0 - ($width))|0;
$4 = ($0|0)!=(1);
$5 = ($2|0)!=(0);
$6 = $5 | $4;
L1: do {
if ($6) {
$7 = (($lp) + ($pshift<<2)|0);
$8 = HEAP32[$7>>2]|0;
$9 = (0 - ($8))|0;
$10 = (($head) + ($9)|0);
$11 = (FUNCTION_TABLE_iii[$cmp & 7]($10,$head)|0);
$12 = ($11|0)<(1);
if ($12) {
$$0$lcssa = $head;$$02$lcssa = $pshift;$$03$lcssa = $trusty;$i$0$lcssa = 1;
label = 19;
} else {
$phitmp = ($trusty|0)==(0);
$$01162 = $head;$$02964 = $pshift;$$03865 = $phitmp;$18 = $10;$27 = $0;$36 = $2;$i$01063 = 1;
while(1) {
$13 = ($$02964|0)>(1);
$or$cond = $$03865 & $13;
if ($or$cond) {
$14 = (($$01162) + ($3)|0);
$15 = (($$02964) + -2)|0;
$16 = (($lp) + ($15<<2)|0);
$17 = HEAP32[$16>>2]|0;
$19 = (FUNCTION_TABLE_iii[$cmp & 7]($14,$18)|0);
$20 = ($19|0)>(-1);
if ($20) {
$$0$lcssa49 = $$01162;$$02$lcssa51 = $$02964;$i$0$lcssa50 = $i$01063;
label = 20;
break L1;
}
$sum = (($17) + ($width))|0;
$$sum = (0 - ($sum))|0;
$21 = (($$01162) + ($$sum)|0);
$22 = (FUNCTION_TABLE_iii[$cmp & 7]($21,$18)|0);
$23 = ($22|0)>(-1);
if ($23) {
$$0$lcssa49 = $$01162;$$02$lcssa51 = $$02964;$i$0$lcssa50 = $i$01063;
label = 20;
break L1;
}
}
$24 = (($i$01063) + 1)|0;
$25 = (($ar) + ($i$01063<<2)|0);
HEAP32[$25>>2] = $18;
$26 = (($27) + -1)|0;
$28 = ($26|0)==(0);
do {
if ($28) {
$49 = 32;
label = 16;
} else {
$29 = $26 & 1;
$30 = ($29|0)==(0);
if ($30) {
$$02$i$i = $26;$nTrailingZeros$03$i$i = 0;
while(1) {
$31 = (($nTrailingZeros$03$i$i) + 1)|0;
$32 = $$02$i$i >>> 1;
$33 = $32 & 1;
$34 = ($33|0)==(0);
if ($34) {
$$02$i$i = $32;$nTrailingZeros$03$i$i = $31;
} else {
$$lcssa = $31;
break;
}
}
$35 = ($$lcssa|0)==(0);
if ($35) {
label = 11;
} else {
$46 = $$lcssa;
}
} else {
label = 11;
}
if ((label|0) == 11) {
label = 0;
$37 = ($36|0)==(0);
if ($37) {
$49 = 64;
label = 16;
break;
}
$38 = $36 & 1;
$39 = ($38|0)==(0);
if ($39) {
$$02$i3$i = $36;$nTrailingZeros$03$i2$i = 0;
} else {
$$0$i = 0;$51 = $27;$54 = $36;$58 = 0;
break;
}
while(1) {
$40 = (($nTrailingZeros$03$i2$i) + 1)|0;
$41 = $$02$i3$i >>> 1;
$42 = $41 & 1;
$43 = ($42|0)==(0);
if ($43) {
$$02$i3$i = $41;$nTrailingZeros$03$i2$i = $40;
} else {
$$lcssa75 = $40;$nTrailingZeros$03$i2$i$lcssa = $nTrailingZeros$03$i2$i;
break;
}
}
$44 = (($nTrailingZeros$03$i2$i$lcssa) + 33)|0;
$45 = ($$lcssa75|0)==(0);
if ($45) {
$$0$i = 0;$51 = $27;$54 = $36;$58 = 0;
break;
} else {
$46 = $44;
}
}
$47 = ($46>>>0)>(31);
if ($47) {
$49 = $46;
label = 16;
} else {
$$0$i = $46;$51 = $27;$54 = $36;$58 = $46;
}
}
} while(0);
if ((label|0) == 16) {
label = 0;
$48 = (($49) + -32)|0;
$$0$i = $48;$51 = $36;$54 = 0;$58 = $49;
}
$50 = $51 >>> $$0$i;
$52 = (32 - ($$0$i))|0;
$53 = $54 << $52;
$55 = $53 | $50;
$56 = $54 >>> $$0$i;
$57 = (($58) + ($$02964))|0;
$59 = ($55|0)!=(1);
$60 = ($56|0)!=(0);
$61 = $60 | $59;
if (!($61)) {
$$0$lcssa49 = $18;$$02$lcssa51 = $57;$i$0$lcssa50 = $24;
label = 20;
break L1;
}
$$pre = HEAP32[$ar>>2]|0;
$62 = (($lp) + ($57<<2)|0);
$63 = HEAP32[$62>>2]|0;
$64 = (0 - ($63))|0;
$65 = (($18) + ($64)|0);
$66 = (FUNCTION_TABLE_iii[$cmp & 7]($65,$$pre)|0);
$67 = ($66|0)<(1);
if ($67) {
$$0$lcssa = $18;$$02$lcssa = $57;$$03$lcssa = 0;$i$0$lcssa = $24;
label = 19;
break;
} else {
$$01162$phi = $18;$$02964 = $57;$$03865 = 1;$18 = $65;$27 = $55;$36 = $56;$i$01063 = $24;$$01162 = $$01162$phi;
}
}
}
} else {
$$0$lcssa = $head;$$02$lcssa = $pshift;$$03$lcssa = $trusty;$i$0$lcssa = 1;
label = 19;
}
} while(0);
if ((label|0) == 19) {
$68 = ($$03$lcssa|0)==(0);
if ($68) {
$$0$lcssa49 = $$0$lcssa;$$02$lcssa51 = $$02$lcssa;$i$0$lcssa50 = $i$0$lcssa;
label = 20;
}
}
if ((label|0) == 20) {
_cycle($width,$ar,$i$0$lcssa50);
_sift($$0$lcssa49,$width,$cmp,$$02$lcssa51,$lp);
}
STACKTOP = sp;return;
}
function _cycle($width,$ar,$n) {
$width = $width|0;
$ar = $ar|0;
$n = $n|0;
var $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0;
var $tmp = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$tmp = sp;
$0 = ($n|0)<(2);
L1: do {
if (!($0)) {
$1 = (($ar) + ($n<<2)|0);
HEAP32[$1>>2] = $tmp;
$2 = ($width|0)==(0);
if (!($2)) {
$$02 = $width;$6 = $tmp;
while(1) {
$3 = ($$02>>>0)>(256);
$4 = $3 ? 256 : $$02;
$5 = HEAP32[$ar>>2]|0;
_memcpy(($6|0),($5|0),($4|0))|0;
$i$01 = 0;
while(1) {
$7 = (($ar) + ($i$01<<2)|0);
$8 = HEAP32[$7>>2]|0;
$9 = (($i$01) + 1)|0;
$10 = (($ar) + ($9<<2)|0);
$11 = HEAP32[$10>>2]|0;
_memcpy(($8|0),($11|0),($4|0))|0;
$12 = HEAP32[$7>>2]|0;
$13 = (($12) + ($4)|0);
HEAP32[$7>>2] = $13;
$exitcond = ($9|0)==($n|0);
if ($exitcond) {
break;
} else {
$i$01 = $9;
}
}
$14 = ($$02|0)==($4|0);
if ($14) {
break L1;
}
$15 = (($$02) - ($4))|0;
$$pre = HEAP32[$1>>2]|0;
$$02 = $15;$6 = $$pre;
}
}
}
} while(0);
STACKTOP = sp;return;
}
function _pop_arg($arg,$type,$ap) {
$arg = $arg|0;
$type = $type|0;
$ap = $ap|0;
var $$mask = 0, $$mask1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0;
var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($type>>>0)>(20);
L1: do {
if (!($0)) {
do {
switch ($type|0) {
case 9: {
$arglist_current = HEAP32[$ap>>2]|0;
$1 = $arglist_current;
$2 = ((0) + 4|0);
$expanded28 = $2;
$expanded = (($expanded28) - 1)|0;
$3 = (($1) + ($expanded))|0;
$4 = ((0) + 4|0);
$expanded32 = $4;
$expanded31 = (($expanded32) - 1)|0;
$expanded30 = $expanded31 ^ -1;
$5 = $3 & $expanded30;
$6 = $5;
$7 = HEAP32[$6>>2]|0;
$arglist_next = ((($6)) + 4|0);
HEAP32[$ap>>2] = $arglist_next;
HEAP32[$arg>>2] = $7;
break L1;
break;
}
case 10: {
$arglist_current2 = HEAP32[$ap>>2]|0;
$8 = $arglist_current2;
$9 = ((0) + 4|0);
$expanded35 = $9;
$expanded34 = (($expanded35) - 1)|0;
$10 = (($8) + ($expanded34))|0;
$11 = ((0) + 4|0);
$expanded39 = $11;
$expanded38 = (($expanded39) - 1)|0;
$expanded37 = $expanded38 ^ -1;
$12 = $10 & $expanded37;
$13 = $12;
$14 = HEAP32[$13>>2]|0;
$arglist_next3 = ((($13)) + 4|0);
HEAP32[$ap>>2] = $arglist_next3;
$15 = ($14|0)<(0);
$16 = $15 << 31 >> 31;
$17 = $arg;
$18 = $17;
HEAP32[$18>>2] = $14;
$19 = (($17) + 4)|0;
$20 = $19;
HEAP32[$20>>2] = $16;
break L1;
break;
}
case 11: {
$arglist_current5 = HEAP32[$ap>>2]|0;
$21 = $arglist_current5;
$22 = ((0) + 4|0);
$expanded42 = $22;
$expanded41 = (($expanded42) - 1)|0;
$23 = (($21) + ($expanded41))|0;
$24 = ((0) + 4|0);
$expanded46 = $24;
$expanded45 = (($expanded46) - 1)|0;
$expanded44 = $expanded45 ^ -1;
$25 = $23 & $expanded44;
$26 = $25;
$27 = HEAP32[$26>>2]|0;
$arglist_next6 = ((($26)) + 4|0);
HEAP32[$ap>>2] = $arglist_next6;
$28 = $arg;
$29 = $28;
HEAP32[$29>>2] = $27;
$30 = (($28) + 4)|0;
$31 = $30;
HEAP32[$31>>2] = 0;
break L1;
break;
}
case 12: {
$arglist_current8 = HEAP32[$ap>>2]|0;
$32 = $arglist_current8;
$33 = ((0) + 8|0);
$expanded49 = $33;
$expanded48 = (($expanded49) - 1)|0;
$34 = (($32) + ($expanded48))|0;
$35 = ((0) + 8|0);
$expanded53 = $35;
$expanded52 = (($expanded53) - 1)|0;
$expanded51 = $expanded52 ^ -1;
$36 = $34 & $expanded51;
$37 = $36;
$38 = $37;
$39 = $38;
$40 = HEAP32[$39>>2]|0;
$41 = (($38) + 4)|0;
$42 = $41;
$43 = HEAP32[$42>>2]|0;
$arglist_next9 = ((($37)) + 8|0);
HEAP32[$ap>>2] = $arglist_next9;
$44 = $arg;
$45 = $44;
HEAP32[$45>>2] = $40;
$46 = (($44) + 4)|0;
$47 = $46;
HEAP32[$47>>2] = $43;
break L1;
break;
}
case 13: {
$arglist_current11 = HEAP32[$ap>>2]|0;
$48 = $arglist_current11;
$49 = ((0) + 4|0);
$expanded56 = $49;
$expanded55 = (($expanded56) - 1)|0;
$50 = (($48) + ($expanded55))|0;
$51 = ((0) + 4|0);
$expanded60 = $51;
$expanded59 = (($expanded60) - 1)|0;
$expanded58 = $expanded59 ^ -1;
$52 = $50 & $expanded58;
$53 = $52;
$54 = HEAP32[$53>>2]|0;
$arglist_next12 = ((($53)) + 4|0);
HEAP32[$ap>>2] = $arglist_next12;
$55 = $54&65535;
$56 = $55 << 16 >> 16;
$57 = ($56|0)<(0);
$58 = $57 << 31 >> 31;
$59 = $arg;
$60 = $59;
HEAP32[$60>>2] = $56;
$61 = (($59) + 4)|0;
$62 = $61;
HEAP32[$62>>2] = $58;
break L1;
break;
}
case 14: {
$arglist_current14 = HEAP32[$ap>>2]|0;
$63 = $arglist_current14;
$64 = ((0) + 4|0);
$expanded63 = $64;
$expanded62 = (($expanded63) - 1)|0;
$65 = (($63) + ($expanded62))|0;
$66 = ((0) + 4|0);
$expanded67 = $66;
$expanded66 = (($expanded67) - 1)|0;
$expanded65 = $expanded66 ^ -1;
$67 = $65 & $expanded65;
$68 = $67;
$69 = HEAP32[$68>>2]|0;
$arglist_next15 = ((($68)) + 4|0);
HEAP32[$ap>>2] = $arglist_next15;
$$mask1 = $69 & 65535;
$70 = $arg;
$71 = $70;
HEAP32[$71>>2] = $$mask1;
$72 = (($70) + 4)|0;
$73 = $72;
HEAP32[$73>>2] = 0;
break L1;
break;
}
case 15: {
$arglist_current17 = HEAP32[$ap>>2]|0;
$74 = $arglist_current17;
$75 = ((0) + 4|0);
$expanded70 = $75;
$expanded69 = (($expanded70) - 1)|0;
$76 = (($74) + ($expanded69))|0;
$77 = ((0) + 4|0);
$expanded74 = $77;
$expanded73 = (($expanded74) - 1)|0;
$expanded72 = $expanded73 ^ -1;
$78 = $76 & $expanded72;
$79 = $78;
$80 = HEAP32[$79>>2]|0;
$arglist_next18 = ((($79)) + 4|0);
HEAP32[$ap>>2] = $arglist_next18;
$81 = $80&255;
$82 = $81 << 24 >> 24;
$83 = ($82|0)<(0);
$84 = $83 << 31 >> 31;
$85 = $arg;
$86 = $85;
HEAP32[$86>>2] = $82;
$87 = (($85) + 4)|0;
$88 = $87;
HEAP32[$88>>2] = $84;
break L1;
break;
}
case 16: {
$arglist_current20 = HEAP32[$ap>>2]|0;
$89 = $arglist_current20;
$90 = ((0) + 4|0);
$expanded77 = $90;
$expanded76 = (($expanded77) - 1)|0;
$91 = (($89) + ($expanded76))|0;
$92 = ((0) + 4|0);
$expanded81 = $92;
$expanded80 = (($expanded81) - 1)|0;
$expanded79 = $expanded80 ^ -1;
$93 = $91 & $expanded79;
$94 = $93;
$95 = HEAP32[$94>>2]|0;
$arglist_next21 = ((($94)) + 4|0);
HEAP32[$ap>>2] = $arglist_next21;
$$mask = $95 & 255;
$96 = $arg;
$97 = $96;
HEAP32[$97>>2] = $$mask;
$98 = (($96) + 4)|0;
$99 = $98;
HEAP32[$99>>2] = 0;
break L1;
break;
}
case 17: {
$arglist_current23 = HEAP32[$ap>>2]|0;
$100 = $arglist_current23;
$101 = ((0) + 8|0);
$expanded84 = $101;
$expanded83 = (($expanded84) - 1)|0;
$102 = (($100) + ($expanded83))|0;
$103 = ((0) + 8|0);
$expanded88 = $103;
$expanded87 = (($expanded88) - 1)|0;
$expanded86 = $expanded87 ^ -1;
$104 = $102 & $expanded86;
$105 = $104;
$106 = +HEAPF64[$105>>3];
$arglist_next24 = ((($105)) + 8|0);
HEAP32[$ap>>2] = $arglist_next24;
HEAPF64[$arg>>3] = $106;
break L1;
break;
}
case 18: {
$arglist_current26 = HEAP32[$ap>>2]|0;
$107 = $arglist_current26;
$108 = ((0) + 8|0);
$expanded91 = $108;
$expanded90 = (($expanded91) - 1)|0;
$109 = (($107) + ($expanded90))|0;
$110 = ((0) + 8|0);
$expanded95 = $110;
$expanded94 = (($expanded95) - 1)|0;
$expanded93 = $expanded94 ^ -1;
$111 = $109 & $expanded93;
$112 = $111;
$113 = +HEAPF64[$112>>3];
$arglist_next27 = ((($112)) + 8|0);
HEAP32[$ap>>2] = $arglist_next27;
HEAPF64[$arg>>3] = $113;
break L1;
break;
}
default: {
break L1;
}
}
} while(0);
}
} while(0);
return;
}
function _fmt_u($0,$1,$s) {
$0 = $0|0;
$1 = $1|0;
$s = $s|0;
var $$0$lcssa = 0, $$01$lcssa$off0 = 0, $$05 = 0, $$1$lcssa = 0, $$12 = 0, $$lcssa20 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $y$03 = 0, label = 0, sp = 0;
sp = STACKTOP;
$2 = ($1>>>0)>(0);
$3 = ($0>>>0)>(4294967295);
$4 = ($1|0)==(0);
$5 = $4 & $3;
$6 = $2 | $5;
if ($6) {
$$05 = $s;$7 = $0;$8 = $1;
while(1) {
$9 = (___uremdi3(($7|0),($8|0),10,0)|0);
$10 = tempRet0;
$11 = $9 | 48;
$12 = $11&255;
$13 = ((($$05)) + -1|0);
HEAP8[$13>>0] = $12;
$14 = (___udivdi3(($7|0),($8|0),10,0)|0);
$15 = tempRet0;
$16 = ($8>>>0)>(9);
$17 = ($7>>>0)>(4294967295);
$18 = ($8|0)==(9);
$19 = $18 & $17;
$20 = $16 | $19;
if ($20) {
$$05 = $13;$7 = $14;$8 = $15;
} else {
$$lcssa20 = $13;$28 = $14;$29 = $15;
break;
}
}
$$0$lcssa = $$lcssa20;$$01$lcssa$off0 = $28;
} else {
$$0$lcssa = $s;$$01$lcssa$off0 = $0;
}
$21 = ($$01$lcssa$off0|0)==(0);
if ($21) {
$$1$lcssa = $$0$lcssa;
} else {
$$12 = $$0$lcssa;$y$03 = $$01$lcssa$off0;
while(1) {
$22 = (($y$03>>>0) % 10)&-1;
$23 = $22 | 48;
$24 = $23&255;
$25 = ((($$12)) + -1|0);
HEAP8[$25>>0] = $24;
$26 = (($y$03>>>0) / 10)&-1;
$27 = ($y$03>>>0)<(10);
if ($27) {
$$1$lcssa = $25;
break;
} else {
$$12 = $25;$y$03 = $26;
}
}
}
return ($$1$lcssa|0);
}
function _pad($f,$c,$w,$l,$fl) {
$f = $f|0;
$c = $c|0;
$w = $w|0;
$l = $l|0;
$fl = $fl|0;
var $$0$lcssa6 = 0, $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
var $8 = 0, $9 = 0, $or$cond = 0, $pad = 0, label = 0, sp = 0;
sp = STACKTOP;
STACKTOP = STACKTOP + 256|0;
$pad = sp;
$0 = $fl & 73728;
$1 = ($0|0)==(0);
$2 = ($w|0)>($l|0);
$or$cond = $2 & $1;
do {
if ($or$cond) {
$3 = (($w) - ($l))|0;
$4 = ($3>>>0)>(256);
$5 = $4 ? 256 : $3;
_memset(($pad|0),($c|0),($5|0))|0;
$6 = ($3>>>0)>(255);
$7 = HEAP32[$f>>2]|0;
$8 = $7 & 32;
$9 = ($8|0)==(0);
if ($6) {
$10 = (($w) - ($l))|0;
$$02 = $3;$17 = $7;$18 = $9;
while(1) {
if ($18) {
(___fwritex($pad,256,$f)|0);
$$pre = HEAP32[$f>>2]|0;
$14 = $$pre;
} else {
$14 = $17;
}
$11 = (($$02) + -256)|0;
$12 = ($11>>>0)>(255);
$13 = $14 & 32;
$15 = ($13|0)==(0);
if ($12) {
$$02 = $11;$17 = $14;$18 = $15;
} else {
break;
}
}
$16 = $10 & 255;
if ($15) {
$$0$lcssa6 = $16;
} else {
break;
}
} else {
if ($9) {
$$0$lcssa6 = $3;
} else {
break;
}
}
(___fwritex($pad,$$0$lcssa6,$f)|0);
}
} while(0);
STACKTOP = sp;return;
}
function _malloc($bytes) {
$bytes = $bytes|0;
var $$3$i = 0, $$lcssa = 0, $$lcssa211 = 0, $$lcssa215 = 0, $$lcssa216 = 0, $$lcssa217 = 0, $$lcssa219 = 0, $$lcssa222 = 0, $$lcssa224 = 0, $$lcssa226 = 0, $$lcssa228 = 0, $$lcssa230 = 0, $$lcssa232 = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i22$i = 0, $$pre$i25 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i23$iZ2D = 0;
var $$pre$phi$i26Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi58$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre105 = 0, $$pre106 = 0, $$pre14$i$i = 0, $$pre43$i = 0, $$pre56$i$i = 0, $$pre57$i$i = 0, $$pre8$i = 0, $$rsize$0$i = 0, $$rsize$3$i = 0, $$sum = 0, $$sum$i$i = 0, $$sum$i$i$i = 0, $$sum$i13$i = 0, $$sum$i14$i = 0, $$sum$i17$i = 0, $$sum$i19$i = 0;
var $$sum$i2334 = 0, $$sum$i32 = 0, $$sum$i35 = 0, $$sum1 = 0, $$sum1$i = 0, $$sum1$i$i = 0, $$sum1$i15$i = 0, $$sum1$i20$i = 0, $$sum1$i24 = 0, $$sum10 = 0, $$sum10$i = 0, $$sum10$i$i = 0, $$sum11$i = 0, $$sum11$i$i = 0, $$sum1112 = 0, $$sum112$i = 0, $$sum113$i = 0, $$sum114$i = 0, $$sum115$i = 0, $$sum116$i = 0;
var $$sum117$i = 0, $$sum118$i = 0, $$sum119$i = 0, $$sum12$i = 0, $$sum12$i$i = 0, $$sum120$i = 0, $$sum121$i = 0, $$sum122$i = 0, $$sum123$i = 0, $$sum124$i = 0, $$sum125$i = 0, $$sum13$i = 0, $$sum13$i$i = 0, $$sum14$i$i = 0, $$sum15$i = 0, $$sum15$i$i = 0, $$sum16$i = 0, $$sum16$i$i = 0, $$sum17$i = 0, $$sum17$i$i = 0;
var $$sum18$i = 0, $$sum1819$i$i = 0, $$sum2 = 0, $$sum2$i = 0, $$sum2$i$i = 0, $$sum2$i$i$i = 0, $$sum2$i16$i = 0, $$sum2$i18$i = 0, $$sum2$i21$i = 0, $$sum20$i$i = 0, $$sum21$i$i = 0, $$sum22$i$i = 0, $$sum23$i$i = 0, $$sum24$i$i = 0, $$sum25$i$i = 0, $$sum27$i$i = 0, $$sum28$i$i = 0, $$sum29$i$i = 0, $$sum3$i = 0, $$sum3$i27 = 0;
var $$sum30$i$i = 0, $$sum3132$i$i = 0, $$sum34$i$i = 0, $$sum3536$i$i = 0, $$sum3738$i$i = 0, $$sum39$i$i = 0, $$sum4 = 0, $$sum4$i = 0, $$sum4$i$i = 0, $$sum4$i28 = 0, $$sum40$i$i = 0, $$sum41$i$i = 0, $$sum42$i$i = 0, $$sum5$i = 0, $$sum5$i$i = 0, $$sum56 = 0, $$sum6$i = 0, $$sum67$i$i = 0, $$sum7$i = 0, $$sum8$i = 0;
var $$sum9 = 0, $$sum9$i = 0, $$sum9$i$i = 0, $$tsize$1$i = 0, $$v$0$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0;
var $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0;
var $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0;
var $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0;
var $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0;
var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0;
var $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0;
var $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0;
var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0;
var $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0;
var $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0;
var $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0;
var $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0;
var $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0;
var $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0;
var $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0;
var $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0;
var $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0;
var $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0;
var $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0;
var $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0;
var $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0;
var $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0;
var $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0;
var $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0;
var $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0;
var $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0;
var $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0;
var $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0;
var $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0;
var $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0;
var $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0;
var $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0;
var $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0;
var $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0;
var $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0;
var $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0;
var $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0;
var $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0;
var $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0;
var $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0;
var $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0;
var $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0;
var $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0;
var $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0;
var $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0;
var $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0;
var $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0;
var $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0;
var $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0;
var $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0;
var $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0;
var $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $F$0$i$i = 0, $F1$0$i = 0, $F4$0 = 0, $F4$0$i$i = 0;
var $F5$0$i = 0, $I1$0$i$i = 0, $I7$0$i = 0, $I7$0$i$i = 0, $K12$029$i = 0, $K2$07$i$i = 0, $K8$051$i$i = 0, $R$0$i = 0, $R$0$i$i = 0, $R$0$i$i$lcssa = 0, $R$0$i$lcssa = 0, $R$0$i18 = 0, $R$0$i18$lcssa = 0, $R$1$i = 0, $R$1$i$i = 0, $R$1$i20 = 0, $RP$0$i = 0, $RP$0$i$i = 0, $RP$0$i$i$lcssa = 0, $RP$0$i$lcssa = 0;
var $RP$0$i17 = 0, $RP$0$i17$lcssa = 0, $T$0$lcssa$i = 0, $T$0$lcssa$i$i = 0, $T$0$lcssa$i25$i = 0, $T$028$i = 0, $T$028$i$lcssa = 0, $T$050$i$i = 0, $T$050$i$i$lcssa = 0, $T$06$i$i = 0, $T$06$i$i$lcssa = 0, $br$0$ph$i = 0, $cond$i = 0, $cond$i$i = 0, $cond$i21 = 0, $exitcond$i$i = 0, $i$02$i$i = 0, $idx$0$i = 0, $mem$0 = 0, $nb$0 = 0;
var $not$$i = 0, $not$$i$i = 0, $not$$i26$i = 0, $oldfirst$0$i$i = 0, $or$cond$i = 0, $or$cond$i30 = 0, $or$cond1$i = 0, $or$cond19$i = 0, $or$cond2$i = 0, $or$cond3$i = 0, $or$cond5$i = 0, $or$cond57$i = 0, $or$cond6$i = 0, $or$cond8$i = 0, $or$cond9$i = 0, $qsize$0$i$i = 0, $rsize$0$i = 0, $rsize$0$i$lcssa = 0, $rsize$0$i15 = 0, $rsize$1$i = 0;
var $rsize$2$i = 0, $rsize$3$lcssa$i = 0, $rsize$331$i = 0, $rst$0$i = 0, $rst$1$i = 0, $sizebits$0$i = 0, $sp$0$i$i = 0, $sp$0$i$i$i = 0, $sp$084$i = 0, $sp$084$i$lcssa = 0, $sp$183$i = 0, $sp$183$i$lcssa = 0, $ssize$0$$i = 0, $ssize$0$i = 0, $ssize$1$ph$i = 0, $ssize$2$i = 0, $t$0$i = 0, $t$0$i14 = 0, $t$1$i = 0, $t$2$ph$i = 0;
var $t$2$v$3$i = 0, $t$230$i = 0, $tbase$255$i = 0, $tsize$0$ph$i = 0, $tsize$0323944$i = 0, $tsize$1$i = 0, $tsize$254$i = 0, $v$0$i = 0, $v$0$i$lcssa = 0, $v$0$i16 = 0, $v$1$i = 0, $v$2$i = 0, $v$3$lcssa$i = 0, $v$3$ph$i = 0, $v$332$i = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($bytes>>>0)<(245);
do {
if ($0) {
$1 = ($bytes>>>0)<(11);
$2 = (($bytes) + 11)|0;
$3 = $2 & -8;
$4 = $1 ? 16 : $3;
$5 = $4 >>> 3;
$6 = HEAP32[9064>>2]|0;
$7 = $6 >>> $5;
$8 = $7 & 3;
$9 = ($8|0)==(0);
if (!($9)) {
$10 = $7 & 1;
$11 = $10 ^ 1;
$12 = (($11) + ($5))|0;
$13 = $12 << 1;
$14 = (9104 + ($13<<2)|0);
$$sum10 = (($13) + 2)|0;
$15 = (9104 + ($$sum10<<2)|0);
$16 = HEAP32[$15>>2]|0;
$17 = ((($16)) + 8|0);
$18 = HEAP32[$17>>2]|0;
$19 = ($14|0)==($18|0);
do {
if ($19) {
$20 = 1 << $12;
$21 = $20 ^ -1;
$22 = $6 & $21;
HEAP32[9064>>2] = $22;
} else {
$23 = HEAP32[(9080)>>2]|0;
$24 = ($18>>>0)<($23>>>0);
if ($24) {
_abort();
// unreachable;
}
$25 = ((($18)) + 12|0);
$26 = HEAP32[$25>>2]|0;
$27 = ($26|0)==($16|0);
if ($27) {
HEAP32[$25>>2] = $14;
HEAP32[$15>>2] = $18;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$28 = $12 << 3;
$29 = $28 | 3;
$30 = ((($16)) + 4|0);
HEAP32[$30>>2] = $29;
$$sum1112 = $28 | 4;
$31 = (($16) + ($$sum1112)|0);
$32 = HEAP32[$31>>2]|0;
$33 = $32 | 1;
HEAP32[$31>>2] = $33;
$mem$0 = $17;
return ($mem$0|0);
}
$34 = HEAP32[(9072)>>2]|0;
$35 = ($4>>>0)>($34>>>0);
if ($35) {
$36 = ($7|0)==(0);
if (!($36)) {
$37 = $7 << $5;
$38 = 2 << $5;
$39 = (0 - ($38))|0;
$40 = $38 | $39;
$41 = $37 & $40;
$42 = (0 - ($41))|0;
$43 = $41 & $42;
$44 = (($43) + -1)|0;
$45 = $44 >>> 12;
$46 = $45 & 16;
$47 = $44 >>> $46;
$48 = $47 >>> 5;
$49 = $48 & 8;
$50 = $49 | $46;
$51 = $47 >>> $49;
$52 = $51 >>> 2;
$53 = $52 & 4;
$54 = $50 | $53;
$55 = $51 >>> $53;
$56 = $55 >>> 1;
$57 = $56 & 2;
$58 = $54 | $57;
$59 = $55 >>> $57;
$60 = $59 >>> 1;
$61 = $60 & 1;
$62 = $58 | $61;
$63 = $59 >>> $61;
$64 = (($62) + ($63))|0;
$65 = $64 << 1;
$66 = (9104 + ($65<<2)|0);
$$sum4 = (($65) + 2)|0;
$67 = (9104 + ($$sum4<<2)|0);
$68 = HEAP32[$67>>2]|0;
$69 = ((($68)) + 8|0);
$70 = HEAP32[$69>>2]|0;
$71 = ($66|0)==($70|0);
do {
if ($71) {
$72 = 1 << $64;
$73 = $72 ^ -1;
$74 = $6 & $73;
HEAP32[9064>>2] = $74;
$88 = $34;
} else {
$75 = HEAP32[(9080)>>2]|0;
$76 = ($70>>>0)<($75>>>0);
if ($76) {
_abort();
// unreachable;
}
$77 = ((($70)) + 12|0);
$78 = HEAP32[$77>>2]|0;
$79 = ($78|0)==($68|0);
if ($79) {
HEAP32[$77>>2] = $66;
HEAP32[$67>>2] = $70;
$$pre = HEAP32[(9072)>>2]|0;
$88 = $$pre;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$80 = $64 << 3;
$81 = (($80) - ($4))|0;
$82 = $4 | 3;
$83 = ((($68)) + 4|0);
HEAP32[$83>>2] = $82;
$84 = (($68) + ($4)|0);
$85 = $81 | 1;
$$sum56 = $4 | 4;
$86 = (($68) + ($$sum56)|0);
HEAP32[$86>>2] = $85;
$87 = (($68) + ($80)|0);
HEAP32[$87>>2] = $81;
$89 = ($88|0)==(0);
if (!($89)) {
$90 = HEAP32[(9084)>>2]|0;
$91 = $88 >>> 3;
$92 = $91 << 1;
$93 = (9104 + ($92<<2)|0);
$94 = HEAP32[9064>>2]|0;
$95 = 1 << $91;
$96 = $94 & $95;
$97 = ($96|0)==(0);
if ($97) {
$98 = $94 | $95;
HEAP32[9064>>2] = $98;
$$pre105 = (($92) + 2)|0;
$$pre106 = (9104 + ($$pre105<<2)|0);
$$pre$phiZ2D = $$pre106;$F4$0 = $93;
} else {
$$sum9 = (($92) + 2)|0;
$99 = (9104 + ($$sum9<<2)|0);
$100 = HEAP32[$99>>2]|0;
$101 = HEAP32[(9080)>>2]|0;
$102 = ($100>>>0)<($101>>>0);
if ($102) {
_abort();
// unreachable;
} else {
$$pre$phiZ2D = $99;$F4$0 = $100;
}
}
HEAP32[$$pre$phiZ2D>>2] = $90;
$103 = ((($F4$0)) + 12|0);
HEAP32[$103>>2] = $90;
$104 = ((($90)) + 8|0);
HEAP32[$104>>2] = $F4$0;
$105 = ((($90)) + 12|0);
HEAP32[$105>>2] = $93;
}
HEAP32[(9072)>>2] = $81;
HEAP32[(9084)>>2] = $84;
$mem$0 = $69;
return ($mem$0|0);
}
$106 = HEAP32[(9068)>>2]|0;
$107 = ($106|0)==(0);
if ($107) {
$nb$0 = $4;
} else {
$108 = (0 - ($106))|0;
$109 = $106 & $108;
$110 = (($109) + -1)|0;
$111 = $110 >>> 12;
$112 = $111 & 16;
$113 = $110 >>> $112;
$114 = $113 >>> 5;
$115 = $114 & 8;
$116 = $115 | $112;
$117 = $113 >>> $115;
$118 = $117 >>> 2;
$119 = $118 & 4;
$120 = $116 | $119;
$121 = $117 >>> $119;
$122 = $121 >>> 1;
$123 = $122 & 2;
$124 = $120 | $123;
$125 = $121 >>> $123;
$126 = $125 >>> 1;
$127 = $126 & 1;
$128 = $124 | $127;
$129 = $125 >>> $127;
$130 = (($128) + ($129))|0;
$131 = (9368 + ($130<<2)|0);
$132 = HEAP32[$131>>2]|0;
$133 = ((($132)) + 4|0);
$134 = HEAP32[$133>>2]|0;
$135 = $134 & -8;
$136 = (($135) - ($4))|0;
$rsize$0$i = $136;$t$0$i = $132;$v$0$i = $132;
while(1) {
$137 = ((($t$0$i)) + 16|0);
$138 = HEAP32[$137>>2]|0;
$139 = ($138|0)==(0|0);
if ($139) {
$140 = ((($t$0$i)) + 20|0);
$141 = HEAP32[$140>>2]|0;
$142 = ($141|0)==(0|0);
if ($142) {
$rsize$0$i$lcssa = $rsize$0$i;$v$0$i$lcssa = $v$0$i;
break;
} else {
$144 = $141;
}
} else {
$144 = $138;
}
$143 = ((($144)) + 4|0);
$145 = HEAP32[$143>>2]|0;
$146 = $145 & -8;
$147 = (($146) - ($4))|0;
$148 = ($147>>>0)<($rsize$0$i>>>0);
$$rsize$0$i = $148 ? $147 : $rsize$0$i;
$$v$0$i = $148 ? $144 : $v$0$i;
$rsize$0$i = $$rsize$0$i;$t$0$i = $144;$v$0$i = $$v$0$i;
}
$149 = HEAP32[(9080)>>2]|0;
$150 = ($v$0$i$lcssa>>>0)<($149>>>0);
if ($150) {
_abort();
// unreachable;
}
$151 = (($v$0$i$lcssa) + ($4)|0);
$152 = ($v$0$i$lcssa>>>0)<($151>>>0);
if (!($152)) {
_abort();
// unreachable;
}
$153 = ((($v$0$i$lcssa)) + 24|0);
$154 = HEAP32[$153>>2]|0;
$155 = ((($v$0$i$lcssa)) + 12|0);
$156 = HEAP32[$155>>2]|0;
$157 = ($156|0)==($v$0$i$lcssa|0);
do {
if ($157) {
$167 = ((($v$0$i$lcssa)) + 20|0);
$168 = HEAP32[$167>>2]|0;
$169 = ($168|0)==(0|0);
if ($169) {
$170 = ((($v$0$i$lcssa)) + 16|0);
$171 = HEAP32[$170>>2]|0;
$172 = ($171|0)==(0|0);
if ($172) {
$R$1$i = 0;
break;
} else {
$R$0$i = $171;$RP$0$i = $170;
}
} else {
$R$0$i = $168;$RP$0$i = $167;
}
while(1) {
$173 = ((($R$0$i)) + 20|0);
$174 = HEAP32[$173>>2]|0;
$175 = ($174|0)==(0|0);
if (!($175)) {
$R$0$i = $174;$RP$0$i = $173;
continue;
}
$176 = ((($R$0$i)) + 16|0);
$177 = HEAP32[$176>>2]|0;
$178 = ($177|0)==(0|0);
if ($178) {
$R$0$i$lcssa = $R$0$i;$RP$0$i$lcssa = $RP$0$i;
break;
} else {
$R$0$i = $177;$RP$0$i = $176;
}
}
$179 = ($RP$0$i$lcssa>>>0)<($149>>>0);
if ($179) {
_abort();
// unreachable;
} else {
HEAP32[$RP$0$i$lcssa>>2] = 0;
$R$1$i = $R$0$i$lcssa;
break;
}
} else {
$158 = ((($v$0$i$lcssa)) + 8|0);
$159 = HEAP32[$158>>2]|0;
$160 = ($159>>>0)<($149>>>0);
if ($160) {
_abort();
// unreachable;
}
$161 = ((($159)) + 12|0);
$162 = HEAP32[$161>>2]|0;
$163 = ($162|0)==($v$0$i$lcssa|0);
if (!($163)) {
_abort();
// unreachable;
}
$164 = ((($156)) + 8|0);
$165 = HEAP32[$164>>2]|0;
$166 = ($165|0)==($v$0$i$lcssa|0);
if ($166) {
HEAP32[$161>>2] = $156;
HEAP32[$164>>2] = $159;
$R$1$i = $156;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$180 = ($154|0)==(0|0);
do {
if (!($180)) {
$181 = ((($v$0$i$lcssa)) + 28|0);
$182 = HEAP32[$181>>2]|0;
$183 = (9368 + ($182<<2)|0);
$184 = HEAP32[$183>>2]|0;
$185 = ($v$0$i$lcssa|0)==($184|0);
if ($185) {
HEAP32[$183>>2] = $R$1$i;
$cond$i = ($R$1$i|0)==(0|0);
if ($cond$i) {
$186 = 1 << $182;
$187 = $186 ^ -1;
$188 = HEAP32[(9068)>>2]|0;
$189 = $188 & $187;
HEAP32[(9068)>>2] = $189;
break;
}
} else {
$190 = HEAP32[(9080)>>2]|0;
$191 = ($154>>>0)<($190>>>0);
if ($191) {
_abort();
// unreachable;
}
$192 = ((($154)) + 16|0);
$193 = HEAP32[$192>>2]|0;
$194 = ($193|0)==($v$0$i$lcssa|0);
if ($194) {
HEAP32[$192>>2] = $R$1$i;
} else {
$195 = ((($154)) + 20|0);
HEAP32[$195>>2] = $R$1$i;
}
$196 = ($R$1$i|0)==(0|0);
if ($196) {
break;
}
}
$197 = HEAP32[(9080)>>2]|0;
$198 = ($R$1$i>>>0)<($197>>>0);
if ($198) {
_abort();
// unreachable;
}
$199 = ((($R$1$i)) + 24|0);
HEAP32[$199>>2] = $154;
$200 = ((($v$0$i$lcssa)) + 16|0);
$201 = HEAP32[$200>>2]|0;
$202 = ($201|0)==(0|0);
do {
if (!($202)) {
$203 = ($201>>>0)<($197>>>0);
if ($203) {
_abort();
// unreachable;
} else {
$204 = ((($R$1$i)) + 16|0);
HEAP32[$204>>2] = $201;
$205 = ((($201)) + 24|0);
HEAP32[$205>>2] = $R$1$i;
break;
}
}
} while(0);
$206 = ((($v$0$i$lcssa)) + 20|0);
$207 = HEAP32[$206>>2]|0;
$208 = ($207|0)==(0|0);
if (!($208)) {
$209 = HEAP32[(9080)>>2]|0;
$210 = ($207>>>0)<($209>>>0);
if ($210) {
_abort();
// unreachable;
} else {
$211 = ((($R$1$i)) + 20|0);
HEAP32[$211>>2] = $207;
$212 = ((($207)) + 24|0);
HEAP32[$212>>2] = $R$1$i;
break;
}
}
}
} while(0);
$213 = ($rsize$0$i$lcssa>>>0)<(16);
if ($213) {
$214 = (($rsize$0$i$lcssa) + ($4))|0;
$215 = $214 | 3;
$216 = ((($v$0$i$lcssa)) + 4|0);
HEAP32[$216>>2] = $215;
$$sum4$i = (($214) + 4)|0;
$217 = (($v$0$i$lcssa) + ($$sum4$i)|0);
$218 = HEAP32[$217>>2]|0;
$219 = $218 | 1;
HEAP32[$217>>2] = $219;
} else {
$220 = $4 | 3;
$221 = ((($v$0$i$lcssa)) + 4|0);
HEAP32[$221>>2] = $220;
$222 = $rsize$0$i$lcssa | 1;
$$sum$i35 = $4 | 4;
$223 = (($v$0$i$lcssa) + ($$sum$i35)|0);
HEAP32[$223>>2] = $222;
$$sum1$i = (($rsize$0$i$lcssa) + ($4))|0;
$224 = (($v$0$i$lcssa) + ($$sum1$i)|0);
HEAP32[$224>>2] = $rsize$0$i$lcssa;
$225 = HEAP32[(9072)>>2]|0;
$226 = ($225|0)==(0);
if (!($226)) {
$227 = HEAP32[(9084)>>2]|0;
$228 = $225 >>> 3;
$229 = $228 << 1;
$230 = (9104 + ($229<<2)|0);
$231 = HEAP32[9064>>2]|0;
$232 = 1 << $228;
$233 = $231 & $232;
$234 = ($233|0)==(0);
if ($234) {
$235 = $231 | $232;
HEAP32[9064>>2] = $235;
$$pre$i = (($229) + 2)|0;
$$pre8$i = (9104 + ($$pre$i<<2)|0);
$$pre$phi$iZ2D = $$pre8$i;$F1$0$i = $230;
} else {
$$sum3$i = (($229) + 2)|0;
$236 = (9104 + ($$sum3$i<<2)|0);
$237 = HEAP32[$236>>2]|0;
$238 = HEAP32[(9080)>>2]|0;
$239 = ($237>>>0)<($238>>>0);
if ($239) {
_abort();
// unreachable;
} else {
$$pre$phi$iZ2D = $236;$F1$0$i = $237;
}
}
HEAP32[$$pre$phi$iZ2D>>2] = $227;
$240 = ((($F1$0$i)) + 12|0);
HEAP32[$240>>2] = $227;
$241 = ((($227)) + 8|0);
HEAP32[$241>>2] = $F1$0$i;
$242 = ((($227)) + 12|0);
HEAP32[$242>>2] = $230;
}
HEAP32[(9072)>>2] = $rsize$0$i$lcssa;
HEAP32[(9084)>>2] = $151;
}
$243 = ((($v$0$i$lcssa)) + 8|0);
$mem$0 = $243;
return ($mem$0|0);
}
} else {
$nb$0 = $4;
}
} else {
$244 = ($bytes>>>0)>(4294967231);
if ($244) {
$nb$0 = -1;
} else {
$245 = (($bytes) + 11)|0;
$246 = $245 & -8;
$247 = HEAP32[(9068)>>2]|0;
$248 = ($247|0)==(0);
if ($248) {
$nb$0 = $246;
} else {
$249 = (0 - ($246))|0;
$250 = $245 >>> 8;
$251 = ($250|0)==(0);
if ($251) {
$idx$0$i = 0;
} else {
$252 = ($246>>>0)>(16777215);
if ($252) {
$idx$0$i = 31;
} else {
$253 = (($250) + 1048320)|0;
$254 = $253 >>> 16;
$255 = $254 & 8;
$256 = $250 << $255;
$257 = (($256) + 520192)|0;
$258 = $257 >>> 16;
$259 = $258 & 4;
$260 = $259 | $255;
$261 = $256 << $259;
$262 = (($261) + 245760)|0;
$263 = $262 >>> 16;
$264 = $263 & 2;
$265 = $260 | $264;
$266 = (14 - ($265))|0;
$267 = $261 << $264;
$268 = $267 >>> 15;
$269 = (($266) + ($268))|0;
$270 = $269 << 1;
$271 = (($269) + 7)|0;
$272 = $246 >>> $271;
$273 = $272 & 1;
$274 = $273 | $270;
$idx$0$i = $274;
}
}
$275 = (9368 + ($idx$0$i<<2)|0);
$276 = HEAP32[$275>>2]|0;
$277 = ($276|0)==(0|0);
L123: do {
if ($277) {
$rsize$2$i = $249;$t$1$i = 0;$v$2$i = 0;
label = 86;
} else {
$278 = ($idx$0$i|0)==(31);
$279 = $idx$0$i >>> 1;
$280 = (25 - ($279))|0;
$281 = $278 ? 0 : $280;
$282 = $246 << $281;
$rsize$0$i15 = $249;$rst$0$i = 0;$sizebits$0$i = $282;$t$0$i14 = $276;$v$0$i16 = 0;
while(1) {
$283 = ((($t$0$i14)) + 4|0);
$284 = HEAP32[$283>>2]|0;
$285 = $284 & -8;
$286 = (($285) - ($246))|0;
$287 = ($286>>>0)<($rsize$0$i15>>>0);
if ($287) {
$288 = ($285|0)==($246|0);
if ($288) {
$rsize$331$i = $286;$t$230$i = $t$0$i14;$v$332$i = $t$0$i14;
label = 90;
break L123;
} else {
$rsize$1$i = $286;$v$1$i = $t$0$i14;
}
} else {
$rsize$1$i = $rsize$0$i15;$v$1$i = $v$0$i16;
}
$289 = ((($t$0$i14)) + 20|0);
$290 = HEAP32[$289>>2]|0;
$291 = $sizebits$0$i >>> 31;
$292 = (((($t$0$i14)) + 16|0) + ($291<<2)|0);
$293 = HEAP32[$292>>2]|0;
$294 = ($290|0)==(0|0);
$295 = ($290|0)==($293|0);
$or$cond19$i = $294 | $295;
$rst$1$i = $or$cond19$i ? $rst$0$i : $290;
$296 = ($293|0)==(0|0);
$297 = $sizebits$0$i << 1;
if ($296) {
$rsize$2$i = $rsize$1$i;$t$1$i = $rst$1$i;$v$2$i = $v$1$i;
label = 86;
break;
} else {
$rsize$0$i15 = $rsize$1$i;$rst$0$i = $rst$1$i;$sizebits$0$i = $297;$t$0$i14 = $293;$v$0$i16 = $v$1$i;
}
}
}
} while(0);
if ((label|0) == 86) {
$298 = ($t$1$i|0)==(0|0);
$299 = ($v$2$i|0)==(0|0);
$or$cond$i = $298 & $299;
if ($or$cond$i) {
$300 = 2 << $idx$0$i;
$301 = (0 - ($300))|0;
$302 = $300 | $301;
$303 = $247 & $302;
$304 = ($303|0)==(0);
if ($304) {
$nb$0 = $246;
break;
}
$305 = (0 - ($303))|0;
$306 = $303 & $305;
$307 = (($306) + -1)|0;
$308 = $307 >>> 12;
$309 = $308 & 16;
$310 = $307 >>> $309;
$311 = $310 >>> 5;
$312 = $311 & 8;
$313 = $312 | $309;
$314 = $310 >>> $312;
$315 = $314 >>> 2;
$316 = $315 & 4;
$317 = $313 | $316;
$318 = $314 >>> $316;
$319 = $318 >>> 1;
$320 = $319 & 2;
$321 = $317 | $320;
$322 = $318 >>> $320;
$323 = $322 >>> 1;
$324 = $323 & 1;
$325 = $321 | $324;
$326 = $322 >>> $324;
$327 = (($325) + ($326))|0;
$328 = (9368 + ($327<<2)|0);
$329 = HEAP32[$328>>2]|0;
$t$2$ph$i = $329;$v$3$ph$i = 0;
} else {
$t$2$ph$i = $t$1$i;$v$3$ph$i = $v$2$i;
}
$330 = ($t$2$ph$i|0)==(0|0);
if ($330) {
$rsize$3$lcssa$i = $rsize$2$i;$v$3$lcssa$i = $v$3$ph$i;
} else {
$rsize$331$i = $rsize$2$i;$t$230$i = $t$2$ph$i;$v$332$i = $v$3$ph$i;
label = 90;
}
}
if ((label|0) == 90) {
while(1) {
label = 0;
$331 = ((($t$230$i)) + 4|0);
$332 = HEAP32[$331>>2]|0;
$333 = $332 & -8;
$334 = (($333) - ($246))|0;
$335 = ($334>>>0)<($rsize$331$i>>>0);
$$rsize$3$i = $335 ? $334 : $rsize$331$i;
$t$2$v$3$i = $335 ? $t$230$i : $v$332$i;
$336 = ((($t$230$i)) + 16|0);
$337 = HEAP32[$336>>2]|0;
$338 = ($337|0)==(0|0);
if (!($338)) {
$rsize$331$i = $$rsize$3$i;$t$230$i = $337;$v$332$i = $t$2$v$3$i;
label = 90;
continue;
}
$339 = ((($t$230$i)) + 20|0);
$340 = HEAP32[$339>>2]|0;
$341 = ($340|0)==(0|0);
if ($341) {
$rsize$3$lcssa$i = $$rsize$3$i;$v$3$lcssa$i = $t$2$v$3$i;
break;
} else {
$rsize$331$i = $$rsize$3$i;$t$230$i = $340;$v$332$i = $t$2$v$3$i;
label = 90;
}
}
}
$342 = ($v$3$lcssa$i|0)==(0|0);
if ($342) {
$nb$0 = $246;
} else {
$343 = HEAP32[(9072)>>2]|0;
$344 = (($343) - ($246))|0;
$345 = ($rsize$3$lcssa$i>>>0)<($344>>>0);
if ($345) {
$346 = HEAP32[(9080)>>2]|0;
$347 = ($v$3$lcssa$i>>>0)<($346>>>0);
if ($347) {
_abort();
// unreachable;
}
$348 = (($v$3$lcssa$i) + ($246)|0);
$349 = ($v$3$lcssa$i>>>0)<($348>>>0);
if (!($349)) {
_abort();
// unreachable;
}
$350 = ((($v$3$lcssa$i)) + 24|0);
$351 = HEAP32[$350>>2]|0;
$352 = ((($v$3$lcssa$i)) + 12|0);
$353 = HEAP32[$352>>2]|0;
$354 = ($353|0)==($v$3$lcssa$i|0);
do {
if ($354) {
$364 = ((($v$3$lcssa$i)) + 20|0);
$365 = HEAP32[$364>>2]|0;
$366 = ($365|0)==(0|0);
if ($366) {
$367 = ((($v$3$lcssa$i)) + 16|0);
$368 = HEAP32[$367>>2]|0;
$369 = ($368|0)==(0|0);
if ($369) {
$R$1$i20 = 0;
break;
} else {
$R$0$i18 = $368;$RP$0$i17 = $367;
}
} else {
$R$0$i18 = $365;$RP$0$i17 = $364;
}
while(1) {
$370 = ((($R$0$i18)) + 20|0);
$371 = HEAP32[$370>>2]|0;
$372 = ($371|0)==(0|0);
if (!($372)) {
$R$0$i18 = $371;$RP$0$i17 = $370;
continue;
}
$373 = ((($R$0$i18)) + 16|0);
$374 = HEAP32[$373>>2]|0;
$375 = ($374|0)==(0|0);
if ($375) {
$R$0$i18$lcssa = $R$0$i18;$RP$0$i17$lcssa = $RP$0$i17;
break;
} else {
$R$0$i18 = $374;$RP$0$i17 = $373;
}
}
$376 = ($RP$0$i17$lcssa>>>0)<($346>>>0);
if ($376) {
_abort();
// unreachable;
} else {
HEAP32[$RP$0$i17$lcssa>>2] = 0;
$R$1$i20 = $R$0$i18$lcssa;
break;
}
} else {
$355 = ((($v$3$lcssa$i)) + 8|0);
$356 = HEAP32[$355>>2]|0;
$357 = ($356>>>0)<($346>>>0);
if ($357) {
_abort();
// unreachable;
}
$358 = ((($356)) + 12|0);
$359 = HEAP32[$358>>2]|0;
$360 = ($359|0)==($v$3$lcssa$i|0);
if (!($360)) {
_abort();
// unreachable;
}
$361 = ((($353)) + 8|0);
$362 = HEAP32[$361>>2]|0;
$363 = ($362|0)==($v$3$lcssa$i|0);
if ($363) {
HEAP32[$358>>2] = $353;
HEAP32[$361>>2] = $356;
$R$1$i20 = $353;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$377 = ($351|0)==(0|0);
do {
if (!($377)) {
$378 = ((($v$3$lcssa$i)) + 28|0);
$379 = HEAP32[$378>>2]|0;
$380 = (9368 + ($379<<2)|0);
$381 = HEAP32[$380>>2]|0;
$382 = ($v$3$lcssa$i|0)==($381|0);
if ($382) {
HEAP32[$380>>2] = $R$1$i20;
$cond$i21 = ($R$1$i20|0)==(0|0);
if ($cond$i21) {
$383 = 1 << $379;
$384 = $383 ^ -1;
$385 = HEAP32[(9068)>>2]|0;
$386 = $385 & $384;
HEAP32[(9068)>>2] = $386;
break;
}
} else {
$387 = HEAP32[(9080)>>2]|0;
$388 = ($351>>>0)<($387>>>0);
if ($388) {
_abort();
// unreachable;
}
$389 = ((($351)) + 16|0);
$390 = HEAP32[$389>>2]|0;
$391 = ($390|0)==($v$3$lcssa$i|0);
if ($391) {
HEAP32[$389>>2] = $R$1$i20;
} else {
$392 = ((($351)) + 20|0);
HEAP32[$392>>2] = $R$1$i20;
}
$393 = ($R$1$i20|0)==(0|0);
if ($393) {
break;
}
}
$394 = HEAP32[(9080)>>2]|0;
$395 = ($R$1$i20>>>0)<($394>>>0);
if ($395) {
_abort();
// unreachable;
}
$396 = ((($R$1$i20)) + 24|0);
HEAP32[$396>>2] = $351;
$397 = ((($v$3$lcssa$i)) + 16|0);
$398 = HEAP32[$397>>2]|0;
$399 = ($398|0)==(0|0);
do {
if (!($399)) {
$400 = ($398>>>0)<($394>>>0);
if ($400) {
_abort();
// unreachable;
} else {
$401 = ((($R$1$i20)) + 16|0);
HEAP32[$401>>2] = $398;
$402 = ((($398)) + 24|0);
HEAP32[$402>>2] = $R$1$i20;
break;
}
}
} while(0);
$403 = ((($v$3$lcssa$i)) + 20|0);
$404 = HEAP32[$403>>2]|0;
$405 = ($404|0)==(0|0);
if (!($405)) {
$406 = HEAP32[(9080)>>2]|0;
$407 = ($404>>>0)<($406>>>0);
if ($407) {
_abort();
// unreachable;
} else {
$408 = ((($R$1$i20)) + 20|0);
HEAP32[$408>>2] = $404;
$409 = ((($404)) + 24|0);
HEAP32[$409>>2] = $R$1$i20;
break;
}
}
}
} while(0);
$410 = ($rsize$3$lcssa$i>>>0)<(16);
L199: do {
if ($410) {
$411 = (($rsize$3$lcssa$i) + ($246))|0;
$412 = $411 | 3;
$413 = ((($v$3$lcssa$i)) + 4|0);
HEAP32[$413>>2] = $412;
$$sum18$i = (($411) + 4)|0;
$414 = (($v$3$lcssa$i) + ($$sum18$i)|0);
$415 = HEAP32[$414>>2]|0;
$416 = $415 | 1;
HEAP32[$414>>2] = $416;
} else {
$417 = $246 | 3;
$418 = ((($v$3$lcssa$i)) + 4|0);
HEAP32[$418>>2] = $417;
$419 = $rsize$3$lcssa$i | 1;
$$sum$i2334 = $246 | 4;
$420 = (($v$3$lcssa$i) + ($$sum$i2334)|0);
HEAP32[$420>>2] = $419;
$$sum1$i24 = (($rsize$3$lcssa$i) + ($246))|0;
$421 = (($v$3$lcssa$i) + ($$sum1$i24)|0);
HEAP32[$421>>2] = $rsize$3$lcssa$i;
$422 = $rsize$3$lcssa$i >>> 3;
$423 = ($rsize$3$lcssa$i>>>0)<(256);
if ($423) {
$424 = $422 << 1;
$425 = (9104 + ($424<<2)|0);
$426 = HEAP32[9064>>2]|0;
$427 = 1 << $422;
$428 = $426 & $427;
$429 = ($428|0)==(0);
if ($429) {
$430 = $426 | $427;
HEAP32[9064>>2] = $430;
$$pre$i25 = (($424) + 2)|0;
$$pre43$i = (9104 + ($$pre$i25<<2)|0);
$$pre$phi$i26Z2D = $$pre43$i;$F5$0$i = $425;
} else {
$$sum17$i = (($424) + 2)|0;
$431 = (9104 + ($$sum17$i<<2)|0);
$432 = HEAP32[$431>>2]|0;
$433 = HEAP32[(9080)>>2]|0;
$434 = ($432>>>0)<($433>>>0);
if ($434) {
_abort();
// unreachable;
} else {
$$pre$phi$i26Z2D = $431;$F5$0$i = $432;
}
}
HEAP32[$$pre$phi$i26Z2D>>2] = $348;
$435 = ((($F5$0$i)) + 12|0);
HEAP32[$435>>2] = $348;
$$sum15$i = (($246) + 8)|0;
$436 = (($v$3$lcssa$i) + ($$sum15$i)|0);
HEAP32[$436>>2] = $F5$0$i;
$$sum16$i = (($246) + 12)|0;
$437 = (($v$3$lcssa$i) + ($$sum16$i)|0);
HEAP32[$437>>2] = $425;
break;
}
$438 = $rsize$3$lcssa$i >>> 8;
$439 = ($438|0)==(0);
if ($439) {
$I7$0$i = 0;
} else {
$440 = ($rsize$3$lcssa$i>>>0)>(16777215);
if ($440) {
$I7$0$i = 31;
} else {
$441 = (($438) + 1048320)|0;
$442 = $441 >>> 16;
$443 = $442 & 8;
$444 = $438 << $443;
$445 = (($444) + 520192)|0;
$446 = $445 >>> 16;
$447 = $446 & 4;
$448 = $447 | $443;
$449 = $444 << $447;
$450 = (($449) + 245760)|0;
$451 = $450 >>> 16;
$452 = $451 & 2;
$453 = $448 | $452;
$454 = (14 - ($453))|0;
$455 = $449 << $452;
$456 = $455 >>> 15;
$457 = (($454) + ($456))|0;
$458 = $457 << 1;
$459 = (($457) + 7)|0;
$460 = $rsize$3$lcssa$i >>> $459;
$461 = $460 & 1;
$462 = $461 | $458;
$I7$0$i = $462;
}
}
$463 = (9368 + ($I7$0$i<<2)|0);
$$sum2$i = (($246) + 28)|0;
$464 = (($v$3$lcssa$i) + ($$sum2$i)|0);
HEAP32[$464>>2] = $I7$0$i;
$$sum3$i27 = (($246) + 16)|0;
$465 = (($v$3$lcssa$i) + ($$sum3$i27)|0);
$$sum4$i28 = (($246) + 20)|0;
$466 = (($v$3$lcssa$i) + ($$sum4$i28)|0);
HEAP32[$466>>2] = 0;
HEAP32[$465>>2] = 0;
$467 = HEAP32[(9068)>>2]|0;
$468 = 1 << $I7$0$i;
$469 = $467 & $468;
$470 = ($469|0)==(0);
if ($470) {
$471 = $467 | $468;
HEAP32[(9068)>>2] = $471;
HEAP32[$463>>2] = $348;
$$sum5$i = (($246) + 24)|0;
$472 = (($v$3$lcssa$i) + ($$sum5$i)|0);
HEAP32[$472>>2] = $463;
$$sum6$i = (($246) + 12)|0;
$473 = (($v$3$lcssa$i) + ($$sum6$i)|0);
HEAP32[$473>>2] = $348;
$$sum7$i = (($246) + 8)|0;
$474 = (($v$3$lcssa$i) + ($$sum7$i)|0);
HEAP32[$474>>2] = $348;
break;
}
$475 = HEAP32[$463>>2]|0;
$476 = ((($475)) + 4|0);
$477 = HEAP32[$476>>2]|0;
$478 = $477 & -8;
$479 = ($478|0)==($rsize$3$lcssa$i|0);
L217: do {
if ($479) {
$T$0$lcssa$i = $475;
} else {
$480 = ($I7$0$i|0)==(31);
$481 = $I7$0$i >>> 1;
$482 = (25 - ($481))|0;
$483 = $480 ? 0 : $482;
$484 = $rsize$3$lcssa$i << $483;
$K12$029$i = $484;$T$028$i = $475;
while(1) {
$491 = $K12$029$i >>> 31;
$492 = (((($T$028$i)) + 16|0) + ($491<<2)|0);
$487 = HEAP32[$492>>2]|0;
$493 = ($487|0)==(0|0);
if ($493) {
$$lcssa232 = $492;$T$028$i$lcssa = $T$028$i;
break;
}
$485 = $K12$029$i << 1;
$486 = ((($487)) + 4|0);
$488 = HEAP32[$486>>2]|0;
$489 = $488 & -8;
$490 = ($489|0)==($rsize$3$lcssa$i|0);
if ($490) {
$T$0$lcssa$i = $487;
break L217;
} else {
$K12$029$i = $485;$T$028$i = $487;
}
}
$494 = HEAP32[(9080)>>2]|0;
$495 = ($$lcssa232>>>0)<($494>>>0);
if ($495) {
_abort();
// unreachable;
} else {
HEAP32[$$lcssa232>>2] = $348;
$$sum11$i = (($246) + 24)|0;
$496 = (($v$3$lcssa$i) + ($$sum11$i)|0);
HEAP32[$496>>2] = $T$028$i$lcssa;
$$sum12$i = (($246) + 12)|0;
$497 = (($v$3$lcssa$i) + ($$sum12$i)|0);
HEAP32[$497>>2] = $348;
$$sum13$i = (($246) + 8)|0;
$498 = (($v$3$lcssa$i) + ($$sum13$i)|0);
HEAP32[$498>>2] = $348;
break L199;
}
}
} while(0);
$499 = ((($T$0$lcssa$i)) + 8|0);
$500 = HEAP32[$499>>2]|0;
$501 = HEAP32[(9080)>>2]|0;
$502 = ($500>>>0)>=($501>>>0);
$not$$i = ($T$0$lcssa$i>>>0)>=($501>>>0);
$503 = $502 & $not$$i;
if ($503) {
$504 = ((($500)) + 12|0);
HEAP32[$504>>2] = $348;
HEAP32[$499>>2] = $348;
$$sum8$i = (($246) + 8)|0;
$505 = (($v$3$lcssa$i) + ($$sum8$i)|0);
HEAP32[$505>>2] = $500;
$$sum9$i = (($246) + 12)|0;
$506 = (($v$3$lcssa$i) + ($$sum9$i)|0);
HEAP32[$506>>2] = $T$0$lcssa$i;
$$sum10$i = (($246) + 24)|0;
$507 = (($v$3$lcssa$i) + ($$sum10$i)|0);
HEAP32[$507>>2] = 0;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$508 = ((($v$3$lcssa$i)) + 8|0);
$mem$0 = $508;
return ($mem$0|0);
} else {
$nb$0 = $246;
}
}
}
}
}
} while(0);
$509 = HEAP32[(9072)>>2]|0;
$510 = ($509>>>0)<($nb$0>>>0);
if (!($510)) {
$511 = (($509) - ($nb$0))|0;
$512 = HEAP32[(9084)>>2]|0;
$513 = ($511>>>0)>(15);
if ($513) {
$514 = (($512) + ($nb$0)|0);
HEAP32[(9084)>>2] = $514;
HEAP32[(9072)>>2] = $511;
$515 = $511 | 1;
$$sum2 = (($nb$0) + 4)|0;
$516 = (($512) + ($$sum2)|0);
HEAP32[$516>>2] = $515;
$517 = (($512) + ($509)|0);
HEAP32[$517>>2] = $511;
$518 = $nb$0 | 3;
$519 = ((($512)) + 4|0);
HEAP32[$519>>2] = $518;
} else {
HEAP32[(9072)>>2] = 0;
HEAP32[(9084)>>2] = 0;
$520 = $509 | 3;
$521 = ((($512)) + 4|0);
HEAP32[$521>>2] = $520;
$$sum1 = (($509) + 4)|0;
$522 = (($512) + ($$sum1)|0);
$523 = HEAP32[$522>>2]|0;
$524 = $523 | 1;
HEAP32[$522>>2] = $524;
}
$525 = ((($512)) + 8|0);
$mem$0 = $525;
return ($mem$0|0);
}
$526 = HEAP32[(9076)>>2]|0;
$527 = ($526>>>0)>($nb$0>>>0);
if ($527) {
$528 = (($526) - ($nb$0))|0;
HEAP32[(9076)>>2] = $528;
$529 = HEAP32[(9088)>>2]|0;
$530 = (($529) + ($nb$0)|0);
HEAP32[(9088)>>2] = $530;
$531 = $528 | 1;
$$sum = (($nb$0) + 4)|0;
$532 = (($529) + ($$sum)|0);
HEAP32[$532>>2] = $531;
$533 = $nb$0 | 3;
$534 = ((($529)) + 4|0);
HEAP32[$534>>2] = $533;
$535 = ((($529)) + 8|0);
$mem$0 = $535;
return ($mem$0|0);
}
$536 = HEAP32[9536>>2]|0;
$537 = ($536|0)==(0);
do {
if ($537) {
$538 = (_sysconf(30)|0);
$539 = (($538) + -1)|0;
$540 = $539 & $538;
$541 = ($540|0)==(0);
if ($541) {
HEAP32[(9544)>>2] = $538;
HEAP32[(9540)>>2] = $538;
HEAP32[(9548)>>2] = -1;
HEAP32[(9552)>>2] = -1;
HEAP32[(9556)>>2] = 0;
HEAP32[(9508)>>2] = 0;
$542 = (_time((0|0))|0);
$543 = $542 & -16;
$544 = $543 ^ 1431655768;
HEAP32[9536>>2] = $544;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$545 = (($nb$0) + 48)|0;
$546 = HEAP32[(9544)>>2]|0;
$547 = (($nb$0) + 47)|0;
$548 = (($546) + ($547))|0;
$549 = (0 - ($546))|0;
$550 = $548 & $549;
$551 = ($550>>>0)>($nb$0>>>0);
if (!($551)) {
$mem$0 = 0;
return ($mem$0|0);
}
$552 = HEAP32[(9504)>>2]|0;
$553 = ($552|0)==(0);
if (!($553)) {
$554 = HEAP32[(9496)>>2]|0;
$555 = (($554) + ($550))|0;
$556 = ($555>>>0)<=($554>>>0);
$557 = ($555>>>0)>($552>>>0);
$or$cond1$i = $556 | $557;
if ($or$cond1$i) {
$mem$0 = 0;
return ($mem$0|0);
}
}
$558 = HEAP32[(9508)>>2]|0;
$559 = $558 & 4;
$560 = ($559|0)==(0);
L258: do {
if ($560) {
$561 = HEAP32[(9088)>>2]|0;
$562 = ($561|0)==(0|0);
L260: do {
if ($562) {
label = 174;
} else {
$sp$0$i$i = (9512);
while(1) {
$563 = HEAP32[$sp$0$i$i>>2]|0;
$564 = ($563>>>0)>($561>>>0);
if (!($564)) {
$565 = ((($sp$0$i$i)) + 4|0);
$566 = HEAP32[$565>>2]|0;
$567 = (($563) + ($566)|0);
$568 = ($567>>>0)>($561>>>0);
if ($568) {
$$lcssa228 = $sp$0$i$i;$$lcssa230 = $565;
break;
}
}
$569 = ((($sp$0$i$i)) + 8|0);
$570 = HEAP32[$569>>2]|0;
$571 = ($570|0)==(0|0);
if ($571) {
label = 174;
break L260;
} else {
$sp$0$i$i = $570;
}
}
$594 = HEAP32[(9076)>>2]|0;
$595 = (($548) - ($594))|0;
$596 = $595 & $549;
$597 = ($596>>>0)<(2147483647);
if ($597) {
$598 = (_sbrk(($596|0))|0);
$599 = HEAP32[$$lcssa228>>2]|0;
$600 = HEAP32[$$lcssa230>>2]|0;
$601 = (($599) + ($600)|0);
$602 = ($598|0)==($601|0);
$$3$i = $602 ? $596 : 0;
if ($602) {
$603 = ($598|0)==((-1)|0);
if ($603) {
$tsize$0323944$i = $$3$i;
} else {
$tbase$255$i = $598;$tsize$254$i = $$3$i;
label = 194;
break L258;
}
} else {
$br$0$ph$i = $598;$ssize$1$ph$i = $596;$tsize$0$ph$i = $$3$i;
label = 184;
}
} else {
$tsize$0323944$i = 0;
}
}
} while(0);
do {
if ((label|0) == 174) {
$572 = (_sbrk(0)|0);
$573 = ($572|0)==((-1)|0);
if ($573) {
$tsize$0323944$i = 0;
} else {
$574 = $572;
$575 = HEAP32[(9540)>>2]|0;
$576 = (($575) + -1)|0;
$577 = $576 & $574;
$578 = ($577|0)==(0);
if ($578) {
$ssize$0$i = $550;
} else {
$579 = (($576) + ($574))|0;
$580 = (0 - ($575))|0;
$581 = $579 & $580;
$582 = (($550) - ($574))|0;
$583 = (($582) + ($581))|0;
$ssize$0$i = $583;
}
$584 = HEAP32[(9496)>>2]|0;
$585 = (($584) + ($ssize$0$i))|0;
$586 = ($ssize$0$i>>>0)>($nb$0>>>0);
$587 = ($ssize$0$i>>>0)<(2147483647);
$or$cond$i30 = $586 & $587;
if ($or$cond$i30) {
$588 = HEAP32[(9504)>>2]|0;
$589 = ($588|0)==(0);
if (!($589)) {
$590 = ($585>>>0)<=($584>>>0);
$591 = ($585>>>0)>($588>>>0);
$or$cond2$i = $590 | $591;
if ($or$cond2$i) {
$tsize$0323944$i = 0;
break;
}
}
$592 = (_sbrk(($ssize$0$i|0))|0);
$593 = ($592|0)==($572|0);
$ssize$0$$i = $593 ? $ssize$0$i : 0;
if ($593) {
$tbase$255$i = $572;$tsize$254$i = $ssize$0$$i;
label = 194;
break L258;
} else {
$br$0$ph$i = $592;$ssize$1$ph$i = $ssize$0$i;$tsize$0$ph$i = $ssize$0$$i;
label = 184;
}
} else {
$tsize$0323944$i = 0;
}
}
}
} while(0);
L280: do {
if ((label|0) == 184) {
$604 = (0 - ($ssize$1$ph$i))|0;
$605 = ($br$0$ph$i|0)!=((-1)|0);
$606 = ($ssize$1$ph$i>>>0)<(2147483647);
$or$cond5$i = $606 & $605;
$607 = ($545>>>0)>($ssize$1$ph$i>>>0);
$or$cond6$i = $607 & $or$cond5$i;
do {
if ($or$cond6$i) {
$608 = HEAP32[(9544)>>2]|0;
$609 = (($547) - ($ssize$1$ph$i))|0;
$610 = (($609) + ($608))|0;
$611 = (0 - ($608))|0;
$612 = $610 & $611;
$613 = ($612>>>0)<(2147483647);
if ($613) {
$614 = (_sbrk(($612|0))|0);
$615 = ($614|0)==((-1)|0);
if ($615) {
(_sbrk(($604|0))|0);
$tsize$0323944$i = $tsize$0$ph$i;
break L280;
} else {
$616 = (($612) + ($ssize$1$ph$i))|0;
$ssize$2$i = $616;
break;
}
} else {
$ssize$2$i = $ssize$1$ph$i;
}
} else {
$ssize$2$i = $ssize$1$ph$i;
}
} while(0);
$617 = ($br$0$ph$i|0)==((-1)|0);
if ($617) {
$tsize$0323944$i = $tsize$0$ph$i;
} else {
$tbase$255$i = $br$0$ph$i;$tsize$254$i = $ssize$2$i;
label = 194;
break L258;
}
}
} while(0);
$618 = HEAP32[(9508)>>2]|0;
$619 = $618 | 4;
HEAP32[(9508)>>2] = $619;
$tsize$1$i = $tsize$0323944$i;
label = 191;
} else {
$tsize$1$i = 0;
label = 191;
}
} while(0);
if ((label|0) == 191) {
$620 = ($550>>>0)<(2147483647);
if ($620) {
$621 = (_sbrk(($550|0))|0);
$622 = (_sbrk(0)|0);
$623 = ($621|0)!=((-1)|0);
$624 = ($622|0)!=((-1)|0);
$or$cond3$i = $623 & $624;
$625 = ($621>>>0)<($622>>>0);
$or$cond8$i = $625 & $or$cond3$i;
if ($or$cond8$i) {
$626 = $622;
$627 = $621;
$628 = (($626) - ($627))|0;
$629 = (($nb$0) + 40)|0;
$630 = ($628>>>0)>($629>>>0);
$$tsize$1$i = $630 ? $628 : $tsize$1$i;
if ($630) {
$tbase$255$i = $621;$tsize$254$i = $$tsize$1$i;
label = 194;
}
}
}
}
if ((label|0) == 194) {
$631 = HEAP32[(9496)>>2]|0;
$632 = (($631) + ($tsize$254$i))|0;
HEAP32[(9496)>>2] = $632;
$633 = HEAP32[(9500)>>2]|0;
$634 = ($632>>>0)>($633>>>0);
if ($634) {
HEAP32[(9500)>>2] = $632;
}
$635 = HEAP32[(9088)>>2]|0;
$636 = ($635|0)==(0|0);
L299: do {
if ($636) {
$637 = HEAP32[(9080)>>2]|0;
$638 = ($637|0)==(0|0);
$639 = ($tbase$255$i>>>0)<($637>>>0);
$or$cond9$i = $638 | $639;
if ($or$cond9$i) {
HEAP32[(9080)>>2] = $tbase$255$i;
}
HEAP32[(9512)>>2] = $tbase$255$i;
HEAP32[(9516)>>2] = $tsize$254$i;
HEAP32[(9524)>>2] = 0;
$640 = HEAP32[9536>>2]|0;
HEAP32[(9100)>>2] = $640;
HEAP32[(9096)>>2] = -1;
$i$02$i$i = 0;
while(1) {
$641 = $i$02$i$i << 1;
$642 = (9104 + ($641<<2)|0);
$$sum$i$i = (($641) + 3)|0;
$643 = (9104 + ($$sum$i$i<<2)|0);
HEAP32[$643>>2] = $642;
$$sum1$i$i = (($641) + 2)|0;
$644 = (9104 + ($$sum1$i$i<<2)|0);
HEAP32[$644>>2] = $642;
$645 = (($i$02$i$i) + 1)|0;
$exitcond$i$i = ($645|0)==(32);
if ($exitcond$i$i) {
break;
} else {
$i$02$i$i = $645;
}
}
$646 = (($tsize$254$i) + -40)|0;
$647 = ((($tbase$255$i)) + 8|0);
$648 = $647;
$649 = $648 & 7;
$650 = ($649|0)==(0);
$651 = (0 - ($648))|0;
$652 = $651 & 7;
$653 = $650 ? 0 : $652;
$654 = (($tbase$255$i) + ($653)|0);
$655 = (($646) - ($653))|0;
HEAP32[(9088)>>2] = $654;
HEAP32[(9076)>>2] = $655;
$656 = $655 | 1;
$$sum$i13$i = (($653) + 4)|0;
$657 = (($tbase$255$i) + ($$sum$i13$i)|0);
HEAP32[$657>>2] = $656;
$$sum2$i$i = (($tsize$254$i) + -36)|0;
$658 = (($tbase$255$i) + ($$sum2$i$i)|0);
HEAP32[$658>>2] = 40;
$659 = HEAP32[(9552)>>2]|0;
HEAP32[(9092)>>2] = $659;
} else {
$sp$084$i = (9512);
while(1) {
$660 = HEAP32[$sp$084$i>>2]|0;
$661 = ((($sp$084$i)) + 4|0);
$662 = HEAP32[$661>>2]|0;
$663 = (($660) + ($662)|0);
$664 = ($tbase$255$i|0)==($663|0);
if ($664) {
$$lcssa222 = $660;$$lcssa224 = $661;$$lcssa226 = $662;$sp$084$i$lcssa = $sp$084$i;
label = 204;
break;
}
$665 = ((($sp$084$i)) + 8|0);
$666 = HEAP32[$665>>2]|0;
$667 = ($666|0)==(0|0);
if ($667) {
break;
} else {
$sp$084$i = $666;
}
}
if ((label|0) == 204) {
$668 = ((($sp$084$i$lcssa)) + 12|0);
$669 = HEAP32[$668>>2]|0;
$670 = $669 & 8;
$671 = ($670|0)==(0);
if ($671) {
$672 = ($635>>>0)>=($$lcssa222>>>0);
$673 = ($635>>>0)<($tbase$255$i>>>0);
$or$cond57$i = $673 & $672;
if ($or$cond57$i) {
$674 = (($$lcssa226) + ($tsize$254$i))|0;
HEAP32[$$lcssa224>>2] = $674;
$675 = HEAP32[(9076)>>2]|0;
$676 = (($675) + ($tsize$254$i))|0;
$677 = ((($635)) + 8|0);
$678 = $677;
$679 = $678 & 7;
$680 = ($679|0)==(0);
$681 = (0 - ($678))|0;
$682 = $681 & 7;
$683 = $680 ? 0 : $682;
$684 = (($635) + ($683)|0);
$685 = (($676) - ($683))|0;
HEAP32[(9088)>>2] = $684;
HEAP32[(9076)>>2] = $685;
$686 = $685 | 1;
$$sum$i17$i = (($683) + 4)|0;
$687 = (($635) + ($$sum$i17$i)|0);
HEAP32[$687>>2] = $686;
$$sum2$i18$i = (($676) + 4)|0;
$688 = (($635) + ($$sum2$i18$i)|0);
HEAP32[$688>>2] = 40;
$689 = HEAP32[(9552)>>2]|0;
HEAP32[(9092)>>2] = $689;
break;
}
}
}
$690 = HEAP32[(9080)>>2]|0;
$691 = ($tbase$255$i>>>0)<($690>>>0);
if ($691) {
HEAP32[(9080)>>2] = $tbase$255$i;
$755 = $tbase$255$i;
} else {
$755 = $690;
}
$692 = (($tbase$255$i) + ($tsize$254$i)|0);
$sp$183$i = (9512);
while(1) {
$693 = HEAP32[$sp$183$i>>2]|0;
$694 = ($693|0)==($692|0);
if ($694) {
$$lcssa219 = $sp$183$i;$sp$183$i$lcssa = $sp$183$i;
label = 212;
break;
}
$695 = ((($sp$183$i)) + 8|0);
$696 = HEAP32[$695>>2]|0;
$697 = ($696|0)==(0|0);
if ($697) {
$sp$0$i$i$i = (9512);
break;
} else {
$sp$183$i = $696;
}
}
if ((label|0) == 212) {
$698 = ((($sp$183$i$lcssa)) + 12|0);
$699 = HEAP32[$698>>2]|0;
$700 = $699 & 8;
$701 = ($700|0)==(0);
if ($701) {
HEAP32[$$lcssa219>>2] = $tbase$255$i;
$702 = ((($sp$183$i$lcssa)) + 4|0);
$703 = HEAP32[$702>>2]|0;
$704 = (($703) + ($tsize$254$i))|0;
HEAP32[$702>>2] = $704;
$705 = ((($tbase$255$i)) + 8|0);
$706 = $705;
$707 = $706 & 7;
$708 = ($707|0)==(0);
$709 = (0 - ($706))|0;
$710 = $709 & 7;
$711 = $708 ? 0 : $710;
$712 = (($tbase$255$i) + ($711)|0);
$$sum112$i = (($tsize$254$i) + 8)|0;
$713 = (($tbase$255$i) + ($$sum112$i)|0);
$714 = $713;
$715 = $714 & 7;
$716 = ($715|0)==(0);
$717 = (0 - ($714))|0;
$718 = $717 & 7;
$719 = $716 ? 0 : $718;
$$sum113$i = (($719) + ($tsize$254$i))|0;
$720 = (($tbase$255$i) + ($$sum113$i)|0);
$721 = $720;
$722 = $712;
$723 = (($721) - ($722))|0;
$$sum$i19$i = (($711) + ($nb$0))|0;
$724 = (($tbase$255$i) + ($$sum$i19$i)|0);
$725 = (($723) - ($nb$0))|0;
$726 = $nb$0 | 3;
$$sum1$i20$i = (($711) + 4)|0;
$727 = (($tbase$255$i) + ($$sum1$i20$i)|0);
HEAP32[$727>>2] = $726;
$728 = ($720|0)==($635|0);
L324: do {
if ($728) {
$729 = HEAP32[(9076)>>2]|0;
$730 = (($729) + ($725))|0;
HEAP32[(9076)>>2] = $730;
HEAP32[(9088)>>2] = $724;
$731 = $730 | 1;
$$sum42$i$i = (($$sum$i19$i) + 4)|0;
$732 = (($tbase$255$i) + ($$sum42$i$i)|0);
HEAP32[$732>>2] = $731;
} else {
$733 = HEAP32[(9084)>>2]|0;
$734 = ($720|0)==($733|0);
if ($734) {
$735 = HEAP32[(9072)>>2]|0;
$736 = (($735) + ($725))|0;
HEAP32[(9072)>>2] = $736;
HEAP32[(9084)>>2] = $724;
$737 = $736 | 1;
$$sum40$i$i = (($$sum$i19$i) + 4)|0;
$738 = (($tbase$255$i) + ($$sum40$i$i)|0);
HEAP32[$738>>2] = $737;
$$sum41$i$i = (($736) + ($$sum$i19$i))|0;
$739 = (($tbase$255$i) + ($$sum41$i$i)|0);
HEAP32[$739>>2] = $736;
break;
}
$$sum2$i21$i = (($tsize$254$i) + 4)|0;
$$sum114$i = (($$sum2$i21$i) + ($719))|0;
$740 = (($tbase$255$i) + ($$sum114$i)|0);
$741 = HEAP32[$740>>2]|0;
$742 = $741 & 3;
$743 = ($742|0)==(1);
if ($743) {
$744 = $741 & -8;
$745 = $741 >>> 3;
$746 = ($741>>>0)<(256);
L332: do {
if ($746) {
$$sum3738$i$i = $719 | 8;
$$sum124$i = (($$sum3738$i$i) + ($tsize$254$i))|0;
$747 = (($tbase$255$i) + ($$sum124$i)|0);
$748 = HEAP32[$747>>2]|0;
$$sum39$i$i = (($tsize$254$i) + 12)|0;
$$sum125$i = (($$sum39$i$i) + ($719))|0;
$749 = (($tbase$255$i) + ($$sum125$i)|0);
$750 = HEAP32[$749>>2]|0;
$751 = $745 << 1;
$752 = (9104 + ($751<<2)|0);
$753 = ($748|0)==($752|0);
do {
if (!($753)) {
$754 = ($748>>>0)<($755>>>0);
if ($754) {
_abort();
// unreachable;
}
$756 = ((($748)) + 12|0);
$757 = HEAP32[$756>>2]|0;
$758 = ($757|0)==($720|0);
if ($758) {
break;
}
_abort();
// unreachable;
}
} while(0);
$759 = ($750|0)==($748|0);
if ($759) {
$760 = 1 << $745;
$761 = $760 ^ -1;
$762 = HEAP32[9064>>2]|0;
$763 = $762 & $761;
HEAP32[9064>>2] = $763;
break;
}
$764 = ($750|0)==($752|0);
do {
if ($764) {
$$pre57$i$i = ((($750)) + 8|0);
$$pre$phi58$i$iZ2D = $$pre57$i$i;
} else {
$765 = ($750>>>0)<($755>>>0);
if ($765) {
_abort();
// unreachable;
}
$766 = ((($750)) + 8|0);
$767 = HEAP32[$766>>2]|0;
$768 = ($767|0)==($720|0);
if ($768) {
$$pre$phi58$i$iZ2D = $766;
break;
}
_abort();
// unreachable;
}
} while(0);
$769 = ((($748)) + 12|0);
HEAP32[$769>>2] = $750;
HEAP32[$$pre$phi58$i$iZ2D>>2] = $748;
} else {
$$sum34$i$i = $719 | 24;
$$sum115$i = (($$sum34$i$i) + ($tsize$254$i))|0;
$770 = (($tbase$255$i) + ($$sum115$i)|0);
$771 = HEAP32[$770>>2]|0;
$$sum5$i$i = (($tsize$254$i) + 12)|0;
$$sum116$i = (($$sum5$i$i) + ($719))|0;
$772 = (($tbase$255$i) + ($$sum116$i)|0);
$773 = HEAP32[$772>>2]|0;
$774 = ($773|0)==($720|0);
do {
if ($774) {
$$sum67$i$i = $719 | 16;
$$sum122$i = (($$sum2$i21$i) + ($$sum67$i$i))|0;
$784 = (($tbase$255$i) + ($$sum122$i)|0);
$785 = HEAP32[$784>>2]|0;
$786 = ($785|0)==(0|0);
if ($786) {
$$sum123$i = (($$sum67$i$i) + ($tsize$254$i))|0;
$787 = (($tbase$255$i) + ($$sum123$i)|0);
$788 = HEAP32[$787>>2]|0;
$789 = ($788|0)==(0|0);
if ($789) {
$R$1$i$i = 0;
break;
} else {
$R$0$i$i = $788;$RP$0$i$i = $787;
}
} else {
$R$0$i$i = $785;$RP$0$i$i = $784;
}
while(1) {
$790 = ((($R$0$i$i)) + 20|0);
$791 = HEAP32[$790>>2]|0;
$792 = ($791|0)==(0|0);
if (!($792)) {
$R$0$i$i = $791;$RP$0$i$i = $790;
continue;
}
$793 = ((($R$0$i$i)) + 16|0);
$794 = HEAP32[$793>>2]|0;
$795 = ($794|0)==(0|0);
if ($795) {
$R$0$i$i$lcssa = $R$0$i$i;$RP$0$i$i$lcssa = $RP$0$i$i;
break;
} else {
$R$0$i$i = $794;$RP$0$i$i = $793;
}
}
$796 = ($RP$0$i$i$lcssa>>>0)<($755>>>0);
if ($796) {
_abort();
// unreachable;
} else {
HEAP32[$RP$0$i$i$lcssa>>2] = 0;
$R$1$i$i = $R$0$i$i$lcssa;
break;
}
} else {
$$sum3536$i$i = $719 | 8;
$$sum117$i = (($$sum3536$i$i) + ($tsize$254$i))|0;
$775 = (($tbase$255$i) + ($$sum117$i)|0);
$776 = HEAP32[$775>>2]|0;
$777 = ($776>>>0)<($755>>>0);
if ($777) {
_abort();
// unreachable;
}
$778 = ((($776)) + 12|0);
$779 = HEAP32[$778>>2]|0;
$780 = ($779|0)==($720|0);
if (!($780)) {
_abort();
// unreachable;
}
$781 = ((($773)) + 8|0);
$782 = HEAP32[$781>>2]|0;
$783 = ($782|0)==($720|0);
if ($783) {
HEAP32[$778>>2] = $773;
HEAP32[$781>>2] = $776;
$R$1$i$i = $773;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$797 = ($771|0)==(0|0);
if ($797) {
break;
}
$$sum30$i$i = (($tsize$254$i) + 28)|0;
$$sum118$i = (($$sum30$i$i) + ($719))|0;
$798 = (($tbase$255$i) + ($$sum118$i)|0);
$799 = HEAP32[$798>>2]|0;
$800 = (9368 + ($799<<2)|0);
$801 = HEAP32[$800>>2]|0;
$802 = ($720|0)==($801|0);
do {
if ($802) {
HEAP32[$800>>2] = $R$1$i$i;
$cond$i$i = ($R$1$i$i|0)==(0|0);
if (!($cond$i$i)) {
break;
}
$803 = 1 << $799;
$804 = $803 ^ -1;
$805 = HEAP32[(9068)>>2]|0;
$806 = $805 & $804;
HEAP32[(9068)>>2] = $806;
break L332;
} else {
$807 = HEAP32[(9080)>>2]|0;
$808 = ($771>>>0)<($807>>>0);
if ($808) {
_abort();
// unreachable;
}
$809 = ((($771)) + 16|0);
$810 = HEAP32[$809>>2]|0;
$811 = ($810|0)==($720|0);
if ($811) {
HEAP32[$809>>2] = $R$1$i$i;
} else {
$812 = ((($771)) + 20|0);
HEAP32[$812>>2] = $R$1$i$i;
}
$813 = ($R$1$i$i|0)==(0|0);
if ($813) {
break L332;
}
}
} while(0);
$814 = HEAP32[(9080)>>2]|0;
$815 = ($R$1$i$i>>>0)<($814>>>0);
if ($815) {
_abort();
// unreachable;
}
$816 = ((($R$1$i$i)) + 24|0);
HEAP32[$816>>2] = $771;
$$sum3132$i$i = $719 | 16;
$$sum119$i = (($$sum3132$i$i) + ($tsize$254$i))|0;
$817 = (($tbase$255$i) + ($$sum119$i)|0);
$818 = HEAP32[$817>>2]|0;
$819 = ($818|0)==(0|0);
do {
if (!($819)) {
$820 = ($818>>>0)<($814>>>0);
if ($820) {
_abort();
// unreachable;
} else {
$821 = ((($R$1$i$i)) + 16|0);
HEAP32[$821>>2] = $818;
$822 = ((($818)) + 24|0);
HEAP32[$822>>2] = $R$1$i$i;
break;
}
}
} while(0);
$$sum120$i = (($$sum2$i21$i) + ($$sum3132$i$i))|0;
$823 = (($tbase$255$i) + ($$sum120$i)|0);
$824 = HEAP32[$823>>2]|0;
$825 = ($824|0)==(0|0);
if ($825) {
break;
}
$826 = HEAP32[(9080)>>2]|0;
$827 = ($824>>>0)<($826>>>0);
if ($827) {
_abort();
// unreachable;
} else {
$828 = ((($R$1$i$i)) + 20|0);
HEAP32[$828>>2] = $824;
$829 = ((($824)) + 24|0);
HEAP32[$829>>2] = $R$1$i$i;
break;
}
}
} while(0);
$$sum9$i$i = $744 | $719;
$$sum121$i = (($$sum9$i$i) + ($tsize$254$i))|0;
$830 = (($tbase$255$i) + ($$sum121$i)|0);
$831 = (($744) + ($725))|0;
$oldfirst$0$i$i = $830;$qsize$0$i$i = $831;
} else {
$oldfirst$0$i$i = $720;$qsize$0$i$i = $725;
}
$832 = ((($oldfirst$0$i$i)) + 4|0);
$833 = HEAP32[$832>>2]|0;
$834 = $833 & -2;
HEAP32[$832>>2] = $834;
$835 = $qsize$0$i$i | 1;
$$sum10$i$i = (($$sum$i19$i) + 4)|0;
$836 = (($tbase$255$i) + ($$sum10$i$i)|0);
HEAP32[$836>>2] = $835;
$$sum11$i$i = (($qsize$0$i$i) + ($$sum$i19$i))|0;
$837 = (($tbase$255$i) + ($$sum11$i$i)|0);
HEAP32[$837>>2] = $qsize$0$i$i;
$838 = $qsize$0$i$i >>> 3;
$839 = ($qsize$0$i$i>>>0)<(256);
if ($839) {
$840 = $838 << 1;
$841 = (9104 + ($840<<2)|0);
$842 = HEAP32[9064>>2]|0;
$843 = 1 << $838;
$844 = $842 & $843;
$845 = ($844|0)==(0);
do {
if ($845) {
$846 = $842 | $843;
HEAP32[9064>>2] = $846;
$$pre$i22$i = (($840) + 2)|0;
$$pre56$i$i = (9104 + ($$pre$i22$i<<2)|0);
$$pre$phi$i23$iZ2D = $$pre56$i$i;$F4$0$i$i = $841;
} else {
$$sum29$i$i = (($840) + 2)|0;
$847 = (9104 + ($$sum29$i$i<<2)|0);
$848 = HEAP32[$847>>2]|0;
$849 = HEAP32[(9080)>>2]|0;
$850 = ($848>>>0)<($849>>>0);
if (!($850)) {
$$pre$phi$i23$iZ2D = $847;$F4$0$i$i = $848;
break;
}
_abort();
// unreachable;
}
} while(0);
HEAP32[$$pre$phi$i23$iZ2D>>2] = $724;
$851 = ((($F4$0$i$i)) + 12|0);
HEAP32[$851>>2] = $724;
$$sum27$i$i = (($$sum$i19$i) + 8)|0;
$852 = (($tbase$255$i) + ($$sum27$i$i)|0);
HEAP32[$852>>2] = $F4$0$i$i;
$$sum28$i$i = (($$sum$i19$i) + 12)|0;
$853 = (($tbase$255$i) + ($$sum28$i$i)|0);
HEAP32[$853>>2] = $841;
break;
}
$854 = $qsize$0$i$i >>> 8;
$855 = ($854|0)==(0);
do {
if ($855) {
$I7$0$i$i = 0;
} else {
$856 = ($qsize$0$i$i>>>0)>(16777215);
if ($856) {
$I7$0$i$i = 31;
break;
}
$857 = (($854) + 1048320)|0;
$858 = $857 >>> 16;
$859 = $858 & 8;
$860 = $854 << $859;
$861 = (($860) + 520192)|0;
$862 = $861 >>> 16;
$863 = $862 & 4;
$864 = $863 | $859;
$865 = $860 << $863;
$866 = (($865) + 245760)|0;
$867 = $866 >>> 16;
$868 = $867 & 2;
$869 = $864 | $868;
$870 = (14 - ($869))|0;
$871 = $865 << $868;
$872 = $871 >>> 15;
$873 = (($870) + ($872))|0;
$874 = $873 << 1;
$875 = (($873) + 7)|0;
$876 = $qsize$0$i$i >>> $875;
$877 = $876 & 1;
$878 = $877 | $874;
$I7$0$i$i = $878;
}
} while(0);
$879 = (9368 + ($I7$0$i$i<<2)|0);
$$sum12$i$i = (($$sum$i19$i) + 28)|0;
$880 = (($tbase$255$i) + ($$sum12$i$i)|0);
HEAP32[$880>>2] = $I7$0$i$i;
$$sum13$i$i = (($$sum$i19$i) + 16)|0;
$881 = (($tbase$255$i) + ($$sum13$i$i)|0);
$$sum14$i$i = (($$sum$i19$i) + 20)|0;
$882 = (($tbase$255$i) + ($$sum14$i$i)|0);
HEAP32[$882>>2] = 0;
HEAP32[$881>>2] = 0;
$883 = HEAP32[(9068)>>2]|0;
$884 = 1 << $I7$0$i$i;
$885 = $883 & $884;
$886 = ($885|0)==(0);
if ($886) {
$887 = $883 | $884;
HEAP32[(9068)>>2] = $887;
HEAP32[$879>>2] = $724;
$$sum15$i$i = (($$sum$i19$i) + 24)|0;
$888 = (($tbase$255$i) + ($$sum15$i$i)|0);
HEAP32[$888>>2] = $879;
$$sum16$i$i = (($$sum$i19$i) + 12)|0;
$889 = (($tbase$255$i) + ($$sum16$i$i)|0);
HEAP32[$889>>2] = $724;
$$sum17$i$i = (($$sum$i19$i) + 8)|0;
$890 = (($tbase$255$i) + ($$sum17$i$i)|0);
HEAP32[$890>>2] = $724;
break;
}
$891 = HEAP32[$879>>2]|0;
$892 = ((($891)) + 4|0);
$893 = HEAP32[$892>>2]|0;
$894 = $893 & -8;
$895 = ($894|0)==($qsize$0$i$i|0);
L418: do {
if ($895) {
$T$0$lcssa$i25$i = $891;
} else {
$896 = ($I7$0$i$i|0)==(31);
$897 = $I7$0$i$i >>> 1;
$898 = (25 - ($897))|0;
$899 = $896 ? 0 : $898;
$900 = $qsize$0$i$i << $899;
$K8$051$i$i = $900;$T$050$i$i = $891;
while(1) {
$907 = $K8$051$i$i >>> 31;
$908 = (((($T$050$i$i)) + 16|0) + ($907<<2)|0);
$903 = HEAP32[$908>>2]|0;
$909 = ($903|0)==(0|0);
if ($909) {
$$lcssa = $908;$T$050$i$i$lcssa = $T$050$i$i;
break;
}
$901 = $K8$051$i$i << 1;
$902 = ((($903)) + 4|0);
$904 = HEAP32[$902>>2]|0;
$905 = $904 & -8;
$906 = ($905|0)==($qsize$0$i$i|0);
if ($906) {
$T$0$lcssa$i25$i = $903;
break L418;
} else {
$K8$051$i$i = $901;$T$050$i$i = $903;
}
}
$910 = HEAP32[(9080)>>2]|0;
$911 = ($$lcssa>>>0)<($910>>>0);
if ($911) {
_abort();
// unreachable;
} else {
HEAP32[$$lcssa>>2] = $724;
$$sum23$i$i = (($$sum$i19$i) + 24)|0;
$912 = (($tbase$255$i) + ($$sum23$i$i)|0);
HEAP32[$912>>2] = $T$050$i$i$lcssa;
$$sum24$i$i = (($$sum$i19$i) + 12)|0;
$913 = (($tbase$255$i) + ($$sum24$i$i)|0);
HEAP32[$913>>2] = $724;
$$sum25$i$i = (($$sum$i19$i) + 8)|0;
$914 = (($tbase$255$i) + ($$sum25$i$i)|0);
HEAP32[$914>>2] = $724;
break L324;
}
}
} while(0);
$915 = ((($T$0$lcssa$i25$i)) + 8|0);
$916 = HEAP32[$915>>2]|0;
$917 = HEAP32[(9080)>>2]|0;
$918 = ($916>>>0)>=($917>>>0);
$not$$i26$i = ($T$0$lcssa$i25$i>>>0)>=($917>>>0);
$919 = $918 & $not$$i26$i;
if ($919) {
$920 = ((($916)) + 12|0);
HEAP32[$920>>2] = $724;
HEAP32[$915>>2] = $724;
$$sum20$i$i = (($$sum$i19$i) + 8)|0;
$921 = (($tbase$255$i) + ($$sum20$i$i)|0);
HEAP32[$921>>2] = $916;
$$sum21$i$i = (($$sum$i19$i) + 12)|0;
$922 = (($tbase$255$i) + ($$sum21$i$i)|0);
HEAP32[$922>>2] = $T$0$lcssa$i25$i;
$$sum22$i$i = (($$sum$i19$i) + 24)|0;
$923 = (($tbase$255$i) + ($$sum22$i$i)|0);
HEAP32[$923>>2] = 0;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$$sum1819$i$i = $711 | 8;
$924 = (($tbase$255$i) + ($$sum1819$i$i)|0);
$mem$0 = $924;
return ($mem$0|0);
} else {
$sp$0$i$i$i = (9512);
}
}
while(1) {
$925 = HEAP32[$sp$0$i$i$i>>2]|0;
$926 = ($925>>>0)>($635>>>0);
if (!($926)) {
$927 = ((($sp$0$i$i$i)) + 4|0);
$928 = HEAP32[$927>>2]|0;
$929 = (($925) + ($928)|0);
$930 = ($929>>>0)>($635>>>0);
if ($930) {
$$lcssa215 = $925;$$lcssa216 = $928;$$lcssa217 = $929;
break;
}
}
$931 = ((($sp$0$i$i$i)) + 8|0);
$932 = HEAP32[$931>>2]|0;
$sp$0$i$i$i = $932;
}
$$sum$i14$i = (($$lcssa216) + -47)|0;
$$sum1$i15$i = (($$lcssa216) + -39)|0;
$933 = (($$lcssa215) + ($$sum1$i15$i)|0);
$934 = $933;
$935 = $934 & 7;
$936 = ($935|0)==(0);
$937 = (0 - ($934))|0;
$938 = $937 & 7;
$939 = $936 ? 0 : $938;
$$sum2$i16$i = (($$sum$i14$i) + ($939))|0;
$940 = (($$lcssa215) + ($$sum2$i16$i)|0);
$941 = ((($635)) + 16|0);
$942 = ($940>>>0)<($941>>>0);
$943 = $942 ? $635 : $940;
$944 = ((($943)) + 8|0);
$945 = (($tsize$254$i) + -40)|0;
$946 = ((($tbase$255$i)) + 8|0);
$947 = $946;
$948 = $947 & 7;
$949 = ($948|0)==(0);
$950 = (0 - ($947))|0;
$951 = $950 & 7;
$952 = $949 ? 0 : $951;
$953 = (($tbase$255$i) + ($952)|0);
$954 = (($945) - ($952))|0;
HEAP32[(9088)>>2] = $953;
HEAP32[(9076)>>2] = $954;
$955 = $954 | 1;
$$sum$i$i$i = (($952) + 4)|0;
$956 = (($tbase$255$i) + ($$sum$i$i$i)|0);
HEAP32[$956>>2] = $955;
$$sum2$i$i$i = (($tsize$254$i) + -36)|0;
$957 = (($tbase$255$i) + ($$sum2$i$i$i)|0);
HEAP32[$957>>2] = 40;
$958 = HEAP32[(9552)>>2]|0;
HEAP32[(9092)>>2] = $958;
$959 = ((($943)) + 4|0);
HEAP32[$959>>2] = 27;
;HEAP32[$944>>2]=HEAP32[(9512)>>2]|0;HEAP32[$944+4>>2]=HEAP32[(9512)+4>>2]|0;HEAP32[$944+8>>2]=HEAP32[(9512)+8>>2]|0;HEAP32[$944+12>>2]=HEAP32[(9512)+12>>2]|0;
HEAP32[(9512)>>2] = $tbase$255$i;
HEAP32[(9516)>>2] = $tsize$254$i;
HEAP32[(9524)>>2] = 0;
HEAP32[(9520)>>2] = $944;
$960 = ((($943)) + 28|0);
HEAP32[$960>>2] = 7;
$961 = ((($943)) + 32|0);
$962 = ($961>>>0)<($$lcssa217>>>0);
if ($962) {
$964 = $960;
while(1) {
$963 = ((($964)) + 4|0);
HEAP32[$963>>2] = 7;
$965 = ((($964)) + 8|0);
$966 = ($965>>>0)<($$lcssa217>>>0);
if ($966) {
$964 = $963;
} else {
break;
}
}
}
$967 = ($943|0)==($635|0);
if (!($967)) {
$968 = $943;
$969 = $635;
$970 = (($968) - ($969))|0;
$971 = HEAP32[$959>>2]|0;
$972 = $971 & -2;
HEAP32[$959>>2] = $972;
$973 = $970 | 1;
$974 = ((($635)) + 4|0);
HEAP32[$974>>2] = $973;
HEAP32[$943>>2] = $970;
$975 = $970 >>> 3;
$976 = ($970>>>0)<(256);
if ($976) {
$977 = $975 << 1;
$978 = (9104 + ($977<<2)|0);
$979 = HEAP32[9064>>2]|0;
$980 = 1 << $975;
$981 = $979 & $980;
$982 = ($981|0)==(0);
if ($982) {
$983 = $979 | $980;
HEAP32[9064>>2] = $983;
$$pre$i$i = (($977) + 2)|0;
$$pre14$i$i = (9104 + ($$pre$i$i<<2)|0);
$$pre$phi$i$iZ2D = $$pre14$i$i;$F$0$i$i = $978;
} else {
$$sum4$i$i = (($977) + 2)|0;
$984 = (9104 + ($$sum4$i$i<<2)|0);
$985 = HEAP32[$984>>2]|0;
$986 = HEAP32[(9080)>>2]|0;
$987 = ($985>>>0)<($986>>>0);
if ($987) {
_abort();
// unreachable;
} else {
$$pre$phi$i$iZ2D = $984;$F$0$i$i = $985;
}
}
HEAP32[$$pre$phi$i$iZ2D>>2] = $635;
$988 = ((($F$0$i$i)) + 12|0);
HEAP32[$988>>2] = $635;
$989 = ((($635)) + 8|0);
HEAP32[$989>>2] = $F$0$i$i;
$990 = ((($635)) + 12|0);
HEAP32[$990>>2] = $978;
break;
}
$991 = $970 >>> 8;
$992 = ($991|0)==(0);
if ($992) {
$I1$0$i$i = 0;
} else {
$993 = ($970>>>0)>(16777215);
if ($993) {
$I1$0$i$i = 31;
} else {
$994 = (($991) + 1048320)|0;
$995 = $994 >>> 16;
$996 = $995 & 8;
$997 = $991 << $996;
$998 = (($997) + 520192)|0;
$999 = $998 >>> 16;
$1000 = $999 & 4;
$1001 = $1000 | $996;
$1002 = $997 << $1000;
$1003 = (($1002) + 245760)|0;
$1004 = $1003 >>> 16;
$1005 = $1004 & 2;
$1006 = $1001 | $1005;
$1007 = (14 - ($1006))|0;
$1008 = $1002 << $1005;
$1009 = $1008 >>> 15;
$1010 = (($1007) + ($1009))|0;
$1011 = $1010 << 1;
$1012 = (($1010) + 7)|0;
$1013 = $970 >>> $1012;
$1014 = $1013 & 1;
$1015 = $1014 | $1011;
$I1$0$i$i = $1015;
}
}
$1016 = (9368 + ($I1$0$i$i<<2)|0);
$1017 = ((($635)) + 28|0);
HEAP32[$1017>>2] = $I1$0$i$i;
$1018 = ((($635)) + 20|0);
HEAP32[$1018>>2] = 0;
HEAP32[$941>>2] = 0;
$1019 = HEAP32[(9068)>>2]|0;
$1020 = 1 << $I1$0$i$i;
$1021 = $1019 & $1020;
$1022 = ($1021|0)==(0);
if ($1022) {
$1023 = $1019 | $1020;
HEAP32[(9068)>>2] = $1023;
HEAP32[$1016>>2] = $635;
$1024 = ((($635)) + 24|0);
HEAP32[$1024>>2] = $1016;
$1025 = ((($635)) + 12|0);
HEAP32[$1025>>2] = $635;
$1026 = ((($635)) + 8|0);
HEAP32[$1026>>2] = $635;
break;
}
$1027 = HEAP32[$1016>>2]|0;
$1028 = ((($1027)) + 4|0);
$1029 = HEAP32[$1028>>2]|0;
$1030 = $1029 & -8;
$1031 = ($1030|0)==($970|0);
L459: do {
if ($1031) {
$T$0$lcssa$i$i = $1027;
} else {
$1032 = ($I1$0$i$i|0)==(31);
$1033 = $I1$0$i$i >>> 1;
$1034 = (25 - ($1033))|0;
$1035 = $1032 ? 0 : $1034;
$1036 = $970 << $1035;
$K2$07$i$i = $1036;$T$06$i$i = $1027;
while(1) {
$1043 = $K2$07$i$i >>> 31;
$1044 = (((($T$06$i$i)) + 16|0) + ($1043<<2)|0);
$1039 = HEAP32[$1044>>2]|0;
$1045 = ($1039|0)==(0|0);
if ($1045) {
$$lcssa211 = $1044;$T$06$i$i$lcssa = $T$06$i$i;
break;
}
$1037 = $K2$07$i$i << 1;
$1038 = ((($1039)) + 4|0);
$1040 = HEAP32[$1038>>2]|0;
$1041 = $1040 & -8;
$1042 = ($1041|0)==($970|0);
if ($1042) {
$T$0$lcssa$i$i = $1039;
break L459;
} else {
$K2$07$i$i = $1037;$T$06$i$i = $1039;
}
}
$1046 = HEAP32[(9080)>>2]|0;
$1047 = ($$lcssa211>>>0)<($1046>>>0);
if ($1047) {
_abort();
// unreachable;
} else {
HEAP32[$$lcssa211>>2] = $635;
$1048 = ((($635)) + 24|0);
HEAP32[$1048>>2] = $T$06$i$i$lcssa;
$1049 = ((($635)) + 12|0);
HEAP32[$1049>>2] = $635;
$1050 = ((($635)) + 8|0);
HEAP32[$1050>>2] = $635;
break L299;
}
}
} while(0);
$1051 = ((($T$0$lcssa$i$i)) + 8|0);
$1052 = HEAP32[$1051>>2]|0;
$1053 = HEAP32[(9080)>>2]|0;
$1054 = ($1052>>>0)>=($1053>>>0);
$not$$i$i = ($T$0$lcssa$i$i>>>0)>=($1053>>>0);
$1055 = $1054 & $not$$i$i;
if ($1055) {
$1056 = ((($1052)) + 12|0);
HEAP32[$1056>>2] = $635;
HEAP32[$1051>>2] = $635;
$1057 = ((($635)) + 8|0);
HEAP32[$1057>>2] = $1052;
$1058 = ((($635)) + 12|0);
HEAP32[$1058>>2] = $T$0$lcssa$i$i;
$1059 = ((($635)) + 24|0);
HEAP32[$1059>>2] = 0;
break;
} else {
_abort();
// unreachable;
}
}
}
} while(0);
$1060 = HEAP32[(9076)>>2]|0;
$1061 = ($1060>>>0)>($nb$0>>>0);
if ($1061) {
$1062 = (($1060) - ($nb$0))|0;
HEAP32[(9076)>>2] = $1062;
$1063 = HEAP32[(9088)>>2]|0;
$1064 = (($1063) + ($nb$0)|0);
HEAP32[(9088)>>2] = $1064;
$1065 = $1062 | 1;
$$sum$i32 = (($nb$0) + 4)|0;
$1066 = (($1063) + ($$sum$i32)|0);
HEAP32[$1066>>2] = $1065;
$1067 = $nb$0 | 3;
$1068 = ((($1063)) + 4|0);
HEAP32[$1068>>2] = $1067;
$1069 = ((($1063)) + 8|0);
$mem$0 = $1069;
return ($mem$0|0);
}
}
$1070 = (___errno_location()|0);
HEAP32[$1070>>2] = 12;
$mem$0 = 0;
return ($mem$0|0);
}
function _free($mem) {
$mem = $mem|0;
var $$lcssa = 0, $$pre = 0, $$pre$phi59Z2D = 0, $$pre$phi61Z2D = 0, $$pre$phiZ2D = 0, $$pre57 = 0, $$pre58 = 0, $$pre60 = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum1718 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0;
var $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum5 = 0, $$sum67 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0;
var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0;
var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0;
var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0;
var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0;
var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0;
var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0;
var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0;
var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0;
var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0;
var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0;
var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
var $321 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0;
var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0;
var $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0;
var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I18$0 = 0, $K19$052 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0;
var $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$051 = 0, $T$051$lcssa = 0, $cond = 0, $cond47 = 0, $not$ = 0, $p$0 = 0, $psize$0 = 0, $psize$1 = 0, $sp$0$i = 0, $sp$0$in$i = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($mem|0)==(0|0);
if ($0) {
return;
}
$1 = ((($mem)) + -8|0);
$2 = HEAP32[(9080)>>2]|0;
$3 = ($1>>>0)<($2>>>0);
if ($3) {
_abort();
// unreachable;
}
$4 = ((($mem)) + -4|0);
$5 = HEAP32[$4>>2]|0;
$6 = $5 & 3;
$7 = ($6|0)==(1);
if ($7) {
_abort();
// unreachable;
}
$8 = $5 & -8;
$$sum = (($8) + -8)|0;
$9 = (($mem) + ($$sum)|0);
$10 = $5 & 1;
$11 = ($10|0)==(0);
do {
if ($11) {
$12 = HEAP32[$1>>2]|0;
$13 = ($6|0)==(0);
if ($13) {
return;
}
$$sum2 = (-8 - ($12))|0;
$14 = (($mem) + ($$sum2)|0);
$15 = (($12) + ($8))|0;
$16 = ($14>>>0)<($2>>>0);
if ($16) {
_abort();
// unreachable;
}
$17 = HEAP32[(9084)>>2]|0;
$18 = ($14|0)==($17|0);
if ($18) {
$$sum3 = (($8) + -4)|0;
$103 = (($mem) + ($$sum3)|0);
$104 = HEAP32[$103>>2]|0;
$105 = $104 & 3;
$106 = ($105|0)==(3);
if (!($106)) {
$p$0 = $14;$psize$0 = $15;
break;
}
HEAP32[(9072)>>2] = $15;
$107 = $104 & -2;
HEAP32[$103>>2] = $107;
$108 = $15 | 1;
$$sum20 = (($$sum2) + 4)|0;
$109 = (($mem) + ($$sum20)|0);
HEAP32[$109>>2] = $108;
HEAP32[$9>>2] = $15;
return;
}
$19 = $12 >>> 3;
$20 = ($12>>>0)<(256);
if ($20) {
$$sum30 = (($$sum2) + 8)|0;
$21 = (($mem) + ($$sum30)|0);
$22 = HEAP32[$21>>2]|0;
$$sum31 = (($$sum2) + 12)|0;
$23 = (($mem) + ($$sum31)|0);
$24 = HEAP32[$23>>2]|0;
$25 = $19 << 1;
$26 = (9104 + ($25<<2)|0);
$27 = ($22|0)==($26|0);
if (!($27)) {
$28 = ($22>>>0)<($2>>>0);
if ($28) {
_abort();
// unreachable;
}
$29 = ((($22)) + 12|0);
$30 = HEAP32[$29>>2]|0;
$31 = ($30|0)==($14|0);
if (!($31)) {
_abort();
// unreachable;
}
}
$32 = ($24|0)==($22|0);
if ($32) {
$33 = 1 << $19;
$34 = $33 ^ -1;
$35 = HEAP32[9064>>2]|0;
$36 = $35 & $34;
HEAP32[9064>>2] = $36;
$p$0 = $14;$psize$0 = $15;
break;
}
$37 = ($24|0)==($26|0);
if ($37) {
$$pre60 = ((($24)) + 8|0);
$$pre$phi61Z2D = $$pre60;
} else {
$38 = ($24>>>0)<($2>>>0);
if ($38) {
_abort();
// unreachable;
}
$39 = ((($24)) + 8|0);
$40 = HEAP32[$39>>2]|0;
$41 = ($40|0)==($14|0);
if ($41) {
$$pre$phi61Z2D = $39;
} else {
_abort();
// unreachable;
}
}
$42 = ((($22)) + 12|0);
HEAP32[$42>>2] = $24;
HEAP32[$$pre$phi61Z2D>>2] = $22;
$p$0 = $14;$psize$0 = $15;
break;
}
$$sum22 = (($$sum2) + 24)|0;
$43 = (($mem) + ($$sum22)|0);
$44 = HEAP32[$43>>2]|0;
$$sum23 = (($$sum2) + 12)|0;
$45 = (($mem) + ($$sum23)|0);
$46 = HEAP32[$45>>2]|0;
$47 = ($46|0)==($14|0);
do {
if ($47) {
$$sum25 = (($$sum2) + 20)|0;
$57 = (($mem) + ($$sum25)|0);
$58 = HEAP32[$57>>2]|0;
$59 = ($58|0)==(0|0);
if ($59) {
$$sum24 = (($$sum2) + 16)|0;
$60 = (($mem) + ($$sum24)|0);
$61 = HEAP32[$60>>2]|0;
$62 = ($61|0)==(0|0);
if ($62) {
$R$1 = 0;
break;
} else {
$R$0 = $61;$RP$0 = $60;
}
} else {
$R$0 = $58;$RP$0 = $57;
}
while(1) {
$63 = ((($R$0)) + 20|0);
$64 = HEAP32[$63>>2]|0;
$65 = ($64|0)==(0|0);
if (!($65)) {
$R$0 = $64;$RP$0 = $63;
continue;
}
$66 = ((($R$0)) + 16|0);
$67 = HEAP32[$66>>2]|0;
$68 = ($67|0)==(0|0);
if ($68) {
$R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0;
break;
} else {
$R$0 = $67;$RP$0 = $66;
}
}
$69 = ($RP$0$lcssa>>>0)<($2>>>0);
if ($69) {
_abort();
// unreachable;
} else {
HEAP32[$RP$0$lcssa>>2] = 0;
$R$1 = $R$0$lcssa;
break;
}
} else {
$$sum29 = (($$sum2) + 8)|0;
$48 = (($mem) + ($$sum29)|0);
$49 = HEAP32[$48>>2]|0;
$50 = ($49>>>0)<($2>>>0);
if ($50) {
_abort();
// unreachable;
}
$51 = ((($49)) + 12|0);
$52 = HEAP32[$51>>2]|0;
$53 = ($52|0)==($14|0);
if (!($53)) {
_abort();
// unreachable;
}
$54 = ((($46)) + 8|0);
$55 = HEAP32[$54>>2]|0;
$56 = ($55|0)==($14|0);
if ($56) {
HEAP32[$51>>2] = $46;
HEAP32[$54>>2] = $49;
$R$1 = $46;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$70 = ($44|0)==(0|0);
if ($70) {
$p$0 = $14;$psize$0 = $15;
} else {
$$sum26 = (($$sum2) + 28)|0;
$71 = (($mem) + ($$sum26)|0);
$72 = HEAP32[$71>>2]|0;
$73 = (9368 + ($72<<2)|0);
$74 = HEAP32[$73>>2]|0;
$75 = ($14|0)==($74|0);
if ($75) {
HEAP32[$73>>2] = $R$1;
$cond = ($R$1|0)==(0|0);
if ($cond) {
$76 = 1 << $72;
$77 = $76 ^ -1;
$78 = HEAP32[(9068)>>2]|0;
$79 = $78 & $77;
HEAP32[(9068)>>2] = $79;
$p$0 = $14;$psize$0 = $15;
break;
}
} else {
$80 = HEAP32[(9080)>>2]|0;
$81 = ($44>>>0)<($80>>>0);
if ($81) {
_abort();
// unreachable;
}
$82 = ((($44)) + 16|0);
$83 = HEAP32[$82>>2]|0;
$84 = ($83|0)==($14|0);
if ($84) {
HEAP32[$82>>2] = $R$1;
} else {
$85 = ((($44)) + 20|0);
HEAP32[$85>>2] = $R$1;
}
$86 = ($R$1|0)==(0|0);
if ($86) {
$p$0 = $14;$psize$0 = $15;
break;
}
}
$87 = HEAP32[(9080)>>2]|0;
$88 = ($R$1>>>0)<($87>>>0);
if ($88) {
_abort();
// unreachable;
}
$89 = ((($R$1)) + 24|0);
HEAP32[$89>>2] = $44;
$$sum27 = (($$sum2) + 16)|0;
$90 = (($mem) + ($$sum27)|0);
$91 = HEAP32[$90>>2]|0;
$92 = ($91|0)==(0|0);
do {
if (!($92)) {
$93 = ($91>>>0)<($87>>>0);
if ($93) {
_abort();
// unreachable;
} else {
$94 = ((($R$1)) + 16|0);
HEAP32[$94>>2] = $91;
$95 = ((($91)) + 24|0);
HEAP32[$95>>2] = $R$1;
break;
}
}
} while(0);
$$sum28 = (($$sum2) + 20)|0;
$96 = (($mem) + ($$sum28)|0);
$97 = HEAP32[$96>>2]|0;
$98 = ($97|0)==(0|0);
if ($98) {
$p$0 = $14;$psize$0 = $15;
} else {
$99 = HEAP32[(9080)>>2]|0;
$100 = ($97>>>0)<($99>>>0);
if ($100) {
_abort();
// unreachable;
} else {
$101 = ((($R$1)) + 20|0);
HEAP32[$101>>2] = $97;
$102 = ((($97)) + 24|0);
HEAP32[$102>>2] = $R$1;
$p$0 = $14;$psize$0 = $15;
break;
}
}
}
} else {
$p$0 = $1;$psize$0 = $8;
}
} while(0);
$110 = ($p$0>>>0)<($9>>>0);
if (!($110)) {
_abort();
// unreachable;
}
$$sum19 = (($8) + -4)|0;
$111 = (($mem) + ($$sum19)|0);
$112 = HEAP32[$111>>2]|0;
$113 = $112 & 1;
$114 = ($113|0)==(0);
if ($114) {
_abort();
// unreachable;
}
$115 = $112 & 2;
$116 = ($115|0)==(0);
if ($116) {
$117 = HEAP32[(9088)>>2]|0;
$118 = ($9|0)==($117|0);
if ($118) {
$119 = HEAP32[(9076)>>2]|0;
$120 = (($119) + ($psize$0))|0;
HEAP32[(9076)>>2] = $120;
HEAP32[(9088)>>2] = $p$0;
$121 = $120 | 1;
$122 = ((($p$0)) + 4|0);
HEAP32[$122>>2] = $121;
$123 = HEAP32[(9084)>>2]|0;
$124 = ($p$0|0)==($123|0);
if (!($124)) {
return;
}
HEAP32[(9084)>>2] = 0;
HEAP32[(9072)>>2] = 0;
return;
}
$125 = HEAP32[(9084)>>2]|0;
$126 = ($9|0)==($125|0);
if ($126) {
$127 = HEAP32[(9072)>>2]|0;
$128 = (($127) + ($psize$0))|0;
HEAP32[(9072)>>2] = $128;
HEAP32[(9084)>>2] = $p$0;
$129 = $128 | 1;
$130 = ((($p$0)) + 4|0);
HEAP32[$130>>2] = $129;
$131 = (($p$0) + ($128)|0);
HEAP32[$131>>2] = $128;
return;
}
$132 = $112 & -8;
$133 = (($132) + ($psize$0))|0;
$134 = $112 >>> 3;
$135 = ($112>>>0)<(256);
do {
if ($135) {
$136 = (($mem) + ($8)|0);
$137 = HEAP32[$136>>2]|0;
$$sum1718 = $8 | 4;
$138 = (($mem) + ($$sum1718)|0);
$139 = HEAP32[$138>>2]|0;
$140 = $134 << 1;
$141 = (9104 + ($140<<2)|0);
$142 = ($137|0)==($141|0);
if (!($142)) {
$143 = HEAP32[(9080)>>2]|0;
$144 = ($137>>>0)<($143>>>0);
if ($144) {
_abort();
// unreachable;
}
$145 = ((($137)) + 12|0);
$146 = HEAP32[$145>>2]|0;
$147 = ($146|0)==($9|0);
if (!($147)) {
_abort();
// unreachable;
}
}
$148 = ($139|0)==($137|0);
if ($148) {
$149 = 1 << $134;
$150 = $149 ^ -1;
$151 = HEAP32[9064>>2]|0;
$152 = $151 & $150;
HEAP32[9064>>2] = $152;
break;
}
$153 = ($139|0)==($141|0);
if ($153) {
$$pre58 = ((($139)) + 8|0);
$$pre$phi59Z2D = $$pre58;
} else {
$154 = HEAP32[(9080)>>2]|0;
$155 = ($139>>>0)<($154>>>0);
if ($155) {
_abort();
// unreachable;
}
$156 = ((($139)) + 8|0);
$157 = HEAP32[$156>>2]|0;
$158 = ($157|0)==($9|0);
if ($158) {
$$pre$phi59Z2D = $156;
} else {
_abort();
// unreachable;
}
}
$159 = ((($137)) + 12|0);
HEAP32[$159>>2] = $139;
HEAP32[$$pre$phi59Z2D>>2] = $137;
} else {
$$sum5 = (($8) + 16)|0;
$160 = (($mem) + ($$sum5)|0);
$161 = HEAP32[$160>>2]|0;
$$sum67 = $8 | 4;
$162 = (($mem) + ($$sum67)|0);
$163 = HEAP32[$162>>2]|0;
$164 = ($163|0)==($9|0);
do {
if ($164) {
$$sum9 = (($8) + 12)|0;
$175 = (($mem) + ($$sum9)|0);
$176 = HEAP32[$175>>2]|0;
$177 = ($176|0)==(0|0);
if ($177) {
$$sum8 = (($8) + 8)|0;
$178 = (($mem) + ($$sum8)|0);
$179 = HEAP32[$178>>2]|0;
$180 = ($179|0)==(0|0);
if ($180) {
$R7$1 = 0;
break;
} else {
$R7$0 = $179;$RP9$0 = $178;
}
} else {
$R7$0 = $176;$RP9$0 = $175;
}
while(1) {
$181 = ((($R7$0)) + 20|0);
$182 = HEAP32[$181>>2]|0;
$183 = ($182|0)==(0|0);
if (!($183)) {
$R7$0 = $182;$RP9$0 = $181;
continue;
}
$184 = ((($R7$0)) + 16|0);
$185 = HEAP32[$184>>2]|0;
$186 = ($185|0)==(0|0);
if ($186) {
$R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0;
break;
} else {
$R7$0 = $185;$RP9$0 = $184;
}
}
$187 = HEAP32[(9080)>>2]|0;
$188 = ($RP9$0$lcssa>>>0)<($187>>>0);
if ($188) {
_abort();
// unreachable;
} else {
HEAP32[$RP9$0$lcssa>>2] = 0;
$R7$1 = $R7$0$lcssa;
break;
}
} else {
$165 = (($mem) + ($8)|0);
$166 = HEAP32[$165>>2]|0;
$167 = HEAP32[(9080)>>2]|0;
$168 = ($166>>>0)<($167>>>0);
if ($168) {
_abort();
// unreachable;
}
$169 = ((($166)) + 12|0);
$170 = HEAP32[$169>>2]|0;
$171 = ($170|0)==($9|0);
if (!($171)) {
_abort();
// unreachable;
}
$172 = ((($163)) + 8|0);
$173 = HEAP32[$172>>2]|0;
$174 = ($173|0)==($9|0);
if ($174) {
HEAP32[$169>>2] = $163;
HEAP32[$172>>2] = $166;
$R7$1 = $163;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$189 = ($161|0)==(0|0);
if (!($189)) {
$$sum12 = (($8) + 20)|0;
$190 = (($mem) + ($$sum12)|0);
$191 = HEAP32[$190>>2]|0;
$192 = (9368 + ($191<<2)|0);
$193 = HEAP32[$192>>2]|0;
$194 = ($9|0)==($193|0);
if ($194) {
HEAP32[$192>>2] = $R7$1;
$cond47 = ($R7$1|0)==(0|0);
if ($cond47) {
$195 = 1 << $191;
$196 = $195 ^ -1;
$197 = HEAP32[(9068)>>2]|0;
$198 = $197 & $196;
HEAP32[(9068)>>2] = $198;
break;
}
} else {
$199 = HEAP32[(9080)>>2]|0;
$200 = ($161>>>0)<($199>>>0);
if ($200) {
_abort();
// unreachable;
}
$201 = ((($161)) + 16|0);
$202 = HEAP32[$201>>2]|0;
$203 = ($202|0)==($9|0);
if ($203) {
HEAP32[$201>>2] = $R7$1;
} else {
$204 = ((($161)) + 20|0);
HEAP32[$204>>2] = $R7$1;
}
$205 = ($R7$1|0)==(0|0);
if ($205) {
break;
}
}
$206 = HEAP32[(9080)>>2]|0;
$207 = ($R7$1>>>0)<($206>>>0);
if ($207) {
_abort();
// unreachable;
}
$208 = ((($R7$1)) + 24|0);
HEAP32[$208>>2] = $161;
$$sum13 = (($8) + 8)|0;
$209 = (($mem) + ($$sum13)|0);
$210 = HEAP32[$209>>2]|0;
$211 = ($210|0)==(0|0);
do {
if (!($211)) {
$212 = ($210>>>0)<($206>>>0);
if ($212) {
_abort();
// unreachable;
} else {
$213 = ((($R7$1)) + 16|0);
HEAP32[$213>>2] = $210;
$214 = ((($210)) + 24|0);
HEAP32[$214>>2] = $R7$1;
break;
}
}
} while(0);
$$sum14 = (($8) + 12)|0;
$215 = (($mem) + ($$sum14)|0);
$216 = HEAP32[$215>>2]|0;
$217 = ($216|0)==(0|0);
if (!($217)) {
$218 = HEAP32[(9080)>>2]|0;
$219 = ($216>>>0)<($218>>>0);
if ($219) {
_abort();
// unreachable;
} else {
$220 = ((($R7$1)) + 20|0);
HEAP32[$220>>2] = $216;
$221 = ((($216)) + 24|0);
HEAP32[$221>>2] = $R7$1;
break;
}
}
}
}
} while(0);
$222 = $133 | 1;
$223 = ((($p$0)) + 4|0);
HEAP32[$223>>2] = $222;
$224 = (($p$0) + ($133)|0);
HEAP32[$224>>2] = $133;
$225 = HEAP32[(9084)>>2]|0;
$226 = ($p$0|0)==($225|0);
if ($226) {
HEAP32[(9072)>>2] = $133;
return;
} else {
$psize$1 = $133;
}
} else {
$227 = $112 & -2;
HEAP32[$111>>2] = $227;
$228 = $psize$0 | 1;
$229 = ((($p$0)) + 4|0);
HEAP32[$229>>2] = $228;
$230 = (($p$0) + ($psize$0)|0);
HEAP32[$230>>2] = $psize$0;
$psize$1 = $psize$0;
}
$231 = $psize$1 >>> 3;
$232 = ($psize$1>>>0)<(256);
if ($232) {
$233 = $231 << 1;
$234 = (9104 + ($233<<2)|0);
$235 = HEAP32[9064>>2]|0;
$236 = 1 << $231;
$237 = $235 & $236;
$238 = ($237|0)==(0);
if ($238) {
$239 = $235 | $236;
HEAP32[9064>>2] = $239;
$$pre = (($233) + 2)|0;
$$pre57 = (9104 + ($$pre<<2)|0);
$$pre$phiZ2D = $$pre57;$F16$0 = $234;
} else {
$$sum11 = (($233) + 2)|0;
$240 = (9104 + ($$sum11<<2)|0);
$241 = HEAP32[$240>>2]|0;
$242 = HEAP32[(9080)>>2]|0;
$243 = ($241>>>0)<($242>>>0);
if ($243) {
_abort();
// unreachable;
} else {
$$pre$phiZ2D = $240;$F16$0 = $241;
}
}
HEAP32[$$pre$phiZ2D>>2] = $p$0;
$244 = ((($F16$0)) + 12|0);
HEAP32[$244>>2] = $p$0;
$245 = ((($p$0)) + 8|0);
HEAP32[$245>>2] = $F16$0;
$246 = ((($p$0)) + 12|0);
HEAP32[$246>>2] = $234;
return;
}
$247 = $psize$1 >>> 8;
$248 = ($247|0)==(0);
if ($248) {
$I18$0 = 0;
} else {
$249 = ($psize$1>>>0)>(16777215);
if ($249) {
$I18$0 = 31;
} else {
$250 = (($247) + 1048320)|0;
$251 = $250 >>> 16;
$252 = $251 & 8;
$253 = $247 << $252;
$254 = (($253) + 520192)|0;
$255 = $254 >>> 16;
$256 = $255 & 4;
$257 = $256 | $252;
$258 = $253 << $256;
$259 = (($258) + 245760)|0;
$260 = $259 >>> 16;
$261 = $260 & 2;
$262 = $257 | $261;
$263 = (14 - ($262))|0;
$264 = $258 << $261;
$265 = $264 >>> 15;
$266 = (($263) + ($265))|0;
$267 = $266 << 1;
$268 = (($266) + 7)|0;
$269 = $psize$1 >>> $268;
$270 = $269 & 1;
$271 = $270 | $267;
$I18$0 = $271;
}
}
$272 = (9368 + ($I18$0<<2)|0);
$273 = ((($p$0)) + 28|0);
HEAP32[$273>>2] = $I18$0;
$274 = ((($p$0)) + 16|0);
$275 = ((($p$0)) + 20|0);
HEAP32[$275>>2] = 0;
HEAP32[$274>>2] = 0;
$276 = HEAP32[(9068)>>2]|0;
$277 = 1 << $I18$0;
$278 = $276 & $277;
$279 = ($278|0)==(0);
L199: do {
if ($279) {
$280 = $276 | $277;
HEAP32[(9068)>>2] = $280;
HEAP32[$272>>2] = $p$0;
$281 = ((($p$0)) + 24|0);
HEAP32[$281>>2] = $272;
$282 = ((($p$0)) + 12|0);
HEAP32[$282>>2] = $p$0;
$283 = ((($p$0)) + 8|0);
HEAP32[$283>>2] = $p$0;
} else {
$284 = HEAP32[$272>>2]|0;
$285 = ((($284)) + 4|0);
$286 = HEAP32[$285>>2]|0;
$287 = $286 & -8;
$288 = ($287|0)==($psize$1|0);
L202: do {
if ($288) {
$T$0$lcssa = $284;
} else {
$289 = ($I18$0|0)==(31);
$290 = $I18$0 >>> 1;
$291 = (25 - ($290))|0;
$292 = $289 ? 0 : $291;
$293 = $psize$1 << $292;
$K19$052 = $293;$T$051 = $284;
while(1) {
$300 = $K19$052 >>> 31;
$301 = (((($T$051)) + 16|0) + ($300<<2)|0);
$296 = HEAP32[$301>>2]|0;
$302 = ($296|0)==(0|0);
if ($302) {
$$lcssa = $301;$T$051$lcssa = $T$051;
break;
}
$294 = $K19$052 << 1;
$295 = ((($296)) + 4|0);
$297 = HEAP32[$295>>2]|0;
$298 = $297 & -8;
$299 = ($298|0)==($psize$1|0);
if ($299) {
$T$0$lcssa = $296;
break L202;
} else {
$K19$052 = $294;$T$051 = $296;
}
}
$303 = HEAP32[(9080)>>2]|0;
$304 = ($$lcssa>>>0)<($303>>>0);
if ($304) {
_abort();
// unreachable;
} else {
HEAP32[$$lcssa>>2] = $p$0;
$305 = ((($p$0)) + 24|0);
HEAP32[$305>>2] = $T$051$lcssa;
$306 = ((($p$0)) + 12|0);
HEAP32[$306>>2] = $p$0;
$307 = ((($p$0)) + 8|0);
HEAP32[$307>>2] = $p$0;
break L199;
}
}
} while(0);
$308 = ((($T$0$lcssa)) + 8|0);
$309 = HEAP32[$308>>2]|0;
$310 = HEAP32[(9080)>>2]|0;
$311 = ($309>>>0)>=($310>>>0);
$not$ = ($T$0$lcssa>>>0)>=($310>>>0);
$312 = $311 & $not$;
if ($312) {
$313 = ((($309)) + 12|0);
HEAP32[$313>>2] = $p$0;
HEAP32[$308>>2] = $p$0;
$314 = ((($p$0)) + 8|0);
HEAP32[$314>>2] = $309;
$315 = ((($p$0)) + 12|0);
HEAP32[$315>>2] = $T$0$lcssa;
$316 = ((($p$0)) + 24|0);
HEAP32[$316>>2] = 0;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$317 = HEAP32[(9096)>>2]|0;
$318 = (($317) + -1)|0;
HEAP32[(9096)>>2] = $318;
$319 = ($318|0)==(0);
if ($319) {
$sp$0$in$i = (9520);
} else {
return;
}
while(1) {
$sp$0$i = HEAP32[$sp$0$in$i>>2]|0;
$320 = ($sp$0$i|0)==(0|0);
$321 = ((($sp$0$i)) + 8|0);
if ($320) {
break;
} else {
$sp$0$in$i = $321;
}
}
HEAP32[(9096)>>2] = -1;
return;
}
function _realloc($oldmem,$bytes) {
$oldmem = $oldmem|0;
$bytes = $bytes|0;
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
var $7 = 0, $8 = 0, $9 = 0, $mem$0 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ($oldmem|0)==(0|0);
if ($0) {
$1 = (_malloc($bytes)|0);
$mem$0 = $1;
return ($mem$0|0);
}
$2 = ($bytes>>>0)>(4294967231);
if ($2) {
$3 = (___errno_location()|0);
HEAP32[$3>>2] = 12;
$mem$0 = 0;
return ($mem$0|0);
}
$4 = ($bytes>>>0)<(11);
$5 = (($bytes) + 11)|0;
$6 = $5 & -8;
$7 = $4 ? 16 : $6;
$8 = ((($oldmem)) + -8|0);
$9 = (_try_realloc_chunk($8,$7)|0);
$10 = ($9|0)==(0|0);
if (!($10)) {
$11 = ((($9)) + 8|0);
$mem$0 = $11;
return ($mem$0|0);
}
$12 = (_malloc($bytes)|0);
$13 = ($12|0)==(0|0);
if ($13) {
$mem$0 = 0;
return ($mem$0|0);
}
$14 = ((($oldmem)) + -4|0);
$15 = HEAP32[$14>>2]|0;
$16 = $15 & -8;
$17 = $15 & 3;
$18 = ($17|0)==(0);
$19 = $18 ? 8 : 4;
$20 = (($16) - ($19))|0;
$21 = ($20>>>0)<($bytes>>>0);
$22 = $21 ? $20 : $bytes;
_memcpy(($12|0),($oldmem|0),($22|0))|0;
_free($oldmem);
$mem$0 = $12;
return ($mem$0|0);
}
function _try_realloc_chunk($p,$nb) {
$p = $p|0;
$nb = $nb|0;
var $$pre = 0, $$pre$phiZ2D = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum2728 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum78 = 0;
var $$sum910 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
var $17 = 0, $170 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $cond = 0, $newp$0 = 0, $notlhs = 0;
var $notrhs = 0, $or$cond$not = 0, $or$cond30 = 0, $storemerge = 0, $storemerge21 = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = ((($p)) + 4|0);
$1 = HEAP32[$0>>2]|0;
$2 = $1 & -8;
$3 = (($p) + ($2)|0);
$4 = HEAP32[(9080)>>2]|0;
$5 = $1 & 3;
$notlhs = ($p>>>0)>=($4>>>0);
$notrhs = ($5|0)!=(1);
$or$cond$not = $notrhs & $notlhs;
$6 = ($p>>>0)<($3>>>0);
$or$cond30 = $or$cond$not & $6;
if (!($or$cond30)) {
_abort();
// unreachable;
}
$$sum2728 = $2 | 4;
$7 = (($p) + ($$sum2728)|0);
$8 = HEAP32[$7>>2]|0;
$9 = $8 & 1;
$10 = ($9|0)==(0);
if ($10) {
_abort();
// unreachable;
}
$11 = ($5|0)==(0);
if ($11) {
$12 = ($nb>>>0)<(256);
if ($12) {
$newp$0 = 0;
return ($newp$0|0);
}
$13 = (($nb) + 4)|0;
$14 = ($2>>>0)<($13>>>0);
if (!($14)) {
$15 = (($2) - ($nb))|0;
$16 = HEAP32[(9544)>>2]|0;
$17 = $16 << 1;
$18 = ($15>>>0)>($17>>>0);
if (!($18)) {
$newp$0 = $p;
return ($newp$0|0);
}
}
$newp$0 = 0;
return ($newp$0|0);
}
$19 = ($2>>>0)<($nb>>>0);
if (!($19)) {
$20 = (($2) - ($nb))|0;
$21 = ($20>>>0)>(15);
if (!($21)) {
$newp$0 = $p;
return ($newp$0|0);
}
$22 = (($p) + ($nb)|0);
$23 = $1 & 1;
$24 = $23 | $nb;
$25 = $24 | 2;
HEAP32[$0>>2] = $25;
$$sum23 = (($nb) + 4)|0;
$26 = (($p) + ($$sum23)|0);
$27 = $20 | 3;
HEAP32[$26>>2] = $27;
$28 = HEAP32[$7>>2]|0;
$29 = $28 | 1;
HEAP32[$7>>2] = $29;
_dispose_chunk($22,$20);
$newp$0 = $p;
return ($newp$0|0);
}
$30 = HEAP32[(9088)>>2]|0;
$31 = ($3|0)==($30|0);
if ($31) {
$32 = HEAP32[(9076)>>2]|0;
$33 = (($32) + ($2))|0;
$34 = ($33>>>0)>($nb>>>0);
if (!($34)) {
$newp$0 = 0;
return ($newp$0|0);
}
$35 = (($33) - ($nb))|0;
$36 = (($p) + ($nb)|0);
$37 = $1 & 1;
$38 = $37 | $nb;
$39 = $38 | 2;
HEAP32[$0>>2] = $39;
$$sum22 = (($nb) + 4)|0;
$40 = (($p) + ($$sum22)|0);
$41 = $35 | 1;
HEAP32[$40>>2] = $41;
HEAP32[(9088)>>2] = $36;
HEAP32[(9076)>>2] = $35;
$newp$0 = $p;
return ($newp$0|0);
}
$42 = HEAP32[(9084)>>2]|0;
$43 = ($3|0)==($42|0);
if ($43) {
$44 = HEAP32[(9072)>>2]|0;
$45 = (($44) + ($2))|0;
$46 = ($45>>>0)<($nb>>>0);
if ($46) {
$newp$0 = 0;
return ($newp$0|0);
}
$47 = (($45) - ($nb))|0;
$48 = ($47>>>0)>(15);
if ($48) {
$49 = (($p) + ($nb)|0);
$50 = (($p) + ($45)|0);
$51 = $1 & 1;
$52 = $51 | $nb;
$53 = $52 | 2;
HEAP32[$0>>2] = $53;
$$sum19 = (($nb) + 4)|0;
$54 = (($p) + ($$sum19)|0);
$55 = $47 | 1;
HEAP32[$54>>2] = $55;
HEAP32[$50>>2] = $47;
$$sum20 = (($45) + 4)|0;
$56 = (($p) + ($$sum20)|0);
$57 = HEAP32[$56>>2]|0;
$58 = $57 & -2;
HEAP32[$56>>2] = $58;
$storemerge = $49;$storemerge21 = $47;
} else {
$59 = $1 & 1;
$60 = $59 | $45;
$61 = $60 | 2;
HEAP32[$0>>2] = $61;
$$sum17 = (($45) + 4)|0;
$62 = (($p) + ($$sum17)|0);
$63 = HEAP32[$62>>2]|0;
$64 = $63 | 1;
HEAP32[$62>>2] = $64;
$storemerge = 0;$storemerge21 = 0;
}
HEAP32[(9072)>>2] = $storemerge21;
HEAP32[(9084)>>2] = $storemerge;
$newp$0 = $p;
return ($newp$0|0);
}
$65 = $8 & 2;
$66 = ($65|0)==(0);
if (!($66)) {
$newp$0 = 0;
return ($newp$0|0);
}
$67 = $8 & -8;
$68 = (($67) + ($2))|0;
$69 = ($68>>>0)<($nb>>>0);
if ($69) {
$newp$0 = 0;
return ($newp$0|0);
}
$70 = (($68) - ($nb))|0;
$71 = $8 >>> 3;
$72 = ($8>>>0)<(256);
do {
if ($72) {
$$sum15 = (($2) + 8)|0;
$73 = (($p) + ($$sum15)|0);
$74 = HEAP32[$73>>2]|0;
$$sum16 = (($2) + 12)|0;
$75 = (($p) + ($$sum16)|0);
$76 = HEAP32[$75>>2]|0;
$77 = $71 << 1;
$78 = (9104 + ($77<<2)|0);
$79 = ($74|0)==($78|0);
if (!($79)) {
$80 = ($74>>>0)<($4>>>0);
if ($80) {
_abort();
// unreachable;
}
$81 = ((($74)) + 12|0);
$82 = HEAP32[$81>>2]|0;
$83 = ($82|0)==($3|0);
if (!($83)) {
_abort();
// unreachable;
}
}
$84 = ($76|0)==($74|0);
if ($84) {
$85 = 1 << $71;
$86 = $85 ^ -1;
$87 = HEAP32[9064>>2]|0;
$88 = $87 & $86;
HEAP32[9064>>2] = $88;
break;
}
$89 = ($76|0)==($78|0);
if ($89) {
$$pre = ((($76)) + 8|0);
$$pre$phiZ2D = $$pre;
} else {
$90 = ($76>>>0)<($4>>>0);
if ($90) {
_abort();
// unreachable;
}
$91 = ((($76)) + 8|0);
$92 = HEAP32[$91>>2]|0;
$93 = ($92|0)==($3|0);
if ($93) {
$$pre$phiZ2D = $91;
} else {
_abort();
// unreachable;
}
}
$94 = ((($74)) + 12|0);
HEAP32[$94>>2] = $76;
HEAP32[$$pre$phiZ2D>>2] = $74;
} else {
$$sum = (($2) + 24)|0;
$95 = (($p) + ($$sum)|0);
$96 = HEAP32[$95>>2]|0;
$$sum2 = (($2) + 12)|0;
$97 = (($p) + ($$sum2)|0);
$98 = HEAP32[$97>>2]|0;
$99 = ($98|0)==($3|0);
do {
if ($99) {
$$sum4 = (($2) + 20)|0;
$109 = (($p) + ($$sum4)|0);
$110 = HEAP32[$109>>2]|0;
$111 = ($110|0)==(0|0);
if ($111) {
$$sum3 = (($2) + 16)|0;
$112 = (($p) + ($$sum3)|0);
$113 = HEAP32[$112>>2]|0;
$114 = ($113|0)==(0|0);
if ($114) {
$R$1 = 0;
break;
} else {
$R$0 = $113;$RP$0 = $112;
}
} else {
$R$0 = $110;$RP$0 = $109;
}
while(1) {
$115 = ((($R$0)) + 20|0);
$116 = HEAP32[$115>>2]|0;
$117 = ($116|0)==(0|0);
if (!($117)) {
$R$0 = $116;$RP$0 = $115;
continue;
}
$118 = ((($R$0)) + 16|0);
$119 = HEAP32[$118>>2]|0;
$120 = ($119|0)==(0|0);
if ($120) {
$R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0;
break;
} else {
$R$0 = $119;$RP$0 = $118;
}
}
$121 = ($RP$0$lcssa>>>0)<($4>>>0);
if ($121) {
_abort();
// unreachable;
} else {
HEAP32[$RP$0$lcssa>>2] = 0;
$R$1 = $R$0$lcssa;
break;
}
} else {
$$sum14 = (($2) + 8)|0;
$100 = (($p) + ($$sum14)|0);
$101 = HEAP32[$100>>2]|0;
$102 = ($101>>>0)<($4>>>0);
if ($102) {
_abort();
// unreachable;
}
$103 = ((($101)) + 12|0);
$104 = HEAP32[$103>>2]|0;
$105 = ($104|0)==($3|0);
if (!($105)) {
_abort();
// unreachable;
}
$106 = ((($98)) + 8|0);
$107 = HEAP32[$106>>2]|0;
$108 = ($107|0)==($3|0);
if ($108) {
HEAP32[$103>>2] = $98;
HEAP32[$106>>2] = $101;
$R$1 = $98;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$122 = ($96|0)==(0|0);
if (!($122)) {
$$sum11 = (($2) + 28)|0;
$123 = (($p) + ($$sum11)|0);
$124 = HEAP32[$123>>2]|0;
$125 = (9368 + ($124<<2)|0);
$126 = HEAP32[$125>>2]|0;
$127 = ($3|0)==($126|0);
if ($127) {
HEAP32[$125>>2] = $R$1;
$cond = ($R$1|0)==(0|0);
if ($cond) {
$128 = 1 << $124;
$129 = $128 ^ -1;
$130 = HEAP32[(9068)>>2]|0;
$131 = $130 & $129;
HEAP32[(9068)>>2] = $131;
break;
}
} else {
$132 = HEAP32[(9080)>>2]|0;
$133 = ($96>>>0)<($132>>>0);
if ($133) {
_abort();
// unreachable;
}
$134 = ((($96)) + 16|0);
$135 = HEAP32[$134>>2]|0;
$136 = ($135|0)==($3|0);
if ($136) {
HEAP32[$134>>2] = $R$1;
} else {
$137 = ((($96)) + 20|0);
HEAP32[$137>>2] = $R$1;
}
$138 = ($R$1|0)==(0|0);
if ($138) {
break;
}
}
$139 = HEAP32[(9080)>>2]|0;
$140 = ($R$1>>>0)<($139>>>0);
if ($140) {
_abort();
// unreachable;
}
$141 = ((($R$1)) + 24|0);
HEAP32[$141>>2] = $96;
$$sum12 = (($2) + 16)|0;
$142 = (($p) + ($$sum12)|0);
$143 = HEAP32[$142>>2]|0;
$144 = ($143|0)==(0|0);
do {
if (!($144)) {
$145 = ($143>>>0)<($139>>>0);
if ($145) {
_abort();
// unreachable;
} else {
$146 = ((($R$1)) + 16|0);
HEAP32[$146>>2] = $143;
$147 = ((($143)) + 24|0);
HEAP32[$147>>2] = $R$1;
break;
}
}
} while(0);
$$sum13 = (($2) + 20)|0;
$148 = (($p) + ($$sum13)|0);
$149 = HEAP32[$148>>2]|0;
$150 = ($149|0)==(0|0);
if (!($150)) {
$151 = HEAP32[(9080)>>2]|0;
$152 = ($149>>>0)<($151>>>0);
if ($152) {
_abort();
// unreachable;
} else {
$153 = ((($R$1)) + 20|0);
HEAP32[$153>>2] = $149;
$154 = ((($149)) + 24|0);
HEAP32[$154>>2] = $R$1;
break;
}
}
}
}
} while(0);
$155 = ($70>>>0)<(16);
if ($155) {
$156 = $1 & 1;
$157 = $68 | $156;
$158 = $157 | 2;
HEAP32[$0>>2] = $158;
$$sum910 = $68 | 4;
$159 = (($p) + ($$sum910)|0);
$160 = HEAP32[$159>>2]|0;
$161 = $160 | 1;
HEAP32[$159>>2] = $161;
$newp$0 = $p;
return ($newp$0|0);
} else {
$162 = (($p) + ($nb)|0);
$163 = $1 & 1;
$164 = $163 | $nb;
$165 = $164 | 2;
HEAP32[$0>>2] = $165;
$$sum5 = (($nb) + 4)|0;
$166 = (($p) + ($$sum5)|0);
$167 = $70 | 3;
HEAP32[$166>>2] = $167;
$$sum78 = $68 | 4;
$168 = (($p) + ($$sum78)|0);
$169 = HEAP32[$168>>2]|0;
$170 = $169 | 1;
HEAP32[$168>>2] = $170;
_dispose_chunk($162,$70);
$newp$0 = $p;
return ($newp$0|0);
}
return (0)|0;
}
function _dispose_chunk($p,$psize) {
$p = $p|0;
$psize = $psize|0;
var $$0 = 0, $$02 = 0, $$1 = 0, $$lcssa = 0, $$pre = 0, $$pre$phi50Z2D = 0, $$pre$phi52Z2D = 0, $$pre$phiZ2D = 0, $$pre48 = 0, $$pre49 = 0, $$pre51 = 0, $$sum = 0, $$sum1 = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum16 = 0, $$sum17 = 0;
var $$sum18 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0;
var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0;
var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0;
var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0;
var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0;
var $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0;
var $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0;
var $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0;
var $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
var $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I19$0 = 0, $K20$043 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$042 = 0, $T$042$lcssa = 0, $cond = 0;
var $cond39 = 0, $not$ = 0, label = 0, sp = 0;
sp = STACKTOP;
$0 = (($p) + ($psize)|0);
$1 = ((($p)) + 4|0);
$2 = HEAP32[$1>>2]|0;
$3 = $2 & 1;
$4 = ($3|0)==(0);
do {
if ($4) {
$5 = HEAP32[$p>>2]|0;
$6 = $2 & 3;
$7 = ($6|0)==(0);
if ($7) {
return;
}
$8 = (0 - ($5))|0;
$9 = (($p) + ($8)|0);
$10 = (($5) + ($psize))|0;
$11 = HEAP32[(9080)>>2]|0;
$12 = ($9>>>0)<($11>>>0);
if ($12) {
_abort();
// unreachable;
}
$13 = HEAP32[(9084)>>2]|0;
$14 = ($9|0)==($13|0);
if ($14) {
$$sum = (($psize) + 4)|0;
$99 = (($p) + ($$sum)|0);
$100 = HEAP32[$99>>2]|0;
$101 = $100 & 3;
$102 = ($101|0)==(3);
if (!($102)) {
$$0 = $9;$$02 = $10;
break;
}
HEAP32[(9072)>>2] = $10;
$103 = $100 & -2;
HEAP32[$99>>2] = $103;
$104 = $10 | 1;
$$sum14 = (4 - ($5))|0;
$105 = (($p) + ($$sum14)|0);
HEAP32[$105>>2] = $104;
HEAP32[$0>>2] = $10;
return;
}
$15 = $5 >>> 3;
$16 = ($5>>>0)<(256);
if ($16) {
$$sum24 = (8 - ($5))|0;
$17 = (($p) + ($$sum24)|0);
$18 = HEAP32[$17>>2]|0;
$$sum25 = (12 - ($5))|0;
$19 = (($p) + ($$sum25)|0);
$20 = HEAP32[$19>>2]|0;
$21 = $15 << 1;
$22 = (9104 + ($21<<2)|0);
$23 = ($18|0)==($22|0);
if (!($23)) {
$24 = ($18>>>0)<($11>>>0);
if ($24) {
_abort();
// unreachable;
}
$25 = ((($18)) + 12|0);
$26 = HEAP32[$25>>2]|0;
$27 = ($26|0)==($9|0);
if (!($27)) {
_abort();
// unreachable;
}
}
$28 = ($20|0)==($18|0);
if ($28) {
$29 = 1 << $15;
$30 = $29 ^ -1;
$31 = HEAP32[9064>>2]|0;
$32 = $31 & $30;
HEAP32[9064>>2] = $32;
$$0 = $9;$$02 = $10;
break;
}
$33 = ($20|0)==($22|0);
if ($33) {
$$pre51 = ((($20)) + 8|0);
$$pre$phi52Z2D = $$pre51;
} else {
$34 = ($20>>>0)<($11>>>0);
if ($34) {
_abort();
// unreachable;
}
$35 = ((($20)) + 8|0);
$36 = HEAP32[$35>>2]|0;
$37 = ($36|0)==($9|0);
if ($37) {
$$pre$phi52Z2D = $35;
} else {
_abort();
// unreachable;
}
}
$38 = ((($18)) + 12|0);
HEAP32[$38>>2] = $20;
HEAP32[$$pre$phi52Z2D>>2] = $18;
$$0 = $9;$$02 = $10;
break;
}
$$sum16 = (24 - ($5))|0;
$39 = (($p) + ($$sum16)|0);
$40 = HEAP32[$39>>2]|0;
$$sum17 = (12 - ($5))|0;
$41 = (($p) + ($$sum17)|0);
$42 = HEAP32[$41>>2]|0;
$43 = ($42|0)==($9|0);
do {
if ($43) {
$$sum18 = (16 - ($5))|0;
$$sum19 = (($$sum18) + 4)|0;
$53 = (($p) + ($$sum19)|0);
$54 = HEAP32[$53>>2]|0;
$55 = ($54|0)==(0|0);
if ($55) {
$56 = (($p) + ($$sum18)|0);
$57 = HEAP32[$56>>2]|0;
$58 = ($57|0)==(0|0);
if ($58) {
$R$1 = 0;
break;
} else {
$R$0 = $57;$RP$0 = $56;
}
} else {
$R$0 = $54;$RP$0 = $53;
}
while(1) {
$59 = ((($R$0)) + 20|0);
$60 = HEAP32[$59>>2]|0;
$61 = ($60|0)==(0|0);
if (!($61)) {
$R$0 = $60;$RP$0 = $59;
continue;
}
$62 = ((($R$0)) + 16|0);
$63 = HEAP32[$62>>2]|0;
$64 = ($63|0)==(0|0);
if ($64) {
$R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0;
break;
} else {
$R$0 = $63;$RP$0 = $62;
}
}
$65 = ($RP$0$lcssa>>>0)<($11>>>0);
if ($65) {
_abort();
// unreachable;
} else {
HEAP32[$RP$0$lcssa>>2] = 0;
$R$1 = $R$0$lcssa;
break;
}
} else {
$$sum23 = (8 - ($5))|0;
$44 = (($p) + ($$sum23)|0);
$45 = HEAP32[$44>>2]|0;
$46 = ($45>>>0)<($11>>>0);
if ($46) {
_abort();
// unreachable;
}
$47 = ((($45)) + 12|0);
$48 = HEAP32[$47>>2]|0;
$49 = ($48|0)==($9|0);
if (!($49)) {
_abort();
// unreachable;
}
$50 = ((($42)) + 8|0);
$51 = HEAP32[$50>>2]|0;
$52 = ($51|0)==($9|0);
if ($52) {
HEAP32[$47>>2] = $42;
HEAP32[$50>>2] = $45;
$R$1 = $42;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$66 = ($40|0)==(0|0);
if ($66) {
$$0 = $9;$$02 = $10;
} else {
$$sum20 = (28 - ($5))|0;
$67 = (($p) + ($$sum20)|0);
$68 = HEAP32[$67>>2]|0;
$69 = (9368 + ($68<<2)|0);
$70 = HEAP32[$69>>2]|0;
$71 = ($9|0)==($70|0);
if ($71) {
HEAP32[$69>>2] = $R$1;
$cond = ($R$1|0)==(0|0);
if ($cond) {
$72 = 1 << $68;
$73 = $72 ^ -1;
$74 = HEAP32[(9068)>>2]|0;
$75 = $74 & $73;
HEAP32[(9068)>>2] = $75;
$$0 = $9;$$02 = $10;
break;
}
} else {
$76 = HEAP32[(9080)>>2]|0;
$77 = ($40>>>0)<($76>>>0);
if ($77) {
_abort();
// unreachable;
}
$78 = ((($40)) + 16|0);
$79 = HEAP32[$78>>2]|0;
$80 = ($79|0)==($9|0);
if ($80) {
HEAP32[$78>>2] = $R$1;
} else {
$81 = ((($40)) + 20|0);
HEAP32[$81>>2] = $R$1;
}
$82 = ($R$1|0)==(0|0);
if ($82) {
$$0 = $9;$$02 = $10;
break;
}
}
$83 = HEAP32[(9080)>>2]|0;
$84 = ($R$1>>>0)<($83>>>0);
if ($84) {
_abort();
// unreachable;
}
$85 = ((($R$1)) + 24|0);
HEAP32[$85>>2] = $40;
$$sum21 = (16 - ($5))|0;
$86 = (($p) + ($$sum21)|0);
$87 = HEAP32[$86>>2]|0;
$88 = ($87|0)==(0|0);
do {
if (!($88)) {
$89 = ($87>>>0)<($83>>>0);
if ($89) {
_abort();
// unreachable;
} else {
$90 = ((($R$1)) + 16|0);
HEAP32[$90>>2] = $87;
$91 = ((($87)) + 24|0);
HEAP32[$91>>2] = $R$1;
break;
}
}
} while(0);
$$sum22 = (($$sum21) + 4)|0;
$92 = (($p) + ($$sum22)|0);
$93 = HEAP32[$92>>2]|0;
$94 = ($93|0)==(0|0);
if ($94) {
$$0 = $9;$$02 = $10;
} else {
$95 = HEAP32[(9080)>>2]|0;
$96 = ($93>>>0)<($95>>>0);
if ($96) {
_abort();
// unreachable;
} else {
$97 = ((($R$1)) + 20|0);
HEAP32[$97>>2] = $93;
$98 = ((($93)) + 24|0);
HEAP32[$98>>2] = $R$1;
$$0 = $9;$$02 = $10;
break;
}
}
}
} else {
$$0 = $p;$$02 = $psize;
}
} while(0);
$106 = HEAP32[(9080)>>2]|0;
$107 = ($0>>>0)<($106>>>0);
if ($107) {
_abort();
// unreachable;
}
$$sum1 = (($psize) + 4)|0;
$108 = (($p) + ($$sum1)|0);
$109 = HEAP32[$108>>2]|0;
$110 = $109 & 2;
$111 = ($110|0)==(0);
if ($111) {
$112 = HEAP32[(9088)>>2]|0;
$113 = ($0|0)==($112|0);
if ($113) {
$114 = HEAP32[(9076)>>2]|0;
$115 = (($114) + ($$02))|0;
HEAP32[(9076)>>2] = $115;
HEAP32[(9088)>>2] = $$0;
$116 = $115 | 1;
$117 = ((($$0)) + 4|0);
HEAP32[$117>>2] = $116;
$118 = HEAP32[(9084)>>2]|0;
$119 = ($$0|0)==($118|0);
if (!($119)) {
return;
}
HEAP32[(9084)>>2] = 0;
HEAP32[(9072)>>2] = 0;
return;
}
$120 = HEAP32[(9084)>>2]|0;
$121 = ($0|0)==($120|0);
if ($121) {
$122 = HEAP32[(9072)>>2]|0;
$123 = (($122) + ($$02))|0;
HEAP32[(9072)>>2] = $123;
HEAP32[(9084)>>2] = $$0;
$124 = $123 | 1;
$125 = ((($$0)) + 4|0);
HEAP32[$125>>2] = $124;
$126 = (($$0) + ($123)|0);
HEAP32[$126>>2] = $123;
return;
}
$127 = $109 & -8;
$128 = (($127) + ($$02))|0;
$129 = $109 >>> 3;
$130 = ($109>>>0)<(256);
do {
if ($130) {
$$sum12 = (($psize) + 8)|0;
$131 = (($p) + ($$sum12)|0);
$132 = HEAP32[$131>>2]|0;
$$sum13 = (($psize) + 12)|0;
$133 = (($p) + ($$sum13)|0);
$134 = HEAP32[$133>>2]|0;
$135 = $129 << 1;
$136 = (9104 + ($135<<2)|0);
$137 = ($132|0)==($136|0);
if (!($137)) {
$138 = ($132>>>0)<($106>>>0);
if ($138) {
_abort();
// unreachable;
}
$139 = ((($132)) + 12|0);
$140 = HEAP32[$139>>2]|0;
$141 = ($140|0)==($0|0);
if (!($141)) {
_abort();
// unreachable;
}
}
$142 = ($134|0)==($132|0);
if ($142) {
$143 = 1 << $129;
$144 = $143 ^ -1;
$145 = HEAP32[9064>>2]|0;
$146 = $145 & $144;
HEAP32[9064>>2] = $146;
break;
}
$147 = ($134|0)==($136|0);
if ($147) {
$$pre49 = ((($134)) + 8|0);
$$pre$phi50Z2D = $$pre49;
} else {
$148 = ($134>>>0)<($106>>>0);
if ($148) {
_abort();
// unreachable;
}
$149 = ((($134)) + 8|0);
$150 = HEAP32[$149>>2]|0;
$151 = ($150|0)==($0|0);
if ($151) {
$$pre$phi50Z2D = $149;
} else {
_abort();
// unreachable;
}
}
$152 = ((($132)) + 12|0);
HEAP32[$152>>2] = $134;
HEAP32[$$pre$phi50Z2D>>2] = $132;
} else {
$$sum2 = (($psize) + 24)|0;
$153 = (($p) + ($$sum2)|0);
$154 = HEAP32[$153>>2]|0;
$$sum3 = (($psize) + 12)|0;
$155 = (($p) + ($$sum3)|0);
$156 = HEAP32[$155>>2]|0;
$157 = ($156|0)==($0|0);
do {
if ($157) {
$$sum5 = (($psize) + 20)|0;
$167 = (($p) + ($$sum5)|0);
$168 = HEAP32[$167>>2]|0;
$169 = ($168|0)==(0|0);
if ($169) {
$$sum4 = (($psize) + 16)|0;
$170 = (($p) + ($$sum4)|0);
$171 = HEAP32[$170>>2]|0;
$172 = ($171|0)==(0|0);
if ($172) {
$R7$1 = 0;
break;
} else {
$R7$0 = $171;$RP9$0 = $170;
}
} else {
$R7$0 = $168;$RP9$0 = $167;
}
while(1) {
$173 = ((($R7$0)) + 20|0);
$174 = HEAP32[$173>>2]|0;
$175 = ($174|0)==(0|0);
if (!($175)) {
$R7$0 = $174;$RP9$0 = $173;
continue;
}
$176 = ((($R7$0)) + 16|0);
$177 = HEAP32[$176>>2]|0;
$178 = ($177|0)==(0|0);
if ($178) {
$R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0;
break;
} else {
$R7$0 = $177;$RP9$0 = $176;
}
}
$179 = ($RP9$0$lcssa>>>0)<($106>>>0);
if ($179) {
_abort();
// unreachable;
} else {
HEAP32[$RP9$0$lcssa>>2] = 0;
$R7$1 = $R7$0$lcssa;
break;
}
} else {
$$sum11 = (($psize) + 8)|0;
$158 = (($p) + ($$sum11)|0);
$159 = HEAP32[$158>>2]|0;
$160 = ($159>>>0)<($106>>>0);
if ($160) {
_abort();
// unreachable;
}
$161 = ((($159)) + 12|0);
$162 = HEAP32[$161>>2]|0;
$163 = ($162|0)==($0|0);
if (!($163)) {
_abort();
// unreachable;
}
$164 = ((($156)) + 8|0);
$165 = HEAP32[$164>>2]|0;
$166 = ($165|0)==($0|0);
if ($166) {
HEAP32[$161>>2] = $156;
HEAP32[$164>>2] = $159;
$R7$1 = $156;
break;
} else {
_abort();
// unreachable;
}
}
} while(0);
$180 = ($154|0)==(0|0);
if (!($180)) {
$$sum8 = (($psize) + 28)|0;
$181 = (($p) + ($$sum8)|0);
$182 = HEAP32[$181>>2]|0;
$183 = (9368 + ($182<<2)|0);
$184 = HEAP32[$183>>2]|0;
$185 = ($0|0)==($184|0);
if ($185) {
HEAP32[$183>>2] = $R7$1;
$cond39 = ($R7$1|0)==(0|0);
if ($cond39) {
$186 = 1 << $182;
$187 = $186 ^ -1;
$188 = HEAP32[(9068)>>2]|0;
$189 = $188 & $187;
HEAP32[(9068)>>2] = $189;
break;
}
} else {
$190 = HEAP32[(9080)>>2]|0;
$191 = ($154>>>0)<($190>>>0);
if ($191) {
_abort();
// unreachable;
}
$192 = ((($154)) + 16|0);
$193 = HEAP32[$192>>2]|0;
$194 = ($193|0)==($0|0);
if ($194) {
HEAP32[$192>>2] = $R7$1;
} else {
$195 = ((($154)) + 20|0);
HEAP32[$195>>2] = $R7$1;
}
$196 = ($R7$1|0)==(0|0);
if ($196) {
break;
}
}
$197 = HEAP32[(9080)>>2]|0;
$198 = ($R7$1>>>0)<($197>>>0);
if ($198) {
_abort();
// unreachable;
}
$199 = ((($R7$1)) + 24|0);
HEAP32[$199>>2] = $154;
$$sum9 = (($psize) + 16)|0;
$200 = (($p) + ($$sum9)|0);
$201 = HEAP32[$200>>2]|0;
$202 = ($201|0)==(0|0);
do {
if (!($202)) {
$203 = ($201>>>0)<($197>>>0);
if ($203) {
_abort();
// unreachable;
} else {
$204 = ((($R7$1)) + 16|0);
HEAP32[$204>>2] = $201;
$205 = ((($201)) + 24|0);
HEAP32[$205>>2] = $R7$1;
break;
}
}
} while(0);
$$sum10 = (($psize) + 20)|0;
$206 = (($p) + ($$sum10)|0);
$207 = HEAP32[$206>>2]|0;
$208 = ($207|0)==(0|0);
if (!($208)) {
$209 = HEAP32[(9080)>>2]|0;
$210 = ($207>>>0)<($209>>>0);
if ($210) {
_abort();
// unreachable;
} else {
$211 = ((($R7$1)) + 20|0);
HEAP32[$211>>2] = $207;
$212 = ((($207)) + 24|0);
HEAP32[$212>>2] = $R7$1;
break;
}
}
}
}
} while(0);
$213 = $128 | 1;
$214 = ((($$0)) + 4|0);
HEAP32[$214>>2] = $213;
$215 = (($$0) + ($128)|0);
HEAP32[$215>>2] = $128;
$216 = HEAP32[(9084)>>2]|0;
$217 = ($$0|0)==($216|0);
if ($217) {
HEAP32[(9072)>>2] = $128;
return;
} else {
$$1 = $128;
}
} else {
$218 = $109 & -2;
HEAP32[$108>>2] = $218;
$219 = $$02 | 1;
$220 = ((($$0)) + 4|0);
HEAP32[$220>>2] = $219;
$221 = (($$0) + ($$02)|0);
HEAP32[$221>>2] = $$02;
$$1 = $$02;
}
$222 = $$1 >>> 3;
$223 = ($$1>>>0)<(256);
if ($223) {
$224 = $222 << 1;
$225 = (9104 + ($224<<2)|0);
$226 = HEAP32[9064>>2]|0;
$227 = 1 << $222;
$228 = $226 & $227;
$229 = ($228|0)==(0);
if ($229) {
$230 = $226 | $227;
HEAP32[9064>>2] = $230;
$$pre = (($224) + 2)|0;
$$pre48 = (9104 + ($$pre<<2)|0);
$$pre$phiZ2D = $$pre48;$F16$0 = $225;
} else {
$$sum7 = (($224) + 2)|0;
$231 = (9104 + ($$sum7<<2)|0);
$232 = HEAP32[$231>>2]|0;
$233 = HEAP32[(9080)>>2]|0;
$234 = ($232>>>0)<($233>>>0);
if ($234) {
_abort();
// unreachable;
} else {
$$pre$phiZ2D = $231;$F16$0 = $232;
}
}
HEAP32[$$pre$phiZ2D>>2] = $$0;
$235 = ((($F16$0)) + 12|0);
HEAP32[$235>>2] = $$0;
$236 = ((($$0)) + 8|0);
HEAP32[$236>>2] = $F16$0;
$237 = ((($$0)) + 12|0);
HEAP32[$237>>2] = $225;
return;
}
$238 = $$1 >>> 8;
$239 = ($238|0)==(0);
if ($239) {
$I19$0 = 0;
} else {
$240 = ($$1>>>0)>(16777215);
if ($240) {
$I19$0 = 31;
} else {
$241 = (($238) + 1048320)|0;
$242 = $241 >>> 16;
$243 = $242 & 8;
$244 = $238 << $243;
$245 = (($244) + 520192)|0;
$246 = $245 >>> 16;
$247 = $246 & 4;
$248 = $247 | $243;
$249 = $244 << $247;
$250 = (($249) + 245760)|0;
$251 = $250 >>> 16;
$252 = $251 & 2;
$253 = $248 | $252;
$254 = (14 - ($253))|0;
$255 = $249 << $252;
$256 = $255 >>> 15;
$257 = (($254) + ($256))|0;
$258 = $257 << 1;
$259 = (($257) + 7)|0;
$260 = $$1 >>> $259;
$261 = $260 & 1;
$262 = $261 | $258;
$I19$0 = $262;
}
}
$263 = (9368 + ($I19$0<<2)|0);
$264 = ((($$0)) + 28|0);
HEAP32[$264>>2] = $I19$0;
$265 = ((($$0)) + 16|0);
$266 = ((($$0)) + 20|0);
HEAP32[$266>>2] = 0;
HEAP32[$265>>2] = 0;
$267 = HEAP32[(9068)>>2]|0;
$268 = 1 << $I19$0;
$269 = $267 & $268;
$270 = ($269|0)==(0);
if ($270) {
$271 = $267 | $268;
HEAP32[(9068)>>2] = $271;
HEAP32[$263>>2] = $$0;
$272 = ((($$0)) + 24|0);
HEAP32[$272>>2] = $263;
$273 = ((($$0)) + 12|0);
HEAP32[$273>>2] = $$0;
$274 = ((($$0)) + 8|0);
HEAP32[$274>>2] = $$0;
return;
}
$275 = HEAP32[$263>>2]|0;
$276 = ((($275)) + 4|0);
$277 = HEAP32[$276>>2]|0;
$278 = $277 & -8;
$279 = ($278|0)==($$1|0);
L191: do {
if ($279) {
$T$0$lcssa = $275;
} else {
$280 = ($I19$0|0)==(31);
$281 = $I19$0 >>> 1;
$282 = (25 - ($281))|0;
$283 = $280 ? 0 : $282;
$284 = $$1 << $283;
$K20$043 = $284;$T$042 = $275;
while(1) {
$291 = $K20$043 >>> 31;
$292 = (((($T$042)) + 16|0) + ($291<<2)|0);
$287 = HEAP32[$292>>2]|0;
$293 = ($287|0)==(0|0);
if ($293) {
$$lcssa = $292;$T$042$lcssa = $T$042;
break;
}
$285 = $K20$043 << 1;
$286 = ((($287)) + 4|0);
$288 = HEAP32[$286>>2]|0;
$289 = $288 & -8;
$290 = ($289|0)==($$1|0);
if ($290) {
$T$0$lcssa = $287;
break L191;
} else {
$K20$043 = $285;$T$042 = $287;
}
}
$294 = HEAP32[(9080)>>2]|0;
$295 = ($$lcssa>>>0)<($294>>>0);
if ($295) {
_abort();
// unreachable;
}
HEAP32[$$lcssa>>2] = $$0;
$296 = ((($$0)) + 24|0);
HEAP32[$296>>2] = $T$042$lcssa;
$297 = ((($$0)) + 12|0);
HEAP32[$297>>2] = $$0;
$298 = ((($$0)) + 8|0);
HEAP32[$298>>2] = $$0;
return;
}
} while(0);
$299 = ((($T$0$lcssa)) + 8|0);
$300 = HEAP32[$299>>2]|0;
$301 = HEAP32[(9080)>>2]|0;
$302 = ($300>>>0)>=($301>>>0);
$not$ = ($T$0$lcssa>>>0)>=($301>>>0);
$303 = $302 & $not$;
if (!($303)) {
_abort();
// unreachable;
}
$304 = ((($300)) + 12|0);
HEAP32[$304>>2] = $$0;
HEAP32[$299>>2] = $$0;
$305 = ((($$0)) + 8|0);
HEAP32[$305>>2] = $300;
$306 = ((($$0)) + 12|0);
HEAP32[$306>>2] = $T$0$lcssa;
$307 = ((($$0)) + 24|0);
HEAP32[$307>>2] = 0;
return;
}
function runPostSets() {
}
function _memcpy(dest, src, num) {
dest = dest|0; src = src|0; num = num|0;
var ret = 0;
if ((num|0) >= 4096) return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
ret = dest|0;
if ((dest&3) == (src&3)) {
while (dest & 3) {
if ((num|0) == 0) return ret|0;
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
dest = (dest+1)|0;
src = (src+1)|0;
num = (num-1)|0;
}
while ((num|0) >= 4) {
HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
dest = (dest+4)|0;
src = (src+4)|0;
num = (num-4)|0;
}
}
while ((num|0) > 0) {
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
dest = (dest+1)|0;
src = (src+1)|0;
num = (num-1)|0;
}
return ret|0;
}
function _memset(ptr, value, num) {
ptr = ptr|0; value = value|0; num = num|0;
var stop = 0, value4 = 0, stop4 = 0, unaligned = 0;
stop = (ptr + num)|0;
if ((num|0) >= 20) {
// This is unaligned, but quite large, so work hard to get to aligned settings
value = value & 0xff;
unaligned = ptr & 3;
value4 = value | (value << 8) | (value << 16) | (value << 24);
stop4 = stop & ~3;
if (unaligned) {
unaligned = (ptr + 4 - unaligned)|0;
while ((ptr|0) < (unaligned|0)) { // no need to check for stop, since we have large num
HEAP8[((ptr)>>0)]=value;
ptr = (ptr+1)|0;
}
}
while ((ptr|0) < (stop4|0)) {
HEAP32[((ptr)>>2)]=value4;
ptr = (ptr+4)|0;
}
}
while ((ptr|0) < (stop|0)) {
HEAP8[((ptr)>>0)]=value;
ptr = (ptr+1)|0;
}
return (ptr-num)|0;
}
function _i64Subtract(a, b, c, d) {
a = a|0; b = b|0; c = c|0; d = d|0;
var l = 0, h = 0;
l = (a - c)>>>0;
h = (b - d)>>>0;
h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
return ((tempRet0 = h,l|0)|0);
}
function _i64Add(a, b, c, d) {
/*
x = a + b*2^32
y = c + d*2^32
result = l + h*2^32
*/
a = a|0; b = b|0; c = c|0; d = d|0;
var l = 0, h = 0;
l = (a + c)>>>0;
h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
return ((tempRet0 = h,l|0)|0);
}
function _memmove(dest, src, num) {
dest = dest|0; src = src|0; num = num|0;
var ret = 0;
if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) {
// Unlikely case: Copy backwards in a safe manner
ret = dest;
src = (src + num)|0;
dest = (dest + num)|0;
while ((num|0) > 0) {
dest = (dest - 1)|0;
src = (src - 1)|0;
num = (num - 1)|0;
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
}
dest = ret;
} else {
_memcpy(dest, src, num) | 0;
}
return dest | 0;
}
function _bitshift64Lshr(low, high, bits) {
low = low|0; high = high|0; bits = bits|0;
var ander = 0;
if ((bits|0) < 32) {
ander = ((1 << bits) - 1)|0;
tempRet0 = high >>> bits;
return (low >>> bits) | ((high&ander) << (32 - bits));
}
tempRet0 = 0;
return (high >>> (bits - 32))|0;
}
function _bitshift64Shl(low, high, bits) {
low = low|0; high = high|0; bits = bits|0;
var ander = 0;
if ((bits|0) < 32) {
ander = ((1 << bits) - 1)|0;
tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
return low << bits;
}
tempRet0 = low << (bits - 32);
return 0;
}
function _bitshift64Ashr(low, high, bits) {
low = low|0; high = high|0; bits = bits|0;
var ander = 0;
if ((bits|0) < 32) {
ander = ((1 << bits) - 1)|0;
tempRet0 = high >> bits;
return (low >>> bits) | ((high&ander) << (32 - bits));
}
tempRet0 = (high|0) < 0 ? -1 : 0;
return (high >> (bits - 32))|0;
}
function _llvm_cttz_i32(x) {
x = x|0;
var ret = 0;
ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
if ((ret|0) < 8) return ret|0;
ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
if ((ret|0) < 8) return (ret + 8)|0;
ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
if ((ret|0) < 8) return (ret + 16)|0;
return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
}
// ======== compiled code from system/lib/compiler-rt , see readme therein
function ___muldsi3($a, $b) {
$a = $a | 0;
$b = $b | 0;
var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
$1 = $a & 65535;
$2 = $b & 65535;
$3 = Math_imul($2, $1) | 0;
$6 = $a >>> 16;
$8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
$11 = $b >>> 16;
$12 = Math_imul($11, $1) | 0;
return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
}
function ___divdi3($a$0, $a$1, $b$0, $b$1) {
$a$0 = $a$0 | 0;
$a$1 = $a$1 | 0;
$b$0 = $b$0 | 0;
$b$1 = $b$1 | 0;
var $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $7$0 = 0, $7$1 = 0, $8$0 = 0, $10$0 = 0;
$1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
$1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
$2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
$2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
$4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0;
$4$1 = tempRet0;
$6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0;
$7$0 = $2$0 ^ $1$0;
$7$1 = $2$1 ^ $1$1;
$8$0 = ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, 0) | 0;
$10$0 = _i64Subtract($8$0 ^ $7$0, tempRet0 ^ $7$1, $7$0, $7$1) | 0;
return $10$0 | 0;
}
function ___remdi3($a$0, $a$1, $b$0, $b$1) {
$a$0 = $a$0 | 0;
$a$1 = $a$1 | 0;
$b$0 = $b$0 | 0;
$b$1 = $b$1 | 0;
var $rem = 0, $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $10$0 = 0, $10$1 = 0, __stackBase__ = 0;
__stackBase__ = STACKTOP;
STACKTOP = STACKTOP + 16 | 0;
$rem = __stackBase__ | 0;
$1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
$1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
$2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
$2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
$4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0;
$4$1 = tempRet0;
$6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0;
___udivmoddi4($4$0, $4$1, $6$0, tempRet0, $rem) | 0;
$10$0 = _i64Subtract(HEAP32[$rem >> 2] ^ $1$0, HEAP32[$rem + 4 >> 2] ^ $1$1, $1$0, $1$1) | 0;
$10$1 = tempRet0;
STACKTOP = __stackBase__;
return (tempRet0 = $10$1, $10$0) | 0;
}
function ___muldi3($a$0, $a$1, $b$0, $b$1) {
$a$0 = $a$0 | 0;
$a$1 = $a$1 | 0;
$b$0 = $b$0 | 0;
$b$1 = $b$1 | 0;
var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
$x_sroa_0_0_extract_trunc = $a$0;
$y_sroa_0_0_extract_trunc = $b$0;
$1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
$1$1 = tempRet0;
$2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
}
function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
$a$0 = $a$0 | 0;
$a$1 = $a$1 | 0;
$b$0 = $b$0 | 0;
$b$1 = $b$1 | 0;
var $1$0 = 0;
$1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
return $1$0 | 0;
}
function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
$a$0 = $a$0 | 0;
$a$1 = $a$1 | 0;
$b$0 = $b$0 | 0;
$b$1 = $b$1 | 0;
var $rem = 0, __stackBase__ = 0;
__stackBase__ = STACKTOP;
STACKTOP = STACKTOP + 16 | 0;
$rem = __stackBase__ | 0;
___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
STACKTOP = __stackBase__;
return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
}
function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
$a$0 = $a$0 | 0;
$a$1 = $a$1 | 0;
$b$0 = $b$0 | 0;
$b$1 = $b$1 | 0;
$rem = $rem | 0;
var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
$n_sroa_0_0_extract_trunc = $a$0;
$n_sroa_1_4_extract_shift$0 = $a$1;
$n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
$d_sroa_0_0_extract_trunc = $b$0;
$d_sroa_1_4_extract_shift$0 = $b$1;
$d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
if (($n_sroa_1_4_extract_trunc | 0) == 0) {
$4 = ($rem | 0) != 0;
if (($d_sroa_1_4_extract_trunc | 0) == 0) {
if ($4) {
HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
HEAP32[$rem + 4 >> 2] = 0;
}
$_0$1 = 0;
$_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
} else {
if (!$4) {
$_0$1 = 0;
$_0$0 = 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
HEAP32[$rem >> 2] = $a$0 & -1;
HEAP32[$rem + 4 >> 2] = $a$1 & 0;
$_0$1 = 0;
$_0$0 = 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
}
$17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
do {
if (($d_sroa_0_0_extract_trunc | 0) == 0) {
if ($17) {
if (($rem | 0) != 0) {
HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
HEAP32[$rem + 4 >> 2] = 0;
}
$_0$1 = 0;
$_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
if (($n_sroa_0_0_extract_trunc | 0) == 0) {
if (($rem | 0) != 0) {
HEAP32[$rem >> 2] = 0;
HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
}
$_0$1 = 0;
$_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
$37 = $d_sroa_1_4_extract_trunc - 1 | 0;
if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
if (($rem | 0) != 0) {
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
}
$_0$1 = 0;
$_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
return (tempRet0 = $_0$1, $_0$0) | 0;
}
$49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
$51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
if ($51 >>> 0 <= 30) {
$57 = $51 + 1 | 0;
$58 = 31 - $51 | 0;
$sr_1_ph = $57;
$r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
$r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
$q_sroa_0_1_ph = 0;
$q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
break;
}
if (($rem | 0) == 0) {
$_0$1 = 0;
$_0$0 = 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
$_0$1 = 0;
$_0$0 = 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
} else {
if (!$17) {
$117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
$119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
if ($119 >>> 0 <= 31) {
$125 = $119 + 1 | 0;
$126 = 31 - $119 | 0;
$130 = $119 - 31 >> 31;
$sr_1_ph = $125;
$r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
$r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
$q_sroa_0_1_ph = 0;
$q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
break;
}
if (($rem | 0) == 0) {
$_0$1 = 0;
$_0$0 = 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
$_0$1 = 0;
$_0$0 = 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
$66 = $d_sroa_0_0_extract_trunc - 1 | 0;
if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
$86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
$88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
$89 = 64 - $88 | 0;
$91 = 32 - $88 | 0;
$92 = $91 >> 31;
$95 = $88 - 32 | 0;
$105 = $95 >> 31;
$sr_1_ph = $88;
$r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
$r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
$q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
$q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
break;
}
if (($rem | 0) != 0) {
HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
HEAP32[$rem + 4 >> 2] = 0;
}
if (($d_sroa_0_0_extract_trunc | 0) == 1) {
$_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
$_0$0 = 0 | $a$0 & -1;
return (tempRet0 = $_0$1, $_0$0) | 0;
} else {
$78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
$_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
$_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
}
} while (0);
if (($sr_1_ph | 0) == 0) {
$q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
$q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
$r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
$r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
$carry_0_lcssa$1 = 0;
$carry_0_lcssa$0 = 0;
} else {
$d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
$d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
$137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
$137$1 = tempRet0;
$q_sroa_1_1198 = $q_sroa_1_1_ph;
$q_sroa_0_1199 = $q_sroa_0_1_ph;
$r_sroa_1_1200 = $r_sroa_1_1_ph;
$r_sroa_0_1201 = $r_sroa_0_1_ph;
$sr_1202 = $sr_1_ph;
$carry_0203 = 0;
while (1) {
$147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
$149 = $carry_0203 | $q_sroa_0_1199 << 1;
$r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
$r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
_i64Subtract($137$0, $137$1, $r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1) | 0;
$150$1 = tempRet0;
$151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
$152 = $151$0 & 1;
$154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1, $151$0 & $d_sroa_0_0_insert_insert99$0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1) | 0;
$r_sroa_0_0_extract_trunc = $154$0;
$r_sroa_1_4_extract_trunc = tempRet0;
$155 = $sr_1202 - 1 | 0;
if (($155 | 0) == 0) {
break;
} else {
$q_sroa_1_1198 = $147;
$q_sroa_0_1199 = $149;
$r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
$r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
$sr_1202 = $155;
$carry_0203 = $152;
}
}
$q_sroa_1_1_lcssa = $147;
$q_sroa_0_1_lcssa = $149;
$r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
$r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
$carry_0_lcssa$1 = 0;
$carry_0_lcssa$0 = $152;
}
$q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
$q_sroa_0_0_insert_ext75$1 = 0;
$q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
if (($rem | 0) != 0) {
HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
}
$_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
$_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
return (tempRet0 = $_0$1, $_0$0) | 0;
}
// =======================================================================
function dynCall_viiiii(index,a1,a2,a3,a4,a5) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0);
}
function dynCall_vd(index,a1) {
index = index|0;
a1=+a1;
FUNCTION_TABLE_vd[index&3](+a1);
}
function dynCall_vid(index,a1,a2) {
index = index|0;
a1=a1|0; a2=+a2;
FUNCTION_TABLE_vid[index&3](a1|0,+a2);
}
function dynCall_vi(index,a1) {
index = index|0;
a1=a1|0;
FUNCTION_TABLE_vi[index&31](a1|0);
}
function dynCall_vii(index,a1,a2) {
index = index|0;
a1=a1|0; a2=a2|0;
FUNCTION_TABLE_vii[index&63](a1|0,a2|0);
}
function dynCall_ii(index,a1) {
index = index|0;
a1=a1|0;
return FUNCTION_TABLE_ii[index&15](a1|0)|0;
}
function dynCall_viddd(index,a1,a2,a3,a4) {
index = index|0;
a1=a1|0; a2=+a2; a3=+a3; a4=+a4;
FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4);
}
function dynCall_vidd(index,a1,a2,a3) {
index = index|0;
a1=a1|0; a2=+a2; a3=+a3;
FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3);
}
function dynCall_iiii(index,a1,a2,a3) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0;
return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0;
}
function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0;
FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0);
}
function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0;
FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0);
}
function dynCall_viii(index,a1,a2,a3) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0;
FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0);
}
function dynCall_vidddd(index,a1,a2,a3,a4,a5) {
index = index|0;
a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5;
FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5);
}
function dynCall_vdi(index,a1,a2) {
index = index|0;
a1=+a1; a2=a2|0;
FUNCTION_TABLE_vdi[index&1](+a1,a2|0);
}
function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0;
FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0);
}
function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0;
FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0);
}
function dynCall_iii(index,a1,a2) {
index = index|0;
a1=a1|0; a2=a2|0;
return FUNCTION_TABLE_iii[index&7](a1|0,a2|0)|0;
}
function dynCall_i(index) {
index = index|0;
return FUNCTION_TABLE_i[index&3]()|0;
}
function dynCall_iiiiii(index,a1,a2,a3,a4,a5) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
return FUNCTION_TABLE_iiiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0)|0;
}
function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) {
index = index|0;
a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6;
FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6);
}
function dynCall_vdddd(index,a1,a2,a3,a4) {
index = index|0;
a1=+a1; a2=+a2; a3=+a3; a4=+a4;
FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4);
}
function dynCall_vdd(index,a1,a2) {
index = index|0;
a1=+a1; a2=+a2;
FUNCTION_TABLE_vdd[index&3](+a1,+a2);
}
function dynCall_v(index) {
index = index|0;
FUNCTION_TABLE_v[index&7]();
}
function dynCall_viid(index,a1,a2,a3) {
index = index|0;
a1=a1|0; a2=a2|0; a3=+a3;
FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3);
}
function dynCall_viiii(index,a1,a2,a3,a4) {
index = index|0;
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0;
FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0);
}
function b0(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(0);
}
function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0);
}
function b1(p0) {
p0 = +p0; abort(1);
}
function _emscripten_glClearDepth__wrapper(p0) {
p0 = +p0; _emscripten_glClearDepth(+p0);
}
function _emscripten_glClearDepthf__wrapper(p0) {
p0 = +p0; _emscripten_glClearDepthf(+p0);
}
function _emscripten_glLineWidth__wrapper(p0) {
p0 = +p0; _emscripten_glLineWidth(+p0);
}
function b2(p0,p1) {
p0 = p0|0;p1 = +p1; abort(2);
}
function _emscripten_glUniform1f__wrapper(p0,p1) {
p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1);
}
function _emscripten_glVertexAttrib1f__wrapper(p0,p1) {
p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1);
}
function b3(p0) {
p0 = p0|0; abort(3);
}
function _emscripten_glDeleteShader__wrapper(p0) {
p0 = p0|0; _emscripten_glDeleteShader(p0|0);
}
function _emscripten_glCompileShader__wrapper(p0) {
p0 = p0|0; _emscripten_glCompileShader(p0|0);
}
function _emscripten_glDeleteProgram__wrapper(p0) {
p0 = p0|0; _emscripten_glDeleteProgram(p0|0);
}
function _emscripten_glLinkProgram__wrapper(p0) {
p0 = p0|0; _emscripten_glLinkProgram(p0|0);
}
function _emscripten_glUseProgram__wrapper(p0) {
p0 = p0|0; _emscripten_glUseProgram(p0|0);
}
function _emscripten_glValidateProgram__wrapper(p0) {
p0 = p0|0; _emscripten_glValidateProgram(p0|0);
}
function _emscripten_glDeleteObjectARB__wrapper(p0) {
p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0);
}
function _emscripten_glEnableClientState__wrapper(p0) {
p0 = p0|0; _emscripten_glEnableClientState(p0|0);
}
function _emscripten_glClientActiveTexture__wrapper(p0) {
p0 = p0|0; _emscripten_glClientActiveTexture(p0|0);
}
function _emscripten_glBindVertexArray__wrapper(p0) {
p0 = p0|0; _emscripten_glBindVertexArray(p0|0);
}
function _emscripten_glMatrixMode__wrapper(p0) {
p0 = p0|0; _emscripten_glMatrixMode(p0|0);
}
function _emscripten_glLoadMatrixf__wrapper(p0) {
p0 = p0|0; _emscripten_glLoadMatrixf(p0|0);
}
function _emscripten_glEnableVertexAttribArray__wrapper(p0) {
p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0);
}
function _emscripten_glDisableVertexAttribArray__wrapper(p0) {
p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0);
}
function _emscripten_glDepthFunc__wrapper(p0) {
p0 = p0|0; _emscripten_glDepthFunc(p0|0);
}
function _emscripten_glEnable__wrapper(p0) {
p0 = p0|0; _emscripten_glEnable(p0|0);
}
function _emscripten_glDisable__wrapper(p0) {
p0 = p0|0; _emscripten_glDisable(p0|0);
}
function _emscripten_glFrontFace__wrapper(p0) {
p0 = p0|0; _emscripten_glFrontFace(p0|0);
}
function _emscripten_glCullFace__wrapper(p0) {
p0 = p0|0; _emscripten_glCullFace(p0|0);
}
function _emscripten_glClear__wrapper(p0) {
p0 = p0|0; _emscripten_glClear(p0|0);
}
function _emscripten_glClearStencil__wrapper(p0) {
p0 = p0|0; _emscripten_glClearStencil(p0|0);
}
function _emscripten_glDepthMask__wrapper(p0) {
p0 = p0|0; _emscripten_glDepthMask(p0|0);
}
function _emscripten_glStencilMask__wrapper(p0) {
p0 = p0|0; _emscripten_glStencilMask(p0|0);
}
function _emscripten_glGenerateMipmap__wrapper(p0) {
p0 = p0|0; _emscripten_glGenerateMipmap(p0|0);
}
function _emscripten_glActiveTexture__wrapper(p0) {
p0 = p0|0; _emscripten_glActiveTexture(p0|0);
}
function _emscripten_glBlendEquation__wrapper(p0) {
p0 = p0|0; _emscripten_glBlendEquation(p0|0);
}
function b4(p0,p1) {
p0 = p0|0;p1 = p1|0; abort(4);
}
function _emscripten_glPixelStorei__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0);
}
function _emscripten_glGetIntegerv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0);
}
function _emscripten_glGetFloatv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0);
}
function _emscripten_glGetBooleanv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0);
}
function _emscripten_glGenTextures__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0);
}
function _emscripten_glDeleteTextures__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0);
}
function _emscripten_glBindTexture__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0);
}
function _emscripten_glGenBuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0);
}
function _emscripten_glDeleteBuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0);
}
function _emscripten_glGenRenderbuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0);
}
function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0);
}
function _emscripten_glBindRenderbuffer__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0);
}
function _emscripten_glUniform1i__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0);
}
function _emscripten_glBindBuffer__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0);
}
function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0);
}
function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0);
}
function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0);
}
function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0);
}
function _emscripten_glAttachShader__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0);
}
function _emscripten_glDetachShader__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0);
}
function _emscripten_glBindFramebuffer__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0);
}
function _emscripten_glGenFramebuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0);
}
function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0);
}
function _emscripten_glBindProgramARB__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0);
}
function _emscripten_glGetPointerv__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0);
}
function _emscripten_glGenVertexArrays__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0);
}
function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0);
}
function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0);
}
function _emscripten_glBlendFunc__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0);
}
function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0);
}
function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0);
}
function _emscripten_glHint__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0);
}
function _emscripten_glDrawBuffers__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0);
}
function b5(p0) {
p0 = p0|0; abort(5);return 0;
}
function _emscripten_glGetString__wrapper(p0) {
p0 = p0|0; return _emscripten_glGetString(p0|0)|0;
}
function _emscripten_glIsTexture__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0;
}
function _emscripten_glIsBuffer__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0;
}
function _emscripten_glIsRenderbuffer__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0;
}
function _emscripten_glCreateShader__wrapper(p0) {
p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0;
}
function _emscripten_glIsShader__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsShader(p0|0)|0;
}
function _emscripten_glIsProgram__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0;
}
function _emscripten_glIsFramebuffer__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0;
}
function _emscripten_glCheckFramebufferStatus__wrapper(p0) {
p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0;
}
function _emscripten_glIsEnabled__wrapper(p0) {
p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0;
}
function b6(p0,p1,p2,p3) {
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; abort(6);
}
function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3);
}
function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3);
}
function b7(p0,p1,p2) {
p0 = p0|0;p1 = +p1;p2 = +p2; abort(7);
}
function _emscripten_glUniform2f__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2);
}
function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2);
}
function b8(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(8);return 0;
}
function b9(p0,p1,p2,p3,p4,p5,p6,p7) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; abort(9);
}
function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
}
function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
}
function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
}
function b10(p0,p1,p2,p3,p4,p5) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; abort(10);
}
function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
}
function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
}
function b11(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(11);
}
function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0);
}
function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform2i__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform1iv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform2iv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform3iv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform4iv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform1fv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform2fv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform3fv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0);
}
function _emscripten_glUniform4fv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0);
}
function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0);
}
function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0);
}
function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0);
}
function _emscripten_glNormalPointer__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0);
}
function _emscripten_glDrawArrays__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0);
}
function _emscripten_glTexParameteri__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0);
}
function _emscripten_glStencilFunc__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0);
}
function _emscripten_glStencilOp__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0);
}
function b12(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; abort(12);
}
function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4);
}
function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4);
}
function b13(p0,p1) {
p0 = +p0;p1 = p1|0; abort(13);
}
function _emscripten_glSampleCoverage__wrapper(p0,p1) {
p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0);
}
function b14(p0,p1,p2,p3,p4,p5,p6) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; abort(14);
}
function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
}
function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
}
function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
}
function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; abort(15);
}
function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
}
function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
}
function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
}
function b16(p0,p1) {
p0 = p0|0;p1 = p1|0; abort(16);return 0;
}
function _emscripten_glGetUniformLocation__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0;
}
function _emscripten_glGetAttribLocation__wrapper(p0,p1) {
p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0;
}
function b17() {
; abort(17);return 0;
}
function _emscripten_glCreateProgram__wrapper() {
; return _emscripten_glCreateProgram()|0;
}
function _emscripten_glGetError__wrapper() {
; return _emscripten_glGetError()|0;
}
function b18(p0,p1,p2,p3,p4) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(18);return 0;
}
function b19(p0,p1,p2,p3,p4,p5) {
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; abort(19);
}
function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) {
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5);
}
function b20(p0,p1,p2,p3) {
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; abort(20);
}
function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) {
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3);
}
function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) {
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3);
}
function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) {
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3);
}
function b21(p0,p1) {
p0 = +p0;p1 = +p1; abort(21);
}
function _emscripten_glDepthRange__wrapper(p0,p1) {
p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1);
}
function _emscripten_glDepthRangef__wrapper(p0,p1) {
p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1);
}
function _emscripten_glPolygonOffset__wrapper(p0,p1) {
p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1);
}
function b22() {
; abort(22);
}
function _emscripten_glLoadIdentity__wrapper() {
; _emscripten_glLoadIdentity();
}
function _emscripten_glReleaseShaderCompiler__wrapper() {
; _emscripten_glReleaseShaderCompiler();
}
function _emscripten_glFinish__wrapper() {
; _emscripten_glFinish();
}
function _emscripten_glFlush__wrapper() {
; _emscripten_glFlush();
}
function b23(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = +p2; abort(23);
}
function _emscripten_glTexParameterf__wrapper(p0,p1,p2) {
p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2);
}
function b24(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; abort(24);
}
function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glViewport__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glScissor__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0);
}
function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) {
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0);
}
// EMSCRIPTEN_END_FUNCS
var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0];
var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper];
var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2];
var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,_cleanup521,_cleanup526
,b3,b3,b3];
var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4
,b4,b4,b4,b4,b4];
var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5];
var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6];
var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7];
var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,___stdout_write,___stdio_seek,_EmscriptenFullscreenChangeCallback,_EmscriptenInputCallback,_do_read,___stdio_read,___stdio_write,b8,b8,b8,b8,b8,b8,b8];
var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper];
var FUNCTION_TABLE_viiiiii = [b10,_stbi__YCbCr_to_RGB_row,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper];
var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_stbi__idct_block,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper];
var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12];
var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper];
var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper];
var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper];
var FUNCTION_TABLE_iii = [b16,_point_compare,_uint32_compare,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16,b16,b16];
var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17];
var FUNCTION_TABLE_iiiiii = [b18,_stbi__resample_row_hv_2,_resample_row_1,_stbi__resample_row_v_2,_stbi__resample_row_h_2,_stbi__resample_row_generic,b18,b18];
var FUNCTION_TABLE_vdddddd = [b19,_emscripten_glFrustum__wrapper];
var FUNCTION_TABLE_vdddd = [b20,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper];
var FUNCTION_TABLE_vdd = [b21,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper];
var FUNCTION_TABLE_v = [b22,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b22,b22];
var FUNCTION_TABLE_viid = [b23,_emscripten_glTexParameterf__wrapper];
var FUNCTION_TABLE_viiii = [b24,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b24,b24,b24];
return { _i64Subtract: _i64Subtract, _fflush: _fflush, _main: _main, _i64Add: _i64Add, _memmove: _memmove, _strstr: _strstr, _memset: _memset, _malloc: _malloc, _memcpy: _memcpy, _bitshift64Lshr: _bitshift64Lshr, _free: _free, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___errno_location: ___errno_location, _bitshift64Shl: _bitshift64Shl, runPostSets: runPostSets, _emscripten_replace_memory: _emscripten_replace_memory, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_iiiiii: dynCall_iiiiii, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii };
})
// EMSCRIPTEN_END_ASM
(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
var _fflush = Module["_fflush"] = asm["_fflush"];
var _main = Module["_main"] = asm["_main"];
var _i64Add = Module["_i64Add"] = asm["_i64Add"];
var _memmove = Module["_memmove"] = asm["_memmove"];
var _strstr = Module["_strstr"] = asm["_strstr"];
var _memset = Module["_memset"] = asm["_memset"];
var runPostSets = Module["runPostSets"] = asm["runPostSets"];
var _malloc = Module["_malloc"] = asm["_malloc"];
var _memcpy = Module["_memcpy"] = asm["_memcpy"];
var _emscripten_replace_memory = Module["_emscripten_replace_memory"] = asm["_emscripten_replace_memory"];
var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
var _free = Module["_free"] = asm["_free"];
var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"];
var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"];
var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"];
var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"];
var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"];
var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"];
var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"];
var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"];
var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"];
var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"];
var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"];
var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"];
var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"];
var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"];
var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"];
var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"];
var dynCall_iiiiii = Module["dynCall_iiiiii"] = asm["dynCall_iiiiii"];
var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"];
var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"];
var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"];
var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"];
var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"];
var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"];
;
Runtime.stackAlloc = asm['stackAlloc'];
Runtime.stackSave = asm['stackSave'];
Runtime.stackRestore = asm['stackRestore'];
Runtime.establishStackSpace = asm['establishStackSpace'];
Runtime.setTempRet0 = asm['setTempRet0'];
Runtime.getTempRet0 = asm['getTempRet0'];
// === Auto-generated postamble setup entry stuff ===
function ExitStatus(status) {
this.name = "ExitStatus";
this.message = "Program terminated with exit(" + status + ")";
this.status = status;
};
ExitStatus.prototype = new Error();
ExitStatus.prototype.constructor = ExitStatus;
var initialStackTop;
var preloadStartTime = null;
var calledMain = false;
dependenciesFulfilled = function runCaller() {
// If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
if (!Module['calledRun']) run();
if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
}
Module['callMain'] = Module.callMain = function callMain(args) {
assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');
args = args || [];
ensureInitRuntime();
var argc = args.length+1;
function pad() {
for (var i = 0; i < 4-1; i++) {
argv.push(0);
}
}
var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
pad();
for (var i = 0; i < argc-1; i = i + 1) {
argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
pad();
}
argv.push(0);
argv = allocate(argv, 'i32', ALLOC_NORMAL);
try {
var ret = Module['_main'](argc, argv, 0);
// if we're not running an evented main loop, it's time to exit
exit(ret, /* implicit = */ true);
}
catch(e) {
if (e instanceof ExitStatus) {
// exit() throws this once it's done to make sure execution
// has been stopped completely
return;
} else if (e == 'SimulateInfiniteLoop') {
// running an evented main loop, don't immediately exit
Module['noExitRuntime'] = true;
return;
} else {
if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
throw e;
}
} finally {
calledMain = true;
}
}
function run(args) {
args = args || Module['arguments'];
if (preloadStartTime === null) preloadStartTime = Date.now();
if (runDependencies > 0) {
return;
}
preRun();
if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
function doRun() {
if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
Module['calledRun'] = true;
if (ABORT) return;
ensureInitRuntime();
preMain();
if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
if (Module['_main'] && shouldRunNow) Module['callMain'](args);
postRun();
}
if (Module['setStatus']) {
Module['setStatus']('Running...');
setTimeout(function() {
setTimeout(function() {
Module['setStatus']('');
}, 1);
doRun();
}, 1);
} else {
doRun();
}
}
Module['run'] = Module.run = run;
function exit(status, implicit) {
if (implicit && Module['noExitRuntime']) {
return;
}
if (Module['noExitRuntime']) {
} else {
ABORT = true;
EXITSTATUS = status;
STACKTOP = initialStackTop;
exitRuntime();
if (Module['onExit']) Module['onExit'](status);
}
if (ENVIRONMENT_IS_NODE) {
// Work around a node.js bug where stdout buffer is not flushed at process exit:
// Instead of process.exit() directly, wait for stdout flush event.
// See https://github.com/joyent/node/issues/1669 and https://github.com/kripken/emscripten/issues/2582
// Workaround is based on https://github.com/RReverser/acorn/commit/50ab143cecc9ed71a2d66f78b4aec3bb2e9844f6
process['stdout']['once']('drain', function () {
process['exit'](status);
});
console.log(' '); // Make sure to print something to force the drain event to occur, in case the stdout buffer was empty.
// Work around another node bug where sometimes 'drain' is never fired - make another effort
// to emit the exit status, after a significant delay (if node hasn't fired drain by then, give up)
setTimeout(function() {
process['exit'](status);
}, 500);
} else
if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') {
quit(status);
}
// if we reach here, we must throw an exception to halt the current execution
throw new ExitStatus(status);
}
Module['exit'] = Module.exit = exit;
var abortDecorators = [];
function abort(what) {
if (what !== undefined) {
Module.print(what);
Module.printErr(what);
what = JSON.stringify(what)
} else {
what = '';
}
ABORT = true;
EXITSTATUS = 1;
var extra = '\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.';
var output = 'abort(' + what + ') at ' + stackTrace() + extra;
if (abortDecorators) {
abortDecorators.forEach(function(decorator) {
output = decorator(output, what);
});
}
throw output;
}
Module['abort'] = Module.abort = abort;
// {{PRE_RUN_ADDITIONS}}
if (Module['preInit']) {
if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
while (Module['preInit'].length > 0) {
Module['preInit'].pop()();
}
}
// shouldRunNow refers to calling main(), not run().
var shouldRunNow = true;
if (Module['noInitialRun']) {
shouldRunNow = false;
}
run();
// {{POST_RUN_ADDITIONS}}
// {{MODULE_ADDITIONS}}