var Module; if (typeof Module === 'undefined') Module = {}; if (!Module.expectedDataFileDownloads) { Module.expectedDataFileDownloads = 0; Module.finishedDataFileDownloads = 0; } Module.expectedDataFileDownloads++; (function() { var loadPackage = function(metadata) { var PACKAGE_PATH; if (typeof window === 'object') { PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/'); } else if (typeof location !== 'undefined') { // worker PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/'); } else { throw 'using preloaded data can only be done on a web page or in a web worker'; } var PACKAGE_NAME = 'raylib_zerouno.data'; var REMOTE_PACKAGE_BASE = 'raylib_zerouno.data'; if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) { Module['locateFile'] = Module['locateFilePackage']; Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)'); } var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ? Module['locateFile'](REMOTE_PACKAGE_BASE) : ((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE); var REMOTE_PACKAGE_SIZE = metadata.remote_package_size; var PACKAGE_UUID = metadata.package_uuid; function fetchRemotePackage(packageName, packageSize, callback, errback) { var xhr = new XMLHttpRequest(); xhr.open('GET', packageName, true); xhr.responseType = 'arraybuffer'; xhr.onprogress = function(event) { var url = packageName; var size = packageSize; if (event.total) size = event.total; if (event.loaded) { if (!xhr.addedTotal) { xhr.addedTotal = true; if (!Module.dataFileDownloads) Module.dataFileDownloads = {}; Module.dataFileDownloads[url] = { loaded: event.loaded, total: size }; } else { Module.dataFileDownloads[url].loaded = event.loaded; } var total = 0; var loaded = 0; var num = 0; for (var download in Module.dataFileDownloads) { var data = Module.dataFileDownloads[download]; total += data.total; loaded += data.loaded; num++; } total = Math.ceil(total * Module.expectedDataFileDownloads/num); if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')'); } else if (!Module.dataFileDownloads) { if (Module['setStatus']) Module['setStatus']('Downloading data...'); } }; xhr.onload = function(event) { var packageData = xhr.response; callback(packageData); }; xhr.send(null); }; function handleError(error) { console.error('package error:', error); }; var fetched = null, fetchedCallback = null; fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) { if (fetchedCallback) { fetchedCallback(data); fetchedCallback = null; } else { fetched = data; } }, handleError); function runWithFS() { function assert(check, msg) { if (!check) throw msg + new Error().stack; } Module['FS_createPath']('/', 'resources', true, true); function DataRequest(start, end, crunched, audio) { this.start = start; this.end = end; this.crunched = crunched; this.audio = audio; } DataRequest.prototype = { requests: {}, open: function(mode, name) { this.name = name; this.requests[name] = this; Module['addRunDependency']('fp ' + this.name); }, send: function() {}, onload: function() { var byteArray = this.byteArray.subarray(this.start, this.end); this.finish(byteArray); }, finish: function(byteArray) { var that = this; Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change Module['removeRunDependency']('fp ' + that.name); this.requests[this.name] = null; }, }; var files = metadata.files; for (i = 0; i < files.length; ++i) { new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename); } function processPackageData(arrayBuffer) { Module.finishedDataFileDownloads++; assert(arrayBuffer, 'Loading data file failed.'); assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData'); var byteArray = new Uint8Array(arrayBuffer); var curr; // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though // (we may be allocating before malloc is ready, during startup). if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting'); var ptr = Module['getMemory'](byteArray.length); Module['HEAPU8'].set(byteArray, ptr); DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length); var files = metadata.files; for (i = 0; i < files.length; ++i) { DataRequest.prototype.requests[files[i].filename].onload(); } Module['removeRunDependency']('datafile_raylib_zerouno.data'); }; Module['addRunDependency']('datafile_raylib_zerouno.data'); if (!Module.preloadResults) Module.preloadResults = {}; Module.preloadResults[PACKAGE_NAME] = {fromCache: false}; if (fetched) { processPackageData(fetched); fetched = null; } else { fetchedCallback = processPackageData; } } if (Module['calledRun']) { runWithFS(); } else { if (!Module['preRun']) Module['preRun'] = []; Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it } } loadPackage({"files": [{"audio": 1, "start": 0, "crunched": 0, "end": 1752213, "filename": "/resources/buddy.ogg"}, {"audio": 0, "start": 1752213, "crunched": 0, "end": 1766897, "filename": "/resources/courier.png"}, {"audio": 0, "start": 1766897, "crunched": 0, "end": 4515146, "filename": "/resources/dwarf.obj"}, {"audio": 0, "start": 4515146, "crunched": 0, "end": 5789769, "filename": "/resources/dwarf_diffuse.png"}, {"audio": 0, "start": 5789769, "crunched": 0, "end": 5799010, "filename": "/resources/example01.png"}, {"audio": 0, "start": 5799010, "crunched": 0, "end": 5814217, "filename": "/resources/example02.png"}, {"audio": 0, "start": 5814217, "crunched": 0, "end": 5865944, "filename": "/resources/example03.png"}, {"audio": 0, "start": 5865944, "crunched": 0, "end": 5905112, "filename": "/resources/example04.png"}, {"audio": 0, "start": 5905112, "crunched": 0, "end": 6011868, "filename": "/resources/example05.png"}, {"audio": 0, "start": 6011868, "crunched": 0, "end": 6110410, "filename": "/resources/parrot_head.png"}, {"audio": 0, "start": 6110410, "crunched": 0, "end": 6162976, "filename": "/resources/raylib_platforms.png"}, {"audio": 0, "start": 6162976, "crunched": 0, "end": 6166241, "filename": "/resources/sample01.png"}, {"audio": 0, "start": 6166241, "crunched": 0, "end": 6173325, "filename": "/resources/sample02.png"}, {"audio": 0, "start": 6173325, "crunched": 0, "end": 6177971, "filename": "/resources/sample03.png"}, {"audio": 0, "start": 6177971, "crunched": 0, "end": 6182206, "filename": "/resources/sample04.png"}, {"audio": 0, "start": 6182206, "crunched": 0, "end": 6187055, "filename": "/resources/sample05.png"}], "remote_package_size": 6187055, "package_uuid": "f758ed76-06b5-4734-9430-c1125a649aab"}); })(); // The Module object: Our interface to the outside world. We import // and export values on it, and do the work to get that through // closure compiler if necessary. There are various ways Module can be used: // 1. Not defined. We create it here // 2. A function parameter, function(Module) { ..generated code.. } // 3. pre-run appended it, var Module = {}; ..generated code.. // 4. External script tag defines var Module. // We need to do an eval in order to handle the closure compiler // case, where this code here is minified but Module was defined // elsewhere (e.g. case 4 above). We also need to check if Module // already exists (e.g. case 3 above). // Note that if you want to run closure, and also to use Module // after the generated code, you will need to define var Module = {}; // before the code. Then that object will be used in the code, and you // can continue to use Module afterwards as well. var Module; if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {}; // Sometimes an existing Module object exists with properties // meant to overwrite the default module functionality. Here // we collect those properties and reapply _after_ we configure // the current environment's defaults to avoid having to be so // defensive during initialization. var moduleOverrides = {}; for (var key in Module) { if (Module.hasOwnProperty(key)) { moduleOverrides[key] = Module[key]; } } // The environment setup code below is customized to use Module. // *** Environment setup code *** var ENVIRONMENT_IS_WEB = typeof window === 'object'; // Three configurations we can be running in: // 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) // 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) // 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) var ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; var ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; if (ENVIRONMENT_IS_NODE) { // Expose functionality in the same simple way that the shells work // Note that we pollute the global namespace here, otherwise we break in node if (!Module['print']) Module['print'] = function print(x) { process['stdout'].write(x + '\n'); }; if (!Module['printErr']) Module['printErr'] = function printErr(x) { process['stderr'].write(x + '\n'); }; var nodeFS = require('fs'); var nodePath = require('path'); Module['read'] = function read(filename, binary) { filename = nodePath['normalize'](filename); var ret = nodeFS['readFileSync'](filename); // The path is absolute if the normalized version is the same as the resolved. if (!ret && filename != nodePath['resolve'](filename)) { filename = path.join(__dirname, '..', 'src', filename); ret = nodeFS['readFileSync'](filename); } if (ret && !binary) ret = ret.toString(); return ret; }; Module['readBinary'] = function readBinary(filename) { var ret = Module['read'](filename, true); if (!ret.buffer) { ret = new Uint8Array(ret); } assert(ret.buffer); return ret; }; Module['load'] = function load(f) { globalEval(read(f)); }; if (!Module['thisProgram']) { if (process['argv'].length > 1) { Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); } else { Module['thisProgram'] = 'unknown-program'; } } Module['arguments'] = process['argv'].slice(2); if (typeof module !== 'undefined') { module['exports'] = Module; } process['on']('uncaughtException', function(ex) { // suppress ExitStatus exceptions from showing an error if (!(ex instanceof ExitStatus)) { throw ex; } }); Module['inspect'] = function () { return '[Emscripten Module object]'; }; } else if (ENVIRONMENT_IS_SHELL) { if (!Module['print']) Module['print'] = print; if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm if (typeof read != 'undefined') { Module['read'] = read; } else { Module['read'] = function read() { throw 'no read() available (jsc?)' }; } Module['readBinary'] = function readBinary(f) { if (typeof readbuffer === 'function') { return new Uint8Array(readbuffer(f)); } var data = read(f, 'binary'); assert(typeof data === 'object'); return data; }; if (typeof scriptArgs != 'undefined') { Module['arguments'] = scriptArgs; } else if (typeof arguments != 'undefined') { Module['arguments'] = arguments; } } else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { Module['read'] = function read(url) { var xhr = new XMLHttpRequest(); xhr.open('GET', url, false); xhr.send(null); return xhr.responseText; }; if (typeof arguments != 'undefined') { Module['arguments'] = arguments; } if (typeof console !== 'undefined') { if (!Module['print']) Module['print'] = function print(x) { console.log(x); }; if (!Module['printErr']) Module['printErr'] = function printErr(x) { console.log(x); }; } else { // Probably a worker, and without console.log. We can do very little here... var TRY_USE_DUMP = false; if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) { dump(x); }) : (function(x) { // self.postMessage(x); // enable this if you want stdout to be sent as messages })); } if (ENVIRONMENT_IS_WORKER) { Module['load'] = importScripts; } if (typeof Module['setWindowTitle'] === 'undefined') { Module['setWindowTitle'] = function(title) { document.title = title }; } } else { // Unreachable because SHELL is dependant on the others throw 'Unknown runtime environment. Where are we?'; } function globalEval(x) { eval.call(null, x); } if (!Module['load'] && Module['read']) { Module['load'] = function load(f) { globalEval(Module['read'](f)); }; } if (!Module['print']) { Module['print'] = function(){}; } if (!Module['printErr']) { Module['printErr'] = Module['print']; } if (!Module['arguments']) { Module['arguments'] = []; } if (!Module['thisProgram']) { Module['thisProgram'] = './this.program'; } // *** Environment setup code *** // Closure helpers Module.print = Module['print']; Module.printErr = Module['printErr']; // Callbacks Module['preRun'] = []; Module['postRun'] = []; // Merge back in the overrides for (var key in moduleOverrides) { if (moduleOverrides.hasOwnProperty(key)) { Module[key] = moduleOverrides[key]; } } // === Preamble library stuff === // Documentation for the public APIs defined in this file must be updated in: // site/source/docs/api_reference/preamble.js.rst // A prebuilt local version of the documentation is available at: // site/build/text/docs/api_reference/preamble.js.txt // You can also build docs locally as HTML or other formats in site/ // An online HTML version (which may be of a different version of Emscripten) // is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html //======================================== // Runtime code shared with compiler //======================================== var Runtime = { setTempRet0: function (value) { tempRet0 = value; }, getTempRet0: function () { return tempRet0; }, stackSave: function () { return STACKTOP; }, stackRestore: function (stackTop) { STACKTOP = stackTop; }, getNativeTypeSize: function (type) { switch (type) { case 'i1': case 'i8': return 1; case 'i16': return 2; case 'i32': return 4; case 'i64': return 8; case 'float': return 4; case 'double': return 8; default: { if (type[type.length-1] === '*') { return Runtime.QUANTUM_SIZE; // A pointer } else if (type[0] === 'i') { var bits = parseInt(type.substr(1)); assert(bits % 8 === 0); return bits/8; } else { return 0; } } } }, getNativeFieldSize: function (type) { return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE); }, STACK_ALIGN: 16, prepVararg: function (ptr, type) { if (type === 'double' || type === 'i64') { // move so the load is aligned if (ptr & 7) { assert((ptr & 7) === 4); ptr += 4; } } else { assert((ptr & 3) === 0); } return ptr; }, getAlignSize: function (type, size, vararg) { // we align i64s and doubles on 64-bit boundaries, unlike x86 if (!vararg && (type == 'i64' || type == 'double')) return 8; if (!type) return Math.min(size, 8); // align structures internally to 64 bits return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE); }, dynCall: function (sig, ptr, args) { if (args && args.length) { if (!args.splice) args = Array.prototype.slice.call(args); args.splice(0, 0, ptr); return Module['dynCall_' + sig].apply(null, args); } else { return Module['dynCall_' + sig].call(null, ptr); } }, functionPointers: [], addFunction: function (func) { for (var i = 0; i < Runtime.functionPointers.length; i++) { if (!Runtime.functionPointers[i]) { Runtime.functionPointers[i] = func; return 2*(1 + i); } } throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; }, removeFunction: function (index) { Runtime.functionPointers[(index-2)/2] = null; }, warnOnce: function (text) { if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {}; if (!Runtime.warnOnce.shown[text]) { Runtime.warnOnce.shown[text] = 1; Module.printErr(text); } }, funcWrappers: {}, getFuncWrapper: function (func, sig) { assert(sig); if (!Runtime.funcWrappers[sig]) { Runtime.funcWrappers[sig] = {}; } var sigCache = Runtime.funcWrappers[sig]; if (!sigCache[func]) { sigCache[func] = function dynCall_wrapper() { return Runtime.dynCall(sig, func, arguments); }; } return sigCache[func]; }, getCompilerSetting: function (name) { throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work'; }, stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; }, staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; }, dynamicAlloc: function (size) { var ret = DYNAMICTOP;DYNAMICTOP = (DYNAMICTOP + size)|0;DYNAMICTOP = (((DYNAMICTOP)+15)&-16); if (DYNAMICTOP >= TOTAL_MEMORY) { var success = enlargeMemory(); if (!success) { DYNAMICTOP = ret; return 0; } }; return ret; }, alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; }, makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; }, GLOBAL_BASE: 8, QUANTUM_SIZE: 4, __dummy__: 0 } Module["Runtime"] = Runtime; //======================================== // Runtime essentials //======================================== var __THREW__ = 0; // Used in checking for thrown exceptions. var ABORT = false; // whether we are quitting the application. no code should run after this. set in exit() and abort() var EXITSTATUS = 0; var undef = 0; // tempInt is used for 32-bit signed values or smaller. tempBigInt is used // for 32-bit unsigned values or more than 32 bits. TODO: audit all uses of tempInt var tempValue, tempInt, tempBigInt, tempInt2, tempBigInt2, tempPair, tempBigIntI, tempBigIntR, tempBigIntS, tempBigIntP, tempBigIntD, tempDouble, tempFloat; var tempI64, tempI64b; var tempRet0, tempRet1, tempRet2, tempRet3, tempRet4, tempRet5, tempRet6, tempRet7, tempRet8, tempRet9; function assert(condition, text) { if (!condition) { abort('Assertion failed: ' + text); } } var globalScope = this; // Returns the C function with a specified identifier (for C++, you need to do manual name mangling) function getCFunc(ident) { var func = Module['_' + ident]; // closure exported function if (!func) { try { func = eval('_' + ident); // explicit lookup } catch(e) {} } assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)'); return func; } var cwrap, ccall; (function(){ var JSfuncs = { // Helpers for cwrap -- it can't refer to Runtime directly because it might // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find // out what the minified function name is. 'stackSave': function() { Runtime.stackSave() }, 'stackRestore': function() { Runtime.stackRestore() }, // type conversion from js to c 'arrayToC' : function(arr) { var ret = Runtime.stackAlloc(arr.length); writeArrayToMemory(arr, ret); return ret; }, 'stringToC' : function(str) { var ret = 0; if (str !== null && str !== undefined && str !== 0) { // null string // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' ret = Runtime.stackAlloc((str.length << 2) + 1); writeStringToMemory(str, ret); } return ret; } }; // For fast lookup of conversion functions var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']}; // C calling interface. ccall = function ccallFunc(ident, returnType, argTypes, args, opts) { var func = getCFunc(ident); var cArgs = []; var stack = 0; if (args) { for (var i = 0; i < args.length; i++) { var converter = toC[argTypes[i]]; if (converter) { if (stack === 0) stack = Runtime.stackSave(); cArgs[i] = converter(args[i]); } else { cArgs[i] = args[i]; } } } var ret = func.apply(null, cArgs); if (returnType === 'string') ret = Pointer_stringify(ret); if (stack !== 0) { if (opts && opts.async) { EmterpreterAsync.asyncFinalizers.push(function() { Runtime.stackRestore(stack); }); return; } Runtime.stackRestore(stack); } return ret; } var sourceRegex = /^function\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/; function parseJSFunc(jsfunc) { // Match the body and the return value of a javascript function source var parsed = jsfunc.toString().match(sourceRegex).slice(1); return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]} } var JSsource = {}; for (var fun in JSfuncs) { if (JSfuncs.hasOwnProperty(fun)) { // Elements of toCsource are arrays of three items: // the code, and the return value JSsource[fun] = parseJSFunc(JSfuncs[fun]); } } cwrap = function cwrap(ident, returnType, argTypes) { argTypes = argTypes || []; var cfunc = getCFunc(ident); // When the function takes numbers and returns a number, we can just return // the original function var numericArgs = argTypes.every(function(type){ return type === 'number'}); var numericRet = (returnType !== 'string'); if ( numericRet && numericArgs) { return cfunc; } // Creation of the arguments list (["$1","$2",...,"$nargs"]) var argNames = argTypes.map(function(x,i){return '$'+i}); var funcstr = "(function(" + argNames.join(',') + ") {"; var nargs = argTypes.length; if (!numericArgs) { // Generate the code needed to convert the arguments from javascript // values to pointers funcstr += 'var stack = ' + JSsource['stackSave'].body + ';'; for (var i = 0; i < nargs; i++) { var arg = argNames[i], type = argTypes[i]; if (type === 'number') continue; var convertCode = JSsource[type + 'ToC']; // [code, return] funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';'; funcstr += convertCode.body + ';'; funcstr += arg + '=' + convertCode.returnValue + ';'; } } // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore var cfuncname = parseJSFunc(function(){return cfunc}).returnValue; // Call the function funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');'; if (!numericRet) { // Return type can only by 'string' or 'number' // Convert the result to a string var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue; funcstr += 'ret = ' + strgfy + '(ret);'; } if (!numericArgs) { // If we had a stack, restore it funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';'; } funcstr += 'return ret})'; return eval(funcstr); }; })(); Module["ccall"] = ccall; Module["cwrap"] = cwrap; function setValue(ptr, value, type, noSafe) { type = type || 'i8'; if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit switch(type) { case 'i1': HEAP8[((ptr)>>0)]=value; break; case 'i8': HEAP8[((ptr)>>0)]=value; break; case 'i16': HEAP16[((ptr)>>1)]=value; break; case 'i32': HEAP32[((ptr)>>2)]=value; break; case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; case 'float': HEAPF32[((ptr)>>2)]=value; break; case 'double': HEAPF64[((ptr)>>3)]=value; break; default: abort('invalid type for setValue: ' + type); } } Module["setValue"] = setValue; function getValue(ptr, type, noSafe) { type = type || 'i8'; if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit switch(type) { case 'i1': return HEAP8[((ptr)>>0)]; case 'i8': return HEAP8[((ptr)>>0)]; case 'i16': return HEAP16[((ptr)>>1)]; case 'i32': return HEAP32[((ptr)>>2)]; case 'i64': return HEAP32[((ptr)>>2)]; case 'float': return HEAPF32[((ptr)>>2)]; case 'double': return HEAPF64[((ptr)>>3)]; default: abort('invalid type for setValue: ' + type); } return null; } Module["getValue"] = getValue; var ALLOC_NORMAL = 0; // Tries to use _malloc() var ALLOC_STACK = 1; // Lives for the duration of the current function call var ALLOC_STATIC = 2; // Cannot be freed var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk var ALLOC_NONE = 4; // Do not allocate Module["ALLOC_NORMAL"] = ALLOC_NORMAL; Module["ALLOC_STACK"] = ALLOC_STACK; Module["ALLOC_STATIC"] = ALLOC_STATIC; Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC; Module["ALLOC_NONE"] = ALLOC_NONE; // allocate(): This is for internal use. You can use it yourself as well, but the interface // is a little tricky (see docs right below). The reason is that it is optimized // for multiple syntaxes to save space in generated code. So you should // normally not use allocate(), and instead allocate memory using _malloc(), // initialize it with setValue(), and so forth. // @slab: An array of data, or a number. If a number, then the size of the block to allocate, // in *bytes* (note that this is sometimes confusing: the next parameter does not // affect this!) // @types: Either an array of types, one for each byte (or 0 if no type at that position), // or a single type which is used for the entire block. This only matters if there // is initial data - if @slab is a number, then this does not matter at all and is // ignored. // @allocator: How to allocate memory, see ALLOC_* function allocate(slab, types, allocator, ptr) { var zeroinit, size; if (typeof slab === 'number') { zeroinit = true; size = slab; } else { zeroinit = false; size = slab.length; } var singleType = typeof types === 'string' ? types : null; var ret; if (allocator == ALLOC_NONE) { ret = ptr; } else { ret = [_malloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); } if (zeroinit) { var ptr = ret, stop; assert((ret & 3) == 0); stop = ret + (size & ~3); for (; ptr < stop; ptr += 4) { HEAP32[((ptr)>>2)]=0; } stop = ret + size; while (ptr < stop) { HEAP8[((ptr++)>>0)]=0; } return ret; } if (singleType === 'i8') { if (slab.subarray || slab.slice) { HEAPU8.set(slab, ret); } else { HEAPU8.set(new Uint8Array(slab), ret); } return ret; } var i = 0, type, typeSize, previousType; while (i < size) { var curr = slab[i]; if (typeof curr === 'function') { curr = Runtime.getFunctionIndex(curr); } type = singleType || types[i]; if (type === 0) { i++; continue; } if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later setValue(ret+i, curr, type); // no need to look up size unless type changes, so cache it if (previousType !== type) { typeSize = Runtime.getNativeTypeSize(type); previousType = type; } i += typeSize; } return ret; } Module["allocate"] = allocate; // Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready function getMemory(size) { if (!staticSealed) return Runtime.staticAlloc(size); if ((typeof _sbrk !== 'undefined' && !_sbrk.called) || !runtimeInitialized) return Runtime.dynamicAlloc(size); return _malloc(size); } Module["getMemory"] = getMemory; function Pointer_stringify(ptr, /* optional */ length) { if (length === 0 || !ptr) return ''; // TODO: use TextDecoder // Find the length, and check for UTF while doing so var hasUtf = 0; var t; var i = 0; while (1) { t = HEAPU8[(((ptr)+(i))>>0)]; hasUtf |= t; if (t == 0 && !length) break; i++; if (length && i == length) break; } if (!length) length = i; var ret = ''; if (hasUtf < 128) { var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack var curr; while (length > 0) { curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); ret = ret ? ret + curr : curr; ptr += MAX_CHUNK; length -= MAX_CHUNK; } return ret; } return Module['UTF8ToString'](ptr); } Module["Pointer_stringify"] = Pointer_stringify; // Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns // a copy of that string as a Javascript String object. function AsciiToString(ptr) { var str = ''; while (1) { var ch = HEAP8[((ptr++)>>0)]; if (!ch) return str; str += String.fromCharCode(ch); } } Module["AsciiToString"] = AsciiToString; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. function stringToAscii(str, outPtr) { return writeAsciiToMemory(str, outPtr, false); } Module["stringToAscii"] = stringToAscii; // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns // a copy of that string as a Javascript String object. function UTF8ArrayToString(u8Array, idx) { var u0, u1, u2, u3, u4, u5; var str = ''; while (1) { // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 u0 = u8Array[idx++]; if (!u0) return str; if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } u1 = u8Array[idx++] & 63; if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } u2 = u8Array[idx++] & 63; if ((u0 & 0xF0) == 0xE0) { u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; } else { u3 = u8Array[idx++] & 63; if ((u0 & 0xF8) == 0xF0) { u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; } else { u4 = u8Array[idx++] & 63; if ((u0 & 0xFC) == 0xF8) { u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; } else { u5 = u8Array[idx++] & 63; u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; } } } if (u0 < 0x10000) { str += String.fromCharCode(u0); } else { var ch = u0 - 0x10000; str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); } } } Module["UTF8ArrayToString"] = UTF8ArrayToString; // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns // a copy of that string as a Javascript String object. function UTF8ToString(ptr) { return UTF8ArrayToString(HEAPU8,ptr); } Module["UTF8ToString"] = UTF8ToString; // Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', // encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. // Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write. // Parameters: // str: the Javascript string to copy. // outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. // outIdx: The starting offset in the array to begin the copying. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null // terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. // maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. return 0; var startIdx = outIdx; var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. // See http://unicode.org/faq/utf_bom.html#utf16-3 // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 var u = str.charCodeAt(i); // possibly a lead surrogate if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); if (u <= 0x7F) { if (outIdx >= endIdx) break; outU8Array[outIdx++] = u; } else if (u <= 0x7FF) { if (outIdx + 1 >= endIdx) break; outU8Array[outIdx++] = 0xC0 | (u >> 6); outU8Array[outIdx++] = 0x80 | (u & 63); } else if (u <= 0xFFFF) { if (outIdx + 2 >= endIdx) break; outU8Array[outIdx++] = 0xE0 | (u >> 12); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } else if (u <= 0x1FFFFF) { if (outIdx + 3 >= endIdx) break; outU8Array[outIdx++] = 0xF0 | (u >> 18); outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } else if (u <= 0x3FFFFFF) { if (outIdx + 4 >= endIdx) break; outU8Array[outIdx++] = 0xF8 | (u >> 24); outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } else { if (outIdx + 5 >= endIdx) break; outU8Array[outIdx++] = 0xFC | (u >> 30); outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } } // Null-terminate the pointer to the buffer. outU8Array[outIdx] = 0; return outIdx - startIdx; } Module["stringToUTF8Array"] = stringToUTF8Array; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. // Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF8(str, outPtr, maxBytesToWrite) { return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); } Module["stringToUTF8"] = stringToUTF8; // Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. function lengthBytesUTF8(str) { var len = 0; for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. // See http://unicode.org/faq/utf_bom.html#utf16-3 var u = str.charCodeAt(i); // possibly a lead surrogate if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); if (u <= 0x7F) { ++len; } else if (u <= 0x7FF) { len += 2; } else if (u <= 0xFFFF) { len += 3; } else if (u <= 0x1FFFFF) { len += 4; } else if (u <= 0x3FFFFFF) { len += 5; } else { len += 6; } } return len; } Module["lengthBytesUTF8"] = lengthBytesUTF8; // Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns // a copy of that string as a Javascript String object. function UTF16ToString(ptr) { var i = 0; var str = ''; while (1) { var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; if (codeUnit == 0) return str; ++i; // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. str += String.fromCharCode(codeUnit); } } Module["UTF16ToString"] = UTF16ToString; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. // Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. // Parameters: // str: the Javascript string to copy. // outPtr: Byte address in Emscripten HEAP where to write the string to. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null // terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. // maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF16(str, outPtr, maxBytesToWrite) { // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. if (maxBytesToWrite === undefined) { maxBytesToWrite = 0x7FFFFFFF; } if (maxBytesToWrite < 2) return 0; maxBytesToWrite -= 2; // Null terminator. var startPtr = outPtr; var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; for (var i = 0; i < numCharsToWrite; ++i) { // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. var codeUnit = str.charCodeAt(i); // possibly a lead surrogate HEAP16[((outPtr)>>1)]=codeUnit; outPtr += 2; } // Null-terminate the pointer to the HEAP. HEAP16[((outPtr)>>1)]=0; return outPtr - startPtr; } Module["stringToUTF16"] = stringToUTF16; // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. function lengthBytesUTF16(str) { return str.length*2; } Module["lengthBytesUTF16"] = lengthBytesUTF16; function UTF32ToString(ptr) { var i = 0; var str = ''; while (1) { var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; if (utf32 == 0) return str; ++i; // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. // See http://unicode.org/faq/utf_bom.html#utf16-3 if (utf32 >= 0x10000) { var ch = utf32 - 0x10000; str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); } else { str += String.fromCharCode(utf32); } } } Module["UTF32ToString"] = UTF32ToString; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. // Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. // Parameters: // str: the Javascript string to copy. // outPtr: Byte address in Emscripten HEAP where to write the string to. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null // terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. // maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF32(str, outPtr, maxBytesToWrite) { // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. if (maxBytesToWrite === undefined) { maxBytesToWrite = 0x7FFFFFFF; } if (maxBytesToWrite < 4) return 0; var startPtr = outPtr; var endPtr = startPtr + maxBytesToWrite - 4; for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. // See http://unicode.org/faq/utf_bom.html#utf16-3 var codeUnit = str.charCodeAt(i); // possibly a lead surrogate if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { var trailSurrogate = str.charCodeAt(++i); codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); } HEAP32[((outPtr)>>2)]=codeUnit; outPtr += 4; if (outPtr + 4 > endPtr) break; } // Null-terminate the pointer to the HEAP. HEAP32[((outPtr)>>2)]=0; return outPtr - startPtr; } Module["stringToUTF32"] = stringToUTF32; // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. function lengthBytesUTF32(str) { var len = 0; for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. // See http://unicode.org/faq/utf_bom.html#utf16-3 var codeUnit = str.charCodeAt(i); if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. len += 4; } return len; } Module["lengthBytesUTF32"] = lengthBytesUTF32; function demangle(func) { var hasLibcxxabi = !!Module['___cxa_demangle']; if (hasLibcxxabi) { try { var buf = _malloc(func.length); writeStringToMemory(func.substr(1), buf); var status = _malloc(4); var ret = Module['___cxa_demangle'](buf, 0, 0, status); if (getValue(status, 'i32') === 0 && ret) { return Pointer_stringify(ret); } // otherwise, libcxxabi failed, we can try ours which may return a partial result } catch(e) { // failure when using libcxxabi, we can try ours which may return a partial result } finally { if (buf) _free(buf); if (status) _free(status); if (ret) _free(ret); } } var i = 3; // params, etc. var basicTypes = { 'v': 'void', 'b': 'bool', 'c': 'char', 's': 'short', 'i': 'int', 'l': 'long', 'f': 'float', 'd': 'double', 'w': 'wchar_t', 'a': 'signed char', 'h': 'unsigned char', 't': 'unsigned short', 'j': 'unsigned int', 'm': 'unsigned long', 'x': 'long long', 'y': 'unsigned long long', 'z': '...' }; var subs = []; var first = true; function dump(x) { //return; if (x) Module.print(x); Module.print(func); var pre = ''; for (var a = 0; a < i; a++) pre += ' '; Module.print (pre + '^'); } function parseNested() { i++; if (func[i] === 'K') i++; // ignore const var parts = []; while (func[i] !== 'E') { if (func[i] === 'S') { // substitution i++; var next = func.indexOf('_', i); var num = func.substring(i, next) || 0; parts.push(subs[num] || '?'); i = next+1; continue; } if (func[i] === 'C') { // constructor parts.push(parts[parts.length-1]); i += 2; continue; } var size = parseInt(func.substr(i)); var pre = size.toString().length; if (!size || !pre) { i--; break; } // counter i++ below us var curr = func.substr(i + pre, size); parts.push(curr); subs.push(curr); i += pre + size; } i++; // skip E return parts; } function parse(rawList, limit, allowVoid) { // main parser limit = limit || Infinity; var ret = '', list = []; function flushList() { return '(' + list.join(', ') + ')'; } var name; if (func[i] === 'N') { // namespaced N-E name = parseNested().join('::'); limit--; if (limit === 0) return rawList ? [name] : name; } else { // not namespaced if (func[i] === 'K' || (first && func[i] === 'L')) i++; // ignore const and first 'L' var size = parseInt(func.substr(i)); if (size) { var pre = size.toString().length; name = func.substr(i + pre, size); i += pre + size; } } first = false; if (func[i] === 'I') { i++; var iList = parse(true); var iRet = parse(true, 1, true); ret += iRet[0] + ' ' + name + '<' + iList.join(', ') + '>'; } else { ret = name; } paramLoop: while (i < func.length && limit-- > 0) { //dump('paramLoop'); var c = func[i++]; if (c in basicTypes) { list.push(basicTypes[c]); } else { switch (c) { case 'P': list.push(parse(true, 1, true)[0] + '*'); break; // pointer case 'R': list.push(parse(true, 1, true)[0] + '&'); break; // reference case 'L': { // literal i++; // skip basic type var end = func.indexOf('E', i); var size = end - i; list.push(func.substr(i, size)); i += size + 2; // size + 'EE' break; } case 'A': { // array var size = parseInt(func.substr(i)); i += size.toString().length; if (func[i] !== '_') throw '?'; i++; // skip _ list.push(parse(true, 1, true)[0] + ' [' + size + ']'); break; } case 'E': break paramLoop; default: ret += '?' + c; break paramLoop; } } } if (!allowVoid && list.length === 1 && list[0] === 'void') list = []; // avoid (void) if (rawList) { if (ret) { list.push(ret + '?'); } return list; } else { return ret + flushList(); } } var parsed = func; try { // Special-case the entry point, since its name differs from other name mangling. if (func == 'Object._main' || func == '_main') { return 'main()'; } if (typeof func === 'number') func = Pointer_stringify(func); if (func[0] !== '_') return func; if (func[1] !== '_') return func; // C function if (func[2] !== 'Z') return func; switch (func[3]) { case 'n': return 'operator new()'; case 'd': return 'operator delete()'; } parsed = parse(); } catch(e) { parsed += '?'; } if (parsed.indexOf('?') >= 0 && !hasLibcxxabi) { Runtime.warnOnce('warning: a problem occurred in builtin C++ name demangling; build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling'); } return parsed; } function demangleAll(text) { return text.replace(/__Z[\w\d_]+/g, function(x) { var y = demangle(x); return x === y ? x : (x + ' [' + y + ']') }); } function jsStackTrace() { var err = new Error(); if (!err.stack) { // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, // so try that as a special-case. try { throw new Error(0); } catch(e) { err = e; } if (!err.stack) { return '(no stack trace available)'; } } return err.stack.toString(); } function stackTrace() { return demangleAll(jsStackTrace()); } Module["stackTrace"] = stackTrace; // Memory management var PAGE_SIZE = 4096; function alignMemoryPage(x) { if (x % 4096 > 0) { x += (4096 - (x % 4096)); } return x; } var HEAP; var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; var STATIC_BASE = 0, STATICTOP = 0, staticSealed = false; // static area var STACK_BASE = 0, STACKTOP = 0, STACK_MAX = 0; // stack area var DYNAMIC_BASE = 0, DYNAMICTOP = 0; // dynamic area handled by sbrk function enlargeMemory() { // TOTAL_MEMORY is the current size of the actual array, and DYNAMICTOP is the new top. var OLD_TOTAL_MEMORY = TOTAL_MEMORY; var LIMIT = Math.pow(2, 31); // 2GB is a practical maximum, as we use signed ints as pointers // and JS engines seem unhappy to give us 2GB arrays currently if (DYNAMICTOP >= LIMIT) return false; while (TOTAL_MEMORY <= DYNAMICTOP) { // Simple heuristic. if (TOTAL_MEMORY < LIMIT/2) { TOTAL_MEMORY = alignMemoryPage(2*TOTAL_MEMORY); // double until 1GB } else { var last = TOTAL_MEMORY; TOTAL_MEMORY = alignMemoryPage((3*TOTAL_MEMORY + LIMIT)/4); // add smaller increments towards 2GB, which we cannot reach if (TOTAL_MEMORY <= last) return false; } } TOTAL_MEMORY = Math.max(TOTAL_MEMORY, 16*1024*1024); if (TOTAL_MEMORY >= LIMIT) return false; try { if (ArrayBuffer.transfer) { buffer = ArrayBuffer.transfer(buffer, TOTAL_MEMORY); } else { var oldHEAP8 = HEAP8; buffer = new ArrayBuffer(TOTAL_MEMORY); } } catch(e) { return false; } var success = _emscripten_replace_memory(buffer); if (!success) return false; // everything worked Module['buffer'] = buffer; Module['HEAP8'] = HEAP8 = new Int8Array(buffer); Module['HEAP16'] = HEAP16 = new Int16Array(buffer); Module['HEAP32'] = HEAP32 = new Int32Array(buffer); Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer); Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer); Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer); Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer); Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer); if (!ArrayBuffer.transfer) { HEAP8.set(oldHEAP8); } return true; } var byteLength; try { byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, 'byteLength').get); byteLength(new ArrayBuffer(4)); // can fail on older ie } catch(e) { // can fail on older node/v8 byteLength = function(buffer) { return buffer.byteLength; }; } var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216; var totalMemory = 64*1024; while (totalMemory < TOTAL_MEMORY || totalMemory < 2*TOTAL_STACK) { if (totalMemory < 16*1024*1024) { totalMemory *= 2; } else { totalMemory += 16*1024*1024 } } totalMemory = Math.max(totalMemory, 16*1024*1024); if (totalMemory !== TOTAL_MEMORY) { TOTAL_MEMORY = totalMemory; } // Initialize the runtime's memory // check for full engine support (use string 'subarray' to avoid closure compiler confusion) assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']), 'JS engine does not provide full typed array support'); var buffer; buffer = new ArrayBuffer(TOTAL_MEMORY); HEAP8 = new Int8Array(buffer); HEAP16 = new Int16Array(buffer); HEAP32 = new Int32Array(buffer); HEAPU8 = new Uint8Array(buffer); HEAPU16 = new Uint16Array(buffer); HEAPU32 = new Uint32Array(buffer); HEAPF32 = new Float32Array(buffer); HEAPF64 = new Float64Array(buffer); // Endianness check (note: assumes compiler arch was little-endian) HEAP32[0] = 255; assert(HEAPU8[0] === 255 && HEAPU8[3] === 0, 'Typed arrays 2 must be run on a little-endian system'); Module['HEAP'] = HEAP; Module['buffer'] = buffer; Module['HEAP8'] = HEAP8; Module['HEAP16'] = HEAP16; Module['HEAP32'] = HEAP32; Module['HEAPU8'] = HEAPU8; Module['HEAPU16'] = HEAPU16; Module['HEAPU32'] = HEAPU32; Module['HEAPF32'] = HEAPF32; Module['HEAPF64'] = HEAPF64; function callRuntimeCallbacks(callbacks) { while(callbacks.length > 0) { var callback = callbacks.shift(); if (typeof callback == 'function') { callback(); continue; } var func = callback.func; if (typeof func === 'number') { if (callback.arg === undefined) { Runtime.dynCall('v', func); } else { Runtime.dynCall('vi', func, [callback.arg]); } } else { func(callback.arg === undefined ? null : callback.arg); } } } var __ATPRERUN__ = []; // functions called before the runtime is initialized var __ATINIT__ = []; // functions called during startup var __ATMAIN__ = []; // functions called when main() is to be run var __ATEXIT__ = []; // functions called during shutdown var __ATPOSTRUN__ = []; // functions called after the runtime has exited var runtimeInitialized = false; var runtimeExited = false; function preRun() { // compatibility - merge in anything from Module['preRun'] at this time if (Module['preRun']) { if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; while (Module['preRun'].length) { addOnPreRun(Module['preRun'].shift()); } } callRuntimeCallbacks(__ATPRERUN__); } function ensureInitRuntime() { if (runtimeInitialized) return; runtimeInitialized = true; callRuntimeCallbacks(__ATINIT__); } function preMain() { callRuntimeCallbacks(__ATMAIN__); } function exitRuntime() { callRuntimeCallbacks(__ATEXIT__); runtimeExited = true; } function postRun() { // compatibility - merge in anything from Module['postRun'] at this time if (Module['postRun']) { if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; while (Module['postRun'].length) { addOnPostRun(Module['postRun'].shift()); } } callRuntimeCallbacks(__ATPOSTRUN__); } function addOnPreRun(cb) { __ATPRERUN__.unshift(cb); } Module["addOnPreRun"] = addOnPreRun; function addOnInit(cb) { __ATINIT__.unshift(cb); } Module["addOnInit"] = addOnInit; function addOnPreMain(cb) { __ATMAIN__.unshift(cb); } Module["addOnPreMain"] = addOnPreMain; function addOnExit(cb) { __ATEXIT__.unshift(cb); } Module["addOnExit"] = addOnExit; function addOnPostRun(cb) { __ATPOSTRUN__.unshift(cb); } Module["addOnPostRun"] = addOnPostRun; // Tools function intArrayFromString(stringy, dontAddNull, length /* optional */) { var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; var u8array = new Array(len); var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); if (dontAddNull) u8array.length = numBytesWritten; return u8array; } Module["intArrayFromString"] = intArrayFromString; function intArrayToString(array) { var ret = []; for (var i = 0; i < array.length; i++) { var chr = array[i]; if (chr > 0xFF) { chr &= 0xFF; } ret.push(String.fromCharCode(chr)); } return ret.join(''); } Module["intArrayToString"] = intArrayToString; function writeStringToMemory(string, buffer, dontAddNull) { var array = intArrayFromString(string, dontAddNull); var i = 0; while (i < array.length) { var chr = array[i]; HEAP8[(((buffer)+(i))>>0)]=chr; i = i + 1; } } Module["writeStringToMemory"] = writeStringToMemory; function writeArrayToMemory(array, buffer) { for (var i = 0; i < array.length; i++) { HEAP8[((buffer++)>>0)]=array[i]; } } Module["writeArrayToMemory"] = writeArrayToMemory; function writeAsciiToMemory(str, buffer, dontAddNull) { for (var i = 0; i < str.length; ++i) { HEAP8[((buffer++)>>0)]=str.charCodeAt(i); } // Null-terminate the pointer to the HEAP. if (!dontAddNull) HEAP8[((buffer)>>0)]=0; } Module["writeAsciiToMemory"] = writeAsciiToMemory; function unSign(value, bits, ignore) { if (value >= 0) { return value; } return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts : Math.pow(2, bits) + value; } function reSign(value, bits, ignore) { if (value <= 0) { return value; } var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 : Math.pow(2, bits-1); if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors // TODO: In i64 mode 1, resign the two parts separately and safely value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts } return value; } // check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 ) if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) { var ah = a >>> 16; var al = a & 0xffff; var bh = b >>> 16; var bl = b & 0xffff; return (al*bl + ((ah*bl + al*bh) << 16))|0; }; Math.imul = Math['imul']; if (!Math['clz32']) Math['clz32'] = function(x) { x = x >>> 0; for (var i = 0; i < 32; i++) { if (x & (1 << (31 - i))) return i; } return 32; }; Math.clz32 = Math['clz32'] var Math_abs = Math.abs; var Math_cos = Math.cos; var Math_sin = Math.sin; var Math_tan = Math.tan; var Math_acos = Math.acos; var Math_asin = Math.asin; var Math_atan = Math.atan; var Math_atan2 = Math.atan2; var Math_exp = Math.exp; var Math_log = Math.log; var Math_sqrt = Math.sqrt; var Math_ceil = Math.ceil; var Math_floor = Math.floor; var Math_pow = Math.pow; var Math_imul = Math.imul; var Math_fround = Math.fround; var Math_min = Math.min; var Math_clz32 = Math.clz32; // A counter of dependencies for calling run(). If we need to // do asynchronous work before running, increment this and // decrement it. Incrementing must happen in a place like // PRE_RUN_ADDITIONS (used by emcc to add file preloading). // Note that you can add dependencies in preRun, even though // it happens right before run - run will be postponed until // the dependencies are met. var runDependencies = 0; var runDependencyWatcher = null; var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled function getUniqueRunDependency(id) { return id; } function addRunDependency(id) { runDependencies++; if (Module['monitorRunDependencies']) { Module['monitorRunDependencies'](runDependencies); } } Module["addRunDependency"] = addRunDependency; function removeRunDependency(id) { runDependencies--; if (Module['monitorRunDependencies']) { Module['monitorRunDependencies'](runDependencies); } if (runDependencies == 0) { if (runDependencyWatcher !== null) { clearInterval(runDependencyWatcher); runDependencyWatcher = null; } if (dependenciesFulfilled) { var callback = dependenciesFulfilled; dependenciesFulfilled = null; callback(); // can add another dependenciesFulfilled } } } Module["removeRunDependency"] = removeRunDependency; Module["preloadedImages"] = {}; // maps url to image data Module["preloadedAudios"] = {}; // maps url to audio data var memoryInitializer = null; // === Body === var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }]; function _emscripten_asm_const_2(code, a0, a1) { return ASM_CONSTS[code](a0, a1); } STATIC_BASE = 8; STATICTOP = STATIC_BASE + 30528; /* global initializers */ __ATINIT__.push(); /* memory initializer */ allocate([0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,16,0,0,0,16,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,255,255,255,0,0,0,0,0,0,0,0,60,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE); /* memory initializer */ allocate([128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,79,103,103,83], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+2222); /* memory initializer */ allocate([1,0,0,128,0,0,0,86,0,0,0,64,0,0,0,62,180,228,51,9,145,243,51,139,178,1,52,60,32,10,52,35,26,19,52,96,169,28,52,167,215,38,52,75,175,49,52,80,59,61,52,112,135,73,52,35,160,86,52,184,146,100,52,85,109,115,52,136,159,129,52,252,11,138,52,147,4,147,52,105,146,156,52,50,191,166,52,63,149,177,52,147,31,189,52,228,105,201,52,173,128,214,52,54,113,228,52,166,73,243,52,136,140,1,53,192,247,9,53,6,239,18,53,118,123,28,53,192,166,38,53,55,123,49,53,218,3,61,53,94,76,73,53,59,97,86,53,185,79,100,53,252,37,115,53,138,121,129,53,134,227,137,53,124,217,146,53,133,100,156,53,82,142,166,53,51,97,177,53,37,232,188,53,220,46,201,53,206,65,214,53,65,46,228,53,87,2,243,53,143,102,1,54,79,207,9,54,245,195,18,54,152,77,28,54,232,117,38,54,50,71,49,54,116,204,60,54,94,17,73,54,101,34,86,54,206,12,100,54,184,222,114,54,151,83,129,54,28,187,137,54,114,174,146,54,175,54,156,54,129,93,166,54,53,45,177,54,199,176,188,54,228,243,200,54,1,3,214,54,96,235,227,54,30,187,242,54,162,64,1,55,235,166,9,55,241,152,18,55,201,31,28,55,30,69,38,55,61,19,49,55,30,149,60,55,111,214,72,55,162,227,85,55,247,201,99,55,137,151,114,55,175,45,129,55,190,146,137,55,116,131,146,55,230,8,156,55,190,44,166,55,71,249,176,55,121,121,188,55,254,184,200,55,71,196,213,55,146,168,227,55,248,115,242,55,192,26,1,56,147,126,9,56,249,109,18,56,6,242,27,56,98,20,38,56,86,223,48,56,216,93,60,56,146,155,72,56,242,164,85,56,51,135,99,56,110,80,114,56,211,7,129,56,107,106,137,56,130,88,146,56,42,219,155,56,9,252,165,56,104,197,176,56,59,66,188,56,41,126,200,56,160,133,213,56,217,101,227,56,232,44,242,56,233,244,0,57,70,86,9,57,14,67,18,57,81,196,27,57,181,227,37,57,127,171,48,57,162,38,60,57,197,96,72,57,83,102,85,57,131,68,99,57,104,9,114,57,1,226,128,57,36,66,137,57,157,45,146,57,123,173,155,57,99,203,165,57,153,145,176,57,13,11,188,57,102,67,200,57,11,71,213,57,50,35,227,57,237,229,241,57,29,207,0,58,5,46,9,58,48,24,18,58,169,150,27,58,21,179,37,58,183,119,48,58,124,239,59,58,10,38,72,58,199,39,85,58,230,1,99,58,120,194,113,58,59,188,128,58,233,25,137,58,198,2,146,58,219,127,155,58,203,154,165,58,216,93,176,58,239,211,187,58,179,8,200,58,136,8,213,58,159,224,226,58,7,159,241,58,92,169,0,59,208,5,9,59,94,237,17,59,15,105,27,59,132,130,37,59,253,67,48,59,103,184,59,59,97,235,71,59,77,233,84,59,93,191,98,59,156,123,113,59,127,150,128,59,186,241,136,59,249,215,145,59,71,82,155,59,65,106,165,59,39,42,176,59,226,156,187,59,18,206,199,59,23,202,212,59,32,158,226,59,53,88,241,59,166,131,0,60,167,221,8,60,152,194,17,60,130,59,27,60,1,82,37,60,84,16,48,60,97,129,59,60,200,176,71,60,229,170,84,60,232,124,98,60,212,52,113,60,207,112,128,60,150,201,136,60,58,173,145,60,192,36,155,60,197,57,165,60,133,246,175,60,229,101,187,60,130,147,199,60,185,139,212,60,180,91,226,60,121,17,241,60,251,93,0,61,137,181,8,61,223,151,17,61,2,14,27,61,141,33,37,61,185,220,47,61,109,74,59,61,64,118,71,61,145,108,84,61,133,58,98,61,34,238,112,61,42,75,128,61,127,161,136,61,136,130,145,61,72,247,154,61,88,9,165,61,242,194,175,61,248,46,187,61,3,89,199,61,109,77,212,61,92,25,226,61,209,202,240,61,91,56,0,62,119,141,8,62,51,109,17,62,144,224,26,62,39,241,36,62,46,169,47,62,135,19,59,62,202,59,71,62,77,46,84,62,55,248,97,62,132,167,112,62,143,37,128,62,115,121,136,62,226,87,145,62,220,201,154,62,249,216,164,62,109,143,175,62,27,248,186,62,149,30,199,62,51,15,212,62,23,215,225,62,61,132,240,62,198,18,0,63,114,101,8,63,147,66,17,63,43,179,26,63,206,192,36,63,177,117,47,63,178,220,58,63,101,1,71,63,29,240,83,63,251,181,97,63,251,96,112,63,0,0,128,63,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,3,0,0,0,7,0,0,0,15,0,0,0,31,0,0,0,63,0,0,0,127,0,0,0,255,0,0,0,255,1,0,0,255,3,0,0,255,7,0,0,255,15,0,0,255,31,0,0,255,63,0,0,255,127,0,0,255,255,0,0,0,0,0,0,255,255,255,255,253,255,255,255,249,255,255,255,241,255,255,255,225,255,255,255,193,255,255,255,129,255,255,255,1,255,255,255,1,254,255,255,1,252,255,255,1,248,255,255,1,240,255,255,1,224,255,255,1,192,255,255,1,128,255,255,1,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,248,34,0,0,248,34,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,3,0,0,0,37,113,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,65,32,115,105,109,112,108,101,32,97,110,100,32,101,97,115,121,45,116,111,45,117,115,101,32,108,105,98,114,97,114,121,10,116,111,32,108,101,97,114,110,32,118,105,100,101,111,103,97,109,101,115,32,112,114,111,103,114,97,109,109,105,110,103,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,35,105,110,99,108,117,100,101,32,34,114,97,121,108,105,98,46,104,34,10,10,105,110,116,32,109,97,105,110,40,41,10,123,10,32,32,32,32,73,110,105,116,87,105,110,100,111,119,40,56,48,48,44,32,52,53,48,44,32,34,104,101,108,108,111,34,41,59,10,10,32,32,32,32,119,104,105,108,101,32,40,33,87,105,110,100,111,119,83,104,111,117,108,100,67,108,111,115,101,40,41,41,10,32,32,32,32,123,10,32,32,32,32,32,32,32,32,66,101,103,105,110,68,114,97,119,105,110,103,40,41,59,10,10,32,32,32,32,32,32,32,32,32,32,32,32,67,108,101,97,114,66,97,99,107,103,114,111,117,110,100,40,82,65,89,87,72,73,84,69,41,59,10,10,32,32,32,32,32,32,32,32,32,32,32,32,68,114,97,119,84,101,120,116,40,34,104,101,108,108,111,32,114,97,121,108,105,98,33,34,44,32,49,57,48,44,32,50,48,48,44,32,52,48,44,32,82,69,68,41,59,10,10,32,32,32,32,32,32,32,32,69,110,100,68,114,97,119,105,110,103,40,41,59,10,32,32,32,32,125,10,32,32,32,32,67,108,111,115,101,87,105,110,100,111,119,40,41,59,10,125,10,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,114,97,121,108,105,98,32,90,69,82,79,85,78,79,0,114,101,115,111,117,114,99,101,115,47,99,111,117,114,105,101,114,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,114,97,121,108,105,98,95,112,108,97,116,102,111,114,109,115,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,112,97,114,114,111,116,95,104,101,97,100,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,100,119,97,114,102,46,111,98,106,0,114,101,115,111,117,114,99,101,115,47,100,119,97,114,102,95,100,105,102,102,117,115,101,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,49,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,50,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,51,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,52,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,101,120,97,109,112,108,101,48,53,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,49,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,50,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,51,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,52,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,97,109,112,108,101,48,53,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,98,117,100,100,121,46,111,103,103,0,80,114,101,115,115,32,69,78,84,69,82,32,116,111,32,80,76,65,89,0,114,97,121,108,105,98,0,112,108,97,105,110,32,67,32,112,114,111,103,114,97,109,109,105,110,103,33,0,104,101,108,108,111,32,114,97,121,108,105,98,33,0,109,117,108,116,105,112,108,97,116,102,111,114,109,33,0,109,97,107,101,32,50,68,32,103,97,109,101,115,33,0,79,77,71,33,0,97,110,100,32,97,108,115,111,32,51,68,32,103,97,109,101,115,33,0,108,111,116,115,32,111,102,32,99,111,100,101,32,101,120,97,109,112,108,101,115,33,0,65,77,65,90,73,78,71,33,0,97,110,100,32,97,108,115,111,32,99,111,109,112,108,101,116,101,32,103,97,109,101,115,33,0,65,87,69,83,79,77,69,33,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,52,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+6841); /* memory initializer */ allocate([83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,86,65,79,32,73,68,32,37,105,93,32,77,111,100,101,108,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,111,100,101,108,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,77,111,100,101,108,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,70,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,102,114,97,109,101,98,117,102,102,101,114,32,111,98,106,101,99,116,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,85,110,108,111,97,100,101,100,32,112,111,115,116,112,114,111,99,101,115,115,105,110,103,32,100,97,116,97,0,79,112,101,110,71,76,32,103,114,97,112,104,105,99,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,78,111,114,109,97,108,0,109,118,112,77,97,116,114,105,120,0,102,114,97,103,84,105,110,116,67,111,108,111,114,0,116,101,120,116,117,114,101,48,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,99,109,97,112,0,108,111,99,97,0,104,101,97,100,0,103,108,121,102,0,104,104,101,97,0,104,109,116,120,0,107,101,114,110,0,109,97,120,112,0,46,47,115,116,98,95,116,114,117,101,116,121,112,101,46,104,0,115,116,98,116,116,95,70,105,110,100,71,108,121,112,104,73,110,100,101,120,0,117,110,105,99,111,100,101,95,99,111,100,101,112,111,105,110,116,32,60,61,32,116,116,85,83,72,79,82,84,40,100,97,116,97,32,43,32,101,110,100,67,111,117,110,116,32,43,32,50,42,105,116,101,109,41,0,115,116,98,116,116,95,71,101,116,71,108,121,112,104,83,104,97,112,101,0,120,43,103,119,32,60,32,112,119,0,115,116,98,116,116,95,66,97,107,101,70,111,110,116,66,105,116,109,97,112,0,121,43,103,104,32,60,32,112,104,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,114,98,109,102,0,116,116,102,0,102,110,116,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,100,97,116,97,32,112,97,114,115,101,100,32,99,111,114,114,101,99,116,108,121,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,110,117,109,32,99,104,97,114,115,32,100,101,116,101,99,116,101,100,58,32,37,105,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,85,110,108,111,97,100,101,100,32,115,112,114,105,116,101,32,102,111,110,116,32,100,97,116,97,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,99,97,110,39,116,32,102,111,112,101,110,0,112,110,103,0,98,109,112,0,116,103,97,0,106,112,103,0,103,105,102,0,112,115,100,0,112,105,99,0,100,100,115,0,112,107,109,0,107,116,120,0,112,118,114,0,97,115,116,99,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,102,105,108,101,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,111,98,106,0,91,37,115,93,32,77,111,100,101,108,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,77,111,100,101,108,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,65,117,100,105,111,32,100,101,118,105,99,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,67,111,117,108,100,32,110,111,116,32,115,101,116,117,112,32,97,117,100,105,111,32,99,111,110,116,101,120,116,0,65,117,100,105,111,32,100,101,118,105,99,101,32,97,110,100,32,99,111,110,116,101,120,116,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,58,32,37,115,0,67,111,117,108,100,32,110,111,116,32,103,101,116,32,99,117,114,114,101,110,116,32,97,117,100,105,111,32,99,111,110,116,101,120,116,32,102,111,114,32,99,108,111,115,105,110,103,0,111,103,103,0,91,37,115,93,32,79,71,71,32,97,117,100,105,111,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,79,103,103,32,115,97,109,112,108,101,32,114,97,116,101,58,32,37,105,0,91,37,115,93,32,79,103,103,32,99,104,97,110,110,101,108,115,58,32,37,105,0,91,37,115,93,32,84,101,109,112,32,109,101,109,111,114,121,32,114,101,113,117,105,114,101,100,58,32,37,105,0,91,37,115,93,32,77,117,115,105,99,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,79,103,103,32,112,108,97,121,105,110,103,44,32,101,114,114,111,114,32,98,117,102,102,101,114,105,110,103,32,100,97,116,97,46,46,46,0,115,116,98,95,118,111,114,98,105,115,46,99,0,73,78,70,79,58,32,0,69,82,82,79,82,58,32,0,87,65,82,78,73,78,71,58,32,0,98,117,102,95,99,32,61,61,32,50,0,99,111,110,118,101,114,116,95,99,104,97,110,110,101,108,115,95,115,104,111,114,116,95,105,110,116,101,114,108,101,97,118,101,100,0,0,0,0,0,0,0,7,0,0,0,0,0,3,5,0,0,0,0,3,7,5,0,0,0,3,5,3,5,0,0,3,7,5,3,5,0,3,7,5,3,5,7,102,45,62,98,121,116,101,115,95,105,110,95,115,101,103,32,62,32,48,0,103,101,116,56,95,112,97,99,107,101,116,95,114,97,119,0,102,45,62,98,121,116,101,115,95,105,110,95,115,101,103,32,61,61,32,48,0,110,101,120,116,95,115,101,103,109,101,110,116,0,0,1,2,2,3,3,3,3,4,4,4,4,4,4,4,4,102,45,62,97,108,108,111,99,46,97,108,108,111,99,95,98,117,102,102,101,114,95,108,101,110,103,116,104,95,105,110,95,98,121,116,101,115,32,61,61,32,102,45,62,116,101,109,112,95,111,102,102,115,101,116,0,118,111,114,98,105,115,95,100,101,99,111,100,101,95,105,110,105,116,105,97,108,0,102,45,62,116,101,109,112,95,111,102,102,115,101,116,32,61,61,32,102,45,62,97,108,108,111,99,46,97,108,108,111,99,95,98,117,102,102,101,114,95,108,101,110,103,116,104,95,105,110,95,98,121,116,101,115,0,115,116,97,114,116,95,100,101,99,111,100,101,114,0,112,111,119,40,40,102,108,111,97,116,41,32,114,43,49,44,32,100,105,109,41,32,62,32,101,110,116,114,105,101,115,0,108,111,111,107,117,112,49,95,118,97,108,117,101,115,0,40,105,110,116,41,32,102,108,111,111,114,40,112,111,119,40,40,102,108,111,97,116,41,32,114,44,32,100,105,109,41,41,32,60,61,32,101,110,116,114,105,101,115,0,107,32,61,61,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,109,112,117,116,101,95,115,111,114,116,101,100,95,104,117,102,102,109,97,110,0,99,45,62,115,111,114,116,101,100,95,99,111,100,101,119,111,114,100,115,91,120,93,32,61,61,32,99,111,100,101,0,108,101,110,32,33,61,32,78,79,95,67,79,68,69,0,105,110,99,108,117,100,101,95,105,110,95,115,111,114,116,0,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,32,61,61,32,48,0,99,111,109,112,117,116,101,95,99,111,100,101,119,111,114,100,115,0,122,32,62,61,32,48,32,38,38,32,122,32,60,32,51,50,0,108,101,110,91,105,93,32,62,61,32,48,32,38,38,32,108,101,110,91,105,93,32,60,32,51,50,0,97,118,97,105,108,97,98,108,101,91,121,93,32,61,61,32,48,0,118,111,114,98,105,115,103,101,116,95,119,105,110,100,111,119,0,118,111,114,98,105,115,95,100,101,99,111,100,101,95,112,97,99,107,101,116,95,114,101,115,116,0,40,110,32,38,32,51,41,32,61,61,32,48,0,105,109,100,99,116,95,115,116,101,112,51,95,105,116,101,114,48,95,108,111,111,112,0,122,32,60,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,115,116,97,114,116,0,33,99,45,62,115,112,97,114,115,101,32,124,124,32,122,32,60,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,100,101,105,110,116,101,114,108,101,97,118,101,95,114,101,112,101,97,116,0,33,99,45,62,115,112,97,114,115,101,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,115,99,97,108,97,114,95,114,97,119,0,78,111,32,109,111,114,101,32,100,97,116,97,32,111,98,116,97,105,110,101,100,32,102,114,111,109,32,115,116,114,101,97,109,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,65,83,84,67,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,98,108,111,99,107,115,58,32,37,105,120,37,105,0,91,37,115,93,32,65,83,84,67,32,98,108,111,99,107,32,115,105,122,101,32,99,111,110,102,105,103,117,114,97,116,105,111,110,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,86,82,32,118,50,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,117,112,100,97,116,101,32,121,111,117,114,32,102,105,108,101,115,32,116,111,32,80,86,82,32,118,51,0,91,37,115,93,32,75,84,88,32,105,109,97,103,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,75,84,88,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,102,105,108,101,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,80,75,77,32,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,68,68,83,32,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,104,101,97,100,101,114,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,102,108,97,103,115,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,98,105,116,32,99,111,117,110,116,58,32,48,120,37,120,0,80,105,116,99,104,32,111,114,32,108,105,110,101,97,114,32,115,105,122,101,58,32,37,105,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,109,97,120,32,118,97,108,117,101,32,62,32,50,53,53,0,83,128,246,52,0,110,111,116,32,66,77,80,0,117,110,107,110,111,119,110,32,66,77,80,0,98,97,100,32,66,77,80,0,109,111,110,111,99,104,114,111,109,101,0,66,77,80,32,82,76,69,0,110,111,116,32,71,73,70,0,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,109,101,109,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,46,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,109,103,95,110,32,61,61,32,51,0,98,97,100,32,112,110,103,32,115,105,103,0,110,111,32,83,79,73,0,110,111,32,83,79,70,0,98,97,100,32,83,79,70,32,108,101,110,0,111,110,108,121,32,56,45,98,105,116,0,110,111,32,104,101,97,100,101,114,32,104,101,105,103,104,116,0,48,32,119,105,100,116,104,0,98,97,100,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,98,97,100,32,99,111,109,112,111,110,101,110,116,32,73,68,0,98,97,100,32,72,0,98,97,100,32,86,0,98,97,100,32,84,81,0,101,120,112,101,99,116,101,100,32,109,97,114,107,101,114,0,98,97,100,32,68,82,73,32,108,101,110,0,98,97,100,32,68,81,84,32,116,121,112,101,0,98,97,100,32,68,81,84,32,116,97,98,108,101,0,0,1,8,16,9,2,3,10,17,24,32,25,18,11,4,5,12,19,26,33,40,48,41,34,27,20,13,6,7,14,21,28,35,42,49,56,57,50,43,36,29,22,15,23,30,37,44,51,58,59,52,45,38,31,39,46,53,60,61,54,47,55,62,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,98,97,100,32,68,72,84,32,104,101,97,100,101,114,0,98,97,100,32,99,111,100,101,32,108,101,110,103,116,104,115,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,101,114,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,102,111,114,109,97,116,0,116,103,97,95,99,111,109,112,32,61,61,32,83,84,66,73,95,114,103,98,0,115,116,98,105,95,95,116,103,97,95,108,111,97,100,0,98,97,100,32,112,97,108,101,116,116,101,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,48,0,98,97,100,32,102,105,108,101,0,80,73,67,84,0,110,111,116,32,80,83,68,0,119,114,111,110,103,32,118,101,114,115,105,111,110,0,119,114,111,110,103,32,99,104,97,110,110,101,108,32,99,111,117,110,116,0,117,110,115,117,112,112,111,114,116,101,100,32,98,105,116,32,100,101,112,116,104,0,119,114,111,110,103,32,99,111,108,111,114,32,102,111,114,109,97,116,0,98,97,100,32,73,109,97,103,101,32,68,101,115,99,114,105,112,116,111,114,0,109,105,115,115,105,110,103,32,99,111,108,111,114,32,116,97,98,108,101,0,117,110,107,110,111,119,110,32,99,111,100,101,0,110,111,32,99,108,101,97,114,32,99,111,100,101,0,116,111,111,32,109,97,110,121,32,99,111,100,101,115,0,105,108,108,101,103,97,108,32,99,111,100,101,32,105,110,32,114,97,115,116,101,114,0,105,110,118,97,108,105,100,0,98,97,100,32,98,112,112,0,98,97,100,32,109,97,115,107,115,0,98,97,100,32,114,101,113,95,99,111,109,112,0,106,117,110,107,32,98,101,102,111,114,101,32,109,97,114,107,101,114,0,99,97,110,39,116,32,109,101,114,103,101,32,100,99,32,97,110,100,32,97,99,0,110,32,62,61,32,48,32,38,38,32,110,32,60,32,40,105,110,116,41,32,40,115,105,122,101,111,102,40,115,116,98,105,95,95,98,109,97,115,107,41,47,115,105,122,101,111,102,40,42,115,116,98,105,95,95,98,109,97,115,107,41,41,0,115,116,98,105,95,95,101,120,116,101,110,100,95,114,101,99,101,105,118,101,0,40,40,40,106,45,62,99,111,100,101,95,98,117,102,102,101,114,41,32,62,62,32,40,51,50,32,45,32,104,45,62,115,105,122,101,91,99,93,41,41,32,38,32,115,116,98,105,95,95,98,109,97,115,107,91,104,45,62,115,105,122,101,91,99,93,93,41,32,61,61,32,104,45,62,99,111,100,101,91,99,93,0,115,116,98,105,95,95,106,112,101,103,95,104,117,102,102,95,100,101,99,111,100,101,0,98,97,100,32,83,79,83,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,98,97,100,32,83,79,83,32,108,101,110,0,98,97,100,32,68,67,32,104,117,102,102,0,98,97,100,32,65,67,32,104,117,102,102,0,98,97,100,32,83,79,83,0,114,116,0,91,37,115,93,32,70,78,84,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,108,105,110,101,72,101,105,103,104,116,0,108,105,110,101,72,101,105,103,104,116,61,37,105,32,98,97,115,101,61,37,105,32,115,99,97,108,101,87,61,37,105,32,115,99,97,108,101,72,61,37,105,0,91,37,115,93,32,70,111,110,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,115,99,97,108,101,58,32,37,105,120,37,105,0,102,105,108,101,0,102,105,108,101,61,34,37,49,50,56,91,94,34,93,34,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,102,105,108,101,110,97,109,101,58,32,37,115,0,99,111,117,110,116,0,99,111,117,110,116,61,37,105,0,91,37,115,93,32,70,111,110,116,32,110,117,109,32,99,104,97,114,115,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,108,111,97,100,105,110,103,32,112,97,116,104,58,32,37,115,0,99,104,97,114,32,105,100,61,37,105,32,120,61,37,105,32,121,61,37,105,32,119,105,100,116,104,61,37,105,32,104,101,105,103,104,116,61,37,105,32,120,111,102,102,115,101,116,61,37,105,32,121,111,102,102,115,101,116,61,37,105,32,120,97,100,118,97,110,99,101,61,37,105,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,114,98,0,91,37,115,93,32,114,66,77,70,32,102,111,110,116,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,91,37,115,93,32,76,111,97,100,105,110,103,32,114,66,77,70,32,102,105,108,101,44,32,115,105,122,101,58,32,37,105,120,37,105,44,32,110,117,109,67,104,97,114,115,58,32,37,105,44,32,99,104,97,114,72,101,105,103,104,116,58,32,37,105,0,91,37,115,93,32,73,109,97,103,101,32,114,101,99,111,110,115,116,114,117,99,116,101,100,32,99,111,114,114,101,99,116,108,121,44,32,110,111,119,32,99,111,110,118,101,114,116,105,110,103,32,105,116,32,116,111,32,116,101,120,116,117,114,101,0,91,37,115,93,32,114,66,77,70,32,102,105,108,101,32,108,111,97,100,101,100,32,99,111,114,114,101,99,116,108,121,32,97,115,32,83,112,114,105,116,101,70,111,110,116,0,122,45,62,100,105,114,101,99,116,105,111,110,0,115,116,98,116,116,95,95,114,97,115,116,101,114,105,122,101,95,115,111,114,116,101,100,95,101,100,103,101,115,0,122,45,62,101,121,32,62,61,32,115,99,97,110,95,121,95,116,111,112,0,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,115,116,98,116,116,95,95,102,105,108,108,95,97,99,116,105,118,101,95,101,100,103,101,115,95,110,101,119,0,101,45,62,115,121,32,60,61,32,121,95,98,111,116,116,111,109,32,38,38,32,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,120,32,62,61,32,48,32,38,38,32,120,32,60,32,108,101,110,0,102,97,98,115,40,97,114,101,97,41,32,60,61,32,49,46,48,49,102,0,121,48,32,60,32,121,49,0,115,116,98,116,116,95,95,104,97,110,100,108,101,95,99,108,105,112,112,101,100,95,101,100,103,101,0,101,45,62,115,121,32,60,61,32,101,45,62,101,121,0,120,49,32,60,61,32,120,43,49,0,120,49,32,62,61,32,120,0,120,49,32,60,61,32,120,0,120,49,32,62,61,32,120,43,49,0,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,120,48,32,62,61,32,120,32,38,38,32,120,48,32,60,61,32,120,43,49,32,38,38,32,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,122,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,115,116,98,116,116,95,95,110,101,119,95,97,99,116,105,118,101,0,91,86,65,79,32,73,68,32,37,105,93,32,76,105,110,101,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,76,105,110,101,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,65,79,32,73,68,32,37,105,93,32,84,114,105,97,110,103,108,101,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,84,114,105,97,110,103,108,101,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,65,79,32,73,68,32,37,105,93,32,81,117,97,100,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,81,117,97,100,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,67,80,85,32,98,117,102,102,101,114,115,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,78,111,114,109,97,108,59,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,10,125,32,32,32,32,32,32], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+11910); /* memory initializer */ allocate([32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,105,109,112,108,101,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,105,109,112,108,101,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,84,105,110,116,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,102,114,97,103,84,105,110,116,67,111,108,111,114,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,67,111,108,111,114,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,114,119,97], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+22150); /* memory initializer */ allocate([17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,46,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+29981); /* no memory initializer */ var tempDoublePtr = Runtime.alignMemory(allocate(12, "i8", ALLOC_STATIC), 8); assert(tempDoublePtr % 8 == 0); function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much HEAP8[tempDoublePtr] = HEAP8[ptr]; HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; } function copyTempDouble(ptr) { HEAP8[tempDoublePtr] = HEAP8[ptr]; HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; } // {{PRE_LIBRARY}} var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},packAlignment:4,unpackAlignment:4,init:function () { GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE); for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) { GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1); } },recordError:function recordError(errorCode) { if (!GL.lastError) { GL.lastError = errorCode; } },getNewId:function (table) { var ret = GL.counter++; for (var i = table.length; i < ret; i++) { table[i] = null; } return ret; },MINI_TEMP_BUFFER_SIZE:16,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) { var source = ''; for (var i = 0; i < count; ++i) { var frag; if (length) { var len = HEAP32[(((length)+(i*4))>>2)]; if (len < 0) { frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); } else { frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len); } } else { frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); } source += frag; } return source; },createContext:function (canvas, webGLContextAttributes) { if (typeof webGLContextAttributes.majorVersion === 'undefined' && typeof webGLContextAttributes.minorVersion === 'undefined') { webGLContextAttributes.majorVersion = 1; webGLContextAttributes.minorVersion = 0; } var ctx; var errorInfo = '?'; function onContextCreationError(event) { errorInfo = event.statusMessage || errorInfo; } try { canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false); try { if (webGLContextAttributes.majorVersion == 1 && webGLContextAttributes.minorVersion == 0) { ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes); } else if (webGLContextAttributes.majorVersion == 2 && webGLContextAttributes.minorVersion == 0) { ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes); } else { throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!' } } finally { canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false); } if (!ctx) throw ':('; } catch (e) { Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]); return 0; } // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx); if (!ctx) return 0; return GL.registerContext(ctx, webGLContextAttributes); },registerContext:function (ctx, webGLContextAttributes) { var handle = GL.getNewId(GL.contexts); var context = { handle: handle, version: webGLContextAttributes.majorVersion, GLctx: ctx }; // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. if (ctx.canvas) ctx.canvas.GLctxObject = context; GL.contexts[handle] = context; if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) { GL.initExtensions(context); } return handle; },makeContextCurrent:function (contextHandle) { var context = GL.contexts[contextHandle]; if (!context) return false; GLctx = Module.ctx = context.GLctx; // Active WebGL context object. GL.currentContext = context; // Active Emscripten GL layer context object. return true; },getContext:function (contextHandle) { return GL.contexts[contextHandle]; },deleteContext:function (contextHandle) { if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. GL.contexts[contextHandle] = null; },initExtensions:function (context) { // If this function is called without a specific context object, init the extensions of the currently active context. if (!context) context = GL.currentContext; if (context.initExtensionsDone) return; context.initExtensionsDone = true; var GLctx = context.GLctx; context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS); // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. if (context.version < 2) { // Extension available from Firefox 26 and Google Chrome 30 var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays'); if (instancedArraysExt) { GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); }; GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); }; GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; } // Extension available from Firefox 25 and WebKit var vaoExt = GLctx.getExtension('OES_vertex_array_object'); if (vaoExt) { GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); }; GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); }; GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); }; GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); }; } var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers'); if (drawBuffersExt) { GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); }; } } // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working. // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions // here, as long as they don't produce a performance impact for users that might not be using those extensions. // E.g. debugging-related extensions should probably be off by default. var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays", "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc", "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources", "EXT_shader_texture_lod" ]; function shouldEnableAutomatically(extension) { var ret = false; automaticallyEnabledExtensions.forEach(function(include) { if (ext.indexOf(include) != -1) { ret = true; } }); return ret; } var exts = GLctx.getSupportedExtensions(); if (exts && exts.length > 0) { GLctx.getSupportedExtensions().forEach(function(ext) { if (automaticallyEnabledExtensions.indexOf(ext) != -1) { GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled. } }); } },populateUniformTable:function (program) { var p = GL.programs[program]; GL.programInfos[program] = { uniforms: {}, maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway. maxAttributeLength: -1 // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet. }; var ptable = GL.programInfos[program]; var utable = ptable.uniforms; // A program's uniform table maps the string name of an uniform to an integer location of that uniform. // The global GL.uniforms map maps integer locations to WebGLUniformLocations. var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS); for (var i = 0; i < numUniforms; ++i) { var u = GLctx.getActiveUniform(p, i); var name = u.name; ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1); // Strip off any trailing array specifier we might have got, e.g. "[0]". if (name.indexOf(']', name.length-1) !== -1) { var ls = name.lastIndexOf('['); name = name.slice(0, ls); } // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i. // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices. var loc = GLctx.getUniformLocation(p, name); var id = GL.getNewId(GL.uniforms); utable[name] = [u.size, id]; GL.uniforms[id] = loc; for (var j = 1; j < u.size; ++j) { var n = name + '['+j+']'; loc = GLctx.getUniformLocation(p, n); id = GL.getNewId(GL.uniforms); GL.uniforms[id] = loc; } } }};function _emscripten_glIsRenderbuffer(renderbuffer) { var rb = GL.renderbuffers[renderbuffer]; if (!rb) return 0; return GLctx.isRenderbuffer(rb); } function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx.stencilMaskSeparate(x0, x1) } var _ceilf=Math_ceil; function _emscripten_get_now() { if (!_emscripten_get_now.actual) { if (ENVIRONMENT_IS_NODE) { _emscripten_get_now.actual = function _emscripten_get_now_actual() { var t = process['hrtime'](); return t[0] * 1e3 + t[1] / 1e6; } } else if (typeof dateNow !== 'undefined') { _emscripten_get_now.actual = dateNow; } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') { _emscripten_get_now.actual = function _emscripten_get_now_actual() { return self['performance']['now'](); }; } else if (typeof performance === 'object' && typeof performance['now'] === 'function') { _emscripten_get_now.actual = function _emscripten_get_now_actual() { return performance['now'](); }; } else { _emscripten_get_now.actual = Date.now; } } return _emscripten_get_now.actual(); }var GLFW={Window:function (id, width, height, title, monitor, share) { this.id = id; this.x = 0; this.y = 0; this.storedX = 0; // Used to store X before fullscreen this.storedY = 0; // Used to store Y before fullscreen this.width = width; this.height = height; this.storedWidth = width; // Used to store width before fullscreen this.storedHeight = height; // Used to store height before fullscreen this.title = title; this.monitor = monitor; this.share = share; this.attributes = GLFW.hints; this.inputModes = { 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL) 0x00033002:0, // GLFW_STICKY_KEYS 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS }; this.buttons = 0; this.keys = new Array(); this.shouldClose = 0; this.title = null; this.windowPosFunc = null; // GLFWwindowposfun this.windowSizeFunc = null; // GLFWwindowsizefun this.windowCloseFunc = null; // GLFWwindowclosefun this.windowRefreshFunc = null; // GLFWwindowrefreshfun this.windowFocusFunc = null; // GLFWwindowfocusfun this.windowIconifyFunc = null; // GLFWwindowiconifyfun this.framebufferSizeFunc = null; // GLFWframebuffersizefun this.mouseButtonFunc = null; // GLFWmousebuttonfun this.cursorPosFunc = null; // GLFWcursorposfun this.cursorEnterFunc = null; // GLFWcursorenterfun this.scrollFunc = null; // GLFWscrollfun this.keyFunc = null; // GLFWkeyfun this.charFunc = null; // GLFWcharfun this.userptr = null; },WindowFromId:function (id) { if (id <= 0 || !GLFW.windows) return null; return GLFW.windows[id - 1]; },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) { switch (keycode) { case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0 case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1 case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2 case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3 case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4 case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5 case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6 case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7 case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8 case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9 case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON case 0x61:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1 case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2 case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3 case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4 case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5 case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6 case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7 case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8 case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9 case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10 case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11 case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12 case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13 case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14 case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15 case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16 case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17 case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18 case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19 case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20 case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21 case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22 case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23 case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24 case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25 case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0 case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1 case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2 case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3 case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4 case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5 case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6 case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7 case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8 case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9 case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT) // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT) case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT) // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT) // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT) // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT) case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these? default:return -1; // GLFW_KEY_UNKNOWN }; },getModBits:function (win) { var mod = 0; if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER return mod; },onKeyPress:function (event) { if (!GLFW.active || !GLFW.active.charFunc) return; // correct unicode charCode is only available with onKeyPress event var charCode = event.charCode; if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return; Runtime.dynCall('vii', GLFW.active.charFunc, [GLFW.active.id, charCode]); },onKeyChanged:function (event, status) { if (!GLFW.active) return; var key = GLFW.DOMToGLFWKeyCode(event.keyCode); if (key == -1) return; GLFW.active.keys[key] = status; if (!GLFW.active.keyFunc) return; Runtime.dynCall('viiiii', GLFW.active.keyFunc, [GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active)]); },onKeydown:function (event) { GLFW.onKeyChanged(event, 1); // GLFW_PRESS // This logic comes directly from the sdl implementation. We cannot // call preventDefault on all keydown events otherwise onKeyPress will // not get called if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) { event.preventDefault(); } },onKeyup:function (event) { GLFW.onKeyChanged(event, 0); // GLFW_RELEASE },onMousemove:function (event) { if (!GLFW.active) return; Browser.calculateMouseEvent(event); if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return; Runtime.dynCall('vidd', GLFW.active.cursorPosFunc, [GLFW.active.id, Browser.mouseX, Browser.mouseY]); },onMouseButtonChanged:function (event, status) { if (!GLFW.active || !GLFW.active.mouseButtonFunc) return; Browser.calculateMouseEvent(event); if (event.target != Module["canvas"]) return; if (status == 1) { // GLFW_PRESS try { event.target.setCapture(); } catch (e) {} } // DOM and glfw have different button codes var eventButton = event['button']; if (eventButton > 0) { if (eventButton == 1) { eventButton = 2; } else { eventButton = 1; } } Runtime.dynCall('viiii', GLFW.active.mouseButtonFunc, [GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)]); },onMouseButtonDown:function (event) { if (!GLFW.active) return; GLFW.active.buttons |= (1 << event['button']); GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS },onMouseButtonUp:function (event) { if (!GLFW.active) return; GLFW.active.buttons &= ~(1 << event['button']); GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE },onMouseWheel:function (event) { // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up) var delta = -Browser.getMouseWheelDelta(event); delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1. GLFW.wheelPos += delta; if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return; var sx = 0; var sy = 0; if (event.type == 'mousewheel') { sx = event.wheelDeltaX; sy = event.wheelDeltaY; } else { sx = event.deltaX; sy = event.deltaY; } Runtime.dynCall('vidd', GLFW.active.scrollFunc, [GLFW.active.id, sx, sy]); event.preventDefault(); },onFullScreenEventChange:function () { if (!GLFW.active) return; if (document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) { GLFW.active.storedX = GLFW.active.x; GLFW.active.storedY = GLFW.active.y; GLFW.active.storedWidth = GLFW.active.width; GLFW.active.storedHeight = GLFW.active.height; GLFW.active.x = GLFW.active.y = 0; GLFW.active.width = screen.width; GLFW.active.height = screen.height; } else { GLFW.active.x = GLFW.active.storedX; GLFW.active.y = GLFW.active.storedY; GLFW.active.width = GLFW.active.storedWidth; GLFW.active.height = GLFW.active.storedHeight; } Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions if (!GLFW.active.windowSizeFunc) return; Runtime.dynCall('viii', GLFW.active.windowSizeFunc, [GLFW.active.id, GLFW.active.width, GLFW.active.height]); },requestFullScreen:function () { var RFS = Module["canvas"]['requestFullscreen'] || Module["canvas"]['requestFullScreen'] || Module["canvas"]['mozRequestFullScreen'] || Module["canvas"]['webkitRequestFullScreen'] || (function() {}); RFS.apply(Module["canvas"], []); },cancelFullScreen:function () { var CFS = document['exitFullscreen'] || document['cancelFullScreen'] || document['mozCancelFullScreen'] || document['webkitCancelFullScreen'] || (function() {}); CFS.apply(document, []); },getTime:function () { return _emscripten_get_now() / 1000; },setWindowTitle:function (winid, title) { var win = GLFW.WindowFromId(winid); if (!win) return; win.title = Pointer_stringify(title); if (GLFW.active.id == win.id) { document.title = win.title; } },setKeyCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.keyFunc = cbfun; },setCharCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.charFunc = cbfun; },setMouseButtonCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.mouseButtonFunc = cbfun; },setCursorPosCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.cursorPosFunc = cbfun; },setScrollCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.scrollFunc = cbfun; },setWindowSizeCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowSizeFunc = cbfun; },setWindowCloseCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowCloseFunc = cbfun; },setWindowRefreshCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowRefreshFunc = cbfun; },getKey:function (winid, key) { var win = GLFW.WindowFromId(winid); if (!win) return 0; return win.keys[key]; },getMouseButton:function (winid, button) { var win = GLFW.WindowFromId(winid); if (!win) return 0; return (win.buttons & (1 << button)) > 0; },getCursorPos:function (winid, x, y) { setValue(x, Browser.mouseX, 'double'); setValue(y, Browser.mouseY, 'double'); },getMousePos:function (winid, x, y) { setValue(x, Browser.mouseX, 'i32'); setValue(y, Browser.mouseY, 'i32'); },setCursorPos:function (winid, x, y) { },getWindowPos:function (winid, x, y) { var wx = 0; var wy = 0; var win = GLFW.WindowFromId(winid); if (win) { wx = win.x; wy = win.y; } setValue(x, wx, 'i32'); setValue(y, wy, 'i32'); },setWindowPos:function (winid, x, y) { var win = GLFW.WindowFromId(winid); if (!win) return; win.x = x; win.y = y; },getWindowSize:function (winid, width, height) { var ww = 0; var wh = 0; var win = GLFW.WindowFromId(winid); if (win) { ww = win.width; wh = win.height; } setValue(width, ww, 'i32'); setValue(height, wh, 'i32'); },setWindowSize:function (winid, width, height) { var win = GLFW.WindowFromId(winid); if (!win) return; if (GLFW.active.id == win.id) { if (width == screen.width && height == screen.height) { GLFW.requestFullScreen(); } else { GLFW.cancelFullScreen(); Browser.setCanvasSize(width, height); win.width = width; win.height = height; } } if (!win.windowResizeFunc) return; Runtime.dynCall('viii', win.windowResizeFunc, [win.id, width, height]); },createWindow:function (width, height, title, monitor, share) { var i, id; for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++); if (i > 0) throw "glfwCreateWindow only supports one window at time currently"; // id for window id = i + 1; // not valid if (width <= 0 || height <= 0) return 0; if (monitor) { GLFW.requestFullScreen(); } else { Browser.setCanvasSize(width, height); } // Create context when there are no existing alive windows for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++); if (i == GLFW.windows.length) { var contextAttributes = { antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS stencil: (GLFW.hints[0x00021006] > 0) // GLFW_STENCIL_BITS } Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes); } // If context creation failed, do not return a valid window if (!Module.ctx) return 0; // Get non alive id var win = new GLFW.Window(id, width, height, title, monitor, share); // Set window to array if (id - 1 == GLFW.windows.length) { GLFW.windows.push(win); } else { GLFW.windows[id - 1] = win; } GLFW.active = win; return win.id; },destroyWindow:function (winid) { var win = GLFW.WindowFromId(winid); if (!win) return; if (win.windowCloseFunc) Runtime.dynCall('vi', win.windowCloseFunc, [win.id]); GLFW.windows[win.id - 1] = null; if (GLFW.active.id == win.id) GLFW.active = null; // Destroy context when no alive windows for (var i = 0; i < GLFW.windows.length; i++) if (GLFW.windows[i] !== null) return; Module.ctx = Browser.destroyContext(Module['canvas'], true, true); },swapBuffers:function (winid) { },GLFW2ParamToGLFW3Param:function (param) { table = { 0x00030001:0, // GLFW_MOUSE_CURSOR 0x00030002:0, // GLFW_STICKY_KEYS 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS 0x00030004:0, // GLFW_SYSTEM_KEYS 0x00030005:0, // GLFW_KEY_REPEAT 0x00030006:0, // GLFW_AUTO_POLL_EVENTS 0x00020001:0, // GLFW_OPENED 0x00020002:0, // GLFW_ACTIVE 0x00020003:0, // GLFW_ICONIFIED 0x00020004:0, // GLFW_ACCELERATED 0x00020005:0x00021001, // GLFW_RED_BITS 0x00020006:0x00021002, // GLFW_GREEN_BITS 0x00020007:0x00021003, // GLFW_BLUE_BITS 0x00020008:0x00021004, // GLFW_ALPHA_BITS 0x00020009:0x00021005, // GLFW_DEPTH_BITS 0x0002000A:0x00021006, // GLFW_STENCIL_BITS 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS 0x00020011:0x0002100C, // GLFW_STEREO 0x00020012:0, // GLFW_WINDOW_NO_RESIZE 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE }; return table[param]; }};function _glfwGetVideoModes(monitor, count) { setValue(count, 0, 'i32'); return 0; } function _glLinkProgram(program) { GLctx.linkProgram(GL.programs[program]); GL.programInfos[program] = null; // uniforms no longer keep the same names after linking GL.populateUniformTable(program); } function _glBindTexture(target, texture) { GLctx.bindTexture(target, texture ? GL.textures[texture] : null); } function _emscripten_glStencilFunc(x0, x1, x2) { GLctx.stencilFunc(x0, x1, x2) } function _glGetString(name_) { if (GL.stringCache[name_]) return GL.stringCache[name_]; var ret; switch(name_) { case 0x1F00 /* GL_VENDOR */: case 0x1F01 /* GL_RENDERER */: case 0x1F02 /* GL_VERSION */: ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL); break; case 0x1F03 /* GL_EXTENSIONS */: var exts = GLctx.getSupportedExtensions(); var gl_exts = []; for (var i in exts) { gl_exts.push(exts[i]); gl_exts.push("GL_" + exts[i]); } ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); break; case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL); break; default: GL.recordError(0x0500/*GL_INVALID_ENUM*/); return 0; } GL.stringCache[name_] = ret; return ret; } function _emscripten_glUniform3iv(location, count, value) { location = GL.uniforms[location]; count *= 3; value = HEAP32.subarray((value)>>2,(value+count*4)>>2); GLctx.uniform3iv(location, value); } function _emscripten_glShaderSource(shader, count, string, length) { var source = GL.getSource(shader, count, string, length); GLctx.shaderSource(GL.shaders[shader], source); } function _emscripten_glReleaseShaderCompiler() { // NOP (as allowed by GLES 2.0 spec) } function _glfwSetScrollCallback(winid, cbfun) { GLFW.setScrollCallback(winid, cbfun); } function _emscripten_glTexParameterf(x0, x1, x2) { GLctx.texParameterf(x0, x1, x2) } function _emscripten_glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) } function _glCompileShader(shader) { GLctx.compileShader(GL.shaders[shader]); } var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86}; var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; function ___setErrNo(value) { if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; return value; } var PATH={splitPath:function (filename) { var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; return splitPathRe.exec(filename).slice(1); },normalizeArray:function (parts, allowAboveRoot) { // if the path tries to go above the root, `up` ends up > 0 var up = 0; for (var i = parts.length - 1; i >= 0; i--) { var last = parts[i]; if (last === '.') { parts.splice(i, 1); } else if (last === '..') { parts.splice(i, 1); up++; } else if (up) { parts.splice(i, 1); up--; } } // if the path is allowed to go above the root, restore leading ..s if (allowAboveRoot) { for (; up--; up) { parts.unshift('..'); } } return parts; },normalize:function (path) { var isAbsolute = path.charAt(0) === '/', trailingSlash = path.substr(-1) === '/'; // Normalize the path path = PATH.normalizeArray(path.split('/').filter(function(p) { return !!p; }), !isAbsolute).join('/'); if (!path && !isAbsolute) { path = '.'; } if (path && trailingSlash) { path += '/'; } return (isAbsolute ? '/' : '') + path; },dirname:function (path) { var result = PATH.splitPath(path), root = result[0], dir = result[1]; if (!root && !dir) { // No dirname whatsoever return '.'; } if (dir) { // It has a dirname, strip trailing slash dir = dir.substr(0, dir.length - 1); } return root + dir; },basename:function (path) { // EMSCRIPTEN return '/'' for '/', not an empty string if (path === '/') return '/'; var lastSlash = path.lastIndexOf('/'); if (lastSlash === -1) return path; return path.substr(lastSlash+1); },extname:function (path) { return PATH.splitPath(path)[3]; },join:function () { var paths = Array.prototype.slice.call(arguments, 0); return PATH.normalize(paths.join('/')); },join2:function (l, r) { return PATH.normalize(l + '/' + r); },resolve:function () { var resolvedPath = '', resolvedAbsolute = false; for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { var path = (i >= 0) ? arguments[i] : FS.cwd(); // Skip empty and invalid entries if (typeof path !== 'string') { throw new TypeError('Arguments to path.resolve must be strings'); } else if (!path) { return ''; // an invalid portion invalidates the whole thing } resolvedPath = path + '/' + resolvedPath; resolvedAbsolute = path.charAt(0) === '/'; } // At this point the path should be resolved to a full absolute path, but // handle relative paths to be safe (might happen when process.cwd() fails) resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { return !!p; }), !resolvedAbsolute).join('/'); return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; },relative:function (from, to) { from = PATH.resolve(from).substr(1); to = PATH.resolve(to).substr(1); function trim(arr) { var start = 0; for (; start < arr.length; start++) { if (arr[start] !== '') break; } var end = arr.length - 1; for (; end >= 0; end--) { if (arr[end] !== '') break; } if (start > end) return []; return arr.slice(start, end - start + 1); } var fromParts = trim(from.split('/')); var toParts = trim(to.split('/')); var length = Math.min(fromParts.length, toParts.length); var samePartsLength = length; for (var i = 0; i < length; i++) { if (fromParts[i] !== toParts[i]) { samePartsLength = i; break; } } var outputParts = []; for (var i = samePartsLength; i < fromParts.length; i++) { outputParts.push('..'); } outputParts = outputParts.concat(toParts.slice(samePartsLength)); return outputParts.join('/'); }}; var TTY={ttys:[],init:function () { // https://github.com/kripken/emscripten/pull/1555 // if (ENVIRONMENT_IS_NODE) { // // currently, FS.init does not distinguish if process.stdin is a file or TTY // // device, it always assumes it's a TTY device. because of this, we're forcing // // process.stdin to UTF8 encoding to at least make stdin reading compatible // // with text files until FS.init can be refactored. // process['stdin']['setEncoding']('utf8'); // } },shutdown:function () { // https://github.com/kripken/emscripten/pull/1555 // if (ENVIRONMENT_IS_NODE) { // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call // process['stdin']['pause'](); // } },register:function (dev, ops) { TTY.ttys[dev] = { input: [], output: [], ops: ops }; FS.registerDevice(dev, TTY.stream_ops); },stream_ops:{open:function (stream) { var tty = TTY.ttys[stream.node.rdev]; if (!tty) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } stream.tty = tty; stream.seekable = false; },close:function (stream) { // flush any pending line data stream.tty.ops.flush(stream.tty); },flush:function (stream) { stream.tty.ops.flush(stream.tty); },read:function (stream, buffer, offset, length, pos /* ignored */) { if (!stream.tty || !stream.tty.ops.get_char) { throw new FS.ErrnoError(ERRNO_CODES.ENXIO); } var bytesRead = 0; for (var i = 0; i < length; i++) { var result; try { result = stream.tty.ops.get_char(stream.tty); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } if (result === undefined && bytesRead === 0) { throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); } if (result === null || result === undefined) break; bytesRead++; buffer[offset+i] = result; } if (bytesRead) { stream.node.timestamp = Date.now(); } return bytesRead; },write:function (stream, buffer, offset, length, pos) { if (!stream.tty || !stream.tty.ops.put_char) { throw new FS.ErrnoError(ERRNO_CODES.ENXIO); } for (var i = 0; i < length; i++) { try { stream.tty.ops.put_char(stream.tty, buffer[offset+i]); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } } if (length) { stream.node.timestamp = Date.now(); } return i; }},default_tty_ops:{get_char:function (tty) { if (!tty.input.length) { var result = null; if (ENVIRONMENT_IS_NODE) { // we will read data by chunks of BUFSIZE var BUFSIZE = 256; var buf = new Buffer(BUFSIZE); var bytesRead = 0; var fd = process.stdin.fd; // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) var usingDevice = false; try { fd = fs.openSync('/dev/stdin', 'r'); usingDevice = true; } catch (e) {} bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); if (usingDevice) { fs.closeSync(fd); } if (bytesRead > 0) { result = buf.slice(0, bytesRead).toString('utf-8'); } else { result = null; } } else if (typeof window != 'undefined' && typeof window.prompt == 'function') { // Browser. result = window.prompt('Input: '); // returns null on cancel if (result !== null) { result += '\n'; } } else if (typeof readline == 'function') { // Command line. result = readline(); if (result !== null) { result += '\n'; } } if (!result) { return null; } tty.input = intArrayFromString(result, true); } return tty.input.shift(); },put_char:function (tty, val) { if (val === null || val === 10) { Module['print'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } else { if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. } },flush:function (tty) { if (tty.output && tty.output.length > 0) { Module['print'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } }},default_tty1_ops:{put_char:function (tty, val) { if (val === null || val === 10) { Module['printErr'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } else { if (val != 0) tty.output.push(val); } },flush:function (tty) { if (tty.output && tty.output.length > 0) { Module['printErr'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } }}}; var MEMFS={ops_table:null,mount:function (mount) { return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); },createNode:function (parent, name, mode, dev) { if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { // no supported throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (!MEMFS.ops_table) { MEMFS.ops_table = { dir: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, lookup: MEMFS.node_ops.lookup, mknod: MEMFS.node_ops.mknod, rename: MEMFS.node_ops.rename, unlink: MEMFS.node_ops.unlink, rmdir: MEMFS.node_ops.rmdir, readdir: MEMFS.node_ops.readdir, symlink: MEMFS.node_ops.symlink }, stream: { llseek: MEMFS.stream_ops.llseek } }, file: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: { llseek: MEMFS.stream_ops.llseek, read: MEMFS.stream_ops.read, write: MEMFS.stream_ops.write, allocate: MEMFS.stream_ops.allocate, mmap: MEMFS.stream_ops.mmap, msync: MEMFS.stream_ops.msync } }, link: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, readlink: MEMFS.node_ops.readlink }, stream: {} }, chrdev: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: FS.chrdev_stream_ops } }; } var node = FS.createNode(parent, name, mode, dev); if (FS.isDir(node.mode)) { node.node_ops = MEMFS.ops_table.dir.node; node.stream_ops = MEMFS.ops_table.dir.stream; node.contents = {}; } else if (FS.isFile(node.mode)) { node.node_ops = MEMFS.ops_table.file.node; node.stream_ops = MEMFS.ops_table.file.stream; node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.buffer.byteLength which gives the whole capacity. // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. node.contents = null; } else if (FS.isLink(node.mode)) { node.node_ops = MEMFS.ops_table.link.node; node.stream_ops = MEMFS.ops_table.link.stream; } else if (FS.isChrdev(node.mode)) { node.node_ops = MEMFS.ops_table.chrdev.node; node.stream_ops = MEMFS.ops_table.chrdev.stream; } node.timestamp = Date.now(); // add the new node to the parent if (parent) { parent.contents[name] = node; } return node; },getFileDataAsRegularArray:function (node) { if (node.contents && node.contents.subarray) { var arr = []; for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); return arr; // Returns a copy of the original data. } return node.contents; // No-op, the file contents are already in a JS array. Return as-is. },getFileDataAsTypedArray:function (node) { if (!node.contents) return new Uint8Array; if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. return new Uint8Array(node.contents); },expandFileStorage:function (node, newCapacity) { // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to // increase the size. if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { node.contents = MEMFS.getFileDataAsRegularArray(node); node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. } if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. var prevCapacity = node.contents ? node.contents.buffer.byteLength : 0; if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to // avoid overshooting the allocation cap by a very large margin. var CAPACITY_DOUBLING_MAX = 1024 * 1024; newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. var oldContents = node.contents; node.contents = new Uint8Array(newCapacity); // Allocate new storage. if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. return; } // Not using a typed array to back the file storage. Use a standard JS array instead. if (!node.contents && newCapacity > 0) node.contents = []; while (node.contents.length < newCapacity) node.contents.push(0); },resizeFileStorage:function (node, newSize) { if (node.usedBytes == newSize) return; if (newSize == 0) { node.contents = null; // Fully decommit when requesting a resize to zero. node.usedBytes = 0; return; } if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. var oldContents = node.contents; node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. if (oldContents) { node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. } node.usedBytes = newSize; return; } // Backing with a JS array. if (!node.contents) node.contents = []; if (node.contents.length > newSize) node.contents.length = newSize; else while (node.contents.length < newSize) node.contents.push(0); node.usedBytes = newSize; },node_ops:{getattr:function (node) { var attr = {}; // device numbers reuse inode numbers. attr.dev = FS.isChrdev(node.mode) ? node.id : 1; attr.ino = node.id; attr.mode = node.mode; attr.nlink = 1; attr.uid = 0; attr.gid = 0; attr.rdev = node.rdev; if (FS.isDir(node.mode)) { attr.size = 4096; } else if (FS.isFile(node.mode)) { attr.size = node.usedBytes; } else if (FS.isLink(node.mode)) { attr.size = node.link.length; } else { attr.size = 0; } attr.atime = new Date(node.timestamp); attr.mtime = new Date(node.timestamp); attr.ctime = new Date(node.timestamp); // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), // but this is not required by the standard. attr.blksize = 4096; attr.blocks = Math.ceil(attr.size / attr.blksize); return attr; },setattr:function (node, attr) { if (attr.mode !== undefined) { node.mode = attr.mode; } if (attr.timestamp !== undefined) { node.timestamp = attr.timestamp; } if (attr.size !== undefined) { MEMFS.resizeFileStorage(node, attr.size); } },lookup:function (parent, name) { throw FS.genericErrors[ERRNO_CODES.ENOENT]; },mknod:function (parent, name, mode, dev) { return MEMFS.createNode(parent, name, mode, dev); },rename:function (old_node, new_dir, new_name) { // if we're overwriting a directory at new_name, make sure it's empty. if (FS.isDir(old_node.mode)) { var new_node; try { new_node = FS.lookupNode(new_dir, new_name); } catch (e) { } if (new_node) { for (var i in new_node.contents) { throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); } } } // do the internal rewiring delete old_node.parent.contents[old_node.name]; old_node.name = new_name; new_dir.contents[new_name] = old_node; old_node.parent = new_dir; },unlink:function (parent, name) { delete parent.contents[name]; },rmdir:function (parent, name) { var node = FS.lookupNode(parent, name); for (var i in node.contents) { throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); } delete parent.contents[name]; },readdir:function (node) { var entries = ['.', '..'] for (var key in node.contents) { if (!node.contents.hasOwnProperty(key)) { continue; } entries.push(key); } return entries; },symlink:function (parent, newname, oldpath) { var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); node.link = oldpath; return node; },readlink:function (node) { if (!FS.isLink(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return node.link; }},stream_ops:{read:function (stream, buffer, offset, length, position) { var contents = stream.node.contents; if (position >= stream.node.usedBytes) return 0; var size = Math.min(stream.node.usedBytes - position, length); assert(size >= 0); if (size > 8 && contents.subarray) { // non-trivial, and typed array buffer.set(contents.subarray(position, position + size), offset); } else { for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; } return size; },write:function (stream, buffer, offset, length, position, canOwn) { if (!length) return 0; var node = stream.node; node.timestamp = Date.now(); if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? if (canOwn) { // Can we just reuse the buffer we are given? node.contents = buffer.subarray(offset, offset + length); node.usedBytes = length; return length; } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); node.usedBytes = length; return length; } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? node.contents.set(buffer.subarray(offset, offset + length), position); return length; } } // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. MEMFS.expandFileStorage(node, position+length); if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. else { for (var i = 0; i < length; i++) { node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. } } node.usedBytes = Math.max(node.usedBytes, position+length); return length; },llseek:function (stream, offset, whence) { var position = offset; if (whence === 1) { // SEEK_CUR. position += stream.position; } else if (whence === 2) { // SEEK_END. if (FS.isFile(stream.node.mode)) { position += stream.node.usedBytes; } } if (position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return position; },allocate:function (stream, offset, length) { MEMFS.expandFileStorage(stream.node, offset + length); stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); },mmap:function (stream, buffer, offset, length, position, prot, flags) { if (!FS.isFile(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } var ptr; var allocated; var contents = stream.node.contents; // Only make a new copy when MAP_PRIVATE is specified. if ( !(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer) ) { // We can't emulate MAP_SHARED when the file is not backed by the buffer // we're mapping to (e.g. the HEAP buffer). allocated = false; ptr = contents.byteOffset; } else { // Try to avoid unnecessary slices. if (position > 0 || position + length < stream.node.usedBytes) { if (contents.subarray) { contents = contents.subarray(position, position + length); } else { contents = Array.prototype.slice.call(contents, position, position + length); } } allocated = true; ptr = _malloc(length); if (!ptr) { throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); } buffer.set(contents, ptr); } return { ptr: ptr, allocated: allocated }; },msync:function (stream, buffer, offset, length, mmapFlags) { if (!FS.isFile(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } if (mmapFlags & 2) { // MAP_PRIVATE calls need not to be synced back to underlying fs return 0; } var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); // should we check if bytesWritten and length are the same? return 0; }}}; var IDBFS={dbs:{},indexedDB:function () { if (typeof indexedDB !== 'undefined') return indexedDB; var ret = null; if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; assert(ret, 'IDBFS used, but indexedDB not supported'); return ret; },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { // reuse all of the core MEMFS functionality return MEMFS.mount.apply(null, arguments); },syncfs:function (mount, populate, callback) { IDBFS.getLocalSet(mount, function(err, local) { if (err) return callback(err); IDBFS.getRemoteSet(mount, function(err, remote) { if (err) return callback(err); var src = populate ? remote : local; var dst = populate ? local : remote; IDBFS.reconcile(src, dst, callback); }); }); },getDB:function (name, callback) { // check the cache first var db = IDBFS.dbs[name]; if (db) { return callback(null, db); } var req; try { req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); } catch (e) { return callback(e); } req.onupgradeneeded = function(e) { var db = e.target.result; var transaction = e.target.transaction; var fileStore; if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); } else { fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); } if (!fileStore.indexNames.contains('timestamp')) { fileStore.createIndex('timestamp', 'timestamp', { unique: false }); } }; req.onsuccess = function() { db = req.result; // add to the cache IDBFS.dbs[name] = db; callback(null, db); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },getLocalSet:function (mount, callback) { var entries = {}; function isRealDir(p) { return p !== '.' && p !== '..'; }; function toAbsolute(root) { return function(p) { return PATH.join2(root, p); } }; var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); while (check.length) { var path = check.pop(); var stat; try { stat = FS.stat(path); } catch (e) { return callback(e); } if (FS.isDir(stat.mode)) { check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); } entries[path] = { timestamp: stat.mtime }; } return callback(null, { type: 'local', entries: entries }); },getRemoteSet:function (mount, callback) { var entries = {}; IDBFS.getDB(mount.mountpoint, function(err, db) { if (err) return callback(err); var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); transaction.onerror = function(e) { callback(this.error); e.preventDefault(); }; var store = transaction.objectStore(IDBFS.DB_STORE_NAME); var index = store.index('timestamp'); index.openKeyCursor().onsuccess = function(event) { var cursor = event.target.result; if (!cursor) { return callback(null, { type: 'remote', db: db, entries: entries }); } entries[cursor.primaryKey] = { timestamp: cursor.key }; cursor.continue(); }; }); },loadLocalEntry:function (path, callback) { var stat, node; try { var lookup = FS.lookupPath(path); node = lookup.node; stat = FS.stat(path); } catch (e) { return callback(e); } if (FS.isDir(stat.mode)) { return callback(null, { timestamp: stat.mtime, mode: stat.mode }); } else if (FS.isFile(stat.mode)) { // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. node.contents = MEMFS.getFileDataAsTypedArray(node); return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); } else { return callback(new Error('node type not supported')); } },storeLocalEntry:function (path, entry, callback) { try { if (FS.isDir(entry.mode)) { FS.mkdir(path, entry.mode); } else if (FS.isFile(entry.mode)) { FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true }); } else { return callback(new Error('node type not supported')); } FS.chmod(path, entry.mode); FS.utime(path, entry.timestamp, entry.timestamp); } catch (e) { return callback(e); } callback(null); },removeLocalEntry:function (path, callback) { try { var lookup = FS.lookupPath(path); var stat = FS.stat(path); if (FS.isDir(stat.mode)) { FS.rmdir(path); } else if (FS.isFile(stat.mode)) { FS.unlink(path); } } catch (e) { return callback(e); } callback(null); },loadRemoteEntry:function (store, path, callback) { var req = store.get(path); req.onsuccess = function(event) { callback(null, event.target.result); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },storeRemoteEntry:function (store, path, entry, callback) { var req = store.put(entry, path); req.onsuccess = function() { callback(null); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },removeRemoteEntry:function (store, path, callback) { var req = store.delete(path); req.onsuccess = function() { callback(null); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },reconcile:function (src, dst, callback) { var total = 0; var create = []; Object.keys(src.entries).forEach(function (key) { var e = src.entries[key]; var e2 = dst.entries[key]; if (!e2 || e.timestamp > e2.timestamp) { create.push(key); total++; } }); var remove = []; Object.keys(dst.entries).forEach(function (key) { var e = dst.entries[key]; var e2 = src.entries[key]; if (!e2) { remove.push(key); total++; } }); if (!total) { return callback(null); } var errored = false; var completed = 0; var db = src.type === 'remote' ? src.db : dst.db; var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); var store = transaction.objectStore(IDBFS.DB_STORE_NAME); function done(err) { if (err) { if (!done.errored) { done.errored = true; return callback(err); } return; } if (++completed >= total) { return callback(null); } }; transaction.onerror = function(e) { done(this.error); e.preventDefault(); }; // sort paths in ascending order so directory entries are created // before the files inside them create.sort().forEach(function (path) { if (dst.type === 'local') { IDBFS.loadRemoteEntry(store, path, function (err, entry) { if (err) return done(err); IDBFS.storeLocalEntry(path, entry, done); }); } else { IDBFS.loadLocalEntry(path, function (err, entry) { if (err) return done(err); IDBFS.storeRemoteEntry(store, path, entry, done); }); } }); // sort paths in descending order so files are deleted before their // parent directories remove.sort().reverse().forEach(function(path) { if (dst.type === 'local') { IDBFS.removeLocalEntry(path, done); } else { IDBFS.removeRemoteEntry(store, path, done); } }); }}; var NODEFS={isWindows:false,staticInit:function () { NODEFS.isWindows = !!process.platform.match(/^win/); },mount:function (mount) { assert(ENVIRONMENT_IS_NODE); return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); },createNode:function (parent, name, mode, dev) { if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var node = FS.createNode(parent, name, mode); node.node_ops = NODEFS.node_ops; node.stream_ops = NODEFS.stream_ops; return node; },getMode:function (path) { var stat; try { stat = fs.lstatSync(path); if (NODEFS.isWindows) { // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so // propagate write bits to execute bits. stat.mode = stat.mode | ((stat.mode & 146) >> 1); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } return stat.mode; },realPath:function (node) { var parts = []; while (node.parent !== node) { parts.push(node.name); node = node.parent; } parts.push(node.mount.opts.root); parts.reverse(); return PATH.join.apply(null, parts); },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) { flags &= ~0100000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. if (flags in NODEFS.flagsToPermissionStringMap) { return NODEFS.flagsToPermissionStringMap[flags]; } else { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } },node_ops:{getattr:function (node) { var path = NODEFS.realPath(node); var stat; try { stat = fs.lstatSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. // See http://support.microsoft.com/kb/140365 if (NODEFS.isWindows && !stat.blksize) { stat.blksize = 4096; } if (NODEFS.isWindows && !stat.blocks) { stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; } return { dev: stat.dev, ino: stat.ino, mode: stat.mode, nlink: stat.nlink, uid: stat.uid, gid: stat.gid, rdev: stat.rdev, size: stat.size, atime: stat.atime, mtime: stat.mtime, ctime: stat.ctime, blksize: stat.blksize, blocks: stat.blocks }; },setattr:function (node, attr) { var path = NODEFS.realPath(node); try { if (attr.mode !== undefined) { fs.chmodSync(path, attr.mode); // update the common node structure mode as well node.mode = attr.mode; } if (attr.timestamp !== undefined) { var date = new Date(attr.timestamp); fs.utimesSync(path, date, date); } if (attr.size !== undefined) { fs.truncateSync(path, attr.size); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },lookup:function (parent, name) { var path = PATH.join2(NODEFS.realPath(parent), name); var mode = NODEFS.getMode(path); return NODEFS.createNode(parent, name, mode); },mknod:function (parent, name, mode, dev) { var node = NODEFS.createNode(parent, name, mode, dev); // create the backing node for this in the fs root as well var path = NODEFS.realPath(node); try { if (FS.isDir(node.mode)) { fs.mkdirSync(path, node.mode); } else { fs.writeFileSync(path, '', { mode: node.mode }); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } return node; },rename:function (oldNode, newDir, newName) { var oldPath = NODEFS.realPath(oldNode); var newPath = PATH.join2(NODEFS.realPath(newDir), newName); try { fs.renameSync(oldPath, newPath); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },unlink:function (parent, name) { var path = PATH.join2(NODEFS.realPath(parent), name); try { fs.unlinkSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },rmdir:function (parent, name) { var path = PATH.join2(NODEFS.realPath(parent), name); try { fs.rmdirSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },readdir:function (node) { var path = NODEFS.realPath(node); try { return fs.readdirSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },symlink:function (parent, newName, oldPath) { var newPath = PATH.join2(NODEFS.realPath(parent), newName); try { fs.symlinkSync(oldPath, newPath); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },readlink:function (node) { var path = NODEFS.realPath(node); try { path = fs.readlinkSync(path); path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); return path; } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } }},stream_ops:{open:function (stream) { var path = NODEFS.realPath(stream.node); try { if (FS.isFile(stream.node.mode)) { stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags)); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },close:function (stream) { try { if (FS.isFile(stream.node.mode) && stream.nfd) { fs.closeSync(stream.nfd); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },read:function (stream, buffer, offset, length, position) { if (length === 0) return 0; // node errors on 0 length reads // FIXME this is terrible. var nbuffer = new Buffer(length); var res; try { res = fs.readSync(stream.nfd, nbuffer, 0, length, position); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES[e.code]); } if (res > 0) { for (var i = 0; i < res; i++) { buffer[offset + i] = nbuffer[i]; } } return res; },write:function (stream, buffer, offset, length, position) { // FIXME this is terrible. var nbuffer = new Buffer(buffer.subarray(offset, offset + length)); var res; try { res = fs.writeSync(stream.nfd, nbuffer, 0, length, position); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES[e.code]); } return res; },llseek:function (stream, offset, whence) { var position = offset; if (whence === 1) { // SEEK_CUR. position += stream.position; } else if (whence === 2) { // SEEK_END. if (FS.isFile(stream.node.mode)) { try { var stat = fs.fstatSync(stream.nfd); position += stat.size; } catch (e) { throw new FS.ErrnoError(ERRNO_CODES[e.code]); } } } if (position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return position; }}}; var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { assert(ENVIRONMENT_IS_WORKER); if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); var createdParents = {}; function ensureParent(path) { // return the parent node, creating subdirs as necessary var parts = path.split('/'); var parent = root; for (var i = 0; i < parts.length-1; i++) { var curr = parts.slice(0, i+1).join('/'); if (!createdParents[curr]) { createdParents[curr] = WORKERFS.createNode(parent, curr, WORKERFS.DIR_MODE, 0); } parent = createdParents[curr]; } return parent; } function base(path) { var parts = path.split('/'); return parts[parts.length-1]; } // We also accept FileList here, by using Array.prototype Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); }); (mount.opts["blobs"] || []).forEach(function(obj) { WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); }); (mount.opts["packages"] || []).forEach(function(pack) { pack['metadata'].files.forEach(function(file) { var name = file.filename.substr(1); // remove initial slash WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); }); }); return root; },createNode:function (parent, name, mode, dev, contents, mtime) { var node = FS.createNode(parent, name, mode); node.mode = mode; node.node_ops = WORKERFS.node_ops; node.stream_ops = WORKERFS.stream_ops; node.timestamp = (mtime || new Date).getTime(); assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); if (mode === WORKERFS.FILE_MODE) { node.size = contents.size; node.contents = contents; } else { node.size = 4096; node.contents = {}; } if (parent) { parent.contents[name] = node; } return node; },node_ops:{getattr:function (node) { return { dev: 1, ino: undefined, mode: node.mode, nlink: 1, uid: 0, gid: 0, rdev: undefined, size: node.size, atime: new Date(node.timestamp), mtime: new Date(node.timestamp), ctime: new Date(node.timestamp), blksize: 4096, blocks: Math.ceil(node.size / 4096), }; },setattr:function (node, attr) { if (attr.mode !== undefined) { node.mode = attr.mode; } if (attr.timestamp !== undefined) { node.timestamp = attr.timestamp; } },lookup:function (parent, name) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); },mknod:function (parent, name, mode, dev) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },rename:function (oldNode, newDir, newName) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },unlink:function (parent, name) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },rmdir:function (parent, name) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },readdir:function (node) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },symlink:function (parent, newName, oldPath) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },readlink:function (node) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); }},stream_ops:{read:function (stream, buffer, offset, length, position) { if (position >= stream.node.size) return 0; var chunk = stream.node.contents.slice(position, position + length); var ab = WORKERFS.reader.readAsArrayBuffer(chunk); buffer.set(new Uint8Array(ab), offset); return chunk.size; },write:function (stream, buffer, offset, length, position) { throw new FS.ErrnoError(ERRNO_CODES.EIO); },llseek:function (stream, offset, whence) { var position = offset; if (whence === 1) { // SEEK_CUR. position += stream.position; } else if (whence === 2) { // SEEK_END. if (FS.isFile(stream.node.mode)) { position += stream.node.size; } } if (position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return position; }}}; var _stdin=allocate(1, "i32*", ALLOC_STATIC); var _stdout=allocate(1, "i32*", ALLOC_STATIC); var _stderr=allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,handleFSError:function (e) { if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); return ___setErrNo(e.errno); },lookupPath:function (path, opts) { path = PATH.resolve(FS.cwd(), path); opts = opts || {}; if (!path) return { path: '', node: null }; var defaults = { follow_mount: true, recurse_count: 0 }; for (var key in defaults) { if (opts[key] === undefined) { opts[key] = defaults[key]; } } if (opts.recurse_count > 8) { // max recursive lookup of 8 throw new FS.ErrnoError(ERRNO_CODES.ELOOP); } // split the path var parts = PATH.normalizeArray(path.split('/').filter(function(p) { return !!p; }), false); // start at the root var current = FS.root; var current_path = '/'; for (var i = 0; i < parts.length; i++) { var islast = (i === parts.length-1); if (islast && opts.parent) { // stop resolving break; } current = FS.lookupNode(current, parts[i]); current_path = PATH.join2(current_path, parts[i]); // jump to the mount's root node if this is a mountpoint if (FS.isMountpoint(current)) { if (!islast || (islast && opts.follow_mount)) { current = current.mounted.root; } } // by default, lookupPath will not follow a symlink if it is the final path component. // setting opts.follow = true will override this behavior. if (!islast || opts.follow) { var count = 0; while (FS.isLink(current.mode)) { var link = FS.readlink(current_path); current_path = PATH.resolve(PATH.dirname(current_path), link); var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); current = lookup.node; if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). throw new FS.ErrnoError(ERRNO_CODES.ELOOP); } } } } return { path: current_path, node: current }; },getPath:function (node) { var path; while (true) { if (FS.isRoot(node)) { var mount = node.mount.mountpoint; if (!path) return mount; return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; } path = path ? node.name + '/' + path : node.name; node = node.parent; } },hashName:function (parentid, name) { var hash = 0; for (var i = 0; i < name.length; i++) { hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; } return ((parentid + hash) >>> 0) % FS.nameTable.length; },hashAddNode:function (node) { var hash = FS.hashName(node.parent.id, node.name); node.name_next = FS.nameTable[hash]; FS.nameTable[hash] = node; },hashRemoveNode:function (node) { var hash = FS.hashName(node.parent.id, node.name); if (FS.nameTable[hash] === node) { FS.nameTable[hash] = node.name_next; } else { var current = FS.nameTable[hash]; while (current) { if (current.name_next === node) { current.name_next = node.name_next; break; } current = current.name_next; } } },lookupNode:function (parent, name) { var err = FS.mayLookup(parent); if (err) { throw new FS.ErrnoError(err, parent); } var hash = FS.hashName(parent.id, name); for (var node = FS.nameTable[hash]; node; node = node.name_next) { var nodeName = node.name; if (node.parent.id === parent.id && nodeName === name) { return node; } } // if we failed to find it in the cache, call into the VFS return FS.lookup(parent, name); },createNode:function (parent, name, mode, rdev) { if (!FS.FSNode) { FS.FSNode = function(parent, name, mode, rdev) { if (!parent) { parent = this; // root node sets parent to itself } this.parent = parent; this.mount = parent.mount; this.mounted = null; this.id = FS.nextInode++; this.name = name; this.mode = mode; this.node_ops = {}; this.stream_ops = {}; this.rdev = rdev; }; FS.FSNode.prototype = {}; // compatibility var readMode = 292 | 73; var writeMode = 146; // NOTE we must use Object.defineProperties instead of individual calls to // Object.defineProperty in order to make closure compiler happy Object.defineProperties(FS.FSNode.prototype, { read: { get: function() { return (this.mode & readMode) === readMode; }, set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } }, write: { get: function() { return (this.mode & writeMode) === writeMode; }, set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } }, isFolder: { get: function() { return FS.isDir(this.mode); } }, isDevice: { get: function() { return FS.isChrdev(this.mode); } } }); } var node = new FS.FSNode(parent, name, mode, rdev); FS.hashAddNode(node); return node; },destroyNode:function (node) { FS.hashRemoveNode(node); },isRoot:function (node) { return node === node.parent; },isMountpoint:function (node) { return !!node.mounted; },isFile:function (mode) { return (mode & 61440) === 32768; },isDir:function (mode) { return (mode & 61440) === 16384; },isLink:function (mode) { return (mode & 61440) === 40960; },isChrdev:function (mode) { return (mode & 61440) === 8192; },isBlkdev:function (mode) { return (mode & 61440) === 24576; },isFIFO:function (mode) { return (mode & 61440) === 4096; },isSocket:function (mode) { return (mode & 49152) === 49152; },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { var flags = FS.flagModes[str]; if (typeof flags === 'undefined') { throw new Error('Unknown file open mode: ' + str); } return flags; },flagsToPermissionString:function (flag) { var perms = ['r', 'w', 'rw'][flag & 3]; if ((flag & 512)) { perms += 'w'; } return perms; },nodePermissions:function (node, perms) { if (FS.ignorePermissions) { return 0; } // return 0 if any user, group or owner bits are set. if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { return ERRNO_CODES.EACCES; } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { return ERRNO_CODES.EACCES; } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { return ERRNO_CODES.EACCES; } return 0; },mayLookup:function (dir) { var err = FS.nodePermissions(dir, 'x'); if (err) return err; if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; return 0; },mayCreate:function (dir, name) { try { var node = FS.lookupNode(dir, name); return ERRNO_CODES.EEXIST; } catch (e) { } return FS.nodePermissions(dir, 'wx'); },mayDelete:function (dir, name, isdir) { var node; try { node = FS.lookupNode(dir, name); } catch (e) { return e.errno; } var err = FS.nodePermissions(dir, 'wx'); if (err) { return err; } if (isdir) { if (!FS.isDir(node.mode)) { return ERRNO_CODES.ENOTDIR; } if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { return ERRNO_CODES.EBUSY; } } else { if (FS.isDir(node.mode)) { return ERRNO_CODES.EISDIR; } } return 0; },mayOpen:function (node, flags) { if (!node) { return ERRNO_CODES.ENOENT; } if (FS.isLink(node.mode)) { return ERRNO_CODES.ELOOP; } else if (FS.isDir(node.mode)) { if ((flags & 2097155) !== 0 || // opening for write (flags & 512)) { return ERRNO_CODES.EISDIR; } } return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { fd_start = fd_start || 0; fd_end = fd_end || FS.MAX_OPEN_FDS; for (var fd = fd_start; fd <= fd_end; fd++) { if (!FS.streams[fd]) { return fd; } } throw new FS.ErrnoError(ERRNO_CODES.EMFILE); },getStream:function (fd) { return FS.streams[fd]; },createStream:function (stream, fd_start, fd_end) { if (!FS.FSStream) { FS.FSStream = function(){}; FS.FSStream.prototype = {}; // compatibility Object.defineProperties(FS.FSStream.prototype, { object: { get: function() { return this.node; }, set: function(val) { this.node = val; } }, isRead: { get: function() { return (this.flags & 2097155) !== 1; } }, isWrite: { get: function() { return (this.flags & 2097155) !== 0; } }, isAppend: { get: function() { return (this.flags & 1024); } } }); } // clone it, so we can return an instance of FSStream var newStream = new FS.FSStream(); for (var p in stream) { newStream[p] = stream[p]; } stream = newStream; var fd = FS.nextfd(fd_start, fd_end); stream.fd = fd; FS.streams[fd] = stream; return stream; },closeStream:function (fd) { FS.streams[fd] = null; },chrdev_stream_ops:{open:function (stream) { var device = FS.getDevice(stream.node.rdev); // override node's stream ops with the device's stream.stream_ops = device.stream_ops; // forward the open call if (stream.stream_ops.open) { stream.stream_ops.open(stream); } },llseek:function () { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); }},major:function (dev) { return ((dev) >> 8); },minor:function (dev) { return ((dev) & 0xff); },makedev:function (ma, mi) { return ((ma) << 8 | (mi)); },registerDevice:function (dev, ops) { FS.devices[dev] = { stream_ops: ops }; },getDevice:function (dev) { return FS.devices[dev]; },getMounts:function (mount) { var mounts = []; var check = [mount]; while (check.length) { var m = check.pop(); mounts.push(m); check.push.apply(check, m.mounts); } return mounts; },syncfs:function (populate, callback) { if (typeof(populate) === 'function') { callback = populate; populate = false; } var mounts = FS.getMounts(FS.root.mount); var completed = 0; function done(err) { if (err) { if (!done.errored) { done.errored = true; return callback(err); } return; } if (++completed >= mounts.length) { callback(null); } }; // sync all mounts mounts.forEach(function (mount) { if (!mount.type.syncfs) { return done(null); } mount.type.syncfs(mount, populate, done); }); },mount:function (type, opts, mountpoint) { var root = mountpoint === '/'; var pseudo = !mountpoint; var node; if (root && FS.root) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } else if (!root && !pseudo) { var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); mountpoint = lookup.path; // use the absolute path node = lookup.node; if (FS.isMountpoint(node)) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } if (!FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } } var mount = { type: type, opts: opts, mountpoint: mountpoint, mounts: [] }; // create a root node for the fs var mountRoot = type.mount(mount); mountRoot.mount = mount; mount.root = mountRoot; if (root) { FS.root = mountRoot; } else if (node) { // set as a mountpoint node.mounted = mount; // add the new mount to the current mount's children if (node.mount) { node.mount.mounts.push(mount); } } return mountRoot; },unmount:function (mountpoint) { var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); if (!FS.isMountpoint(lookup.node)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } // destroy the nodes for this mount, and all its child mounts var node = lookup.node; var mount = node.mounted; var mounts = FS.getMounts(mount); Object.keys(FS.nameTable).forEach(function (hash) { var current = FS.nameTable[hash]; while (current) { var next = current.name_next; if (mounts.indexOf(current.mount) !== -1) { FS.destroyNode(current); } current = next; } }); // no longer a mountpoint node.mounted = null; // remove this mount from the child mounts var idx = node.mount.mounts.indexOf(mount); assert(idx !== -1); node.mount.mounts.splice(idx, 1); },lookup:function (parent, name) { return parent.node_ops.lookup(parent, name); },mknod:function (path, mode, dev) { var lookup = FS.lookupPath(path, { parent: true }); var parent = lookup.node; var name = PATH.basename(path); if (!name || name === '.' || name === '..') { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var err = FS.mayCreate(parent, name); if (err) { throw new FS.ErrnoError(err); } if (!parent.node_ops.mknod) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } return parent.node_ops.mknod(parent, name, mode, dev); },create:function (path, mode) { mode = mode !== undefined ? mode : 438 /* 0666 */; mode &= 4095; mode |= 32768; return FS.mknod(path, mode, 0); },mkdir:function (path, mode) { mode = mode !== undefined ? mode : 511 /* 0777 */; mode &= 511 | 512; mode |= 16384; return FS.mknod(path, mode, 0); },mkdev:function (path, mode, dev) { if (typeof(dev) === 'undefined') { dev = mode; mode = 438 /* 0666 */; } mode |= 8192; return FS.mknod(path, mode, dev); },symlink:function (oldpath, newpath) { if (!PATH.resolve(oldpath)) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } var lookup = FS.lookupPath(newpath, { parent: true }); var parent = lookup.node; if (!parent) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } var newname = PATH.basename(newpath); var err = FS.mayCreate(parent, newname); if (err) { throw new FS.ErrnoError(err); } if (!parent.node_ops.symlink) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } return parent.node_ops.symlink(parent, newname, oldpath); },rename:function (old_path, new_path) { var old_dirname = PATH.dirname(old_path); var new_dirname = PATH.dirname(new_path); var old_name = PATH.basename(old_path); var new_name = PATH.basename(new_path); // parents must exist var lookup, old_dir, new_dir; try { lookup = FS.lookupPath(old_path, { parent: true }); old_dir = lookup.node; lookup = FS.lookupPath(new_path, { parent: true }); new_dir = lookup.node; } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); // need to be part of the same mount if (old_dir.mount !== new_dir.mount) { throw new FS.ErrnoError(ERRNO_CODES.EXDEV); } // source must exist var old_node = FS.lookupNode(old_dir, old_name); // old path should not be an ancestor of the new path var relative = PATH.relative(old_path, new_dirname); if (relative.charAt(0) !== '.') { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } // new path should not be an ancestor of the old path relative = PATH.relative(new_path, old_dirname); if (relative.charAt(0) !== '.') { throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); } // see if the new path already exists var new_node; try { new_node = FS.lookupNode(new_dir, new_name); } catch (e) { // not fatal } // early out if nothing needs to change if (old_node === new_node) { return; } // we'll need to delete the old entry var isdir = FS.isDir(old_node.mode); var err = FS.mayDelete(old_dir, old_name, isdir); if (err) { throw new FS.ErrnoError(err); } // need delete permissions if we'll be overwriting. // need create permissions if new doesn't already exist. err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name); if (err) { throw new FS.ErrnoError(err); } if (!old_dir.node_ops.rename) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } // if we are going to change the parent, check write permissions if (new_dir !== old_dir) { err = FS.nodePermissions(old_dir, 'w'); if (err) { throw new FS.ErrnoError(err); } } try { if (FS.trackingDelegate['willMovePath']) { FS.trackingDelegate['willMovePath'](old_path, new_path); } } catch(e) { console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); } // remove the node from the lookup hash FS.hashRemoveNode(old_node); // do the underlying fs rename try { old_dir.node_ops.rename(old_node, new_dir, new_name); } catch (e) { throw e; } finally { // add the node back to the hash (in case node_ops.rename // changed its name) FS.hashAddNode(old_node); } try { if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); } catch(e) { console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); } },rmdir:function (path) { var lookup = FS.lookupPath(path, { parent: true }); var parent = lookup.node; var name = PATH.basename(path); var node = FS.lookupNode(parent, name); var err = FS.mayDelete(parent, name, true); if (err) { throw new FS.ErrnoError(err); } if (!parent.node_ops.rmdir) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isMountpoint(node)) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } try { if (FS.trackingDelegate['willDeletePath']) { FS.trackingDelegate['willDeletePath'](path); } } catch(e) { console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); } parent.node_ops.rmdir(parent, name); FS.destroyNode(node); try { if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); } catch(e) { console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); } },readdir:function (path) { var lookup = FS.lookupPath(path, { follow: true }); var node = lookup.node; if (!node.node_ops.readdir) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } return node.node_ops.readdir(node); },unlink:function (path) { var lookup = FS.lookupPath(path, { parent: true }); var parent = lookup.node; var name = PATH.basename(path); var node = FS.lookupNode(parent, name); var err = FS.mayDelete(parent, name, false); if (err) { // POSIX says unlink should set EPERM, not EISDIR if (err === ERRNO_CODES.EISDIR) err = ERRNO_CODES.EPERM; throw new FS.ErrnoError(err); } if (!parent.node_ops.unlink) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isMountpoint(node)) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } try { if (FS.trackingDelegate['willDeletePath']) { FS.trackingDelegate['willDeletePath'](path); } } catch(e) { console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); } parent.node_ops.unlink(parent, name); FS.destroyNode(node); try { if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); } catch(e) { console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); } },readlink:function (path) { var lookup = FS.lookupPath(path); var link = lookup.node; if (!link) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } if (!link.node_ops.readlink) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); },stat:function (path, dontFollow) { var lookup = FS.lookupPath(path, { follow: !dontFollow }); var node = lookup.node; if (!node) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } if (!node.node_ops.getattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } return node.node_ops.getattr(node); },lstat:function (path) { return FS.stat(path, true); },chmod:function (path, mode, dontFollow) { var node; if (typeof path === 'string') { var lookup = FS.lookupPath(path, { follow: !dontFollow }); node = lookup.node; } else { node = path; } if (!node.node_ops.setattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } node.node_ops.setattr(node, { mode: (mode & 4095) | (node.mode & ~4095), timestamp: Date.now() }); },lchmod:function (path, mode) { FS.chmod(path, mode, true); },fchmod:function (fd, mode) { var stream = FS.getStream(fd); if (!stream) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } FS.chmod(stream.node, mode); },chown:function (path, uid, gid, dontFollow) { var node; if (typeof path === 'string') { var lookup = FS.lookupPath(path, { follow: !dontFollow }); node = lookup.node; } else { node = path; } if (!node.node_ops.setattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } node.node_ops.setattr(node, { timestamp: Date.now() // we ignore the uid / gid for now }); },lchown:function (path, uid, gid) { FS.chown(path, uid, gid, true); },fchown:function (fd, uid, gid) { var stream = FS.getStream(fd); if (!stream) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } FS.chown(stream.node, uid, gid); },truncate:function (path, len) { if (len < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var node; if (typeof path === 'string') { var lookup = FS.lookupPath(path, { follow: true }); node = lookup.node; } else { node = path; } if (!node.node_ops.setattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EISDIR); } if (!FS.isFile(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var err = FS.nodePermissions(node, 'w'); if (err) { throw new FS.ErrnoError(err); } node.node_ops.setattr(node, { size: len, timestamp: Date.now() }); },ftruncate:function (fd, len) { var stream = FS.getStream(fd); if (!stream) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if ((stream.flags & 2097155) === 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } FS.truncate(stream.node, len); },utime:function (path, atime, mtime) { var lookup = FS.lookupPath(path, { follow: true }); var node = lookup.node; node.node_ops.setattr(node, { timestamp: Math.max(atime, mtime) }); },open:function (path, flags, mode, fd_start, fd_end) { if (path === "") { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; if ((flags & 64)) { mode = (mode & 4095) | 32768; } else { mode = 0; } var node; if (typeof path === 'object') { node = path; } else { path = PATH.normalize(path); try { var lookup = FS.lookupPath(path, { follow: !(flags & 131072) }); node = lookup.node; } catch (e) { // ignore } } // perhaps we need to create the node var created = false; if ((flags & 64)) { if (node) { // if O_CREAT and O_EXCL are set, error out if the node already exists if ((flags & 128)) { throw new FS.ErrnoError(ERRNO_CODES.EEXIST); } } else { // node doesn't exist, try to create it node = FS.mknod(path, mode, 0); created = true; } } if (!node) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } // can't truncate a device if (FS.isChrdev(node.mode)) { flags &= ~512; } // if asked only for a directory, then this must be one if ((flags & 65536) && !FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } // check permissions, if this is not a file we just created now (it is ok to // create and write to a file with read-only permissions; it is read-only // for later use) if (!created) { var err = FS.mayOpen(node, flags); if (err) { throw new FS.ErrnoError(err); } } // do truncation if necessary if ((flags & 512)) { FS.truncate(node, 0); } // we've already handled these, don't pass down to the underlying vfs flags &= ~(128 | 512); // register the stream with the filesystem var stream = FS.createStream({ node: node, path: FS.getPath(node), // we want the absolute path to the node flags: flags, seekable: true, position: 0, stream_ops: node.stream_ops, // used by the file family libc calls (fopen, fwrite, ferror, etc.) ungotten: [], error: false }, fd_start, fd_end); // call the new stream's open function if (stream.stream_ops.open) { stream.stream_ops.open(stream); } if (Module['logReadFiles'] && !(flags & 1)) { if (!FS.readFiles) FS.readFiles = {}; if (!(path in FS.readFiles)) { FS.readFiles[path] = 1; Module['printErr']('read file: ' + path); } } try { if (FS.trackingDelegate['onOpenFile']) { var trackingFlags = 0; if ((flags & 2097155) !== 1) { trackingFlags |= FS.tracking.openFlags.READ; } if ((flags & 2097155) !== 0) { trackingFlags |= FS.tracking.openFlags.WRITE; } FS.trackingDelegate['onOpenFile'](path, trackingFlags); } } catch(e) { console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); } return stream; },close:function (stream) { if (stream.getdents) stream.getdents = null; // free readdir state try { if (stream.stream_ops.close) { stream.stream_ops.close(stream); } } catch (e) { throw e; } finally { FS.closeStream(stream.fd); } },llseek:function (stream, offset, whence) { if (!stream.seekable || !stream.stream_ops.llseek) { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); } stream.position = stream.stream_ops.llseek(stream, offset, whence); stream.ungotten = []; return stream.position; },read:function (stream, buffer, offset, length, position) { if (length < 0 || position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if ((stream.flags & 2097155) === 1) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if (FS.isDir(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EISDIR); } if (!stream.stream_ops.read) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var seeking = true; if (typeof position === 'undefined') { position = stream.position; seeking = false; } else if (!stream.seekable) { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); } var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); if (!seeking) stream.position += bytesRead; return bytesRead; },write:function (stream, buffer, offset, length, position, canOwn) { if (length < 0 || position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if ((stream.flags & 2097155) === 0) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if (FS.isDir(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EISDIR); } if (!stream.stream_ops.write) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if (stream.flags & 1024) { // seek to the end before writing in append mode FS.llseek(stream, 0, 2); } var seeking = true; if (typeof position === 'undefined') { position = stream.position; seeking = false; } else if (!stream.seekable) { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); } var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); if (!seeking) stream.position += bytesWritten; try { if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); } catch(e) { console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); } return bytesWritten; },allocate:function (stream, offset, length) { if (offset < 0 || length <= 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if ((stream.flags & 2097155) === 0) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } if (!stream.stream_ops.allocate) { throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); } stream.stream_ops.allocate(stream, offset, length); },mmap:function (stream, buffer, offset, length, position, prot, flags) { // TODO if PROT is PROT_WRITE, make sure we have write access if ((stream.flags & 2097155) === 1) { throw new FS.ErrnoError(ERRNO_CODES.EACCES); } if (!stream.stream_ops.mmap) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); },msync:function (stream, buffer, offset, length, mmapFlags) { if (!stream || !stream.stream_ops.msync) { return 0; } return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); },munmap:function (stream) { return 0; },ioctl:function (stream, cmd, arg) { if (!stream.stream_ops.ioctl) { throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); } return stream.stream_ops.ioctl(stream, cmd, arg); },readFile:function (path, opts) { opts = opts || {}; opts.flags = opts.flags || 'r'; opts.encoding = opts.encoding || 'binary'; if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { throw new Error('Invalid encoding type "' + opts.encoding + '"'); } var ret; var stream = FS.open(path, opts.flags); var stat = FS.stat(path); var length = stat.size; var buf = new Uint8Array(length); FS.read(stream, buf, 0, length, 0); if (opts.encoding === 'utf8') { ret = UTF8ArrayToString(buf, 0); } else if (opts.encoding === 'binary') { ret = buf; } FS.close(stream); return ret; },writeFile:function (path, data, opts) { opts = opts || {}; opts.flags = opts.flags || 'w'; opts.encoding = opts.encoding || 'utf8'; if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { throw new Error('Invalid encoding type "' + opts.encoding + '"'); } var stream = FS.open(path, opts.flags, opts.mode); if (opts.encoding === 'utf8') { var buf = new Uint8Array(lengthBytesUTF8(data)+1); var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn); } else if (opts.encoding === 'binary') { FS.write(stream, data, 0, data.length, 0, opts.canOwn); } FS.close(stream); },cwd:function () { return FS.currentPath; },chdir:function (path) { var lookup = FS.lookupPath(path, { follow: true }); if (!FS.isDir(lookup.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } var err = FS.nodePermissions(lookup.node, 'x'); if (err) { throw new FS.ErrnoError(err); } FS.currentPath = lookup.path; },createDefaultDirectories:function () { FS.mkdir('/tmp'); FS.mkdir('/home'); FS.mkdir('/home/web_user'); },createDefaultDevices:function () { // create /dev FS.mkdir('/dev'); // setup /dev/null FS.registerDevice(FS.makedev(1, 3), { read: function() { return 0; }, write: function(stream, buffer, offset, length, pos) { return length; } }); FS.mkdev('/dev/null', FS.makedev(1, 3)); // setup /dev/tty and /dev/tty1 // stderr needs to print output using Module['printErr'] // so we register a second tty just for it. TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); FS.mkdev('/dev/tty', FS.makedev(5, 0)); FS.mkdev('/dev/tty1', FS.makedev(6, 0)); // setup /dev/[u]random var random_device; if (typeof crypto !== 'undefined') { // for modern web browsers var randomBuffer = new Uint8Array(1); random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; } else if (ENVIRONMENT_IS_NODE) { // for nodejs random_device = function() { return require('crypto').randomBytes(1)[0]; }; } else { // default for ES5 platforms random_device = function() { return (Math.random()*256)|0; }; } FS.createDevice('/dev', 'random', random_device); FS.createDevice('/dev', 'urandom', random_device); // we're not going to emulate the actual shm device, // just create the tmp dirs that reside in it commonly FS.mkdir('/dev/shm'); FS.mkdir('/dev/shm/tmp'); },createSpecialDirectories:function () { // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) FS.mkdir('/proc'); FS.mkdir('/proc/self'); FS.mkdir('/proc/self/fd'); FS.mount({ mount: function() { var node = FS.createNode('/proc/self', 'fd', 16384 | 0777, 73); node.node_ops = { lookup: function(parent, name) { var fd = +name; var stream = FS.getStream(fd); if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); var ret = { parent: null, mount: { mountpoint: 'fake' }, node_ops: { readlink: function() { return stream.path } } }; ret.parent = ret; // make it look like a simple root node return ret; } }; return node; } }, {}, '/proc/self/fd'); },createStandardStreams:function () { // TODO deprecate the old functionality of a single // input / output callback and that utilizes FS.createDevice // and instead require a unique set of stream ops // by default, we symlink the standard streams to the // default tty devices. however, if the standard streams // have been overwritten we create a unique device for // them instead. if (Module['stdin']) { FS.createDevice('/dev', 'stdin', Module['stdin']); } else { FS.symlink('/dev/tty', '/dev/stdin'); } if (Module['stdout']) { FS.createDevice('/dev', 'stdout', null, Module['stdout']); } else { FS.symlink('/dev/tty', '/dev/stdout'); } if (Module['stderr']) { FS.createDevice('/dev', 'stderr', null, Module['stderr']); } else { FS.symlink('/dev/tty1', '/dev/stderr'); } // open default streams for the stdin, stdout and stderr devices var stdin = FS.open('/dev/stdin', 'r'); assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); var stdout = FS.open('/dev/stdout', 'w'); assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); var stderr = FS.open('/dev/stderr', 'w'); assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); },ensureErrnoError:function () { if (FS.ErrnoError) return; FS.ErrnoError = function ErrnoError(errno, node) { //Module.printErr(stackTrace()); // useful for debugging this.node = node; this.setErrno = function(errno) { this.errno = errno; for (var key in ERRNO_CODES) { if (ERRNO_CODES[key] === errno) { this.code = key; break; } } }; this.setErrno(errno); this.message = ERRNO_MESSAGES[errno]; }; FS.ErrnoError.prototype = new Error(); FS.ErrnoError.prototype.constructor = FS.ErrnoError; // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) [ERRNO_CODES.ENOENT].forEach(function(code) { FS.genericErrors[code] = new FS.ErrnoError(code); FS.genericErrors[code].stack = ''; }); },staticInit:function () { FS.ensureErrnoError(); FS.nameTable = new Array(4096); FS.mount(MEMFS, {}, '/'); FS.createDefaultDirectories(); FS.createDefaultDevices(); FS.createSpecialDirectories(); FS.filesystems = { 'MEMFS': MEMFS, 'IDBFS': IDBFS, 'NODEFS': NODEFS, 'WORKERFS': WORKERFS, }; },init:function (input, output, error) { assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); FS.init.initialized = true; FS.ensureErrnoError(); // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here Module['stdin'] = input || Module['stdin']; Module['stdout'] = output || Module['stdout']; Module['stderr'] = error || Module['stderr']; FS.createStandardStreams(); },quit:function () { FS.init.initialized = false; // force-flush all streams, so we get musl std streams printed out var fflush = Module['_fflush']; if (fflush) fflush(0); // close all of our streams for (var i = 0; i < FS.streams.length; i++) { var stream = FS.streams[i]; if (!stream) { continue; } FS.close(stream); } },getMode:function (canRead, canWrite) { var mode = 0; if (canRead) mode |= 292 | 73; if (canWrite) mode |= 146; return mode; },joinPath:function (parts, forceRelative) { var path = PATH.join.apply(null, parts); if (forceRelative && path[0] == '/') path = path.substr(1); return path; },absolutePath:function (relative, base) { return PATH.resolve(base, relative); },standardizePath:function (path) { return PATH.normalize(path); },findObject:function (path, dontResolveLastLink) { var ret = FS.analyzePath(path, dontResolveLastLink); if (ret.exists) { return ret.object; } else { ___setErrNo(ret.error); return null; } },analyzePath:function (path, dontResolveLastLink) { // operate from within the context of the symlink's target try { var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); path = lookup.path; } catch (e) { } var ret = { isRoot: false, exists: false, error: 0, name: null, path: null, object: null, parentExists: false, parentPath: null, parentObject: null }; try { var lookup = FS.lookupPath(path, { parent: true }); ret.parentExists = true; ret.parentPath = lookup.path; ret.parentObject = lookup.node; ret.name = PATH.basename(path); lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); ret.exists = true; ret.path = lookup.path; ret.object = lookup.node; ret.name = lookup.node.name; ret.isRoot = lookup.path === '/'; } catch (e) { ret.error = e.errno; }; return ret; },createFolder:function (parent, name, canRead, canWrite) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); var mode = FS.getMode(canRead, canWrite); return FS.mkdir(path, mode); },createPath:function (parent, path, canRead, canWrite) { parent = typeof parent === 'string' ? parent : FS.getPath(parent); var parts = path.split('/').reverse(); while (parts.length) { var part = parts.pop(); if (!part) continue; var current = PATH.join2(parent, part); try { FS.mkdir(current); } catch (e) { // ignore EEXIST } parent = current; } return current; },createFile:function (parent, name, properties, canRead, canWrite) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); var mode = FS.getMode(canRead, canWrite); return FS.create(path, mode); },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; var mode = FS.getMode(canRead, canWrite); var node = FS.create(path, mode); if (data) { if (typeof data === 'string') { var arr = new Array(data.length); for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); data = arr; } // make sure we can write to the file FS.chmod(node, mode | 146); var stream = FS.open(node, 'w'); FS.write(stream, data, 0, data.length, 0, canOwn); FS.close(stream); FS.chmod(node, mode); } return node; },createDevice:function (parent, name, input, output) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); var mode = FS.getMode(!!input, !!output); if (!FS.createDevice.major) FS.createDevice.major = 64; var dev = FS.makedev(FS.createDevice.major++, 0); // Create a fake device that a set of stream ops to emulate // the old behavior. FS.registerDevice(dev, { open: function(stream) { stream.seekable = false; }, close: function(stream) { // flush any pending line data if (output && output.buffer && output.buffer.length) { output(10); } }, read: function(stream, buffer, offset, length, pos /* ignored */) { var bytesRead = 0; for (var i = 0; i < length; i++) { var result; try { result = input(); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } if (result === undefined && bytesRead === 0) { throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); } if (result === null || result === undefined) break; bytesRead++; buffer[offset+i] = result; } if (bytesRead) { stream.node.timestamp = Date.now(); } return bytesRead; }, write: function(stream, buffer, offset, length, pos) { for (var i = 0; i < length; i++) { try { output(buffer[offset+i]); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } } if (length) { stream.node.timestamp = Date.now(); } return i; } }); return FS.mkdev(path, mode, dev); },createLink:function (parent, name, target, canRead, canWrite) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); return FS.symlink(target, path); },forceLoadFile:function (obj) { if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; var success = true; if (typeof XMLHttpRequest !== 'undefined') { throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); } else if (Module['read']) { // Command-line. try { // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as // read() will try to parse UTF8. obj.contents = intArrayFromString(Module['read'](obj.url), true); obj.usedBytes = obj.contents.length; } catch (e) { success = false; } } else { throw new Error('Cannot load without read() or XMLHttpRequest.'); } if (!success) ___setErrNo(ERRNO_CODES.EIO); return success; },createLazyFile:function (parent, name, url, canRead, canWrite) { // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. function LazyUint8Array() { this.lengthKnown = false; this.chunks = []; // Loaded chunks. Index is the chunk number } LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { if (idx > this.length-1 || idx < 0) { return undefined; } var chunkOffset = idx % this.chunkSize; var chunkNum = (idx / this.chunkSize)|0; return this.getter(chunkNum)[chunkOffset]; } LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { this.getter = getter; } LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { // Find length var xhr = new XMLHttpRequest(); xhr.open('HEAD', url, false); xhr.send(null); if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); var datalength = Number(xhr.getResponseHeader("Content-length")); var header; var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; var chunkSize = 1024*1024; // Chunk size in bytes if (!hasByteServing) chunkSize = datalength; // Function to get a range from the remote URL. var doXHR = (function(from, to) { if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. var xhr = new XMLHttpRequest(); xhr.open('GET', url, false); if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); // Some hints to the browser that we want binary data. if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; if (xhr.overrideMimeType) { xhr.overrideMimeType('text/plain; charset=x-user-defined'); } xhr.send(null); if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); if (xhr.response !== undefined) { return new Uint8Array(xhr.response || []); } else { return intArrayFromString(xhr.responseText || '', true); } }); var lazyArray = this; lazyArray.setDataGetter(function(chunkNum) { var start = chunkNum * chunkSize; var end = (chunkNum+1) * chunkSize - 1; // including this byte end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { lazyArray.chunks[chunkNum] = doXHR(start, end); } if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); return lazyArray.chunks[chunkNum]; }); this._length = datalength; this._chunkSize = chunkSize; this.lengthKnown = true; } if (typeof XMLHttpRequest !== 'undefined') { if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; var lazyArray = new LazyUint8Array(); Object.defineProperty(lazyArray, "length", { get: function() { if(!this.lengthKnown) { this.cacheLength(); } return this._length; } }); Object.defineProperty(lazyArray, "chunkSize", { get: function() { if(!this.lengthKnown) { this.cacheLength(); } return this._chunkSize; } }); var properties = { isDevice: false, contents: lazyArray }; } else { var properties = { isDevice: false, url: url }; } var node = FS.createFile(parent, name, properties, canRead, canWrite); // This is a total hack, but I want to get this lazy file code out of the // core of MEMFS. If we want to keep this lazy file concept I feel it should // be its own thin LAZYFS proxying calls to MEMFS. if (properties.contents) { node.contents = properties.contents; } else if (properties.url) { node.contents = null; node.url = properties.url; } // Add a function that defers querying the file size until it is asked the first time. Object.defineProperty(node, "usedBytes", { get: function() { return this.contents.length; } }); // override each stream op with one that tries to force load the lazy file first var stream_ops = {}; var keys = Object.keys(node.stream_ops); keys.forEach(function(key) { var fn = node.stream_ops[key]; stream_ops[key] = function forceLoadLazyFile() { if (!FS.forceLoadFile(node)) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } return fn.apply(null, arguments); }; }); // use a custom read function stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { if (!FS.forceLoadFile(node)) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } var contents = stream.node.contents; if (position >= contents.length) return 0; var size = Math.min(contents.length - position, length); assert(size >= 0); if (contents.slice) { // normal array for (var i = 0; i < size; i++) { buffer[offset + i] = contents[position + i]; } } else { for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR buffer[offset + i] = contents.get(position + i); } } return size; }; node.stream_ops = stream_ops; return node; },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { Browser.init(); // TODO we should allow people to just pass in a complete filename instead // of parent and name being that we just join them anyways var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname function processData(byteArray) { function finish(byteArray) { if (preFinish) preFinish(); if (!dontCreateFile) { FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); } if (onload) onload(); removeRunDependency(dep); } var handled = false; Module['preloadPlugins'].forEach(function(plugin) { if (handled) return; if (plugin['canHandle'](fullname)) { plugin['handle'](byteArray, fullname, finish, function() { if (onerror) onerror(); removeRunDependency(dep); }); handled = true; } }); if (!handled) finish(byteArray); } addRunDependency(dep); if (typeof url == 'string') { Browser.asyncLoad(url, function(byteArray) { processData(byteArray); }, onerror); } else { processData(url); } },indexedDB:function () { return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; },DB_NAME:function () { return 'EM_FS_' + window.location.pathname; },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { onload = onload || function(){}; onerror = onerror || function(){}; var indexedDB = FS.indexedDB(); try { var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); } catch (e) { return onerror(e); } openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { console.log('creating db'); var db = openRequest.result; db.createObjectStore(FS.DB_STORE_NAME); }; openRequest.onsuccess = function openRequest_onsuccess() { var db = openRequest.result; var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); var files = transaction.objectStore(FS.DB_STORE_NAME); var ok = 0, fail = 0, total = paths.length; function finish() { if (fail == 0) onload(); else onerror(); } paths.forEach(function(path) { var putRequest = files.put(FS.analyzePath(path).object.contents, path); putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; }); transaction.onerror = onerror; }; openRequest.onerror = onerror; },loadFilesFromDB:function (paths, onload, onerror) { onload = onload || function(){}; onerror = onerror || function(){}; var indexedDB = FS.indexedDB(); try { var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); } catch (e) { return onerror(e); } openRequest.onupgradeneeded = onerror; // no database to load from openRequest.onsuccess = function openRequest_onsuccess() { var db = openRequest.result; try { var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); } catch(e) { onerror(e); return; } var files = transaction.objectStore(FS.DB_STORE_NAME); var ok = 0, fail = 0, total = paths.length; function finish() { if (fail == 0) onload(); else onerror(); } paths.forEach(function(path) { var getRequest = files.get(path); getRequest.onsuccess = function getRequest_onsuccess() { if (FS.analyzePath(path).exists) { FS.unlink(path); } FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); ok++; if (ok + fail == total) finish(); }; getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; }); transaction.onerror = onerror; }; openRequest.onerror = onerror; }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { if (path[0] !== '/') { // relative path var dir; if (dirfd === -100) { dir = FS.cwd(); } else { var dirstream = FS.getStream(dirfd); if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); dir = dirstream.path; } path = PATH.join2(dir, path); } return path; },doStat:function (func, path, buf) { try { var stat = func(path); } catch (e) { if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { // an error occurred while trying to look up the path; we should just report ENOTDIR return -ERRNO_CODES.ENOTDIR; } throw e; } HEAP32[((buf)>>2)]=stat.dev; HEAP32[(((buf)+(4))>>2)]=0; HEAP32[(((buf)+(8))>>2)]=stat.ino; HEAP32[(((buf)+(12))>>2)]=stat.mode; HEAP32[(((buf)+(16))>>2)]=stat.nlink; HEAP32[(((buf)+(20))>>2)]=stat.uid; HEAP32[(((buf)+(24))>>2)]=stat.gid; HEAP32[(((buf)+(28))>>2)]=stat.rdev; HEAP32[(((buf)+(32))>>2)]=0; HEAP32[(((buf)+(36))>>2)]=stat.size; HEAP32[(((buf)+(40))>>2)]=4096; HEAP32[(((buf)+(44))>>2)]=stat.blocks; HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; HEAP32[(((buf)+(52))>>2)]=0; HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; HEAP32[(((buf)+(60))>>2)]=0; HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; HEAP32[(((buf)+(68))>>2)]=0; HEAP32[(((buf)+(72))>>2)]=stat.ino; return 0; },doMsync:function (addr, stream, len, flags) { var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); FS.msync(stream, buffer, 0, len, flags); },doMkdir:function (path, mode) { // remove a trailing slash, if one - /a/b/ has basename of '', but // we want to create b in the context of this function path = PATH.normalize(path); if (path[path.length-1] === '/') path = path.substr(0, path.length-1); FS.mkdir(path, mode, 0); return 0; },doMknod:function (path, mode, dev) { // we don't want this in the JS API as it uses mknod to create all nodes. switch (mode & 61440) { case 32768: case 8192: case 24576: case 4096: case 49152: break; default: return -ERRNO_CODES.EINVAL; } FS.mknod(path, mode, dev); return 0; },doReadlink:function (path, buf, bufsize) { if (bufsize <= 0) return -ERRNO_CODES.EINVAL; var ret = FS.readlink(path); ret = ret.slice(0, Math.max(0, bufsize)); writeStringToMemory(ret, buf, true); return ret.length; },doAccess:function (path, amode) { if (amode & ~7) { // need a valid mode return -ERRNO_CODES.EINVAL; } var node; var lookup = FS.lookupPath(path, { follow: true }); node = lookup.node; var perms = ''; if (amode & 4) perms += 'r'; if (amode & 2) perms += 'w'; if (amode & 1) perms += 'x'; if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { return -ERRNO_CODES.EACCES; } return 0; },doDup:function (path, flags, suggestFD) { var suggest = FS.getStream(suggestFD); if (suggest) FS.close(suggest); return FS.open(path, flags, 0, suggestFD, suggestFD).fd; },doReadv:function (stream, iov, iovcnt, offset) { var ret = 0; for (var i = 0; i < iovcnt; i++) { var ptr = HEAP32[(((iov)+(i*8))>>2)]; var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; var curr = FS.read(stream, HEAP8,ptr, len, offset); if (curr < 0) return -1; ret += curr; if (curr < len) break; // nothing more to read } return ret; },doWritev:function (stream, iov, iovcnt, offset) { var ret = 0; for (var i = 0; i < iovcnt; i++) { var ptr = HEAP32[(((iov)+(i*8))>>2)]; var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; var curr = FS.write(stream, HEAP8,ptr, len, offset); if (curr < 0) return -1; ret += curr; } return ret; },varargs:0,get:function (varargs) { SYSCALLS.varargs += 4; var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; return ret; },getStr:function () { var ret = Pointer_stringify(SYSCALLS.get()); return ret; },getStreamFromFD:function () { var stream = FS.getStream(SYSCALLS.get()); if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); return stream; },getSocketFromFD:function () { var socket = SOCKFS.getSocket(SYSCALLS.get()); if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); return socket; },getSocketAddress:function (allowNull) { var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); if (allowNull && addrp === 0) return null; var info = __read_sockaddr(addrp, addrlen); if (info.errno) throw new FS.ErrnoError(info.errno); info.addr = DNS.lookup_addr(info.addr) || info.addr; return info; },get64:function () { var low = SYSCALLS.get(), high = SYSCALLS.get(); if (low >= 0) assert(high === 0); else assert(high === -1); return low; },getZero:function () { assert(SYSCALLS.get() === 0); }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; try { // ioctl var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); switch (op) { case 21505: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; return 0; } case 21506: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; return 0; // no-op, not actually adjusting terminal settings } case 21519: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; var argp = SYSCALLS.get(); HEAP32[((argp)>>2)]=0; return 0; } case 21520: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; return -ERRNO_CODES.EINVAL; // not supported } case 21531: { var argp = SYSCALLS.get(); return FS.ioctl(stream, op, argp); } default: abort('bad ioctl syscall ' + op); } } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function _emscripten_glSampleCoverage(x0, x1) { GLctx.sampleCoverage(x0, x1) } function _glDeleteTextures(n, textures) { for (var i = 0; i < n; i++) { var id = HEAP32[(((textures)+(i*4))>>2)]; var texture = GL.textures[id]; if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". GLctx.deleteTexture(texture); texture.name = 0; GL.textures[id] = null; } } function _emscripten_glFrustum() { Module['printErr']('missing function: emscripten_glFrustum'); abort(-1); } function _glfwSetWindowSizeCallback(winid, cbfun) { GLFW.setWindowSizeCallback(winid, cbfun); } function _emscripten_glGetTexParameterfv(target, pname, params) { if (!params) { // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname); } function _emscripten_glUniform4i(location, v0, v1, v2, v3) { location = GL.uniforms[location]; GLctx.uniform4i(location, v0, v1, v2, v3); } function _emscripten_glBindRenderbuffer(target, renderbuffer) { GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null); } function _emscripten_set_main_loop_timing(mode, value) { Browser.mainLoop.timingMode = mode; Browser.mainLoop.timingValue = value; if (!Browser.mainLoop.func) { return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. } if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { setTimeout(Browser.mainLoop.runner, value); // doing this each time means that on exception, we stop }; Browser.mainLoop.method = 'timeout'; } else if (mode == 1 /*EM_TIMING_RAF*/) { Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { Browser.requestAnimationFrame(Browser.mainLoop.runner); }; Browser.mainLoop.method = 'rAF'; } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { if (!window['setImmediate']) { // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) var setImmediates = []; var emscriptenMainLoopMessageId = '__emcc'; function Browser_setImmediate_messageHandler(event) { if (event.source === window && event.data === emscriptenMainLoopMessageId) { event.stopPropagation(); setImmediates.shift()(); } } window.addEventListener("message", Browser_setImmediate_messageHandler, true); window['setImmediate'] = function Browser_emulated_setImmediate(func) { setImmediates.push(func); window.postMessage(emscriptenMainLoopMessageId, "*"); } } Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { window['setImmediate'](Browser.mainLoop.runner); }; Browser.mainLoop.method = 'immediate'; } return 0; }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { Module['noExitRuntime'] = true; assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); Browser.mainLoop.func = func; Browser.mainLoop.arg = arg; var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; Browser.mainLoop.runner = function Browser_mainLoop_runner() { if (ABORT) return; if (Browser.mainLoop.queue.length > 0) { var start = Date.now(); var blocker = Browser.mainLoop.queue.shift(); blocker.func(blocker.arg); if (Browser.mainLoop.remainingBlockers) { var remaining = Browser.mainLoop.remainingBlockers; var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); if (blocker.counted) { Browser.mainLoop.remainingBlockers = next; } else { // not counted, but move the progress along a tiny bit next = next + 0.5; // do not steal all the next one's progress Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; } } console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); Browser.mainLoop.updateStatus(); setTimeout(Browser.mainLoop.runner, 0); return; } // catch pauses from non-main loop sources if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; // Implement very basic swap interval control Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { // Not the scheduled time to render this frame - skip. Browser.mainLoop.scheduler(); return; } // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize // VBO double-buffering and reduce GPU stalls. if (Browser.mainLoop.method === 'timeout' && Module.ctx) { Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); Browser.mainLoop.method = ''; // just warn once per call to set main loop } Browser.mainLoop.runIter(function() { if (typeof arg !== 'undefined') { Runtime.dynCall('vi', func, [arg]); } else { Runtime.dynCall('v', func); } }); // catch pauses from the main loop itself if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able // to queue the newest produced audio samples. // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() // do not need to be hardcoded into this function, but can be more generic. if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); Browser.mainLoop.scheduler(); } if (!noSetTiming) { if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) Browser.mainLoop.scheduler(); } if (simulateInfiniteLoop) { throw 'SimulateInfiniteLoop'; } }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () { Browser.mainLoop.scheduler = null; Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. },resume:function () { Browser.mainLoop.currentlyRunningMainloop++; var timingMode = Browser.mainLoop.timingMode; var timingValue = Browser.mainLoop.timingValue; var func = Browser.mainLoop.func; Browser.mainLoop.func = null; _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); _emscripten_set_main_loop_timing(timingMode, timingValue); Browser.mainLoop.scheduler(); },updateStatus:function () { if (Module['setStatus']) { var message = Module['statusMessage'] || 'Please wait...'; var remaining = Browser.mainLoop.remainingBlockers; var expected = Browser.mainLoop.expectedBlockers; if (remaining) { if (remaining < expected) { Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); } else { Module['setStatus'](message); } } else { Module['setStatus'](''); } } },runIter:function (func) { if (ABORT) return; if (Module['preMainLoop']) { var preRet = Module['preMainLoop'](); if (preRet === false) { return; // |return false| skips a frame } } try { func(); } catch (e) { if (e instanceof ExitStatus) { return; } else { if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); throw e; } } if (Module['postMainLoop']) Module['postMainLoop'](); }},isFullScreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () { if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers if (Browser.initted) return; Browser.initted = true; try { new Blob(); Browser.hasBlobConstructor = true; } catch(e) { Browser.hasBlobConstructor = false; console.log("warning: no blob constructor, cannot create blobs with mimetypes"); } Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); Module.noImageDecoding = true; } // Support for plugins that can process preloaded files. You can add more of these to // your app by creating and appending to Module.preloadPlugins. // // Each plugin is asked if it can handle a file based on the file's name. If it can, // it is given the file's raw data. When it is done, it calls a callback with the file's // (possibly modified) data. For example, a plugin might decompress a file, or it // might create some side data structure for use later (like an Image element, etc.). var imagePlugin = {}; imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); }; imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { var b = null; if (Browser.hasBlobConstructor) { try { b = new Blob([byteArray], { type: Browser.getMimetype(name) }); if (b.size !== byteArray.length) { // Safari bug #118630 // Safari's Blob can only take an ArrayBuffer b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); } } catch(e) { Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); } } if (!b) { var bb = new Browser.BlobBuilder(); bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range b = bb.getBlob(); } var url = Browser.URLObject.createObjectURL(b); var img = new Image(); img.onload = function img_onload() { assert(img.complete, 'Image ' + name + ' could not be decoded'); var canvas = document.createElement('canvas'); canvas.width = img.width; canvas.height = img.height; var ctx = canvas.getContext('2d'); ctx.drawImage(img, 0, 0); Module["preloadedImages"][name] = canvas; Browser.URLObject.revokeObjectURL(url); if (onload) onload(byteArray); }; img.onerror = function img_onerror(event) { console.log('Image ' + url + ' could not be decoded'); if (onerror) onerror(); }; img.src = url; }; Module['preloadPlugins'].push(imagePlugin); var audioPlugin = {}; audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; }; audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { var done = false; function finish(audio) { if (done) return; done = true; Module["preloadedAudios"][name] = audio; if (onload) onload(byteArray); } function fail() { if (done) return; done = true; Module["preloadedAudios"][name] = new Audio(); // empty shim if (onerror) onerror(); } if (Browser.hasBlobConstructor) { try { var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); } catch(e) { return fail(); } var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! var audio = new Audio(); audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 audio.onerror = function audio_onerror(event) { if (done) return; console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); function encode64(data) { var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; var PAD = '='; var ret = ''; var leftchar = 0; var leftbits = 0; for (var i = 0; i < data.length; i++) { leftchar = (leftchar << 8) | data[i]; leftbits += 8; while (leftbits >= 6) { var curr = (leftchar >> (leftbits-6)) & 0x3f; leftbits -= 6; ret += BASE[curr]; } } if (leftbits == 2) { ret += BASE[(leftchar&3) << 4]; ret += PAD + PAD; } else if (leftbits == 4) { ret += BASE[(leftchar&0xf) << 2]; ret += PAD; } return ret; } audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); finish(audio); // we don't wait for confirmation this worked - but it's worth trying }; audio.src = url; // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror Browser.safeSetTimeout(function() { finish(audio); // try to use it even though it is not necessarily ready to play }, 10000); } else { return fail(); } }; Module['preloadPlugins'].push(audioPlugin); // Canvas event setup var canvas = Module['canvas']; function pointerLockChange() { Browser.pointerLock = document['pointerLockElement'] === canvas || document['mozPointerLockElement'] === canvas || document['webkitPointerLockElement'] === canvas || document['msPointerLockElement'] === canvas; } if (canvas) { // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module // Module['forcedAspectRatio'] = 4 / 3; canvas.requestPointerLock = canvas['requestPointerLock'] || canvas['mozRequestPointerLock'] || canvas['webkitRequestPointerLock'] || canvas['msRequestPointerLock'] || function(){}; canvas.exitPointerLock = document['exitPointerLock'] || document['mozExitPointerLock'] || document['webkitExitPointerLock'] || document['msExitPointerLock'] || function(){}; // no-op if function does not exist canvas.exitPointerLock = canvas.exitPointerLock.bind(document); document.addEventListener('pointerlockchange', pointerLockChange, false); document.addEventListener('mozpointerlockchange', pointerLockChange, false); document.addEventListener('webkitpointerlockchange', pointerLockChange, false); document.addEventListener('mspointerlockchange', pointerLockChange, false); if (Module['elementPointerLock']) { canvas.addEventListener("click", function(ev) { if (!Browser.pointerLock && canvas.requestPointerLock) { canvas.requestPointerLock(); ev.preventDefault(); } }, false); } } },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) { if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. var ctx; var contextHandle; if (useWebGL) { // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. var contextAttributes = { antialias: false, alpha: false }; if (webGLContextAttributes) { for (var attribute in webGLContextAttributes) { contextAttributes[attribute] = webGLContextAttributes[attribute]; } } contextHandle = GL.createContext(canvas, contextAttributes); if (contextHandle) { ctx = GL.getContext(contextHandle).GLctx; } // Set the background of the WebGL canvas to black canvas.style.backgroundColor = "black"; } else { ctx = canvas.getContext('2d'); } if (!ctx) return null; if (setInModule) { if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); Module.ctx = ctx; if (useWebGL) GL.makeContextCurrent(contextHandle); Module.useWebGL = useWebGL; Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); Browser.init(); } return ctx; },destroyContext:function (canvas, useWebGL, setInModule) {},fullScreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) { Browser.lockPointer = lockPointer; Browser.resizeCanvas = resizeCanvas; Browser.vrDevice = vrDevice; if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null; var canvas = Module['canvas']; function fullScreenChange() { Browser.isFullScreen = false; var canvasContainer = canvas.parentNode; if ((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] || document['mozFullScreenElement'] || document['mozFullscreenElement'] || document['fullScreenElement'] || document['fullscreenElement'] || document['msFullScreenElement'] || document['msFullscreenElement'] || document['webkitCurrentFullScreenElement']) === canvasContainer) { canvas.cancelFullScreen = document['cancelFullScreen'] || document['mozCancelFullScreen'] || document['webkitCancelFullScreen'] || document['msExitFullscreen'] || document['exitFullscreen'] || function() {}; canvas.cancelFullScreen = canvas.cancelFullScreen.bind(document); if (Browser.lockPointer) canvas.requestPointerLock(); Browser.isFullScreen = true; if (Browser.resizeCanvas) Browser.setFullScreenCanvasSize(); } else { // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen canvasContainer.parentNode.insertBefore(canvas, canvasContainer); canvasContainer.parentNode.removeChild(canvasContainer); if (Browser.resizeCanvas) Browser.setWindowedCanvasSize(); } if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullScreen); Browser.updateCanvasDimensions(canvas); } if (!Browser.fullScreenHandlersInstalled) { Browser.fullScreenHandlersInstalled = true; document.addEventListener('fullscreenchange', fullScreenChange, false); document.addEventListener('mozfullscreenchange', fullScreenChange, false); document.addEventListener('webkitfullscreenchange', fullScreenChange, false); document.addEventListener('MSFullscreenChange', fullScreenChange, false); } // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root var canvasContainer = document.createElement("div"); canvas.parentNode.insertBefore(canvasContainer, canvas); canvasContainer.appendChild(canvas); // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) canvasContainer.requestFullScreen = canvasContainer['requestFullScreen'] || canvasContainer['mozRequestFullScreen'] || canvasContainer['msRequestFullscreen'] || (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); if (vrDevice) { canvasContainer.requestFullScreen({ vrDisplay: vrDevice }); } else { canvasContainer.requestFullScreen(); } },nextRAF:0,fakeRequestAnimationFrame:function (func) { // try to keep 60fps between calls to here var now = Date.now(); if (Browser.nextRAF === 0) { Browser.nextRAF = now + 1000/60; } else { while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 Browser.nextRAF += 1000/60; } } var delay = Math.max(Browser.nextRAF - now, 0); setTimeout(func, delay); },requestAnimationFrame:function requestAnimationFrame(func) { if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js) Browser.fakeRequestAnimationFrame(func); } else { if (!window.requestAnimationFrame) { window.requestAnimationFrame = window['requestAnimationFrame'] || window['mozRequestAnimationFrame'] || window['webkitRequestAnimationFrame'] || window['msRequestAnimationFrame'] || window['oRequestAnimationFrame'] || Browser.fakeRequestAnimationFrame; } window.requestAnimationFrame(func); } },safeCallback:function (func) { return function() { if (!ABORT) return func.apply(null, arguments); }; },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () { Browser.allowAsyncCallbacks = false; },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now Browser.allowAsyncCallbacks = true; if (Browser.queuedAsyncCallbacks.length > 0) { var callbacks = Browser.queuedAsyncCallbacks; Browser.queuedAsyncCallbacks = []; callbacks.forEach(function(func) { func(); }); } },safeRequestAnimationFrame:function (func) { return Browser.requestAnimationFrame(function() { if (ABORT) return; if (Browser.allowAsyncCallbacks) { func(); } else { Browser.queuedAsyncCallbacks.push(func); } }); },safeSetTimeout:function (func, timeout) { Module['noExitRuntime'] = true; return setTimeout(function() { if (ABORT) return; if (Browser.allowAsyncCallbacks) { func(); } else { Browser.queuedAsyncCallbacks.push(func); } }, timeout); },safeSetInterval:function (func, timeout) { Module['noExitRuntime'] = true; return setInterval(function() { if (ABORT) return; if (Browser.allowAsyncCallbacks) { func(); } // drop it on the floor otherwise, next interval will kick in }, timeout); },getMimetype:function (name) { return { 'jpg': 'image/jpeg', 'jpeg': 'image/jpeg', 'png': 'image/png', 'bmp': 'image/bmp', 'ogg': 'audio/ogg', 'wav': 'audio/wav', 'mp3': 'audio/mpeg' }[name.substr(name.lastIndexOf('.')+1)]; },getUserMedia:function (func) { if(!window.getUserMedia) { window.getUserMedia = navigator['getUserMedia'] || navigator['mozGetUserMedia']; } window.getUserMedia(func); },getMovementX:function (event) { return event['movementX'] || event['mozMovementX'] || event['webkitMovementX'] || 0; },getMovementY:function (event) { return event['movementY'] || event['mozMovementY'] || event['webkitMovementY'] || 0; },getMouseWheelDelta:function (event) { var delta = 0; switch (event.type) { case 'DOMMouseScroll': delta = event.detail; break; case 'mousewheel': delta = event.wheelDelta; break; case 'wheel': delta = event['deltaY']; break; default: throw 'unrecognized mouse wheel event: ' + event.type; } return delta; },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup if (Browser.pointerLock) { // When the pointer is locked, calculate the coordinates // based on the movement of the mouse. // Workaround for Firefox bug 764498 if (event.type != 'mousemove' && ('mozMovementX' in event)) { Browser.mouseMovementX = Browser.mouseMovementY = 0; } else { Browser.mouseMovementX = Browser.getMovementX(event); Browser.mouseMovementY = Browser.getMovementY(event); } // check if SDL is available if (typeof SDL != "undefined") { Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; } else { // just add the mouse delta to the current absolut mouse position // FIXME: ideally this should be clamped against the canvas size and zero Browser.mouseX += Browser.mouseMovementX; Browser.mouseY += Browser.mouseMovementY; } } else { // Otherwise, calculate the movement based on the changes // in the coordinates. var rect = Module["canvas"].getBoundingClientRect(); var cw = Module["canvas"].width; var ch = Module["canvas"].height; // Neither .scrollX or .pageXOffset are defined in a spec, but // we prefer .scrollX because it is currently in a spec draft. // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { var touch = event.touch; if (touch === undefined) { return; // the "touch" property is only defined in SDL } var adjustedX = touch.pageX - (scrollX + rect.left); var adjustedY = touch.pageY - (scrollY + rect.top); adjustedX = adjustedX * (cw / rect.width); adjustedY = adjustedY * (ch / rect.height); var coords = { x: adjustedX, y: adjustedY }; if (event.type === 'touchstart') { Browser.lastTouches[touch.identifier] = coords; Browser.touches[touch.identifier] = coords; } else if (event.type === 'touchend' || event.type === 'touchmove') { var last = Browser.touches[touch.identifier]; if (!last) last = coords; Browser.lastTouches[touch.identifier] = last; Browser.touches[touch.identifier] = coords; } return; } var x = event.pageX - (scrollX + rect.left); var y = event.pageY - (scrollY + rect.top); // the canvas might be CSS-scaled compared to its backbuffer; // SDL-using content will want mouse coordinates in terms // of backbuffer units. x = x * (cw / rect.width); y = y * (ch / rect.height); Browser.mouseMovementX = x - Browser.mouseX; Browser.mouseMovementY = y - Browser.mouseY; Browser.mouseX = x; Browser.mouseY = y; } },xhrLoad:function (url, onload, onerror) { var xhr = new XMLHttpRequest(); xhr.open('GET', url, true); xhr.responseType = 'arraybuffer'; xhr.onload = function xhr_onload() { if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 onload(xhr.response); } else { onerror(); } }; xhr.onerror = onerror; xhr.send(null); },asyncLoad:function (url, onload, onerror, noRunDep) { Browser.xhrLoad(url, function(arrayBuffer) { assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); onload(new Uint8Array(arrayBuffer)); if (!noRunDep) removeRunDependency('al ' + url); }, function(event) { if (onerror) { onerror(); } else { throw 'Loading data file "' + url + '" failed.'; } }); if (!noRunDep) addRunDependency('al ' + url); },resizeListeners:[],updateResizeListeners:function () { var canvas = Module['canvas']; Browser.resizeListeners.forEach(function(listener) { listener(canvas.width, canvas.height); }); },setCanvasSize:function (width, height, noUpdates) { var canvas = Module['canvas']; Browser.updateCanvasDimensions(canvas, width, height); if (!noUpdates) Browser.updateResizeListeners(); },windowedWidth:0,windowedHeight:0,setFullScreenCanvasSize:function () { // check if SDL is available if (typeof SDL != "undefined") { var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; flags = flags | 0x00800000; // set SDL_FULLSCREEN flag HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags } Browser.updateResizeListeners(); },setWindowedCanvasSize:function () { // check if SDL is available if (typeof SDL != "undefined") { var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags } Browser.updateResizeListeners(); },updateCanvasDimensions:function (canvas, wNative, hNative) { if (wNative && hNative) { canvas.widthNative = wNative; canvas.heightNative = hNative; } else { wNative = canvas.widthNative; hNative = canvas.heightNative; } var w = wNative; var h = hNative; if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { if (w/h < Module['forcedAspectRatio']) { w = Math.round(h * Module['forcedAspectRatio']); } else { h = Math.round(w / Module['forcedAspectRatio']); } } if (((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] || document['mozFullScreenElement'] || document['mozFullscreenElement'] || document['fullScreenElement'] || document['fullscreenElement'] || document['msFullScreenElement'] || document['msFullscreenElement'] || document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { var factor = Math.min(screen.width / w, screen.height / h); w = Math.round(w * factor); h = Math.round(h * factor); } if (Browser.resizeCanvas) { if (canvas.width != w) canvas.width = w; if (canvas.height != h) canvas.height = h; if (typeof canvas.style != 'undefined') { canvas.style.removeProperty( "width"); canvas.style.removeProperty("height"); } } else { if (canvas.width != wNative) canvas.width = wNative; if (canvas.height != hNative) canvas.height = hNative; if (typeof canvas.style != 'undefined') { if (w != wNative || h != hNative) { canvas.style.setProperty( "width", w + "px", "important"); canvas.style.setProperty("height", h + "px", "important"); } else { canvas.style.removeProperty( "width"); canvas.style.removeProperty("height"); } } } },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () { var handle = Browser.nextWgetRequestHandle; Browser.nextWgetRequestHandle++; return handle; }};var AL={contexts:[],currentContext:null,alcErr:0,stringCache:{},alcStringCache:{},QUEUE_INTERVAL:25,QUEUE_LOOKAHEAD:100,newSrcId:1,updateSources:function updateSources(context) { // If we are animating using the requestAnimationFrame method, then the main loop does not run when in the background. // To give a perfect glitch-free audio stop when switching from foreground to background, we need to avoid updating // audio altogether when in the background, so detect that case and kill audio buffer streaming if so. if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && document['visibilityState'] != 'visible') return; for (var srcId in context.src) { AL.updateSource(context.src[srcId]); } },updateSource:function updateSource(src) { if (src.state !== 0x1012 /* AL_PLAYING */) { return; } var currentTime = AL.currentContext.ctx.currentTime; var startTime = src.bufferPosition; for (var i = src.buffersPlayed; i < src.queue.length; i++) { var entry = src.queue[i]; var startOffset = startTime - currentTime; var endTime = startTime + entry.buffer.duration; // Clean up old buffers. if (currentTime >= endTime) { // Update our location in the queue. src.bufferPosition = endTime; src.buffersPlayed = i + 1; // Stop / restart the source when we hit the end. if (src.buffersPlayed >= src.queue.length) { if (src.loop) { AL.setSourceState(src, 0x1012 /* AL_PLAYING */); } else { AL.setSourceState(src, 0x1014 /* AL_STOPPED */); } } } // Process all buffers that'll be played before the next tick. else if (startOffset < (AL.QUEUE_LOOKAHEAD / 1000) && !entry.src) { // If the start offset is negative, we need to offset the actual buffer. var offset = Math.abs(Math.min(startOffset, 0)); entry.src = AL.currentContext.ctx.createBufferSource(); entry.src.buffer = entry.buffer; entry.src.connect(src.gain); if (typeof(entry.src.start) !== 'undefined') { entry.src.start(startTime, offset); } else if (typeof(entry.src.noteOn) !== 'undefined') { entry.src.noteOn(startTime); } } startTime = endTime; } },setSourceState:function setSourceState(src, state) { if (state === 0x1012 /* AL_PLAYING */) { if (src.state !== 0x1013 /* AL_PAUSED */) { src.state = 0x1012 /* AL_PLAYING */; // Reset our position. src.bufferPosition = AL.currentContext.ctx.currentTime; src.buffersPlayed = 0; } else { src.state = 0x1012 /* AL_PLAYING */; // Use the current offset from src.bufferPosition to resume at the correct point. src.bufferPosition = AL.currentContext.ctx.currentTime - src.bufferPosition; } AL.stopSourceQueue(src); AL.updateSource(src); } else if (state === 0x1013 /* AL_PAUSED */) { if (src.state === 0x1012 /* AL_PLAYING */) { src.state = 0x1013 /* AL_PAUSED */; // Store off the current offset to restore with on resume. src.bufferPosition = AL.currentContext.ctx.currentTime - src.bufferPosition; AL.stopSourceQueue(src); } } else if (state === 0x1014 /* AL_STOPPED */) { if (src.state !== 0x1011 /* AL_INITIAL */) { src.state = 0x1014 /* AL_STOPPED */; src.buffersPlayed = src.queue.length; AL.stopSourceQueue(src); } } else if (state == 0x1011 /* AL_INITIAL */) { if (src.state !== 0x1011 /* AL_INITIAL */) { src.state = 0x1011 /* AL_INITIAL */; src.bufferPosition = 0; src.buffersPlayed = 0; } } },stopSourceQueue:function stopSourceQueue(src) { for (var i = 0; i < src.queue.length; i++) { var entry = src.queue[i]; if (entry.src) { entry.src.stop(0); entry.src = null; } } }};function _alcGetCurrentContext() { for (var i = 0; i < AL.contexts.length; ++i) { if (AL.contexts[i] == AL.currentContext) { return i + 1; } } return 0; } function _emscripten_glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) } function _emscripten_memcpy_big(dest, src, num) { HEAPU8.set(HEAPU8.subarray(src, src+num), dest); return dest; } Module["_memcpy"] = _memcpy; var _llvm_pow_f64=Math_pow; function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) } function _alcGetString(device, param) { if (AL.alcStringCache[param]) return AL.alcStringCache[param]; var ret; switch (param) { case 0 /* ALC_NO_ERROR */: ret = 'No Error'; break; case 0xA001 /* ALC_INVALID_DEVICE */: ret = 'Invalid Device'; break; case 0xA002 /* ALC_INVALID_CONTEXT */: ret = 'Invalid Context'; break; case 0xA003 /* ALC_INVALID_ENUM */: ret = 'Invalid Enum'; break; case 0xA004 /* ALC_INVALID_VALUE */: ret = 'Invalid Value'; break; case 0xA005 /* ALC_OUT_OF_MEMORY */: ret = 'Out of Memory'; break; case 0x1004 /* ALC_DEFAULT_DEVICE_SPECIFIER */: if (typeof(AudioContext) !== "undefined" || typeof(webkitAudioContext) !== "undefined") { ret = 'Device'; } else { return 0; } break; case 0x1005 /* ALC_DEVICE_SPECIFIER */: if (typeof(AudioContext) !== "undefined" || typeof(webkitAudioContext) !== "undefined") { ret = 'Device\0'; } else { ret = '\0'; } break; case 0x311 /* ALC_CAPTURE_DEFAULT_DEVICE_SPECIFIER */: return 0; break; case 0x310 /* ALC_CAPTURE_DEVICE_SPECIFIER */: ret = '\0' break; case 0x1006 /* ALC_EXTENSIONS */: if (!device) { AL.alcErr = 0xA001 /* ALC_INVALID_DEVICE */; return 0; } ret = ''; break; default: AL.alcErr = 0xA003 /* ALC_INVALID_ENUM */; return 0; } ret = allocate(intArrayFromString(ret), 'i8', ALLOC_NORMAL); AL.alcStringCache[param] = ret; return ret; } function _emscripten_glTexParameterfv(target, pname, params) { var param = HEAPF32[((params)>>2)]; GLctx.texParameterf(target, pname, param); } function _emscripten_glLinkProgram(program) { GLctx.linkProgram(GL.programs[program]); GL.programInfos[program] = null; // uniforms no longer keep the same names after linking GL.populateUniformTable(program); } function _emscripten_glUniform3f(location, v0, v1, v2) { location = GL.uniforms[location]; GLctx.uniform3f(location, v0, v1, v2); } function _emscripten_glGetObjectParameterivARB() { Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1); } function _emscripten_glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) } function _emscripten_glUniform3i(location, v0, v1, v2) { location = GL.uniforms[location]; GLctx.uniform3i(location, v0, v1, v2); } function _emscripten_glStencilOp(x0, x1, x2) { GLctx.stencilOp(x0, x1, x2) } function _glCreateShader(shaderType) { var id = GL.getNewId(GL.shaders); GL.shaders[id] = GLctx.createShader(shaderType); return id; } function _glUniform1i(location, v0) { location = GL.uniforms[location]; GLctx.uniform1i(location, v0); } function _emscripten_glBindAttribLocation(program, index, name) { name = Pointer_stringify(name); GLctx.bindAttribLocation(GL.programs[program], index, name); } var _cosf=Math_cos; function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { var heapView; if (data) { heapView = HEAPU8.subarray((data),(data+imageSize)); } else { heapView = null; } GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView); } function _emscripten_glEnableVertexAttribArray(index) { GLctx.enableVertexAttribArray(index); } Module["_memset"] = _memset; var _BDtoILow=true; function _alDeleteBuffers(count, buffers) { if (!AL.currentContext) { return; } if (count > AL.currentContext.buf.length) { AL.currentContext.err = 0xA003 /* AL_INVALID_VALUE */; return; } for (var i = 0; i < count; ++i) { var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)] - 1; // Make sure the buffer index is valid. if (bufferIdx >= AL.currentContext.buf.length || !AL.currentContext.buf[bufferIdx]) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } // Make sure the buffer is no longer in use. var buffer = AL.currentContext.buf[bufferIdx]; for (var srcId in AL.currentContext.src) { var src = AL.currentContext.src[srcId]; if (!src) { continue; } for (var k = 0; k < src.queue.length; k++) { if (buffer === src.queue[k].buffer) { AL.currentContext.err = 0xA004 /* AL_INVALID_OPERATION */; return; } } } } for (var i = 0; i < count; ++i) { var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)] - 1; delete AL.currentContext.buf[bufferIdx]; } } function _alListener3f(param, v1, v2, v3) { if (!AL.currentContext) { return; } switch (param) { case 0x1004 /* AL_POSITION */: AL.currentContext.ctx.listener._position = [v1, v2, v3]; AL.currentContext.ctx.listener.setPosition(v1, v2, v3); break; case 0x1006 /* AL_VELOCITY */: AL.currentContext.ctx.listener._velocity = [v1, v2, v3]; AL.currentContext.ctx.listener.setVelocity(v1, v2, v3); break; default: AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */; break; } } function _glfwMakeContextCurrent(winid) {} var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,registerRemoveEventListeners:function () { if (!JSEvents.removeEventListenersRegistered) { __ATEXIT__.push(function() { for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { JSEvents._removeHandler(i); } }); JSEvents.removeEventListenersRegistered = true; } },findEventTarget:function (target) { if (target) { if (typeof target == "number") { target = Pointer_stringify(target); } if (target == '#window') return window; else if (target == '#document') return document; else if (target == '#screen') return window.screen; else if (target == '#canvas') return Module['canvas']; if (typeof target == 'string') return document.getElementById(target); else return target; } else { // The sensible target varies between events, but use window as the default // since DOM events mostly can default to that. Specific callback registrations // override their own defaults. return window; } },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) { function arraysHaveEqualContent(arrA, arrB) { if (arrA.length != arrB.length) return false; for(var i in arrA) { if (arrA[i] != arrB[i]) return false; } return true; } // Test if the given call was already queued, and if so, don't add it again. for(var i in JSEvents.deferredCalls) { var call = JSEvents.deferredCalls[i]; if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { return; } } JSEvents.deferredCalls.push({ targetFunction: targetFunction, precedence: precedence, argsList: argsList }); JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); },removeDeferredCalls:function (targetFunction) { for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { JSEvents.deferredCalls.splice(i, 1); --i; } } },canPerformEventHandlerRequests:function () { return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; },runDeferredCalls:function () { if (!JSEvents.canPerformEventHandlerRequests()) { return; } for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { var call = JSEvents.deferredCalls[i]; JSEvents.deferredCalls.splice(i, 1); --i; call.targetFunction.apply(this, call.argsList); } },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) { for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { JSEvents._removeHandler(i--); } } },_removeHandler:function (i) { var h = JSEvents.eventHandlers[i]; h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); JSEvents.eventHandlers.splice(i, 1); },registerOrRemoveHandler:function (eventHandler) { var jsEventHandler = function jsEventHandler(event) { // Increment nesting count for the event handler. ++JSEvents.inEventHandler; JSEvents.currentEventHandler = eventHandler; // Process any old deferred calls the user has placed. JSEvents.runDeferredCalls(); // Process the actual event, calls back to user C code handler. eventHandler.handlerFunc(event); // Process any new deferred calls that were placed right now from this event handler. JSEvents.runDeferredCalls(); // Out of event handler - restore nesting count. --JSEvents.inEventHandler; } if (eventHandler.callbackfunc) { eventHandler.eventListenerFunc = jsEventHandler; eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); JSEvents.eventHandlers.push(eventHandler); JSEvents.registerRemoveEventListeners(); } else { for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { JSEvents._removeHandler(i--); } } } },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.keyEvent) { JSEvents.keyEvent = _malloc( 164 ); } var handlerFunc = function(event) { var e = event || window.event; writeStringToMemory(e.key ? e.key : "", JSEvents.keyEvent + 0 ); writeStringToMemory(e.code ? e.code : "", JSEvents.keyEvent + 32 ); HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location; HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey; HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey; HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey; HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey; HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat; writeStringToMemory(e.locale ? e.locale : "", JSEvents.keyEvent + 88 ); writeStringToMemory(e.char ? e.char : "", JSEvents.keyEvent + 120 ); HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode; HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode; HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.keyEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do. eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },getBoundingClientRectOrZeros:function (target) { return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 }; },fillMouseEventData:function (eventStruct, e, target) { HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); HEAP32[(((eventStruct)+(8))>>2)]=e.screenX; HEAP32[(((eventStruct)+(12))>>2)]=e.screenY; HEAP32[(((eventStruct)+(16))>>2)]=e.clientX; HEAP32[(((eventStruct)+(20))>>2)]=e.clientY; HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey; HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey; HEAP32[(((eventStruct)+(32))>>2)]=e.altKey; HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey; HEAP16[(((eventStruct)+(40))>>1)]=e.button; HEAP16[(((eventStruct)+(42))>>1)]=e.buttons; HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX); HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY); if (Module['canvas']) { var rect = Module['canvas'].getBoundingClientRect(); HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left; HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top; } else { // Canvas is not initialized, return 0. HEAP32[(((eventStruct)+(60))>>2)]=0; HEAP32[(((eventStruct)+(64))>>2)]=0; } if (target) { var rect = JSEvents.getBoundingClientRectOrZeros(target); HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left; HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top; } else { // No specific target passed, return 0. HEAP32[(((eventStruct)+(52))>>2)]=0; HEAP32[(((eventStruct)+(56))>>2)]=0; } JSEvents.previousScreenX = e.screenX; JSEvents.previousScreenY = e.screenY; },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.mouseEvent) { JSEvents.mouseEvent = _malloc( 72 ); } target = JSEvents.findEventTarget(target); var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.mouseEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; // In IE, mousedown events don't either allow deferred calls to be run! if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false; JSEvents.registerOrRemoveHandler(eventHandler); },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.wheelEvent) { JSEvents.wheelEvent = _malloc( 104 ); } target = JSEvents.findEventTarget(target); // The DOM Level 3 events spec event 'wheel' var wheelHandlerFunc = function(event) { var e = event || window.event; JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"]; HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"]; HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"]; HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"]; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; // The 'mousewheel' event as implemented in Safari 6.0.5 var mouseWheelHandlerFunc = function(event) { var e = event || window.event; JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"]; HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-e["wheelDeltaY"] /* Invert to unify direction with the DOM Level 3 wheel event. */; HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */; HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: true, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },pageScrollPos:function () { if (window.pageXOffset > 0 || window.pageYOffset > 0) { return [window.pageXOffset, window.pageYOffset]; } if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') { return [document.documentElement.scrollLeft, document.documentElement.scrollTop]; } return [document.body.scrollLeft|0, document.body.scrollTop|0]; },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.uiEvent) { JSEvents.uiEvent = _malloc( 36 ); } if (eventTypeString == "scroll" && !target) { target = document; // By default read scroll events on document rather than window. } else { target = JSEvents.findEventTarget(target); } var handlerFunc = function(event) { var e = event || window.event; if (e.target != target) { // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print, // causing a new scroll, etc.. return; } var scrollPos = JSEvents.pageScrollPos(); HEAP32[((JSEvents.uiEvent)>>2)]=e.detail; HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth; HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight; HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth; HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight; HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth; HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight; HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0]; HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1]; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.uiEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them. eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },getNodeNameForTarget:function (target) { if (!target) return ''; if (target == window) return '#window'; if (target == window.screen) return '#screen'; return (target && target.nodeName) ? target.nodeName : ''; },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.focusEvent) { JSEvents.focusEvent = _malloc( 256 ); } var handlerFunc = function(event) { var e = event || window.event; var nodeName = JSEvents.getNodeNameForTarget(e.target); var id = e.target.id ? e.target.id : ''; writeStringToMemory(nodeName, JSEvents.focusEvent + 0 ); writeStringToMemory(id, JSEvents.focusEvent + 128 ); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.focusEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },tick:function () { if (window['performance'] && window['performance']['now']) return window['performance']['now'](); else return Date.now(); },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.deviceOrientationEvent) { JSEvents.deviceOrientationEvent = _malloc( 40 ); } var handlerFunc = function(event) { var e = event || window.event; HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick(); HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha; HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta; HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma; HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceOrientationEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.deviceMotionEvent) { JSEvents.deviceMotionEvent = _malloc( 80 ); } var handlerFunc = function(event) { var e = event || window.event; HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick(); HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x; HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y; HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z; HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x; HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y; HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z; HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha; HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta; HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceMotionEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },screenOrientation:function () { if (!window.screen) return undefined; return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation; },fillOrientationChangeEventData:function (eventStruct, e) { var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"]; var orientations2 = ["portrait", "portrait", "landscape", "landscape"]; var orientationString = JSEvents.screenOrientation(); var orientation = orientations.indexOf(orientationString); if (orientation == -1) { orientation = orientations2.indexOf(orientationString); } HEAP32[((eventStruct)>>2)]=1 << orientation; HEAP32[(((eventStruct)+(4))>>2)]=window.orientation; },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.orientationChangeEvent) { JSEvents.orientationChangeEvent = _malloc( 8 ); } if (!target) { target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window' } else { target = JSEvents.findEventTarget(target); } var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.orientationChangeEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) { eventTypeString = "mozorientationchange"; } var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },fullscreenEnabled:function () { return document.fullscreenEnabled || document.mozFullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled; },fillFullscreenChangeEventData:function (eventStruct, e) { var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; var isFullscreen = !!fullscreenElement; HEAP32[((eventStruct)>>2)]=isFullscreen; HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled(); // If transitioning to fullscreen, report info about the element that is now fullscreen. // If transitioning to windowed mode, report info about the element that just was fullscreen. var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; var nodeName = JSEvents.getNodeNameForTarget(reportedElement); var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; writeStringToMemory(nodeName, eventStruct + 8 ); writeStringToMemory(id, eventStruct + 136 ); HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0; HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0; HEAP32[(((eventStruct)+(272))>>2)]=screen.width; HEAP32[(((eventStruct)+(276))>>2)]=screen.height; if (isFullscreen) { JSEvents.previousFullscreenElement = fullscreenElement; } },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.fullscreenChangeEvent) { JSEvents.fullscreenChangeEvent = _malloc( 280 ); } if (!target) { target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window' } else { target = JSEvents.findEventTarget(target); } var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.fullscreenChangeEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },resizeCanvasForFullscreen:function (target, strategy) { var restoreOldStyle = __registerRestoreOldStyle(target); var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width; var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height; var rect = target.getBoundingClientRect(); var windowedCssWidth = rect.right - rect.left; var windowedCssHeight = rect.bottom - rect.top; var windowedRttWidth = target.width; var windowedRttHeight = target.height; if (strategy.scaleMode == 3) { __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); cssWidth = windowedCssWidth; cssHeight = windowedCssHeight; } else if (strategy.scaleMode == 2) { if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); cssHeight = desiredCssHeight; } else { var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); cssWidth = desiredCssWidth; } } // If we are adding padding, must choose a background color or otherwise Chrome will give the // padding a default white color. Do it only if user has not customized their own background color. if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; // IE11 does the same, but requires the color to be set in the document body. if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 // Firefox always shows black letterboxes independent of style color. target.style.width = cssWidth + 'px'; target.style.height = cssHeight + 'px'; if (strategy.filteringMode == 1) { target.style.imageRendering = 'optimizeSpeed'; target.style.imageRendering = '-moz-crisp-edges'; target.style.imageRendering = '-o-crisp-edges'; target.style.imageRendering = '-webkit-optimize-contrast'; target.style.imageRendering = 'optimize-contrast'; target.style.imageRendering = 'crisp-edges'; target.style.imageRendering = 'pixelated'; } var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1; if (strategy.canvasResolutionScaleMode != 0) { target.width = cssWidth * dpiScale; target.height = cssHeight * dpiScale; if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height); } return restoreOldStyle; },requestFullscreen:function (target, strategy) { // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { JSEvents.resizeCanvasForFullscreen(target, strategy); } if (target.requestFullscreen) { target.requestFullscreen(); } else if (target.msRequestFullscreen) { target.msRequestFullscreen(); } else if (target.mozRequestFullScreen) { target.mozRequestFullScreen(); } else if (target.mozRequestFullscreen) { target.mozRequestFullscreen(); } else if (target.webkitRequestFullscreen) { target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); } else { if (typeof JSEvents.fullscreenEnabled() === 'undefined') { return -1; } else { return -3; } } if (strategy.canvasResizedCallback) { Runtime.dynCall('iiii', strategy.canvasResizedCallback, [37, 0, strategy.canvasResizedCallbackUserData]); } return 0; },fillPointerlockChangeEventData:function (eventStruct, e) { var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; var isPointerlocked = !!pointerLockElement; HEAP32[((eventStruct)>>2)]=isPointerlocked; var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; writeStringToMemory(nodeName, eventStruct + 4 ); writeStringToMemory(id, eventStruct + 132); },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.pointerlockChangeEvent) { JSEvents.pointerlockChangeEvent = _malloc( 260 ); } if (!target) { target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window' } else { target = JSEvents.findEventTarget(target); } var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.pointerlockChangeEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },requestPointerLock:function (target) { if (target.requestPointerLock) { target.requestPointerLock(); } else if (target.mozRequestPointerLock) { target.mozRequestPointerLock(); } else if (target.webkitRequestPointerLock) { target.webkitRequestPointerLock(); } else if (target.msRequestPointerLock) { target.msRequestPointerLock(); } else { // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, // or if the whole browser just doesn't support the feature. if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) { return -3; } else { return -1; } } return 0; },fillVisibilityChangeEventData:function (eventStruct, e) { var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ]; var visibilityState = visibilityStates.indexOf(document.visibilityState); HEAP32[((eventStruct)>>2)]=document.hidden; HEAP32[(((eventStruct)+(4))>>2)]=visibilityState; },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.visibilityChangeEvent) { JSEvents.visibilityChangeEvent = _malloc( 8 ); } if (!target) { target = document; // Visibility change events need to be captured from 'document' by default instead of 'window' } else { target = JSEvents.findEventTarget(target); } var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.visibilityChangeEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.touchEvent) { JSEvents.touchEvent = _malloc( 1684 ); } target = JSEvents.findEventTarget(target); var handlerFunc = function(event) { var e = event || window.event; var touches = {}; for(var i = 0; i < e.touches.length; ++i) { var touch = e.touches[i]; touches[touch.identifier] = touch; } for(var i = 0; i < e.changedTouches.length; ++i) { var touch = e.changedTouches[i]; touches[touch.identifier] = touch; touch.changed = true; } for(var i = 0; i < e.targetTouches.length; ++i) { var touch = e.targetTouches[i]; touches[touch.identifier].onTarget = true; } var ptr = JSEvents.touchEvent; HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey; HEAP32[(((ptr)+(8))>>2)]=e.shiftKey; HEAP32[(((ptr)+(12))>>2)]=e.altKey; HEAP32[(((ptr)+(16))>>2)]=e.metaKey; ptr += 20; // Advance to the start of the touch array. var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined; var targetRect = JSEvents.getBoundingClientRectOrZeros(target); var numTouches = 0; for(var i in touches) { var t = touches[i]; HEAP32[((ptr)>>2)]=t.identifier; HEAP32[(((ptr)+(4))>>2)]=t.screenX; HEAP32[(((ptr)+(8))>>2)]=t.screenY; HEAP32[(((ptr)+(12))>>2)]=t.clientX; HEAP32[(((ptr)+(16))>>2)]=t.clientY; HEAP32[(((ptr)+(20))>>2)]=t.pageX; HEAP32[(((ptr)+(24))>>2)]=t.pageY; HEAP32[(((ptr)+(28))>>2)]=t.changed; HEAP32[(((ptr)+(32))>>2)]=t.onTarget; if (canvasRect) { HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left; HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top; } else { HEAP32[(((ptr)+(44))>>2)]=0; HEAP32[(((ptr)+(48))>>2)]=0; } HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left; HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top; ptr += 52; if (++numTouches >= 32) { break; } } HEAP32[((JSEvents.touchEvent)>>2)]=numTouches; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.touchEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: target, allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493 // Once the above bug is resolved, enable the following condition if possible: // allowsDeferredCalls: eventTypeString == 'touchstart', eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },fillGamepadEventData:function (eventStruct, e) { HEAPF64[((eventStruct)>>3)]=e.timestamp; for(var i = 0; i < e.axes.length; ++i) { HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i]; } for(var i = 0; i < e.buttons.length; ++i) { if (typeof(e.buttons[i]) === 'object') { HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value; } else { HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i]; } } for(var i = 0; i < e.buttons.length; ++i) { if (typeof(e.buttons[i]) === 'object') { HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed; } else { HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0; } } HEAP32[(((eventStruct)+(1296))>>2)]=e.connected; HEAP32[(((eventStruct)+(1300))>>2)]=e.index; HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length; HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length; writeStringToMemory(e.id, eventStruct + 1304 ); writeStringToMemory(e.mapping, eventStruct + 1368 ); },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.gamepadEvent) { JSEvents.gamepadEvent = _malloc( 1432 ); } var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.gamepadEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: true, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { var handlerFunc = function(event) { var e = event || window.event; var confirmationMessage = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]); if (confirmationMessage) { confirmationMessage = Pointer_stringify(confirmationMessage); } if (confirmationMessage) { e.preventDefault(); e.returnValue = confirmationMessage; return confirmationMessage; } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) { HEAPF64[((eventStruct)>>3)]=e.chargingTime; HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime; HEAPF64[(((eventStruct)+(16))>>3)]=e.level; HEAP32[(((eventStruct)+(24))>>2)]=e.charging; },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!JSEvents.batteryEvent) { JSEvents.batteryEvent = _malloc( 32 ); } var handlerFunc = function(event) { var e = event || window.event; JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery()); var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.batteryEvent, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { if (!target) { target = Module['canvas']; } var handlerFunc = function(event) { var e = event || window.event; var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]); if (shouldCancel) { e.preventDefault(); } }; var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: handlerFunc, useCapture: useCapture }; JSEvents.registerOrRemoveHandler(eventHandler); }};function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) { JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel"); return 0; } function _glBindFramebuffer(target, framebuffer) { GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null); } function ___lock() {} function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx.blendFuncSeparate(x0, x1, x2, x3) } function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) { if (!pointer) { // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense // if pointer == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname); } function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx.vertexAttrib3f(x0, x1, x2, x3) } function _alSource3f(source, param, v1, v2, v3) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } switch (param) { case 0x1004 /* AL_POSITION */: src.position = [v1, v2, v3]; break; case 0x1005 /* AL_DIRECTION */: src.direction = [v1, v2, v3]; break; case 0x1006 /* AL_VELOCITY */: src.velocity = [v1, v2, v3]; break; default: AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */; break; } } function _emscripten_glNormalPointer() { Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1); } var _emscripten_GetProcAddress=undefined; Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress; function _eglWaitClient() { EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); return 1; }var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) { EGL.errorCode = code; },chooseConfig:function (display, attribList, config, config_size, numConfigs) { if (display != 62000 /* Magic ID for Emscripten 'default display' */) { EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); return 0; } // TODO: read attribList. if ((!config || !config_size) && !numConfigs) { EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); return 0; } if (numConfigs) { HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1. } if (config && config_size > 0) { HEAP32[((config)>>2)]=62002; } EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); return 1; }};function _eglGetProcAddress(name_) { return _emscripten_GetProcAddress(name_); } function _glDeleteProgram(id) { if (!id) return; var program = GL.programs[id]; if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } GLctx.deleteProgram(program); program.name = 0; GL.programs[id] = null; GL.programInfos[id] = null; } var _setSourceState=undefined;function _alSourcePlay(source) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } AL.setSourceState(src, 0x1012 /* AL_PLAYING */); } function _glAttachShader(program, shader) { GLctx.attachShader(GL.programs[program], GL.shaders[shader]); } function _glfwGetPrimaryMonitor() { return 1; } function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { if (!params) { // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense // if params == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } var data = GLctx.getVertexAttrib(index, pname); if (typeof data == 'number' || typeof data == 'boolean') { switch (type) { case 'Integer': HEAP32[((params)>>2)]=data; break; case 'Float': HEAPF32[((params)>>2)]=data; break; case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break; default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type; } } else { for (var i = 0; i < data.length; i++) { switch (type) { case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break; case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break; case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break; default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type; } } } }function _emscripten_glGetVertexAttribfv(index, pname, params) { // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), // otherwise the results are undefined. (GLES3 spec 6.1.12) emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float'); } function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) { JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart"); return 0; } function _emscripten_glDeleteShader(id) { if (!id) return; var shader = GL.shaders[id]; if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } GLctx.deleteShader(shader); GL.shaders[id] = null; } function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } function _emscripten_glDeleteBuffers(n, buffers) { for (var i = 0; i < n; i++) { var id = HEAP32[(((buffers)+(i*4))>>2)]; var buffer = GL.buffers[id]; // From spec: "glDeleteBuffers silently ignores 0's and names that do not // correspond to existing buffer objects." if (!buffer) continue; GLctx.deleteBuffer(buffer); buffer.name = 0; GL.buffers[id] = null; if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; } } function _emscripten_glTexParameteriv(target, pname, params) { var param = HEAP32[((params)>>2)]; GLctx.texParameteri(target, pname, param); } function _glDrawElements(mode, count, type, indices) { GLctx.drawElements(mode, count, type, indices); } function _glfwTerminate() { window.removeEventListener("keydown", GLFW.onKeydown, true); window.removeEventListener("keypress", GLFW.onKeyPress, true); window.removeEventListener("keyup", GLFW.onKeyup, true); Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true); Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true); Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true); Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true); Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true); Module["canvas"].width = Module["canvas"].height = 1; GLFW.windows = null; GLFW.active = null; } function _emscripten_glUniformMatrix2fv(location, count, transpose, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform matrix view = GL.miniTempBufferViews[3]; for (var i = 0; i < 4; i++) { view[i] = HEAPF32[(((value)+(i*4))>>2)]; } } else { view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); } GLctx.uniformMatrix2fv(location, transpose, view); } function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs; try { // open var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO var stream = FS.open(pathname, flags, mode); return stream.fd; } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs; try { // close var stream = SYSCALLS.getStreamFromFD(); FS.close(stream); return 0; } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } var _cos=Math_cos; function _llvm_stacksave() { var self = _llvm_stacksave; if (!self.LLVM_SAVEDSTACKS) { self.LLVM_SAVEDSTACKS = []; } self.LLVM_SAVEDSTACKS.push(Runtime.stackSave()); return self.LLVM_SAVEDSTACKS.length-1; } function _emscripten_glGetVertexAttribiv(index, pname, params) { // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), // otherwise the results are undefined. (GLES3 spec 6.1.12) emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger'); } function _emscripten_glUniformMatrix4fv(location, count, transpose, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform matrix view = GL.miniTempBufferViews[15]; for (var i = 0; i < 16; i++) { view[i] = HEAPF32[(((value)+(i*4))>>2)]; } } else { view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); } GLctx.uniformMatrix4fv(location, transpose, view); } function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) { GLctx['drawArraysInstanced'](mode, first, count, primcount); } function _emscripten_glEnableClientState() { Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1); } function _emscripten_glGetPointerv() { Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1); } function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs; try { // llseek var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); var offset = offset_low; assert(offset_high === 0); FS.llseek(stream, offset, whence); HEAP32[((result)>>2)]=stream.position; if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state return 0; } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs; try { // writev var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); return SYSCALLS.doWritev(stream, iov, iovcnt); } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function _emscripten_glUniform1i(location, v0) { location = GL.uniforms[location]; GLctx.uniform1i(location, v0); } function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs; try { // readv var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); return SYSCALLS.doReadv(stream, iov, iovcnt); } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function _emscripten_glStencilMask(x0) { GLctx.stencilMask(x0) } function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx.stencilFuncSeparate(x0, x1, x2, x3) } Module["_i64Subtract"] = _i64Subtract; var _fabsf=Math_abs; Module["_i64Add"] = _i64Add; function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) { JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend"); return 0; } function _glUseProgram(program) { GLctx.useProgram(program ? GL.programs[program] : null); } var _sinf=Math_sin; function _emscripten_glDisableVertexAttribArray(index) { GLctx.disableVertexAttribArray(index); } function _emscripten_glVertexAttrib1f(x0, x1) { GLctx.vertexAttrib1f(x0, x1) } function _emscripten_glFinish() { GLctx.finish() } function _glDeleteFramebuffers(n, framebuffers) { for (var i = 0; i < n; ++i) { var id = HEAP32[(((framebuffers)+(i*4))>>2)]; var framebuffer = GL.framebuffers[id]; if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". GLctx.deleteFramebuffer(framebuffer); framebuffer.name = 0; GL.framebuffers[id] = null; } } function _glDrawArrays(mode, first, count) { GLctx.drawArrays(mode, first, count); } function _emscripten_glDepthFunc(x0) { GLctx.depthFunc(x0) } function _alcOpenDevice(deviceName) { if (typeof(AudioContext) !== "undefined" || typeof(webkitAudioContext) !== "undefined") { return 1; // non-null pointer -- we just simulate one device } else { return 0; } } function _sysconf(name) { // long sysconf(int name); // http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html switch(name) { case 30: return PAGE_SIZE; case 85: return totalMemory / PAGE_SIZE; case 132: case 133: case 12: case 137: case 138: case 15: case 235: case 16: case 17: case 18: case 19: case 20: case 149: case 13: case 10: case 236: case 153: case 9: case 21: case 22: case 159: case 154: case 14: case 77: case 78: case 139: case 80: case 81: case 82: case 68: case 67: case 164: case 11: case 29: case 47: case 48: case 95: case 52: case 51: case 46: return 200809; case 79: return 0; case 27: case 246: case 127: case 128: case 23: case 24: case 160: case 161: case 181: case 182: case 242: case 183: case 184: case 243: case 244: case 245: case 165: case 178: case 179: case 49: case 50: case 168: case 169: case 175: case 170: case 171: case 172: case 97: case 76: case 32: case 173: case 35: return -1; case 176: case 177: case 7: case 155: case 8: case 157: case 125: case 126: case 92: case 93: case 129: case 130: case 131: case 94: case 91: return 1; case 74: case 60: case 69: case 70: case 4: return 1024; case 31: case 42: case 72: return 32; case 87: case 26: case 33: return 2147483647; case 34: case 1: return 47839; case 38: case 36: return 99; case 43: case 37: return 2048; case 0: return 2097152; case 3: return 65536; case 28: return 32768; case 44: return 32767; case 75: return 16384; case 39: return 1000; case 89: return 700; case 71: return 256; case 40: return 255; case 2: return 100; case 180: return 64; case 25: return 20; case 5: return 16; case 6: return 6; case 73: return 4; case 84: { if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1; return 1; } } ___setErrNo(ERRNO_CODES.EINVAL); return -1; } function _emscripten_glUniform4iv(location, count, value) { location = GL.uniforms[location]; count *= 4; value = HEAP32.subarray((value)>>2,(value+count*4)>>2); GLctx.uniform4iv(location, value); } function _glClear(x0) { GLctx.clear(x0) } function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } function _emscripten_glUniform3fv(location, count, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform view = GL.miniTempBufferViews[2]; view[0] = HEAPF32[((value)>>2)]; view[1] = HEAPF32[(((value)+(4))>>2)]; view[2] = HEAPF32[(((value)+(8))>>2)]; } else { view = HEAPF32.subarray((value)>>2,(value+count*12)>>2); } GLctx.uniform3fv(location, view); } function _emscripten_glIsTexture(texture) { var texture = GL.textures[texture]; if (!texture) return 0; return GLctx.isTexture(texture); } function _glEnableVertexAttribArray(index) { GLctx.enableVertexAttribArray(index); } function _emscripten_glAttachShader(program, shader) { GLctx.attachShader(GL.programs[program], GL.shaders[shader]); } function _alSourceUnqueueBuffers(source, count, buffers) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } if (count > src.buffersPlayed) { AL.currentContext.err = 0xA003 /* AL_INVALID_VALUE */; return; } for (var i = 0; i < count; i++) { var entry = src.queue.shift(); // Write the buffers index out to the return list. for (var j = 0; j < AL.currentContext.buf.length; j++) { var b = AL.currentContext.buf[j]; if (b && b == entry.buffer) { HEAP32[(((buffers)+(i*4))>>2)]=j+1; break; } } src.buffersPlayed--; } AL.updateSource(src); } function _glfwCreateWindow(width, height, title, monitor, share) { return GLFW.createWindow(width, height, title, monitor, share); } function _alGetSourcei(source, param, value) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } // Being that we have no way to receive end events from buffer nodes, // we currently proccess and update a source's buffer queue every // ~QUEUE_INTERVAL milliseconds. However, this interval is not precise, // so we also forcefully update the source when alGetSourcei is queried // to aid in the common scenario of application calling alGetSourcei(AL_BUFFERS_PROCESSED) // to recycle buffers. AL.updateSource(src); switch (param) { case 0x202 /* AL_SOURCE_RELATIVE */: HEAP32[((value)>>2)]=src.panner ? 1 : 0; break; case 0x1001 /* AL_CONE_INNER_ANGLE */: HEAP32[((value)>>2)]=src.coneInnerAngle; break; case 0x1002 /* AL_CONE_OUTER_ANGLE */: HEAP32[((value)>>2)]=src.coneOuterAngle; break; case 0x1007 /* AL_LOOPING */: HEAP32[((value)>>2)]=src.loop; break; case 0x1009 /* AL_BUFFER */: if (!src.queue.length) { HEAP32[((value)>>2)]=0; } else { // Find the first unprocessed buffer. var buffer = src.queue[src.buffersPlayed].buffer; // Return its index. for (var i = 0; i < AL.currentContext.buf.length; ++i) { if (buffer == AL.currentContext.buf[i]) { HEAP32[((value)>>2)]=i+1; return; } } HEAP32[((value)>>2)]=0; } break; case 0x1010 /* AL_SOURCE_STATE */: HEAP32[((value)>>2)]=src.state; break; case 0x1015 /* AL_BUFFERS_QUEUED */: HEAP32[((value)>>2)]=src.queue.length break; case 0x1016 /* AL_BUFFERS_PROCESSED */: if (src.loop) { HEAP32[((value)>>2)]=0 } else { HEAP32[((value)>>2)]=src.buffersPlayed } break; default: AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */; break; } } function _pthread_cleanup_pop() { assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!'); __ATEXIT__.pop(); _pthread_cleanup_push.level = __ATEXIT__.length; } function _emscripten_glClearStencil(x0) { GLctx.clearStencil(x0) } function _emscripten_glDetachShader(program, shader) { GLctx.detachShader(GL.programs[program], GL.shaders[shader]); } function _emscripten_glDeleteVertexArrays(n, vaos) { for(var i = 0; i < n; i++) { var id = HEAP32[(((vaos)+(i*4))>>2)]; GLctx['deleteVertexArray'](GL.vaos[id]); GL.vaos[id] = null; } } function _alGenSources(count, sources) { if (!AL.currentContext) { return; } for (var i = 0; i < count; ++i) { var gain = AL.currentContext.ctx.createGain(); gain.connect(AL.currentContext.gain); AL.currentContext.src[AL.newSrcId] = { state: 0x1011 /* AL_INITIAL */, queue: [], loop: false, get refDistance() { return this._refDistance || 1; }, set refDistance(val) { this._refDistance = val; if (this.panner) this.panner.refDistance = val; }, get maxDistance() { return this._maxDistance || 10000; }, set maxDistance(val) { this._maxDistance = val; if (this.panner) this.panner.maxDistance = val; }, get rolloffFactor() { return this._rolloffFactor || 1; }, set rolloffFactor(val) { this._rolloffFactor = val; if (this.panner) this.panner.rolloffFactor = val; }, get position() { return this._position || [0, 0, 0]; }, set position(val) { this._position = val; if (this.panner) this.panner.setPosition(val[0], val[1], val[2]); }, get velocity() { return this._velocity || [0, 0, 0]; }, set velocity(val) { this._velocity = val; if (this.panner) this.panner.setVelocity(val[0], val[1], val[2]); }, get direction() { return this._direction || [0, 0, 0]; }, set direction(val) { this._direction = val; if (this.panner) this.panner.setOrientation(val[0], val[1], val[2]); }, get coneOuterGain() { return this._coneOuterGain || 0.0; }, set coneOuterGain(val) { this._coneOuterGain = val; if (this.panner) this.panner.coneOuterGain = val; }, get coneInnerAngle() { return this._coneInnerAngle || 360.0; }, set coneInnerAngle(val) { this._coneInnerAngle = val; if (this.panner) this.panner.coneInnerAngle = val; }, get coneOuterAngle() { return this._coneOuterAngle || 360.0; }, set coneOuterAngle(val) { this._coneOuterAngle = val; if (this.panner) this.panner.coneOuterAngle = val; }, gain: gain, panner: null, buffersPlayed: 0, bufferPosition: 0 }; HEAP32[(((sources)+(i*4))>>2)]=AL.newSrcId; AL.newSrcId++; } } function _glfwInit() { if (GLFW.windows) return 1; // GL_TRUE GLFW.initialTime = GLFW.getTime(); GLFW.hints = GLFW.defaultHints; GLFW.windows = new Array() GLFW.active = null; window.addEventListener("keydown", GLFW.onKeydown, true); window.addEventListener("keypress", GLFW.onKeyPress, true); window.addEventListener("keyup", GLFW.onKeyup, true); Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true); Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true); Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true); Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true); Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true); Browser.resizeListeners.push(function(width, height) { GLFW.onFullScreenEventChange(); }); return 1; // GL_TRUE } function _emscripten_glGetTexParameteriv(target, pname, params) { if (!params) { // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname); } function _alDeleteSources(count, sources) { if (!AL.currentContext) { return; } for (var i = 0; i < count; ++i) { var sourceIdx = HEAP32[(((sources)+(i*4))>>2)]; delete AL.currentContext.src[sourceIdx]; } } function _glfwSwapBuffers(winid) { GLFW.swapBuffers(winid); } function _emscripten_glGenerateMipmap(x0) { GLctx.generateMipmap(x0) } function _emscripten_glCullFace(x0) { GLctx.cullFace(x0) } function _emscripten_glUniform4f(location, v0, v1, v2, v3) { location = GL.uniforms[location]; GLctx.uniform4f(location, v0, v1, v2, v3); } function _glDisableVertexAttribArray(index) { GLctx.disableVertexAttribArray(index); } function _emscripten_glUseProgram(program) { GLctx.useProgram(program ? GL.programs[program] : null); } function _emscripten_glHint(x0, x1) { GLctx.hint(x0, x1) } function _emscripten_glUniform2fv(location, count, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform view = GL.miniTempBufferViews[1]; view[0] = HEAPF32[((value)>>2)]; view[1] = HEAPF32[(((value)+(4))>>2)]; } else { view = HEAPF32.subarray((value)>>2,(value+count*8)>>2); } GLctx.uniform2fv(location, view); } function _glfwSwapInterval(interval) { interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same. if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0); else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval); } function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { var log = GLctx.getShaderInfoLog(GL.shaders[shader]); if (log === null) log = '(unknown error)'; log = log.substr(0, maxLength - 1); if (maxLength > 0 && infoLog) { writeStringToMemory(log, infoLog); if (length) HEAP32[((length)>>2)]=log.length; } else { if (length) HEAP32[((length)>>2)]=0; } } function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } function _abort() { Module['abort'](); } function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]); } function _alGenBuffers(count, buffers) { if (!AL.currentContext) { return; } for (var i = 0; i < count; ++i) { AL.currentContext.buf.push(null); HEAP32[(((buffers)+(i*4))>>2)]=AL.currentContext.buf.length; } } function _emscripten_glDeleteFramebuffers(n, framebuffers) { for (var i = 0; i < n; ++i) { var id = HEAP32[(((framebuffers)+(i*4))>>2)]; var framebuffer = GL.framebuffers[id]; if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". GLctx.deleteFramebuffer(framebuffer); framebuffer.name = 0; GL.framebuffers[id] = null; } } function _emscripten_glIsBuffer(buffer) { var b = GL.buffers[buffer]; if (!b) return 0; return GLctx.isBuffer(b); } function _emscripten_glUniform2iv(location, count, value) { location = GL.uniforms[location]; count *= 2; value = HEAP32.subarray((value)>>2,(value+count*4)>>2); GLctx.uniform2iv(location, value); } function _emscripten_glVertexAttrib1fv(index, v) { v = HEAPF32.subarray((v)>>2,(v+4)>>2); GLctx.vertexAttrib1fv(index, v); } function _glEnable(x0) { GLctx.enable(x0) } function _alBufferData(buffer, format, data, size, freq) { if (!AL.currentContext) { return; } if (buffer > AL.currentContext.buf.length) { return; } var channels, bytes; switch (format) { case 0x1100 /* AL_FORMAT_MONO8 */: bytes = 1; channels = 1; break; case 0x1101 /* AL_FORMAT_MONO16 */: bytes = 2; channels = 1; break; case 0x1102 /* AL_FORMAT_STEREO8 */: bytes = 1; channels = 2; break; case 0x1103 /* AL_FORMAT_STEREO16 */: bytes = 2; channels = 2; break; case 0x10010 /* AL_FORMAT_MONO_FLOAT32 */: bytes = 4; channels = 1; break; case 0x10011 /* AL_FORMAT_STEREO_FLOAT32 */: bytes = 4; channels = 2; break; default: return; } try { AL.currentContext.buf[buffer - 1] = AL.currentContext.ctx.createBuffer(channels, size / (bytes * channels), freq); AL.currentContext.buf[buffer - 1].bytesPerSample = bytes; } catch (e) { AL.currentContext.err = 0xA003 /* AL_INVALID_VALUE */; return; } var buf = new Array(channels); for (var i = 0; i < channels; ++i) { buf[i] = AL.currentContext.buf[buffer - 1].getChannelData(i); } for (var i = 0; i < size / (bytes * channels); ++i) { for (var j = 0; j < channels; ++j) { switch (bytes) { case 1: var val = HEAP8[(((data)+(i*channels+j))>>0)] & 0xff; // unsigned buf[j][i] = -1.0 + val * (2/256); break; case 2: var val = HEAP16[(((data)+(2*(i*channels+j)))>>1)]; buf[j][i] = val/32768; break; case 4: buf[j][i] = HEAPF32[(((data)+(4*(i*channels+j)))>>2)]; break; } } } } function _alSourceStop(source) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } AL.setSourceState(src, 0x1014 /* AL_STOPPED */); } function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) { function roundedToNextMultipleOf(x, y) { return Math.floor((x + y - 1) / y) * y } var plainRowSize = width * sizePerPixel; var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); return (height <= 0) ? 0 : ((height - 1) * alignedRowSize + plainRowSize); }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { var sizePerPixel; var numChannels; switch(format) { case 0x1906 /* GL_ALPHA */: case 0x1909 /* GL_LUMINANCE */: case 0x1902 /* GL_DEPTH_COMPONENT */: case 0x1903 /* GL_RED */: numChannels = 1; break; case 0x190A /* GL_LUMINANCE_ALPHA */: case 0x8227 /* GL_RG */: numChannels = 2; break; case 0x1907 /* GL_RGB */: case 0x8C40 /* GL_SRGB_EXT */: numChannels = 3; break; case 0x1908 /* GL_RGBA */: case 0x8C42 /* GL_SRGB_ALPHA_EXT */: numChannels = 4; break; default: GL.recordError(0x0500); // GL_INVALID_ENUM return { pixels: null, internalFormat: 0x0 }; } switch (type) { case 0x1401 /* GL_UNSIGNED_BYTE */: sizePerPixel = numChannels*1; break; case 0x1403 /* GL_UNSIGNED_SHORT */: case 0x8D61 /* GL_HALF_FLOAT_OES */: sizePerPixel = numChannels*2; break; case 0x1405 /* GL_UNSIGNED_INT */: case 0x1406 /* GL_FLOAT */: sizePerPixel = numChannels*4; break; case 0x84FA /* UNSIGNED_INT_24_8_WEBGL/UNSIGNED_INT_24_8 */: sizePerPixel = 4; break; case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */: case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */: case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */: sizePerPixel = 2; break; default: GL.recordError(0x0500); // GL_INVALID_ENUM return { pixels: null, internalFormat: 0x0 }; } var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment); if (type == 0x1401 /* GL_UNSIGNED_BYTE */) { pixels = HEAPU8.subarray((pixels),(pixels+bytes)); } else if (type == 0x1406 /* GL_FLOAT */) { pixels = HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2); } else if (type == 0x1405 /* GL_UNSIGNED_INT */ || type == 0x84FA /* UNSIGNED_INT_24_8_WEBGL */) { pixels = HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2); } else { pixels = HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1); } return { pixels: pixels, internalFormat: internalFormat }; }function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { var pixelData; if (pixels) { pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, -1).pixels; } else { pixelData = null; } GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData); } function _emscripten_glPolygonOffset(x0, x1) { GLctx.polygonOffset(x0, x1) } var _emscripten_asm_const_int=true; function _emscripten_glUniform2f(location, v0, v1) { location = GL.uniforms[location]; GLctx.uniform2f(location, v0, v1); } function _glGetAttribLocation(program, name) { program = GL.programs[program]; name = Pointer_stringify(name); return GLctx.getAttribLocation(program, name); } function _glfwWindowHint(target, hint) { GLFW.hints[target] = hint; } var _sin=Math_sin; function _glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) } function _glCreateProgram() { var id = GL.getNewId(GL.programs); var program = GLctx.createProgram(); program.name = id; GL.programs[id] = program; return id; } function _emscripten_glDeleteRenderbuffers(n, renderbuffers) { for (var i = 0; i < n; i++) { var id = HEAP32[(((renderbuffers)+(i*4))>>2)]; var renderbuffer = GL.renderbuffers[id]; if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects". GLctx.deleteRenderbuffer(renderbuffer); renderbuffer.name = 0; GL.renderbuffers[id] = null; } } function _emscripten_glGetBufferParameteriv(target, value, data) { if (!data) { // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense // if data == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value); } function emscriptenWebGLGetUniform(program, location, params, type) { if (!params) { // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense // if params == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]); if (typeof data == 'number' || typeof data == 'boolean') { switch (type) { case 'Integer': HEAP32[((params)>>2)]=data; break; case 'Float': HEAPF32[((params)>>2)]=data; break; default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type; } } else { for (var i = 0; i < data.length; i++) { switch (type) { case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break; case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break; default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type; } } } }function _emscripten_glGetUniformiv(program, location, params) { emscriptenWebGLGetUniform(program, location, params, 'Integer'); } function _emscripten_glDepthMask(x0) { GLctx.depthMask(x0) } function _emscripten_glDepthRangef(x0, x1) { GLctx.depthRange(x0, x1) } function _emscripten_glDepthRange(x0, x1) { GLctx.depthRange(x0, x1) } function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) { if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1; if (!target) target = document; else { target = JSEvents.findEventTarget(target); if (!target) return -4; } JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange"); JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange"); JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange"); JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange"); return 0; } var _fabs=Math_abs; function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); HEAP32[((range)>>2)]=result.rangeMin; HEAP32[(((range)+(4))>>2)]=result.rangeMax; HEAP32[((precision)>>2)]=result.precision; } function _emscripten_glUniform1fv(location, count, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform view = GL.miniTempBufferViews[0]; view[0] = HEAPF32[((value)>>2)]; } else { view = HEAPF32.subarray((value)>>2,(value+count*4)>>2); } GLctx.uniform1fv(location, view); } function _glDeleteBuffers(n, buffers) { for (var i = 0; i < n; i++) { var id = HEAP32[(((buffers)+(i*4))>>2)]; var buffer = GL.buffers[id]; // From spec: "glDeleteBuffers silently ignores 0's and names that do not // correspond to existing buffer objects." if (!buffer) continue; GLctx.deleteBuffer(buffer); buffer.name = 0; GL.buffers[id] = null; if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; } } var _atan2=Math_atan2; function _emscripten_glBindProgramARB() { Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1); } function _emscripten_glBindTexture(target, texture) { GLctx.bindTexture(target, texture ? GL.textures[texture] : null); } function _glfwDefaultWindowHints() { GLFW.hints = GLFW.defaultHints; } function _emscripten_glDeleteProgram(id) { if (!id) return; var program = GL.programs[id]; if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } GLctx.deleteProgram(program); program.name = 0; GL.programs[id] = null; GL.programInfos[id] = null; } function _emscripten_glDisable(x0) { GLctx.disable(x0) } function _emscripten_glVertexAttrib3fv(index, v) { v = HEAPF32.subarray((v)>>2,(v+12)>>2); GLctx.vertexAttrib3fv(index, v); } function _glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) } function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) { program = GL.programs[program]; var info = GLctx.getActiveAttrib(program, index); if (!info) return; // If an error occurs, nothing will be written to length, size and type and name. var infoname = info.name.slice(0, Math.max(0, bufSize - 1)); if (bufSize > 0 && name) { writeStringToMemory(infoname, name); if (length) HEAP32[((length)>>2)]=infoname.length; } else { if (length) HEAP32[((length)>>2)]=0; } if (size) HEAP32[((size)>>2)]=info.size; if (type) HEAP32[((type)>>2)]=info.type; } function _emscripten_glIsFramebuffer(framebuffer) { var fb = GL.framebuffers[framebuffer]; if (!fb) return 0; return GLctx.isFramebuffer(fb); } function _emscripten_glLineWidth(x0) { GLctx.lineWidth(x0) } function _glfwGetCursorPos(winid, x, y) { GLFW.getCursorPos(winid, x, y); } function _emscripten_glGetString(name_) { if (GL.stringCache[name_]) return GL.stringCache[name_]; var ret; switch(name_) { case 0x1F00 /* GL_VENDOR */: case 0x1F01 /* GL_RENDERER */: case 0x1F02 /* GL_VERSION */: ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL); break; case 0x1F03 /* GL_EXTENSIONS */: var exts = GLctx.getSupportedExtensions(); var gl_exts = []; for (var i in exts) { gl_exts.push(exts[i]); gl_exts.push("GL_" + exts[i]); } ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); break; case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL); break; default: GL.recordError(0x0500/*GL_INVALID_ENUM*/); return 0; } GL.stringCache[name_] = ret; return ret; } function _emscripten_glGetAttribLocation(program, name) { program = GL.programs[program]; name = Pointer_stringify(name); return GLctx.getAttribLocation(program, name); } function _emscripten_glRotatef() { Module['printErr']('missing function: emscripten_glRotatef'); abort(-1); } function emscriptenWebGLGet(name_, p, type) { // Guard against user passing a null pointer. // Note that GLES2 spec does not say anything about how passing a null pointer should be treated. // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but // better to report an error instead of doing anything random. if (!p) { GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } var ret = undefined; switch(name_) { // Handle a few trivial GLES values case 0x8DFA: // GL_SHADER_COMPILER ret = 1; break; case 0x8DF8: // GL_SHADER_BINARY_FORMATS if (type !== 'Integer' && type !== 'Integer64') { GL.recordError(0x0500); // GL_INVALID_ENUM } return; // Do not write anything to the out pointer, since no binary formats are supported. case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS ret = 0; break; case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length), // so implement it ourselves to allow C++ GLES2 code get the length. var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/); ret = formats.length; break; case 0x8B9A: // GL_IMPLEMENTATION_COLOR_READ_TYPE ret = 0x1401; // GL_UNSIGNED_BYTE break; case 0x8B9B: // GL_IMPLEMENTATION_COLOR_READ_FORMAT ret = 0x1908; // GL_RGBA break; } if (ret === undefined) { var result = GLctx.getParameter(name_); switch (typeof(result)) { case "number": ret = result; break; case "boolean": ret = result ? 1 : 0; break; case "string": GL.recordError(0x0500); // GL_INVALID_ENUM return; case "object": if (result === null) { // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise // can mean an invalid name_, which we need to report as an error switch(name_) { case 0x8894: // ARRAY_BUFFER_BINDING case 0x8B8D: // CURRENT_PROGRAM case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING case 0x8CA6: // FRAMEBUFFER_BINDING case 0x8CA7: // RENDERBUFFER_BINDING case 0x8069: // TEXTURE_BINDING_2D case 0x8514: { // TEXTURE_BINDING_CUBE_MAP ret = 0; break; } default: { GL.recordError(0x0500); // GL_INVALID_ENUM return; } } } else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) { for (var i = 0; i < result.length; ++i) { switch (type) { case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break; case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break; case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break; default: throw 'internal glGet error, bad type: ' + type; } } return; } else if (result instanceof WebGLBuffer || result instanceof WebGLProgram || result instanceof WebGLFramebuffer || result instanceof WebGLRenderbuffer || result instanceof WebGLTexture) { ret = result.name | 0; } else { GL.recordError(0x0500); // GL_INVALID_ENUM return; } break; default: GL.recordError(0x0500); // GL_INVALID_ENUM return; } } switch (type) { case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break; case 'Integer': HEAP32[((p)>>2)]=ret; break; case 'Float': HEAPF32[((p)>>2)]=ret; break; case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break; default: throw 'internal glGet error, bad type: ' + type; } }function _emscripten_glGetIntegerv(name_, p) { emscriptenWebGLGet(name_, p, 'Integer'); } function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); HEAP32[((params)>>2)]=result; } function _llvm_stackrestore(p) { var self = _llvm_stacksave; var ret = self.LLVM_SAVEDSTACKS[p]; self.LLVM_SAVEDSTACKS.splice(p, 1); Runtime.stackRestore(ret); } function _glfwSetWindowShouldClose(winid, value) { var win = GLFW.WindowFromId(winid); if (!win) return; win.shouldClose = value; } function _emscripten_glClientActiveTexture() { Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1); } function _glGenBuffers(n, buffers) { for (var i = 0; i < n; i++) { var buffer = GLctx.createBuffer(); if (!buffer) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.buffers); buffer.name = id; GL.buffers[id] = buffer; HEAP32[(((buffers)+(i*4))>>2)]=id; } } function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) { var log = GLctx.getShaderInfoLog(GL.shaders[shader]); if (log === null) log = '(unknown error)'; log = log.substr(0, maxLength - 1); if (maxLength > 0 && infoLog) { writeStringToMemory(log, infoLog); if (length) HEAP32[((length)>>2)]=log.length; } else { if (length) HEAP32[((length)>>2)]=0; } } function _glfwGetTime() { return GLFW.getTime() - GLFW.initialTime; } function _emscripten_glGetRenderbufferParameteriv(target, pname, params) { if (!params) { // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense // if params == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname); } function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx.stencilOpSeparate(x0, x1, x2, x3) } function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) { var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); if (!data.pixels) { GL.recordError(0x0500/*GL_INVALID_ENUM*/); return; } GLctx.readPixels(x, y, width, height, format, type, data.pixels); } function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { var heapView; if (data) { heapView = HEAPU8.subarray((data),(data+imageSize)); } else { heapView = null; } GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, heapView); } function _emscripten_glGetError() { // First return any GL error generated by the emscripten library_gl.js interop layer. if (GL.lastError) { var error = GL.lastError; GL.lastError = 0/*GL_NO_ERROR*/; return error; } else { // If there were none, return the GL error from the browser GL context. return GLctx.getError(); } } function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) { GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level); } function _pthread_cleanup_push(routine, arg) { __ATEXIT__.push(function() { Runtime.dynCall('vi', routine, [arg]) }) _pthread_cleanup_push.level = __ATEXIT__.length; } function _emscripten_glIsEnabled(x0) { return GLctx.isEnabled(x0) } function _alSourceQueueBuffers(source, count, buffers) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } for (var i = 0; i < count; ++i) { var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)]; if (bufferIdx > AL.currentContext.buf.length) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } } for (var i = 0; i < count; ++i) { var bufferIdx = HEAP32[(((buffers)+(i*4))>>2)]; var buffer = AL.currentContext.buf[bufferIdx - 1]; src.queue.push({ buffer: buffer, src: null }); } AL.updateSource(src); } function _alSourcef(source, param, value) { if (!AL.currentContext) { return; } var src = AL.currentContext.src[source]; if (!src) { AL.currentContext.err = 0xA001 /* AL_INVALID_NAME */; return; } switch (param) { case 0x1003 /* AL_PITCH */: break; case 0x100A /* AL_GAIN */: src.gain.gain.value = value; break; // case 0x100D /* AL_MIN_GAIN */: // break; // case 0x100E /* AL_MAX_GAIN */: // break; case 0x1023 /* AL_MAX_DISTANCE */: src.maxDistance = value; break; case 0x1021 /* AL_ROLLOFF_FACTOR */: src.rolloffFactor = value; break; case 0x1022 /* AL_CONE_OUTER_GAIN */: src.coneOuterGain = value; break; case 0x1001 /* AL_CONE_INNER_ANGLE */: src.coneInnerAngle = value; break; case 0x1002 /* AL_CONE_OUTER_ANGLE */: src.coneOuterAngle = value; break; case 0x1020 /* AL_REFERENCE_DISTANCE */: src.refDistance = value; break; default: AL.currentContext.err = 0xA002 /* AL_INVALID_ENUM */; break; } } Module["_memmove"] = _memmove; function _glGenTextures(n, textures) { for (var i = 0; i < n; i++) { var texture = GLctx.createTexture(); if (!texture) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.textures); texture.name = id; GL.textures[id] = texture; HEAP32[(((textures)+(i*4))>>2)]=id; } } function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) } function _glDepthFunc(x0) { GLctx.depthFunc(x0) } function _emscripten_glUniform2i(location, v0, v1) { location = GL.uniforms[location]; GLctx.uniform2i(location, v0, v1); } function _emscripten_glClearDepthf(x0) { GLctx.clearDepth(x0) } function _emscripten_glClear(x0) { GLctx.clear(x0) } function _alGetError() { if (!AL.currentContext) { return 0xA004 /* AL_INVALID_OPERATION */; } else { // Reset error on get. var err = AL.currentContext.err; AL.currentContext.err = 0 /* AL_NO_ERROR */; return err; } } function _emscripten_glBindBuffer(target, buffer) { var bufferObj = buffer ? GL.buffers[buffer] : null; GLctx.bindBuffer(target, bufferObj); } function _emscripten_glGetUniformfv(program, location, params) { emscriptenWebGLGetUniform(program, location, params, 'Float'); } function _glGetProgramiv(program, pname, p) { if (!p) { // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH var log = GLctx.getProgramInfoLog(GL.programs[program]); if (log === null) log = '(unknown error)'; HEAP32[((p)>>2)]=log.length + 1; } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { var ptable = GL.programInfos[program]; if (ptable) { HEAP32[((p)>>2)]=ptable.maxUniformLength; return; } else if (program < GL.counter) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); } else { GL.recordError(0x0501 /* GL_INVALID_VALUE */); } } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { var ptable = GL.programInfos[program]; if (ptable) { if (ptable.maxAttributeLength == -1) { var program = GL.programs[program]; var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. for(var i = 0; i < numAttribs; ++i) { var activeAttrib = GLctx.getActiveAttrib(program, i); ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); } } HEAP32[((p)>>2)]=ptable.maxAttributeLength; return; } else if (program < GL.counter) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); } else { GL.recordError(0x0501 /* GL_INVALID_VALUE */); } } else { HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); } } function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr); } function _alcMakeContextCurrent(context) { if (context == 0) { AL.currentContext = null; return 0; } else { AL.currentContext = AL.contexts[context - 1]; return 1; } } function _glGetUniformLocation(program, name) { name = Pointer_stringify(name); var arrayOffset = 0; // If user passed an array accessor "[index]", parse the array index off the accessor. if (name.indexOf(']', name.length-1) !== -1) { var ls = name.lastIndexOf('['); var arrayIndex = name.slice(ls+1, -1); if (arrayIndex.length > 0) { arrayOffset = parseInt(arrayIndex); if (arrayOffset < 0) { return -1; } } name = name.slice(0, ls); } var ptable = GL.programInfos[program]; if (!ptable) { return -1; } var utable = ptable.uniforms; var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. return uniformInfo[1]+arrayOffset; } else { return -1; } } function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) { var result = GLctx.getAttachedShaders(GL.programs[program]); var len = result.length; if (len > maxCount) { len = maxCount; } HEAP32[((count)>>2)]=len; for (var i = 0; i < len; ++i) { var id = GL.shaders.indexOf(result[i]); HEAP32[(((shaders)+(i*4))>>2)]=id; } } function _emscripten_glGenRenderbuffers(n, renderbuffers) { for (var i = 0; i < n; i++) { var renderbuffer = GLctx.createRenderbuffer(); if (!renderbuffer) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.renderbuffers); renderbuffer.name = id; GL.renderbuffers[id] = renderbuffer; HEAP32[(((renderbuffers)+(i*4))>>2)]=id; } } function _emscripten_glFrontFace(x0) { GLctx.frontFace(x0) } function _emscripten_glActiveTexture(x0) { GLctx.activeTexture(x0) } function _emscripten_glUniform1iv(location, count, value) { location = GL.uniforms[location]; value = HEAP32.subarray((value)>>2,(value+count*4)>>2); GLctx.uniform1iv(location, value); } function _glUniform4fv(location, count, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform view = GL.miniTempBufferViews[3]; view[0] = HEAPF32[((value)>>2)]; view[1] = HEAPF32[(((value)+(4))>>2)]; view[2] = HEAPF32[(((value)+(8))>>2)]; view[3] = HEAPF32[(((value)+(12))>>2)]; } else { view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); } GLctx.uniform4fv(location, view); } function _emscripten_glTexCoordPointer() { Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1); } function _emscripten_glGetInfoLogARB() { Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1); } function __exit(status) { // void _exit(int status); // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html Module['exit'](status); }function _exit(status) { __exit(status); } function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx.renderbufferStorage(x0, x1, x2, x3) } function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) } function _glfwSetCursorPosCallback(winid, cbfun) { GLFW.setCursorPosCallback(winid, cbfun); } function _emscripten_glShaderBinary() { GL.recordError(0x0500/*GL_INVALID_ENUM*/); } function _emscripten_glIsProgram(program) { var program = GL.programs[program]; if (!program) return 0; return GLctx.isProgram(program); } function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx.blendColor(x0, x1, x2, x3) } function _emscripten_glGetShaderiv(shader, pname, p) { if (!p) { // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH var log = GLctx.getShaderInfoLog(GL.shaders[shader]); if (log === null) log = '(unknown error)'; HEAP32[((p)>>2)]=log.length + 1; } else { HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); } } function _emscripten_glUniformMatrix3fv(location, count, transpose, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform matrix view = GL.miniTempBufferViews[8]; for (var i = 0; i < 9; i++) { view[i] = HEAPF32[(((value)+(i*4))>>2)]; } } else { view = HEAPF32.subarray((value)>>2,(value+count*36)>>2); } GLctx.uniformMatrix3fv(location, transpose, view); } function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx.vertexAttrib2f(x0, x1, x2) } function _emscripten_glUniform4fv(location, count, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform view = GL.miniTempBufferViews[3]; view[0] = HEAPF32[((value)>>2)]; view[1] = HEAPF32[(((value)+(4))>>2)]; view[2] = HEAPF32[(((value)+(8))>>2)]; view[3] = HEAPF32[(((value)+(12))>>2)]; } else { view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); } GLctx.uniform4fv(location, view); } function _glBufferSubData(target, offset, size, data) { GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); } function _glGetProgramInfoLog(program, maxLength, length, infoLog) { var log = GLctx.getProgramInfoLog(GL.programs[program]); if (log === null) log = '(unknown error)'; log = log.substr(0, maxLength - 1); if (maxLength > 0 && infoLog) { writeStringToMemory(log, infoLog); if (length) HEAP32[((length)>>2)]=log.length; } else { if (length) HEAP32[((length)>>2)]=0; } } function _alcDestroyContext(context) { // Stop playback, etc clearInterval(AL.contexts[context - 1].interval); } function _emscripten_glGenFramebuffers(n, ids) { for (var i = 0; i < n; ++i) { var framebuffer = GLctx.createFramebuffer(); if (!framebuffer) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.framebuffers); framebuffer.name = id; GL.framebuffers[id] = framebuffer; HEAP32[(((ids)+(i*4))>>2)]=id; } } function _glGetShaderiv(shader, pname, p) { if (!p) { // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH var log = GLctx.getShaderInfoLog(GL.shaders[shader]); if (log === null) log = '(unknown error)'; HEAP32[((p)>>2)]=log.length + 1; } else { HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); } } function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx.blendEquationSeparate(x0, x1) } function _glfwSetWindowIconifyCallback(winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowIconifyFunc = cbfun; } function _emscripten_glDrawRangeElements() { Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1); } function _emscripten_glGenTextures(n, textures) { for (var i = 0; i < n; i++) { var texture = GLctx.createTexture(); if (!texture) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.textures); texture.name = id; GL.textures[id] = texture; HEAP32[(((textures)+(i*4))>>2)]=id; } } function _emscripten_glVertexAttrib2fv(index, v) { v = HEAPF32.subarray((v)>>2,(v+8)>>2); GLctx.vertexAttrib2fv(index, v); } var _floorf=Math_floor; function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) { program = GL.programs[program]; var info = GLctx.getActiveUniform(program, index); if (!info) return; // If an error occurs, nothing will be written to length, size, type and name. var infoname = info.name.slice(0, Math.max(0, bufSize - 1)); if (bufSize > 0 && name) { writeStringToMemory(infoname, name); if (length) HEAP32[((length)>>2)]=infoname.length; } else { if (length) HEAP32[((length)>>2)]=0; } if (size) HEAP32[((size)>>2)]=info.size; if (type) HEAP32[((type)>>2)]=info.type; } function _emscripten_glDeleteObjectARB() { Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1); } function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) { JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove"); return 0; } function _emscripten_glUniform1f(location, v0) { location = GL.uniforms[location]; GLctx.uniform1f(location, v0); } function _alcCreateContext(device, attrList) { if (device != 1) { return 0; } if (attrList) { return 0; } var ctx; try { ctx = new AudioContext(); } catch (e) { try { ctx = new webkitAudioContext(); } catch (e) {} } if (ctx) { // Old Web Audio API (e.g. Safari 6.0.5) had an inconsistently named createGainNode function. if (typeof(ctx.createGain) === 'undefined') ctx.createGain = ctx.createGainNode; var gain = ctx.createGain(); gain.connect(ctx.destination); var context = { ctx: ctx, err: 0, src: {}, buf: [], interval: setInterval(function() { AL.updateSources(context); }, AL.QUEUE_INTERVAL), gain: gain }; AL.contexts.push(context); return AL.contexts.length; } else { return 0; } } function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) { GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr); } function _alcCloseDevice(device) { // Stop playback, etc } function _glShaderSource(shader, count, string, length) { var source = GL.getSource(shader, count, string, length); GLctx.shaderSource(GL.shaders[shader], source); } var _sqrtf=Math_sqrt; function _emscripten_glDrawArrays(mode, first, count) { GLctx.drawArrays(mode, first, count); } function _emscripten_glGenBuffers(n, buffers) { for (var i = 0; i < n; i++) { var buffer = GLctx.createBuffer(); if (!buffer) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.buffers); buffer.name = id; GL.buffers[id] = buffer; HEAP32[(((buffers)+(i*4))>>2)]=id; } } var _log=Math_log; function _glfwSetCharCallback(winid, cbfun) { GLFW.setCharCallback(winid, cbfun); } function _emscripten_glGetUniformLocation(program, name) { name = Pointer_stringify(name); var arrayOffset = 0; // If user passed an array accessor "[index]", parse the array index off the accessor. if (name.indexOf(']', name.length-1) !== -1) { var ls = name.lastIndexOf('['); var arrayIndex = name.slice(ls+1, -1); if (arrayIndex.length > 0) { arrayOffset = parseInt(arrayIndex); if (arrayOffset < 0) { return -1; } } name = name.slice(0, ls); } var ptable = GL.programInfos[program]; if (!ptable) { return -1; } var utable = ptable.uniforms; var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. return uniformInfo[1]+arrayOffset; } else { return -1; } } function _glActiveTexture(x0) { GLctx.activeTexture(x0) } function _glBindBuffer(target, buffer) { var bufferObj = buffer ? GL.buffers[buffer] : null; GLctx.bindBuffer(target, bufferObj); } function _glPixelStorei(pname, param) { if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) { GL.packAlignment = param; } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) { GL.unpackAlignment = param; } GLctx.pixelStorei(pname, param); } function _emscripten_glEnable(x0) { GLctx.enable(x0) } function _emscripten_glScissor(x0, x1, x2, x3) { GLctx.scissor(x0, x1, x2, x3) } function _glfwSetCursorEnterCallback(winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.cursorEnterFunc = cbfun; } Module["_bitshift64Lshr"] = _bitshift64Lshr; function _glBufferData(target, size, data, usage) { switch (usage) { // fix usages, WebGL only has *_DRAW case 0x88E1: // GL_STREAM_READ case 0x88E2: // GL_STREAM_COPY usage = 0x88E0; // GL_STREAM_DRAW break; case 0x88E5: // GL_STATIC_READ case 0x88E6: // GL_STATIC_COPY usage = 0x88E4; // GL_STATIC_DRAW break; case 0x88E9: // GL_DYNAMIC_READ case 0x88EA: // GL_DYNAMIC_COPY usage = 0x88E8; // GL_DYNAMIC_DRAW break; } if (!data) { GLctx.bufferData(target, size, usage); } else { GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); } } var _BDtoIHigh=true; function _emscripten_glIsShader(shader) { var s = GL.shaders[shader]; if (!s) return 0; return GLctx.isShader(s); } function _emscripten_glDrawBuffers(n, bufs) { var bufArray = []; for (var i = 0; i < n; i++) bufArray.push(HEAP32[(((bufs)+(i*4))>>2)]); GLctx['drawBuffers'](bufArray); } function _emscripten_glBindFramebuffer(target, framebuffer) { GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null); } function _alcGetContextsDevice(context) { if (context <= AL.contexts.length && context > 0) { // Returns the only one audio device return 1; } return 0; } function _emscripten_glBlendEquation(x0) { GLctx.blendEquation(x0) } function _emscripten_glBufferSubData(target, offset, size, data) { GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); } function _emscripten_glBufferData(target, size, data, usage) { switch (usage) { // fix usages, WebGL only has *_DRAW case 0x88E1: // GL_STREAM_READ case 0x88E2: // GL_STREAM_COPY usage = 0x88E0; // GL_STREAM_DRAW break; case 0x88E5: // GL_STATIC_READ case 0x88E6: // GL_STATIC_COPY usage = 0x88E4; // GL_STATIC_DRAW break; case 0x88E9: // GL_DYNAMIC_READ case 0x88EA: // GL_DYNAMIC_COPY usage = 0x88E8; // GL_DYNAMIC_DRAW break; } if (!data) { GLctx.bufferData(target, size, usage); } else { GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); } } function _sbrk(bytes) { // Implement a Linux-like 'memory area' for our 'process'. // Changes the size of the memory area by |bytes|; returns the // address of the previous top ('break') of the memory area // We control the "dynamic" memory - DYNAMIC_BASE to DYNAMICTOP var self = _sbrk; if (!self.called) { DYNAMICTOP = alignMemoryPage(DYNAMICTOP); // make sure we start out aligned self.called = true; assert(Runtime.dynamicAlloc); self.alloc = Runtime.dynamicAlloc; Runtime.dynamicAlloc = function() { abort('cannot dynamically allocate, sbrk now has control') }; } var ret = DYNAMICTOP; if (bytes != 0) { var success = self.alloc(bytes); if (!success) return -1 >>> 0; // sbrk failure code } return ret; // Previous break location. } Module["_bitshift64Shl"] = _bitshift64Shl; function _emscripten_glVertexAttrib4fv(index, v) { v = HEAPF32.subarray((v)>>2,(v+16)>>2); GLctx.vertexAttrib4fv(index, v); } var _BItoD=true; function _emscripten_glGetShaderSource(shader, bufSize, length, source) { var result = GLctx.getShaderSource(GL.shaders[shader]); if (!result) return; // If an error occurs, nothing will be written to length or source. result = result.slice(0, Math.max(0, bufSize - 1)); if (bufSize > 0 && source) { writeStringToMemory(result, source); if (length) HEAP32[((length)>>2)]=result.length; } else { if (length) HEAP32[((length)>>2)]=0; } } function _emscripten_glClearDepth(x0) { GLctx.clearDepth(x0) } function _emscripten_glGetFloatv(name_, p) { emscriptenWebGLGet(name_, p, 'Float'); } function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { var pixelData; if (pixels) { var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); pixelData = data.pixels; internalFormat = data.internalFormat; } else { pixelData = null; } GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); } function ___assert_fail(condition, filename, line, func) { ABORT = true; throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace(); } function _emscripten_glVertexAttribDivisor(index, divisor) { GLctx['vertexAttribDivisor'](index, divisor); } function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) { GLctx['drawElementsInstanced'](mode, count, type, indices, primcount); } function _emscripten_glDrawElements(mode, count, type, indices) { GLctx.drawElements(mode, count, type, indices); } function _glfwSetMouseButtonCallback(winid, cbfun) { GLFW.setMouseButtonCallback(winid, cbfun); } function _emscripten_glCreateProgram() { var id = GL.getNewId(GL.programs); var program = GLctx.createProgram(); program.name = id; GL.programs[id] = program; return id; } function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { var heapView; if (data) { heapView = HEAPU8.subarray((data),(data+imageSize)); } else { heapView = null; } GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView); } function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) } function _emscripten_glBindVertexArray(vao) { GLctx['bindVertexArray'](GL.vaos[vao]); } var _floor=Math_floor; function _emscripten_glLoadMatrixf() { Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1); } function _glDeleteShader(id) { if (!id) return; var shader = GL.shaders[id]; if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } GLctx.deleteShader(shader); GL.shaders[id] = null; } function _emscripten_glGetProgramiv(program, pname, p) { if (!p) { // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH var log = GLctx.getProgramInfoLog(GL.programs[program]); if (log === null) log = '(unknown error)'; HEAP32[((p)>>2)]=log.length + 1; } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { var ptable = GL.programInfos[program]; if (ptable) { HEAP32[((p)>>2)]=ptable.maxUniformLength; return; } else if (program < GL.counter) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); } else { GL.recordError(0x0501 /* GL_INVALID_VALUE */); } } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { var ptable = GL.programInfos[program]; if (ptable) { if (ptable.maxAttributeLength == -1) { var program = GL.programs[program]; var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. for(var i = 0; i < numAttribs; ++i) { var activeAttrib = GLctx.getActiveAttrib(program, i); ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); } } HEAP32[((p)>>2)]=ptable.maxAttributeLength; return; } else if (program < GL.counter) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); } else { GL.recordError(0x0501 /* GL_INVALID_VALUE */); } } else { HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); } } function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) { var log = GLctx.getProgramInfoLog(GL.programs[program]); if (log === null) log = '(unknown error)'; log = log.substr(0, maxLength - 1); if (maxLength > 0 && infoLog) { writeStringToMemory(log, infoLog); if (length) HEAP32[((length)>>2)]=log.length; } else { if (length) HEAP32[((length)>>2)]=0; } } function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { var pixelData; if (pixels) { var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); pixelData = data.pixels; internalFormat = data.internalFormat; } else { pixelData = null; } GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); } var _exp=Math_exp; function ___unlock() {} function _emscripten_glColorPointer() { Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1); } function _glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) } function _glfwPollEvents() {} function _emscripten_glCheckFramebufferStatus(x0) { return GLctx.checkFramebufferStatus(x0) } function _glfwDestroyWindow(winid) { return GLFW.destroyWindow(winid); } function _emscripten_glFlush() { GLctx.flush() } function _glfwSetErrorCallback(cbfun) { GLFW.errorFunc = cbfun; } function _emscripten_glCreateShader(shaderType) { var id = GL.getNewId(GL.shaders); GL.shaders[id] = GLctx.createShader(shaderType); return id; } function _glUniformMatrix4fv(location, count, transpose, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform matrix view = GL.miniTempBufferViews[15]; for (var i = 0; i < 16; i++) { view[i] = HEAPF32[(((value)+(i*4))>>2)]; } } else { view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); } GLctx.uniformMatrix4fv(location, transpose, view); } function _emscripten_glValidateProgram(program) { GLctx.validateProgram(GL.programs[program]); } function _glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) } function _glfwSetKeyCallback(winid, cbfun) { GLFW.setKeyCallback(winid, cbfun); } function _emscripten_glColorMask(x0, x1, x2, x3) { GLctx.colorMask(x0, x1, x2, x3) } function _emscripten_glPixelStorei(pname, param) { if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) { GL.packAlignment = param; } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) { GL.unpackAlignment = param; } GLctx.pixelStorei(pname, param); } function _emscripten_glDeleteTextures(n, textures) { for (var i = 0; i < n; i++) { var id = HEAP32[(((textures)+(i*4))>>2)]; var texture = GL.textures[id]; if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". GLctx.deleteTexture(texture); texture.name = 0; GL.textures[id] = null; } } function _emscripten_glCompileShader(shader) { GLctx.compileShader(GL.shaders[shader]); } function _emscripten_glGenVertexArrays(n, arrays) { for(var i = 0; i < n; i++) { var vao = GLctx['createVertexArray'](); if (!vao) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.vaos); vao.name = id; GL.vaos[id] = vao; HEAP32[(((arrays)+(i*4))>>2)]=id; } } function _time(ptr) { var ret = (Date.now()/1000)|0; if (ptr) { HEAP32[((ptr)>>2)]=ret; } return ret; } function _pthread_self() { //FIXME: assumes only a single thread return 0; } function _emscripten_glGetBooleanv(name_, p) { emscriptenWebGLGet(name_, p, 'Boolean'); } function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs; try { // fcntl64 var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get(); switch (cmd) { case 0: { var arg = SYSCALLS.get(); if (arg < 0) { return -ERRNO_CODES.EINVAL; } var newStream; newStream = FS.open(stream.path, stream.flags, 0, arg); return newStream.fd; } case 1: case 2: return 0; // FD_CLOEXEC makes no sense for a single process. case 3: return stream.flags; case 4: { var arg = SYSCALLS.get(); stream.flags |= arg; return 0; } case 12: case 12: { var arg = SYSCALLS.get(); var offset = 0; // We're always unlocked. HEAP16[(((arg)+(offset))>>1)]=2; return 0; } case 13: case 14: case 13: case 14: return 0; // Pretend that the locking is successful. case 16: case 8: return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet. case 9: // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves. ___setErrNo(ERRNO_CODES.EINVAL); return -1; default: { return -ERRNO_CODES.EINVAL; } } } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } var GLctx; GL.init() FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink; __ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() }); if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); } Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) }; Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) } STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP); staticSealed = true; // seal the static portion of memory STACK_MAX = STACK_BASE + TOTAL_STACK; DYNAMIC_BASE = DYNAMICTOP = Runtime.alignMemory(STACK_MAX); assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack"); var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_DYNAMIC); function invoke_viiiii(index,a1,a2,a3,a4,a5) { try { Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vd(index,a1) { try { Module["dynCall_vd"](index,a1); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vid(index,a1,a2) { try { Module["dynCall_vid"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vi(index,a1) { try { Module["dynCall_vi"](index,a1); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vii(index,a1,a2) { try { Module["dynCall_vii"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_ii(index,a1) { try { return Module["dynCall_ii"](index,a1); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viddd(index,a1,a2,a3,a4) { try { Module["dynCall_viddd"](index,a1,a2,a3,a4); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vidd(index,a1,a2,a3) { try { Module["dynCall_vidd"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_iiii(index,a1,a2,a3) { try { return Module["dynCall_iiii"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { try { Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) { try { Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viii(index,a1,a2,a3) { try { Module["dynCall_viii"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vidddd(index,a1,a2,a3,a4,a5) { try { Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vdi(index,a1,a2) { try { Module["dynCall_vdi"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { try { Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { try { Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_iii(index,a1,a2) { try { return Module["dynCall_iii"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_i(index) { try { return Module["dynCall_i"](index); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_iiiiii(index,a1,a2,a3,a4,a5) { try { return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) { try { Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vdddd(index,a1,a2,a3,a4) { try { Module["dynCall_vdddd"](index,a1,a2,a3,a4); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vdd(index,a1,a2) { try { Module["dynCall_vdd"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_v(index) { try { Module["dynCall_v"](index); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viid(index,a1,a2,a3) { try { Module["dynCall_viid"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viiii(index,a1,a2,a3,a4) { try { Module["dynCall_viiii"](index,a1,a2,a3,a4); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity, "byteLength": byteLength }; Module.asmLibraryArg = { "abort": abort, "assert": assert, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_iiiiii": invoke_iiiiii, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_exp": _exp, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_alBufferData": _alBufferData, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_alSource3f": _alSource3f, "_sqrtf": _sqrtf, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_ceilf": _ceilf, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_alcGetString": _alcGetString, "_sysconf": _sysconf, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "___syscall221": ___syscall221, "_cos": _cos, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_pthread_cleanup_push": _pthread_cleanup_push, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_alSourcePlay": _alSourcePlay, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "___syscall146": ___syscall146, "_glfwDestroyWindow": _glfwDestroyWindow, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_alcCreateContext": _alcCreateContext, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_abort": _abort, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_atan2": _atan2, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_fabsf": _fabsf, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_glDrawElements": _glDrawElements, "_alGetSourcei": _alGetSourcei, "_glBufferSubData": _glBufferSubData, "_alcMakeContextCurrent": _alcMakeContextCurrent, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_alSourceQueueBuffers": _alSourceQueueBuffers, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_eglGetProcAddress": _eglGetProcAddress, "_alcGetCurrentContext": _alcGetCurrentContext, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_alGenBuffers": _alGenBuffers, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_fabs": _fabs, "_glGenTextures": _glGenTextures, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_alDeleteSources": _alDeleteSources, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_alSourceUnqueueBuffers": _alSourceUnqueueBuffers, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_alGetError": _alGetError, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glFinish": _emscripten_glFinish, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_glBindFramebuffer": _glBindFramebuffer, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_asm_const_2": _emscripten_asm_const_2, "_glGetString": _glGetString, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_alSourcef": _alSourcef, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_llvm_pow_f64": _llvm_pow_f64, "_glDeleteFramebuffers": _glDeleteFramebuffers, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_glfwPollEvents": _glfwPollEvents, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_glfwSwapInterval": _glfwSwapInterval, "_glfwGetVideoModes": _glfwGetVideoModes, "_sin": _sin, "_emscripten_glClear": _emscripten_glClear, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_sbrk": _sbrk, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_emscripten_glUniform2i": _emscripten_glUniform2i, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glHint": _emscripten_glHint, "_glfwSetCharCallback": _glfwSetCharCallback, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_alcDestroyContext": _alcDestroyContext, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_glCreateShader": _glCreateShader, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_floorf": _floorf, "_log": _log, "_glActiveTexture": _glActiveTexture, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_alSourceStop": _alSourceStop, "_eglWaitClient": _eglWaitClient, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_alcCloseDevice": _alcCloseDevice, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_alcGetContextsDevice": _alcGetContextsDevice, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glEnable": _emscripten_glEnable, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_floor": _floor, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_cosf": _cosf, "_glGetProgramiv": _glGetProgramiv, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_alListener3f": _alListener3f, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_glUniform4fv": _glUniform4fv, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_sinf": _sinf, "__exit": __exit, "_glfwTerminate": _glfwTerminate, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_alDeleteBuffers": _alDeleteBuffers, "_pthread_self": _pthread_self, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_alGenSources": _alGenSources, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_alcOpenDevice": _alcOpenDevice, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_glTexParameteri": _glTexParameteri, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "cttz_i8": cttz_i8 }; // EMSCRIPTEN_START_ASM var asm = (function(global, env, buffer) { 'use asm'; var Int8View = global.Int8Array; var Int16View = global.Int16Array; var Int32View = global.Int32Array; var Uint8View = global.Uint8Array; var Uint16View = global.Uint16Array; var Uint32View = global.Uint32Array; var Float32View = global.Float32Array; var Float64View = global.Float64Array; var HEAP8 = new Int8View(buffer); var HEAP16 = new Int16View(buffer); var HEAP32 = new Int32View(buffer); var HEAPU8 = new Uint8View(buffer); var HEAPU16 = new Uint16View(buffer); var HEAPU32 = new Uint32View(buffer); var HEAPF32 = new Float32View(buffer); var HEAPF64 = new Float64View(buffer); var byteLength = global.byteLength; var STACKTOP=env.STACKTOP|0; var STACK_MAX=env.STACK_MAX|0; var tempDoublePtr=env.tempDoublePtr|0; var ABORT=env.ABORT|0; var cttz_i8=env.cttz_i8|0; var __THREW__ = 0; var threwValue = 0; var setjmpId = 0; var undef = 0; var nan = global.NaN, inf = global.Infinity; var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0; var tempRet0 = 0; var tempRet1 = 0; var tempRet2 = 0; var tempRet3 = 0; var tempRet4 = 0; var tempRet5 = 0; var tempRet6 = 0; var tempRet7 = 0; var tempRet8 = 0; var tempRet9 = 0; var Math_floor=global.Math.floor; var Math_abs=global.Math.abs; var Math_sqrt=global.Math.sqrt; var Math_pow=global.Math.pow; var Math_cos=global.Math.cos; var Math_sin=global.Math.sin; var Math_tan=global.Math.tan; var Math_acos=global.Math.acos; var Math_asin=global.Math.asin; var Math_atan=global.Math.atan; var Math_atan2=global.Math.atan2; var Math_exp=global.Math.exp; var Math_log=global.Math.log; var Math_ceil=global.Math.ceil; var Math_imul=global.Math.imul; var Math_min=global.Math.min; var Math_clz32=global.Math.clz32; var abort=env.abort; var assert=env.assert; var invoke_viiiii=env.invoke_viiiii; var invoke_vd=env.invoke_vd; var invoke_vid=env.invoke_vid; var invoke_vi=env.invoke_vi; var invoke_vii=env.invoke_vii; var invoke_ii=env.invoke_ii; var invoke_viddd=env.invoke_viddd; var invoke_vidd=env.invoke_vidd; var invoke_iiii=env.invoke_iiii; var invoke_viiiiiiii=env.invoke_viiiiiiii; var invoke_viiiiii=env.invoke_viiiiii; var invoke_viii=env.invoke_viii; var invoke_vidddd=env.invoke_vidddd; var invoke_vdi=env.invoke_vdi; var invoke_viiiiiii=env.invoke_viiiiiii; var invoke_viiiiiiiii=env.invoke_viiiiiiiii; var invoke_iii=env.invoke_iii; var invoke_i=env.invoke_i; var invoke_iiiiii=env.invoke_iiiiii; var invoke_vdddddd=env.invoke_vdddddd; var invoke_vdddd=env.invoke_vdddd; var invoke_vdd=env.invoke_vdd; var invoke_v=env.invoke_v; var invoke_viid=env.invoke_viid; var invoke_viiii=env.invoke_viiii; var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv; var _glUseProgram=env._glUseProgram; var _exp=env._exp; var _glfwCreateWindow=env._glfwCreateWindow; var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler; var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate; var _emscripten_glUniform4iv=env._emscripten_glUniform4iv; var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer; var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv; var _emscripten_glCullFace=env._emscripten_glCullFace; var _emscripten_glIsProgram=env._emscripten_glIsProgram; var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate; var _emscripten_glViewport=env._emscripten_glViewport; var _emscripten_glFrontFace=env._emscripten_glFrontFace; var _alBufferData=env._alBufferData; var ___assert_fail=env.___assert_fail; var _glDeleteProgram=env._glDeleteProgram; var _emscripten_glUniform3fv=env._emscripten_glUniform3fv; var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset; var _emscripten_glUseProgram=env._emscripten_glUseProgram; var _emscripten_glBlendColor=env._emscripten_glBlendColor; var _glBindBuffer=env._glBindBuffer; var _emscripten_glDepthFunc=env._emscripten_glDepthFunc; var _glGetShaderInfoLog=env._glGetShaderInfoLog; var _alSource3f=env._alSource3f; var _sqrtf=env._sqrtf; var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback; var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback; var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing; var _ceilf=env._ceilf; var _glBlendFunc=env._glBlendFunc; var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray; var _glGetAttribLocation=env._glGetAttribLocation; var _glDisableVertexAttribArray=env._glDisableVertexAttribArray; var _emscripten_memcpy_big=env._emscripten_memcpy_big; var _emscripten_glReadPixels=env._emscripten_glReadPixels; var _alcGetString=env._alcGetString; var _sysconf=env._sysconf; var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage; var _emscripten_glVertexPointer=env._emscripten_glVertexPointer; var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback; var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize; var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv; var ___syscall221=env.___syscall221; var _cos=env._cos; var _llvm_stacksave=env._llvm_stacksave; var _emscripten_glUniform1i=env._emscripten_glUniform1i; var _emscripten_glGenBuffers=env._emscripten_glGenBuffers; var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB; var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback; var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat; var _glfwInit=env._glfwInit; var _emscripten_glGetPointerv=env._emscripten_glGetPointerv; var _glGenBuffers=env._glGenBuffers; var _glShaderSource=env._glShaderSource; var _emscripten_glGetString=env._emscripten_glGetString; var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer; var _emscripten_glIsEnabled=env._emscripten_glIsEnabled; var _emscripten_glScissor=env._emscripten_glScissor; var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv; var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv; var _pthread_cleanup_push=env._pthread_cleanup_push; var ___syscall145=env.___syscall145; var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB; var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate; var _alSourcePlay=env._alSourcePlay; var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer; var ___syscall140=env.___syscall140; var _glfwSetErrorCallback=env._glfwSetErrorCallback; var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback; var _glfwDefaultWindowHints=env._glfwDefaultWindowHints; var _emscripten_glIsBuffer=env._emscripten_glIsBuffer; var ___syscall146=env.___syscall146; var _glfwDestroyWindow=env._glfwDestroyWindow; var _pthread_cleanup_pop=env._pthread_cleanup_pop; var _emscripten_glAttachShader=env._emscripten_glAttachShader; var _glVertexAttribPointer=env._glVertexAttribPointer; var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D; var _emscripten_glUniform2f=env._emscripten_glUniform2f; var _alcCreateContext=env._alcCreateContext; var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv; var _abort=env._abort; var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv; var _atan2=env._atan2; var _glGetProgramInfoLog=env._glGetProgramInfoLog; var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv; var _emscripten_glTexParameterf=env._emscripten_glTexParameterf; var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders; var _emscripten_glGenTextures=env._emscripten_glGenTextures; var _emscripten_glTexParameteri=env._emscripten_glTexParameteri; var _llvm_stackrestore=env._llvm_stackrestore; var _fabsf=env._fabsf; var _glfwMakeContextCurrent=env._glfwMakeContextCurrent; var _emscripten_glShaderBinary=env._emscripten_glShaderBinary; var _glDrawElements=env._glDrawElements; var _alGetSourcei=env._alGetSourcei; var _glBufferSubData=env._glBufferSubData; var _alcMakeContextCurrent=env._alcMakeContextCurrent; var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays; var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv; var _glViewport=env._glViewport; var _alSourceQueueBuffers=env._alSourceQueueBuffers; var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv; var ___setErrNo=env.___setErrNo; var _eglGetProcAddress=env._eglGetProcAddress; var _alcGetCurrentContext=env._alcGetCurrentContext; var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation; var _glDeleteTextures=env._glDeleteTextures; var _glDepthFunc=env._glDepthFunc; var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture; var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f; var _emscripten_glFlush=env._emscripten_glFlush; var _emscripten_glUniform4i=env._emscripten_glUniform4i; var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus; var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap; var _emscripten_glGetError=env._emscripten_glGetError; var _alGenBuffers=env._alGenBuffers; var _emscripten_glClearDepthf=env._emscripten_glClearDepthf; var _emscripten_glBufferData=env._emscripten_glBufferData; var _emscripten_glUniform3i=env._emscripten_glUniform3i; var _emscripten_glRotatef=env._emscripten_glRotatef; var _emscripten_glDeleteShader=env._emscripten_glDeleteShader; var _glEnable=env._glEnable; var _fabs=env._fabs; var _glGenTextures=env._glGenTextures; var _emscripten_glMatrixMode=env._emscripten_glMatrixMode; var _alDeleteSources=env._alDeleteSources; var _emscripten_glClearStencil=env._emscripten_glClearStencil; var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation; var emscriptenWebGLGet=env.emscriptenWebGLGet; var _alSourceUnqueueBuffers=env._alSourceUnqueueBuffers; var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray; var _alGetError=env._alGetError; var _emscripten_get_now=env._emscripten_get_now; var _emscripten_glNormalPointer=env._emscripten_glNormalPointer; var _glAttachShader=env._glAttachShader; var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer; var _emscripten_glFinish=env._emscripten_glFinish; var _glCreateProgram=env._glCreateProgram; var _glUniformMatrix4fv=env._glUniformMatrix4fv; var _emscripten_glClearDepth=env._emscripten_glClearDepth; var ___lock=env.___lock; var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer; var ___syscall6=env.___syscall6; var ___syscall5=env.___syscall5; var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate; var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f; var _time=env._time; var _glBindFramebuffer=env._glBindFramebuffer; var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f; var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv; var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate; var _exit=env._exit; var _emscripten_asm_const_2=env._emscripten_asm_const_2; var _glGetString=env._glGetString; var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib; var _alSourcef=env._alSourcef; var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements; var _llvm_pow_f64=env._llvm_pow_f64; var _glDeleteFramebuffers=env._glDeleteFramebuffers; var _glCompressedTexImage2D=env._glCompressedTexImage2D; var _glfwPollEvents=env._glfwPollEvents; var _emscripten_glUniform4f=env._emscripten_glUniform4f; var _glfwSwapInterval=env._glfwSwapInterval; var _glfwGetVideoModes=env._glfwGetVideoModes; var _sin=env._sin; var _emscripten_glClear=env._emscripten_glClear; var _emscripten_glDrawElements=env._emscripten_glDrawElements; var _emscripten_glBlendFunc=env._emscripten_glBlendFunc; var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog; var _sbrk=env._sbrk; var _emscripten_glStencilMask=env._emscripten_glStencilMask; var _emscripten_glUniform1iv=env._emscripten_glUniform1iv; var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv; var _emscripten_glUniform2i=env._emscripten_glUniform2i; var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform; var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers; var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays; var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose; var _emscripten_glUniform1fv=env._emscripten_glUniform1fv; var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform; var _glBindTexture=env._glBindTexture; var _emscripten_glUniform3iv=env._emscripten_glUniform3iv; var _emscripten_glUniform2iv=env._emscripten_glUniform2iv; var _emscripten_glHint=env._emscripten_glHint; var _glfwSetCharCallback=env._glfwSetCharCallback; var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv; var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf; var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram; var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers; var _glfwSetScrollCallback=env._glfwSetScrollCallback; var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced; var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f; var _alcDestroyContext=env._alcDestroyContext; var _glDrawArrays=env._glDrawArrays; var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D; var _glCreateShader=env._glCreateShader; var _emscripten_glPixelStorei=env._emscripten_glPixelStorei; var _glCompileShader=env._glCompileShader; var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv; var _emscripten_glDepthRange=env._emscripten_glDepthRange; var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D; var _floorf=env._floorf; var _log=env._log; var _glActiveTexture=env._glActiveTexture; var _glfwSwapBuffers=env._glfwSwapBuffers; var _emscripten_glDepthMask=env._emscripten_glDepthMask; var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback; var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers; var _alSourceStop=env._alSourceStop; var _eglWaitClient=env._eglWaitClient; var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB; var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D; var _alcCloseDevice=env._alcCloseDevice; var _glUniform1i=env._glUniform1i; var _glEnableVertexAttribArray=env._glEnableVertexAttribArray; var _emscripten_glStencilFunc=env._emscripten_glStencilFunc; var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib; var _alcGetContextsDevice=env._alcGetContextsDevice; var _emscripten_glUniform2fv=env._emscripten_glUniform2fv; var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv; var _glDeleteBuffers=env._glDeleteBuffers; var _glBufferData=env._glBufferData; var _glTexImage2D=env._glTexImage2D; var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv; var _emscripten_glEnable=env._emscripten_glEnable; var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers; var _floor=env._floor; var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv; var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity; var _glDeleteShader=env._glDeleteShader; var _cosf=env._cosf; var _glGetProgramiv=env._glGetProgramiv; var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData; var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer; var _glfwGetTime=env._glfwGetTime; var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage; var _alListener3f=env._alListener3f; var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv; var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray; var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced; var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback; var _emscripten_glCreateShader=env._emscripten_glCreateShader; var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor; var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures; var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer; var _glLinkProgram=env._glLinkProgram; var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor; var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback; var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv; var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv; var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv; var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers; var _glGetShaderiv=env._glGetShaderiv; var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv; var _glGetUniformLocation=env._glGetUniformLocation; var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB; var _emscripten_glCompileShader=env._emscripten_glCompileShader; var _glClear=env._glClear; var _glUniform4fv=env._glUniform4fv; var _emscripten_glFrustum=env._emscripten_glFrustum; var _emscripten_glDisable=env._emscripten_glDisable; var _emscripten_glDepthRangef=env._emscripten_glDepthRangef; var _sinf=env._sinf; var __exit=env.__exit; var _glfwTerminate=env._glfwTerminate; var _emscripten_glUniform3f=env._emscripten_glUniform3f; var _emscripten_glStencilOp=env._emscripten_glStencilOp; var _glPixelStorei=env._glPixelStorei; var _emscripten_glColorMask=env._emscripten_glColorMask; var _emscripten_glLinkProgram=env._emscripten_glLinkProgram; var _emscripten_glBlendEquation=env._emscripten_glBlendEquation; var _emscripten_glIsTexture=env._emscripten_glIsTexture; var _alDeleteBuffers=env._alDeleteBuffers; var _pthread_self=env._pthread_self; var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv; var _emscripten_glLineWidth=env._emscripten_glLineWidth; var _emscripten_glBindTexture=env._emscripten_glBindTexture; var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback; var _glfwGetCursorPos=env._glfwGetCursorPos; var _emscripten_glActiveTexture=env._emscripten_glActiveTexture; var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers; var ___syscall54=env.___syscall54; var ___unlock=env.___unlock; var _emscripten_glBufferSubData=env._emscripten_glBufferSubData; var _emscripten_glColorPointer=env._emscripten_glColorPointer; var _emscripten_set_main_loop=env._emscripten_set_main_loop; var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog; var _glfwWindowHint=env._glfwWindowHint; var _alGenSources=env._alGenSources; var _emscripten_glShaderSource=env._emscripten_glShaderSource; var _emscripten_glIsShader=env._emscripten_glIsShader; var _emscripten_glUniform4fv=env._emscripten_glUniform4fv; var _emscripten_glUniform1f=env._emscripten_glUniform1f; var _alcOpenDevice=env._alcOpenDevice; var _emscripten_glDrawArrays=env._emscripten_glDrawArrays; var _glfwSetKeyCallback=env._glfwSetKeyCallback; var _emscripten_glClearColor=env._emscripten_glClearColor; var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource; var _emscripten_glCreateProgram=env._emscripten_glCreateProgram; var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D; var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation; var _glTexParameteri=env._glTexParameteri; var _emscripten_glValidateProgram=env._emscripten_glValidateProgram; var _emscripten_glBindBuffer=env._emscripten_glBindBuffer; var _emscripten_glGetFloatv=env._emscripten_glGetFloatv; var _emscripten_glDetachShader=env._emscripten_glDetachShader; var _glClearColor=env._glClearColor; var _emscripten_glEnableClientState=env._emscripten_glEnableClientState; var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback; var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D; var _emscripten_glTexImage2D=env._emscripten_glTexImage2D; var tempFloat = 0.0; function _emscripten_replace_memory(newBuffer) { if ((byteLength(newBuffer) & 0xffffff || byteLength(newBuffer) <= 0xffffff) || byteLength(newBuffer) > 0x80000000) return false; HEAP8 = new Int8View(newBuffer); HEAP16 = new Int16View(newBuffer); HEAP32 = new Int32View(newBuffer); HEAPU8 = new Uint8View(newBuffer); HEAPU16 = new Uint16View(newBuffer); HEAPU32 = new Uint32View(newBuffer); HEAPF32 = new Float32View(newBuffer); HEAPF64 = new Float64View(newBuffer); buffer = newBuffer; return true; } // EMSCRIPTEN_START_FUNCS function stackAlloc(size) { size = size|0; var ret = 0; ret = STACKTOP; STACKTOP = (STACKTOP + size)|0; STACKTOP = (STACKTOP + 15)&-16; return ret|0; } function stackSave() { return STACKTOP|0; } function stackRestore(top) { top = top|0; STACKTOP = top; } function establishStackSpace(stackBase, stackMax) { stackBase = stackBase|0; stackMax = stackMax|0; STACKTOP = stackBase; STACK_MAX = stackMax; } function setThrew(threw, value) { threw = threw|0; value = value|0; if ((__THREW__|0) == 0) { __THREW__ = threw; threwValue = value; } } function copyTempFloat(ptr) { ptr = ptr|0; HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0]; HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0]; HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0]; HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0]; } function copyTempDouble(ptr) { ptr = ptr|0; HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0]; HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0]; HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0]; HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0]; HEAP8[tempDoublePtr+4>>0] = HEAP8[ptr+4>>0]; HEAP8[tempDoublePtr+5>>0] = HEAP8[ptr+5>>0]; HEAP8[tempDoublePtr+6>>0] = HEAP8[ptr+6>>0]; HEAP8[tempDoublePtr+7>>0] = HEAP8[ptr+7>>0]; } function setTempRet0(value) { value = value|0; tempRet0 = value; } function getTempRet0() { return tempRet0|0; } function _main() { var $$byval_copy10 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 752|0; $$byval_copy10 = sp + 528|0; $0 = sp + 480|0; $1 = sp + 460|0; $2 = sp + 440|0; $3 = sp + 224|0; $4 = sp + 200|0; $5 = sp + 180|0; $6 = sp + 160|0; $7 = sp + 140|0; $8 = sp + 120|0; $9 = sp + 100|0; $10 = sp + 80|0; $11 = sp + 60|0; $12 = sp + 40|0; $13 = sp + 20|0; $14 = sp; _InitWindow(1280,720,10200); _InitAudioDevice(); $15 = (_GetScreenWidth()|0); $16 = (($15|0) / 2)&-1; $17 = (($16) + -128)|0; HEAP32[232>>2] = $17; $18 = (_GetScreenHeight()|0); $19 = (($18|0) / 2)&-1; $20 = (($19) + -128)|0; HEAP32[236>>2] = $20; _LoadSpriteFont($0,10215); dest=240; src=$0; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _LoadTexture($1,10237); ;HEAP32[284>>2]=HEAP32[$1>>2]|0;HEAP32[284+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[284+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[284+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[284+16>>2]=HEAP32[$1+16>>2]|0; _LoadTexture($2,10268); ;HEAP32[304>>2]=HEAP32[$2>>2]|0;HEAP32[304+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[304+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[304+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[304+16>>2]=HEAP32[$2+16>>2]|0; HEAPF32[324>>2] = -4.0; HEAPF32[(328)>>2] = 2.0; HEAPF32[(332)>>2] = 3.0; HEAPF32[(336)>>2] = -4.0; HEAPF32[(340)>>2] = 0.80000001192092896; HEAPF32[(344)>>2] = 0.0; HEAPF32[(348)>>2] = 0.0; HEAPF32[(352)>>2] = 1.0; HEAPF32[(356)>>2] = 0.0; _LoadModel($3,10294); _memcpy((360|0),($3|0),216)|0; _LoadTexture($4,10314); ;HEAP32[576>>2]=HEAP32[$4>>2]|0;HEAP32[576+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[576+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[576+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[576+16>>2]=HEAP32[$4+16>>2]|0; ;HEAP32[$$byval_copy10>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[$4+16>>2]|0; _SetModelTexture(360,$$byval_copy10); HEAPF32[596>>2] = -1.0; HEAPF32[(600)>>2] = 0.0; HEAPF32[(604)>>2] = 0.0; _LoadTexture($5,10342); ;HEAP32[608>>2]=HEAP32[$5>>2]|0;HEAP32[608+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[608+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[608+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[608+16>>2]=HEAP32[$5+16>>2]|0; _LoadTexture($6,10366); ;HEAP32[(628)>>2]=HEAP32[$6>>2]|0;HEAP32[(628)+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[(628)+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[(628)+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[(628)+16>>2]=HEAP32[$6+16>>2]|0; _LoadTexture($7,10390); ;HEAP32[(648)>>2]=HEAP32[$7>>2]|0;HEAP32[(648)+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[(648)+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[(648)+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[(648)+16>>2]=HEAP32[$7+16>>2]|0; _LoadTexture($8,10414); ;HEAP32[(668)>>2]=HEAP32[$8>>2]|0;HEAP32[(668)+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[(668)+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[(668)+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[(668)+16>>2]=HEAP32[$8+16>>2]|0; _LoadTexture($9,10438); ;HEAP32[(688)>>2]=HEAP32[$9>>2]|0;HEAP32[(688)+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[(688)+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[(688)+12>>2]=HEAP32[$9+12>>2]|0;HEAP32[(688)+16>>2]=HEAP32[$9+16>>2]|0; _LoadTexture($10,10462); ;HEAP32[708>>2]=HEAP32[$10>>2]|0;HEAP32[708+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[708+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[708+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[708+16>>2]=HEAP32[$10+16>>2]|0; _LoadTexture($11,10485); ;HEAP32[(728)>>2]=HEAP32[$11>>2]|0;HEAP32[(728)+4>>2]=HEAP32[$11+4>>2]|0;HEAP32[(728)+8>>2]=HEAP32[$11+8>>2]|0;HEAP32[(728)+12>>2]=HEAP32[$11+12>>2]|0;HEAP32[(728)+16>>2]=HEAP32[$11+16>>2]|0; _LoadTexture($12,10508); ;HEAP32[(748)>>2]=HEAP32[$12>>2]|0;HEAP32[(748)+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[(748)+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[(748)+12>>2]=HEAP32[$12+12>>2]|0;HEAP32[(748)+16>>2]=HEAP32[$12+16>>2]|0; _LoadTexture($13,10531); ;HEAP32[(768)>>2]=HEAP32[$13>>2]|0;HEAP32[(768)+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[(768)+8>>2]=HEAP32[$13+8>>2]|0;HEAP32[(768)+12>>2]=HEAP32[$13+12>>2]|0;HEAP32[(768)+16>>2]=HEAP32[$13+16>>2]|0; _LoadTexture($14,10554); ;HEAP32[(788)>>2]=HEAP32[$14>>2]|0;HEAP32[(788)+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[(788)+8>>2]=HEAP32[$14+8>>2]|0;HEAP32[(788)+12>>2]=HEAP32[$14+12>>2]|0;HEAP32[(788)+16>>2]=HEAP32[$14+16>>2]|0; _emscripten_set_main_loop((1|0),0,1); dest=$$byval_copy10; src=240; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _UnloadSpriteFont($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[284>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[284+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[304>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[304+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[304+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[304+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[304+16>>2]|0; _UnloadTexture($$byval_copy10); _memcpy(($$byval_copy10|0),(360|0),216)|0; _UnloadModel($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[576>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[576+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[576+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[576+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[576+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[608>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[608+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[608+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[608+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[608+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(628)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(628)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(628)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(628)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(628)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(648)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(648)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(648)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(648)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(648)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(668)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(668)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(668)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(668)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(668)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(688)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(688)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(688)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(688)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(688)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[708>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[708+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[708+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[708+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[708+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(728)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(728)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(728)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(728)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(728)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(748)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(748)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(748)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(748)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(748)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(768)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(768)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(768)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(768)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(768)+16>>2]|0; _UnloadTexture($$byval_copy10); ;HEAP32[$$byval_copy10>>2]=HEAP32[(788)>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[(788)+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[(788)+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[(788)+12>>2]|0;HEAP32[$$byval_copy10+16>>2]=HEAP32[(788)+16>>2]|0; _UnloadTexture($$byval_copy10); _CloseAudioDevice(); _CloseWindow(); STACKTOP = sp;return 0; } function _UpdateDrawFrame() { var $$byval_copy103 = 0, $$byval_copy112 = 0, $$byval_copy76 = 0, $$off = 0, $$pr286 = 0, $$pr288 = 0, $$pr289 = 0, $$pr290 = 0, $$pr293$pr = 0, $$pr296$pr = 0, $$pr299$pr$pr = 0, $$pr302$pr$pr = 0, $$pr305 = 0, $$pr306 = 0, $$pr308 = 0, $$pr311$pr = 0, $$pr314$pr = 0, $$pr317$pr$pr = 0, $$pr320$pr$pr = 0, $$pr323$pr$pr = 0; var $$pr326$pr$pr = 0, $$pr329$pr$pr$pr = 0, $$pr332 = 0, $$pr334 = 0, $$pr337$pr = 0, $$pr340$pr = 0, $$pr343$pr$pr = 0, $$pr346$pr$pr = 0, $$pr350$pr$pr = 0, $$pr352 = 0, $$pr355$pr = 0, $$pr358$pr = 0, $$pr361$pr$pr = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0; var $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0; var $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0; var $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0; var $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0.0, $173 = 0, $174 = 0, $175 = 0, $176 = 0; var $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0; var $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0; var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0; var $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0; var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0; var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0; var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0; var $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0; var $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0.0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0.0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0.0; var $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0.0, $346 = 0.0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0.0, $353 = 0.0, $354 = 0, $355 = 0, $356 = 0; var $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0.0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0.0, $367 = 0.0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0.0, $374 = 0.0; var $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0.0, $381 = 0.0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0.0, $39 = 0, $390 = 0, $391 = 0, $392 = 0; var $393 = 0, $394 = 0, $395 = 0.0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0.0, $402 = 0, $403 = 0, $404 = 0, $405 = 0.0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0; var $410 = 0.0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0.0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0.0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0; var $429 = 0.0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0.0, $435 = 0, $436 = 0, $437 = 0, $438 = 0.0, $439 = 0, $44 = 0, $440 = 0.0, $441 = 0, $442 = 0.0, $443 = 0, $444 = 0, $445 = 0, $446 = 0; var $447 = 0.0, $448 = 0, $449 = 0, $45 = 0, $450 = 0.0, $451 = 0, $452 = 0, $453 = 0.0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0.0, $462 = 0, $463 = 0, $464 = 0.0; var $465 = 0, $466 = 0, $467 = 0.0, $468 = 0, $469 = 0.0, $47 = 0, $470 = 0, $471 = 0.0, $472 = 0, $473 = 0.0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0.0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0; var $483 = 0.0, $484 = 0, $485 = 0, $486 = 0.0, $487 = 0, $488 = 0, $489 = 0.0, $49 = 0, $490 = 0, $491 = 0.0, $492 = 0, $493 = 0.0, $494 = 0, $495 = 0.0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0; var $500 = 0.0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0, $506 = 0.0, $507 = 0, $508 = 0.0, $509 = 0.0, $51 = 0, $510 = 0.0, $511 = 0.0, $512 = 0, $513 = 0.0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0.0; var $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0.0, $523 = 0, $524 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0; var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0; var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dwarf$byval_copy = 0, $or$cond = 0; var $or$cond365 = 0, $position$byval_copy = 0, $storemerge = 0.0, $storemerge366 = 0.0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 976|0; $$byval_copy112 = sp + 612|0; $$byval_copy103 = sp + 592|0; $$byval_copy76 = sp + 396|0; $position$byval_copy = sp + 376|0; $dwarf$byval_copy = sp + 152|0; $0 = sp + 960|0; $1 = sp + 956|0; $2 = sp + 952|0; $3 = sp + 948|0; $4 = sp + 944|0; $5 = sp + 940|0; $6 = sp + 936|0; $7 = sp + 932|0; $8 = sp + 928|0; $9 = sp + 924|0; $10 = sp + 920|0; $11 = sp + 916|0; $12 = sp + 912|0; $13 = sp + 908|0; $14 = sp + 904|0; $15 = sp + 900|0; $16 = sp + 896|0; $17 = sp + 892|0; $18 = sp + 584|0; $19 = sp + 888|0; $20 = sp + 884|0; $21 = sp + 880|0; $22 = sp + 876|0; $23 = sp + 872|0; $24 = sp + 868|0; $25 = sp + 568|0; $26 = sp + 560|0; $27 = sp + 864|0; $28 = sp + 552|0; $29 = sp + 536|0; $30 = sp + 528|0; $31 = sp + 860|0; $32 = sp + 520|0; $33 = sp + 504|0; $34 = sp + 496|0; $35 = sp + 856|0; $36 = sp + 488|0; $37 = sp + 472|0; $38 = sp + 464|0; $39 = sp + 852|0; $40 = sp + 456|0; $41 = sp + 440|0; $42 = sp + 368|0; $43 = sp + 848|0; $44 = sp + 144|0; $45 = sp + 128|0; $46 = sp + 120|0; $47 = sp + 844|0; $48 = sp + 112|0; $49 = sp + 840|0; $50 = sp + 836|0; $51 = sp + 832|0; $52 = sp + 828|0; $53 = sp + 824|0; $54 = sp + 820|0; $55 = sp + 816|0; $56 = sp + 812|0; $57 = sp + 808|0; $58 = sp + 804|0; $59 = sp + 104|0; $60 = sp + 96|0; $61 = sp + 88|0; $62 = sp + 800|0; $63 = sp + 796|0; $64 = sp + 792|0; $65 = sp + 788|0; $66 = sp + 80|0; $67 = sp + 784|0; $68 = sp + 780|0; $69 = sp + 776|0; $70 = sp + 772|0; $71 = sp + 768|0; $72 = sp + 764|0; $73 = sp + 760|0; $74 = sp + 72|0; $75 = sp + 756|0; $76 = sp + 68|0; $77 = sp + 752|0; $78 = sp + 748|0; $79 = sp + 56|0; $80 = sp + 44|0; $81 = sp + 744|0; $82 = sp + 40|0; $83 = sp + 740|0; $84 = sp + 736|0; $85 = sp + 732|0; $86 = sp + 36|0; $87 = sp + 728|0; $88 = sp + 32|0; $89 = sp + 724|0; $90 = sp + 28|0; $91 = sp + 720|0; $92 = sp + 24|0; $93 = sp + 716|0; $94 = sp + 20|0; $95 = sp + 712|0; $96 = sp + 708|0; $97 = sp + 704|0; $98 = sp + 700|0; $99 = sp + 696|0; $100 = sp + 16|0; $101 = sp + 692|0; $102 = sp + 12|0; $103 = sp + 688|0; $104 = sp + 8|0; $105 = sp + 684|0; $106 = sp + 4|0; $107 = sp + 680|0; $108 = sp; $109 = sp + 676|0; $110 = sp + 672|0; $111 = sp + 668|0; $112 = sp + 664|0; $113 = sp + 660|0; $114 = sp + 656|0; $115 = sp + 652|0; $116 = sp + 648|0; _UpdateMusicStream(); $117 = HEAP32[200>>2]|0; $118 = ($117|0)==(0); L1: do { if ($118) { $119 = HEAP32[220>>2]|0; switch ($119|0) { case 0: { $120 = (_IsKeyPressed(257)|0); $121 = ($120|0)==(0); if ($121) { break L1; } _TransitionToScreen(1); _PlayMusicStream(10577); break L1; break; } case 1: { break; } default: { break L1; } } $122 = HEAP32[176>>2]|0; switch ($122|0) { case 0: { $123 = HEAP32[216>>2]|0; $124 = (($123) + 1)|0; HEAP32[216>>2] = $124; $125 = ($124|0)==(120); if ($125) { HEAP32[176>>2] = 1; HEAP32[216>>2] = 0; } break; } case 1: { $126 = HEAP32[160>>2]|0; $127 = (($126) + 4)|0; HEAP32[160>>2] = $127; $128 = HEAP32[164>>2]|0; $129 = (($128) + 4)|0; HEAP32[164>>2] = $129; $130 = ($127|0)==(256); if ($130) { HEAP32[176>>2] = 2; } break; } case 2: { $131 = HEAP32[168>>2]|0; $132 = (($131) + 4)|0; HEAP32[168>>2] = $132; $133 = HEAP32[172>>2]|0; $134 = (($133) + 4)|0; HEAP32[172>>2] = $134; $135 = ($132|0)==(256); if ($135) { HEAP32[180>>2] = 0; HEAP32[176>>2] = 3; } break; } case 3: { $136 = HEAP32[216>>2]|0; $137 = (($136) + 1)|0; HEAP32[216>>2] = $137; $138 = (($137|0) % 12)&-1; $139 = ($138|0)==(0); $140 = HEAP32[156>>2]|0; if ($139) { $141 = (($140) + 1)|0; HEAP32[156>>2] = $141; $142 = $141; } else { $142 = $140; } $143 = ($142|0)>(9); if ($143) { $144 = HEAP32[216>>2]|0; $145 = $144 & 1; $146 = ($145|0)==(0); $147 = HEAP32[180>>2]|0; if ($146) { $148 = (($147) + 1)|0; HEAP32[180>>2] = $148; $149 = $148; } else { $149 = $147; } $150 = ($149|0)>(100); if ($150) { HEAP32[216>>2] = 0; HEAP32[176>>2] = 4; } } break; } case 4: { $151 = HEAP32[216>>2]|0; $152 = (($151) + 1)|0; HEAP32[216>>2] = $152; $153 = ($151|0)>(119); if ($153) { $154 = HEAP32[152>>2]|0; $155 = (($154) + 1)|0; HEAP32[152>>2] = $155; $$pr286 = HEAP32[216>>2]|0; $156 = $$pr286; } else { $156 = $152; } $157 = ($156|0)>(1230); if ($157) { $158 = +HEAPF32[184>>2]; $159 = $158 + -0.05000000074505806; HEAPF32[184>>2] = $159; $160 = $159 < 0.0; if ($160) { HEAP32[216>>2] = 0; HEAP32[176>>2] = 5; HEAPF32[184>>2] = 1.0; } } break; } case 5: { $161 = HEAP32[216>>2]|0; $162 = (($161) + 1)|0; HEAP32[216>>2] = $162; $163 = +HEAPF32[192>>2]; $164 = $163 + 1.0; HEAPF32[192>>2] = $164; $165 = ($161|0)>(439); if ($165) { $166 = +HEAPF32[596>>2]; $167 = $166 + -0.0099999997764825821; $168 = $167 < -2.4000000953674316; $storemerge366 = $168 ? -2.4000000953674316 : $167; HEAPF32[596>>2] = $storemerge366; $$pr288 = HEAP32[216>>2]|0; $169 = $$pr288; } else { $169 = $162; } $170 = ($169|0)>(840); if ($170) { $171 = +HEAPF32[184>>2]; $172 = $171 + -0.05000000074505806; HEAPF32[184>>2] = $172; $173 = $172 < 0.0; if ($173) { HEAP32[216>>2] = 0; HEAP32[176>>2] = 6; HEAPF32[184>>2] = 1.0; } } break; } case 6: { $174 = HEAP32[216>>2]|0; $175 = (($174) + 1)|0; HEAP32[216>>2] = $175; $176 = ($174|0)>(899); if ($176) { $177 = +HEAPF32[184>>2]; $178 = $177 + -0.05000000074505806; HEAPF32[184>>2] = $178; $179 = $178 < 0.0; if ($179) { HEAP32[216>>2] = 0; HEAP32[176>>2] = 7; HEAPF32[184>>2] = 1.0; } } break; } case 7: { $180 = +HEAPF32[188>>2]; $181 = $180 + -0.004999999888241291; $182 = $181 < 0.0; $storemerge = $182 ? 0.0 : $181; HEAPF32[188>>2] = $storemerge; _SetMusicVolume($storemerge); break; } default: { } } $183 = HEAP32[228>>2]|0; $184 = HEAP32[224>>2]|0; $185 = ($183|0)<($184|0); if ($185) { $186 = (($183) + 1)|0; HEAP32[228>>2] = $186; } } else { _UpdateTransition(); } } while(0); _BeginDrawing(); HEAP8[$0>>0] = -11; $187 = ((($0)) + 1|0); HEAP8[$187>>0] = -11; $188 = ((($0)) + 2|0); HEAP8[$188>>0] = -11; $189 = ((($0)) + 3|0); HEAP8[$189>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$0+3>>0]|0; _ClearBackground($$byval_copy112); $190 = HEAP32[220>>2]|0; switch ($190|0) { case 0: { HEAP8[$1>>0] = -56; $191 = ((($1)) + 1|0); HEAP8[$191>>0] = -56; $192 = ((($1)) + 2|0); HEAP8[$192>>0] = -56; $193 = ((($1)) + 3|0); HEAP8[$193>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$1+3>>0]|0; _DrawText(10597,290,260,60,$$byval_copy112); break; } case 1: { $194 = HEAP32[176>>2]|0; switch ($194|0) { case 0: { $195 = HEAP32[216>>2]|0; $196 = (($195|0) / 15)&-1; $197 = $196 & 1; $198 = ($197|0)==(0); if (!($198)) { $199 = HEAP32[232>>2]|0; $200 = HEAP32[236>>2]|0; $201 = (($200) + -60)|0; HEAP8[$2>>0] = 0; $202 = ((($2)) + 1|0); HEAP8[$202>>0] = 0; $203 = ((($2)) + 2|0); HEAP8[$203>>0] = 0; $204 = ((($2)) + 3|0); HEAP8[$204>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$2+3>>0]|0; _DrawRectangle($199,$201,16,16,$$byval_copy112); } break; } case 1: { $205 = HEAP32[232>>2]|0; $206 = HEAP32[236>>2]|0; $207 = (($206) + -60)|0; $208 = HEAP32[160>>2]|0; HEAP8[$3>>0] = 0; $209 = ((($3)) + 1|0); HEAP8[$209>>0] = 0; $210 = ((($3)) + 2|0); HEAP8[$210>>0] = 0; $211 = ((($3)) + 3|0); HEAP8[$211>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$3+3>>0]|0; _DrawRectangle($205,$207,$208,16,$$byval_copy112); $212 = HEAP32[232>>2]|0; $213 = HEAP32[236>>2]|0; $214 = (($213) + -60)|0; $215 = HEAP32[164>>2]|0; HEAP8[$4>>0] = 0; $216 = ((($4)) + 1|0); HEAP8[$216>>0] = 0; $217 = ((($4)) + 2|0); HEAP8[$217>>0] = 0; $218 = ((($4)) + 3|0); HEAP8[$218>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$4+3>>0]|0; _DrawRectangle($212,$214,16,$215,$$byval_copy112); break; } case 2: { $219 = HEAP32[232>>2]|0; $220 = HEAP32[236>>2]|0; $221 = (($220) + -60)|0; $222 = HEAP32[160>>2]|0; HEAP8[$5>>0] = 0; $223 = ((($5)) + 1|0); HEAP8[$223>>0] = 0; $224 = ((($5)) + 2|0); HEAP8[$224>>0] = 0; $225 = ((($5)) + 3|0); HEAP8[$225>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$5+3>>0]|0; _DrawRectangle($219,$221,$222,16,$$byval_copy112); $226 = HEAP32[232>>2]|0; $227 = HEAP32[236>>2]|0; $228 = (($227) + -60)|0; $229 = HEAP32[164>>2]|0; HEAP8[$6>>0] = 0; $230 = ((($6)) + 1|0); HEAP8[$230>>0] = 0; $231 = ((($6)) + 2|0); HEAP8[$231>>0] = 0; $232 = ((($6)) + 3|0); HEAP8[$232>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$6>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$6+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$6+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$6+3>>0]|0; _DrawRectangle($226,$228,16,$229,$$byval_copy112); $233 = HEAP32[232>>2]|0; $234 = (($233) + 240)|0; $235 = HEAP32[236>>2]|0; $236 = (($235) + -60)|0; $237 = HEAP32[172>>2]|0; HEAP8[$7>>0] = 0; $238 = ((($7)) + 1|0); HEAP8[$238>>0] = 0; $239 = ((($7)) + 2|0); HEAP8[$239>>0] = 0; $240 = ((($7)) + 3|0); HEAP8[$240>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$7>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$7+3>>0]|0; _DrawRectangle($234,$236,16,$237,$$byval_copy112); $241 = HEAP32[232>>2]|0; $242 = HEAP32[236>>2]|0; $243 = (($242) + 180)|0; $244 = HEAP32[168>>2]|0; HEAP8[$8>>0] = 0; $245 = ((($8)) + 1|0); HEAP8[$245>>0] = 0; $246 = ((($8)) + 2|0); HEAP8[$246>>0] = 0; $247 = ((($8)) + 3|0); HEAP8[$247>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$8>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$8+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$8+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$8+3>>0]|0; _DrawRectangle($241,$243,$244,16,$$byval_copy112); break; } default: { $$off = (($194) + -3)|0; $248 = ($$off>>>0)<(5); if ($248) { $249 = HEAP32[232>>2]|0; $250 = HEAP32[236>>2]|0; $251 = (($250) + -60)|0; $252 = HEAP32[160>>2]|0; HEAP8[$9>>0] = 0; $253 = ((($9)) + 1|0); HEAP8[$253>>0] = 0; $254 = ((($9)) + 2|0); HEAP8[$254>>0] = 0; $255 = ((($9)) + 3|0); HEAP8[$255>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$9>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$9+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$9+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$9+3>>0]|0; _DrawRectangle($249,$251,$252,16,$$byval_copy112); $256 = HEAP32[232>>2]|0; $257 = HEAP32[236>>2]|0; $258 = (($257) + -44)|0; $259 = HEAP32[164>>2]|0; $260 = (($259) + -32)|0; HEAP8[$10>>0] = 0; $261 = ((($10)) + 1|0); HEAP8[$261>>0] = 0; $262 = ((($10)) + 2|0); HEAP8[$262>>0] = 0; $263 = ((($10)) + 3|0); HEAP8[$263>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$10>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$10+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$10+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$10+3>>0]|0; _DrawRectangle($256,$258,16,$260,$$byval_copy112); $264 = HEAP32[232>>2]|0; $265 = (($264) + 240)|0; $266 = HEAP32[236>>2]|0; $267 = (($266) + -44)|0; $268 = HEAP32[172>>2]|0; $269 = (($268) + -32)|0; HEAP8[$11>>0] = 0; $270 = ((($11)) + 1|0); HEAP8[$270>>0] = 0; $271 = ((($11)) + 2|0); HEAP8[$271>>0] = 0; $272 = ((($11)) + 3|0); HEAP8[$272>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$11>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$11+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$11+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$11+3>>0]|0; _DrawRectangle($265,$267,16,$269,$$byval_copy112); $273 = HEAP32[232>>2]|0; $274 = HEAP32[236>>2]|0; $275 = (($274) + 180)|0; $276 = HEAP32[168>>2]|0; HEAP8[$12>>0] = 0; $277 = ((($12)) + 1|0); HEAP8[$277>>0] = 0; $278 = ((($12)) + 2|0); HEAP8[$278>>0] = 0; $279 = ((($12)) + 3|0); HEAP8[$279>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$12>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$12+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$12+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$12+3>>0]|0; _DrawRectangle($273,$275,$276,16,$$byval_copy112); $280 = (_GetScreenWidth()|0); $281 = (($280|0) / 2)&-1; $282 = (($281) + -112)|0; $283 = (_GetScreenHeight()|0); $284 = (($283|0) / 2)&-1; $285 = (($284) + -172)|0; HEAP8[$13>>0] = -11; $286 = ((($13)) + 1|0); HEAP8[$286>>0] = -11; $287 = ((($13)) + 2|0); HEAP8[$287>>0] = -11; $288 = ((($13)) + 3|0); HEAP8[$288>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$13>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$13+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$13+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$13+3>>0]|0; _DrawRectangle($282,$285,224,224,$$byval_copy112); $289 = HEAP32[156>>2]|0; $290 = (_SubText(10617,0,$289)|0); $291 = (_GetScreenWidth()|0); $292 = (($291|0) / 2)&-1; $293 = (($292) + -44)|0; $294 = (_GetScreenHeight()|0); $295 = (($294|0) / 2)&-1; $296 = (($295) + -12)|0; HEAP8[$14>>0] = 0; $297 = ((($14)) + 1|0); HEAP8[$297>>0] = 0; $298 = ((($14)) + 2|0); HEAP8[$298>>0] = 0; $299 = ((($14)) + 3|0); HEAP8[$299>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$14>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$14+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$14+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$14+3>>0]|0; _DrawText($290,$293,$296,50,$$byval_copy112); $300 = HEAP32[180>>2]|0; $301 = (_SubText(9560,0,$300)|0); $302 = (_GetScreenWidth()|0); $303 = (($302|0) / 2)&-1; $304 = (_MeasureText(9560,30)|0); $305 = (($304|0) / 2)&-1; $306 = (($303) - ($305))|0; $307 = HEAP32[236>>2]|0; $308 = (($307) + 230)|0; HEAP8[$15>>0] = -126; $309 = ((($15)) + 1|0); HEAP8[$309>>0] = -126; $310 = ((($15)) + 2|0); HEAP8[$310>>0] = -126; $311 = ((($15)) + 3|0); HEAP8[$311>>0] = -1; ;HEAP8[$$byval_copy112>>0]=HEAP8[$15>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$15+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$15+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$15+3>>0]|0; _DrawText($301,$306,$308,30,$$byval_copy112); } } } $312 = HEAP32[176>>2]|0; $313 = ($312|0)==(4); if ($313) { $314 = HEAP32[216>>2]|0; $315 = ($314|0)>(80); if ($315) { HEAP8[$17>>0] = 80; $316 = ((($17)) + 1|0); HEAP8[$316>>0] = 80; $317 = ((($17)) + 2|0); HEAP8[$317>>0] = 80; $318 = ((($17)) + 3|0); HEAP8[$318>>0] = -1; $319 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$17>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$17+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$17+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$17+3>>0]|0; _Fade($16,$$byval_copy112,$319); ;HEAP8[$$byval_copy112>>0]=HEAP8[$16>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$16+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$16+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$16+3>>0]|0; _DrawText(10624,50,50,40,$$byval_copy112); $320 = HEAP32[152>>2]|0; $321 = (_SubText(9688,0,$320)|0); HEAPF32[$18>>2] = 60.0; $322 = ((($18)) + 4|0); HEAPF32[$322>>2] = 120.0; $323 = HEAP32[(260)>>2]|0; HEAP8[$20>>0] = -126; $324 = ((($20)) + 1|0); HEAP8[$324>>0] = -126; $325 = ((($20)) + 2|0); HEAP8[$325>>0] = -126; $326 = ((($20)) + 3|0); HEAP8[$326>>0] = -1; $327 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$20>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$20+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$20+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$20+3>>0]|0; _Fade($19,$$byval_copy112,$327); dest=$$byval_copy76; src=240; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); ;HEAP32[$$byval_copy103>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$18+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$19>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$19+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$19+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$19+3>>0]|0; _DrawTextEx($$byval_copy76,$321,$$byval_copy103,$323,0,$$byval_copy112); $328 = HEAP32[216>>2]|0; $329 = ($328|0)>(460); if ($329) { HEAP8[$22>>0] = -26; $330 = ((($22)) + 1|0); HEAP8[$330>>0] = 41; $331 = ((($22)) + 2|0); HEAP8[$331>>0] = 55; $332 = ((($22)) + 3|0); HEAP8[$332>>0] = -1; $333 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$22>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$22+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$22+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$22+3>>0]|0; _Fade($21,$$byval_copy112,$333); ;HEAP8[$$byval_copy112>>0]=HEAP8[$21>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$21+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$21+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$21+3>>0]|0; _DrawText(10645,70,318,60,$$byval_copy112); $$pr289 = HEAP32[216>>2]|0; $334 = ($$pr289|0)>(550); if ($334) { HEAP8[$24>>0] = 80; $335 = ((($24)) + 1|0); HEAP8[$335>>0] = 80; $336 = ((($24)) + 2|0); HEAP8[$336>>0] = 80; $337 = ((($24)) + 3|0); HEAP8[$337>>0] = -1; $338 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$24>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$24+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$24+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$24+3>>0]|0; _Fade($23,$$byval_copy112,$338); ;HEAP8[$$byval_copy112>>0]=HEAP8[$23>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$23+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$23+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$23+3>>0]|0; _DrawText(10659,870,50,40,$$byval_copy112); $339 = HEAP32[216>>2]|0; $340 = ($339|0)>(600); if ($340) { HEAP32[$25>>2] = 0; $341 = ((($25)) + 4|0); HEAP32[$341>>2] = 0; $342 = ((($25)) + 8|0); HEAP32[$342>>2] = 160; $343 = ((($25)) + 12|0); HEAP32[$343>>2] = 160; HEAPF32[$26>>2] = 810.0; $344 = ((($26)) + 4|0); HEAPF32[$344>>2] = 130.0; HEAP32[$28>>2] = -1; $345 = +HEAPF32[184>>2]; $346 = $345 * 0.60000002384185791; ;HEAP8[$$byval_copy112>>0]=HEAP8[$28>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$28+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$28+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$28+3>>0]|0; _Fade($27,$$byval_copy112,$346); ;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$25>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$25+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$25+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$25+12>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$26>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$26+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$27>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$27+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$27+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$27+3>>0]|0; _DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); $$pr290 = HEAP32[216>>2]|0; $347 = ($$pr290|0)>(640); if ($347) { HEAP32[$29>>2] = 160; $348 = ((($29)) + 4|0); HEAP32[$348>>2] = 0; $349 = ((($29)) + 8|0); HEAP32[$349>>2] = 160; $350 = ((($29)) + 12|0); HEAP32[$350>>2] = 160; HEAPF32[$30>>2] = 950.0; $351 = ((($30)) + 4|0); HEAPF32[$351>>2] = 130.0; HEAP32[$32>>2] = -1; $352 = +HEAPF32[184>>2]; $353 = $352 * 0.60000002384185791; ;HEAP8[$$byval_copy112>>0]=HEAP8[$32>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$32+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$32+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$32+3>>0]|0; _Fade($31,$$byval_copy112,$353); ;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$29>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$29+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$29+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$29+12>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$30>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$30+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$31>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$31+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$31+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$31+3>>0]|0; _DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); $$pr293$pr = HEAP32[216>>2]|0; $354 = ($$pr293$pr|0)>(680); if ($354) { HEAP32[$33>>2] = 320; $355 = ((($33)) + 4|0); HEAP32[$355>>2] = 0; $356 = ((($33)) + 8|0); HEAP32[$356>>2] = 160; $357 = ((($33)) + 12|0); HEAP32[$357>>2] = 160; HEAPF32[$34>>2] = 1090.0; $358 = ((($34)) + 4|0); HEAPF32[$358>>2] = 130.0; HEAP32[$36>>2] = -1; $359 = +HEAPF32[184>>2]; $360 = $359 * 0.60000002384185791; ;HEAP8[$$byval_copy112>>0]=HEAP8[$36>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$36+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$36+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$36+3>>0]|0; _Fade($35,$$byval_copy112,$360); ;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$33>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$33+12>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$34>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$34+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$35>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$35+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$35+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$35+3>>0]|0; _DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); $$pr296$pr = HEAP32[216>>2]|0; $361 = ($$pr296$pr|0)>(730); if ($361) { HEAP32[$37>>2] = 480; $362 = ((($37)) + 4|0); HEAP32[$362>>2] = 0; $363 = ((($37)) + 8|0); HEAP32[$363>>2] = 160; $364 = ((($37)) + 12|0); HEAP32[$364>>2] = 160; HEAPF32[$38>>2] = 880.0; $365 = ((($38)) + 4|0); HEAPF32[$365>>2] = 300.0; HEAP32[$40>>2] = -1; $366 = +HEAPF32[184>>2]; $367 = $366 * 0.60000002384185791; ;HEAP8[$$byval_copy112>>0]=HEAP8[$40>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$40+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$40+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$40+3>>0]|0; _Fade($39,$$byval_copy112,$367); ;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$37>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$37+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$37+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$37+12>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$38>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$38+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$39>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$39+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$39+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$39+3>>0]|0; _DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); $$pr299$pr$pr = HEAP32[216>>2]|0; $368 = ($$pr299$pr$pr|0)>(780); if ($368) { HEAP32[$41>>2] = 640; $369 = ((($41)) + 4|0); HEAP32[$369>>2] = 0; $370 = ((($41)) + 8|0); HEAP32[$370>>2] = 160; $371 = ((($41)) + 12|0); HEAP32[$371>>2] = 160; HEAPF32[$42>>2] = 1020.0; $372 = ((($42)) + 4|0); HEAPF32[$372>>2] = 300.0; HEAP32[$44>>2] = -1; $373 = +HEAPF32[184>>2]; $374 = $373 * 0.60000002384185791; ;HEAP8[$$byval_copy112>>0]=HEAP8[$44>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$44+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$44+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$44+3>>0]|0; _Fade($43,$$byval_copy112,$374); ;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$41>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$41+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$41+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$41+12>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$42>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$42+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$43>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$43+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$43+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$43+3>>0]|0; _DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); $$pr302$pr$pr = HEAP32[216>>2]|0; $375 = ($$pr302$pr$pr|0)>(850); if ($375) { HEAP32[$45>>2] = 800; $376 = ((($45)) + 4|0); HEAP32[$376>>2] = 0; $377 = ((($45)) + 8|0); HEAP32[$377>>2] = 160; $378 = ((($45)) + 12|0); HEAP32[$378>>2] = 160; HEAPF32[$46>>2] = 960.0; $379 = ((($46)) + 4|0); HEAPF32[$379>>2] = 450.0; HEAP32[$48>>2] = -1; $380 = +HEAPF32[184>>2]; $381 = $380 * 0.60000002384185791; ;HEAP8[$$byval_copy112>>0]=HEAP8[$48>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$48+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$48+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$48+3>>0]|0; _Fade($47,$$byval_copy112,$381); ;HEAP32[$position$byval_copy>>2]=HEAP32[284>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[284+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[284+8>>2]|0;HEAP32[$position$byval_copy+12>>2]=HEAP32[284+12>>2]|0;HEAP32[$position$byval_copy+16>>2]=HEAP32[284+16>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$45>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$45+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$45+8>>2]|0;HEAP32[$$byval_copy76+12>>2]=HEAP32[$45+12>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$46>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$46+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$47>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$47+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$47+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$47+3>>0]|0; _DrawTextureRec($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); } } } } } } } } } $$pr305 = HEAP32[176>>2]|0; $382 = $$pr305; } else { $382 = $312; } $383 = ($382|0)==(5); $384 = HEAP32[216>>2]|0; $385 = ($384|0)>(80); $or$cond = $383 & $385; if ($or$cond) { HEAP8[$50>>0] = 80; $386 = ((($50)) + 1|0); HEAP8[$386>>0] = 80; $387 = ((($50)) + 2|0); HEAP8[$387>>0] = 80; $388 = ((($50)) + 3|0); HEAP8[$388>>0] = -1; $389 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$50>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$50+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$50+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$50+3>>0]|0; _Fade($49,$$byval_copy112,$389); ;HEAP8[$$byval_copy112>>0]=HEAP8[$49>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$49+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$49+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$49+3>>0]|0; _DrawText(10674,100,50,40,$$byval_copy112); $$pr306 = HEAP32[216>>2]|0; $390 = ($$pr306|0)>(120); if ($390) { $391 = ($$pr306|0)>(130); if ($391) { HEAP8[$52>>0] = 0; $392 = ((($52)) + 1|0); HEAP8[$392>>0] = -28; $393 = ((($52)) + 2|0); HEAP8[$393>>0] = 48; $394 = ((($52)) + 3|0); HEAP8[$394>>0] = -1; $395 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$52>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$52+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$52+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$52+3>>0]|0; _Fade($51,$$byval_copy112,$395); ;HEAP8[$$byval_copy112>>0]=HEAP8[$51>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$51+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$51+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$51+3>>0]|0; _DrawCircle(140,240,80.0,$$byval_copy112); } $396 = HEAP32[216>>2]|0; $397 = ($396|0)>(150); if ($397) { HEAP8[$54>>0] = -66; $398 = ((($54)) + 1|0); HEAP8[$398>>0] = 33; $399 = ((($54)) + 2|0); HEAP8[$399>>0] = 55; $400 = ((($54)) + 3|0); HEAP8[$400>>0] = -1; $401 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$54>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$54+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$54+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$54+3>>0]|0; _Fade($53,$$byval_copy112,$401); HEAP8[$56>>0] = -1; $402 = ((($56)) + 1|0); HEAP8[$402>>0] = -53; $403 = ((($56)) + 2|0); HEAP8[$403>>0] = 0; $404 = ((($56)) + 3|0); HEAP8[$404>>0] = -1; $405 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$56>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$56+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$56+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$56+3>>0]|0; _Fade($55,$$byval_copy112,$405); ;HEAP8[$$byval_copy103>>0]=HEAP8[$53>>0]|0;HEAP8[$$byval_copy103+1>>0]=HEAP8[$53+1>>0]|0;HEAP8[$$byval_copy103+2>>0]=HEAP8[$53+2>>0]|0;HEAP8[$$byval_copy103+3>>0]=HEAP8[$53+3>>0]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$55>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$55+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$55+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$55+3>>0]|0; _DrawRectangleGradient(220,140,250,130,$$byval_copy103,$$byval_copy112); $$pr308 = HEAP32[216>>2]|0; $406 = ($$pr308|0)>(170); if ($406) { HEAP8[$58>>0] = 0; $407 = ((($58)) + 1|0); HEAP8[$407>>0] = 82; $408 = ((($58)) + 2|0); HEAP8[$408>>0] = -84; $409 = ((($58)) + 3|0); HEAP8[$409>>0] = -1; $410 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$58>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$58+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$58+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$58+3>>0]|0; _Fade($57,$$byval_copy112,$410); ;HEAP8[$$byval_copy112>>0]=HEAP8[$57>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$57+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$57+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$57+3>>0]|0; _DrawCircleLines(380,330,80.0,$$byval_copy112); $$pr311$pr = HEAP32[216>>2]|0; $411 = ($$pr311$pr|0)>(190); if ($411) { HEAPF32[$59>>2] = 130.0; $412 = ((($59)) + 4|0); HEAPF32[$412>>2] = 350.0; HEAPF32[$60>>2] = 40.0; $413 = ((($60)) + 4|0); HEAPF32[$413>>2] = 520.0; HEAPF32[$61>>2] = 240.0; $414 = ((($61)) + 4|0); HEAPF32[$414>>2] = 520.0; HEAP8[$63>>0] = -121; $415 = ((($63)) + 1|0); HEAP8[$415>>0] = 60; $416 = ((($63)) + 2|0); HEAP8[$416>>0] = -66; $417 = ((($63)) + 3|0); HEAP8[$417>>0] = -1; $418 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$63>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$63+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$63+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$63+3>>0]|0; _Fade($62,$$byval_copy112,$418); ;HEAP32[$position$byval_copy>>2]=HEAP32[$59>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$59+4>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$60>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$60+4>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$61>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$61+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$62>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$62+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$62+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$62+3>>0]|0; _DrawTriangle($position$byval_copy,$$byval_copy76,$$byval_copy103,$$byval_copy112); $$pr314$pr = HEAP32[216>>2]|0; $419 = ($$pr314$pr|0)>(210); if ($419) { HEAP8[$65>>0] = -26; $420 = ((($65)) + 1|0); HEAP8[$420>>0] = 41; $421 = ((($65)) + 2|0); HEAP8[$421>>0] = 55; $422 = ((($65)) + 3|0); HEAP8[$422>>0] = -1; $423 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$65>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$65+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$65+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$65+3>>0]|0; _Fade($64,$$byval_copy112,$423); ;HEAP8[$$byval_copy112>>0]=HEAP8[$64>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$64+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$64+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$64+3>>0]|0; _DrawRectangle(230,300,200,90,$$byval_copy112); $$pr317$pr$pr = HEAP32[216>>2]|0; $424 = ($$pr317$pr$pr|0)>(230); if ($424) { HEAPF32[$66>>2] = 210.0; $425 = ((($66)) + 4|0); HEAPF32[$425>>2] = 560.0; HEAP8[$68>>0] = 127; $426 = ((($68)) + 1|0); HEAP8[$426>>0] = 106; $427 = ((($68)) + 2|0); HEAP8[$427>>0] = 79; $428 = ((($68)) + 3|0); HEAP8[$428>>0] = -1; $429 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$68>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$68+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$68+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$68+3>>0]|0; _Fade($67,$$byval_copy112,$429); ;HEAP32[$$byval_copy103>>2]=HEAP32[$66>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$66+4>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$67>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$67+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$67+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$67+3>>0]|0; _DrawPoly($$byval_copy103,6,90.0,0.0,$$byval_copy112); $$pr320$pr$pr = HEAP32[216>>2]|0; $430 = ($$pr320$pr$pr|0)>(250); if ($430) { HEAP8[$70>>0] = 0; $431 = ((($70)) + 1|0); HEAP8[$431>>0] = -28; $432 = ((($70)) + 2|0); HEAP8[$432>>0] = 48; $433 = ((($70)) + 3|0); HEAP8[$433>>0] = -1; $434 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$70>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$70+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$70+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$70+3>>0]|0; _Fade($69,$$byval_copy112,$434); HEAP8[$72>>0] = 102; $435 = ((($72)) + 1|0); HEAP8[$435>>0] = -65; $436 = ((($72)) + 2|0); HEAP8[$436>>0] = -1; $437 = ((($72)) + 3|0); HEAP8[$437>>0] = -1; $438 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$72>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$72+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$72+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$72+3>>0]|0; _Fade($71,$$byval_copy112,$438); ;HEAP8[$$byval_copy103>>0]=HEAP8[$69>>0]|0;HEAP8[$$byval_copy103+1>>0]=HEAP8[$69+1>>0]|0;HEAP8[$$byval_copy103+2>>0]=HEAP8[$69+2>>0]|0;HEAP8[$$byval_copy103+3>>0]=HEAP8[$69+3>>0]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$71>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$71+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$71+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$71+3>>0]|0; _DrawCircleGradient(240,370,60.0,$$byval_copy103,$$byval_copy112); $$pr323$pr$pr = HEAP32[216>>2]|0; $439 = ($$pr323$pr$pr|0)>(300); if ($439) { HEAP32[$74>>2] = -1; $440 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$74>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$74+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$74+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$74+3>>0]|0; _Fade($73,$$byval_copy112,$440); ;HEAP32[$$byval_copy103>>2]=HEAP32[304>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[304+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[304+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[304+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[304+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$73>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$73+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$73+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$73+3>>0]|0; _DrawTexture($$byval_copy103,100,250,$$byval_copy112); $$pr326$pr$pr = HEAP32[216>>2]|0; $441 = ($$pr326$pr$pr|0)>(360); if ($441) { HEAP32[$76>>2] = -1; $442 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$76>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$76+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$76+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$76+3>>0]|0; _Fade($75,$$byval_copy112,$442); ;HEAP8[$$byval_copy112>>0]=HEAP8[$75>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$75+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$75+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$75+3>>0]|0; _DrawText(10689,150,410,80,$$byval_copy112); $$pr329$pr$pr$pr = HEAP32[216>>2]|0; $443 = ($$pr329$pr$pr$pr|0)>(440); if ($443) { HEAP8[$78>>0] = 80; $444 = ((($78)) + 1|0); HEAP8[$444>>0] = 80; $445 = ((($78)) + 2|0); HEAP8[$445>>0] = 80; $446 = ((($78)) + 3|0); HEAP8[$446>>0] = -1; $447 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$78>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$78+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$78+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$78+3>>0]|0; _Fade($77,$$byval_copy112,$447); ;HEAP8[$$byval_copy112>>0]=HEAP8[$77>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$77+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$77+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$77+3>>0]|0; _DrawText(10694,840,50,40,$$byval_copy112); dest=$$byval_copy112; src=324; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _Begin3dMode($$byval_copy112); HEAPF32[$79>>2] = 0.0; $448 = ((($79)) + 4|0); HEAPF32[$448>>2] = 1.0; $449 = ((($79)) + 8|0); HEAPF32[$449>>2] = 0.0; $450 = +HEAPF32[192>>2]; HEAPF32[$80>>2] = 1.0; $451 = ((($80)) + 4|0); HEAPF32[$451>>2] = 1.0; $452 = ((($80)) + 8|0); HEAPF32[$452>>2] = 1.0; HEAP32[$82>>2] = -1; $453 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$82>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$82+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$82+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$82+3>>0]|0; _Fade($81,$$byval_copy112,$453); _memcpy(($dwarf$byval_copy|0),(360|0),216)|0; ;HEAP32[$position$byval_copy>>2]=HEAP32[596>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[596+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[596+8>>2]|0; ;HEAP32[$$byval_copy76>>2]=HEAP32[$79>>2]|0;HEAP32[$$byval_copy76+4>>2]=HEAP32[$79+4>>2]|0;HEAP32[$$byval_copy76+8>>2]=HEAP32[$79+8>>2]|0; ;HEAP32[$$byval_copy103>>2]=HEAP32[$80>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$80+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$80+8>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$81>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$81+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$81+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$81+3>>0]|0; _DrawModelEx($dwarf$byval_copy,$position$byval_copy,$$byval_copy76,$450,$$byval_copy103,$$byval_copy112); _End3dMode(); } } } } } } } } } } } $454 = HEAP32[176>>2]|0; $455 = ($454|0)==(6); $456 = HEAP32[216>>2]|0; $457 = ($456|0)>(80); $or$cond365 = $455 & $457; do { if ($or$cond365) { HEAP8[$84>>0] = -66; $458 = ((($84)) + 1|0); HEAP8[$458>>0] = 33; $459 = ((($84)) + 2|0); HEAP8[$459>>0] = 55; $460 = ((($84)) + 3|0); HEAP8[$460>>0] = -1; $461 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$84>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$84+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$84+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$84+3>>0]|0; _Fade($83,$$byval_copy112,$461); ;HEAP8[$$byval_copy112>>0]=HEAP8[$83>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$83+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$83+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$83+3>>0]|0; _DrawText(10713,50,50,40,$$byval_copy112); $$pr332 = HEAP32[216>>2]|0; $462 = ($$pr332|0)>(120); if ($462) { $463 = ($$pr332|0)>(130); if ($463) { HEAP32[$86>>2] = -1; $464 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$86>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$86+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$86+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$86+3>>0]|0; _Fade($85,$$byval_copy112,$464); ;HEAP32[$$byval_copy103>>2]=HEAP32[608>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[608+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[608+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[608+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[608+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$85>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$85+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$85+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$85+3>>0]|0; _DrawTexture($$byval_copy103,70,110,$$byval_copy112); } $465 = HEAP32[216>>2]|0; $466 = ($465|0)>(160); if ($466) { HEAP32[$88>>2] = -1; $467 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$88>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$88+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$88+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$88+3>>0]|0; _Fade($87,$$byval_copy112,$467); ;HEAP32[$$byval_copy103>>2]=HEAP32[(628)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(628)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(628)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(628)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(628)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$87>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$87+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$87+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$87+3>>0]|0; _DrawTexture($$byval_copy103,50,135,$$byval_copy112); $$pr334 = HEAP32[216>>2]|0; $468 = ($$pr334|0)>(190); if ($468) { HEAP32[$90>>2] = -1; $469 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$90>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$90+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$90+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$90+3>>0]|0; _Fade($89,$$byval_copy112,$469); ;HEAP32[$$byval_copy103>>2]=HEAP32[(648)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(648)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(648)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(648)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(648)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$89>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$89+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$89+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$89+3>>0]|0; _DrawTexture($$byval_copy103,75,160,$$byval_copy112); $$pr337$pr = HEAP32[216>>2]|0; $470 = ($$pr337$pr|0)>(220); if ($470) { HEAP32[$92>>2] = -1; $471 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$92>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$92+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$92+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$92+3>>0]|0; _Fade($91,$$byval_copy112,$471); ;HEAP32[$$byval_copy103>>2]=HEAP32[(668)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(668)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(668)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(668)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(668)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$91>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$91+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$91+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$91+3>>0]|0; _DrawTexture($$byval_copy103,55,185,$$byval_copy112); $$pr340$pr = HEAP32[216>>2]|0; $472 = ($$pr340$pr|0)>(250); if ($472) { HEAP32[$94>>2] = -1; $473 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$94>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$94+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$94+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$94+3>>0]|0; _Fade($93,$$byval_copy112,$473); ;HEAP32[$$byval_copy103>>2]=HEAP32[(688)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(688)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(688)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(688)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(688)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$93>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$93+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$93+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$93+3>>0]|0; _DrawTexture($$byval_copy103,70,210,$$byval_copy112); $$pr343$pr$pr = HEAP32[216>>2]|0; $474 = ($$pr343$pr$pr|0)>(380); if ($474) { HEAP8[$96>>0] = -26; $475 = ((($96)) + 1|0); HEAP8[$475>>0] = 41; $476 = ((($96)) + 2|0); HEAP8[$476>>0] = 55; $477 = ((($96)) + 3|0); HEAP8[$477>>0] = -1; $478 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$96>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$96+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$96+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$96+3>>0]|0; _Fade($95,$$byval_copy112,$478); ;HEAP8[$$byval_copy112>>0]=HEAP8[$95>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$95+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$95+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$95+3>>0]|0; _DrawText(10736,70,570,80,$$byval_copy112); $$pr346$pr$pr = HEAP32[216>>2]|0; $479 = ($$pr346$pr$pr|0)>(440); if ($479) { HEAP8[$98>>0] = -66; $480 = ((($98)) + 1|0); HEAP8[$480>>0] = 33; $481 = ((($98)) + 2|0); HEAP8[$481>>0] = 55; $482 = ((($98)) + 3|0); HEAP8[$482>>0] = -1; $483 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$98>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$98+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$98+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$98+3>>0]|0; _Fade($97,$$byval_copy112,$483); ;HEAP8[$$byval_copy112>>0]=HEAP8[$97>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$97+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$97+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$97+3>>0]|0; _DrawText(10745,750,50,40,$$byval_copy112); $$pr350$pr$pr = HEAP32[216>>2]|0; $484 = ($$pr350$pr$pr|0)>(480); if ($484) { $485 = ($$pr350$pr$pr|0)>(510); if ($485) { HEAP32[$100>>2] = -1; $486 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$100>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$100+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$100+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$100+3>>0]|0; _Fade($99,$$byval_copy112,$486); ;HEAP32[$$byval_copy103>>2]=HEAP32[708>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[708+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[708+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[708+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[708+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$99>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$99+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$99+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$99+3>>0]|0; _DrawTexture($$byval_copy103,800,110,$$byval_copy112); } $487 = HEAP32[216>>2]|0; $488 = ($487|0)>(540); if ($488) { HEAP32[$102>>2] = -1; $489 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$102>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$102+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$102+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$102+3>>0]|0; _Fade($101,$$byval_copy112,$489); ;HEAP32[$$byval_copy103>>2]=HEAP32[(728)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(728)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(728)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(728)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(728)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$101>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$101+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$101+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$101+3>>0]|0; _DrawTexture($$byval_copy103,790,135,$$byval_copy112); $$pr352 = HEAP32[216>>2]|0; $490 = ($$pr352|0)>(570); if ($490) { HEAP32[$104>>2] = -1; $491 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$104>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$104+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$104+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$104+3>>0]|0; _Fade($103,$$byval_copy112,$491); ;HEAP32[$$byval_copy103>>2]=HEAP32[(748)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(748)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(748)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(748)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(748)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$103>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$103+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$103+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$103+3>>0]|0; _DrawTexture($$byval_copy103,810,160,$$byval_copy112); $$pr355$pr = HEAP32[216>>2]|0; $492 = ($$pr355$pr|0)>(600); if ($492) { HEAP32[$106>>2] = -1; $493 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$106>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$106+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$106+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$106+3>>0]|0; _Fade($105,$$byval_copy112,$493); ;HEAP32[$$byval_copy103>>2]=HEAP32[(768)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(768)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(768)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(768)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(768)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$105>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$105+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$105+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$105+3>>0]|0; _DrawTexture($$byval_copy103,795,185,$$byval_copy112); $$pr358$pr = HEAP32[216>>2]|0; $494 = ($$pr358$pr|0)>(630); if ($494) { HEAP32[$108>>2] = -1; $495 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$108>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$108+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$108+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$108+3>>0]|0; _Fade($107,$$byval_copy112,$495); ;HEAP32[$$byval_copy103>>2]=HEAP32[(788)>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[(788)+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[(788)+8>>2]|0;HEAP32[$$byval_copy103+12>>2]=HEAP32[(788)+12>>2]|0;HEAP32[$$byval_copy103+16>>2]=HEAP32[(788)+16>>2]|0; ;HEAP8[$$byval_copy112>>0]=HEAP8[$107>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$107+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$107+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$107+3>>0]|0; _DrawTexture($$byval_copy103,800,210,$$byval_copy112); $$pr361$pr$pr = HEAP32[216>>2]|0; $496 = ($$pr361$pr$pr|0)>(690); if (!($496)) { break; } HEAP8[$110>>0] = -26; $497 = ((($110)) + 1|0); HEAP8[$497>>0] = 41; $498 = ((($110)) + 2|0); HEAP8[$498>>0] = 55; $499 = ((($110)) + 3|0); HEAP8[$499>>0] = -1; $500 = +HEAPF32[184>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$110>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$110+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$110+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$110+3>>0]|0; _Fade($109,$$byval_copy112,$500); ;HEAP8[$$byval_copy112>>0]=HEAP8[$109>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$109+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$109+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$109+3>>0]|0; _DrawText(10770,810,570,80,$$byval_copy112); } } } } } } } } } } } } } } while(0); HEAP8[$112>>0] = -126; $501 = ((($112)) + 1|0); HEAP8[$501>>0] = -126; $502 = ((($112)) + 2|0); HEAP8[$502>>0] = -126; $503 = ((($112)) + 3|0); HEAP8[$503>>0] = -1; $504 = +HEAPF32[188>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$112>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$112+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$112+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$112+3>>0]|0; _Fade($111,$$byval_copy112,$504); ;HEAP8[$$byval_copy112>>0]=HEAP8[$111>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$111+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$111+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$111+3>>0]|0; _DrawRectangle(20,680,1240,20,$$byval_copy112); $505 = HEAP32[228>>2]|0; $506 = (+($505|0)); $507 = HEAP32[224>>2]|0; $508 = (+($507|0)); $509 = $506 / $508; $510 = $509 * 1240.0; $511 = $510 + 20.0; $512 = (~~(($511))); $513 = 1240.0 - $510; $514 = (~~(($513))); HEAP8[$114>>0] = -11; $515 = ((($114)) + 1|0); HEAP8[$515>>0] = -11; $516 = ((($114)) + 2|0); HEAP8[$516>>0] = -11; $517 = ((($114)) + 3|0); HEAP8[$517>>0] = -1; $518 = +HEAPF32[188>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$114>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$114+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$114+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$114+3>>0]|0; _Fade($113,$$byval_copy112,$518); ;HEAP8[$$byval_copy112>>0]=HEAP8[$113>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$113+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$113+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$113+3>>0]|0; _DrawRectangle($512,680,$514,20,$$byval_copy112); HEAP8[$116>>0] = 80; $519 = ((($116)) + 1|0); HEAP8[$519>>0] = 80; $520 = ((($116)) + 2|0); HEAP8[$520>>0] = 80; $521 = ((($116)) + 3|0); HEAP8[$521>>0] = -1; $522 = +HEAPF32[188>>2]; ;HEAP8[$$byval_copy112>>0]=HEAP8[$116>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$116+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$116+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$116+3>>0]|0; _Fade($115,$$byval_copy112,$522); ;HEAP8[$$byval_copy112>>0]=HEAP8[$115>>0]|0;HEAP8[$$byval_copy112+1>>0]=HEAP8[$115+1>>0]|0;HEAP8[$$byval_copy112+2>>0]=HEAP8[$115+2>>0]|0;HEAP8[$$byval_copy112+3>>0]=HEAP8[$115+3>>0]|0; _DrawRectangleLines(20,679,1240,20,$$byval_copy112); break; } default: { } } $523 = HEAP32[200>>2]|0; $524 = ($523|0)==(0); if ($524) { _EndDrawing(); STACKTOP = sp;return; } _DrawTransition(); _EndDrawing(); STACKTOP = sp;return; } function _TransitionToScreen($screen) { $screen = $screen|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; HEAP32[200>>2] = 1; $0 = HEAP32[220>>2]|0; HEAP32[208>>2] = $0; HEAP32[212>>2] = $screen; return; } function _UpdateTransition() { var $0 = 0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[204>>2]|0; $1 = ($0|0)==(0); $2 = +HEAPF32[196>>2]; if ($1) { $3 = $2 + 0.05000000074505806; HEAPF32[196>>2] = $3; $4 = !($3 >= 1.0); if ($4) { return; } HEAPF32[196>>2] = 1.0; $5 = HEAP32[212>>2]|0; HEAP32[220>>2] = $5; HEAP32[204>>2] = 1; HEAP32[216>>2] = 0; return; } else { $6 = $2 + -0.05000000074505806; HEAPF32[196>>2] = $6; $7 = !($6 <= 0.0); if ($7) { return; } HEAPF32[196>>2] = 0.0; HEAP32[204>>2] = 0; HEAP32[200>>2] = 0; HEAP32[208>>2] = -1; HEAP32[212>>2] = -1; return; } } function _DrawTransition() { var $$byval_copy1 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $$byval_copy1 = sp + 8|0; $0 = sp + 4|0; $1 = sp; $2 = (_GetScreenWidth()|0); $3 = (_GetScreenHeight()|0); HEAP8[$1>>0] = -11; $4 = ((($1)) + 1|0); HEAP8[$4>>0] = -11; $5 = ((($1)) + 2|0); HEAP8[$5>>0] = -11; $6 = ((($1)) + 3|0); HEAP8[$6>>0] = -1; $7 = +HEAPF32[196>>2]; ;HEAP8[$$byval_copy1>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$1+3>>0]|0; _Fade($0,$$byval_copy1,$7); ;HEAP8[$$byval_copy1>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$0+3>>0]|0; _DrawRectangle(0,0,$2,$3,$$byval_copy1); STACKTOP = sp;return; } function _VectorSubtract($agg$result,$v1,$v2) { $agg$result = $agg$result|0; $v1 = $v1|0; $v2 = $v2|0; var $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$v1>>2]; $1 = +HEAPF32[$v2>>2]; $2 = $0 - $1; $3 = ((($v1)) + 4|0); $4 = +HEAPF32[$3>>2]; $5 = ((($v2)) + 4|0); $6 = +HEAPF32[$5>>2]; $7 = $4 - $6; $8 = ((($v1)) + 8|0); $9 = +HEAPF32[$8>>2]; $10 = ((($v2)) + 8|0); $11 = +HEAPF32[$10>>2]; $12 = $9 - $11; HEAPF32[$agg$result>>2] = $2; $13 = ((($agg$result)) + 4|0); HEAPF32[$13>>2] = $7; $14 = ((($agg$result)) + 8|0); HEAPF32[$14>>2] = $12; return; } function _VectorCrossProduct($agg$result,$v1,$v2) { $agg$result = $agg$result|0; $v1 = $v1|0; $v2 = $v2|0; var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0; var $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($v1)) + 4|0); $1 = +HEAPF32[$0>>2]; $2 = ((($v2)) + 8|0); $3 = +HEAPF32[$2>>2]; $4 = $1 * $3; $5 = ((($v1)) + 8|0); $6 = +HEAPF32[$5>>2]; $7 = ((($v2)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = $6 * $8; $10 = $4 - $9; $11 = +HEAPF32[$v2>>2]; $12 = $6 * $11; $13 = +HEAPF32[$v1>>2]; $14 = $3 * $13; $15 = $12 - $14; $16 = $8 * $13; $17 = $1 * $11; $18 = $16 - $17; HEAPF32[$agg$result>>2] = $10; $19 = ((($agg$result)) + 4|0); HEAPF32[$19>>2] = $15; $20 = ((($agg$result)) + 8|0); HEAPF32[$20>>2] = $18; return; } function _VectorLength($v) { $v = $v|0; var $0 = 0.0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$v>>2]; $1 = $0 * $0; $2 = ((($v)) + 4|0); $3 = +HEAPF32[$2>>2]; $4 = $3 * $3; $5 = $1 + $4; $6 = ((($v)) + 8|0); $7 = +HEAPF32[$6>>2]; $8 = $7 * $7; $9 = $5 + $8; $sqrtf = (+Math_sqrt((+$9))); return (+$sqrtf); } function _VectorNormalize($v) { $v = $v|0; var $$op = 0.0, $0 = 0.0, $1 = 0, $10 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $v$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $v$byval_copy = sp; ;HEAP32[$v$byval_copy>>2]=HEAP32[$v>>2]|0;HEAP32[$v$byval_copy+4>>2]=HEAP32[$v+4>>2]|0;HEAP32[$v$byval_copy+8>>2]=HEAP32[$v+8>>2]|0; $0 = (+_VectorLength($v$byval_copy)); $1 = $0 == 0.0; $$op = 1.0 / $0; $2 = $1 ? 1.0 : $$op; $3 = +HEAPF32[$v>>2]; $4 = $3 * $2; HEAPF32[$v>>2] = $4; $5 = ((($v)) + 4|0); $6 = +HEAPF32[$5>>2]; $7 = $2 * $6; HEAPF32[$5>>2] = $7; $8 = ((($v)) + 8|0); $9 = +HEAPF32[$8>>2]; $10 = $2 * $9; HEAPF32[$8>>2] = $10; STACKTOP = sp;return; } function _VectorTransform($v,$mat) { $v = $v|0; $mat = $mat|0; var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0; var $45 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$v>>2]; $1 = ((($v)) + 4|0); $2 = +HEAPF32[$1>>2]; $3 = ((($v)) + 8|0); $4 = +HEAPF32[$3>>2]; $5 = +HEAPF32[$mat>>2]; $6 = $0 * $5; $7 = ((($mat)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = $2 * $8; $10 = $6 + $9; $11 = ((($mat)) + 8|0); $12 = +HEAPF32[$11>>2]; $13 = $4 * $12; $14 = $10 + $13; $15 = ((($mat)) + 12|0); $16 = +HEAPF32[$15>>2]; $17 = $16 + $14; HEAPF32[$v>>2] = $17; $18 = ((($mat)) + 16|0); $19 = +HEAPF32[$18>>2]; $20 = $0 * $19; $21 = ((($mat)) + 20|0); $22 = +HEAPF32[$21>>2]; $23 = $2 * $22; $24 = $20 + $23; $25 = ((($mat)) + 24|0); $26 = +HEAPF32[$25>>2]; $27 = $4 * $26; $28 = $24 + $27; $29 = ((($mat)) + 28|0); $30 = +HEAPF32[$29>>2]; $31 = $30 + $28; HEAPF32[$1>>2] = $31; $32 = ((($mat)) + 32|0); $33 = +HEAPF32[$32>>2]; $34 = $0 * $33; $35 = ((($mat)) + 36|0); $36 = +HEAPF32[$35>>2]; $37 = $2 * $36; $38 = $34 + $37; $39 = ((($mat)) + 40|0); $40 = +HEAPF32[$39>>2]; $41 = $4 * $40; $42 = $38 + $41; $43 = ((($mat)) + 44|0); $44 = +HEAPF32[$43>>2]; $45 = $44 + $42; HEAPF32[$3>>2] = $45; return; } function _VectorZero($agg$result) { $agg$result = $agg$result|0; var label = 0, sp = 0; sp = STACKTOP; ;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0; return; } function _MatrixTranspose($mat) { $mat = $mat|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($mat)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ((($mat)) + 8|0); $3 = HEAP32[$2>>2]|0; $4 = ((($mat)) + 12|0); $5 = HEAP32[$4>>2]|0; $6 = ((($mat)) + 16|0); $7 = HEAP32[$6>>2]|0; $8 = ((($mat)) + 24|0); $9 = HEAP32[$8>>2]|0; $10 = ((($mat)) + 28|0); $11 = HEAP32[$10>>2]|0; $12 = ((($mat)) + 32|0); $13 = HEAP32[$12>>2]|0; $14 = ((($mat)) + 36|0); $15 = HEAP32[$14>>2]|0; $16 = ((($mat)) + 44|0); $17 = HEAP32[$16>>2]|0; $18 = ((($mat)) + 48|0); $19 = HEAP32[$18>>2]|0; $20 = ((($mat)) + 52|0); $21 = HEAP32[$20>>2]|0; $22 = ((($mat)) + 56|0); $23 = HEAP32[$22>>2]|0; HEAP32[$0>>2] = $7; HEAP32[$2>>2] = $13; HEAP32[$4>>2] = $19; HEAP32[$6>>2] = $1; HEAP32[$8>>2] = $15; HEAP32[$10>>2] = $21; HEAP32[$12>>2] = $3; HEAP32[$14>>2] = $9; HEAP32[$16>>2] = $23; HEAP32[$18>>2] = $5; HEAP32[$20>>2] = $11; HEAP32[$22>>2] = $17; return; } function _MatrixIdentity($agg$result) { $agg$result = $agg$result|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $result$sroa$5 = sp + 32|0; $result$sroa$6 = sp + 16|0; $result$sroa$7 = sp; ;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0; ;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0; ;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0; HEAPF32[$agg$result>>2] = 1.0; $0 = ((($agg$result)) + 4|0); ;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0; $1 = ((($agg$result)) + 20|0); HEAPF32[$1>>2] = 1.0; $2 = ((($agg$result)) + 24|0); ;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0; $3 = ((($agg$result)) + 40|0); HEAPF32[$3>>2] = 1.0; $4 = ((($agg$result)) + 44|0); ;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0; $5 = ((($agg$result)) + 60|0); HEAPF32[$5>>2] = 1.0; STACKTOP = sp;return; } function _MatrixTranslate($agg$result,$x,$y,$z) { $agg$result = $agg$result|0; $x = +$x; $y = +$y; $z = +$z; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; HEAPF32[$agg$result>>2] = 1.0; $0 = ((($agg$result)) + 4|0); $1 = ((($agg$result)) + 20|0); ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0; HEAPF32[$1>>2] = 1.0; $2 = ((($agg$result)) + 24|0); $3 = ((($agg$result)) + 40|0); ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0; HEAPF32[$3>>2] = 1.0; $4 = ((($agg$result)) + 44|0); HEAPF32[$4>>2] = 0.0; $5 = ((($agg$result)) + 48|0); HEAPF32[$5>>2] = $x; $6 = ((($agg$result)) + 52|0); HEAPF32[$6>>2] = $y; $7 = ((($agg$result)) + 56|0); HEAPF32[$7>>2] = $z; $8 = ((($agg$result)) + 60|0); HEAPF32[$8>>2] = 1.0; return; } function _MatrixRotate($agg$result,$axis,$angle) { $agg$result = $agg$result|0; $axis = $axis|0; $angle = +$angle; var $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0; var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0; var $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0; var $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0.0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0; var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0; var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0; var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $mat = 0, $or$cond = 0, $sqrtf = 0.0, $x$0 = 0.0, $y$0 = 0.0, $z$0 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $mat = sp; _MatrixIdentity($mat); $0 = +HEAPF32[$axis>>2]; $1 = ((($axis)) + 4|0); $2 = +HEAPF32[$1>>2]; $3 = ((($axis)) + 8|0); $4 = +HEAPF32[$3>>2]; $5 = $0 * $0; $6 = $2 * $2; $7 = $5 + $6; $8 = $4 * $4; $9 = $7 + $8; $sqrtf = (+Math_sqrt((+$9))); $10 = $sqrtf != 1.0; $11 = $sqrtf != 0.0; $or$cond = $10 & $11; if ($or$cond) { $12 = 1.0 / $sqrtf; $13 = $0 * $12; $14 = $2 * $12; $15 = $4 * $12; $x$0 = $13;$y$0 = $14;$z$0 = $15; } else { $x$0 = $0;$y$0 = $2;$z$0 = $4; } $16 = (+Math_sin((+$angle))); $17 = (+Math_cos((+$angle))); $18 = 1.0 - $17; $19 = +HEAPF32[$mat>>2]; $20 = ((($mat)) + 16|0); $21 = +HEAPF32[$20>>2]; $22 = ((($mat)) + 32|0); $23 = +HEAPF32[$22>>2]; $24 = ((($mat)) + 48|0); $25 = +HEAPF32[$24>>2]; $26 = ((($mat)) + 4|0); $27 = +HEAPF32[$26>>2]; $28 = ((($mat)) + 20|0); $29 = +HEAPF32[$28>>2]; $30 = ((($mat)) + 36|0); $31 = +HEAPF32[$30>>2]; $32 = ((($mat)) + 52|0); $33 = +HEAPF32[$32>>2]; $34 = ((($mat)) + 8|0); $35 = +HEAPF32[$34>>2]; $36 = ((($mat)) + 24|0); $37 = +HEAPF32[$36>>2]; $38 = ((($mat)) + 40|0); $39 = +HEAPF32[$38>>2]; $40 = ((($mat)) + 56|0); $41 = +HEAPF32[$40>>2]; $42 = $x$0 * $x$0; $43 = $42 * $18; $44 = $17 + $43; $45 = $y$0 * $x$0; $46 = $45 * $18; $47 = $z$0 * $16; $48 = $47 + $46; $49 = $z$0 * $x$0; $50 = $49 * $18; $51 = $y$0 * $16; $52 = $50 - $51; $53 = $46 - $47; $54 = $y$0 * $y$0; $55 = $54 * $18; $56 = $17 + $55; $57 = $z$0 * $y$0; $58 = $57 * $18; $59 = $x$0 * $16; $60 = $59 + $58; $61 = $51 + $50; $62 = $58 - $59; $63 = $z$0 * $z$0; $64 = $63 * $18; $65 = $17 + $64; $66 = $19 * $44; $67 = $48 * $27; $68 = $66 + $67; $69 = $52 * $35; $70 = $68 + $69; $71 = $21 * $44; $72 = $48 * $29; $73 = $71 + $72; $74 = $52 * $37; $75 = $73 + $74; $76 = $23 * $44; $77 = $48 * $31; $78 = $76 + $77; $79 = $52 * $39; $80 = $78 + $79; $81 = $44 * $25; $82 = $48 * $33; $83 = $81 + $82; $84 = $52 * $41; $85 = $83 + $84; $86 = $19 * $53; $87 = $56 * $27; $88 = $86 + $87; $89 = $60 * $35; $90 = $88 + $89; $91 = $21 * $53; $92 = $56 * $29; $93 = $91 + $92; $94 = $60 * $37; $95 = $93 + $94; $96 = $23 * $53; $97 = $56 * $31; $98 = $96 + $97; $99 = $60 * $39; $100 = $98 + $99; $101 = $53 * $25; $102 = $56 * $33; $103 = $101 + $102; $104 = $60 * $41; $105 = $103 + $104; $106 = $19 * $61; $107 = $62 * $27; $108 = $106 + $107; $109 = $65 * $35; $110 = $108 + $109; $111 = $21 * $61; $112 = $62 * $29; $113 = $111 + $112; $114 = $65 * $37; $115 = $113 + $114; $116 = $23 * $61; $117 = $62 * $31; $118 = $116 + $117; $119 = $65 * $39; $120 = $118 + $119; $121 = $61 * $25; $122 = $62 * $33; $123 = $121 + $122; $124 = $65 * $41; $125 = $123 + $124; $126 = ((($mat)) + 12|0); $127 = HEAP32[$126>>2]|0; $128 = ((($mat)) + 28|0); $129 = HEAP32[$128>>2]|0; $130 = ((($mat)) + 44|0); $131 = HEAP32[$130>>2]|0; $132 = ((($mat)) + 60|0); $133 = HEAP32[$132>>2]|0; HEAPF32[$agg$result>>2] = $70; $134 = ((($agg$result)) + 4|0); HEAPF32[$134>>2] = $90; $135 = ((($agg$result)) + 8|0); HEAPF32[$135>>2] = $110; $136 = ((($agg$result)) + 12|0); HEAP32[$136>>2] = $127; $137 = ((($agg$result)) + 16|0); HEAPF32[$137>>2] = $75; $138 = ((($agg$result)) + 20|0); HEAPF32[$138>>2] = $95; $139 = ((($agg$result)) + 24|0); HEAPF32[$139>>2] = $115; $140 = ((($agg$result)) + 28|0); HEAP32[$140>>2] = $129; $141 = ((($agg$result)) + 32|0); HEAPF32[$141>>2] = $80; $142 = ((($agg$result)) + 36|0); HEAPF32[$142>>2] = $100; $143 = ((($agg$result)) + 40|0); HEAPF32[$143>>2] = $120; $144 = ((($agg$result)) + 44|0); HEAP32[$144>>2] = $131; $145 = ((($agg$result)) + 48|0); HEAPF32[$145>>2] = $85; $146 = ((($agg$result)) + 52|0); HEAPF32[$146>>2] = $105; $147 = ((($agg$result)) + 56|0); HEAPF32[$147>>2] = $125; $148 = ((($agg$result)) + 60|0); HEAP32[$148>>2] = $133; STACKTOP = sp;return; } function _MatrixScale($agg$result,$x,$y,$z) { $agg$result = $agg$result|0; $x = +$x; $y = +$y; $z = +$z; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $result$sroa$5 = sp + 32|0; $result$sroa$6 = sp + 16|0; $result$sroa$7 = sp; ;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0; ;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0; ;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0; HEAPF32[$agg$result>>2] = $x; $0 = ((($agg$result)) + 4|0); ;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0; $1 = ((($agg$result)) + 20|0); HEAPF32[$1>>2] = $y; $2 = ((($agg$result)) + 24|0); ;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0; $3 = ((($agg$result)) + 40|0); HEAPF32[$3>>2] = $z; $4 = ((($agg$result)) + 44|0); ;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0; $5 = ((($agg$result)) + 60|0); HEAPF32[$5>>2] = 1.0; STACKTOP = sp;return; } function _MatrixMultiply($agg$result,$left,$right) { $agg$result = $agg$result|0; $left = $left|0; $right = $right|0; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0.0; var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0; var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0.0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0.0; var $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0; var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0.0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0; var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0; var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0; var $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0; var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$right>>2]; $1 = +HEAPF32[$left>>2]; $2 = $0 * $1; $3 = ((($right)) + 16|0); $4 = +HEAPF32[$3>>2]; $5 = ((($left)) + 4|0); $6 = +HEAPF32[$5>>2]; $7 = $4 * $6; $8 = $2 + $7; $9 = ((($right)) + 32|0); $10 = +HEAPF32[$9>>2]; $11 = ((($left)) + 8|0); $12 = +HEAPF32[$11>>2]; $13 = $10 * $12; $14 = $8 + $13; $15 = ((($right)) + 48|0); $16 = +HEAPF32[$15>>2]; $17 = ((($left)) + 12|0); $18 = +HEAPF32[$17>>2]; $19 = $16 * $18; $20 = $14 + $19; $21 = ((($left)) + 16|0); $22 = +HEAPF32[$21>>2]; $23 = $0 * $22; $24 = ((($left)) + 20|0); $25 = +HEAPF32[$24>>2]; $26 = $4 * $25; $27 = $23 + $26; $28 = ((($left)) + 24|0); $29 = +HEAPF32[$28>>2]; $30 = $10 * $29; $31 = $27 + $30; $32 = ((($left)) + 28|0); $33 = +HEAPF32[$32>>2]; $34 = $16 * $33; $35 = $31 + $34; $36 = ((($left)) + 32|0); $37 = +HEAPF32[$36>>2]; $38 = $0 * $37; $39 = ((($left)) + 36|0); $40 = +HEAPF32[$39>>2]; $41 = $4 * $40; $42 = $38 + $41; $43 = ((($left)) + 40|0); $44 = +HEAPF32[$43>>2]; $45 = $10 * $44; $46 = $42 + $45; $47 = ((($left)) + 44|0); $48 = +HEAPF32[$47>>2]; $49 = $16 * $48; $50 = $46 + $49; $51 = ((($left)) + 48|0); $52 = +HEAPF32[$51>>2]; $53 = $0 * $52; $54 = ((($left)) + 52|0); $55 = +HEAPF32[$54>>2]; $56 = $4 * $55; $57 = $53 + $56; $58 = ((($left)) + 56|0); $59 = +HEAPF32[$58>>2]; $60 = $10 * $59; $61 = $57 + $60; $62 = ((($left)) + 60|0); $63 = +HEAPF32[$62>>2]; $64 = $16 * $63; $65 = $61 + $64; $66 = ((($right)) + 4|0); $67 = +HEAPF32[$66>>2]; $68 = $1 * $67; $69 = ((($right)) + 20|0); $70 = +HEAPF32[$69>>2]; $71 = $6 * $70; $72 = $68 + $71; $73 = ((($right)) + 36|0); $74 = +HEAPF32[$73>>2]; $75 = $12 * $74; $76 = $72 + $75; $77 = ((($right)) + 52|0); $78 = +HEAPF32[$77>>2]; $79 = $18 * $78; $80 = $76 + $79; $81 = $22 * $67; $82 = $25 * $70; $83 = $81 + $82; $84 = $29 * $74; $85 = $83 + $84; $86 = $33 * $78; $87 = $85 + $86; $88 = $37 * $67; $89 = $40 * $70; $90 = $88 + $89; $91 = $44 * $74; $92 = $90 + $91; $93 = $48 * $78; $94 = $92 + $93; $95 = $52 * $67; $96 = $55 * $70; $97 = $95 + $96; $98 = $59 * $74; $99 = $97 + $98; $100 = $63 * $78; $101 = $99 + $100; $102 = ((($right)) + 8|0); $103 = +HEAPF32[$102>>2]; $104 = $1 * $103; $105 = ((($right)) + 24|0); $106 = +HEAPF32[$105>>2]; $107 = $6 * $106; $108 = $104 + $107; $109 = ((($right)) + 40|0); $110 = +HEAPF32[$109>>2]; $111 = $12 * $110; $112 = $108 + $111; $113 = ((($right)) + 56|0); $114 = +HEAPF32[$113>>2]; $115 = $18 * $114; $116 = $112 + $115; $117 = $22 * $103; $118 = $25 * $106; $119 = $117 + $118; $120 = $29 * $110; $121 = $119 + $120; $122 = $33 * $114; $123 = $121 + $122; $124 = $37 * $103; $125 = $40 * $106; $126 = $124 + $125; $127 = $44 * $110; $128 = $126 + $127; $129 = $48 * $114; $130 = $128 + $129; $131 = $52 * $103; $132 = $55 * $106; $133 = $131 + $132; $134 = $59 * $110; $135 = $133 + $134; $136 = $63 * $114; $137 = $135 + $136; $138 = ((($right)) + 12|0); $139 = +HEAPF32[$138>>2]; $140 = $1 * $139; $141 = ((($right)) + 28|0); $142 = +HEAPF32[$141>>2]; $143 = $6 * $142; $144 = $140 + $143; $145 = ((($right)) + 44|0); $146 = +HEAPF32[$145>>2]; $147 = $12 * $146; $148 = $144 + $147; $149 = ((($right)) + 60|0); $150 = +HEAPF32[$149>>2]; $151 = $18 * $150; $152 = $148 + $151; $153 = $22 * $139; $154 = $25 * $142; $155 = $153 + $154; $156 = $29 * $146; $157 = $155 + $156; $158 = $33 * $150; $159 = $157 + $158; $160 = $37 * $139; $161 = $40 * $142; $162 = $160 + $161; $163 = $44 * $146; $164 = $162 + $163; $165 = $48 * $150; $166 = $164 + $165; $167 = $52 * $139; $168 = $55 * $142; $169 = $167 + $168; $170 = $59 * $146; $171 = $169 + $170; $172 = $63 * $150; $173 = $171 + $172; HEAPF32[$agg$result>>2] = $20; $174 = ((($agg$result)) + 4|0); HEAPF32[$174>>2] = $80; $175 = ((($agg$result)) + 8|0); HEAPF32[$175>>2] = $116; $176 = ((($agg$result)) + 12|0); HEAPF32[$176>>2] = $152; $177 = ((($agg$result)) + 16|0); HEAPF32[$177>>2] = $35; $178 = ((($agg$result)) + 20|0); HEAPF32[$178>>2] = $87; $179 = ((($agg$result)) + 24|0); HEAPF32[$179>>2] = $123; $180 = ((($agg$result)) + 28|0); HEAPF32[$180>>2] = $159; $181 = ((($agg$result)) + 32|0); HEAPF32[$181>>2] = $50; $182 = ((($agg$result)) + 36|0); HEAPF32[$182>>2] = $94; $183 = ((($agg$result)) + 40|0); HEAPF32[$183>>2] = $130; $184 = ((($agg$result)) + 44|0); HEAPF32[$184>>2] = $166; $185 = ((($agg$result)) + 48|0); HEAPF32[$185>>2] = $65; $186 = ((($agg$result)) + 52|0); HEAPF32[$186>>2] = $101; $187 = ((($agg$result)) + 56|0); HEAPF32[$187>>2] = $137; $188 = ((($agg$result)) + 60|0); HEAPF32[$188>>2] = $173; return; } function _MatrixFrustum($agg$result,$left,$right,$bottom,$top,$near,$far) { $agg$result = $agg$result|0; $left = +$left; $right = +$right; $bottom = +$bottom; $top = +$top; $near = +$near; $far = +$far; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0.0; var $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = $right - $left; $1 = $0; $2 = $top - $bottom; $3 = $2; $4 = $far - $near; $5 = $4; $6 = $near * 2.0; $7 = $1; $8 = $6 / $7; $9 = $8; $10 = $3; $11 = $6 / $10; $12 = $11; $13 = $left + $right; $14 = $13 / $7; $15 = $14; $16 = $bottom + $top; $17 = $16 / $10; $18 = $17; $19 = $near + $far; $20 = -$19; $21 = $5; $22 = $20 / $21; $23 = $22; $24 = $near * $far; $25 = $24 * 2.0; $26 = -$25; $27 = $26 / $21; $28 = $27; HEAPF32[$agg$result>>2] = $9; $29 = ((($agg$result)) + 4|0); HEAPF32[$29>>2] = 0.0; $30 = ((($agg$result)) + 8|0); HEAPF32[$30>>2] = $15; $31 = ((($agg$result)) + 12|0); HEAPF32[$31>>2] = 0.0; $32 = ((($agg$result)) + 16|0); HEAPF32[$32>>2] = 0.0; $33 = ((($agg$result)) + 20|0); HEAPF32[$33>>2] = $12; $34 = ((($agg$result)) + 24|0); HEAPF32[$34>>2] = $18; $35 = ((($agg$result)) + 28|0); HEAPF32[$35>>2] = 0.0; $36 = ((($agg$result)) + 32|0); HEAPF32[$36>>2] = 0.0; $37 = ((($agg$result)) + 36|0); HEAPF32[$37>>2] = 0.0; $38 = ((($agg$result)) + 40|0); HEAPF32[$38>>2] = $23; $39 = ((($agg$result)) + 44|0); HEAPF32[$39>>2] = $28; $40 = ((($agg$result)) + 48|0); HEAPF32[$40>>2] = 0.0; $41 = ((($agg$result)) + 52|0); HEAPF32[$41>>2] = 0.0; $42 = ((($agg$result)) + 56|0); HEAPF32[$42>>2] = -1.0; $43 = ((($agg$result)) + 60|0); HEAPF32[$43>>2] = 0.0; return; } function _MatrixOrtho($agg$result,$left,$right,$bottom,$top,$near,$far) { $agg$result = $agg$result|0; $left = +$left; $right = +$right; $bottom = +$bottom; $top = +$top; $near = +$near; $far = +$far; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0; var sp = 0; sp = STACKTOP; $0 = $right - $left; $1 = $0; $2 = $top - $bottom; $3 = $2; $4 = $far - $near; $5 = $4; $6 = 2.0 / $1; $7 = 2.0 / $3; $8 = -2.0 / $5; $9 = $left + $right; $10 = -$9; $11 = $1; $12 = $10 / $11; $13 = $12; $14 = $bottom + $top; $15 = -$14; $16 = $3; $17 = $15 / $16; $18 = $17; $19 = $near + $far; $20 = -$19; $21 = $5; $22 = $20 / $21; $23 = $22; HEAPF32[$agg$result>>2] = $6; $24 = ((($agg$result)) + 4|0); HEAPF32[$24>>2] = 0.0; $25 = ((($agg$result)) + 8|0); HEAPF32[$25>>2] = 0.0; $26 = ((($agg$result)) + 12|0); HEAPF32[$26>>2] = $13; $27 = ((($agg$result)) + 16|0); HEAPF32[$27>>2] = 0.0; $28 = ((($agg$result)) + 20|0); HEAPF32[$28>>2] = $7; $29 = ((($agg$result)) + 24|0); HEAPF32[$29>>2] = 0.0; $30 = ((($agg$result)) + 28|0); HEAPF32[$30>>2] = $18; $31 = ((($agg$result)) + 32|0); HEAPF32[$31>>2] = 0.0; $32 = ((($agg$result)) + 36|0); HEAPF32[$32>>2] = 0.0; $33 = ((($agg$result)) + 40|0); HEAPF32[$33>>2] = $8; $34 = ((($agg$result)) + 44|0); HEAPF32[$34>>2] = $23; $35 = ((($agg$result)) + 48|0); HEAPF32[$35>>2] = 0.0; $36 = ((($agg$result)) + 52|0); HEAPF32[$36>>2] = 0.0; $37 = ((($agg$result)) + 56|0); HEAPF32[$37>>2] = 0.0; $38 = ((($agg$result)) + 60|0); HEAPF32[$38>>2] = 1.0; return; } function _MatrixLookAt($agg$result,$eye,$target,$up) { $agg$result = $agg$result|0; $eye = $eye|0; $target = $target|0; $up = $up|0; var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, $x = 0, $x$byval_copy = 0, $y = 0, $z = 0, $z$byval_copy1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $x$byval_copy = sp + 48|0; $z$byval_copy1 = sp + 36|0; $z = sp + 24|0; $x = sp + 12|0; $y = sp; ;HEAP32[$z$byval_copy1>>2]=HEAP32[$eye>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$eye+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$eye+8>>2]|0; ;HEAP32[$x$byval_copy>>2]=HEAP32[$target>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$target+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$target+8>>2]|0; _VectorSubtract($z,$z$byval_copy1,$x$byval_copy); _VectorNormalize($z); ;HEAP32[$z$byval_copy1>>2]=HEAP32[$up>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$up+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$up+8>>2]|0; ;HEAP32[$x$byval_copy>>2]=HEAP32[$z>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$z+8>>2]|0; _VectorCrossProduct($x,$z$byval_copy1,$x$byval_copy); _VectorNormalize($x); ;HEAP32[$z$byval_copy1>>2]=HEAP32[$z>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$z+8>>2]|0; ;HEAP32[$x$byval_copy>>2]=HEAP32[$x>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$x+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$x+8>>2]|0; _VectorCrossProduct($y,$z$byval_copy1,$x$byval_copy); _VectorNormalize($y); $0 = +HEAPF32[$x>>2]; $1 = ((($x)) + 4|0); $2 = +HEAPF32[$1>>2]; $3 = ((($x)) + 8|0); $4 = +HEAPF32[$3>>2]; $5 = +HEAPF32[$eye>>2]; $6 = $0 * $5; $7 = ((($eye)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = $2 * $8; $10 = $6 + $9; $11 = ((($eye)) + 8|0); $12 = +HEAPF32[$11>>2]; $13 = $4 * $12; $14 = $10 + $13; $15 = -$14; $16 = +HEAPF32[$y>>2]; $17 = ((($y)) + 4|0); $18 = +HEAPF32[$17>>2]; $19 = ((($y)) + 8|0); $20 = +HEAPF32[$19>>2]; $21 = $5 * $16; $22 = $8 * $18; $23 = $21 + $22; $24 = $12 * $20; $25 = $23 + $24; $26 = -$25; $27 = +HEAPF32[$z>>2]; $28 = ((($z)) + 4|0); $29 = +HEAPF32[$28>>2]; $30 = ((($z)) + 8|0); $31 = +HEAPF32[$30>>2]; $32 = $5 * $27; $33 = $8 * $29; $34 = $32 + $33; $35 = $12 * $31; $36 = $34 + $35; $37 = -$36; HEAPF32[$agg$result>>2] = $0; $38 = ((($agg$result)) + 4|0); HEAPF32[$38>>2] = $16; $39 = ((($agg$result)) + 8|0); HEAPF32[$39>>2] = $27; $40 = ((($agg$result)) + 12|0); HEAPF32[$40>>2] = 0.0; $41 = ((($agg$result)) + 16|0); HEAPF32[$41>>2] = $2; $42 = ((($agg$result)) + 20|0); HEAPF32[$42>>2] = $18; $43 = ((($agg$result)) + 24|0); HEAPF32[$43>>2] = $29; $44 = ((($agg$result)) + 28|0); HEAPF32[$44>>2] = 0.0; $45 = ((($agg$result)) + 32|0); HEAPF32[$45>>2] = $4; $46 = ((($agg$result)) + 36|0); HEAPF32[$46>>2] = $20; $47 = ((($agg$result)) + 40|0); HEAPF32[$47>>2] = $31; $48 = ((($agg$result)) + 44|0); HEAPF32[$48>>2] = 0.0; $49 = ((($agg$result)) + 48|0); HEAPF32[$49>>2] = $15; $50 = ((($agg$result)) + 52|0); HEAPF32[$50>>2] = $26; $51 = ((($agg$result)) + 56|0); HEAPF32[$51>>2] = $37; $52 = ((($agg$result)) + 60|0); HEAPF32[$52>>2] = 1.0; STACKTOP = sp;return; } function _InitWindow($width,$height,$title) { $width = $width|0; $height = $height|0; $title = $title|0; var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; _TraceLog(0,10779,$vararg_buffer); HEAP32[812>>2] = $title; _InitDisplay($width,$height); _InitGraphics(); _LoadDefaultFont(); _InitTimer(); (_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(4|0))|0); (_emscripten_set_touchstart_callback((10808|0),(0|0),1,(5|0))|0); (_emscripten_set_touchend_callback((10808|0),(0|0),1,(5|0))|0); (_emscripten_set_touchmove_callback((10808|0),(0|0),1,(5|0))|0); (_emscripten_set_touchcancel_callback((10808|0),(0|0),1,(5|0))|0); $0 = HEAP32[816>>2]|0; $1 = (+($0|0)); $2 = $1 * 0.5; HEAPF32[8>>2] = $2; $3 = HEAP32[820>>2]|0; $4 = (+($3|0)); $5 = $4 * 0.5; HEAPF32[(12)>>2] = $5; $6 = HEAP32[824>>2]|0; $7 = ($6|0)==(0); if ($7) { STACKTOP = sp;return; } _SetTargetFPS(60); _LogoAnimation(); STACKTOP = sp;return; } function _SetTargetFPS($fps) { $fps = $fps|0; var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $0 = (+($fps|0)); $1 = 1.0 / $0; HEAPF64[16>>3] = $1; $2 = $1; $3 = $2 * 1000.0; $4 = $3; HEAPF64[$vararg_buffer>>3] = $4; _TraceLog(0,10816,$vararg_buffer); STACKTOP = sp;return; } function _CloseWindow() { var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; _UnloadDefaultFont(); _rlglClose(); $0 = HEAP32[828>>2]|0; _glfwDestroyWindow(($0|0)); _glfwTerminate(); _TraceLog(0,10860,$vararg_buffer); STACKTOP = sp;return; } function _GetScreenWidth() { var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[816>>2]|0; return ($0|0); } function _GetScreenHeight() { var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[820>>2]|0; return ($0|0); } function _ClearBackground($color) { $color = $color|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP8[$color>>0]|0; $1 = ((($color)) + 1|0); $2 = HEAP8[$1>>0]|0; $3 = ((($color)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color)) + 3|0); $6 = HEAP8[$5>>0]|0; _rlClearColor($0,$2,$4,$6); return; } function _BeginDrawing() { var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $downscaleView$byval_copy = sp; $0 = (+_GetTime()); HEAPF64[24>>3] = $0; $1 = +HEAPF64[32>>3]; $2 = $0 - $1; HEAPF64[40>>3] = $2; HEAPF64[32>>3] = $0; $3 = (_IsPosproShaderEnabled()|0); $4 = ($3|0)==(0); if (!($4)) { _rlEnablePostproFBO(); } _rlClearScreenBuffers(); _rlLoadIdentity(); dest=$downscaleView$byval_copy; src=840; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); (_MatrixToFloat($downscaleView$byval_copy)|0); _rlMultMatrixf(904); STACKTOP = sp;return; } function _MatrixToFloat($mat) { $mat = $mat|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$mat>>2]|0; HEAP32[904>>2] = $0; $1 = ((($mat)) + 4|0); $2 = HEAP32[$1>>2]|0; HEAP32[(908)>>2] = $2; $3 = ((($mat)) + 8|0); $4 = HEAP32[$3>>2]|0; HEAP32[(912)>>2] = $4; $5 = ((($mat)) + 12|0); $6 = HEAP32[$5>>2]|0; HEAP32[(916)>>2] = $6; $7 = ((($mat)) + 16|0); $8 = HEAP32[$7>>2]|0; HEAP32[(920)>>2] = $8; $9 = ((($mat)) + 20|0); $10 = HEAP32[$9>>2]|0; HEAP32[(924)>>2] = $10; $11 = ((($mat)) + 24|0); $12 = HEAP32[$11>>2]|0; HEAP32[(928)>>2] = $12; $13 = ((($mat)) + 28|0); $14 = HEAP32[$13>>2]|0; HEAP32[(932)>>2] = $14; $15 = ((($mat)) + 32|0); $16 = HEAP32[$15>>2]|0; HEAP32[(936)>>2] = $16; $17 = ((($mat)) + 36|0); $18 = HEAP32[$17>>2]|0; HEAP32[(940)>>2] = $18; $19 = ((($mat)) + 40|0); $20 = HEAP32[$19>>2]|0; HEAP32[(944)>>2] = $20; $21 = ((($mat)) + 44|0); $22 = HEAP32[$21>>2]|0; HEAP32[(948)>>2] = $22; $23 = ((($mat)) + 48|0); $24 = HEAP32[$23>>2]|0; HEAP32[(952)>>2] = $24; $25 = ((($mat)) + 52|0); $26 = HEAP32[$25>>2]|0; HEAP32[(956)>>2] = $26; $27 = ((($mat)) + 56|0); $28 = HEAP32[$27>>2]|0; HEAP32[(960)>>2] = $28; $29 = ((($mat)) + 60|0); $30 = HEAP32[$29>>2]|0; HEAP32[(964)>>2] = $30; return (904|0); } function _EndDrawing() { var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; _rlglDraw(); $0 = (_IsPosproShaderEnabled()|0); $1 = ($0|0)==(0); if (!($1)) { _rlglDrawPostpro(); } _SwapBuffers(); _PollInputEvents(); $2 = (+_GetTime()); HEAPF64[24>>3] = $2; $3 = +HEAPF64[32>>3]; $4 = $2 - $3; HEAPF64[48>>3] = $4; HEAPF64[32>>3] = $2; $5 = +HEAPF64[40>>3]; $6 = $5 + $4; HEAPF64[56>>3] = $6; $7 = +HEAPF64[16>>3]; $8 = $6 < $7; if (!($8)) { return; } while(1) { $9 = (+_GetTime()); HEAPF64[24>>3] = $9; $10 = +HEAPF64[32>>3]; $11 = $9 - $10; HEAPF64[32>>3] = $9; $12 = +HEAPF64[56>>3]; $13 = $12 + $11; HEAPF64[56>>3] = $13; $14 = +HEAPF64[16>>3]; $15 = $13 < $14; if (!($15)) { break; } } return; } function _Begin3dMode($camera) { $camera = $camera|0; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $matView = 0, $matView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 160|0; $matView$byval_copy = sp + 88|0; $$byval_copy1 = sp + 76|0; $$byval_copy = sp + 64|0; $matView = sp; _rlglDraw(); _rlMatrixMode(0); _rlPushMatrix(); _rlLoadIdentity(); $0 = HEAP32[816>>2]|0; $1 = (+($0|0)); $2 = HEAP32[820>>2]|0; $3 = (+($2|0)); $4 = $1 / $3; $5 = $4; $6 = $5 * 0.041421356237309505; $7 = -$6; _rlFrustum($7,$6,-0.041421356237309505,0.041421356237309505,0.10000000149011612,1000.0); _rlMatrixMode(1); _rlLoadIdentity(); $8 = ((($camera)) + 12|0); $9 = ((($camera)) + 24|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$camera>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$camera+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$camera+8>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$8>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$8+8>>2]|0; ;HEAP32[$matView$byval_copy>>2]=HEAP32[$9>>2]|0;HEAP32[$matView$byval_copy+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$matView$byval_copy+8>>2]=HEAP32[$9+8>>2]|0; _MatrixLookAt($matView,$$byval_copy,$$byval_copy1,$matView$byval_copy); dest=$matView$byval_copy; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); (_MatrixToFloat($matView$byval_copy)|0); _rlMultMatrixf(904); STACKTOP = sp;return; } function _End3dMode() { var label = 0, sp = 0; sp = STACKTOP; _rlglDraw(); _rlMatrixMode(0); _rlPopMatrix(); _rlMatrixMode(1); _rlLoadIdentity(); return; } function _Fade($agg$result,$color,$alpha) { $agg$result = $agg$result|0; $color = $color|0; $alpha = +$alpha; var $$0 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $alpha < 0.0; if ($0) { $$0 = 0.0; } else { $1 = $alpha > 1.0; if ($1) { $$0 = 1.0; } else { $$0 = $alpha; } } $2 = ((($color)) + 3|0); $3 = HEAP8[$2>>0]|0; $4 = (+($3&255)); $5 = $$0 * $4; $6 = HEAP8[$color>>0]|0; HEAP8[$agg$result>>0] = $6; $7 = ((($agg$result)) + 1|0); $8 = ((($color)) + 1|0); $9 = HEAP8[$8>>0]|0; HEAP8[$7>>0] = $9; $10 = ((($agg$result)) + 2|0); $11 = ((($color)) + 2|0); $12 = HEAP8[$11>>0]|0; HEAP8[$10>>0] = $12; $13 = ((($agg$result)) + 3|0); $14 = (~~(($5))&255); HEAP8[$13>>0] = $14; return; } function _IsKeyPressed($key) { $key = $key|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $pressed$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (10888 + ($key)|0); $1 = HEAP8[$0>>0]|0; $2 = (11400 + ($key)|0); $3 = HEAP8[$2>>0]|0; $4 = ($1<<24>>24)!=($3<<24>>24); $5 = ($1<<24>>24)==(1); $or$cond = $5 & $4; $pressed$0 = $or$cond&1; return ($pressed$0|0); } function _IsMouseButtonPressed($button) { $button = $button|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $pressed$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (11912 + ($button)|0); $1 = HEAP8[$0>>0]|0; $2 = (11915 + ($button)|0); $3 = HEAP8[$2>>0]|0; $4 = ($1<<24>>24)!=($3<<24>>24); $5 = ($1<<24>>24)==(1); $or$cond = $5 & $4; $pressed$0 = $or$cond&1; return ($pressed$0|0); } function _IsMouseButtonReleased($button) { $button = $button|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $released$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (11912 + ($button)|0); $1 = HEAP8[$0>>0]|0; $2 = (11915 + ($button)|0); $3 = HEAP8[$2>>0]|0; $4 = ($1<<24>>24)!=($3<<24>>24); $5 = ($1<<24>>24)==(0); $or$cond = $5 & $4; $released$0 = $or$cond&1; return ($released$0|0); } function _GetMousePosition($agg$result) { $agg$result = $agg$result|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = 8; $1 = $0; $2 = HEAP32[$1>>2]|0; $3 = (($0) + 4)|0; $4 = $3; $5 = HEAP32[$4>>2]|0; $6 = $agg$result; $7 = $6; HEAP32[$7>>2] = $2; $8 = (($6) + 4)|0; $9 = $8; HEAP32[$9>>2] = $5; return; } function _mystrdup($str) { $str = $str|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_strlen($str)|0); $1 = (($0) + 1)|0; $2 = (_malloc($1)|0); $3 = ($2|0)==(0|0); if ($3) { $$0 = 0; return ($$0|0); } _memcpy(($2|0),($str|0),($1|0))|0; $$0 = $2; return ($$0|0); } function _rlMatrixMode($mode) { $mode = $mode|0; var label = 0, sp = 0; sp = STACKTOP; switch ($mode|0) { case 0: { HEAP32[1068>>2] = 1004; break; } case 1: { HEAP32[1068>>2] = 1072; break; } default: { } } HEAP32[1136>>2] = $mode; return; } function _rlPushMatrix() { var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $0 = HEAP32[1140>>2]|0; $1 = ($0|0)==(15); if ($1) { HEAP32[$vararg_buffer>>2] = 16; _TraceLog(1,11918,$vararg_buffer); } $2 = HEAP32[1140>>2]|0; $3 = (1144 + ($2<<6)|0); $4 = HEAP32[1068>>2]|0; dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _rlLoadIdentity(); $5 = HEAP32[1140>>2]|0; $6 = (($5) + 1)|0; HEAP32[1140>>2] = $6; $7 = HEAP32[1136>>2]|0; $8 = ($7|0)==(1); if (!($8)) { STACKTOP = sp;return; } HEAP32[2168>>2] = 1; STACKTOP = sp;return; } function _rlLoadIdentity() { var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $0 = sp; $1 = HEAP32[1068>>2]|0; _MatrixIdentity($0); dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _rlPopMatrix() { var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[1140>>2]|0; $1 = ($0|0)>(0); if (!($1)) { return; } $2 = HEAP32[1140>>2]|0; $3 = (($2) + -1)|0; $4 = (1144 + ($3<<6)|0); $5 = HEAP32[1068>>2]|0; _memmove(($5|0),($4|0),64)|0; $6 = HEAP32[1140>>2]|0; $7 = (($6) + -1)|0; HEAP32[1140>>2] = $7; return; } function _rlTranslatef($x,$y,$z) { $x = +$x; $y = +$y; $z = +$z; var $$byval_copy = 0, $0 = 0, $1 = 0, $matTranslation = 0, $matTranslation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $matTranslation$byval_copy = sp + 192|0; $$byval_copy = sp + 128|0; $matTranslation = sp + 64|0; $0 = sp; _MatrixTranslate($matTranslation,$x,$y,$z); _MatrixTranspose($matTranslation); $1 = HEAP32[1068>>2]|0; dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matTranslation$byval_copy; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($0,$$byval_copy,$matTranslation$byval_copy); dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _rlRotatef($angleDeg,$x,$y,$z) { $angleDeg = +$angleDeg; $x = +$x; $y = +$y; $z = +$z; var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $axis = 0, $matRotation = 0, $matRotation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 336|0; $matRotation$byval_copy = sp + 272|0; $$byval_copy = sp + 208|0; $matRotation = sp + 144|0; $axis = sp + 128|0; $0 = sp + 64|0; $1 = sp; _MatrixIdentity($matRotation); HEAPF32[$axis>>2] = $x; $2 = ((($axis)) + 4|0); HEAPF32[$2>>2] = $y; $3 = ((($axis)) + 8|0); HEAPF32[$3>>2] = $z; _VectorNormalize($axis); $4 = $angleDeg; $5 = $4 * 0.017453292519943295; $6 = $5; ;HEAP32[$matRotation$byval_copy>>2]=HEAP32[$axis>>2]|0;HEAP32[$matRotation$byval_copy+4>>2]=HEAP32[$axis+4>>2]|0;HEAP32[$matRotation$byval_copy+8>>2]=HEAP32[$axis+8>>2]|0; _MatrixRotate($0,$matRotation$byval_copy,$6); dest=$matRotation; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixTranspose($matRotation); $7 = HEAP32[1068>>2]|0; dest=$$byval_copy; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matRotation$byval_copy; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($1,$$byval_copy,$matRotation$byval_copy); dest=$7; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _rlMultMatrixf($m) { $m = $m|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $mat = 0, $mat$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $mat$byval_copy = sp + 192|0; $$byval_copy = sp + 128|0; $mat = sp + 64|0; $0 = sp; $1 = HEAP32[$m>>2]|0; HEAP32[$mat>>2] = $1; $2 = ((($mat)) + 4|0); $3 = ((($m)) + 4|0); $4 = HEAP32[$3>>2]|0; HEAP32[$2>>2] = $4; $5 = ((($mat)) + 8|0); $6 = ((($m)) + 8|0); $7 = HEAP32[$6>>2]|0; HEAP32[$5>>2] = $7; $8 = ((($mat)) + 12|0); $9 = ((($m)) + 12|0); $10 = HEAP32[$9>>2]|0; HEAP32[$8>>2] = $10; $11 = ((($mat)) + 16|0); $12 = ((($m)) + 16|0); $13 = HEAP32[$12>>2]|0; HEAP32[$11>>2] = $13; $14 = ((($mat)) + 20|0); $15 = ((($m)) + 20|0); $16 = HEAP32[$15>>2]|0; HEAP32[$14>>2] = $16; $17 = ((($mat)) + 24|0); $18 = ((($m)) + 24|0); $19 = HEAP32[$18>>2]|0; HEAP32[$17>>2] = $19; $20 = ((($mat)) + 28|0); $21 = ((($m)) + 28|0); $22 = HEAP32[$21>>2]|0; HEAP32[$20>>2] = $22; $23 = ((($mat)) + 32|0); $24 = ((($m)) + 32|0); $25 = HEAP32[$24>>2]|0; HEAP32[$23>>2] = $25; $26 = ((($mat)) + 36|0); $27 = ((($m)) + 36|0); $28 = HEAP32[$27>>2]|0; HEAP32[$26>>2] = $28; $29 = ((($mat)) + 40|0); $30 = ((($m)) + 40|0); $31 = HEAP32[$30>>2]|0; HEAP32[$29>>2] = $31; $32 = ((($mat)) + 44|0); $33 = ((($m)) + 44|0); $34 = HEAP32[$33>>2]|0; HEAP32[$32>>2] = $34; $35 = ((($mat)) + 48|0); $36 = ((($m)) + 48|0); $37 = HEAP32[$36>>2]|0; HEAP32[$35>>2] = $37; $38 = ((($mat)) + 52|0); $39 = ((($m)) + 52|0); $40 = HEAP32[$39>>2]|0; HEAP32[$38>>2] = $40; $41 = ((($mat)) + 56|0); $42 = ((($m)) + 56|0); $43 = HEAP32[$42>>2]|0; HEAP32[$41>>2] = $43; $44 = ((($mat)) + 60|0); $45 = ((($m)) + 60|0); $46 = HEAP32[$45>>2]|0; HEAP32[$44>>2] = $46; $47 = HEAP32[1068>>2]|0; dest=$$byval_copy; src=$47; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$mat$byval_copy; src=$mat; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($0,$$byval_copy,$mat$byval_copy); dest=$47; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _rlFrustum($left,$right,$bottom,$top,$near,$far) { $left = +$left; $right = +$right; $bottom = +$bottom; $top = +$top; $near = +$near; $far = +$far; var $$byval_copy = 0, $0 = 0, $1 = 0, $matPerps = 0, $matPerps$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $matPerps$byval_copy = sp + 192|0; $$byval_copy = sp + 128|0; $matPerps = sp + 64|0; $0 = sp; _MatrixFrustum($matPerps,$left,$right,$bottom,$top,$near,$far); _MatrixTranspose($matPerps); $1 = HEAP32[1068>>2]|0; dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matPerps$byval_copy; src=$matPerps; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($0,$$byval_copy,$matPerps$byval_copy); dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _rlOrtho($left,$right,$bottom,$top,$near,$far) { $left = +$left; $right = +$right; $bottom = +$bottom; $top = +$top; $near = +$near; $far = +$far; var $$byval_copy = 0, $0 = 0, $1 = 0, $matOrtho = 0, $matOrtho$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $matOrtho$byval_copy = sp + 192|0; $$byval_copy = sp + 128|0; $matOrtho = sp + 64|0; $0 = sp; _MatrixOrtho($matOrtho,$left,$right,$bottom,$top,$near,$far); _MatrixTranspose($matOrtho); $1 = HEAP32[1068>>2]|0; dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matOrtho$byval_copy; src=$matOrtho; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($0,$$byval_copy,$matOrtho$byval_copy); dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _rlBegin($mode) { $mode = $mode|0; var label = 0, sp = 0; sp = STACKTOP; HEAP32[2172>>2] = $mode; return; } function _rlEnd() { var $$byval_copy = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0; var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0; var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0; var $150 = 0, $151 = 0.0, $152 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0; var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0; var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0; var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0; var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond16 = 0, $exitcond17 = 0, $exitcond18 = 0, $i$013 = 0; var $i1$011 = 0, $i2$04 = 0, $i4$05 = 0, $i6$09 = 0, $i7$07 = 0, $quads$1$promoted = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $$byval_copy = sp; $0 = HEAP32[2168>>2]|0; $1 = ($0|0)==(0); if (!($1)) { $2 = HEAP32[2176>>2]|0; $3 = ($2|0)>(0); if ($3) { $i$013 = 0; while(1) { $4 = HEAP32[2180>>2]|0; $5 = (($4) + (($i$013*12)|0)|0); $6 = HEAP32[1068>>2]|0; dest=$$byval_copy; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _VectorTransform($5,$$byval_copy); $7 = (($i$013) + 1)|0; $8 = HEAP32[2176>>2]|0; $9 = ($7|0)<($8|0); if ($9) { $i$013 = $7; } else { $$lcssa = $8; break; } } HEAP32[2168>>2] = 0; $10 = ($$lcssa|0)>(0); if ($10) { $i1$011 = 0; while(1) { $11 = HEAP32[2180>>2]|0; $12 = (($11) + (($i1$011*12)|0)|0); $13 = +HEAPF32[$12>>2]; $14 = (((($11) + (($i1$011*12)|0)|0)) + 4|0); $15 = +HEAPF32[$14>>2]; $16 = (((($11) + (($i1$011*12)|0)|0)) + 8|0); $17 = +HEAPF32[$16>>2]; _rlVertex3f($13,$15,$17); $18 = (($i1$011) + 1)|0; $19 = HEAP32[2176>>2]|0; $20 = ($18|0)<($19|0); if ($20) { $i1$011 = $18; } else { break; } } } } else { HEAP32[2168>>2] = 0; } HEAP32[2176>>2] = 0; } $21 = HEAP32[2172>>2]|0; switch ($21|0) { case 0: { $22 = HEAP32[2184>>2]|0; $23 = HEAP32[2188>>2]|0; $24 = ($22|0)>($23|0); if (!($24)) { $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; } $25 = (($22) - ($23))|0; $i2$04 = 0; while(1) { $26 = HEAP32[2188>>2]|0; $27 = $26 << 2; $28 = (($27) + -4)|0; $29 = HEAP32[2192>>2]|0; $30 = (($29) + ($28)|0); $31 = HEAP8[$30>>0]|0; $32 = (($29) + ($27)|0); HEAP8[$32>>0] = $31; $33 = HEAP32[2188>>2]|0; $34 = $33 << 2; $35 = (($34) + -3)|0; $36 = HEAP32[2192>>2]|0; $37 = (($36) + ($35)|0); $38 = HEAP8[$37>>0]|0; $39 = $34 | 1; $40 = (($36) + ($39)|0); HEAP8[$40>>0] = $38; $41 = HEAP32[2188>>2]|0; $42 = $41 << 2; $43 = (($42) + -2)|0; $44 = HEAP32[2192>>2]|0; $45 = (($44) + ($43)|0); $46 = HEAP8[$45>>0]|0; $47 = $42 | 2; $48 = (($44) + ($47)|0); HEAP8[$48>>0] = $46; $49 = HEAP32[2188>>2]|0; $50 = $49 << 2; $51 = (($50) + -1)|0; $52 = HEAP32[2192>>2]|0; $53 = (($52) + ($51)|0); $54 = HEAP8[$53>>0]|0; $55 = $50 | 3; $56 = (($52) + ($55)|0); HEAP8[$56>>0] = $54; $57 = HEAP32[2188>>2]|0; $58 = (($57) + 1)|0; HEAP32[2188>>2] = $58; $59 = (($i2$04) + 1)|0; $exitcond = ($59|0)==($25|0); if ($exitcond) { break; } else { $i2$04 = $59; } } $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; break; } case 1: { $60 = HEAP32[2196>>2]|0; $61 = HEAP32[2200>>2]|0; $62 = ($60|0)>($61|0); if (!($62)) { $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; } $63 = (($60) - ($61))|0; $i4$05 = 0; while(1) { $64 = HEAP32[2200>>2]|0; $65 = $64 << 2; $66 = (($65) + -4)|0; $67 = HEAP32[2204>>2]|0; $68 = (($67) + ($66)|0); $69 = HEAP8[$68>>0]|0; $70 = (($67) + ($65)|0); HEAP8[$70>>0] = $69; $71 = HEAP32[2200>>2]|0; $72 = $71 << 2; $73 = (($72) + -3)|0; $74 = HEAP32[2204>>2]|0; $75 = (($74) + ($73)|0); $76 = HEAP8[$75>>0]|0; $77 = $72 | 1; $78 = (($74) + ($77)|0); HEAP8[$78>>0] = $76; $79 = HEAP32[2200>>2]|0; $80 = $79 << 2; $81 = (($80) + -2)|0; $82 = HEAP32[2204>>2]|0; $83 = (($82) + ($81)|0); $84 = HEAP8[$83>>0]|0; $85 = $80 | 2; $86 = (($82) + ($85)|0); HEAP8[$86>>0] = $84; $87 = HEAP32[2200>>2]|0; $88 = $87 << 2; $89 = (($88) + -1)|0; $90 = HEAP32[2204>>2]|0; $91 = (($90) + ($89)|0); $92 = HEAP8[$91>>0]|0; $93 = $88 | 3; $94 = (($90) + ($93)|0); HEAP8[$94>>0] = $92; $95 = HEAP32[2200>>2]|0; $96 = (($95) + 1)|0; HEAP32[2200>>2] = $96; $97 = (($i4$05) + 1)|0; $exitcond16 = ($97|0)==($63|0); if ($exitcond16) { break; } else { $i4$05 = $97; } } $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; break; } case 2: { $98 = HEAP32[2208>>2]|0; $99 = HEAP32[2212>>2]|0; $100 = ($98|0)>($99|0); if ($100) { $101 = (($98) - ($99))|0; $i6$09 = 0; while(1) { $102 = HEAP32[2212>>2]|0; $103 = $102 << 2; $104 = (($103) + -4)|0; $105 = HEAP32[2216>>2]|0; $106 = (($105) + ($104)|0); $107 = HEAP8[$106>>0]|0; $108 = (($105) + ($103)|0); HEAP8[$108>>0] = $107; $109 = HEAP32[2212>>2]|0; $110 = $109 << 2; $111 = (($110) + -3)|0; $112 = HEAP32[2216>>2]|0; $113 = (($112) + ($111)|0); $114 = HEAP8[$113>>0]|0; $115 = $110 | 1; $116 = (($112) + ($115)|0); HEAP8[$116>>0] = $114; $117 = HEAP32[2212>>2]|0; $118 = $117 << 2; $119 = (($118) + -2)|0; $120 = HEAP32[2216>>2]|0; $121 = (($120) + ($119)|0); $122 = HEAP8[$121>>0]|0; $123 = $118 | 2; $124 = (($120) + ($123)|0); HEAP8[$124>>0] = $122; $125 = HEAP32[2212>>2]|0; $126 = $125 << 2; $127 = (($126) + -1)|0; $128 = HEAP32[2216>>2]|0; $129 = (($128) + ($127)|0); $130 = HEAP8[$129>>0]|0; $131 = $126 | 3; $132 = (($128) + ($131)|0); HEAP8[$132>>0] = $130; $133 = HEAP32[2212>>2]|0; $134 = (($133) + 1)|0; HEAP32[2212>>2] = $134; $135 = (($i6$09) + 1)|0; $exitcond18 = ($135|0)==($101|0); if ($exitcond18) { break; } else { $i6$09 = $135; } } } $136 = HEAP32[2208>>2]|0; $137 = HEAP32[2220>>2]|0; $138 = ($136|0)>($137|0); if (!($138)) { $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; } $139 = HEAP32[2224>>2]|0; $quads$1$promoted = HEAP32[2220>>2]|0; $140 = (($136) + ($quads$1$promoted))|0; $141 = (($136) - ($137))|0; $143 = $quads$1$promoted;$i7$07 = 0; while(1) { $142 = $143 << 1; $144 = (($139) + ($142<<2)|0); HEAPF32[$144>>2] = 0.0; $145 = $143 << 1; $146 = $145 | 1; $147 = (($139) + ($146<<2)|0); HEAPF32[$147>>2] = 0.0; $148 = (($143) + 1)|0; $149 = (($i7$07) + 1)|0; $exitcond17 = ($149|0)==($141|0); if ($exitcond17) { break; } else { $143 = $148;$i7$07 = $149; } } $150 = (($140) - ($137))|0; HEAP32[2220>>2] = $150; $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; break; } default: { $151 = +HEAPF32[2228>>2]; $152 = $151 + 4.9999998736893758E-5; HEAPF32[2228>>2] = $152; STACKTOP = sp;return; } } } function _rlVertex3f($x,$y,$z) { $x = +$x; $y = +$y; $z = +$z; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $0 = HEAP32[2168>>2]|0; $1 = ($0|0)==(0); if (!($1)) { $2 = HEAP32[2176>>2]|0; $3 = HEAP32[2180>>2]|0; $4 = (($3) + (($2*12)|0)|0); HEAPF32[$4>>2] = $x; $5 = HEAP32[2176>>2]|0; $6 = HEAP32[2180>>2]|0; $7 = (((($6) + (($5*12)|0)|0)) + 4|0); HEAPF32[$7>>2] = $y; $8 = HEAP32[2176>>2]|0; $9 = HEAP32[2180>>2]|0; $10 = (((($9) + (($8*12)|0)|0)) + 8|0); HEAPF32[$10>>2] = $z; $11 = HEAP32[2176>>2]|0; $12 = (($11) + 1)|0; HEAP32[2176>>2] = $12; STACKTOP = sp;return; } $13 = HEAP32[2172>>2]|0; switch ($13|0) { case 0: { $14 = HEAP32[2184>>2]|0; $15 = ($14|0)<(2048); if ($15) { $16 = ($14*3)|0; $17 = HEAP32[2232>>2]|0; $18 = (($17) + ($16<<2)|0); HEAPF32[$18>>2] = $x; $19 = HEAP32[2184>>2]|0; $20 = ($19*3)|0; $21 = (($20) + 1)|0; $22 = HEAP32[2232>>2]|0; $23 = (($22) + ($21<<2)|0); HEAPF32[$23>>2] = $y; $24 = HEAP32[2184>>2]|0; $25 = ($24*3)|0; $26 = (($25) + 2)|0; $27 = HEAP32[2232>>2]|0; $28 = (($27) + ($26<<2)|0); HEAPF32[$28>>2] = $z; $29 = HEAP32[2184>>2]|0; $30 = (($29) + 1)|0; HEAP32[2184>>2] = $30; STACKTOP = sp;return; } else { _TraceLog(1,11956,$vararg_buffer); STACKTOP = sp;return; } break; } case 1: { $31 = HEAP32[2196>>2]|0; $32 = ($31|0)<(6144); if ($32) { $33 = ($31*3)|0; $34 = HEAP32[2236>>2]|0; $35 = (($34) + ($33<<2)|0); HEAPF32[$35>>2] = $x; $36 = HEAP32[2196>>2]|0; $37 = ($36*3)|0; $38 = (($37) + 1)|0; $39 = HEAP32[2236>>2]|0; $40 = (($39) + ($38<<2)|0); HEAPF32[$40>>2] = $y; $41 = HEAP32[2196>>2]|0; $42 = ($41*3)|0; $43 = (($42) + 2)|0; $44 = HEAP32[2236>>2]|0; $45 = (($44) + ($43<<2)|0); HEAPF32[$45>>2] = $z; $46 = HEAP32[2196>>2]|0; $47 = (($46) + 1)|0; HEAP32[2196>>2] = $47; STACKTOP = sp;return; } else { _TraceLog(1,11981,$vararg_buffer1); STACKTOP = sp;return; } break; } case 2: { $48 = HEAP32[2208>>2]|0; $49 = ($48|0)<(4096); if ($49) { $50 = ($48*3)|0; $51 = HEAP32[2240>>2]|0; $52 = (($51) + ($50<<2)|0); HEAPF32[$52>>2] = $x; $53 = HEAP32[2208>>2]|0; $54 = ($53*3)|0; $55 = (($54) + 1)|0; $56 = HEAP32[2240>>2]|0; $57 = (($56) + ($55<<2)|0); HEAPF32[$57>>2] = $y; $58 = HEAP32[2208>>2]|0; $59 = ($58*3)|0; $60 = (($59) + 2)|0; $61 = HEAP32[2240>>2]|0; $62 = (($61) + ($60<<2)|0); HEAPF32[$62>>2] = $z; $63 = HEAP32[2208>>2]|0; $64 = (($63) + 1)|0; HEAP32[2208>>2] = $64; $65 = HEAP32[2244>>2]|0; $66 = (($65) + -1)|0; $67 = HEAP32[2248>>2]|0; $68 = (((($67) + ($66<<3)|0)) + 4|0); $69 = HEAP32[$68>>2]|0; $70 = (($69) + 1)|0; HEAP32[$68>>2] = $70; STACKTOP = sp;return; } else { _TraceLog(1,12010,$vararg_buffer3); STACKTOP = sp;return; } break; } default: { STACKTOP = sp;return; } } } function _rlVertex2f($x,$y) { $x = +$x; $y = +$y; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[2228>>2]; _rlVertex3f($x,$y,$0); return; } function _rlVertex2i($x,$y) { $x = $x|0; $y = $y|0; var $0 = 0.0, $1 = 0.0, $2 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+($x|0)); $1 = (+($y|0)); $2 = +HEAPF32[2228>>2]; _rlVertex3f($0,$1,$2); return; } function _rlTexCoord2f($x,$y) { $x = +$x; $y = +$y; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[2172>>2]|0; $1 = ($0|0)==(2); if (!($1)) { return; } $2 = HEAP32[2220>>2]|0; $3 = $2 << 1; $4 = HEAP32[2224>>2]|0; $5 = (($4) + ($3<<2)|0); HEAPF32[$5>>2] = $x; $6 = HEAP32[2220>>2]|0; $7 = $6 << 1; $8 = $7 | 1; $9 = HEAP32[2224>>2]|0; $10 = (($9) + ($8<<2)|0); HEAPF32[$10>>2] = $y; $11 = HEAP32[2220>>2]|0; $12 = (($11) + 1)|0; HEAP32[2220>>2] = $12; return; } function _rlNormal3f($x,$y,$z) { $x = +$x; $y = +$y; $z = +$z; var label = 0, sp = 0; sp = STACKTOP; return; } function _rlColor4ub($x,$y,$z,$w) { $x = $x|0; $y = $y|0; $z = $z|0; $w = $w|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[2172>>2]|0; switch ($0|0) { case 0: { $1 = HEAP32[2188>>2]|0; $2 = $1 << 2; $3 = HEAP32[2192>>2]|0; $4 = (($3) + ($2)|0); HEAP8[$4>>0] = $x; $5 = HEAP32[2188>>2]|0; $6 = $5 << 2; $7 = $6 | 1; $8 = HEAP32[2192>>2]|0; $9 = (($8) + ($7)|0); HEAP8[$9>>0] = $y; $10 = HEAP32[2188>>2]|0; $11 = $10 << 2; $12 = $11 | 2; $13 = HEAP32[2192>>2]|0; $14 = (($13) + ($12)|0); HEAP8[$14>>0] = $z; $15 = HEAP32[2188>>2]|0; $16 = $15 << 2; $17 = $16 | 3; $18 = HEAP32[2192>>2]|0; $19 = (($18) + ($17)|0); HEAP8[$19>>0] = $w; $20 = HEAP32[2188>>2]|0; $21 = (($20) + 1)|0; HEAP32[2188>>2] = $21; return; break; } case 1: { $22 = HEAP32[2200>>2]|0; $23 = $22 << 2; $24 = HEAP32[2204>>2]|0; $25 = (($24) + ($23)|0); HEAP8[$25>>0] = $x; $26 = HEAP32[2200>>2]|0; $27 = $26 << 2; $28 = $27 | 1; $29 = HEAP32[2204>>2]|0; $30 = (($29) + ($28)|0); HEAP8[$30>>0] = $y; $31 = HEAP32[2200>>2]|0; $32 = $31 << 2; $33 = $32 | 2; $34 = HEAP32[2204>>2]|0; $35 = (($34) + ($33)|0); HEAP8[$35>>0] = $z; $36 = HEAP32[2200>>2]|0; $37 = $36 << 2; $38 = $37 | 3; $39 = HEAP32[2204>>2]|0; $40 = (($39) + ($38)|0); HEAP8[$40>>0] = $w; $41 = HEAP32[2200>>2]|0; $42 = (($41) + 1)|0; HEAP32[2200>>2] = $42; return; break; } case 2: { $43 = HEAP32[2212>>2]|0; $44 = $43 << 2; $45 = HEAP32[2216>>2]|0; $46 = (($45) + ($44)|0); HEAP8[$46>>0] = $x; $47 = HEAP32[2212>>2]|0; $48 = $47 << 2; $49 = $48 | 1; $50 = HEAP32[2216>>2]|0; $51 = (($50) + ($49)|0); HEAP8[$51>>0] = $y; $52 = HEAP32[2212>>2]|0; $53 = $52 << 2; $54 = $53 | 2; $55 = HEAP32[2216>>2]|0; $56 = (($55) + ($54)|0); HEAP8[$56>>0] = $z; $57 = HEAP32[2212>>2]|0; $58 = $57 << 2; $59 = $58 | 3; $60 = HEAP32[2216>>2]|0; $61 = (($60) + ($59)|0); HEAP8[$61>>0] = $w; $62 = HEAP32[2212>>2]|0; $63 = (($62) + 1)|0; HEAP32[2212>>2] = $63; return; break; } default: { return; } } } function _rlEnableTexture($id) { $id = $id|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[2244>>2]|0; $1 = (($0) + -1)|0; $2 = HEAP32[2248>>2]|0; $3 = (($2) + ($1<<3)|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==($id|0); if ($5) { return; } $6 = (((($2) + ($1<<3)|0)) + 4|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)>(0); if ($8) { $9 = (($0) + 1)|0; HEAP32[2244>>2] = $9; } $10 = HEAP32[2244>>2]|0; $11 = (($10) + -1)|0; $12 = HEAP32[2248>>2]|0; $13 = (($12) + ($11<<3)|0); HEAP32[$13>>2] = $id; $14 = HEAP32[2244>>2]|0; $15 = (($14) + -1)|0; $16 = HEAP32[2248>>2]|0; $17 = (((($16) + ($15<<3)|0)) + 4|0); HEAP32[$17>>2] = 0; return; } function _rlDisableTexture() { var label = 0, sp = 0; sp = STACKTOP; return; } function _rlDeleteTextures($id) { $id = $id|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $0 = sp; HEAP32[$0>>2] = $id; _glDeleteTextures(1,($0|0)); STACKTOP = sp;return; } function _rlEnablePostproFBO() { var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[2252>>2]|0; _glBindFramebuffer(36160,($0|0)); return; } function _rlDeleteVertexArrays($id) { $id = $id|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $0 = sp; HEAP32[$0>>2] = $id; $1 = HEAP32[2264>>2]|0; $2 = ($1|0)==(0); if ($2) { STACKTOP = sp;return; } $3 = HEAP32[2268>>2]|0; FUNCTION_TABLE_vii[$3 & 63](1,$0); STACKTOP = sp;return; } function _rlDeleteBuffers($id) { $id = $id|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $0 = sp; HEAP32[$0>>2] = $id; _glDeleteBuffers(1,($0|0)); STACKTOP = sp;return; } function _rlClearColor($r,$g,$b,$a) { $r = $r|0; $g = $g|0; $b = $b|0; $a = $a|0; var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+($r&255)); $1 = $0 / 255.0; $2 = (+($g&255)); $3 = $2 / 255.0; $4 = (+($b&255)); $5 = $4 / 255.0; $6 = (+($a&255)); $7 = $6 / 255.0; _glClearColor((+$1),(+$3),(+$5),(+$7)); return; } function _rlClearScreenBuffers() { var label = 0, sp = 0; sp = STACKTOP; _glClear(16640); return; } function _rlGetVersion() { var label = 0, sp = 0; sp = STACKTOP; return 3; } function _rlglInit() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond10 = 0, $exitcond12 = 0, $i$04 = 0, $i2$02 = 0, $i3$01 = 0, $numExt$0$lcssa = 0; var $numExt$05 = 0, $pixels = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0, $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, dest = 0, label = 0; var sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 2480|0; $vararg_buffer34 = sp + 2160|0; $vararg_buffer31 = sp + 2152|0; $vararg_buffer29 = sp + 2144|0; $vararg_buffer27 = sp + 2136|0; $vararg_buffer25 = sp + 2128|0; $vararg_buffer23 = sp + 2120|0; $vararg_buffer21 = sp + 2112|0; $vararg_buffer19 = sp + 2104|0; $vararg_buffer17 = sp + 2096|0; $vararg_buffer15 = sp + 2088|0; $vararg_buffer13 = sp + 2080|0; $vararg_buffer10 = sp + 2072|0; $vararg_buffer7 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $0 = sp + 2416|0; $1 = sp + 2352|0; $2 = sp + 2288|0; $pixels = sp + 2280|0; $3 = sp + 2228|0; $4 = sp + 2176|0; $5 = sp + 2164|0; $6 = (_glGetString(7936)|0); HEAP32[$vararg_buffer>>2] = $6; _TraceLog(0,12035,$vararg_buffer); $7 = (_glGetString(7937)|0); HEAP32[$vararg_buffer1>>2] = $7; _TraceLog(0,12053,$vararg_buffer1); $8 = (_glGetString(7938)|0); HEAP32[$vararg_buffer4>>2] = $8; _TraceLog(0,12071,$vararg_buffer4); $9 = (_glGetString(35724)|0); HEAP32[$vararg_buffer7>>2] = $9; _TraceLog(0,12089,$vararg_buffer7); $10 = (_glGetString(7939)|0); $11 = (_mystrdup($10)|0); $12 = (_strtok($11,12107)|0); HEAP32[$vararg_buffer7>>2] = $12; $13 = ($12|0)==(0|0); if ($13) { $numExt$0$lcssa = -1; } else { $numExt$05 = 0; while(1) { $14 = (($numExt$05) + 1)|0; $15 = (_strtok(0,12107)|0); $16 = (($vararg_buffer7) + ($14<<2)|0); HEAP32[$16>>2] = $15; $17 = ($15|0)==(0|0); if ($17) { $numExt$0$lcssa = $numExt$05; break; } else { $numExt$05 = $14; } } } _free($11); HEAP32[$vararg_buffer10>>2] = $numExt$0$lcssa; _TraceLog(0,12109,$vararg_buffer10); $18 = ($numExt$0$lcssa|0)>(0); if ($18) { $i$04 = 0; while(1) { $19 = (($vararg_buffer7) + ($i$04<<2)|0); $20 = HEAP32[$19>>2]|0; $21 = (_strcmp($20,12144)|0); $22 = ($21|0)==(0); if ($22) { HEAP32[2264>>2] = 1; $23 = (_eglGetProcAddress((12171|0))|0); HEAP32[2272>>2] = $23; $24 = (_eglGetProcAddress((12192|0))|0); HEAP32[2276>>2] = $24; $25 = (_eglGetProcAddress((12213|0))|0); HEAP32[2268>>2] = $25; } $26 = HEAP32[$19>>2]|0; $27 = (_strcmp($26,12237)|0); $28 = ($27|0)==(0); if ($28) { HEAP32[2280>>2] = 1; } $29 = HEAP32[$19>>2]|0; $30 = (_strcmp($29,12257)|0); $31 = ($30|0)==(0); if ($31) { label = 10; } else { $32 = (_strcmp($29,12289)|0); $33 = ($32|0)==(0); if ($33) { label = 10; } } if ((label|0) == 10) { label = 0; HEAP32[2284>>2] = 1; } $34 = HEAP32[$19>>2]|0; $35 = (_strcmp($34,12329)|0); $36 = ($35|0)==(0); if ($36) { HEAP32[2288>>2] = 1; } $37 = HEAP32[$19>>2]|0; $38 = (_strcmp($37,12365)|0); $39 = ($38|0)==(0); if ($39) { HEAP32[2292>>2] = 1; } $40 = HEAP32[$19>>2]|0; $41 = (_strcmp($40,12390)|0); $42 = ($41|0)==(0); if ($42) { HEAP32[2296>>2] = 1; } $43 = HEAP32[$19>>2]|0; $44 = (_strcmp($43,12423)|0); $45 = ($44|0)==(0); if ($45) { HEAP32[2300>>2] = 1; } $46 = (($i$04) + 1)|0; $exitcond12 = ($46|0)==($numExt$0$lcssa|0); if ($exitcond12) { break; } else { $i$04 = $46; } } } $47 = HEAP32[2264>>2]|0; $48 = ($47|0)==(0); if ($48) { _TraceLog(2,12534,$vararg_buffer15); } else { _TraceLog(0,12459,$vararg_buffer13); } $49 = HEAP32[2280>>2]|0; $50 = ($49|0)==(0); if ($50) { _TraceLog(2,12670,$vararg_buffer19); } else { _TraceLog(0,12595,$vararg_buffer17); } $51 = HEAP32[2284>>2]|0; $52 = ($51|0)==(0); if (!($52)) { _TraceLog(0,12762,$vararg_buffer21); } $53 = HEAP32[2288>>2]|0; $54 = ($53|0)==(0); if (!($54)) { _TraceLog(0,12808,$vararg_buffer23); } $55 = HEAP32[2292>>2]|0; $56 = ($55|0)==(0); if (!($56)) { _TraceLog(0,12855,$vararg_buffer25); } $57 = HEAP32[2296>>2]|0; $58 = ($57|0)==(0); if (!($58)) { _TraceLog(0,12906,$vararg_buffer27); } $59 = HEAP32[2300>>2]|0; $60 = ($59|0)==(0); if (!($60)) { _TraceLog(0,12953,$vararg_buffer29); } HEAP32[2172>>2] = 1; _MatrixIdentity($0); dest=1004; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($1); dest=1072; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); HEAP32[1068>>2] = 1072; _MatrixIdentity($2); dest=1144; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1208); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1272); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1336); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1400); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1464); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1528); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1592); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1656); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1720); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1784); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1848); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1912); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(1976); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(2040); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixIdentity($2); dest=(2104); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); HEAP32[$pixels>>2] = -1; $61 = (_rlglLoadTexture($pixels,1,1,7,1)|0); HEAP32[808>>2] = $61; $62 = ($61|0)==(0); if ($62) { _TraceLog(2,13051,$vararg_buffer34); } else { HEAP32[$vararg_buffer31>>2] = $61; _TraceLog(0,13000,$vararg_buffer31); } _LoadDefaultShader($3); dest=2304; src=$3; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _LoadSimpleShader($4); dest=2356; src=$4; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=2408; src=2304; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _InitializeBuffers(); _InitializeBuffersGPU(); $63 = (_malloc(49152)|0); HEAP32[2180>>2] = $63; $i2$02 = 0; while(1) { $64 = HEAP32[2180>>2]|0; $65 = (($64) + (($i2$02*12)|0)|0); _VectorZero($5); ;HEAP32[$65>>2]=HEAP32[$5>>2]|0;HEAP32[$65+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$65+8>>2]=HEAP32[$5+8>>2]|0; $66 = (($i2$02) + 1)|0; $exitcond10 = ($66|0)==(4096); if ($exitcond10) { break; } else { $i2$02 = $66; } } $67 = (_malloc(2048)|0); HEAP32[2248>>2] = $67; $i3$01 = 0; while(1) { $68 = (($67) + ($i3$01<<3)|0); HEAP32[$68>>2] = 0; $69 = (((($67) + ($i3$01<<3)|0)) + 4|0); HEAP32[$69>>2] = 0; $70 = (($i3$01) + 1)|0; $exitcond = ($70|0)==(256); if ($exitcond) { break; } else { $i3$01 = $70; } } HEAP32[2244>>2] = 1; $71 = HEAP32[808>>2]|0; $72 = HEAP32[2248>>2]|0; HEAP32[$72>>2] = $71; STACKTOP = sp;return; } function _rlglLoadTexture($data,$width,$height,$textureFormat,$mipmapCount) { $data = $data|0; $width = $width|0; $height = $height|0; $textureFormat = $textureFormat|0; $mipmapCount = $mipmapCount|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $id = 0, $or$cond = 0, $or$cond20 = 0, $or$cond22 = 0, $or$cond24 = 0, $or$cond9 = 0, $switch = 0, $textureFormat$off = 0, $textureFormat$off16 = 0, $textureFormat$off17 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0; var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; $vararg_buffer15 = sp + 64|0; $vararg_buffer11 = sp + 48|0; $vararg_buffer9 = sp + 40|0; $vararg_buffer7 = sp + 32|0; $vararg_buffer5 = sp + 24|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $id = sp + 68|0; _glBindTexture(3553,0); HEAP32[$id>>2] = 0; $0 = HEAP32[2284>>2]|0; $1 = ($0|0)==(0); $2 = $textureFormat & -4; $switch = ($2|0)==(8); $or$cond24 = $switch & $1; if ($or$cond24) { _TraceLog(2,13090,$vararg_buffer); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } $3 = HEAP32[2288>>2]|0; $4 = ($3|0)==(0); $5 = ($textureFormat|0)==(12); $or$cond9 = $5 & $4; if ($or$cond9) { _TraceLog(2,13134,$vararg_buffer1); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } $6 = HEAP32[2292>>2]|0; $7 = ($6|0)==(0); $textureFormat$off = (($textureFormat) + -13)|0; $8 = ($textureFormat$off>>>0)<(2); $or$cond = $8 & $7; if ($or$cond) { _TraceLog(2,13179,$vararg_buffer3); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } $9 = HEAP32[2296>>2]|0; $10 = ($9|0)==(0); $textureFormat$off16 = (($textureFormat) + -15)|0; $11 = ($textureFormat$off16>>>0)<(2); $or$cond20 = $11 & $10; if ($or$cond20) { _TraceLog(2,13224,$vararg_buffer5); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } $12 = HEAP32[2300>>2]|0; $13 = ($12|0)==(0); $textureFormat$off17 = (($textureFormat) + -17)|0; $14 = ($textureFormat$off17>>>0)<(2); $or$cond22 = $14 & $13; if ($or$cond22) { _TraceLog(2,13269,$vararg_buffer7); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } _glGenTextures(1,($id|0)); $15 = HEAP32[$id>>2]|0; _glBindTexture(3553,($15|0)); do { switch ($textureFormat|0) { case 1: { _glTexImage2D(3553,0,6409,($width|0),($height|0),0,6409,5121,($data|0)); break; } case 2: { _glTexImage2D(3553,0,6410,($width|0),($height|0),0,6410,5121,($data|0)); break; } case 3: { _glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,33635,($data|0)); break; } case 4: { _glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,5121,($data|0)); break; } case 5: { _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32820,($data|0)); break; } case 6: { _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32819,($data|0)); break; } case 7: { _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,5121,($data|0)); break; } case 8: { $16 = HEAP32[2284>>2]|0; $17 = ($16|0)==(0); if (!($17)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,33776); } break; } case 9: { $18 = HEAP32[2284>>2]|0; $19 = ($18|0)==(0); if (!($19)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,33777); } break; } case 10: { $20 = HEAP32[2284>>2]|0; $21 = ($20|0)==(0); if (!($21)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,33778); } break; } case 11: { $22 = HEAP32[2284>>2]|0; $23 = ($22|0)==(0); if (!($23)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,33779); } break; } case 12: { $24 = HEAP32[2288>>2]|0; $25 = ($24|0)==(0); if (!($25)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,36196); } break; } case 13: { $26 = HEAP32[2292>>2]|0; $27 = ($26|0)==(0); if (!($27)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,37492); } break; } case 14: { $28 = HEAP32[2292>>2]|0; $29 = ($28|0)==(0); if (!($29)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,37496); } break; } case 15: { $30 = HEAP32[2296>>2]|0; $31 = ($30|0)==(0); if (!($31)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,35840); } break; } case 16: { $32 = HEAP32[2296>>2]|0; $33 = ($32|0)==(0); if (!($33)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,35842); } break; } case 17: { $34 = HEAP32[2300>>2]|0; $35 = ($34|0)==(0); if (!($35)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,37808); } break; } case 18: { $36 = HEAP32[2300>>2]|0; $37 = ($36|0)==(0); if (!($37)) { _LoadCompressedTexture($data,$width,$height,$mipmapCount,37815); } break; } default: { _TraceLog(2,13314,$vararg_buffer9); } } } while(0); $38 = HEAP32[2280>>2]|0; $39 = ($38|0)==(0); if ($39) { _glTexParameteri(3553,10242,33071); _glTexParameteri(3553,10243,33071); } else { _glTexParameteri(3553,10242,10497); _glTexParameteri(3553,10243,10497); } _glTexParameteri(3553,10240,9728); _glTexParameteri(3553,10241,9728); _glBindTexture(3553,0); $40 = HEAP32[$id>>2]|0; $41 = ($40|0)==(0); if ($41) { _TraceLog(2,14761,$vararg_buffer15); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } else { HEAP32[$vararg_buffer11>>2] = $40; $vararg_ptr13 = ((($vararg_buffer11)) + 4|0); HEAP32[$vararg_ptr13>>2] = $width; $vararg_ptr14 = ((($vararg_buffer11)) + 8|0); HEAP32[$vararg_ptr14>>2] = $height; _TraceLog(0,13343,$vararg_buffer11); $$0 = HEAP32[$id>>2]|0; STACKTOP = sp;return ($$0|0); } return (0)|0; } function _rlglLoadModel($agg$result,$mesh) { $agg$result = $agg$result|0; $mesh = $mesh|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $model$sroa$0 = 0, $model$sroa$15 = 0, $model$sroa$20 = 0, $model$sroa$27 = 0, $model$sroa$4$0 = 0, $vaoModel = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, $vararg_ptr6 = 0; var $vararg_ptr7 = 0, $vertexBuffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 288|0; $vararg_buffer3 = sp + 112|0; $vararg_buffer1 = sp + 104|0; $vararg_buffer = sp + 96|0; $model$sroa$0 = sp + 40|0; $model$sroa$15 = sp + 208|0; $model$sroa$20 = sp + 24|0; $model$sroa$27 = sp; $0 = sp + 144|0; $vaoModel = sp + 136|0; $vertexBuffer = sp + 124|0; dest=$model$sroa$0; src=$mesh; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $1 = ((($mesh)) + 68|0); ;HEAP32[$model$sroa$15>>2]=HEAP32[$1>>2]|0;HEAP32[$model$sroa$15+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$model$sroa$15+8>>2]=HEAP32[$1+8>>2]|0; _MatrixIdentity($0); $2 = ((($model$sroa$15)) + 12|0); dest=$2; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $3 = HEAP32[808>>2]|0; ;HEAP32[$model$sroa$20>>2]=HEAP32[2356>>2]|0;HEAP32[$model$sroa$20+4>>2]=HEAP32[2356+4>>2]|0;HEAP32[$model$sroa$20+8>>2]=HEAP32[2356+8>>2]|0;HEAP32[$model$sroa$20+12>>2]=HEAP32[2356+12>>2]|0; $4 = HEAP32[(2372)>>2]|0; $5 = HEAP32[(2376)>>2]|0; $6 = HEAP32[(2380)>>2]|0; ;HEAP32[$model$sroa$27>>2]=HEAP32[(2384)>>2]|0;HEAP32[$model$sroa$27+4>>2]=HEAP32[(2384)+4>>2]|0;HEAP32[$model$sroa$27+8>>2]=HEAP32[(2384)+8>>2]|0;HEAP32[$model$sroa$27+12>>2]=HEAP32[(2384)+12>>2]|0;HEAP32[$model$sroa$27+16>>2]=HEAP32[(2384)+16>>2]|0;HEAP32[$model$sroa$27+20>>2]=HEAP32[(2384)+20>>2]|0; HEAP32[$vaoModel>>2] = 0; $7 = HEAP32[2264>>2]|0; $8 = ($7|0)==(0); if (!($8)) { $9 = HEAP32[2272>>2]|0; FUNCTION_TABLE_vii[$9 & 63](1,$vaoModel); $10 = HEAP32[2276>>2]|0; $11 = HEAP32[$vaoModel>>2]|0; FUNCTION_TABLE_vi[$10 & 31]($11); } _glGenBuffers(3,($vertexBuffer|0)); $12 = HEAP32[$vertexBuffer>>2]|0; _glBindBuffer(34962,($12|0)); $13 = HEAP32[$mesh>>2]|0; $14 = ($13*12)|0; $15 = ((($mesh)) + 4|0); $16 = HEAP32[$15>>2]|0; _glBufferData(34962,($14|0),($16|0),35044); _glVertexAttribPointer(($4|0),3,5126,0,0,(0|0)); _glEnableVertexAttribArray(($4|0)); $17 = ((($vertexBuffer)) + 4|0); $18 = HEAP32[$17>>2]|0; _glBindBuffer(34962,($18|0)); $19 = HEAP32[$mesh>>2]|0; $20 = $19 << 3; $21 = ((($mesh)) + 8|0); $22 = HEAP32[$21>>2]|0; _glBufferData(34962,($20|0),($22|0),35044); _glVertexAttribPointer(($5|0),2,5126,0,0,(0|0)); _glEnableVertexAttribArray(($5|0)); $23 = ((($vertexBuffer)) + 8|0); $24 = HEAP32[$23>>2]|0; _glBindBuffer(34962,($24|0)); $25 = HEAP32[$mesh>>2]|0; $26 = ($25*12)|0; $27 = ((($mesh)) + 16|0); $28 = HEAP32[$27>>2]|0; _glBufferData(34962,($26|0),($28|0),35044); _glVertexAttribPointer(($6|0),3,5126,0,0,(0|0)); _glEnableVertexAttribArray(($6|0)); $29 = HEAP32[$vertexBuffer>>2]|0; $30 = HEAP32[$17>>2]|0; $31 = HEAP32[$23>>2]|0; $32 = HEAP32[2264>>2]|0; $33 = ($32|0)==(0); do { if ($33) { HEAP32[$vararg_buffer3>>2] = $29; $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); HEAP32[$vararg_ptr6>>2] = $30; $vararg_ptr7 = ((($vararg_buffer3)) + 8|0); HEAP32[$vararg_ptr7>>2] = $31; _TraceLog(0,13488,$vararg_buffer3); $model$sroa$4$0 = 0; } else { $34 = HEAP32[$vaoModel>>2]|0; $35 = ($34|0)==(0); if ($35) { _TraceLog(2,13446,$vararg_buffer1); $model$sroa$4$0 = 0; break; } else { HEAP32[$vararg_buffer>>2] = $34; _TraceLog(0,13392,$vararg_buffer); $model$sroa$4$0 = $34; break; } } } while(0); dest=$agg$result; src=$model$sroa$0; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $36 = ((($agg$result)) + 52|0); HEAP32[$36>>2] = $model$sroa$4$0; $37 = ((($agg$result)) + 56|0); HEAP32[$37>>2] = $29; $38 = ((($agg$result)) + 60|0); HEAP32[$38>>2] = $30; $39 = ((($agg$result)) + 64|0); HEAP32[$39>>2] = $31; $40 = ((($agg$result)) + 68|0); dest=$40; src=$model$sroa$15; stop=dest+76|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $41 = ((($agg$result)) + 144|0); HEAP32[$41>>2] = $3; $42 = ((($agg$result)) + 148|0); HEAP32[$42>>2] = 1; $43 = ((($agg$result)) + 152|0); HEAP32[$43>>2] = 1; $44 = ((($agg$result)) + 160|0); HEAP32[$44>>2] = 7; $45 = ((($agg$result)) + 164|0); ;HEAP32[$45>>2]=HEAP32[$model$sroa$20>>2]|0;HEAP32[$45+4>>2]=HEAP32[$model$sroa$20+4>>2]|0;HEAP32[$45+8>>2]=HEAP32[$model$sroa$20+8>>2]|0;HEAP32[$45+12>>2]=HEAP32[$model$sroa$20+12>>2]|0; $46 = ((($agg$result)) + 180|0); HEAP32[$46>>2] = $4; $47 = ((($agg$result)) + 184|0); HEAP32[$47>>2] = $5; $48 = ((($agg$result)) + 188|0); HEAP32[$48>>2] = $6; $49 = ((($agg$result)) + 192|0); ;HEAP32[$49>>2]=HEAP32[$model$sroa$27>>2]|0;HEAP32[$49+4>>2]=HEAP32[$model$sroa$27+4>>2]|0;HEAP32[$49+8>>2]=HEAP32[$model$sroa$27+8>>2]|0;HEAP32[$49+12>>2]=HEAP32[$model$sroa$27+12>>2]|0;HEAP32[$49+16>>2]=HEAP32[$model$sroa$27+16>>2]|0;HEAP32[$49+20>>2]=HEAP32[$model$sroa$27+20>>2]|0; STACKTOP = sp;return; } function _rlglUnloadFBO($fbo) { $fbo = $fbo|0; var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; _glDeleteFramebuffers(1,($fbo|0)); $0 = ((($fbo)) + 4|0); _glDeleteTextures(1,($0|0)); $1 = ((($fbo)) + 8|0); _glDeleteTextures(1,($1|0)); $2 = HEAP32[$fbo>>2]|0; HEAP32[$vararg_buffer>>2] = $2; _TraceLog(0,13564,$vararg_buffer); STACKTOP = sp;return; } function _rlglClose() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $postproFbo$byval_copy = 0, $vararg_buffer1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $postproFbo$byval_copy = sp + 8|0; $vararg_buffer1 = sp; $0 = HEAP32[2264>>2]|0; $1 = ($0|0)==(0); if (!($1)) { $2 = HEAP32[2276>>2]|0; FUNCTION_TABLE_vi[$2 & 31](0); } _glDisableVertexAttribArray(0); _glDisableVertexAttribArray(1); _glDisableVertexAttribArray(2); _glDisableVertexAttribArray(3); _glBindBuffer(34962,0); _glBindBuffer(34963,0); _glUseProgram(0); _glDeleteBuffers(1,(2684|0)); _glDeleteBuffers(1,((2688)|0)); _glDeleteBuffers(1,(2692|0)); _glDeleteBuffers(1,((2696)|0)); _glDeleteBuffers(1,(2700|0)); _glDeleteBuffers(1,((2704)|0)); _glDeleteBuffers(1,((2708)|0)); _glDeleteBuffers(1,((2712)|0)); $3 = HEAP32[2264>>2]|0; $4 = ($3|0)==(0); if (!($4)) { $5 = HEAP32[2268>>2]|0; FUNCTION_TABLE_vii[$5 & 63](1,2716); $6 = HEAP32[2268>>2]|0; FUNCTION_TABLE_vii[$6 & 63](1,2720); $7 = HEAP32[2268>>2]|0; FUNCTION_TABLE_vii[$7 & 63](1,2724); } $8 = HEAP32[2304>>2]|0; _glDeleteProgram(($8|0)); $9 = HEAP32[2356>>2]|0; _glDeleteProgram(($9|0)); $10 = HEAP32[2232>>2]|0; _free($10); $11 = HEAP32[2192>>2]|0; _free($11); $12 = HEAP32[2236>>2]|0; _free($12); $13 = HEAP32[2204>>2]|0; _free($13); $14 = HEAP32[2240>>2]|0; _free($14); $15 = HEAP32[2224>>2]|0; _free($15); $16 = HEAP32[2216>>2]|0; _free($16); $17 = HEAP32[2728>>2]|0; _free($17); _glDeleteTextures(1,(808|0)); $18 = HEAP32[808>>2]|0; HEAP32[$postproFbo$byval_copy>>2] = $18; _TraceLog(0,13617,$postproFbo$byval_copy); $19 = HEAP32[2252>>2]|0; $20 = ($19|0)==(0); if ($20) { $25 = HEAP32[2248>>2]|0; _free($25); STACKTOP = sp;return; } ;HEAP32[$postproFbo$byval_copy>>2]=HEAP32[2252>>2]|0;HEAP32[$postproFbo$byval_copy+4>>2]=HEAP32[2252+4>>2]|0;HEAP32[$postproFbo$byval_copy+8>>2]=HEAP32[2252+8>>2]|0; _rlglUnloadFBO($postproFbo$byval_copy); $21 = HEAP32[(2524)>>2]|0; _rlDeleteBuffers($21); $22 = HEAP32[(2528)>>2]|0; _rlDeleteBuffers($22); $23 = HEAP32[(2532)>>2]|0; _rlDeleteBuffers($23); $24 = HEAP32[(2520)>>2]|0; _rlDeleteVertexArrays($24); _TraceLog(0,13682,$vararg_buffer1); $25 = HEAP32[2248>>2]|0; _free($25); STACKTOP = sp;return; } function _rlglDraw() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $i$05 = 0, $indicesOffset$04 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $modelview$byval_copy = 0, $or$cond = 0, $or$cond3 = 0; var dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 192|0; $matMVP$byval_copy = sp + 128|0; $modelview$byval_copy = sp + 64|0; $matMVP = sp; _UpdateBuffers(); $0 = HEAP32[2184>>2]|0; $1 = ($0|0)>(0); $2 = HEAP32[2196>>2]|0; $3 = ($2|0)>(0); $or$cond = $1 | $3; $4 = HEAP32[2208>>2]|0; $5 = ($4|0)>(0); $or$cond3 = $or$cond | $5; if ($or$cond3) { $6 = HEAP32[2408>>2]|0; _glUseProgram(($6|0)); dest=$modelview$byval_copy; src=1072; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matMVP$byval_copy; src=1004; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($matMVP,$modelview$byval_copy,$matMVP$byval_copy); $7 = HEAP32[(2440)>>2]|0; dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $8 = (_MatrixToFloat($matMVP$byval_copy)|0); _glUniformMatrix4fv(($7|0),1,0,($8|0)); $9 = HEAP32[(2448)>>2]|0; _glUniform1i(($9|0),0); } $10 = HEAP32[2184>>2]|0; $11 = ($10|0)>(0); if ($11) { $12 = HEAP32[808>>2]|0; _glBindTexture(3553,($12|0)); $13 = HEAP32[2264>>2]|0; $14 = ($13|0)==(0); if ($14) { $17 = HEAP32[2684>>2]|0; _glBindBuffer(34962,($17|0)); $18 = HEAP32[(2424)>>2]|0; _glVertexAttribPointer(($18|0),3,5126,0,0,(0|0)); $19 = HEAP32[(2424)>>2]|0; _glEnableVertexAttribArray(($19|0)); $20 = HEAP32[(2436)>>2]|0; $21 = ($20|0)==(-1); if (!($21)) { $22 = HEAP32[(2688)>>2]|0; _glBindBuffer(34962,($22|0)); $23 = HEAP32[(2436)>>2]|0; _glVertexAttribPointer(($23|0),4,5121,1,0,(0|0)); $24 = HEAP32[(2436)>>2]|0; _glEnableVertexAttribArray(($24|0)); } } else { $15 = HEAP32[2276>>2]|0; $16 = HEAP32[2716>>2]|0; FUNCTION_TABLE_vi[$15 & 31]($16); } $25 = HEAP32[2184>>2]|0; _glDrawArrays(1,0,($25|0)); $26 = HEAP32[2264>>2]|0; $27 = ($26|0)==(0); if ($27) { _glBindBuffer(34962,0); } _glBindTexture(3553,0); } $28 = HEAP32[2196>>2]|0; $29 = ($28|0)>(0); if ($29) { $30 = HEAP32[808>>2]|0; _glBindTexture(3553,($30|0)); $31 = HEAP32[2264>>2]|0; $32 = ($31|0)==(0); if ($32) { $35 = HEAP32[2692>>2]|0; _glBindBuffer(34962,($35|0)); $36 = HEAP32[(2424)>>2]|0; _glVertexAttribPointer(($36|0),3,5126,0,0,(0|0)); $37 = HEAP32[(2424)>>2]|0; _glEnableVertexAttribArray(($37|0)); $38 = HEAP32[(2436)>>2]|0; $39 = ($38|0)==(-1); if (!($39)) { $40 = HEAP32[(2696)>>2]|0; _glBindBuffer(34962,($40|0)); $41 = HEAP32[(2436)>>2]|0; _glVertexAttribPointer(($41|0),4,5121,1,0,(0|0)); $42 = HEAP32[(2436)>>2]|0; _glEnableVertexAttribArray(($42|0)); } } else { $33 = HEAP32[2276>>2]|0; $34 = HEAP32[2720>>2]|0; FUNCTION_TABLE_vi[$33 & 31]($34); } $43 = HEAP32[2196>>2]|0; _glDrawArrays(4,0,($43|0)); $44 = HEAP32[2264>>2]|0; $45 = ($44|0)==(0); if ($45) { _glBindBuffer(34962,0); } _glBindTexture(3553,0); } $46 = HEAP32[2208>>2]|0; $47 = ($46|0)>(0); if ($47) { $48 = HEAP32[2264>>2]|0; $49 = ($48|0)==(0); if ($49) { $52 = HEAP32[2700>>2]|0; _glBindBuffer(34962,($52|0)); $53 = HEAP32[(2424)>>2]|0; _glVertexAttribPointer(($53|0),3,5126,0,0,(0|0)); $54 = HEAP32[(2424)>>2]|0; _glEnableVertexAttribArray(($54|0)); $55 = HEAP32[(2704)>>2]|0; _glBindBuffer(34962,($55|0)); $56 = HEAP32[(2428)>>2]|0; _glVertexAttribPointer(($56|0),2,5126,0,0,(0|0)); $57 = HEAP32[(2428)>>2]|0; _glEnableVertexAttribArray(($57|0)); $58 = HEAP32[(2436)>>2]|0; $59 = ($58|0)==(-1); if (!($59)) { $60 = HEAP32[(2708)>>2]|0; _glBindBuffer(34962,($60|0)); $61 = HEAP32[(2436)>>2]|0; _glVertexAttribPointer(($61|0),4,5121,1,0,(0|0)); $62 = HEAP32[(2436)>>2]|0; _glEnableVertexAttribArray(($62|0)); } $63 = HEAP32[(2712)>>2]|0; _glBindBuffer(34963,($63|0)); } else { $50 = HEAP32[2276>>2]|0; $51 = HEAP32[2724>>2]|0; FUNCTION_TABLE_vi[$50 & 31]($51); } $64 = HEAP32[2244>>2]|0; $65 = ($64|0)>(0); if ($65) { $i$05 = 0;$indicesOffset$04 = 0; while(1) { $66 = HEAP32[2248>>2]|0; $67 = (((($66) + ($i$05<<3)|0)) + 4|0); $68 = HEAP32[$67>>2]|0; $69 = (($68|0) / 4)&-1; $70 = ($69*6)|0; $71 = (($66) + ($i$05<<3)|0); $72 = HEAP32[$71>>2]|0; _glBindTexture(3553,($72|0)); $73 = $indicesOffset$04 << 1; $74 = $73; _glDrawElements(4,($70|0),5123,($74|0)); $75 = HEAP32[2248>>2]|0; $76 = (((($75) + ($i$05<<3)|0)) + 4|0); $77 = HEAP32[$76>>2]|0; $78 = (($77|0) / 4)&-1; $79 = ($78*6)|0; $80 = (($79) + ($indicesOffset$04))|0; $81 = (($i$05) + 1)|0; $82 = HEAP32[2244>>2]|0; $83 = ($81|0)<($82|0); if ($83) { $i$05 = $81;$indicesOffset$04 = $80; } else { break; } } } $84 = HEAP32[2264>>2]|0; $85 = ($84|0)==(0); if ($85) { _glBindBuffer(34962,0); _glBindBuffer(34963,0); } _glBindTexture(3553,0); } $86 = HEAP32[2264>>2]|0; $87 = ($86|0)==(0); if ($87) { _glUseProgram(0); HEAP32[2244>>2] = 1; $89 = HEAP32[808>>2]|0; $90 = HEAP32[2248>>2]|0; HEAP32[$90>>2] = $89; $91 = HEAP32[2248>>2]|0; $92 = ((($91)) + 4|0); HEAP32[$92>>2] = 0; HEAP32[2184>>2] = 0; HEAP32[2188>>2] = 0; HEAP32[2196>>2] = 0; HEAP32[2200>>2] = 0; HEAP32[2208>>2] = 0; HEAP32[2220>>2] = 0; HEAP32[2212>>2] = 0; HEAPF32[2228>>2] = -1.0; STACKTOP = sp;return; } $88 = HEAP32[2276>>2]|0; FUNCTION_TABLE_vi[$88 & 31](0); _glUseProgram(0); HEAP32[2244>>2] = 1; $89 = HEAP32[808>>2]|0; $90 = HEAP32[2248>>2]|0; HEAP32[$90>>2] = $89; $91 = HEAP32[2248>>2]|0; $92 = ((($91)) + 4|0); HEAP32[$92>>2] = 0; HEAP32[2184>>2] = 0; HEAP32[2188>>2] = 0; HEAP32[2196>>2] = 0; HEAP32[2200>>2] = 0; HEAP32[2208>>2] = 0; HEAP32[2220>>2] = 0; HEAP32[2212>>2] = 0; HEAPF32[2228>>2] = -1.0; STACKTOP = sp;return; } function _rlglDrawPostpro() { var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $postproQuad$byval_copy = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 304|0; $tmpcast$byval_copy = sp + 292|0; $$byval_copy2 = sp + 280|0; $$byval_copy1 = sp + 268|0; $$byval_copy = sp + 256|0; $postproQuad$byval_copy = sp + 40|0; $0 = sp + 28|0; $1 = sp + 16|0; $2 = sp + 4|0; $3 = sp; _glBindFramebuffer(36160,0); HEAPF32[$0>>2] = 0.0; $4 = ((($0)) + 4|0); HEAPF32[$4>>2] = 0.0; $5 = ((($0)) + 8|0); HEAPF32[$5>>2] = 0.0; HEAPF32[$1>>2] = 0.0; $6 = ((($1)) + 4|0); HEAPF32[$6>>2] = 0.0; $7 = ((($1)) + 8|0); HEAPF32[$7>>2] = 0.0; HEAPF32[$2>>2] = 1.0; $8 = ((($2)) + 4|0); HEAPF32[$8>>2] = 1.0; $9 = ((($2)) + 8|0); HEAPF32[$9>>2] = 1.0; HEAP32[$3>>2] = -1; _memcpy(($postproQuad$byval_copy|0),(2468|0),216)|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$1+8>>2]|0; ;HEAP32[$$byval_copy2>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$2+8>>2]|0; ;HEAP8[$tmpcast$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$tmpcast$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$tmpcast$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$tmpcast$byval_copy+3>>0]=HEAP8[$3+3>>0]|0; _rlglDrawModel($postproQuad$byval_copy,$$byval_copy,$$byval_copy1,0.0,$$byval_copy2,$tmpcast$byval_copy,0); STACKTOP = sp;return; } function _rlglDrawModel($model,$position,$rotationAxis,$rotationAngle,$scale,$color,$wires) { $model = $model|0; $position = $position|0; $rotationAxis = $rotationAxis|0; $rotationAngle = +$rotationAngle; $scale = $scale|0; $color = $color|0; $wires = $wires|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0.0, $80 = 0; var $81 = 0, $9 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $matModel = 0, $matModelView = 0, $matModelView$byval_copy = 0, $matProjection = 0, $matRotation = 0, $matScale = 0, $matTransform = 0, $matTranslation = 0, $matView = 0, $vColor = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 784|0; $matMVP$byval_copy = sp + 720|0; $matModelView$byval_copy = sp + 656|0; $matView = sp + 512|0; $matProjection = sp + 448|0; $matRotation = sp + 384|0; $matScale = sp + 320|0; $matTranslation = sp + 256|0; $matTransform = sp + 192|0; $0 = sp + 592|0; $matModel = sp + 128|0; $matModelView = sp + 64|0; $matMVP = sp; $vColor = sp + 576|0; $1 = ((($model)) + 164|0); $2 = HEAP32[$1>>2]|0; _glUseProgram(($2|0)); dest=$matView; src=1072; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matProjection; src=1004; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $3 = $rotationAngle; $4 = $3 * 0.017453292519943295; $5 = $4; ;HEAP32[$matMVP$byval_copy>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$matMVP$byval_copy+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$matMVP$byval_copy+8>>2]=HEAP32[$rotationAxis+8>>2]|0; _MatrixRotate($matRotation,$matMVP$byval_copy,$5); $6 = +HEAPF32[$scale>>2]; $7 = ((($scale)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = ((($scale)) + 8|0); $10 = +HEAPF32[$9>>2]; _MatrixScale($matScale,$6,$8,$10); $11 = +HEAPF32[$position>>2]; $12 = ((($position)) + 4|0); $13 = +HEAPF32[$12>>2]; $14 = ((($position)) + 8|0); $15 = +HEAPF32[$14>>2]; _MatrixTranslate($matTranslation,$11,$13,$15); dest=$matModelView$byval_copy; src=$matScale; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matMVP$byval_copy; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($0,$matModelView$byval_copy,$matMVP$byval_copy); dest=$matModelView$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matMVP$byval_copy; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($matTransform,$matModelView$byval_copy,$matMVP$byval_copy); $16 = ((($model)) + 80|0); dest=$matModelView$byval_copy; src=$16; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matMVP$byval_copy; src=$matTransform; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($matModel,$matModelView$byval_copy,$matMVP$byval_copy); dest=$matModelView$byval_copy; src=$matModel; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matMVP$byval_copy; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($matModelView,$matModelView$byval_copy,$matMVP$byval_copy); dest=$matModelView$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); dest=$matMVP$byval_copy; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MatrixMultiply($matMVP,$matModelView$byval_copy,$matMVP$byval_copy); $17 = ((($model)) + 196|0); $18 = HEAP32[$17>>2]|0; dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $19 = (_MatrixToFloat($matMVP$byval_copy)|0); _glUniformMatrix4fv(($18|0),1,0,($19|0)); $20 = HEAP8[$color>>0]|0; $21 = (+($20&255)); $22 = $21 / 255.0; HEAPF32[$vColor>>2] = $22; $23 = ((($vColor)) + 4|0); $24 = ((($color)) + 1|0); $25 = HEAP8[$24>>0]|0; $26 = (+($25&255)); $27 = $26 / 255.0; HEAPF32[$23>>2] = $27; $28 = ((($vColor)) + 8|0); $29 = ((($color)) + 2|0); $30 = HEAP8[$29>>0]|0; $31 = (+($30&255)); $32 = $31 / 255.0; HEAPF32[$28>>2] = $32; $33 = ((($vColor)) + 12|0); $34 = ((($color)) + 3|0); $35 = HEAP8[$34>>0]|0; $36 = (+($35&255)); $37 = $36 / 255.0; HEAPF32[$33>>2] = $37; $38 = ((($model)) + 200|0); $39 = HEAP32[$38>>2]|0; _glUniform4fv(($39|0),1,($vColor|0)); _glActiveTexture(33984); $40 = ((($model)) + 168|0); $41 = HEAP32[$40>>2]|0; _glBindTexture(3553,($41|0)); $42 = ((($model)) + 204|0); $43 = HEAP32[$42>>2]|0; _glUniform1i(($43|0),0); $44 = ((($model)) + 172|0); $45 = HEAP32[$44>>2]|0; $46 = ($45|0)==(0); if (!($46)) { _glActiveTexture(33985); $47 = HEAP32[$44>>2]|0; _glBindTexture(3553,($47|0)); } $48 = ((($model)) + 176|0); $49 = HEAP32[$48>>2]|0; $50 = ($49|0)==(0); if (!($50)) { _glActiveTexture(33986); $51 = HEAP32[$48>>2]|0; _glBindTexture(3553,($51|0)); } $52 = HEAP32[2264>>2]|0; $53 = ($52|0)==(0); if ($53) { $57 = ((($model)) + 56|0); $58 = HEAP32[$57>>2]|0; _glBindBuffer(34962,($58|0)); $59 = ((($model)) + 180|0); $60 = HEAP32[$59>>2]|0; _glVertexAttribPointer(($60|0),3,5126,0,0,(0|0)); $61 = HEAP32[$59>>2]|0; _glEnableVertexAttribArray(($61|0)); $62 = ((($model)) + 60|0); $63 = HEAP32[$62>>2]|0; _glBindBuffer(34962,($63|0)); $64 = ((($model)) + 184|0); $65 = HEAP32[$64>>2]|0; _glVertexAttribPointer(($65|0),2,5126,0,0,(0|0)); $66 = HEAP32[$64>>2]|0; _glEnableVertexAttribArray(($66|0)); $67 = ((($model)) + 188|0); $68 = HEAP32[$67>>2]|0; $69 = ($68|0)==(-1); if (!($69)) { $70 = ((($model)) + 64|0); $71 = HEAP32[$70>>2]|0; _glBindBuffer(34962,($71|0)); $72 = HEAP32[$67>>2]|0; _glVertexAttribPointer(($72|0),3,5126,0,0,(0|0)); $73 = HEAP32[$67>>2]|0; _glEnableVertexAttribArray(($73|0)); } } else { $54 = HEAP32[2276>>2]|0; $55 = ((($model)) + 52|0); $56 = HEAP32[$55>>2]|0; FUNCTION_TABLE_vi[$54 & 31]($56); } $74 = HEAP32[$model>>2]|0; _glDrawArrays(4,0,($74|0)); $75 = HEAP32[$44>>2]|0; $76 = ($75|0)==(0); if (!($76)) { _glActiveTexture(33985); _glBindTexture(3553,0); } $77 = HEAP32[$48>>2]|0; $78 = ($77|0)==(0); if (!($78)) { _glActiveTexture(33986); _glBindTexture(3553,0); } _glActiveTexture(33984); _glBindTexture(3553,0); $79 = HEAP32[2264>>2]|0; $80 = ($79|0)==(0); if ($80) { _glBindBuffer(34962,0); _glUseProgram(0); STACKTOP = sp;return; } else { $81 = HEAP32[2276>>2]|0; FUNCTION_TABLE_vi[$81 & 31](0); _glUseProgram(0); STACKTOP = sp;return; } } function _rlglInitGraphics($offsetX,$offsetY,$width,$height) { $offsetX = $offsetX|0; $offsetY = $offsetY|0; $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; HEAP32[2460>>2] = $width; HEAP32[2464>>2] = $height; $0 = (($offsetX|0) / 2)&-1; $1 = (($offsetY|0) / 2)&-1; $2 = (($width) - ($offsetX))|0; $3 = (($height) - ($offsetY))|0; _glViewport(($0|0),($1|0),($2|0),($3|0)); _glClearColor(0.0,0.0,0.0,1.0); _glClear(16640); _glEnable(2929); _glDepthFunc(515); _glEnable(3042); _glBlendFunc(770,771); _rlMatrixMode(0); _rlLoadIdentity(); $4 = (+($2|0)); $5 = (+($3|0)); _rlOrtho(0.0,$4,$5,0.0,0.0,1.0); _rlMatrixMode(1); _rlLoadIdentity(); _glEnable(2884); _TraceLog(0,13711,$vararg_buffer); STACKTOP = sp;return; } function _LoadShaderProgram($vShaderStr,$fShaderStr) { $vShaderStr = $vShaderStr|0; $fShaderStr = $fShaderStr|0; var $$alloca_mul = 0, $$alloca_mul25 = 0, $$alloca_mul27 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $length = 0, $length2 = 0, $length4 = 0, $maxLength = 0, $maxLength1 = 0, $maxLength3 = 0, $pfs = 0, $program$0 = 0, $pvs = 0, $success = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0; var $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $vararg_buffer22 = sp + 64|0; $vararg_buffer19 = sp + 56|0; $vararg_buffer16 = sp + 48|0; $vararg_buffer13 = sp + 40|0; $vararg_buffer10 = sp + 32|0; $vararg_buffer7 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $pvs = sp + 100|0; $pfs = sp + 96|0; $success = sp + 92|0; $maxLength = sp + 88|0; $length = sp + 84|0; $maxLength1 = sp + 80|0; $length2 = sp + 76|0; $maxLength3 = sp + 72|0; $length4 = sp + 68|0; $0 = (_glCreateShader(35633)|0); $1 = (_glCreateShader(35632)|0); HEAP32[$pvs>>2] = $vShaderStr; HEAP32[$pfs>>2] = $fShaderStr; _glShaderSource(($0|0),1,($pvs|0),(0|0)); _glShaderSource(($1|0),1,($pfs|0),(0|0)); HEAP32[$success>>2] = 0; _glCompileShader(($0|0)); _glGetShaderiv(($0|0),35713,($success|0)); $2 = HEAP32[$success>>2]|0; $3 = ($2|0)==(1); if ($3) { HEAP32[$vararg_buffer4>>2] = $0; _TraceLog(0,13886,$vararg_buffer4); } else { HEAP32[$vararg_buffer>>2] = $0; _TraceLog(2,13834,$vararg_buffer); HEAP32[$maxLength>>2] = 0; _glGetShaderiv(($0|0),35716,($maxLength|0)); $4 = HEAP32[$maxLength>>2]|0; $5 = (_llvm_stacksave()|0); $$alloca_mul = $4; $6 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;; $7 = HEAP32[$maxLength>>2]|0; _glGetShaderInfoLog(($0|0),($7|0),($length|0),($6|0)); HEAP32[$vararg_buffer1>>2] = $6; _TraceLog(0,13883,$vararg_buffer1); _llvm_stackrestore(($5|0)); } _glCompileShader(($1|0)); _glGetShaderiv(($1|0),35713,($success|0)); $8 = HEAP32[$success>>2]|0; $9 = ($8|0)==(1); if ($9) { HEAP32[$vararg_buffer13>>2] = $1; _TraceLog(0,13987,$vararg_buffer13); } else { HEAP32[$vararg_buffer7>>2] = $1; _TraceLog(2,13936,$vararg_buffer7); HEAP32[$maxLength1>>2] = 0; _glGetShaderiv(($1|0),35716,($maxLength1|0)); $10 = HEAP32[$maxLength1>>2]|0; $11 = (_llvm_stacksave()|0); $$alloca_mul25 = $10; $12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul25)|0)+15)&-16)|0;; $13 = HEAP32[$maxLength1>>2]|0; _glGetShaderInfoLog(($1|0),($13|0),($length2|0),($12|0)); HEAP32[$vararg_buffer10>>2] = $12; _TraceLog(0,13883,$vararg_buffer10); _llvm_stackrestore(($11|0)); } $14 = (_glCreateProgram()|0); _glAttachShader(($14|0),($0|0)); _glAttachShader(($14|0),($1|0)); _glLinkProgram(($14|0)); _glGetProgramiv(($14|0),35714,($success|0)); $15 = HEAP32[$success>>2]|0; $16 = ($15|0)==(0); if ($16) { HEAP32[$vararg_buffer16>>2] = $14; _TraceLog(2,14039,$vararg_buffer16); HEAP32[$maxLength3>>2] = 0; _glGetProgramiv(($14|0),35716,($maxLength3|0)); $17 = HEAP32[$maxLength3>>2]|0; $18 = (_llvm_stacksave()|0); $$alloca_mul27 = $17; $19 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul27)|0)+15)&-16)|0;; $20 = HEAP32[$maxLength3>>2]|0; _glGetProgramInfoLog(($14|0),($20|0),($length4|0),($19|0)); HEAP32[$vararg_buffer19>>2] = $19; _TraceLog(0,13883,$vararg_buffer19); _glDeleteProgram(($14|0)); _llvm_stackrestore(($18|0)); $program$0 = 0; _glDeleteShader(($0|0)); _glDeleteShader(($1|0)); STACKTOP = sp;return ($program$0|0); } else { HEAP32[$vararg_buffer22>>2] = $14; _TraceLog(0,14085,$vararg_buffer22); $program$0 = $14; _glDeleteShader(($0|0)); _glDeleteShader(($1|0)); STACKTOP = sp;return ($program$0|0); } return (0)|0; } function _IsPosproShaderEnabled() { var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[2732>>2]|0; return ($0|0); } function _DrawCircle($centerX,$centerY,$radius,$color) { $centerX = $centerX|0; $centerY = $centerY|0; $radius = +$radius; $color = $color|0; var $$byval_copy = 0, $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $color$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $color$byval_copy = sp + 16|0; $$byval_copy = sp + 8|0; $0 = sp; $1 = (+($centerX|0)); $2 = (+($centerY|0)); HEAPF32[$0>>2] = $1; $3 = ((($0)) + 4|0); HEAPF32[$3>>2] = $2; ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _DrawPoly($$byval_copy,36,$radius,0.0,$color$byval_copy); STACKTOP = sp;return; } function _DrawPoly($center,$sides,$radius,$rotation,$color) { $center = $center|0; $sides = $sides|0; $radius = +$radius; $rotation = +$rotation; $color = $color|0; var $$sides = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0; var $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($sides|0)<(3); $$sides = $0 ? 3 : $sides; _rlPushMatrix(); $1 = +HEAPF32[$center>>2]; $2 = ((($center)) + 4|0); $3 = +HEAPF32[$2>>2]; _rlTranslatef($1,$3,0.0); _rlRotatef($rotation,0.0,0.0,1.0); _rlBegin(1); $4 = HEAP8[$color>>0]|0; $5 = ((($color)) + 1|0); $6 = HEAP8[$5>>0]|0; $7 = ((($color)) + 2|0); $8 = HEAP8[$7>>0]|0; $9 = ((($color)) + 3|0); $10 = HEAP8[$9>>0]|0; $11 = $radius; $12 = (360 / ($$sides|0))&-1; $i$01 = 0; while(1) { _rlColor4ub($4,$6,$8,$10); _rlVertex2i(0,0); $13 = (+($i$01|0)); $14 = $13 * 0.017453292519943295; $15 = (+Math_sin((+$14))); $16 = $11 * $15; $17 = $16; $18 = (+Math_cos((+$14))); $19 = $11 * $18; $20 = $19; _rlVertex2f($17,$20); $21 = (($12) + ($i$01))|0; $22 = (+($21|0)); $23 = $22 * 0.017453292519943295; $24 = (+Math_sin((+$23))); $25 = $11 * $24; $26 = $25; $27 = (+Math_cos((+$23))); $28 = $11 * $27; $29 = $28; _rlVertex2f($26,$29); $30 = ($21|0)<(360); if ($30) { $i$01 = $21; } else { break; } } _rlEnd(); _rlPopMatrix(); return; } function _DrawCircleGradient($centerX,$centerY,$radius,$color1,$color2) { $centerX = $centerX|0; $centerY = $centerY|0; $radius = +$radius; $color1 = $color1|0; $color2 = $color2|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; _rlBegin(1); $0 = HEAP8[$color1>>0]|0; $1 = ((($color1)) + 1|0); $2 = HEAP8[$1>>0]|0; $3 = ((($color1)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color1)) + 3|0); $6 = HEAP8[$5>>0]|0; $7 = HEAP8[$color2>>0]|0; $8 = ((($color2)) + 1|0); $9 = HEAP8[$8>>0]|0; $10 = ((($color2)) + 2|0); $11 = HEAP8[$10>>0]|0; $12 = ((($color2)) + 3|0); $13 = HEAP8[$12>>0]|0; $14 = (+($centerX|0)); $15 = $radius; $16 = (+($centerY|0)); $17 = HEAP8[$color2>>0]|0; $18 = HEAP8[$8>>0]|0; $19 = HEAP8[$10>>0]|0; $20 = HEAP8[$12>>0]|0; $i$01 = 0; while(1) { _rlColor4ub($0,$2,$4,$6); _rlVertex2i($centerX,$centerY); _rlColor4ub($7,$9,$11,$13); $21 = (+($i$01|0)); $22 = $21 * 0.017453292519943295; $23 = (+Math_sin((+$22))); $24 = $15 * $23; $25 = $14 + $24; $26 = $25; $27 = (+Math_cos((+$22))); $28 = $15 * $27; $29 = $16 + $28; $30 = $29; _rlVertex2f($26,$30); _rlColor4ub($17,$18,$19,$20); $31 = (($i$01) + 10)|0; $32 = (+($31|0)); $33 = $32 * 0.017453292519943295; $34 = (+Math_sin((+$33))); $35 = $15 * $34; $36 = $14 + $35; $37 = $36; $38 = (+Math_cos((+$33))); $39 = $15 * $38; $40 = $16 + $39; $41 = $40; _rlVertex2f($37,$41); $42 = ($31|0)<(360); if ($42) { $i$01 = $31; } else { break; } } _rlEnd(); return; } function _DrawCircleLines($centerX,$centerY,$radius,$color) { $centerX = $centerX|0; $centerY = $centerY|0; $radius = +$radius; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; _rlBegin(0); $0 = HEAP8[$color>>0]|0; $1 = ((($color)) + 1|0); $2 = HEAP8[$1>>0]|0; $3 = ((($color)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color)) + 3|0); $6 = HEAP8[$5>>0]|0; _rlColor4ub($0,$2,$4,$6); $7 = (+($centerX|0)); $8 = $radius; $9 = (+($centerY|0)); $i$01 = 0; while(1) { $10 = (+($i$01|0)); $11 = $10 * 0.017453292519943295; $12 = (+Math_sin((+$11))); $13 = $8 * $12; $14 = $7 + $13; $15 = $14; $16 = (+Math_cos((+$11))); $17 = $8 * $16; $18 = $9 + $17; $19 = $18; _rlVertex2f($15,$19); $20 = (($i$01) + 10)|0; $21 = (+($20|0)); $22 = $21 * 0.017453292519943295; $23 = (+Math_sin((+$22))); $24 = $8 * $23; $25 = $7 + $24; $26 = $25; $27 = (+Math_cos((+$22))); $28 = $8 * $27; $29 = $9 + $28; $30 = $29; _rlVertex2f($26,$30); $31 = ($20|0)<(360); if ($31) { $i$01 = $20; } else { break; } } _rlEnd(); return; } function _DrawRectangle($posX,$posY,$width,$height,$color) { $posX = $posX|0; $posY = $posY|0; $width = $width|0; $height = $height|0; $color = $color|0; var $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0.0, $color$byval_copy = 0, $position = 0, $position$byval_copy = 0, $size = 0, $size$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $color$byval_copy = sp + 32|0; $size$byval_copy = sp + 24|0; $position$byval_copy = sp + 16|0; $position = sp + 8|0; $size = sp; $0 = (+($posX|0)); HEAPF32[$position>>2] = $0; $1 = ((($position)) + 4|0); $2 = (+($posY|0)); HEAPF32[$1>>2] = $2; $3 = (+($width|0)); HEAPF32[$size>>2] = $3; $4 = ((($size)) + 4|0); $5 = (+($height|0)); HEAPF32[$4>>2] = $5; ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0; ;HEAP32[$size$byval_copy>>2]=HEAP32[$size>>2]|0;HEAP32[$size$byval_copy+4>>2]=HEAP32[$size+4>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _DrawRectangleV($position$byval_copy,$size$byval_copy,$color$byval_copy); STACKTOP = sp;return; } function _DrawRectangleV($position,$size,$color) { $position = $position|0; $size = $size|0; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0; var $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0; var $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (_rlGetVersion()|0); $1 = ($0|0)==(1); if ($1) { _rlBegin(1); $2 = HEAP8[$color>>0]|0; $3 = ((($color)) + 1|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color)) + 2|0); $6 = HEAP8[$5>>0]|0; $7 = ((($color)) + 3|0); $8 = HEAP8[$7>>0]|0; _rlColor4ub($2,$4,$6,$8); $9 = +HEAPF32[$position>>2]; $10 = (~~(($9))); $11 = ((($position)) + 4|0); $12 = +HEAPF32[$11>>2]; $13 = (~~(($12))); _rlVertex2i($10,$13); $14 = +HEAPF32[$position>>2]; $15 = (~~(($14))); $16 = +HEAPF32[$11>>2]; $17 = ((($size)) + 4|0); $18 = +HEAPF32[$17>>2]; $19 = $16 + $18; $20 = (~~(($19))); _rlVertex2i($15,$20); $21 = +HEAPF32[$position>>2]; $22 = +HEAPF32[$size>>2]; $23 = $21 + $22; $24 = (~~(($23))); $25 = +HEAPF32[$11>>2]; $26 = +HEAPF32[$17>>2]; $27 = $25 + $26; $28 = (~~(($27))); _rlVertex2i($24,$28); $29 = +HEAPF32[$position>>2]; $30 = (~~(($29))); $31 = +HEAPF32[$11>>2]; $32 = (~~(($31))); _rlVertex2i($30,$32); $33 = +HEAPF32[$position>>2]; $34 = +HEAPF32[$size>>2]; $35 = $33 + $34; $36 = (~~(($35))); $37 = +HEAPF32[$11>>2]; $38 = +HEAPF32[$17>>2]; $39 = $37 + $38; $40 = (~~(($39))); _rlVertex2i($36,$40); $41 = +HEAPF32[$position>>2]; $42 = +HEAPF32[$size>>2]; $43 = $41 + $42; $44 = (~~(($43))); $45 = +HEAPF32[$11>>2]; $46 = (~~(($45))); _rlVertex2i($44,$46); _rlEnd(); return; } $47 = (_rlGetVersion()|0); $48 = ($47|0)==(2); if (!($48)) { $49 = (_rlGetVersion()|0); $50 = ($49|0)==(3); if (!($50)) { return; } } $51 = HEAP32[808>>2]|0; _rlEnableTexture($51); _rlBegin(2); $52 = HEAP8[$color>>0]|0; $53 = ((($color)) + 1|0); $54 = HEAP8[$53>>0]|0; $55 = ((($color)) + 2|0); $56 = HEAP8[$55>>0]|0; $57 = ((($color)) + 3|0); $58 = HEAP8[$57>>0]|0; _rlColor4ub($52,$54,$56,$58); _rlTexCoord2f(0.0,0.0); $59 = +HEAPF32[$position>>2]; $60 = ((($position)) + 4|0); $61 = +HEAPF32[$60>>2]; _rlVertex2f($59,$61); _rlTexCoord2f(0.0,1.0); $62 = +HEAPF32[$position>>2]; $63 = +HEAPF32[$60>>2]; $64 = ((($size)) + 4|0); $65 = +HEAPF32[$64>>2]; $66 = $63 + $65; _rlVertex2f($62,$66); _rlTexCoord2f(1.0,1.0); $67 = +HEAPF32[$position>>2]; $68 = +HEAPF32[$size>>2]; $69 = $67 + $68; $70 = +HEAPF32[$60>>2]; $71 = +HEAPF32[$64>>2]; $72 = $70 + $71; _rlVertex2f($69,$72); _rlTexCoord2f(1.0,0.0); $73 = +HEAPF32[$position>>2]; $74 = +HEAPF32[$size>>2]; $75 = $73 + $74; $76 = +HEAPF32[$60>>2]; _rlVertex2f($75,$76); _rlEnd(); return; } function _DrawRectangleGradient($posX,$posY,$width,$height,$color1,$color2) { $posX = $posX|0; $posY = $posY|0; $width = $width|0; $height = $height|0; $color1 = $color1|0; $color2 = $color2|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; _rlBegin(1); $0 = HEAP8[$color1>>0]|0; $1 = ((($color1)) + 1|0); $2 = HEAP8[$1>>0]|0; $3 = ((($color1)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color1)) + 3|0); $6 = HEAP8[$5>>0]|0; _rlColor4ub($0,$2,$4,$6); _rlVertex2i($posX,$posY); $7 = HEAP8[$color2>>0]|0; $8 = ((($color2)) + 1|0); $9 = HEAP8[$8>>0]|0; $10 = ((($color2)) + 2|0); $11 = HEAP8[$10>>0]|0; $12 = ((($color2)) + 3|0); $13 = HEAP8[$12>>0]|0; _rlColor4ub($7,$9,$11,$13); $14 = (($height) + ($posY))|0; _rlVertex2i($posX,$14); $15 = HEAP8[$color2>>0]|0; $16 = HEAP8[$8>>0]|0; $17 = HEAP8[$10>>0]|0; $18 = HEAP8[$12>>0]|0; _rlColor4ub($15,$16,$17,$18); $19 = (($width) + ($posX))|0; _rlVertex2i($19,$14); $20 = HEAP8[$color1>>0]|0; $21 = HEAP8[$1>>0]|0; $22 = HEAP8[$3>>0]|0; $23 = HEAP8[$5>>0]|0; _rlColor4ub($20,$21,$22,$23); _rlVertex2i($posX,$posY); $24 = HEAP8[$color2>>0]|0; $25 = HEAP8[$8>>0]|0; $26 = HEAP8[$10>>0]|0; $27 = HEAP8[$12>>0]|0; _rlColor4ub($24,$25,$26,$27); _rlVertex2i($19,$14); $28 = HEAP8[$color1>>0]|0; $29 = HEAP8[$1>>0]|0; $30 = HEAP8[$3>>0]|0; $31 = HEAP8[$5>>0]|0; _rlColor4ub($28,$29,$30,$31); _rlVertex2i($19,$posY); _rlEnd(); return; } function _DrawRectangleLines($posX,$posY,$width,$height,$color) { $posX = $posX|0; $posY = $posY|0; $width = $width|0; $height = $height|0; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; _rlBegin(0); $0 = HEAP8[$color>>0]|0; $1 = ((($color)) + 1|0); $2 = HEAP8[$1>>0]|0; $3 = ((($color)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color)) + 3|0); $6 = HEAP8[$5>>0]|0; _rlColor4ub($0,$2,$4,$6); $7 = (($posX) + 1)|0; $8 = (($posY) + 1)|0; _rlVertex2i($7,$8); $9 = (($width) + ($posX))|0; _rlVertex2i($9,$8); _rlVertex2i($9,$8); $10 = (($height) + ($posY))|0; _rlVertex2i($9,$10); _rlVertex2i($9,$10); _rlVertex2i($7,$10); _rlVertex2i($7,$10); _rlVertex2i($7,$8); _rlEnd(); return; } function _DrawTriangle($v1,$v2,$v3,$color) { $v1 = $v1|0; $v2 = $v2|0; $v3 = $v3|0; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; _rlBegin(1); $0 = HEAP8[$color>>0]|0; $1 = ((($color)) + 1|0); $2 = HEAP8[$1>>0]|0; $3 = ((($color)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = ((($color)) + 3|0); $6 = HEAP8[$5>>0]|0; _rlColor4ub($0,$2,$4,$6); $7 = +HEAPF32[$v1>>2]; $8 = ((($v1)) + 4|0); $9 = +HEAPF32[$8>>2]; _rlVertex2f($7,$9); $10 = +HEAPF32[$v2>>2]; $11 = ((($v2)) + 4|0); $12 = +HEAPF32[$11>>2]; _rlVertex2f($10,$12); $13 = +HEAPF32[$v3>>2]; $14 = ((($v3)) + 4|0); $15 = +HEAPF32[$14>>2]; _rlVertex2f($13,$15); _rlEnd(); return; } function _stbtt_InitFont($info,$data2,$fontstart) { $info = $info|0; $data2 = $data2|0; $fontstart = $fontstart|0; var $$0 = 0, $$pr = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$06 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($info)) + 4|0); HEAP32[$0>>2] = $data2; $1 = ((($info)) + 8|0); HEAP32[$1>>2] = $fontstart; $2 = (_stbtt__find_table($data2,$fontstart,14133)|0); $3 = (_stbtt__find_table($data2,$fontstart,14138)|0); $4 = ((($info)) + 16|0); HEAP32[$4>>2] = $3; $5 = (_stbtt__find_table($data2,$fontstart,14143)|0); $6 = ((($info)) + 20|0); HEAP32[$6>>2] = $5; $7 = (_stbtt__find_table($data2,$fontstart,14148)|0); $8 = ((($info)) + 24|0); HEAP32[$8>>2] = $7; $9 = (_stbtt__find_table($data2,$fontstart,14153)|0); $10 = ((($info)) + 28|0); HEAP32[$10>>2] = $9; $11 = (_stbtt__find_table($data2,$fontstart,14158)|0); $12 = ((($info)) + 32|0); HEAP32[$12>>2] = $11; $13 = (_stbtt__find_table($data2,$fontstart,14163)|0); $14 = ((($info)) + 36|0); HEAP32[$14>>2] = $13; $15 = ($2|0)==(0); if ($15) { $$0 = 0; return ($$0|0); } $16 = HEAP32[$4>>2]|0; $17 = ($16|0)==(0); if ($17) { $$0 = 0; return ($$0|0); } $18 = HEAP32[$6>>2]|0; $19 = ($18|0)==(0); if ($19) { $$0 = 0; return ($$0|0); } $20 = HEAP32[$8>>2]|0; $21 = ($20|0)==(0); if ($21) { $$0 = 0; return ($$0|0); } $22 = HEAP32[$10>>2]|0; $23 = ($22|0)==(0); if ($23) { $$0 = 0; return ($$0|0); } $24 = HEAP32[$12>>2]|0; $25 = ($24|0)==(0); if ($25) { $$0 = 0; return ($$0|0); } $26 = (_stbtt__find_table($data2,$fontstart,14168)|0); $27 = ($26|0)==(0); if ($27) { $32 = ((($info)) + 12|0); HEAP32[$32>>2] = 65535; } else { $$sum5 = (($26) + 4)|0; $28 = (($data2) + ($$sum5)|0); $29 = (_ttUSHORT($28)|0); $30 = $29&65535; $31 = ((($info)) + 12|0); HEAP32[$31>>2] = $30; } $$sum = (($2) + 2)|0; $33 = (($data2) + ($$sum)|0); $34 = (_ttUSHORT($33)|0); $35 = ((($info)) + 40|0); HEAP32[$35>>2] = 0; $36 = ($34<<16>>16)==(0); if ($36) { $$0 = 0; return ($$0|0); } $37 = (($2) + 4)|0; $38 = $34&65535; $i$06 = 0; while(1) { $39 = $i$06 << 3; $40 = (($37) + ($39))|0; $41 = (($data2) + ($40)|0); $42 = (_ttUSHORT($41)|0); $43 = $42&65535; L28: do { switch ($43|0) { case 3: { $$sum3 = (($40) + 2)|0; $44 = (($data2) + ($$sum3)|0); $45 = (_ttUSHORT($44)|0); $46 = $45&65535; switch ($46|0) { case 10: case 1: { break; } default: { break L28; } } $$sum4 = (($40) + 4)|0; $47 = (($data2) + ($$sum4)|0); $48 = (_ttULONG($47)|0); $49 = (($48) + ($2))|0; HEAP32[$35>>2] = $49; break; } case 0: { $$sum2 = (($40) + 4)|0; $50 = (($data2) + ($$sum2)|0); $51 = (_ttULONG($50)|0); $52 = (($51) + ($2))|0; HEAP32[$35>>2] = $52; break; } default: { } } } while(0); $53 = (($i$06) + 1)|0; $exitcond = ($53|0)==($38|0); if ($exitcond) { break; } else { $i$06 = $53; } } $$pr = HEAP32[$35>>2]|0; $54 = ($$pr|0)==(0); if ($54) { $$0 = 0; return ($$0|0); } $55 = HEAP32[$6>>2]|0; $$sum1 = (($55) + 50)|0; $56 = (($data2) + ($$sum1)|0); $57 = (_ttUSHORT($56)|0); $58 = $57&65535; $59 = ((($info)) + 44|0); HEAP32[$59>>2] = $58; $$0 = 1; return ($$0|0); } function _stbtt_FindGlyphIndex($info,$unicode_codepoint) { $info = $info|0; $unicode_codepoint = $unicode_codepoint|0; var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa50 = 0, $$lcssa50$lcssa = 0, $$neg = 0, $$search$1 = 0, $$sum = 0, $$sum1 = 0, $$sum10 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum19 = 0, $$sum2 = 0, $$sum2$lcssa = 0, $$sum2$lcssa$lcssa = 0; var $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum32 = 0, $$sum33 = 0, $$sum34 = 0, $$sum4 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0; var $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0; var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0; var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0; var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $entrySelector$039 = 0, $high$0 = 0, $high$0$lcssa49 = 0, $high$0$ph = 0, $low$0$ph = 0, $search$1$lcssa = 0, $search$138 = 0, $searchRange$040 = 0, $switch = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($info)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ((($info)) + 40|0); $3 = HEAP32[$2>>2]|0; $4 = (($1) + ($3)|0); $5 = (_ttUSHORT($4)|0); switch ($5<<16>>16) { case 0: { $$sum32 = (($3) + 2)|0; $6 = (($1) + ($$sum32)|0); $7 = (_ttUSHORT($6)|0); $8 = $7&65535; $9 = (($8) + -6)|0; $10 = ($9|0)>($unicode_codepoint|0); if (!($10)) { $$0 = 0; return ($$0|0); } $$sum33 = (($unicode_codepoint) + 6)|0; $$sum34 = (($$sum33) + ($3))|0; $11 = (($1) + ($$sum34)|0); $12 = HEAP8[$11>>0]|0; $13 = $12&255; $$0 = $13; return ($$0|0); break; } case 6: { $$sum28 = (($3) + 6)|0; $14 = (($1) + ($$sum28)|0); $15 = (_ttUSHORT($14)|0); $16 = $15&65535; $17 = ($16>>>0)>($unicode_codepoint>>>0); if ($17) { $$0 = 0; return ($$0|0); } $$sum29 = (($3) + 8)|0; $18 = (($1) + ($$sum29)|0); $19 = (_ttUSHORT($18)|0); $20 = $19&65535; $21 = (($20) + ($16))|0; $22 = ($21>>>0)>($unicode_codepoint>>>0); if (!($22)) { $$0 = 0; return ($$0|0); } $$sum30 = (($3) + 10)|0; $23 = (($unicode_codepoint) - ($16))|0; $24 = $23 << 1; $$sum31 = (($$sum30) + ($24))|0; $25 = (($1) + ($$sum31)|0); $26 = (_ttUSHORT($25)|0); $27 = $26&65535; $$0 = $27; return ($$0|0); break; } case 2: { ___assert_fail((19474|0),(14173|0),1094,(14190|0)); // unreachable; break; } case 4: { $$sum5 = (($3) + 6)|0; $28 = (($1) + ($$sum5)|0); $29 = (_ttUSHORT($28)|0); $30 = ($29&65535) >>> 1; $31 = (($3) + 14)|0; $32 = ($unicode_codepoint|0)>(65535); if ($32) { $$0 = 0; return ($$0|0); } $$sum8 = (($3) + 12)|0; $33 = (($1) + ($$sum8)|0); $34 = (_ttUSHORT($33)|0); $$sum7 = (($3) + 10)|0; $35 = (($1) + ($$sum7)|0); $36 = (_ttUSHORT($35)|0); $37 = ($34&65535) >>> 1; $38 = $37&65535; $39 = $38 << 1; $$sum9 = (($39) + ($31))|0; $40 = (($1) + ($$sum9)|0); $41 = (_ttUSHORT($40)|0); $42 = $41&65535; $43 = ($42|0)>($unicode_codepoint|0); $$ = $43 ? $31 : $$sum9; $44 = (($$) + -2)|0; $45 = ($36<<16>>16)==(0); if ($45) { $search$1$lcssa = $44; } else { $$sum6 = (($3) + 8)|0; $46 = (($1) + ($$sum6)|0); $47 = (_ttUSHORT($46)|0); $48 = ($47&65535) >>> 1; $entrySelector$039 = $36;$search$138 = $44;$searchRange$040 = $48; while(1) { $49 = ($searchRange$040&65535) >>> 1; $50 = $49&65535; $51 = $50 << 1; $$sum27 = (($51) + ($search$138))|0; $52 = (($1) + ($$sum27)|0); $53 = (_ttUSHORT($52)|0); $54 = $53&65535; $55 = ($54|0)<($unicode_codepoint|0); $$search$1 = $55 ? $$sum27 : $search$138; $56 = (($entrySelector$039) + -1)<<16>>16; $57 = ($56<<16>>16)==(0); if ($57) { $search$1$lcssa = $$search$1; break; } else { $entrySelector$039 = $56;$search$138 = $$search$1;$searchRange$040 = $49; } } } $$neg = (-14 - ($3))|0; $58 = (($$neg) + 2)|0; $59 = (($58) + ($search$1$lcssa))|0; $60 = $59 & 131070; $$sum10 = (($60) + ($31))|0; $61 = (($1) + ($$sum10)|0); $62 = (_ttUSHORT($61)|0); $63 = $62&65535; $64 = ($63|0)<($unicode_codepoint|0); if ($64) { ___assert_fail((14211|0),(14173|0),1130,(14190|0)); // unreachable; } $65 = $30&65535; $66 = $65 << 1; $$sum12 = (($3) + 16)|0; $$sum13 = (($$sum12) + ($66))|0; $$sum14 = (($$sum13) + ($60))|0; $67 = (($1) + ($$sum14)|0); $68 = (_ttUSHORT($67)|0); $69 = $68&65535; $70 = ($69|0)>($unicode_codepoint|0); if ($70) { $$0 = 0; return ($$0|0); } $71 = ($65*6)|0; $$sum15 = (($3) + 16)|0; $$sum16 = (($$sum15) + ($71))|0; $$sum17 = (($$sum16) + ($60))|0; $72 = (($1) + ($$sum17)|0); $73 = (_ttUSHORT($72)|0); $74 = ($73<<16>>16)==(0); if ($74) { $75 = $65 << 2; $$sum24 = (($3) + 16)|0; $$sum25 = (($$sum24) + ($75))|0; $$sum26 = (($$sum25) + ($60))|0; $76 = (($1) + ($$sum26)|0); $77 = (_ttSHORT($76)|0); $78 = $77&65535; $79 = (($78) + ($unicode_codepoint))|0; $80 = $79 & 65535; $$0 = $80; return ($$0|0); } else { $81 = $73&65535; $82 = (($unicode_codepoint) - ($69))|0; $83 = $82 << 1; $$sum19 = (($3) + 16)|0; $$sum20 = (($$sum19) + ($71))|0; $$sum21 = (($$sum20) + ($60))|0; $$sum22 = (($$sum21) + ($83))|0; $$sum23 = (($$sum22) + ($81))|0; $84 = (($1) + ($$sum23)|0); $85 = (_ttUSHORT($84)|0); $86 = $85&65535; $$0 = $86; return ($$0|0); } break; } default: { $87 = ($5<<16>>16)==(12); $88 = $5 & -2; $switch = ($88<<16>>16)==(12); if (!($switch)) { ___assert_fail((19474|0),(14173|0),1165,(14190|0)); // unreachable; } $$sum = (($3) + 12)|0; $89 = (($1) + ($$sum)|0); $90 = (_ttULONG($89)|0); $$sum1 = (($3) + 16)|0; $high$0$ph = $90;$low$0$ph = 0; L6: while(1) { $high$0 = $high$0$ph; while(1) { $91 = ($high$0|0)>($low$0$ph|0); if (!($91)) { $$0 = 0; label = 27; break L6; } $92 = (($high$0) - ($low$0$ph))|0; $93 = $92 >> 1; $94 = (($93) + ($low$0$ph))|0; $95 = ($94*12)|0; $$sum2 = (($$sum1) + ($95))|0; $96 = (($1) + ($$sum2)|0); $97 = (_ttULONG($96)|0); $98 = ($97>>>0)>($unicode_codepoint>>>0); if ($98) { $high$0 = $94; } else { $$lcssa = $94;$$lcssa50 = $97;$$sum2$lcssa = $$sum2;$high$0$lcssa49 = $high$0; break; } } $$sum3 = (($$sum2$lcssa) + 4)|0; $99 = (($1) + ($$sum3)|0); $100 = (_ttULONG($99)|0); $101 = ($100>>>0)<($unicode_codepoint>>>0); $102 = (($$lcssa) + 1)|0; if ($101) { $high$0$ph = $high$0$lcssa49;$low$0$ph = $102; } else { $$lcssa50$lcssa = $$lcssa50;$$sum2$lcssa$lcssa = $$sum2$lcssa; break; } } if ((label|0) == 27) { return ($$0|0); } $$sum4 = (($$sum2$lcssa$lcssa) + 8)|0; $103 = (($1) + ($$sum4)|0); $104 = (_ttULONG($103)|0); if (!($87)) { $$0 = $104; return ($$0|0); } $105 = (($unicode_codepoint) - ($$lcssa50$lcssa))|0; $106 = (($105) + ($104))|0; $$0 = $106; return ($$0|0); } } return (0)|0; } function _stbtt_GetGlyphShape($info,$glyph_index,$pvertices) { $info = $info|0; $glyph_index = $glyph_index|0; $pvertices = $pvertices|0; var $$0 = 0, $$sum = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0; var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0; var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0; var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0.0; var $163 = 0, $164 = 0, $165 = 0.0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0, $180 = 0; var $181 = 0, $182 = 0, $183 = 0.0, $184 = 0.0, $185 = 0, $186 = 0, $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0.0, $195 = 0.0, $196 = 0, $197 = 0, $198 = 0.0, $199 = 0.0; var $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0.0, $203 = 0.0, $204 = 0, $205 = 0, $206 = 0, $207 = 0.0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0, $211 = 0.0, $212 = 0.0, $213 = 0.0, $214 = 0.0, $215 = 0.0, $216 = 0.0; var $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0.0, $226 = 0.0, $227 = 0.0, $228 = 0.0, $229 = 0.0, $23 = 0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0.0, $234 = 0.0; var $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0.0, $244 = 0.0, $245 = 0.0, $246 = 0.0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0, $250 = 0, $251 = 0.0, $252 = 0.0; var $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0; var $271 = 0, $272 = 0, $273 = 0, $274 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; var $97 = 0, $98 = 0, $99 = 0, $comp$046 = 0, $comp$1 = 0, $comp$2 = 0, $comp_verts = 0, $cx$024 = 0, $cx$1 = 0, $cx$1$lcssa = 0, $cy$025 = 0, $cy$1 = 0, $cy$1$lcssa = 0, $exitcond = 0, $exitcond51 = 0, $exitcond52 = 0, $exitcond53 = 0, $flagcount$043 = 0, $flagcount$1 = 0, $flags$044 = 0; var $flags$1 = 0, $i$042 = 0, $i$140 = 0, $i$237 = 0, $i$333 = 0, $i$4 = 0, $i$5 = 0, $i2$045 = 0, $j$032 = 0, $j$1 = 0, $mtx$sroa$0$0 = 0.0, $mtx$sroa$15$0 = 0.0, $mtx$sroa$22$0 = 0.0, $mtx$sroa$29$0 = 0.0, $mtx$sroa$33$0 = 0.0, $mtx$sroa$8$0 = 0.0, $next_move$031 = 0, $next_move$1 = 0, $num_vertices$034 = 0, $num_vertices$1 = 0; var $num_vertices$3 = 0, $num_vertices$3$lcssa = 0, $num_vertices$447 = 0, $num_vertices$5 = 0, $num_vertices$6 = 0, $points$041 = 0, $points$1 = 0, $points$1$lcssa = 0, $points$239 = 0, $points$3 = 0, $points$3$lcssa = 0, $points$436 = 0, $points$5 = 0, $scx$028 = 0, $scx$1 = 0, $scx$2 = 0, $scx$2$lcssa = 0, $scy$029 = 0, $scy$1 = 0, $scy$2 = 0; var $scy$2$lcssa = 0, $sext = 0, $sext8 = 0, $sqrtf = 0.0, $sqrtf1 = 0.0, $start_off$023 = 0, $start_off$1 = 0, $start_off$1$lcssa = 0, $sx$026 = 0, $sx$1 = 0, $sx$2 = 0, $sx$2$lcssa = 0, $sy$027 = 0, $sy$1 = 0, $sy$2 = 0, $sy$2$lcssa = 0, $vertices$048 = 0, $vertices$048$lcssa60 = 0, $vertices$1 = 0, $vertices$2 = 0; var $was_off$030 = 0, $was_off$1 = 0, $was_off$1$lcssa = 0, $x$038 = 0, $x$1 = 0, $y$035 = 0, $y$1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $comp_verts = sp; $0 = ((($info)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = (_stbtt__GetGlyfOffset($info,$glyph_index)|0); HEAP32[$pvertices>>2] = 0; $3 = ($2|0)<(0); if ($3) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $4 = (($1) + ($2)|0); $5 = (_ttSHORT($4)|0); $6 = ($5<<16>>16)>(0); L4: do { if ($6) { $7 = $5 << 16 >> 16; $$sum2 = (($2) + 10)|0; $8 = $7 << 1; $$sum3 = (($8) + ($$sum2))|0; $9 = (($1) + ($$sum3)|0); $10 = (_ttUSHORT($9)|0); $$sum6 = (($$sum3) + -2)|0; $11 = (($1) + ($$sum6)|0); $12 = (_ttUSHORT($11)|0); $13 = $12&65535; $14 = (($13) + 1)|0; $15 = (($14) + ($8))|0; $16 = ($15*10)|0; $17 = (_malloc($16)|0); $18 = ($17|0)==(0|0); if ($18) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $$sum4 = (($$sum3) + 2)|0; $19 = $10&65535; $$sum5 = (($$sum4) + ($19))|0; $20 = (($1) + ($$sum5)|0); $21 = $12&65535; $flagcount$043 = 0;$flags$044 = 0;$i$042 = 0;$points$041 = $20; while(1) { $23 = ($flagcount$043<<24>>24)==(0); if ($23) { $24 = ((($points$041)) + 1|0); $25 = HEAP8[$points$041>>0]|0; $26 = $25 & 8; $27 = ($26<<24>>24)==(0); if ($27) { $flagcount$1 = 0;$flags$1 = $25;$points$1 = $24; } else { $28 = ((($points$041)) + 2|0); $29 = HEAP8[$24>>0]|0; $flagcount$1 = $29;$flags$1 = $25;$points$1 = $28; } } else { $30 = (($flagcount$043) + -1)<<24>>24; $flagcount$1 = $30;$flags$1 = $flags$044;$points$1 = $points$041; } $31 = (($i$042) + ($8))|0; $32 = (((($17) + (($31*10)|0)|0)) + 8|0); HEAP8[$32>>0] = $flags$1; $33 = (($i$042) + 1)|0; $exitcond52 = ($i$042|0)==($21|0); if ($exitcond52) { $points$1$lcssa = $points$1; break; } else { $flagcount$043 = $flagcount$1;$flags$044 = $flags$1;$i$042 = $33;$points$041 = $points$1; } } $22 = $12&65535; $i$140 = 0;$points$239 = $points$1$lcssa;$x$038 = 0; while(1) { $35 = (($i$140) + ($8))|0; $36 = (((($17) + (($35*10)|0)|0)) + 8|0); $37 = HEAP8[$36>>0]|0; $38 = $37&255; $39 = $38 & 2; $40 = ($39|0)==(0); if ($40) { $49 = $38 & 16; $50 = ($49|0)==(0); if ($50) { $51 = HEAP8[$points$239>>0]|0; $52 = $51&255; $53 = $52 << 8; $54 = ((($points$239)) + 1|0); $55 = HEAP8[$54>>0]|0; $56 = $55&255; $57 = $53 | $56; $sext8 = $57 << 16; $58 = $sext8 >> 16; $59 = (($58) + ($x$038))|0; $60 = ((($points$239)) + 2|0); $points$3 = $60;$x$1 = $59; } else { $points$3 = $points$239;$x$1 = $x$038; } } else { $41 = ((($points$239)) + 1|0); $42 = HEAP8[$points$239>>0]|0; $43 = $38 & 16; $44 = ($43|0)!=(0); $45 = $42&255; $46 = (0 - ($45))|0; $47 = $44 ? $45 : $46; $48 = (($47) + ($x$038))|0; $points$3 = $41;$x$1 = $48; } $61 = $x$1&65535; $62 = (($17) + (($35*10)|0)|0); HEAP16[$62>>1] = $61; $63 = (($i$140) + 1)|0; $exitcond51 = ($i$140|0)==($22|0); if ($exitcond51) { $points$3$lcssa = $points$3; break; } else { $i$140 = $63;$points$239 = $points$3;$x$038 = $x$1; } } $34 = $12&65535; $i$237 = 0;$points$436 = $points$3$lcssa;$y$035 = 0; while(1) { $64 = (($i$237) + ($8))|0; $65 = (((($17) + (($64*10)|0)|0)) + 8|0); $66 = HEAP8[$65>>0]|0; $67 = $66&255; $68 = $67 & 4; $69 = ($68|0)==(0); if ($69) { $78 = $67 & 32; $79 = ($78|0)==(0); if ($79) { $80 = HEAP8[$points$436>>0]|0; $81 = $80&255; $82 = $81 << 8; $83 = ((($points$436)) + 1|0); $84 = HEAP8[$83>>0]|0; $85 = $84&255; $86 = $82 | $85; $sext = $86 << 16; $87 = $sext >> 16; $88 = (($87) + ($y$035))|0; $89 = ((($points$436)) + 2|0); $points$5 = $89;$y$1 = $88; } else { $points$5 = $points$436;$y$1 = $y$035; } } else { $70 = ((($points$436)) + 1|0); $71 = HEAP8[$points$436>>0]|0; $72 = $67 & 32; $73 = ($72|0)!=(0); $74 = $71&255; $75 = (0 - ($74))|0; $76 = $73 ? $74 : $75; $77 = (($76) + ($y$035))|0; $points$5 = $70;$y$1 = $77; } $90 = $y$1&65535; $91 = (((($17) + (($64*10)|0)|0)) + 2|0); HEAP16[$91>>1] = $90; $92 = (($i$237) + 1)|0; $exitcond = ($i$237|0)==($34|0); if ($exitcond) { $cx$024 = 0;$cy$025 = 0;$i$333 = 0;$j$032 = 0;$next_move$031 = 0;$num_vertices$034 = 0;$scx$028 = 0;$scy$029 = 0;$start_off$023 = 0;$sx$026 = 0;$sy$027 = 0;$was_off$030 = 0; break; } else { $i$237 = $92;$points$436 = $points$5;$y$035 = $y$1; } } while(1) { $93 = (($i$333) + ($8))|0; $94 = (((($17) + (($93*10)|0)|0)) + 8|0); $95 = HEAP8[$94>>0]|0; $96 = (($17) + (($93*10)|0)|0); $97 = HEAP16[$96>>1]|0; $98 = $97 << 16 >> 16; $99 = (((($17) + (($93*10)|0)|0)) + 2|0); $100 = HEAP16[$99>>1]|0; $101 = $100 << 16 >> 16; $102 = ($next_move$031|0)==($i$333|0); do { if ($102) { $103 = ($i$333|0)==(0); if ($103) { $num_vertices$1 = $num_vertices$034; } else { $104 = (_stbtt__close_shape($17,$num_vertices$034,$was_off$030,$start_off$023,$sx$026,$sy$027,$scx$028,$scy$029,$cx$024,$cy$025)|0); $num_vertices$1 = $104; } $105 = $95 & 1; $106 = ($105<<24>>24)==(0); $107 = $105 ^ 1; $108 = $107&255; do { if ($106) { $109 = (($93) + 1)|0; $110 = (((($17) + (($109*10)|0)|0)) + 8|0); $111 = HEAP8[$110>>0]|0; $112 = $111 & 1; $113 = ($112<<24>>24)==(0); $114 = (($17) + (($109*10)|0)|0); $115 = HEAP16[$114>>1]|0; $116 = $115 << 16 >> 16; if ($113) { $117 = (($116) + ($98))|0; $118 = $117 >> 1; $119 = (((($17) + (($109*10)|0)|0)) + 2|0); $120 = HEAP16[$119>>1]|0; $121 = $120 << 16 >> 16; $122 = (($121) + ($101))|0; $123 = $122 >> 1; $i$4 = $i$333;$scx$1 = $98;$scy$1 = $101;$sx$1 = $118;$sy$1 = $123; break; } else { $124 = (((($17) + (($109*10)|0)|0)) + 2|0); $125 = HEAP16[$124>>1]|0; $126 = $125 << 16 >> 16; $127 = (($i$333) + 1)|0; $i$4 = $127;$scx$1 = $98;$scy$1 = $101;$sx$1 = $116;$sy$1 = $126; break; } } else { $i$4 = $i$333;$scx$1 = $scx$028;$scy$1 = $scy$029;$sx$1 = $98;$sy$1 = $101; } } while(0); $128 = (($num_vertices$1) + 1)|0; $129 = (($17) + (($num_vertices$1*10)|0)|0); _stbtt_setvertex($129,1,$sx$1,$sy$1,0,0); $130 = $j$032 << 1; $$sum7 = (($130) + ($$sum2))|0; $131 = (($1) + ($$sum7)|0); $132 = (_ttUSHORT($131)|0); $133 = $132&65535; $134 = (($133) + 1)|0; $135 = (($j$032) + 1)|0; $cx$1 = $cx$024;$cy$1 = $cy$025;$i$5 = $i$4;$j$1 = $135;$next_move$1 = $134;$num_vertices$3 = $128;$scx$2 = $scx$1;$scy$2 = $scy$1;$start_off$1 = $108;$sx$2 = $sx$1;$sy$2 = $sy$1;$was_off$1 = 0; } else { $136 = $95 & 1; $137 = ($136<<24>>24)==(0); $138 = ($was_off$030|0)!=(0); if ($137) { if (!($138)) { $cx$1 = $98;$cy$1 = $101;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $num_vertices$034;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 1; break; } $139 = (($num_vertices$034) + 1)|0; $140 = (($17) + (($num_vertices$034*10)|0)|0); $141 = (($98) + ($cx$024))|0; $142 = $141 >> 1; $143 = (($101) + ($cy$025))|0; $144 = $143 >> 1; _stbtt_setvertex($140,3,$142,$144,$cx$024,$cy$025); $cx$1 = $98;$cy$1 = $101;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $139;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 1; break; } $145 = (($num_vertices$034) + 1)|0; $146 = (($17) + (($num_vertices$034*10)|0)|0); if ($138) { _stbtt_setvertex($146,3,$98,$101,$cx$024,$cy$025); $cx$1 = $cx$024;$cy$1 = $cy$025;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $145;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 0; break; } else { _stbtt_setvertex($146,2,$98,$101,0,0); $cx$1 = $cx$024;$cy$1 = $cy$025;$i$5 = $i$333;$j$1 = $j$032;$next_move$1 = $next_move$031;$num_vertices$3 = $145;$scx$2 = $scx$028;$scy$2 = $scy$029;$start_off$1 = $start_off$023;$sx$2 = $sx$026;$sy$2 = $sy$027;$was_off$1 = 0; break; } } } while(0); $147 = (($i$5) + 1)|0; $148 = ($147|0)<($14|0); if ($148) { $cx$024 = $cx$1;$cy$025 = $cy$1;$i$333 = $147;$j$032 = $j$1;$next_move$031 = $next_move$1;$num_vertices$034 = $num_vertices$3;$scx$028 = $scx$2;$scy$029 = $scy$2;$start_off$023 = $start_off$1;$sx$026 = $sx$2;$sy$027 = $sy$2;$was_off$030 = $was_off$1; } else { $cx$1$lcssa = $cx$1;$cy$1$lcssa = $cy$1;$num_vertices$3$lcssa = $num_vertices$3;$scx$2$lcssa = $scx$2;$scy$2$lcssa = $scy$2;$start_off$1$lcssa = $start_off$1;$sx$2$lcssa = $sx$2;$sy$2$lcssa = $sy$2;$was_off$1$lcssa = $was_off$1; break; } } $149 = (_stbtt__close_shape($17,$num_vertices$3$lcssa,$was_off$1$lcssa,$start_off$1$lcssa,$sx$2$lcssa,$sy$2$lcssa,$scx$2$lcssa,$scy$2$lcssa,$cx$1$lcssa,$cy$1$lcssa)|0); $num_vertices$6 = $149;$vertices$2 = $17; } else { $150 = ($5<<16>>16)==(-1); if (!($150)) { $274 = ($5<<16>>16)<(0); if (!($274)) { $num_vertices$6 = 0;$vertices$2 = 0; break; } ___assert_fail((19474|0),(14173|0),1460,(14267|0)); // unreachable; } $$sum = (($2) + 10)|0; $151 = (($1) + ($$sum)|0); $comp$046 = $151;$num_vertices$447 = 0;$vertices$048 = 0; while(1) { HEAP32[$comp_verts>>2] = 0; $152 = (_ttSHORT($comp$046)|0); $153 = ((($comp$046)) + 2|0); $154 = (_ttSHORT($153)|0); $155 = ((($comp$046)) + 4|0); $156 = $152&65535; $157 = $156 & 2; $158 = ($157|0)==(0); if ($158) { label = 44; break; } $159 = $156 & 1; $160 = ($159|0)==(0); if ($160) { $167 = HEAP8[$155>>0]|0; $168 = (+($167<<24>>24)); $169 = ((($comp$046)) + 5|0); $170 = HEAP8[$169>>0]|0; $171 = (+($170<<24>>24)); $172 = ((($comp$046)) + 6|0); $179 = 8;$190 = 10;$205 = 12;$210 = 14;$comp$1 = $172;$mtx$sroa$29$0 = $168;$mtx$sroa$33$0 = $171; } else { $161 = (_ttSHORT($155)|0); $162 = (+($161<<16>>16)); $163 = ((($comp$046)) + 6|0); $164 = (_ttSHORT($163)|0); $165 = (+($164<<16>>16)); $166 = ((($comp$046)) + 8|0); $179 = 10;$190 = 12;$205 = 14;$210 = 16;$comp$1 = $166;$mtx$sroa$29$0 = $162;$mtx$sroa$33$0 = $165; } $173 = $156 & 8; $174 = ($173|0)==(0); do { if ($174) { $180 = $156 & 64; $181 = ($180|0)==(0); if (!($181)) { $182 = (_ttSHORT($comp$1)|0); $183 = (+($182<<16>>16)); $184 = $183 * 6.103515625E-5; $185 = (($comp$046) + ($179)|0); $186 = (_ttSHORT($185)|0); $187 = (+($186<<16>>16)); $188 = $187 * 6.103515625E-5; $189 = (($comp$046) + ($190)|0); $comp$2 = $189;$mtx$sroa$0$0 = $184;$mtx$sroa$15$0 = 0.0;$mtx$sroa$22$0 = $188;$mtx$sroa$8$0 = 0.0; break; } $191 = $156 & 128; $192 = ($191|0)==(0); if ($192) { $comp$2 = $comp$1;$mtx$sroa$0$0 = 1.0;$mtx$sroa$15$0 = 0.0;$mtx$sroa$22$0 = 1.0;$mtx$sroa$8$0 = 0.0; } else { $193 = (_ttSHORT($comp$1)|0); $194 = (+($193<<16>>16)); $195 = $194 * 6.103515625E-5; $196 = (($comp$046) + ($179)|0); $197 = (_ttSHORT($196)|0); $198 = (+($197<<16>>16)); $199 = $198 * 6.103515625E-5; $200 = (($comp$046) + ($190)|0); $201 = (_ttSHORT($200)|0); $202 = (+($201<<16>>16)); $203 = $202 * 6.103515625E-5; $204 = (($comp$046) + ($205)|0); $206 = (_ttSHORT($204)|0); $207 = (+($206<<16>>16)); $208 = $207 * 6.103515625E-5; $209 = (($comp$046) + ($210)|0); $comp$2 = $209;$mtx$sroa$0$0 = $195;$mtx$sroa$15$0 = $203;$mtx$sroa$22$0 = $208;$mtx$sroa$8$0 = $199; } } else { $175 = (_ttSHORT($comp$1)|0); $176 = (+($175<<16>>16)); $177 = $176 * 6.103515625E-5; $178 = (($comp$046) + ($179)|0); $comp$2 = $178;$mtx$sroa$0$0 = $177;$mtx$sroa$15$0 = 0.0;$mtx$sroa$22$0 = $177;$mtx$sroa$8$0 = 0.0; } } while(0); $211 = $mtx$sroa$0$0 * $mtx$sroa$0$0; $212 = $mtx$sroa$8$0 * $mtx$sroa$8$0; $213 = $212 + $211; $sqrtf = (+Math_sqrt((+$213))); $214 = $mtx$sroa$15$0 * $mtx$sroa$15$0; $215 = $mtx$sroa$22$0 * $mtx$sroa$22$0; $216 = $215 + $214; $sqrtf1 = (+Math_sqrt((+$216))); $217 = $154&65535; $218 = (_stbtt_GetGlyphShape($info,$217,$comp_verts)|0); $219 = ($218|0)>(0); if ($219) { $220 = HEAP32[$comp_verts>>2]|0; $i2$045 = 0; while(1) { $221 = (($220) + (($i2$045*10)|0)|0); $222 = HEAP16[$221>>1]|0; $223 = (((($220) + (($i2$045*10)|0)|0)) + 2|0); $224 = HEAP16[$223>>1]|0; $225 = (+($222<<16>>16)); $226 = $mtx$sroa$0$0 * $225; $227 = (+($224<<16>>16)); $228 = $mtx$sroa$15$0 * $227; $229 = $226 + $228; $230 = $mtx$sroa$29$0 + $229; $231 = $sqrtf * $230; $232 = (~~(($231))); HEAP16[$221>>1] = $232; $233 = $mtx$sroa$8$0 * $225; $234 = $mtx$sroa$22$0 * $227; $235 = $233 + $234; $236 = $mtx$sroa$33$0 + $235; $237 = $sqrtf1 * $236; $238 = (~~(($237))); HEAP16[$223>>1] = $238; $239 = (((($220) + (($i2$045*10)|0)|0)) + 4|0); $240 = HEAP16[$239>>1]|0; $241 = (((($220) + (($i2$045*10)|0)|0)) + 6|0); $242 = HEAP16[$241>>1]|0; $243 = (+($240<<16>>16)); $244 = $mtx$sroa$0$0 * $243; $245 = (+($242<<16>>16)); $246 = $mtx$sroa$15$0 * $245; $247 = $244 + $246; $248 = $mtx$sroa$29$0 + $247; $249 = $sqrtf * $248; $250 = (~~(($249))); HEAP16[$239>>1] = $250; $251 = $mtx$sroa$8$0 * $243; $252 = $mtx$sroa$22$0 * $245; $253 = $251 + $252; $254 = $mtx$sroa$33$0 + $253; $255 = $sqrtf1 * $254; $256 = (~~(($255))); HEAP16[$241>>1] = $256; $257 = (($i2$045) + 1)|0; $exitcond53 = ($257|0)==($218|0); if ($exitcond53) { break; } else { $i2$045 = $257; } } $258 = (($218) + ($num_vertices$447))|0; $259 = ($258*10)|0; $260 = (_malloc($259)|0); $261 = ($260|0)==(0|0); if ($261) { $vertices$048$lcssa60 = $vertices$048; break; } $265 = ($num_vertices$447|0)>(0); if ($265) { $266 = ($num_vertices$447*10)|0; _memcpy(($260|0),($vertices$048|0),($266|0))|0; } $267 = (($260) + (($num_vertices$447*10)|0)|0); $268 = HEAP32[$comp_verts>>2]|0; $269 = ($218*10)|0; _memcpy(($267|0),($268|0),($269|0))|0; $270 = ($vertices$048|0)==(0|0); if (!($270)) { _free($vertices$048); } $271 = HEAP32[$comp_verts>>2]|0; _free($271); $num_vertices$5 = $258;$vertices$1 = $260; } else { $num_vertices$5 = $num_vertices$447;$vertices$1 = $vertices$048; } $272 = $156 & 32; $273 = ($272|0)==(0); if ($273) { $num_vertices$6 = $num_vertices$5;$vertices$2 = $vertices$1; break L4; } else { $comp$046 = $comp$2;$num_vertices$447 = $num_vertices$5;$vertices$048 = $vertices$1; } } if ((label|0) == 44) { ___assert_fail((19474|0),(14173|0),1407,(14267|0)); // unreachable; } $262 = ($vertices$048$lcssa60|0)==(0|0); if (!($262)) { _free($vertices$048$lcssa60); } $263 = HEAP32[$comp_verts>>2]|0; $264 = ($263|0)==(0|0); if ($264) { $$0 = 0; STACKTOP = sp;return ($$0|0); } _free($263); $$0 = 0; STACKTOP = sp;return ($$0|0); } } while(0); HEAP32[$pvertices>>2] = $vertices$2; $$0 = $num_vertices$6; STACKTOP = sp;return ($$0|0); } function _stbtt_GetGlyphBox($info,$glyph_index,$x0,$y0,$x1,$y1) { $info = $info|0; $glyph_index = $glyph_index|0; $x0 = $x0|0; $y0 = $y0|0; $x1 = $x1|0; $y1 = $y1|0; var $$0 = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbtt__GetGlyfOffset($info,$glyph_index)|0); $1 = ($0|0)<(0); if ($1) { $$0 = 0; return ($$0|0); } $2 = ($x0|0)==(0|0); if (!($2)) { $3 = ((($info)) + 4|0); $4 = HEAP32[$3>>2]|0; $$sum3 = (($0) + 2)|0; $5 = (($4) + ($$sum3)|0); $6 = (_ttSHORT($5)|0); $7 = $6 << 16 >> 16; HEAP32[$x0>>2] = $7; } $8 = ($y0|0)==(0|0); if (!($8)) { $9 = ((($info)) + 4|0); $10 = HEAP32[$9>>2]|0; $$sum2 = (($0) + 4)|0; $11 = (($10) + ($$sum2)|0); $12 = (_ttSHORT($11)|0); $13 = $12 << 16 >> 16; HEAP32[$y0>>2] = $13; } $14 = ($x1|0)==(0|0); if (!($14)) { $15 = ((($info)) + 4|0); $16 = HEAP32[$15>>2]|0; $$sum1 = (($0) + 6)|0; $17 = (($16) + ($$sum1)|0); $18 = (_ttSHORT($17)|0); $19 = $18 << 16 >> 16; HEAP32[$x1>>2] = $19; } $20 = ($y1|0)==(0|0); if ($20) { $$0 = 1; return ($$0|0); } $21 = ((($info)) + 4|0); $22 = HEAP32[$21>>2]|0; $$sum = (($0) + 8)|0; $23 = (($22) + ($$sum)|0); $24 = (_ttSHORT($23)|0); $25 = $24 << 16 >> 16; HEAP32[$y1>>2] = $25; $$0 = 1; return ($$0|0); } function _stbtt_GetGlyphHMetrics($info,$glyph_index,$advanceWidth,$leftSideBearing) { $info = $info|0; $glyph_index = $glyph_index|0; $advanceWidth = $advanceWidth|0; $leftSideBearing = $leftSideBearing|0; var $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum47 = 0, $$sum5 = 0, $$sum6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; var $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($info)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ((($info)) + 28|0); $3 = HEAP32[$2>>2]|0; $$sum = (($3) + 34)|0; $4 = (($1) + ($$sum)|0); $5 = (_ttUSHORT($4)|0); $6 = $5&65535; $7 = ($6|0)>($glyph_index|0); $8 = ($advanceWidth|0)!=(0|0); if ($7) { if ($8) { $9 = ((($info)) + 32|0); $10 = HEAP32[$9>>2]|0; $11 = $glyph_index << 2; $$sum6 = (($10) + ($11))|0; $12 = (($1) + ($$sum6)|0); $13 = (_ttSHORT($12)|0); $14 = $13 << 16 >> 16; HEAP32[$advanceWidth>>2] = $14; } $15 = ($leftSideBearing|0)==(0|0); if ($15) { return; } $16 = HEAP32[$0>>2]|0; $17 = ((($info)) + 32|0); $18 = HEAP32[$17>>2]|0; $19 = $glyph_index << 2; $$sum47 = $19 | 2; $$sum5 = (($$sum47) + ($18))|0; $20 = (($16) + ($$sum5)|0); $21 = (_ttSHORT($20)|0); $22 = $21 << 16 >> 16; HEAP32[$leftSideBearing>>2] = $22; return; } else { if ($8) { $23 = ((($info)) + 32|0); $24 = HEAP32[$23>>2]|0; $25 = $6 << 2; $26 = (($25) + -4)|0; $$sum3 = (($26) + ($24))|0; $27 = (($1) + ($$sum3)|0); $28 = (_ttSHORT($27)|0); $29 = $28 << 16 >> 16; HEAP32[$advanceWidth>>2] = $29; } $30 = ($leftSideBearing|0)==(0|0); if ($30) { return; } $31 = HEAP32[$0>>2]|0; $32 = ((($info)) + 32|0); $33 = HEAP32[$32>>2]|0; $34 = $6 << 2; $35 = (($glyph_index) - ($6))|0; $36 = $35 << 1; $$sum1 = (($36) + ($34))|0; $$sum2 = (($$sum1) + ($33))|0; $37 = (($31) + ($$sum2)|0); $38 = (_ttSHORT($37)|0); $39 = $38 << 16 >> 16; HEAP32[$leftSideBearing>>2] = $39; return; } } function _stbtt_ScaleForPixelHeight($info,$height) { $info = $info|0; $height = +$height; var $$sum = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($info)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ((($info)) + 28|0); $3 = HEAP32[$2>>2]|0; $$sum = (($3) + 4)|0; $4 = (($1) + ($$sum)|0); $5 = (_ttSHORT($4)|0); $6 = $5 << 16 >> 16; $$sum1 = (($3) + 6)|0; $7 = (($1) + ($$sum1)|0); $8 = (_ttSHORT($7)|0); $9 = $8 << 16 >> 16; $10 = (($6) - ($9))|0; $11 = (+($10|0)); $12 = $height / $11; return (+$12); } function _stbtt_GetGlyphBitmapBoxSubpixel($font,$glyph,$scale_x,$scale_y,$shift_x,$shift_y,$ix0,$iy0,$ix1,$iy1) { $font = $font|0; $glyph = $glyph|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $ix0 = $ix0|0; $iy0 = $iy0|0; $ix1 = $ix1|0; $iy1 = $iy1|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $ceilf = 0.0, $ceilf1 = 0.0, $floorf = 0.0, $floorf2 = 0.0, $x0 = 0, $x1 = 0, $y0 = 0, $y1 = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $x0 = sp + 12|0; $y0 = sp + 8|0; $x1 = sp + 4|0; $y1 = sp; HEAP32[$x0>>2] = 0; HEAP32[$y0>>2] = 0; $0 = (_stbtt_GetGlyphBox($font,$glyph,$x0,$y0,$x1,$y1)|0); $1 = ($0|0)==(0); $2 = ($ix0|0)!=(0|0); if ($1) { if ($2) { HEAP32[$ix0>>2] = 0; } $3 = ($iy0|0)==(0|0); if (!($3)) { HEAP32[$iy0>>2] = 0; } $4 = ($ix1|0)==(0|0); if (!($4)) { HEAP32[$ix1>>2] = 0; } $5 = ($iy1|0)==(0|0); if ($5) { STACKTOP = sp;return; } HEAP32[$iy1>>2] = 0; STACKTOP = sp;return; } else { if ($2) { $6 = HEAP32[$x0>>2]|0; $7 = (+($6|0)); $8 = $7 * $scale_x; $9 = $8 + $shift_x; $floorf2 = (+Math_floor((+$9))); $10 = (~~(($floorf2))); HEAP32[$ix0>>2] = $10; } $11 = ($iy0|0)==(0|0); if (!($11)) { $12 = HEAP32[$y1>>2]|0; $13 = (0 - ($12))|0; $14 = (+($13|0)); $15 = $14 * $scale_y; $16 = $15 + $shift_y; $floorf = (+Math_floor((+$16))); $17 = (~~(($floorf))); HEAP32[$iy0>>2] = $17; } $18 = ($ix1|0)==(0|0); if (!($18)) { $19 = HEAP32[$x1>>2]|0; $20 = (+($19|0)); $21 = $20 * $scale_x; $22 = $21 + $shift_x; $ceilf1 = (+Math_ceil((+$22))); $23 = (~~(($ceilf1))); HEAP32[$ix1>>2] = $23; } $24 = ($iy1|0)==(0|0); if ($24) { STACKTOP = sp;return; } $25 = HEAP32[$y0>>2]|0; $26 = (0 - ($25))|0; $27 = (+($26|0)); $28 = $27 * $scale_y; $29 = $28 + $shift_y; $ceilf = (+Math_ceil((+$29))); $30 = (~~(($ceilf))); HEAP32[$iy1>>2] = $30; STACKTOP = sp;return; } } function _stbtt_GetGlyphBitmapBox($font,$glyph,$scale_x,$scale_y,$ix0,$iy0,$ix1,$iy1) { $font = $font|0; $glyph = $glyph|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $ix0 = $ix0|0; $iy0 = $iy0|0; $ix1 = $ix1|0; $iy1 = $iy1|0; var label = 0, sp = 0; sp = STACKTOP; _stbtt_GetGlyphBitmapBoxSubpixel($font,$glyph,$scale_x,$scale_y,0.0,0.0,$ix0,$iy0,$ix1,$iy1); return; } function _stbtt_Rasterize($result,$flatness_in_pixels,$vertices,$num_verts,$scale_x,$scale_y,$shift_x,$shift_y,$x_off,$y_off,$invert,$userdata) { $result = $result|0; $flatness_in_pixels = +$flatness_in_pixels; $vertices = $vertices|0; $num_verts = $num_verts|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $x_off = $x_off|0; $y_off = $y_off|0; $invert = $invert|0; $userdata = $userdata|0; var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $winding_count = 0, $winding_lengths = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $winding_count = sp + 4|0; $winding_lengths = sp; $0 = $scale_x > $scale_y; $1 = $0 ? $scale_y : $scale_x; $2 = $flatness_in_pixels / $1; $3 = (_stbtt_FlattenCurves($vertices,$num_verts,$2,$winding_lengths,$winding_count)|0); $4 = ($3|0)==(0|0); if ($4) { STACKTOP = sp;return; } $5 = HEAP32[$winding_lengths>>2]|0; $6 = HEAP32[$winding_count>>2]|0; _stbtt__rasterize($result,$3,$5,$6,$scale_x,$scale_y,$shift_x,$shift_y,$x_off,$y_off,$invert); $7 = HEAP32[$winding_lengths>>2]|0; _free($7); _free($3); STACKTOP = sp;return; } function _stbtt_MakeGlyphBitmapSubpixel($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,$shift_x,$shift_y,$glyph) { $info = $info|0; $output = $output|0; $out_w = $out_w|0; $out_h = $out_h|0; $out_stride = $out_stride|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $glyph = $glyph|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gbm = 0, $ix0 = 0, $iy0 = 0, $or$cond = 0, $vertices = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $ix0 = sp + 24|0; $iy0 = sp + 20|0; $vertices = sp + 16|0; $gbm = sp; $0 = (_stbtt_GetGlyphShape($info,$glyph,$vertices)|0); _stbtt_GetGlyphBitmapBoxSubpixel($info,$glyph,$scale_x,$scale_y,$shift_x,$shift_y,$ix0,$iy0,0,0); $1 = ((($gbm)) + 12|0); HEAP32[$1>>2] = $output; HEAP32[$gbm>>2] = $out_w; $2 = ((($gbm)) + 4|0); HEAP32[$2>>2] = $out_h; $3 = ((($gbm)) + 8|0); HEAP32[$3>>2] = $out_stride; $4 = HEAP32[$gbm>>2]|0; $5 = ($4|0)==(0); $6 = HEAP32[$2>>2]|0; $7 = ($6|0)==(0); $or$cond = $5 | $7; if ($or$cond) { $11 = HEAP32[$vertices>>2]|0; _free($11); STACKTOP = sp;return; } $8 = HEAP32[$vertices>>2]|0; $9 = HEAP32[$ix0>>2]|0; $10 = HEAP32[$iy0>>2]|0; _stbtt_Rasterize($gbm,0.34999999403953552,$8,$0,$scale_x,$scale_y,$shift_x,$shift_y,$9,$10,1,0); $11 = HEAP32[$vertices>>2]|0; _free($11); STACKTOP = sp;return; } function _stbtt_MakeGlyphBitmap($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,$glyph) { $info = $info|0; $output = $output|0; $out_w = $out_w|0; $out_h = $out_h|0; $out_stride = $out_stride|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $glyph = $glyph|0; var label = 0, sp = 0; sp = STACKTOP; _stbtt_MakeGlyphBitmapSubpixel($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,0.0,0.0,$glyph); return; } function _stbtt_BakeFontBitmap($data,$offset,$pixel_height,$pixels,$pw,$ph,$first_char,$num_chars,$chardata) { $data = $data|0; $offset = $offset|0; $pixel_height = +$pixel_height; $pixels = $pixels|0; $pw = $pw|0; $ph = $ph|0; $first_char = $first_char|0; $num_chars = $num_chars|0; $chardata = $chardata|0; var $$0 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $advance = 0, $bottom_y$0$ = 0, $bottom_y$07 = 0, $f = 0, $i$08 = 0, $i$08$lcssa = 0, $lsb = 0, $x$0$ = 0, $x$010 = 0, $x0 = 0, $x1 = 0; var $y$0$bottom_y$0 = 0, $y$09 = 0, $y0 = 0, $y1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; $f = sp + 24|0; $advance = sp + 20|0; $lsb = sp + 16|0; $x0 = sp + 12|0; $y0 = sp + 8|0; $x1 = sp + 4|0; $y1 = sp; HEAP32[$f>>2] = 0; $0 = (_stbtt_InitFont($f,$data,$offset)|0); $1 = ($0|0)==(0); if ($1) { $$0 = -1; STACKTOP = sp;return ($$0|0); } $2 = Math_imul($ph, $pw)|0; _memset(($pixels|0),0,($2|0))|0; $3 = (+_stbtt_ScaleForPixelHeight($f,$pixel_height)); $4 = ($num_chars|0)>(0); if ($4) { $bottom_y$07 = 1;$i$08 = 0;$x$010 = 1;$y$09 = 1; } else { $$0 = 1; STACKTOP = sp;return ($$0|0); } while(1) { $5 = (($i$08) + ($first_char))|0; $6 = (_stbtt_FindGlyphIndex($f,$5)|0); _stbtt_GetGlyphHMetrics($f,$6,$advance,$lsb); _stbtt_GetGlyphBitmapBox($f,$6,$3,$3,$x0,$y0,$x1,$y1); $7 = HEAP32[$x1>>2]|0; $8 = HEAP32[$x0>>2]|0; $9 = (($7) - ($8))|0; $10 = HEAP32[$y1>>2]|0; $11 = HEAP32[$y0>>2]|0; $12 = (($10) - ($11))|0; $13 = (($x$010) + 1)|0; $14 = (($13) + ($9))|0; $15 = ($14|0)<($pw|0); $y$0$bottom_y$0 = $15 ? $y$09 : $bottom_y$07; $x$0$ = $15 ? $x$010 : 1; $16 = (($y$0$bottom_y$0) + ($12))|0; $17 = (($16) + 1)|0; $18 = ($17|0)<($ph|0); if (!($18)) { $i$08$lcssa = $i$08; label = 4; break; } $20 = (($x$0$) + ($9))|0; $21 = ($20|0)<($pw|0); if (!($21)) { label = 6; break; } $22 = ($16|0)<($ph|0); if (!($22)) { label = 8; break; } $23 = Math_imul($y$0$bottom_y$0, $pw)|0; $$sum = (($23) + ($x$0$))|0; $24 = (($pixels) + ($$sum)|0); _stbtt_MakeGlyphBitmap($f,$24,$9,$12,$pw,$3,$3,$6); $25 = $x$0$&65535; $26 = (($chardata) + (($i$08*20)|0)|0); HEAP16[$26>>1] = $25; $27 = $y$0$bottom_y$0&65535; $28 = (((($chardata) + (($i$08*20)|0)|0)) + 2|0); HEAP16[$28>>1] = $27; $29 = $20&65535; $30 = (((($chardata) + (($i$08*20)|0)|0)) + 4|0); HEAP16[$30>>1] = $29; $31 = $16&65535; $32 = (((($chardata) + (($i$08*20)|0)|0)) + 6|0); HEAP16[$32>>1] = $31; $33 = HEAP32[$advance>>2]|0; $34 = (+($33|0)); $35 = $3 * $34; $36 = (((($chardata) + (($i$08*20)|0)|0)) + 16|0); HEAPF32[$36>>2] = $35; $37 = HEAP32[$x0>>2]|0; $38 = (+($37|0)); $39 = (((($chardata) + (($i$08*20)|0)|0)) + 8|0); HEAPF32[$39>>2] = $38; $40 = HEAP32[$y0>>2]|0; $41 = (+($40|0)); $42 = (((($chardata) + (($i$08*20)|0)|0)) + 12|0); HEAPF32[$42>>2] = $41; $43 = (($20) + 1)|0; $44 = ($16|0)<($bottom_y$07|0); $bottom_y$0$ = $44 ? $bottom_y$07 : $17; $45 = (($i$08) + 1)|0; $46 = ($45|0)<($num_chars|0); if ($46) { $bottom_y$07 = $bottom_y$0$;$i$08 = $45;$x$010 = $43;$y$09 = $y$0$bottom_y$0; } else { $$0 = $bottom_y$0$; label = 10; break; } } if ((label|0) == 4) { $19 = (0 - ($i$08$lcssa))|0; $$0 = $19; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 6) { ___assert_fail((14287|0),(14173|0),2545,(14297|0)); // unreachable; } else if ((label|0) == 8) { ___assert_fail((14318|0),(14173|0),2546,(14297|0)); // unreachable; } else if ((label|0) == 10) { STACKTOP = sp;return ($$0|0); } return (0)|0; } function _LoadDefaultFont() { var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $counter$013 = 0, $currentLine$08 = 0, $currentLine$1 = 0, $currentPosX$09 = 0, $currentPosX$1 = 0, $exitcond = 0; var $i$014 = 0, $i1$012 = 0, $i2$010 = 0, $image = 0, $image$byval_copy1 = 0, $j$011 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $image$byval_copy1 = sp + 44|0; $vararg_buffer = sp; $image = sp + 24|0; $0 = sp + 4|0; HEAP32[(2760)>>2] = 224; $1 = (_malloc(65536)|0); $i$014 = 0; while(1) { $2 = (($1) + ($i$014<<2)|0); $3 = (($i$014) + 1)|0; $exitcond = ($3|0)==(16384); HEAP8[$2>>0]=0&255;HEAP8[$2+1>>0]=(0>>8)&255;HEAP8[$2+2>>0]=(0>>16)&255;HEAP8[$2+3>>0]=0>>24; if ($exitcond) { $counter$013 = 0;$i1$012 = 0; break; } else { $i$014 = $3; } } while(1) { $4 = (2780 + ($counter$013<<2)|0); $5 = HEAP32[$4>>2]|0; $j$011 = 31; while(1) { $6 = 1 << $j$011; $7 = $5 & $6; $8 = ($7|0)==(0); if (!($8)) { $9 = (($j$011) + ($i1$012))|0; $10 = (($1) + ($9<<2)|0); HEAP8[$10>>0]=-1&255;HEAP8[$10+1>>0]=(-1>>8)&255;HEAP8[$10+2>>0]=(-1>>16)&255;HEAP8[$10+3>>0]=-1>>24; } $11 = (($j$011) + -1)|0; $12 = ($j$011|0)>(0); if ($12) { $j$011 = $11; } else { break; } } $13 = (($counter$013) + 1)|0; $14 = ($counter$013|0)>(511); $$ = $14 ? 0 : $13; $15 = (($i1$012) + 32)|0; $16 = ($15|0)<(16384); if ($16) { $counter$013 = $$;$i1$012 = $15; } else { break; } } _LoadImageEx($image,$1,128,128); _ImageFormat($image,2); _free($1); ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; _LoadTextureFromImage($0,$image$byval_copy1); ;HEAP32[2736>>2]=HEAP32[$0>>2]|0;HEAP32[2736+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[2736+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[2736+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[2736+16>>2]=HEAP32[$0+16>>2]|0; ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; _UnloadImage($image$byval_copy1); $17 = HEAP32[(2760)>>2]|0; $18 = $17 << 2; $19 = (_malloc($18)|0); HEAP32[(2764)>>2] = $19; $20 = HEAP32[(2760)>>2]|0; $21 = $20 << 4; $22 = (_malloc($21)|0); HEAP32[(2768)>>2] = $22; $23 = HEAP32[(2760)>>2]|0; $24 = $23 << 3; $25 = (_malloc($24)|0); HEAP32[(2772)>>2] = $25; $26 = HEAP32[(2760)>>2]|0; $27 = $26 << 2; $28 = (_malloc($27)|0); HEAP32[(2776)>>2] = $28; $29 = HEAP32[(2760)>>2]|0; $30 = ($29|0)>(0); if ($30) { $currentLine$08 = 0;$currentPosX$09 = 1;$i2$010 = 0; } else { $69 = HEAP32[(2768)>>2]|0; $70 = ((($69)) + 12|0); $71 = HEAP32[$70>>2]|0; HEAP32[(2756)>>2] = $71; $72 = HEAP32[2736>>2]|0; HEAP32[$vararg_buffer>>2] = $72; _TraceLog(0,14328,$vararg_buffer); STACKTOP = sp;return; } while(1) { $31 = (($i2$010) + 32)|0; $32 = HEAP32[(2764)>>2]|0; $33 = (($32) + ($i2$010<<2)|0); HEAP32[$33>>2] = $31; $34 = HEAP32[(2768)>>2]|0; $35 = (($34) + ($i2$010<<4)|0); HEAP32[$35>>2] = $currentPosX$09; $36 = ($currentLine$08*11)|0; $37 = (($36) + 1)|0; $38 = HEAP32[(2768)>>2]|0; $39 = (((($38) + ($i2$010<<4)|0)) + 4|0); HEAP32[$39>>2] = $37; $40 = (4828 + ($i2$010<<2)|0); $41 = HEAP32[$40>>2]|0; $42 = HEAP32[(2768)>>2]|0; $43 = (((($42) + ($i2$010<<4)|0)) + 8|0); HEAP32[$43>>2] = $41; $44 = HEAP32[(2768)>>2]|0; $45 = (((($44) + ($i2$010<<4)|0)) + 12|0); HEAP32[$45>>2] = 10; $46 = HEAP32[(2768)>>2]|0; $47 = (((($46) + ($i2$010<<4)|0)) + 8|0); $48 = HEAP32[$47>>2]|0; $49 = (($currentPosX$09) + 1)|0; $50 = (($49) + ($48))|0; $51 = HEAP32[(2740)>>2]|0; $52 = ($50|0)<($51|0); if ($52) { $currentLine$1 = $currentLine$08;$currentPosX$1 = $50; } else { $53 = (($currentLine$08) + 1)|0; $54 = HEAP32[$40>>2]|0; $55 = (($54) + 2)|0; $56 = (($46) + ($i2$010<<4)|0); HEAP32[$56>>2] = 1; $57 = ($53*11)|0; $58 = (($57) + 1)|0; $59 = HEAP32[(2768)>>2]|0; $60 = (((($59) + ($i2$010<<4)|0)) + 4|0); HEAP32[$60>>2] = $58; $currentLine$1 = $53;$currentPosX$1 = $55; } $61 = HEAP32[(2772)>>2]|0; $62 = (($61) + ($i2$010<<3)|0); HEAPF32[$62>>2] = 0.0; $63 = (((($61) + ($i2$010<<3)|0)) + 4|0); HEAPF32[$63>>2] = 0.0; $64 = HEAP32[(2776)>>2]|0; $65 = (($64) + ($i2$010<<2)|0); HEAP32[$65>>2] = 0; $66 = (($i2$010) + 1)|0; $67 = HEAP32[(2760)>>2]|0; $68 = ($66|0)<($67|0); if ($68) { $currentLine$08 = $currentLine$1;$currentPosX$09 = $currentPosX$1;$i2$010 = $66; } else { break; } } $69 = HEAP32[(2768)>>2]|0; $70 = ((($69)) + 12|0); $71 = HEAP32[$70>>2]|0; HEAP32[(2756)>>2] = $71; $72 = HEAP32[2736>>2]|0; HEAP32[$vararg_buffer>>2] = $72; _TraceLog(0,14328,$vararg_buffer); STACKTOP = sp;return; } function _UnloadDefaultFont() { var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $$byval_copy = sp; ;HEAP32[$$byval_copy>>2]=HEAP32[2736>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[2736+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[2736+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[2736+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[2736+16>>2]|0; _UnloadTexture($$byval_copy); $0 = HEAP32[(2764)>>2]|0; _free($0); $1 = HEAP32[(2768)>>2]|0; _free($1); $2 = HEAP32[(2772)>>2]|0; _free($2); $3 = HEAP32[(2776)>>2]|0; _free($3); STACKTOP = sp;return; } function _GetDefaultFont($agg$result) { $agg$result = $agg$result|0; var dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; dest=$agg$result; src=2736; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); return; } function _LoadSpriteFont($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $i$01 = 0, $image = 0, $image$byval_copy12 = 0, $spriteFont = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer5 = 0, $vararg_buffer8 = 0, $vararg_ptr4 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; $image$byval_copy12 = sp + 112|0; $vararg_buffer8 = sp + 24|0; $vararg_buffer5 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $spriteFont = sp + 28|0; $image = sp + 92|0; $0 = sp + 72|0; $1 = (_GetExtension($fileName)|0); $2 = (_strcmp($1,14373)|0); $3 = ($2|0)==(0); do { if ($3) { _LoadRBMF($spriteFont,$fileName); } else { $4 = (_GetExtension($fileName)|0); $5 = (_strcmp($4,14378)|0); $6 = ($5|0)==(0); if ($6) { _LoadTTF($spriteFont,$fileName); break; } $7 = (_GetExtension($fileName)|0); $8 = (_strcmp($7,14382)|0); $9 = ($8|0)==(0); if ($9) { _LoadBMFont($spriteFont,$fileName); break; } _LoadImage($image,$fileName); $10 = HEAP32[$image>>2]|0; $11 = ($10|0)==(0|0); if ($11) { HEAP32[$vararg_buffer5>>2] = $fileName; _TraceLog(2,14463,$vararg_buffer5); _GetDefaultFont($spriteFont); } else { $12 = ((($spriteFont)) + 28|0); $13 = ((($spriteFont)) + 32|0); ;HEAP32[$image$byval_copy12>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy12+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy12+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy12+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy12+16>>2]=HEAP32[$image+16>>2]|0; $14 = (_ParseImageData($image$byval_copy12,$12,$13)|0); HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(3,14386,$vararg_buffer); HEAP32[$vararg_buffer1>>2] = $fileName; $vararg_ptr4 = ((($vararg_buffer1)) + 4|0); HEAP32[$vararg_ptr4>>2] = $14; _TraceLog(3,14424,$vararg_buffer1); $15 = ((($spriteFont)) + 24|0); HEAP32[$15>>2] = $14; ;HEAP32[$image$byval_copy12>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy12+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy12+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy12+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy12+16>>2]=HEAP32[$image+16>>2]|0; _LoadTextureFromImage($0,$image$byval_copy12); ;HEAP32[$spriteFont>>2]=HEAP32[$0>>2]|0;HEAP32[$spriteFont+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$spriteFont+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$spriteFont+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$spriteFont+16>>2]=HEAP32[$0+16>>2]|0; $16 = HEAP32[$13>>2]|0; $17 = ((($16)) + 12|0); $18 = HEAP32[$17>>2]|0; $19 = ((($spriteFont)) + 20|0); HEAP32[$19>>2] = $18; $20 = HEAP32[$15>>2]|0; $21 = $20 << 3; $22 = (_malloc($21)|0); $23 = ((($spriteFont)) + 36|0); HEAP32[$23>>2] = $22; $24 = HEAP32[$15>>2]|0; $25 = $24 << 2; $26 = (_malloc($25)|0); $27 = ((($spriteFont)) + 40|0); HEAP32[$27>>2] = $26; $28 = HEAP32[$15>>2]|0; $29 = ($28|0)>(0); if ($29) { $30 = HEAP32[$23>>2]|0; $31 = HEAP32[$27>>2]|0; $32 = HEAP32[$15>>2]|0; $i$01 = 0; while(1) { $33 = (($30) + ($i$01<<3)|0); HEAPF32[$33>>2] = 0.0; $34 = (((($30) + ($i$01<<3)|0)) + 4|0); HEAPF32[$34>>2] = 0.0; $35 = (($31) + ($i$01<<2)|0); HEAP32[$35>>2] = 0; $36 = (($i$01) + 1)|0; $37 = ($36|0)<($32|0); if ($37) { $i$01 = $36; } else { break; } } } } ;HEAP32[$image$byval_copy12>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy12+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy12+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy12+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy12+16>>2]=HEAP32[$image+16>>2]|0; _UnloadImage($image$byval_copy12); } } while(0); $38 = HEAP32[$spriteFont>>2]|0; $39 = ($38|0)==(0); if (!($39)) { dest=$agg$result; src=$spriteFont; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } HEAP32[$vararg_buffer8>>2] = $fileName; _TraceLog(2,14463,$vararg_buffer8); _GetDefaultFont($spriteFont); dest=$agg$result; src=$spriteFont; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _UnloadSpriteFont($spriteFont) { $spriteFont = $spriteFont|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $$byval_copy = sp + 4|0; $vararg_buffer = sp; $0 = HEAP32[$spriteFont>>2]|0; $1 = HEAP32[2736>>2]|0; $2 = ($0|0)==($1|0); if ($2) { STACKTOP = sp;return; } ;HEAP32[$$byval_copy>>2]=HEAP32[$spriteFont>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$spriteFont+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$spriteFont+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$spriteFont+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$spriteFont+16>>2]|0; _UnloadTexture($$byval_copy); $3 = ((($spriteFont)) + 28|0); $4 = HEAP32[$3>>2]|0; _free($4); $5 = ((($spriteFont)) + 32|0); $6 = HEAP32[$5>>2]|0; _free($6); $7 = ((($spriteFont)) + 36|0); $8 = HEAP32[$7>>2]|0; _free($8); $9 = ((($spriteFont)) + 40|0); $10 = HEAP32[$9>>2]|0; _free($10); _TraceLog(0,14519,$vararg_buffer); STACKTOP = sp;return; } function _DrawText($text,$posX,$posY,$fontSize,$color) { $text = $text|0; $posX = $posX|0; $posY = $posY|0; $fontSize = $fontSize|0; $color = $color|0; var $$fontSize = 0, $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0, $color$byval_copy = 0, $defaultFont$byval_copy = 0, $position = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; $color$byval_copy = sp + 64|0; $position$byval_copy = sp + 56|0; $defaultFont$byval_copy = sp + 8|0; $position = sp; $0 = (+($posX|0)); HEAPF32[$position>>2] = $0; $1 = ((($position)) + 4|0); $2 = (+($posY|0)); HEAPF32[$1>>2] = $2; $3 = ($fontSize|0)<(10); $$fontSize = $3 ? 10 : $fontSize; $4 = (($$fontSize|0) / 10)&-1; dest=$defaultFont$byval_copy; src=2736; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _DrawTextEx($defaultFont$byval_copy,$text,$position$byval_copy,$$fontSize,$4,$color$byval_copy); STACKTOP = sp;return; } function _DrawTextEx($spriteFont,$text,$position,$fontSize,$spacing,$tint) { $spriteFont = $spriteFont|0; $text = $text|0; $position = $position|0; $fontSize = $fontSize|0; $spacing = $spacing|0; $tint = $tint|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0; var $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0; var $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0; var $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0; var $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0, $i$03 = 0, $i$1$ph = 0, $i$16 = 0, $rec = 0, $rec$byval_copy = 0, $textOffsetX$05 = 0, $textOffsetX$2 = 0, $textOffsetY$04 = 0, $textOffsetY$17 = 0, $tint$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $tint$byval_copy = sp + 104|0; $$byval_copy2 = sp + 96|0; $$byval_copy1 = sp + 80|0; $rec$byval_copy = sp + 64|0; $$byval_copy = sp + 40|0; $rec = sp + 24|0; $0 = sp + 8|0; $1 = sp; $2 = (_strlen($text)|0); $3 = (+($fontSize|0)); $4 = ((($spriteFont)) + 20|0); $5 = HEAP32[$4>>2]|0; $6 = (+($5|0)); $7 = $3 / $6; $8 = ($2|0)>(0); if (!($8)) { STACKTOP = sp;return; } $9 = ((($spriteFont)) + 32|0); $10 = +HEAPF32[$position>>2]; $11 = ((($spriteFont)) + 36|0); $12 = ((($position)) + 4|0); $13 = +HEAPF32[$12>>2]; $14 = ((($rec)) + 8|0); $15 = ((($rec)) + 12|0); $16 = ((($0)) + 4|0); $17 = ((($0)) + 8|0); $18 = ((($0)) + 12|0); $19 = ((($1)) + 4|0); $20 = ((($spriteFont)) + 40|0); $21 = (+($spacing|0)); $22 = (+($spacing|0)); $23 = ((($spriteFont)) + 32|0); $24 = ((($spriteFont)) + 32|0); $i$03 = 0;$textOffsetX$05 = 0;$textOffsetY$04 = 0; while(1) { $25 = (($text) + ($i$03)|0); $26 = HEAP8[$25>>0]|0; switch ($26<<24>>24) { case -62: { $27 = (($i$03) + 1)|0; $28 = (($text) + ($27)|0); $29 = HEAP8[$28>>0]|0; $30 = $29&255; $31 = (($30) + -32)|0; $32 = HEAP32[$23>>2]|0; $33 = (($32) + ($31<<4)|0); ;HEAP32[$rec>>2]=HEAP32[$33>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$33+12>>2]|0; $i$1$ph = $27; label = 8; break; } case -61: { $34 = (($i$03) + 1)|0; $35 = (($text) + ($34)|0); $36 = HEAP8[$35>>0]|0; $37 = $36&255; $38 = (($37) + 32)|0; $39 = HEAP32[$24>>2]|0; $40 = (($39) + ($38<<4)|0); ;HEAP32[$rec>>2]=HEAP32[$40>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$40+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$40+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$40+12>>2]|0; $i$1$ph = $34; label = 8; break; } case 10: { $41 = HEAP32[$4>>2]|0; $42 = (($41|0) / 2)&-1; $43 = (($42) + ($41))|0; $44 = (+($43|0)); $45 = $7 * $44; $46 = (+($textOffsetY$04|0)); $47 = $46 + $45; $48 = (~~(($47))); HEAP32[$rec>>2] = -1; $i$16 = $i$03;$textOffsetX$2 = 0;$textOffsetY$17 = $48; break; } default: { $49 = $26 << 24 >> 24; $50 = (($49) + -32)|0; $51 = HEAP32[$9>>2]|0; $52 = (($51) + ($50<<4)|0); ;HEAP32[$rec>>2]=HEAP32[$52>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$52+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$52+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$52+12>>2]|0; $i$1$ph = $i$03; label = 8; } } do { if ((label|0) == 8) { label = 0; $$pr = HEAP32[$rec>>2]|0; $53 = ($$pr|0)>(0); if ($53) { $54 = (+($textOffsetX$05|0)); $55 = $54 + $10; $56 = (($text) + ($i$1$ph)|0); $57 = HEAP8[$56>>0]|0; $58 = $57 << 24 >> 24; $59 = (($58) + -32)|0; $60 = HEAP32[$11>>2]|0; $61 = (($60) + ($59<<3)|0); $62 = +HEAPF32[$61>>2]; $63 = $7 * $62; $64 = $55 + $63; $65 = (~~(($64))); $66 = (+($textOffsetY$04|0)); $67 = $66 + $13; $68 = (((($60) + ($59<<3)|0)) + 4|0); $69 = +HEAPF32[$68>>2]; $70 = $7 * $69; $71 = $67 + $70; $72 = (~~(($71))); $73 = HEAP32[$14>>2]|0; $74 = (+($73|0)); $75 = $7 * $74; $76 = (~~(($75))); $77 = HEAP32[$15>>2]|0; $78 = (+($77|0)); $79 = $7 * $78; $80 = (~~(($79))); HEAP32[$0>>2] = $65; HEAP32[$16>>2] = $72; HEAP32[$17>>2] = $76; HEAP32[$18>>2] = $80; HEAPF32[$1>>2] = 0.0; HEAPF32[$19>>2] = 0.0; ;HEAP32[$$byval_copy>>2]=HEAP32[$spriteFont>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$spriteFont+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$spriteFont+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$spriteFont+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$spriteFont+16>>2]|0; ;HEAP32[$rec$byval_copy>>2]=HEAP32[$rec>>2]|0;HEAP32[$rec$byval_copy+4>>2]=HEAP32[$rec+4>>2]|0;HEAP32[$rec$byval_copy+8>>2]=HEAP32[$rec+8>>2]|0;HEAP32[$rec$byval_copy+12>>2]=HEAP32[$rec+12>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0; ;HEAP32[$$byval_copy2>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$1+4>>2]|0; ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; _DrawTexturePro($$byval_copy,$rec$byval_copy,$$byval_copy1,$$byval_copy2,0.0,$tint$byval_copy); $81 = HEAP8[$56>>0]|0; $82 = $81 << 24 >> 24; $83 = (($82) + -32)|0; $84 = HEAP32[$20>>2]|0; $85 = (($84) + ($83<<2)|0); $86 = HEAP32[$85>>2]|0; $87 = ($86|0)==(0); if ($87) { $88 = HEAP32[$14>>2]|0; $89 = (+($88|0)); $90 = $7 * $89; $91 = $21 + $90; $92 = $54 + $91; $93 = (~~(($92))); $i$16 = $i$1$ph;$textOffsetX$2 = $93;$textOffsetY$17 = $textOffsetY$04; break; } else { $94 = (+($86|0)); $95 = $7 * $94; $96 = $22 + $95; $97 = $54 + $96; $98 = (~~(($97))); $i$16 = $i$1$ph;$textOffsetX$2 = $98;$textOffsetY$17 = $textOffsetY$04; break; } } else { $i$16 = $i$1$ph;$textOffsetX$2 = $textOffsetX$05;$textOffsetY$17 = $textOffsetY$04; } } } while(0); $99 = (($i$16) + 1)|0; $100 = ($99|0)<($2|0); if ($100) { $i$03 = $99;$textOffsetX$05 = $textOffsetX$2;$textOffsetY$04 = $textOffsetY$17; } else { break; } } STACKTOP = sp;return; } function _SubText($text,$position,$length) { $text = $text|0; $position = $position|0; $length = $length|0; var $$03 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$04 = 0, $exitcond = 0, $length$ = 0, $position$ = 0, label = 0; var sp = 0; sp = STACKTOP; $0 = (_strlen($text)|0); $1 = ($0|0)>($position|0); $2 = (($0) + -1)|0; $position$ = $1 ? $position : $2; $length$ = $1 ? $length : 0; $3 = ($length$|0)<($0|0); $$1 = $3 ? $length$ : $0; $4 = ($$1|0)>(0); if (!($4)) { $12 = (14545 + ($$1)|0); HEAP8[$12>>0] = 0; return (14545|0); } $5 = ($0|0)>($length$|0); $6 = $5 ? $length$ : $0; $$03 = $text;$c$04 = 0; while(1) { $7 = (($$03) + ($position$)|0); $8 = HEAP8[$7>>0]|0; $9 = (14545 + ($c$04)|0); HEAP8[$9>>0] = $8; $10 = ((($$03)) + 1|0); $11 = (($c$04) + 1)|0; $exitcond = ($11|0)==($6|0); if ($exitcond) { break; } else { $$03 = $10;$c$04 = $11; } } $12 = (14545 + ($$1)|0); HEAP8[$12>>0] = 0; return (14545|0); } function _MeasureText($text,$fontSize) { $text = $text|0; $fontSize = $fontSize|0; var $$fontSize = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0.0, $4 = 0, $defaultFont$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $defaultFont$byval_copy = sp + 8|0; $0 = sp; $1 = ($fontSize|0)<(10); $$fontSize = $1 ? 10 : $fontSize; $2 = (($$fontSize|0) / 10)&-1; dest=$defaultFont$byval_copy; src=2736; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _MeasureTextEx($0,$defaultFont$byval_copy,$text,$$fontSize,$2); $3 = +HEAPF32[$0>>2]; $4 = (~~(($3))); STACKTOP = sp;return ($4|0); } function _MeasureTextEx($agg$result,$spriteFont,$text,$fontSize,$spacing) { $agg$result = $agg$result|0; $spriteFont = $spriteFont|0; $text = $text|0; $fontSize = $fontSize|0; $spacing = $spacing|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0; var $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$05 = 0, $lenCounter$06 = 0, $lenCounter$1 = 0, $lenCounter$1$tempLen$0 = 0, $lenCounter$1$tempLen$0$lcssa = 0, $phitmp = 0, $scaleFactor$0 = 0.0, $tempLen$0$lcssa = 0, $tempLen$07 = 0; var $tempTextWidth$0$lcssa = 0, $tempTextWidth$03 = 0, $tempTextWidth$2 = 0, $tempTextWidth$2$lcssa = 0, $textHeight$0$lcssa = 0, $textHeight$04 = 0, $textHeight$1 = 0, $textHeight$1$lcssa = 0, $textWidth$0$lcssa = 0, $textWidth$0$tempTextWidth$0 = 0, $textWidth$0$tempTextWidth$01 = 0, $textWidth$02 = 0, $textWidth$1 = 0, $textWidth$1$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_strlen($text)|0); $1 = ((($spriteFont)) + 20|0); $2 = HEAP32[$1>>2]|0; $3 = ($0|0)>(0); if ($3) { $4 = HEAP32[$1>>2]|0; $5 = (($4|0) / 2)&-1; $6 = ((($spriteFont)) + 40|0); $7 = HEAP32[$6>>2]|0; $8 = ((($spriteFont)) + 32|0); $9 = HEAP32[$8>>2]|0; $10 = ((($spriteFont)) + 36|0); $11 = HEAP32[$10>>2]|0; $i$05 = 0;$lenCounter$06 = 0;$tempLen$07 = 0;$tempTextWidth$03 = 0;$textHeight$04 = $2;$textWidth$02 = 0; while(1) { $12 = (($lenCounter$06) + 1)|0; $13 = (($text) + ($i$05)|0); $14 = HEAP8[$13>>0]|0; $15 = ($14<<24>>24)==(10); do { if ($15) { $31 = ($tempTextWidth$03|0)<($textWidth$02|0); $textWidth$0$tempTextWidth$0 = $31 ? $textWidth$02 : $tempTextWidth$03; $32 = (($4) + ($textHeight$04))|0; $33 = (($32) + ($5))|0; $lenCounter$1 = 0;$tempTextWidth$2 = $textWidth$0$tempTextWidth$0;$textHeight$1 = $33;$textWidth$1 = 0; } else { $16 = $14 << 24 >> 24; $17 = (($16) + -32)|0; $18 = (($7) + ($17<<2)|0); $19 = HEAP32[$18>>2]|0; $20 = ($19|0)==(0); if ($20) { $22 = (((($9) + ($17<<4)|0)) + 8|0); $23 = HEAP32[$22>>2]|0; $24 = (+($23|0)); $25 = (($11) + ($17<<3)|0); $26 = +HEAPF32[$25>>2]; $27 = $24 + $26; $28 = (+($textWidth$02|0)); $29 = $28 + $27; $30 = (~~(($29))); $lenCounter$1 = $12;$tempTextWidth$2 = $tempTextWidth$03;$textHeight$1 = $textHeight$04;$textWidth$1 = $30; break; } else { $21 = (($19) + ($textWidth$02))|0; $lenCounter$1 = $12;$tempTextWidth$2 = $tempTextWidth$03;$textHeight$1 = $textHeight$04;$textWidth$1 = $21; break; } } } while(0); $34 = ($tempLen$07|0)<($lenCounter$1|0); $lenCounter$1$tempLen$0 = $34 ? $lenCounter$1 : $tempLen$07; $35 = (($i$05) + 1)|0; $exitcond = ($35|0)==($0|0); if ($exitcond) { $lenCounter$1$tempLen$0$lcssa = $lenCounter$1$tempLen$0;$tempTextWidth$2$lcssa = $tempTextWidth$2;$textHeight$1$lcssa = $textHeight$1;$textWidth$1$lcssa = $textWidth$1; break; } else { $i$05 = $35;$lenCounter$06 = $lenCounter$1;$tempLen$07 = $lenCounter$1$tempLen$0;$tempTextWidth$03 = $tempTextWidth$2;$textHeight$04 = $textHeight$1;$textWidth$02 = $textWidth$1; } } $phitmp = (($lenCounter$1$tempLen$0$lcssa) + -1)|0; $tempLen$0$lcssa = $phitmp;$tempTextWidth$0$lcssa = $tempTextWidth$2$lcssa;$textHeight$0$lcssa = $textHeight$1$lcssa;$textWidth$0$lcssa = $textWidth$1$lcssa; } else { $tempLen$0$lcssa = -1;$tempTextWidth$0$lcssa = 0;$textHeight$0$lcssa = $2;$textWidth$0$lcssa = 0; } $36 = ($tempTextWidth$0$lcssa|0)<($textWidth$0$lcssa|0); $textWidth$0$tempTextWidth$01 = $36 ? $textWidth$0$lcssa : $tempTextWidth$0$lcssa; $37 = HEAP32[$1>>2]|0; $38 = ($37|0)<($fontSize|0); if (!($38)) { $scaleFactor$0 = 1.0; $42 = (+($textWidth$0$tempTextWidth$01|0)); $43 = $42 * $scaleFactor$0; $44 = Math_imul($tempLen$0$lcssa, $spacing)|0; $45 = (+($44|0)); $46 = $45 + $43; $47 = (+($textHeight$0$lcssa|0)); $48 = $47 * $scaleFactor$0; HEAPF32[$agg$result>>2] = $46; $49 = ((($agg$result)) + 4|0); HEAPF32[$49>>2] = $48; return; } $39 = (+($fontSize|0)); $40 = (+($37|0)); $41 = $39 / $40; $scaleFactor$0 = $41; $42 = (+($textWidth$0$tempTextWidth$01|0)); $43 = $42 * $scaleFactor$0; $44 = Math_imul($tempLen$0$lcssa, $spacing)|0; $45 = (+($44|0)); $46 = $45 + $43; $47 = (+($textHeight$0$lcssa|0)); $48 = $47 * $scaleFactor$0; HEAPF32[$agg$result>>2] = $46; $49 = ((($agg$result)) + 4|0); HEAPF32[$49>>2] = $48; return; } function _stbi_load($filename,$x,$y,$comp,$req_comp) { $filename = $filename|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__fopen($filename)|0); $1 = ($0|0)==(0|0); if ($1) { _stbi__err(14609); $$0 = 0; return ($$0|0); } else { $2 = (_stbi_load_from_file($0,$x,$y,$comp,$req_comp)|0); (_fclose($0)|0); $$0 = $2; return ($$0|0); } return (0)|0; } function _stbi_load_from_file($f,$x,$y,$comp,$req_comp) { $f = $f|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $s = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 192|0; $s = sp; _stbi__start_file($s,$f); $0 = (_stbi__load_flip($s,$x,$y,$comp,$req_comp)|0); $1 = ($0|0)==(0|0); if ($1) { STACKTOP = sp;return ($0|0); } $2 = ((($s)) + 172|0); $3 = HEAP32[$2>>2]|0; $4 = ((($s)) + 168|0); $5 = HEAP32[$4>>2]|0; $6 = $3; $7 = $5; $8 = (($7) - ($6))|0; (_fseek($f,$8,1)|0); STACKTOP = sp;return ($0|0); } function _stbi_zlib_decode_malloc_guesssize_headerflag($buffer,$len,$initial_size,$outlen,$parse_header) { $buffer = $buffer|0; $len = $len|0; $initial_size = $initial_size|0; $outlen = $outlen|0; $parse_header = $parse_header|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 4080|0; $a = sp; $0 = (_stbi__malloc($initial_size)|0); $1 = ($0|0)==(0|0); if ($1) { $$0 = 0; STACKTOP = sp;return ($$0|0); } HEAP32[$a>>2] = $buffer; $2 = (($buffer) + ($len)|0); $3 = ((($a)) + 4|0); HEAP32[$3>>2] = $2; $4 = (_stbi__do_zlib($a,$0,$initial_size,1,$parse_header)|0); $5 = ($4|0)==(0); if ($5) { $16 = ((($a)) + 20|0); $17 = HEAP32[$16>>2]|0; _free($17); $$0 = 0; STACKTOP = sp;return ($$0|0); } $6 = ($outlen|0)==(0|0); if (!($6)) { $7 = ((($a)) + 16|0); $8 = HEAP32[$7>>2]|0; $9 = ((($a)) + 20|0); $10 = HEAP32[$9>>2]|0; $11 = $8; $12 = $10; $13 = (($11) - ($12))|0; HEAP32[$outlen>>2] = $13; } $14 = ((($a)) + 20|0); $15 = HEAP32[$14>>2]|0; $$0 = $15; STACKTOP = sp;return ($$0|0); } function _stbi__tga_read_rgb16($s,$out) { $s = $s|0; $out = $out|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get16le($s)|0); $1 = $0 >>> 10; $2 = $1 & 31; $3 = $0 >>> 5; $4 = $3 & 31; $5 = $0 & 31; $6 = ($2*255)|0; $7 = (($6>>>0) / 31)&-1; $8 = $7&255; HEAP8[$out>>0] = $8; $9 = ($4*255)|0; $10 = (($9>>>0) / 31)&-1; $11 = $10&255; $12 = ((($out)) + 1|0); HEAP8[$12>>0] = $11; $13 = ($5*255)|0; $14 = (($13>>>0) / 31)&-1; $15 = $14&255; $16 = ((($out)) + 2|0); HEAP8[$16>>0] = $15; return; } function _LoadImage($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $image$sroa$0$0 = 0, $image$sroa$0$09 = 0, $image$sroa$12$0 = 0; var $image$sroa$12$05 = 0, $image$sroa$12$06 = 0, $image$sroa$15$0 = 0, $image$sroa$15$03 = 0, $image$sroa$15$04 = 0, $image$sroa$17$0 = 0, $image$sroa$17$01 = 0, $image$sroa$17$02 = 0, $image$sroa$9$0 = 0, $image$sroa$9$07 = 0, $image$sroa$9$08 = 0, $imgBpp = 0, $imgHeight = 0, $imgWidth = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer = sp; $imgWidth = sp + 128|0; $imgHeight = sp + 124|0; $imgBpp = sp + 120|0; $0 = sp + 100|0; $1 = sp + 80|0; $2 = sp + 60|0; $3 = sp + 40|0; $4 = sp + 20|0; $5 = (_GetExtension($fileName)|0); $6 = (_strcmp($5,14621)|0); $7 = ($6|0)==(0); do { if ($7) { label = 8; } else { $8 = (_GetExtension($fileName)|0); $9 = (_strcmp($8,14625)|0); $10 = ($9|0)==(0); if ($10) { label = 8; } else { $11 = (_GetExtension($fileName)|0); $12 = (_strcmp($11,14629)|0); $13 = ($12|0)==(0); if ($13) { label = 8; } else { $14 = (_GetExtension($fileName)|0); $15 = (_strcmp($14,14633)|0); $16 = ($15|0)==(0); if ($16) { label = 8; } else { $17 = (_GetExtension($fileName)|0); $18 = (_strcmp($17,14637)|0); $19 = ($18|0)==(0); if ($19) { label = 8; } else { $20 = (_GetExtension($fileName)|0); $21 = (_strcmp($20,14641)|0); $22 = ($21|0)==(0); if ($22) { label = 8; } else { $23 = (_GetExtension($fileName)|0); $24 = (_strcmp($23,14645)|0); $25 = ($24|0)==(0); if ($25) { label = 8; } else { $31 = (_GetExtension($fileName)|0); $32 = (_strcmp($31,14649)|0); $33 = ($32|0)==(0); if ($33) { _LoadDDS($0,$fileName); $34 = HEAP32[$0>>2]|0; $35 = ((($0)) + 4|0); $36 = HEAP32[$35>>2]|0; $37 = ((($0)) + 8|0); $38 = HEAP32[$37>>2]|0; $39 = ((($0)) + 12|0); $40 = HEAP32[$39>>2]|0; $41 = ((($0)) + 16|0); $42 = HEAP32[$41>>2]|0; $image$sroa$0$0 = $34;$image$sroa$12$0 = $38;$image$sroa$15$0 = $40;$image$sroa$17$0 = $42;$image$sroa$9$0 = $36; label = 22; break; } $43 = (_GetExtension($fileName)|0); $44 = (_strcmp($43,14653)|0); $45 = ($44|0)==(0); if ($45) { _LoadPKM($1,$fileName); $46 = HEAP32[$1>>2]|0; $47 = ((($1)) + 4|0); $48 = HEAP32[$47>>2]|0; $49 = ((($1)) + 8|0); $50 = HEAP32[$49>>2]|0; $51 = ((($1)) + 12|0); $52 = HEAP32[$51>>2]|0; $53 = ((($1)) + 16|0); $54 = HEAP32[$53>>2]|0; $image$sroa$0$0 = $46;$image$sroa$12$0 = $50;$image$sroa$15$0 = $52;$image$sroa$17$0 = $54;$image$sroa$9$0 = $48; label = 22; break; } $55 = (_GetExtension($fileName)|0); $56 = (_strcmp($55,14657)|0); $57 = ($56|0)==(0); if ($57) { _LoadKTX($2,$fileName); $58 = HEAP32[$2>>2]|0; $59 = ((($2)) + 4|0); $60 = HEAP32[$59>>2]|0; $61 = ((($2)) + 8|0); $62 = HEAP32[$61>>2]|0; $63 = ((($2)) + 12|0); $64 = HEAP32[$63>>2]|0; $65 = ((($2)) + 16|0); $66 = HEAP32[$65>>2]|0; $image$sroa$0$0 = $58;$image$sroa$12$0 = $62;$image$sroa$15$0 = $64;$image$sroa$17$0 = $66;$image$sroa$9$0 = $60; label = 22; break; } $67 = (_GetExtension($fileName)|0); $68 = (_strcmp($67,14661)|0); $69 = ($68|0)==(0); if ($69) { _LoadPVR($3,$fileName); $70 = HEAP32[$3>>2]|0; $71 = ((($3)) + 4|0); $72 = HEAP32[$71>>2]|0; $73 = ((($3)) + 8|0); $74 = HEAP32[$73>>2]|0; $75 = ((($3)) + 12|0); $76 = HEAP32[$75>>2]|0; $77 = ((($3)) + 16|0); $78 = HEAP32[$77>>2]|0; $image$sroa$0$0 = $70;$image$sroa$12$0 = $74;$image$sroa$15$0 = $76;$image$sroa$17$0 = $78;$image$sroa$9$0 = $72; label = 22; break; } $79 = (_GetExtension($fileName)|0); $80 = (_strcmp($79,14665)|0); $81 = ($80|0)==(0); if ($81) { _LoadASTC($4,$fileName); $82 = HEAP32[$4>>2]|0; $83 = ((($4)) + 4|0); $84 = HEAP32[$83>>2]|0; $85 = ((($4)) + 8|0); $86 = HEAP32[$85>>2]|0; $87 = ((($4)) + 12|0); $88 = HEAP32[$87>>2]|0; $89 = ((($4)) + 16|0); $90 = HEAP32[$89>>2]|0; $image$sroa$0$0 = $82;$image$sroa$12$0 = $86;$image$sroa$15$0 = $88;$image$sroa$17$0 = $90;$image$sroa$9$0 = $84; label = 22; } else { $image$sroa$12$06 = 0;$image$sroa$15$04 = 0;$image$sroa$17$02 = 0;$image$sroa$9$08 = 0; } } } } } } } } } while(0); L22: do { if ((label|0) == 8) { HEAP32[$imgWidth>>2] = 0; HEAP32[$imgHeight>>2] = 0; HEAP32[$imgBpp>>2] = 0; $26 = (_stbi_load($fileName,$imgWidth,$imgHeight,$imgBpp,0)|0); $27 = HEAP32[$imgWidth>>2]|0; $28 = HEAP32[$imgHeight>>2]|0; $29 = HEAP32[$imgBpp>>2]|0; switch ($29|0) { case 1: { $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 1;$image$sroa$9$0 = $27; label = 22; break L22; break; } case 2: { $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 2;$image$sroa$9$0 = $27; label = 22; break L22; break; } case 3: { $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 4;$image$sroa$9$0 = $27; label = 22; break L22; break; } default: { $30 = ($29|0)==(4); $$ = $30 ? 7 : 0; $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = $$;$image$sroa$9$0 = $27; label = 22; break L22; } } } } while(0); if ((label|0) == 22) { $91 = ($image$sroa$0$0|0)==(0|0); if ($91) { $image$sroa$12$06 = $image$sroa$12$0;$image$sroa$15$04 = $image$sroa$15$0;$image$sroa$17$02 = $image$sroa$17$0;$image$sroa$9$08 = $image$sroa$9$0; } else { HEAP32[$vararg_buffer>>2] = $fileName; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $image$sroa$9$0; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $image$sroa$12$0; _TraceLog(0,14670,$vararg_buffer); $image$sroa$0$09 = $image$sroa$0$0;$image$sroa$12$05 = $image$sroa$12$0;$image$sroa$15$03 = $image$sroa$15$0;$image$sroa$17$01 = $image$sroa$17$0;$image$sroa$9$07 = $image$sroa$9$0; HEAP32[$agg$result>>2] = $image$sroa$0$09; $92 = ((($agg$result)) + 4|0); HEAP32[$92>>2] = $image$sroa$9$07; $93 = ((($agg$result)) + 8|0); HEAP32[$93>>2] = $image$sroa$12$05; $94 = ((($agg$result)) + 12|0); HEAP32[$94>>2] = $image$sroa$15$03; $95 = ((($agg$result)) + 16|0); HEAP32[$95>>2] = $image$sroa$17$01; STACKTOP = sp;return; } } HEAP32[$vararg_buffer3>>2] = $fileName; _TraceLog(2,14709,$vararg_buffer3); $image$sroa$0$09 = 0;$image$sroa$12$05 = $image$sroa$12$06;$image$sroa$15$03 = $image$sroa$15$04;$image$sroa$17$01 = $image$sroa$17$02;$image$sroa$9$07 = $image$sroa$9$08; HEAP32[$agg$result>>2] = $image$sroa$0$09; $92 = ((($agg$result)) + 4|0); HEAP32[$92>>2] = $image$sroa$9$07; $93 = ((($agg$result)) + 8|0); HEAP32[$93>>2] = $image$sroa$12$05; $94 = ((($agg$result)) + 12|0); HEAP32[$94>>2] = $image$sroa$15$03; $95 = ((($agg$result)) + 16|0); HEAP32[$95>>2] = $image$sroa$17$01; STACKTOP = sp;return; } function _LoadImageEx($agg$result,$pixels,$width,$height) { $agg$result = $agg$result|0; $pixels = $pixels|0; $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $width << 2; $1 = Math_imul($0, $height)|0; $2 = (_malloc($1)|0); $3 = ($1|0)>(0); if ($3) { $4 = Math_imul($height, $width)|0; $5 = $4 << 2; $6 = (($5) + -1)|0; $7 = $6 >>> 2; $i$02 = 0;$k$01 = 0; while(1) { $8 = (($pixels) + ($k$01<<2)|0); $9 = HEAP8[$8>>0]|0; $10 = (($2) + ($i$02)|0); HEAP8[$10>>0] = $9; $11 = (((($pixels) + ($k$01<<2)|0)) + 1|0); $12 = HEAP8[$11>>0]|0; $13 = $i$02 | 1; $14 = (($2) + ($13)|0); HEAP8[$14>>0] = $12; $15 = (((($pixels) + ($k$01<<2)|0)) + 2|0); $16 = HEAP8[$15>>0]|0; $17 = $i$02 | 2; $18 = (($2) + ($17)|0); HEAP8[$18>>0] = $16; $19 = (((($pixels) + ($k$01<<2)|0)) + 3|0); $20 = HEAP8[$19>>0]|0; $21 = $i$02 | 3; $22 = (($2) + ($21)|0); HEAP8[$22>>0] = $20; $23 = (($k$01) + 1)|0; $24 = (($i$02) + 4)|0; $exitcond = ($k$01|0)==($7|0); if ($exitcond) { break; } else { $i$02 = $24;$k$01 = $23; } } } HEAP32[$agg$result>>2] = $2; $25 = ((($agg$result)) + 4|0); HEAP32[$25>>2] = $width; $26 = ((($agg$result)) + 8|0); HEAP32[$26>>2] = $height; $27 = ((($agg$result)) + 12|0); HEAP32[$27>>2] = 1; $28 = ((($agg$result)) + 16|0); HEAP32[$28>>2] = 7; return; } function _LoadTexture($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $image = 0, $image$byval_copy1 = 0, $texture$sroa$0$0 = 0, $texture$sroa$3 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; $image$byval_copy1 = sp + 64|0; $vararg_buffer = sp; $texture$sroa$3 = sp + 8|0; $image = sp + 44|0; $0 = sp + 24|0; _LoadImage($image,$fileName); $1 = HEAP32[$image>>2]|0; $2 = ($1|0)==(0|0); if ($2) { _TraceLog(2,14761,$vararg_buffer); $texture$sroa$0$0 = 0; } else { ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; _LoadTextureFromImage($0,$image$byval_copy1); $3 = HEAP32[$0>>2]|0; $4 = ((($0)) + 4|0); ;HEAP32[$texture$sroa$3>>2]=HEAP32[$4>>2]|0;HEAP32[$texture$sroa$3+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$texture$sroa$3+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$texture$sroa$3+12>>2]=HEAP32[$4+12>>2]|0; ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; _UnloadImage($image$byval_copy1); $texture$sroa$0$0 = $3; } HEAP32[$agg$result>>2] = $texture$sroa$0$0; $5 = ((($agg$result)) + 4|0); ;HEAP32[$5>>2]=HEAP32[$texture$sroa$3>>2]|0;HEAP32[$5+4>>2]=HEAP32[$texture$sroa$3+4>>2]|0;HEAP32[$5+8>>2]=HEAP32[$texture$sroa$3+8>>2]|0;HEAP32[$5+12>>2]=HEAP32[$texture$sroa$3+12>>2]|0; STACKTOP = sp;return; } function _LoadTextureFromImage($agg$result,$image) { $agg$result = $agg$result|0; $image = $image|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$image>>2]|0; $1 = ((($image)) + 4|0); $2 = HEAP32[$1>>2]|0; $3 = ((($image)) + 8|0); $4 = HEAP32[$3>>2]|0; $5 = ((($image)) + 16|0); $6 = HEAP32[$5>>2]|0; $7 = ((($image)) + 12|0); $8 = HEAP32[$7>>2]|0; $9 = (_rlglLoadTexture($0,$2,$4,$6,$8)|0); $10 = HEAP32[$1>>2]|0; $11 = HEAP32[$3>>2]|0; $12 = HEAP32[$7>>2]|0; $13 = HEAP32[$5>>2]|0; HEAP32[$agg$result>>2] = $9; $14 = ((($agg$result)) + 4|0); HEAP32[$14>>2] = $10; $15 = ((($agg$result)) + 8|0); HEAP32[$15>>2] = $11; $16 = ((($agg$result)) + 12|0); HEAP32[$16>>2] = $12; $17 = ((($agg$result)) + 16|0); HEAP32[$17>>2] = $13; return; } function _UnloadImage($image) { $image = $image|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$image>>2]|0; _free($0); return; } function _UnloadTexture($texture) { $texture = $texture|0; var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $0 = HEAP32[$texture>>2]|0; $1 = ($0|0)==(0); if ($1) { STACKTOP = sp;return; } _rlDeleteTextures($0); $2 = HEAP32[$texture>>2]|0; HEAP32[$vararg_buffer>>2] = $2; _TraceLog(0,14790,$vararg_buffer); STACKTOP = sp;return; } function _GetImageData($image) { $image = $image|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0; var $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0; var $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0; var $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$01 = 0, $k$02 = 0, $k$1 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $0 = ((($image)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ((($image)) + 8|0); $3 = HEAP32[$2>>2]|0; $4 = $1 << 2; $5 = Math_imul($4, $3)|0; $6 = (_malloc($5)|0); $7 = HEAP32[$0>>2]|0; $8 = HEAP32[$2>>2]|0; $9 = Math_imul($8, $7)|0; $10 = ($9|0)>(0); if (!($10)) { STACKTOP = sp;return ($6|0); } $11 = ((($image)) + 16|0); $12 = HEAP32[$11>>2]|0; $13 = HEAP32[$0>>2]|0; $14 = HEAP32[$2>>2]|0; $15 = Math_imul($14, $13)|0; $16 = HEAP32[$image>>2]|0; $i$01 = 0;$k$02 = 0; while(1) { switch ($12|0) { case 1: { $17 = (($16) + ($k$02)|0); $18 = HEAP8[$17>>0]|0; $19 = (($6) + ($i$01<<2)|0); HEAP8[$19>>0] = $18; $20 = (($16) + ($k$02)|0); $21 = HEAP8[$20>>0]|0; $22 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$22>>0] = $21; $23 = (($16) + ($k$02)|0); $24 = HEAP8[$23>>0]|0; $25 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$25>>0] = $24; $26 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$26>>0] = -1; $27 = (($k$02) + 1)|0; $k$1 = $27; break; } case 2: { $28 = (($16) + ($k$02)|0); $29 = HEAP8[$28>>0]|0; $30 = (($6) + ($i$01<<2)|0); HEAP8[$30>>0] = $29; $31 = (($16) + ($k$02)|0); $32 = HEAP8[$31>>0]|0; $33 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$33>>0] = $32; $34 = (($16) + ($k$02)|0); $35 = HEAP8[$34>>0]|0; $36 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$36>>0] = $35; $37 = (($k$02) + 1)|0; $38 = (($16) + ($37)|0); $39 = HEAP8[$38>>0]|0; $40 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$40>>0] = $39; $41 = (($k$02) + 2)|0; $k$1 = $41; break; } case 5: { $42 = (($16) + ($k$02<<1)|0); $43 = HEAP16[$42>>1]|0; $44 = $43&65535; $45 = $44 >>> 11; $46 = (+($45|0)); $47 = $46 * 8.0; $48 = (~~(($47))&255); $49 = (($6) + ($i$01<<2)|0); HEAP8[$49>>0] = $48; $50 = $44 >>> 6; $51 = $50 & 31; $52 = (+($51|0)); $53 = $52 * 8.0; $54 = (~~(($53))&255); $55 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$55>>0] = $54; $56 = $44 >>> 1; $57 = $56 & 31; $58 = (+($57|0)); $59 = $58 * 8.0; $60 = (~~(($59))&255); $61 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$61>>0] = $60; $62 = $44 & 1; $63 = (0 - ($62))|0; $64 = $63&255; $65 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$65>>0] = $64; $66 = (($k$02) + 1)|0; $k$1 = $66; break; } case 3: { $67 = (($16) + ($k$02<<1)|0); $68 = HEAP16[$67>>1]|0; $69 = $68&65535; $70 = $69 >>> 11; $71 = (+($70|0)); $72 = $71 * 8.0; $73 = (~~(($72))&255); $74 = (($6) + ($i$01<<2)|0); HEAP8[$74>>0] = $73; $75 = $69 >>> 5; $76 = $75 & 63; $77 = (+($76|0)); $78 = $77 * 4.0; $79 = (~~(($78))&255); $80 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$80>>0] = $79; $81 = $69 & 31; $82 = (+($81|0)); $83 = $82 * 8.0; $84 = (~~(($83))&255); $85 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$85>>0] = $84; $86 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$86>>0] = -1; $87 = (($k$02) + 1)|0; $k$1 = $87; break; } case 6: { $88 = (($16) + ($k$02<<1)|0); $89 = HEAP16[$88>>1]|0; $90 = $89&65535; $91 = $90 >>> 12; $92 = (+($91|0)); $93 = $92 * 17.0; $94 = (~~(($93))&255); $95 = (($6) + ($i$01<<2)|0); HEAP8[$95>>0] = $94; $96 = $90 >>> 8; $97 = $96 & 15; $98 = (+($97|0)); $99 = $98 * 17.0; $100 = (~~(($99))&255); $101 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$101>>0] = $100; $102 = $90 >>> 4; $103 = $102 & 15; $104 = (+($103|0)); $105 = $104 * 17.0; $106 = (~~(($105))&255); $107 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$107>>0] = $106; $108 = $90 & 15; $109 = (+($108|0)); $110 = $109 * 17.0; $111 = (~~(($110))&255); $112 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$112>>0] = $111; $113 = (($k$02) + 1)|0; $k$1 = $113; break; } case 7: { $114 = (($16) + ($k$02)|0); $115 = HEAP8[$114>>0]|0; $116 = (($6) + ($i$01<<2)|0); HEAP8[$116>>0] = $115; $117 = (($k$02) + 1)|0; $118 = (($16) + ($117)|0); $119 = HEAP8[$118>>0]|0; $120 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$120>>0] = $119; $121 = (($k$02) + 2)|0; $122 = (($16) + ($121)|0); $123 = HEAP8[$122>>0]|0; $124 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$124>>0] = $123; $125 = (($k$02) + 3)|0; $126 = (($16) + ($125)|0); $127 = HEAP8[$126>>0]|0; $128 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$128>>0] = $127; $129 = (($k$02) + 4)|0; $k$1 = $129; break; } case 4: { $130 = (($16) + ($k$02)|0); $131 = HEAP8[$130>>0]|0; $132 = (($6) + ($i$01<<2)|0); HEAP8[$132>>0] = $131; $133 = (($k$02) + 1)|0; $134 = (($16) + ($133)|0); $135 = HEAP8[$134>>0]|0; $136 = (((($6) + ($i$01<<2)|0)) + 1|0); HEAP8[$136>>0] = $135; $137 = (($k$02) + 2)|0; $138 = (($16) + ($137)|0); $139 = HEAP8[$138>>0]|0; $140 = (((($6) + ($i$01<<2)|0)) + 2|0); HEAP8[$140>>0] = $139; $141 = (((($6) + ($i$01<<2)|0)) + 3|0); HEAP8[$141>>0] = -1; $142 = (($k$02) + 3)|0; $k$1 = $142; break; } default: { _TraceLog(2,14840,$vararg_buffer); $k$1 = $k$02; } } $143 = (($i$01) + 1)|0; $144 = ($143|0)<($15|0); if ($144) { $i$01 = $143;$k$02 = $k$1; } else { break; } } STACKTOP = sp;return ($6|0); } function _ImageFormat($image,$newFormat) { $image = $image|0; $newFormat = $newFormat|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0; var $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0.0; var $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0.0; var $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; var $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0; var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0; var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0; var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$017 = 0, $i1$019 = 0, $i12$028 = 0; var $i13$031 = 0, $i2$021 = 0, $i3$024 = 0, $i7$026 = 0, $image$byval_copy = 0, $k$018 = 0, $k$123 = 0, $k$230 = 0, $or$cond = 0, $roundf = 0.0, $roundf10 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $roundf4 = 0.0, $roundf5 = 0.0, $roundf6 = 0.0, $roundf7 = 0.0, $roundf8 = 0.0, $roundf9 = 0.0, $vararg_buffer = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $image$byval_copy = sp + 4|0; $vararg_buffer = sp; $0 = ((($image)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==($newFormat|0); if ($2) { STACKTOP = sp;return; } $3 = ($1|0)<(8); $4 = ($newFormat|0)<(8); $or$cond = $4 & $3; if (!($or$cond)) { _TraceLog(2,14886,$vararg_buffer); STACKTOP = sp;return; } ;HEAP32[$image$byval_copy>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy+16>>2]=HEAP32[$image+16>>2]|0; $5 = (_GetImageData($image$byval_copy)|0); $6 = HEAP32[$image>>2]|0; _free($6); HEAP32[$0>>2] = $newFormat; switch ($newFormat|0) { case 1: { $7 = ((($image)) + 4|0); $8 = HEAP32[$7>>2]|0; $9 = ((($image)) + 8|0); $10 = HEAP32[$9>>2]|0; $11 = Math_imul($10, $8)|0; $12 = (_malloc($11)|0); HEAP32[$image>>2] = $12; $13 = HEAP32[$7>>2]|0; $14 = HEAP32[$9>>2]|0; $15 = Math_imul($14, $13)|0; $16 = ($15|0)>(0); if ($16) { $i$017 = 0; while(1) { $17 = (($5) + ($i$017<<2)|0); $18 = HEAP8[$17>>0]|0; $19 = (+($18&255)); $20 = $19 * 0.29899999499320984; $21 = (((($5) + ($i$017<<2)|0)) + 1|0); $22 = HEAP8[$21>>0]|0; $23 = (+($22&255)); $24 = $23 * 0.58700001239776611; $25 = $20 + $24; $26 = (((($5) + ($i$017<<2)|0)) + 2|0); $27 = HEAP8[$26>>0]|0; $28 = (+($27&255)); $29 = $28 * 0.11400000005960464; $30 = $25 + $29; $31 = (~~(($30))&255); $32 = HEAP32[$image>>2]|0; $33 = (($32) + ($i$017)|0); HEAP8[$33>>0] = $31; $34 = (($i$017) + 1)|0; $35 = HEAP32[$7>>2]|0; $36 = HEAP32[$9>>2]|0; $37 = Math_imul($36, $35)|0; $38 = ($34|0)<($37|0); if ($38) { $i$017 = $34; } else { break; } } } break; } case 2: { $39 = ((($image)) + 4|0); $40 = HEAP32[$39>>2]|0; $41 = ((($image)) + 8|0); $42 = HEAP32[$41>>2]|0; $43 = $40 << 1; $44 = Math_imul($43, $42)|0; $45 = (_malloc($44)|0); HEAP32[$image>>2] = $45; $46 = HEAP32[$39>>2]|0; $47 = HEAP32[$41>>2]|0; $48 = $46 << 1; $49 = Math_imul($48, $47)|0; $50 = ($49|0)>(0); if ($50) { $i1$019 = 0;$k$018 = 0; while(1) { $51 = (($5) + ($k$018<<2)|0); $52 = HEAP8[$51>>0]|0; $53 = (+($52&255)); $54 = $53 * 0.29899999499320984; $55 = (((($5) + ($k$018<<2)|0)) + 1|0); $56 = HEAP8[$55>>0]|0; $57 = (+($56&255)); $58 = $57 * 0.58700001239776611; $59 = $54 + $58; $60 = (((($5) + ($k$018<<2)|0)) + 2|0); $61 = HEAP8[$60>>0]|0; $62 = (+($61&255)); $63 = $62 * 0.11400000005960464; $64 = $59 + $63; $65 = (~~(($64))&255); $66 = HEAP32[$image>>2]|0; $67 = (($66) + ($i1$019)|0); HEAP8[$67>>0] = $65; $68 = (((($5) + ($k$018<<2)|0)) + 3|0); $69 = HEAP8[$68>>0]|0; $70 = $i1$019 | 1; $71 = HEAP32[$image>>2]|0; $72 = (($71) + ($70)|0); HEAP8[$72>>0] = $69; $73 = (($k$018) + 1)|0; $74 = (($i1$019) + 2)|0; $75 = HEAP32[$39>>2]|0; $76 = HEAP32[$41>>2]|0; $77 = $75 << 1; $78 = Math_imul($77, $76)|0; $79 = ($74|0)<($78|0); if ($79) { $i1$019 = $74;$k$018 = $73; } else { break; } } } break; } case 3: { $80 = ((($image)) + 4|0); $81 = HEAP32[$80>>2]|0; $82 = ((($image)) + 8|0); $83 = HEAP32[$82>>2]|0; $84 = $81 << 1; $85 = Math_imul($84, $83)|0; $86 = (_malloc($85)|0); HEAP32[$image>>2] = $86; $87 = HEAP32[$80>>2]|0; $88 = HEAP32[$82>>2]|0; $89 = Math_imul($88, $87)|0; $90 = ($89|0)>(0); if ($90) { $91 = HEAP8[$5>>0]|0; $92 = (+($91&255)); $93 = $92 * 31.0; $94 = $93 / 255.0; $roundf8 = (+_roundf($94)); $95 = (~~(($roundf8))&255); $96 = ((($5)) + 1|0); $97 = HEAP8[$96>>0]|0; $98 = (+($97&255)); $99 = $98 * 63.0; $100 = $99 / 255.0; $roundf9 = (+_roundf($100)); $101 = (~~(($roundf9))&255); $102 = ((($5)) + 2|0); $103 = HEAP8[$102>>0]|0; $104 = (+($103&255)); $105 = $104 * 31.0; $106 = $105 / 255.0; $roundf10 = (+_roundf($106)); $107 = (~~(($roundf10))&255); $108 = $95&255; $109 = $108 << 11; $110 = $101&255; $111 = $110 << 5; $112 = $111 | $109; $113 = $107&255; $114 = $112 | $113; $115 = $114&65535; $116 = HEAP32[$image>>2]|0; $117 = HEAP32[$80>>2]|0; $118 = HEAP32[$82>>2]|0; $119 = Math_imul($118, $117)|0; $i2$021 = 0; while(1) { $120 = (($116) + ($i2$021<<1)|0); HEAP16[$120>>1] = $115; $121 = (($i2$021) + 1)|0; $122 = ($121|0)<($119|0); if ($122) { $i2$021 = $121; } else { break; } } } break; } case 4: { $123 = ((($image)) + 4|0); $124 = HEAP32[$123>>2]|0; $125 = ((($image)) + 8|0); $126 = HEAP32[$125>>2]|0; $127 = ($124*3)|0; $128 = Math_imul($127, $126)|0; $129 = (_malloc($128)|0); HEAP32[$image>>2] = $129; $130 = HEAP32[$123>>2]|0; $131 = HEAP32[$125>>2]|0; $132 = ($130*3)|0; $133 = Math_imul($132, $131)|0; $134 = ($133|0)>(0); if ($134) { $i3$024 = 0;$k$123 = 0; while(1) { $135 = (($5) + ($k$123<<2)|0); $136 = HEAP8[$135>>0]|0; $137 = HEAP32[$image>>2]|0; $138 = (($137) + ($i3$024)|0); HEAP8[$138>>0] = $136; $139 = (((($5) + ($k$123<<2)|0)) + 1|0); $140 = HEAP8[$139>>0]|0; $141 = (($i3$024) + 1)|0; $142 = HEAP32[$image>>2]|0; $143 = (($142) + ($141)|0); HEAP8[$143>>0] = $140; $144 = (((($5) + ($k$123<<2)|0)) + 2|0); $145 = HEAP8[$144>>0]|0; $146 = (($i3$024) + 2)|0; $147 = HEAP32[$image>>2]|0; $148 = (($147) + ($146)|0); HEAP8[$148>>0] = $145; $149 = (($k$123) + 1)|0; $150 = (($i3$024) + 3)|0; $151 = HEAP32[$123>>2]|0; $152 = HEAP32[$125>>2]|0; $153 = ($151*3)|0; $154 = Math_imul($153, $152)|0; $155 = ($150|0)<($154|0); if ($155) { $i3$024 = $150;$k$123 = $149; } else { break; } } } break; } case 5: { $156 = ((($image)) + 4|0); $157 = HEAP32[$156>>2]|0; $158 = ((($image)) + 8|0); $159 = HEAP32[$158>>2]|0; $160 = $157 << 1; $161 = Math_imul($160, $159)|0; $162 = (_malloc($161)|0); HEAP32[$image>>2] = $162; $163 = HEAP32[$156>>2]|0; $164 = HEAP32[$158>>2]|0; $165 = Math_imul($164, $163)|0; $166 = ($165|0)>(0); if ($166) { $167 = HEAP32[$image>>2]|0; $168 = HEAP32[$156>>2]|0; $169 = HEAP32[$158>>2]|0; $170 = Math_imul($169, $168)|0; $i7$026 = 0; while(1) { $171 = (($5) + ($i7$026<<2)|0); $172 = HEAP8[$171>>0]|0; $173 = (+($172&255)); $174 = $173 * 31.0; $175 = $174 / 255.0; $roundf5 = (+_roundf($175)); $176 = (~~(($roundf5))&255); $177 = (((($5) + ($i7$026<<2)|0)) + 1|0); $178 = HEAP8[$177>>0]|0; $179 = (+($178&255)); $180 = $179 * 31.0; $181 = $180 / 255.0; $roundf6 = (+_roundf($181)); $182 = (~~(($roundf6))&255); $183 = (((($5) + ($i7$026<<2)|0)) + 2|0); $184 = HEAP8[$183>>0]|0; $185 = (+($184&255)); $186 = $185 * 31.0; $187 = $186 / 255.0; $roundf7 = (+_roundf($187)); $188 = (~~(($roundf7))&255); $189 = (((($5) + ($i7$026<<2)|0)) + 3|0); $190 = HEAP8[$189>>0]|0; $191 = ($190&255)>(50); $192 = $176&255; $193 = $192 << 11; $194 = $182&255; $195 = $194 << 6; $196 = $195 | $193; $197 = $188&255; $198 = $197 << 1; $199 = $196 | $198; $200 = $191&1; $201 = $199 | $200; $202 = $201&65535; $203 = (($167) + ($i7$026<<1)|0); HEAP16[$203>>1] = $202; $204 = (($i7$026) + 1)|0; $205 = ($204|0)<($170|0); if ($205) { $i7$026 = $204; } else { break; } } } break; } case 6: { $206 = ((($image)) + 4|0); $207 = HEAP32[$206>>2]|0; $208 = ((($image)) + 8|0); $209 = HEAP32[$208>>2]|0; $210 = $207 << 1; $211 = Math_imul($210, $209)|0; $212 = (_malloc($211)|0); HEAP32[$image>>2] = $212; $213 = HEAP32[$206>>2]|0; $214 = HEAP32[$208>>2]|0; $215 = Math_imul($214, $213)|0; $216 = ($215|0)>(0); if ($216) { $217 = HEAP32[$image>>2]|0; $218 = HEAP32[$206>>2]|0; $219 = HEAP32[$208>>2]|0; $220 = Math_imul($219, $218)|0; $i12$028 = 0; while(1) { $221 = (($5) + ($i12$028<<2)|0); $222 = HEAP8[$221>>0]|0; $223 = (+($222&255)); $224 = $223 * 15.0; $225 = $224 / 255.0; $roundf = (+_roundf($225)); $226 = (~~(($roundf))&255); $227 = (((($5) + ($i12$028<<2)|0)) + 1|0); $228 = HEAP8[$227>>0]|0; $229 = (+($228&255)); $230 = $229 * 15.0; $231 = $230 / 255.0; $roundf2 = (+_roundf($231)); $232 = (~~(($roundf2))&255); $233 = (((($5) + ($i12$028<<2)|0)) + 2|0); $234 = HEAP8[$233>>0]|0; $235 = (+($234&255)); $236 = $235 * 15.0; $237 = $236 / 255.0; $roundf3 = (+_roundf($237)); $238 = (~~(($roundf3))&255); $239 = (((($5) + ($i12$028<<2)|0)) + 3|0); $240 = HEAP8[$239>>0]|0; $241 = (+($240&255)); $242 = $241 * 15.0; $243 = $242 / 255.0; $roundf4 = (+_roundf($243)); $244 = (~~(($roundf4))&255); $245 = $226&255; $246 = $245 << 12; $247 = $232&255; $248 = $247 << 8; $249 = $248 | $246; $250 = $238&255; $251 = $250 << 4; $252 = $249 | $251; $253 = $244&255; $254 = $252 | $253; $255 = $254&65535; $256 = (($217) + ($i12$028<<1)|0); HEAP16[$256>>1] = $255; $257 = (($i12$028) + 1)|0; $258 = ($257|0)<($220|0); if ($258) { $i12$028 = $257; } else { break; } } } break; } case 7: { $259 = ((($image)) + 4|0); $260 = HEAP32[$259>>2]|0; $261 = ((($image)) + 8|0); $262 = HEAP32[$261>>2]|0; $263 = $260 << 2; $264 = Math_imul($263, $262)|0; $265 = (_malloc($264)|0); HEAP32[$image>>2] = $265; $266 = HEAP32[$259>>2]|0; $267 = HEAP32[$261>>2]|0; $268 = $266 << 2; $269 = Math_imul($268, $267)|0; $270 = ($269|0)>(0); if ($270) { $i13$031 = 0;$k$230 = 0; while(1) { $271 = (($5) + ($k$230<<2)|0); $272 = HEAP8[$271>>0]|0; $273 = HEAP32[$image>>2]|0; $274 = (($273) + ($i13$031)|0); HEAP8[$274>>0] = $272; $275 = (((($5) + ($k$230<<2)|0)) + 1|0); $276 = HEAP8[$275>>0]|0; $277 = $i13$031 | 1; $278 = HEAP32[$image>>2]|0; $279 = (($278) + ($277)|0); HEAP8[$279>>0] = $276; $280 = (((($5) + ($k$230<<2)|0)) + 2|0); $281 = HEAP8[$280>>0]|0; $282 = $i13$031 | 2; $283 = HEAP32[$image>>2]|0; $284 = (($283) + ($282)|0); HEAP8[$284>>0] = $281; $285 = (((($5) + ($k$230<<2)|0)) + 3|0); $286 = HEAP8[$285>>0]|0; $287 = $i13$031 | 3; $288 = HEAP32[$image>>2]|0; $289 = (($288) + ($287)|0); HEAP8[$289>>0] = $286; $290 = (($k$230) + 1)|0; $291 = (($i13$031) + 4)|0; $292 = HEAP32[$259>>2]|0; $293 = HEAP32[$261>>2]|0; $294 = $292 << 2; $295 = Math_imul($294, $293)|0; $296 = ($291|0)<($295|0); if ($296) { $i13$031 = $291;$k$230 = $290; } else { break; } } } break; } default: { } } _free($5); STACKTOP = sp;return; } function _DrawTexture($texture,$posX,$posY,$tint) { $texture = $texture|0; $posX = $posX|0; $posY = $posY|0; $tint = $tint|0; var $$byval_copy = 0, $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $texture$byval_copy = 0, $tint$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $tint$byval_copy = sp + 40|0; $$byval_copy = sp + 32|0; $texture$byval_copy = sp + 8|0; $0 = sp; $1 = (+($posX|0)); $2 = (+($posY|0)); HEAPF32[$0>>2] = $1; $3 = ((($0)) + 4|0); HEAPF32[$3>>2] = $2; ;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0;HEAP32[$texture$byval_copy+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$texture$byval_copy+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$texture$byval_copy+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$texture$byval_copy+16>>2]=HEAP32[$texture+16>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0; ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; _DrawTextureEx($texture$byval_copy,$$byval_copy,0.0,1.0,$tint$byval_copy); STACKTOP = sp;return; } function _DrawTextureEx($texture,$position,$rotation,$scale,$tint) { $texture = $texture|0; $position = $position|0; $rotation = +$rotation; $scale = +$scale; $tint = $tint|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0, $destRec = 0, $destRec$byval_copy = 0, $origin = 0, $sourceRec = 0, $sourceRec$byval_copy = 0, $texture$byval_copy = 0, $tint$byval_copy = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $tint$byval_copy = sp + 104|0; $tmpcast$byval_copy = sp + 96|0; $destRec$byval_copy = sp + 80|0; $sourceRec$byval_copy = sp + 64|0; $texture$byval_copy = sp + 40|0; $sourceRec = sp + 24|0; $destRec = sp + 8|0; $origin = sp; HEAP32[$sourceRec>>2] = 0; $0 = ((($sourceRec)) + 4|0); HEAP32[$0>>2] = 0; $1 = ((($sourceRec)) + 8|0); $2 = ((($texture)) + 4|0); $3 = HEAP32[$2>>2]|0; HEAP32[$1>>2] = $3; $4 = ((($sourceRec)) + 12|0); $5 = ((($texture)) + 8|0); $6 = HEAP32[$5>>2]|0; HEAP32[$4>>2] = $6; $7 = +HEAPF32[$position>>2]; $8 = (~~(($7))); HEAP32[$destRec>>2] = $8; $9 = ((($destRec)) + 4|0); $10 = ((($position)) + 4|0); $11 = +HEAPF32[$10>>2]; $12 = (~~(($11))); HEAP32[$9>>2] = $12; $13 = ((($destRec)) + 8|0); $14 = HEAP32[$2>>2]|0; $15 = (+($14|0)); $16 = $15 * $scale; $17 = (~~(($16))); HEAP32[$13>>2] = $17; $18 = ((($destRec)) + 12|0); $19 = HEAP32[$5>>2]|0; $20 = (+($19|0)); $21 = $20 * $scale; $22 = (~~(($21))); HEAP32[$18>>2] = $22; $23 = $origin; $24 = $23; HEAP32[$24>>2] = 0; $25 = (($23) + 4)|0; $26 = $25; HEAP32[$26>>2] = 0; ;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0;HEAP32[$texture$byval_copy+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$texture$byval_copy+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$texture$byval_copy+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$texture$byval_copy+16>>2]=HEAP32[$texture+16>>2]|0; ;HEAP32[$sourceRec$byval_copy>>2]=HEAP32[$sourceRec>>2]|0;HEAP32[$sourceRec$byval_copy+4>>2]=HEAP32[$sourceRec+4>>2]|0;HEAP32[$sourceRec$byval_copy+8>>2]=HEAP32[$sourceRec+8>>2]|0;HEAP32[$sourceRec$byval_copy+12>>2]=HEAP32[$sourceRec+12>>2]|0; ;HEAP32[$destRec$byval_copy>>2]=HEAP32[$destRec>>2]|0;HEAP32[$destRec$byval_copy+4>>2]=HEAP32[$destRec+4>>2]|0;HEAP32[$destRec$byval_copy+8>>2]=HEAP32[$destRec+8>>2]|0;HEAP32[$destRec$byval_copy+12>>2]=HEAP32[$destRec+12>>2]|0; ;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$origin>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$origin+4>>2]|0; ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; _DrawTexturePro($texture$byval_copy,$sourceRec$byval_copy,$destRec$byval_copy,$tmpcast$byval_copy,$rotation,$tint$byval_copy); STACKTOP = sp;return; } function _DrawTexturePro($texture,$sourceRec,$destRec,$origin,$rotation,$tint) { $texture = $texture|0; $sourceRec = $sourceRec|0; $destRec = $destRec|0; $origin = $origin|0; $rotation = +$rotation; $tint = $tint|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0; var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0; var $63 = 0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0.0; var $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$texture>>2]|0; _rlEnableTexture($0); _rlPushMatrix(); $1 = HEAP32[$destRec>>2]|0; $2 = (+($1|0)); $3 = ((($destRec)) + 4|0); $4 = HEAP32[$3>>2]|0; $5 = (+($4|0)); _rlTranslatef($2,$5,0.0); _rlRotatef($rotation,0.0,0.0,1.0); $6 = +HEAPF32[$origin>>2]; $7 = -$6; $8 = ((($origin)) + 4|0); $9 = +HEAPF32[$8>>2]; $10 = -$9; _rlTranslatef($7,$10,0.0); _rlBegin(2); $11 = HEAP8[$tint>>0]|0; $12 = ((($tint)) + 1|0); $13 = HEAP8[$12>>0]|0; $14 = ((($tint)) + 2|0); $15 = HEAP8[$14>>0]|0; $16 = ((($tint)) + 3|0); $17 = HEAP8[$16>>0]|0; _rlColor4ub($11,$13,$15,$17); $18 = HEAP32[$sourceRec>>2]|0; $19 = (+($18|0)); $20 = ((($texture)) + 4|0); $21 = HEAP32[$20>>2]|0; $22 = (+($21|0)); $23 = $19 / $22; $24 = ((($sourceRec)) + 4|0); $25 = HEAP32[$24>>2]|0; $26 = (+($25|0)); $27 = ((($texture)) + 8|0); $28 = HEAP32[$27>>2]|0; $29 = (+($28|0)); $30 = $26 / $29; _rlTexCoord2f($23,$30); _rlVertex2f(0.0,0.0); $31 = HEAP32[$sourceRec>>2]|0; $32 = (+($31|0)); $33 = HEAP32[$20>>2]|0; $34 = (+($33|0)); $35 = $32 / $34; $36 = HEAP32[$24>>2]|0; $37 = ((($sourceRec)) + 12|0); $38 = HEAP32[$37>>2]|0; $39 = (($38) + ($36))|0; $40 = (+($39|0)); $41 = HEAP32[$27>>2]|0; $42 = (+($41|0)); $43 = $40 / $42; _rlTexCoord2f($35,$43); $44 = ((($destRec)) + 12|0); $45 = HEAP32[$44>>2]|0; $46 = (+($45|0)); _rlVertex2f(0.0,$46); $47 = HEAP32[$sourceRec>>2]|0; $48 = ((($sourceRec)) + 8|0); $49 = HEAP32[$48>>2]|0; $50 = (($49) + ($47))|0; $51 = (+($50|0)); $52 = HEAP32[$20>>2]|0; $53 = (+($52|0)); $54 = $51 / $53; $55 = HEAP32[$24>>2]|0; $56 = HEAP32[$37>>2]|0; $57 = (($56) + ($55))|0; $58 = (+($57|0)); $59 = HEAP32[$27>>2]|0; $60 = (+($59|0)); $61 = $58 / $60; _rlTexCoord2f($54,$61); $62 = ((($destRec)) + 8|0); $63 = HEAP32[$62>>2]|0; $64 = (+($63|0)); $65 = HEAP32[$44>>2]|0; $66 = (+($65|0)); _rlVertex2f($64,$66); $67 = HEAP32[$sourceRec>>2]|0; $68 = HEAP32[$48>>2]|0; $69 = (($68) + ($67))|0; $70 = (+($69|0)); $71 = HEAP32[$20>>2]|0; $72 = (+($71|0)); $73 = $70 / $72; $74 = HEAP32[$24>>2]|0; $75 = (+($74|0)); $76 = HEAP32[$27>>2]|0; $77 = (+($76|0)); $78 = $75 / $77; _rlTexCoord2f($73,$78); $79 = HEAP32[$62>>2]|0; $80 = (+($79|0)); _rlVertex2f($80,0.0); _rlEnd(); _rlPopMatrix(); return; } function _DrawTextureRec($texture,$sourceRec,$position,$tint) { $texture = $texture|0; $sourceRec = $sourceRec|0; $position = $position|0; $tint = $tint|0; var $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $destRec = 0, $destRec$byval_copy = 0; var $ispos = 0, $ispos1 = 0, $neg = 0, $neg2 = 0, $origin = 0, $sourceRec$byval_copy = 0, $texture$byval_copy = 0, $tint$byval_copy = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; $tint$byval_copy = sp + 88|0; $tmpcast$byval_copy = sp + 80|0; $destRec$byval_copy = sp + 64|0; $sourceRec$byval_copy = sp + 48|0; $texture$byval_copy = sp + 24|0; $destRec = sp + 8|0; $origin = sp; $0 = +HEAPF32[$position>>2]; $1 = (~~(($0))); HEAP32[$destRec>>2] = $1; $2 = ((($destRec)) + 4|0); $3 = ((($position)) + 4|0); $4 = +HEAPF32[$3>>2]; $5 = (~~(($4))); HEAP32[$2>>2] = $5; $6 = ((($destRec)) + 8|0); $7 = ((($sourceRec)) + 8|0); $8 = HEAP32[$7>>2]|0; $ispos = ($8|0)>(-1); $neg = (0 - ($8))|0; $9 = $ispos ? $8 : $neg; HEAP32[$6>>2] = $9; $10 = ((($destRec)) + 12|0); $11 = ((($sourceRec)) + 12|0); $12 = HEAP32[$11>>2]|0; $ispos1 = ($12|0)>(-1); $neg2 = (0 - ($12))|0; $13 = $ispos1 ? $12 : $neg2; HEAP32[$10>>2] = $13; $14 = $origin; $15 = $14; HEAP32[$15>>2] = 0; $16 = (($14) + 4)|0; $17 = $16; HEAP32[$17>>2] = 0; ;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0;HEAP32[$texture$byval_copy+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$texture$byval_copy+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$texture$byval_copy+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$texture$byval_copy+16>>2]=HEAP32[$texture+16>>2]|0; ;HEAP32[$sourceRec$byval_copy>>2]=HEAP32[$sourceRec>>2]|0;HEAP32[$sourceRec$byval_copy+4>>2]=HEAP32[$sourceRec+4>>2]|0;HEAP32[$sourceRec$byval_copy+8>>2]=HEAP32[$sourceRec+8>>2]|0;HEAP32[$sourceRec$byval_copy+12>>2]=HEAP32[$sourceRec+12>>2]|0; ;HEAP32[$destRec$byval_copy>>2]=HEAP32[$destRec>>2]|0;HEAP32[$destRec$byval_copy+4>>2]=HEAP32[$destRec+4>>2]|0;HEAP32[$destRec$byval_copy+8>>2]=HEAP32[$destRec+8>>2]|0;HEAP32[$destRec$byval_copy+12>>2]=HEAP32[$destRec+12>>2]|0; ;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$origin>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$origin+4>>2]|0; ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; _DrawTexturePro($texture$byval_copy,$sourceRec$byval_copy,$destRec$byval_copy,$tmpcast$byval_copy,0.0,$tint$byval_copy); STACKTOP = sp;return; } function _LoadModel($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $mesh = 0, $mesh$byval_copy = 0, $model = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 688|0; $mesh$byval_copy = sp + 608|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $model = sp + 392|0; $mesh = sp + 312|0; $0 = sp + 232|0; $1 = sp + 16|0; _memset(($model|0),0,216)|0; dest=$mesh; stop=dest+80|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $2 = (_GetExtension($fileName)|0); $3 = (_strcmp($2,14940)|0); $4 = ($3|0)==(0); if ($4) { _LoadOBJ($0,$fileName); dest=$mesh; src=$0; stop=dest+80|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); } else { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,14944,$vararg_buffer); } $5 = HEAP32[$mesh>>2]|0; $6 = ($5|0)==(0); if ($6) { _TraceLog(2,15000,$vararg_buffer1); _memcpy(($agg$result|0),($model|0),216)|0; STACKTOP = sp;return; } else { dest=$mesh$byval_copy; src=$mesh; stop=dest+80|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); _rlglLoadModel($1,$mesh$byval_copy); _memcpy(($model|0),($1|0),216)|0; _memcpy(($agg$result|0),($model|0),216)|0; STACKTOP = sp;return; } } function _UnloadModel($model) { $model = $model|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_ptr4 = 0, $vararg_ptr5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $0 = (_rlGetVersion()|0); $1 = ($0|0)==(1); if ($1) { $2 = ((($model)) + 4|0); $3 = HEAP32[$2>>2]|0; _free($3); $4 = ((($model)) + 8|0); $5 = HEAP32[$4>>2]|0; _free($5); $6 = ((($model)) + 16|0); $7 = HEAP32[$6>>2]|0; _free($7); } $8 = ((($model)) + 56|0); $9 = HEAP32[$8>>2]|0; _rlDeleteBuffers($9); $10 = ((($model)) + 60|0); $11 = HEAP32[$10>>2]|0; _rlDeleteBuffers($11); $12 = ((($model)) + 64|0); $13 = HEAP32[$12>>2]|0; _rlDeleteBuffers($13); $14 = ((($model)) + 52|0); $15 = HEAP32[$14>>2]|0; _rlDeleteVertexArrays($15); $16 = HEAP32[$14>>2]|0; $17 = ($16|0)==(0); if ($17) { $18 = HEAP32[$8>>2]|0; $19 = HEAP32[$10>>2]|0; $20 = HEAP32[$12>>2]|0; HEAP32[$vararg_buffer1>>2] = $18; $vararg_ptr4 = ((($vararg_buffer1)) + 4|0); HEAP32[$vararg_ptr4>>2] = $19; $vararg_ptr5 = ((($vararg_buffer1)) + 8|0); HEAP32[$vararg_ptr5>>2] = $20; _TraceLog(0,15074,$vararg_buffer1); STACKTOP = sp;return; } else { HEAP32[$vararg_buffer>>2] = $16; _TraceLog(0,15026,$vararg_buffer); STACKTOP = sp;return; } } function _SetModelTexture($model,$texture) { $model = $model|0; $texture = $texture|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$texture>>2]|0; $1 = ($0|0)==(0); if ($1) { $2 = HEAP32[808>>2]|0; $3 = ((($model)) + 144|0); HEAP32[$3>>2] = $2; $4 = HEAP32[808>>2]|0; $5 = ((($model)) + 168|0); HEAP32[$5>>2] = $4; return; } else { $6 = ((($model)) + 144|0); ;HEAP32[$6>>2]=HEAP32[$texture>>2]|0;HEAP32[$6+4>>2]=HEAP32[$texture+4>>2]|0;HEAP32[$6+8>>2]=HEAP32[$texture+8>>2]|0;HEAP32[$6+12>>2]=HEAP32[$texture+12>>2]|0;HEAP32[$6+16>>2]=HEAP32[$texture+16>>2]|0; $7 = HEAP32[$texture>>2]|0; $8 = ((($model)) + 168|0); HEAP32[$8>>2] = $7; return; } } function _DrawModelEx($model,$position,$rotationAxis,$rotationAngle,$scale,$tint) { $model = $model|0; $position = $position|0; $rotationAxis = $rotationAxis|0; $rotationAngle = +$rotationAngle; $scale = $scale|0; $tint = $tint|0; var $model$byval_copy = 0, $position$byval_copy = 0, $rotationAxis$byval_copy = 0, $scale$byval_copy = 0, $tint$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $tint$byval_copy = sp + 252|0; $scale$byval_copy = sp + 240|0; $rotationAxis$byval_copy = sp + 228|0; $position$byval_copy = sp + 216|0; $model$byval_copy = sp; _memcpy(($model$byval_copy|0),($model|0),216)|0; ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[$position+8>>2]|0; ;HEAP32[$rotationAxis$byval_copy>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$rotationAxis$byval_copy+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$rotationAxis$byval_copy+8>>2]=HEAP32[$rotationAxis+8>>2]|0; ;HEAP32[$scale$byval_copy>>2]=HEAP32[$scale>>2]|0;HEAP32[$scale$byval_copy+4>>2]=HEAP32[$scale+4>>2]|0;HEAP32[$scale$byval_copy+8>>2]=HEAP32[$scale+8>>2]|0; ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; _rlglDrawModel($model$byval_copy,$position$byval_copy,$rotationAxis$byval_copy,$rotationAngle,$scale$byval_copy,$tint$byval_copy,0); STACKTOP = sp;return; } function _InitAudioDevice() { var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $0 = (_alcOpenDevice((0|0))|0); $1 = ($0|0)==(0|0); if ($1) { _TraceLog(1,15144,$vararg_buffer); } $2 = (_alcCreateContext(($0|0),(0|0))|0); $cond = ($2|0)==(0|0); if ($cond) { label = 6; } else { $3 = (_alcMakeContextCurrent(($2|0))|0); $4 = ($3<<24>>24)==(0); if ($4) { _alcDestroyContext(($2|0)); label = 6; } } if ((label|0) == 6) { (_alcCloseDevice(($0|0))|0); _TraceLog(1,15177,$vararg_buffer1); } $5 = (_alcGetString(($0|0),4101)|0); HEAP32[$vararg_buffer3>>2] = $5; _TraceLog(0,15207,$vararg_buffer3); _alListener3f(4100,0.0,0.0,0.0); _alListener3f(4102,0.0,0.0,0.0); _alListener3f(4111,0.0,0.0,-1.0); STACKTOP = sp;return; } function _CloseAudioDevice() { var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; _StopMusicStream(); $0 = (_alcGetCurrentContext()|0); $1 = ($0|0)==(0|0); if ($1) { _TraceLog(2,15261,$vararg_buffer); } $2 = (_alcGetContextsDevice(($0|0))|0); (_alcMakeContextCurrent((0|0))|0); _alcDestroyContext(($0|0)); (_alcCloseDevice(($2|0))|0); STACKTOP = sp;return; } function _StopMusicStream() { var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[5740>>2]|0; $1 = ($0|0)==(0); if ($1) { HEAP32[5740>>2] = 0; return; } $2 = HEAP32[(5756)>>2]|0; _alSourceStop(($2|0)); _EmptyMusicStream(); _alDeleteSources(1,((5756)|0)); _alDeleteBuffers(2,((5748)|0)); $3 = HEAP32[5744>>2]|0; _stb_vorbis_close($3); HEAP32[5740>>2] = 0; return; } function _PlayMusicStream($fileName) { $fileName = $fileName|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $info = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer13 = 0, $vararg_buffer5 = 0, $vararg_buffer9 = 0, $vararg_ptr12 = 0, $vararg_ptr4 = 0, $vararg_ptr8 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $vararg_buffer13 = sp + 32|0; $vararg_buffer9 = sp + 24|0; $vararg_buffer5 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $info = sp + 40|0; $0 = (_GetExtension($fileName)|0); $1 = (_strcmp($0,15309)|0); $2 = ($1|0)==(0); if (!($2)) { HEAP32[$vararg_buffer13>>2] = $fileName; _TraceLog(2,15430,$vararg_buffer13); STACKTOP = sp;return; } _StopMusicStream(); $3 = (_stb_vorbis_open_filename($fileName,0,0)|0); HEAP32[5744>>2] = $3; $4 = ($3|0)==(0|0); if ($4) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,15313,$vararg_buffer); STACKTOP = sp;return; } else { _stb_vorbis_get_info($info,$3); $5 = ((($info)) + 4|0); $6 = HEAP32[$5>>2]|0; HEAP32[(5764)>>2] = $6; $7 = HEAP32[$info>>2]|0; HEAP32[(5768)>>2] = $7; $8 = HEAP32[$info>>2]|0; HEAP32[$vararg_buffer1>>2] = $fileName; $vararg_ptr4 = ((($vararg_buffer1)) + 4|0); HEAP32[$vararg_ptr4>>2] = $8; _TraceLog(0,15353,$vararg_buffer1); $9 = HEAP32[$5>>2]|0; HEAP32[$vararg_buffer5>>2] = $fileName; $vararg_ptr8 = ((($vararg_buffer5)) + 4|0); HEAP32[$vararg_ptr8>>2] = $9; _TraceLog(0,15378,$vararg_buffer5); $10 = ((($info)) + 16|0); $11 = HEAP32[$10>>2]|0; HEAP32[$vararg_buffer9>>2] = $fileName; $vararg_ptr12 = ((($vararg_buffer9)) + 4|0); HEAP32[$vararg_ptr12>>2] = $11; _TraceLog(3,15400,$vararg_buffer9); $12 = HEAP32[$5>>2]|0; $13 = ($12|0)==(2); $$ = $13 ? 4355 : 4353; HEAP32[(5760)>>2] = $$; HEAP32[(5776)>>2] = 1; HEAP32[5740>>2] = 1; _alGenSources(1,((5756)|0)); $14 = HEAP32[(5756)>>2]|0; _alSourcef(($14|0),4099,1.0); $15 = HEAP32[(5756)>>2]|0; _alSourcef(($15|0),4106,1.0); $16 = HEAP32[(5756)>>2]|0; _alSource3f(($16|0),4100,0.0,0.0,0.0); $17 = HEAP32[(5756)>>2]|0; _alSource3f(($17|0),4102,0.0,0.0,0.0); _alGenBuffers(2,((5748)|0)); $18 = HEAP32[(5748)>>2]|0; (_BufferMusicStream($18)|0); $19 = HEAP32[(5752)>>2]|0; (_BufferMusicStream($19)|0); $20 = HEAP32[(5756)>>2]|0; _alSourceQueueBuffers(($20|0),2,((5748)|0)); $21 = HEAP32[(5756)>>2]|0; _alSourcePlay(($21|0)); $22 = HEAP32[5744>>2]|0; $23 = (_stb_vorbis_stream_length_in_samples($22)|0); $24 = HEAP32[(5764)>>2]|0; $25 = Math_imul($24, $23)|0; HEAP32[(5772)>>2] = $25; STACKTOP = sp;return; } } function _SetMusicVolume($volume) { $volume = +$volume; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[(5756)>>2]|0; _alSourcef(($0|0),4106,(+$volume)); return; } function _UpdateMusicStream() { var $$lcssa = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $active$0$lcssa = 0, $active$1 = 0, $buffer = 0, $or$cond = 0, $or$cond3 = 0, $processed = 0, $state = 0, $vararg_buffer = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $buffer = sp + 12|0; $processed = sp + 8|0; $state = sp + 4|0; HEAP32[$buffer>>2] = 0; HEAP32[$processed>>2] = 0; $0 = HEAP32[5740>>2]|0; $1 = ($0|0)==(0); if ($1) { STACKTOP = sp;return; } $2 = HEAP32[(5756)>>2]|0; _alGetSourcei(($2|0),4118,($processed|0)); $$pr = HEAP32[$processed>>2]|0; $3 = ($$pr|0)>(0); $4 = HEAP32[(5756)>>2]|0; if ($3) { $5 = $4; while(1) { _alSourceUnqueueBuffers(($5|0),1,($buffer|0)); $6 = HEAP32[$buffer>>2]|0; $7 = (_BufferMusicStream($6)|0); $8 = ($7|0)==(0); $9 = HEAP32[(5776)>>2]|0; $10 = ($9|0)!=(0); $or$cond = $8 & $10; if ($or$cond) { $11 = HEAP32[5744>>2]|0; _stb_vorbis_seek_start($11); $12 = HEAP32[5744>>2]|0; $13 = (_stb_vorbis_stream_length_in_samples($12)|0); $14 = HEAP32[(5764)>>2]|0; $15 = Math_imul($14, $13)|0; HEAP32[(5772)>>2] = $15; $16 = HEAP32[$buffer>>2]|0; $17 = (_BufferMusicStream($16)|0); $active$1 = $17; } else { $active$1 = $7; } $18 = HEAP32[(5756)>>2]|0; _alSourceQueueBuffers(($18|0),1,($buffer|0)); $19 = (_alGetError()|0); $20 = ($19|0)==(0); if (!($20)) { _TraceLog(2,15486,$vararg_buffer); } $21 = HEAP32[$processed>>2]|0; $22 = (($21) + -1)|0; HEAP32[$processed>>2] = $22; $23 = ($21|0)>(1); $24 = HEAP32[(5756)>>2]|0; if ($23) { $5 = $24; } else { $$lcssa = $24;$active$0$lcssa = $active$1; break; } } } else { $$lcssa = $4;$active$0$lcssa = 1; } _alGetSourcei(($$lcssa|0),4112,($state|0)); $25 = HEAP32[$state>>2]|0; $26 = ($25|0)!=(4114); $27 = ($active$0$lcssa|0)!=(0); $or$cond3 = $27 & $26; if ($or$cond3) { $28 = HEAP32[(5756)>>2]|0; _alSourcePlay(($28|0)); } if ($27) { STACKTOP = sp;return; } _StopMusicStream(); STACKTOP = sp;return; } function _stb_vorbis_close($p) { $p = $p|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($p|0)==(0|0); if ($0) { return; } _vorbis_deinit($p); _setup_free($p,$p); return; } function _stb_vorbis_get_info($agg$result,$f) { $agg$result = $agg$result|0; $f = $f|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = HEAP32[$f>>2]|0; $3 = ((($f)) + 8|0); $4 = HEAP32[$3>>2]|0; $5 = ((($f)) + 16|0); $6 = HEAP32[$5>>2]|0; $7 = ((($f)) + 12|0); $8 = HEAP32[$7>>2]|0; $9 = ((($f)) + 116|0); $10 = HEAP32[$9>>2]|0; $11 = $10 >> 1; HEAP32[$agg$result>>2] = $2; $12 = ((($agg$result)) + 4|0); HEAP32[$12>>2] = $1; $13 = ((($agg$result)) + 8|0); HEAP32[$13>>2] = $4; $14 = ((($agg$result)) + 12|0); HEAP32[$14>>2] = $6; $15 = ((($agg$result)) + 16|0); HEAP32[$15>>2] = $8; $16 = ((($agg$result)) + 20|0); HEAP32[$16>>2] = $11; return; } function _stb_vorbis_get_file_offset($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 48|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if (!($2)) { $$0 = 0; return ($$0|0); } $3 = ((($f)) + 32|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(0|0); if ($5) { $11 = ((($f)) + 20|0); $12 = HEAP32[$11>>2]|0; $13 = (_ftell($12)|0); $14 = ((($f)) + 24|0); $15 = HEAP32[$14>>2]|0; $16 = (($13) - ($15))|0; $$0 = $16; return ($$0|0); } else { $6 = ((($f)) + 36|0); $7 = HEAP32[$6>>2]|0; $8 = $4; $9 = $7; $10 = (($8) - ($9))|0; $$0 = $10; return ($$0|0); } return (0)|0; } function _stb_vorbis_get_frame_float($f,$channels,$output) { $f = $f|0; $channels = $channels|0; $output = $output|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, $left = 0, $len = 0, $right = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $len = sp + 8|0; $right = sp + 4|0; $left = sp; $0 = ((($f)) + 48|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if (!($2)) { _error($f,2); $$0 = 0; STACKTOP = sp;return ($$0|0); } $3 = (_vorbis_decode_packet($f,$len,$left,$right)|0); $4 = ($3|0)==(0); if ($4) { $5 = ((($f)) + 1508|0); HEAP32[$5>>2] = 0; $6 = ((($f)) + 1504|0); HEAP32[$6>>2] = 0; $$0 = 0; STACKTOP = sp;return ($$0|0); } $7 = HEAP32[$len>>2]|0; $8 = HEAP32[$left>>2]|0; $9 = HEAP32[$right>>2]|0; $10 = (_vorbis_finish_frame($f,$7,$8,$9)|0); HEAP32[$len>>2] = $10; $11 = ((($f)) + 4|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)>(0); if ($13) { $14 = HEAP32[$left>>2]|0; $i$01 = 0; while(1) { $15 = (((($f)) + 800|0) + ($i$01<<2)|0); $16 = HEAP32[$15>>2]|0; $17 = (($16) + ($14<<2)|0); $18 = (((($f)) + 864|0) + ($i$01<<2)|0); HEAP32[$18>>2] = $17; $19 = (($i$01) + 1)|0; $20 = HEAP32[$11>>2]|0; $21 = ($19|0)<($20|0); if ($21) { $i$01 = $19; } else { break; } } } $22 = HEAP32[$left>>2]|0; $23 = ((($f)) + 1504|0); HEAP32[$23>>2] = $22; $24 = HEAP32[$left>>2]|0; $25 = HEAP32[$len>>2]|0; $26 = (($25) + ($24))|0; $27 = ((($f)) + 1508|0); HEAP32[$27>>2] = $26; $28 = ($channels|0)==(0|0); if (!($28)) { $29 = HEAP32[$11>>2]|0; HEAP32[$channels>>2] = $29; } $30 = ($output|0)==(0|0); if (!($30)) { $31 = ((($f)) + 864|0); HEAP32[$output>>2] = $31; } $32 = HEAP32[$len>>2]|0; $$0 = $32; STACKTOP = sp;return ($$0|0); } function _stb_vorbis_seek_start($f) { $f = $f|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 48|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if ($2) { $3 = ((($f)) + 52|0); $4 = HEAP32[$3>>2]|0; _set_file_offset($f,$4); $5 = ((($f)) + 992|0); HEAP32[$5>>2] = 0; $6 = ((($f)) + 1377|0); HEAP8[$6>>0] = 1; $7 = ((($f)) + 1380|0); HEAP32[$7>>2] = -1; _vorbis_pump_first_frame($f); return; } else { _error($f,2); return; } } function _stb_vorbis_stream_length_in_samples($f) { $f = $f|0; var $$ = 0, $$0 = 0, $$2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $end = 0, $header = 0, $last = 0, $last_page_loc$0$lcssa = 0, $last_page_loc$03 = 0, $previous_safe$0 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $end = sp + 4|0; $last = sp; $header = sp + 8|0; $0 = ((($f)) + 48|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if (!($2)) { _error($f,2); $$0 = 0; STACKTOP = sp;return ($$0|0); } $3 = ((($f)) + 796|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(0); if ($5) { $6 = (_stb_vorbis_get_file_offset($f)|0); $7 = ((($f)) + 44|0); $8 = HEAP32[$7>>2]|0; $9 = ($8>>>0)>(65535); if ($9) { $10 = (($8) + -65536)|0; $11 = ((($f)) + 52|0); $12 = HEAP32[$11>>2]|0; $13 = ($10>>>0)<($12>>>0); if ($13) { label = 6; } else { $previous_safe$0 = $10; } } else { label = 6; } if ((label|0) == 6) { $14 = ((($f)) + 52|0); $15 = HEAP32[$14>>2]|0; $previous_safe$0 = $15; } _set_file_offset($f,$previous_safe$0); $16 = (_vorbis_find_page($f,$end,$last)|0); $17 = ($16|0)==(0); do { if ($17) { $18 = ((($f)) + 100|0); HEAP32[$18>>2] = 36; HEAP32[$3>>2] = -1; } else { $19 = (_stb_vorbis_get_file_offset($f)|0); $20 = HEAP32[$last>>2]|0; $21 = ($20|0)==(0); L15: do { if ($21) { $last_page_loc$03 = $19; while(1) { $22 = HEAP32[$end>>2]|0; _set_file_offset($f,$22); $23 = (_vorbis_find_page($f,$end,$last)|0); $24 = ($23|0)==(0); if ($24) { $last_page_loc$0$lcssa = $last_page_loc$03; break L15; } $25 = (_stb_vorbis_get_file_offset($f)|0); $26 = HEAP32[$last>>2]|0; $27 = ($26|0)==(0); if ($27) { $last_page_loc$03 = $25; } else { $last_page_loc$0$lcssa = $25; break; } } } else { $last_page_loc$0$lcssa = $19; } } while(0); _set_file_offset($f,$last_page_loc$0$lcssa); (_getn($f,$header,6)|0); $28 = (_get32($f)|0); $29 = (_get32($f)|0); $30 = $29 & $28; $31 = ($30|0)==(-1); if ($31) { $32 = ((($f)) + 100|0); HEAP32[$32>>2] = 36; HEAP32[$3>>2] = -1; break; } else { $33 = ($29|0)==(0); $$ = $33 ? $28 : -2; HEAP32[$3>>2] = $$; $34 = ((($f)) + 68|0); HEAP32[$34>>2] = $last_page_loc$0$lcssa; $35 = HEAP32[$end>>2]|0; $36 = ((($f)) + 72|0); HEAP32[$36>>2] = $35; $37 = ((($f)) + 76|0); HEAP32[$37>>2] = $$; break; } } } while(0); _set_file_offset($f,$6); } $38 = HEAP32[$3>>2]|0; $39 = ($38|0)==(-1); $$2 = $39 ? 0 : $38; $$0 = $$2; STACKTOP = sp;return ($$0|0); } function _stb_vorbis_open_file_section($file,$close_on_free,$error,$alloc,$length) { $file = $file|0; $close_on_free = $close_on_free|0; $error = $error|0; $alloc = $alloc|0; $length = $length|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $p = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 1520|0; $p = sp; _vorbis_init($p,$alloc); $0 = ((($p)) + 20|0); HEAP32[$0>>2] = $file; $1 = (_ftell($file)|0); $2 = ((($p)) + 24|0); HEAP32[$2>>2] = $1; $3 = ((($p)) + 44|0); HEAP32[$3>>2] = $length; $4 = ((($p)) + 28|0); HEAP32[$4>>2] = $close_on_free; $5 = (_start_decoder($p)|0); $6 = ($5|0)==(0); if (!($6)) { $7 = (_vorbis_alloc($p)|0); $8 = ($7|0)==(0|0); if (!($8)) { _memcpy(($7|0),($p|0),1512)|0; _vorbis_pump_first_frame($7); $$0 = $7; STACKTOP = sp;return ($$0|0); } } $9 = ($error|0)==(0|0); if (!($9)) { $10 = ((($p)) + 100|0); $11 = HEAP32[$10>>2]|0; HEAP32[$error>>2] = $11; } _vorbis_deinit($p); $$0 = 0; STACKTOP = sp;return ($$0|0); } function _stb_vorbis_open_file($file,$close_on_free,$error,$alloc) { $file = $file|0; $close_on_free = $close_on_free|0; $error = $error|0; $alloc = $alloc|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_ftell($file)|0); (_fseek($file,0,2)|0); $1 = (_ftell($file)|0); $2 = (($1) - ($0))|0; (_fseek($file,$0,0)|0); $3 = (_stb_vorbis_open_file_section($file,$close_on_free,$error,$alloc,$2)|0); return ($3|0); } function _stb_vorbis_open_filename($filename,$error,$alloc) { $filename = $filename|0; $error = $error|0; $alloc = $alloc|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_fopen($filename,20392)|0); $1 = ($0|0)==(0|0); if (!($1)) { $2 = (_stb_vorbis_open_file($0,1,$error,$alloc)|0); $$0 = $2; return ($$0|0); } $3 = ($error|0)==(0|0); if ($3) { $$0 = 0; return ($$0|0); } HEAP32[$error>>2] = 6; $$0 = 0; return ($$0|0); } function _stb_vorbis_get_samples_short_interleaved($f,$channels,$buffer,$num_shorts) { $f = $f|0; $channels = $channels|0; $buffer = $buffer|0; $num_shorts = $num_shorts|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $n$0 = 0, $n$1 = 0, $outputs = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $outputs = sp; $0 = (($num_shorts|0) / ($channels|0))&-1; $1 = ((($f)) + 4|0); $2 = ((($f)) + 1508|0); $3 = ((($f)) + 1504|0); $4 = ((($f)) + 800|0); $$0 = $buffer;$n$0 = 0; while(1) { $5 = ($0|0)>($n$0|0); if (!($5)) { $n$1 = $n$0; label = 7; break; } $6 = HEAP32[$2>>2]|0; $7 = HEAP32[$3>>2]|0; $8 = (($6) - ($7))|0; $9 = (($8) + ($n$0))|0; $10 = ($9|0)<($0|0); $11 = (($0) - ($n$0))|0; $$ = $10 ? $8 : $11; $12 = ($$|0)==(0); if (!($12)) { $13 = HEAP32[$1>>2]|0; _convert_channels_short_interleaved($channels,$$0,$13,$4,$7,$$); } $14 = (($$) + ($n$0))|0; $15 = HEAP32[$3>>2]|0; $16 = (($15) + ($$))|0; HEAP32[$3>>2] = $16; $17 = ($14|0)==($0|0); if ($17) { $n$1 = $14; label = 7; break; } $18 = Math_imul($$, $channels)|0; $19 = (($$0) + ($18<<1)|0); $20 = (_stb_vorbis_get_frame_float($f,0,$outputs)|0); $21 = ($20|0)==(0); if ($21) { $n$1 = $14; label = 7; break; } else { $$0 = $19;$n$0 = $14; } } if ((label|0) == 7) { STACKTOP = sp;return ($n$1|0); } return (0)|0; } function _TraceLog($msgType,$text,$varargs) { $msgType = $msgType|0; $text = $text|0; $varargs = $varargs|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $args = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $args = sp; switch ($msgType|0) { case 0: { $0 = HEAP32[8900>>2]|0; (_fwrite(15536,6,1,$0)|0); break; } case 1: { $1 = HEAP32[8900>>2]|0; (_fwrite(15543,7,1,$1)|0); break; } case 2: { $2 = HEAP32[8900>>2]|0; (_fwrite(15551,9,1,$2)|0); break; } case 3: { STACKTOP = sp;return; break; } default: { } } HEAP32[$args>>2] = $varargs; $3 = HEAP32[8900>>2]|0; (_vfprintf($3,$text,$args)|0); $4 = HEAP32[8900>>2]|0; (_fputc(10,$4)|0); $5 = ($msgType|0)==(1); if ($5) { _exit(1); // unreachable; } else { STACKTOP = sp;return; } } function _GetExtension($fileName) { $fileName = $fileName|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_strrchr($fileName,46)|0); $1 = ($0|0)==(0|0); $2 = ($0|0)==($fileName|0); $or$cond = $1 | $2; $3 = ((($0)) + 1|0); $$0 = $or$cond ? 17818 : $3; return ($$0|0); } function _ProcessGestureEvent($event) { $event = $event|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0.0, $183 = 0, $184 = 0.0, $185 = 0.0, $186 = 0.0, $187 = 0, $188 = 0.0; var $189 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0; var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0; var $54 = 0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $moveDownPosition$byval_copy11 = 0, $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond11 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $moveDownPosition2$byval_copy12 = sp + 8|0; $moveDownPosition$byval_copy11 = sp; $0 = ((($event)) + 4|0); $1 = HEAP32[$0>>2]|0; HEAP32[5780>>2] = $1; $2 = ($1|0)<(2); if (!($2)) { $102 = HEAP32[$event>>2]|0; switch ($102|0) { case 1: { $103 = ((($event)) + 16|0); $104 = $103; $105 = $104; $106 = HEAP32[$105>>2]|0; $107 = (($104) + 4)|0; $108 = $107; $109 = HEAP32[$108>>2]|0; $110 = 80; $111 = $110; HEAP32[$111>>2] = $106; $112 = (($110) + 4)|0; $113 = $112; HEAP32[$113>>2] = $109; $114 = ((($event)) + 24|0); $115 = $114; $116 = $115; $117 = HEAP32[$116>>2]|0; $118 = (($115) + 4)|0; $119 = $118; $120 = HEAP32[$119>>2]|0; $121 = 120; $122 = $121; HEAP32[$122>>2] = $117; $123 = (($121) + 4)|0; $124 = $123; HEAP32[$124>>2] = $120; $125 = +HEAPF32[120>>2]; $126 = +HEAPF32[80>>2]; $127 = $125 - $126; HEAPF32[128>>2] = $127; $128 = +HEAPF32[(124)>>2]; $129 = +HEAPF32[(84)>>2]; $130 = $128 - $129; HEAPF32[(132)>>2] = $130; HEAP32[5792>>2] = 4; STACKTOP = sp;return; break; } case 2: { ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; $131 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); HEAPF32[5812>>2] = $131; $132 = 112; $133 = $132; $134 = HEAP32[$133>>2]|0; $135 = (($132) + 4)|0; $136 = $135; $137 = HEAP32[$136>>2]|0; $138 = 80; $139 = $138; HEAP32[$139>>2] = $134; $140 = (($138) + 4)|0; $141 = $140; HEAP32[$141>>2] = $137; $142 = 136; $143 = $142; $144 = HEAP32[$143>>2]|0; $145 = (($142) + 4)|0; $146 = $145; $147 = HEAP32[$146>>2]|0; $148 = 120; $149 = $148; HEAP32[$149>>2] = $144; $150 = (($148) + 4)|0; $151 = $150; HEAP32[$151>>2] = $147; $152 = ((($event)) + 16|0); $153 = $152; $154 = $153; $155 = HEAP32[$154>>2]|0; $156 = (($153) + 4)|0; $157 = $156; $158 = HEAP32[$157>>2]|0; $159 = 112; $160 = $159; HEAP32[$160>>2] = $155; $161 = (($159) + 4)|0; $162 = $161; HEAP32[$162>>2] = $158; $163 = ((($event)) + 24|0); $164 = $163; $165 = $164; $166 = HEAP32[$165>>2]|0; $167 = (($164) + 4)|0; $168 = $167; $169 = HEAP32[$168>>2]|0; $170 = 136; $171 = $170; HEAP32[$171>>2] = $166; $172 = (($170) + 4)|0; $173 = $172; HEAP32[$173>>2] = $169; $174 = +HEAPF32[136>>2]; $175 = +HEAPF32[112>>2]; $176 = $174 - $175; HEAPF32[128>>2] = $176; $177 = +HEAPF32[(140)>>2]; $178 = +HEAPF32[(116)>>2]; $179 = $177 - $178; HEAPF32[(132)>>2] = $179; ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0; $180 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $181 = !($180 >= 0.004999999888241291); if ($181) { ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[120>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[120+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; $182 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $183 = !($182 >= 0.004999999888241291); if ($183) { HEAP32[5792>>2] = 4; } else { label = 34; } } else { label = 34; } do { if ((label|0) == 34) { ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; $184 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $185 = +HEAPF32[5812>>2]; $186 = $184 - $185; $187 = $186 < 0.0; if ($187) { HEAP32[5792>>2] = 256; break; } else { HEAP32[5792>>2] = 512; break; } } } while(0); ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; $188 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $189 = 360.0 - $188; HEAPF32[5816>>2] = $189; STACKTOP = sp;return; break; } case 0: { HEAPF32[5812>>2] = 0.0; HEAPF32[5816>>2] = 0.0; HEAPF32[128>>2] = 0.0; HEAPF32[(132)>>2] = 0.0; HEAP32[5792>>2] = 0; STACKTOP = sp;return; break; } default: { STACKTOP = sp;return; } } } $3 = ((($event)) + 8|0); $4 = HEAP32[$3>>2]|0; HEAP32[5784>>2] = $4; $5 = HEAP32[$event>>2]|0; switch ($5|0) { case 1: { $6 = HEAP32[5788>>2]|0; $7 = (($6) + 1)|0; HEAP32[5788>>2] = $7; $8 = HEAP32[5792>>2]|0; $9 = ($8|0)==(0); $10 = ($6|0)>(0); $or$cond = $10 & $9; if ($or$cond) { $11 = ((($event)) + 16|0); ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$11>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$11+4>>2]|0; $12 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $13 = $12 < 0.029999999329447746; if ($13) { HEAP32[5792>>2] = 2; HEAP32[5788>>2] = 0; } else { label = 6; } } else { label = 6; } if ((label|0) == 6) { HEAP32[5788>>2] = 1; HEAP32[5792>>2] = 1; } $14 = ((($event)) + 16|0); $15 = $14; $16 = $15; $17 = HEAP32[$16>>2]|0; $18 = (($15) + 4)|0; $19 = $18; $20 = HEAP32[$19>>2]|0; $21 = 80; $22 = $21; HEAP32[$22>>2] = $17; $23 = (($21) + 4)|0; $24 = $23; HEAP32[$24>>2] = $20; $25 = $14; $26 = $25; $27 = HEAP32[$26>>2]|0; $28 = (($25) + 4)|0; $29 = $28; $30 = HEAP32[$29>>2]|0; $31 = 88; $32 = $31; HEAP32[$32>>2] = $27; $33 = (($31) + 4)|0; $34 = $33; HEAP32[$34>>2] = $30; $35 = 96; $36 = $35; HEAP32[$36>>2] = $17; $37 = (($35) + 4)|0; $38 = $37; HEAP32[$38>>2] = $20; HEAPF32[104>>2] = 0.0; HEAPF32[(108)>>2] = 0.0; STACKTOP = sp;return; break; } case 0: { $39 = HEAP32[5792>>2]|0; $40 = ($39|0)==(8); if ($40) { $41 = ((($event)) + 16|0); $42 = $41; $43 = $42; $44 = HEAP32[$43>>2]|0; $45 = (($42) + 4)|0; $46 = $45; $47 = HEAP32[$46>>2]|0; $48 = 96; $49 = $48; HEAP32[$49>>2] = $44; $50 = (($48) + 4)|0; $51 = $50; HEAP32[$51>>2] = $47; } ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0; $52 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $53 = $52 / 0.0; HEAPF32[5796>>2] = $53; HEAP32[5800>>2] = 0; $54 = $53 > 5.0000002374872565E-4; $55 = HEAP32[5784>>2]|0; $56 = ($55|0)==(0); $or$cond3 = $54 & $56; do { if ($or$cond3) { ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0; $57 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $58 = 360.0 - $57; HEAPF32[5804>>2] = $58; $59 = $58 < 30.0; $60 = $58 > 330.0; $or$cond5 = $59 | $60; if ($or$cond5) { HEAP32[5792>>2] = 16; break; } $61 = $58 > 30.0; $62 = $58 < 120.0; $or$cond7 = $61 & $62; if ($or$cond7) { HEAP32[5792>>2] = 64; break; } $63 = $58 > 120.0; $64 = $58 < 210.0; $or$cond9 = $63 & $64; if ($or$cond9) { HEAP32[5792>>2] = 32; break; } $65 = $58 > 210.0; $66 = $58 < 300.0; $or$cond11 = $65 & $66; if ($or$cond11) { HEAP32[5792>>2] = 128; break; } else { HEAP32[5792>>2] = 0; break; } } else { HEAPF32[5796>>2] = 0.0; HEAPF32[5804>>2] = 0.0; HEAP32[5792>>2] = 0; } } while(0); HEAPF32[88>>2] = 0.0; HEAPF32[(92)>>2] = 0.0; STACKTOP = sp;return; break; } case 2: { $67 = HEAP32[5800>>2]|0; $68 = ($67|0)==(0); if ($68) { HEAP32[5800>>2] = 1; } $69 = ((($event)) + 16|0); $70 = $69; $71 = $70; $72 = HEAP32[$71>>2]|0; $73 = (($70) + 4)|0; $74 = $73; $75 = HEAP32[$74>>2]|0; $76 = 112; $77 = $76; HEAP32[$77>>2] = $72; $78 = (($76) + 4)|0; $79 = $78; HEAP32[$79>>2] = $75; $80 = HEAP32[5792>>2]|0; $81 = ($80|0)==(4); if ($81) { $82 = HEAP32[5808>>2]|0; $83 = ($82|0)==(1); if ($83) { $84 = $69; $85 = $84; $86 = HEAP32[$85>>2]|0; $87 = (($84) + 4)|0; $88 = $87; $89 = HEAP32[$88>>2]|0; $90 = 80; $91 = $90; HEAP32[$91>>2] = $86; $92 = (($90) + 4)|0; $93 = $92; HEAP32[$93>>2] = $89; } HEAP32[5808>>2] = 2; ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0; $94 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); $95 = !($94 >= 0.014999999664723873); if (!($95)) { HEAP32[5792>>2] = 8; } } $96 = +HEAPF32[112>>2]; $97 = +HEAPF32[88>>2]; $98 = $96 - $97; HEAPF32[104>>2] = $98; $99 = +HEAPF32[(116)>>2]; $100 = +HEAPF32[(92)>>2]; $101 = $99 - $100; HEAPF32[(108)>>2] = $101; STACKTOP = sp;return; break; } default: { STACKTOP = sp;return; } } } function _UpdateGestures() { var $$off = 0, $$pr = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[5792>>2]|0; $$off = (($0) + -1)|0; $1 = ($$off>>>0)<(2); $2 = HEAP32[5780>>2]|0; $3 = ($2|0)<(2); $or$cond3 = $1 & $3; if ($or$cond3) { HEAP32[5792>>2] = 4; return; } $$pr = HEAP32[5792>>2]|0; switch ($$pr|0) { case 16: case 32: case 64: case 128: { break; } default: { return; } } HEAP32[5792>>2] = 0; return; } function _InitDisplay($width,$height) { $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $count = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr9 = 0, dest = 0, label = 0; var sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; $vararg_buffer18 = sp + 56|0; $vararg_buffer14 = sp + 48|0; $vararg_buffer10 = sp + 40|0; $vararg_buffer7 = sp + 32|0; $vararg_buffer5 = sp + 24|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $0 = sp + 64|0; $count = sp + 60|0; HEAP32[816>>2] = $width; HEAP32[820>>2] = $height; _MatrixIdentity($0); dest=840; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); (_glfwSetErrorCallback((2|0))|0); $1 = (_glfwInit()|0); $2 = ($1|0)==(0); if ($2) { _TraceLog(1,23369,$vararg_buffer); } $3 = HEAP32[816>>2]|0; HEAP32[980>>2] = $3; $4 = HEAP32[820>>2]|0; HEAP32[984>>2] = $4; _glfwDefaultWindowHints(); _glfwWindowHint(131075,0); $5 = (_rlGetVersion()|0); $6 = ($5|0)==(2); if ($6) { $7 = HEAP8[10887>>0]|0; $8 = $7 & 16; $9 = ($8<<24>>24)==(0); if (!($9)) { _glfwWindowHint(135181,4); _TraceLog(0,23395,$vararg_buffer1); } _glfwWindowHint(139266,3); _glfwWindowHint(139267,3); _glfwWindowHint(139272,204801); _glfwWindowHint(139270,0); } $10 = HEAP32[968>>2]|0; $11 = ($10|0)==(0); if ($11) { $20 = HEAP32[816>>2]|0; $21 = HEAP32[820>>2]|0; $22 = HEAP32[812>>2]|0; $23 = (_glfwCreateWindow(($20|0),($21|0),($22|0),(0|0),(0|0))|0); HEAP32[828>>2] = $23; $24 = HEAP32[816>>2]|0; HEAP32[996>>2] = $24; $25 = HEAP32[820>>2]|0; HEAP32[1000>>2] = $25; $26 = $23; } else { $12 = HEAP32[980>>2]|0; $13 = HEAP32[984>>2]|0; _SetupFramebufferSize($12,$13); $14 = (_glfwGetPrimaryMonitor()|0); (_glfwGetVideoModes(($14|0),($count|0))|0); $15 = HEAP32[816>>2]|0; $16 = HEAP32[820>>2]|0; $17 = HEAP32[812>>2]|0; $18 = (_glfwGetPrimaryMonitor()|0); $19 = (_glfwCreateWindow(($15|0),($16|0),($17|0),($18|0),(0|0))|0); HEAP32[828>>2] = $19; $26 = $19; } $27 = ($26|0)==(0|0); if ($27) { _glfwTerminate(); _TraceLog(1,23420,$vararg_buffer3); } else { _TraceLog(0,23453,$vararg_buffer5); $28 = HEAP32[996>>2]|0; $29 = HEAP32[1000>>2]|0; HEAP32[$vararg_buffer7>>2] = $28; $vararg_ptr9 = ((($vararg_buffer7)) + 4|0); HEAP32[$vararg_ptr9>>2] = $29; _TraceLog(0,23493,$vararg_buffer7); $30 = HEAP32[816>>2]|0; $31 = HEAP32[820>>2]|0; HEAP32[$vararg_buffer10>>2] = $30; $vararg_ptr13 = ((($vararg_buffer10)) + 4|0); HEAP32[$vararg_ptr13>>2] = $31; _TraceLog(0,23514,$vararg_buffer10); $32 = HEAP32[988>>2]|0; $33 = HEAP32[992>>2]|0; HEAP32[$vararg_buffer14>>2] = $32; $vararg_ptr17 = ((($vararg_buffer14)) + 4|0); HEAP32[$vararg_ptr17>>2] = $33; _TraceLog(0,23535,$vararg_buffer14); } $34 = HEAP32[828>>2]|0; (_glfwSetWindowSizeCallback(($34|0),(1|0))|0); $35 = HEAP32[828>>2]|0; (_glfwSetCursorEnterCallback(($35|0),(3|0))|0); $36 = HEAP32[828>>2]|0; (_glfwSetKeyCallback(($36|0),(1|0))|0); $37 = HEAP32[828>>2]|0; (_glfwSetMouseButtonCallback(($37|0),(1|0))|0); $38 = HEAP32[828>>2]|0; (_glfwSetCursorPosCallback(($38|0),(1|0))|0); $39 = HEAP32[828>>2]|0; (_glfwSetCharCallback(($39|0),(4|0))|0); $40 = HEAP32[828>>2]|0; (_glfwSetScrollCallback(($40|0),(2|0))|0); $41 = HEAP32[828>>2]|0; (_glfwSetWindowIconifyCallback(($41|0),(5|0))|0); $42 = HEAP32[828>>2]|0; _glfwMakeContextCurrent(($42|0)); $43 = HEAP8[10887>>0]|0; $44 = $43 & 32; $45 = ($44<<24>>24)==(0); if ($45) { STACKTOP = sp;return; } _glfwSwapInterval(1); _TraceLog(0,23560,$vararg_buffer18); STACKTOP = sp;return; } function _InitGraphics() { var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $$byval_copy = sp + 4|0; $0 = sp; _rlglInit(); $1 = HEAP32[988>>2]|0; $2 = HEAP32[992>>2]|0; $3 = HEAP32[996>>2]|0; $4 = HEAP32[1000>>2]|0; _rlglInitGraphics($1,$2,$3,$4); HEAP8[$0>>0] = -11; $5 = ((($0)) + 1|0); HEAP8[$5>>0] = -11; $6 = ((($0)) + 2|0); HEAP8[$6>>0] = -11; $7 = ((($0)) + 3|0); HEAP8[$7>>0] = -1; ;HEAP8[$$byval_copy>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$0+3>>0]|0; _ClearBackground($$byval_copy); STACKTOP = sp;return; } function _InitTimer() { var $0 = 0, $1 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (_time((0|0))|0); _srand($0); $1 = (+_GetTime()); HEAPF64[32>>3] = $1; return; } function _EmscriptenFullscreenChangeCallback($eventType,$e,$userData) { $eventType = $eventType|0; $e = $e|0; $userData = $userData|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer = sp; $0 = HEAP32[$e>>2]|0; $1 = ($0|0)==(0); $2 = ((($e)) + 264|0); $3 = HEAP32[$2>>2]|0; $4 = ((($e)) + 268|0); $5 = HEAP32[$4>>2]|0; $6 = ((($e)) + 272|0); $7 = HEAP32[$6>>2]|0; $8 = ((($e)) + 276|0); $9 = HEAP32[$8>>2]|0; if ($1) { HEAP32[$vararg_buffer4>>2] = $3; $vararg_ptr7 = ((($vararg_buffer4)) + 4|0); HEAP32[$vararg_ptr7>>2] = $5; $vararg_ptr8 = ((($vararg_buffer4)) + 8|0); HEAP32[$vararg_ptr8>>2] = $7; $vararg_ptr9 = ((($vararg_buffer4)) + 12|0); HEAP32[$vararg_ptr9>>2] = $9; _TraceLog(0,23302,$vararg_buffer4); STACKTOP = sp;return 0; } else { HEAP32[$vararg_buffer>>2] = $3; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $5; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $7; $vararg_ptr3 = ((($vararg_buffer)) + 12|0); HEAP32[$vararg_ptr3>>2] = $9; _TraceLog(0,23233,$vararg_buffer); STACKTOP = sp;return 0; } return (0)|0; } function _EmscriptenInputCallback($eventType,$touchEvent,$userData) { $eventType = $eventType|0; $touchEvent = $touchEvent|0; $userData = $userData|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $7 = 0; var $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $gestureEvent$byval_copy = sp + 32|0; $gestureEvent = sp; switch ($eventType|0) { case 22: { HEAP32[$gestureEvent>>2] = 1; break; } case 23: { HEAP32[$gestureEvent>>2] = 0; break; } case 24: { HEAP32[$gestureEvent>>2] = 2; break; } default: { } } $0 = HEAP32[$touchEvent>>2]|0; $1 = ((($gestureEvent)) + 4|0); HEAP32[$1>>2] = $0; $2 = ((($touchEvent)) + 20|0); $3 = HEAP32[$2>>2]|0; $4 = ((($gestureEvent)) + 8|0); HEAP32[$4>>2] = $3; $5 = ((($touchEvent)) + 72|0); $6 = HEAP32[$5>>2]|0; $7 = ((($gestureEvent)) + 12|0); HEAP32[$7>>2] = $6; $8 = ((($touchEvent)) + 56|0); $9 = HEAP32[$8>>2]|0; $10 = (+($9|0)); $11 = ((($touchEvent)) + 60|0); $12 = HEAP32[$11>>2]|0; $13 = (+($12|0)); $14 = ((($gestureEvent)) + 16|0); HEAPF32[$14>>2] = $10; $15 = ((($gestureEvent)) + 20|0); HEAPF32[$15>>2] = $13; $16 = ((($touchEvent)) + 108|0); $17 = HEAP32[$16>>2]|0; $18 = (+($17|0)); $19 = ((($touchEvent)) + 112|0); $20 = HEAP32[$19>>2]|0; $21 = (+($20|0)); $22 = ((($gestureEvent)) + 24|0); HEAPF32[$22>>2] = $18; $23 = ((($gestureEvent)) + 28|0); HEAPF32[$23>>2] = $21; $24 = ((($gestureEvent)) + 16|0); $25 = $24; $26 = $25; $27 = HEAP32[$26>>2]|0; $28 = (($25) + 4)|0; $29 = $28; $30 = HEAP32[$29>>2]|0; $31 = 64; $32 = $31; HEAP32[$32>>2] = $27; $33 = (($31) + 4)|0; $34 = $33; HEAP32[$34>>2] = $30; $35 = ((($gestureEvent)) + 24|0); $36 = $35; $37 = $36; $38 = HEAP32[$37>>2]|0; $39 = (($36) + 4)|0; $40 = $39; $41 = HEAP32[$40>>2]|0; $42 = (72); $43 = $42; HEAP32[$43>>2] = $38; $44 = (($42) + 4)|0; $45 = $44; HEAP32[$45>>2] = $41; $46 = (_GetScreenWidth()|0); $47 = (+($46|0)); $48 = +HEAPF32[$24>>2]; $49 = $48 / $47; HEAPF32[$24>>2] = $49; $50 = (_GetScreenHeight()|0); $51 = (+($50|0)); $52 = +HEAPF32[$15>>2]; $53 = $52 / $51; HEAPF32[$15>>2] = $53; $54 = (_GetScreenWidth()|0); $55 = (+($54|0)); $56 = +HEAPF32[$35>>2]; $57 = $56 / $55; HEAPF32[$35>>2] = $57; $58 = (_GetScreenHeight()|0); $59 = (+($58|0)); $60 = +HEAPF32[$23>>2]; $61 = $60 / $59; HEAPF32[$23>>2] = $61; ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0; _ProcessGestureEvent($gestureEvent$byval_copy); STACKTOP = sp;return 1; } function _LogoAnimation() { var label = 0, sp = 0; sp = STACKTOP; HEAP32[824>>2] = 0; return; } function _GetTime() { var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_glfwGetTime()); return (+$0); } function _SwapBuffers() { var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[828>>2]|0; _glfwSwapBuffers(($0|0)); return; } function _PollInputEvents() { var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $mouseX = 0, $mouseY = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $mouseX = sp + 8|0; $mouseY = sp; _UpdateGestures(); $0 = HEAP32[828>>2]|0; _glfwGetCursorPos(($0|0),($mouseX|0),($mouseY|0)); $1 = +HEAPF64[$mouseX>>3]; $2 = $1; HEAPF32[8>>2] = $2; $3 = +HEAPF64[$mouseY>>3]; $4 = $3; HEAPF32[(12)>>2] = $4; HEAP32[972>>2] = -1; _memcpy((11400|0),(10888|0),512)|0; ;HEAP8[11915>>0]=HEAP8[11912>>0]|0;HEAP8[11915+1>>0]=HEAP8[11912+1>>0]|0;HEAP8[11915+2>>0]=HEAP8[11912+2>>0]|0; $5 = HEAP32[8648>>2]|0; HEAP32[976>>2] = $5; HEAP32[8648>>2] = 0; _glfwPollEvents(); STACKTOP = sp;return; } function _LoadDefaultShader($agg$result) { $agg$result = $agg$result|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $fShaderStr = 0, $vShaderStr = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 864|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $vShaderStr = sp + 390|0; $fShaderStr = sp + 12|0; _memcpy(($vShaderStr|0),(22282|0),466)|0; _memcpy(($fShaderStr|0),(22748|0),377)|0; $0 = (_LoadShaderProgram($vShaderStr,$fShaderStr)|0); $1 = ($0|0)==(0); if ($1) { HEAP32[$vararg_buffer1>>2] = $0; _TraceLog(2,23173,$vararg_buffer1); } else { HEAP32[$vararg_buffer>>2] = $0; _TraceLog(0,23125,$vararg_buffer); } $2 = (_glGetAttribLocation(($0|0),(13758|0))|0); $3 = (_glGetAttribLocation(($0|0),(13773|0))|0); $4 = (_glGetAttribLocation(($0|0),(23221|0))|0); $5 = (_glGetUniformLocation(($0|0),(13801|0))|0); $6 = (_glGetUniformLocation(($0|0),(13825|0))|0); $7 = HEAP32[808>>2]|0; HEAP32[$agg$result>>2] = $0; $8 = ((($agg$result)) + 4|0); HEAP32[$8>>2] = $7; $9 = ((($agg$result)) + 8|0); HEAP32[$9>>2] = 0; $10 = ((($agg$result)) + 12|0); HEAP32[$10>>2] = 0; $11 = ((($agg$result)) + 16|0); HEAP32[$11>>2] = $2; $12 = ((($agg$result)) + 20|0); HEAP32[$12>>2] = $3; $13 = ((($agg$result)) + 24|0); HEAP32[$13>>2] = -1; $14 = ((($agg$result)) + 28|0); HEAP32[$14>>2] = $4; $15 = ((($agg$result)) + 32|0); HEAP32[$15>>2] = $5; $16 = ((($agg$result)) + 36|0); HEAP32[$16>>2] = -1; $17 = ((($agg$result)) + 40|0); HEAP32[$17>>2] = $6; $18 = ((($agg$result)) + 44|0); HEAP32[$18>>2] = -1; $19 = ((($agg$result)) + 48|0); HEAP32[$19>>2] = -1; STACKTOP = sp;return; } function _LoadSimpleShader($agg$result) { $agg$result = $agg$result|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $fShaderStr = 0, $vShaderStr = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 800|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $vShaderStr = sp + 389|0; $fShaderStr = sp + 12|0; _memcpy(($vShaderStr|0),(21410|0),401)|0; _memcpy(($fShaderStr|0),(21811|0),377)|0; $0 = (_LoadShaderProgram($vShaderStr,$fShaderStr)|0); $1 = ($0|0)==(0); if ($1) { HEAP32[$vararg_buffer1>>2] = $0; _TraceLog(2,22235,$vararg_buffer1); } else { HEAP32[$vararg_buffer>>2] = $0; _TraceLog(0,22188,$vararg_buffer); } $2 = (_glGetAttribLocation(($0|0),(13758|0))|0); $3 = (_glGetAttribLocation(($0|0),(13773|0))|0); $4 = (_glGetAttribLocation(($0|0),(13788|0))|0); $5 = (_glGetUniformLocation(($0|0),(13801|0))|0); $6 = (_glGetUniformLocation(($0|0),(13811|0))|0); $7 = (_glGetUniformLocation(($0|0),(13825|0))|0); $8 = HEAP32[808>>2]|0; HEAP32[$agg$result>>2] = $0; $9 = ((($agg$result)) + 4|0); HEAP32[$9>>2] = $8; $10 = ((($agg$result)) + 8|0); HEAP32[$10>>2] = 0; $11 = ((($agg$result)) + 12|0); HEAP32[$11>>2] = 0; $12 = ((($agg$result)) + 16|0); HEAP32[$12>>2] = $2; $13 = ((($agg$result)) + 20|0); HEAP32[$13>>2] = $3; $14 = ((($agg$result)) + 24|0); HEAP32[$14>>2] = $4; $15 = ((($agg$result)) + 28|0); HEAP32[$15>>2] = -1; $16 = ((($agg$result)) + 32|0); HEAP32[$16>>2] = $5; $17 = ((($agg$result)) + 36|0); HEAP32[$17>>2] = $6; $18 = ((($agg$result)) + 40|0); HEAP32[$18>>2] = $7; $19 = ((($agg$result)) + 44|0); HEAP32[$19>>2] = -1; $20 = ((($agg$result)) + 48|0); HEAP32[$20>>2] = -1; STACKTOP = sp;return; } function _InitializeBuffers() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond14 = 0, $exitcond17 = 0, $exitcond19 = 0, $i1$012 = 0, $i3$010 = 0, $i6$07 = 0, $i7$06 = 0, $k$05 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $0 = (_malloc(24576)|0); HEAP32[2232>>2] = $0; $1 = (_malloc(8192)|0); HEAP32[2192>>2] = $1; $2 = HEAP32[2232>>2]|0; _memset(($2|0),0,24576)|0; $i1$012 = 0; while(1) { $3 = HEAP32[2192>>2]|0; $4 = (($3) + ($i1$012)|0); HEAP8[$4>>0] = 0; $5 = (($i1$012) + 1)|0; $exitcond19 = ($5|0)==(8192); if ($exitcond19) { break; } else { $i1$012 = $5; } } HEAP32[2184>>2] = 0; HEAP32[2188>>2] = 0; $6 = (_malloc(73728)|0); HEAP32[2236>>2] = $6; $7 = (_malloc(24576)|0); HEAP32[2204>>2] = $7; $8 = HEAP32[2236>>2]|0; _memset(($8|0),0,73728)|0; $i3$010 = 0; while(1) { $9 = HEAP32[2204>>2]|0; $10 = (($9) + ($i3$010)|0); HEAP8[$10>>0] = 0; $11 = (($i3$010) + 1)|0; $exitcond17 = ($11|0)==(24576); if ($exitcond17) { break; } else { $i3$010 = $11; } } HEAP32[2196>>2] = 0; HEAP32[2200>>2] = 0; $12 = (_malloc(49152)|0); HEAP32[2240>>2] = $12; $13 = (_malloc(32768)|0); HEAP32[2224>>2] = $13; $14 = (_malloc(16384)|0); HEAP32[2216>>2] = $14; $15 = (_malloc(12288)|0); HEAP32[2728>>2] = $15; $16 = HEAP32[2240>>2]|0; _memset(($16|0),0,49152)|0; $17 = HEAP32[2224>>2]|0; _memset(($17|0),0,32768)|0; $i6$07 = 0; while(1) { $19 = HEAP32[2216>>2]|0; $20 = (($19) + ($i6$07)|0); HEAP8[$20>>0] = 0; $21 = (($i6$07) + 1)|0; $exitcond14 = ($21|0)==(16384); if ($exitcond14) { break; } else { $i6$07 = $21; } } $18 = HEAP32[2728>>2]|0; $i7$06 = 0;$k$05 = 0; while(1) { $22 = $k$05 << 2; $23 = $22&65535; $24 = (($18) + ($i7$06<<1)|0); HEAP16[$24>>1] = $23; $25 = $22 | 1; $26 = $25&65535; $27 = $i7$06 | 1; $28 = (($18) + ($27<<1)|0); HEAP16[$28>>1] = $26; $29 = $22 | 2; $30 = $29&65535; $31 = (($i7$06) + 2)|0; $32 = (($18) + ($31<<1)|0); HEAP16[$32>>1] = $30; $33 = (($i7$06) + 3)|0; $34 = (($18) + ($33<<1)|0); HEAP16[$34>>1] = $23; $35 = (($i7$06) + 4)|0; $36 = (($18) + ($35<<1)|0); HEAP16[$36>>1] = $30; $37 = $22 | 3; $38 = $37&65535; $39 = (($i7$06) + 5)|0; $40 = (($18) + ($39<<1)|0); HEAP16[$40>>1] = $38; $41 = (($k$05) + 1)|0; $42 = (($i7$06) + 6)|0; $exitcond = ($41|0)==(1024); if ($exitcond) { break; } else { $i7$06 = $42;$k$05 = $41; } } HEAP32[2208>>2] = 0; HEAP32[2220>>2] = 0; HEAP32[2212>>2] = 0; _TraceLog(0,21347,$vararg_buffer); STACKTOP = sp;return; } function _InitializeBuffersGPU() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer12 = 0, $vararg_buffer15 = 0, $vararg_buffer5 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr18 = 0, $vararg_ptr19 = 0, $vararg_ptr20 = 0, $vararg_ptr4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $vararg_buffer15 = sp + 40|0; $vararg_buffer12 = sp + 32|0; $vararg_buffer8 = sp + 24|0; $vararg_buffer5 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $0 = HEAP32[2264>>2]|0; $1 = ($0|0)==(0); if (!($1)) { $2 = HEAP32[2272>>2]|0; FUNCTION_TABLE_vii[$2 & 63](1,2716); $3 = HEAP32[2276>>2]|0; $4 = HEAP32[2716>>2]|0; FUNCTION_TABLE_vi[$3 & 31]($4); } _glGenBuffers(2,(2684|0)); $5 = HEAP32[2684>>2]|0; _glBindBuffer(34962,($5|0)); $6 = HEAP32[2232>>2]|0; _glBufferData(34962,24576,($6|0),35048); $7 = HEAP32[(2424)>>2]|0; _glEnableVertexAttribArray(($7|0)); $8 = HEAP32[(2424)>>2]|0; _glVertexAttribPointer(($8|0),3,5126,0,0,(0|0)); $9 = HEAP32[(2688)>>2]|0; _glBindBuffer(34962,($9|0)); $10 = HEAP32[2192>>2]|0; _glBufferData(34962,8192,($10|0),35048); $11 = HEAP32[(2436)>>2]|0; _glEnableVertexAttribArray(($11|0)); $12 = HEAP32[(2436)>>2]|0; _glVertexAttribPointer(($12|0),4,5121,1,0,(0|0)); $13 = HEAP32[2264>>2]|0; $14 = ($13|0)==(0); if ($14) { $16 = HEAP32[2684>>2]|0; $17 = HEAP32[(2688)>>2]|0; HEAP32[$vararg_buffer1>>2] = $16; $vararg_ptr4 = ((($vararg_buffer1)) + 4|0); HEAP32[$vararg_ptr4>>2] = $17; _TraceLog(0,21046,$vararg_buffer1); } else { $15 = HEAP32[2716>>2]|0; HEAP32[$vararg_buffer>>2] = $15; _TraceLog(0,20999,$vararg_buffer); } $18 = HEAP32[2264>>2]|0; $19 = ($18|0)==(0); if (!($19)) { $20 = HEAP32[2272>>2]|0; FUNCTION_TABLE_vii[$20 & 63](1,2720); $21 = HEAP32[2276>>2]|0; $22 = HEAP32[2720>>2]|0; FUNCTION_TABLE_vi[$21 & 31]($22); } _glGenBuffers(2,(2692|0)); $23 = HEAP32[2692>>2]|0; _glBindBuffer(34962,($23|0)); $24 = HEAP32[2236>>2]|0; _glBufferData(34962,73728,($24|0),35048); $25 = HEAP32[(2424)>>2]|0; _glEnableVertexAttribArray(($25|0)); $26 = HEAP32[(2424)>>2]|0; _glVertexAttribPointer(($26|0),3,5126,0,0,(0|0)); $27 = HEAP32[(2696)>>2]|0; _glBindBuffer(34962,($27|0)); $28 = HEAP32[2204>>2]|0; _glBufferData(34962,24576,($28|0),35048); $29 = HEAP32[(2436)>>2]|0; _glEnableVertexAttribArray(($29|0)); $30 = HEAP32[(2436)>>2]|0; _glVertexAttribPointer(($30|0),4,5121,1,0,(0|0)); $31 = HEAP32[2264>>2]|0; $32 = ($31|0)==(0); if ($32) { $34 = HEAP32[2692>>2]|0; $35 = HEAP32[(2696)>>2]|0; HEAP32[$vararg_buffer8>>2] = $34; $vararg_ptr11 = ((($vararg_buffer8)) + 4|0); HEAP32[$vararg_ptr11>>2] = $35; _TraceLog(0,21156,$vararg_buffer8); } else { $33 = HEAP32[2720>>2]|0; HEAP32[$vararg_buffer5>>2] = $33; _TraceLog(0,21105,$vararg_buffer5); } $36 = HEAP32[2264>>2]|0; $37 = ($36|0)==(0); if (!($37)) { $38 = HEAP32[2272>>2]|0; FUNCTION_TABLE_vii[$38 & 63](1,2724); $39 = HEAP32[2276>>2]|0; $40 = HEAP32[2724>>2]|0; FUNCTION_TABLE_vi[$39 & 31]($40); } _glGenBuffers(4,(2700|0)); $41 = HEAP32[2700>>2]|0; _glBindBuffer(34962,($41|0)); $42 = HEAP32[2240>>2]|0; _glBufferData(34962,49152,($42|0),35048); $43 = HEAP32[(2424)>>2]|0; _glEnableVertexAttribArray(($43|0)); $44 = HEAP32[(2424)>>2]|0; _glVertexAttribPointer(($44|0),3,5126,0,0,(0|0)); $45 = HEAP32[(2704)>>2]|0; _glBindBuffer(34962,($45|0)); $46 = HEAP32[2224>>2]|0; _glBufferData(34962,32768,($46|0),35048); $47 = HEAP32[(2428)>>2]|0; _glEnableVertexAttribArray(($47|0)); $48 = HEAP32[(2428)>>2]|0; _glVertexAttribPointer(($48|0),2,5126,0,0,(0|0)); $49 = HEAP32[(2708)>>2]|0; _glBindBuffer(34962,($49|0)); $50 = HEAP32[2216>>2]|0; _glBufferData(34962,16384,($50|0),35048); $51 = HEAP32[(2436)>>2]|0; _glEnableVertexAttribArray(($51|0)); $52 = HEAP32[(2436)>>2]|0; _glVertexAttribPointer(($52|0),4,5121,1,0,(0|0)); $53 = HEAP32[(2712)>>2]|0; _glBindBuffer(34963,($53|0)); $54 = HEAP32[2728>>2]|0; _glBufferData(34963,12288,($54|0),35044); $55 = HEAP32[2264>>2]|0; $56 = ($55|0)==(0); if ($56) { $58 = HEAP32[2700>>2]|0; $59 = HEAP32[(2704)>>2]|0; $60 = HEAP32[(2708)>>2]|0; $61 = HEAP32[(2712)>>2]|0; HEAP32[$vararg_buffer15>>2] = $58; $vararg_ptr18 = ((($vararg_buffer15)) + 4|0); HEAP32[$vararg_ptr18>>2] = $59; $vararg_ptr19 = ((($vararg_buffer15)) + 8|0); HEAP32[$vararg_ptr19>>2] = $60; $vararg_ptr20 = ((($vararg_buffer15)) + 12|0); HEAP32[$vararg_ptr20>>2] = $61; _TraceLog(0,21266,$vararg_buffer15); } else { $57 = HEAP32[2724>>2]|0; HEAP32[$vararg_buffer12>>2] = $57; _TraceLog(0,21219,$vararg_buffer12); } $62 = HEAP32[2264>>2]|0; $63 = ($62|0)==(0); if ($63) { STACKTOP = sp;return; } $64 = HEAP32[2276>>2]|0; FUNCTION_TABLE_vi[$64 & 31](0); STACKTOP = sp;return; } function _LoadCompressedTexture($data,$width,$height,$mipmapCount,$compressedFormat) { $data = $data|0; $width = $width|0; $height = $height|0; $mipmapCount = $mipmapCount|0; $compressedFormat = $compressedFormat|0; var $$ = 0, $$013 = 0, $$0610 = 0, $$17 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $blockSize$0 = 0, $level$012 = 0, $offset$011 = 0, $or$cond = 0, $or$cond9 = 0, label = 0, sp = 0; sp = STACKTOP; _glPixelStorei(3317,1); switch ($compressedFormat|0) { case 33776: case 33777: case 36196: case 37492: { $blockSize$0 = 8; break; } default: { $blockSize$0 = 16; } } $0 = ($mipmapCount|0)<(1); $1 = $width | $height; $2 = ($1|0)==(0); $or$cond9 = $0 | $2; if ($or$cond9) { return; } else { $$013 = $width;$$0610 = $height;$level$012 = 0;$offset$011 = 0; } while(1) { $3 = (($$013) + 3)|0; $4 = (($3|0) / 4)&-1; $5 = (($$0610) + 3)|0; $6 = (($5|0) / 4)&-1; $7 = Math_imul($4, $blockSize$0)|0; $8 = Math_imul($7, $6)|0; $9 = (($data) + ($offset$011)|0); _glCompressedTexImage2D(3553,($level$012|0),($compressedFormat|0),($$013|0),($$0610|0),0,($8|0),($9|0)); $10 = (($8) + ($offset$011))|0; $11 = (($$013|0) / 2)&-1; $12 = (($$0610|0) / 2)&-1; $13 = ($$013|0)<(2); $$ = $13 ? 1 : $11; $14 = ($$0610|0)<(2); $$17 = $14 ? 1 : $12; $15 = (($level$012) + 1)|0; $16 = ($15|0)>=($mipmapCount|0); $17 = $$ | $$17; $18 = ($17|0)==(0); $or$cond = $16 | $18; if ($or$cond) { break; } else { $$013 = $$;$$0610 = $$17;$level$012 = $15;$offset$011 = $10; } } return; } function _UpdateBuffers() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[2184>>2]|0; $1 = ($0|0)>(0); if ($1) { $2 = HEAP32[2264>>2]|0; $3 = ($2|0)==(0); if (!($3)) { $4 = HEAP32[2276>>2]|0; $5 = HEAP32[2716>>2]|0; FUNCTION_TABLE_vi[$4 & 31]($5); } $6 = HEAP32[2684>>2]|0; _glBindBuffer(34962,($6|0)); $7 = HEAP32[2184>>2]|0; $8 = ($7*12)|0; $9 = HEAP32[2232>>2]|0; _glBufferSubData(34962,0,($8|0),($9|0)); $10 = HEAP32[(2688)>>2]|0; _glBindBuffer(34962,($10|0)); $11 = HEAP32[2188>>2]|0; $12 = $11 << 2; $13 = HEAP32[2192>>2]|0; _glBufferSubData(34962,0,($12|0),($13|0)); } $14 = HEAP32[2196>>2]|0; $15 = ($14|0)>(0); if ($15) { $16 = HEAP32[2264>>2]|0; $17 = ($16|0)==(0); if (!($17)) { $18 = HEAP32[2276>>2]|0; $19 = HEAP32[2720>>2]|0; FUNCTION_TABLE_vi[$18 & 31]($19); } $20 = HEAP32[2692>>2]|0; _glBindBuffer(34962,($20|0)); $21 = HEAP32[2196>>2]|0; $22 = ($21*12)|0; $23 = HEAP32[2236>>2]|0; _glBufferSubData(34962,0,($22|0),($23|0)); $24 = HEAP32[(2696)>>2]|0; _glBindBuffer(34962,($24|0)); $25 = HEAP32[2200>>2]|0; $26 = $25 << 2; $27 = HEAP32[2204>>2]|0; _glBufferSubData(34962,0,($26|0),($27|0)); } $28 = HEAP32[2208>>2]|0; $29 = ($28|0)>(0); if ($29) { $30 = HEAP32[2264>>2]|0; $31 = ($30|0)==(0); if (!($31)) { $32 = HEAP32[2276>>2]|0; $33 = HEAP32[2724>>2]|0; FUNCTION_TABLE_vi[$32 & 31]($33); } $34 = HEAP32[2700>>2]|0; _glBindBuffer(34962,($34|0)); $35 = HEAP32[2208>>2]|0; $36 = ($35*12)|0; $37 = HEAP32[2240>>2]|0; _glBufferSubData(34962,0,($36|0),($37|0)); $38 = HEAP32[(2704)>>2]|0; _glBindBuffer(34962,($38|0)); $39 = HEAP32[2208>>2]|0; $40 = $39 << 3; $41 = HEAP32[2224>>2]|0; _glBufferSubData(34962,0,($40|0),($41|0)); $42 = HEAP32[(2708)>>2]|0; _glBindBuffer(34962,($42|0)); $43 = HEAP32[2208>>2]|0; $44 = $43 << 2; $45 = HEAP32[2216>>2]|0; _glBufferSubData(34962,0,($44|0),($45|0)); } $46 = HEAP32[2264>>2]|0; $47 = ($46|0)==(0); if ($47) { return; } $48 = HEAP32[2276>>2]|0; FUNCTION_TABLE_vi[$48 & 31](0); return; } function _ttULONG($p) { $p = $p|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP8[$p>>0]|0; $1 = $0&255; $2 = $1 << 24; $3 = ((($p)) + 1|0); $4 = HEAP8[$3>>0]|0; $5 = $4&255; $6 = $5 << 16; $7 = $6 | $2; $8 = ((($p)) + 2|0); $9 = HEAP8[$8>>0]|0; $10 = $9&255; $11 = $10 << 8; $12 = $7 | $11; $13 = ((($p)) + 3|0); $14 = HEAP8[$13>>0]|0; $15 = $14&255; $16 = $12 | $15; return ($16|0); } function _stbtt__find_table($data,$fontstart,$tag) { $data = $data|0; $fontstart = $fontstart|0; $tag = $tag|0; var $$0 = 0, $$lcssa = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$05 = 0, label = 0, sp = 0; sp = STACKTOP; $$sum = (($fontstart) + 4)|0; $0 = (($data) + ($$sum)|0); $1 = (_ttUSHORT($0)|0); $2 = $1&65535; $3 = (($fontstart) + 12)|0; $4 = ($1<<16>>16)==(0); if ($4) { $$0 = 0; return ($$0|0); } $5 = HEAP8[$tag>>0]|0; $6 = $5 << 24 >> 24; $7 = ((($tag)) + 1|0); $8 = ((($tag)) + 2|0); $9 = ((($tag)) + 3|0); $i$05 = 0; while(1) { $10 = $i$05 << 4; $11 = (($3) + ($10))|0; $12 = (($data) + ($11)|0); $13 = HEAP8[$12>>0]|0; $14 = $13&255; $15 = ($14|0)==($6|0); if ($15) { $$sum1 = (($11) + 1)|0; $16 = (($data) + ($$sum1)|0); $17 = HEAP8[$16>>0]|0; $18 = $17&255; $19 = HEAP8[$7>>0]|0; $20 = $19 << 24 >> 24; $21 = ($18|0)==($20|0); if ($21) { $$sum2 = (($11) + 2)|0; $22 = (($data) + ($$sum2)|0); $23 = HEAP8[$22>>0]|0; $24 = $23&255; $25 = HEAP8[$8>>0]|0; $26 = $25 << 24 >> 24; $27 = ($24|0)==($26|0); if ($27) { $$sum3 = (($11) + 3)|0; $28 = (($data) + ($$sum3)|0); $29 = HEAP8[$28>>0]|0; $30 = $29&255; $31 = HEAP8[$9>>0]|0; $32 = $31 << 24 >> 24; $33 = ($30|0)==($32|0); if ($33) { $$lcssa = $11; break; } } } } $36 = (($i$05) + 1)|0; $37 = ($36|0)<($2|0); if ($37) { $i$05 = $36; } else { $$0 = 0; label = 9; break; } } if ((label|0) == 9) { return ($$0|0); } $$sum4 = (($$lcssa) + 8)|0; $34 = (($data) + ($$sum4)|0); $35 = (_ttULONG($34)|0); $$0 = $35; return ($$0|0); } function _ttUSHORT($p) { $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP8[$p>>0]|0; $1 = $0&255; $2 = $1 << 8; $3 = ((($p)) + 1|0); $4 = HEAP8[$3>>0]|0; $5 = $4&255; $6 = $2 | $5; $7 = $6&65535; return ($7|0); } function _ttSHORT($p) { $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP8[$p>>0]|0; $1 = $0&255; $2 = $1 << 8; $3 = ((($p)) + 1|0); $4 = HEAP8[$3>>0]|0; $5 = $4&255; $6 = $2 | $5; $7 = $6&65535; return ($7|0); } function _stbtt__GetGlyfOffset($info,$glyph_index) { $info = $info|0; $glyph_index = $glyph_index|0; var $$0 = 0, $$pn = 0, $$sink = 0, $$sum = 0, $$sum2 = 0, $$sum3 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $g1$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($info)) + 12|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>($glyph_index|0); if (!($2)) { $$0 = -1; return ($$0|0); } $3 = ((($info)) + 44|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)>(1); if ($5) { $$0 = -1; return ($$0|0); } $6 = ($4|0)==(0); $7 = ((($info)) + 24|0); $8 = HEAP32[$7>>2]|0; $9 = ((($info)) + 4|0); $10 = HEAP32[$9>>2]|0; $11 = ((($info)) + 16|0); $12 = HEAP32[$11>>2]|0; if ($6) { $13 = $glyph_index << 1; $$sum3 = (($12) + ($13))|0; $14 = (($10) + ($$sum3)|0); $15 = (_ttUSHORT($14)|0); $16 = $15&65535; $17 = $16 << 1; $$sum5 = (($$sum3) + 2)|0; $18 = (($10) + ($$sum5)|0); $19 = (_ttUSHORT($18)|0); $20 = $19&65535; $21 = $20 << 1; $$pn = $17;$$sink = $21; } else { $22 = $glyph_index << 2; $$sum = (($12) + ($22))|0; $23 = (($10) + ($$sum)|0); $24 = (_ttULONG($23)|0); $$sum2 = (($$sum) + 4)|0; $25 = (($10) + ($$sum2)|0); $26 = (_ttULONG($25)|0); $$pn = $24;$$sink = $26; } $27 = (($$sink) + ($8))|0; $g1$0 = (($$pn) + ($8))|0; $28 = ($g1$0|0)==($27|0); $29 = $28 ? -1 : $g1$0; $$0 = $29; return ($$0|0); } function _stbtt__close_shape($vertices,$num_vertices,$was_off,$start_off,$sx,$sy,$scx,$scy,$cx,$cy) { $vertices = $vertices|0; $num_vertices = $num_vertices|0; $was_off = $was_off|0; $start_off = $start_off|0; $sx = $sx|0; $sy = $sy|0; $scx = $scx|0; $scy = $scy|0; $cx = $cx|0; $cy = $cy|0; var $$0 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($start_off|0)==(0); $1 = ($was_off|0)!=(0); if (!($0)) { if ($1) { $2 = (($num_vertices) + 1)|0; $3 = (($vertices) + (($num_vertices*10)|0)|0); $4 = (($cx) + ($scx))|0; $5 = $4 >> 1; $6 = (($cy) + ($scy))|0; $7 = $6 >> 1; _stbtt_setvertex($3,3,$5,$7,$cx,$cy); $$0 = $2; } else { $$0 = $num_vertices; } $8 = (($$0) + 1)|0; $9 = (($vertices) + (($$0*10)|0)|0); _stbtt_setvertex($9,3,$sx,$sy,$scx,$scy); $$1 = $8; return ($$1|0); } $10 = (($num_vertices) + 1)|0; $11 = (($vertices) + (($num_vertices*10)|0)|0); if ($1) { _stbtt_setvertex($11,3,$sx,$sy,$cx,$cy); $$1 = $10; return ($$1|0); } else { _stbtt_setvertex($11,2,$sx,$sy,0,0); $$1 = $10; return ($$1|0); } return (0)|0; } function _stbtt_setvertex($v,$type,$x,$y,$cx,$cy) { $v = $v|0; $type = $type|0; $x = $x|0; $y = $y|0; $cx = $cx|0; $cy = $cy|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($v)) + 8|0); HEAP8[$0>>0] = $type; $1 = $x&65535; HEAP16[$v>>1] = $1; $2 = $y&65535; $3 = ((($v)) + 2|0); HEAP16[$3>>1] = $2; $4 = $cx&65535; $5 = ((($v)) + 4|0); HEAP16[$5>>1] = $4; $6 = $cy&65535; $7 = ((($v)) + 6|0); HEAP16[$7>>1] = $6; return; } function _stbtt_FlattenCurves($vertices,$num_verts,$objspace_flatness,$contour_lengths,$num_contours) { $vertices = $vertices|0; $num_verts = $num_verts|0; $objspace_flatness = +$objspace_flatness; $contour_lengths = $contour_lengths|0; $num_contours = $num_contours|0; var $$0 = 0, $$lcssa = 0, $$n$0 = 0, $$n$0$lcssa = 0, $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond18 = 0, $i$012 = 0, $i$12 = 0, $n$013 = 0, $n$2$lcssa = 0, $n$24 = 0, $n$3 = 0, $num_points = 0, $pass$011 = 0, $points$09 = 0, $points$1 = 0; var $start$010 = 0, $start$1$lcssa = 0, $start$15 = 0, $start$2 = 0, $x$06 = 0.0, $x$1 = 0.0, $y$07 = 0.0, $y$1 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $num_points = sp; HEAP32[$num_points>>2] = 0; $0 = $objspace_flatness * $objspace_flatness; $1 = ($num_verts|0)>(0); if ($1) { $i$012 = 0;$n$013 = 0; } else { HEAP32[$num_contours>>2] = 0; $$0 = 0; STACKTOP = sp;return ($$0|0); } while(1) { $2 = (((($vertices) + (($i$012*10)|0)|0)) + 8|0); $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)==(1); $5 = $4&1; $$n$0 = (($5) + ($n$013))|0; $6 = (($i$012) + 1)|0; $exitcond18 = ($6|0)==($num_verts|0); if ($exitcond18) { $$n$0$lcssa = $$n$0; break; } else { $i$012 = $6;$n$013 = $$n$0; } } HEAP32[$num_contours>>2] = $$n$0$lcssa; $7 = ($$n$0$lcssa|0)==(0); if ($7) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $8 = $$n$0$lcssa << 2; $9 = (_malloc($8)|0); HEAP32[$contour_lengths>>2] = $9; $10 = ($9|0)==(0|0); if ($10) { HEAP32[$num_contours>>2] = 0; $$0 = 0; STACKTOP = sp;return ($$0|0); } $11 = ($num_verts|0)>(0); $pass$011 = 0;$points$09 = 0;$start$010 = 0; while(1) { $12 = ($pass$011|0)==(1); if ($12) { $13 = HEAP32[$num_points>>2]|0; $14 = $13 << 3; $15 = (_malloc($14)|0); $16 = ($15|0)==(0|0); if ($16) { $$lcssa = $15; break; } else { $points$1 = $15; } } else { $points$1 = $points$09; } HEAP32[$num_points>>2] = 0; L19: do { if ($11) { $i$12 = 0;$n$24 = -1;$start$15 = $start$010;$x$06 = 0.0;$y$07 = 0.0; while(1) { $17 = (($vertices) + (($i$12*10)|0)|0); $18 = (((($vertices) + (($i$12*10)|0)|0)) + 8|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; switch ($20|0) { case 1: { $21 = ($n$24|0)>(-1); if ($21) { $22 = HEAP32[$num_points>>2]|0; $23 = (($22) - ($start$15))|0; $24 = HEAP32[$contour_lengths>>2]|0; $25 = (($24) + ($n$24<<2)|0); HEAP32[$25>>2] = $23; } $26 = (($n$24) + 1)|0; $27 = HEAP32[$num_points>>2]|0; $28 = HEAP16[$17>>1]|0; $29 = (+($28<<16>>16)); $30 = (((($vertices) + (($i$12*10)|0)|0)) + 2|0); $31 = HEAP16[$30>>1]|0; $32 = (+($31<<16>>16)); $33 = (($27) + 1)|0; HEAP32[$num_points>>2] = $33; _stbtt__add_point($points$1,$27,$29,$32); $n$3 = $26;$start$2 = $27;$x$1 = $29;$y$1 = $32; break; } case 2: { $34 = HEAP16[$17>>1]|0; $35 = (+($34<<16>>16)); $36 = (((($vertices) + (($i$12*10)|0)|0)) + 2|0); $37 = HEAP16[$36>>1]|0; $38 = (+($37<<16>>16)); $39 = HEAP32[$num_points>>2]|0; $40 = (($39) + 1)|0; HEAP32[$num_points>>2] = $40; _stbtt__add_point($points$1,$39,$35,$38); $n$3 = $n$24;$start$2 = $start$15;$x$1 = $35;$y$1 = $38; break; } case 3: { $41 = (((($vertices) + (($i$12*10)|0)|0)) + 4|0); $42 = HEAP16[$41>>1]|0; $43 = (+($42<<16>>16)); $44 = (((($vertices) + (($i$12*10)|0)|0)) + 6|0); $45 = HEAP16[$44>>1]|0; $46 = (+($45<<16>>16)); $47 = HEAP16[$17>>1]|0; $48 = (+($47<<16>>16)); $49 = (((($vertices) + (($i$12*10)|0)|0)) + 2|0); $50 = HEAP16[$49>>1]|0; $51 = (+($50<<16>>16)); _stbtt__tesselate_curve($points$1,$num_points,$x$06,$y$07,$43,$46,$48,$51,$0,0); $52 = HEAP16[$17>>1]|0; $53 = (+($52<<16>>16)); $54 = HEAP16[$49>>1]|0; $55 = (+($54<<16>>16)); $n$3 = $n$24;$start$2 = $start$15;$x$1 = $53;$y$1 = $55; break; } default: { $n$3 = $n$24;$start$2 = $start$15;$x$1 = $x$06;$y$1 = $y$07; } } $56 = (($i$12) + 1)|0; $exitcond = ($56|0)==($num_verts|0); if ($exitcond) { $n$2$lcssa = $n$3;$start$1$lcssa = $start$2; break L19; } else { $i$12 = $56;$n$24 = $n$3;$start$15 = $start$2;$x$06 = $x$1;$y$07 = $y$1; } } } else { $n$2$lcssa = -1;$start$1$lcssa = $start$010; } } while(0); $57 = HEAP32[$num_points>>2]|0; $58 = (($57) - ($start$1$lcssa))|0; $59 = HEAP32[$contour_lengths>>2]|0; $60 = (($59) + ($n$2$lcssa<<2)|0); HEAP32[$60>>2] = $58; $61 = (($pass$011) + 1)|0; $62 = ($61|0)<(2); if ($62) { $pass$011 = $61;$points$09 = $points$1;$start$010 = $start$1$lcssa; } else { $$0 = $points$1; label = 20; break; } } if ((label|0) == 20) { STACKTOP = sp;return ($$0|0); } _free($$lcssa); $63 = HEAP32[$contour_lengths>>2]|0; _free($63); HEAP32[$contour_lengths>>2] = 0; HEAP32[$num_contours>>2] = 0; $$0 = 0; STACKTOP = sp;return ($$0|0); } function _stbtt__rasterize($result,$pts,$wcount,$windings,$scale_x,$scale_y,$shift_x,$shift_y,$off_x,$off_y,$invert) { $result = $result|0; $pts = $pts|0; $wcount = $wcount|0; $windings = $windings|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $off_x = $off_x|0; $off_y = $off_y|0; $invert = $invert|0; var $$lcssa = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0; var $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0; var $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a$0 = 0, $b$0 = 0, $exitcond = 0, $exitcond20 = 0; var $i$013 = 0, $i$18 = 0, $j$04 = 0, $j$04$phi = 0, $k$05 = 0, $m$07 = 0, $n$0$lcssa = 0, $n$014 = 0, $n$1$lcssa = 0, $n$19 = 0, $n$2$lcssa = 0, $n$26 = 0, $n$3 = 0, $phitmp = 0, $phitmp19 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($invert|0)!=(0); $1 = -$scale_y; $2 = $0 ? $1 : $scale_y; $3 = ($windings|0)>(0); if ($3) { $i$013 = 0;$n$014 = 0; while(1) { $4 = (($wcount) + ($i$013<<2)|0); $5 = HEAP32[$4>>2]|0; $6 = (($5) + ($n$014))|0; $7 = (($i$013) + 1)|0; $exitcond20 = ($7|0)==($windings|0); if ($exitcond20) { $$lcssa = $6; break; } else { $i$013 = $7;$n$014 = $6; } } $phitmp = ($$lcssa*20)|0; $phitmp19 = (($phitmp) + 20)|0; $n$0$lcssa = $phitmp19; } else { $n$0$lcssa = 20; } $8 = (_malloc($n$0$lcssa)|0); $9 = ($8|0)==(0|0); if ($9) { return; } $10 = ($windings|0)>(0); if ($10) { $i$18 = 0;$m$07 = 0;$n$19 = 0; while(1) { $11 = (($wcount) + ($i$18<<2)|0); $12 = HEAP32[$11>>2]|0; $13 = (($12) + ($m$07))|0; $14 = ($12|0)>(0); if ($14) { $15 = (($12) + -1)|0; $16 = HEAP32[$11>>2]|0; $j$04 = $15;$k$05 = 0;$n$26 = $n$19; while(1) { $$sum = (($j$04) + ($m$07))|0; $17 = (((($pts) + ($$sum<<3)|0)) + 4|0); $18 = +HEAPF32[$17>>2]; $$sum1 = (($k$05) + ($m$07))|0; $19 = (((($pts) + ($$sum1<<3)|0)) + 4|0); $20 = +HEAPF32[$19>>2]; $21 = $18 == $20; if ($21) { $n$3 = $n$26; } else { $22 = (((($8) + (($n$26*20)|0)|0)) + 16|0); HEAP32[$22>>2] = 0; $23 = +HEAPF32[$17>>2]; $24 = +HEAPF32[$19>>2]; if ($0) { $25 = $23 > $24; if ($25) { label = 12; } else { $a$0 = $k$05;$b$0 = $j$04; } } else { $26 = $23 < $24; if ($26) { label = 12; } else { $a$0 = $k$05;$b$0 = $j$04; } } if ((label|0) == 12) { label = 0; HEAP32[$22>>2] = 1; $a$0 = $j$04;$b$0 = $k$05; } $$sum2 = (($a$0) + ($m$07))|0; $27 = (($pts) + ($$sum2<<3)|0); $28 = +HEAPF32[$27>>2]; $29 = $28 * $scale_x; $30 = $29 + $shift_x; $31 = (($8) + (($n$26*20)|0)|0); HEAPF32[$31>>2] = $30; $32 = (((($pts) + ($$sum2<<3)|0)) + 4|0); $33 = +HEAPF32[$32>>2]; $34 = $2 * $33; $35 = $34 + $shift_y; $36 = (((($8) + (($n$26*20)|0)|0)) + 4|0); HEAPF32[$36>>2] = $35; $$sum3 = (($b$0) + ($m$07))|0; $37 = (($pts) + ($$sum3<<3)|0); $38 = +HEAPF32[$37>>2]; $39 = $38 * $scale_x; $40 = $39 + $shift_x; $41 = (((($8) + (($n$26*20)|0)|0)) + 8|0); HEAPF32[$41>>2] = $40; $42 = (((($pts) + ($$sum3<<3)|0)) + 4|0); $43 = +HEAPF32[$42>>2]; $44 = $2 * $43; $45 = $44 + $shift_y; $46 = (((($8) + (($n$26*20)|0)|0)) + 12|0); HEAPF32[$46>>2] = $45; $47 = (($n$26) + 1)|0; $n$3 = $47; } $48 = (($k$05) + 1)|0; $49 = ($48|0)<($16|0); if ($49) { $j$04$phi = $k$05;$k$05 = $48;$n$26 = $n$3;$j$04 = $j$04$phi; } else { $n$2$lcssa = $n$3; break; } } } else { $n$2$lcssa = $n$19; } $50 = (($i$18) + 1)|0; $exitcond = ($50|0)==($windings|0); if ($exitcond) { $n$1$lcssa = $n$2$lcssa; break; } else { $i$18 = $50;$m$07 = $13;$n$19 = $n$2$lcssa; } } } else { $n$1$lcssa = 0; } _stbtt__sort_edges($8,$n$1$lcssa); _stbtt__rasterize_sorted_edges($result,$8,$n$1$lcssa,$off_x,$off_y); _free($8); return; } function _LoadRBMF($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$lcssa = 0, $$lcssa9 = 0, $$op = 0, $$op$op = 0, $$op$op$op = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0; var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0; var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0; var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0; var $99 = 0, $counter$014 = 0, $currentLine$010 = 0, $currentLine$1 = 0, $currentPosX$011 = 0, $currentPosX$1 = 0, $exitcond = 0, $exitcond29 = 0, $exitcond30 = 0, $i$025 = 0, $i1$021 = 0, $i2$018 = 0, $i3$015 = 0, $i4$012 = 0, $image = 0, $image$byval_copy14 = 0, $j$013 = 0, $rbmfCharWidthData$0 = 0, $rbmfFileData$0 = 0, $rbmfHeader = 0; var $spriteFont$sroa$0$0 = 0, $spriteFont$sroa$16$0 = 0, $spriteFont$sroa$18$0 = 0, $spriteFont$sroa$27$0 = 0, $spriteFont$sroa$29$0 = 0, $spriteFont$sroa$6$0 = 0, $spriteFont$sroa$7 = 0, $spriteFont$sroa$77$0 = 0, $spriteFont$sroa$8$0 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_ptr4 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 176|0; $image$byval_copy14 = sp + 56|0; $vararg_buffer11 = sp + 48|0; $vararg_buffer1 = sp + 24|0; $vararg_buffer = sp + 16|0; $spriteFont$sroa$7 = sp; $rbmfHeader = sp + 160|0; $0 = sp + 116|0; $image = sp + 96|0; $1 = sp + 76|0; ;HEAP32[$spriteFont$sroa$7>>2]=0|0;HEAP32[$spriteFont$sroa$7+4>>2]=0|0;HEAP32[$spriteFont$sroa$7+8>>2]=0|0; $2 = (_fopen($fileName,20392)|0); $3 = ($2|0)==(0|0); if ($3) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,20395,$vararg_buffer); _GetDefaultFont($0); $4 = HEAP32[$0>>2]|0; $5 = ((($0)) + 4|0); $6 = HEAP32[$5>>2]|0; $7 = ((($0)) + 8|0); ;HEAP32[$spriteFont$sroa$7>>2]=HEAP32[$7>>2]|0;HEAP32[$spriteFont$sroa$7+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$spriteFont$sroa$7+8>>2]=HEAP32[$7+8>>2]|0; $8 = ((($0)) + 20|0); $9 = HEAP32[$8>>2]|0; $10 = ((($0)) + 24|0); $11 = HEAP32[$10>>2]|0; $12 = ((($0)) + 28|0); $13 = HEAP32[$12>>2]|0; $14 = ((($0)) + 32|0); $15 = HEAP32[$14>>2]|0; $16 = ((($0)) + 36|0); $17 = HEAP32[$16>>2]|0; $18 = ((($0)) + 40|0); $19 = HEAP32[$18>>2]|0; $rbmfCharWidthData$0 = 0;$rbmfFileData$0 = 0;$spriteFont$sroa$0$0 = $4;$spriteFont$sroa$16$0 = $13;$spriteFont$sroa$18$0 = $15;$spriteFont$sroa$27$0 = $17;$spriteFont$sroa$29$0 = $19;$spriteFont$sroa$6$0 = $6;$spriteFont$sroa$77$0 = $9;$spriteFont$sroa$8$0 = $11; (_fclose($2)|0); _free($rbmfFileData$0); _free($rbmfCharWidthData$0); HEAP32[$agg$result>>2] = $spriteFont$sroa$0$0; $148 = ((($agg$result)) + 4|0); HEAP32[$148>>2] = $spriteFont$sroa$6$0; $149 = ((($agg$result)) + 8|0); ;HEAP32[$149>>2]=HEAP32[$spriteFont$sroa$7>>2]|0;HEAP32[$149+4>>2]=HEAP32[$spriteFont$sroa$7+4>>2]|0;HEAP32[$149+8>>2]=HEAP32[$spriteFont$sroa$7+8>>2]|0; $150 = ((($agg$result)) + 20|0); HEAP32[$150>>2] = $spriteFont$sroa$77$0; $151 = ((($agg$result)) + 24|0); HEAP32[$151>>2] = $spriteFont$sroa$8$0; $152 = ((($agg$result)) + 28|0); HEAP32[$152>>2] = $spriteFont$sroa$16$0; $153 = ((($agg$result)) + 32|0); HEAP32[$153>>2] = $spriteFont$sroa$18$0; $154 = ((($agg$result)) + 36|0); HEAP32[$154>>2] = $spriteFont$sroa$27$0; $155 = ((($agg$result)) + 40|0); HEAP32[$155>>2] = $spriteFont$sroa$29$0; STACKTOP = sp;return; } (_fread($rbmfHeader,16,1,$2)|0); $20 = ((($rbmfHeader)) + 6|0); $21 = HEAP16[$20>>1]|0; $22 = $21 << 16 >> 16; $23 = ((($rbmfHeader)) + 8|0); $24 = HEAP16[$23>>1]|0; $25 = $24 << 16 >> 16; $26 = ((($rbmfHeader)) + 10|0); $27 = HEAP16[$26>>1]|0; $28 = $27 << 16 >> 16; $29 = ((($rbmfHeader)) + 12|0); $30 = HEAP16[$29>>1]|0; $31 = $30 << 16 >> 16; HEAP32[$vararg_buffer1>>2] = $fileName; $vararg_ptr4 = ((($vararg_buffer1)) + 4|0); HEAP32[$vararg_ptr4>>2] = $22; $vararg_ptr5 = ((($vararg_buffer1)) + 8|0); HEAP32[$vararg_ptr5>>2] = $25; $vararg_ptr6 = ((($vararg_buffer1)) + 12|0); HEAP32[$vararg_ptr6>>2] = $28; $vararg_ptr7 = ((($vararg_buffer1)) + 16|0); HEAP32[$vararg_ptr7>>2] = $31; _TraceLog(3,20455,$vararg_buffer1); $32 = HEAP16[$26>>1]|0; $33 = $32 << 16 >> 16; $34 = HEAP16[$20>>1]|0; $35 = $34 << 16 >> 16; $36 = HEAP16[$23>>1]|0; $37 = $36 << 16 >> 16; $38 = Math_imul($37, $35)|0; $39 = (($38|0) / 32)&-1; $40 = $39 << 2; $41 = (_malloc($40)|0); $42 = ($38|0)>(31); if ($42) { $i$025 = 0; while(1) { $43 = (($41) + ($i$025<<2)|0); (_fread($43,4,1,$2)|0); $44 = (($i$025) + 1)|0; $45 = ($44|0)<($39|0); if ($45) { $i$025 = $44; } else { break; } } } $46 = (_malloc($33)|0); $47 = ($32<<16>>16)>(0); if ($47) { $48 = $32 << 16 >> 16; $i1$021 = 0; while(1) { $49 = (($46) + ($i1$021)|0); (_fread($49,1,1,$2)|0); $50 = (($i1$021) + 1)|0; $exitcond30 = ($50|0)==($48|0); if ($exitcond30) { break; } else { $i1$021 = $50; } } } $51 = HEAP16[$20>>1]|0; $52 = $51 << 16 >> 16; $53 = HEAP16[$23>>1]|0; $54 = $53 << 16 >> 16; $55 = $52 << 2; $56 = Math_imul($55, $54)|0; $57 = (_malloc($56)|0); $58 = HEAP16[$20>>1]|0; $59 = $58 << 16 >> 16; $60 = HEAP16[$23>>1]|0; $61 = $60 << 16 >> 16; $62 = Math_imul($61, $59)|0; $63 = ($62|0)>(0); if ($63) { $64 = HEAP16[$20>>1]|0; $65 = $64 << 16 >> 16; $66 = HEAP16[$23>>1]|0; $67 = $66 << 16 >> 16; $68 = Math_imul($67, $65)|0; $i2$018 = 0; while(1) { $82 = (($57) + ($i2$018<<2)|0); $83 = (($i2$018) + 1)|0; $84 = ($83|0)<($68|0); HEAP8[$82>>0]=0&255;HEAP8[$82+1>>0]=(0>>8)&255;HEAP8[$82+2>>0]=(0>>16)&255;HEAP8[$82+3>>0]=0>>24; if ($84) { $i2$018 = $83; } else { break; } } } $69 = HEAP16[$20>>1]|0; $70 = $69 << 16 >> 16; $71 = HEAP16[$23>>1]|0; $72 = $71 << 16 >> 16; $73 = Math_imul($72, $70)|0; $74 = ($73|0)>(0); if ($74) { $75 = HEAP16[$20>>1]|0; $76 = HEAP16[$23>>1]|0; $77 = $76 << 16 >> 16; $78 = $75 << 16 >> 16; $79 = Math_imul($77, $78)|0; $80 = ($79|0)>(32); $$op = (($79) + -1)|0; $$op$op = $$op >>> 5; $$op$op$op = (($$op$op) + 1)|0; $81 = $80 ? $$op$op$op : 1; $counter$014 = 0;$i3$015 = 0; while(1) { $85 = (($41) + ($counter$014<<2)|0); $86 = HEAP32[$85>>2]|0; $j$013 = 31; while(1) { $87 = 1 << $j$013; $88 = $86 & $87; $89 = ($88|0)==(0); if (!($89)) { $90 = (($j$013) + ($i3$015))|0; $91 = (($57) + ($90<<2)|0); HEAP8[$91>>0]=-1&255;HEAP8[$91+1>>0]=(-1>>8)&255;HEAP8[$91+2>>0]=(-1>>16)&255;HEAP8[$91+3>>0]=-1>>24; } $92 = (($j$013) + -1)|0; $93 = ($j$013|0)>(0); if ($93) { $j$013 = $92; } else { break; } } $94 = (($counter$014) + 1)|0; $95 = (($i3$015) + 32)|0; $exitcond29 = ($94|0)==($81|0); if ($exitcond29) { break; } else { $counter$014 = $94;$i3$015 = $95; } } $96 = $75 << 16 >> 16; $97 = $76 << 16 >> 16; $$lcssa = $96;$$lcssa9 = $97; } else { $$lcssa = $70;$$lcssa9 = $72; } _LoadImageEx($image,$57,$$lcssa,$$lcssa9); _ImageFormat($image,2); _free($57); HEAP32[$image$byval_copy14>>2] = $fileName; _TraceLog(3,20521,$image$byval_copy14); ;HEAP32[$image$byval_copy14>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy14+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy14+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy14+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy14+16>>2]=HEAP32[$image+16>>2]|0; _LoadTextureFromImage($1,$image$byval_copy14); $98 = HEAP32[$1>>2]|0; $99 = ((($1)) + 4|0); $100 = HEAP32[$99>>2]|0; $101 = ((($1)) + 8|0); ;HEAP32[$spriteFont$sroa$7>>2]=HEAP32[$101>>2]|0;HEAP32[$spriteFont$sroa$7+4>>2]=HEAP32[$101+4>>2]|0;HEAP32[$spriteFont$sroa$7+8>>2]=HEAP32[$101+8>>2]|0; ;HEAP32[$image$byval_copy14>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy14+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy14+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy14+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy14+16>>2]=HEAP32[$image+16>>2]|0; _UnloadImage($image$byval_copy14); $102 = $33 << 2; $103 = (_malloc($102)|0); $104 = $33 << 4; $105 = (_malloc($104)|0); $106 = $33 << 3; $107 = (_malloc($106)|0); $108 = (_malloc($102)|0); $109 = ($32<<16>>16)>(0); if ($109) { $110 = ((($rbmfHeader)) + 5|0); $111 = HEAP8[$110>>0]|0; $112 = $111 << 24 >> 24; $113 = HEAP16[$29>>1]|0; $114 = $113 << 16 >> 16; $115 = (($114) + 1)|0; $116 = $113 << 16 >> 16; $117 = $113 << 16 >> 16; $118 = (($117) + 1)|0; $119 = $32 << 16 >> 16; $120 = $32 << 16 >> 16; $121 = $120 << 2; _memset(($108|0),0,($121|0))|0; $currentLine$010 = 0;$currentPosX$011 = 1;$i4$012 = 0; while(1) { $122 = (($112) + ($i4$012))|0; $123 = (($103) + ($i4$012<<2)|0); HEAP32[$123>>2] = $122; $124 = (($105) + ($i4$012<<4)|0); HEAP32[$124>>2] = $currentPosX$011; $125 = Math_imul($115, $currentLine$010)|0; $126 = (($125) + 1)|0; $127 = (((($105) + ($i4$012<<4)|0)) + 4|0); HEAP32[$127>>2] = $126; $128 = (($46) + ($i4$012)|0); $129 = HEAP8[$128>>0]|0; $130 = $129&255; $131 = (((($105) + ($i4$012<<4)|0)) + 8|0); HEAP32[$131>>2] = $130; $132 = (((($105) + ($i4$012<<4)|0)) + 12|0); HEAP32[$132>>2] = $116; $133 = (($107) + ($i4$012<<3)|0); HEAPF32[$133>>2] = 0.0; $134 = (((($107) + ($i4$012<<3)|0)) + 4|0); HEAPF32[$134>>2] = 0.0; $135 = HEAP32[$131>>2]|0; $136 = (($currentPosX$011) + 1)|0; $137 = (($136) + ($135))|0; $138 = ($137|0)>($100|0); if ($138) { $139 = (($currentLine$010) + 1)|0; $140 = HEAP8[$128>>0]|0; $141 = $140&255; $142 = (($141) + 2)|0; HEAP32[$124>>2] = 1; $143 = Math_imul($118, $139)|0; $144 = (($143) + 1)|0; HEAP32[$127>>2] = $144; $currentLine$1 = $139;$currentPosX$1 = $142; } else { $currentLine$1 = $currentLine$010;$currentPosX$1 = $137; } $145 = (($i4$012) + 1)|0; $exitcond = ($145|0)==($119|0); if ($exitcond) { break; } else { $currentLine$010 = $currentLine$1;$currentPosX$011 = $currentPosX$1;$i4$012 = $145; } } } $146 = ((($105)) + 12|0); $147 = HEAP32[$146>>2]|0; HEAP32[$vararg_buffer11>>2] = $fileName; _TraceLog(0,20586,$vararg_buffer11); $rbmfCharWidthData$0 = $46;$rbmfFileData$0 = $41;$spriteFont$sroa$0$0 = $98;$spriteFont$sroa$16$0 = $103;$spriteFont$sroa$18$0 = $105;$spriteFont$sroa$27$0 = $107;$spriteFont$sroa$29$0 = $108;$spriteFont$sroa$6$0 = $100;$spriteFont$sroa$77$0 = $147;$spriteFont$sroa$8$0 = $33; (_fclose($2)|0); _free($rbmfFileData$0); _free($rbmfCharWidthData$0); HEAP32[$agg$result>>2] = $spriteFont$sroa$0$0; $148 = ((($agg$result)) + 4|0); HEAP32[$148>>2] = $spriteFont$sroa$6$0; $149 = ((($agg$result)) + 8|0); ;HEAP32[$149>>2]=HEAP32[$spriteFont$sroa$7>>2]|0;HEAP32[$149+4>>2]=HEAP32[$spriteFont$sroa$7+4>>2]|0;HEAP32[$149+8>>2]=HEAP32[$spriteFont$sroa$7+8>>2]|0; $150 = ((($agg$result)) + 20|0); HEAP32[$150>>2] = $spriteFont$sroa$77$0; $151 = ((($agg$result)) + 24|0); HEAP32[$151>>2] = $spriteFont$sroa$8$0; $152 = ((($agg$result)) + 28|0); HEAP32[$152>>2] = $spriteFont$sroa$16$0; $153 = ((($agg$result)) + 32|0); HEAP32[$153>>2] = $spriteFont$sroa$18$0; $154 = ((($agg$result)) + 36|0); HEAP32[$154>>2] = $spriteFont$sroa$27$0; $155 = ((($agg$result)) + 40|0); HEAP32[$155>>2] = $spriteFont$sroa$29$0; STACKTOP = sp;return; } function _LoadTTF($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $7 = 0, $8 = 0, $9 = 0, $charData = 0, $exitcond = 0, $exitcond4 = 0, $font$sroa$0 = 0, $i$03 = 0, $i1$01 = 0, $image = 0, $image$byval_copy1 = 0, $k$02 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 2000|0; $image$byval_copy1 = sp + 1968|0; $vararg_buffer = sp + 24|0; $charData = sp + 68|0; $font$sroa$0 = sp; $image = sp + 48|0; $0 = sp + 28|0; $1 = (_malloc(33554432)|0); $2 = (_malloc(262144)|0); ;HEAP32[$font$sroa$0>>2]=0|0;HEAP32[$font$sroa$0+4>>2]=0|0;HEAP32[$font$sroa$0+8>>2]=0|0;HEAP32[$font$sroa$0+12>>2]=0|0;HEAP32[$font$sroa$0+16>>2]=0|0; $3 = (_fopen($fileName,20392)|0); $4 = ($3|0)==(0|0); if ($4) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,20019,$vararg_buffer); ;HEAP32[$agg$result>>2]=HEAP32[$font$sroa$0>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$font$sroa$0+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$font$sroa$0+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$font$sroa$0+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$font$sroa$0+16>>2]|0; $5 = ((($agg$result)) + 20|0); ;HEAP32[$5>>2]=0|0;HEAP32[$5+4>>2]=0|0;HEAP32[$5+8>>2]=0|0;HEAP32[$5+12>>2]=0|0;HEAP32[$5+16>>2]=0|0;HEAP32[$5+20>>2]=0|0; STACKTOP = sp;return; } (_fread($1,1,33554432,$3)|0); (_stbtt_BakeFontBitmap($1,0,32.0,$2,512,512,32,95,$charData)|0); _free($1); $6 = (_malloc(524288)|0); $i$03 = 0;$k$02 = 0; while(1) { $7 = (($6) + ($k$02)|0); HEAP8[$7>>0] = -1; $8 = (($2) + ($i$03)|0); $9 = HEAP8[$8>>0]|0; $10 = $k$02 | 1; $11 = (($6) + ($10)|0); HEAP8[$11>>0] = $9; $12 = (($k$02) + 2)|0; $13 = (($i$03) + 1)|0; $exitcond4 = ($13|0)==(262144); if ($exitcond4) { break; } else { $i$03 = $13;$k$02 = $12; } } _free($2); $14 = ((($image)) + 4|0); HEAP32[$14>>2] = 512; $15 = ((($image)) + 8|0); HEAP32[$15>>2] = 512; $16 = ((($image)) + 12|0); HEAP32[$16>>2] = 1; $17 = ((($image)) + 16|0); HEAP32[$17>>2] = 2; HEAP32[$image>>2] = $6; ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; _LoadTextureFromImage($0,$image$byval_copy1); ;HEAP32[$font$sroa$0>>2]=HEAP32[$0>>2]|0;HEAP32[$font$sroa$0+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$font$sroa$0+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$font$sroa$0+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$font$sroa$0+16>>2]=HEAP32[$0+16>>2]|0; ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; _UnloadImage($image$byval_copy1); $18 = (_malloc(380)|0); $19 = (_malloc(1520)|0); $20 = (_malloc(760)|0); $21 = (_malloc(380)|0); $i1$01 = 0; while(1) { $22 = (($i1$01) + 32)|0; $23 = (($18) + ($i1$01<<2)|0); HEAP32[$23>>2] = $22; $24 = (($charData) + (($i1$01*20)|0)|0); $25 = HEAP16[$24>>1]|0; $26 = $25&65535; $27 = (($19) + ($i1$01<<4)|0); HEAP32[$27>>2] = $26; $28 = (((($charData) + (($i1$01*20)|0)|0)) + 2|0); $29 = HEAP16[$28>>1]|0; $30 = $29&65535; $31 = (((($19) + ($i1$01<<4)|0)) + 4|0); HEAP32[$31>>2] = $30; $32 = (((($charData) + (($i1$01*20)|0)|0)) + 4|0); $33 = HEAP16[$32>>1]|0; $34 = $33&65535; $35 = HEAP16[$24>>1]|0; $36 = $35&65535; $37 = (($34) - ($36))|0; $38 = (((($19) + ($i1$01<<4)|0)) + 8|0); HEAP32[$38>>2] = $37; $39 = (((($charData) + (($i1$01*20)|0)|0)) + 6|0); $40 = HEAP16[$39>>1]|0; $41 = $40&65535; $42 = HEAP16[$28>>1]|0; $43 = $42&65535; $44 = (($41) - ($43))|0; $45 = (((($19) + ($i1$01<<4)|0)) + 12|0); HEAP32[$45>>2] = $44; $46 = (($20) + ($i1$01<<3)|0); $47 = (((($charData) + (($i1$01*20)|0)|0)) + 8|0); $48 = HEAP32[$47>>2]|0; $49 = (((($charData) + (($i1$01*20)|0)|0)) + 12|0); $50 = HEAP32[$49>>2]|0; HEAP32[$46>>2] = $48; $51 = (((($20) + ($i1$01<<3)|0)) + 4|0); HEAP32[$51>>2] = $50; $52 = (((($charData) + (($i1$01*20)|0)|0)) + 16|0); $53 = +HEAPF32[$52>>2]; $54 = (~~(($53))); $55 = (($21) + ($i1$01<<2)|0); HEAP32[$55>>2] = $54; $56 = (($i1$01) + 1)|0; $exitcond = ($56|0)==(95); if ($exitcond) { break; } else { $i1$01 = $56; } } ;HEAP32[$agg$result>>2]=HEAP32[$font$sroa$0>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$font$sroa$0+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$font$sroa$0+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$font$sroa$0+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$font$sroa$0+16>>2]|0; $57 = ((($agg$result)) + 20|0); HEAP32[$57>>2] = 32; $58 = ((($agg$result)) + 24|0); HEAP32[$58>>2] = 95; $59 = ((($agg$result)) + 28|0); HEAP32[$59>>2] = $18; $60 = ((($agg$result)) + 32|0); HEAP32[$60>>2] = $19; $61 = ((($agg$result)) + 36|0); HEAP32[$61>>2] = $20; $62 = ((($agg$result)) + 40|0); HEAP32[$62>>2] = $21; STACKTOP = sp;return; } function _LoadBMFont($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $7 = 0, $8 = 0, $9 = 0, $base = 0, $buffer = 0, $charAdvanceX = 0, $charHeight = 0, $charId = 0, $charOffsetX = 0, $charOffsetY = 0, $charWidth = 0, $charX = 0, $charY = 0, $endptr = 0, $font$sroa$7 = 0; var $fontSize = 0, $i$04 = 0, $numChars = 0, $strlen = 0, $texFileName = 0, $texHeight = 0, $texWidth = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer30 = 0, $vararg_buffer34 = 0, $vararg_buffer44 = 0, $vararg_buffer7 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0; var $vararg_ptr15 = 0, $vararg_ptr22 = 0, $vararg_ptr29 = 0, $vararg_ptr33 = 0, $vararg_ptr37 = 0, $vararg_ptr38 = 0, $vararg_ptr39 = 0, $vararg_ptr4 = 0, $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr42 = 0, $vararg_ptr43 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 608|0; $vararg_buffer44 = sp + 136|0; $vararg_buffer34 = sp + 104|0; $vararg_buffer30 = sp + 96|0; $vararg_buffer26 = sp + 88|0; $vararg_buffer23 = sp + 80|0; $vararg_buffer19 = sp + 72|0; $vararg_buffer16 = sp + 64|0; $vararg_buffer11 = sp + 48|0; $vararg_buffer7 = sp + 40|0; $vararg_buffer1 = sp + 24|0; $vararg_buffer = sp + 16|0; $font$sroa$7 = sp; $buffer = sp + 344|0; $fontSize = sp + 208|0; $texWidth = sp + 204|0; $texHeight = sp + 200|0; $texFileName = sp + 216|0; $numChars = sp + 196|0; $base = sp + 192|0; $0 = sp + 172|0; $charId = sp + 168|0; $charX = sp + 164|0; $charY = sp + 160|0; $charWidth = sp + 156|0; $charHeight = sp + 152|0; $charOffsetX = sp + 148|0; $charOffsetY = sp + 144|0; $charAdvanceX = sp + 140|0; ;HEAP32[$font$sroa$7>>2]=0|0;HEAP32[$font$sroa$7+4>>2]=0|0;HEAP32[$font$sroa$7+8>>2]=0|0;HEAP32[$font$sroa$7+12>>2]=0|0; HEAP32[$fontSize>>2] = 0; HEAP32[$numChars>>2] = 0; $1 = (_fopen($fileName,20016)|0); $2 = ($1|0)==(0|0); if ($2) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,20019,$vararg_buffer); HEAP32[$agg$result>>2] = 0; $3 = ((($agg$result)) + 4|0); ;HEAP32[$3>>2]=HEAP32[$font$sroa$7>>2]|0;HEAP32[$3+4>>2]=HEAP32[$font$sroa$7+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$font$sroa$7+8>>2]|0;HEAP32[$3+12>>2]=HEAP32[$font$sroa$7+12>>2]|0; $4 = ((($agg$result)) + 20|0); ;HEAP32[$4>>2]=0|0;HEAP32[$4+4>>2]=0|0;HEAP32[$4+8>>2]=0|0;HEAP32[$4+12>>2]=0|0;HEAP32[$4+16>>2]=0|0;HEAP32[$4+20>>2]=0|0; STACKTOP = sp;return; } (_fgets($buffer,256,$1)|0); (_fgets($buffer,256,$1)|0); $5 = (_strstr($buffer,20053)|0); HEAP32[$vararg_buffer1>>2] = $fontSize; $vararg_ptr4 = ((($vararg_buffer1)) + 4|0); HEAP32[$vararg_ptr4>>2] = $base; $vararg_ptr5 = ((($vararg_buffer1)) + 8|0); HEAP32[$vararg_ptr5>>2] = $texWidth; $vararg_ptr6 = ((($vararg_buffer1)) + 12|0); HEAP32[$vararg_ptr6>>2] = $texHeight; (_sscanf($5,20064,$vararg_buffer1)|0); $6 = HEAP32[$fontSize>>2]|0; HEAP32[$vararg_buffer7>>2] = $fileName; $vararg_ptr10 = ((($vararg_buffer7)) + 4|0); HEAP32[$vararg_ptr10>>2] = $6; _TraceLog(3,20106,$vararg_buffer7); $7 = HEAP32[$texWidth>>2]|0; $8 = HEAP32[$texHeight>>2]|0; HEAP32[$vararg_buffer11>>2] = $fileName; $vararg_ptr14 = ((($vararg_buffer11)) + 4|0); HEAP32[$vararg_ptr14>>2] = $7; $vararg_ptr15 = ((($vararg_buffer11)) + 8|0); HEAP32[$vararg_ptr15>>2] = $8; _TraceLog(3,20125,$vararg_buffer11); (_fgets($buffer,256,$1)|0); $9 = (_strstr($buffer,20156)|0); HEAP32[$vararg_buffer16>>2] = $texFileName; (_sscanf($9,20161,$vararg_buffer16)|0); HEAP32[$vararg_buffer19>>2] = $fileName; $vararg_ptr22 = ((($vararg_buffer19)) + 4|0); HEAP32[$vararg_ptr22>>2] = $texFileName; _TraceLog(3,20177,$vararg_buffer19); (_fgets($buffer,256,$1)|0); $10 = (_strstr($buffer,20208)|0); HEAP32[$vararg_buffer23>>2] = $numChars; (_sscanf($10,20214,$vararg_buffer23)|0); $11 = HEAP32[$numChars>>2]|0; HEAP32[$vararg_buffer26>>2] = $fileName; $vararg_ptr29 = ((($vararg_buffer26)) + 4|0); HEAP32[$vararg_ptr29>>2] = $11; _TraceLog(3,20223,$vararg_buffer26); $12 = (_strrchr($fileName,47)|0); $13 = (_strlen($fileName)|0); $14 = (_strlen($12)|0); $15 = (_strlen($texFileName)|0); $16 = (($13) + 2)|0; $17 = (($16) - ($14))|0; $18 = (($17) + ($15))|0; $19 = (_malloc($18)|0); $20 = (_strlen($fileName)|0); $21 = (_strlen($12)|0); $22 = (($20) - ($21))|0; _memcpy(($19|0),($fileName|0),($22|0))|0; $strlen = (_strlen($19)|0); $endptr = (($19) + ($strlen)|0); HEAP8[$endptr>>0]=47&255;HEAP8[$endptr+1>>0]=47>>8; (_strcat($19,$texFileName)|0); HEAP32[$vararg_buffer30>>2] = $fileName; $vararg_ptr33 = ((($vararg_buffer30)) + 4|0); HEAP32[$vararg_ptr33>>2] = $19; _TraceLog(3,20247,$vararg_buffer30); _LoadTexture($0,$19); $23 = HEAP32[$0>>2]|0; $24 = ((($0)) + 4|0); ;HEAP32[$font$sroa$7>>2]=HEAP32[$24>>2]|0;HEAP32[$font$sroa$7+4>>2]=HEAP32[$24+4>>2]|0;HEAP32[$font$sroa$7+8>>2]=HEAP32[$24+8>>2]|0;HEAP32[$font$sroa$7+12>>2]=HEAP32[$24+12>>2]|0; $25 = HEAP32[$fontSize>>2]|0; $26 = HEAP32[$numChars>>2]|0; $27 = $26 << 2; $28 = (_malloc($27)|0); $29 = HEAP32[$numChars>>2]|0; $30 = $29 << 4; $31 = (_malloc($30)|0); $32 = HEAP32[$numChars>>2]|0; $33 = $32 << 3; $34 = (_malloc($33)|0); $35 = HEAP32[$numChars>>2]|0; $36 = $35 << 2; $37 = (_malloc($36)|0); _free($19); $38 = HEAP32[$numChars>>2]|0; $39 = ($38|0)>(0); if ($39) { $i$04 = 0; while(1) { (_fgets($buffer,256,$1)|0); HEAP32[$vararg_buffer34>>2] = $charId; $vararg_ptr37 = ((($vararg_buffer34)) + 4|0); HEAP32[$vararg_ptr37>>2] = $charX; $vararg_ptr38 = ((($vararg_buffer34)) + 8|0); HEAP32[$vararg_ptr38>>2] = $charY; $vararg_ptr39 = ((($vararg_buffer34)) + 12|0); HEAP32[$vararg_ptr39>>2] = $charWidth; $vararg_ptr40 = ((($vararg_buffer34)) + 16|0); HEAP32[$vararg_ptr40>>2] = $charHeight; $vararg_ptr41 = ((($vararg_buffer34)) + 20|0); HEAP32[$vararg_ptr41>>2] = $charOffsetX; $vararg_ptr42 = ((($vararg_buffer34)) + 24|0); HEAP32[$vararg_ptr42>>2] = $charOffsetY; $vararg_ptr43 = ((($vararg_buffer34)) + 28|0); HEAP32[$vararg_ptr43>>2] = $charAdvanceX; (_sscanf($buffer,20282,$vararg_buffer34)|0); $40 = HEAP32[$charId>>2]|0; $41 = (($28) + ($i$04<<2)|0); HEAP32[$41>>2] = $40; $42 = HEAP32[$charX>>2]|0; $43 = HEAP32[$charY>>2]|0; $44 = HEAP32[$charWidth>>2]|0; $45 = HEAP32[$charHeight>>2]|0; $46 = (($31) + ($i$04<<4)|0); HEAP32[$46>>2] = $42; $47 = (((($31) + ($i$04<<4)|0)) + 4|0); HEAP32[$47>>2] = $43; $48 = (((($31) + ($i$04<<4)|0)) + 8|0); HEAP32[$48>>2] = $44; $49 = (((($31) + ($i$04<<4)|0)) + 12|0); HEAP32[$49>>2] = $45; $50 = HEAP32[$charOffsetX>>2]|0; $51 = (+($50|0)); $52 = HEAP32[$charOffsetY>>2]|0; $53 = (+($52|0)); $54 = (($34) + ($i$04<<3)|0); HEAPF32[$54>>2] = $51; $55 = (((($34) + ($i$04<<3)|0)) + 4|0); HEAPF32[$55>>2] = $53; $56 = HEAP32[$charAdvanceX>>2]|0; $57 = (($37) + ($i$04<<2)|0); HEAP32[$57>>2] = $56; $58 = (($i$04) + 1)|0; $59 = HEAP32[$numChars>>2]|0; $60 = ($58|0)<($59|0); if ($60) { $i$04 = $58; } else { break; } } } (_fclose($1)|0); HEAP32[$vararg_buffer44>>2] = $fileName; _TraceLog(0,20356,$vararg_buffer44); HEAP32[$agg$result>>2] = $23; $61 = ((($agg$result)) + 4|0); ;HEAP32[$61>>2]=HEAP32[$font$sroa$7>>2]|0;HEAP32[$61+4>>2]=HEAP32[$font$sroa$7+4>>2]|0;HEAP32[$61+8>>2]=HEAP32[$font$sroa$7+8>>2]|0;HEAP32[$61+12>>2]=HEAP32[$font$sroa$7+12>>2]|0; $62 = ((($agg$result)) + 20|0); HEAP32[$62>>2] = $25; $63 = ((($agg$result)) + 24|0); HEAP32[$63>>2] = $26; $64 = ((($agg$result)) + 28|0); HEAP32[$64>>2] = $28; $65 = ((($agg$result)) + 32|0); HEAP32[$65>>2] = $31; $66 = ((($agg$result)) + 36|0); HEAP32[$66>>2] = $34; $67 = ((($agg$result)) + 40|0); HEAP32[$67>>2] = $37; STACKTOP = sp;return; } function _ParseImageData($image,$charValues,$charRecs) { $image = $image|0; $charValues = $charValues|0; $charRecs = $charRecs|0; var $$byval_copy4 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $8 = 0, $9 = 0, $charWidth$0 = 0, $charWidth$0$lcssa = 0; var $exitcond = 0, $i$06 = 0, $index$0$lcssa = 0, $index$012 = 0, $index$1$lcssa = 0, $index$17 = 0, $j$0 = 0, $j$0$lcssa = 0, $lineToRead$013 = 0, $tempCharRecs = 0, $tempCharValues = 0, $x$1$lcssa = 0, $x$116 = 0, $x$2 = 0, $xPosToRead$18 = 0, $y$0$lcssa = 0, $y$024 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 2592|0; $$byval_copy4 = sp + 2560|0; $tempCharValues = sp + 2048|0; $tempCharRecs = sp; ;HEAP32[$$byval_copy4>>2]=HEAP32[$image>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$$byval_copy4+16>>2]=HEAP32[$image+16>>2]|0; $0 = (_GetImageData($$byval_copy4)|0); $1 = ((($image)) + 8|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(0); L1: do { if ($3) { $4 = ((($image)) + 4|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)>(0); $7 = HEAP32[$1>>2]|0; $y$024 = 0; while(1) { L5: do { if ($6) { $8 = Math_imul($5, $y$024)|0; $x$116 = 0; while(1) { $9 = (($8) + ($x$116))|0; $10 = (($0) + ($9<<2)|0); ;HEAP8[$$byval_copy4>>0]=HEAP8[$10>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$10+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$10+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$10+3>>0]|0; $11 = (_PixelIsMagenta($$byval_copy4)|0); $12 = ($11|0)==(0); if ($12) { $x$1$lcssa = $x$116; break L5; } $13 = (($x$116) + 1)|0; $14 = ($13|0)<($5|0); if ($14) { $x$116 = $13; } else { $x$1$lcssa = $13; break; } } } else { $x$1$lcssa = 0; } } while(0); $15 = Math_imul($5, $y$024)|0; $16 = (($15) + ($x$1$lcssa))|0; $17 = (($0) + ($16<<2)|0); ;HEAP8[$$byval_copy4>>0]=HEAP8[$17>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$17+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$17+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$17+3>>0]|0; $18 = (_PixelIsMagenta($$byval_copy4)|0); $19 = ($18|0)==(0); if ($19) { $x$2 = $x$1$lcssa;$y$0$lcssa = $y$024; break L1; } $20 = (($y$024) + 1)|0; $21 = ($20|0)<($7|0); if ($21) { $y$024 = $20; } else { $x$2 = $x$1$lcssa;$y$0$lcssa = $20; break; } } } else { $x$2 = 0;$y$0$lcssa = 0; } } while(0); $22 = ((($image)) + 4|0); $23 = HEAP32[$22>>2]|0; $j$0 = 0; while(1) { $24 = (($j$0) + ($y$0$lcssa))|0; $25 = Math_imul($24, $23)|0; $26 = (($25) + ($x$2))|0; $27 = (($0) + ($26<<2)|0); ;HEAP8[$$byval_copy4>>0]=HEAP8[$27>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$27+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$27+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$27+3>>0]|0; $28 = (_PixelIsMagenta($$byval_copy4)|0); $29 = ($28|0)==(0); $30 = (($j$0) + 1)|0; if ($29) { $j$0 = $30; } else { $$lcssa = $24;$j$0$lcssa = $j$0; break; } } $31 = HEAP32[$1>>2]|0; $32 = ($y$0$lcssa|0)<($31|0); if ($32) { $33 = HEAP32[$22>>2]|0; $34 = ($x$2|0)<($33|0); $35 = HEAP32[$1>>2]|0; $37 = $y$0$lcssa;$index$012 = 0;$lineToRead$013 = 0; while(1) { L20: do { if ($34) { $36 = Math_imul($33, $37)|0; $38 = Math_imul($33, $37)|0; $index$17 = $index$012;$xPosToRead$18 = $x$2; while(1) { $39 = (($38) + ($xPosToRead$18))|0; $40 = (($0) + ($39<<2)|0); ;HEAP8[$$byval_copy4>>0]=HEAP8[$40>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$40+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$40+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$40+3>>0]|0; $41 = (_PixelIsMagenta($$byval_copy4)|0); $42 = ($41|0)==(0); if (!($42)) { $index$1$lcssa = $index$17; break L20; } $43 = (($index$17) + 32)|0; $44 = (($tempCharValues) + ($index$17<<2)|0); HEAP32[$44>>2] = $43; $45 = (($tempCharRecs) + ($index$17<<4)|0); HEAP32[$45>>2] = $xPosToRead$18; $46 = (((($tempCharRecs) + ($index$17<<4)|0)) + 4|0); HEAP32[$46>>2] = $37; $47 = (((($tempCharRecs) + ($index$17<<4)|0)) + 12|0); HEAP32[$47>>2] = $j$0$lcssa; $charWidth$0 = 0; while(1) { $48 = (($charWidth$0) + ($xPosToRead$18))|0; $49 = (($48) + ($36))|0; $50 = (($0) + ($49<<2)|0); ;HEAP8[$$byval_copy4>>0]=HEAP8[$50>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$50+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$50+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$50+3>>0]|0; $51 = (_PixelIsMagenta($$byval_copy4)|0); $52 = ($51|0)==(0); $53 = (($charWidth$0) + 1)|0; if ($52) { $charWidth$0 = $53; } else { $charWidth$0$lcssa = $charWidth$0; break; } } $54 = (((($tempCharRecs) + ($index$17<<4)|0)) + 8|0); HEAP32[$54>>2] = $charWidth$0$lcssa; $55 = (($index$17) + 1)|0; $56 = (($xPosToRead$18) + ($x$2))|0; $57 = (($56) + ($charWidth$0$lcssa))|0; $58 = ($57|0)<($33|0); if ($58) { $index$17 = $55;$xPosToRead$18 = $57; } else { $index$1$lcssa = $55; break; } } } else { $index$1$lcssa = $index$012; } } while(0); $59 = (($lineToRead$013) + 1)|0; $60 = Math_imul($59, $$lcssa)|0; $61 = (($60) + ($y$0$lcssa))|0; $62 = ($61|0)<($35|0); if ($62) { $37 = $61;$index$012 = $index$1$lcssa;$lineToRead$013 = $59; } else { $index$0$lcssa = $index$1$lcssa; break; } } } else { $index$0$lcssa = 0; } _free($0); $63 = $index$0$lcssa << 4; $64 = (_malloc($63)|0); HEAP32[$charRecs>>2] = $64; $65 = $index$0$lcssa << 2; $66 = (_malloc($65)|0); HEAP32[$charValues>>2] = $66; $67 = ($index$0$lcssa|0)>(0); if ($67) { $i$06 = 0; } else { STACKTOP = sp;return ($index$0$lcssa|0); } while(1) { $68 = (($tempCharValues) + ($i$06<<2)|0); $69 = HEAP32[$68>>2]|0; $70 = HEAP32[$charValues>>2]|0; $71 = (($70) + ($i$06<<2)|0); HEAP32[$71>>2] = $69; $72 = HEAP32[$charRecs>>2]|0; $73 = (($72) + ($i$06<<4)|0); $74 = (($tempCharRecs) + ($i$06<<4)|0); ;HEAP32[$73>>2]=HEAP32[$74>>2]|0;HEAP32[$73+4>>2]=HEAP32[$74+4>>2]|0;HEAP32[$73+8>>2]=HEAP32[$74+8>>2]|0;HEAP32[$73+12>>2]=HEAP32[$74+12>>2]|0; $75 = (($i$06) + 1)|0; $exitcond = ($75|0)==($index$0$lcssa|0); if ($exitcond) { break; } else { $i$06 = $75; } } STACKTOP = sp;return ($index$0$lcssa|0); } function _stbi__fopen($filename) { $filename = $filename|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_fopen($filename,20392)|0); return ($0|0); } function _stbi__err($str) { $str = $str|0; var label = 0, sp = 0; sp = STACKTOP; HEAP32[5724>>2] = $str; return; } function _stbi__start_file($s,$f) { $s = $s|0; $f = $f|0; var label = 0, sp = 0; sp = STACKTOP; _stbi__start_callbacks($s,8636,$f); return; } function _stbi__load_flip($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$04 = 0, $exitcond = 0, $exitcond7 = 0, $exitcond8 = 0, $or$cond = 0, $row$06 = 0, $z$03 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__load_main($s,$x,$y,$comp,$req_comp)|0); $1 = HEAP32[5728>>2]|0; $2 = ($1|0)!=(0); $3 = ($0|0)!=(0|0); $or$cond = $3 & $2; if (!($or$cond)) { return ($0|0); } $4 = HEAP32[$x>>2]|0; $5 = HEAP32[$y>>2]|0; $6 = ($req_comp|0)==(0); if ($6) { $7 = HEAP32[$comp>>2]|0; $11 = $7; } else { $11 = $req_comp; } $8 = $5 >> 1; $9 = ($8|0)>(0); if (!($9)) { return ($0|0); } $10 = ($4|0)>(0); $12 = ($11|0)>(0); $13 = (($5) + -1)|0; $row$06 = 0; while(1) { if ($10) { $14 = Math_imul($row$06, $4)|0; $15 = (($13) - ($row$06))|0; $16 = Math_imul($15, $4)|0; $col$04 = 0; while(1) { if ($12) { $17 = (($col$04) + ($14))|0; $18 = Math_imul($17, $11)|0; $19 = (($col$04) + ($16))|0; $20 = Math_imul($19, $11)|0; $z$03 = 0; while(1) { $21 = (($z$03) + ($18))|0; $22 = (($0) + ($21)|0); $23 = HEAP8[$22>>0]|0; $24 = (($z$03) + ($20))|0; $25 = (($0) + ($24)|0); $26 = HEAP8[$25>>0]|0; HEAP8[$22>>0] = $26; HEAP8[$25>>0] = $23; $27 = (($z$03) + 1)|0; $exitcond = ($27|0)==($11|0); if ($exitcond) { break; } else { $z$03 = $27; } } } $28 = (($col$04) + 1)|0; $exitcond7 = ($28|0)==($4|0); if ($exitcond7) { break; } else { $col$04 = $28; } } } $29 = (($row$06) + 1)|0; $exitcond8 = ($29|0)==($8|0); if ($exitcond8) { break; } else { $row$06 = $29; } } return ($0|0); } function _stbi__start_callbacks($s,$c,$user) { $s = $s|0; $c = $c|0; $user = $user|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($s)) + 16|0); ;HEAP32[$0>>2]=HEAP32[$c>>2]|0;HEAP32[$0+4>>2]=HEAP32[$c+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$c+8>>2]|0; $1 = ((($s)) + 28|0); HEAP32[$1>>2] = $user; $2 = ((($s)) + 36|0); HEAP32[$2>>2] = 128; $3 = ((($s)) + 32|0); HEAP32[$3>>2] = 1; $4 = ((($s)) + 40|0); $5 = ((($s)) + 176|0); HEAP32[$5>>2] = $4; _stbi__refill_buffer($s); $6 = ((($s)) + 172|0); $7 = HEAP32[$6>>2]|0; $8 = ((($s)) + 180|0); HEAP32[$8>>2] = $7; return; } function _stbi__malloc($size) { $size = $size|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_malloc($size)|0); return ($0|0); } function _stbi__do_zlib($a,$obuf,$olen,$exp,$parse_header) { $a = $a|0; $obuf = $obuf|0; $olen = $olen|0; $exp = $exp|0; $parse_header = $parse_header|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($a)) + 20|0); HEAP32[$0>>2] = $obuf; $1 = ((($a)) + 16|0); HEAP32[$1>>2] = $obuf; $2 = (($obuf) + ($olen)|0); $3 = ((($a)) + 24|0); HEAP32[$3>>2] = $2; $4 = ((($a)) + 28|0); HEAP32[$4>>2] = $exp; $5 = (_stbi__parse_zlib($a,$parse_header)|0); return ($5|0); } function _stbi__get16le($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = $0&255; $2 = (_stbi__get8($s)|0); $3 = $2&255; $4 = $3 << 8; $5 = $4 | $1; return ($5|0); } function _LoadDDS($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $bufsize$0 = 0, $exitcond = 0, $exitcond13 = 0, $filecode = 0, $header = 0, $i$09 = 0, $i2$011 = 0, $i3$08 = 0, $image$sroa$0$0 = 0; var $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$0$3 = 0, $image$sroa$26$0 = 0, $image$sroa$26$1 = 0, $image$sroa$41$0 = 0, $image$sroa$41$1 = 0, $image$sroa$56$0 = 0, $image$sroa$56$1 = 0, $image$sroa$56$2 = 0, $image$sroa$59$0 = 0, $image$sroa$59$1 = 0, $image$sroa$59$2 = 0, $image$sroa$59$3 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $switch = 0, $switch$split12D = 0, $switch$split2D = 0; var $switch$split42D = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer12 = 0, $vararg_buffer16 = 0, $vararg_buffer20 = 0, $vararg_buffer24 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr19 = 0, $vararg_ptr23 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 192|0; $vararg_buffer24 = sp + 56|0; $vararg_buffer20 = sp + 48|0; $vararg_buffer16 = sp + 40|0; $vararg_buffer12 = sp + 32|0; $vararg_buffer8 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $filecode = sp + 184|0; $header = sp + 60|0; $0 = (_fopen($fileName,20392)|0); $1 = ($0|0)==(0|0); if ($1) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,17449,$vararg_buffer); $image$sroa$0$3 = 0;$image$sroa$26$1 = 0;$image$sroa$41$1 = 0;$image$sroa$56$2 = 0;$image$sroa$59$3 = 0; HEAP32[$agg$result>>2] = $image$sroa$0$3; $86 = ((($agg$result)) + 4|0); HEAP32[$86>>2] = $image$sroa$26$1; $87 = ((($agg$result)) + 8|0); HEAP32[$87>>2] = $image$sroa$41$1; $88 = ((($agg$result)) + 12|0); HEAP32[$88>>2] = $image$sroa$56$2; $89 = ((($agg$result)) + 16|0); HEAP32[$89>>2] = $image$sroa$59$3; STACKTOP = sp;return; } (_fread($filecode,1,4,$0)|0); $2 = (_strncmp($filecode,17483,4)|0); $3 = ($2|0)==(0); if ($3) { (_fread($header,124,1,$0)|0); HEAP32[$vararg_buffer4>>2] = $fileName; $vararg_ptr7 = ((($vararg_buffer4)) + 4|0); HEAP32[$vararg_ptr7>>2] = 124; _TraceLog(3,17536,$vararg_buffer4); $4 = ((($header)) + 72|0); $5 = HEAP32[$4>>2]|0; HEAP32[$vararg_buffer8>>2] = $fileName; $vararg_ptr11 = ((($vararg_buffer8)) + 4|0); HEAP32[$vararg_ptr11>>2] = $5; _TraceLog(3,17566,$vararg_buffer8); $6 = ((($header)) + 76|0); $7 = HEAP32[$6>>2]|0; HEAP32[$vararg_buffer12>>2] = $fileName; $vararg_ptr15 = ((($vararg_buffer12)) + 4|0); HEAP32[$vararg_ptr15>>2] = $7; _TraceLog(3,17602,$vararg_buffer12); $8 = ((($header)) + 80|0); $9 = HEAP32[$8>>2]|0; HEAP32[$vararg_buffer16>>2] = $fileName; $vararg_ptr19 = ((($vararg_buffer16)) + 4|0); HEAP32[$vararg_ptr19>>2] = $9; _TraceLog(3,17641,$vararg_buffer16); $10 = ((($header)) + 84|0); $11 = HEAP32[$10>>2]|0; HEAP32[$vararg_buffer20>>2] = $fileName; $vararg_ptr23 = ((($vararg_buffer20)) + 4|0); HEAP32[$vararg_ptr23>>2] = $11; _TraceLog(3,17668,$vararg_buffer20); $12 = ((($header)) + 12|0); $13 = HEAP32[$12>>2]|0; $14 = ((($header)) + 8|0); $15 = HEAP32[$14>>2]|0; $16 = HEAP32[$10>>2]|0; $17 = ($16|0)==(16); L7: do { if ($17) { $18 = HEAP32[$6>>2]|0; switch ($18|0) { case 64: { $19 = $13 << 1; $20 = Math_imul($19, $15)|0; $21 = (_malloc($20)|0); (_fread($21,$20,1,$0)|0); $image$sroa$0$0 = $21;$image$sroa$59$0 = 3; break L7; break; } case 65: { break; } default: { $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; break L7; } } $22 = ((($header)) + 100|0); $23 = HEAP32[$22>>2]|0; $switch$split2D = ($23|0)<(61440); if ($switch$split2D) { switch ($23|0) { case 32768: { break; } default: { $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; break L7; } } $24 = Math_imul($15, $13)|0; $25 = $24 << 1; $26 = (_malloc($25)|0); (_fread($26,$25,1,$0)|0); $27 = ($24|0)>(0); if (!($27)) { $image$sroa$0$0 = $26;$image$sroa$59$0 = 5; break; } $28 = Math_imul($15, $13)|0; $i$09 = 0; while(1) { $29 = (($26) + ($i$09<<1)|0); $30 = HEAP16[$29>>1]|0; $31 = $30&65535; $32 = ($30&65535) >>> 15; $33 = $32&65535; $34 = $31 << 1; $35 = $34 | $33; $36 = $35&65535; HEAP16[$29>>1] = $36; $37 = (($i$09) + 1)|0; $exitcond = ($37|0)==($28|0); if ($exitcond) { $image$sroa$0$0 = $26;$image$sroa$59$0 = 5; break; } else { $i$09 = $37; } } } else { switch ($23|0) { case 61440: { break; } default: { $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; break L7; } } $38 = Math_imul($15, $13)|0; $39 = $38 << 1; $40 = (_malloc($39)|0); (_fread($40,$39,1,$0)|0); $41 = ($38|0)>(0); if (!($41)) { $image$sroa$0$0 = $40;$image$sroa$59$0 = 6; break; } $42 = Math_imul($15, $13)|0; $i2$011 = 0; while(1) { $43 = (($40) + ($i2$011<<1)|0); $44 = HEAP16[$43>>1]|0; $45 = $44&65535; $46 = ($44&65535) >>> 12; $47 = $46&65535; $48 = $45 << 4; $49 = $48 | $47; $50 = $49&65535; HEAP16[$43>>1] = $50; $51 = (($i2$011) + 1)|0; $exitcond13 = ($51|0)==($42|0); if ($exitcond13) { $image$sroa$0$0 = $40;$image$sroa$59$0 = 6; break; } else { $i2$011 = $51; } } } } else { $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; } } while(0); $52 = HEAP32[$6>>2]|0; $53 = ($52|0)==(64); $54 = HEAP32[$10>>2]|0; $55 = ($54|0)==(24); $or$cond = $53 & $55; L24: do { if ($or$cond) { $56 = ($13*3)|0; $57 = Math_imul($56, $15)|0; $58 = (_malloc($57)|0); (_fread($58,$57,1,$0)|0); $image$sroa$0$1 = $58;$image$sroa$56$0 = 1;$image$sroa$59$1 = 4; } else { $59 = ($52|0)==(65); $60 = ($54|0)==(32); $or$cond3 = $59 & $60; if ($or$cond3) { $61 = $13 << 2; $62 = Math_imul($61, $15)|0; $63 = (_malloc($62)|0); (_fread($63,$62,1,$0)|0); $64 = ($62|0)>(0); if ($64) { $i3$08 = 0; } else { $image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7; break; } while(1) { $65 = (($63) + ($i3$08)|0); $66 = HEAP8[$65>>0]|0; $67 = $i3$08 | 2; $68 = (($63) + ($67)|0); $69 = HEAP8[$68>>0]|0; HEAP8[$65>>0] = $69; HEAP8[$68>>0] = $66; $70 = (($i3$08) + 4)|0; $71 = ($70|0)<($62|0); if ($71) { $i3$08 = $70; } else { $image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7; break L24; } } } $72 = $52 & -2; $switch = ($72|0)!=(4); $73 = HEAP32[$8>>2]|0; $74 = ($73|0)==(0); $or$cond5 = $switch | $74; if ($or$cond5) { $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$56$0 = 1;$image$sroa$59$1 = $image$sroa$59$0; } else { $75 = ((($header)) + 24|0); $76 = HEAP32[$75>>2]|0; $77 = ($76>>>0)>(1); $78 = ((($header)) + 16|0); $79 = HEAP32[$78>>2]|0; $80 = $77&1; $bufsize$0 = $79 << $80; HEAP32[$vararg_buffer24>>2] = $79; _TraceLog(3,17698,$vararg_buffer24); $81 = (_malloc($bufsize$0)|0); (_fread($81,1,$bufsize$0,$0)|0); $82 = HEAP32[$75>>2]|0; $83 = HEAP32[$8>>2]|0; $switch$split12D = ($83|0)<(861165636); if ($switch$split12D) { switch ($83|0) { case 827611204: { break; } default: { $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0; break L24; } } $84 = HEAP32[$6>>2]|0; $85 = ($84|0)==(4); $$ = $85 ? 8 : 9; $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $$; break; } $switch$split42D = ($83|0)<(894720068); if ($switch$split42D) { switch ($83|0) { case 861165636: { break; } default: { $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0; break L24; } } $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 10; break; } else { switch ($83|0) { case 894720068: { break; } default: { $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0; break L24; } } $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 11; break; } } } } while(0); $image$sroa$0$2 = $image$sroa$0$1;$image$sroa$26$0 = $13;$image$sroa$41$0 = $15;$image$sroa$56$1 = $image$sroa$56$0;$image$sroa$59$2 = $image$sroa$59$1; } else { HEAP32[$vararg_buffer1>>2] = $fileName; _TraceLog(2,17488,$vararg_buffer1); $image$sroa$0$2 = 0;$image$sroa$26$0 = 0;$image$sroa$41$0 = 0;$image$sroa$56$1 = 0;$image$sroa$59$2 = 0; } (_fclose($0)|0); $image$sroa$0$3 = $image$sroa$0$2;$image$sroa$26$1 = $image$sroa$26$0;$image$sroa$41$1 = $image$sroa$41$0;$image$sroa$56$2 = $image$sroa$56$1;$image$sroa$59$3 = $image$sroa$59$2; HEAP32[$agg$result>>2] = $image$sroa$0$3; $86 = ((($agg$result)) + 4|0); HEAP32[$86>>2] = $image$sroa$26$1; $87 = ((($agg$result)) + 8|0); HEAP32[$87>>2] = $image$sroa$41$1; $88 = ((($agg$result)) + 12|0); HEAP32[$88>>2] = $image$sroa$56$2; $89 = ((($agg$result)) + 16|0); HEAP32[$89>>2] = $image$sroa$59$3; STACKTOP = sp;return; } function _LoadPKM($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$ = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0; var $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $vararg_buffer10 = sp + 32|0; $vararg_buffer7 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $header = sp + 40|0; $0 = (_fopen($fileName,20392)|0); $1 = ($0|0)==(0|0); if ($1) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,17282,$vararg_buffer); $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$1 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0; HEAP32[$agg$result>>2] = $image$sroa$0$1; $43 = ((($agg$result)) + 4|0); HEAP32[$43>>2] = $image$sroa$4$1; $44 = ((($agg$result)) + 8|0); HEAP32[$44>>2] = $image$sroa$7$1; $45 = ((($agg$result)) + 12|0); HEAP32[$45>>2] = $image$sroa$10$1; $46 = ((($agg$result)) + 16|0); HEAP32[$46>>2] = $image$sroa$12$1; STACKTOP = sp;return; } (_fread($header,16,1,$0)|0); $2 = (_strncmp($header,17316,4)|0); $3 = ($2|0)==(0); L5: do { if ($3) { $4 = ((($header)) + 6|0); $5 = HEAP16[$4>>1]|0; $6 = $5&65535; $7 = $6 << 8; $8 = $6 >>> 8; $9 = $7 | $8; $10 = $9&65535; HEAP16[$4>>1] = $10; $11 = ((($header)) + 8|0); $12 = HEAP16[$11>>1]|0; $13 = $12&65535; $14 = $13 << 8; $15 = $13 >>> 8; $16 = $14 | $15; $17 = $16&65535; HEAP16[$11>>1] = $17; $18 = ((($header)) + 10|0); $19 = HEAP16[$18>>1]|0; $20 = $19&65535; $21 = $20 << 8; $22 = $20 >>> 8; $23 = $21 | $22; $24 = $23&65535; HEAP16[$18>>1] = $24; $25 = HEAP16[$11>>1]|0; $26 = $25&65535; HEAP32[$vararg_buffer4>>2] = $26; _TraceLog(3,17369,$vararg_buffer4); $27 = HEAP16[$18>>1]|0; $28 = $27&65535; HEAP32[$vararg_buffer7>>2] = $28; _TraceLog(3,17395,$vararg_buffer7); $29 = HEAP16[$4>>1]|0; $30 = $29&65535; HEAP32[$vararg_buffer10>>2] = $30; _TraceLog(3,17422,$vararg_buffer10); $31 = HEAP16[$11>>1]|0; $32 = $31&65535; $33 = HEAP16[$18>>1]|0; $34 = $33&65535; $35 = HEAP16[$4>>1]|0; $36 = ($35<<16>>16)==(3); $$ = $36 ? 8 : 4; $37 = Math_imul($34, $32)|0; $38 = Math_imul($37, $$)|0; $39 = $38 >>> 3; $40 = (_malloc($39)|0); (_fread($40,1,$39,$0)|0); $41 = HEAP16[$4>>1]|0; switch ($41<<16>>16) { case 0: { $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 12;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34; break L5; break; } case 1: { $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 13;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34; break L5; break; } default: { $42 = ($41<<16>>16)==(3); $$1 = $42 ? 14 : 0; $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = $$1;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34; break L5; } } } else { HEAP32[$vararg_buffer1>>2] = $fileName; _TraceLog(2,17321,$vararg_buffer1); $image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$0 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0; } } while(0); (_fclose($0)|0); $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0; HEAP32[$agg$result>>2] = $image$sroa$0$1; $43 = ((($agg$result)) + 4|0); HEAP32[$43>>2] = $image$sroa$4$1; $44 = ((($agg$result)) + 8|0); HEAP32[$44>>2] = $image$sroa$7$1; $45 = ((($agg$result)) + 12|0); HEAP32[$45>>2] = $image$sroa$10$1; $46 = ((($agg$result)) + 16|0); HEAP32[$46>>2] = $image$sroa$12$1; STACKTOP = sp;return; } function _LoadKTX($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dataSize = 0, $header = 0, $i$01 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$3$0 = 0, $image$sroa$3$1 = 0, $image$sroa$5$0 = 0, $image$sroa$5$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$9$0 = 0, $image$sroa$9$1 = 0, $unused = 0, $vararg_buffer = 0; var $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $vararg_buffer10 = sp + 32|0; $vararg_buffer7 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $header = sp + 40|0; $unused = sp + 104|0; $dataSize = sp + 36|0; $0 = (_fopen($fileName,20392)|0); $1 = ($0|0)==(0|0); if ($1) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,17113,$vararg_buffer); $image$sroa$0$1 = 0;$image$sroa$3$1 = 0;$image$sroa$5$1 = 0;$image$sroa$7$1 = 0;$image$sroa$9$1 = 0; HEAP32[$agg$result>>2] = $image$sroa$0$1; $40 = ((($agg$result)) + 4|0); HEAP32[$40>>2] = $image$sroa$3$1; $41 = ((($agg$result)) + 8|0); HEAP32[$41>>2] = $image$sroa$5$1; $42 = ((($agg$result)) + 12|0); HEAP32[$42>>2] = $image$sroa$7$1; $43 = ((($agg$result)) + 16|0); HEAP32[$43>>2] = $image$sroa$9$1; STACKTOP = sp;return; } (_fread($header,64,1,$0)|0); $2 = ((($header)) + 1|0); $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)==(75); L5: do { if ($4) { $5 = ((($header)) + 2|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)==(84); if ($7) { $8 = ((($header)) + 3|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(88); if ($10) { $11 = ((($header)) + 4|0); $12 = HEAP8[$11>>0]|0; $13 = ($12<<24>>24)==(32); if ($13) { $14 = ((($header)) + 5|0); $15 = HEAP8[$14>>0]|0; $16 = ($15<<24>>24)==(49); if ($16) { $17 = ((($header)) + 6|0); $18 = HEAP8[$17>>0]|0; $19 = ($18<<24>>24)==(49); if ($19) { $20 = ((($header)) + 36|0); $21 = HEAP32[$20>>2]|0; $22 = ((($header)) + 40|0); $23 = HEAP32[$22>>2]|0; $24 = ((($header)) + 56|0); $25 = HEAP32[$24>>2]|0; HEAP32[$vararg_buffer4>>2] = $21; _TraceLog(3,17200,$vararg_buffer4); $26 = HEAP32[$22>>2]|0; HEAP32[$vararg_buffer7>>2] = $26; _TraceLog(3,17226,$vararg_buffer7); $27 = ((($header)) + 28|0); $28 = HEAP32[$27>>2]|0; HEAP32[$vararg_buffer10>>2] = $28; _TraceLog(3,17253,$vararg_buffer10); $29 = ((($header)) + 60|0); $30 = HEAP32[$29>>2]|0; $31 = ($30|0)==(0); if (!($31)) { $32 = HEAP32[$29>>2]|0; $i$01 = 0; while(1) { (_fread($unused,1,1,$0)|0); $33 = (($i$01) + 1)|0; $34 = ($33>>>0)<($32>>>0); if ($34) { $i$01 = $33; } else { break; } } } (_fread($dataSize,4,1,$0)|0); $35 = HEAP32[$dataSize>>2]|0; $36 = (_malloc($35)|0); $37 = HEAP32[$dataSize>>2]|0; (_fread($36,1,$37,$0)|0); $38 = HEAP32[$27>>2]|0; switch ($38|0) { case 36196: { $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 12; break L5; break; } case 37492: { $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 13; break L5; break; } default: { $39 = ($38|0)==(37496); $$ = $39 ? 14 : 0; $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = $$; break L5; } } } else { label = 9; } } else { label = 9; } } else { label = 9; } } else { label = 9; } } else { label = 9; } } else { label = 9; } } while(0); if ((label|0) == 9) { HEAP32[$vararg_buffer1>>2] = $fileName; _TraceLog(2,17153,$vararg_buffer1); $image$sroa$0$0 = 0;$image$sroa$3$0 = 0;$image$sroa$5$0 = 0;$image$sroa$7$0 = 0;$image$sroa$9$0 = 0; } (_fclose($0)|0); $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$3$1 = $image$sroa$3$0;$image$sroa$5$1 = $image$sroa$5$0;$image$sroa$7$1 = $image$sroa$7$0;$image$sroa$9$1 = $image$sroa$9$0; HEAP32[$agg$result>>2] = $image$sroa$0$1; $40 = ((($agg$result)) + 4|0); HEAP32[$40>>2] = $image$sroa$3$1; $41 = ((($agg$result)) + 8|0); HEAP32[$41>>2] = $image$sroa$5$1; $42 = ((($agg$result)) + 12|0); HEAP32[$42>>2] = $image$sroa$7$1; $43 = ((($agg$result)) + 16|0); HEAP32[$43>>2] = $image$sroa$9$1; STACKTOP = sp;return; } function _LoadPVR($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$ = 0, $$1 = 0, $$2 = 0, $$pr = 0, $$pr3 = 0, $$pr5 = 0, $$pr7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0; var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $bpp$0 = 0, $header = 0, $i$08 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$10$2 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$12$2 = 0, $image$sroa$12$3 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$4$2 = 0; var $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$7$2 = 0, $pvrVersion = 0, $unused = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $pvrVersion = sp + 73|0; $header = sp + 20|0; $unused = sp + 72|0; $0 = (_fopen($fileName,20392)|0); $1 = ($0|0)==(0|0); if ($1) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,16981,$vararg_buffer); $image$sroa$0$2 = 0;$image$sroa$10$2 = 0;$image$sroa$12$3 = 0;$image$sroa$4$2 = 0;$image$sroa$7$2 = 0; HEAP32[$agg$result>>2] = $image$sroa$0$2; $113 = ((($agg$result)) + 4|0); HEAP32[$113>>2] = $image$sroa$4$2; $114 = ((($agg$result)) + 8|0); HEAP32[$114>>2] = $image$sroa$7$2; $115 = ((($agg$result)) + 12|0); HEAP32[$115>>2] = $image$sroa$10$2; $116 = ((($agg$result)) + 16|0); HEAP32[$116>>2] = $image$sroa$12$3; STACKTOP = sp;return; } HEAP8[$pvrVersion>>0] = 0; (_fread($pvrVersion,1,1,$0)|0); (_fseek($0,0,0)|0); $2 = HEAP8[$pvrVersion>>0]|0; switch ($2<<24>>24) { case 80: { (_fread($header,52,1,$0)|0); $3 = HEAP8[$header>>0]|0; $4 = ($3<<24>>24)==(80); if ($4) { $5 = ((($header)) + 1|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)==(86); if ($7) { $8 = ((($header)) + 2|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(82); if ($10) { $11 = ((($header)) + 3|0); $12 = HEAP8[$11>>0]|0; $13 = ($12<<24>>24)==(3); if ($13) { $14 = ((($header)) + 28|0); $15 = HEAP32[$14>>2]|0; $16 = ((($header)) + 24|0); $17 = HEAP32[$16>>2]|0; $18 = ((($header)) + 44|0); $19 = HEAP32[$18>>2]|0; $20 = ((($header)) + 8|0); $21 = HEAP8[$20>>0]|0; $22 = ($21<<24>>24)==(108); do { if ($22) { $23 = ((($header)) + 9|0); $24 = HEAP8[$23>>0]|0; $25 = ($24<<24>>24)==(0); if ($25) { $26 = ((($header)) + 12|0); $27 = HEAP8[$26>>0]|0; $28 = ($27<<24>>24)==(8); if ($28) { $image$sroa$12$0 = 1; break; } } $$pr = HEAP8[$20>>0]|0; $29 = ($$pr<<24>>24)==(108); if ($29) { $30 = ((($header)) + 9|0); $31 = HEAP8[$30>>0]|0; $32 = ($31<<24>>24)==(97); if ($32) { $33 = ((($header)) + 12|0); $34 = HEAP8[$33>>0]|0; $35 = ($34<<24>>24)==(8); if ($35) { $36 = ((($header)) + 13|0); $37 = HEAP8[$36>>0]|0; $38 = ($37<<24>>24)==(8); if ($38) { $image$sroa$12$0 = 2; } else { label = 16; } } else { label = 16; } } else { label = 16; } } else { $39 = $$pr; label = 17; } } else { label = 16; } } while(0); if ((label|0) == 16) { $$pr3 = HEAP8[$20>>0]|0; $39 = $$pr3; label = 17; } L22: do { if ((label|0) == 17) { $40 = ($39<<24>>24)==(114); if ($40) { $41 = ((($header)) + 9|0); $42 = HEAP8[$41>>0]|0; $43 = ($42<<24>>24)==(103); if ($43) { $44 = ((($header)) + 10|0); $45 = HEAP8[$44>>0]|0; $46 = ($45<<24>>24)==(98); if ($46) { $47 = ((($header)) + 11|0); $48 = HEAP8[$47>>0]|0; switch ($48<<24>>24) { case 97: { break; } case 0: { $83 = ((($header)) + 12|0); $84 = HEAP8[$83>>0]|0; $85 = ($84<<24>>24)==(5); if ($85) { $86 = ((($header)) + 13|0); $87 = HEAP8[$86>>0]|0; $88 = ($87<<24>>24)==(6); if ($88) { $89 = ((($header)) + 14|0); $90 = HEAP8[$89>>0]|0; $91 = ($90<<24>>24)==(5); if ($91) { $image$sroa$12$0 = 3; break L22; } } $$pr7 = HEAP8[$83>>0]|0; $92 = $$pr7; } else { $92 = $84; } $93 = ($92<<24>>24)==(8); if (!($93)) { $image$sroa$12$0 = 0; break L22; } $94 = ((($header)) + 13|0); $95 = HEAP8[$94>>0]|0; $96 = ($95<<24>>24)==(8); if (!($96)) { $image$sroa$12$0 = 0; break L22; } $97 = ((($header)) + 14|0); $98 = HEAP8[$97>>0]|0; $99 = ($98<<24>>24)==(8); $$1 = $99 ? 4 : 0; $image$sroa$12$0 = $$1; break L22; break; } default: { $image$sroa$12$0 = 0; break L22; } } $49 = ((($header)) + 12|0); $50 = HEAP8[$49>>0]|0; $51 = ($50<<24>>24)==(5); if ($51) { $52 = ((($header)) + 13|0); $53 = HEAP8[$52>>0]|0; $54 = ($53<<24>>24)==(5); if ($54) { $55 = ((($header)) + 14|0); $56 = HEAP8[$55>>0]|0; $57 = ($56<<24>>24)==(5); if ($57) { $58 = ((($header)) + 15|0); $59 = HEAP8[$58>>0]|0; $60 = ($59<<24>>24)==(1); if ($60) { $image$sroa$12$0 = 5; break; } } } $$pr5 = HEAP8[$49>>0]|0; $61 = $$pr5; } else { $61 = $50; } $62 = ($61<<24>>24)==(4); if ($62) { $63 = ((($header)) + 13|0); $64 = HEAP8[$63>>0]|0; $65 = ($64<<24>>24)==(4); if ($65) { $66 = ((($header)) + 14|0); $67 = HEAP8[$66>>0]|0; $68 = ($67<<24>>24)==(4); if ($68) { $69 = ((($header)) + 15|0); $70 = HEAP8[$69>>0]|0; $71 = ($70<<24>>24)==(4); if ($71) { $image$sroa$12$0 = 6; break; } } } } $72 = HEAP8[$49>>0]|0; $73 = ($72<<24>>24)==(8); if (!($73)) { $image$sroa$12$0 = 0; break; } $74 = ((($header)) + 13|0); $75 = HEAP8[$74>>0]|0; $76 = ($75<<24>>24)==(8); if (!($76)) { $image$sroa$12$0 = 0; break; } $77 = ((($header)) + 14|0); $78 = HEAP8[$77>>0]|0; $79 = ($78<<24>>24)==(8); if (!($79)) { $image$sroa$12$0 = 0; break; } $80 = ((($header)) + 15|0); $81 = HEAP8[$80>>0]|0; $82 = ($81<<24>>24)==(8); $$ = $82 ? 7 : 0; $image$sroa$12$0 = $$; break; } } } $100 = HEAP8[$20>>0]|0; $101 = ($100<<24>>24)==(2); if ($101) { $image$sroa$12$0 = 15; } else { $102 = ($100<<24>>24)==(3); $$2 = $102 ? 16 : 0; $image$sroa$12$0 = $$2; } } } while(0); HEAP8[$unused>>0] = 0; $103 = ((($header)) + 48|0); $104 = HEAP32[$103>>2]|0; $105 = ($104|0)==(0); if (!($105)) { $i$08 = 0; while(1) { (_fread($unused,1,1,$0)|0); $106 = (($i$08) + 1)|0; $107 = HEAP32[$103>>2]|0; $108 = ($106>>>0)<($107>>>0); if ($108) { $i$08 = $106; } else { break; } } } switch ($image$sroa$12$0|0) { case 1: { $bpp$0 = 8; break; } case 6: case 3: case 5: case 2: { $bpp$0 = 16; break; } case 7: { $bpp$0 = 32; break; } case 4: { $bpp$0 = 24; break; } case 16: case 15: { $bpp$0 = 4; break; } default: { $bpp$0 = 0; } } $109 = Math_imul($17, $15)|0; $110 = Math_imul($109, $bpp$0)|0; $111 = (($110|0) / 8)&-1; $112 = (_malloc($111)|0); (_fread($112,$111,1,$0)|0); $image$sroa$0$0 = $112;$image$sroa$10$0 = $19;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$0 = $15;$image$sroa$7$0 = $17; } else { label = 8; } } else { label = 8; } } else { label = 8; } } else { label = 8; } if ((label|0) == 8) { HEAP32[$vararg_buffer1>>2] = $fileName; _TraceLog(2,17015,$vararg_buffer1); $image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$1 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0; } $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$2 = $image$sroa$12$1;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0; break; } case 52: { _TraceLog(0,17063,$vararg_buffer4); $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0; break; } default: { $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0; } } (_fclose($0)|0); $image$sroa$0$2 = $image$sroa$0$1;$image$sroa$10$2 = $image$sroa$10$1;$image$sroa$12$3 = $image$sroa$12$2;$image$sroa$4$2 = $image$sroa$4$1;$image$sroa$7$2 = $image$sroa$7$1; HEAP32[$agg$result>>2] = $image$sroa$0$2; $113 = ((($agg$result)) + 4|0); HEAP32[$113>>2] = $image$sroa$4$2; $114 = ((($agg$result)) + 8|0); HEAP32[$114>>2] = $image$sroa$7$2; $115 = ((($agg$result)) + 12|0); HEAP32[$115>>2] = $image$sroa$10$2; $116 = ((($agg$result)) + 16|0); HEAP32[$116>>2] = $image$sroa$12$3; STACKTOP = sp;return; } function _LoadASTC($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$14$0 = 0, $image$sroa$14$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$8$0 = 0, $image$sroa$8$1 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer4 = 0; var $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $vararg_buffer14 = sp + 40|0; $vararg_buffer10 = sp + 32|0; $vararg_buffer7 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $header = sp + 48|0; $0 = (_fopen($fileName,20392)|0); $1 = ($0|0)==(0|0); if ($1) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,16780,$vararg_buffer); $image$sroa$0$1 = 0;$image$sroa$12$1 = 0;$image$sroa$14$1 = 0;$image$sroa$4$1 = 0;$image$sroa$8$1 = 0; HEAP32[$agg$result>>2] = $image$sroa$0$1; $58 = ((($agg$result)) + 4|0); HEAP32[$58>>2] = $image$sroa$4$1; $59 = ((($agg$result)) + 8|0); HEAP32[$59>>2] = $image$sroa$8$1; $60 = ((($agg$result)) + 12|0); HEAP32[$60>>2] = $image$sroa$12$1; $61 = ((($agg$result)) + 16|0); HEAP32[$61>>2] = $image$sroa$14$1; STACKTOP = sp;return; } (_fread($header,16,1,$0)|0); $2 = ((($header)) + 3|0); $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)==(92); L5: do { if ($4) { $5 = ((($header)) + 2|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)==(-95); if ($7) { $8 = ((($header)) + 1|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(-85); $11 = HEAP8[$header>>0]|0; $12 = ($11<<24>>24)==(19); $or$cond = $10 & $12; if ($or$cond) { $13 = ((($header)) + 9|0); $14 = HEAP8[$13>>0]|0; $15 = $14&255; $16 = $15 << 16; $17 = ((($header)) + 8|0); $18 = HEAP8[$17>>0]|0; $19 = $18&255; $20 = $19 << 8; $21 = $20 | $16; $22 = ((($header)) + 7|0); $23 = HEAP8[$22>>0]|0; $24 = $23&255; $25 = $21 | $24; $26 = ((($header)) + 12|0); $27 = HEAP8[$26>>0]|0; $28 = $27&255; $29 = $28 << 16; $30 = ((($header)) + 11|0); $31 = HEAP8[$30>>0]|0; $32 = $31&255; $33 = $32 << 8; $34 = $33 | $29; $35 = ((($header)) + 10|0); $36 = HEAP8[$35>>0]|0; $37 = $36&255; $38 = $34 | $37; HEAP32[$vararg_buffer4>>2] = $25; _TraceLog(3,16864,$vararg_buffer4); HEAP32[$vararg_buffer7>>2] = $38; _TraceLog(3,16885,$vararg_buffer7); $39 = ((($header)) + 4|0); $40 = HEAP8[$39>>0]|0; $41 = $40&255; $42 = ((($header)) + 5|0); $43 = HEAP8[$42>>0]|0; $44 = $43&255; HEAP32[$vararg_buffer10>>2] = $41; $vararg_ptr13 = ((($vararg_buffer10)) + 4|0); HEAP32[$vararg_ptr13>>2] = $44; _TraceLog(3,16907,$vararg_buffer10); $45 = HEAP8[$39>>0]|0; $46 = $45&255; $47 = HEAP8[$42>>0]|0; $48 = $47&255; $49 = Math_imul($48, $46)|0; $50 = (128 / ($49>>>0))&-1; $51 = ($50|0)==(8); $52 = ($50|0)==(2); switch ($50|0) { case 2: case 8: { $53 = Math_imul($38, $25)|0; $54 = Math_imul($53, $50)|0; $55 = $54 >>> 3; $56 = (_malloc($55)|0); (_fread($56,$55,1,$0)|0); $57 = $51 | $52; $$$ = $57 ? 17 : 0; $image$sroa$0$0 = $56;$image$sroa$12$0 = 1;$image$sroa$14$0 = $$$;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38; break L5; break; } default: { HEAP32[$vararg_buffer14>>2] = $fileName; _TraceLog(2,16932,$vararg_buffer14); $image$sroa$0$0 = 0;$image$sroa$12$0 = 1;$image$sroa$14$0 = 0;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38; break L5; } } } else { label = 6; } } else { label = 6; } } else { label = 6; } } while(0); if ((label|0) == 6) { HEAP32[$vararg_buffer1>>2] = $fileName; _TraceLog(2,16815,$vararg_buffer1); $image$sroa$0$0 = 0;$image$sroa$12$0 = 0;$image$sroa$14$0 = 0;$image$sroa$4$0 = 0;$image$sroa$8$0 = 0; } (_fclose($0)|0); $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$14$1 = $image$sroa$14$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$8$1 = $image$sroa$8$0; HEAP32[$agg$result>>2] = $image$sroa$0$1; $58 = ((($agg$result)) + 4|0); HEAP32[$58>>2] = $image$sroa$4$1; $59 = ((($agg$result)) + 8|0); HEAP32[$59>>2] = $image$sroa$8$1; $60 = ((($agg$result)) + 12|0); HEAP32[$60>>2] = $image$sroa$12$1; $61 = ((($agg$result)) + 16|0); HEAP32[$61>>2] = $image$sroa$14$1; STACKTOP = sp;return; } function _LoadOBJ($agg$result,$fileName) { $agg$result = $agg$result|0; $fileName = $fileName|0; var $$byval_copy89 = 0, $$byval_copy90 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0; var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0; var $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0; var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0; var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0; var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0.0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0; var $258 = 0, $259 = 0, $26 = 0, $260 = 0.0, $261 = 0.0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0.0, $274 = 0.0, $275 = 0; var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0; var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0; var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0; var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0; var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $comments = 0, $countNormals$0$ph44 = 0, $countNormals$0$ph841 = 0, $countNormals$0$ph841$lcssa = 0, $countTexCoords$0$ph1140 = 0, $countTexCoords$0$ph1140$lcssa = 0, $countTexCoords$0$ph1140$lcssa221 = 0; var $countTexCoords$0$ph45 = 0, $countTexCoords$0$ph942 = 0, $countVertex$0$ph43 = 0, $dataType = 0, $mesh$sroa$51 = 0, $midNormals$0 = 0, $midTexCoords$0 = 0, $nCounter$0$ph = 0, $nCounter$0$ph$ph = 0, $nCounter$1 = 0, $nCounter$1$lcssa = 0, $norm = 0, $numNormals$0$ph16$lcssa32 = 0, $numNormals$0$ph1674 = 0, $numNormals$0$ph1674$lcssa237 = 0, $numNormals$0$ph86 = 0, $numTexCoords$0$ph1775 = 0, $numTexCoords$0$ph20$lcssa31 = 0, $numTexCoords$0$ph2064 = 0, $numTexCoords$0$ph2064$lcssa232 = 0; var $numTexCoords$0$ph2064$lcssa233 = 0, $numTexCoords$0$ph87 = 0, $numTriangles$0$ph1876 = 0, $numTriangles$0$ph2165 = 0, $numTriangles$0$ph23$lcssa28 = 0, $numTriangles$0$ph2355 = 0, $numTriangles$0$ph2355$lcssa = 0, $numTriangles$0$ph2355$lcssa$lcssa = 0, $numTriangles$0$ph2355$lcssa$lcssa229 = 0, $numTriangles$0$ph88 = 0, $numVertex$0$ph$lcssa = 0, $numVertex$0$ph85 = 0, $or$cond = 0, $tcCounter$0$ph$ph = 0, $useless = 0, $vCounter$0$ph = 0, $vCounter$0$ph$ph = 0, $vNum = 0, $vararg_buffer = 0, $vararg_buffer1 = 0; var $vararg_buffer11 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer29 = 0, $vararg_buffer34 = 0, $vararg_buffer37 = 0, $vararg_buffer4 = 0, $vararg_buffer42 = 0, $vararg_buffer45 = 0, $vararg_buffer50 = 0, $vararg_buffer53 = 0, $vararg_buffer56 = 0, $vararg_buffer59 = 0, $vararg_buffer64 = 0, $vararg_buffer7 = 0, $vararg_buffer72 = 0, $vararg_buffer83 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0, $vararg_ptr18 = 0; var $vararg_ptr22 = 0, $vararg_ptr32 = 0, $vararg_ptr33 = 0, $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr48 = 0, $vararg_ptr49 = 0, $vararg_ptr62 = 0, $vararg_ptr63 = 0, $vararg_ptr67 = 0, $vararg_ptr68 = 0, $vararg_ptr69 = 0, $vararg_ptr70 = 0, $vararg_ptr71 = 0, $vararg_ptr75 = 0, $vararg_ptr76 = 0, $vararg_ptr77 = 0, $vararg_ptr78 = 0, $vararg_ptr79 = 0, $vararg_ptr80 = 0; var $vararg_ptr81 = 0, $vararg_ptr82 = 0, $vnNum = 0, $vtNum = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 608|0; $$byval_copy90 = sp + 304|0; $$byval_copy89 = sp + 288|0; $vararg_buffer83 = sp + 280|0; $vararg_buffer72 = sp + 240|0; $vararg_buffer64 = sp + 216|0; $vararg_buffer59 = sp + 200|0; $vararg_buffer56 = sp + 192|0; $vararg_buffer53 = sp + 184|0; $vararg_buffer50 = sp + 176|0; $vararg_buffer45 = sp + 160|0; $vararg_buffer42 = sp + 152|0; $vararg_buffer37 = sp + 136|0; $vararg_buffer34 = sp + 128|0; $vararg_buffer29 = sp + 112|0; $vararg_buffer26 = sp + 104|0; $vararg_buffer23 = sp + 96|0; $vararg_buffer11 = sp + 88|0; $vararg_buffer7 = sp + 80|0; $vararg_buffer4 = sp + 72|0; $vararg_buffer1 = sp + 64|0; $vararg_buffer = sp + 56|0; $mesh$sroa$51 = sp; $dataType = sp + 592|0; $comments = sp + 392|0; $useless = sp + 388|0; $vNum = sp + 376|0; $vtNum = sp + 364|0; $vnNum = sp + 352|0; $norm = sp + 340|0; $0 = sp + 328|0; $1 = sp + 316|0; dest=$mesh$sroa$51; stop=dest+52|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $2 = (_fopen($fileName,20016)|0); $3 = ($2|0)==(0|0); if ($3) { HEAP32[$vararg_buffer>>2] = $fileName; _TraceLog(2,16452,$vararg_buffer); $6 = ((($agg$result)) + 28|0); ;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0;HEAP32[$agg$result+12>>2]=0|0;HEAP32[$agg$result+16>>2]=0|0;HEAP32[$agg$result+20>>2]=0|0;HEAP32[$agg$result+24>>2]=0|0; dest=$6; src=$mesh$sroa$51; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } $4 = (_feof($2)|0); $5 = ($4|0)==(0); L5: do { if ($5) { $numNormals$0$ph86 = 0;$numTexCoords$0$ph87 = 0;$numTriangles$0$ph88 = 0;$numVertex$0$ph85 = 0; while(1) { $numNormals$0$ph1674 = $numNormals$0$ph86;$numTexCoords$0$ph1775 = $numTexCoords$0$ph87;$numTriangles$0$ph1876 = $numTriangles$0$ph88; L8: while(1) { $numTexCoords$0$ph2064 = $numTexCoords$0$ph1775;$numTriangles$0$ph2165 = $numTriangles$0$ph1876; L10: while(1) { $numTriangles$0$ph2355 = $numTriangles$0$ph2165; L12: while(1) { L14: while(1) { HEAP32[$vararg_buffer1>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer1)|0); $7 = HEAP8[$dataType>>0]|0; $8 = $7 << 24 >> 24; switch ($8|0) { case 118: { $numTriangles$0$ph2355$lcssa = $numTriangles$0$ph2355; break L12; break; } case 102: { break L14; break; } case 117: case 109: case 115: case 103: case 111: case 35: { (_fgets($comments,200,$2)|0); break; } default: { } } $9 = (_feof($2)|0); $10 = ($9|0)==(0); if (!($10)) { $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355;$numVertex$0$ph$lcssa = $numVertex$0$ph85; break L5; } } $21 = (($numTriangles$0$ph2355) + 1)|0; (_fgets($comments,200,$2)|0); $22 = (_feof($2)|0); $23 = ($22|0)==(0); if ($23) { $numTriangles$0$ph2355 = $21; } else { $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064;$numTriangles$0$ph23$lcssa28 = $21;$numVertex$0$ph$lcssa = $numVertex$0$ph85; break L5; } } HEAP32[$vararg_buffer4>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer4)|0); $11 = HEAP8[$dataType>>0]|0; switch ($11<<24>>24) { case 110: { $numTexCoords$0$ph2064$lcssa233 = $numTexCoords$0$ph2064;$numTriangles$0$ph2355$lcssa$lcssa229 = $numTriangles$0$ph2355$lcssa; break L10; break; } case 116: { break; } default: { $numNormals$0$ph1674$lcssa237 = $numNormals$0$ph1674;$numTexCoords$0$ph2064$lcssa232 = $numTexCoords$0$ph2064;$numTriangles$0$ph2355$lcssa$lcssa = $numTriangles$0$ph2355$lcssa; break L8; } } $12 = (($numTexCoords$0$ph2064) + 1)|0; (_fgets($comments,200,$2)|0); $13 = (_feof($2)|0); $14 = ($13|0)==(0); if ($14) { $numTexCoords$0$ph2064 = $12;$numTriangles$0$ph2165 = $numTriangles$0$ph2355$lcssa; } else { $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674;$numTexCoords$0$ph20$lcssa31 = $12;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355$lcssa;$numVertex$0$ph$lcssa = $numVertex$0$ph85; break L5; } } $15 = (($numNormals$0$ph1674) + 1)|0; (_fgets($comments,200,$2)|0); $16 = (_feof($2)|0); $17 = ($16|0)==(0); if ($17) { $numNormals$0$ph1674 = $15;$numTexCoords$0$ph1775 = $numTexCoords$0$ph2064$lcssa233;$numTriangles$0$ph1876 = $numTriangles$0$ph2355$lcssa$lcssa229; } else { $numNormals$0$ph16$lcssa32 = $15;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064$lcssa233;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355$lcssa$lcssa229;$numVertex$0$ph$lcssa = $numVertex$0$ph85; break L5; } } $18 = (($numVertex$0$ph85) + 1)|0; (_fgets($comments,200,$2)|0); $19 = (_feof($2)|0); $20 = ($19|0)==(0); if ($20) { $numNormals$0$ph86 = $numNormals$0$ph1674$lcssa237;$numTexCoords$0$ph87 = $numTexCoords$0$ph2064$lcssa232;$numTriangles$0$ph88 = $numTriangles$0$ph2355$lcssa$lcssa;$numVertex$0$ph85 = $18; } else { $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1674$lcssa237;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2064$lcssa232;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2355$lcssa$lcssa;$numVertex$0$ph$lcssa = $18; break; } } } else { $numNormals$0$ph16$lcssa32 = 0;$numTexCoords$0$ph20$lcssa31 = 0;$numTriangles$0$ph23$lcssa28 = 0;$numVertex$0$ph$lcssa = 0; } } while(0); HEAP32[$vararg_buffer7>>2] = $fileName; $vararg_ptr10 = ((($vararg_buffer7)) + 4|0); HEAP32[$vararg_ptr10>>2] = $numVertex$0$ph$lcssa; _TraceLog(3,16489,$vararg_buffer7); HEAP32[$vararg_buffer11>>2] = $fileName; $vararg_ptr14 = ((($vararg_buffer11)) + 4|0); HEAP32[$vararg_ptr14>>2] = $numTexCoords$0$ph20$lcssa31; _TraceLog(3,16517,$vararg_buffer11); HEAP32[$$byval_copy89>>2] = $fileName; $vararg_ptr18 = ((($$byval_copy89)) + 4|0); HEAP32[$vararg_ptr18>>2] = $numNormals$0$ph16$lcssa32; _TraceLog(3,16546,$$byval_copy89); HEAP32[$$byval_copy90>>2] = $fileName; $vararg_ptr22 = ((($$byval_copy90)) + 4|0); HEAP32[$vararg_ptr22>>2] = $numTriangles$0$ph23$lcssa28; _TraceLog(3,16573,$$byval_copy90); $24 = ($numVertex$0$ph$lcssa*12)|0; $25 = (_malloc($24)|0); $26 = ($numNormals$0$ph16$lcssa32|0)>(0); if ($26) { $27 = ($numNormals$0$ph16$lcssa32*12)|0; $28 = (_malloc($27)|0); $midNormals$0 = $28; } else { $midNormals$0 = 0; } $29 = ($numTexCoords$0$ph20$lcssa31|0)>(0); if ($29) { $30 = $numTexCoords$0$ph20$lcssa31 << 3; $31 = (_malloc($30)|0); $midTexCoords$0 = $31; } else { $midTexCoords$0 = 0; } _rewind($2); $32 = (_feof($2)|0); $33 = ($32|0)==(0); L31: do { if ($33) { $countNormals$0$ph44 = 0;$countTexCoords$0$ph45 = 0;$countVertex$0$ph43 = 0; while(1) { $countNormals$0$ph841 = $countNormals$0$ph44;$countTexCoords$0$ph942 = $countTexCoords$0$ph45; L34: while(1) { $countTexCoords$0$ph1140 = $countTexCoords$0$ph942; L36: while(1) { L38: while(1) { HEAP32[$vararg_buffer23>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer23)|0); $34 = HEAP8[$dataType>>0]|0; $35 = $34 << 24 >> 24; switch ($35|0) { case 118: { break L38; break; } case 102: case 117: case 109: case 115: case 103: case 111: case 35: { (_fgets($comments,200,$2)|0); break; } default: { } } $36 = (_feof($2)|0); $37 = ($36|0)==(0); if (!($37)) { break L31; } } HEAP32[$vararg_buffer26>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer26)|0); $38 = HEAP8[$dataType>>0]|0; switch ($38<<24>>24) { case 110: { $countTexCoords$0$ph1140$lcssa221 = $countTexCoords$0$ph1140; break L36; break; } case 116: { break; } default: { $countNormals$0$ph841$lcssa = $countNormals$0$ph841;$countTexCoords$0$ph1140$lcssa = $countTexCoords$0$ph1140; break L34; } } HEAPF32[$useless>>2] = 0.0; $39 = (($midTexCoords$0) + ($countTexCoords$0$ph1140<<3)|0); $40 = (((($midTexCoords$0) + ($countTexCoords$0$ph1140<<3)|0)) + 4|0); HEAP32[$vararg_buffer29>>2] = $39; $vararg_ptr32 = ((($vararg_buffer29)) + 4|0); HEAP32[$vararg_ptr32>>2] = $40; $vararg_ptr33 = ((($vararg_buffer29)) + 8|0); HEAP32[$vararg_ptr33>>2] = $useless; (_fscanf($2,16602,$vararg_buffer29)|0); $41 = (($countTexCoords$0$ph1140) + 1)|0; HEAP32[$vararg_buffer34>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer34)|0); $42 = (_feof($2)|0); $43 = ($42|0)==(0); if ($43) { $countTexCoords$0$ph1140 = $41; } else { break L31; } } $44 = (($midNormals$0) + (($countNormals$0$ph841*12)|0)|0); $45 = (((($midNormals$0) + (($countNormals$0$ph841*12)|0)|0)) + 4|0); $46 = (((($midNormals$0) + (($countNormals$0$ph841*12)|0)|0)) + 8|0); HEAP32[$vararg_buffer37>>2] = $44; $vararg_ptr40 = ((($vararg_buffer37)) + 4|0); HEAP32[$vararg_ptr40>>2] = $45; $vararg_ptr41 = ((($vararg_buffer37)) + 8|0); HEAP32[$vararg_ptr41>>2] = $46; (_fscanf($2,16602,$vararg_buffer37)|0); $47 = (($countNormals$0$ph841) + 1)|0; HEAP32[$vararg_buffer42>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer42)|0); $48 = (_feof($2)|0); $49 = ($48|0)==(0); if ($49) { $countNormals$0$ph841 = $47;$countTexCoords$0$ph942 = $countTexCoords$0$ph1140$lcssa221; } else { break L31; } } $50 = (($25) + (($countVertex$0$ph43*12)|0)|0); $51 = (((($25) + (($countVertex$0$ph43*12)|0)|0)) + 4|0); $52 = (((($25) + (($countVertex$0$ph43*12)|0)|0)) + 8|0); HEAP32[$vararg_buffer45>>2] = $50; $vararg_ptr48 = ((($vararg_buffer45)) + 4|0); HEAP32[$vararg_ptr48>>2] = $51; $vararg_ptr49 = ((($vararg_buffer45)) + 8|0); HEAP32[$vararg_ptr49>>2] = $52; (_fscanf($2,16602,$vararg_buffer45)|0); $53 = (($countVertex$0$ph43) + 1)|0; HEAP32[$vararg_buffer50>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer50)|0); $54 = (_feof($2)|0); $55 = ($54|0)==(0); if ($55) { $countNormals$0$ph44 = $countNormals$0$ph841$lcssa;$countTexCoords$0$ph45 = $countTexCoords$0$ph1140$lcssa;$countVertex$0$ph43 = $53; } else { break; } } } } while(0); $56 = ($numTriangles$0$ph23$lcssa28*3)|0; $57 = ($numTriangles$0$ph23$lcssa28*36)|0; $58 = (_malloc($57)|0); $59 = ($numTriangles$0$ph23$lcssa28*6)|0; $60 = ($numTriangles$0$ph23$lcssa28*24)|0; $61 = (_malloc($60)|0); $62 = (_malloc($57)|0); $63 = ($numTriangles$0$ph23$lcssa28*12)|0; $64 = (_malloc($63)|0); _rewind($2); $65 = ($numNormals$0$ph16$lcssa32|0)==(0); if ($65) { HEAP32[$vararg_buffer53>>2] = $fileName; _TraceLog(0,16611,$vararg_buffer53); } $66 = $numTexCoords$0$ph20$lcssa31 | $numNormals$0$ph16$lcssa32; $67 = ($66|0)==(0); $68 = ((($vNum)) + 4|0); $69 = ((($vNum)) + 8|0); $70 = ((($vNum)) + 4|0); $71 = ((($vNum)) + 8|0); $72 = ((($vnNum)) + 4|0); $73 = ((($vnNum)) + 8|0); $74 = ((($norm)) + 4|0); $75 = ((($norm)) + 8|0); $76 = ((($vNum)) + 4|0); $77 = ((($vtNum)) + 4|0); $78 = ((($vNum)) + 8|0); $79 = ((($vtNum)) + 8|0); $80 = ((($vNum)) + 4|0); $81 = ((($vtNum)) + 4|0); $82 = ((($vnNum)) + 4|0); $83 = ((($vNum)) + 8|0); $84 = ((($vtNum)) + 8|0); $85 = ((($vnNum)) + 8|0); $86 = ((($vtNum)) + 4|0); $87 = ((($vtNum)) + 8|0); $nCounter$0$ph$ph = 0;$tcCounter$0$ph$ph = 0;$vCounter$0$ph$ph = 0; L51: while(1) { $nCounter$0$ph = $nCounter$0$ph$ph;$vCounter$0$ph = $vCounter$0$ph$ph; while(1) { $88 = (_feof($2)|0); $89 = ($88|0)==(0); if (!($89)) { break L51; } L55: while(1) { HEAP32[$vararg_buffer56>>2] = $dataType; (_fscanf($2,16486,$vararg_buffer56)|0); $90 = HEAP8[$dataType>>0]|0; $91 = $90 << 24 >> 24; switch ($91|0) { case 102: { break L55; break; } case 118: case 117: case 109: case 115: case 103: case 111: case 35: { (_fgets($comments,200,$2)|0); break; } default: { } } $92 = (_feof($2)|0); $93 = ($92|0)==(0); if (!($93)) { break L51; } } do { if ($67) { HEAP32[$vararg_buffer59>>2] = $vNum; $vararg_ptr62 = ((($vararg_buffer59)) + 4|0); HEAP32[$vararg_ptr62>>2] = $68; $vararg_ptr63 = ((($vararg_buffer59)) + 8|0); HEAP32[$vararg_ptr63>>2] = $69; (_fscanf($2,16682,$vararg_buffer59)|0); } else { if ($65) { HEAP32[$vararg_buffer64>>2] = $vNum; $vararg_ptr67 = ((($vararg_buffer64)) + 4|0); HEAP32[$vararg_ptr67>>2] = $vtNum; $vararg_ptr68 = ((($vararg_buffer64)) + 8|0); HEAP32[$vararg_ptr68>>2] = $76; $vararg_ptr69 = ((($vararg_buffer64)) + 12|0); HEAP32[$vararg_ptr69>>2] = $77; $vararg_ptr70 = ((($vararg_buffer64)) + 16|0); HEAP32[$vararg_ptr70>>2] = $78; $vararg_ptr71 = ((($vararg_buffer64)) + 20|0); HEAP32[$vararg_ptr71>>2] = $79; (_fscanf($2,16691,$vararg_buffer64)|0); break; } else { HEAP32[$vararg_buffer72>>2] = $vNum; $vararg_ptr75 = ((($vararg_buffer72)) + 4|0); HEAP32[$vararg_ptr75>>2] = $vtNum; $vararg_ptr76 = ((($vararg_buffer72)) + 8|0); HEAP32[$vararg_ptr76>>2] = $vnNum; $vararg_ptr77 = ((($vararg_buffer72)) + 12|0); HEAP32[$vararg_ptr77>>2] = $80; $vararg_ptr78 = ((($vararg_buffer72)) + 16|0); HEAP32[$vararg_ptr78>>2] = $81; $vararg_ptr79 = ((($vararg_buffer72)) + 20|0); HEAP32[$vararg_ptr79>>2] = $82; $vararg_ptr80 = ((($vararg_buffer72)) + 24|0); HEAP32[$vararg_ptr80>>2] = $83; $vararg_ptr81 = ((($vararg_buffer72)) + 28|0); HEAP32[$vararg_ptr81>>2] = $84; $vararg_ptr82 = ((($vararg_buffer72)) + 32|0); HEAP32[$vararg_ptr82>>2] = $85; (_fscanf($2,16709,$vararg_buffer72)|0); break; } } } while(0); $94 = HEAP32[$vNum>>2]|0; $95 = (($94) + -1)|0; $96 = (($25) + (($95*12)|0)|0); $97 = HEAP32[$96>>2]|0; $98 = (($58) + ($vCounter$0$ph<<2)|0); HEAP32[$98>>2] = $97; $99 = HEAP32[$vNum>>2]|0; $100 = (($99) + -1)|0; $101 = (((($25) + (($100*12)|0)|0)) + 4|0); $102 = HEAP32[$101>>2]|0; $103 = (($vCounter$0$ph) + 1)|0; $104 = (($58) + ($103<<2)|0); HEAP32[$104>>2] = $102; $105 = HEAP32[$vNum>>2]|0; $106 = (($105) + -1)|0; $107 = (((($25) + (($106*12)|0)|0)) + 8|0); $108 = HEAP32[$107>>2]|0; $109 = (($vCounter$0$ph) + 2)|0; $110 = (($58) + ($109<<2)|0); HEAP32[$110>>2] = $108; $111 = (($vCounter$0$ph) + 3)|0; $112 = HEAP32[$70>>2]|0; $113 = (($112) + -1)|0; $114 = (($25) + (($113*12)|0)|0); $115 = HEAP32[$114>>2]|0; $116 = (($58) + ($111<<2)|0); HEAP32[$116>>2] = $115; $117 = HEAP32[$70>>2]|0; $118 = (($117) + -1)|0; $119 = (((($25) + (($118*12)|0)|0)) + 4|0); $120 = HEAP32[$119>>2]|0; $121 = (($vCounter$0$ph) + 4)|0; $122 = (($58) + ($121<<2)|0); HEAP32[$122>>2] = $120; $123 = HEAP32[$70>>2]|0; $124 = (($123) + -1)|0; $125 = (((($25) + (($124*12)|0)|0)) + 8|0); $126 = HEAP32[$125>>2]|0; $127 = (($vCounter$0$ph) + 5)|0; $128 = (($58) + ($127<<2)|0); HEAP32[$128>>2] = $126; $129 = (($vCounter$0$ph) + 6)|0; $130 = HEAP32[$71>>2]|0; $131 = (($130) + -1)|0; $132 = (($25) + (($131*12)|0)|0); $133 = HEAP32[$132>>2]|0; $134 = (($58) + ($129<<2)|0); HEAP32[$134>>2] = $133; $135 = HEAP32[$71>>2]|0; $136 = (($135) + -1)|0; $137 = (((($25) + (($136*12)|0)|0)) + 4|0); $138 = HEAP32[$137>>2]|0; $139 = (($vCounter$0$ph) + 7)|0; $140 = (($58) + ($139<<2)|0); HEAP32[$140>>2] = $138; $141 = HEAP32[$71>>2]|0; $142 = (($141) + -1)|0; $143 = (((($25) + (($142*12)|0)|0)) + 8|0); $144 = HEAP32[$143>>2]|0; $145 = (($vCounter$0$ph) + 8)|0; $146 = (($58) + ($145<<2)|0); HEAP32[$146>>2] = $144; $147 = (($vCounter$0$ph) + 9)|0; if ($26) { $148 = HEAP32[$vnNum>>2]|0; $149 = (($148) + -1)|0; $150 = (($midNormals$0) + (($149*12)|0)|0); $151 = HEAP32[$150>>2]|0; $152 = (($62) + ($nCounter$0$ph<<2)|0); HEAP32[$152>>2] = $151; $153 = HEAP32[$vnNum>>2]|0; $154 = (($153) + -1)|0; $155 = (((($midNormals$0) + (($154*12)|0)|0)) + 4|0); $156 = HEAP32[$155>>2]|0; $157 = (($nCounter$0$ph) + 1)|0; $158 = (($62) + ($157<<2)|0); HEAP32[$158>>2] = $156; $159 = HEAP32[$vnNum>>2]|0; $160 = (($159) + -1)|0; $161 = (((($midNormals$0) + (($160*12)|0)|0)) + 8|0); $162 = HEAP32[$161>>2]|0; $163 = (($nCounter$0$ph) + 2)|0; $164 = (($62) + ($163<<2)|0); HEAP32[$164>>2] = $162; $165 = (($nCounter$0$ph) + 3)|0; $166 = HEAP32[$72>>2]|0; $167 = (($166) + -1)|0; $168 = (($midNormals$0) + (($167*12)|0)|0); $169 = HEAP32[$168>>2]|0; $170 = (($62) + ($165<<2)|0); HEAP32[$170>>2] = $169; $171 = HEAP32[$72>>2]|0; $172 = (($171) + -1)|0; $173 = (((($midNormals$0) + (($172*12)|0)|0)) + 4|0); $174 = HEAP32[$173>>2]|0; $175 = (($nCounter$0$ph) + 4)|0; $176 = (($62) + ($175<<2)|0); HEAP32[$176>>2] = $174; $177 = HEAP32[$72>>2]|0; $178 = (($177) + -1)|0; $179 = (((($midNormals$0) + (($178*12)|0)|0)) + 8|0); $180 = HEAP32[$179>>2]|0; $181 = (($nCounter$0$ph) + 5)|0; $182 = (($62) + ($181<<2)|0); HEAP32[$182>>2] = $180; $183 = (($nCounter$0$ph) + 6)|0; $184 = HEAP32[$73>>2]|0; $185 = (($184) + -1)|0; $186 = (($midNormals$0) + (($185*12)|0)|0); $187 = HEAP32[$186>>2]|0; $188 = (($62) + ($183<<2)|0); HEAP32[$188>>2] = $187; $189 = HEAP32[$73>>2]|0; $190 = (($189) + -1)|0; $191 = (((($midNormals$0) + (($190*12)|0)|0)) + 4|0); $192 = HEAP32[$191>>2]|0; $193 = (($nCounter$0$ph) + 7)|0; $194 = (($62) + ($193<<2)|0); HEAP32[$194>>2] = $192; $195 = HEAP32[$73>>2]|0; $196 = (($195) + -1)|0; $197 = (((($midNormals$0) + (($196*12)|0)|0)) + 8|0); $198 = HEAP32[$197>>2]|0; $199 = (($nCounter$0$ph) + 8)|0; $200 = (($62) + ($199<<2)|0); HEAP32[$200>>2] = $198; } else { $201 = HEAP32[$70>>2]|0; $202 = (($201) + -1)|0; $203 = (($25) + (($202*12)|0)|0); $204 = HEAP32[$vNum>>2]|0; $205 = (($204) + -1)|0; $206 = (($25) + (($205*12)|0)|0); ;HEAP32[$$byval_copy89>>2]=HEAP32[$203>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$203+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$203+8>>2]|0; ;HEAP32[$$byval_copy90>>2]=HEAP32[$206>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$206+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$206+8>>2]|0; _VectorSubtract($0,$$byval_copy89,$$byval_copy90); $207 = HEAP32[$71>>2]|0; $208 = (($207) + -1)|0; $209 = (($25) + (($208*12)|0)|0); $210 = HEAP32[$vNum>>2]|0; $211 = (($210) + -1)|0; $212 = (($25) + (($211*12)|0)|0); ;HEAP32[$$byval_copy89>>2]=HEAP32[$209>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$209+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$209+8>>2]|0; ;HEAP32[$$byval_copy90>>2]=HEAP32[$212>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$212+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$212+8>>2]|0; _VectorSubtract($1,$$byval_copy89,$$byval_copy90); ;HEAP32[$$byval_copy89>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$0+8>>2]|0; ;HEAP32[$$byval_copy90>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$1+8>>2]|0; _VectorCrossProduct($norm,$$byval_copy89,$$byval_copy90); _VectorNormalize($norm); $213 = HEAP32[$norm>>2]|0; $214 = (($62) + ($nCounter$0$ph<<2)|0); HEAP32[$214>>2] = $213; $215 = HEAP32[$74>>2]|0; $216 = (($nCounter$0$ph) + 1)|0; $217 = (($62) + ($216<<2)|0); HEAP32[$217>>2] = $215; $218 = HEAP32[$75>>2]|0; $219 = (($nCounter$0$ph) + 2)|0; $220 = (($62) + ($219<<2)|0); HEAP32[$220>>2] = $218; $221 = (($nCounter$0$ph) + 3)|0; $222 = HEAP32[$norm>>2]|0; $223 = (($62) + ($221<<2)|0); HEAP32[$223>>2] = $222; $224 = HEAP32[$74>>2]|0; $225 = (($nCounter$0$ph) + 4)|0; $226 = (($62) + ($225<<2)|0); HEAP32[$226>>2] = $224; $227 = HEAP32[$75>>2]|0; $228 = (($nCounter$0$ph) + 5)|0; $229 = (($62) + ($228<<2)|0); HEAP32[$229>>2] = $227; $230 = (($nCounter$0$ph) + 6)|0; $231 = HEAP32[$norm>>2]|0; $232 = (($62) + ($230<<2)|0); HEAP32[$232>>2] = $231; $233 = HEAP32[$74>>2]|0; $234 = (($nCounter$0$ph) + 7)|0; $235 = (($62) + ($234<<2)|0); HEAP32[$235>>2] = $233; $236 = HEAP32[$75>>2]|0; $237 = (($nCounter$0$ph) + 8)|0; $238 = (($62) + ($237<<2)|0); HEAP32[$238>>2] = $236; } $nCounter$1 = (($nCounter$0$ph) + 9)|0; if ($29) { $$lcssa = $147;$nCounter$1$lcssa = $nCounter$1; break; } else { $nCounter$0$ph = $nCounter$1;$vCounter$0$ph = $147; } } $239 = HEAP32[$vtNum>>2]|0; $240 = (($239) + -1)|0; $241 = (($midTexCoords$0) + ($240<<3)|0); $242 = HEAP32[$241>>2]|0; $243 = (($61) + ($tcCounter$0$ph$ph<<2)|0); HEAP32[$243>>2] = $242; $244 = HEAP32[$vtNum>>2]|0; $245 = (($244) + -1)|0; $246 = (((($midTexCoords$0) + ($245<<3)|0)) + 4|0); $247 = +HEAPF32[$246>>2]; $248 = 1.0 - $247; $249 = $tcCounter$0$ph$ph | 1; $250 = (($61) + ($249<<2)|0); HEAPF32[$250>>2] = $248; $251 = (($tcCounter$0$ph$ph) + 2)|0; $252 = HEAP32[$86>>2]|0; $253 = (($252) + -1)|0; $254 = (($midTexCoords$0) + ($253<<3)|0); $255 = HEAP32[$254>>2]|0; $256 = (($61) + ($251<<2)|0); HEAP32[$256>>2] = $255; $257 = HEAP32[$86>>2]|0; $258 = (($257) + -1)|0; $259 = (((($midTexCoords$0) + ($258<<3)|0)) + 4|0); $260 = +HEAPF32[$259>>2]; $261 = 1.0 - $260; $262 = (($tcCounter$0$ph$ph) + 3)|0; $263 = (($61) + ($262<<2)|0); HEAPF32[$263>>2] = $261; $264 = (($tcCounter$0$ph$ph) + 4)|0; $265 = HEAP32[$87>>2]|0; $266 = (($265) + -1)|0; $267 = (($midTexCoords$0) + ($266<<3)|0); $268 = HEAP32[$267>>2]|0; $269 = (($61) + ($264<<2)|0); HEAP32[$269>>2] = $268; $270 = HEAP32[$87>>2]|0; $271 = (($270) + -1)|0; $272 = (((($midTexCoords$0) + ($271<<3)|0)) + 4|0); $273 = +HEAPF32[$272>>2]; $274 = 1.0 - $273; $275 = (($tcCounter$0$ph$ph) + 5)|0; $276 = (($61) + ($275<<2)|0); HEAPF32[$276>>2] = $274; $277 = (($tcCounter$0$ph$ph) + 6)|0; $nCounter$0$ph$ph = $nCounter$1$lcssa;$tcCounter$0$ph$ph = $277;$vCounter$0$ph$ph = $$lcssa; } (_fclose($2)|0); $278 = ($numTexCoords$0$ph20$lcssa31|0)==(0); $279 = ($59|0)>(0); $or$cond = $278 & $279; if ($or$cond) { $280 = ($numTriangles$0$ph23$lcssa28*24)|0; _memset(($61|0),0,($280|0))|0; } $281 = ($63|0)>(0); if ($281) { $282 = ($numTriangles$0$ph23$lcssa28*12)|0; _memset(($64|0),-1,($282|0))|0; } _free($25); _free($midNormals$0); _free($midTexCoords$0); HEAP32[$vararg_buffer83>>2] = $fileName; _TraceLog(0,16736,$vararg_buffer83); HEAP32[$agg$result>>2] = $56; $283 = ((($agg$result)) + 4|0); HEAP32[$283>>2] = $58; $284 = ((($agg$result)) + 8|0); HEAP32[$284>>2] = $61; $285 = ((($agg$result)) + 12|0); HEAP32[$285>>2] = 0; $286 = ((($agg$result)) + 16|0); HEAP32[$286>>2] = $62; $287 = ((($agg$result)) + 20|0); HEAP32[$287>>2] = 0; $288 = ((($agg$result)) + 24|0); HEAP32[$288>>2] = $64; $289 = ((($agg$result)) + 28|0); dest=$289; src=$mesh$sroa$51; stop=dest+52|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _EmptyMusicStream() { var $$pr = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $buffer = 0, $queued = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $buffer = sp + 4|0; $queued = sp; HEAP32[$buffer>>2] = 0; HEAP32[$queued>>2] = 0; $0 = HEAP32[(5756)>>2]|0; _alGetSourcei(($0|0),4117,($queued|0)); $$pr = HEAP32[$queued>>2]|0; $1 = ($$pr|0)>(0); if (!($1)) { STACKTOP = sp;return; } while(1) { $2 = HEAP32[(5756)>>2]|0; _alSourceUnqueueBuffers(($2|0),1,($buffer|0)); $3 = HEAP32[$queued>>2]|0; $4 = (($3) + -1)|0; HEAP32[$queued>>2] = $4; $5 = ($3|0)>(1); if (!($5)) { break; } } STACKTOP = sp;return; } function _BufferMusicStream($buffer) { $buffer = $buffer|0; var $$old1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $active$0 = 0, $pcm = 0; var $size$0 = 0, $size$0$lcssa = 0, $size$12 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 65552|0; $vararg_buffer = sp; $pcm = sp + 8|0; $0 = HEAP32[5740>>2]|0; $1 = ($0|0)==(0); do { if (!($1)) { $size$0 = 0; while(1) { $2 = HEAP32[5744>>2]|0; $3 = HEAP32[(5764)>>2]|0; $4 = (($pcm) + ($size$0<<1)|0); $5 = (32768 - ($size$0))|0; $6 = (_stb_vorbis_get_samples_short_interleaved($2,$3,$4,$5)|0); $7 = ($6|0)>(0); if (!($7)) { $size$0$lcssa = $size$0; label = 4; break; } $8 = HEAP32[(5764)>>2]|0; $9 = Math_imul($8, $6)|0; $10 = (($9) + ($size$0))|0; $$old1 = ($10|0)<(32768); if ($$old1) { $size$0 = $10; } else { $size$12 = $10; break; } } if ((label|0) == 4) { $11 = ($size$0$lcssa|0)>(0); if ($11) { $size$12 = $size$0$lcssa; } else { break; } } $12 = HEAP32[(5760)>>2]|0; $13 = $size$12 << 1; $14 = HEAP32[(5768)>>2]|0; _alBufferData(($buffer|0),($12|0),($pcm|0),($13|0),($14|0)); $15 = HEAP32[(5772)>>2]|0; $16 = (($15) - ($size$12))|0; HEAP32[(5772)>>2] = $16; $active$0 = 1; STACKTOP = sp;return ($active$0|0); } } while(0); _TraceLog(2,16418,$vararg_buffer); $active$0 = 0; STACKTOP = sp;return ($active$0|0); } function _vorbis_deinit($p) { $p = $p|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $12 = 0, $13 = 0, $14 = 0; var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0; var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0; var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0; var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0; var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i$016 = 0, $i$110 = 0, $i$28 = 0, $i$37 = 0, $j$013 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($p)) + 396|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if (!($2)) { $3 = ((($p)) + 264|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)>(0); if ($5) { $6 = ((($p)) + 124|0); $i$016 = 0; while(1) { $7 = HEAP32[$0>>2]|0; $8 = (((($7) + (($i$016*24)|0)|0)) + 16|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)==(0|0); if (!($10)) { $11 = (((($7) + (($i$016*24)|0)|0)) + 13|0); $12 = HEAP8[$11>>0]|0; $13 = $12&255; $14 = HEAP32[$6>>2]|0; $15 = (((($14) + (($13*2096)|0)|0)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)>(0); if ($17) { $j$013 = 0; while(1) { $18 = HEAP32[$8>>2]|0; $19 = (($18) + ($j$013<<2)|0); $20 = HEAP32[$19>>2]|0; _setup_free($p,$20); $21 = (($j$013) + 1)|0; $22 = HEAP8[$11>>0]|0; $23 = $22&255; $24 = HEAP32[$6>>2]|0; $25 = (((($24) + (($23*2096)|0)|0)) + 4|0); $26 = HEAP32[$25>>2]|0; $27 = ($21|0)<($26|0); if ($27) { $j$013 = $21; } else { break; } } } $28 = HEAP32[$8>>2]|0; _setup_free($p,$28); } $29 = (((($7) + (($i$016*24)|0)|0)) + 20|0); $30 = HEAP32[$29>>2]|0; _setup_free($p,$30); $31 = (($i$016) + 1)|0; $32 = HEAP32[$3>>2]|0; $33 = ($31|0)<($32|0); if ($33) { $i$016 = $31; } else { break; } } } } $34 = ((($p)) + 124|0); $35 = HEAP32[$34>>2]|0; $36 = ($35|0)==(0|0); if (!($36)) { $37 = ((($p)) + 120|0); $38 = HEAP32[$37>>2]|0; $39 = ($38|0)>(0); if ($39) { $i$110 = 0; while(1) { $40 = HEAP32[$34>>2]|0; $41 = (((($40) + (($i$110*2096)|0)|0)) + 8|0); $42 = HEAP32[$41>>2]|0; _setup_free($p,$42); $43 = (((($40) + (($i$110*2096)|0)|0)) + 28|0); $44 = HEAP32[$43>>2]|0; _setup_free($p,$44); $45 = (((($40) + (($i$110*2096)|0)|0)) + 32|0); $46 = HEAP32[$45>>2]|0; _setup_free($p,$46); $47 = (((($40) + (($i$110*2096)|0)|0)) + 2084|0); $48 = HEAP32[$47>>2]|0; _setup_free($p,$48); $49 = (((($40) + (($i$110*2096)|0)|0)) + 2088|0); $50 = HEAP32[$49>>2]|0; $51 = ($50|0)==(0|0); $52 = ((($50)) + -4|0); $53 = $51 ? 0 : $52; _setup_free($p,$53); $54 = (($i$110) + 1)|0; $55 = HEAP32[$37>>2]|0; $56 = ($54|0)<($55|0); if ($56) { $i$110 = $54; } else { break; } } } $57 = HEAP32[$34>>2]|0; _setup_free($p,$57); } $58 = ((($p)) + 260|0); $59 = HEAP32[$58>>2]|0; _setup_free($p,$59); $60 = HEAP32[$0>>2]|0; _setup_free($p,$60); $61 = ((($p)) + 404|0); $62 = HEAP32[$61>>2]|0; $63 = ($62|0)==(0|0); if (!($63)) { $64 = ((($p)) + 400|0); $65 = HEAP32[$64>>2]|0; $66 = ($65|0)>(0); if ($66) { $i$28 = 0; while(1) { $67 = HEAP32[$61>>2]|0; $68 = (((($67) + (($i$28*40)|0)|0)) + 4|0); $69 = HEAP32[$68>>2]|0; _setup_free($p,$69); $70 = (($i$28) + 1)|0; $71 = HEAP32[$64>>2]|0; $72 = ($70|0)<($71|0); if ($72) { $i$28 = $70; } else { break; } } } $73 = HEAP32[$61>>2]|0; _setup_free($p,$73); } $74 = ((($p)) + 4|0); $75 = HEAP32[$74>>2]|0; $76 = ($75|0)>(0); if ($76) { $i$37 = 0; while(1) { $77 = (((($p)) + 800|0) + ($i$37<<2)|0); $78 = HEAP32[$77>>2]|0; _setup_free($p,$78); $79 = (((($p)) + 928|0) + ($i$37<<2)|0); $80 = HEAP32[$79>>2]|0; _setup_free($p,$80); $81 = (((($p)) + 996|0) + ($i$37<<2)|0); $82 = HEAP32[$81>>2]|0; _setup_free($p,$82); $83 = (($i$37) + 1)|0; $84 = HEAP32[$74>>2]|0; $85 = ($83|0)<($84|0); $86 = ($83|0)<(16); $87 = $86 & $85; if ($87) { $i$37 = $83; } else { break; } } } $88 = ((($p)) + 1068|0); $89 = HEAP32[$88>>2]|0; _setup_free($p,$89); $90 = ((($p)) + 1076|0); $91 = HEAP32[$90>>2]|0; _setup_free($p,$91); $92 = ((($p)) + 1084|0); $93 = HEAP32[$92>>2]|0; _setup_free($p,$93); $94 = ((($p)) + 1092|0); $95 = HEAP32[$94>>2]|0; _setup_free($p,$95); $96 = ((($p)) + 1100|0); $97 = HEAP32[$96>>2]|0; _setup_free($p,$97); $98 = ((($p)) + 1072|0); $99 = HEAP32[$98>>2]|0; _setup_free($p,$99); $100 = ((($p)) + 1080|0); $101 = HEAP32[$100>>2]|0; _setup_free($p,$101); $102 = ((($p)) + 1088|0); $103 = HEAP32[$102>>2]|0; _setup_free($p,$103); $104 = ((($p)) + 1096|0); $105 = HEAP32[$104>>2]|0; _setup_free($p,$105); $106 = ((($p)) + 1104|0); $107 = HEAP32[$106>>2]|0; _setup_free($p,$107); $108 = ((($p)) + 28|0); $109 = HEAP32[$108>>2]|0; $110 = ($109|0)==(0); if ($110) { return; } $111 = ((($p)) + 20|0); $112 = HEAP32[$111>>2]|0; (_fclose($112)|0); return; } function _setup_free($f,$p) { $f = $f|0; $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 80|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if (!($2)) { return; } _free($p); return; } function _error($f,$e) { $f = $f|0; $e = $e|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 100|0); HEAP32[$0>>2] = $e; return; } function _is_whole_packet_present($f,$end_page) { $f = $f|0; $end_page = $end_page|0; var $$0 = 0, $$s$0 = 0, $$s$3 = 0, $$sum = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0; var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, $first$0 = 0, $first$0$ph = 0, $or$cond = 0, $p$011 = 0, $p$1 = 0, $p$2 = 0, $p$2$ph = 0, $p$35 = 0, $p$4 = 0; var $s$0$lcssa = 0, $s$012 = 0, $s$2 = 0, $s$2$ph = 0, $s$3$lcssa = 0, $s$36 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1380|0); $1 = HEAP32[$0>>2]|0; $2 = ((($f)) + 32|0); $3 = HEAP32[$2>>2]|0; $4 = ($1|0)==(-1); if ($4) { $first$0$ph = 1;$p$2$ph = $3;$s$2$ph = -1; } else { $5 = ((($f)) + 1116|0); $6 = HEAP32[$5>>2]|0; $7 = ($1|0)<($6|0); L3: do { if ($7) { $p$011 = $3;$s$012 = $1; while(1) { $8 = (((($f)) + 1120|0) + ($s$012)|0); $9 = HEAP8[$8>>0]|0; $10 = $9&255; $11 = (($p$011) + ($10)|0); $12 = ($9<<24>>24)==(-1); if (!($12)) { $p$1 = $11;$s$0$lcssa = $s$012; break L3; } $13 = (($s$012) + 1)|0; $14 = HEAP32[$5>>2]|0; $15 = ($13|0)<($14|0); if ($15) { $p$011 = $11;$s$012 = $13; } else { $p$1 = $11;$s$0$lcssa = $13; break; } } } else { $p$1 = $3;$s$0$lcssa = $1; } } while(0); $16 = ($end_page|0)==(0); if (!($16)) { $17 = HEAP32[$5>>2]|0; $18 = (($17) + -1)|0; $19 = ($s$0$lcssa|0)<($18|0); if ($19) { _error($f,21); $$0 = 0; return ($$0|0); } } $20 = HEAP32[$5>>2]|0; $21 = ($s$0$lcssa|0)==($20|0); $$s$0 = $21 ? -1 : $s$0$lcssa; $22 = ((($f)) + 40|0); $23 = HEAP32[$22>>2]|0; $24 = ($p$1>>>0)>($23>>>0); if ($24) { _error($f,1); $$0 = 0; return ($$0|0); } else { $first$0$ph = 0;$p$2$ph = $p$1;$s$2$ph = $$s$0; } } $25 = ((($f)) + 40|0); $26 = ($end_page|0)!=(0); $27 = ((($f)) + 992|0); $first$0 = $first$0$ph;$p$2 = $p$2$ph;$s$2 = $s$2$ph; while(1) { $28 = ($s$2|0)==(-1); if (!($28)) { $$0 = 1; label = 33; break; } $29 = ((($p$2)) + 26|0); $30 = HEAP32[$25>>2]|0; $31 = ($29>>>0)<($30>>>0); if (!($31)) { label = 13; break; } $32 = (_memcmp($p$2,5820,4)|0); $33 = ($32|0)==(0); if (!($33)) { label = 15; break; } $34 = ((($p$2)) + 4|0); $35 = HEAP8[$34>>0]|0; $36 = ($35<<24>>24)==(0); if (!($36)) { label = 17; break; } $37 = ($first$0|0)==(0); if ($37) { $44 = ((($p$2)) + 5|0); $45 = HEAP8[$44>>0]|0; $46 = $45 & 1; $47 = ($46<<24>>24)==(0); if ($47) { label = 23; break; } } else { $38 = HEAP32[$27>>2]|0; $39 = ($38|0)==(0); if (!($39)) { $40 = ((($p$2)) + 5|0); $41 = HEAP8[$40>>0]|0; $42 = $41 & 1; $43 = ($42<<24>>24)==(0); if (!($43)) { label = 21; break; } } } $48 = HEAP8[$29>>0]|0; $49 = $48&255; $$sum = (($49) + 27)|0; $50 = (($p$2) + ($$sum)|0); $51 = HEAP32[$25>>2]|0; $52 = ($50>>>0)>($51>>>0); if ($52) { label = 26; break; } $53 = ($48<<24>>24)==(0); L28: do { if ($53) { $p$4 = $50;$s$3$lcssa = 0; } else { $p$35 = $50;$s$36 = 0; while(1) { $$sum1 = (($s$36) + 27)|0; $54 = (($p$2) + ($$sum1)|0); $55 = HEAP8[$54>>0]|0; $56 = $55&255; $57 = (($p$35) + ($56)|0); $58 = ($55<<24>>24)==(-1); if (!($58)) { $p$4 = $57;$s$3$lcssa = $s$36; break L28; } $59 = (($s$36) + 1)|0; $60 = ($59|0)<($49|0); if ($60) { $p$35 = $57;$s$36 = $59; } else { $p$4 = $57;$s$3$lcssa = $59; break; } } } } while(0); $61 = (($49) + -1)|0; $62 = ($s$3$lcssa|0)<($61|0); $or$cond = $26 & $62; if ($or$cond) { label = 30; break; } $63 = ($s$3$lcssa|0)==($49|0); $$s$3 = $63 ? -1 : $s$3$lcssa; $64 = HEAP32[$25>>2]|0; $65 = ($p$4>>>0)>($64>>>0); if ($65) { label = 32; break; } else { $first$0 = 0;$p$2 = $p$4;$s$2 = $$s$3; } } if ((label|0) == 13) { _error($f,1); $$0 = 0; return ($$0|0); } else if ((label|0) == 15) { _error($f,21); $$0 = 0; return ($$0|0); } else if ((label|0) == 17) { _error($f,21); $$0 = 0; return ($$0|0); } else if ((label|0) == 21) { _error($f,21); $$0 = 0; return ($$0|0); } else if ((label|0) == 23) { _error($f,21); $$0 = 0; return ($$0|0); } else if ((label|0) == 26) { _error($f,1); $$0 = 0; return ($$0|0); } else if ((label|0) == 30) { _error($f,21); $$0 = 0; return ($$0|0); } else if ((label|0) == 32) { _error($f,1); $$0 = 0; return ($$0|0); } else if ((label|0) == 33) { return ($$0|0); } return (0)|0; } function _vorbis_decode_packet($f,$len,$p_left,$p_right) { $f = $f|0; $len = $len|0; $p_left = $p_left|0; $p_right = $p_right|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $left_end = 0, $mode = 0, $right_end = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $mode = sp + 8|0; $left_end = sp + 4|0; $right_end = sp; $0 = (_vorbis_decode_initial($f,$p_left,$left_end,$p_right,$right_end,$mode)|0); $1 = ($0|0)==(0); if ($1) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $2 = HEAP32[$mode>>2]|0; $3 = (((($f)) + 412|0) + (($2*6)|0)|0); $4 = HEAP32[$p_left>>2]|0; $5 = HEAP32[$p_right>>2]|0; $6 = HEAP32[$right_end>>2]|0; $7 = (_vorbis_decode_packet_rest($f,$len,$3,$4,$5,$6,$p_left)|0); $$0 = $7; STACKTOP = sp;return ($$0|0); } function _get8_packet($f) { $f = $f|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_get8_packet_raw($f)|0); $1 = ((($f)) + 1396|0); HEAP32[$1>>2] = 0; return ($0|0); } function _vorbis_finish_frame($f,$len,$left,$right) { $f = $f|0; $len = $len|0; $left = $left|0; $right = $right|0; var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0; var $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond10 = 0; var $i$04 = 0, $i1$09 = 0, $j$03 = 0, $j2$06 = 0, $len$right = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 992|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { $49 = 0; } else { $3 = (_get_window($f,$1)|0); $4 = ((($f)) + 4|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)>(0); if ($6) { $7 = ($1|0)>(0); $8 = HEAP32[$4>>2]|0; $9 = (($1) + -1)|0; $i1$09 = 0; while(1) { if ($7) { $10 = (((($f)) + 800|0) + ($i1$09<<2)|0); $11 = HEAP32[$10>>2]|0; $12 = (((($f)) + 928|0) + ($i1$09<<2)|0); $13 = HEAP32[$12>>2]|0; $j2$06 = 0; while(1) { $14 = (($j2$06) + ($left))|0; $15 = (($11) + ($14<<2)|0); $16 = +HEAPF32[$15>>2]; $17 = (($3) + ($j2$06<<2)|0); $18 = +HEAPF32[$17>>2]; $19 = $16 * $18; $20 = (($13) + ($j2$06<<2)|0); $21 = +HEAPF32[$20>>2]; $22 = (($9) - ($j2$06))|0; $23 = (($3) + ($22<<2)|0); $24 = +HEAPF32[$23>>2]; $25 = $21 * $24; $26 = $19 + $25; HEAPF32[$15>>2] = $26; $27 = (($j2$06) + 1)|0; $exitcond10 = ($27|0)==($1|0); if ($exitcond10) { break; } else { $j2$06 = $27; } } } $28 = (($i1$09) + 1)|0; $29 = ($28|0)<($8|0); if ($29) { $i1$09 = $28; } else { break; } } } $$pr = HEAP32[$0>>2]|0; $49 = $$pr; } $30 = (($len) - ($right))|0; HEAP32[$0>>2] = $30; $31 = ((($f)) + 4|0); $32 = HEAP32[$31>>2]|0; $33 = ($32|0)>(0); if ($33) { $34 = ($len|0)>($right|0); $35 = HEAP32[$31>>2]|0; $36 = (($len) - ($right))|0; $i$04 = 0; while(1) { if ($34) { $37 = (((($f)) + 800|0) + ($i$04<<2)|0); $38 = HEAP32[$37>>2]|0; $39 = (((($f)) + 928|0) + ($i$04<<2)|0); $40 = HEAP32[$39>>2]|0; $42 = $right;$j$03 = 0; while(1) { $41 = (($38) + ($42<<2)|0); $43 = HEAP32[$41>>2]|0; $44 = (($40) + ($j$03<<2)|0); HEAP32[$44>>2] = $43; $45 = (($j$03) + 1)|0; $46 = (($45) + ($right))|0; $exitcond = ($45|0)==($36|0); if ($exitcond) { break; } else { $42 = $46;$j$03 = $45; } } } $47 = (($i$04) + 1)|0; $48 = ($47|0)<($35|0); if ($48) { $i$04 = $47; } else { break; } } } $50 = ($49|0)==(0); if ($50) { $$0 = 0; return ($$0|0); } $51 = ($len|0)<($right|0); $len$right = $51 ? $len : $right; $52 = (($len$right) - ($left))|0; $53 = ((($f)) + 1416|0); $54 = HEAP32[$53>>2]|0; $55 = (($54) + ($52))|0; HEAP32[$53>>2] = $55; $$0 = $52; return ($$0|0); } function _vorbis_init($p,$z) { $p = $p|0; $z = $z|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; _memset(($p|0),0,1512)|0; $0 = ($z|0)==(0|0); if (!($0)) { $1 = ((($p)) + 80|0); $2 = $z; $3 = $2; $4 = HEAP32[$3>>2]|0; $5 = (($2) + 4)|0; $6 = $5; $7 = HEAP32[$6>>2]|0; $8 = $1; $9 = $8; HEAP32[$9>>2] = $4; $10 = (($8) + 4)|0; $11 = $10; HEAP32[$11>>2] = $7; $12 = ((($p)) + 84|0); $13 = HEAP32[$12>>2]|0; $14 = (($13) + 3)|0; $15 = $14 & -4; HEAP32[$12>>2] = $15; $16 = ((($p)) + 92|0); HEAP32[$16>>2] = $15; } $17 = ((($p)) + 96|0); HEAP32[$17>>2] = 0; $18 = ((($p)) + 100|0); HEAP32[$18>>2] = 0; $19 = ((($p)) + 32|0); HEAP32[$19>>2] = 0; $20 = ((($p)) + 124|0); HEAP32[$20>>2] = 0; $21 = ((($p)) + 1420|0); HEAP32[$21>>2] = -1; $22 = ((($p)) + 28|0); HEAP32[$22>>2] = 0; $23 = ((($p)) + 20|0); HEAP32[$23>>2] = 0; return; } function _start_decoder($f) { $f = $f|0; var $$ = 0, $$15 = 0, $$4 = 0, $$lcssa = 0, $$lcssa457 = 0, $$lcssa465 = 0, $$lcssa466 = 0, $$lcssa476 = 0, $$lcssa499 = 0, $$lcssa50 = 0, $$lcssa501 = 0, $$lcssa504 = 0, $$lcssa505 = 0, $$lcssa506 = 0, $$lcssa507 = 0, $$lcssa508 = 0, $$lcssa51 = 0, $$lcssa63 = 0, $$lcssa65 = 0, $$longest_floorlist$0 = 0; var $$longest_floorlist$0$lcssa = 0, $$max_class$0 = 0, $$max_class$0$lcssa = 0, $$max_part_read$0 = 0, $$max_part_read$0$lcssa = 0, $$off = 0, $$off7 = 0, $$pr = 0, $$pr17 = 0, $$pr287 = 0, $$pr288 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0; var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0; var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0; var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0; var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0; var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0; var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0; var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0; var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0; var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0, $262 = 0.0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0; var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0; var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0; var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0; var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0.0, $337 = 0.0, $338 = 0.0, $339 = 0.0; var $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0; var $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0.0, $374 = 0.0, $375 = 0.0; var $376 = 0.0, $377 = 0.0, $378 = 0.0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0; var $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0; var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0; var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0; var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0; var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0; var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0; var $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0; var $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0; var $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0; var $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0; var $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0; var $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0; var $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0; var $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0; var $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0; var $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0; var $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0; var $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0; var $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0; var $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0; var $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0; var $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0; var $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0; var $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0; var $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0; var $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0; var $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0; var $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0; var $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $current_entry$0203 = 0, $current_length$0204 = 0, $current_length$0204$in = 0, $div$0$ph = 0, $header = 0, $hi = 0, $high_bits$0 = 0, $i$1225 = 0, $i$2194 = 0, $i$3189 = 0, $i$3189$lcssa459 = 0, $i$4154 = 0, $i$5133 = 0; var $i$6118 = 0, $i$7114 = 0, $i9$0109 = 0, $j$0199 = 0, $j$10181 = 0, $j$11184 = 0, $j$1208 = 0, $j$12138 = 0, $j$13143 = 0, $j$14150 = 0, $j$15127 = 0, $j$16125 = 0, $j$17129 = 0, $j$2211 = 0, $j$3221 = 0, $j$4216 = 0, $j$5108 = 0, $j$6159 = 0, $j$7166 = 0, $j$8174 = 0; var $j$9177 = 0, $k$0 = 0, $k$0$ph = 0, $k$1163 = 0, $k$2170 = 0, $k$3142 = 0, $k$4147 = 0, $k$4147$in = 0, $k$5122 = 0, $last$0220 = 0.0, $last$1 = 0.0, $last$1$ = 0.0, $last$1$$lcssa = 0.0, $last$1$lcssa = 0.0, $last$1$ph = 0.0, $last2$0$ = 0.0, $last2$0215 = 0.0, $lengths$0 = 0, $lengths$119 = 0, $lengths$120$ph = 0; var $longest_floorlist$0$lcssa = 0, $longest_floorlist$0188 = 0, $low = 0, $max_class$0158 = 0, $max_part_read$0$lcssa = 0, $max_part_read$0110 = 0, $or$cond = 0, $or$cond14 = 0, $p = 0, $phitmp = 0, $phitmp233 = 0, $phitmp234 = 0, $sext = 0, $sorted_count$0207 = 0, $sorted_count$1 = 0, $sorted_count$2 = 0, $temp$0146 = 0, $total$0198 = 0, $total$1 = 0, $total$2 = 0; var $values$0 = 0, $values$1 = 0, $values$1$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 1024|0; $header = sp + 1008|0; $p = sp + 8|0; $low = sp + 4|0; $hi = sp; $0 = (_start_page($f)|0); $1 = ($0|0)==(0); if ($1) { $$4 = 0; STACKTOP = sp;return ($$4|0); } $2 = ((($f)) + 1375|0); $3 = HEAP8[$2>>0]|0; $4 = $3&255; $5 = $4 & 2; $6 = ($5|0)==(0); if ($6) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $7 = $4 & 4; $8 = ($7|0)==(0); if (!($8)) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $9 = $4 & 1; $10 = ($9|0)==(0); if (!($10)) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $11 = ((($f)) + 1116|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)==(1); if (!($13)) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $14 = ((($f)) + 1120|0); $15 = HEAP8[$14>>0]|0; $16 = ($15<<24>>24)==(30); if (!($16)) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $17 = (_get8($f)|0); $18 = ($17<<24>>24)==(1); if (!($18)) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $19 = (_getn($f,$header,6)|0); $20 = ($19|0)==(0); if ($20) { _error($f,10); $$4 = 0; STACKTOP = sp;return ($$4|0); } $21 = (_vorbis_validate($header)|0); $22 = ($21|0)==(0); if ($22) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $23 = (_get32($f)|0); $24 = ($23|0)==(0); if (!($24)) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $25 = (_get8($f)|0); $26 = $25&255; $27 = ((($f)) + 4|0); HEAP32[$27>>2] = $26; $28 = ($25<<24>>24)==(0); if ($28) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $29 = ($25&255)>(16); if ($29) { _error($f,5); $$4 = 0; STACKTOP = sp;return ($$4|0); } $30 = (_get32($f)|0); HEAP32[$f>>2] = $30; $31 = ($30|0)==(0); if ($31) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } (_get32($f)|0); (_get32($f)|0); (_get32($f)|0); $32 = (_get8($f)|0); $33 = $32&255; $34 = $33 & 15; $35 = $33 >>> 4; $36 = 1 << $34; $37 = ((($f)) + 112|0); HEAP32[$37>>2] = $36; $38 = 1 << $35; $39 = ((($f)) + 116|0); HEAP32[$39>>2] = $38; $$off = (($34) + -6)|0; $40 = ($$off>>>0)>(7); if ($40) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } $$off7 = (($32) + -96)<<24>>24; $41 = ($$off7<<24>>24)<(0); if ($41) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } $42 = ($34>>>0)>($35>>>0); if ($42) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } $43 = (_get8($f)|0); $44 = $43 & 1; $45 = ($44<<24>>24)==(0); if ($45) { _error($f,34); $$4 = 0; STACKTOP = sp;return ($$4|0); } $46 = (_start_page($f)|0); $47 = ($46|0)==(0); if ($47) { $$4 = 0; STACKTOP = sp;return ($$4|0); } $48 = (_start_packet($f)|0); $49 = ($48|0)==(0); if ($49) { $$4 = 0; STACKTOP = sp;return ($$4|0); } $50 = ((($f)) + 1376|0); while(1) { $51 = (_next_segment($f)|0); _skip($f,$51); HEAP8[$50>>0] = 0; $52 = ($51|0)==(0); if ($52) { break; } } $53 = (_start_packet($f)|0); $54 = ($53|0)==(0); if ($54) { $$4 = 0; STACKTOP = sp;return ($$4|0); } $55 = ((($f)) + 48|0); $56 = HEAP8[$55>>0]|0; $57 = ($56<<24>>24)==(0); do { if (!($57)) { $58 = (_is_whole_packet_present($f,1)|0); $59 = ($58|0)==(0); if (!($59)) { break; } $60 = ((($f)) + 100|0); $61 = HEAP32[$60>>2]|0; $62 = ($61|0)==(21); if (!($62)) { $$4 = 0; STACKTOP = sp;return ($$4|0); } HEAP32[$60>>2] = 20; $$4 = 0; STACKTOP = sp;return ($$4|0); } } while(0); _crc32_init(); $63 = (_get8_packet($f)|0); $64 = ($63|0)==(5); if (!($64)) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } $65 = (_get8_packet($f)|0); $66 = $65&255; HEAP8[$header>>0] = $66; $67 = (_get8_packet($f)|0); $68 = $67&255; $69 = ((($header)) + 1|0); HEAP8[$69>>0] = $68; $70 = (_get8_packet($f)|0); $71 = $70&255; $72 = ((($header)) + 2|0); HEAP8[$72>>0] = $71; $73 = (_get8_packet($f)|0); $74 = $73&255; $75 = ((($header)) + 3|0); HEAP8[$75>>0] = $74; $76 = (_get8_packet($f)|0); $77 = $76&255; $78 = ((($header)) + 4|0); HEAP8[$78>>0] = $77; $79 = (_get8_packet($f)|0); $80 = $79&255; $81 = ((($header)) + 5|0); HEAP8[$81>>0] = $80; $82 = (_vorbis_validate($header)|0); $83 = ($82|0)==(0); if ($83) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } $84 = (_get_bits($f,8)|0); $85 = (($84) + 1)|0; $86 = ((($f)) + 120|0); HEAP32[$86>>2] = $85; $87 = ($85*2096)|0; $88 = (_setup_malloc($f,$87)|0); $89 = ((($f)) + 124|0); HEAP32[$89>>2] = $88; $90 = ($88|0)==(0|0); if ($90) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } $91 = HEAP32[$86>>2]|0; $92 = ($91*2096)|0; _memset(($88|0),0,($92|0))|0; $93 = HEAP32[$86>>2]|0; $94 = ($93|0)>(0); L100: do { if ($94) { $95 = ((($f)) + 16|0); $96 = ((($f)) + 16|0); $i$1225 = 0; L102: while(1) { $97 = HEAP32[$89>>2]|0; $98 = (($97) + (($i$1225*2096)|0)|0); $99 = (_get_bits($f,8)|0); $100 = $99 & 255; $101 = ($100|0)==(66); if (!($101)) { label = 52; break; } $102 = (_get_bits($f,8)|0); $103 = $102 & 255; $104 = ($103|0)==(67); if (!($104)) { label = 54; break; } $105 = (_get_bits($f,8)|0); $106 = $105 & 255; $107 = ($106|0)==(86); if (!($107)) { label = 56; break; } $108 = (_get_bits($f,8)|0); $109 = (_get_bits($f,8)|0); $110 = $109 << 8; $111 = $108 & 255; $112 = $110 | $111; HEAP32[$98>>2] = $112; $113 = (_get_bits($f,8)|0); $114 = (_get_bits($f,8)|0); $115 = (_get_bits($f,8)|0); $116 = $115 << 16; $117 = $114 << 8; $118 = $117 & 65280; $119 = $113 & 255; $120 = $118 | $119; $121 = $120 | $116; $122 = (((($97) + (($i$1225*2096)|0)|0)) + 4|0); HEAP32[$122>>2] = $121; $123 = (_get_bits($f,1)|0); $124 = ($123|0)!=(0); if ($124) { $127 = 0; } else { $125 = (_get_bits($f,1)|0); $127 = $125; } $126 = $127&255; $128 = (((($97) + (($i$1225*2096)|0)|0)) + 23|0); HEAP8[$128>>0] = $126; $129 = HEAP32[$98>>2]|0; $130 = ($129|0)==(0); if ($130) { $131 = HEAP32[$122>>2]|0; $132 = ($131|0)==(0); if (!($132)) { label = 61; break; } $$pr = HEAP8[$128>>0]|0; $133 = $$pr; } else { $133 = $126; } $134 = ($133<<24>>24)==(0); $135 = HEAP32[$122>>2]|0; if ($134) { $137 = (_setup_malloc($f,$135)|0); $138 = (((($97) + (($i$1225*2096)|0)|0)) + 8|0); HEAP32[$138>>2] = $137; $lengths$0 = $137; } else { $136 = (_setup_temp_malloc($f,$135)|0); $lengths$0 = $136; } $139 = ($lengths$0|0)==(0|0); if ($139) { label = 67; break; } do { if ($124) { $142 = (_get_bits($f,5)|0); $143 = HEAP32[$122>>2]|0; $144 = ($143|0)>(0); if ($144) { $146 = $143;$current_entry$0203 = 0;$current_length$0204$in = $142; } else { $total$2 = 0; break; } while(1) { $current_length$0204 = (($current_length$0204$in) + 1)|0; $145 = (($146) - ($current_entry$0203))|0; $147 = (_ilog($145)|0); $148 = (_get_bits($f,$147)|0); $149 = (($148) + ($current_entry$0203))|0; $150 = HEAP32[$122>>2]|0; $151 = ($149|0)>($150|0); if ($151) { label = 72; break L102; } $152 = (($lengths$0) + ($current_entry$0203)|0); $153 = $current_length$0204&255; _memset(($152|0),($153|0),($148|0))|0; $154 = HEAP32[$122>>2]|0; $155 = ($154|0)>($149|0); if ($155) { $146 = $154;$current_entry$0203 = $149;$current_length$0204$in = $current_length$0204; } else { $total$2 = 0; break; } } } else { $140 = HEAP32[$122>>2]|0; $141 = ($140|0)>(0); if ($141) { $j$0199 = 0;$total$0198 = 0; } else { $total$2 = 0; break; } while(1) { $156 = HEAP8[$128>>0]|0; $157 = ($156<<24>>24)==(0); do { if ($157) { label = 76; } else { $158 = (_get_bits($f,1)|0); $159 = ($158|0)==(0); if (!($159)) { label = 76; break; } $167 = (($lengths$0) + ($j$0199)|0); HEAP8[$167>>0] = -1; $total$1 = $total$0198; } } while(0); if ((label|0) == 76) { label = 0; $160 = (_get_bits($f,5)|0); $161 = (($160) + 1)|0; $162 = $161&255; $163 = (($lengths$0) + ($j$0199)|0); HEAP8[$163>>0] = $162; $164 = (($total$0198) + 1)|0; $165 = $161 & 255; $166 = ($165|0)==(32); if ($166) { label = 77; break L102; } else { $total$1 = $164; } } $168 = (($j$0199) + 1)|0; $169 = HEAP32[$122>>2]|0; $170 = ($168|0)<($169|0); if ($170) { $j$0199 = $168;$total$0198 = $total$1; } else { $total$2 = $total$1; break; } } } } while(0); $171 = HEAP8[$128>>0]|0; $172 = ($171<<24>>24)==(0); do { if ($172) { $lengths$120$ph = $lengths$0; label = 88; } else { $173 = HEAP32[$122>>2]|0; $174 = $173 >> 2; $175 = ($total$2|0)<($174|0); if ($175) { $$pr17 = HEAP8[$128>>0]|0; $185 = ($$pr17<<24>>24)==(0); if ($185) { $lengths$120$ph = $lengths$0; label = 88; break; } else { $lengths$119 = $lengths$0;$sorted_count$2 = $total$2; break; } } $176 = HEAP32[$96>>2]|0; $177 = ($173|0)>($176|0); if ($177) { HEAP32[$96>>2] = $173; } $178 = HEAP32[$122>>2]|0; $179 = (_setup_malloc($f,$178)|0); $180 = (((($97) + (($i$1225*2096)|0)|0)) + 8|0); HEAP32[$180>>2] = $179; $181 = ($179|0)==(0|0); if ($181) { label = 85; break L102; } $182 = HEAP32[$122>>2]|0; _memcpy(($179|0),($lengths$0|0),($182|0))|0; $183 = HEAP32[$122>>2]|0; _setup_temp_free($f,$lengths$0,$183); $184 = HEAP32[$180>>2]|0; HEAP8[$128>>0] = 0; $lengths$120$ph = $184; label = 88; } } while(0); do { if ((label|0) == 88) { label = 0; $186 = HEAP32[$122>>2]|0; $187 = ($186|0)>(0); if (!($187)) { $lengths$119 = $lengths$120$ph;$sorted_count$2 = 0; break; } $188 = HEAP32[$122>>2]|0; $j$1208 = 0;$sorted_count$0207 = 0; while(1) { $189 = (($lengths$120$ph) + ($j$1208)|0); $190 = HEAP8[$189>>0]|0; $191 = ($190&255)<(11); $192 = ($190<<24>>24)==(-1); $or$cond = $191 | $192; $193 = $or$cond&1; $194 = $193 ^ 1; $sorted_count$1 = (($194) + ($sorted_count$0207))|0; $195 = (($j$1208) + 1)|0; $196 = ($195|0)<($188|0); if ($196) { $j$1208 = $195;$sorted_count$0207 = $sorted_count$1; } else { $lengths$119 = $lengths$120$ph;$sorted_count$2 = $sorted_count$1; break; } } } } while(0); $197 = (((($97) + (($i$1225*2096)|0)|0)) + 2092|0); HEAP32[$197>>2] = $sorted_count$2; $198 = HEAP8[$128>>0]|0; $199 = ($198<<24>>24)==(0); do { if ($199) { $200 = HEAP32[$122>>2]|0; $201 = $200 << 2; $202 = (_setup_malloc($f,$201)|0); $203 = (((($97) + (($i$1225*2096)|0)|0)) + 32|0); HEAP32[$203>>2] = $202; $204 = ($202|0)==(0|0); if ($204) { label = 93; break L102; } else { $values$1 = 0; } } else { $205 = ($sorted_count$2|0)==(0); if ($205) { $values$0 = 0; } else { $206 = (_setup_malloc($f,$sorted_count$2)|0); $207 = (((($97) + (($i$1225*2096)|0)|0)) + 8|0); HEAP32[$207>>2] = $206; $208 = ($206|0)==(0|0); if ($208) { label = 96; break L102; } $209 = HEAP32[$197>>2]|0; $210 = $209 << 2; $211 = (_setup_temp_malloc($f,$210)|0); $212 = (((($97) + (($i$1225*2096)|0)|0)) + 32|0); HEAP32[$212>>2] = $211; $213 = ($211|0)==(0|0); if ($213) { label = 98; break L102; } $214 = HEAP32[$197>>2]|0; $215 = $214 << 2; $216 = (_setup_temp_malloc($f,$215)|0); $217 = ($216|0)==(0|0); if ($217) { label = 100; break L102; } else { $values$0 = $216; } } $218 = HEAP32[$122>>2]|0; $219 = HEAP32[$197>>2]|0; $220 = $219 << 3; $221 = (($220) + ($218))|0; $222 = HEAP32[$95>>2]|0; $223 = ($221>>>0)>($222>>>0); if (!($223)) { $values$1 = $values$0; break; } HEAP32[$95>>2] = $221; $values$1 = $values$0; } } while(0); $224 = HEAP32[$122>>2]|0; $225 = (_compute_codewords($98,$lengths$119,$224,$values$1)|0); $226 = ($225|0)==(0); if ($226) { $$lcssa476 = $128;$values$1$lcssa = $values$1; label = 104; break; } $229 = HEAP32[$197>>2]|0; $230 = ($229|0)==(0); if (!($230)) { $231 = $229 << 2; $232 = (($231) + 4)|0; $233 = (_setup_malloc($f,$232)|0); $234 = (((($97) + (($i$1225*2096)|0)|0)) + 2084|0); HEAP32[$234>>2] = $233; $235 = ($233|0)==(0|0); if ($235) { label = 109; break; } $236 = HEAP32[$197>>2]|0; $237 = $236 << 2; $238 = (($237) + 4)|0; $239 = (_setup_malloc($f,$238)|0); $240 = (((($97) + (($i$1225*2096)|0)|0)) + 2088|0); HEAP32[$240>>2] = $239; $241 = ($239|0)==(0|0); if ($241) { label = 111; break; } $242 = ((($239)) + 4|0); HEAP32[$240>>2] = $242; HEAP32[$239>>2] = -1; _compute_sorted_huffman($98,$lengths$119,$values$1); } $243 = HEAP8[$128>>0]|0; $244 = ($243<<24>>24)==(0); if (!($244)) { $245 = HEAP32[$197>>2]|0; $246 = $245 << 2; _setup_temp_free($f,$values$1,$246); $247 = (((($97) + (($i$1225*2096)|0)|0)) + 32|0); $248 = HEAP32[$247>>2]|0; $249 = HEAP32[$197>>2]|0; $250 = $249 << 2; _setup_temp_free($f,$248,$250); $251 = HEAP32[$122>>2]|0; _setup_temp_free($f,$lengths$119,$251); HEAP32[$247>>2] = 0; } _compute_accelerated_huffman($98); $252 = (_get_bits($f,4)|0); $253 = $252&255; $254 = (((($97) + (($i$1225*2096)|0)|0)) + 21|0); HEAP8[$254>>0] = $253; $255 = $252 & 255; $256 = ($255>>>0)>(2); if ($256) { label = 116; break; } $257 = ($255|0)==(0); do { if (!($257)) { $258 = (_get_bits($f,32)|0); $259 = (+_float32_unpack($258)); $260 = (((($97) + (($i$1225*2096)|0)|0)) + 12|0); HEAPF32[$260>>2] = $259; $261 = (_get_bits($f,32)|0); $262 = (+_float32_unpack($261)); $263 = (((($97) + (($i$1225*2096)|0)|0)) + 16|0); HEAPF32[$263>>2] = $262; $264 = (_get_bits($f,4)|0); $265 = (($264) + 1)|0; $266 = $265&255; $267 = (((($97) + (($i$1225*2096)|0)|0)) + 20|0); HEAP8[$267>>0] = $266; $268 = (_get_bits($f,1)|0); $269 = $268&255; $270 = (((($97) + (($i$1225*2096)|0)|0)) + 22|0); HEAP8[$270>>0] = $269; $271 = HEAP8[$254>>0]|0; $272 = ($271<<24>>24)==(1); $273 = HEAP32[$122>>2]|0; $274 = HEAP32[$98>>2]|0; if ($272) { $275 = (_lookup1_values($273,$274)|0); $276 = (((($97) + (($i$1225*2096)|0)|0)) + 24|0); HEAP32[$276>>2] = $275; } else { $277 = Math_imul($274, $273)|0; $278 = (((($97) + (($i$1225*2096)|0)|0)) + 24|0); HEAP32[$278>>2] = $277; } $279 = (((($97) + (($i$1225*2096)|0)|0)) + 24|0); $280 = HEAP32[$279>>2]|0; $281 = ($280|0)==(0); if ($281) { label = 122; break L102; } $282 = $280 << 1; $283 = (_setup_temp_malloc($f,$282)|0); $284 = ($283|0)==(0|0); if ($284) { label = 125; break L102; } $285 = HEAP32[$279>>2]|0; $286 = ($285|0)>(0); if ($286) { $j$2211 = 0; while(1) { $287 = HEAP8[$267>>0]|0; $288 = $287&255; $289 = (_get_bits($f,$288)|0); $290 = ($289|0)==(-1); if ($290) { $$lcssa499 = $279;$$lcssa504 = $283; label = 127; break L102; } $293 = $289&65535; $294 = (($283) + ($j$2211<<1)|0); HEAP16[$294>>1] = $293; $295 = (($j$2211) + 1)|0; $296 = HEAP32[$279>>2]|0; $297 = ($295|0)<($296|0); if ($297) { $j$2211 = $295; } else { $$lcssa63 = $296; break; } } } else { $$lcssa63 = $285; } $298 = HEAP8[$254>>0]|0; $299 = ($298<<24>>24)==(1); if (!($299)) { $359 = $$lcssa63 << 2; $360 = (_setup_malloc($f,$359)|0); $361 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0); HEAP32[$361>>2] = $360; $362 = ($360|0)==(0|0); $363 = HEAP32[$279>>2]|0; if ($362) { $$lcssa505 = $283;$$lcssa508 = $363; label = 152; break L102; } $364 = ($363|0)>(0); if ($364) { $365 = HEAP32[$361>>2]|0; $366 = HEAP8[$270>>0]|0; $367 = ($366<<24>>24)==(0); $368 = HEAP32[$279>>2]|0; $j$4216 = 0;$last2$0215 = 0.0; while(1) { $370 = (($283) + ($j$4216<<1)|0); $371 = HEAP16[$370>>1]|0; $372 = $371&65535; $373 = (+($372|0)); $374 = +HEAPF32[$263>>2]; $375 = $374 * $373; $376 = +HEAPF32[$260>>2]; $377 = $376 + $375; $378 = $last2$0215 + $377; $379 = (($365) + ($j$4216<<2)|0); HEAPF32[$379>>2] = $378; $last2$0$ = $367 ? $last2$0215 : $378; $380 = (($j$4216) + 1)|0; $381 = ($380|0)<($368|0); if ($381) { $j$4216 = $380;$last2$0215 = $last2$0$; } else { $$lcssa65 = $368; break; } } } else { $$lcssa65 = $363; } $382 = $$lcssa65 << 1; _setup_temp_free($f,$283,$382); break; } $300 = HEAP8[$128>>0]|0; $301 = ($300<<24>>24)!=(0); if ($301) { $302 = HEAP32[$197>>2]|0; $303 = ($302|0)==(0); if ($303) { break; } $304 = $302 << 2; $305 = HEAP32[$98>>2]|0; $306 = Math_imul($304, $305)|0; $307 = (_setup_malloc($f,$306)|0); $308 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0); HEAP32[$308>>2] = $307; } else { $309 = HEAP32[$122>>2]|0; $310 = $309 << 2; $311 = HEAP32[$98>>2]|0; $312 = Math_imul($310, $311)|0; $313 = (_setup_malloc($f,$312)|0); $314 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0); HEAP32[$314>>2] = $313; } $315 = (((($97) + (($i$1225*2096)|0)|0)) + 28|0); $316 = HEAP32[$315>>2]|0; $317 = ($316|0)==(0|0); if ($317) { $$lcssa501 = $279;$$lcssa506 = $283; label = 135; break L102; } $$ = $301 ? $197 : $122; $320 = HEAP32[$$>>2]|0; $321 = ($320|0)>(0); if ($321) { $322 = (((($97) + (($i$1225*2096)|0)|0)) + 2088|0); $323 = HEAP32[$98>>2]|0; $j$3221 = 0;$last$0220 = 0.0; while(1) { if ($301) { $324 = HEAP32[$322>>2]|0; $325 = (($324) + ($j$3221<<2)|0); $326 = HEAP32[$325>>2]|0; $330 = $326; } else { $330 = $j$3221; } $327 = Math_imul($323, $j$3221)|0; $div$0$ph = 1;$k$0$ph = 0;$last$1$ph = $last$0220; L204: while(1) { $k$0 = $k$0$ph;$last$1 = $last$1$ph; while(1) { $328 = ($k$0|0)<($323|0); if (!($328)) { $last$1$lcssa = $last$1; break L204; } $329 = (($330>>>0) / ($div$0$ph>>>0))&-1; $331 = HEAP32[$279>>2]|0; $332 = (($329>>>0) % ($331>>>0))&-1; $333 = (($283) + ($332<<1)|0); $334 = HEAP16[$333>>1]|0; $335 = $334&65535; $336 = (+($335|0)); $337 = +HEAPF32[$263>>2]; $338 = $337 * $336; $339 = +HEAPF32[$260>>2]; $340 = $339 + $338; $341 = $last$1 + $340; $342 = (($327) + ($k$0))|0; $343 = HEAP32[$315>>2]|0; $344 = (($343) + ($342<<2)|0); HEAPF32[$344>>2] = $341; $345 = HEAP8[$270>>0]|0; $346 = ($345<<24>>24)==(0); $last$1$ = $346 ? $last$1 : $341; $347 = (($k$0) + 1)|0; $348 = HEAP32[$98>>2]|0; $349 = ($347|0)<($348|0); if ($349) { $$lcssa465 = $347;$last$1$$lcssa = $last$1$; break; } else { $k$0 = $347;$last$1 = $last$1$; } } $350 = HEAP32[$279>>2]|0; $351 = (4294967295 / ($350>>>0))&-1; $352 = ($div$0$ph>>>0)>($351>>>0); if ($352) { $$lcssa466 = $350;$$lcssa507 = $283; label = 145; break L102; } $354 = Math_imul($350, $div$0$ph)|0; $div$0$ph = $354;$k$0$ph = $$lcssa465;$last$1$ph = $last$1$$lcssa; } $355 = (($j$3221) + 1)|0; $356 = ($355|0)<($320|0); if ($356) { $j$3221 = $355;$last$0220 = $last$1$lcssa; } else { break; } } } $357 = HEAP32[$279>>2]|0; $358 = $357 << 1; _setup_temp_free($f,$283,$358); HEAP8[$254>>0] = 2; } } while(0); $383 = (($i$1225) + 1)|0; $384 = HEAP32[$86>>2]|0; $385 = ($383|0)<($384|0); if ($385) { $i$1225 = $383; } else { break L100; } } switch (label|0) { case 52: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 54: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 56: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 61: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 67: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 72: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 77: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 85: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 93: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 96: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 98: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 100: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 104: { $227 = HEAP8[$$lcssa476>>0]|0; $228 = ($227<<24>>24)==(0); if (!($228)) { _setup_temp_free($f,$values$1$lcssa,0); } _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 109: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 111: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 116: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 122: { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 125: { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 127: { $291 = HEAP32[$$lcssa499>>2]|0; $292 = $291 << 1; _setup_temp_free($f,$$lcssa504,$292); _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 135: { $318 = HEAP32[$$lcssa501>>2]|0; $319 = $318 << 1; _setup_temp_free($f,$$lcssa506,$319); _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 145: { $353 = $$lcssa466 << 1; _setup_temp_free($f,$$lcssa507,$353); _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } case 152: { $369 = $$lcssa508 << 1; _setup_temp_free($f,$$lcssa505,$369); _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); break; } } } } while(0); $386 = (_get_bits($f,6)|0); $387 = (($386) + 1)|0; $388 = $387 & 255; $389 = ($388|0)==(0); L263: do { if (!($389)) { $i$2194 = 0; while(1) { $392 = (_get_bits($f,16)|0); $393 = ($392|0)==(0); $390 = (($i$2194) + 1)|0; if (!($393)) { break; } $391 = ($390|0)<($388|0); if ($391) { $i$2194 = $390; } else { break L263; } } _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } } while(0); $394 = (_get_bits($f,6)|0); $395 = (($394) + 1)|0; $396 = ((($f)) + 128|0); HEAP32[$396>>2] = $395; $397 = ($395*1596)|0; $398 = (_setup_malloc($f,$397)|0); $399 = ((($f)) + 260|0); HEAP32[$399>>2] = $398; $400 = ($398|0)==(0|0); if ($400) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } $401 = HEAP32[$396>>2]|0; $402 = ($401|0)>(0); do { if ($402) { $i$3189 = 0;$longest_floorlist$0188 = 0; L276: while(1) { $403 = (_get_bits($f,16)|0); $404 = $403&65535; $405 = (((($f)) + 132|0) + ($i$3189<<1)|0); HEAP16[$405>>1] = $404; $406 = $403 & 65535; $407 = ($406>>>0)>(1); if ($407) { label = 165; break; } $408 = ($406|0)==(0); if ($408) { $i$3189$lcssa459 = $i$3189; label = 167; break; } $438 = HEAP32[$399>>2]|0; $439 = (_get_bits($f,5)|0); $440 = $439&255; $441 = (($438) + (($i$3189*1596)|0)|0); HEAP8[$441>>0] = $440; $442 = $439 & 255; $443 = ($442|0)==(0); do { if (!($443)) { $j$6159 = 0;$max_class$0158 = -1; while(1) { $445 = (_get_bits($f,4)|0); $446 = $445&255; $447 = ((((($438) + (($i$3189*1596)|0)|0)) + 1|0) + ($j$6159)|0); HEAP8[$447>>0] = $446; $448 = $445 & 255; $449 = ($448|0)>($max_class$0158|0); $$max_class$0 = $449 ? $448 : $max_class$0158; $450 = (($j$6159) + 1)|0; $451 = HEAP8[$441>>0]|0; $452 = $451&255; $453 = ($450|0)<($452|0); if ($453) { $j$6159 = $450;$max_class$0158 = $$max_class$0; } else { $$max_class$0$lcssa = $$max_class$0; break; } } $444 = ($$max_class$0$lcssa|0)<(0); if ($444) { break; } else { $j$7166 = 0; } while(1) { $454 = (_get_bits($f,3)|0); $455 = (($454) + 1)|0; $456 = $455&255; $457 = ((((($438) + (($i$3189*1596)|0)|0)) + 33|0) + ($j$7166)|0); HEAP8[$457>>0] = $456; $458 = (_get_bits($f,2)|0); $459 = $458&255; $460 = ((((($438) + (($i$3189*1596)|0)|0)) + 49|0) + ($j$7166)|0); HEAP8[$460>>0] = $459; $461 = ($459<<24>>24)==(0); if ($461) { $k$1163 = 0; label = 178; } else { $463 = (_get_bits($f,8)|0); $464 = $463&255; $465 = ((((($438) + (($i$3189*1596)|0)|0)) + 65|0) + ($j$7166)|0); HEAP8[$465>>0] = $464; $466 = $463 & 255; $467 = HEAP32[$86>>2]|0; $468 = ($466|0)<($467|0); if (!($468)) { label = 176; break L276; } $$pr287 = HEAP8[$460>>0]|0; $462 = ($$pr287<<24>>24)==(31); if (!($462)) { $k$1163 = 0; label = 178; } } if ((label|0) == 178) { while(1) { label = 0; $474 = (_get_bits($f,8)|0); $475 = (($474) + 65535)|0; $476 = $475&65535; $477 = (((((($438) + (($i$3189*1596)|0)|0)) + 82|0) + ($j$7166<<4)|0) + ($k$1163<<1)|0); HEAP16[$477>>1] = $476; $sext = $475 << 16; $478 = $sext >> 16; $479 = HEAP32[$86>>2]|0; $480 = ($478|0)<($479|0); $472 = (($k$1163) + 1)|0; if (!($480)) { label = 179; break L276; } $469 = HEAP8[$460>>0]|0; $470 = $469&255; $471 = 1 << $470; $473 = ($472|0)<($471|0); if ($473) { $k$1163 = $472; label = 178; } else { break; } } } $481 = (($j$7166) + 1)|0; $482 = ($j$7166|0)<($$max_class$0$lcssa|0); if ($482) { $j$7166 = $481; } else { break; } } } } while(0); $483 = (_get_bits($f,2)|0); $484 = (($483) + 1)|0; $485 = $484&255; $486 = (((($438) + (($i$3189*1596)|0)|0)) + 1588|0); HEAP8[$486>>0] = $485; $487 = (_get_bits($f,4)|0); $488 = $487&255; $489 = (((($438) + (($i$3189*1596)|0)|0)) + 1589|0); HEAP8[$489>>0] = $488; $490 = (((($438) + (($i$3189*1596)|0)|0)) + 338|0); HEAP16[$490>>1] = 0; $491 = HEAP8[$489>>0]|0; $492 = $491&255; $493 = 1 << $492; $494 = $493&65535; $495 = (((($438) + (($i$3189*1596)|0)|0)) + 340|0); HEAP16[$495>>1] = $494; $496 = (((($438) + (($i$3189*1596)|0)|0)) + 1592|0); HEAP32[$496>>2] = 2; $497 = HEAP8[$441>>0]|0; $498 = ($497<<24>>24)==(0); if ($498) { $j$9177 = 0; label = 186; } else { $j$8174 = 0; while(1) { $500 = ((((($438) + (($i$3189*1596)|0)|0)) + 1|0) + ($j$8174)|0); $501 = HEAP8[$500>>0]|0; $502 = $501&255; $503 = ((((($438) + (($i$3189*1596)|0)|0)) + 33|0) + ($502)|0); $504 = HEAP8[$503>>0]|0; $505 = ($504<<24>>24)==(0); if (!($505)) { $k$2170 = 0; while(1) { $506 = HEAP8[$489>>0]|0; $507 = $506&255; $508 = (_get_bits($f,$507)|0); $509 = $508&65535; $510 = HEAP32[$496>>2]|0; $511 = ((((($438) + (($i$3189*1596)|0)|0)) + 338|0) + ($510<<1)|0); HEAP16[$511>>1] = $509; $512 = HEAP32[$496>>2]|0; $513 = (($512) + 1)|0; HEAP32[$496>>2] = $513; $514 = (($k$2170) + 1)|0; $515 = HEAP8[$503>>0]|0; $516 = $515&255; $517 = ($514|0)<($516|0); if ($517) { $k$2170 = $514; } else { break; } } } $518 = (($j$8174) + 1)|0; $519 = HEAP8[$441>>0]|0; $520 = $519&255; $521 = ($518|0)<($520|0); if ($521) { $j$8174 = $518; } else { break; } } $$pr288 = HEAP32[$496>>2]|0; $499 = ($$pr288|0)>(0); if ($499) { $j$9177 = 0; label = 186; } else { $$lcssa50 = $$pr288; } } if ((label|0) == 186) { while(1) { label = 0; $522 = ((((($438) + (($i$3189*1596)|0)|0)) + 338|0) + ($j$9177<<1)|0); $523 = HEAP16[$522>>1]|0; $524 = (($p) + ($j$9177<<2)|0); HEAP16[$524>>1] = $523; $525 = $j$9177&65535; $526 = (((($p) + ($j$9177<<2)|0)) + 2|0); HEAP16[$526>>1] = $525; $527 = (($j$9177) + 1)|0; $528 = HEAP32[$496>>2]|0; $529 = ($527|0)<($528|0); if ($529) { $j$9177 = $527; label = 186; } else { $$lcssa50 = $528; break; } } } _qsort($p,$$lcssa50,4,1); $530 = HEAP32[$496>>2]|0; $531 = ($530|0)>(0); do { if ($531) { $j$10181 = 0; while(1) { $533 = (((($p) + ($j$10181<<2)|0)) + 2|0); $534 = HEAP16[$533>>1]|0; $535 = $534&255; $536 = ((((($438) + (($i$3189*1596)|0)|0)) + 838|0) + ($j$10181)|0); HEAP8[$536>>0] = $535; $537 = (($j$10181) + 1)|0; $538 = HEAP32[$496>>2]|0; $539 = ($537|0)<($538|0); if ($539) { $j$10181 = $537; } else { $$lcssa457 = $538; break; } } $532 = ($$lcssa457|0)>(2); if ($532) { $j$11184 = 2; } else { $$lcssa51 = $$lcssa457; break; } while(1) { _neighbors($490,$j$11184,$low,$hi); $540 = HEAP32[$low>>2]|0; $541 = $540&255; $542 = ((((($438) + (($i$3189*1596)|0)|0)) + 1088|0) + ($j$11184<<1)|0); HEAP8[$542>>0] = $541; $543 = HEAP32[$hi>>2]|0; $544 = $543&255; $545 = ((((((($438) + (($i$3189*1596)|0)|0)) + 1088|0) + ($j$11184<<1)|0)) + 1|0); HEAP8[$545>>0] = $544; $546 = (($j$11184) + 1)|0; $547 = HEAP32[$496>>2]|0; $548 = ($546|0)<($547|0); if ($548) { $j$11184 = $546; } else { $$lcssa51 = $547; break; } } } else { $$lcssa51 = $530; } } while(0); $549 = ($$lcssa51|0)>($longest_floorlist$0188|0); $$longest_floorlist$0 = $549 ? $$lcssa51 : $longest_floorlist$0188; $550 = (($i$3189) + 1)|0; $551 = HEAP32[$396>>2]|0; $552 = ($550|0)<($551|0); if ($552) { $i$3189 = $550;$longest_floorlist$0188 = $$longest_floorlist$0; } else { $$longest_floorlist$0$lcssa = $$longest_floorlist$0; label = 193; break; } } if ((label|0) == 165) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 167) { $409 = HEAP32[$399>>2]|0; $410 = (_get_bits($f,8)|0); $411 = $410&255; $412 = (($409) + (($i$3189$lcssa459*1596)|0)|0); HEAP8[$412>>0] = $411; $413 = (_get_bits($f,16)|0); $414 = $413&65535; $415 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 2|0); HEAP16[$415>>1] = $414; $416 = (_get_bits($f,16)|0); $417 = $416&65535; $418 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 4|0); HEAP16[$418>>1] = $417; $419 = (_get_bits($f,6)|0); $420 = $419&255; $421 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 6|0); HEAP8[$421>>0] = $420; $422 = (_get_bits($f,8)|0); $423 = $422&255; $424 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 7|0); HEAP8[$424>>0] = $423; $425 = (_get_bits($f,4)|0); $426 = (($425) + 1)|0; $427 = $426&255; $428 = (((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 8|0); HEAP8[$428>>0] = $427; $429 = $426 & 255; $430 = ($429|0)==(0); if (!($430)) { $j$5108 = 0; while(1) { $431 = (_get_bits($f,8)|0); $432 = $431&255; $$sum = (($j$5108) + 8)|0; $433 = ((((($409) + (($i$3189$lcssa459*1596)|0)|0)) + 1|0) + ($$sum)|0); HEAP8[$433>>0] = $432; $434 = (($j$5108) + 1)|0; $435 = HEAP8[$428>>0]|0; $436 = $435&255; $437 = ($434|0)<($436|0); if ($437) { $j$5108 = $434; } else { break; } } } _error($f,4); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 176) { _error($f,20); } else if ((label|0) == 179) { _error($f,20); } else if ((label|0) == 193) { $phitmp234 = $$longest_floorlist$0$lcssa << 1; $longest_floorlist$0$lcssa = $phitmp234; break; } $$4 = 0; STACKTOP = sp;return ($$4|0); } else { $longest_floorlist$0$lcssa = 0; } } while(0); $553 = (_get_bits($f,6)|0); $554 = (($553) + 1)|0; $555 = ((($f)) + 264|0); HEAP32[$555>>2] = $554; $556 = ($554*24)|0; $557 = (_setup_malloc($f,$556)|0); $558 = ((($f)) + 396|0); HEAP32[$558>>2] = $557; $559 = ($557|0)==(0|0); if ($559) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } $560 = HEAP32[$555>>2]|0; $561 = ($560*24)|0; _memset(($557|0),0,($561|0))|0; $562 = HEAP32[$555>>2]|0; $563 = ($562|0)>(0); L333: do { if ($563) { $i$4154 = 0; L335: while(1) { $564 = HEAP32[$558>>2]|0; $565 = (_get_bits($f,16)|0); $566 = $565&65535; $567 = (((($f)) + 268|0) + ($i$4154<<1)|0); HEAP16[$567>>1] = $566; $568 = $565 & 65535; $569 = ($568>>>0)>(2); if ($569) { label = 199; break; } $570 = (_get_bits($f,24)|0); $571 = (($564) + (($i$4154*24)|0)|0); HEAP32[$571>>2] = $570; $572 = (_get_bits($f,24)|0); $573 = (((($564) + (($i$4154*24)|0)|0)) + 4|0); HEAP32[$573>>2] = $572; $574 = HEAP32[$571>>2]|0; $575 = ($572>>>0)<($574>>>0); if ($575) { label = 201; break; } $576 = (_get_bits($f,24)|0); $577 = (($576) + 1)|0; $578 = (((($564) + (($i$4154*24)|0)|0)) + 8|0); HEAP32[$578>>2] = $577; $579 = (_get_bits($f,6)|0); $580 = (($579) + 1)|0; $581 = $580&255; $582 = (((($564) + (($i$4154*24)|0)|0)) + 12|0); HEAP8[$582>>0] = $581; $583 = (_get_bits($f,8)|0); $584 = $583&255; $585 = (((($564) + (($i$4154*24)|0)|0)) + 13|0); HEAP8[$585>>0] = $584; $586 = $583 & 255; $587 = HEAP32[$86>>2]|0; $588 = ($586|0)<($587|0); if (!($588)) { label = 204; break; } $589 = HEAP8[$582>>0]|0; $590 = $589&255; $591 = ($589<<24>>24)==(0); if ($591) { $$lcssa = $590; } else { $j$12138 = 0; while(1) { $592 = (_get_bits($f,3)|0); $593 = (_get_bits($f,1)|0); $594 = ($593|0)==(0); if ($594) { $high_bits$0 = 0; } else { $595 = (_get_bits($f,5)|0); $high_bits$0 = $595; } $596 = $high_bits$0 << 3; $597 = (($596) + ($592))|0; $598 = $597&255; $599 = (($p) + ($j$12138)|0); HEAP8[$599>>0] = $598; $600 = (($j$12138) + 1)|0; $601 = HEAP8[$582>>0]|0; $602 = $601&255; $603 = ($600|0)<($602|0); if ($603) { $j$12138 = $600; } else { $$lcssa = $602; break; } } } $604 = $$lcssa << 4; $605 = (_setup_malloc($f,$604)|0); $606 = (((($564) + (($i$4154*24)|0)|0)) + 20|0); HEAP32[$606>>2] = $605; $607 = ($605|0)==(0|0); if ($607) { label = 210; break; } $608 = HEAP8[$582>>0]|0; $609 = ($608<<24>>24)==(0); if (!($609)) { $j$13143 = 0; while(1) { $610 = (($p) + ($j$13143)|0); $611 = HEAP8[$610>>0]|0; $612 = $611&255; $k$3142 = 0; while(1) { $613 = 1 << $k$3142; $614 = $612 & $613; $615 = ($614|0)==(0); if ($615) { $626 = HEAP32[$606>>2]|0; $627 = ((($626) + ($j$13143<<4)|0) + ($k$3142<<1)|0); HEAP16[$627>>1] = -1; } else { $616 = (_get_bits($f,8)|0); $617 = $616&65535; $618 = HEAP32[$606>>2]|0; $619 = ((($618) + ($j$13143<<4)|0) + ($k$3142<<1)|0); HEAP16[$619>>1] = $617; $620 = HEAP32[$606>>2]|0; $621 = ((($620) + ($j$13143<<4)|0) + ($k$3142<<1)|0); $622 = HEAP16[$621>>1]|0; $623 = $622 << 16 >> 16; $624 = HEAP32[$86>>2]|0; $625 = ($623|0)<($624|0); if (!($625)) { label = 214; break L335; } } $628 = (($k$3142) + 1)|0; $629 = ($628|0)<(8); if ($629) { $k$3142 = $628; } else { break; } } $630 = (($j$13143) + 1)|0; $631 = HEAP8[$582>>0]|0; $632 = $631&255; $633 = ($630|0)<($632|0); if ($633) { $j$13143 = $630; } else { break; } } } $634 = HEAP8[$585>>0]|0; $635 = $634&255; $636 = HEAP32[$89>>2]|0; $637 = (((($636) + (($635*2096)|0)|0)) + 4|0); $638 = HEAP32[$637>>2]|0; $639 = $638 << 2; $640 = (_setup_malloc($f,$639)|0); $641 = (((($564) + (($i$4154*24)|0)|0)) + 16|0); HEAP32[$641>>2] = $640; $642 = ($640|0)==(0|0); if ($642) { label = 219; break; } $643 = HEAP8[$585>>0]|0; $644 = $643&255; $645 = HEAP32[$89>>2]|0; $646 = (((($645) + (($644*2096)|0)|0)) + 4|0); $647 = HEAP32[$646>>2]|0; $648 = $647 << 2; _memset(($640|0),0,($648|0))|0; $649 = HEAP8[$585>>0]|0; $650 = $649&255; $651 = HEAP32[$89>>2]|0; $652 = (((($651) + (($650*2096)|0)|0)) + 4|0); $653 = HEAP32[$652>>2]|0; $654 = ($653|0)>(0); if ($654) { $656 = $651;$657 = $650;$j$14150 = 0; while(1) { $655 = (($656) + (($657*2096)|0)|0); $658 = HEAP32[$655>>2]|0; $659 = (_setup_malloc($f,$658)|0); $660 = HEAP32[$641>>2]|0; $661 = (($660) + ($j$14150<<2)|0); HEAP32[$661>>2] = $659; $662 = HEAP32[$641>>2]|0; $663 = (($662) + ($j$14150<<2)|0); $664 = HEAP32[$663>>2]|0; $665 = ($664|0)==(0|0); if ($665) { label = 223; break L335; } $666 = ($658|0)>(0); if ($666) { $k$4147$in = $658;$temp$0146 = $j$14150; while(1) { $k$4147 = (($k$4147$in) + -1)|0; $667 = HEAP8[$582>>0]|0; $668 = $667&255; $669 = (($temp$0146|0) % ($668|0))&-1; $670 = $669&255; $671 = HEAP32[$641>>2]|0; $672 = (($671) + ($j$14150<<2)|0); $673 = HEAP32[$672>>2]|0; $674 = (($673) + ($k$4147)|0); HEAP8[$674>>0] = $670; $675 = HEAP8[$582>>0]|0; $676 = $675&255; $677 = (($temp$0146|0) / ($676|0))&-1; $678 = ($k$4147$in|0)>(1); if ($678) { $k$4147$in = $k$4147;$temp$0146 = $677; } else { break; } } } $679 = (($j$14150) + 1)|0; $680 = HEAP8[$585>>0]|0; $681 = $680&255; $682 = HEAP32[$89>>2]|0; $683 = (((($682) + (($681*2096)|0)|0)) + 4|0); $684 = HEAP32[$683>>2]|0; $685 = ($679|0)<($684|0); if ($685) { $656 = $682;$657 = $681;$j$14150 = $679; } else { break; } } } $686 = (($i$4154) + 1)|0; $687 = HEAP32[$555>>2]|0; $688 = ($686|0)<($687|0); if ($688) { $i$4154 = $686; } else { break L333; } } if ((label|0) == 199) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 201) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 204) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 210) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 214) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 219) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 223) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } } } while(0); $689 = (_get_bits($f,6)|0); $690 = (($689) + 1)|0; $691 = ((($f)) + 400|0); HEAP32[$691>>2] = $690; $692 = ($690*40)|0; $693 = (_setup_malloc($f,$692)|0); $694 = ((($f)) + 404|0); HEAP32[$694>>2] = $693; $695 = ($693|0)==(0|0); if ($695) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } $696 = HEAP32[$691>>2]|0; $697 = ($696*40)|0; _memset(($693|0),0,($697|0))|0; $698 = HEAP32[$691>>2]|0; $699 = ($698|0)>(0); L389: do { if ($699) { $i$5133 = 0; L390: while(1) { $700 = HEAP32[$694>>2]|0; $701 = (($700) + (($i$5133*40)|0)|0); $702 = (_get_bits($f,16)|0); $703 = ($702|0)==(0); if (!($703)) { label = 231; break; } $704 = HEAP32[$27>>2]|0; $705 = ($704*3)|0; $706 = (_setup_malloc($f,$705)|0); $707 = (((($700) + (($i$5133*40)|0)|0)) + 4|0); HEAP32[$707>>2] = $706; $708 = ($706|0)==(0|0); if ($708) { label = 233; break; } $709 = (_get_bits($f,1)|0); $710 = ($709|0)==(0); if ($710) { $715 = (((($700) + (($i$5133*40)|0)|0)) + 8|0); HEAP8[$715>>0] = 1; } else { $711 = (_get_bits($f,4)|0); $712 = (($711) + 1)|0; $713 = $712&255; $714 = (((($700) + (($i$5133*40)|0)|0)) + 8|0); HEAP8[$714>>0] = $713; } $716 = (((($700) + (($i$5133*40)|0)|0)) + 8|0); $717 = (_get_bits($f,1)|0); $718 = ($717|0)==(0); do { if ($718) { HEAP16[$701>>1] = 0; } else { $719 = (_get_bits($f,8)|0); $720 = (($719) + 1)|0; $721 = $720&65535; HEAP16[$701>>1] = $721; $722 = $720 & 65535; $723 = ($722|0)==(0); if ($723) { break; } else { $k$5122 = 0; } while(1) { $728 = HEAP32[$27>>2]|0; $729 = (($728) + -1)|0; $730 = (_ilog($729)|0); $731 = (_get_bits($f,$730)|0); $732 = $731&255; $733 = HEAP32[$707>>2]|0; $734 = (($733) + (($k$5122*3)|0)|0); HEAP8[$734>>0] = $732; $735 = HEAP32[$27>>2]|0; $736 = (($735) + -1)|0; $737 = (_ilog($736)|0); $738 = (_get_bits($f,$737)|0); $739 = $738&255; $740 = HEAP32[$707>>2]|0; $741 = (((($740) + (($k$5122*3)|0)|0)) + 1|0); HEAP8[$741>>0] = $739; $742 = HEAP32[$707>>2]|0; $743 = (($742) + (($k$5122*3)|0)|0); $744 = HEAP8[$743>>0]|0; $745 = $744&255; $746 = HEAP32[$27>>2]|0; $747 = ($745|0)<($746|0); if (!($747)) { label = 241; break L390; } $748 = (((($742) + (($k$5122*3)|0)|0)) + 1|0); $749 = HEAP8[$748>>0]|0; $750 = $749&255; $751 = ($750|0)<($746|0); if (!($751)) { label = 243; break L390; } $752 = ($744<<24>>24)==($749<<24>>24); $726 = (($k$5122) + 1)|0; if ($752) { label = 245; break L390; } $724 = HEAP16[$701>>1]|0; $725 = $724&65535; $727 = ($726|0)<($725|0); if ($727) { $k$5122 = $726; } else { break; } } } } while(0); $753 = (_get_bits($f,2)|0); $754 = ($753|0)==(0); if (!($754)) { label = 248; break; } $755 = HEAP8[$716>>0]|0; $756 = ($755&255)>(1); $757 = HEAP32[$27>>2]|0; $758 = ($757|0)>(0); do { if ($756) { if ($758) { $j$15127 = 0; } else { break; } while(1) { $766 = (_get_bits($f,4)|0); $767 = $766&255; $768 = HEAP32[$707>>2]|0; $769 = (((($768) + (($j$15127*3)|0)|0)) + 2|0); HEAP8[$769>>0] = $767; $770 = HEAP32[$707>>2]|0; $771 = (((($770) + (($j$15127*3)|0)|0)) + 2|0); $772 = HEAP8[$771>>0]|0; $773 = HEAP8[$716>>0]|0; $774 = ($772&255)<($773&255); $762 = (($j$15127) + 1)|0; if (!($774)) { label = 256; break L390; } $761 = HEAP32[$27>>2]|0; $763 = ($762|0)<($761|0); if ($763) { $j$15127 = $762; } else { break; } } } else { if (!($758)) { break; } $759 = HEAP32[$707>>2]|0; $760 = HEAP32[$27>>2]|0; $j$16125 = 0; while(1) { $775 = (((($759) + (($j$16125*3)|0)|0)) + 2|0); HEAP8[$775>>0] = 0; $776 = (($j$16125) + 1)|0; $777 = ($776|0)<($760|0); if ($777) { $j$16125 = $776; } else { break; } } } } while(0); $764 = HEAP8[$716>>0]|0; $765 = ($764<<24>>24)==(0); if (!($765)) { $j$17129 = 0; while(1) { (_get_bits($f,8)|0); $782 = (_get_bits($f,8)|0); $783 = $782&255; $784 = ((((($700) + (($i$5133*40)|0)|0)) + 9|0) + ($j$17129)|0); HEAP8[$784>>0] = $783; $785 = (_get_bits($f,8)|0); $786 = $785&255; $787 = ((((($700) + (($i$5133*40)|0)|0)) + 24|0) + ($j$17129)|0); HEAP8[$787>>0] = $786; $788 = HEAP8[$784>>0]|0; $789 = $788&255; $790 = HEAP32[$396>>2]|0; $791 = ($789|0)<($790|0); if (!($791)) { label = 260; break L390; } $792 = $785 & 255; $793 = HEAP32[$555>>2]|0; $794 = ($792|0)<($793|0); $780 = (($j$17129) + 1)|0; if (!($794)) { label = 262; break L390; } $778 = HEAP8[$716>>0]|0; $779 = $778&255; $781 = ($780|0)<($779|0); if ($781) { $j$17129 = $780; } else { break; } } } $795 = (($i$5133) + 1)|0; $796 = HEAP32[$691>>2]|0; $797 = ($795|0)<($796|0); if ($797) { $i$5133 = $795; } else { break L389; } } if ((label|0) == 231) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 233) { _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 241) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 243) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 245) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 248) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 256) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 260) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 262) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } } } while(0); $798 = (_get_bits($f,6)|0); $799 = (($798) + 1)|0; $800 = ((($f)) + 408|0); HEAP32[$800>>2] = $799; $801 = ($799|0)>(0); L444: do { if ($801) { $i$6118 = 0; while(1) { $805 = (_get_bits($f,1)|0); $806 = $805&255; $807 = (((($f)) + 412|0) + (($i$6118*6)|0)|0); HEAP8[$807>>0] = $806; $808 = (_get_bits($f,16)|0); $809 = $808&65535; $810 = (((((($f)) + 412|0) + (($i$6118*6)|0)|0)) + 2|0); HEAP16[$810>>1] = $809; $811 = (_get_bits($f,16)|0); $812 = $811&65535; $813 = (((((($f)) + 412|0) + (($i$6118*6)|0)|0)) + 4|0); HEAP16[$813>>1] = $812; $814 = (_get_bits($f,8)|0); $815 = $814&255; $816 = (((((($f)) + 412|0) + (($i$6118*6)|0)|0)) + 1|0); HEAP8[$816>>0] = $815; $817 = HEAP16[$810>>1]|0; $818 = ($817<<16>>16)==(0); if (!($818)) { label = 267; break; } $819 = HEAP16[$813>>1]|0; $820 = ($819<<16>>16)==(0); if (!($820)) { label = 269; break; } $821 = $814 & 255; $822 = HEAP32[$691>>2]|0; $823 = ($821|0)<($822|0); $803 = (($i$6118) + 1)|0; if (!($823)) { label = 271; break; } $802 = HEAP32[$800>>2]|0; $804 = ($803|0)<($802|0); if ($804) { $i$6118 = $803; } else { break L444; } } if ((label|0) == 267) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 269) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } else if ((label|0) == 271) { _error($f,20); $$4 = 0; STACKTOP = sp;return ($$4|0); } } } while(0); _flush_packet($f); $824 = ((($f)) + 992|0); HEAP32[$824>>2] = 0; $825 = HEAP32[$27>>2]|0; $826 = ($825|0)>(0); L458: do { if ($826) { $i$7114 = 0; while(1) { $830 = HEAP32[$39>>2]|0; $831 = $830 << 2; $832 = (_setup_malloc($f,$831)|0); $833 = (((($f)) + 800|0) + ($i$7114<<2)|0); HEAP32[$833>>2] = $832; $834 = HEAP32[$39>>2]|0; $835 = $834 << 1; $836 = $835 & 2147483646; $837 = (_setup_malloc($f,$836)|0); $838 = (((($f)) + 928|0) + ($i$7114<<2)|0); HEAP32[$838>>2] = $837; $839 = (_setup_malloc($f,$longest_floorlist$0$lcssa)|0); $840 = (((($f)) + 996|0) + ($i$7114<<2)|0); HEAP32[$840>>2] = $839; $841 = HEAP32[$833>>2]|0; $842 = ($841|0)==(0|0); if ($842) { break; } $843 = HEAP32[$838>>2]|0; $844 = ($843|0)==(0|0); $845 = ($839|0)==(0|0); $or$cond14 = $845 | $844; $828 = (($i$7114) + 1)|0; if ($or$cond14) { break; } $827 = HEAP32[$27>>2]|0; $829 = ($828|0)<($827|0); if ($829) { $i$7114 = $828; } else { break L458; } } _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } } while(0); $846 = HEAP32[$37>>2]|0; $847 = (_init_blocksize($f,0,$846)|0); $848 = ($847|0)==(0); if ($848) { $$4 = 0; STACKTOP = sp;return ($$4|0); } $849 = HEAP32[$39>>2]|0; $850 = (_init_blocksize($f,1,$849)|0); $851 = ($850|0)==(0); if ($851) { $$4 = 0; STACKTOP = sp;return ($$4|0); } $852 = HEAP32[$37>>2]|0; $853 = ((($f)) + 104|0); HEAP32[$853>>2] = $852; $854 = HEAP32[$39>>2]|0; $855 = ((($f)) + 108|0); HEAP32[$855>>2] = $854; $856 = HEAP32[$39>>2]|0; $857 = $856 << 1; $858 = $857 & 2147483646; $859 = HEAP32[$555>>2]|0; $860 = ($859|0)>(0); if ($860) { $861 = HEAP32[$558>>2]|0; $862 = HEAP32[$555>>2]|0; $i9$0109 = 0;$max_part_read$0110 = 0; while(1) { $863 = (((($861) + (($i9$0109*24)|0)|0)) + 4|0); $864 = HEAP32[$863>>2]|0; $865 = (($861) + (($i9$0109*24)|0)|0); $866 = HEAP32[$865>>2]|0; $867 = (($864) - ($866))|0; $868 = (((($861) + (($i9$0109*24)|0)|0)) + 8|0); $869 = HEAP32[$868>>2]|0; $870 = (($867>>>0) / ($869>>>0))&-1; $871 = ($870|0)>($max_part_read$0110|0); $$max_part_read$0 = $871 ? $870 : $max_part_read$0110; $872 = (($i9$0109) + 1)|0; $873 = ($872|0)<($862|0); if ($873) { $i9$0109 = $872;$max_part_read$0110 = $$max_part_read$0; } else { $$max_part_read$0$lcssa = $$max_part_read$0; break; } } $phitmp = $$max_part_read$0$lcssa << 2; $phitmp233 = (($phitmp) + 4)|0; $max_part_read$0$lcssa = $phitmp233; } else { $max_part_read$0$lcssa = 4; } $874 = HEAP32[$27>>2]|0; $875 = Math_imul($874, $max_part_read$0$lcssa)|0; $876 = ((($f)) + 12|0); $877 = ($858>>>0)>($875>>>0); $$15 = $877 ? $858 : $875; HEAP32[$876>>2] = $$15; $878 = ((($f)) + 1377|0); HEAP8[$878>>0] = 1; $879 = ((($f)) + 80|0); $880 = HEAP32[$879>>2]|0; $881 = ($880|0)==(0|0); do { if (!($881)) { $882 = ((($f)) + 92|0); $883 = HEAP32[$882>>2]|0; $884 = ((($f)) + 84|0); $885 = HEAP32[$884>>2]|0; $886 = ($883|0)==($885|0); if (!($886)) { ___assert_fail((15813|0),(15523|0),3780,(15869|0)); // unreachable; } $887 = ((($f)) + 88|0); $888 = HEAP32[$887>>2]|0; $889 = (($888) + 1512)|0; $890 = HEAP32[$876>>2]|0; $891 = (($889) + ($890))|0; $892 = ($891>>>0)>($883>>>0); if (!($892)) { break; } _error($f,3); $$4 = 0; STACKTOP = sp;return ($$4|0); } } while(0); $893 = (_stb_vorbis_get_file_offset($f)|0); $894 = ((($f)) + 52|0); HEAP32[$894>>2] = $893; $$4 = 1; STACKTOP = sp;return ($$4|0); } function _vorbis_alloc($f) { $f = $f|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_setup_malloc($f,1512)|0); return ($0|0); } function _vorbis_pump_first_frame($f) { $f = $f|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $left = 0, $len = 0, $right = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $len = sp + 8|0; $right = sp + 4|0; $left = sp; $0 = (_vorbis_decode_packet($f,$len,$left,$right)|0); $1 = ($0|0)==(0); if ($1) { STACKTOP = sp;return; } $2 = HEAP32[$len>>2]|0; $3 = HEAP32[$left>>2]|0; $4 = HEAP32[$right>>2]|0; (_vorbis_finish_frame($f,$2,$3,$4)|0); STACKTOP = sp;return; } function _maybe_start_packet($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1380|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(-1); if ($2) { $3 = (_get8($f)|0); $4 = ((($f)) + 96|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)==(0); if (!($6)) { $$0 = 0; return ($$0|0); } $7 = ($3<<24>>24)==(79); if (!($7)) { _error($f,30); $$0 = 0; return ($$0|0); } $8 = (_get8($f)|0); $9 = ($8<<24>>24)==(103); if (!($9)) { _error($f,30); $$0 = 0; return ($$0|0); } $10 = (_get8($f)|0); $11 = ($10<<24>>24)==(103); if (!($11)) { _error($f,30); $$0 = 0; return ($$0|0); } $12 = (_get8($f)|0); $13 = ($12<<24>>24)==(83); if (!($13)) { _error($f,30); $$0 = 0; return ($$0|0); } $14 = (_start_page_no_capturepattern($f)|0); $15 = ($14|0)==(0); if ($15) { $$0 = 0; return ($$0|0); } $16 = ((($f)) + 1375|0); $17 = HEAP8[$16>>0]|0; $18 = $17 & 1; $19 = ($18<<24>>24)==(0); if (!($19)) { $20 = ((($f)) + 1384|0); HEAP32[$20>>2] = 0; $21 = ((($f)) + 1376|0); HEAP8[$21>>0] = 0; _error($f,32); $$0 = 0; return ($$0|0); } } $22 = (_start_packet($f)|0); $$0 = $22; return ($$0|0); } function _flush_packet($f) { $f = $f|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; while(1) { $0 = (_get8_packet_raw($f)|0); $1 = ($0|0)==(-1); if ($1) { break; } } return; } function _set_file_offset($f,$loc) { $f = $f|0; $loc = $loc|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 48|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if (!($2)) { return; } $3 = ((($f)) + 96|0); HEAP32[$3>>2] = 0; $4 = ((($f)) + 32|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)==(0|0); if (!($6)) { $7 = ((($f)) + 36|0); $8 = HEAP32[$7>>2]|0; $9 = (($8) + ($loc)|0); $10 = ((($f)) + 40|0); $11 = HEAP32[$10>>2]|0; $12 = ($9>>>0)>=($11>>>0); $13 = ($loc|0)<(0); $or$cond1 = $13 | $12; if ($or$cond1) { $14 = HEAP32[$10>>2]|0; HEAP32[$4>>2] = $14; HEAP32[$3>>2] = 1; return; } else { HEAP32[$4>>2] = $9; return; } } $15 = ((($f)) + 24|0); $16 = HEAP32[$15>>2]|0; $17 = (($16) + ($loc))|0; $18 = ($17>>>0)<($loc>>>0); $19 = ($loc|0)<(0); $or$cond = $19 | $18; if ($or$cond) { HEAP32[$3>>2] = 1; $$0 = 2147483647; } else { $$0 = $17; } $20 = ((($f)) + 20|0); $21 = HEAP32[$20>>2]|0; $22 = (_fseek($21,$$0,0)|0); $23 = ($22|0)==(0); if ($23) { return; } HEAP32[$3>>2] = 1; $24 = HEAP32[$20>>2]|0; $25 = HEAP32[$15>>2]|0; (_fseek($24,$25,2)|0); return; } function _vorbis_find_page($f,$end,$last) { $f = $f|0; $end = $end|0; $last = $last|0; var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa58 = 0, $$lcssa59 = 0, $$lcssa61 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0; var $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0; var $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0; var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0; var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $crc$011 = 0, $crc$113 = 0, $crc$2$lcssa = 0, $crc$219 = 0, $exitcond = 0, $exitcond40 = 0, $header = 0, $i$0$lcssa = 0, $i1$310 = 0, $i1$412 = 0; var $i1$518 = 0, $len$014 = 0, $scevgep = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $header = sp; $0 = ((($f)) + 96|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if (!($2)) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $3 = ((($f)) + 44|0); $4 = ((($header)) + 4|0); $5 = ((($header)) + 22|0); $6 = ((($header)) + 23|0); $7 = ((($header)) + 24|0); $8 = ((($header)) + 25|0); $9 = ((($header)) + 26|0); $scevgep = ((($header)) + 22|0); $10 = ((($header)) + 4|0); $11 = ((($header)) + 5|0); $12 = ((($header)) + 6|0); $13 = ((($header)) + 7|0); $14 = ((($header)) + 8|0); $15 = ((($header)) + 9|0); $16 = ((($header)) + 10|0); $17 = ((($header)) + 11|0); $18 = ((($header)) + 12|0); $19 = ((($header)) + 13|0); $20 = ((($header)) + 14|0); $21 = ((($header)) + 15|0); $22 = ((($header)) + 16|0); $23 = ((($header)) + 17|0); $24 = ((($header)) + 18|0); $25 = ((($header)) + 19|0); $26 = ((($header)) + 20|0); $27 = ((($header)) + 21|0); $28 = ((($header)) + 22|0); $29 = ((($header)) + 23|0); $30 = ((($header)) + 24|0); $31 = ((($header)) + 25|0); $32 = ((($header)) + 26|0); while(1) { $33 = (_get8($f)|0); $34 = ($33<<24>>24)==(79); if ($34) { $35 = (_stb_vorbis_get_file_offset($f)|0); $36 = (($35) + -25)|0; $37 = HEAP32[$3>>2]|0; $38 = ($36>>>0)>($37>>>0); if ($38) { $$0 = 0; label = 29; break; } $39 = (_get8($f)|0); $40 = HEAP8[(5821)>>0]|0; $41 = ($39<<24>>24)==($40<<24>>24); if ($41) { $42 = (_get8($f)|0); $43 = HEAP8[(5822)>>0]|0; $44 = ($42<<24>>24)==($43<<24>>24); if ($44) { $121 = (_get8($f)|0); $122 = HEAP8[(5823)>>0]|0; $123 = ($121<<24>>24)==($122<<24>>24); $$ = $123 ? 4 : 3; $i$0$lcssa = $$; } else { $i$0$lcssa = 2; } } else { $i$0$lcssa = 1; } $45 = HEAP32[$0>>2]|0; $46 = ($45|0)==(0); if (!($46)) { $$0 = 0; label = 29; break; } $47 = ($i$0$lcssa|0)==(4); if ($47) { $48 = HEAP32[5820>>2]|0; HEAP32[$header>>2] = $48; $49 = (_get8($f)|0); HEAP8[$10>>0] = $49; $50 = (_get8($f)|0); HEAP8[$11>>0] = $50; $51 = (_get8($f)|0); HEAP8[$12>>0] = $51; $52 = (_get8($f)|0); HEAP8[$13>>0] = $52; $53 = (_get8($f)|0); HEAP8[$14>>0] = $53; $54 = (_get8($f)|0); HEAP8[$15>>0] = $54; $55 = (_get8($f)|0); HEAP8[$16>>0] = $55; $56 = (_get8($f)|0); HEAP8[$17>>0] = $56; $57 = (_get8($f)|0); HEAP8[$18>>0] = $57; $58 = (_get8($f)|0); HEAP8[$19>>0] = $58; $59 = (_get8($f)|0); HEAP8[$20>>0] = $59; $60 = (_get8($f)|0); HEAP8[$21>>0] = $60; $61 = (_get8($f)|0); HEAP8[$22>>0] = $61; $62 = (_get8($f)|0); HEAP8[$23>>0] = $62; $63 = (_get8($f)|0); HEAP8[$24>>0] = $63; $64 = (_get8($f)|0); HEAP8[$25>>0] = $64; $65 = (_get8($f)|0); HEAP8[$26>>0] = $65; $66 = (_get8($f)|0); HEAP8[$27>>0] = $66; $67 = (_get8($f)|0); HEAP8[$28>>0] = $67; $68 = (_get8($f)|0); HEAP8[$29>>0] = $68; $69 = (_get8($f)|0); HEAP8[$30>>0] = $69; $70 = (_get8($f)|0); HEAP8[$31>>0] = $70; $71 = (_get8($f)|0); HEAP8[$32>>0] = $71; $72 = HEAP32[$0>>2]|0; $73 = ($72|0)==(0); if (!($73)) { $$0 = 0; label = 29; break; } $74 = HEAP8[$4>>0]|0; $75 = ($74<<24>>24)==(0); if ($75) { $76 = HEAP8[$5>>0]|0; $77 = HEAP8[$6>>0]|0; $78 = HEAP8[$7>>0]|0; $79 = HEAP8[$8>>0]|0; $80 = $79&255; $81 = $80 << 24; HEAP16[$scevgep>>1]=0&65535;HEAP16[$scevgep+2>>1]=0>>>16; $82 = $78&255; $83 = $82 << 16; $84 = $77&255; $85 = $84 << 8; $86 = $76&255; $87 = $85 | $86; $88 = $87 | $83; $crc$011 = 0;$i1$310 = 0; while(1) { $94 = (($header) + ($i1$310)|0); $95 = HEAP8[$94>>0]|0; $96 = (_crc32_update($crc$011,$95)|0); $97 = (($i1$310) + 1)|0; $exitcond = ($97|0)==(27); if ($exitcond) { $$lcssa = $96; break; } else { $crc$011 = $96;$i1$310 = $97; } } $89 = $88 | $81; $90 = HEAP8[$9>>0]|0; $91 = ($90<<24>>24)==(0); if ($91) { $crc$2$lcssa = $$lcssa; } else { $92 = HEAP8[$9>>0]|0; $93 = $92&255; $crc$113 = $$lcssa;$i1$412 = 0;$len$014 = 0; while(1) { $98 = (_get8($f)|0); $99 = $98&255; $100 = (_crc32_update($crc$113,$98)|0); $101 = (($99) + ($len$014))|0; $102 = (($i1$412) + 1)|0; $103 = ($102>>>0)<($93>>>0); if ($103) { $crc$113 = $100;$i1$412 = $102;$len$014 = $101; } else { $$lcssa58 = $100;$$lcssa59 = $101; break; } } $104 = ($$lcssa59|0)==(0); if ($104) { $crc$2$lcssa = $$lcssa58; } else { $105 = HEAP32[$0>>2]|0; $106 = ($105|0)==(0); if ($106) { $crc$219 = $$lcssa58;$i1$518 = 0; } else { $$0 = 0; label = 29; break; } while(1) { $107 = (_get8($f)|0); $108 = (_crc32_update($crc$219,$107)|0); $109 = (($i1$518) + 1)|0; $exitcond40 = ($109|0)==($$lcssa59|0); if ($exitcond40) { $crc$2$lcssa = $108; break; } else { $crc$219 = $108;$i1$518 = $109; } } } } $110 = ($crc$2$lcssa|0)==($89|0); if ($110) { $$lcssa61 = $35; label = 20; break; } } } _set_file_offset($f,$35); } $119 = HEAP32[$0>>2]|0; $120 = ($119|0)==(0); if (!($120)) { $$0 = 0; label = 29; break; } } if ((label|0) == 20) { $111 = ($end|0)==(0|0); if (!($111)) { $112 = (_stb_vorbis_get_file_offset($f)|0); HEAP32[$end>>2] = $112; } $113 = ($last|0)==(0|0); do { if (!($113)) { $114 = ((($header)) + 5|0); $115 = HEAP8[$114>>0]|0; $116 = $115 & 4; $117 = ($116<<24>>24)==(0); if ($117) { HEAP32[$last>>2] = 0; break; } else { HEAP32[$last>>2] = 1; break; } } } while(0); $118 = (($$lcssa61) + -1)|0; _set_file_offset($f,$118); $$0 = 1; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 29) { STACKTOP = sp;return ($$0|0); } return (0)|0; } function _getn($z,$data,$n) { $z = $z|0; $data = $data|0; $n = $n|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 32|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $10 = ((($z)) + 20|0); $11 = HEAP32[$10>>2]|0; $12 = (_fread($data,$n,1,$11)|0); $13 = ($12|0)==(1); if ($13) { $$0 = 1; return ($$0|0); } $14 = ((($z)) + 96|0); HEAP32[$14>>2] = 1; $$0 = 0; return ($$0|0); } $3 = (($1) + ($n)|0); $4 = ((($z)) + 40|0); $5 = HEAP32[$4>>2]|0; $6 = ($3>>>0)>($5>>>0); if ($6) { $7 = ((($z)) + 96|0); HEAP32[$7>>2] = 1; $$0 = 0; return ($$0|0); } else { _memcpy(($data|0),($1|0),($n|0))|0; $8 = HEAP32[$0>>2]|0; $9 = (($8) + ($n)|0); HEAP32[$0>>2] = $9; $$0 = 1; return ($$0|0); } return (0)|0; } function _get32($f) { $f = $f|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_get8($f)|0); $1 = $0&255; $2 = (_get8($f)|0); $3 = $2&255; $4 = $3 << 8; $5 = $4 | $1; $6 = (_get8($f)|0); $7 = $6&255; $8 = $7 << 16; $9 = $5 | $8; $10 = (_get8($f)|0); $11 = $10&255; $12 = $11 << 24; $13 = $9 | $12; return ($13|0); } function _convert_channels_short_interleaved($buf_c,$buffer,$data_c,$data,$d_offset,$len) { $buf_c = $buf_c|0; $buffer = $buffer|0; $data_c = $data_c|0; $data = $data|0; $d_offset = $d_offset|0; $len = $len|0; var $$017 = 0, $$1$lcssa = 0, $$19 = 0, $$2$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond20 = 0, $exitcond25 = 0, $i$07 = 0, $i$1$lcssa = 0, $i$18 = 0, $j$016 = 0; var $or$cond = 0, $or$cond3 = 0, $scevgep = 0, $scevgep21$sum = 0, $scevgep22 = 0, $v$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($buf_c|0)!=($data_c|0); $1 = ($buf_c|0)<(3); $or$cond = $1 & $0; $2 = ($data_c|0)<(7); $or$cond3 = $2 & $or$cond; if ($or$cond3) { $3 = ($buf_c|0)==(2); if ($3) { $i$07 = 0; } else { ___assert_fail((15561|0),(15523|0),4820,(15572|0)); // unreachable; } while(1) { _compute_stereo_samples($buffer,$data_c,$data,$d_offset,$len); $4 = (($i$07) + 1)|0; $exitcond = ($4|0)==($buf_c|0); if ($exitcond) { break; } else { $i$07 = $4; } } return; } $5 = ($len|0)>(0); if (!($5)) { return; } $6 = ($buf_c|0)<($data_c|0); $7 = $6 ? $buf_c : $data_c; $8 = ($7|0)>(0); $9 = ($data_c|0)<($buf_c|0); $10 = $9 ? $data_c : $buf_c; $$017 = $buffer;$j$016 = 0; while(1) { if ($8) { $11 = (($j$016) + ($d_offset))|0; $$19 = $$017;$i$18 = 0; while(1) { $13 = (($data) + ($i$18<<2)|0); $14 = HEAP32[$13>>2]|0; $15 = (($14) + ($11<<2)|0); $16 = +HEAPF32[$15>>2]; $17 = $16 + 384.0; $18 = (HEAPF32[tempDoublePtr>>2]=$17,HEAP32[tempDoublePtr>>2]|0); $19 = (($18) + -1136623616)|0; $20 = ($19>>>0)>(65535); $21 = ($18|0)<(1136656384); $22 = $21 ? 32768 : 32767; $v$0 = $20 ? $22 : $18; $23 = $v$0&65535; $24 = ((($$19)) + 2|0); HEAP16[$$19>>1] = $23; $25 = (($i$18) + 1)|0; $exitcond20 = ($25|0)==($10|0); if ($exitcond20) { break; } else { $$19 = $24;$i$18 = $25; } } $scevgep = (($$017) + ($10<<1)|0); $$1$lcssa = $scevgep;$i$1$lcssa = $10; } else { $$1$lcssa = $$017;$i$1$lcssa = 0; } $12 = ($i$1$lcssa|0)<($buf_c|0); if ($12) { $26 = (($buf_c) - ($i$1$lcssa))|0; $27 = $26 << 1; _memset(($$1$lcssa|0),0,($27|0))|0; $scevgep21$sum = (($buf_c) - ($i$1$lcssa))|0; $scevgep22 = (($$1$lcssa) + ($scevgep21$sum<<1)|0); $$2$lcssa = $scevgep22; } else { $$2$lcssa = $$1$lcssa; } $28 = (($j$016) + 1)|0; $exitcond25 = ($28|0)==($len|0); if ($exitcond25) { break; } else { $$017 = $$2$lcssa;$j$016 = $28; } } return; } function _Vector2Distance($v1,$v2) { $v1 = $v1|0; $v2 = $v2|0; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$v2>>2]; $1 = +HEAPF32[$v1>>2]; $2 = $0 - $1; $3 = ((($v2)) + 4|0); $4 = +HEAPF32[$3>>2]; $5 = ((($v1)) + 4|0); $6 = +HEAPF32[$5>>2]; $7 = $4 - $6; $8 = $2 * $2; $9 = $7 * $7; $10 = $8 + $9; $sqrtf = (+Math_sqrt((+$10))); return (+$sqrtf); } function _Vector2Angle($initialPosition,$finalPosition) { $initialPosition = $initialPosition|0; $finalPosition = $finalPosition|0; var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $angle$0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($finalPosition)) + 4|0); $1 = +HEAPF32[$0>>2]; $2 = ((($initialPosition)) + 4|0); $3 = +HEAPF32[$2>>2]; $4 = $1 - $3; $5 = $4; $6 = +HEAPF32[$finalPosition>>2]; $7 = +HEAPF32[$initialPosition>>2]; $8 = $6 - $7; $9 = $8; $10 = (+Math_atan2((+$5),(+$9))); $11 = $10; $12 = $11; $13 = $12 * 57.295779513082323; $14 = $13; $15 = $14 < 0.0; $16 = $14 + 360.0; $angle$0 = $15 ? $16 : $14; return (+$angle$0); } function _compute_stereo_samples($output,$num_c,$data,$d_offset,$len) { $output = $output|0; $num_c = $num_c|0; $data = $data|0; $d_offset = $d_offset|0; $len = $len|0; var $$n$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0; var $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0.0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $9 = 0, $buffer = 0, $exitcond = 0, $exitcond23 = 0, $exitcond27 = 0, $exitcond28 = 0, $exitcond34 = 0, $i$09 = 0, $i$17 = 0, $i$26 = 0, $i$313 = 0, $indvars$iv$next30 = 0, $indvars$iv$next32 = 0, $indvars$iv29 = 0, $indvars$iv31 = 0, $j$011 = 0; var $n$015 = 0, $o$016 = 0, $smax = 0, $smax22 = 0, $smax26 = 0, $smax33 = 0, $v$0 = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; $buffer = sp; $0 = ($len|0)>(0); if (!($0)) { STACKTOP = sp;return; } $1 = ($num_c|0)>(0); $2 = $len ^ -1; $indvars$iv29 = -2;$indvars$iv31 = -1;$n$015 = 16;$o$016 = 0; while(1) { $3 = $o$016 << 1; dest=$buffer; stop=dest+128|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $4 = (($o$016) + ($n$015))|0; $5 = ($4|0)>($len|0); $6 = (($len) - ($o$016))|0; $$n$0 = $5 ? $6 : $n$015; L6: do { if ($1) { $7 = ($$n$0|0)>(0); $8 = (($o$016) + ($d_offset))|0; $9 = ($$n$0|0)>(0); $10 = (($o$016) + ($d_offset))|0; $11 = ($$n$0|0)>(0); $12 = (($o$016) + ($d_offset))|0; $13 = (($indvars$iv31) - ($n$015))|0; $14 = ($13|0)>($2|0); $smax = $14 ? $13 : $2; $15 = (($indvars$iv31) - ($smax))|0; $16 = (($indvars$iv31) - ($n$015))|0; $17 = ($16|0)>($2|0); $smax22 = $17 ? $16 : $2; $18 = (($indvars$iv31) - ($smax22))|0; $19 = (($indvars$iv31) - ($n$015))|0; $20 = ($19|0)>($2|0); $smax26 = $20 ? $19 : $2; $21 = (($indvars$iv31) - ($smax26))|0; $j$011 = 0; while(1) { $28 = ((15607 + (($num_c*6)|0)|0) + ($j$011)|0); $29 = HEAP8[$28>>0]|0; $30 = $29&255; $31 = $30 & 6; switch ($31|0) { case 6: { if ($7) { $36 = (($data) + ($j$011<<2)|0); $37 = HEAP32[$36>>2]|0; $i$09 = 0; while(1) { $38 = (($8) + ($i$09))|0; $39 = (($37) + ($38<<2)|0); $40 = +HEAPF32[$39>>2]; $41 = $i$09 << 1; $42 = (($buffer) + ($41<<2)|0); $43 = +HEAPF32[$42>>2]; $44 = $40 + $43; HEAPF32[$42>>2] = $44; $45 = (($37) + ($38<<2)|0); $46 = +HEAPF32[$45>>2]; $47 = $41 | 1; $48 = (($buffer) + ($47<<2)|0); $49 = +HEAPF32[$48>>2]; $50 = $46 + $49; HEAPF32[$48>>2] = $50; $51 = (($i$09) + 1)|0; $exitcond27 = ($51|0)==($21|0); if ($exitcond27) { break; } else { $i$09 = $51; } } } break; } case 2: { if ($9) { $34 = (($data) + ($j$011<<2)|0); $35 = HEAP32[$34>>2]|0; $i$17 = 0; while(1) { $52 = (($10) + ($i$17))|0; $53 = (($35) + ($52<<2)|0); $54 = +HEAPF32[$53>>2]; $55 = $i$17 << 1; $56 = (($buffer) + ($55<<2)|0); $57 = +HEAPF32[$56>>2]; $58 = $54 + $57; HEAPF32[$56>>2] = $58; $59 = (($i$17) + 1)|0; $exitcond23 = ($59|0)==($18|0); if ($exitcond23) { break; } else { $i$17 = $59; } } } break; } case 4: { if ($11) { $32 = (($data) + ($j$011<<2)|0); $33 = HEAP32[$32>>2]|0; $i$26 = 0; while(1) { $60 = (($12) + ($i$26))|0; $61 = (($33) + ($60<<2)|0); $62 = +HEAPF32[$61>>2]; $63 = $i$26 << 1; $64 = $63 | 1; $65 = (($buffer) + ($64<<2)|0); $66 = +HEAPF32[$65>>2]; $67 = $62 + $66; HEAPF32[$65>>2] = $67; $68 = (($i$26) + 1)|0; $exitcond = ($68|0)==($15|0); if ($exitcond) { break; } else { $i$26 = $68; } } } break; } default: { } } $69 = (($j$011) + 1)|0; $exitcond28 = ($69|0)==($num_c|0); if ($exitcond28) { break L6; } else { $j$011 = $69; } } } } while(0); $22 = $$n$0 << 1; $23 = ($22|0)>(0); if ($23) { $24 = (($indvars$iv31) - ($n$015))|0; $25 = ($24|0)>($2|0); $smax33 = $25 ? $24 : $2; $26 = $smax33 << 1; $27 = (($indvars$iv29) - ($26))|0; $i$313 = 0; while(1) { $70 = (($buffer) + ($i$313<<2)|0); $71 = +HEAPF32[$70>>2]; $72 = $71 + 384.0; $73 = (HEAPF32[tempDoublePtr>>2]=$72,HEAP32[tempDoublePtr>>2]|0); $74 = (($73) + -1136623616)|0; $75 = ($74>>>0)>(65535); $76 = ($73|0)<(1136656384); $77 = $76 ? 32768 : 32767; $v$0 = $75 ? $77 : $73; $78 = $v$0&65535; $79 = (($i$313) + ($3))|0; $80 = (($output) + ($79<<1)|0); HEAP16[$80>>1] = $78; $81 = (($i$313) + 1)|0; $exitcond34 = ($81|0)==($27|0); if ($exitcond34) { break; } else { $i$313 = $81; } } } $82 = (($o$016) + 16)|0; $83 = ($82|0)<($len|0); $indvars$iv$next32 = (($indvars$iv31) + -16)|0; $indvars$iv$next30 = (($indvars$iv29) + -32)|0; if ($83) { $indvars$iv29 = $indvars$iv$next30;$indvars$iv31 = $indvars$iv$next32;$n$015 = $$n$0;$o$016 = $82; } else { break; } } STACKTOP = sp;return; } function _get8($z) { $z = $z|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 32|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $9 = ((($z)) + 20|0); $10 = HEAP32[$9>>2]|0; $11 = (_fgetc($10)|0); $12 = ($11|0)==(-1); if ($12) { $13 = ((($z)) + 96|0); HEAP32[$13>>2] = 1; $$0 = 0; return ($$0|0); } else { $14 = $11&255; $$0 = $14; return ($$0|0); } } else { $3 = ((($z)) + 40|0); $4 = HEAP32[$3>>2]|0; $5 = ($1>>>0)<($4>>>0); if ($5) { $7 = ((($1)) + 1|0); HEAP32[$0>>2] = $7; $8 = HEAP8[$1>>0]|0; $$0 = $8; return ($$0|0); } else { $6 = ((($z)) + 96|0); HEAP32[$6>>2] = 1; $$0 = 0; return ($$0|0); } } return (0)|0; } function _crc32_update($crc,$byte) { $crc = $crc|0; $byte = $byte|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $crc << 8; $1 = $byte&255; $2 = $crc >>> 24; $3 = $1 ^ $2; $4 = (5824 + ($3<<2)|0); $5 = HEAP32[$4>>2]|0; $6 = $5 ^ $0; return ($6|0); } function _get8_packet_raw($f) { $f = $f|0; var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1376|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if ($2) { $3 = ((($f)) + 1384|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(0); if (!($5)) { $$0 = -1; return ($$0|0); } $6 = (_next_segment($f)|0); $7 = ($6|0)==(0); if ($7) { $$0 = -1; return ($$0|0); } $$pr = HEAP8[$0>>0]|0; $8 = ($$pr<<24>>24)==(0); if ($8) { ___assert_fail((15649|0),(15523|0),1132,(15669|0)); // unreachable; } else { $10 = $$pr; } } else { $10 = $1; } $9 = (($10) + -1)<<24>>24; HEAP8[$0>>0] = $9; $11 = ((($f)) + 1400|0); $12 = HEAP32[$11>>2]|0; $13 = (($12) + 1)|0; HEAP32[$11>>2] = $13; $14 = (_get8($f)|0); $15 = $14&255; $$0 = $15; return ($$0|0); } function _next_segment($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1384|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if (!($2)) { $$0 = 0; return ($$0|0); } $3 = ((($f)) + 1380|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(-1); if ($5) { $6 = ((($f)) + 1116|0); $7 = HEAP32[$6>>2]|0; $8 = (($7) + -1)|0; $9 = ((($f)) + 1388|0); HEAP32[$9>>2] = $8; $10 = (_start_page($f)|0); $11 = ($10|0)==(0); if ($11) { HEAP32[$0>>2] = 1; $$0 = 0; return ($$0|0); } $12 = ((($f)) + 1375|0); $13 = HEAP8[$12>>0]|0; $14 = $13 & 1; $15 = ($14<<24>>24)==(0); if ($15) { _error($f,32); $$0 = 0; return ($$0|0); } } $16 = HEAP32[$3>>2]|0; $17 = (($16) + 1)|0; HEAP32[$3>>2] = $17; $18 = (((($f)) + 1120|0) + ($16)|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $21 = ($19<<24>>24)==(-1); if (!($21)) { HEAP32[$0>>2] = 1; $22 = HEAP32[$3>>2]|0; $23 = (($22) + -1)|0; $24 = ((($f)) + 1388|0); HEAP32[$24>>2] = $23; } $25 = HEAP32[$3>>2]|0; $26 = ((($f)) + 1116|0); $27 = HEAP32[$26>>2]|0; $28 = ($25|0)<($27|0); if (!($28)) { HEAP32[$3>>2] = -1; } $29 = ((($f)) + 1376|0); $30 = HEAP8[$29>>0]|0; $31 = ($30<<24>>24)==(0); if (!($31)) { ___assert_fail((15685|0),(15523|0),1118,(15706|0)); // unreachable; } HEAP8[$29>>0] = $19; $$0 = $20; return ($$0|0); } function _start_page($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_capture_pattern($f)|0); $1 = ($0|0)==(0); if ($1) { _error($f,30); $$0 = 0; return ($$0|0); } else { $2 = (_start_page_no_capturepattern($f)|0); $$0 = $2; return ($$0|0); } return (0)|0; } function _capture_pattern($f) { $f = $f|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_get8($f)|0); $1 = ($0<<24>>24)==(79); if ($1) { $2 = (_get8($f)|0); $3 = ($2<<24>>24)==(103); if ($3) { $4 = (_get8($f)|0); $5 = ($4<<24>>24)==(103); if ($5) { $6 = (_get8($f)|0); $7 = ($6<<24>>24)==(83); $$ = $7&1; $$0 = $$; } else { $$0 = 0; } } else { $$0 = 0; } } else { $$0 = 0; } return ($$0|0); } function _start_page_no_capturepattern($f) { $f = $f|0; var $$0 = 0, $$lcssa = 0, $$lcssa14 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$in = 0, $i$0$lcssa15 = 0, $i1$04 = 0, $len$0$lcssa = 0, $len$03 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_get8($f)|0); $1 = ($0<<24>>24)==(0); if (!($1)) { _error($f,31); $$0 = 0; return ($$0|0); } $2 = (_get8($f)|0); $3 = ((($f)) + 1375|0); HEAP8[$3>>0] = $2; $4 = (_get32($f)|0); $5 = (_get32($f)|0); (_get32($f)|0); $6 = (_get32($f)|0); $7 = ((($f)) + 1112|0); HEAP32[$7>>2] = $6; (_get32($f)|0); $8 = (_get8($f)|0); $9 = $8&255; $10 = ((($f)) + 1116|0); HEAP32[$10>>2] = $9; $11 = ((($f)) + 1120|0); $12 = (_getn($f,$11,$9)|0); $13 = ($12|0)==(0); if ($13) { _error($f,10); $$0 = 0; return ($$0|0); } $14 = ((($f)) + 1404|0); HEAP32[$14>>2] = -2; $15 = $5 & $4; $16 = ($15|0)==(-1); L9: do { if (!($16)) { $17 = HEAP32[$10>>2]|0; $i$0$in = $17; while(1) { $i$0 = (($i$0$in) + -1)|0; $18 = ($i$0$in|0)>(0); if (!($18)) { break L9; } $19 = (((($f)) + 1120|0) + ($i$0)|0); $20 = HEAP8[$19>>0]|0; $21 = ($20<<24>>24)==(-1); if ($21) { $i$0$in = $i$0; } else { $i$0$lcssa15 = $i$0; break; } } HEAP32[$14>>2] = $i$0$lcssa15; $22 = ((($f)) + 1408|0); HEAP32[$22>>2] = $4; } } while(0); $23 = ((($f)) + 1377|0); $24 = HEAP8[$23>>0]|0; $25 = ($24<<24>>24)==(0); if (!($25)) { $26 = HEAP32[$10>>2]|0; $27 = ($26|0)>(0); if ($27) { $28 = HEAP32[$10>>2]|0; $i1$04 = 0;$len$03 = 0; while(1) { $29 = (((($f)) + 1120|0) + ($i1$04)|0); $30 = HEAP8[$29>>0]|0; $31 = $30&255; $32 = (($31) + ($len$03))|0; $33 = (($i1$04) + 1)|0; $34 = ($33|0)<($28|0); if ($34) { $i1$04 = $33;$len$03 = $32; } else { $$lcssa14 = $32; break; } } $phitmp = (($$lcssa14) + 27)|0; $$lcssa = $28;$len$0$lcssa = $phitmp; } else { $$lcssa = $26;$len$0$lcssa = 27; } $35 = ((($f)) + 52|0); $36 = HEAP32[$35>>2]|0; $37 = (($len$0$lcssa) + ($$lcssa))|0; $38 = (($37) + ($36))|0; $39 = ((($f)) + 56|0); HEAP32[$39>>2] = $36; $40 = ((($f)) + 60|0); HEAP32[$40>>2] = $38; $41 = ((($f)) + 64|0); HEAP32[$41>>2] = $4; } $42 = ((($f)) + 1380|0); HEAP32[$42>>2] = 0; $$0 = 1; return ($$0|0); } function _start_packet($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1380|0); $1 = ((($f)) + 1375|0); while(1) { $2 = HEAP32[$0>>2]|0; $3 = ($2|0)==(-1); if (!($3)) { label = 6; break; } $4 = (_start_page($f)|0); $5 = ($4|0)==(0); if ($5) { $$0 = 0; label = 7; break; } $6 = HEAP8[$1>>0]|0; $7 = $6 & 1; $8 = ($7<<24>>24)==(0); if (!($8)) { label = 5; break; } } if ((label|0) == 5) { _error($f,32); $$0 = 0; return ($$0|0); } else if ((label|0) == 6) { $9 = ((($f)) + 1384|0); HEAP32[$9>>2] = 0; $10 = ((($f)) + 1396|0); HEAP32[$10>>2] = 0; $11 = ((($f)) + 1400|0); HEAP32[$11>>2] = 0; $12 = ((($f)) + 1376|0); HEAP8[$12>>0] = 0; $$0 = 1; return ($$0|0); } else if ((label|0) == 7) { return ($$0|0); } return (0)|0; } function _vorbis_decode_initial($f,$p_left_start,$p_left_end,$p_right_start,$p_right_end,$mode) { $f = $f|0; $p_left_start = $p_left_start|0; $p_left_end = $p_left_end|0; $p_right_start = $p_right_start|0; $p_right_end = $p_right_end|0; $mode = $mode|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $7 = 0, $8 = 0, $9 = 0, $n$0 = 0, $next$0 = 0, $or$cond = 0, $or$cond3 = 0, $phitmp = 0, $prev$0 = 0, $storemerge = 0, $storemerge4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1508|0); HEAP32[$0>>2] = 0; $1 = ((($f)) + 1504|0); HEAP32[$1>>2] = 0; $2 = ((($f)) + 96|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)==(0); if (!($4)) { $$0 = 0; return ($$0|0); } $5 = ((($f)) + 48|0); while(1) { $8 = (_maybe_start_packet($f)|0); $9 = ($8|0)==(0); if ($9) { $$0 = 0; label = 24; break; } $10 = (_get_bits($f,1)|0); $11 = ($10|0)==(0); if ($11) { label = 9; break; } $12 = HEAP8[$5>>0]|0; $13 = ($12<<24>>24)==(0); if (!($13)) { label = 7; break; } while(1) { $14 = (_get8_packet($f)|0); $15 = ($14|0)==(-1); if ($15) { break; } } $6 = HEAP32[$2>>2]|0; $7 = ($6|0)==(0); if (!($7)) { $$0 = 0; label = 24; break; } } if ((label|0) == 7) { _error($f,35); $$0 = 0; return ($$0|0); } else if ((label|0) == 9) { $16 = ((($f)) + 80|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)==(0|0); if (!($18)) { $19 = ((($f)) + 84|0); $20 = HEAP32[$19>>2]|0; $21 = ((($f)) + 92|0); $22 = HEAP32[$21>>2]|0; $23 = ($20|0)==($22|0); if (!($23)) { ___assert_fail((15735|0),(15523|0),2804,(15791|0)); // unreachable; } } $24 = ((($f)) + 408|0); $25 = HEAP32[$24>>2]|0; $26 = (($25) + -1)|0; $27 = (_ilog($26)|0); $28 = (_get_bits($f,$27)|0); $29 = ($28|0)==(-1); if ($29) { $$0 = 0; return ($$0|0); } $30 = HEAP32[$24>>2]|0; $31 = ($28|0)<($30|0); if (!($31)) { $$0 = 0; return ($$0|0); } HEAP32[$mode>>2] = $28; $32 = (((($f)) + 412|0) + (($28*6)|0)|0); $33 = HEAP8[$32>>0]|0; $34 = ($33<<24>>24)==(0); if ($34) { $39 = ((($f)) + 112|0); $40 = HEAP32[$39>>2]|0; $n$0 = $40;$next$0 = 0;$prev$0 = 0; } else { $35 = ((($f)) + 116|0); $36 = HEAP32[$35>>2]|0; $37 = (_get_bits($f,1)|0); $38 = (_get_bits($f,1)|0); $phitmp = ($37|0)!=(0); $n$0 = $36;$next$0 = $38;$prev$0 = $phitmp; } $41 = $n$0 >> 1; $42 = HEAP8[$32>>0]|0; $43 = ($42<<24>>24)==(0); $or$cond = $prev$0 | $43; if ($or$cond) { HEAP32[$p_left_start>>2] = 0; $storemerge = $41; } else { $44 = ((($f)) + 112|0); $45 = HEAP32[$44>>2]|0; $46 = (($n$0) - ($45))|0; $47 = $46 >> 2; HEAP32[$p_left_start>>2] = $47; $48 = HEAP32[$44>>2]|0; $49 = (($48) + ($n$0))|0; $50 = $49 >> 2; $storemerge = $50; } HEAP32[$p_left_end>>2] = $storemerge; $51 = HEAP8[$32>>0]|0; $52 = ($51<<24>>24)==(0); $53 = ($next$0|0)!=(0); $or$cond3 = $53 | $52; if ($or$cond3) { HEAP32[$p_right_start>>2] = $41; $storemerge4 = $n$0; } else { $54 = ($n$0*3)|0; $55 = ((($f)) + 112|0); $56 = HEAP32[$55>>2]|0; $57 = (($54) - ($56))|0; $58 = $57 >> 2; HEAP32[$p_right_start>>2] = $58; $59 = HEAP32[$55>>2]|0; $60 = (($59) + ($54))|0; $61 = $60 >> 2; $storemerge4 = $61; } HEAP32[$p_right_end>>2] = $storemerge4; $$0 = 1; return ($$0|0); } else if ((label|0) == 24) { return ($$0|0); } return (0)|0; } function _ilog($n) { $n = $n|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($n|0)<(16384); if ($0) { $1 = ($n|0)<(16); if ($1) { $2 = (15719 + ($n)|0); $3 = HEAP8[$2>>0]|0; $4 = $3 << 24 >> 24; $$0 = $4; return ($$0|0); } $5 = ($n|0)<(512); if ($5) { $6 = $n >> 5; $7 = (15719 + ($6)|0); $8 = HEAP8[$7>>0]|0; $9 = $8 << 24 >> 24; $10 = (($9) + 5)|0; $$0 = $10; return ($$0|0); } else { $11 = $n >> 10; $12 = (15719 + ($11)|0); $13 = HEAP8[$12>>0]|0; $14 = $13 << 24 >> 24; $15 = (($14) + 10)|0; $$0 = $15; return ($$0|0); } } $16 = ($n|0)<(16777216); if (!($16)) { $28 = ($n|0)<(536870912); if (!($28)) { $$0 = 0; return ($$0|0); } $29 = $n >> 25; $30 = (15719 + ($29)|0); $31 = HEAP8[$30>>0]|0; $32 = $31 << 24 >> 24; $33 = (($32) + 25)|0; $$0 = $33; return ($$0|0); } $17 = ($n|0)<(524288); if ($17) { $18 = $n >> 15; $19 = (15719 + ($18)|0); $20 = HEAP8[$19>>0]|0; $21 = $20 << 24 >> 24; $22 = (($21) + 15)|0; $$0 = $22; return ($$0|0); } else { $23 = $n >> 20; $24 = (15719 + ($23)|0); $25 = HEAP8[$24>>0]|0; $26 = $25 << 24 >> 24; $27 = (($26) + 20)|0; $$0 = $27; return ($$0|0); } return (0)|0; } function _skip($z,$n) { $z = $z|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 32|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $8 = ((($z)) + 20|0); $9 = HEAP32[$8>>2]|0; $10 = (_ftell($9)|0); $11 = HEAP32[$8>>2]|0; $12 = (($10) + ($n))|0; (_fseek($11,$12,0)|0); return; } $3 = (($1) + ($n)|0); HEAP32[$0>>2] = $3; $4 = ((($z)) + 40|0); $5 = HEAP32[$4>>2]|0; $6 = ($3>>>0)<($5>>>0); if ($6) { return; } $7 = ((($z)) + 96|0); HEAP32[$7>>2] = 1; return; } function _get_bits($f,$n) { $f = $f|0; $n = $n|0; var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1396|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(0); if ($2) { $$0 = 0; return ($$0|0); } $3 = ($1|0)<($n|0); L4: do { if ($3) { $4 = ($n|0)>(24); if ($4) { $5 = (_get_bits($f,24)|0); $6 = (($n) + -24)|0; $7 = (_get_bits($f,$6)|0); $8 = $7 << 24; $9 = (($8) + ($5))|0; return ($9|0); } $10 = ($1|0)==(0); if ($10) { $11 = ((($f)) + 1392|0); HEAP32[$11>>2] = 0; } $12 = HEAP32[$0>>2]|0; $13 = ($12|0)<($n|0); if ($13) { $14 = ((($f)) + 1392|0); while(1) { $15 = (_get8_packet_raw($f)|0); $16 = ($15|0)==(-1); if ($16) { break; } $17 = HEAP32[$0>>2]|0; $18 = $15 << $17; $19 = HEAP32[$14>>2]|0; $20 = (($19) + ($18))|0; HEAP32[$14>>2] = $20; $21 = HEAP32[$0>>2]|0; $22 = (($21) + 8)|0; HEAP32[$0>>2] = $22; $23 = ($22|0)<($n|0); if (!($23)) { $24 = $22; break L4; } } HEAP32[$0>>2] = -1; $$0 = 0; return ($$0|0); } else { $24 = $12; } } else { $$pr = HEAP32[$0>>2]|0; $24 = $$pr; } } while(0); $25 = ($24|0)<(0); if ($25) { $$0 = 0; return ($$0|0); } $26 = ((($f)) + 1392|0); $27 = HEAP32[$26>>2]|0; $28 = 1 << $n; $29 = (($28) + -1)|0; $30 = $27 & $29; $31 = $27 >>> $n; HEAP32[$26>>2] = $31; $32 = HEAP32[$0>>2]|0; $33 = (($32) - ($n))|0; HEAP32[$0>>2] = $33; $$0 = $30; return ($$0|0); } function _setup_malloc($f,$sz) { $f = $f|0; $sz = $sz|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (($sz) + 3)|0; $1 = $0 & -4; $2 = ((($f)) + 8|0); $3 = HEAP32[$2>>2]|0; $4 = (($3) + ($1))|0; HEAP32[$2>>2] = $4; $5 = ((($f)) + 80|0); $6 = HEAP32[$5>>2]|0; $7 = ($6|0)==(0|0); if ($7) { $15 = ($1|0)==(0); if ($15) { $$0 = 0; return ($$0|0); } $16 = (_malloc($1)|0); $$0 = $16; return ($$0|0); } else { $8 = ((($f)) + 88|0); $9 = HEAP32[$8>>2]|0; $10 = (($9) + ($1))|0; $11 = ((($f)) + 92|0); $12 = HEAP32[$11>>2]|0; $13 = ($10|0)>($12|0); if ($13) { $$0 = 0; return ($$0|0); } $14 = (($6) + ($9)|0); HEAP32[$8>>2] = $10; $$0 = $14; return ($$0|0); } return (0)|0; } function _vorbis_validate($data) { $data = $data|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_memcmp($data,16185,6)|0); $1 = ($0|0)==(0); $2 = $1&1; return ($2|0); } function _crc32_init() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$03 = 0, label = 0, sp = 0; sp = STACKTOP; $i$03 = 0; while(1) { $0 = $i$03 << 24; $1 = $i$03 << 25; $2 = $0 >> 31; $3 = $2 & 79764919; $4 = $3 ^ $1; $5 = $4 << 1; $6 = $1 >> 31; $7 = $6 & 79764919; $8 = $7 ^ $5; $9 = $8 << 1; $10 = $5 >> 31; $11 = $10 & 79764919; $12 = $11 ^ $9; $13 = $12 << 1; $14 = $9 >> 31; $15 = $14 & 79764919; $16 = $15 ^ $13; $17 = $16 << 1; $18 = $13 >> 31; $19 = $18 & 79764919; $20 = $19 ^ $17; $21 = $20 << 1; $22 = $17 >> 31; $23 = $22 & 79764919; $24 = $23 ^ $21; $25 = $24 << 1; $26 = $21 >> 31; $27 = $26 & 79764919; $28 = $27 ^ $25; $29 = $28 << 1; $30 = $25 >> 31; $31 = $30 & 79764919; $32 = $31 ^ $29; $33 = (5824 + ($i$03<<2)|0); HEAP32[$33>>2] = $32; $34 = (($i$03) + 1)|0; $exitcond = ($34|0)==(256); if ($exitcond) { break; } else { $i$03 = $34; } } return; } function _setup_temp_malloc($f,$sz) { $f = $f|0; $sz = $sz|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (($sz) + 3)|0; $1 = $0 & -4; $2 = ((($f)) + 80|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)==(0|0); if ($4) { $13 = (_malloc($1)|0); $$0 = $13; return ($$0|0); } $5 = ((($f)) + 92|0); $6 = HEAP32[$5>>2]|0; $7 = (($6) - ($1))|0; $8 = ((($f)) + 88|0); $9 = HEAP32[$8>>2]|0; $10 = ($7|0)<($9|0); if ($10) { $$0 = 0; return ($$0|0); } HEAP32[$5>>2] = $7; $11 = HEAP32[$2>>2]|0; $12 = (($11) + ($7)|0); $$0 = $12; return ($$0|0); } function _setup_temp_free($f,$p,$sz) { $f = $f|0; $p = $p|0; $sz = $sz|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 80|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { _free($p); return; } else { $3 = (($sz) + 3)|0; $4 = $3 & -4; $5 = ((($f)) + 92|0); $6 = HEAP32[$5>>2]|0; $7 = (($6) + ($4))|0; HEAP32[$5>>2] = $7; return; } } function _compute_codewords($c,$len,$n,$values) { $c = $c|0; $len = $len|0; $n = $n|0; $values = $values|0; var $$0 = 0, $$lcssa = 0, $$lcssa37 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $available = 0, $i$014 = 0, $i$1 = 0; var $i$1$in = 0, $i$1$in$ph = 0, $i$1$lcssa36 = 0, $k$0$lcssa = 0, $k$016 = 0, $m$0$ph = 0, $y$012 = 0, $z$0$lcssa = 0, $z$09 = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; $available = sp; dest=$available; stop=dest+128|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $0 = ($n|0)>(0); L1: do { if ($0) { $k$016 = 0; while(1) { $1 = (($len) + ($k$016)|0); $2 = HEAP8[$1>>0]|0; $3 = ($2<<24>>24)==(-1); if (!($3)) { $k$0$lcssa = $k$016; break L1; } $4 = (($k$016) + 1)|0; $5 = ($4|0)<($n|0); if ($5) { $k$016 = $4; } else { $k$0$lcssa = $4; break; } } } else { $k$0$lcssa = 0; } } while(0); $6 = ($k$0$lcssa|0)==($n|0); if ($6) { $7 = ((($c)) + 2092|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)==(0); if ($9) { $$0 = 1; STACKTOP = sp;return ($$0|0); } else { ___assert_fail((16082|0),(15523|0),659,(16105|0)); // unreachable; } } $10 = (($len) + ($k$0$lcssa)|0); $11 = HEAP8[$10>>0]|0; $12 = $11&255; _add_entry($c,0,$k$0$lcssa,0,$12,$values); $13 = HEAP8[$10>>0]|0; $14 = ($13<<24>>24)==(0); if ($14) { $i$1$in$ph = $k$0$lcssa;$m$0$ph = 1; } else { $15 = HEAP8[$10>>0]|0; $16 = $15&255; $i$014 = 1; while(1) { $17 = (32 - ($i$014))|0; $18 = 1 << $17; $19 = (($available) + ($i$014<<2)|0); HEAP32[$19>>2] = $18; $20 = (($i$014) + 1)|0; $21 = ($i$014|0)<($16|0); if ($21) { $i$014 = $20; } else { $i$1$in$ph = $k$0$lcssa;$m$0$ph = 1; break; } } } L16: while(1) { $i$1$in = $i$1$in$ph; while(1) { $i$1 = (($i$1$in) + 1)|0; $22 = ($i$1|0)<($n|0); if (!($22)) { $$0 = 1; label = 26; break L16; } $23 = (($len) + ($i$1)|0); $24 = HEAP8[$23>>0]|0; $25 = ($24<<24>>24)==(-1); if ($25) { $i$1$in = $i$1; } else { $$lcssa = $23;$$lcssa37 = $24;$i$1$lcssa36 = $i$1; break; } } $26 = $$lcssa37&255; $27 = ($$lcssa37<<24>>24)==(0); L22: do { if ($27) { $z$0$lcssa = $26; } else { $z$09 = $26; while(1) { $28 = (($available) + ($z$09<<2)|0); $29 = HEAP32[$28>>2]|0; $30 = ($29|0)==(0); if (!($30)) { $z$0$lcssa = $z$09; break L22; } $31 = (($z$09) + -1)|0; $32 = ($z$09|0)>(1); if ($32) { $z$09 = $31; } else { $z$0$lcssa = $31; break; } } } } while(0); $33 = ($z$0$lcssa|0)==(0); if ($33) { $$0 = 0; label = 26; break; } $34 = (($available) + ($z$0$lcssa<<2)|0); $35 = HEAP32[$34>>2]|0; $36 = ($z$0$lcssa>>>0)<(32); if (!($36)) { label = 18; break; } HEAP32[$34>>2] = 0; $37 = (_bit_reverse($35)|0); $38 = (($m$0$ph) + 1)|0; $39 = HEAP8[$$lcssa>>0]|0; $40 = $39&255; _add_entry($c,$37,$i$1$lcssa36,$m$0$ph,$40,$values); $41 = HEAP8[$$lcssa>>0]|0; $42 = $41&255; $43 = ($z$0$lcssa|0)==($42|0); if ($43) { $i$1$in$ph = $i$1$lcssa36;$m$0$ph = $38; continue; } $44 = ($41&255)<(32); if (!($44)) { label = 22; break; } $45 = ($42|0)>($z$0$lcssa|0); if ($45) { $y$012 = $42; } else { $i$1$in$ph = $i$1$lcssa36;$m$0$ph = $38; continue; } while(1) { $46 = (($available) + ($y$012<<2)|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)==(0); if (!($48)) { label = 24; break L16; } $49 = (32 - ($y$012))|0; $50 = 1 << $49; $51 = (($50) + ($35))|0; HEAP32[$46>>2] = $51; $52 = (($y$012) + -1)|0; $53 = ($52|0)>($z$0$lcssa|0); if ($53) { $y$012 = $52; } else { $i$1$in$ph = $i$1$lcssa36;$m$0$ph = $38; continue L16; } } } if ((label|0) == 18) { ___assert_fail((16123|0),(15523|0),682,(16105|0)); // unreachable; } else if ((label|0) == 22) { ___assert_fail((16140|0),(15523|0),687,(16105|0)); // unreachable; } else if ((label|0) == 24) { ___assert_fail((16167|0),(15523|0),689,(16105|0)); // unreachable; } else if ((label|0) == 26) { STACKTOP = sp;return ($$0|0); } return (0)|0; } function _compute_sorted_huffman($c,$lengths,$values) { $c = $c|0; $lengths = $lengths|0; $values = $values|0; var $$ = 0, $$in = 0, $$pn = 0, $$sink$in = 0, $$sink1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0; var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0; var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $i$010 = 0, $i$114 = 0, $i$25 = 0, $k$0$lcssa = 0; var $k$09 = 0, $k$1 = 0, $n$04 = 0, $x$0$ = 0, $x$0$lcssa = 0, $x$03 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($c)) + 23|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if ($2) { $10 = ((($c)) + 4|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)>(0); if ($12) { $13 = ((($c)) + 32|0); $14 = ((($c)) + 2084|0); $i$010 = 0;$k$09 = 0; while(1) { $15 = (($lengths) + ($i$010)|0); $16 = HEAP8[$15>>0]|0; $17 = (_include_in_sort($c,$16)|0); $18 = ($17|0)==(0); if ($18) { $k$1 = $k$09; } else { $19 = HEAP32[$13>>2]|0; $20 = (($19) + ($i$010<<2)|0); $21 = HEAP32[$20>>2]|0; $22 = (_bit_reverse($21)|0); $23 = (($k$09) + 1)|0; $24 = HEAP32[$14>>2]|0; $25 = (($24) + ($k$09<<2)|0); HEAP32[$25>>2] = $22; $k$1 = $23; } $26 = (($i$010) + 1)|0; $27 = HEAP32[$10>>2]|0; $28 = ($26|0)<($27|0); if ($28) { $i$010 = $26;$k$09 = $k$1; } else { $k$0$lcssa = $k$1; break; } } } else { $k$0$lcssa = 0; } $29 = ((($c)) + 2092|0); $30 = HEAP32[$29>>2]|0; $31 = ($k$0$lcssa|0)==($30|0); if (!($31)) { ___assert_fail((15974|0),(15523|0),756,(15997|0)); // unreachable; } } else { $3 = ((($c)) + 2092|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)>(0); if ($5) { $6 = ((($c)) + 32|0); $7 = HEAP32[$6>>2]|0; $8 = ((($c)) + 2084|0); $9 = HEAP32[$8>>2]|0; $i$114 = 0; while(1) { $32 = (($7) + ($i$114<<2)|0); $33 = HEAP32[$32>>2]|0; $34 = (_bit_reverse($33)|0); $35 = (($9) + ($i$114<<2)|0); HEAP32[$35>>2] = $34; $36 = (($i$114) + 1)|0; $37 = HEAP32[$3>>2]|0; $38 = ($36|0)<($37|0); if ($38) { $i$114 = $36; } else { break; } } } } $39 = ((($c)) + 2084|0); $40 = HEAP32[$39>>2]|0; $41 = ((($c)) + 2092|0); $42 = HEAP32[$41>>2]|0; _qsort($40,$42,4,2); $43 = HEAP32[$41>>2]|0; $44 = HEAP32[$39>>2]|0; $45 = (($44) + ($43<<2)|0); HEAP32[$45>>2] = -1; $46 = HEAP8[$0>>0]|0; $47 = ($46<<24>>24)==(0); $48 = ((($c)) + 4|0); $$in = $47 ? $48 : $41; $49 = HEAP32[$$in>>2]|0; $50 = ($49|0)>(0); if (!($50)) { return; } $51 = ((($c)) + 32|0); $52 = ((($c)) + 2088|0); $53 = ((($c)) + 2088|0); $54 = ((($c)) + 8|0); $i$25 = 0; L20: while(1) { $55 = HEAP8[$0>>0]|0; $56 = ($55<<24>>24)==(0); if ($56) { $$pn = $i$25; } else { $57 = (($values) + ($i$25<<2)|0); $58 = HEAP32[$57>>2]|0; $$pn = $58; } $$sink$in = (($lengths) + ($$pn)|0); $$sink1 = HEAP8[$$sink$in>>0]|0; $59 = (_include_in_sort($c,$$sink1)|0); $60 = ($59|0)==(0); do { if (!($60)) { $61 = HEAP32[$51>>2]|0; $62 = (($61) + ($i$25<<2)|0); $63 = HEAP32[$62>>2]|0; $64 = (_bit_reverse($63)|0); $65 = HEAP32[$41>>2]|0; $66 = ($65|0)>(1); if ($66) { $67 = HEAP32[$39>>2]|0; $n$04 = $65;$x$03 = 0; while(1) { $68 = $n$04 >> 1; $69 = (($68) + ($x$03))|0; $70 = (($67) + ($69<<2)|0); $71 = HEAP32[$70>>2]|0; $72 = ($71>>>0)>($64>>>0); $73 = (($n$04) - ($68))|0; $x$0$ = $72 ? $x$03 : $69; $$ = $72 ? $68 : $73; $74 = ($$|0)>(1); if ($74) { $n$04 = $$;$x$03 = $x$0$; } else { $x$0$lcssa = $x$0$; break; } } } else { $x$0$lcssa = 0; } $75 = HEAP32[$39>>2]|0; $76 = (($75) + ($x$0$lcssa<<2)|0); $77 = HEAP32[$76>>2]|0; $78 = ($77|0)==($64|0); if (!($78)) { label = 21; break L20; } $79 = HEAP8[$0>>0]|0; $80 = ($79<<24>>24)==(0); if ($80) { $87 = HEAP32[$52>>2]|0; $88 = (($87) + ($x$0$lcssa<<2)|0); HEAP32[$88>>2] = $i$25; break; } else { $81 = (($values) + ($i$25<<2)|0); $82 = HEAP32[$81>>2]|0; $83 = HEAP32[$53>>2]|0; $84 = (($83) + ($x$0$lcssa<<2)|0); HEAP32[$84>>2] = $82; $85 = HEAP32[$54>>2]|0; $86 = (($85) + ($x$0$lcssa)|0); HEAP8[$86>>0] = $$sink1; break; } } } while(0); $89 = (($i$25) + 1)|0; $90 = ($89|0)<($49|0); if ($90) { $i$25 = $89; } else { label = 26; break; } } if ((label|0) == 21) { ___assert_fail((16020|0),(15523|0),786,(15997|0)); // unreachable; } else if ((label|0) == 26) { return; } } function _compute_accelerated_huffman($c) { $c = $c|0; var $$in = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$12 = 0, $scevgep = 0; var $z$0$ph = 0, $z$01 = 0, label = 0, sp = 0; sp = STACKTOP; $scevgep = ((($c)) + 36|0); _memset(($scevgep|0),-1,2048)|0; $0 = ((($c)) + 23|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); $3 = ((($c)) + 2092|0); $4 = ((($c)) + 4|0); $$in = $2 ? $4 : $3; $5 = HEAP32[$$in>>2]|0; $6 = ($5|0)>(0); if (!($6)) { return; } $7 = ((($c)) + 8|0); $8 = ((($c)) + 32|0); $9 = ((($c)) + 2084|0); $10 = ($5|0)<(32767); $11 = $10 ? $5 : 32767; $i$12 = 0; while(1) { $12 = HEAP32[$7>>2]|0; $13 = (($12) + ($i$12)|0); $14 = HEAP8[$13>>0]|0; $15 = ($14&255)<(11); if ($15) { $16 = HEAP8[$0>>0]|0; $17 = ($16<<24>>24)==(0); if ($17) { $22 = HEAP32[$8>>2]|0; $23 = (($22) + ($i$12<<2)|0); $24 = HEAP32[$23>>2]|0; $z$0$ph = $24; } else { $18 = HEAP32[$9>>2]|0; $19 = (($18) + ($i$12<<2)|0); $20 = HEAP32[$19>>2]|0; $21 = (_bit_reverse($20)|0); $z$0$ph = $21; } $25 = ($z$0$ph>>>0)<(1024); if ($25) { $26 = $i$12&65535; $z$01 = $z$0$ph; while(1) { $27 = (((($c)) + 36|0) + ($z$01<<1)|0); HEAP16[$27>>1] = $26; $28 = HEAP32[$7>>2]|0; $29 = (($28) + ($i$12)|0); $30 = HEAP8[$29>>0]|0; $31 = $30&255; $32 = 1 << $31; $33 = (($32) + ($z$01))|0; $34 = ($33>>>0)<(1024); if ($34) { $z$01 = $33; } else { break; } } } } $35 = (($i$12) + 1)|0; $exitcond = ($35|0)==($11|0); if ($exitcond) { break; } else { $i$12 = $35; } } return; } function _float32_unpack($x) { $x = $x|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $x & 2097151; $1 = $x >>> 21; $2 = $1 & 1023; $3 = ($x|0)<(0); $4 = (+($0>>>0)); $5 = -$4; $6 = $3 ? $5 : $4; $7 = $6; $8 = $7; $9 = (($2) + -788)|0; $10 = (+_ldexp($8,$9)); $11 = $10; return (+$11); } function _lookup1_values($entries,$dim) { $entries = $entries|0; $dim = $dim|0; var $$ = 0, $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0; var $26 = 0.0, $27 = 0, $28 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (+($entries|0)); $1 = $0; $2 = (+Math_log((+$1))); $3 = $2; $4 = (+($dim|0)); $5 = $3 / $4; $6 = $5; $7 = (+Math_exp((+$6))); $8 = (+Math_floor((+$7))); $9 = (~~(($8))); $10 = (+($9|0)); $11 = $10 + 1.0; $12 = $11; $13 = (+($dim|0)); $14 = (+Math_pow((+$12),(+$13))); $15 = (+Math_floor((+$14))); $16 = (~~(($15))); $not$ = ($16|0)<=($entries|0); $17 = $not$&1; $$ = (($17) + ($9))|0; $18 = (+($$|0)); $19 = $18 + 1.0; $20 = $19; $21 = (+Math_pow((+$20),(+$13))); $22 = (+($entries|0)); $23 = $21 > $22; if (!($23)) { ___assert_fail((15883|0),(15523|0),811,(15915|0)); // unreachable; } $24 = $18; $25 = (+Math_pow((+$24),(+$13))); $26 = (+Math_floor((+$25))); $27 = (~~(($26))); $28 = ($27|0)>($entries|0); if ($28) { ___assert_fail((15930|0),(15523|0),812,(15915|0)); // unreachable; } else { return ($$|0); } return (0)|0; } function _point_compare($p,$q) { $p = $p|0; $q = $q|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP16[$p>>1]|0; $1 = HEAP16[$q>>1]|0; $2 = ($0&65535)<($1&65535); $3 = ($0&65535)>($1&65535); $4 = $3&1; $5 = $2 ? -1 : $4; return ($5|0); } function _neighbors($x,$n,$plow,$phigh) { $x = $x|0; $n = $n|0; $plow = $plow|0; $phigh = $phigh|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0; var $high$02 = 0, $high$1 = 0, $i$03 = 0, $low$01 = 0, $low$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($n|0)>(0); if (!($0)) { return; } $1 = (($x) + ($n<<1)|0); $2 = (($x) + ($n<<1)|0); $high$02 = 65536;$i$03 = 0;$low$01 = -1; while(1) { $3 = (($x) + ($i$03<<1)|0); $4 = HEAP16[$3>>1]|0; $5 = $4&65535; $6 = ($5|0)>($low$01|0); if ($6) { $7 = HEAP16[$1>>1]|0; $8 = ($4&65535)<($7&65535); if ($8) { HEAP32[$plow>>2] = $i$03; $9 = HEAP16[$3>>1]|0; $10 = $9&65535; $low$1 = $10; } else { $low$1 = $low$01; } } else { $low$1 = $low$01; } $11 = HEAP16[$3>>1]|0; $12 = $11&65535; $13 = ($12|0)<($high$02|0); if ($13) { $14 = HEAP16[$2>>1]|0; $15 = ($11&65535)>($14&65535); if ($15) { HEAP32[$phigh>>2] = $i$03; $16 = HEAP16[$3>>1]|0; $17 = $16&65535; $high$1 = $17; } else { $high$1 = $high$02; } } else { $high$1 = $high$02; } $18 = (($i$03) + 1)|0; $exitcond = ($18|0)==($n|0); if ($exitcond) { break; } else { $high$02 = $high$1;$i$03 = $18;$low$01 = $low$1; } } return; } function _init_blocksize($f,$b,$n) { $f = $f|0; $b = $b|0; $n = $n|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n >>> 1; $1 = $n & -4; $2 = $n >> 3; $3 = $0 << 2; $4 = (_setup_malloc($f,$3)|0); $5 = (((($f)) + 1068|0) + ($b<<2)|0); HEAP32[$5>>2] = $4; $6 = (_setup_malloc($f,$3)|0); $7 = (((($f)) + 1076|0) + ($b<<2)|0); HEAP32[$7>>2] = $6; $8 = (_setup_malloc($f,$1)|0); $9 = (((($f)) + 1084|0) + ($b<<2)|0); HEAP32[$9>>2] = $8; $10 = HEAP32[$5>>2]|0; $11 = ($10|0)==(0|0); if (!($11)) { $12 = HEAP32[$7>>2]|0; $13 = ($12|0)==(0|0); $14 = ($8|0)==(0|0); $or$cond = $14 | $13; if (!($or$cond)) { _compute_twiddle_factors($n,$10,$12,$8); $15 = (_setup_malloc($f,$3)|0); $16 = (((($f)) + 1092|0) + ($b<<2)|0); HEAP32[$16>>2] = $15; $17 = ($15|0)==(0|0); if ($17) { _error($f,3); $$0 = 0; return ($$0|0); } _compute_window($n,$15); $18 = $2 << 1; $19 = (_setup_malloc($f,$18)|0); $20 = (((($f)) + 1100|0) + ($b<<2)|0); HEAP32[$20>>2] = $19; $21 = ($19|0)==(0|0); if ($21) { _error($f,3); $$0 = 0; return ($$0|0); } else { _compute_bitreverse($n,$19); $$0 = 1; return ($$0|0); } } } _error($f,3); $$0 = 0; return ($$0|0); } function _compute_twiddle_factors($n,$A,$B,$C) { $n = $n|0; $A = $A|0; $B = $B|0; $C = $C|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0; var $45 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $exitcond = 0, $exitcond7 = 0, $k$03 = 0, $k$11 = 0, $k2$04 = 0, $k2$12 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n >> 2; $1 = $n >> 3; $2 = ($0|0)>(0); if ($2) { $3 = (+($n|0)); $k$03 = 0;$k2$04 = 0; while(1) { $6 = $k$03 << 2; $7 = (+($6|0)); $8 = $7 * 3.1415926535897931; $9 = $8 / $3; $10 = (+Math_cos((+$9))); $11 = $10; $12 = (($A) + ($k2$04<<2)|0); HEAPF32[$12>>2] = $11; $13 = (+Math_sin((+$9))); $14 = $13; $15 = -$14; $16 = $k2$04 | 1; $17 = (($A) + ($16<<2)|0); HEAPF32[$17>>2] = $15; $18 = (+($16|0)); $19 = $18 * 3.1415926535897931; $20 = $19 / $3; $21 = $20 * 0.5; $22 = (+Math_cos((+$21))); $23 = $22; $24 = $23 * 0.5; $25 = (($B) + ($k2$04<<2)|0); HEAPF32[$25>>2] = $24; $26 = (+Math_sin((+$21))); $27 = $26; $28 = $27 * 0.5; $29 = (($B) + ($16<<2)|0); HEAPF32[$29>>2] = $28; $30 = (($k$03) + 1)|0; $31 = (($k2$04) + 2)|0; $exitcond7 = ($30|0)==($0|0); if ($exitcond7) { break; } else { $k$03 = $30;$k2$04 = $31; } } } $4 = ($1|0)>(0); if (!($4)) { return; } $5 = (+($n|0)); $k$11 = 0;$k2$12 = 0; while(1) { $32 = $k2$12 | 1; $33 = $32 << 1; $34 = (+($33|0)); $35 = $34 * 3.1415926535897931; $36 = $35 / $5; $37 = (+Math_cos((+$36))); $38 = $37; $39 = (($C) + ($k2$12<<2)|0); HEAPF32[$39>>2] = $38; $40 = (+Math_sin((+$36))); $41 = $40; $42 = -$41; $43 = (($C) + ($32<<2)|0); HEAPF32[$43>>2] = $42; $44 = (($k$11) + 1)|0; $45 = (($k2$12) + 2)|0; $exitcond = ($44|0)==($1|0); if ($exitcond) { break; } else { $k$11 = $44;$k2$12 = $45; } } return; } function _compute_window($n,$window) { $n = $n|0; $window = $window|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $exitcond = 0, $i$01 = 0, label = 0; var sp = 0; sp = STACKTOP; $0 = $n >> 1; $1 = ($0|0)>(0); if (!($1)) { return; } $2 = (+($0|0)); $i$01 = 0; while(1) { $3 = (+($i$01|0)); $4 = $3 + 0.5; $5 = $4 / $2; $6 = $5 * 0.5; $7 = $6 * 3.1415926535897931; $8 = (+Math_sin((+$7))); $9 = $8; $10 = (+_square($9)); $11 = $10; $12 = $11 * 1.5707963267948966; $13 = (+Math_sin((+$12))); $14 = $13; $15 = (($window) + ($i$01<<2)|0); HEAPF32[$15>>2] = $14; $16 = (($i$01) + 1)|0; $exitcond = ($16|0)==($0|0); if ($exitcond) { break; } else { $i$01 = $16; } } return; } function _compute_bitreverse($n,$rev) { $n = $n|0; $rev = $rev|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n >> 3; $1 = ($0|0)>(0); if (!($1)) { return; } $2 = (_ilog($n)|0); $3 = (36 - ($2))|0; $i$01 = 0; while(1) { $4 = (_bit_reverse($i$01)|0); $5 = $4 >>> $3; $6 = $5 << 2; $7 = $6&65535; $8 = (($rev) + ($i$01<<1)|0); HEAP16[$8>>1] = $7; $9 = (($i$01) + 1)|0; $exitcond = ($9|0)==($0|0); if ($exitcond) { break; } else { $i$01 = $9; } } return; } function _bit_reverse($n) { $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n >>> 1; $1 = $0 & 1431655765; $2 = $n << 1; $3 = $2 & -1431655766; $4 = $1 | $3; $5 = $4 >>> 2; $6 = $5 & 858993459; $7 = $4 << 2; $8 = $7 & -858993460; $9 = $6 | $8; $10 = $9 >>> 4; $11 = $10 & 252645135; $12 = $9 << 4; $13 = $12 & -252645136; $14 = $11 | $13; $15 = $14 >>> 8; $16 = $15 & 16711935; $17 = $14 << 8; $18 = $17 & -16711936; $19 = $16 | $18; $20 = $19 >>> 16; $21 = $19 << 16; $22 = $20 | $21; return ($22|0); } function _square($x) { $x = +$x; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = $x * $x; return (+$0); } function _include_in_sort($c,$len) { $c = $c|0; $len = $len|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($c)) + 23|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); $3 = ($len<<24>>24)==(-1); if (!($2)) { if ($3) { ___assert_fail((16051|0),(15523|0),736,(16066|0)); // unreachable; } else { $$0 = 1; return ($$0|0); } } if ($3) { $$0 = 0; return ($$0|0); } $4 = ($len&255)>(10); $$ = $4&1; $$0 = $$; return ($$0|0); } function _uint32_compare($p,$q) { $p = $p|0; $q = $q|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$p>>2]|0; $1 = HEAP32[$q>>2]|0; $2 = ($0>>>0)<($1>>>0); $3 = ($0>>>0)>($1>>>0); $4 = $3&1; $5 = $2 ? -1 : $4; return ($5|0); } function _add_entry($c,$huff_code,$symbol,$count,$len,$values) { $c = $c|0; $huff_code = $huff_code|0; $symbol = $symbol|0; $count = $count|0; $len = $len|0; $values = $values|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($c)) + 23|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); $3 = ((($c)) + 32|0); $4 = HEAP32[$3>>2]|0; if ($2) { $5 = (($4) + ($symbol<<2)|0); HEAP32[$5>>2] = $huff_code; return; } else { $6 = (($4) + ($count<<2)|0); HEAP32[$6>>2] = $huff_code; $7 = $len&255; $8 = ((($c)) + 8|0); $9 = HEAP32[$8>>2]|0; $10 = (($9) + ($count)|0); HEAP8[$10>>0] = $7; $11 = (($values) + ($count<<2)|0); HEAP32[$11>>2] = $symbol; return; } } function _get_window($f,$len) { $f = $f|0; $len = $len|0; var $$0 = 0, $$0$in = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $len << 1; $1 = ((($f)) + 112|0); $2 = HEAP32[$1>>2]|0; $3 = ($0|0)==($2|0); if ($3) { $4 = ((($f)) + 1092|0); $$0$in = $4; $$0 = HEAP32[$$0$in>>2]|0; return ($$0|0); } $5 = ((($f)) + 116|0); $6 = HEAP32[$5>>2]|0; $7 = ($0|0)==($6|0); if (!($7)) { ___assert_fail((19474|0),(15523|0),2725,(16191|0)); // unreachable; } $8 = ((($f)) + 1096|0); $$0$in = $8; $$0 = HEAP32[$$0$in>>2]|0; return ($$0|0); } function _vorbis_decode_packet_rest($f,$len,$m,$left_start,$right_start,$right_end,$p_left) { $f = $f|0; $len = $len|0; $m = $m|0; $left_start = $left_start|0; $right_start = $right_start|0; $right_end = $right_end|0; $p_left = $p_left|0; var $$ = 0, $$0 = 0, $$01 = 0, $$2 = 0, $$3 = 0, $$4 = 0, $$5 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0; var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0; var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0; var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0; var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0; var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0; var $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0; var $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0; var $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0; var $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0; var $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0; var $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0; var $307 = 0.0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0.0, $313 = 0.0, $314 = 0.0, $315 = 0.0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0; var $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0; var $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0; var $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0; var $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $a2$0 = 0.0, $ch$0$lcssa = 0, $ch$023 = 0, $ch$1 = 0, $cval$0 = 0, $cval$2$ph = 0, $cval$236 = 0, $do_not_decode = 0, $exitcond = 0, $exitcond58 = 0, $i$053 = 0, $i$131 = 0, $i$228 = 0, $i$320 = 0, $i$320$in = 0, $i$414 = 0; var $i$513 = 0, $j$043 = 0, $j$147 = 0, $j$251 = 0, $j$324 = 0, $j$416 = 0, $k$038 = 0, $m2$0 = 0.0, $offset$042 = 0, $offset$1$lcssa = 0, $offset$137 = 0, $offset$2 = 0, $really_zero_channel = 0, $right_end$ = 0, $room$0 = 0, $step2_flag = 0, $storemerge = 0, $temp$0 = 0, $temp$1 = 0, $zero_channel = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 2560|0; $zero_channel = sp + 1280|0; $really_zero_channel = sp + 256|0; $step2_flag = sp; $do_not_decode = sp + 2304|0; $0 = HEAP8[$m>>0]|0; $1 = $0&255; $2 = (((($f)) + 104|0) + ($1<<2)|0); $3 = HEAP32[$2>>2]|0; $4 = ((($m)) + 1|0); $5 = HEAP8[$4>>0]|0; $6 = $5&255; $7 = ((($f)) + 404|0); $8 = HEAP32[$7>>2]|0; $9 = (($8) + (($6*40)|0)|0); $10 = $3 >> 1; $11 = (0 - ($10))|0; $12 = ((($f)) + 4|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)>(0); L1: do { if ($14) { $15 = (((($8) + (($6*40)|0)|0)) + 4|0); $16 = ((($f)) + 260|0); $17 = ((($f)) + 1396|0); $18 = ((($step2_flag)) + 1|0); $19 = ((($f)) + 124|0); $20 = ((($f)) + 1396|0); $21 = ((($f)) + 1392|0); $22 = ((($f)) + 124|0); $23 = ((($f)) + 1396|0); $24 = ((($f)) + 1392|0); $i$053 = 0; while(1) { $25 = HEAP32[$15>>2]|0; $26 = (((($25) + (($i$053*3)|0)|0)) + 2|0); $27 = HEAP8[$26>>0]|0; $28 = $27&255; $29 = (($zero_channel) + ($i$053<<2)|0); HEAP32[$29>>2] = 0; $30 = ((((($8) + (($6*40)|0)|0)) + 9|0) + ($28)|0); $31 = HEAP8[$30>>0]|0; $32 = $31&255; $33 = (((($f)) + 132|0) + ($32<<1)|0); $34 = HEAP16[$33>>1]|0; $35 = ($34<<16>>16)==(0); if ($35) { break; } $36 = HEAP32[$16>>2]|0; $37 = (_get_bits($f,1)|0); $38 = ($37|0)==(0); do { if ($38) { label = 50; } else { $39 = (((($36) + (($32*1596)|0)|0)) + 1588|0); $40 = HEAP8[$39>>0]|0; $41 = $40&255; $42 = (($41) + -1)|0; $43 = (6848 + ($42<<2)|0); $44 = HEAP32[$43>>2]|0; $45 = (((($f)) + 996|0) + ($i$053<<2)|0); $46 = HEAP32[$45>>2]|0; $47 = (_ilog($44)|0); $48 = (($47) + -1)|0; $49 = (_get_bits($f,$48)|0); $50 = $49&65535; HEAP16[$46>>1] = $50; $51 = (_get_bits($f,$48)|0); $52 = $51&65535; $53 = ((($46)) + 2|0); HEAP16[$53>>1] = $52; $54 = (($36) + (($32*1596)|0)|0); $55 = HEAP8[$54>>0]|0; $56 = ($55<<24>>24)==(0); if (!($56)) { $j$043 = 0;$offset$042 = 2; while(1) { $57 = ((((($36) + (($32*1596)|0)|0)) + 1|0) + ($j$043)|0); $58 = HEAP8[$57>>0]|0; $59 = $58&255; $60 = ((((($36) + (($32*1596)|0)|0)) + 33|0) + ($59)|0); $61 = HEAP8[$60>>0]|0; $62 = ((((($36) + (($32*1596)|0)|0)) + 49|0) + ($59)|0); $63 = HEAP8[$62>>0]|0; $64 = $63&255; $65 = 1 << $64; $66 = (($65) + -1)|0; $67 = ($63<<24>>24)==(0); if ($67) { $cval$2$ph = 0; } else { $68 = HEAP32[$19>>2]|0; $69 = ((((($36) + (($32*1596)|0)|0)) + 65|0) + ($59)|0); $70 = HEAP8[$69>>0]|0; $71 = $70&255; $72 = (($68) + (($71*2096)|0)|0); $73 = HEAP32[$20>>2]|0; $74 = ($73|0)<(10); if ($74) { _prep_huffman($f); } $75 = HEAP32[$21>>2]|0; $76 = $75 & 1023; $77 = ((((($68) + (($71*2096)|0)|0)) + 36|0) + ($76<<1)|0); $78 = HEAP16[$77>>1]|0; $79 = $78 << 16 >> 16; $80 = ($78<<16>>16)>(-1); if ($80) { $81 = (((($68) + (($71*2096)|0)|0)) + 8|0); $82 = HEAP32[$81>>2]|0; $83 = (($82) + ($79)|0); $84 = HEAP8[$83>>0]|0; $85 = $84&255; $86 = $75 >>> $85; HEAP32[$21>>2] = $86; $87 = HEAP32[$20>>2]|0; $88 = (($87) - ($85))|0; $89 = ($88|0)<(0); $$ = $89 ? 0 : $88; HEAP32[$20>>2] = $$; $$2 = $89 ? -1 : $79; $cval$0 = $$2; } else { $90 = (_codebook_decode_scalar_raw($f,$72)|0); $cval$0 = $90; } $91 = (((($68) + (($71*2096)|0)|0)) + 23|0); $92 = HEAP8[$91>>0]|0; $93 = ($92<<24>>24)==(0); if ($93) { $cval$2$ph = $cval$0; } else { $94 = (((($68) + (($71*2096)|0)|0)) + 2088|0); $95 = HEAP32[$94>>2]|0; $96 = (($95) + ($cval$0<<2)|0); $97 = HEAP32[$96>>2]|0; $cval$2$ph = $97; } } $98 = ($61<<24>>24)==(0); if ($98) { $offset$1$lcssa = $offset$042; } else { $99 = $61&255; $cval$236 = $cval$2$ph;$k$038 = 0;$offset$137 = $offset$042; while(1) { $100 = $cval$236 & $66; $101 = (((((($36) + (($32*1596)|0)|0)) + 82|0) + ($59<<4)|0) + ($100<<1)|0); $102 = HEAP16[$101>>1]|0; $103 = $cval$236 >> $64; $104 = ($102<<16>>16)>(-1); if ($104) { $105 = $102 << 16 >> 16; $106 = HEAP32[$22>>2]|0; $107 = (($106) + (($105*2096)|0)|0); $108 = HEAP32[$23>>2]|0; $109 = ($108|0)<(10); if ($109) { _prep_huffman($f); } $110 = HEAP32[$24>>2]|0; $111 = $110 & 1023; $112 = ((((($106) + (($105*2096)|0)|0)) + 36|0) + ($111<<1)|0); $113 = HEAP16[$112>>1]|0; $114 = $113 << 16 >> 16; $115 = ($113<<16>>16)>(-1); if ($115) { $116 = (((($106) + (($105*2096)|0)|0)) + 8|0); $117 = HEAP32[$116>>2]|0; $118 = (($117) + ($114)|0); $119 = HEAP8[$118>>0]|0; $120 = $119&255; $121 = $110 >>> $120; HEAP32[$24>>2] = $121; $122 = HEAP32[$23>>2]|0; $123 = (($122) - ($120))|0; $124 = ($123|0)<(0); $$3 = $124 ? 0 : $123; HEAP32[$23>>2] = $$3; $$4 = $124 ? -1 : $114; $temp$0 = $$4; } else { $125 = (_codebook_decode_scalar_raw($f,$107)|0); $temp$0 = $125; } $126 = (((($106) + (($105*2096)|0)|0)) + 23|0); $127 = HEAP8[$126>>0]|0; $128 = ($127<<24>>24)==(0); if ($128) { $temp$1 = $temp$0; } else { $129 = (((($106) + (($105*2096)|0)|0)) + 2088|0); $130 = HEAP32[$129>>2]|0; $131 = (($130) + ($temp$0<<2)|0); $132 = HEAP32[$131>>2]|0; $temp$1 = $132; } $133 = $temp$1&65535; $134 = (($46) + ($offset$137<<1)|0); HEAP16[$134>>1] = $133; } else { $135 = (($46) + ($offset$137<<1)|0); HEAP16[$135>>1] = 0; } $offset$2 = (($offset$137) + 1)|0; $136 = (($k$038) + 1)|0; $exitcond58 = ($136|0)==($99|0); if ($exitcond58) { break; } else { $cval$236 = $103;$k$038 = $136;$offset$137 = $offset$2; } } $137 = (($offset$042) + ($99))|0; $offset$1$lcssa = $137; } $138 = (($j$043) + 1)|0; $139 = HEAP8[$54>>0]|0; $140 = $139&255; $141 = ($138|0)<($140|0); if ($141) { $j$043 = $138;$offset$042 = $offset$1$lcssa; } else { break; } } } $142 = HEAP32[$17>>2]|0; $143 = ($142|0)==(-1); if ($143) { label = 50; break; } HEAP8[$18>>0] = 1; HEAP8[$step2_flag>>0] = 1; $144 = (((($36) + (($32*1596)|0)|0)) + 1592|0); $145 = HEAP32[$144>>2]|0; $146 = ($145|0)>(2); if ($146) { $147 = (($44) + 65535)|0; $j$147 = 2; while(1) { $151 = ((((($36) + (($32*1596)|0)|0)) + 1088|0) + ($j$147<<1)|0); $152 = HEAP8[$151>>0]|0; $153 = $152&255; $154 = ((((((($36) + (($32*1596)|0)|0)) + 1088|0) + ($j$147<<1)|0)) + 1|0); $155 = HEAP8[$154>>0]|0; $156 = $155&255; $157 = ((((($36) + (($32*1596)|0)|0)) + 338|0) + ($j$147<<1)|0); $158 = HEAP16[$157>>1]|0; $159 = $158&65535; $160 = ((((($36) + (($32*1596)|0)|0)) + 338|0) + ($153<<1)|0); $161 = HEAP16[$160>>1]|0; $162 = $161&65535; $163 = ((((($36) + (($32*1596)|0)|0)) + 338|0) + ($156<<1)|0); $164 = HEAP16[$163>>1]|0; $165 = $164&65535; $166 = (($46) + ($153<<1)|0); $167 = HEAP16[$166>>1]|0; $168 = $167 << 16 >> 16; $169 = (($46) + ($156<<1)|0); $170 = HEAP16[$169>>1]|0; $171 = $170 << 16 >> 16; $172 = (_predict_point($159,$162,$165,$168,$171)|0); $173 = (($46) + ($j$147<<1)|0); $174 = HEAP16[$173>>1]|0; $175 = $174 << 16 >> 16; $176 = (($44) - ($172))|0; $177 = ($174<<16>>16)==(0); do { if ($177) { $195 = (($step2_flag) + ($j$147)|0); HEAP8[$195>>0] = 0; $196 = $172&65535; HEAP16[$173>>1] = $196; } else { $178 = ($176|0)<($172|0); $$5 = $178 ? $176 : $172; $room$0 = $$5 << 1; $179 = (($step2_flag) + ($156)|0); HEAP8[$179>>0] = 1; $180 = (($step2_flag) + ($153)|0); HEAP8[$180>>0] = 1; $181 = (($step2_flag) + ($j$147)|0); HEAP8[$181>>0] = 1; $182 = ($175|0)<($room$0|0); if ($182) { $186 = $175 & 1; $187 = ($186|0)==(0); if ($187) { $192 = $175 >>> 1; $193 = (($192) + ($172))|0; $194 = $193&65535; HEAP16[$173>>1] = $194; break; } else { $188 = (($175) + 1)|0; $189 = $188 >>> 1; $190 = (($172) - ($189))|0; $191 = $190&65535; HEAP16[$173>>1] = $191; break; } } else { $183 = ($176|0)>($172|0); if ($183) { HEAP16[$173>>1] = $174; break; } else { $184 = (($147) - ($175))|0; $185 = $184&65535; HEAP16[$173>>1] = $185; break; } } } } while(0); $197 = (($j$147) + 1)|0; $198 = HEAP32[$144>>2]|0; $199 = ($197|0)<($198|0); if ($199) { $j$147 = $197; } else { $148 = $198; break; } } } else { $148 = $145; } $149 = ($148|0)>(0); if ($149) { $150 = HEAP32[$144>>2]|0; $j$251 = 0; while(1) { $200 = (($step2_flag) + ($j$251)|0); $201 = HEAP8[$200>>0]|0; $202 = ($201<<24>>24)==(0); if ($202) { $203 = (($46) + ($j$251<<1)|0); HEAP16[$203>>1] = -1; } $204 = (($j$251) + 1)|0; $205 = ($204|0)<($150|0); if ($205) { $j$251 = $204; } else { break; } } } } } while(0); if ((label|0) == 50) { label = 0; HEAP32[$29>>2] = 1; } $206 = (($i$053) + 1)|0; $207 = HEAP32[$12>>2]|0; $208 = ($206|0)<($207|0); if ($208) { $i$053 = $206; } else { break L1; } } _error($f,21); $$0 = 0; STACKTOP = sp;return ($$0|0); } } while(0); $209 = ((($f)) + 80|0); $210 = HEAP32[$209>>2]|0; $211 = ($210|0)==(0|0); if (!($211)) { $212 = ((($f)) + 84|0); $213 = HEAP32[$212>>2]|0; $214 = ((($f)) + 92|0); $215 = HEAP32[$214>>2]|0; $216 = ($213|0)==($215|0); if (!($216)) { ___assert_fail((15735|0),(15523|0),2953,(16202|0)); // unreachable; } } $217 = HEAP32[$12>>2]|0; $218 = $217 << 2; _memcpy(($really_zero_channel|0),($zero_channel|0),($218|0))|0; $219 = HEAP16[$9>>1]|0; $220 = ($219<<16>>16)==(0); if (!($220)) { $221 = (((($8) + (($6*40)|0)|0)) + 4|0); $222 = HEAP32[$221>>2]|0; $223 = HEAP16[$9>>1]|0; $224 = $223&65535; $i$131 = 0; while(1) { $229 = (($222) + (($i$131*3)|0)|0); $230 = HEAP8[$229>>0]|0; $231 = $230&255; $232 = (($zero_channel) + ($231<<2)|0); $233 = HEAP32[$232>>2]|0; $234 = ($233|0)==(0); if ($234) { label = 61; } else { $235 = (((($222) + (($i$131*3)|0)|0)) + 1|0); $236 = HEAP8[$235>>0]|0; $237 = $236&255; $238 = (($zero_channel) + ($237<<2)|0); $239 = HEAP32[$238>>2]|0; $240 = ($239|0)==(0); if ($240) { label = 61; } } if ((label|0) == 61) { label = 0; $241 = HEAP32[$221>>2]|0; $242 = (((($241) + (($i$131*3)|0)|0)) + 1|0); $243 = HEAP8[$242>>0]|0; $244 = $243&255; $245 = (($zero_channel) + ($244<<2)|0); HEAP32[$245>>2] = 0; $246 = HEAP32[$221>>2]|0; $247 = (($246) + (($i$131*3)|0)|0); $248 = HEAP8[$247>>0]|0; $249 = $248&255; $250 = (($zero_channel) + ($249<<2)|0); HEAP32[$250>>2] = 0; } $251 = (($i$131) + 1)|0; $252 = ($251|0)<($224|0); if ($252) { $i$131 = $251; } else { break; } } } $225 = (((($8) + (($6*40)|0)|0)) + 8|0); $226 = HEAP8[$225>>0]|0; $227 = ($226<<24>>24)==(0); if (!($227)) { $228 = (((($8) + (($6*40)|0)|0)) + 4|0); $i$228 = 0; while(1) { $253 = HEAP32[$12>>2]|0; $254 = ($253|0)>(0); if ($254) { $255 = HEAP32[$228>>2]|0; $256 = HEAP32[$12>>2]|0; $ch$023 = 0;$j$324 = 0; while(1) { $257 = (((($255) + (($j$324*3)|0)|0)) + 2|0); $258 = HEAP8[$257>>0]|0; $259 = $258&255; $260 = ($259|0)==($i$228|0); if ($260) { $261 = (($zero_channel) + ($j$324<<2)|0); $262 = HEAP32[$261>>2]|0; $263 = ($262|0)==(0); $264 = (($do_not_decode) + ($ch$023)|0); if ($263) { HEAP8[$264>>0] = 0; $266 = (((($f)) + 800|0) + ($j$324<<2)|0); $267 = HEAP32[$266>>2]|0; $268 = (($step2_flag) + ($ch$023<<2)|0); HEAP32[$268>>2] = $267; } else { HEAP8[$264>>0] = 1; $265 = (($step2_flag) + ($ch$023<<2)|0); HEAP32[$265>>2] = 0; } $269 = (($ch$023) + 1)|0; $ch$1 = $269; } else { $ch$1 = $ch$023; } $270 = (($j$324) + 1)|0; $271 = ($270|0)<($256|0); if ($271) { $ch$023 = $ch$1;$j$324 = $270; } else { $ch$0$lcssa = $ch$1; break; } } } else { $ch$0$lcssa = 0; } $272 = ((((($8) + (($6*40)|0)|0)) + 24|0) + ($i$228)|0); $273 = HEAP8[$272>>0]|0; $274 = $273&255; _decode_residue($f,$step2_flag,$ch$0$lcssa,$10,$274,$do_not_decode); $275 = (($i$228) + 1)|0; $276 = HEAP8[$225>>0]|0; $277 = $276&255; $278 = ($275|0)<($277|0); if ($278) { $i$228 = $275; } else { break; } } } $279 = HEAP32[$209>>2]|0; $280 = ($279|0)==(0|0); if (!($280)) { $281 = ((($f)) + 84|0); $282 = HEAP32[$281>>2]|0; $283 = ((($f)) + 92|0); $284 = HEAP32[$283>>2]|0; $285 = ($282|0)==($284|0); if (!($285)) { ___assert_fail((15735|0),(15523|0),2986,(16202|0)); // unreachable; } } $286 = HEAP16[$9>>1]|0; $287 = ($286<<16>>16)==(0); if (!($287)) { $288 = $286&65535; $289 = (((($8) + (($6*40)|0)|0)) + 4|0); $290 = HEAP32[$289>>2]|0; $291 = ($10|0)>(0); $i$320$in = $288; while(1) { $i$320 = (($i$320$in) + -1)|0; $296 = (($290) + (($i$320*3)|0)|0); $297 = HEAP8[$296>>0]|0; $298 = $297&255; $299 = (((($f)) + 800|0) + ($298<<2)|0); $300 = HEAP32[$299>>2]|0; $301 = (((($290) + (($i$320*3)|0)|0)) + 1|0); $302 = HEAP8[$301>>0]|0; $303 = $302&255; $304 = (((($f)) + 800|0) + ($303<<2)|0); $305 = HEAP32[$304>>2]|0; if ($291) { $j$416 = 0; while(1) { $306 = (($300) + ($j$416<<2)|0); $307 = +HEAPF32[$306>>2]; $308 = $307 > 0.0; $309 = (($305) + ($j$416<<2)|0); $310 = +HEAPF32[$309>>2]; $311 = $310 > 0.0; do { if ($308) { if ($311) { $312 = $307 - $310; $a2$0 = $312;$m2$0 = $307; break; } else { $313 = $307 + $310; $a2$0 = $307;$m2$0 = $313; break; } } else { if ($311) { $314 = $307 + $310; $a2$0 = $314;$m2$0 = $307; break; } else { $315 = $307 - $310; $a2$0 = $307;$m2$0 = $315; break; } } } while(0); HEAPF32[$306>>2] = $m2$0; HEAPF32[$309>>2] = $a2$0; $316 = (($j$416) + 1)|0; $exitcond = ($316|0)==($10|0); if ($exitcond) { break; } else { $j$416 = $316; } } } $292 = ($i$320$in|0)>(1); if ($292) { $i$320$in = $i$320; } else { break; } } } $293 = HEAP32[$12>>2]|0; $294 = ($293|0)>(0); if ($294) { $295 = $10 << 2; $i$414 = 0; while(1) { $318 = (($really_zero_channel) + ($i$414<<2)|0); $319 = HEAP32[$318>>2]|0; $320 = ($319|0)==(0); $321 = (((($f)) + 800|0) + ($i$414<<2)|0); if ($320) { $323 = HEAP32[$321>>2]|0; $324 = (((($f)) + 996|0) + ($i$414<<2)|0); $325 = HEAP32[$324>>2]|0; _do_floor($f,$9,$i$414,$3,$323,$325); } else { $322 = HEAP32[$321>>2]|0; _memset(($322|0),0,($295|0))|0; } $326 = (($i$414) + 1)|0; $327 = HEAP32[$12>>2]|0; $328 = ($326|0)<($327|0); if ($328) { $i$414 = $326; } else { $$lcssa = $327; break; } } $317 = ($$lcssa|0)>(0); if ($317) { $i$513 = 0; while(1) { $329 = (((($f)) + 800|0) + ($i$513<<2)|0); $330 = HEAP32[$329>>2]|0; $331 = HEAP8[$m>>0]|0; $332 = $331&255; _inverse_mdct($330,$3,$f,$332); $333 = (($i$513) + 1)|0; $334 = HEAP32[$12>>2]|0; $335 = ($333|0)<($334|0); if ($335) { $i$513 = $333; } else { break; } } } } _flush_packet($f); $336 = ((($f)) + 1377|0); $337 = HEAP8[$336>>0]|0; $338 = ($337<<24>>24)==(0); do { if ($338) { $343 = ((($f)) + 1412|0); $344 = HEAP32[$343>>2]|0; $345 = ($344|0)==(0); if ($345) { $$01 = $left_start; } else { $346 = (($right_start) - ($left_start))|0; $347 = ($344|0)<($346|0); if ($347) { $349 = (($344) + ($left_start))|0; HEAP32[$p_left>>2] = $349; HEAP32[$343>>2] = 0; $$01 = $349; break; } else { $348 = (($344) - ($346))|0; HEAP32[$343>>2] = $348; HEAP32[$p_left>>2] = $right_start; $$01 = $right_start; break; } } } else { $339 = ((($f)) + 1060|0); HEAP32[$339>>2] = $11; $340 = (($3) - ($right_end))|0; $341 = ((($f)) + 1412|0); HEAP32[$341>>2] = $340; $342 = ((($f)) + 1064|0); HEAP32[$342>>2] = 1; HEAP8[$336>>0] = 0; $$01 = $left_start; } } while(0); $350 = ((($f)) + 1388|0); $351 = HEAP32[$350>>2]|0; $352 = ((($f)) + 1404|0); $353 = HEAP32[$352>>2]|0; $354 = ($351|0)==($353|0); if ($354) { $355 = ((($f)) + 1064|0); $356 = HEAP32[$355>>2]|0; $357 = ($356|0)==(0); if (!($357)) { $358 = ((($f)) + 1375|0); $359 = HEAP8[$358>>0]|0; $360 = $359 & 4; $361 = ($360<<24>>24)==(0); if (!($361)) { $362 = ((($f)) + 1408|0); $363 = HEAP32[$362>>2]|0; $364 = (($right_end) - ($3))|0; $365 = (($363) + ($364))|0; $366 = ((($f)) + 1060|0); $367 = HEAP32[$366>>2]|0; $368 = (($right_end) - ($$01))|0; $369 = (($368) + ($367))|0; $370 = ($365>>>0)<($369>>>0); if ($370) { $371 = ($365>>>0)<($367>>>0); $372 = (($365) - ($367))|0; $storemerge = $371 ? 0 : $372; $373 = (($storemerge) + ($$01))|0; $374 = ($373|0)>($right_end|0); $right_end$ = $374 ? $right_end : $373; HEAP32[$len>>2] = $right_end$; $375 = HEAP32[$366>>2]|0; $376 = (($375) + ($right_end$))|0; HEAP32[$366>>2] = $376; $$0 = 1; STACKTOP = sp;return ($$0|0); } } } $377 = ((($f)) + 1408|0); $378 = HEAP32[$377>>2]|0; $379 = (($$01) - ($10))|0; $380 = (($379) + ($378))|0; $381 = ((($f)) + 1060|0); HEAP32[$381>>2] = $380; HEAP32[$355>>2] = 1; } $382 = ((($f)) + 1064|0); $383 = HEAP32[$382>>2]|0; $384 = ($383|0)==(0); if (!($384)) { $385 = (($right_start) - ($$01))|0; $386 = ((($f)) + 1060|0); $387 = HEAP32[$386>>2]|0; $388 = (($385) + ($387))|0; HEAP32[$386>>2] = $388; } $389 = HEAP32[$209>>2]|0; $390 = ($389|0)==(0|0); if (!($390)) { $391 = ((($f)) + 84|0); $392 = HEAP32[$391>>2]|0; $393 = ((($f)) + 92|0); $394 = HEAP32[$393>>2]|0; $395 = ($392|0)==($394|0); if (!($395)) { ___assert_fail((15735|0),(15523|0),3102,(16202|0)); // unreachable; } } HEAP32[$len>>2] = $right_end; $$0 = 1; STACKTOP = sp;return ($$0|0); } function _prep_huffman($f) { $f = $f|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 1396|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(25); if (!($2)) { return; } $3 = ($1|0)==(0); if ($3) { $4 = ((($f)) + 1392|0); HEAP32[$4>>2] = 0; } $5 = ((($f)) + 1376|0); $6 = ((($f)) + 1384|0); $7 = ((($f)) + 1392|0); while(1) { $8 = HEAP32[$6>>2]|0; $9 = ($8|0)==(0); if (!($9)) { $10 = HEAP8[$5>>0]|0; $11 = ($10<<24>>24)==(0); if ($11) { label = 9; break; } } $12 = (_get8_packet_raw($f)|0); $13 = ($12|0)==(-1); if ($13) { label = 9; break; } $14 = HEAP32[$0>>2]|0; $15 = $12 << $14; $16 = HEAP32[$7>>2]|0; $17 = (($16) + ($15))|0; HEAP32[$7>>2] = $17; $18 = HEAP32[$0>>2]|0; $19 = (($18) + 8)|0; HEAP32[$0>>2] = $19; $20 = ($19|0)<(25); if (!($20)) { label = 9; break; } } if ((label|0) == 9) { return; } } function _codebook_decode_scalar_raw($f,$c) { $f = $f|0; $c = $c|0; var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa25 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $9 = 0, $i$05 = 0, $i$05$lcssa = 0, $n$07 = 0, $x$0$ = 0, $x$0$lcssa = 0, $x$06 = 0, $x$1 = 0, label = 0, sp = 0; sp = STACKTOP; _prep_huffman($f); $0 = ((($c)) + 32|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $3 = ((($c)) + 2084|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(0|0); if ($5) { $$0 = -1; return ($$0|0); } } $6 = ((($c)) + 4|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)>(8); if ($8) { $9 = ((($c)) + 2084|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)==(0|0); if (!($11)) { label = 6; } } else { $12 = HEAP32[$0>>2]|0; $13 = ($12|0)==(0|0); if ($13) { label = 6; } } if ((label|0) == 6) { $14 = ((($f)) + 1392|0); $15 = HEAP32[$14>>2]|0; $16 = (_bit_reverse($15)|0); $17 = ((($c)) + 2092|0); $18 = HEAP32[$17>>2]|0; $19 = ($18|0)>(1); if ($19) { $20 = ((($c)) + 2084|0); $21 = HEAP32[$20>>2]|0; $n$07 = $18;$x$06 = 0; while(1) { $22 = $n$07 >> 1; $23 = (($22) + ($x$06))|0; $24 = (($21) + ($23<<2)|0); $25 = HEAP32[$24>>2]|0; $26 = ($25>>>0)>($16>>>0); $27 = (($n$07) - ($22))|0; $x$0$ = $26 ? $x$06 : $23; $$ = $26 ? $22 : $27; $28 = ($$|0)>(1); if ($28) { $n$07 = $$;$x$06 = $x$0$; } else { $x$0$lcssa = $x$0$; break; } } } else { $x$0$lcssa = 0; } $29 = ((($c)) + 23|0); $30 = HEAP8[$29>>0]|0; $31 = ($30<<24>>24)==(0); if ($31) { $32 = ((($c)) + 2088|0); $33 = HEAP32[$32>>2]|0; $34 = (($33) + ($x$0$lcssa<<2)|0); $35 = HEAP32[$34>>2]|0; $x$1 = $35; } else { $x$1 = $x$0$lcssa; } $36 = ((($c)) + 8|0); $37 = HEAP32[$36>>2]|0; $38 = (($37) + ($x$1)|0); $39 = HEAP8[$38>>0]|0; $40 = $39&255; $41 = ((($f)) + 1396|0); $42 = HEAP32[$41>>2]|0; $43 = ($42|0)<($40|0); if ($43) { HEAP32[$41>>2] = 0; $$0 = -1; return ($$0|0); } else { $44 = HEAP32[$14>>2]|0; $45 = $44 >>> $40; HEAP32[$14>>2] = $45; $46 = HEAP32[$41>>2]|0; $47 = (($46) - ($40))|0; HEAP32[$41>>2] = $47; $$0 = $x$1; return ($$0|0); } } $48 = ((($c)) + 23|0); $49 = HEAP8[$48>>0]|0; $50 = ($49<<24>>24)==(0); if (!($50)) { ___assert_fail((16380|0),(15523|0),1248,(16391|0)); // unreachable; } $51 = HEAP32[$6>>2]|0; $52 = ($51|0)>(0); L27: do { if ($52) { $53 = ((($c)) + 8|0); $54 = HEAP32[$53>>2]|0; $55 = ((($f)) + 1392|0); $i$05 = 0; while(1) { $56 = (($54) + ($i$05)|0); $57 = HEAP8[$56>>0]|0; $58 = $57&255; $59 = ($57<<24>>24)==(-1); if (!($59)) { $60 = HEAP32[$0>>2]|0; $61 = (($60) + ($i$05<<2)|0); $62 = HEAP32[$61>>2]|0; $63 = HEAP32[$55>>2]|0; $64 = 1 << $58; $65 = (($64) + -1)|0; $66 = $63 & $65; $67 = ($62|0)==($66|0); if ($67) { $$lcssa = $58;$$lcssa25 = $63;$i$05$lcssa = $i$05; break; } } $78 = (($i$05) + 1)|0; $79 = HEAP32[$6>>2]|0; $80 = ($78|0)<($79|0); if ($80) { $i$05 = $78; } else { break L27; } } $68 = ((($f)) + 1396|0); $69 = HEAP32[$68>>2]|0; $70 = ($69|0)<($$lcssa|0); if ($70) { HEAP32[$68>>2] = 0; $$0 = -1; return ($$0|0); } else { $71 = $$lcssa25 >>> $$lcssa; HEAP32[$55>>2] = $71; $72 = HEAP32[$53>>2]|0; $73 = (($72) + ($i$05$lcssa)|0); $74 = HEAP8[$73>>0]|0; $75 = $74&255; $76 = HEAP32[$68>>2]|0; $77 = (($76) - ($75))|0; HEAP32[$68>>2] = $77; $$0 = $i$05$lcssa; return ($$0|0); } } } while(0); _error($f,21); $81 = ((($f)) + 1396|0); HEAP32[$81>>2] = 0; $$0 = -1; return ($$0|0); } function _predict_point($x,$x0,$x1,$y0,$y1) { $x = $x|0; $x0 = $x0|0; $x1 = $x1|0; $y0 = $y0|0; $y1 = $y1|0; var $$p = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $ispos = 0, $neg = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (($y1) - ($y0))|0; $1 = (($x1) - ($x0))|0; $ispos = ($0|0)>(-1); $neg = (0 - ($0))|0; $2 = $ispos ? $0 : $neg; $3 = (($x) - ($x0))|0; $4 = Math_imul($2, $3)|0; $5 = (($4|0) / ($1|0))&-1; $6 = ($0|0)<(0); $7 = (0 - ($5))|0; $$p = $6 ? $7 : $5; $8 = (($$p) + ($y0))|0; return ($8|0); } function _decode_residue($f,$residue_buffers,$ch,$n,$rn,$do_not_decode) { $f = $f|0; $residue_buffers = $residue_buffers|0; $ch = $ch|0; $n = $n|0; $rn = $rn|0; $do_not_decode = $do_not_decode|0; var $$ = 0, $$10 = 0, $$11 = 0, $$13 = 0, $$14 = 0, $$5 = 0, $$7 = 0, $$8 = 0, $$alloca_mul = 0, $$not = 0, $$not115 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0; var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0; var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0; var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0; var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0; var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0; var $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0; var $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0; var $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0; var $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0; var $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0; var $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0; var $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0; var $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0; var $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0; var $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $c_inter = 0, $c_inter16 = 0, $c_inter6 = 0; var $class_set$055 = 0, $class_set$147 = 0, $class_set$263 = 0, $class_set26$087 = 0, $exitcond = 0, $i$092 = 0, $i$152 = 0, $i$246 = 0, $i$360 = 0, $i$484 = 0, $j$0$lcssa = 0, $j$070 = 0, $j$175 = 0, $j$278 = 0, $or$cond = 0, $or$cond12 = 0, $or$cond1258 = 0, $or$cond15 = 0, $or$cond1581 = 0, $or$cond6 = 0; var $or$cond650 = 0, $or$cond9 = 0, $or$cond944 = 0, $p_inter = 0, $p_inter17 = 0, $p_inter7 = 0, $pass$066 = 0, $pass$190 = 0, $pcount$056 = 0, $pcount$1$lcssa = 0, $pcount$151 = 0, $pcount$248 = 0, $pcount$3$lcssa = 0, $pcount$345 = 0, $pcount$464 = 0, $pcount$5$lcssa = 0, $pcount$559 = 0, $pcount25$086 = 0, $pcount25$1$lcssa = 0, $pcount25$182 = 0; var $q$0 = 0, $q$1 = 0, $q19$0 = 0, $q19$1 = 0, $q9$0 = 0, $q9$1 = 0, $temp$0 = 0, $temp$1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $c_inter = sp + 20|0; $p_inter = sp + 16|0; $c_inter6 = sp + 12|0; $p_inter7 = sp + 8|0; $c_inter16 = sp + 4|0; $p_inter17 = sp; $0 = ((($f)) + 396|0); $1 = HEAP32[$0>>2]|0; $2 = (((($f)) + 268|0) + ($rn<<1)|0); $3 = HEAP16[$2>>1]|0; $4 = $3&65535; $5 = (((($1) + (($rn*24)|0)|0)) + 13|0); $6 = HEAP8[$5>>0]|0; $7 = $6&255; $8 = ((($f)) + 124|0); $9 = HEAP32[$8>>2]|0; $10 = (($9) + (($7*2096)|0)|0); $11 = HEAP32[$10>>2]|0; $12 = (((($1) + (($rn*24)|0)|0)) + 4|0); $13 = HEAP32[$12>>2]|0; $14 = (($1) + (($rn*24)|0)|0); $15 = HEAP32[$14>>2]|0; $16 = (($13) - ($15))|0; $17 = (((($1) + (($rn*24)|0)|0)) + 8|0); $18 = HEAP32[$17>>2]|0; $19 = (($16>>>0) / ($18>>>0))&-1; $20 = ((($f)) + 92|0); $21 = HEAP32[$20>>2]|0; $22 = ((($f)) + 80|0); $23 = HEAP32[$22>>2]|0; $24 = ($23|0)==(0|0); $25 = ((($f)) + 4|0); $26 = HEAP32[$25>>2]|0; $27 = $19 << 2; $28 = (($27) + 4)|0; $29 = Math_imul($26, $28)|0; if ($24) { $$alloca_mul = $29; $31 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;; $33 = $31; } else { $30 = (_setup_temp_malloc($f,$29)|0); $33 = $30; } $32 = HEAP32[$25>>2]|0; $34 = (_make_block_array($33,$32,$27)|0); $35 = ($ch|0)>(0); if ($35) { $36 = $n << 2; $i$092 = 0; while(1) { $37 = (($do_not_decode) + ($i$092)|0); $38 = HEAP8[$37>>0]|0; $39 = ($38<<24>>24)==(0); if ($39) { $40 = (($residue_buffers) + ($i$092<<2)|0); $41 = HEAP32[$40>>2]|0; _memset(($41|0),0,($36|0))|0; } $42 = (($i$092) + 1)|0; $exitcond = ($42|0)==($ch|0); if ($exitcond) { break; } else { $i$092 = $42; } } } $43 = ($3<<16>>16)==(2); $44 = ($ch|0)!=(1); $or$cond = $44 & $43; if (!($or$cond)) { $45 = ($19|0)>(0); $46 = ($11|0)>(0); $47 = ($ch|0)>(0); $48 = (((($1) + (($rn*24)|0)|0)) + 20|0); $49 = ((($f)) + 1396|0); $50 = ((($f)) + 1392|0); $51 = (((($1) + (($rn*24)|0)|0)) + 16|0); $$not115 = ($ch|0)<(1); $pass$190 = 0; L15: while(1) { if ($45) { $$not = ($pass$190|0)!=(0); $brmerge = $$not | $$not115; $class_set26$087 = 0;$pcount25$086 = 0; while(1) { if (!($brmerge)) { $j$175 = 0; while(1) { $289 = (($do_not_decode) + ($j$175)|0); $290 = HEAP8[$289>>0]|0; $291 = ($290<<24>>24)==(0); if ($291) { $292 = HEAP32[$8>>2]|0; $293 = HEAP8[$5>>0]|0; $294 = $293&255; $295 = (($292) + (($294*2096)|0)|0); $296 = HEAP32[$49>>2]|0; $297 = ($296|0)<(10); if ($297) { _prep_huffman($f); } $298 = HEAP32[$50>>2]|0; $299 = $298 & 1023; $300 = ((((($292) + (($294*2096)|0)|0)) + 36|0) + ($299<<1)|0); $301 = HEAP16[$300>>1]|0; $302 = $301 << 16 >> 16; $303 = ($301<<16>>16)>(-1); if ($303) { $304 = (((($292) + (($294*2096)|0)|0)) + 8|0); $305 = HEAP32[$304>>2]|0; $306 = (($305) + ($302)|0); $307 = HEAP8[$306>>0]|0; $308 = $307&255; $309 = $298 >>> $308; HEAP32[$50>>2] = $309; $310 = HEAP32[$49>>2]|0; $311 = (($310) - ($308))|0; $312 = ($311|0)<(0); $$13 = $312 ? 0 : $311; HEAP32[$49>>2] = $$13; $$14 = $312 ? -1 : $302; $temp$0 = $$14; } else { $313 = (_codebook_decode_scalar_raw($f,$295)|0); $temp$0 = $313; } $314 = (((($292) + (($294*2096)|0)|0)) + 23|0); $315 = HEAP8[$314>>0]|0; $316 = ($315<<24>>24)==(0); if ($316) { $temp$1 = $temp$0; } else { $317 = (((($292) + (($294*2096)|0)|0)) + 2088|0); $318 = HEAP32[$317>>2]|0; $319 = (($318) + ($temp$0<<2)|0); $320 = HEAP32[$319>>2]|0; $temp$1 = $320; } $321 = ($temp$1|0)==(-1); if ($321) { label = 95; break L15; } $322 = HEAP32[$51>>2]|0; $323 = (($322) + ($temp$1<<2)|0); $324 = HEAP32[$323>>2]|0; $325 = (($34) + ($j$175<<2)|0); $326 = HEAP32[$325>>2]|0; $327 = (($326) + ($class_set26$087<<2)|0); HEAP32[$327>>2] = $324; } $328 = (($j$175) + 1)|0; $329 = ($328|0)<($ch|0); if ($329) { $j$175 = $328; } else { break; } } } $288 = ($pcount25$086|0)<($19|0); $or$cond1581 = $288 & $46; if ($or$cond1581) { $i$484 = 0;$pcount25$182 = $pcount25$086; while(1) { if ($47) { $j$278 = 0; while(1) { $330 = (($do_not_decode) + ($j$278)|0); $331 = HEAP8[$330>>0]|0; $332 = ($331<<24>>24)==(0); if ($332) { $333 = (($34) + ($j$278<<2)|0); $334 = HEAP32[$333>>2]|0; $335 = (($334) + ($class_set26$087<<2)|0); $336 = HEAP32[$335>>2]|0; $337 = (($336) + ($i$484)|0); $338 = HEAP8[$337>>0]|0; $339 = $338&255; $340 = HEAP32[$48>>2]|0; $341 = ((($340) + ($339<<4)|0) + ($pass$190<<1)|0); $342 = HEAP16[$341>>1]|0; $343 = ($342<<16>>16)>(-1); if ($343) { $344 = $342 << 16 >> 16; $345 = (($residue_buffers) + ($j$278<<2)|0); $346 = HEAP32[$345>>2]|0; $347 = HEAP32[$14>>2]|0; $348 = HEAP32[$17>>2]|0; $349 = Math_imul($348, $pcount25$182)|0; $350 = (($349) + ($347))|0; $351 = HEAP32[$8>>2]|0; $352 = (($351) + (($344*2096)|0)|0); $353 = (_residue_decode($f,$352,$346,$350,$348,$4)|0); $354 = ($353|0)==(0); if ($354) { label = 95; break L15; } } } $355 = (($j$278) + 1)|0; $356 = ($355|0)<($ch|0); if ($356) { $j$278 = $355; } else { break; } } } $357 = (($i$484) + 1)|0; $358 = (($pcount25$182) + 1)|0; $359 = ($357|0)<($11|0); $360 = ($358|0)<($19|0); $or$cond15 = $360 & $359; if ($or$cond15) { $i$484 = $357;$pcount25$182 = $358; } else { $pcount25$1$lcssa = $358; break; } } } else { $pcount25$1$lcssa = $pcount25$086; } $361 = (($class_set26$087) + 1)|0; $362 = ($pcount25$1$lcssa|0)<($19|0); if ($362) { $class_set26$087 = $361;$pcount25$086 = $pcount25$1$lcssa; } else { break; } } } $363 = (($pass$190) + 1)|0; $364 = ($363|0)<(8); if ($364) { $pass$190 = $363; } else { label = 95; break; } } if ((label|0) == 95) { HEAP32[$20>>2] = $21; STACKTOP = sp;return; } } $52 = ($ch|0)>(0); L57: do { if ($52) { $j$070 = 0; while(1) { $53 = (($do_not_decode) + ($j$070)|0); $54 = HEAP8[$53>>0]|0; $55 = ($54<<24>>24)==(0); if ($55) { $j$0$lcssa = $j$070; break L57; } $56 = (($j$070) + 1)|0; $57 = ($56|0)<($ch|0); if ($57) { $j$070 = $56; } else { $j$0$lcssa = $56; break; } } } else { $j$0$lcssa = 0; } } while(0); $58 = ($j$0$lcssa|0)==($ch|0); if ($58) { HEAP32[$20>>2] = $21; STACKTOP = sp;return; } $59 = ($19|0)>(0); $60 = ((($f)) + 1396|0); $61 = ((($f)) + 1392|0); $62 = (((($1) + (($rn*24)|0)|0)) + 16|0); $63 = ($11|0)>(0); $64 = (((($1) + (($rn*24)|0)|0)) + 20|0); $65 = ($19|0)>(0); $66 = ((($f)) + 1396|0); $67 = ((($f)) + 1392|0); $68 = (((($1) + (($rn*24)|0)|0)) + 16|0); $69 = ($11|0)>(0); $70 = (((($1) + (($rn*24)|0)|0)) + 20|0); $71 = ($19|0)>(0); $72 = ((($f)) + 1396|0); $73 = ((($f)) + 1392|0); $74 = (((($1) + (($rn*24)|0)|0)) + 16|0); $75 = ($11|0)>(0); $76 = (((($1) + (($rn*24)|0)|0)) + 20|0); $pass$066 = 0; L65: while(1) { switch ($ch|0) { case 2: { if ($65) { $78 = ($pass$066|0)==(0); $class_set$055 = 0;$pcount$056 = 0; while(1) { $80 = HEAP32[$14>>2]|0; $81 = HEAP32[$17>>2]|0; $82 = Math_imul($81, $pcount$056)|0; $83 = (($82) + ($80))|0; $84 = $83 & 1; HEAP32[$c_inter>>2] = $84; $85 = $83 >> 1; HEAP32[$p_inter>>2] = $85; if ($78) { $86 = HEAP32[$8>>2]|0; $87 = HEAP8[$5>>0]|0; $88 = $87&255; $89 = (($86) + (($88*2096)|0)|0); $90 = HEAP32[$66>>2]|0; $91 = ($90|0)<(10); if ($91) { _prep_huffman($f); } $92 = HEAP32[$67>>2]|0; $93 = $92 & 1023; $94 = ((((($86) + (($88*2096)|0)|0)) + 36|0) + ($93<<1)|0); $95 = HEAP16[$94>>1]|0; $96 = $95 << 16 >> 16; $97 = ($95<<16>>16)>(-1); if ($97) { $98 = (((($86) + (($88*2096)|0)|0)) + 8|0); $99 = HEAP32[$98>>2]|0; $100 = (($99) + ($96)|0); $101 = HEAP8[$100>>0]|0; $102 = $101&255; $103 = $92 >>> $102; HEAP32[$67>>2] = $103; $104 = HEAP32[$66>>2]|0; $105 = (($104) - ($102))|0; $106 = ($105|0)<(0); $$ = $106 ? 0 : $105; HEAP32[$66>>2] = $$; $$5 = $106 ? -1 : $96; $q$0 = $$5; } else { $107 = (_codebook_decode_scalar_raw($f,$89)|0); $q$0 = $107; } $108 = (((($86) + (($88*2096)|0)|0)) + 23|0); $109 = HEAP8[$108>>0]|0; $110 = ($109<<24>>24)==(0); if ($110) { $q$1 = $q$0; } else { $111 = (((($86) + (($88*2096)|0)|0)) + 2088|0); $112 = HEAP32[$111>>2]|0; $113 = (($112) + ($q$0<<2)|0); $114 = HEAP32[$113>>2]|0; $q$1 = $114; } $115 = ($q$1|0)==(-1); if ($115) { label = 95; break L65; } $116 = HEAP32[$68>>2]|0; $117 = (($116) + ($q$1<<2)|0); $118 = HEAP32[$117>>2]|0; $119 = HEAP32[$34>>2]|0; $120 = (($119) + ($class_set$055<<2)|0); HEAP32[$120>>2] = $118; } $121 = ($pcount$056|0)<($19|0); $or$cond650 = $121 & $69; if ($or$cond650) { $i$152 = 0;$pcount$151 = $pcount$056; while(1) { $122 = HEAP32[$17>>2]|0; $123 = HEAP32[$34>>2]|0; $124 = (($123) + ($class_set$055<<2)|0); $125 = HEAP32[$124>>2]|0; $126 = (($125) + ($i$152)|0); $127 = HEAP8[$126>>0]|0; $128 = $127&255; $129 = HEAP32[$70>>2]|0; $130 = ((($129) + ($128<<4)|0) + ($pass$066<<1)|0); $131 = HEAP16[$130>>1]|0; $132 = ($131<<16>>16)>(-1); if ($132) { $133 = $131 << 16 >> 16; $134 = HEAP32[$8>>2]|0; $135 = (($134) + (($133*2096)|0)|0); $136 = (_codebook_decode_deinterleave_repeat($f,$135,$residue_buffers,$ch,$c_inter,$p_inter,$n,$122)|0); $137 = ($136|0)==(0); if ($137) { label = 95; break L65; } } else { $138 = HEAP32[$14>>2]|0; $139 = Math_imul($122, $pcount$151)|0; $140 = (($139) + ($122))|0; $141 = (($140) + ($138))|0; $142 = $141 & 1; HEAP32[$c_inter>>2] = $142; $143 = $141 >> 1; HEAP32[$p_inter>>2] = $143; } $144 = (($i$152) + 1)|0; $145 = (($pcount$151) + 1)|0; $146 = ($144|0)<($11|0); $147 = ($145|0)<($19|0); $or$cond6 = $147 & $146; if ($or$cond6) { $i$152 = $144;$pcount$151 = $145; } else { $pcount$1$lcssa = $145; break; } } } else { $pcount$1$lcssa = $pcount$056; } $148 = (($class_set$055) + 1)|0; $149 = ($pcount$1$lcssa|0)<($19|0); if ($149) { $class_set$055 = $148;$pcount$056 = $pcount$1$lcssa; } else { break; } } } break; } case 1: { if ($71) { $77 = ($pass$066|0)==(0); $class_set$147 = 0;$pcount$248 = 0; while(1) { $150 = HEAP32[$14>>2]|0; $151 = HEAP32[$17>>2]|0; $152 = Math_imul($151, $pcount$248)|0; $153 = (($152) + ($150))|0; HEAP32[$c_inter6>>2] = 0; HEAP32[$p_inter7>>2] = $153; if ($77) { $154 = HEAP32[$8>>2]|0; $155 = HEAP8[$5>>0]|0; $156 = $155&255; $157 = (($154) + (($156*2096)|0)|0); $158 = HEAP32[$72>>2]|0; $159 = ($158|0)<(10); if ($159) { _prep_huffman($f); } $160 = HEAP32[$73>>2]|0; $161 = $160 & 1023; $162 = ((((($154) + (($156*2096)|0)|0)) + 36|0) + ($161<<1)|0); $163 = HEAP16[$162>>1]|0; $164 = $163 << 16 >> 16; $165 = ($163<<16>>16)>(-1); if ($165) { $166 = (((($154) + (($156*2096)|0)|0)) + 8|0); $167 = HEAP32[$166>>2]|0; $168 = (($167) + ($164)|0); $169 = HEAP8[$168>>0]|0; $170 = $169&255; $171 = $160 >>> $170; HEAP32[$73>>2] = $171; $172 = HEAP32[$72>>2]|0; $173 = (($172) - ($170))|0; $174 = ($173|0)<(0); $$7 = $174 ? 0 : $173; HEAP32[$72>>2] = $$7; $$8 = $174 ? -1 : $164; $q9$0 = $$8; } else { $175 = (_codebook_decode_scalar_raw($f,$157)|0); $q9$0 = $175; } $176 = (((($154) + (($156*2096)|0)|0)) + 23|0); $177 = HEAP8[$176>>0]|0; $178 = ($177<<24>>24)==(0); if ($178) { $q9$1 = $q9$0; } else { $179 = (((($154) + (($156*2096)|0)|0)) + 2088|0); $180 = HEAP32[$179>>2]|0; $181 = (($180) + ($q9$0<<2)|0); $182 = HEAP32[$181>>2]|0; $q9$1 = $182; } $183 = ($q9$1|0)==(-1); if ($183) { label = 95; break L65; } $184 = HEAP32[$74>>2]|0; $185 = (($184) + ($q9$1<<2)|0); $186 = HEAP32[$185>>2]|0; $187 = HEAP32[$34>>2]|0; $188 = (($187) + ($class_set$147<<2)|0); HEAP32[$188>>2] = $186; } $189 = ($pcount$248|0)<($19|0); $or$cond944 = $189 & $75; if ($or$cond944) { $i$246 = 0;$pcount$345 = $pcount$248; while(1) { $190 = HEAP32[$17>>2]|0; $191 = HEAP32[$34>>2]|0; $192 = (($191) + ($class_set$147<<2)|0); $193 = HEAP32[$192>>2]|0; $194 = (($193) + ($i$246)|0); $195 = HEAP8[$194>>0]|0; $196 = $195&255; $197 = HEAP32[$76>>2]|0; $198 = ((($197) + ($196<<4)|0) + ($pass$066<<1)|0); $199 = HEAP16[$198>>1]|0; $200 = ($199<<16>>16)>(-1); if ($200) { $201 = $199 << 16 >> 16; $202 = HEAP32[$8>>2]|0; $203 = (($202) + (($201*2096)|0)|0); $204 = (_codebook_decode_deinterleave_repeat($f,$203,$residue_buffers,$ch,$c_inter6,$p_inter7,$n,$190)|0); $205 = ($204|0)==(0); if ($205) { label = 95; break L65; } } else { $206 = HEAP32[$14>>2]|0; $207 = Math_imul($190, $pcount$345)|0; $208 = (($207) + ($190))|0; $209 = (($208) + ($206))|0; HEAP32[$c_inter6>>2] = 0; HEAP32[$p_inter7>>2] = $209; } $210 = (($i$246) + 1)|0; $211 = (($pcount$345) + 1)|0; $212 = ($210|0)<($11|0); $213 = ($211|0)<($19|0); $or$cond9 = $213 & $212; if ($or$cond9) { $i$246 = $210;$pcount$345 = $211; } else { $pcount$3$lcssa = $211; break; } } } else { $pcount$3$lcssa = $pcount$248; } $214 = (($class_set$147) + 1)|0; $215 = ($pcount$3$lcssa|0)<($19|0); if ($215) { $class_set$147 = $214;$pcount$248 = $pcount$3$lcssa; } else { break; } } } break; } default: { if ($59) { $79 = ($pass$066|0)==(0); $class_set$263 = 0;$pcount$464 = 0; while(1) { $216 = HEAP32[$14>>2]|0; $217 = HEAP32[$17>>2]|0; $218 = Math_imul($217, $pcount$464)|0; $219 = (($218) + ($216))|0; $220 = (($219|0) % ($ch|0))&-1; HEAP32[$c_inter16>>2] = $220; $221 = (($219|0) / ($ch|0))&-1; HEAP32[$p_inter17>>2] = $221; if ($79) { $222 = HEAP32[$8>>2]|0; $223 = HEAP8[$5>>0]|0; $224 = $223&255; $225 = (($222) + (($224*2096)|0)|0); $226 = HEAP32[$60>>2]|0; $227 = ($226|0)<(10); if ($227) { _prep_huffman($f); } $228 = HEAP32[$61>>2]|0; $229 = $228 & 1023; $230 = ((((($222) + (($224*2096)|0)|0)) + 36|0) + ($229<<1)|0); $231 = HEAP16[$230>>1]|0; $232 = $231 << 16 >> 16; $233 = ($231<<16>>16)>(-1); if ($233) { $234 = (((($222) + (($224*2096)|0)|0)) + 8|0); $235 = HEAP32[$234>>2]|0; $236 = (($235) + ($232)|0); $237 = HEAP8[$236>>0]|0; $238 = $237&255; $239 = $228 >>> $238; HEAP32[$61>>2] = $239; $240 = HEAP32[$60>>2]|0; $241 = (($240) - ($238))|0; $242 = ($241|0)<(0); $$10 = $242 ? 0 : $241; HEAP32[$60>>2] = $$10; $$11 = $242 ? -1 : $232; $q19$0 = $$11; } else { $243 = (_codebook_decode_scalar_raw($f,$225)|0); $q19$0 = $243; } $244 = (((($222) + (($224*2096)|0)|0)) + 23|0); $245 = HEAP8[$244>>0]|0; $246 = ($245<<24>>24)==(0); if ($246) { $q19$1 = $q19$0; } else { $247 = (((($222) + (($224*2096)|0)|0)) + 2088|0); $248 = HEAP32[$247>>2]|0; $249 = (($248) + ($q19$0<<2)|0); $250 = HEAP32[$249>>2]|0; $q19$1 = $250; } $251 = ($q19$1|0)==(-1); if ($251) { label = 95; break L65; } $252 = HEAP32[$62>>2]|0; $253 = (($252) + ($q19$1<<2)|0); $254 = HEAP32[$253>>2]|0; $255 = HEAP32[$34>>2]|0; $256 = (($255) + ($class_set$263<<2)|0); HEAP32[$256>>2] = $254; } $257 = ($pcount$464|0)<($19|0); $or$cond1258 = $257 & $63; if ($or$cond1258) { $i$360 = 0;$pcount$559 = $pcount$464; while(1) { $258 = HEAP32[$17>>2]|0; $259 = HEAP32[$34>>2]|0; $260 = (($259) + ($class_set$263<<2)|0); $261 = HEAP32[$260>>2]|0; $262 = (($261) + ($i$360)|0); $263 = HEAP8[$262>>0]|0; $264 = $263&255; $265 = HEAP32[$64>>2]|0; $266 = ((($265) + ($264<<4)|0) + ($pass$066<<1)|0); $267 = HEAP16[$266>>1]|0; $268 = ($267<<16>>16)>(-1); if ($268) { $269 = $267 << 16 >> 16; $270 = HEAP32[$8>>2]|0; $271 = (($270) + (($269*2096)|0)|0); $272 = (_codebook_decode_deinterleave_repeat($f,$271,$residue_buffers,$ch,$c_inter16,$p_inter17,$n,$258)|0); $273 = ($272|0)==(0); if ($273) { label = 95; break L65; } } else { $274 = HEAP32[$14>>2]|0; $275 = Math_imul($258, $pcount$559)|0; $276 = (($275) + ($258))|0; $277 = (($276) + ($274))|0; $278 = (($277|0) % ($ch|0))&-1; HEAP32[$c_inter16>>2] = $278; $279 = (($277|0) / ($ch|0))&-1; HEAP32[$p_inter17>>2] = $279; } $280 = (($i$360) + 1)|0; $281 = (($pcount$559) + 1)|0; $282 = ($280|0)<($11|0); $283 = ($281|0)<($19|0); $or$cond12 = $283 & $282; if ($or$cond12) { $i$360 = $280;$pcount$559 = $281; } else { $pcount$5$lcssa = $281; break; } } } else { $pcount$5$lcssa = $pcount$464; } $284 = (($class_set$263) + 1)|0; $285 = ($pcount$5$lcssa|0)<($19|0); if ($285) { $class_set$263 = $284;$pcount$464 = $pcount$5$lcssa; } else { break; } } } } } $286 = (($pass$066) + 1)|0; $287 = ($286|0)<(8); if ($287) { $pass$066 = $286; } else { label = 95; break; } } if ((label|0) == 95) { HEAP32[$20>>2] = $21; STACKTOP = sp;return; } } function _do_floor($f,$map,$i,$n,$target,$finalY) { $f = $f|0; $map = $map|0; $i = $i|0; $n = $n|0; $target = $target|0; $finalY = $finalY|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0; var $45 = 0.0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $j$01 = 0, $lx$0$lcssa = 0, $lx$03 = 0, $lx$1 = 0, $ly$0$lcssa = 0, $ly$04 = 0, $ly$1 = 0, $q$02 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n >> 1; $1 = ((($map)) + 4|0); $2 = HEAP32[$1>>2]|0; $3 = (((($2) + (($i*3)|0)|0)) + 2|0); $4 = HEAP8[$3>>0]|0; $5 = $4&255; $6 = (((($map)) + 9|0) + ($5)|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = (((($f)) + 132|0) + ($8<<1)|0); $10 = HEAP16[$9>>1]|0; $11 = ($10<<16>>16)==(0); if ($11) { _error($f,21); return; } $12 = ((($f)) + 260|0); $13 = HEAP32[$12>>2]|0; $14 = HEAP16[$finalY>>1]|0; $15 = $14 << 16 >> 16; $16 = (((($13) + (($8*1596)|0)|0)) + 1588|0); $17 = HEAP8[$16>>0]|0; $18 = $17&255; $19 = Math_imul($18, $15)|0; $20 = (((($13) + (($8*1596)|0)|0)) + 1592|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)>(1); if ($22) { $lx$03 = 0;$ly$04 = $19;$q$02 = 1; while(1) { $23 = ((((($13) + (($8*1596)|0)|0)) + 838|0) + ($q$02)|0); $24 = HEAP8[$23>>0]|0; $25 = $24&255; $26 = (($finalY) + ($25<<1)|0); $27 = HEAP16[$26>>1]|0; $28 = ($27<<16>>16)>(-1); if ($28) { $29 = $27 << 16 >> 16; $30 = HEAP8[$16>>0]|0; $31 = $30&255; $32 = Math_imul($31, $29)|0; $33 = ((((($13) + (($8*1596)|0)|0)) + 338|0) + ($25<<1)|0); $34 = HEAP16[$33>>1]|0; $35 = $34&65535; $36 = ($lx$03|0)==($35|0); if ($36) { $lx$1 = $35;$ly$1 = $32; } else { _draw_line($target,$lx$03,$ly$04,$35,$32,$0); $lx$1 = $35;$ly$1 = $32; } } else { $lx$1 = $lx$03;$ly$1 = $ly$04; } $37 = (($q$02) + 1)|0; $38 = HEAP32[$20>>2]|0; $39 = ($37|0)<($38|0); if ($39) { $lx$03 = $lx$1;$ly$04 = $ly$1;$q$02 = $37; } else { $lx$0$lcssa = $lx$1;$ly$0$lcssa = $ly$1; break; } } } else { $lx$0$lcssa = 0;$ly$0$lcssa = $19; } $40 = ($lx$0$lcssa|0)<($0|0); if (!($40)) { return; } $41 = (6864 + ($ly$0$lcssa<<2)|0); $42 = +HEAPF32[$41>>2]; $j$01 = $lx$0$lcssa; while(1) { $43 = (($target) + ($j$01<<2)|0); $44 = +HEAPF32[$43>>2]; $45 = $42 * $44; HEAPF32[$43>>2] = $45; $46 = (($j$01) + 1)|0; $exitcond = ($46|0)==($0|0); if ($exitcond) { break; } else { $j$01 = $46; } } return; } function _inverse_mdct($buffer,$n,$f,$blocktype) { $buffer = $buffer|0; $n = $n|0; $f = $f|0; $blocktype = $blocktype|0; var $$alloca_mul = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0; var $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0; var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0; var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0; var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0; var $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0; var $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0; var $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0.0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0.0; var $241 = 0.0, $242 = 0, $243 = 0.0, $244 = 0.0, $245 = 0.0, $246 = 0.0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0.0, $250 = 0.0, $251 = 0.0, $252 = 0.0, $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0.0, $257 = 0, $258 = 0.0, $259 = 0.0; var $26 = 0.0, $260 = 0.0, $261 = 0, $262 = 0.0, $263 = 0, $264 = 0.0, $265 = 0.0, $266 = 0, $267 = 0.0, $268 = 0.0, $269 = 0, $27 = 0.0, $270 = 0.0, $271 = 0.0, $272 = 0.0, $273 = 0.0, $274 = 0.0, $275 = 0.0, $276 = 0.0, $277 = 0.0; var $278 = 0.0, $279 = 0.0, $28 = 0, $280 = 0.0, $281 = 0.0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0.0; var $296 = 0, $297 = 0.0, $298 = 0.0, $299 = 0, $3 = 0, $30 = 0, $300 = 0.0, $301 = 0, $302 = 0.0, $303 = 0.0, $304 = 0.0, $305 = 0.0, $306 = 0.0, $307 = 0.0, $308 = 0.0, $309 = 0.0, $31 = 0.0, $310 = 0, $311 = 0, $312 = 0; var $313 = 0.0, $314 = 0, $315 = 0.0, $316 = 0.0, $317 = 0, $318 = 0.0, $319 = 0, $32 = 0.0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0.0, $325 = 0.0, $326 = 0.0, $327 = 0, $328 = 0.0, $329 = 0, $33 = 0.0, $330 = 0; var $331 = 0, $332 = 0, $333 = 0.0, $334 = 0, $335 = 0.0, $336 = 0.0, $337 = 0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0.0, $347 = 0, $348 = 0.0, $349 = 0; var $35 = 0.0, $350 = 0, $351 = 0, $352 = 0.0, $353 = 0, $354 = 0.0, $355 = 0.0, $356 = 0, $357 = 0.0, $358 = 0.0, $359 = 0.0, $36 = 0.0, $360 = 0.0, $361 = 0.0, $362 = 0.0, $363 = 0.0, $364 = 0.0, $365 = 0, $366 = 0.0, $367 = 0; var $368 = 0, $369 = 0, $37 = 0.0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0; var $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $A0$024 = 0, $AA$0$lcssa = 0, $AA$050 = 0, $AA$144 = 0; var $AA1$040 = 0, $B$08 = 0, $C$010 = 0, $bitrev$016 = 0, $d$0$lcssa = 0, $d$052 = 0, $d$146 = 0, $d0$039 = 0, $d05$017 = 0, $d09$04 = 0, $d1$038 = 0, $d110$05 = 0, $d16$018 = 0, $d2$06 = 0, $d3$07 = 0, $d7$011 = 0, $e$051 = 0, $e$145 = 0, $e0$037 = 0, $e1$036 = 0; var $e11$09 = 0, $e8$012 = 0, $exitcond = 0, $exitcond60 = 0, $i$030 = 0, $i_off$023 = 0, $l$0$lcssa = 0, $l$033 = 0, $l$127 = 0, $r$022 = 0, $scevgep = 0, $scevgep61 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n >> 1; $1 = $n >> 2; $2 = $n >> 3; $3 = ((($f)) + 92|0); $4 = HEAP32[$3>>2]|0; $5 = ((($f)) + 80|0); $6 = HEAP32[$5>>2]|0; $7 = ($6|0)==(0|0); $8 = $0 << 2; if ($7) { $$alloca_mul = $8; $10 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;; $15 = $10; } else { $9 = (_setup_temp_malloc($f,$8)|0); $15 = $9; } $11 = (((($f)) + 1068|0) + ($blocktype<<2)|0); $12 = HEAP32[$11>>2]|0; $13 = (($0) + -2)|0; $14 = (($15) + ($13<<2)|0); $16 = (($buffer) + ($0<<2)|0); $17 = ($0|0)==(0); if ($17) { $AA$0$lcssa = $12;$d$0$lcssa = $14; } else { $18 = $0 << 2; $19 = (($18) + -16)|0; $20 = $19 >>> 4; $21 = $20 << 1; $22 = (($21) + 2)|0; $23 = $20 << 3; $24 = (($19) - ($23))|0; $scevgep61 = (($15) + ($24)|0); $AA$050 = $12;$d$052 = $14;$e$051 = $buffer; while(1) { $25 = +HEAPF32[$e$051>>2]; $26 = +HEAPF32[$AA$050>>2]; $27 = $25 * $26; $28 = ((($e$051)) + 8|0); $29 = +HEAPF32[$28>>2]; $30 = ((($AA$050)) + 4|0); $31 = +HEAPF32[$30>>2]; $32 = $29 * $31; $33 = $27 - $32; $34 = ((($d$052)) + 4|0); HEAPF32[$34>>2] = $33; $35 = +HEAPF32[$e$051>>2]; $36 = +HEAPF32[$30>>2]; $37 = $35 * $36; $38 = +HEAPF32[$28>>2]; $39 = +HEAPF32[$AA$050>>2]; $40 = $38 * $39; $41 = $37 + $40; HEAPF32[$d$052>>2] = $41; $42 = ((($d$052)) + -8|0); $43 = ((($AA$050)) + 8|0); $44 = ((($e$051)) + 16|0); $45 = ($44|0)==($16|0); if ($45) { break; } else { $AA$050 = $43;$d$052 = $42;$e$051 = $44; } } $scevgep = (($12) + ($22<<2)|0); $AA$0$lcssa = $scevgep;$d$0$lcssa = $scevgep61; } $46 = ($d$0$lcssa>>>0)<($15>>>0); if (!($46)) { $47 = (($0) + -3)|0; $48 = (($buffer) + ($47<<2)|0); $AA$144 = $AA$0$lcssa;$d$146 = $d$0$lcssa;$e$145 = $48; while(1) { $49 = ((($e$145)) + 8|0); $50 = +HEAPF32[$49>>2]; $51 = +HEAPF32[$AA$144>>2]; $52 = $50 * $51; $53 = +HEAPF32[$e$145>>2]; $54 = ((($AA$144)) + 4|0); $55 = +HEAPF32[$54>>2]; $56 = $53 * $55; $57 = $56 - $52; $58 = ((($d$146)) + 4|0); HEAPF32[$58>>2] = $57; $59 = +HEAPF32[$49>>2]; $60 = +HEAPF32[$54>>2]; $61 = $59 * $60; $62 = +HEAPF32[$e$145>>2]; $63 = +HEAPF32[$AA$144>>2]; $64 = $62 * $63; $65 = -$64; $66 = $65 - $61; HEAPF32[$d$146>>2] = $66; $67 = ((($d$146)) + -8|0); $68 = ((($AA$144)) + 8|0); $69 = ((($e$145)) + -16|0); $70 = ($67>>>0)<($15>>>0); if ($70) { break; } else { $AA$144 = $68;$d$146 = $67;$e$145 = $69; } } } $71 = (($0) + -8)|0; $72 = ($0|0)<(8); if (!($72)) { $73 = (($12) + ($71<<2)|0); $74 = (($buffer) + ($1<<2)|0); $75 = (($15) + ($1<<2)|0); $AA1$040 = $73;$d0$039 = $74;$d1$038 = $buffer;$e0$037 = $75;$e1$036 = $15; while(1) { $76 = ((($e0$037)) + 4|0); $77 = +HEAPF32[$76>>2]; $78 = ((($e1$036)) + 4|0); $79 = +HEAPF32[$78>>2]; $80 = $77 - $79; $81 = +HEAPF32[$e0$037>>2]; $82 = +HEAPF32[$e1$036>>2]; $83 = $81 - $82; $84 = $77 + $79; $85 = ((($d0$039)) + 4|0); HEAPF32[$85>>2] = $84; $86 = +HEAPF32[$e0$037>>2]; $87 = +HEAPF32[$e1$036>>2]; $88 = $86 + $87; HEAPF32[$d0$039>>2] = $88; $89 = ((($AA1$040)) + 16|0); $90 = +HEAPF32[$89>>2]; $91 = $80 * $90; $92 = ((($AA1$040)) + 20|0); $93 = +HEAPF32[$92>>2]; $94 = $83 * $93; $95 = $91 - $94; $96 = ((($d1$038)) + 4|0); HEAPF32[$96>>2] = $95; $97 = +HEAPF32[$89>>2]; $98 = $83 * $97; $99 = +HEAPF32[$92>>2]; $100 = $80 * $99; $101 = $98 + $100; HEAPF32[$d1$038>>2] = $101; $102 = ((($e0$037)) + 12|0); $103 = +HEAPF32[$102>>2]; $104 = ((($e1$036)) + 12|0); $105 = +HEAPF32[$104>>2]; $106 = $103 - $105; $107 = ((($e0$037)) + 8|0); $108 = +HEAPF32[$107>>2]; $109 = ((($e1$036)) + 8|0); $110 = +HEAPF32[$109>>2]; $111 = $108 - $110; $112 = $103 + $105; $113 = ((($d0$039)) + 12|0); HEAPF32[$113>>2] = $112; $114 = +HEAPF32[$107>>2]; $115 = +HEAPF32[$109>>2]; $116 = $114 + $115; $117 = ((($d0$039)) + 8|0); HEAPF32[$117>>2] = $116; $118 = +HEAPF32[$AA1$040>>2]; $119 = $106 * $118; $120 = ((($AA1$040)) + 4|0); $121 = +HEAPF32[$120>>2]; $122 = $111 * $121; $123 = $119 - $122; $124 = ((($d1$038)) + 12|0); HEAPF32[$124>>2] = $123; $125 = +HEAPF32[$AA1$040>>2]; $126 = $111 * $125; $127 = +HEAPF32[$120>>2]; $128 = $106 * $127; $129 = $126 + $128; $130 = ((($d1$038)) + 8|0); HEAPF32[$130>>2] = $129; $131 = ((($AA1$040)) + -32|0); $132 = ((($d0$039)) + 16|0); $133 = ((($d1$038)) + 16|0); $134 = ((($e0$037)) + 16|0); $135 = ((($e1$036)) + 16|0); $136 = ($131>>>0)<($12>>>0); if ($136) { break; } else { $AA1$040 = $131;$d0$039 = $132;$d1$038 = $133;$e0$037 = $134;$e1$036 = $135; } } } $137 = (_ilog($n)|0); $138 = $n >> 4; $139 = (($0) + -1)|0; $140 = (0 - ($2))|0; _imdct_step3_iter0_loop($138,$buffer,$139,$140,$12); $141 = (($139) - ($1))|0; _imdct_step3_iter0_loop($138,$buffer,$141,$140,$12); $142 = $n >> 5; $143 = (0 - ($138))|0; _imdct_step3_inner_r_loop($142,$buffer,$139,$143,$12,16); $144 = (($139) - ($2))|0; _imdct_step3_inner_r_loop($142,$buffer,$144,$143,$12,16); $145 = $2 << 1; $146 = (($139) - ($145))|0; _imdct_step3_inner_r_loop($142,$buffer,$146,$143,$12,16); $147 = Math_imul($2, -3)|0; $148 = (($139) + ($147))|0; _imdct_step3_inner_r_loop($142,$buffer,$148,$143,$12,16); $149 = (($137) + -4)|0; $150 = $149 >> 1; $151 = ($150|0)>(2); if ($151) { $l$033 = 2; while(1) { $156 = (($l$033) + 2)|0; $157 = $n >> $156; $152 = (($l$033) + 1)|0; $158 = 1 << $152; $159 = ($152|0)==(31); if (!($159)) { $160 = $157 >> 1; $161 = (($l$033) + 4)|0; $162 = $n >> $161; $163 = (0 - ($160))|0; $164 = (($l$033) + 3)|0; $165 = 1 << $164; $i$030 = 0; while(1) { $166 = Math_imul($i$030, $157)|0; $167 = (($139) - ($166))|0; _imdct_step3_inner_r_loop($162,$buffer,$167,$163,$12,$165); $168 = (($i$030) + 1)|0; $169 = ($168|0)<($158|0); if ($169) { $i$030 = $168; } else { break; } } } $exitcond60 = ($152|0)==($150|0); if ($exitcond60) { $l$0$lcssa = $150; break; } else { $l$033 = $152; } } } else { $l$0$lcssa = 2; } $153 = (($137) + -7)|0; $154 = ($l$0$lcssa|0)<($153|0); if ($154) { $155 = (($137) + -7)|0; $l$127 = $l$0$lcssa; while(1) { $171 = (($l$127) + 2)|0; $172 = $n >> $171; $173 = (($l$127) + 3)|0; $174 = 1 << $173; $175 = (($l$127) + 6)|0; $176 = $n >> $175; $170 = (($l$127) + 1)|0; $177 = 1 << $170; $178 = ($176|0)>(0); if ($178) { $179 = $172 >> 1; $180 = (0 - ($179))|0; $181 = $174 << 2; $A0$024 = $12;$i_off$023 = $139;$r$022 = $176; while(1) { _imdct_step3_inner_s_loop($177,$buffer,$i_off$023,$180,$A0$024,$174,$172); $182 = (($A0$024) + ($181<<2)|0); $183 = (($i_off$023) + -8)|0; $184 = (($r$022) + -1)|0; $185 = ($r$022|0)>(1); if ($185) { $A0$024 = $182;$i_off$023 = $183;$r$022 = $184; } else { break; } } } $exitcond = ($170|0)==($155|0); if ($exitcond) { break; } else { $l$127 = $170; } } } _imdct_step3_inner_s_loop_ld654($142,$buffer,$139,$12,$n); $186 = (($1) + -4)|0; $187 = (($15) + ($186<<2)|0); $188 = (($0) + -4)|0; $189 = (($15) + ($188<<2)|0); $190 = ($187>>>0)<($15>>>0); if (!($190)) { $191 = (((($f)) + 1100|0) + ($blocktype<<2)|0); $192 = HEAP32[$191>>2]|0; $bitrev$016 = $192;$d05$017 = $187;$d16$018 = $189; while(1) { $193 = HEAP16[$bitrev$016>>1]|0; $194 = $193&65535; $195 = (($buffer) + ($194<<2)|0); $196 = HEAP32[$195>>2]|0; $197 = ((($d16$018)) + 12|0); HEAP32[$197>>2] = $196; $198 = (($194) + 1)|0; $199 = (($buffer) + ($198<<2)|0); $200 = HEAP32[$199>>2]|0; $201 = ((($d16$018)) + 8|0); HEAP32[$201>>2] = $200; $202 = (($194) + 2)|0; $203 = (($buffer) + ($202<<2)|0); $204 = HEAP32[$203>>2]|0; $205 = ((($d05$017)) + 12|0); HEAP32[$205>>2] = $204; $206 = (($194) + 3)|0; $207 = (($buffer) + ($206<<2)|0); $208 = HEAP32[$207>>2]|0; $209 = ((($d05$017)) + 8|0); HEAP32[$209>>2] = $208; $210 = ((($bitrev$016)) + 2|0); $211 = HEAP16[$210>>1]|0; $212 = $211&65535; $213 = (($buffer) + ($212<<2)|0); $214 = HEAP32[$213>>2]|0; $215 = ((($d16$018)) + 4|0); HEAP32[$215>>2] = $214; $216 = (($212) + 1)|0; $217 = (($buffer) + ($216<<2)|0); $218 = HEAP32[$217>>2]|0; HEAP32[$d16$018>>2] = $218; $219 = (($212) + 2)|0; $220 = (($buffer) + ($219<<2)|0); $221 = HEAP32[$220>>2]|0; $222 = ((($d05$017)) + 4|0); HEAP32[$222>>2] = $221; $223 = (($212) + 3)|0; $224 = (($buffer) + ($223<<2)|0); $225 = HEAP32[$224>>2]|0; HEAP32[$d05$017>>2] = $225; $226 = ((($d05$017)) + -16|0); $227 = ((($d16$018)) + -16|0); $228 = ((($bitrev$016)) + 4|0); $229 = ($226>>>0)<($15>>>0); if ($229) { break; } else { $bitrev$016 = $228;$d05$017 = $226;$d16$018 = $227; } } } $230 = ($15>>>0)<($189>>>0); if ($230) { $231 = (((($f)) + 1084|0) + ($blocktype<<2)|0); $232 = HEAP32[$231>>2]|0; $C$010 = $232;$d7$011 = $15;$e8$012 = $189; while(1) { $233 = +HEAPF32[$d7$011>>2]; $234 = ((($e8$012)) + 8|0); $235 = +HEAPF32[$234>>2]; $236 = $233 - $235; $237 = ((($d7$011)) + 4|0); $238 = +HEAPF32[$237>>2]; $239 = ((($e8$012)) + 12|0); $240 = +HEAPF32[$239>>2]; $241 = $238 + $240; $242 = ((($C$010)) + 4|0); $243 = +HEAPF32[$242>>2]; $244 = $236 * $243; $245 = +HEAPF32[$C$010>>2]; $246 = $241 * $245; $247 = $244 + $246; $248 = $243 * $241; $249 = $236 * $245; $250 = $248 - $249; $251 = $233 + $235; $252 = $238 - $240; $253 = $251 + $247; HEAPF32[$d7$011>>2] = $253; $254 = $252 + $250; HEAPF32[$237>>2] = $254; $255 = $251 - $247; HEAPF32[$234>>2] = $255; $256 = $250 - $252; HEAPF32[$239>>2] = $256; $257 = ((($d7$011)) + 8|0); $258 = +HEAPF32[$257>>2]; $259 = +HEAPF32[$e8$012>>2]; $260 = $258 - $259; $261 = ((($d7$011)) + 12|0); $262 = +HEAPF32[$261>>2]; $263 = ((($e8$012)) + 4|0); $264 = +HEAPF32[$263>>2]; $265 = $262 + $264; $266 = ((($C$010)) + 12|0); $267 = +HEAPF32[$266>>2]; $268 = $260 * $267; $269 = ((($C$010)) + 8|0); $270 = +HEAPF32[$269>>2]; $271 = $265 * $270; $272 = $268 + $271; $273 = $267 * $265; $274 = $260 * $270; $275 = $273 - $274; $276 = $258 + $259; $277 = $262 - $264; $278 = $276 + $272; HEAPF32[$257>>2] = $278; $279 = $277 + $275; HEAPF32[$261>>2] = $279; $280 = $276 - $272; HEAPF32[$e8$012>>2] = $280; $281 = $275 - $277; HEAPF32[$263>>2] = $281; $282 = ((($C$010)) + 16|0); $283 = ((($d7$011)) + 16|0); $284 = ((($e8$012)) + -16|0); $285 = ($283>>>0)<($284>>>0); if ($285) { $C$010 = $282;$d7$011 = $283;$e8$012 = $284; } else { break; } } } $286 = (($15) + ($71<<2)|0); $287 = ($286>>>0)<($15>>>0); if ($287) { HEAP32[$3>>2] = $4; STACKTOP = sp;return; } $288 = (($n) + -4)|0; $289 = (($buffer) + ($288<<2)|0); $290 = (($buffer) + ($188<<2)|0); $291 = (((($f)) + 1076|0) + ($blocktype<<2)|0); $292 = HEAP32[$291>>2]|0; $293 = (($292) + ($71<<2)|0); $B$08 = $293;$d09$04 = $buffer;$d110$05 = $290;$d2$06 = $16;$d3$07 = $289;$e11$09 = $286; while(1) { $294 = ((($e11$09)) + 24|0); $295 = +HEAPF32[$294>>2]; $296 = ((($B$08)) + 28|0); $297 = +HEAPF32[$296>>2]; $298 = $295 * $297; $299 = ((($e11$09)) + 28|0); $300 = +HEAPF32[$299>>2]; $301 = ((($B$08)) + 24|0); $302 = +HEAPF32[$301>>2]; $303 = $300 * $302; $304 = $298 - $303; $305 = $295 * $302; $306 = -$305; $307 = $297 * $300; $308 = $306 - $307; HEAPF32[$d09$04>>2] = $304; $309 = -$304; $310 = ((($d110$05)) + 12|0); HEAPF32[$310>>2] = $309; HEAPF32[$d2$06>>2] = $308; $311 = ((($d3$07)) + 12|0); HEAPF32[$311>>2] = $308; $312 = ((($e11$09)) + 16|0); $313 = +HEAPF32[$312>>2]; $314 = ((($B$08)) + 20|0); $315 = +HEAPF32[$314>>2]; $316 = $313 * $315; $317 = ((($e11$09)) + 20|0); $318 = +HEAPF32[$317>>2]; $319 = ((($B$08)) + 16|0); $320 = +HEAPF32[$319>>2]; $321 = $318 * $320; $322 = $316 - $321; $323 = $313 * $320; $324 = -$323; $325 = $315 * $318; $326 = $324 - $325; $327 = ((($d09$04)) + 4|0); HEAPF32[$327>>2] = $322; $328 = -$322; $329 = ((($d110$05)) + 8|0); HEAPF32[$329>>2] = $328; $330 = ((($d2$06)) + 4|0); HEAPF32[$330>>2] = $326; $331 = ((($d3$07)) + 8|0); HEAPF32[$331>>2] = $326; $332 = ((($e11$09)) + 8|0); $333 = +HEAPF32[$332>>2]; $334 = ((($B$08)) + 12|0); $335 = +HEAPF32[$334>>2]; $336 = $333 * $335; $337 = ((($e11$09)) + 12|0); $338 = +HEAPF32[$337>>2]; $339 = ((($B$08)) + 8|0); $340 = +HEAPF32[$339>>2]; $341 = $338 * $340; $342 = $336 - $341; $343 = $333 * $340; $344 = -$343; $345 = $335 * $338; $346 = $344 - $345; $347 = ((($d09$04)) + 8|0); HEAPF32[$347>>2] = $342; $348 = -$342; $349 = ((($d110$05)) + 4|0); HEAPF32[$349>>2] = $348; $350 = ((($d2$06)) + 8|0); HEAPF32[$350>>2] = $346; $351 = ((($d3$07)) + 4|0); HEAPF32[$351>>2] = $346; $352 = +HEAPF32[$e11$09>>2]; $353 = ((($B$08)) + 4|0); $354 = +HEAPF32[$353>>2]; $355 = $352 * $354; $356 = ((($e11$09)) + 4|0); $357 = +HEAPF32[$356>>2]; $358 = +HEAPF32[$B$08>>2]; $359 = $357 * $358; $360 = $355 - $359; $361 = $352 * $358; $362 = -$361; $363 = $354 * $357; $364 = $362 - $363; $365 = ((($d09$04)) + 12|0); HEAPF32[$365>>2] = $360; $366 = -$360; HEAPF32[$d110$05>>2] = $366; $367 = ((($d2$06)) + 12|0); HEAPF32[$367>>2] = $364; HEAPF32[$d3$07>>2] = $364; $368 = ((($B$08)) + -32|0); $369 = ((($e11$09)) + -32|0); $370 = ((($d09$04)) + 16|0); $371 = ((($d2$06)) + 16|0); $372 = ((($d110$05)) + -16|0); $373 = ((($d3$07)) + -16|0); $374 = ($369>>>0)<($15>>>0); if ($374) { break; } else { $B$08 = $368;$d09$04 = $370;$d110$05 = $372;$d2$06 = $371;$d3$07 = $373;$e11$09 = $369; } } HEAP32[$3>>2] = $4; STACKTOP = sp;return; } function _imdct_step3_iter0_loop($n,$e,$i_off,$k_off,$A) { $n = $n|0; $e = $e|0; $i_off = $i_off|0; $k_off = $k_off|0; $A = $A|0; var $$04 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $12 = 0.0, $13 = 0.0; var $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0; var $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0; var $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0; var $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0.0; var $87 = 0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0.0, $ee0$03 = 0, $ee2$01 = 0, $i$02 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $n & 3; $1 = ($0|0)==(0); if (!($1)) { ___assert_fail((16228|0),(15523|0),2075,(16241|0)); // unreachable; } $2 = $n >> 2; $3 = ($2|0)>(0); if (!($3)) { return; } $$sum = (($k_off) + ($i_off))|0; $4 = (($e) + ($$sum<<2)|0); $5 = (($e) + ($i_off<<2)|0); $$04 = $A;$ee0$03 = $5;$ee2$01 = $4;$i$02 = $2; while(1) { $6 = +HEAPF32[$ee0$03>>2]; $7 = +HEAPF32[$ee2$01>>2]; $8 = $6 - $7; $9 = ((($ee0$03)) + -4|0); $10 = +HEAPF32[$9>>2]; $11 = ((($ee2$01)) + -4|0); $12 = +HEAPF32[$11>>2]; $13 = $10 - $12; $14 = $6 + $7; HEAPF32[$ee0$03>>2] = $14; $15 = +HEAPF32[$11>>2]; $16 = +HEAPF32[$9>>2]; $17 = $15 + $16; HEAPF32[$9>>2] = $17; $18 = +HEAPF32[$$04>>2]; $19 = $8 * $18; $20 = ((($$04)) + 4|0); $21 = +HEAPF32[$20>>2]; $22 = $13 * $21; $23 = $19 - $22; HEAPF32[$ee2$01>>2] = $23; $24 = +HEAPF32[$$04>>2]; $25 = $13 * $24; $26 = +HEAPF32[$20>>2]; $27 = $8 * $26; $28 = $25 + $27; HEAPF32[$11>>2] = $28; $29 = ((($$04)) + 32|0); $30 = ((($ee0$03)) + -8|0); $31 = +HEAPF32[$30>>2]; $32 = ((($ee2$01)) + -8|0); $33 = +HEAPF32[$32>>2]; $34 = $31 - $33; $35 = ((($ee0$03)) + -12|0); $36 = +HEAPF32[$35>>2]; $37 = ((($ee2$01)) + -12|0); $38 = +HEAPF32[$37>>2]; $39 = $36 - $38; $40 = $31 + $33; HEAPF32[$30>>2] = $40; $41 = +HEAPF32[$37>>2]; $42 = +HEAPF32[$35>>2]; $43 = $41 + $42; HEAPF32[$35>>2] = $43; $44 = +HEAPF32[$29>>2]; $45 = $34 * $44; $46 = ((($$04)) + 36|0); $47 = +HEAPF32[$46>>2]; $48 = $39 * $47; $49 = $45 - $48; HEAPF32[$32>>2] = $49; $50 = +HEAPF32[$29>>2]; $51 = $39 * $50; $52 = +HEAPF32[$46>>2]; $53 = $34 * $52; $54 = $51 + $53; HEAPF32[$37>>2] = $54; $55 = ((($$04)) + 64|0); $56 = ((($ee0$03)) + -16|0); $57 = +HEAPF32[$56>>2]; $58 = ((($ee2$01)) + -16|0); $59 = +HEAPF32[$58>>2]; $60 = $57 - $59; $61 = ((($ee0$03)) + -20|0); $62 = +HEAPF32[$61>>2]; $63 = ((($ee2$01)) + -20|0); $64 = +HEAPF32[$63>>2]; $65 = $62 - $64; $66 = $57 + $59; HEAPF32[$56>>2] = $66; $67 = +HEAPF32[$63>>2]; $68 = +HEAPF32[$61>>2]; $69 = $67 + $68; HEAPF32[$61>>2] = $69; $70 = +HEAPF32[$55>>2]; $71 = $60 * $70; $72 = ((($$04)) + 68|0); $73 = +HEAPF32[$72>>2]; $74 = $65 * $73; $75 = $71 - $74; HEAPF32[$58>>2] = $75; $76 = +HEAPF32[$55>>2]; $77 = $65 * $76; $78 = +HEAPF32[$72>>2]; $79 = $60 * $78; $80 = $77 + $79; HEAPF32[$63>>2] = $80; $81 = ((($$04)) + 96|0); $82 = ((($ee0$03)) + -24|0); $83 = +HEAPF32[$82>>2]; $84 = ((($ee2$01)) + -24|0); $85 = +HEAPF32[$84>>2]; $86 = $83 - $85; $87 = ((($ee0$03)) + -28|0); $88 = +HEAPF32[$87>>2]; $89 = ((($ee2$01)) + -28|0); $90 = +HEAPF32[$89>>2]; $91 = $88 - $90; $92 = $83 + $85; HEAPF32[$82>>2] = $92; $93 = +HEAPF32[$89>>2]; $94 = +HEAPF32[$87>>2]; $95 = $93 + $94; HEAPF32[$87>>2] = $95; $96 = +HEAPF32[$81>>2]; $97 = $86 * $96; $98 = ((($$04)) + 100|0); $99 = +HEAPF32[$98>>2]; $100 = $91 * $99; $101 = $97 - $100; HEAPF32[$84>>2] = $101; $102 = +HEAPF32[$81>>2]; $103 = $91 * $102; $104 = +HEAPF32[$98>>2]; $105 = $86 * $104; $106 = $103 + $105; HEAPF32[$89>>2] = $106; $107 = ((($$04)) + 128|0); $108 = ((($ee0$03)) + -32|0); $109 = ((($ee2$01)) + -32|0); $110 = (($i$02) + -1)|0; $111 = ($i$02|0)>(1); if ($111) { $$04 = $107;$ee0$03 = $108;$ee2$01 = $109;$i$02 = $110; } else { break; } } return; } function _imdct_step3_inner_r_loop($lim,$e,$d0,$k_off,$A,$k1) { $lim = $lim|0; $e = $e|0; $d0 = $d0|0; $k_off = $k_off|0; $A = $A|0; $k1 = $k1|0; var $$09 = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum34 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0, $108 = 0; var $109 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0; var $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0.0; var $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0; var $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0.0, $80 = 0, $81 = 0.0, $82 = 0; var $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $e0$010 = 0, $e2$011 = 0; var $i$08 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $lim >> 2; $1 = ($0|0)>(0); if (!($1)) { return; } $$sum = (($k_off) + ($d0))|0; $2 = (($e) + ($$sum<<2)|0); $3 = (($e) + ($d0<<2)|0); $$sum1 = (($k1) + 1)|0; $$sum2 = $k1 << 1; $$sum34 = $$sum2 | 1; $$sum5 = ($k1*3)|0; $$sum6 = (($$sum5) + 1)|0; $$sum7 = $k1 << 2; $$09 = $A;$e0$010 = $3;$e2$011 = $2;$i$08 = $0; while(1) { $4 = +HEAPF32[$e0$010>>2]; $5 = +HEAPF32[$e2$011>>2]; $6 = $4 - $5; $7 = ((($e0$010)) + -4|0); $8 = +HEAPF32[$7>>2]; $9 = ((($e2$011)) + -4|0); $10 = +HEAPF32[$9>>2]; $11 = $8 - $10; $12 = $4 + $5; HEAPF32[$e0$010>>2] = $12; $13 = +HEAPF32[$9>>2]; $14 = +HEAPF32[$7>>2]; $15 = $13 + $14; HEAPF32[$7>>2] = $15; $16 = +HEAPF32[$$09>>2]; $17 = $6 * $16; $18 = ((($$09)) + 4|0); $19 = +HEAPF32[$18>>2]; $20 = $11 * $19; $21 = $17 - $20; HEAPF32[$e2$011>>2] = $21; $22 = +HEAPF32[$$09>>2]; $23 = $11 * $22; $24 = +HEAPF32[$18>>2]; $25 = $6 * $24; $26 = $23 + $25; HEAPF32[$9>>2] = $26; $27 = (($$09) + ($k1<<2)|0); $28 = ((($e0$010)) + -8|0); $29 = +HEAPF32[$28>>2]; $30 = ((($e2$011)) + -8|0); $31 = +HEAPF32[$30>>2]; $32 = $29 - $31; $33 = ((($e0$010)) + -12|0); $34 = +HEAPF32[$33>>2]; $35 = ((($e2$011)) + -12|0); $36 = +HEAPF32[$35>>2]; $37 = $34 - $36; $38 = $29 + $31; HEAPF32[$28>>2] = $38; $39 = +HEAPF32[$35>>2]; $40 = +HEAPF32[$33>>2]; $41 = $39 + $40; HEAPF32[$33>>2] = $41; $42 = +HEAPF32[$27>>2]; $43 = $32 * $42; $44 = (($$09) + ($$sum1<<2)|0); $45 = +HEAPF32[$44>>2]; $46 = $37 * $45; $47 = $43 - $46; HEAPF32[$30>>2] = $47; $48 = +HEAPF32[$27>>2]; $49 = $37 * $48; $50 = +HEAPF32[$44>>2]; $51 = $32 * $50; $52 = $49 + $51; HEAPF32[$35>>2] = $52; $53 = (($$09) + ($$sum2<<2)|0); $54 = ((($e0$010)) + -16|0); $55 = +HEAPF32[$54>>2]; $56 = ((($e2$011)) + -16|0); $57 = +HEAPF32[$56>>2]; $58 = $55 - $57; $59 = ((($e0$010)) + -20|0); $60 = +HEAPF32[$59>>2]; $61 = ((($e2$011)) + -20|0); $62 = +HEAPF32[$61>>2]; $63 = $60 - $62; $64 = $55 + $57; HEAPF32[$54>>2] = $64; $65 = +HEAPF32[$61>>2]; $66 = +HEAPF32[$59>>2]; $67 = $65 + $66; HEAPF32[$59>>2] = $67; $68 = +HEAPF32[$53>>2]; $69 = $58 * $68; $70 = (($$09) + ($$sum34<<2)|0); $71 = +HEAPF32[$70>>2]; $72 = $63 * $71; $73 = $69 - $72; HEAPF32[$56>>2] = $73; $74 = +HEAPF32[$53>>2]; $75 = $63 * $74; $76 = +HEAPF32[$70>>2]; $77 = $58 * $76; $78 = $75 + $77; HEAPF32[$61>>2] = $78; $79 = (($$09) + ($$sum5<<2)|0); $80 = ((($e0$010)) + -24|0); $81 = +HEAPF32[$80>>2]; $82 = ((($e2$011)) + -24|0); $83 = +HEAPF32[$82>>2]; $84 = $81 - $83; $85 = ((($e0$010)) + -28|0); $86 = +HEAPF32[$85>>2]; $87 = ((($e2$011)) + -28|0); $88 = +HEAPF32[$87>>2]; $89 = $86 - $88; $90 = $81 + $83; HEAPF32[$80>>2] = $90; $91 = +HEAPF32[$87>>2]; $92 = +HEAPF32[$85>>2]; $93 = $91 + $92; HEAPF32[$85>>2] = $93; $94 = +HEAPF32[$79>>2]; $95 = $84 * $94; $96 = (($$09) + ($$sum6<<2)|0); $97 = +HEAPF32[$96>>2]; $98 = $89 * $97; $99 = $95 - $98; HEAPF32[$82>>2] = $99; $100 = +HEAPF32[$79>>2]; $101 = $89 * $100; $102 = +HEAPF32[$96>>2]; $103 = $84 * $102; $104 = $101 + $103; HEAPF32[$87>>2] = $104; $105 = ((($e0$010)) + -32|0); $106 = ((($e2$011)) + -32|0); $107 = (($$09) + ($$sum7<<2)|0); $108 = (($i$08) + -1)|0; $109 = ($i$08|0)>(1); if ($109) { $$09 = $107;$e0$010 = $105;$e2$011 = $106;$i$08 = $108; } else { break; } } return; } function _imdct_step3_inner_s_loop($n,$e,$i_off,$k_off,$A,$a_off,$k0) { $n = $n|0; $e = $e|0; $i_off = $i_off|0; $k_off = $k_off|0; $A = $A|0; $a_off = $a_off|0; $k0 = $k0|0; var $$sum = 0, $0 = 0.0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0; var $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0; var $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0; var $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0; var $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $ee0$02 = 0, $ee2$03 = 0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$A>>2]; $1 = ((($A)) + 4|0); $2 = +HEAPF32[$1>>2]; $3 = (($A) + ($a_off<<2)|0); $4 = +HEAPF32[$3>>2]; $5 = (($a_off) + 1)|0; $6 = (($A) + ($5<<2)|0); $7 = +HEAPF32[$6>>2]; $8 = $a_off << 1; $9 = (($A) + ($8<<2)|0); $10 = +HEAPF32[$9>>2]; $11 = $8 | 1; $12 = (($A) + ($11<<2)|0); $13 = +HEAPF32[$12>>2]; $14 = ($a_off*3)|0; $15 = (($A) + ($14<<2)|0); $16 = +HEAPF32[$15>>2]; $17 = (($14) + 1)|0; $18 = (($A) + ($17<<2)|0); $19 = +HEAPF32[$18>>2]; $20 = ($n|0)>(0); if (!($20)) { return; } $$sum = (($k_off) + ($i_off))|0; $21 = (($e) + ($$sum<<2)|0); $22 = (($e) + ($i_off<<2)|0); $23 = (0 - ($k0))|0; $ee0$02 = $22;$ee2$03 = $21;$i$01 = $n; while(1) { $24 = +HEAPF32[$ee0$02>>2]; $25 = +HEAPF32[$ee2$03>>2]; $26 = $24 - $25; $27 = ((($ee0$02)) + -4|0); $28 = +HEAPF32[$27>>2]; $29 = ((($ee2$03)) + -4|0); $30 = +HEAPF32[$29>>2]; $31 = $28 - $30; $32 = $24 + $25; HEAPF32[$ee0$02>>2] = $32; $33 = +HEAPF32[$27>>2]; $34 = +HEAPF32[$29>>2]; $35 = $33 + $34; HEAPF32[$27>>2] = $35; $36 = $0 * $26; $37 = $2 * $31; $38 = $36 - $37; HEAPF32[$ee2$03>>2] = $38; $39 = $0 * $31; $40 = $2 * $26; $41 = $40 + $39; HEAPF32[$29>>2] = $41; $42 = ((($ee0$02)) + -8|0); $43 = +HEAPF32[$42>>2]; $44 = ((($ee2$03)) + -8|0); $45 = +HEAPF32[$44>>2]; $46 = $43 - $45; $47 = ((($ee0$02)) + -12|0); $48 = +HEAPF32[$47>>2]; $49 = ((($ee2$03)) + -12|0); $50 = +HEAPF32[$49>>2]; $51 = $48 - $50; $52 = $43 + $45; HEAPF32[$42>>2] = $52; $53 = +HEAPF32[$47>>2]; $54 = +HEAPF32[$49>>2]; $55 = $53 + $54; HEAPF32[$47>>2] = $55; $56 = $4 * $46; $57 = $7 * $51; $58 = $56 - $57; HEAPF32[$44>>2] = $58; $59 = $4 * $51; $60 = $7 * $46; $61 = $60 + $59; HEAPF32[$49>>2] = $61; $62 = ((($ee0$02)) + -16|0); $63 = +HEAPF32[$62>>2]; $64 = ((($ee2$03)) + -16|0); $65 = +HEAPF32[$64>>2]; $66 = $63 - $65; $67 = ((($ee0$02)) + -20|0); $68 = +HEAPF32[$67>>2]; $69 = ((($ee2$03)) + -20|0); $70 = +HEAPF32[$69>>2]; $71 = $68 - $70; $72 = $63 + $65; HEAPF32[$62>>2] = $72; $73 = +HEAPF32[$67>>2]; $74 = +HEAPF32[$69>>2]; $75 = $73 + $74; HEAPF32[$67>>2] = $75; $76 = $10 * $66; $77 = $13 * $71; $78 = $76 - $77; HEAPF32[$64>>2] = $78; $79 = $10 * $71; $80 = $13 * $66; $81 = $80 + $79; HEAPF32[$69>>2] = $81; $82 = ((($ee0$02)) + -24|0); $83 = +HEAPF32[$82>>2]; $84 = ((($ee2$03)) + -24|0); $85 = +HEAPF32[$84>>2]; $86 = $83 - $85; $87 = ((($ee0$02)) + -28|0); $88 = +HEAPF32[$87>>2]; $89 = ((($ee2$03)) + -28|0); $90 = +HEAPF32[$89>>2]; $91 = $88 - $90; $92 = $83 + $85; HEAPF32[$82>>2] = $92; $93 = +HEAPF32[$87>>2]; $94 = +HEAPF32[$89>>2]; $95 = $93 + $94; HEAPF32[$87>>2] = $95; $96 = $16 * $86; $97 = $19 * $91; $98 = $96 - $97; HEAPF32[$84>>2] = $98; $99 = $16 * $91; $100 = $19 * $86; $101 = $100 + $99; HEAPF32[$89>>2] = $101; $102 = (($ee0$02) + ($23<<2)|0); $103 = (($ee2$03) + ($23<<2)|0); $104 = (($i$01) + -1)|0; $105 = ($i$01|0)>(1); if ($105) { $ee0$02 = $102;$ee2$03 = $103;$i$01 = $104; } else { break; } } return; } function _imdct_step3_inner_s_loop_ld654($n,$e,$i_off,$A,$base_n) { $n = $n|0; $e = $e|0; $i_off = $i_off|0; $A = $A|0; $base_n = $base_n|0; var $$sum = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0; var $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0; var $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0; var $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0, $71 = 0, $8 = 0, $9 = 0.0, $z$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $base_n >> 3; $1 = (($A) + ($0<<2)|0); $2 = +HEAPF32[$1>>2]; $3 = $n << 4; $$sum = (($i_off) - ($3))|0; $4 = (($e) + ($$sum<<2)|0); $5 = ($$sum|0)<($i_off|0); if (!($5)) { return; } $6 = (($e) + ($i_off<<2)|0); $z$01 = $6; while(1) { $7 = +HEAPF32[$z$01>>2]; $8 = ((($z$01)) + -32|0); $9 = +HEAPF32[$8>>2]; $10 = $7 - $9; $11 = ((($z$01)) + -4|0); $12 = +HEAPF32[$11>>2]; $13 = ((($z$01)) + -36|0); $14 = +HEAPF32[$13>>2]; $15 = $12 - $14; $16 = $7 + $9; HEAPF32[$z$01>>2] = $16; $17 = +HEAPF32[$11>>2]; $18 = +HEAPF32[$13>>2]; $19 = $17 + $18; HEAPF32[$11>>2] = $19; HEAPF32[$8>>2] = $10; HEAPF32[$13>>2] = $15; $20 = ((($z$01)) + -8|0); $21 = +HEAPF32[$20>>2]; $22 = ((($z$01)) + -40|0); $23 = +HEAPF32[$22>>2]; $24 = $21 - $23; $25 = ((($z$01)) + -12|0); $26 = +HEAPF32[$25>>2]; $27 = ((($z$01)) + -44|0); $28 = +HEAPF32[$27>>2]; $29 = $26 - $28; $30 = $21 + $23; HEAPF32[$20>>2] = $30; $31 = +HEAPF32[$25>>2]; $32 = +HEAPF32[$27>>2]; $33 = $31 + $32; HEAPF32[$25>>2] = $33; $34 = $24 + $29; $35 = $2 * $34; HEAPF32[$22>>2] = $35; $36 = $29 - $24; $37 = $2 * $36; HEAPF32[$27>>2] = $37; $38 = ((($z$01)) + -48|0); $39 = +HEAPF32[$38>>2]; $40 = ((($z$01)) + -16|0); $41 = +HEAPF32[$40>>2]; $42 = $39 - $41; $43 = ((($z$01)) + -20|0); $44 = +HEAPF32[$43>>2]; $45 = ((($z$01)) + -52|0); $46 = +HEAPF32[$45>>2]; $47 = $44 - $46; $48 = $39 + $41; HEAPF32[$40>>2] = $48; $49 = +HEAPF32[$43>>2]; $50 = +HEAPF32[$45>>2]; $51 = $49 + $50; HEAPF32[$43>>2] = $51; HEAPF32[$38>>2] = $47; HEAPF32[$45>>2] = $42; $52 = ((($z$01)) + -56|0); $53 = +HEAPF32[$52>>2]; $54 = ((($z$01)) + -24|0); $55 = +HEAPF32[$54>>2]; $56 = $53 - $55; $57 = ((($z$01)) + -28|0); $58 = +HEAPF32[$57>>2]; $59 = ((($z$01)) + -60|0); $60 = +HEAPF32[$59>>2]; $61 = $58 - $60; $62 = $53 + $55; HEAPF32[$54>>2] = $62; $63 = +HEAPF32[$57>>2]; $64 = +HEAPF32[$59>>2]; $65 = $63 + $64; HEAPF32[$57>>2] = $65; $66 = $56 + $61; $67 = $2 * $66; HEAPF32[$52>>2] = $67; $68 = $56 - $61; $69 = $2 * $68; HEAPF32[$59>>2] = $69; _iter_54($z$01); _iter_54($8); $70 = ((($z$01)) + -64|0); $71 = ($70>>>0)>($4>>>0); if ($71) { $z$01 = $70; } else { break; } } return; } function _iter_54($z) { $z = $z|0; var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = +HEAPF32[$z>>2]; $1 = ((($z)) + -16|0); $2 = +HEAPF32[$1>>2]; $3 = $0 - $2; $4 = $0 + $2; $5 = ((($z)) + -8|0); $6 = +HEAPF32[$5>>2]; $7 = ((($z)) + -24|0); $8 = +HEAPF32[$7>>2]; $9 = $6 + $8; $10 = $6 - $8; $11 = $4 + $9; HEAPF32[$z>>2] = $11; $12 = $4 - $9; HEAPF32[$5>>2] = $12; $13 = ((($z)) + -12|0); $14 = +HEAPF32[$13>>2]; $15 = ((($z)) + -28|0); $16 = +HEAPF32[$15>>2]; $17 = $14 - $16; $18 = $3 + $17; HEAPF32[$1>>2] = $18; $19 = $3 - $17; HEAPF32[$7>>2] = $19; $20 = ((($z)) + -4|0); $21 = +HEAPF32[$20>>2]; $22 = ((($z)) + -20|0); $23 = +HEAPF32[$22>>2]; $24 = $21 - $23; $25 = $21 + $23; $26 = +HEAPF32[$13>>2]; $27 = +HEAPF32[$15>>2]; $28 = $26 + $27; $29 = $25 + $28; HEAPF32[$20>>2] = $29; $30 = $25 - $28; HEAPF32[$13>>2] = $30; $31 = $24 - $10; HEAPF32[$22>>2] = $31; $32 = $10 + $24; HEAPF32[$15>>2] = $32; return; } function _draw_line($output,$x0,$y0,$x1,$y1,$n) { $output = $output|0; $x0 = $x0|0; $y0 = $y0|0; $x1 = $x1|0; $y1 = $y1|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $err$05 = 0, $err$1 = 0, $exitcond = 0, $ispos = 0, $ispos1 = 0, $n$x1 = 0, $neg = 0, $neg2 = 0, $sy$0 = 0, $sy$0$pn = 0, $x$0 = 0, $x$03 = 0, $x$06 = 0; var $y$04 = 0, $y$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (($y1) - ($y0))|0; $1 = (($x1) - ($x0))|0; $ispos = ($0|0)>(-1); $neg = (0 - ($0))|0; $2 = $ispos ? $0 : $neg; $3 = (($0|0) / ($1|0))&-1; $4 = $0 >> 31; $5 = $4 | 1; $ispos1 = ($3|0)>(-1); $neg2 = (0 - ($3))|0; $6 = $ispos1 ? $3 : $neg2; $7 = Math_imul($6, $1)|0; $8 = (($2) - ($7))|0; $9 = ($x1|0)>($n|0); $n$x1 = $9 ? $n : $x1; $10 = ($n$x1|0)>($x0|0); if (!($10)) { return; } $11 = (6864 + ($y0<<2)|0); $12 = +HEAPF32[$11>>2]; $13 = (($output) + ($x0<<2)|0); $14 = +HEAPF32[$13>>2]; $15 = $12 * $14; HEAPF32[$13>>2] = $15; $x$03 = (($x0) + 1)|0; $16 = ($x$03|0)<($n$x1|0); if (!($16)) { return; } $17 = ($n|0)<($x1|0); $18 = $17 ? $n : $x1; $err$05 = 0;$x$06 = $x$03;$y$04 = $y0; while(1) { $19 = (($err$05) + ($8))|0; $20 = ($19|0)<($1|0); $sy$0 = $20 ? 0 : $5; $21 = $20 ? 0 : $1; $err$1 = (($19) - ($21))|0; $sy$0$pn = (($y$04) + ($3))|0; $y$1 = (($sy$0$pn) + ($sy$0))|0; $22 = (6864 + ($y$1<<2)|0); $23 = +HEAPF32[$22>>2]; $24 = (($output) + ($x$06<<2)|0); $25 = +HEAPF32[$24>>2]; $26 = $23 * $25; HEAPF32[$24>>2] = $26; $x$0 = (($x$06) + 1)|0; $exitcond = ($x$0|0)==($18|0); if ($exitcond) { break; } else { $err$05 = $err$1;$x$06 = $x$0;$y$04 = $y$1; } } return; } function _make_block_array($mem,$count,$size) { $mem = $mem|0; $count = $count|0; $size = $size|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $exitcond = 0, $i$01 = 0, $q$02 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($count|0)>(0); if (!($0)) { return ($mem|0); } $1 = (($mem) + ($count<<2)|0); $i$01 = 0;$q$02 = $1; while(1) { $2 = (($mem) + ($i$01<<2)|0); HEAP32[$2>>2] = $q$02; $3 = (($q$02) + ($size)|0); $4 = (($i$01) + 1)|0; $exitcond = ($4|0)==($count|0); if ($exitcond) { break; } else { $i$01 = $4;$q$02 = $3; } } return ($mem|0); } function _codebook_decode_deinterleave_repeat($f,$c,$outputs,$ch,$c_inter_p,$p_inter_p,$len,$total_decode) { $f = $f|0; $c = $c|0; $outputs = $outputs|0; $ch = $ch|0; $c_inter_p = $c_inter_p|0; $p_inter_p = $p_inter_p|0; $len = $len|0; $total_decode = $total_decode|0; var $$ = 0, $$0 = 0, $$0126 = 0, $$2 = 0, $$3 = 0, $$4 = 0, $$p_inter$1 = 0, $$p_inter$3 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; var $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0; var $74 = 0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $c_inter$0$lcssa = 0, $c_inter$025 = 0, $c_inter$115 = 0, $c_inter$319 = 0, $c_inter$5 = 0; var $effective$024 = 0, $effective$1 = 0, $exitcond = 0, $exitcond30 = 0, $i$013 = 0, $i$118 = 0, $last$014 = 0.0, $p_inter$0$lcssa = 0, $p_inter$023 = 0, $p_inter$112 = 0, $p_inter$317 = 0, $p_inter$5 = 0, $z$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$c_inter_p>>2]|0; $1 = HEAP32[$p_inter_p>>2]|0; $2 = HEAP32[$c>>2]|0; $3 = ((($c)) + 21|0); $4 = HEAP8[$3>>0]|0; $5 = ($4<<24>>24)==(0); if ($5) { _error($f,21); $$0 = 0; return ($$0|0); } $6 = ($total_decode|0)>(0); L5: do { if ($6) { $7 = ((($f)) + 1396|0); $8 = ((($f)) + 1392|0); $9 = ((($c)) + 8|0); $10 = ((($c)) + 23|0); $11 = Math_imul($len, $ch)|0; $12 = ((($c)) + 22|0); $13 = ((($c)) + 28|0); $14 = ((($c)) + 28|0); $15 = ((($c)) + 2092|0); $$0126 = $total_decode;$c_inter$025 = $0;$effective$024 = $2;$p_inter$023 = $1; while(1) { $16 = HEAP32[$7>>2]|0; $17 = ($16|0)<(10); if ($17) { _prep_huffman($f); } $18 = HEAP32[$8>>2]|0; $19 = $18 & 1023; $20 = (((($c)) + 36|0) + ($19<<1)|0); $21 = HEAP16[$20>>1]|0; $22 = $21 << 16 >> 16; $23 = ($21<<16>>16)>(-1); if ($23) { $24 = HEAP32[$9>>2]|0; $25 = (($24) + ($22)|0); $26 = HEAP8[$25>>0]|0; $27 = $26&255; $28 = $18 >>> $27; HEAP32[$8>>2] = $28; $29 = HEAP32[$7>>2]|0; $30 = (($29) - ($27))|0; $31 = ($30|0)<(0); $$ = $31 ? 0 : $30; HEAP32[$7>>2] = $$; $$2 = $31 ? -1 : $22; $z$0 = $$2; } else { $32 = (_codebook_decode_scalar_raw($f,$c)|0); $z$0 = $32; } $33 = HEAP8[$10>>0]|0; $34 = ($33<<24>>24)==(0); if (!($34)) { $35 = HEAP32[$15>>2]|0; $36 = ($z$0|0)<($35|0); if (!($36)) { label = 12; break; } } $37 = ($z$0|0)<(0); if ($37) { break; } $44 = Math_imul($p_inter$023, $ch)|0; $45 = (($effective$024) + ($44))|0; $46 = (($45) + ($c_inter$025))|0; $47 = ($46|0)>($11|0); $48 = (($11) - ($44))|0; $49 = (($48) + ($c_inter$025))|0; $effective$1 = $47 ? $49 : $effective$024; $50 = HEAP32[$c>>2]|0; $51 = Math_imul($50, $z$0)|0; $52 = HEAP8[$12>>0]|0; $53 = ($52<<24>>24)==(0); $54 = ($effective$1|0)>(0); if ($53) { if ($54) { $c_inter$319 = $c_inter$025;$i$118 = 0;$p_inter$317 = $p_inter$023; while(1) { $70 = (($outputs) + ($c_inter$319<<2)|0); $71 = HEAP32[$70>>2]|0; $72 = ($71|0)==(0|0); if (!($72)) { $73 = HEAP32[$13>>2]|0; $74 = (($i$118) + ($51))|0; $75 = (($73) + ($74<<2)|0); $76 = +HEAPF32[$75>>2]; $77 = $76 + 0.0; $78 = (($71) + ($p_inter$317<<2)|0); $79 = +HEAPF32[$78>>2]; $80 = $79 + $77; HEAPF32[$78>>2] = $80; } $81 = (($c_inter$319) + 1)|0; $82 = ($81|0)==($ch|0); $83 = $82&1; $$p_inter$3 = (($83) + ($p_inter$317))|0; $$4 = $82 ? 0 : $81; $84 = (($i$118) + 1)|0; $exitcond30 = ($84|0)==($effective$1|0); if ($exitcond30) { $c_inter$5 = $$4;$p_inter$5 = $$p_inter$3; break; } else { $c_inter$319 = $$4;$i$118 = $84;$p_inter$317 = $$p_inter$3; } } } else { $c_inter$5 = $c_inter$025;$p_inter$5 = $p_inter$023; } } else { if ($54) { $55 = HEAP32[$14>>2]|0; $c_inter$115 = $c_inter$025;$i$013 = 0;$last$014 = 0.0;$p_inter$112 = $p_inter$023; while(1) { $56 = (($i$013) + ($51))|0; $57 = (($55) + ($56<<2)|0); $58 = +HEAPF32[$57>>2]; $59 = $last$014 + $58; $60 = (($outputs) + ($c_inter$115<<2)|0); $61 = HEAP32[$60>>2]|0; $62 = ($61|0)==(0|0); if (!($62)) { $63 = (($61) + ($p_inter$112<<2)|0); $64 = +HEAPF32[$63>>2]; $65 = $59 + $64; HEAPF32[$63>>2] = $65; } $66 = (($c_inter$115) + 1)|0; $67 = ($66|0)==($ch|0); $68 = $67&1; $$p_inter$1 = (($68) + ($p_inter$112))|0; $$3 = $67 ? 0 : $66; $69 = (($i$013) + 1)|0; $exitcond = ($69|0)==($effective$1|0); if ($exitcond) { $c_inter$5 = $$3;$p_inter$5 = $$p_inter$1; break; } else { $c_inter$115 = $$3;$i$013 = $69;$last$014 = $59;$p_inter$112 = $$p_inter$1; } } } else { $c_inter$5 = $c_inter$025;$p_inter$5 = $p_inter$023; } } $85 = (($$0126) - ($effective$1))|0; $86 = ($85|0)>(0); if ($86) { $$0126 = $85;$c_inter$025 = $c_inter$5;$effective$024 = $effective$1;$p_inter$023 = $p_inter$5; } else { $c_inter$0$lcssa = $c_inter$5;$p_inter$0$lcssa = $p_inter$5; break L5; } } if ((label|0) == 12) { ___assert_fail((16308|0),(15523|0),1430,(16344|0)); // unreachable; } $38 = ((($f)) + 1376|0); $39 = HEAP8[$38>>0]|0; $40 = ($39<<24>>24)==(0); if ($40) { $41 = ((($f)) + 1384|0); $42 = HEAP32[$41>>2]|0; $43 = ($42|0)==(0); if (!($43)) { $$0 = 0; return ($$0|0); } } _error($f,21); $$0 = 0; return ($$0|0); } else { $c_inter$0$lcssa = $0;$p_inter$0$lcssa = $1; } } while(0); HEAP32[$c_inter_p>>2] = $c_inter$0$lcssa; HEAP32[$p_inter_p>>2] = $p_inter$0$lcssa; $$0 = 1; return ($$0|0); } function _residue_decode($f,$book,$target,$offset,$n,$rtype) { $f = $f|0; $book = $book|0; $target = $target|0; $offset = $offset|0; $n = $n|0; $rtype = $rtype|0; var $$0 = 0, $$017 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $k$04 = 0, $k$18 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($rtype|0)==(0); if ($0) { $2 = HEAP32[$book>>2]|0; $3 = (($n|0) / ($2|0))&-1; $4 = ($3|0)>(0); if (!($4)) { $$0 = 1; return ($$0|0); } $5 = (($n) - ($offset))|0; $k$04 = 0; while(1) { $$sum = (($k$04) + ($offset))|0; $8 = (($target) + ($$sum<<2)|0); $9 = (($5) - ($k$04))|0; $10 = (_codebook_decode_step($f,$book,$8,$9,$3)|0); $11 = ($10|0)==(0); $6 = (($k$04) + 1)|0; if ($11) { $$0 = 0; label = 10; break; } $7 = ($6|0)<($3|0); if ($7) { $k$04 = $6; } else { $$0 = 1; label = 10; break; } } if ((label|0) == 10) { return ($$0|0); } } else { $1 = ($n|0)>(0); if (!($1)) { $$0 = 1; return ($$0|0); } $$017 = $offset;$k$18 = 0; while(1) { $12 = (($target) + ($$017<<2)|0); $13 = (($n) - ($k$18))|0; $14 = (_codebook_decode($f,$book,$12,$13)|0); $15 = ($14|0)==(0); if ($15) { $$0 = 0; label = 10; break; } $16 = HEAP32[$book>>2]|0; $17 = (($16) + ($k$18))|0; $18 = (($16) + ($$017))|0; $19 = ($17|0)<($n|0); if ($19) { $$017 = $18;$k$18 = $17; } else { $$0 = 1; label = 10; break; } } if ((label|0) == 10) { return ($$0|0); } } return (0)|0; } function _codebook_decode_step($f,$c,$output,$len,$step) { $f = $f|0; $c = $c|0; $output = $output|0; $len = $len|0; $step = $step|0; var $$0 = 0, $$len = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $last$0$ = 0.0, $last$03 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (_codebook_decode_start($f,$c)|0); $1 = ($0|0)<(0); if ($1) { $$0 = 0; return ($$0|0); } $2 = HEAP32[$c>>2]|0; $3 = ($2|0)<($len|0); $$len = $3 ? $2 : $len; $4 = Math_imul($2, $0)|0; $5 = ($$len|0)>(0); if (!($5)) { $$0 = 1; return ($$0|0); } $6 = ((($c)) + 28|0); $7 = HEAP32[$6>>2]|0; $8 = ((($c)) + 22|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(0); $11 = ($2|0)<($len|0); $12 = $11 ? $2 : $len; $i$02 = 0;$last$03 = 0.0; while(1) { $13 = (($i$02) + ($4))|0; $14 = (($7) + ($13<<2)|0); $15 = +HEAPF32[$14>>2]; $16 = $last$03 + $15; $17 = Math_imul($i$02, $step)|0; $18 = (($output) + ($17<<2)|0); $19 = +HEAPF32[$18>>2]; $20 = $19 + $16; HEAPF32[$18>>2] = $20; $last$0$ = $10 ? $last$03 : $16; $21 = (($i$02) + 1)|0; $exitcond = ($21|0)==($12|0); if ($exitcond) { $$0 = 1; break; } else { $i$02 = $21;$last$03 = $last$0$; } } return ($$0|0); } function _codebook_decode($f,$c,$output,$len) { $f = $f|0; $c = $c|0; $output = $output|0; $len = $len|0; var $$0 = 0, $$len = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0; var $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0; var $i$05 = 0, $i$14 = 0, $last$06 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (_codebook_decode_start($f,$c)|0); $1 = ($0|0)<(0); if ($1) { $$0 = 0; return ($$0|0); } $2 = HEAP32[$c>>2]|0; $3 = ($2|0)<($len|0); $$len = $3 ? $2 : $len; $4 = Math_imul($2, $0)|0; $5 = ((($c)) + 22|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)==(0); $8 = ($$len|0)>(0); if ($7) { if (!($8)) { $$0 = 1; return ($$0|0); } $14 = ((($c)) + 28|0); $15 = HEAP32[$14>>2]|0; $16 = ($2|0)<($len|0); $17 = $16 ? $2 : $len; $i$14 = 0; while(1) { $28 = (($i$14) + ($4))|0; $29 = (($15) + ($28<<2)|0); $30 = +HEAPF32[$29>>2]; $31 = $30 + 0.0; $32 = (($output) + ($i$14<<2)|0); $33 = +HEAPF32[$32>>2]; $34 = $33 + $31; HEAPF32[$32>>2] = $34; $35 = (($i$14) + 1)|0; $exitcond = ($35|0)==($17|0); if ($exitcond) { $$0 = 1; break; } else { $i$14 = $35; } } return ($$0|0); } else { if (!($8)) { $$0 = 1; return ($$0|0); } $9 = ((($c)) + 28|0); $10 = HEAP32[$9>>2]|0; $11 = ((($c)) + 12|0); $12 = ($2|0)<($len|0); $13 = $12 ? $2 : $len; $i$05 = 0;$last$06 = 0.0; while(1) { $18 = (($i$05) + ($4))|0; $19 = (($10) + ($18<<2)|0); $20 = +HEAPF32[$19>>2]; $21 = $last$06 + $20; $22 = (($output) + ($i$05<<2)|0); $23 = +HEAPF32[$22>>2]; $24 = $23 + $21; HEAPF32[$22>>2] = $24; $25 = +HEAPF32[$11>>2]; $26 = $21 + $25; $27 = (($i$05) + 1)|0; $exitcond9 = ($27|0)==($13|0); if ($exitcond9) { $$0 = 1; break; } else { $i$05 = $27;$last$06 = $26; } } return ($$0|0); } return (0)|0; } function _codebook_decode_start($f,$c) { $f = $f|0; $c = $c|0; var $$ = 0, $$0 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $z$0 = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = ((($c)) + 21|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(0); if ($2) { _error($f,21); $$0 = -1; return ($$0|0); } $3 = ((($f)) + 1396|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)<(10); if ($5) { _prep_huffman($f); } $6 = ((($f)) + 1392|0); $7 = HEAP32[$6>>2]|0; $8 = $7 & 1023; $9 = (((($c)) + 36|0) + ($8<<1)|0); $10 = HEAP16[$9>>1]|0; $11 = $10 << 16 >> 16; $12 = ($10<<16>>16)>(-1); if ($12) { $13 = ((($c)) + 8|0); $14 = HEAP32[$13>>2]|0; $15 = (($14) + ($11)|0); $16 = HEAP8[$15>>0]|0; $17 = $16&255; $18 = $7 >>> $17; HEAP32[$6>>2] = $18; $19 = HEAP32[$3>>2]|0; $20 = (($19) - ($17))|0; $21 = ($20|0)<(0); $$ = $21 ? 0 : $20; HEAP32[$3>>2] = $$; $$1 = $21 ? -1 : $11; $z$0 = $$1; } else { $22 = (_codebook_decode_scalar_raw($f,$c)|0); $z$0 = $22; } $23 = ((($c)) + 23|0); $24 = HEAP8[$23>>0]|0; $25 = ($24<<24>>24)==(0); if (!($25)) { $26 = ((($c)) + 2092|0); $27 = HEAP32[$26>>2]|0; $28 = ($z$0|0)<($27|0); if (!($28)) { ___assert_fail((16264|0),(15523|0),1336,(16286|0)); // unreachable; } } $29 = ($z$0|0)<(0); if (!($29)) { $$0 = $z$0; return ($$0|0); } $30 = ((($f)) + 1376|0); $31 = HEAP8[$30>>0]|0; $32 = ($31<<24>>24)==(0); if ($32) { $33 = ((($f)) + 1384|0); $34 = HEAP32[$33>>2]|0; $35 = ($34|0)==(0); if (!($35)) { $$0 = $z$0; return ($$0|0); } } _error($f,21); $$0 = $z$0; return ($$0|0); } function _stbi__pnm_info($s,$x,$y,$comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $c = sp; _stbi__rewind($s); $0 = (_stbi__get8($s)|0); $1 = (_stbi__get8($s)|0); $2 = ($0<<24>>24)==(80); $$off = (($1) + -53)<<24>>24; $switch = ($$off&255)<(2); $or$cond = $2 & $switch; if (!($or$cond)) { _stbi__rewind($s); $$0 = 0; STACKTOP = sp;return ($$0|0); } $3 = ($1<<24>>24)==(54); $4 = $3 ? 3 : 1; HEAP32[$comp>>2] = $4; $5 = (_stbi__get8($s)|0); HEAP8[$c>>0] = $5; _stbi__pnm_skip_whitespace($s,$c); $6 = (_stbi__pnm_getinteger($s,$c)|0); HEAP32[$x>>2] = $6; _stbi__pnm_skip_whitespace($s,$c); $7 = (_stbi__pnm_getinteger($s,$c)|0); HEAP32[$y>>2] = $7; _stbi__pnm_skip_whitespace($s,$c); $8 = (_stbi__pnm_getinteger($s,$c)|0); $9 = ($8|0)>(255); if (!($9)) { $$0 = 1; STACKTOP = sp;return ($$0|0); } _stbi__err(17742); $$0 = 0; STACKTOP = sp;return ($$0|0); } function _stbi__get8($s) { $s = $s|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($s)) + 168|0); $1 = HEAP32[$0>>2]|0; $2 = ((($s)) + 172|0); $3 = HEAP32[$2>>2]|0; $4 = ($1>>>0)<($3>>>0); if ($4) { $5 = ((($1)) + 1|0); HEAP32[$0>>2] = $5; $6 = HEAP8[$1>>0]|0; $$0 = $6; return ($$0|0); } $7 = ((($s)) + 32|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)==(0); if ($9) { $$0 = 0; return ($$0|0); } _stbi__refill_buffer($s); $10 = HEAP32[$0>>2]|0; $11 = ((($10)) + 1|0); HEAP32[$0>>2] = $11; $12 = HEAP8[$10>>0]|0; $$0 = $12; return ($$0|0); } function _stbi__rewind($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($s)) + 176|0); $1 = HEAP32[$0>>2]|0; $2 = ((($s)) + 168|0); HEAP32[$2>>2] = $1; $3 = ((($s)) + 180|0); $4 = HEAP32[$3>>2]|0; $5 = ((($s)) + 172|0); HEAP32[$5>>2] = $4; return; } function _stbi__skip($s,$n) { $s = $s|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($n|0)<(0); if ($0) { $1 = ((($s)) + 172|0); $2 = HEAP32[$1>>2]|0; $3 = ((($s)) + 168|0); HEAP32[$3>>2] = $2; return; } $4 = ((($s)) + 16|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)==(0|0); if (!($6)) { $7 = ((($s)) + 172|0); $8 = HEAP32[$7>>2]|0; $9 = ((($s)) + 168|0); $10 = HEAP32[$9>>2]|0; $11 = $8; $12 = $10; $13 = (($11) - ($12))|0; $14 = ($13|0)<($n|0); if ($14) { HEAP32[$9>>2] = $8; $15 = ((($s)) + 20|0); $16 = HEAP32[$15>>2]|0; $17 = ((($s)) + 28|0); $18 = HEAP32[$17>>2]|0; $19 = (($n) - ($13))|0; FUNCTION_TABLE_vii[$16 & 63]($18,$19); return; } } $20 = ((($s)) + 168|0); $21 = HEAP32[$20>>2]|0; $22 = (($21) + ($n)|0); HEAP32[$20>>2] = $22; return; } function _stbi__tga_get_comp($bits_per_pixel,$is_grey,$is_rgb16) { $bits_per_pixel = $bits_per_pixel|0; $is_grey = $is_grey|0; $is_rgb16 = $is_rgb16|0; var $$0 = 0, $$mux = 0, $$not = 0, $$not1 = 0, $0 = 0, $1 = 0, $brmerge = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($is_rgb16|0)!=(0|0); if ($0) { HEAP32[$is_rgb16>>2] = 0; } switch ($bits_per_pixel|0) { case 8: { $$0 = 1; break; } case 16: { $$not = ($is_grey|0)!=(0); $$not1 = $0 ^ 1; $brmerge = $$not | $$not1; $$mux = $$not ? 2 : 3; if ($brmerge) { $$0 = $$mux; } else { label = 6; } break; } case 15: { if ($0) { label = 6; } else { $$0 = 3; } break; } case 32: case 24: { $1 = (($bits_per_pixel|0) / 8)&-1; $$0 = $1; break; } default: { $$0 = 0; } } if ((label|0) == 6) { HEAP32[$is_rgb16>>2] = 1; $$0 = 3; } return ($$0|0); } function _stbi__refill_buffer($s) { $s = $s|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($s)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ((($s)) + 28|0); $3 = HEAP32[$2>>2]|0; $4 = ((($s)) + 40|0); $5 = ((($s)) + 36|0); $6 = HEAP32[$5>>2]|0; $7 = (FUNCTION_TABLE_iiii[$1 & 15]($3,$4,$6)|0); $8 = ($7|0)==(0); if ($8) { $9 = ((($s)) + 32|0); HEAP32[$9>>2] = 0; $10 = ((($s)) + 168|0); HEAP32[$10>>2] = $4; $11 = ((($s)) + 41|0); $12 = ((($s)) + 172|0); HEAP32[$12>>2] = $11; $13 = HEAP32[$10>>2]|0; HEAP8[$13>>0] = 0; return; } else { $14 = ((($s)) + 168|0); HEAP32[$14>>2] = $4; $15 = (((($s)) + 40|0) + ($7)|0); $16 = ((($s)) + 172|0); HEAP32[$16>>2] = $15; return; } } function _stbi__pnm_skip_whitespace($s,$c) { $s = $s|0; $c = $c|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; L1: while(1) { $0 = (_stbi__at_eof($s)|0); $1 = ($0|0)==(0); if ($1) { $2 = HEAP8[$c>>0]|0; $3 = (_stbi__pnm_isspace($2)|0); $4 = ($3|0)==(0); if (!($4)) { $5 = (_stbi__get8($s)|0); HEAP8[$c>>0] = $5; continue; } } $6 = (_stbi__at_eof($s)|0); $7 = ($6|0)==(0); if (!($7)) { label = 10; break; } $8 = HEAP8[$c>>0]|0; $9 = ($8<<24>>24)==(35); if (!($9)) { label = 10; break; } $10 = (_stbi__at_eof($s)|0); $11 = ($10|0)==(0); if (!($11)) { continue; } while(1) { $12 = HEAP8[$c>>0]|0; switch ($12<<24>>24) { case 13: case 10: { continue L1; break; } default: { } } $13 = (_stbi__get8($s)|0); HEAP8[$c>>0] = $13; $14 = (_stbi__at_eof($s)|0); $15 = ($14|0)==(0); if (!($15)) { continue L1; } } } if ((label|0) == 10) { return; } } function _stbi__pnm_getinteger($s,$c) { $s = $s|0; $c = $c|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $value$0$lcssa = 0, $value$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__at_eof($s)|0); $1 = ($0|0)==(0); if ($1) { $value$01 = 0; } else { $value$0$lcssa = 0; return ($value$0$lcssa|0); } while(1) { $2 = HEAP8[$c>>0]|0; $3 = (_stbi__pnm_isdigit($2)|0); $4 = ($3|0)==(0); if ($4) { $value$0$lcssa = $value$01; label = 4; break; } $5 = ($value$01*10)|0; $6 = $2 << 24 >> 24; $7 = (($5) + -48)|0; $8 = (($7) + ($6))|0; $9 = (_stbi__get8($s)|0); HEAP8[$c>>0] = $9; $10 = (_stbi__at_eof($s)|0); $11 = ($10|0)==(0); if ($11) { $value$01 = $8; } else { $value$0$lcssa = $8; label = 4; break; } } if ((label|0) == 4) { return ($value$0$lcssa|0); } return (0)|0; } function _stbi__at_eof($s) { $s = $s|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0; var sp = 0; sp = STACKTOP; $0 = ((($s)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if (!($2)) { $3 = ((($s)) + 24|0); $4 = HEAP32[$3>>2]|0; $5 = ((($s)) + 28|0); $6 = HEAP32[$5>>2]|0; $7 = (FUNCTION_TABLE_ii[$4 & 15]($6)|0); $8 = ($7|0)==(0); if ($8) { $$0 = 0; return ($$0|0); } $9 = ((($s)) + 32|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)==(0); if ($11) { $$0 = 1; return ($$0|0); } } $12 = ((($s)) + 168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($s)) + 172|0); $15 = HEAP32[$14>>2]|0; $16 = ($13>>>0)>=($15>>>0); $17 = $16&1; $$0 = $17; return ($$0|0); } function _stbi__pnm_isdigit($c) { $c = $c|0; var $0 = 0, $1 = 0, $c$off = 0, label = 0, sp = 0; sp = STACKTOP; $c$off = (($c) + -48)<<24>>24; $0 = ($c$off&255)<(10); $1 = $0&1; return ($1|0); } function _stbi__pnm_isspace($c) { $c = $c|0; var $0 = 0, $1 = 0, $phitmp = 0, $switch$cast = 0, $switch$cast$clear = 0, $switch$downshift = 0, $switch$masked = 0, $switch$tableidx = 0, label = 0, sp = 0; sp = STACKTOP; $switch$tableidx = (($c) + -9)<<24>>24; $0 = ($switch$tableidx&255)<(24); if (!($0)) { $1 = 0; return ($1|0); } $switch$cast = $switch$tableidx&255; $switch$cast$clear = $switch$cast & 16777215; $switch$downshift = 8388639 >>> $switch$cast$clear; $switch$masked = $switch$downshift & 16777215; $phitmp = $switch$masked & 1; $1 = $phitmp; return ($1|0); } function _stbi__pic_is4($s,$str) { $s = $s|0; $str = $str|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = HEAP8[$str>>0]|0; $2 = ($0<<24>>24)==($1<<24>>24); if (!($2)) { return 0; } $3 = (_stbi__get8($s)|0); $4 = ((($str)) + 1|0); $5 = HEAP8[$4>>0]|0; $6 = ($3<<24>>24)==($5<<24>>24); if (!($6)) { return 0; } $7 = (_stbi__get8($s)|0); $8 = ((($str)) + 2|0); $9 = HEAP8[$8>>0]|0; $10 = ($7<<24>>24)==($9<<24>>24); if ($10) { $11 = (_stbi__get8($s)|0); $12 = ((($str)) + 3|0); $13 = HEAP8[$12>>0]|0; $14 = ($11<<24>>24)==($13<<24>>24); $$ = $14&1; return ($$|0); } else { return 0; } return (0)|0; } function _stbi__get16be($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = $0&255; $2 = $1 << 8; $3 = (_stbi__get8($s)|0); $4 = $3&255; $5 = $2 | $4; return ($5|0); } function _stbi__get32be($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get16be($s)|0); $1 = $0 << 16; $2 = (_stbi__get16be($s)|0); $3 = (($1) + ($2))|0; return ($3|0); } function _stbi__bmp_parse_header($s,$info) { $s = $s|0; $info = $info|0; var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = ($0<<24>>24)==(66); if ($1) { $2 = (_stbi__get8($s)|0); $3 = ($2<<24>>24)==(77); if ($3) { (_stbi__get32le($s)|0); (_stbi__get16le($s)|0); (_stbi__get16le($s)|0); $4 = (_stbi__get32le($s)|0); $5 = ((($info)) + 4|0); HEAP32[$5>>2] = $4; $6 = (_stbi__get32le($s)|0); $7 = ((($info)) + 8|0); HEAP32[$7>>2] = $6; $8 = ($6|0)==(12); switch ($6|0) { case 12: { $9 = (_stbi__get16le($s)|0); HEAP32[$s>>2] = $9; $10 = (_stbi__get16le($s)|0); $11 = ((($s)) + 4|0); HEAP32[$11>>2] = $10; break; } case 124: case 108: case 56: case 40: { $12 = (_stbi__get32le($s)|0); HEAP32[$s>>2] = $12; $13 = (_stbi__get32le($s)|0); $14 = ((($s)) + 4|0); HEAP32[$14>>2] = $13; break; } default: { _stbi__err(17771); $$0 = 0; return ($$0|0); } } $15 = (_stbi__get16le($s)|0); $16 = ($15|0)==(1); if (!($16)) { _stbi__err(17783); $$0 = 0; return ($$0|0); } $17 = (_stbi__get16le($s)|0); HEAP32[$info>>2] = $17; $18 = ($17|0)==(1); if ($18) { _stbi__err(17791); $$0 = 0; return ($$0|0); } if ($8) { $$0 = (1); return ($$0|0); } $19 = (_stbi__get32le($s)|0); $$off = (($19) + -1)|0; $20 = ($$off>>>0)<(2); if ($20) { _stbi__err(17802); $$0 = 0; return ($$0|0); } (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); $21 = $6 & -17; $22 = ($21|0)==(40); if (!($22)) { switch ($6|0) { case 108: case 124: { break; } default: { _stbi__err(17783); $$0 = 0; return ($$0|0); } } $39 = (_stbi__get32le($s)|0); $40 = ((($info)) + 12|0); HEAP32[$40>>2] = $39; $41 = (_stbi__get32le($s)|0); $42 = ((($info)) + 16|0); HEAP32[$42>>2] = $41; $43 = (_stbi__get32le($s)|0); $44 = ((($info)) + 20|0); HEAP32[$44>>2] = $43; $45 = (_stbi__get32le($s)|0); $46 = ((($info)) + 24|0); HEAP32[$46>>2] = $45; (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); $47 = ($6|0)==(124); if (!($47)) { $$0 = (1); return ($$0|0); } (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); $$0 = (1); return ($$0|0); } $23 = ($6|0)==(56); if ($23) { (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); (_stbi__get32le($s)|0); } $24 = HEAP32[$info>>2]|0; switch ($24|0) { case 32: case 16: { break; } default: { $$0 = (1); return ($$0|0); } } $25 = ((($info)) + 20|0); HEAP32[$25>>2] = 0; $26 = ((($info)) + 16|0); HEAP32[$26>>2] = 0; $27 = ((($info)) + 12|0); HEAP32[$27>>2] = 0; switch ($19|0) { case 0: { $28 = HEAP32[$info>>2]|0; $29 = ($28|0)==(32); if ($29) { HEAP32[$27>>2] = 16711680; HEAP32[$26>>2] = 65280; HEAP32[$25>>2] = 255; $30 = ((($info)) + 24|0); HEAP32[$30>>2] = -16777216; $31 = ((($info)) + 28|0); HEAP32[$31>>2] = 0; $$0 = (1); return ($$0|0); } else { HEAP32[$27>>2] = 31744; HEAP32[$26>>2] = 992; HEAP32[$25>>2] = 31; $$0 = (1); return ($$0|0); } break; } case 3: { $32 = (_stbi__get32le($s)|0); HEAP32[$27>>2] = $32; $33 = (_stbi__get32le($s)|0); HEAP32[$26>>2] = $33; $34 = (_stbi__get32le($s)|0); HEAP32[$25>>2] = $34; $35 = HEAP32[$27>>2]|0; $36 = HEAP32[$26>>2]|0; $37 = ($35|0)==($36|0); $38 = ($36|0)==($34|0); $or$cond = $37 & $38; if (!($or$cond)) { $$0 = (1); return ($$0|0); } _stbi__err(17783); $$0 = 0; return ($$0|0); break; } default: { _stbi__err(17783); $$0 = 0; return ($$0|0); } } } } _stbi__err(17763); $$0 = 0; return ($$0|0); } function _stbi__get32le($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get16le($s)|0); $1 = (_stbi__get16le($s)|0); $2 = $1 << 16; $3 = (($2) + ($0))|0; return ($3|0); } function _stbi__gif_header($s,$g,$comp,$is_info) { $s = $s|0; $g = $g|0; $comp = $comp|0; $is_info = $is_info|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = ($0<<24>>24)==(71); if ($1) { $2 = (_stbi__get8($s)|0); $3 = ($2<<24>>24)==(73); if ($3) { $4 = (_stbi__get8($s)|0); $5 = ($4<<24>>24)==(70); if ($5) { $6 = (_stbi__get8($s)|0); $7 = ($6<<24>>24)==(56); if ($7) { $8 = (_stbi__get8($s)|0); switch ($8<<24>>24) { case 57: case 55: { break; } default: { _stbi__err(17810); $$0 = 0; return ($$0|0); } } $9 = (_stbi__get8($s)|0); $10 = ($9<<24>>24)==(97); if (!($10)) { _stbi__err(17810); $$0 = 0; return ($$0|0); } HEAP32[5724>>2] = 17818; $11 = (_stbi__get16le($s)|0); HEAP32[$g>>2] = $11; $12 = (_stbi__get16le($s)|0); $13 = ((($g)) + 4|0); HEAP32[$13>>2] = $12; $14 = (_stbi__get8($s)|0); $15 = $14&255; $16 = ((($g)) + 16|0); HEAP32[$16>>2] = $15; $17 = (_stbi__get8($s)|0); $18 = $17&255; $19 = ((($g)) + 20|0); HEAP32[$19>>2] = $18; $20 = (_stbi__get8($s)|0); $21 = $20&255; $22 = ((($g)) + 24|0); HEAP32[$22>>2] = $21; $23 = ((($g)) + 28|0); HEAP32[$23>>2] = -1; $24 = ($comp|0)==(0|0); if (!($24)) { HEAP32[$comp>>2] = 4; } $25 = ($is_info|0)==(0); if (!($25)) { $$0 = 1; return ($$0|0); } $26 = HEAP32[$16>>2]|0; $27 = $26 & 128; $28 = ($27|0)==(0); if ($28) { $$0 = 1; return ($$0|0); } $29 = ((($g)) + 40|0); $30 = $26 & 7; $31 = 2 << $30; _stbi__gif_parse_colortable($s,$29,$31,-1); $$0 = 1; return ($$0|0); } } } } _stbi__err(17810); $$0 = 0; return ($$0|0); } function _stbi__gif_parse_colortable($s,$pal,$num_entries,$transp) { $s = $s|0; $pal = $pal|0; $num_entries = $num_entries|0; $transp = $transp|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($num_entries|0)>(0); if ($0) { $i$01 = 0; } else { return; } while(1) { $1 = (_stbi__get8($s)|0); $2 = (((($pal) + ($i$01<<2)|0)) + 2|0); HEAP8[$2>>0] = $1; $3 = (_stbi__get8($s)|0); $4 = (((($pal) + ($i$01<<2)|0)) + 1|0); HEAP8[$4>>0] = $3; $5 = (_stbi__get8($s)|0); $6 = (($pal) + ($i$01<<2)|0); HEAP8[$6>>0] = $5; $not$ = ($i$01|0)!=($transp|0); $7 = $not$ << 31 >> 31; $8 = (((($pal) + ($i$01<<2)|0)) + 3|0); HEAP8[$8>>0] = $7; $9 = (($i$01) + 1)|0; $exitcond = ($9|0)==($num_entries|0); if ($exitcond) { break; } else { $i$01 = $9; } } return; } function _stbi__parse_png_file($z,$scan,$req_comp) { $z = $z|0; $scan = $scan|0; $req_comp = $req_comp|0; var $$ = 0, $$0 = 0, $$lcssa1740 = 0, $$lobit = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0; var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0; var $c = 0, $color$0 = 0, $color$0$lcssa = 0, $color$1 = 0, $depth$0 = 0, $depth$0$lcssa = 0, $depth$1 = 0, $first$0 = 0, $first$0$lcssa = 0, $first$1 = 0, $has_trans$0 = 0, $has_trans$0$lcssa = 0, $has_trans$1 = 0, $i$0337 = 0, $i$1334 = 0, $idata_limit$0 = 0, $idata_limit$1 = 0, $idata_limit$1$lcssa = 0, $idata_limit$1$ph = 0, $idata_limit$2 = 0; var $idata_limit$3 = 0, $interlace$0 = 0, $interlace$0$lcssa = 0, $interlace$1 = 0, $ioff$0 = 0, $ioff$0$lcssa = 0, $ioff$1 = 0, $is_iphone$0 = 0, $is_iphone$0$lcssa = 0, $is_iphone$1 = 0, $k$0335 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond7 = 0, $or$cond9$not = 0, $pal_img_n$0 = 0, $pal_img_n$0$lcssa = 0; var $pal_img_n$0$lcssa1681 = 0, $pal_img_n$1 = 0, $pal_img_n$2 = 0, $pal_len$0 = 0, $pal_len$1 = 0, $palette = 0, $raw_len = 0, $req_comp$ = 0, $switch$split102D = 0, $switch$split12D = 0, $switch$split2D = 0, $switch$split42D = 0, $switch$split72D = 0, $tc = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 1056|0; $palette = sp + 24|0; $tc = sp + 16|0; $c = sp + 8|0; $raw_len = sp; $0 = HEAP32[$z>>2]|0; $1 = ((($z)) + 8|0); HEAP32[$1>>2] = 0; $2 = ((($z)) + 4|0); HEAP32[$2>>2] = 0; $3 = ((($z)) + 12|0); HEAP32[$3>>2] = 0; $4 = (_stbi__check_png_header($0)|0); $5 = ($4|0)==(0); if ($5) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $6 = ($scan|0)==(1); if ($6) { $$0 = 1; STACKTOP = sp;return ($$0|0); } $7 = ((($c)) + 4|0); $8 = ((($0)) + 4|0); $9 = ((($0)) + 8|0); $10 = ($scan|0)==(2); $11 = ((($0)) + 8|0); $12 = ((($0)) + 8|0); $13 = ($scan|0)==(2); $14 = ($scan|0)==(2); $color$0 = 0;$depth$0 = 0;$first$0 = 1;$has_trans$0 = 0;$idata_limit$0 = 0;$interlace$0 = 0;$ioff$0 = 0;$is_iphone$0 = 0;$pal_img_n$0 = 0;$pal_len$0 = 0; L7: while(1) { _stbi__get_chunk_header($c,$0); $15 = HEAP32[$7>>2]|0; $switch$split2D = ($15|0)<(1229472850); L9: do { if ($switch$split2D) { $switch$split12D = ($15|0)<(1229209940); if ($switch$split12D) { switch ($15|0) { case 1130840649: { break; } default: { label = 96; break L9; } } $16 = HEAP32[$c>>2]|0; _stbi__skip($0,$16); $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = 1;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; break; } $switch$split72D = ($15|0)<(1229278788); if (!($switch$split72D)) { switch ($15|0) { case 1229278788: { $color$0$lcssa = $color$0;$depth$0$lcssa = $depth$0;$first$0$lcssa = $first$0;$has_trans$0$lcssa = $has_trans$0;$interlace$0$lcssa = $interlace$0;$ioff$0$lcssa = $ioff$0;$is_iphone$0$lcssa = $is_iphone$0;$pal_img_n$0$lcssa = $pal_img_n$0; label = 81; break L7; break; } default: { label = 96; break L9; } } } switch ($15|0) { case 1229209940: { break; } default: { label = 96; break L9; } } $114 = ($first$0|0)==(0); if (!($114)) { label = 66; break L7; } $115 = ($pal_img_n$0<<24>>24)==(0); $116 = ($pal_len$0|0)!=(0); $or$cond7 = $116 | $115; if (!($or$cond7)) { label = 68; break L7; } if ($14) { $pal_img_n$0$lcssa1681 = $pal_img_n$0; label = 70; break L7; } $119 = HEAP32[$c>>2]|0; $120 = (($119) + ($ioff$0))|0; $121 = ($120|0)<($ioff$0|0); if ($121) { $$0 = 0; label = 102; break L7; } $122 = ($120>>>0)>($idata_limit$0>>>0); if ($122) { $123 = ($idata_limit$0|0)==(0); $124 = ($119>>>0)>(4096); $125 = $124 ? $119 : 4096; $idata_limit$1$ph = $123 ? $125 : $idata_limit$0; $126 = HEAP32[$c>>2]|0; $127 = (($126) + ($ioff$0))|0; $idata_limit$1 = $idata_limit$1$ph; while(1) { $128 = ($127>>>0)>($idata_limit$1>>>0); $129 = $idata_limit$1 << 1; if ($128) { $idata_limit$1 = $129; } else { $idata_limit$1$lcssa = $idata_limit$1; break; } } $130 = HEAP32[$2>>2]|0; $131 = (_realloc($130,$idata_limit$1$lcssa)|0); $132 = ($131|0)==(0|0); if ($132) { label = 76; break L7; } HEAP32[$2>>2] = $131; $idata_limit$2 = $idata_limit$1$lcssa; } else { $idata_limit$2 = $idata_limit$0; } $133 = HEAP32[$2>>2]|0; $134 = (($133) + ($ioff$0)|0); $135 = HEAP32[$c>>2]|0; $136 = (_stbi__getn($0,$134,$135)|0); $137 = ($136|0)==(0); if ($137) { label = 79; break L7; } $138 = HEAP32[$c>>2]|0; $139 = (($138) + ($ioff$0))|0; $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$2;$interlace$1 = $interlace$0;$ioff$1 = $139;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; } else { $switch$split42D = ($15|0)<(1347179589); if ($switch$split42D) { switch ($15|0) { case 1229472850: { break; } default: { label = 96; break L9; } } $17 = ($first$0|0)==(0); if ($17) { label = 7; break L7; } $18 = HEAP32[$c>>2]|0; $19 = ($18|0)==(13); if (!($19)) { label = 9; break L7; } $20 = (_stbi__get32be($0)|0); HEAP32[$0>>2] = $20; $21 = ($20>>>0)>(16777216); if ($21) { label = 11; break L7; } $22 = (_stbi__get32be($0)|0); HEAP32[$8>>2] = $22; $23 = ($22>>>0)>(16777216); if ($23) { label = 13; break L7; } $24 = (_stbi__get8($0)|0); $25 = $24&255; switch ($24<<24>>24) { case 1: case 2: case 4: case 8: { break; } default: { label = 15; break L7; } } $26 = (_stbi__get8($0)|0); $27 = $26&255; $28 = ($26&255)>(6); if ($28) { label = 17; break L7; } $29 = ($26<<24>>24)==(3); if ($29) { $pal_img_n$1 = 3; } else { $30 = $27 & 1; $31 = ($30|0)==(0); if ($31) { $pal_img_n$1 = $pal_img_n$0; } else { label = 20; break L7; } } $32 = (_stbi__get8($0)|0); $33 = ($32<<24>>24)==(0); if (!($33)) { label = 22; break L7; } $34 = (_stbi__get8($0)|0); $35 = ($34<<24>>24)==(0); if (!($35)) { label = 24; break L7; } $36 = (_stbi__get8($0)|0); $37 = $36&255; $38 = ($36&255)>(1); if ($38) { label = 26; break L7; } $39 = HEAP32[$0>>2]|0; $40 = ($39|0)==(0); if ($40) { label = 29; break L7; } $41 = HEAP32[$8>>2]|0; $42 = ($41|0)==(0); if ($42) { label = 29; break L7; } $43 = ($pal_img_n$1<<24>>24)==(0); if (!($43)) { HEAP32[$11>>2] = 1; $53 = HEAP32[$0>>2]|0; $54 = (1073741824 / ($53>>>0))&-1; $55 = $54 >>> 2; $56 = HEAP32[$8>>2]|0; $57 = ($55>>>0)<($56>>>0); if ($57) { label = 35; break L7; } else { $color$1 = $27;$depth$1 = $25;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $37;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$1;$pal_len$1 = $pal_len$0; break; } } $44 = $27 & 2; $45 = $44 | 1; $46 = $27 >>> 2; $$lobit = $46 & 1; $47 = (($45) + ($$lobit))|0; HEAP32[$9>>2] = $47; $48 = HEAP32[$0>>2]|0; $49 = (1073741824 / ($48>>>0))&-1; $50 = (($49>>>0) / ($47>>>0))&-1; $51 = HEAP32[$8>>2]|0; $52 = ($50>>>0)<($51>>>0); if ($52) { label = 32; break L7; } if ($10) { $$0 = 1; label = 102; break L7; } else { $color$1 = $27;$depth$1 = $25;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $37;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0; break; } } $switch$split102D = ($15|0)<(1951551059); if ($switch$split102D) { switch ($15|0) { case 1347179589: { break; } default: { label = 96; break L9; } } $58 = ($first$0|0)==(0); if (!($58)) { label = 37; break L7; } $59 = HEAP32[$c>>2]|0; $60 = ($59>>>0)>(768); if ($60) { label = 39; break L7; } $61 = (($59>>>0) / 3)&-1; $62 = ($61*3)|0; $63 = ($62|0)==($59|0); if (!($63)) { label = 42; break L7; } $64 = ($59>>>0)>(2); if ($64) { $i$0337 = 0; } else { $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $61; break; } while(1) { $65 = (_stbi__get8($0)|0); $66 = $i$0337 << 2; $67 = (($palette) + ($66)|0); HEAP8[$67>>0] = $65; $68 = (_stbi__get8($0)|0); $69 = $66 | 1; $70 = (($palette) + ($69)|0); HEAP8[$70>>0] = $68; $71 = (_stbi__get8($0)|0); $72 = $66 | 2; $73 = (($palette) + ($72)|0); HEAP8[$73>>0] = $71; $74 = $66 | 3; $75 = (($palette) + ($74)|0); HEAP8[$75>>0] = -1; $76 = (($i$0337) + 1)|0; $77 = ($76>>>0)<($61>>>0); if ($77) { $i$0337 = $76; } else { $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $61; break L9; } } } switch ($15|0) { case 1951551059: { break; } default: { label = 96; break L9; } } $78 = ($first$0|0)==(0); if (!($78)) { label = 45; break L7; } $79 = HEAP32[$2>>2]|0; $80 = ($79|0)==(0|0); if (!($80)) { label = 47; break L7; } $81 = ($pal_img_n$0<<24>>24)==(0); if ($81) { $95 = HEAP32[$12>>2]|0; $96 = $95 & 1; $97 = ($96|0)==(0); if ($97) { label = 59; break L7; } $98 = HEAP32[$c>>2]|0; $99 = $95 << 1; $100 = ($98|0)==($99|0); if (!($100)) { label = 63; break L7; } $101 = HEAP32[$12>>2]|0; $102 = ($101|0)>(0); if (!($102)) { $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0; break; } $103 = (18042 + ($depth$0)|0); $104 = HEAP8[$103>>0]|0; $105 = $104&255; $k$0335 = 0; while(1) { $106 = (_stbi__get16be($0)|0); $107 = $106 & 255; $108 = Math_imul($105, $107)|0; $109 = $108&255; $110 = (($tc) + ($k$0335)|0); HEAP8[$110>>0] = $109; $111 = (($k$0335) + 1)|0; $112 = HEAP32[$12>>2]|0; $113 = ($111|0)<($112|0); if ($113) { $k$0335 = $111; } else { $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; break L9; } } } if ($13) { label = 50; break L7; } $83 = ($pal_len$0|0)==(0); if ($83) { label = 52; break L7; } $84 = HEAP32[$c>>2]|0; $85 = ($84>>>0)>($pal_len$0>>>0); if ($85) { label = 56; break L7; } $86 = HEAP32[$c>>2]|0; $87 = ($86|0)==(0); if ($87) { $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0; } else { $88 = HEAP32[$c>>2]|0; $i$1334 = 0; while(1) { $89 = (_stbi__get8($0)|0); $90 = $i$1334 << 2; $91 = $90 | 3; $92 = (($palette) + ($91)|0); HEAP8[$92>>0] = $89; $93 = (($i$1334) + 1)|0; $94 = ($93>>>0)<($88>>>0); if ($94) { $i$1334 = $93; } else { $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0; break; } } } } } while(0); if ((label|0) == 96) { label = 0; $182 = ($first$0|0)==(0); if (!($182)) { label = 97; break; } $183 = $15 & 536870912; $184 = ($183|0)==(0); if ($184) { $$lcssa1740 = $15; label = 99; break; } $195 = HEAP32[$c>>2]|0; _stbi__skip($0,$195); $color$1 = $color$0;$depth$1 = $depth$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; } (_stbi__get32be($0)|0); $color$0 = $color$1;$depth$0 = $depth$1;$first$0 = $first$1;$has_trans$0 = $has_trans$1;$idata_limit$0 = $idata_limit$3;$interlace$0 = $interlace$1;$ioff$0 = $ioff$1;$is_iphone$0 = $is_iphone$1;$pal_img_n$0 = $pal_img_n$2;$pal_len$0 = $pal_len$1; } switch (label|0) { case 7: { _stbi__err(17819); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 9: { _stbi__err(17833); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 11: { _stbi__err(17846); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 13: { _stbi__err(17846); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 15: { _stbi__err(17856); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 17: { _stbi__err(17873); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 20: { _stbi__err(17873); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 22: { _stbi__err(17883); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 24: { _stbi__err(17899); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 26: { _stbi__err(17917); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 29: { _stbi__err(17938); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 32: { _stbi__err(17846); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 35: { _stbi__err(17846); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 37: { _stbi__err(17952); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 39: { _stbi__err(17967); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 42: { _stbi__err(17967); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 45: { _stbi__err(17952); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 47: { _stbi__err(17980); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 50: { $82 = ((($0)) + 8|0); HEAP32[$82>>2] = 4; $$0 = 1; STACKTOP = sp;return ($$0|0); break; } case 52: { _stbi__err(17996); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 56: { _stbi__err(18013); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 59: { _stbi__err(18026); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 63: { _stbi__err(18013); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 66: { _stbi__err(17952); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 68: { _stbi__err(18051); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 70: { $117 = $pal_img_n$0$lcssa1681&255; $118 = ((($0)) + 8|0); HEAP32[$118>>2] = $117; $$0 = 1; STACKTOP = sp;return ($$0|0); break; } case 76: { _stbi__err(18059); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 79: { _stbi__err(18068); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 81: { $140 = ($first$0$lcssa|0)==(0); if (!($140)) { _stbi__err(17952); $$0 = 0; STACKTOP = sp;return ($$0|0); } $141 = ($scan|0)==(0); if (!($141)) { $$0 = 1; STACKTOP = sp;return ($$0|0); } $142 = HEAP32[$2>>2]|0; $143 = ($142|0)==(0|0); if ($143) { _stbi__err(18078); $$0 = 0; STACKTOP = sp;return ($$0|0); } $144 = HEAP32[$0>>2]|0; $145 = Math_imul($144, $depth$0$lcssa)|0; $146 = (($145) + 7)|0; $147 = $146 >>> 3; $148 = ((($0)) + 4|0); $149 = HEAP32[$148>>2]|0; $150 = ((($0)) + 8|0); $151 = HEAP32[$150>>2]|0; $152 = Math_imul($151, $149)|0; $153 = Math_imul($152, $147)|0; $154 = (($153) + ($149))|0; HEAP32[$raw_len>>2] = $154; $155 = HEAP32[$2>>2]|0; $156 = ($is_iphone$0$lcssa|0)!=(0); $157 = $156&1; $158 = $157 ^ 1; $159 = (_stbi_zlib_decode_malloc_guesssize_headerflag($155,$ioff$0$lcssa,$154,$raw_len,$158)|0); HEAP32[$1>>2] = $159; $160 = ($159|0)==(0|0); if ($160) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $161 = HEAP32[$2>>2]|0; _free($161); HEAP32[$2>>2] = 0; $162 = HEAP32[$150>>2]|0; $163 = (($162) + 1)|0; $notlhs = ($163|0)!=($req_comp|0); $notrhs = ($req_comp|0)==(3); $or$cond9$not = $notrhs | $notlhs; $164 = ($pal_img_n$0$lcssa<<24>>24)!=(0); $or$cond11 = $164 | $or$cond9$not; $165 = ($has_trans$0$lcssa<<24>>24)==(0); $or$cond = $165 & $or$cond11; $166 = ((($0)) + 12|0); $$ = $or$cond ? $162 : $163; HEAP32[$166>>2] = $$; $167 = HEAP32[$1>>2]|0; $168 = HEAP32[$raw_len>>2]|0; $169 = ((($0)) + 12|0); $170 = (_stbi__create_png_image($z,$167,$168,$$,$depth$0$lcssa,$color$0$lcssa,$interlace$0$lcssa)|0); $171 = ($170|0)==(0); if ($171) { $$0 = 0; STACKTOP = sp;return ($$0|0); } if (!($165)) { $172 = HEAP32[$169>>2]|0; _stbi__compute_transparency($z,$tc,$172); } $173 = HEAP32[5736>>2]|0; $174 = ($173|0)!=(0); $or$cond13 = $156 & $174; if ($or$cond13) { $175 = HEAP32[$169>>2]|0; $176 = ($175|0)>(2); if ($176) { _stbi__de_iphone($z); } } if ($164) { $177 = $pal_img_n$0$lcssa&255; HEAP32[$150>>2] = $177; $178 = ($req_comp|0)>(2); $req_comp$ = $178 ? $req_comp : $177; HEAP32[$169>>2] = $req_comp$; $179 = (_stbi__expand_png_palette($z,$palette,$req_comp$)|0); $180 = ($179|0)==(0); if ($180) { $$0 = 0; STACKTOP = sp;return ($$0|0); } } $181 = HEAP32[$1>>2]|0; _free($181); HEAP32[$1>>2] = 0; $$0 = 1; STACKTOP = sp;return ($$0|0); break; } case 97: { _stbi__err(17952); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 99: { $185 = $$lcssa1740 >>> 24; $186 = $185&255; HEAP8[18086>>0] = $186; $187 = HEAP32[$7>>2]|0; $188 = $187 >>> 16; $189 = $188&255; HEAP8[(18087)>>0] = $189; $190 = HEAP32[$7>>2]|0; $191 = $190 >>> 8; $192 = $191&255; HEAP8[(18088)>>0] = $192; $193 = HEAP32[$7>>2]|0; $194 = $193&255; HEAP8[(18089)>>0] = $194; _stbi__err(18086); $$0 = 0; STACKTOP = sp;return ($$0|0); break; } case 102: { STACKTOP = sp;return ($$0|0); break; } } return (0)|0; } function _stbi__check_png_header($s) { $s = $s|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = ($0<<24>>24)==(-119); if ($1) { $2 = (_stbi__get8($s)|0); $3 = ($2<<24>>24)==(80); if ($3) { $4 = (_stbi__get8($s)|0); $5 = ($4<<24>>24)==(78); if ($5) { $6 = (_stbi__get8($s)|0); $7 = ($6<<24>>24)==(71); if ($7) { $8 = (_stbi__get8($s)|0); $9 = ($8<<24>>24)==(13); if ($9) { $10 = (_stbi__get8($s)|0); $11 = ($10<<24>>24)==(10); if ($11) { $12 = (_stbi__get8($s)|0); $13 = ($12<<24>>24)==(26); if ($13) { $14 = (_stbi__get8($s)|0); $15 = ($14<<24>>24)==(10); if ($15) { $$0 = 1; return ($$0|0); } } } } } } } } _stbi__err(18366); $$0 = 0; return ($$0|0); } function _stbi__get_chunk_header($agg$result,$s) { $agg$result = $agg$result|0; $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get32be($s)|0); $1 = (_stbi__get32be($s)|0); HEAP32[$agg$result>>2] = $0; $2 = ((($agg$result)) + 4|0); HEAP32[$2>>2] = $1; return; } function _stbi__getn($s,$buffer,$n) { $s = $s|0; $buffer = $buffer|0; $n = $n|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($s)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if (!($2)) { $3 = ((($s)) + 172|0); $4 = HEAP32[$3>>2]|0; $5 = ((($s)) + 168|0); $6 = HEAP32[$5>>2]|0; $7 = $4; $8 = $6; $9 = (($7) - ($8))|0; $10 = ($9|0)<($n|0); if ($10) { _memcpy(($buffer|0),($6|0),($9|0))|0; $11 = HEAP32[$0>>2]|0; $12 = ((($s)) + 28|0); $13 = HEAP32[$12>>2]|0; $14 = (($buffer) + ($9)|0); $15 = (($n) - ($9))|0; $16 = (FUNCTION_TABLE_iiii[$11 & 15]($13,$14,$15)|0); $17 = ($16|0)==($15|0); $18 = $17&1; $19 = HEAP32[$3>>2]|0; HEAP32[$5>>2] = $19; $$0 = $18; return ($$0|0); } } $20 = ((($s)) + 168|0); $21 = HEAP32[$20>>2]|0; $22 = (($21) + ($n)|0); $23 = ((($s)) + 172|0); $24 = HEAP32[$23>>2]|0; $25 = ($22>>>0)>($24>>>0); if ($25) { $$0 = 0; return ($$0|0); } _memcpy(($buffer|0),($21|0),($n|0))|0; $26 = HEAP32[$20>>2]|0; $27 = (($26) + ($n)|0); HEAP32[$20>>2] = $27; $$0 = 1; return ($$0|0); } function _stbi__create_png_image($a,$image_data,$image_data_len,$out_n,$depth,$color,$interlaced) { $a = $a|0; $image_data = $image_data|0; $image_data_len = $image_data_len|0; $out_n = $out_n|0; $depth = $depth|0; $color = $color|0; $interlaced = $interlaced|0; var $$0 = 0, $$0212 = 0, $$0311 = 0, $$1 = 0, $$14 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $i$07 = 0; var $j$08 = 0, $or$cond = 0, $p$010 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($interlaced|0)==(0); $1 = HEAP32[$a>>2]|0; $2 = HEAP32[$1>>2]|0; $3 = ((($1)) + 4|0); $4 = HEAP32[$3>>2]|0; if ($0) { $5 = (_stbi__create_png_image_raw($a,$image_data,$image_data_len,$out_n,$2,$4,$depth,$color)|0); $$0 = $5; return ($$0|0); } $6 = Math_imul($2, $out_n)|0; $7 = Math_imul($6, $4)|0; $8 = (_stbi__malloc($7)|0); $9 = ((($a)) + 12|0); $10 = ((($a)) + 12|0); $$0212 = $image_data;$$0311 = $image_data_len;$p$010 = 0; while(1) { $11 = HEAP32[$a>>2]|0; $12 = HEAP32[$11>>2]|0; $13 = (7888 + ($p$010<<2)|0); $14 = HEAP32[$13>>2]|0; $15 = (7916 + ($p$010<<2)|0); $16 = HEAP32[$15>>2]|0; $17 = (($12) + -1)|0; $18 = (($17) - ($14))|0; $19 = (($18) + ($16))|0; $20 = (($19>>>0) / ($16>>>0))&-1; $21 = ((($11)) + 4|0); $22 = HEAP32[$21>>2]|0; $23 = (7944 + ($p$010<<2)|0); $24 = HEAP32[$23>>2]|0; $25 = (7972 + ($p$010<<2)|0); $26 = HEAP32[$25>>2]|0; $27 = (($22) + -1)|0; $28 = (($27) - ($24))|0; $29 = (($28) + ($26))|0; $30 = (($29>>>0) / ($26>>>0))&-1; $31 = ($20|0)!=(0); $32 = ($30|0)!=(0); $or$cond = $31 & $32; if ($or$cond) { $33 = ((($11)) + 8|0); $34 = HEAP32[$33>>2]|0; $35 = Math_imul($20, $depth)|0; $36 = Math_imul($35, $34)|0; $37 = (($36) + 7)|0; $38 = $37 >> 3; $39 = (($38) + 1)|0; $40 = Math_imul($39, $30)|0; $41 = (_stbi__create_png_image_raw($a,$$0212,$$0311,$out_n,$20,$30,$depth,$color)|0); $42 = ($41|0)==(0); if ($42) { label = 8; break; } $43 = ($30|0)>(0); if ($43) { $44 = ($20|0)>(0); $j$08 = 0; while(1) { if ($44) { $45 = HEAP32[$25>>2]|0; $46 = Math_imul($45, $j$08)|0; $47 = HEAP32[$23>>2]|0; $48 = (($46) + ($47))|0; $49 = HEAP32[$15>>2]|0; $50 = HEAP32[$13>>2]|0; $51 = Math_imul($j$08, $20)|0; $i$07 = 0; while(1) { $52 = Math_imul($49, $i$07)|0; $53 = (($52) + ($50))|0; $54 = HEAP32[$a>>2]|0; $55 = HEAP32[$54>>2]|0; $56 = Math_imul($55, $48)|0; $57 = (($53) + ($56))|0; $$sum = Math_imul($57, $out_n)|0; $58 = (($8) + ($$sum)|0); $59 = HEAP32[$10>>2]|0; $60 = (($i$07) + ($51))|0; $61 = Math_imul($60, $out_n)|0; $62 = (($59) + ($61)|0); _memcpy(($58|0),($62|0),($out_n|0))|0; $63 = (($i$07) + 1)|0; $64 = ($63|0)<($20|0); if ($64) { $i$07 = $63; } else { break; } } } $65 = (($j$08) + 1)|0; $66 = ($65|0)<($30|0); if ($66) { $j$08 = $65; } else { break; } } } $67 = HEAP32[$9>>2]|0; _free($67); $68 = (($$0212) + ($40)|0); $69 = (($$0311) - ($40))|0; $$1 = $68;$$14 = $69; } else { $$1 = $$0212;$$14 = $$0311; } $70 = (($p$010) + 1)|0; $71 = ($70|0)<(7); if ($71) { $$0212 = $$1;$$0311 = $$14;$p$010 = $70; } else { label = 15; break; } } if ((label|0) == 8) { _free($8); $$0 = 0; return ($$0|0); } else if ((label|0) == 15) { $72 = ((($a)) + 12|0); HEAP32[$72>>2] = $8; $$0 = 1; return ($$0|0); } return (0)|0; } function _stbi__compute_transparency($z,$tc,$out_n) { $z = $z|0; $tc = $tc|0; $out_n = $out_n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$03 = 0, $i$15 = 0, $not$ = 0, $p$04 = 0, $p$16 = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$z>>2]|0; $1 = HEAP32[$0>>2]|0; $2 = ((($0)) + 4|0); $3 = HEAP32[$2>>2]|0; $4 = Math_imul($3, $1)|0; $5 = ((($z)) + 12|0); $6 = HEAP32[$5>>2]|0; switch ($out_n|0) { case 2: { $11 = ($4|0)==(0); if ($11) { return; } $12 = Math_imul($3, $1)|0; $i$03 = 0;$p$04 = $6; while(1) { $13 = HEAP8[$p$04>>0]|0; $14 = HEAP8[$tc>>0]|0; $not$ = ($13<<24>>24)!=($14<<24>>24); $15 = $not$ << 31 >> 31; $16 = ((($p$04)) + 1|0); HEAP8[$16>>0] = $15; $17 = ((($p$04)) + 2|0); $18 = (($i$03) + 1)|0; $exitcond = ($18|0)==($12|0); if ($exitcond) { break; } else { $i$03 = $18;$p$04 = $17; } } return; break; } case 4: { $7 = ($4|0)==(0); if ($7) { return; } $8 = ((($tc)) + 1|0); $9 = ((($tc)) + 2|0); $10 = Math_imul($3, $1)|0; $i$15 = 0;$p$16 = $6; while(1) { $19 = HEAP8[$p$16>>0]|0; $20 = HEAP8[$tc>>0]|0; $21 = ($19<<24>>24)==($20<<24>>24); if ($21) { $22 = ((($p$16)) + 1|0); $23 = HEAP8[$22>>0]|0; $24 = HEAP8[$8>>0]|0; $25 = ($23<<24>>24)==($24<<24>>24); if ($25) { $26 = ((($p$16)) + 2|0); $27 = HEAP8[$26>>0]|0; $28 = HEAP8[$9>>0]|0; $29 = ($27<<24>>24)==($28<<24>>24); if ($29) { $30 = ((($p$16)) + 3|0); HEAP8[$30>>0] = 0; } } } $31 = ((($p$16)) + 4|0); $32 = (($i$15) + 1)|0; $exitcond8 = ($32|0)==($10|0); if ($exitcond8) { break; } else { $i$15 = $32;$p$16 = $31; } } return; break; } default: { ___assert_fail((18159|0),(18129|0),4214,(18184|0)); // unreachable; } } } function _stbi__de_iphone($z) { $z = $z|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $exitcond14 = 0, $i$06 = 0, $i$111 = 0, $i$28 = 0, $p$05 = 0, $p$110 = 0, $p$27 = 0, $storemerge = 0, label = 0; var sp = 0; sp = STACKTOP; $0 = HEAP32[$z>>2]|0; $1 = HEAP32[$0>>2]|0; $2 = ((($0)) + 4|0); $3 = HEAP32[$2>>2]|0; $4 = Math_imul($3, $1)|0; $5 = ((($z)) + 12|0); $6 = HEAP32[$5>>2]|0; $7 = ((($0)) + 12|0); $8 = HEAP32[$7>>2]|0; switch ($8|0) { case 3: { $9 = ($4|0)==(0); if ($9) { return; } $10 = Math_imul($3, $1)|0; $i$06 = 0;$p$05 = $6; while(1) { $11 = HEAP8[$p$05>>0]|0; $12 = ((($p$05)) + 2|0); $13 = HEAP8[$12>>0]|0; HEAP8[$p$05>>0] = $13; HEAP8[$12>>0] = $11; $14 = ((($p$05)) + 3|0); $15 = (($i$06) + 1)|0; $exitcond = ($15|0)==($10|0); if ($exitcond) { break; } else { $i$06 = $15;$p$05 = $14; } } return; break; } case 4: { $16 = HEAP32[5732>>2]|0; $17 = ($16|0)==(0); $18 = ($4|0)==(0); if ($17) { if ($18) { return; } $20 = Math_imul($3, $1)|0; $i$28 = 0;$p$27 = $6; while(1) { $44 = HEAP8[$p$27>>0]|0; $45 = ((($p$27)) + 2|0); $46 = HEAP8[$45>>0]|0; HEAP8[$p$27>>0] = $46; HEAP8[$45>>0] = $44; $47 = ((($p$27)) + 4|0); $48 = (($i$28) + 1)|0; $exitcond13 = ($48|0)==($20|0); if ($exitcond13) { break; } else { $i$28 = $48;$p$27 = $47; } } return; } if ($18) { return; } $19 = Math_imul($3, $1)|0; $i$111 = 0;$p$110 = $6; while(1) { $21 = ((($p$110)) + 3|0); $22 = HEAP8[$21>>0]|0; $23 = HEAP8[$p$110>>0]|0; $24 = ($22<<24>>24)==(0); $25 = ((($p$110)) + 2|0); $26 = HEAP8[$25>>0]|0; if ($24) { HEAP8[$p$110>>0] = $26; $storemerge = $23; } else { $27 = $26&255; $28 = ($27*255)|0; $29 = $22&255; $30 = (($28>>>0) / ($29>>>0))&-1; $31 = $30&255; HEAP8[$p$110>>0] = $31; $32 = ((($p$110)) + 1|0); $33 = HEAP8[$32>>0]|0; $34 = $33&255; $35 = ($34*255)|0; $36 = (($35>>>0) / ($29>>>0))&-1; $37 = $36&255; HEAP8[$32>>0] = $37; $38 = $23&255; $39 = ($38*255)|0; $40 = (($39>>>0) / ($29>>>0))&-1; $41 = $40&255; $storemerge = $41; } HEAP8[$25>>0] = $storemerge; $42 = ((($p$110)) + 4|0); $43 = (($i$111) + 1)|0; $exitcond14 = ($43|0)==($19|0); if ($exitcond14) { break; } else { $i$111 = $43;$p$110 = $42; } } return; break; } default: { ___assert_fail((18111|0),(18129|0),4295,(18143|0)); // unreachable; } } } function _stbi__expand_png_palette($a,$palette,$pal_img_n) { $a = $a|0; $palette = $palette|0; $pal_img_n = $pal_img_n|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$04 = 0, $i$16 = 0, $p$03 = 0, $p$15 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$a>>2]|0; $1 = HEAP32[$0>>2]|0; $2 = ((($0)) + 4|0); $3 = HEAP32[$2>>2]|0; $4 = Math_imul($3, $1)|0; $5 = ((($a)) + 12|0); $6 = HEAP32[$5>>2]|0; $7 = Math_imul($4, $pal_img_n)|0; $8 = (_stbi__malloc($7)|0); $9 = ($8|0)==(0|0); if ($9) { _stbi__err(18059); $$0 = 0; return ($$0|0); } $10 = ($pal_img_n|0)==(3); $11 = ($4|0)==(0); if ($10) { if (!($11)) { $13 = Math_imul($3, $1)|0; $i$04 = 0;$p$03 = $8; while(1) { $14 = (($6) + ($i$04)|0); $15 = HEAP8[$14>>0]|0; $16 = $15&255; $17 = $16 << 2; $18 = (($palette) + ($17)|0); $19 = HEAP8[$18>>0]|0; HEAP8[$p$03>>0] = $19; $20 = $17 | 1; $21 = (($palette) + ($20)|0); $22 = HEAP8[$21>>0]|0; $23 = ((($p$03)) + 1|0); HEAP8[$23>>0] = $22; $24 = $17 | 2; $25 = (($palette) + ($24)|0); $26 = HEAP8[$25>>0]|0; $27 = ((($p$03)) + 2|0); HEAP8[$27>>0] = $26; $28 = ((($p$03)) + 3|0); $29 = (($i$04) + 1)|0; $exitcond = ($29|0)==($13|0); if ($exitcond) { break; } else { $i$04 = $29;$p$03 = $28; } } } } else { if (!($11)) { $12 = Math_imul($3, $1)|0; $i$16 = 0;$p$15 = $8; while(1) { $30 = (($6) + ($i$16)|0); $31 = HEAP8[$30>>0]|0; $32 = $31&255; $33 = $32 << 2; $34 = (($palette) + ($33)|0); $35 = HEAP8[$34>>0]|0; HEAP8[$p$15>>0] = $35; $36 = $33 | 1; $37 = (($palette) + ($36)|0); $38 = HEAP8[$37>>0]|0; $39 = ((($p$15)) + 1|0); HEAP8[$39>>0] = $38; $40 = $33 | 2; $41 = (($palette) + ($40)|0); $42 = HEAP8[$41>>0]|0; $43 = ((($p$15)) + 2|0); HEAP8[$43>>0] = $42; $44 = $33 | 3; $45 = (($palette) + ($44)|0); $46 = HEAP8[$45>>0]|0; $47 = ((($p$15)) + 3|0); HEAP8[$47>>0] = $46; $48 = ((($p$15)) + 4|0); $49 = (($i$16) + 1)|0; $exitcond8 = ($49|0)==($12|0); if ($exitcond8) { break; } else { $i$16 = $49;$p$15 = $48; } } } } $50 = HEAP32[$5>>2]|0; _free($50); HEAP32[$5>>2] = $8; $$0 = 1; return ($$0|0); } function _stbi__create_png_image_raw($a,$raw,$raw_len,$out_n,$x,$y,$depth,$color) { $a = $a|0; $raw = $raw|0; $raw_len = $raw_len|0; $out_n = $out_n|0; $x = $x|0; $y = $y|0; $depth = $depth|0; $color = $color|0; var $$0 = 0, $$01229 = 0, $$1 = 0, $$2213 = 0, $$3205 = 0, $$4197 = 0, $$5188 = 0, $$6179 = 0, $$7170 = 0, $$8162 = 0, $$9 = 0, $$sum = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0; var $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum26 = 0, $$sum27$pn = 0, $$sum290 = 0, $$sum291 = 0, $$sum292 = 0, $$sum293 = 0, $$sum294 = 0, $$sum295 = 0, $$sum296 = 0, $$sum297 = 0, $$sum298 = 0, $$sum299 = 0; var $$sum3 = 0, $$sum300 = 0, $$sum301 = 0, $$sum302 = 0, $$sum303 = 0, $$sum304 = 0, $$sum31 = 0, $$sum32 = 0, $$sum33 = 0, $$sum34 = 0, $$sum35 = 0, $$sum36 = 0, $$sum37 = 0, $$sum38 = 0, $$sum39 = 0, $$sum4 = 0, $$sum40 = 0, $$sum41 = 0, $$sum41$pn = 0, $$sum5 = 0; var $$sum6 = 0, $$sum63 = 0, $$sum64 = 0, $$sum65 = 0, $$sum66 = 0, $$sum67 = 0, $$sum68 = 0, $$sum69 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0; var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0; var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0; var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0; var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0; var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0; var $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0; var $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0; var $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0; var $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0; var $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0; var $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0; var $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0; var $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0; var $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0; var $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0; var $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0; var $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0; var $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0; var $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0; var $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0; var $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0; var $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0; var $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0; var $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0; var $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0; var $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0; var $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0; var $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0; var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0; var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $cur$0$sum = 0; var $cur$0$sum42 = 0, $cur$0$sum43 = 0, $cur$0$sum44 = 0, $cur$0$sum45 = 0, $cur$0$sum46 = 0, $cur$0$sum47 = 0, $cur$0$sum48 = 0, $cur$0$sum49 = 0, $cur$0$sum50 = 0, $cur$0$sum51 = 0, $cur$0$sum53$pn = 0, $cur$0$sum54 = 0, $cur$0$sum55 = 0, $cur$0$sum56 = 0, $cur$0$sum57 = 0, $cur$0$sum58 = 0, $cur$0$sum59 = 0, $cur$0$sum60 = 0, $cur$0$sum61 = 0, $cur$1 = 0; var $cur$2212 = 0, $cur$3204 = 0, $cur$4195 = 0, $cur$5186 = 0, $cur$6177 = 0, $cur$7169 = 0, $cur$8161 = 0, $cur1$0$lcssa = 0, $cur1$0138 = 0, $cur1$1$lcssa = 0, $cur1$1130 = 0, $cur1$4$lcssa = 0, $cur1$4125 = 0, $exitcond = 0, $exitcond269 = 0, $exitcond271 = 0, $exitcond273 = 0, $exitcond275 = 0, $exitcond277 = 0, $exitcond279 = 0; var $exitcond281 = 0, $exitcond284 = 0, $exitcond285 = 0, $exitcond286 = 0, $exitcond287 = 0, $exitcond288 = 0, $exitcond289 = 0, $filter$0 = 0, $filter_bytes$0 = 0, $i$0 = 0, $i$0211 = 0, $i$0214 = 0, $i$1 = 0, $i$1203 = 0, $i$1206 = 0, $i$2 = 0, $i$2194 = 0, $i$2198 = 0, $i$3 = 0, $i$3185 = 0; var $i$3189 = 0, $i$4 = 0, $i$4176 = 0, $i$4180 = 0, $i$5 = 0, $i$5168 = 0, $i$5171 = 0, $i$6 = 0, $i$6160 = 0, $i$6163 = 0, $in$0$lcssa = 0, $in$0139 = 0, $in$1$lcssa = 0, $in$1131 = 0, $in$2$lcssa = 0, $in$2126 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next255 = 0, $indvars$iv$next258 = 0; var $indvars$iv$next261 = 0, $indvars$iv$next264 = 0, $indvars$iv$next267 = 0, $indvars$iv254 = 0, $indvars$iv257 = 0, $indvars$iv260 = 0, $indvars$iv263 = 0, $indvars$iv266 = 0, $j$0228 = 0, $j$1151 = 0, $k$0153 = 0, $k$10182 = 0, $k$11173 = 0, $k$12165 = 0, $k$1226 = 0, $k$13157 = 0, $k$14$lcssa = 0, $k$14137 = 0, $k$15$lcssa = 0, $k$15129 = 0; var $k$16$lcssa = 0, $k$16124 = 0, $k$2224 = 0, $k$3222 = 0, $k$4220 = 0, $k$5218 = 0, $k$6216 = 0, $k$7208 = 0, $k$8200 = 0, $k$9191 = 0, $or$cond = 0, $or$cond311 = 0, $prior$0 = 0, $prior$0$sum = 0, $prior$0$sum28 = 0, $prior$0$sum29 = 0, $prior$0$sum30 = 0, $prior$3196 = 0, $prior$4187 = 0, $prior$5178 = 0; var $q$0 = 0, $q$0148 = 0, $q$0149 = 0, $q$1 = 0, $q$1145 = 0, $q$1146 = 0, $scevgep = 0, $scevgep256 = 0, $scevgep259 = 0, $scevgep262 = 0, $scevgep265 = 0, $scevgep268 = 0, $scevgep270 = 0, $scevgep272 = 0, $scevgep274 = 0, $scevgep276 = 0, $scevgep278 = 0, $scevgep280 = 0, $scevgep283 = 0, $width$0 = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$a>>2]|0; $1 = Math_imul($x, $out_n)|0; $2 = ((($0)) + 8|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)==($out_n|0); $5 = (($3) + 1)|0; $6 = ($5|0)==($out_n|0); $or$cond = $4 | $6; if (!($or$cond)) { ___assert_fail((18211|0),(18129|0),3994,(18252|0)); // unreachable; } $7 = Math_imul($x, $out_n)|0; $8 = Math_imul($7, $y)|0; $9 = (_stbi__malloc($8)|0); $10 = ((($a)) + 12|0); HEAP32[$10>>2] = $9; $11 = ($9|0)==(0|0); if ($11) { _stbi__err(18059); $$0 = 0; return ($$0|0); } $12 = Math_imul($3, $x)|0; $13 = Math_imul($12, $depth)|0; $14 = (($13) + 7)|0; $15 = $14 >>> 3; $16 = (($15) + 1)|0; $17 = Math_imul($16, $y)|0; $18 = HEAP32[$0>>2]|0; $19 = ($18|0)==($x|0); if ($19) { $20 = ((($0)) + 4|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)==($y|0); if ($22) { $23 = ($17|0)==($raw_len|0); if (!($23)) { _stbi__err(18279); $$0 = 0; return ($$0|0); } } else { label = 9; } } else { label = 9; } if ((label|0) == 9) { $24 = ($17>>>0)>($raw_len>>>0); if ($24) { _stbi__err(18279); $$0 = 0; return ($$0|0); } } $25 = ($y|0)==(0); L18: do { if (!($25)) { $26 = ($depth|0)<(8); $27 = ($15>>>0)>($x>>>0); $28 = (($1) - ($15))|0; $29 = ($depth|0)==(8); $$sum26 = (($3) + 1)|0; $brmerge = $26 | $4; $i$0211 = (($x) + -1)|0; $30 = ($i$0211|0)==(0); $31 = ($3|0)>(0); $i$1203 = (($x) + -1)|0; $32 = ($i$1203|0)==(0); $33 = ($3|0)>(0); $i$2194 = (($x) + -1)|0; $34 = ($i$2194|0)==(0); $35 = ($3|0)>(0); $i$3185 = (($x) + -1)|0; $36 = ($i$3185|0)==(0); $37 = ($3|0)>(0); $i$4176 = (($x) + -1)|0; $38 = ($i$4176|0)==(0); $39 = ($3|0)>(0); $i$5168 = (($x) + -1)|0; $40 = ($i$5168|0)==(0); $41 = ($3|0)>(0); $i$6160 = (($x) + -1)|0; $42 = ($i$6160|0)==(0); $43 = ($3|0)>(0); $44 = Math_imul($3, $i$6160)|0; $$01229 = $raw;$j$0228 = 0; L20: while(1) { $45 = HEAP32[$10>>2]|0; $46 = Math_imul($j$0228, $1)|0; $$sum13 = (($46) - ($1))|0; $47 = HEAP8[$$01229>>0]|0; $48 = $47&255; $49 = ($47&255)>(4); if ($49) { label = 14; break; } if ($26) { if ($27) { label = 17; break; } $$sum41 = (($28) + ($46))|0; $$sum41$pn = $$sum41;$filter_bytes$0 = 1;$width$0 = $15; } else { $$sum41$pn = $46;$filter_bytes$0 = $3;$width$0 = $x; } $50 = ($j$0228|0)==(0); if ($50) { $51 = (18333 + ($48)|0); $52 = HEAP8[$51>>0]|0; $53 = $52&255; $filter$0 = $53; } else { $filter$0 = $48; } $54 = ($filter_bytes$0|0)>(0); L30: do { if ($54) { $k$0153 = 0; while(1) { switch ($filter$0|0) { case 0: { $$sum40 = (($k$0153) + 1)|0; $55 = (($$01229) + ($$sum40)|0); $56 = HEAP8[$55>>0]|0; $cur$0$sum55 = (($k$0153) + ($$sum41$pn))|0; $57 = (($45) + ($cur$0$sum55)|0); HEAP8[$57>>0] = $56; break; } case 1: { $$sum39 = (($k$0153) + 1)|0; $58 = (($$01229) + ($$sum39)|0); $59 = HEAP8[$58>>0]|0; $cur$0$sum56 = (($k$0153) + ($$sum41$pn))|0; $60 = (($45) + ($cur$0$sum56)|0); HEAP8[$60>>0] = $59; break; } case 2: { $$sum37 = (($k$0153) + 1)|0; $61 = (($$01229) + ($$sum37)|0); $62 = HEAP8[$61>>0]|0; $63 = $62&255; $$sum38 = (($k$0153) + ($$sum13))|0; $64 = (($45) + ($$sum38)|0); $65 = HEAP8[$64>>0]|0; $66 = $65&255; $67 = (($66) + ($63))|0; $68 = $67&255; $cur$0$sum57 = (($k$0153) + ($$sum41$pn))|0; $69 = (($45) + ($cur$0$sum57)|0); HEAP8[$69>>0] = $68; break; } case 3: { $$sum35 = (($k$0153) + 1)|0; $70 = (($$01229) + ($$sum35)|0); $71 = HEAP8[$70>>0]|0; $72 = $71&255; $$sum36 = (($k$0153) + ($$sum13))|0; $73 = (($45) + ($$sum36)|0); $74 = HEAP8[$73>>0]|0; $75 = $74&255; $76 = $75 >>> 1; $77 = (($76) + ($72))|0; $78 = $77&255; $cur$0$sum58 = (($k$0153) + ($$sum41$pn))|0; $79 = (($45) + ($cur$0$sum58)|0); HEAP8[$79>>0] = $78; break; } case 4: { $$sum33 = (($k$0153) + 1)|0; $80 = (($$01229) + ($$sum33)|0); $81 = HEAP8[$80>>0]|0; $82 = $81&255; $$sum34 = (($k$0153) + ($$sum13))|0; $83 = (($45) + ($$sum34)|0); $84 = HEAP8[$83>>0]|0; $85 = $84&255; $86 = (_stbi__paeth(0,$85,0)|0); $87 = (($86) + ($82))|0; $88 = $87&255; $cur$0$sum59 = (($k$0153) + ($$sum41$pn))|0; $89 = (($45) + ($cur$0$sum59)|0); HEAP8[$89>>0] = $88; break; } case 5: { $$sum32 = (($k$0153) + 1)|0; $90 = (($$01229) + ($$sum32)|0); $91 = HEAP8[$90>>0]|0; $cur$0$sum60 = (($k$0153) + ($$sum41$pn))|0; $92 = (($45) + ($cur$0$sum60)|0); HEAP8[$92>>0] = $91; break; } case 6: { $$sum31 = (($k$0153) + 1)|0; $93 = (($$01229) + ($$sum31)|0); $94 = HEAP8[$93>>0]|0; $cur$0$sum61 = (($k$0153) + ($$sum41$pn))|0; $95 = (($45) + ($cur$0$sum61)|0); HEAP8[$95>>0] = $94; break; } default: { } } $96 = (($k$0153) + 1)|0; $exitcond = ($96|0)==($filter_bytes$0|0); if ($exitcond) { break L30; } else { $k$0153 = $96; } } } } while(0); if ($29) { if (!($4)) { $cur$0$sum54 = (($$sum41$pn) + ($3))|0; $97 = (($45) + ($cur$0$sum54)|0); HEAP8[$97>>0] = -1; } $98 = (($$01229) + ($$sum26)|0); $$1 = $98;$100 = $out_n;$125 = $$sum26; } else { $99 = ((($$01229)) + 2|0); $$1 = $99;$100 = 1;$125 = 2; } $$sum27$pn = (($100) + ($$sum13))|0; $cur$0$sum53$pn = (($100) + ($$sum41$pn))|0; $cur$1 = (($45) + ($cur$0$sum53$pn)|0); $prior$0 = (($45) + ($$sum27$pn)|0); L50: do { if ($brmerge) { $101 = (($width$0) + -1)|0; $102 = Math_imul($101, $3)|0; switch ($filter$0|0) { case 0: { _memcpy(($cur$1|0),($$1|0),($102|0))|0; break; } case 1: { $121 = ($102|0)>(0); if ($121) { $122 = (($$sum41$pn) - ($filter_bytes$0))|0; $$sum24 = (($122) + ($100))|0; $$sum25 = (($100) + ($$sum41$pn))|0; $123 = (($width$0) + -1)|0; $124 = Math_imul($3, $123)|0; $k$1226 = 0; while(1) { $$sum69 = (($k$1226) + ($125))|0; $126 = (($$01229) + ($$sum69)|0); $127 = HEAP8[$126>>0]|0; $128 = $127&255; $cur$0$sum42 = (($$sum24) + ($k$1226))|0; $129 = (($45) + ($cur$0$sum42)|0); $130 = HEAP8[$129>>0]|0; $131 = $130&255; $132 = (($131) + ($128))|0; $133 = $132&255; $cur$0$sum = (($$sum25) + ($k$1226))|0; $134 = (($45) + ($cur$0$sum)|0); HEAP8[$134>>0] = $133; $135 = (($k$1226) + 1)|0; $exitcond289 = ($135|0)==($124|0); if ($exitcond289) { break; } else { $k$1226 = $135; } } } break; } case 2: { $118 = ($102|0)>(0); if ($118) { $$sum23 = (($100) + ($$sum41$pn))|0; $119 = (($width$0) + -1)|0; $120 = Math_imul($3, $119)|0; $k$2224 = 0; while(1) { $$sum68 = (($k$2224) + ($125))|0; $136 = (($$01229) + ($$sum68)|0); $137 = HEAP8[$136>>0]|0; $138 = $137&255; $prior$0$sum = (($k$2224) + ($$sum27$pn))|0; $139 = (($45) + ($prior$0$sum)|0); $140 = HEAP8[$139>>0]|0; $141 = $140&255; $142 = (($141) + ($138))|0; $143 = $142&255; $cur$0$sum43 = (($$sum23) + ($k$2224))|0; $144 = (($45) + ($cur$0$sum43)|0); HEAP8[$144>>0] = $143; $145 = (($k$2224) + 1)|0; $exitcond288 = ($145|0)==($120|0); if ($exitcond288) { break; } else { $k$2224 = $145; } } } break; } case 3: { $114 = ($102|0)>(0); if ($114) { $115 = (($$sum41$pn) - ($filter_bytes$0))|0; $$sum21 = (($115) + ($100))|0; $$sum22 = (($100) + ($$sum41$pn))|0; $116 = (($width$0) + -1)|0; $117 = Math_imul($3, $116)|0; $k$3222 = 0; while(1) { $$sum67 = (($k$3222) + ($125))|0; $146 = (($$01229) + ($$sum67)|0); $147 = HEAP8[$146>>0]|0; $148 = $147&255; $prior$0$sum28 = (($k$3222) + ($$sum27$pn))|0; $149 = (($45) + ($prior$0$sum28)|0); $150 = HEAP8[$149>>0]|0; $151 = $150&255; $cur$0$sum45 = (($$sum21) + ($k$3222))|0; $152 = (($45) + ($cur$0$sum45)|0); $153 = HEAP8[$152>>0]|0; $154 = $153&255; $155 = (($154) + ($151))|0; $156 = $155 >>> 1; $157 = (($156) + ($148))|0; $158 = $157&255; $cur$0$sum44 = (($$sum22) + ($k$3222))|0; $159 = (($45) + ($cur$0$sum44)|0); HEAP8[$159>>0] = $158; $160 = (($k$3222) + 1)|0; $exitcond287 = ($160|0)==($117|0); if ($exitcond287) { break; } else { $k$3222 = $160; } } } break; } case 4: { $111 = ($102|0)>(0); if ($111) { $$sum19 = (($100) + ($$sum41$pn))|0; $$sum20 = (($100) + ($$sum41$pn))|0; $112 = (($width$0) + -1)|0; $113 = Math_imul($3, $112)|0; $k$4220 = 0; while(1) { $$sum66 = (($k$4220) + ($125))|0; $161 = (($$01229) + ($$sum66)|0); $162 = HEAP8[$161>>0]|0; $163 = $162&255; $164 = (($k$4220) - ($filter_bytes$0))|0; $cur$0$sum47 = (($$sum19) + ($164))|0; $165 = (($45) + ($cur$0$sum47)|0); $166 = HEAP8[$165>>0]|0; $167 = $166&255; $prior$0$sum30 = (($k$4220) + ($$sum27$pn))|0; $168 = (($45) + ($prior$0$sum30)|0); $169 = HEAP8[$168>>0]|0; $170 = $169&255; $prior$0$sum29 = (($164) + ($$sum27$pn))|0; $171 = (($45) + ($prior$0$sum29)|0); $172 = HEAP8[$171>>0]|0; $173 = $172&255; $174 = (_stbi__paeth($167,$170,$173)|0); $175 = (($174) + ($163))|0; $176 = $175&255; $cur$0$sum46 = (($$sum20) + ($k$4220))|0; $177 = (($45) + ($cur$0$sum46)|0); HEAP8[$177>>0] = $176; $178 = (($k$4220) + 1)|0; $exitcond286 = ($178|0)==($113|0); if ($exitcond286) { break; } else { $k$4220 = $178; } } } break; } case 5: { $107 = ($102|0)>(0); if ($107) { $108 = (($$sum41$pn) - ($filter_bytes$0))|0; $$sum17 = (($108) + ($100))|0; $$sum18 = (($100) + ($$sum41$pn))|0; $109 = (($width$0) + -1)|0; $110 = Math_imul($3, $109)|0; $k$5218 = 0; while(1) { $$sum65 = (($k$5218) + ($125))|0; $179 = (($$01229) + ($$sum65)|0); $180 = HEAP8[$179>>0]|0; $181 = $180&255; $cur$0$sum49 = (($$sum17) + ($k$5218))|0; $182 = (($45) + ($cur$0$sum49)|0); $183 = HEAP8[$182>>0]|0; $184 = $183&255; $185 = $184 >>> 1; $186 = (($185) + ($181))|0; $187 = $186&255; $cur$0$sum48 = (($$sum18) + ($k$5218))|0; $188 = (($45) + ($cur$0$sum48)|0); HEAP8[$188>>0] = $187; $189 = (($k$5218) + 1)|0; $exitcond285 = ($189|0)==($110|0); if ($exitcond285) { break; } else { $k$5218 = $189; } } } break; } case 6: { $103 = ($102|0)>(0); if ($103) { $104 = (($$sum41$pn) - ($filter_bytes$0))|0; $$sum15 = (($104) + ($100))|0; $$sum16 = (($100) + ($$sum41$pn))|0; $105 = (($width$0) + -1)|0; $106 = Math_imul($3, $105)|0; $k$6216 = 0; while(1) { $$sum64 = (($k$6216) + ($125))|0; $190 = (($$01229) + ($$sum64)|0); $191 = HEAP8[$190>>0]|0; $192 = $191&255; $cur$0$sum51 = (($$sum15) + ($k$6216))|0; $193 = (($45) + ($cur$0$sum51)|0); $194 = HEAP8[$193>>0]|0; $195 = $194&255; $196 = (_stbi__paeth($195,0,0)|0); $197 = (($196) + ($192))|0; $198 = $197&255; $cur$0$sum50 = (($$sum16) + ($k$6216))|0; $199 = (($45) + ($cur$0$sum50)|0); HEAP8[$199>>0] = $198; $200 = (($k$6216) + 1)|0; $exitcond284 = ($200|0)==($106|0); if ($exitcond284) { break; } else { $k$6216 = $200; } } } break; } default: { } } $$sum63 = (($125) + ($102))|0; $201 = (($$01229) + ($$sum63)|0); $$9 = $201; } else { if (!($6)) { label = 59; break L20; } switch ($filter$0|0) { case 0: { if ($30) { $$9 = $$1; break L50; } else { $$2213 = $$1;$cur$2212 = $cur$1;$i$0214 = $i$0211; } while(1) { if ($31) { $k$7208 = 0; while(1) { $202 = (($$2213) + ($k$7208)|0); $203 = HEAP8[$202>>0]|0; $204 = (($cur$2212) + ($k$7208)|0); HEAP8[$204>>0] = $203; $205 = (($k$7208) + 1)|0; $exitcond281 = ($205|0)==($3|0); if ($exitcond281) { break; } else { $k$7208 = $205; } } } $206 = (($cur$2212) + ($3)|0); HEAP8[$206>>0] = -1; $207 = (($$2213) + ($3)|0); $208 = (($cur$2212) + ($out_n)|0); $i$0 = (($i$0214) + -1)|0; $209 = ($i$0|0)==(0); if ($209) { break; } else { $$2213 = $207;$cur$2212 = $208;$i$0214 = $i$0; } } $$sum304 = (($125) + ($44))|0; $scevgep283 = (($$01229) + ($$sum304)|0); $$9 = $scevgep283; break L50; break; } case 1: { if ($32) { $$9 = $$1; break L50; } else { $$3205 = $$1;$cur$3204 = $cur$1;$i$1206 = $i$1203; } while(1) { if ($33) { $k$8200 = 0; while(1) { $210 = (($$3205) + ($k$8200)|0); $211 = HEAP8[$210>>0]|0; $212 = $211&255; $213 = (($k$8200) - ($out_n))|0; $214 = (($cur$3204) + ($213)|0); $215 = HEAP8[$214>>0]|0; $216 = $215&255; $217 = (($216) + ($212))|0; $218 = $217&255; $219 = (($cur$3204) + ($k$8200)|0); HEAP8[$219>>0] = $218; $220 = (($k$8200) + 1)|0; $exitcond279 = ($220|0)==($3|0); if ($exitcond279) { break; } else { $k$8200 = $220; } } } $221 = (($cur$3204) + ($3)|0); HEAP8[$221>>0] = -1; $222 = (($$3205) + ($3)|0); $223 = (($cur$3204) + ($out_n)|0); $i$1 = (($i$1206) + -1)|0; $224 = ($i$1|0)==(0); if ($224) { break; } else { $$3205 = $222;$cur$3204 = $223;$i$1206 = $i$1; } } $$sum303 = (($125) + ($44))|0; $scevgep280 = (($$01229) + ($$sum303)|0); $$9 = $scevgep280; break L50; break; } case 2: { if ($34) { $$9 = $$1; break L50; } else { $$4197 = $$1;$cur$4195 = $cur$1;$i$2198 = $i$2194;$prior$3196 = $prior$0; } while(1) { if ($35) { $k$9191 = 0; while(1) { $225 = (($$4197) + ($k$9191)|0); $226 = HEAP8[$225>>0]|0; $227 = $226&255; $228 = (($prior$3196) + ($k$9191)|0); $229 = HEAP8[$228>>0]|0; $230 = $229&255; $231 = (($230) + ($227))|0; $232 = $231&255; $233 = (($cur$4195) + ($k$9191)|0); HEAP8[$233>>0] = $232; $234 = (($k$9191) + 1)|0; $exitcond277 = ($234|0)==($3|0); if ($exitcond277) { break; } else { $k$9191 = $234; } } } $235 = (($cur$4195) + ($3)|0); HEAP8[$235>>0] = -1; $236 = (($$4197) + ($3)|0); $237 = (($cur$4195) + ($out_n)|0); $238 = (($prior$3196) + ($out_n)|0); $i$2 = (($i$2198) + -1)|0; $239 = ($i$2|0)==(0); if ($239) { break; } else { $$4197 = $236;$cur$4195 = $237;$i$2198 = $i$2;$prior$3196 = $238; } } $$sum302 = (($125) + ($44))|0; $scevgep278 = (($$01229) + ($$sum302)|0); $$9 = $scevgep278; break L50; break; } case 3: { if ($36) { $$9 = $$1; break L50; } else { $$5188 = $$1;$cur$5186 = $cur$1;$i$3189 = $i$3185;$prior$4187 = $prior$0; } while(1) { if ($37) { $k$10182 = 0; while(1) { $240 = (($$5188) + ($k$10182)|0); $241 = HEAP8[$240>>0]|0; $242 = $241&255; $243 = (($prior$4187) + ($k$10182)|0); $244 = HEAP8[$243>>0]|0; $245 = $244&255; $246 = (($k$10182) - ($out_n))|0; $247 = (($cur$5186) + ($246)|0); $248 = HEAP8[$247>>0]|0; $249 = $248&255; $250 = (($249) + ($245))|0; $251 = $250 >>> 1; $252 = (($251) + ($242))|0; $253 = $252&255; $254 = (($cur$5186) + ($k$10182)|0); HEAP8[$254>>0] = $253; $255 = (($k$10182) + 1)|0; $exitcond275 = ($255|0)==($3|0); if ($exitcond275) { break; } else { $k$10182 = $255; } } } $256 = (($cur$5186) + ($3)|0); HEAP8[$256>>0] = -1; $257 = (($$5188) + ($3)|0); $258 = (($cur$5186) + ($out_n)|0); $259 = (($prior$4187) + ($out_n)|0); $i$3 = (($i$3189) + -1)|0; $260 = ($i$3|0)==(0); if ($260) { break; } else { $$5188 = $257;$cur$5186 = $258;$i$3189 = $i$3;$prior$4187 = $259; } } $$sum301 = (($125) + ($44))|0; $scevgep276 = (($$01229) + ($$sum301)|0); $$9 = $scevgep276; break L50; break; } case 4: { if ($38) { $$9 = $$1; break L50; } else { $$6179 = $$1;$cur$6177 = $cur$1;$i$4180 = $i$4176;$prior$5178 = $prior$0; } while(1) { if ($39) { $k$11173 = 0; while(1) { $261 = (($$6179) + ($k$11173)|0); $262 = HEAP8[$261>>0]|0; $263 = $262&255; $264 = (($k$11173) - ($out_n))|0; $265 = (($cur$6177) + ($264)|0); $266 = HEAP8[$265>>0]|0; $267 = $266&255; $268 = (($prior$5178) + ($k$11173)|0); $269 = HEAP8[$268>>0]|0; $270 = $269&255; $271 = (($prior$5178) + ($264)|0); $272 = HEAP8[$271>>0]|0; $273 = $272&255; $274 = (_stbi__paeth($267,$270,$273)|0); $275 = (($274) + ($263))|0; $276 = $275&255; $277 = (($cur$6177) + ($k$11173)|0); HEAP8[$277>>0] = $276; $278 = (($k$11173) + 1)|0; $exitcond273 = ($278|0)==($3|0); if ($exitcond273) { break; } else { $k$11173 = $278; } } } $279 = (($cur$6177) + ($3)|0); HEAP8[$279>>0] = -1; $280 = (($$6179) + ($3)|0); $281 = (($cur$6177) + ($out_n)|0); $282 = (($prior$5178) + ($out_n)|0); $i$4 = (($i$4180) + -1)|0; $283 = ($i$4|0)==(0); if ($283) { break; } else { $$6179 = $280;$cur$6177 = $281;$i$4180 = $i$4;$prior$5178 = $282; } } $$sum300 = (($125) + ($44))|0; $scevgep274 = (($$01229) + ($$sum300)|0); $$9 = $scevgep274; break L50; break; } case 5: { if ($40) { $$9 = $$1; break L50; } else { $$7170 = $$1;$cur$7169 = $cur$1;$i$5171 = $i$5168; } while(1) { if ($41) { $k$12165 = 0; while(1) { $284 = (($$7170) + ($k$12165)|0); $285 = HEAP8[$284>>0]|0; $286 = $285&255; $287 = (($k$12165) - ($out_n))|0; $288 = (($cur$7169) + ($287)|0); $289 = HEAP8[$288>>0]|0; $290 = $289&255; $291 = $290 >>> 1; $292 = (($291) + ($286))|0; $293 = $292&255; $294 = (($cur$7169) + ($k$12165)|0); HEAP8[$294>>0] = $293; $295 = (($k$12165) + 1)|0; $exitcond271 = ($295|0)==($3|0); if ($exitcond271) { break; } else { $k$12165 = $295; } } } $296 = (($cur$7169) + ($3)|0); HEAP8[$296>>0] = -1; $297 = (($$7170) + ($3)|0); $298 = (($cur$7169) + ($out_n)|0); $i$5 = (($i$5171) + -1)|0; $299 = ($i$5|0)==(0); if ($299) { break; } else { $$7170 = $297;$cur$7169 = $298;$i$5171 = $i$5; } } $$sum299 = (($125) + ($44))|0; $scevgep272 = (($$01229) + ($$sum299)|0); $$9 = $scevgep272; break L50; break; } case 6: { if ($42) { $$9 = $$1; break L50; } else { $$8162 = $$1;$cur$8161 = $cur$1;$i$6163 = $i$6160; } while(1) { if ($43) { $k$13157 = 0; while(1) { $300 = (($$8162) + ($k$13157)|0); $301 = HEAP8[$300>>0]|0; $302 = $301&255; $303 = (($k$13157) - ($out_n))|0; $304 = (($cur$8161) + ($303)|0); $305 = HEAP8[$304>>0]|0; $306 = $305&255; $307 = (_stbi__paeth($306,0,0)|0); $308 = (($307) + ($302))|0; $309 = $308&255; $310 = (($cur$8161) + ($k$13157)|0); HEAP8[$310>>0] = $309; $311 = (($k$13157) + 1)|0; $exitcond269 = ($311|0)==($3|0); if ($exitcond269) { break; } else { $k$13157 = $311; } } } $312 = (($cur$8161) + ($3)|0); HEAP8[$312>>0] = -1; $313 = (($$8162) + ($3)|0); $314 = (($cur$8161) + ($out_n)|0); $i$6 = (($i$6163) + -1)|0; $315 = ($i$6|0)==(0); if ($315) { break; } else { $$8162 = $313;$cur$8161 = $314;$i$6163 = $i$6; } } $$sum290 = (($125) + ($44))|0; $scevgep270 = (($$01229) + ($$sum290)|0); $$9 = $scevgep270; break L50; break; } default: { $$9 = $$1; break L50; } } } } while(0); $316 = (($j$0228) + 1)|0; $317 = ($316>>>0)<($y>>>0); if ($317) { $$01229 = $$9;$j$0228 = $316; } else { break L18; } } if ((label|0) == 14) { _stbi__err(18297); $$0 = 0; return ($$0|0); } else if ((label|0) == 17) { ___assert_fail((18312|0),(18129|0),4016,(18252|0)); // unreachable; } else if ((label|0) == 59) { ___assert_fail((18338|0),(18129|0),4069,(18252|0)); // unreachable; } } } while(0); $318 = ($depth|0)>(7); $319 = ($y|0)==(0); $or$cond311 = $318 | $319; if ($or$cond311) { $$0 = 1; return ($$0|0); } $$sum = (($1) - ($15))|0; $320 = ($color|0)==(0); $321 = (18042 + ($depth)|0); $q$0148 = (($x) + -1)|0; $322 = ($q$0148|0)>(-1); $q$1145 = (($x) + -1)|0; $323 = ($q$1145|0)>(-1); $324 = ($12|0)>(1); $325 = ($12|0)>(3); $326 = ($12|0)>(7); $327 = Math_imul($3, $x)|0; $328 = (($327) + -8)|0; $329 = $328 >>> 3; $330 = Math_imul($x, $out_n)|0; $331 = (($329) + ($330))|0; $332 = (($331) + 1)|0; $333 = Math_imul($3, $depth)|0; $334 = Math_imul($333, $x)|0; $335 = (($334) + 7)|0; $336 = $335 >>> 3; $337 = (($332) - ($336))|0; $338 = (($327) + -8)|0; $339 = $329 << 3; $340 = (($338) - ($339))|0; $341 = (($339) + 8)|0; $342 = Math_imul($3, $x)|0; $343 = (($342) + -4)|0; $344 = $343 >>> 2; $345 = Math_imul($x, $out_n)|0; $346 = (($344) + ($345))|0; $347 = (($346) + 1)|0; $348 = Math_imul($3, $depth)|0; $349 = Math_imul($348, $x)|0; $350 = (($349) + 7)|0; $351 = $350 >>> 3; $352 = (($347) - ($351))|0; $353 = (($342) + -4)|0; $354 = $344 << 2; $355 = (($353) - ($354))|0; $356 = (($354) + 4)|0; $357 = Math_imul($3, $x)|0; $358 = (($357) + -2)|0; $359 = $358 >>> 1; $360 = Math_imul($x, $out_n)|0; $361 = (($359) + ($360))|0; $362 = (($361) + 1)|0; $363 = Math_imul($3, $depth)|0; $364 = Math_imul($363, $x)|0; $365 = (($364) + 7)|0; $366 = $365 >>> 3; $367 = (($362) - ($366))|0; $368 = (($357) + -2)|0; $369 = $359 << 1; $370 = (($368) - ($369))|0; $371 = (($369) + 2)|0; $indvars$iv = $337;$indvars$iv254 = $341;$indvars$iv257 = $352;$indvars$iv260 = $356;$indvars$iv263 = $367;$indvars$iv266 = $371;$j$1151 = 0; L148: while(1) { $372 = HEAP32[$10>>2]|0; $373 = Math_imul($j$1151, $1)|0; $374 = (($372) + ($373)|0); $$sum2 = (($$sum) + ($373))|0; $375 = (($372) + ($$sum2)|0); if ($320) { $376 = HEAP8[$321>>0]|0; $377 = $376&255; $382 = $377; } else { $382 = 1; } switch ($depth|0) { case 4: { if ($324) { $scevgep265 = (($372) + ($indvars$iv263)|0); $cur1$0138 = $374;$in$0139 = $375;$k$14137 = $12; while(1) { $378 = HEAP8[$in$0139>>0]|0; $379 = $378&255; $380 = $379 >>> 4; $381 = Math_imul($380, $382)|0; $383 = $381&255; $384 = ((($cur1$0138)) + 1|0); HEAP8[$cur1$0138>>0] = $383; $385 = HEAP8[$in$0139>>0]|0; $386 = $385&255; $387 = $386 & 15; $388 = Math_imul($387, $382)|0; $389 = $388&255; $390 = ((($cur1$0138)) + 2|0); HEAP8[$384>>0] = $389; $391 = (($k$14137) + -2)|0; $392 = ((($in$0139)) + 1|0); $393 = ($391|0)>(1); if ($393) { $cur1$0138 = $390;$in$0139 = $392;$k$14137 = $391; } else { break; } } $scevgep268 = (($372) + ($indvars$iv266)|0); $cur1$0$lcssa = $scevgep268;$in$0$lcssa = $scevgep265;$k$14$lcssa = $370; } else { $cur1$0$lcssa = $374;$in$0$lcssa = $375;$k$14$lcssa = $12; } $394 = ($k$14$lcssa|0)>(0); if ($394) { $395 = HEAP8[$in$0$lcssa>>0]|0; $396 = $395&255; $397 = $396 >>> 4; $398 = Math_imul($397, $382)|0; $399 = $398&255; HEAP8[$cur1$0$lcssa>>0] = $399; } break; } case 2: { if ($325) { $scevgep259 = (($372) + ($indvars$iv257)|0); $cur1$1130 = $374;$in$1131 = $375;$k$15129 = $12; while(1) { $400 = HEAP8[$in$1131>>0]|0; $401 = $400&255; $402 = $401 >>> 6; $403 = Math_imul($402, $382)|0; $404 = $403&255; $405 = ((($cur1$1130)) + 1|0); HEAP8[$cur1$1130>>0] = $404; $406 = HEAP8[$in$1131>>0]|0; $407 = $406&255; $408 = $407 >>> 4; $409 = $408 & 3; $410 = Math_imul($409, $382)|0; $411 = $410&255; $412 = ((($cur1$1130)) + 2|0); HEAP8[$405>>0] = $411; $413 = HEAP8[$in$1131>>0]|0; $414 = $413&255; $415 = $414 >>> 2; $416 = $415 & 3; $417 = Math_imul($416, $382)|0; $418 = $417&255; $419 = ((($cur1$1130)) + 3|0); HEAP8[$412>>0] = $418; $420 = HEAP8[$in$1131>>0]|0; $421 = $420&255; $422 = $421 & 3; $423 = Math_imul($422, $382)|0; $424 = $423&255; $425 = ((($cur1$1130)) + 4|0); HEAP8[$419>>0] = $424; $426 = (($k$15129) + -4)|0; $427 = ((($in$1131)) + 1|0); $428 = ($426|0)>(3); if ($428) { $cur1$1130 = $425;$in$1131 = $427;$k$15129 = $426; } else { break; } } $scevgep262 = (($372) + ($indvars$iv260)|0); $436 = $indvars$iv260;$cur1$1$lcssa = $scevgep262;$in$1$lcssa = $scevgep259;$k$15$lcssa = $355; } else { $436 = $373;$cur1$1$lcssa = $374;$in$1$lcssa = $375;$k$15$lcssa = $12; } $429 = ($k$15$lcssa|0)>(0); if ($429) { $430 = HEAP8[$in$1$lcssa>>0]|0; $431 = $430&255; $432 = $431 >>> 6; $433 = Math_imul($432, $382)|0; $434 = $433&255; HEAP8[$cur1$1$lcssa>>0] = $434; $435 = ($k$15$lcssa|0)>(1); if ($435) { $$sum297 = (($436) + 1)|0; $437 = (($372) + ($$sum297)|0); $438 = HEAP8[$in$1$lcssa>>0]|0; $439 = $438&255; $440 = $439 >>> 4; $441 = $440 & 3; $442 = Math_imul($441, $382)|0; $443 = $442&255; HEAP8[$437>>0] = $443; $444 = ($k$15$lcssa|0)>(2); if ($444) { $$sum298 = (($436) + 2)|0; $445 = (($372) + ($$sum298)|0); $446 = HEAP8[$in$1$lcssa>>0]|0; $447 = $446&255; $448 = $447 >>> 2; $449 = $448 & 3; $450 = Math_imul($449, $382)|0; $451 = $450&255; HEAP8[$445>>0] = $451; } } } break; } case 1: { if ($326) { $scevgep = (($372) + ($indvars$iv)|0); $cur1$4125 = $374;$in$2126 = $375;$k$16124 = $12; while(1) { $452 = HEAP8[$in$2126>>0]|0; $453 = $452&255; $454 = $453 >>> 7; $455 = (0 - ($454))|0; $456 = $382 & $455; $457 = $456&255; $458 = ((($cur1$4125)) + 1|0); HEAP8[$cur1$4125>>0] = $457; $459 = HEAP8[$in$2126>>0]|0; $460 = $459&255; $461 = $460 >>> 6; $462 = $461 & 1; $463 = (0 - ($462))|0; $464 = $382 & $463; $465 = $464&255; $466 = ((($cur1$4125)) + 2|0); HEAP8[$458>>0] = $465; $467 = HEAP8[$in$2126>>0]|0; $468 = $467&255; $469 = $468 >>> 5; $470 = $469 & 1; $471 = (0 - ($470))|0; $472 = $382 & $471; $473 = $472&255; $474 = ((($cur1$4125)) + 3|0); HEAP8[$466>>0] = $473; $475 = HEAP8[$in$2126>>0]|0; $476 = $475&255; $477 = $476 >>> 4; $478 = $477 & 1; $479 = (0 - ($478))|0; $480 = $382 & $479; $481 = $480&255; $482 = ((($cur1$4125)) + 4|0); HEAP8[$474>>0] = $481; $483 = HEAP8[$in$2126>>0]|0; $484 = $483&255; $485 = $484 >>> 3; $486 = $485 & 1; $487 = (0 - ($486))|0; $488 = $382 & $487; $489 = $488&255; $490 = ((($cur1$4125)) + 5|0); HEAP8[$482>>0] = $489; $491 = HEAP8[$in$2126>>0]|0; $492 = $491&255; $493 = $492 >>> 2; $494 = $493 & 1; $495 = (0 - ($494))|0; $496 = $382 & $495; $497 = $496&255; $498 = ((($cur1$4125)) + 6|0); HEAP8[$490>>0] = $497; $499 = HEAP8[$in$2126>>0]|0; $500 = $499&255; $501 = $500 >>> 1; $502 = $501 & 1; $503 = (0 - ($502))|0; $504 = $382 & $503; $505 = $504&255; $506 = ((($cur1$4125)) + 7|0); HEAP8[$498>>0] = $505; $507 = HEAP8[$in$2126>>0]|0; $508 = $507&255; $509 = $508 & 1; $510 = (0 - ($509))|0; $511 = $382 & $510; $512 = $511&255; $513 = ((($cur1$4125)) + 8|0); HEAP8[$506>>0] = $512; $514 = (($k$16124) + -8)|0; $515 = ((($in$2126)) + 1|0); $516 = ($514|0)>(7); if ($516) { $cur1$4125 = $513;$in$2126 = $515;$k$16124 = $514; } else { break; } } $scevgep256 = (($372) + ($indvars$iv254)|0); $525 = $indvars$iv254;$cur1$4$lcssa = $scevgep256;$in$2$lcssa = $scevgep;$k$16$lcssa = $340; } else { $525 = $373;$cur1$4$lcssa = $374;$in$2$lcssa = $375;$k$16$lcssa = $12; } $517 = ($k$16$lcssa|0)>(0); if ($517) { $518 = HEAP8[$in$2$lcssa>>0]|0; $519 = $518&255; $520 = $519 >>> 7; $521 = (0 - ($520))|0; $522 = $382 & $521; $523 = $522&255; HEAP8[$cur1$4$lcssa>>0] = $523; $524 = ($k$16$lcssa|0)>(1); if ($524) { $$sum291 = (($525) + 1)|0; $526 = (($372) + ($$sum291)|0); $527 = HEAP8[$in$2$lcssa>>0]|0; $528 = $527&255; $529 = $528 >>> 6; $530 = $529 & 1; $531 = (0 - ($530))|0; $532 = $382 & $531; $533 = $532&255; HEAP8[$526>>0] = $533; $534 = ($k$16$lcssa|0)>(2); if ($534) { $$sum292 = (($525) + 2)|0; $535 = (($372) + ($$sum292)|0); $536 = HEAP8[$in$2$lcssa>>0]|0; $537 = $536&255; $538 = $537 >>> 5; $539 = $538 & 1; $540 = (0 - ($539))|0; $541 = $382 & $540; $542 = $541&255; HEAP8[$535>>0] = $542; $543 = ($k$16$lcssa|0)>(3); if ($543) { $$sum293 = (($525) + 3)|0; $544 = (($372) + ($$sum293)|0); $545 = HEAP8[$in$2$lcssa>>0]|0; $546 = $545&255; $547 = $546 >>> 4; $548 = $547 & 1; $549 = (0 - ($548))|0; $550 = $382 & $549; $551 = $550&255; HEAP8[$544>>0] = $551; $552 = ($k$16$lcssa|0)>(4); if ($552) { $$sum294 = (($525) + 4)|0; $553 = (($372) + ($$sum294)|0); $554 = HEAP8[$in$2$lcssa>>0]|0; $555 = $554&255; $556 = $555 >>> 3; $557 = $556 & 1; $558 = (0 - ($557))|0; $559 = $382 & $558; $560 = $559&255; HEAP8[$553>>0] = $560; $561 = ($k$16$lcssa|0)>(5); if ($561) { $$sum295 = (($525) + 5)|0; $562 = (($372) + ($$sum295)|0); $563 = HEAP8[$in$2$lcssa>>0]|0; $564 = $563&255; $565 = $564 >>> 2; $566 = $565 & 1; $567 = (0 - ($566))|0; $568 = $382 & $567; $569 = $568&255; HEAP8[$562>>0] = $569; $570 = ($k$16$lcssa|0)>(6); if ($570) { $$sum296 = (($525) + 6)|0; $571 = (($372) + ($$sum296)|0); $572 = HEAP8[$in$2$lcssa>>0]|0; $573 = $572&255; $574 = $573 >>> 1; $575 = $574 & 1; $576 = (0 - ($575))|0; $577 = $382 & $576; $578 = $577&255; HEAP8[$571>>0] = $578; } } } } } } } break; } default: { } } L187: do { if (!($4)) { $579 = HEAP32[$10>>2]|0; switch ($3|0) { case 1: { if ($322) { $q$0149 = $q$0148; } else { break L187; } while(1) { $582 = $q$0149 << 1; $583 = $582 | 1; $$sum10 = (($583) + ($373))|0; $584 = (($579) + ($$sum10)|0); HEAP8[$584>>0] = -1; $$sum11 = (($q$0149) + ($373))|0; $585 = (($579) + ($$sum11)|0); $586 = HEAP8[$585>>0]|0; $$sum12 = (($582) + ($373))|0; $587 = (($579) + ($$sum12)|0); HEAP8[$587>>0] = $586; $q$0 = (($q$0149) + -1)|0; $588 = ($q$0|0)>(-1); if ($588) { $q$0149 = $q$0; } else { break L187; } } break; } case 3: { break; } default: { label = 134; break L148; } } if ($323) { $580 = (($373) + 2)|0; $581 = (($373) + 1)|0; $q$1146 = $q$1145; while(1) { $589 = $q$1146 << 2; $590 = $589 | 3; $$sum3 = (($590) + ($373))|0; $591 = (($579) + ($$sum3)|0); HEAP8[$591>>0] = -1; $592 = ($q$1146*3)|0; $$sum4 = (($580) + ($592))|0; $593 = (($579) + ($$sum4)|0); $594 = HEAP8[$593>>0]|0; $595 = $589 | 2; $$sum5 = (($595) + ($373))|0; $596 = (($579) + ($$sum5)|0); HEAP8[$596>>0] = $594; $$sum6 = (($581) + ($592))|0; $597 = (($579) + ($$sum6)|0); $598 = HEAP8[$597>>0]|0; $599 = $589 | 1; $$sum7 = (($599) + ($373))|0; $600 = (($579) + ($$sum7)|0); HEAP8[$600>>0] = $598; $$sum8 = (($592) + ($373))|0; $601 = (($579) + ($$sum8)|0); $602 = HEAP8[$601>>0]|0; $$sum9 = (($589) + ($373))|0; $603 = (($579) + ($$sum9)|0); HEAP8[$603>>0] = $602; $q$1 = (($q$1146) + -1)|0; $604 = ($q$1|0)>(-1); if ($604) { $q$1146 = $q$1; } else { break; } } } } } while(0); $605 = (($j$1151) + 1)|0; $606 = ($605>>>0)<($y>>>0); $indvars$iv$next = (($indvars$iv) + ($330))|0; $indvars$iv$next255 = (($indvars$iv254) + ($330))|0; $indvars$iv$next258 = (($indvars$iv257) + ($345))|0; $indvars$iv$next261 = (($indvars$iv260) + ($345))|0; $indvars$iv$next264 = (($indvars$iv263) + ($360))|0; $indvars$iv$next267 = (($indvars$iv266) + ($360))|0; if ($606) { $indvars$iv = $indvars$iv$next;$indvars$iv254 = $indvars$iv$next255;$indvars$iv257 = $indvars$iv$next258;$indvars$iv260 = $indvars$iv$next261;$indvars$iv263 = $indvars$iv$next264;$indvars$iv266 = $indvars$iv$next267;$j$1151 = $605; } else { $$0 = 1; label = 137; break; } } if ((label|0) == 134) { ___assert_fail((18355|0),(18129|0),4149,(18252|0)); // unreachable; } else if ((label|0) == 137) { return ($$0|0); } return (0)|0; } function _stbi__paeth($a,$b,$c) { $a = $a|0; $b = $b|0; $c = $c|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$b = 0, $ispos = 0, $ispos1 = 0, $ispos3 = 0, $neg = 0, $neg2 = 0, $neg4 = 0, $or$cond = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = (($b) + ($a))|0; $1 = (($0) - ($c))|0; $2 = (($1) - ($a))|0; $ispos = ($2|0)>(-1); $neg = (0 - ($2))|0; $3 = $ispos ? $2 : $neg; $4 = (($1) - ($b))|0; $ispos1 = ($4|0)>(-1); $neg2 = (0 - ($4))|0; $5 = $ispos1 ? $4 : $neg2; $6 = (($1) - ($c))|0; $ispos3 = ($6|0)>(-1); $neg4 = (0 - ($6))|0; $7 = $ispos3 ? $6 : $neg4; $8 = ($3|0)>($5|0); $9 = ($3|0)>($7|0); $or$cond = $8 | $9; $10 = ($5|0)>($7|0); $c$b = $10 ? $c : $b; $$0 = $or$cond ? $c$b : $a; return ($$0|0); } function _stbi__decode_jpeg_header($z,$scan) { $z = $z|0; $scan = $scan|0; var $$ = 0, $$0 = 0, $$2 = 0, $$9 = 0, $$lcssa = 0, $$lcssa20 = 0, $$lcssa5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $m$010 = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 18116|0); HEAP8[$0>>0] = -1; $1 = (_stbi__get_marker($z)|0); $2 = ($1<<24>>24)==(-40); if (!($2)) { _stbi__err(18378); $$0 = 0; return ($$0|0); } $3 = ($scan|0)==(1); if ($3) { $$0 = 1; return ($$0|0); } $4 = (_stbi__get_marker($z)|0); $5 = $4&255; $6 = $5 & 254; $7 = ($6|0)==(192); $8 = ($4<<24>>24)==(-62); $$9 = $8 | $7; L8: do { if ($$9) { $$lcssa5 = $8; } else { $m$010 = $5; L10: while(1) { $13 = (_stbi__process_marker($z,$m$010)|0); $14 = ($13|0)==(0); if ($14) { $$0 = 0; label = 14; break; } $15 = (_stbi__get_marker($z)|0); $16 = $15&255; $17 = ($15<<24>>24)==(-1); if ($17) { while(1) { $18 = HEAP32[$z>>2]|0; $19 = (_stbi__at_eof($18)|0); $20 = ($19|0)==(0); if (!($20)) { break L10; } $21 = (_stbi__get_marker($z)|0); $22 = ($21<<24>>24)==(-1); if (!($22)) { $$lcssa20 = $21; break; } } $9 = $$lcssa20&255; $$lcssa = $9; } else { $$lcssa = $16; } $10 = $$lcssa & 254; $11 = ($10|0)==(192); $12 = ($$lcssa|0)==(194); $$ = $12 | $11; if ($$) { $$lcssa5 = $12; break L8; } else { $m$010 = $$lcssa; } } if ((label|0) == 14) { return ($$0|0); } _stbi__err(18385); $$0 = 0; return ($$0|0); } } while(0); $23 = $$lcssa5&1; $24 = ((($z)) + 18124|0); HEAP32[$24>>2] = $23; $25 = (_stbi__process_frame_header($z,$scan)|0); $not$ = ($25|0)!=(0); $$2 = $not$&1; $$0 = $$2; return ($$0|0); } function _stbi__get_marker($j) { $j = $j|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18116|0); $1 = HEAP8[$0>>0]|0; $2 = ($1<<24>>24)==(-1); if (!($2)) { HEAP8[$0>>0] = -1; $$0 = $1; return ($$0|0); } $3 = HEAP32[$j>>2]|0; $4 = (_stbi__get8($3)|0); $5 = ($4<<24>>24)==(-1); if (!($5)) { $$0 = -1; return ($$0|0); } while(1) { $6 = HEAP32[$j>>2]|0; $7 = (_stbi__get8($6)|0); $8 = ($7<<24>>24)==(-1); if (!($8)) { $$0 = $7; break; } } return ($$0|0); } function _stbi__process_marker($z,$m) { $z = $z|0; $m = $m|0; var $$2 = 0, $$mask = 0, $$mask7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0; var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $L$0$lcssa = 0, $L$015 = 0, $L$1$lcssa = 0, $L$122 = 0; var $exitcond = 0, $exitcond30 = 0, $i$014 = 0, $i1$118 = 0, $or$cond = 0, $or$cond5 = 0, $sizes = 0, $v$0 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $sizes = sp; switch ($m|0) { case 255: { _stbi__err(18496); $$2 = 0; STACKTOP = sp;return ($$2|0); break; } case 221: { $0 = HEAP32[$z>>2]|0; $1 = (_stbi__get16be($0)|0); $2 = ($1|0)==(4); if ($2) { $3 = HEAP32[$z>>2]|0; $4 = (_stbi__get16be($3)|0); $5 = ((($z)) + 18168|0); HEAP32[$5>>2] = $4; $$2 = 1; STACKTOP = sp;return ($$2|0); } else { _stbi__err(18512); $$2 = 0; STACKTOP = sp;return ($$2|0); } break; } case 219: { $6 = HEAP32[$z>>2]|0; $7 = (_stbi__get16be($6)|0); $8 = (($7) + -2)|0; $9 = ($7|0)>(2); L16: do { if ($9) { $L$015 = $8; while(1) { $10 = HEAP32[$z>>2]|0; $11 = (_stbi__get8($10)|0); $12 = $11&255; $13 = $12 & 15; $$mask = $12 & 240; $14 = ($$mask|0)==(0); if (!($14)) { label = 8; break; } $15 = ($13>>>0)>(3); if ($15) { label = 10; break; } else { $i$014 = 0; } while(1) { $16 = HEAP32[$z>>2]|0; $17 = (_stbi__get8($16)|0); $18 = (18551 + ($i$014)|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $21 = ((((($z)) + 13444|0) + ($13<<6)|0) + ($20)|0); HEAP8[$21>>0] = $17; $22 = (($i$014) + 1)|0; $exitcond = ($22|0)==(64); if ($exitcond) { break; } else { $i$014 = $22; } } $23 = (($L$015) + -65)|0; $24 = ($L$015|0)>(65); if ($24) { $L$015 = $23; } else { $L$0$lcssa = $23; break L16; } } if ((label|0) == 8) { _stbi__err(18524); $$2 = 0; STACKTOP = sp;return ($$2|0); } else if ((label|0) == 10) { _stbi__err(18537); $$2 = 0; STACKTOP = sp;return ($$2|0); } } else { $L$0$lcssa = $8; } } while(0); $25 = ($L$0$lcssa|0)==(0); $26 = $25&1; $$2 = $26; STACKTOP = sp;return ($$2|0); break; } case 196: { $27 = HEAP32[$z>>2]|0; $28 = (_stbi__get16be($27)|0); $29 = (($28) + -2)|0; $30 = ($28|0)>(2); L31: do { if ($30) { $31 = ((($sizes)) + 4|0); $32 = ((($sizes)) + 8|0); $33 = ((($sizes)) + 12|0); $34 = ((($sizes)) + 16|0); $35 = ((($sizes)) + 20|0); $36 = ((($sizes)) + 24|0); $37 = ((($sizes)) + 28|0); $38 = ((($sizes)) + 32|0); $39 = ((($sizes)) + 36|0); $40 = ((($sizes)) + 40|0); $41 = ((($sizes)) + 44|0); $42 = ((($sizes)) + 48|0); $43 = ((($sizes)) + 52|0); $44 = ((($sizes)) + 56|0); $45 = ((($sizes)) + 60|0); $L$122 = $29; while(1) { $46 = HEAP32[$z>>2]|0; $47 = (_stbi__get8($46)|0); $48 = $47&255; $49 = $48 & 15; $50 = ($47&255)>(31); $51 = ($49>>>0)>(3); $or$cond = $50 | $51; if ($or$cond) { label = 17; break; } $52 = HEAP32[$z>>2]|0; $53 = (_stbi__get8($52)|0); $54 = $53&255; HEAP32[$sizes>>2] = $54; $55 = HEAP32[$z>>2]|0; $56 = (_stbi__get8($55)|0); $57 = $56&255; HEAP32[$31>>2] = $57; $58 = (($57) + ($54))|0; $59 = HEAP32[$z>>2]|0; $60 = (_stbi__get8($59)|0); $61 = $60&255; HEAP32[$32>>2] = $61; $62 = (($61) + ($58))|0; $63 = HEAP32[$z>>2]|0; $64 = (_stbi__get8($63)|0); $65 = $64&255; HEAP32[$33>>2] = $65; $66 = (($65) + ($62))|0; $67 = HEAP32[$z>>2]|0; $68 = (_stbi__get8($67)|0); $69 = $68&255; HEAP32[$34>>2] = $69; $70 = (($69) + ($66))|0; $71 = HEAP32[$z>>2]|0; $72 = (_stbi__get8($71)|0); $73 = $72&255; HEAP32[$35>>2] = $73; $74 = (($73) + ($70))|0; $75 = HEAP32[$z>>2]|0; $76 = (_stbi__get8($75)|0); $77 = $76&255; HEAP32[$36>>2] = $77; $78 = (($77) + ($74))|0; $79 = HEAP32[$z>>2]|0; $80 = (_stbi__get8($79)|0); $81 = $80&255; HEAP32[$37>>2] = $81; $82 = (($81) + ($78))|0; $83 = HEAP32[$z>>2]|0; $84 = (_stbi__get8($83)|0); $85 = $84&255; HEAP32[$38>>2] = $85; $86 = (($85) + ($82))|0; $87 = HEAP32[$z>>2]|0; $88 = (_stbi__get8($87)|0); $89 = $88&255; HEAP32[$39>>2] = $89; $90 = (($89) + ($86))|0; $91 = HEAP32[$z>>2]|0; $92 = (_stbi__get8($91)|0); $93 = $92&255; HEAP32[$40>>2] = $93; $94 = (($93) + ($90))|0; $95 = HEAP32[$z>>2]|0; $96 = (_stbi__get8($95)|0); $97 = $96&255; HEAP32[$41>>2] = $97; $98 = (($97) + ($94))|0; $99 = HEAP32[$z>>2]|0; $100 = (_stbi__get8($99)|0); $101 = $100&255; HEAP32[$42>>2] = $101; $102 = (($101) + ($98))|0; $103 = HEAP32[$z>>2]|0; $104 = (_stbi__get8($103)|0); $105 = $104&255; HEAP32[$43>>2] = $105; $106 = (($105) + ($102))|0; $107 = HEAP32[$z>>2]|0; $108 = (_stbi__get8($107)|0); $109 = $108&255; HEAP32[$44>>2] = $109; $110 = (($109) + ($106))|0; $111 = HEAP32[$z>>2]|0; $112 = (_stbi__get8($111)|0); $113 = $112&255; HEAP32[$45>>2] = $113; $114 = (($113) + ($110))|0; $115 = (($L$122) + -17)|0; $$mask7 = $48 & 240; $116 = ($$mask7|0)==(0); if ($116) { $117 = (((($z)) + 4|0) + (($49*1680)|0)|0); $118 = (_stbi__build_huffman($117,$sizes)|0); $119 = ($118|0)==(0); if ($119) { break; } $120 = (((((($z)) + 4|0) + (($49*1680)|0)|0)) + 1024|0); $v$0 = $120; } else { $121 = (((($z)) + 6724|0) + (($49*1680)|0)|0); $122 = (_stbi__build_huffman($121,$sizes)|0); $123 = ($122|0)==(0); if ($123) { break; } $124 = (((((($z)) + 6724|0) + (($49*1680)|0)|0)) + 1024|0); $v$0 = $124; } $125 = ($114|0)>(0); if ($125) { $126 = $56&255; $127 = $53&255; $128 = (($126) + ($127))|0; $129 = $60&255; $130 = (($128) + ($129))|0; $131 = $64&255; $132 = (($130) + ($131))|0; $133 = $68&255; $134 = (($132) + ($133))|0; $135 = $72&255; $136 = (($134) + ($135))|0; $137 = $76&255; $138 = (($136) + ($137))|0; $139 = $80&255; $140 = (($138) + ($139))|0; $141 = $84&255; $142 = (($140) + ($141))|0; $143 = $88&255; $144 = (($142) + ($143))|0; $145 = $92&255; $146 = (($144) + ($145))|0; $147 = $96&255; $148 = (($146) + ($147))|0; $149 = $100&255; $150 = (($148) + ($149))|0; $151 = $104&255; $152 = (($150) + ($151))|0; $153 = $108&255; $154 = (($152) + ($153))|0; $155 = $112&255; $156 = (($154) + ($155))|0; $i1$118 = 0; while(1) { $157 = HEAP32[$z>>2]|0; $158 = (_stbi__get8($157)|0); $159 = (($v$0) + ($i1$118)|0); HEAP8[$159>>0] = $158; $160 = (($i1$118) + 1)|0; $exitcond30 = ($160|0)==($156|0); if ($exitcond30) { break; } else { $i1$118 = $160; } } } if (!($116)) { $161 = (((($z)) + 13700|0) + ($49<<10)|0); $162 = (((($z)) + 6724|0) + (($49*1680)|0)|0); _stbi__build_fast_ac($161,$162); } $163 = (($115) - ($114))|0; $164 = ($163|0)>(0); if ($164) { $L$122 = $163; } else { $L$1$lcssa = $163; break L31; } } if ((label|0) == 17) { _stbi__err(18630); } $$2 = 0; STACKTOP = sp;return ($$2|0); } else { $L$1$lcssa = $29; } } while(0); $165 = ($L$1$lcssa|0)==(0); $166 = $165&1; $$2 = $166; STACKTOP = sp;return ($$2|0); break; } default: { $167 = $m & -16; $168 = ($167|0)==(224); $169 = ($m|0)==(254); $or$cond5 = $169 | $168; if (!($or$cond5)) { $$2 = 0; STACKTOP = sp;return ($$2|0); } $170 = HEAP32[$z>>2]|0; $171 = (_stbi__get16be($170)|0); $172 = (($171) + -2)|0; _stbi__skip($170,$172); $$2 = 1; STACKTOP = sp;return ($$2|0); } } return (0)|0; } function _stbi__process_frame_header($z,$scan) { $z = $z|0; $scan = $scan|0; var $$0 = 0, $$h_max$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $15 = 0; var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $h_max$0$lcssa = 0, $h_max$017 = 0, $i$022 = 0, $i$1 = 0, $i$216 = 0, $i$313 = 0, $i$313$lcssa = 0; var $i$412 = 0, $i$412$in = 0, $or$cond = 0, $or$cond2 = 0, $v_max$0$lcssa = 0, $v_max$018 = 0, $v_max$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$z>>2]|0; $1 = (_stbi__get16be($0)|0); $2 = ($1|0)<(11); if ($2) { _stbi__err(18392); $$0 = 0; return ($$0|0); } $3 = (_stbi__get8($0)|0); $4 = ($3<<24>>24)==(8); if (!($4)) { _stbi__err(18404); $$0 = 0; return ($$0|0); } $5 = (_stbi__get16be($0)|0); $6 = ((($0)) + 4|0); HEAP32[$6>>2] = $5; $7 = ($5|0)==(0); if ($7) { _stbi__err(18415); $$0 = 0; return ($$0|0); } $8 = (_stbi__get16be($0)|0); HEAP32[$0>>2] = $8; $9 = ($8|0)==(0); if ($9) { _stbi__err(18432); $$0 = 0; return ($$0|0); } $10 = (_stbi__get8($0)|0); $11 = $10&255; switch ($10<<24>>24) { case 1: case 3: { break; } default: { _stbi__err(18440); $$0 = 0; return ($$0|0); } } $12 = ((($0)) + 8|0); HEAP32[$12>>2] = $11; $13 = $10&255; $i$022 = 0; while(1) { $14 = (((((($z)) + 17820|0) + (($i$022*72)|0)|0)) + 44|0); HEAP32[$14>>2] = 0; $15 = (((((($z)) + 17820|0) + (($i$022*72)|0)|0)) + 56|0); HEAP32[$15>>2] = 0; $16 = (($i$022) + 1)|0; $exitcond = ($16|0)==($13|0); if ($exitcond) { break; } else { $i$022 = $16; } } $17 = HEAP32[$12>>2]|0; $18 = ($17*3)|0; $19 = (($18) + 8)|0; $20 = ($1|0)==($19|0); if ($20) { $i$1 = 0; } else { _stbi__err(18392); $$0 = 0; return ($$0|0); } while(1) { $21 = HEAP32[$12>>2]|0; $22 = ($i$1|0)<($21|0); if (!($22)) { $$lcssa = $21; label = 24; break; } $23 = (_stbi__get8($0)|0); $24 = $23&255; $25 = (((($z)) + 17820|0) + (($i$1*72)|0)|0); HEAP32[$25>>2] = $24; $26 = (($i$1) + 1)|0; $27 = ($24|0)==($26|0); $28 = ($24|0)==($i$1|0); $or$cond = $27 | $28; if (!($or$cond)) { label = 17; break; } $29 = (_stbi__get8($0)|0); $30 = $29&255; $31 = $30 >>> 4; $32 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 4|0); HEAP32[$32>>2] = $31; $33 = ($31|0)==(0); $34 = ($29&255)>(79); $or$cond2 = $34 | $33; if ($or$cond2) { label = 19; break; } $35 = $30 & 15; $36 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 8|0); HEAP32[$36>>2] = $35; $37 = (($35) + -1)|0; $38 = ($37>>>0)>(3); if ($38) { label = 21; break; } $39 = (_stbi__get8($0)|0); $40 = $39&255; $41 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 12|0); HEAP32[$41>>2] = $40; $42 = ($39&255)>(3); if ($42) { label = 23; break; } else { $i$1 = $26; } } if ((label|0) == 17) { _stbi__err(18460); $$0 = 0; return ($$0|0); } else if ((label|0) == 19) { _stbi__err(18477); $$0 = 0; return ($$0|0); } else if ((label|0) == 21) { _stbi__err(18483); $$0 = 0; return ($$0|0); } else if ((label|0) == 23) { _stbi__err(18489); $$0 = 0; return ($$0|0); } else if ((label|0) == 24) { $43 = ($scan|0)==(0); if (!($43)) { $$0 = 1; return ($$0|0); } $44 = HEAP32[$0>>2]|0; $45 = (1073741824 / ($44>>>0))&-1; $46 = (($45>>>0) / ($$lcssa>>>0))&-1; $47 = HEAP32[$6>>2]|0; $48 = ($46>>>0)<($47>>>0); if ($48) { _stbi__err(17846); $$0 = 0; return ($$0|0); } $49 = HEAP32[$12>>2]|0; $50 = ($49|0)>(0); if ($50) { $51 = HEAP32[$12>>2]|0; $h_max$017 = 1;$i$216 = 0;$v_max$018 = 1; while(1) { $52 = (((((($z)) + 17820|0) + (($i$216*72)|0)|0)) + 4|0); $53 = HEAP32[$52>>2]|0; $54 = ($53|0)>($h_max$017|0); $$h_max$0 = $54 ? $53 : $h_max$017; $55 = (((((($z)) + 17820|0) + (($i$216*72)|0)|0)) + 8|0); $56 = HEAP32[$55>>2]|0; $57 = ($56|0)>($v_max$018|0); $v_max$1 = $57 ? $56 : $v_max$018; $58 = (($i$216) + 1)|0; $59 = ($58|0)<($51|0); if ($59) { $h_max$017 = $$h_max$0;$i$216 = $58;$v_max$018 = $v_max$1; } else { $h_max$0$lcssa = $$h_max$0;$v_max$0$lcssa = $v_max$1; break; } } } else { $h_max$0$lcssa = 1;$v_max$0$lcssa = 1; } $60 = ((($z)) + 17796|0); HEAP32[$60>>2] = $h_max$0$lcssa; $61 = ((($z)) + 17800|0); HEAP32[$61>>2] = $v_max$0$lcssa; $62 = $h_max$0$lcssa << 3; $63 = ((($z)) + 17812|0); HEAP32[$63>>2] = $62; $64 = $v_max$0$lcssa << 3; $65 = ((($z)) + 17816|0); HEAP32[$65>>2] = $64; $66 = HEAP32[$0>>2]|0; $67 = HEAP32[$63>>2]|0; $68 = (($66) + -1)|0; $69 = (($68) + ($67))|0; $70 = (($69>>>0) / ($67>>>0))&-1; $71 = ((($z)) + 17804|0); HEAP32[$71>>2] = $70; $72 = HEAP32[$6>>2]|0; $73 = HEAP32[$65>>2]|0; $74 = (($72) + -1)|0; $75 = (($74) + ($73))|0; $76 = (($75>>>0) / ($73>>>0))&-1; $77 = ((($z)) + 17808|0); HEAP32[$77>>2] = $76; $78 = HEAP32[$12>>2]|0; $79 = ($78|0)>(0); if (!($79)) { $$0 = 1; return ($$0|0); } $80 = (($h_max$0$lcssa) + -1)|0; $81 = (($v_max$0$lcssa) + -1)|0; $82 = ((($z)) + 18124|0); $i$313 = 0; while(1) { $83 = HEAP32[$0>>2]|0; $84 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 4|0); $85 = HEAP32[$84>>2]|0; $86 = Math_imul($85, $83)|0; $87 = (($80) + ($86))|0; $88 = (($87>>>0) / ($h_max$0$lcssa>>>0))&-1; $89 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 28|0); HEAP32[$89>>2] = $88; $90 = HEAP32[$6>>2]|0; $91 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 8|0); $92 = HEAP32[$91>>2]|0; $93 = Math_imul($92, $90)|0; $94 = (($81) + ($93))|0; $95 = (($94>>>0) / ($v_max$0$lcssa>>>0))&-1; $96 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 32|0); HEAP32[$96>>2] = $95; $97 = HEAP32[$71>>2]|0; $98 = HEAP32[$84>>2]|0; $99 = $97 << 3; $100 = Math_imul($99, $98)|0; $101 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 36|0); HEAP32[$101>>2] = $100; $102 = HEAP32[$77>>2]|0; $103 = HEAP32[$91>>2]|0; $104 = $102 << 3; $105 = Math_imul($104, $103)|0; $106 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 40|0); HEAP32[$106>>2] = $105; $107 = HEAP32[$101>>2]|0; $108 = Math_imul($105, $107)|0; $109 = (($108) + 15)|0; $110 = (_stbi__malloc($109)|0); $111 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 48|0); HEAP32[$111>>2] = $110; $112 = ($110|0)==(0|0); if ($112) { $i$313$lcssa = $i$313; break; } $117 = $110; $118 = (($117) + 15)|0; $119 = $118 & -16; $120 = $119; $121 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 44|0); HEAP32[$121>>2] = $120; $122 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 56|0); HEAP32[$122>>2] = 0; $123 = HEAP32[$82>>2]|0; $124 = ($123|0)==(0); if ($124) { $144 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 60|0); HEAP32[$144>>2] = 0; $145 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 52|0); HEAP32[$145>>2] = 0; } else { $125 = HEAP32[$101>>2]|0; $126 = (($125) + 7)|0; $127 = $126 >> 3; $128 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 64|0); HEAP32[$128>>2] = $127; $129 = HEAP32[$106>>2]|0; $130 = (($129) + 7)|0; $131 = $130 >> 3; $132 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 68|0); HEAP32[$132>>2] = $131; $133 = HEAP32[$128>>2]|0; $134 = $133 << 7; $135 = Math_imul($134, $131)|0; $136 = $135 | 15; $137 = (_malloc($136)|0); $138 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 52|0); HEAP32[$138>>2] = $137; $139 = $137; $140 = (($139) + 15)|0; $141 = $140 & -16; $142 = $141; $143 = (((((($z)) + 17820|0) + (($i$313*72)|0)|0)) + 60|0); HEAP32[$143>>2] = $142; } $146 = (($i$313) + 1)|0; $147 = HEAP32[$12>>2]|0; $148 = ($146|0)<($147|0); if ($148) { $i$313 = $146; } else { $$0 = 1; label = 40; break; } } if ((label|0) == 40) { return ($$0|0); } $113 = ($i$313$lcssa|0)>(0); if ($113) { $i$412$in = $i$313$lcssa; while(1) { $i$412 = (($i$412$in) + -1)|0; $114 = (((((($z)) + 17820|0) + (($i$412*72)|0)|0)) + 48|0); $115 = HEAP32[$114>>2]|0; _free($115); HEAP32[$114>>2] = 0; $116 = ($i$412$in|0)>(1); if ($116) { $i$412$in = $i$412; } else { break; } } } _stbi__err(18059); $$0 = 0; return ($$0|0); } return (0)|0; } function _stbi__build_huffman($h,$count) { $h = $h|0; $count = $count|0; var $$0 = 0, $$lcssa37 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $code$014 = 0, $code$1$lcssa = 0, $code$110 = 0, $code$2 = 0, $exitcond = 0; var $exitcond26 = 0, $i$022 = 0, $i$17 = 0, $j$017 = 0, $j$115 = 0, $k$021 = 0, $k$1$lcssa = 0, $k$1$lcssa$lcssa = 0, $k$116 = 0, $k$213 = 0, $k$3$lcssa = 0, $k$39 = 0, $k$4 = 0, $k$4$lcssa = 0, $scevgep = 0, $smax = 0, label = 0, sp = 0; sp = STACKTOP; $i$022 = 0;$k$021 = 0; while(1) { $1 = (($count) + ($i$022<<2)|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(0); $0 = (($i$022) + 1)|0; if ($3) { $4 = $0&255; $j$017 = 0;$k$116 = $k$021; while(1) { $5 = (($k$116) + 1)|0; $6 = (((($h)) + 1280|0) + ($k$116)|0); HEAP8[$6>>0] = $4; $7 = (($j$017) + 1)|0; $8 = HEAP32[$1>>2]|0; $9 = ($7|0)<($8|0); if ($9) { $j$017 = $7;$k$116 = $5; } else { $k$1$lcssa = $5; break; } } } else { $k$1$lcssa = $k$021; } $exitcond26 = ($0|0)==(16); if ($exitcond26) { $k$1$lcssa$lcssa = $k$1$lcssa; break; } else { $i$022 = $0;$k$021 = $k$1$lcssa; } } $10 = (((($h)) + 1280|0) + ($k$1$lcssa$lcssa)|0); HEAP8[$10>>0] = 0; $code$014 = 0;$j$115 = 1;$k$213 = 0; while(1) { $11 = (($k$213) - ($code$014))|0; $12 = (((($h)) + 1612|0) + ($j$115<<2)|0); HEAP32[$12>>2] = $11; $13 = (((($h)) + 1280|0) + ($k$213)|0); $14 = HEAP8[$13>>0]|0; $15 = $14&255; $16 = ($15|0)==($j$115|0); if ($16) { $17 = (((($h)) + 1280|0) + ($k$213)|0); $18 = HEAP8[$17>>0]|0; $19 = $18&255; $20 = ($19|0)==($j$115|0); if ($20) { $code$110 = $code$014;$k$39 = $k$213; while(1) { $21 = (($code$110) + 1)|0; $22 = $code$110&65535; $23 = (($k$39) + 1)|0; $24 = (((($h)) + 512|0) + ($k$39<<1)|0); HEAP16[$24>>1] = $22; $25 = (((($h)) + 1280|0) + ($23)|0); $26 = HEAP8[$25>>0]|0; $27 = $26&255; $28 = ($27|0)==($j$115|0); if ($28) { $code$110 = $21;$k$39 = $23; } else { $code$1$lcssa = $21;$k$3$lcssa = $23; break; } } } else { $code$1$lcssa = $code$014;$k$3$lcssa = $k$213; } $29 = 1 << $j$115; $30 = ($code$1$lcssa|0)>($29|0); if ($30) { label = 11; break; } else { $code$2 = $code$1$lcssa;$k$4 = $k$3$lcssa; } } else { $code$2 = $code$014;$k$4 = $k$213; } $31 = (16 - ($j$115))|0; $32 = $code$2 << $31; $33 = (((($h)) + 1540|0) + ($j$115<<2)|0); HEAP32[$33>>2] = $32; $34 = $code$2 << 1; $35 = (($j$115) + 1)|0; $36 = ($35|0)<(17); if ($36) { $code$014 = $34;$j$115 = $35;$k$213 = $k$4; } else { $$lcssa37 = $35;$k$4$lcssa = $k$4; break; } } if ((label|0) == 11) { _stbi__err(18645); $$0 = 0; return ($$0|0); } $37 = (((($h)) + 1540|0) + ($$lcssa37<<2)|0); HEAP32[$37>>2] = -1; _memset(($h|0),-1,512)|0; $38 = ($k$4$lcssa|0)>(0); if ($38) { $i$17 = 0; } else { $$0 = 1; return ($$0|0); } while(1) { $39 = (((($h)) + 1280|0) + ($i$17)|0); $40 = HEAP8[$39>>0]|0; $41 = ($40&255)<(10); if ($41) { $42 = $40&255; $43 = (9 - ($42))|0; $44 = 1 << $43; $45 = ($43|0)==(31); if (!($45)) { $46 = (((($h)) + 512|0) + ($i$17<<1)|0); $47 = HEAP16[$46>>1]|0; $48 = $47&65535; $49 = $48 << $43; $50 = $i$17&255; $scevgep = (($h) + ($49)|0); $51 = ($44|0)>(1); $smax = $51 ? $44 : 1; _memset(($scevgep|0),($50|0),($smax|0))|0; } } $52 = (($i$17) + 1)|0; $exitcond = ($52|0)==($k$4$lcssa|0); if ($exitcond) { $$0 = 1; break; } else { $i$17 = $52; } } return ($$0|0); } function _stbi__build_fast_ac($fast_ac,$h) { $fast_ac = $fast_ac|0; $h = $h|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$0 = 0, $k$0$off = 0, label = 0, sp = 0; sp = STACKTOP; $i$02 = 0; while(1) { $0 = (($h) + ($i$02)|0); $1 = HEAP8[$0>>0]|0; $2 = (($fast_ac) + ($i$02<<1)|0); HEAP16[$2>>1] = 0; $3 = $1&255; $4 = ($1<<24>>24)==(-1); if (!($4)) { $5 = (((($h)) + 1024|0) + ($3)|0); $6 = HEAP8[$5>>0]|0; $7 = $6&255; $8 = $7 & 240; $9 = $7 & 15; $10 = (((($h)) + 1280|0) + ($3)|0); $11 = HEAP8[$10>>0]|0; $12 = $11&255; $13 = ($9|0)==(0); if (!($13)) { $14 = (($12) + ($9))|0; $15 = ($14|0)<(10); if ($15) { $16 = $i$02 << $12; $17 = $16 & 511; $18 = (9 - ($9))|0; $19 = $17 >>> $18; $20 = (($9) + -1)|0; $21 = 1 << $20; $22 = ($19|0)<($21|0); if ($22) { $23 = -1 << $9; $24 = (($23) + 1)|0; $25 = (($24) + ($19))|0; $k$0 = $25; } else { $k$0 = $19; } $k$0$off = (($k$0) + 128)|0; $26 = ($k$0$off>>>0)<(256); if ($26) { $27 = $k$0 << 8; $28 = $27 | $8; $29 = (($28) + ($14))|0; $30 = $29&65535; HEAP16[$2>>1] = $30; } } } } $31 = (($i$02) + 1)|0; $exitcond = ($31|0)==(512); if ($exitcond) { break; } else { $i$02 = $31; } } return; } function _stbi__parse_zlib($a,$parse_header) { $a = $a|0; $parse_header = $parse_header|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($parse_header|0)==(0); if (!($0)) { $1 = (_stbi__parse_zlib_header($a)|0); $2 = ($1|0)==(0); if ($2) { $$0 = 0; return ($$0|0); } } $3 = ((($a)) + 8|0); HEAP32[$3>>2] = 0; $4 = ((($a)) + 12|0); HEAP32[$4>>2] = 0; $5 = ((($a)) + 2052|0); $6 = ((($a)) + 32|0); L5: while(1) { $7 = (_stbi__zreceive($a,1)|0); $8 = (_stbi__zreceive($a,2)|0); switch ($8|0) { case 3: { $$0 = 0; label = 13; break L5; break; } case 0: { $9 = (_stbi__parse_uncomperssed_block($a)|0); $10 = ($9|0)==(0); if ($10) { $$0 = 0; label = 13; break L5; } break; } case 1: { $11 = HEAP8[(18693)>>0]|0; $12 = ($11<<24>>24)==(0); if ($12) { _stbi__init_zdefaults(); } $13 = (_stbi__zbuild_huffman($6,18694,288)|0); $14 = ($13|0)==(0); if ($14) { $$0 = 0; label = 13; break L5; } $15 = (_stbi__zbuild_huffman($5,18662,32)|0); $16 = ($15|0)==(0); if ($16) { $$0 = 0; label = 13; break L5; } else { label = 11; } break; } default: { $17 = (_stbi__compute_huffman_codes($a)|0); $18 = ($17|0)==(0); if ($18) { $$0 = 0; label = 13; break L5; } else { label = 11; } } } if ((label|0) == 11) { label = 0; $19 = (_stbi__parse_huffman_block($a)|0); $20 = ($19|0)==(0); if ($20) { $$0 = 0; label = 13; break; } } $21 = ($7|0)==(0); if (!($21)) { $$0 = 1; label = 13; break; } } if ((label|0) == 13) { return ($$0|0); } return (0)|0; } function _stbi__parse_zlib_header($a) { $a = $a|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__zget8($a)|0); $1 = $0&255; $2 = $1 & 15; $3 = (_stbi__zget8($a)|0); $4 = $3&255; $5 = $1 << 8; $6 = $5 | $4; $7 = (($6>>>0) % 31)&-1; $8 = ($7|0)==(0); if (!($8)) { _stbi__err(19316); $$0 = 0; return ($$0|0); } $9 = $4 & 32; $10 = ($9|0)==(0); if (!($10)) { _stbi__err(19332); $$0 = 0; return ($$0|0); } $11 = ($2|0)==(8); if ($11) { $$0 = 1; return ($$0|0); } _stbi__err(19347); $$0 = 0; return ($$0|0); } function _stbi__zreceive($z,$n) { $z = $z|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 8|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<($n|0); if ($2) { _stbi__fill_bits($z); } $3 = ((($z)) + 12|0); $4 = HEAP32[$3>>2]|0; $5 = 1 << $n; $6 = (($5) + -1)|0; $7 = $4 & $6; $8 = $4 >>> $n; HEAP32[$3>>2] = $8; $9 = HEAP32[$0>>2]|0; $10 = (($9) - ($n))|0; HEAP32[$0>>2] = $10; return ($7|0); } function _stbi__parse_uncomperssed_block($a) { $a = $a|0; var $$0 = 0, $$lcssa = 0, $$lcssa17 = 0, $$op = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $$promoted8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $header = 0, $k$0$lcssa = 0, $k$03 = 0, $k$12 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $header = sp; $0 = ((($a)) + 8|0); $1 = HEAP32[$0>>2]|0; $2 = $1 & 7; $3 = ($2|0)==(0); if ($3) { $$ph = $1; } else { (_stbi__zreceive($a,$2)|0); $$pr = HEAP32[$0>>2]|0; $$ph = $$pr; } $4 = ($$ph|0)>(0); if ($4) { $5 = ((($a)) + 12|0); $$promoted = HEAP32[$5>>2]|0; $$promoted8 = HEAP32[$0>>2]|0; $6 = ($$promoted8|0)<(8); $$op = $$promoted8 ^ -1; $7 = $6 ? $$op : -9; $8 = (($$promoted8) + ($7))|0; $9 = (($8) + 8)|0; $10 = $9 >>> 3; $11 = $10 << 3; $12 = (($10) + 1)|0; $14 = $$promoted;$k$03 = 0; while(1) { $13 = $14&255; $15 = (($k$03) + 1)|0; $16 = (($header) + ($k$03)|0); HEAP8[$16>>0] = $13; $17 = $14 >>> 8; $exitcond13 = ($15|0)==($12|0); if ($exitcond13) { $$lcssa17 = $17; break; } else { $14 = $17;$k$03 = $15; } } $18 = (($$promoted8) + -8)|0; $19 = (($18) - ($11))|0; HEAP32[$5>>2] = $$lcssa17; HEAP32[$0>>2] = $19; $$lcssa = $19;$k$0$lcssa = $12; } else { $$lcssa = $$ph;$k$0$lcssa = 0; } $20 = ($$lcssa|0)==(0); if (!($20)) { ___assert_fail((19238|0),(18129|0),3754,(19255|0)); // unreachable; } $21 = ($k$0$lcssa|0)<(4); if ($21) { $k$12 = $k$0$lcssa; while(1) { $22 = (_stbi__zget8($a)|0); $23 = (($k$12) + 1)|0; $24 = (($header) + ($k$12)|0); HEAP8[$24>>0] = $22; $exitcond = ($23|0)==(4); if ($exitcond) { break; } else { $k$12 = $23; } } } $25 = ((($header)) + 1|0); $26 = HEAP8[$25>>0]|0; $27 = $26&255; $28 = $27 << 8; $29 = HEAP8[$header>>0]|0; $30 = $29&255; $31 = $28 | $30; $32 = ((($header)) + 3|0); $33 = HEAP8[$32>>0]|0; $34 = $33&255; $35 = $34 << 8; $36 = ((($header)) + 2|0); $37 = HEAP8[$36>>0]|0; $38 = $37&255; $39 = $35 | $38; $40 = $31 ^ 65535; $41 = ($39|0)==($40|0); if (!($41)) { _stbi__err(19286); $$0 = 0; STACKTOP = sp;return ($$0|0); } $42 = HEAP32[$a>>2]|0; $43 = (($42) + ($31)|0); $44 = ((($a)) + 4|0); $45 = HEAP32[$44>>2]|0; $46 = ($43>>>0)>($45>>>0); if ($46) { _stbi__err(19299); $$0 = 0; STACKTOP = sp;return ($$0|0); } $47 = ((($a)) + 16|0); $48 = HEAP32[$47>>2]|0; $49 = (($48) + ($31)|0); $50 = ((($a)) + 24|0); $51 = HEAP32[$50>>2]|0; $52 = ($49>>>0)>($51>>>0); if ($52) { $53 = (_stbi__zexpand($a,$48,$31)|0); $54 = ($53|0)==(0); if ($54) { $$0 = 0; STACKTOP = sp;return ($$0|0); } } $55 = HEAP32[$47>>2]|0; $56 = HEAP32[$a>>2]|0; _memcpy(($55|0),($56|0),($31|0))|0; $57 = HEAP32[$a>>2]|0; $58 = (($57) + ($31)|0); HEAP32[$a>>2] = $58; $59 = HEAP32[$47>>2]|0; $60 = (($59) + ($31)|0); HEAP32[$47>>2] = $60; $$0 = 1; STACKTOP = sp;return ($$0|0); } function _stbi__init_zdefaults() { var $0 = 0, $1 = 0, $2 = 0, $3 = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; _memset((18694|0),8,144)|0; dest=(18838); stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); dest=(18950); stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); $0 = (18974); $1 = $0; HEAP8[$1>>0]=134744072&255;HEAP8[$1+1>>0]=(134744072>>8)&255;HEAP8[$1+2>>0]=(134744072>>16)&255;HEAP8[$1+3>>0]=134744072>>24; $2 = (($0) + 4)|0; $3 = $2; HEAP8[$3>>0]=134744072&255;HEAP8[$3+1>>0]=(134744072>>8)&255;HEAP8[$3+2>>0]=(134744072>>16)&255;HEAP8[$3+3>>0]=134744072>>24; dest=18662; stop=dest+32|0; do { HEAP8[dest>>0]=5|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); return; } function _stbi__zbuild_huffman($z,$sizelist,$num) { $z = $z|0; $sizelist = $sizelist|0; $num = $num|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $code$06 = 0, $exitcond = 0, $exitcond13 = 0, $i$010 = 0, $i$28 = 0, $i$34 = 0, $j$03 = 0, $k$07 = 0, $next_code = 0, $or$cond = 0, $sizes = 0, dest = 0, label = 0, sp = 0; var stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; $next_code = sp + 72|0; $sizes = sp; dest=$sizes; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); _memset(($z|0),0,1024)|0; $0 = ($num|0)>(0); if ($0) { $i$010 = 0; while(1) { $1 = (($sizelist) + ($i$010)|0); $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = (($sizes) + ($3<<2)|0); $5 = HEAP32[$4>>2]|0; $6 = (($5) + 1)|0; HEAP32[$4>>2] = $6; $7 = (($i$010) + 1)|0; $exitcond13 = ($7|0)==($num|0); if ($exitcond13) { break; } else { $i$010 = $7; } } } HEAP32[$sizes>>2] = 0; $11 = ((($sizes)) + 4|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)>(2); if (!($13)) { $8 = ((($sizes)) + 8|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)>(4); if (!($10)) { $66 = ((($sizes)) + 12|0); $67 = HEAP32[$66>>2]|0; $68 = ($67|0)>(8); if (!($68)) { $69 = ((($sizes)) + 16|0); $70 = HEAP32[$69>>2]|0; $71 = ($70|0)>(16); if (!($71)) { $72 = ((($sizes)) + 20|0); $73 = HEAP32[$72>>2]|0; $74 = ($73|0)>(32); if (!($74)) { $75 = ((($sizes)) + 24|0); $76 = HEAP32[$75>>2]|0; $77 = ($76|0)>(64); if (!($77)) { $78 = ((($sizes)) + 28|0); $79 = HEAP32[$78>>2]|0; $80 = ($79|0)>(128); if (!($80)) { $81 = ((($sizes)) + 32|0); $82 = HEAP32[$81>>2]|0; $83 = ($82|0)>(256); if (!($83)) { $84 = ((($sizes)) + 36|0); $85 = HEAP32[$84>>2]|0; $86 = ($85|0)>(512); if (!($86)) { $87 = ((($sizes)) + 40|0); $88 = HEAP32[$87>>2]|0; $89 = ($88|0)>(1024); if (!($89)) { $90 = ((($sizes)) + 44|0); $91 = HEAP32[$90>>2]|0; $92 = ($91|0)>(2048); if (!($92)) { $93 = ((($sizes)) + 48|0); $94 = HEAP32[$93>>2]|0; $95 = ($94|0)>(4096); if (!($95)) { $96 = ((($sizes)) + 52|0); $97 = HEAP32[$96>>2]|0; $98 = ($97|0)>(8192); if (!($98)) { $99 = ((($sizes)) + 56|0); $100 = HEAP32[$99>>2]|0; $101 = ($100|0)>(16384); if (!($101)) { $102 = ((($sizes)) + 60|0); $103 = HEAP32[$102>>2]|0; $104 = ($103|0)>(32768); if (!($104)) { $code$06 = 0;$i$28 = 1;$k$07 = 0; while(1) { $14 = (($next_code) + ($i$28<<2)|0); HEAP32[$14>>2] = $code$06; $15 = $code$06&65535; $16 = (((($z)) + 1024|0) + ($i$28<<1)|0); HEAP16[$16>>1] = $15; $17 = $k$07&65535; $18 = (((($z)) + 1124|0) + ($i$28<<1)|0); HEAP16[$18>>1] = $17; $19 = (($sizes) + ($i$28<<2)|0); $20 = HEAP32[$19>>2]|0; $21 = (($20) + ($code$06))|0; $22 = ($20|0)!=(0); $23 = 1 << $i$28; $24 = ($21|0)>($23|0); $or$cond = $22 & $24; if ($or$cond) { label = 7; break; } $25 = (16 - ($i$28))|0; $26 = $21 << $25; $27 = (((($z)) + 1056|0) + ($i$28<<2)|0); HEAP32[$27>>2] = $26; $28 = $21 << 1; $29 = HEAP32[$19>>2]|0; $30 = (($29) + ($k$07))|0; $31 = (($i$28) + 1)|0; $32 = ($31|0)<(16); if ($32) { $code$06 = $28;$i$28 = $31;$k$07 = $30; } else { break; } } if ((label|0) == 7) { _stbi__err(19176); $$0 = 0; STACKTOP = sp;return ($$0|0); } $33 = ((($z)) + 1120|0); HEAP32[$33>>2] = 65536; $34 = ($num|0)>(0); if ($34) { $i$34 = 0; } else { $$0 = 1; STACKTOP = sp;return ($$0|0); } while(1) { $35 = (($sizelist) + ($i$34)|0); $36 = HEAP8[$35>>0]|0; $37 = $36&255; $38 = ($36<<24>>24)==(0); if (!($38)) { $39 = (($next_code) + ($37<<2)|0); $40 = HEAP32[$39>>2]|0; $41 = (((($z)) + 1024|0) + ($37<<1)|0); $42 = HEAP16[$41>>1]|0; $43 = $42&65535; $44 = (($40) - ($43))|0; $45 = (((($z)) + 1124|0) + ($37<<1)|0); $46 = HEAP16[$45>>1]|0; $47 = $46&65535; $48 = (($44) + ($47))|0; $49 = $37 << 9; $50 = $49 | $i$34; $51 = $50&65535; $52 = (((($z)) + 1156|0) + ($48)|0); HEAP8[$52>>0] = $36; $53 = $i$34&65535; $54 = (((($z)) + 1444|0) + ($48<<1)|0); HEAP16[$54>>1] = $53; $55 = ($36&255)<(10); do { if ($55) { $56 = HEAP32[$39>>2]|0; $57 = (_stbi__bit_reverse($56,$37)|0); $58 = ($57|0)<(512); if (!($58)) { break; } $59 = 1 << $37; $j$03 = $57; while(1) { $60 = (($z) + ($j$03<<1)|0); HEAP16[$60>>1] = $51; $61 = (($j$03) + ($59))|0; $62 = ($61|0)<(512); if ($62) { $j$03 = $61; } else { break; } } } } while(0); $63 = HEAP32[$39>>2]|0; $64 = (($63) + 1)|0; HEAP32[$39>>2] = $64; } $65 = (($i$34) + 1)|0; $exitcond = ($65|0)==($num|0); if ($exitcond) { $$0 = 1; break; } else { $i$34 = $65; } } STACKTOP = sp;return ($$0|0); } } } } } } } } } } } } } } } _stbi__err(19228); $$0 = 0; STACKTOP = sp;return ($$0|0); } function _stbi__compute_huffman_codes($a) { $a = $a|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $codelength_sizes = 0, $exitcond = 0, $i$08 = 0, $lencodes = 0, $n$0$be = 0, $n$0$lcssa = 0, $n$06 = 0, $not$ = 0, $z_codelength = 0, dest = 0; var label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 2496|0; $z_codelength = sp; $lencodes = sp + 2039|0; $codelength_sizes = sp + 2020|0; $0 = (_stbi__zreceive($a,5)|0); $1 = (($0) + 257)|0; $2 = (_stbi__zreceive($a,5)|0); $3 = (($2) + 1)|0; $4 = (_stbi__zreceive($a,4)|0); $5 = (($4) + 4)|0; dest=$codelength_sizes; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); $6 = ($5|0)>(0); if ($6) { $7 = (($4) + 3)|0; $i$08 = 0; while(1) { $8 = (_stbi__zreceive($a,3)|0); $9 = $8&255; $10 = (19157 + ($i$08)|0); $11 = HEAP8[$10>>0]|0; $12 = $11&255; $13 = (($codelength_sizes) + ($12)|0); HEAP8[$13>>0] = $9; $14 = (($i$08) + 1)|0; $exitcond = ($i$08|0)==($7|0); if ($exitcond) { break; } else { $i$08 = $14; } } } $15 = (_stbi__zbuild_huffman($z_codelength,$codelength_sizes,19)|0); $16 = ($15|0)==(0); if ($16) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $17 = (($3) + ($1))|0; $18 = ($17|0)>(0); L9: do { if ($18) { $n$06 = 0; L10: while(1) { $19 = (_stbi__zhuffman_decode($a,$z_codelength)|0); $20 = ($19>>>0)>(18); if ($20) { break; } $21 = ($19|0)<(16); L13: do { if ($21) { $22 = $19&255; $23 = (($n$06) + 1)|0; $24 = (($lencodes) + ($n$06)|0); HEAP8[$24>>0] = $22; $n$0$be = $23; } else { switch ($19|0) { case 16: { $25 = (_stbi__zreceive($a,2)|0); $26 = (($25) + 3)|0; $27 = (($lencodes) + ($n$06)|0); $28 = (($n$06) + -1)|0; $29 = (($lencodes) + ($28)|0); $30 = HEAP8[$29>>0]|0; _memset(($27|0),($30|0),($26|0))|0; $31 = (($26) + ($n$06))|0; $n$0$be = $31; break L13; break; } case 17: { $33 = (_stbi__zreceive($a,3)|0); $34 = (($33) + 3)|0; $35 = (($lencodes) + ($n$06)|0); _memset(($35|0),0,($34|0))|0; $36 = (($34) + ($n$06))|0; $n$0$be = $36; break L13; break; } case 18: { $37 = (_stbi__zreceive($a,7)|0); $38 = (($37) + 11)|0; $39 = (($lencodes) + ($n$06)|0); _memset(($39|0),0,($38|0))|0; $40 = (($38) + ($n$06))|0; $n$0$be = $40; break L13; break; } default: { label = 14; break L10; } } } } while(0); $32 = ($n$0$be|0)<($17|0); if ($32) { $n$06 = $n$0$be; } else { $n$0$lcssa = $n$0$be; break L9; } } if ((label|0) == 14) { ___assert_fail((19192|0),(18129|0),3729,(19200|0)); // unreachable; } _stbi__err(19176); $$0 = 0; STACKTOP = sp;return ($$0|0); } else { $n$0$lcssa = 0; } } while(0); $41 = ($n$0$lcssa|0)==($17|0); if (!($41)) { _stbi__err(19176); $$0 = 0; STACKTOP = sp;return ($$0|0); } $42 = ((($a)) + 32|0); $43 = (_stbi__zbuild_huffman($42,$lencodes,$1)|0); $44 = ($43|0)==(0); if ($44) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $45 = ((($a)) + 2052|0); $46 = (($lencodes) + ($1)|0); $47 = (_stbi__zbuild_huffman($45,$46,$3)|0); $not$ = ($47|0)!=(0); $$ = $not$&1; $$0 = $$; STACKTOP = sp;return ($$0|0); } function _stbi__parse_huffman_block($a) { $a = $a|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dist$0 = 0; var $len$0 = 0, $len$2 = 0, $p$0 = 0, $scevgep = 0, $scevgep14 = 0, $zout$0 = 0, $zout$0$lcssa = 0, $zout$1 = 0, $zout$2 = 0, $zout$4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($a)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ((($a)) + 32|0); $3 = ((($a)) + 24|0); $4 = ((($a)) + 2052|0); $5 = ((($a)) + 20|0); $6 = ((($a)) + 24|0); $zout$0 = $1; while(1) { $9 = (_stbi__zhuffman_decode($a,$2)|0); $10 = ($9|0)<(256); if ($10) { $11 = ($9|0)<(0); if ($11) { label = 6; break; } $12 = HEAP32[$3>>2]|0; $13 = ($zout$0>>>0)<($12>>>0); if ($13) { $zout$1 = $zout$0; } else { $14 = (_stbi__zexpand($a,$zout$0,1)|0); $15 = ($14|0)==(0); if ($15) { $$0 = 0; label = 28; break; } $16 = HEAP32[$0>>2]|0; $zout$1 = $16; } $17 = $9&255; $18 = ((($zout$1)) + 1|0); HEAP8[$zout$1>>0] = $17; $zout$0 = $18; continue; } $19 = ($9|0)==(256); if ($19) { $zout$0$lcssa = $zout$0; label = 12; break; } $20 = (($9) + -257)|0; $21 = (8000 + ($20<<2)|0); $22 = HEAP32[$21>>2]|0; $23 = (($9) + -265)|0; $24 = ($23>>>0)<(20); if ($24) { $25 = (8124 + ($20<<2)|0); $26 = HEAP32[$25>>2]|0; $27 = (_stbi__zreceive($a,$26)|0); $28 = (($27) + ($22))|0; $len$0 = $28; } else { $len$0 = $22; } $29 = (_stbi__zhuffman_decode($a,$4)|0); $30 = ($29|0)<(0); if ($30) { label = 16; break; } $31 = (8248 + ($29<<2)|0); $32 = HEAP32[$31>>2]|0; $33 = (($29) + -4)|0; $34 = ($33>>>0)<(26); if ($34) { $35 = (8376 + ($29<<2)|0); $36 = HEAP32[$35>>2]|0; $37 = (_stbi__zreceive($a,$36)|0); $38 = (($37) + ($32))|0; $dist$0 = $38; } else { $dist$0 = $32; } $39 = HEAP32[$5>>2]|0; $40 = $zout$0; $41 = $39; $42 = (($40) - ($41))|0; $43 = ($42|0)<($dist$0|0); if ($43) { label = 20; break; } $44 = (($zout$0) + ($len$0)|0); $45 = HEAP32[$6>>2]|0; $46 = ($44>>>0)>($45>>>0); if ($46) { $47 = (_stbi__zexpand($a,$zout$0,$len$0)|0); $48 = ($47|0)==(0); if ($48) { $$0 = 0; label = 28; break; } $49 = HEAP32[$0>>2]|0; $zout$2 = $49; } else { $zout$2 = $zout$0; } $50 = (0 - ($dist$0))|0; $8 = (($zout$2) + ($50)|0); $51 = ($dist$0|0)==(1); $52 = ($len$0|0)==(0); if ($51) { if ($52) { $zout$0 = $zout$2; continue; } $7 = HEAP8[$8>>0]|0; _memset(($zout$2|0),($7|0),($len$0|0))|0; $scevgep14 = (($zout$2) + ($len$0)|0); $zout$0 = $scevgep14; continue; } if ($52) { $zout$0 = $zout$2; continue; } else { $len$2 = $len$0;$p$0 = $8;$zout$4 = $zout$2; } while(1) { $53 = ((($p$0)) + 1|0); $54 = HEAP8[$p$0>>0]|0; $55 = ((($zout$4)) + 1|0); HEAP8[$zout$4>>0] = $54; $56 = (($len$2) + -1)|0; $57 = ($56|0)==(0); if ($57) { break; } else { $len$2 = $56;$p$0 = $53;$zout$4 = $55; } } $scevgep = (($zout$2) + ($len$0)|0); $zout$0 = $scevgep; } if ((label|0) == 6) { _stbi__err(18982); $$0 = 0; return ($$0|0); } else if ((label|0) == 12) { HEAP32[$0>>2] = $zout$0$lcssa; $$0 = 1; return ($$0|0); } else if ((label|0) == 16) { _stbi__err(18982); $$0 = 0; return ($$0|0); } else if ((label|0) == 20) { _stbi__err(18999); $$0 = 0; return ($$0|0); } else if ((label|0) == 28) { return ($$0|0); } return (0)|0; } function _stbi__zhuffman_decode($a,$z) { $a = $a|0; $z = $z|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($a)) + 8|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(16); if ($2) { _stbi__fill_bits($a); } $3 = ((($a)) + 12|0); $4 = HEAP32[$3>>2]|0; $5 = $4 & 511; $6 = (($z) + ($5<<1)|0); $7 = HEAP16[$6>>1]|0; $8 = $7&65535; $9 = ($7<<16>>16)==(0); if ($9) { $15 = (_stbi__zhuffman_decode_slowpath($a,$z)|0); $$0 = $15; return ($$0|0); } else { $10 = $8 >>> 9; $11 = $4 >>> $10; HEAP32[$3>>2] = $11; $12 = HEAP32[$0>>2]|0; $13 = (($12) - ($10))|0; HEAP32[$0>>2] = $13; $14 = $8 & 511; $$0 = $14; return ($$0|0); } return (0)|0; } function _stbi__zexpand($z,$zout,$n) { $z = $z|0; $zout = $zout|0; $n = $n|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $limit$0 = 0, $limit$0$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 16|0); HEAP32[$0>>2] = $zout; $1 = ((($z)) + 28|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)==(0); if ($3) { _stbi__err(19008); $$0 = 0; return ($$0|0); } $4 = ((($z)) + 20|0); $5 = HEAP32[$4>>2]|0; $6 = $zout; $7 = $5; $8 = (($6) - ($7))|0; $9 = ((($z)) + 24|0); $10 = HEAP32[$9>>2]|0; $11 = $10; $12 = (($11) - ($7))|0; $13 = (($8) + ($n))|0; $limit$0 = $12; while(1) { $14 = ($13|0)>($limit$0|0); $15 = $limit$0 << 1; if ($14) { $limit$0 = $15; } else { $limit$0$lcssa = $limit$0; break; } } $16 = HEAP32[$4>>2]|0; $17 = (_realloc($16,$limit$0$lcssa)|0); $18 = ($17|0)==(0|0); if ($18) { _stbi__err(18059); $$0 = 0; return ($$0|0); } else { HEAP32[$4>>2] = $17; $19 = (($17) + ($8)|0); HEAP32[$0>>2] = $19; $20 = (($17) + ($limit$0$lcssa)|0); HEAP32[$9>>2] = $20; $$0 = 1; return ($$0|0); } return (0)|0; } function _stbi__fill_bits($z) { $z = $z|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 12|0); $1 = ((($z)) + 8|0); while(1) { $2 = HEAP32[$0>>2]|0; $3 = HEAP32[$1>>2]|0; $4 = 1 << $3; $5 = ($2>>>0)<($4>>>0); if (!($5)) { label = 3; break; } $6 = (_stbi__zget8($z)|0); $7 = $6&255; $8 = HEAP32[$1>>2]|0; $9 = $7 << $8; $10 = HEAP32[$0>>2]|0; $11 = $10 | $9; HEAP32[$0>>2] = $11; $12 = HEAP32[$1>>2]|0; $13 = (($12) + 8)|0; HEAP32[$1>>2] = $13; $14 = ($13|0)<(25); if (!($14)) { label = 5; break; } } if ((label|0) == 3) { ___assert_fail((19104|0),(18129|0),3573,(19141|0)); // unreachable; } else if ((label|0) == 5) { return; } } function _stbi__zhuffman_decode_slowpath($a,$z) { $a = $a|0; $z = $z|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $s$0 = 0, $s$0$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($a)) + 12|0); $1 = HEAP32[$0>>2]|0; $2 = (_stbi__bit_reverse($1,16)|0); $s$0 = 10; while(1) { $3 = (((($z)) + 1056|0) + ($s$0<<2)|0); $4 = HEAP32[$3>>2]|0; $5 = ($2|0)<($4|0); $6 = (($s$0) + 1)|0; if ($5) { $s$0$lcssa = $s$0; break; } else { $s$0 = $6; } } $7 = ($s$0$lcssa|0)==(16); if ($7) { $$0 = -1; return ($$0|0); } $8 = (16 - ($s$0$lcssa))|0; $9 = $2 >> $8; $10 = (((($z)) + 1024|0) + ($s$0$lcssa<<1)|0); $11 = HEAP16[$10>>1]|0; $12 = $11&65535; $13 = (($9) - ($12))|0; $14 = (((($z)) + 1124|0) + ($s$0$lcssa<<1)|0); $15 = HEAP16[$14>>1]|0; $16 = $15&65535; $17 = (($13) + ($16))|0; $18 = (((($z)) + 1156|0) + ($17)|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $21 = ($20|0)==($s$0$lcssa|0); if (!($21)) { ___assert_fail((19028|0),(18129|0),3601,(19044|0)); // unreachable; } $22 = HEAP32[$0>>2]|0; $23 = $22 >>> $s$0$lcssa; HEAP32[$0>>2] = $23; $24 = ((($a)) + 8|0); $25 = HEAP32[$24>>2]|0; $26 = (($25) - ($s$0$lcssa))|0; HEAP32[$24>>2] = $26; $27 = (((($z)) + 1444|0) + ($17<<1)|0); $28 = HEAP16[$27>>1]|0; $29 = $28&65535; $$0 = $29; return ($$0|0); } function _stbi__bit_reverse($v,$bits) { $v = $v|0; $bits = $bits|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($bits|0)<(17); if ($0) { $1 = (_stbi__bitreverse16($v)|0); $2 = (16 - ($bits))|0; $3 = $1 >> $2; return ($3|0); } else { ___assert_fail((19075|0),(18129|0),3491,(19086|0)); // unreachable; } return (0)|0; } function _stbi__bitreverse16($n) { $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0; var sp = 0; sp = STACKTOP; $0 = $n >>> 1; $1 = $0 & 21845; $2 = $n << 1; $3 = $2 & 43690; $4 = $1 | $3; $5 = $4 >>> 2; $6 = $5 & 13107; $7 = $4 << 2; $8 = $7 & 52428; $9 = $6 | $8; $10 = $9 >>> 4; $11 = $10 & 3855; $12 = $9 << 4; $13 = $12 & 61680; $14 = $11 | $13; $15 = $14 >>> 8; $16 = $14 << 8; $17 = $16 & 65280; $18 = $17 | $15; return ($18|0); } function _stbi__zget8($z) { $z = $z|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$z>>2]|0; $1 = ((($z)) + 4|0); $2 = HEAP32[$1>>2]|0; $3 = ($0>>>0)<($2>>>0); if (!($3)) { $$0 = 0; return ($$0|0); } $4 = ((($0)) + 1|0); HEAP32[$z>>2] = $4; $5 = HEAP8[$0>>0]|0; $$0 = $5; return ($$0|0); } function _stbi__load_main($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__jpeg_test($s)|0); $1 = ($0|0)==(0); if (!($1)) { $2 = (_stbi__jpeg_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $2; return ($$0|0); } $3 = (_stbi__png_test($s)|0); $4 = ($3|0)==(0); if (!($4)) { $5 = (_stbi__png_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $5; return ($$0|0); } $6 = (_stbi__bmp_test($s)|0); $7 = ($6|0)==(0); if (!($7)) { $8 = (_stbi__bmp_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $8; return ($$0|0); } $9 = (_stbi__gif_test($s)|0); $10 = ($9|0)==(0); if (!($10)) { $11 = (_stbi__gif_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $11; return ($$0|0); } $12 = (_stbi__psd_test($s)|0); $13 = ($12|0)==(0); if (!($13)) { $14 = (_stbi__psd_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $14; return ($$0|0); } $15 = (_stbi__pic_test($s)|0); $16 = ($15|0)==(0); if (!($16)) { $17 = (_stbi__pic_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $17; return ($$0|0); } $18 = (_stbi__pnm_test($s)|0); $19 = ($18|0)==(0); if (!($19)) { $20 = (_stbi__pnm_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $20; return ($$0|0); } $21 = (_stbi__tga_test($s)|0); $22 = ($21|0)==(0); if ($22) { _stbi__err(17723); $$0 = 0; return ($$0|0); } else { $23 = (_stbi__tga_load($s,$x,$y,$comp,$req_comp)|0); $$0 = $23; return ($$0|0); } return (0)|0; } function _stbi__jpeg_test($s) { $s = $s|0; var $0 = 0, $j = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 18192|0; $j = sp; HEAP32[$j>>2] = $s; _stbi__setup_jpeg($j); $0 = (_stbi__decode_jpeg_header($j,1)|0); _stbi__rewind($s); STACKTOP = sp;return ($0|0); } function _stbi__jpeg_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $0 = 0, $j = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 18192|0; $j = sp; HEAP32[$j>>2] = $s; _stbi__setup_jpeg($j); $0 = (_load_jpeg_image($j,$x,$y,$comp,$req_comp)|0); STACKTOP = sp;return ($0|0); } function _stbi__png_test($s) { $s = $s|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__check_png_header($s)|0); _stbi__rewind($s); return ($0|0); } function _stbi__png_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $0 = 0, $p = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $p = sp; HEAP32[$p>>2] = $s; $0 = (_stbi__do_png($p,$x,$y,$comp,$req_comp)|0); STACKTOP = sp;return ($0|0); } function _stbi__bmp_test($s) { $s = $s|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__bmp_test_raw($s)|0); _stbi__rewind($s); return ($0|0); } function _stbi__bmp_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$0 = 0, $$pr = 0, $$sum = 0, $$sum16 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0; var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0; var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0; var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0; var $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0; var $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $acount$0 = 0, $all_a$064 = 0, $all_a$158 = 0, $all_a$251 = 0, $all_a$3 = 0, $all_a$4 = 0, $ashift$0 = 0, $bcount$0 = 0, $bshift$0 = 0, $easy$017 = 0, $exitcond = 0, $gcount$0 = 0, $gshift$0 = 0, $i$046 = 0; var $i$138 = 0, $i$256 = 0, $i$349 = 0, $i$435 = 0, $i$532 = 0, $info = 0, $ispos = 0, $j$044 = 0, $j$162 = 0, $j$233 = 0, $neg = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $out$0 = 0; var $pal = 0, $psize$0 = 0, $rcount$0 = 0, $req_comp$ = 0, $rshift$0 = 0, $v$0 = 0, $v2$0 = 0, $width$0 = 0, $width$1 = 0, $width$1$ph = 0, $z$045 = 0, $z$139 = 0, $z$2 = 0, $z$3 = 0, $z$4 = 0, $z1$063 = 0, $z1$157 = 0, $z1$2 = 0, $z1$350 = 0, $z1$4 = 0; var $z1$5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 1056|0; $pal = sp + 32|0; $info = sp; $0 = ((($info)) + 28|0); HEAP32[$0>>2] = 255; $1 = (_stbi__bmp_parse_header($s,$info)|0); $2 = ($1|0)==(0|0); if ($2) { $$0 = 0; STACKTOP = sp;return ($$0|0); } $3 = ((($s)) + 4|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)>(0); $ispos = ($4|0)>(-1); $neg = (0 - ($4))|0; $6 = $ispos ? $4 : $neg; HEAP32[$3>>2] = $6; $7 = ((($info)) + 12|0); $8 = HEAP32[$7>>2]|0; $9 = ((($info)) + 16|0); $10 = HEAP32[$9>>2]|0; $11 = ((($info)) + 20|0); $12 = HEAP32[$11>>2]|0; $13 = ((($info)) + 24|0); $14 = HEAP32[$13>>2]|0; $15 = HEAP32[$0>>2]|0; $16 = ((($info)) + 8|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)==(12); $19 = HEAP32[$info>>2]|0; if ($18) { $20 = ($19|0)<(24); if ($20) { $21 = ((($info)) + 4|0); $22 = HEAP32[$21>>2]|0; $23 = (($22) + -38)|0; $24 = (($23|0) / 3)&-1; $psize$0 = $24; } else { $psize$0 = 0; } } else { $25 = ($19|0)<(16); if ($25) { $26 = ((($info)) + 4|0); $27 = HEAP32[$26>>2]|0; $28 = (-14 - ($17))|0; $29 = (($28) + ($27))|0; $30 = $29 >> 2; $psize$0 = $30; } else { $psize$0 = 0; } } $31 = ($14|0)!=(0); $32 = $31 ? 4 : 3; $33 = ((($s)) + 8|0); HEAP32[$33>>2] = $32; $34 = ($req_comp|0)==(0); $35 = ($req_comp|0)>(2); $req_comp$ = $35 ? $req_comp : $32; $36 = HEAP32[$s>>2]|0; $37 = Math_imul($36, $req_comp$)|0; $38 = HEAP32[$3>>2]|0; $39 = Math_imul($37, $38)|0; $40 = (_stbi__malloc($39)|0); $41 = ($40|0)==(0|0); if ($41) { _stbi__err(18059); $$0 = 0; STACKTOP = sp;return ($$0|0); } $42 = HEAP32[$info>>2]|0; $43 = ($42|0)<(16); if ($43) { $44 = ($psize$0|0)==(0); $45 = ($psize$0|0)>(256); $or$cond3 = $44 | $45; if ($or$cond3) { _free($40); _stbi__err(19679); $$0 = 0; STACKTOP = sp;return ($$0|0); } $46 = ($psize$0|0)>(0); if ($46) { $47 = HEAP32[$16>>2]|0; $48 = ($47|0)==(12); $i$046 = 0; while(1) { $49 = (_stbi__get8($s)|0); $50 = (((($pal) + ($i$046<<2)|0)) + 2|0); HEAP8[$50>>0] = $49; $51 = (_stbi__get8($s)|0); $52 = (((($pal) + ($i$046<<2)|0)) + 1|0); HEAP8[$52>>0] = $51; $53 = (_stbi__get8($s)|0); $54 = (($pal) + ($i$046<<2)|0); HEAP8[$54>>0] = $53; if (!($48)) { (_stbi__get8($s)|0); } $55 = (((($pal) + ($i$046<<2)|0)) + 3|0); HEAP8[$55>>0] = -1; $56 = (($i$046) + 1)|0; $exitcond = ($56|0)==($psize$0|0); if ($exitcond) { break; } else { $i$046 = $56; } } } $57 = ((($info)) + 4|0); $58 = HEAP32[$57>>2]|0; $59 = (($58) + -14)|0; $60 = HEAP32[$16>>2]|0; $61 = (($59) - ($60))|0; $62 = ($60|0)==(12); $63 = $62 ? 3 : 4; $64 = Math_imul($63, $psize$0)|0; $65 = (($61) - ($64))|0; _stbi__skip($s,$65); $66 = HEAP32[$info>>2]|0; switch ($66|0) { case 4: { $67 = HEAP32[$s>>2]|0; $68 = (($67) + 1)|0; $69 = $68 >>> 1; $width$0 = $69; break; } case 8: { $70 = HEAP32[$s>>2]|0; $width$0 = $70; break; } default: { _free($40); _stbi__err(19687); $$0 = 0; STACKTOP = sp;return ($$0|0); } } $71 = (0 - ($width$0))|0; $72 = $71 & 3; $73 = HEAP32[$3>>2]|0; $74 = ($73|0)>(0); if ($74) { $75 = HEAP32[$info>>2]|0; $76 = ($75|0)==(4); $77 = ($req_comp$|0)==(4); $78 = ($75|0)==(8); $j$044 = 0;$z$045 = 0; while(1) { $79 = HEAP32[$s>>2]|0; $80 = ($79|0)>(0); L37: do { if ($80) { $i$138 = 0;$z$139 = $z$045; while(1) { $81 = (_stbi__get8($s)|0); $82 = $81&255; $83 = $82 & 15; $84 = $82 >>> 4; $v$0 = $76 ? $84 : $82; $v2$0 = $76 ? $83 : 0; $85 = (($pal) + ($v$0<<2)|0); $86 = HEAP8[$85>>0]|0; $87 = (($z$139) + 1)|0; $88 = (($40) + ($z$139)|0); HEAP8[$88>>0] = $86; $89 = (((($pal) + ($v$0<<2)|0)) + 1|0); $90 = HEAP8[$89>>0]|0; $91 = (($z$139) + 2)|0; $92 = (($40) + ($87)|0); HEAP8[$92>>0] = $90; $93 = (((($pal) + ($v$0<<2)|0)) + 2|0); $94 = HEAP8[$93>>0]|0; $95 = (($z$139) + 3)|0; $96 = (($40) + ($91)|0); HEAP8[$96>>0] = $94; if ($77) { $97 = (($z$139) + 4)|0; $98 = (($40) + ($95)|0); HEAP8[$98>>0] = -1; $z$2 = $97; } else { $z$2 = $95; } $99 = $i$138 | 1; $100 = HEAP32[$s>>2]|0; $101 = ($99|0)==($100|0); if ($101) { $z$4 = $z$2; break L37; } if ($78) { $102 = (_stbi__get8($s)|0); $103 = $102&255; $105 = $103; } else { $105 = $v2$0; } $104 = (($pal) + ($105<<2)|0); $106 = HEAP8[$104>>0]|0; $107 = (($z$2) + 1)|0; $108 = (($40) + ($z$2)|0); HEAP8[$108>>0] = $106; $109 = (((($pal) + ($105<<2)|0)) + 1|0); $110 = HEAP8[$109>>0]|0; $111 = (($z$2) + 2)|0; $112 = (($40) + ($107)|0); HEAP8[$112>>0] = $110; $113 = (((($pal) + ($105<<2)|0)) + 2|0); $114 = HEAP8[$113>>0]|0; $115 = (($z$2) + 3)|0; $116 = (($40) + ($111)|0); HEAP8[$116>>0] = $114; if ($77) { $117 = (($z$2) + 4)|0; $118 = (($40) + ($115)|0); HEAP8[$118>>0] = -1; $z$3 = $117; } else { $z$3 = $115; } $119 = (($i$138) + 2)|0; $120 = HEAP32[$s>>2]|0; $121 = ($119|0)<($120|0); if ($121) { $i$138 = $119;$z$139 = $z$3; } else { $z$4 = $z$3; break; } } } else { $z$4 = $z$045; } } while(0); _stbi__skip($s,$72); $122 = (($j$044) + 1)|0; $123 = HEAP32[$3>>2]|0; $124 = ($122|0)<($123|0); if ($124) { $j$044 = $122;$z$045 = $z$4; } else { $all_a$4 = $15; break; } } } else { $all_a$4 = $15; } } else { $125 = ((($info)) + 4|0); $126 = HEAP32[$125>>2]|0; $127 = (($126) + -14)|0; $128 = HEAP32[$16>>2]|0; $129 = (($127) - ($128))|0; _stbi__skip($s,$129); $130 = HEAP32[$info>>2]|0; switch ($130|0) { case 24: { $131 = HEAP32[$s>>2]|0; $132 = ($131*3)|0; $width$1$ph = $132; label = 36; break; } case 16: { $133 = HEAP32[$s>>2]|0; $134 = $133 << 1; $width$1$ph = $134; label = 36; break; } default: { $137 = $130;$width$1 = 0; } } if ((label|0) == 36) { $$pr = HEAP32[$info>>2]|0; $137 = $$pr;$width$1 = $width$1$ph; } $135 = (0 - ($width$1))|0; $136 = $135 & 3; switch ($137|0) { case 24: { $261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 1;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0; break; } case 32: { $138 = ($12|0)==(255); $139 = ($10|0)==(65280); $or$cond5 = $139 & $138; $140 = ($8|0)==(16711680); $or$cond7 = $140 & $or$cond5; $141 = ($14|0)==(-16777216); $or$cond9 = $141 & $or$cond7; if ($or$cond9) { $261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 2;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0; } else { label = 39; } break; } default: { label = 39; } } do { if ((label|0) == 39) { $142 = ($8|0)!=(0); $143 = ($10|0)!=(0); $or$cond11 = $142 & $143; $144 = ($12|0)!=(0); $or$cond13 = $or$cond11 & $144; if ($or$cond13) { $145 = (_stbi__high_bit($8)|0); $146 = (($145) + -7)|0; $147 = (_stbi__bitcount($8)|0); $148 = (_stbi__high_bit($10)|0); $149 = (($148) + -7)|0; $150 = (_stbi__bitcount($10)|0); $151 = (_stbi__high_bit($12)|0); $152 = (($151) + -7)|0; $153 = (_stbi__bitcount($12)|0); $154 = (_stbi__high_bit($14)|0); $155 = (($154) + -7)|0; $156 = (_stbi__bitcount($14)|0); $261 = 0;$acount$0 = $156;$ashift$0 = $155;$bcount$0 = $153;$bshift$0 = $152;$easy$017 = 0;$gcount$0 = $150;$gshift$0 = $149;$rcount$0 = $147;$rshift$0 = $146; break; } _free($40); _stbi__err(19695); $$0 = 0; STACKTOP = sp;return ($$0|0); } } while(0); $157 = HEAP32[$3>>2]|0; $158 = ($157|0)>(0); if ($158) { $159 = HEAP32[$info>>2]|0; $160 = ($159|0)==(16); $161 = ($req_comp$|0)==(4); $162 = ($easy$017|0)==(2); $163 = ($req_comp$|0)==(4); $all_a$064 = $15;$j$162 = 0;$z1$063 = 0; while(1) { $164 = HEAP32[$s>>2]|0; $165 = ($164|0)>(0); if ($261) { if ($165) { $all_a$158 = $all_a$064;$i$256 = 0;$z1$157 = $z1$063; while(1) { $166 = (_stbi__get8($s)|0); $167 = (($z1$157) + 2)|0; $168 = (($40) + ($167)|0); HEAP8[$168>>0] = $166; $169 = (_stbi__get8($s)|0); $170 = (($z1$157) + 1)|0; $171 = (($40) + ($170)|0); HEAP8[$171>>0] = $169; $172 = (_stbi__get8($s)|0); $173 = (($40) + ($z1$157)|0); HEAP8[$173>>0] = $172; $174 = (($z1$157) + 3)|0; if ($162) { $175 = (_stbi__get8($s)|0); $176 = $175&255; $178 = $176; } else { $178 = 255; } $177 = $178 | $all_a$158; if ($163) { $179 = $178&255; $180 = (($z1$157) + 4)|0; $181 = (($40) + ($174)|0); HEAP8[$181>>0] = $179; $z1$2 = $180; } else { $z1$2 = $174; } $182 = (($i$256) + 1)|0; $183 = HEAP32[$s>>2]|0; $184 = ($182|0)<($183|0); if ($184) { $all_a$158 = $177;$i$256 = $182;$z1$157 = $z1$2; } else { $all_a$3 = $177;$z1$5 = $z1$2; break; } } } else { $all_a$3 = $all_a$064;$z1$5 = $z1$063; } } else { if ($165) { $all_a$251 = $all_a$064;$i$349 = 0;$z1$350 = $z1$063; while(1) { if ($160) { $185 = (_stbi__get16le($s)|0); $188 = $185; } else { $186 = (_stbi__get32le($s)|0); $188 = $186; } $187 = $188 & $8; $189 = (_stbi__shiftsigned($187,$rshift$0,$rcount$0)|0); $190 = $189&255; $191 = (($z1$350) + 1)|0; $192 = (($40) + ($z1$350)|0); HEAP8[$192>>0] = $190; $193 = $188 & $10; $194 = (_stbi__shiftsigned($193,$gshift$0,$gcount$0)|0); $195 = $194&255; $196 = (($z1$350) + 2)|0; $197 = (($40) + ($191)|0); HEAP8[$197>>0] = $195; $198 = $188 & $12; $199 = (_stbi__shiftsigned($198,$bshift$0,$bcount$0)|0); $200 = $199&255; $201 = (($z1$350) + 3)|0; $202 = (($40) + ($196)|0); HEAP8[$202>>0] = $200; if ($31) { $203 = $188 & $14; $204 = (_stbi__shiftsigned($203,$ashift$0,$acount$0)|0); $206 = $204; } else { $206 = 255; } $205 = $206 | $all_a$251; if ($161) { $207 = $206&255; $208 = (($z1$350) + 4)|0; $209 = (($40) + ($201)|0); HEAP8[$209>>0] = $207; $z1$4 = $208; } else { $z1$4 = $201; } $210 = (($i$349) + 1)|0; $211 = HEAP32[$s>>2]|0; $212 = ($210|0)<($211|0); if ($212) { $all_a$251 = $205;$i$349 = $210;$z1$350 = $z1$4; } else { $all_a$3 = $205;$z1$5 = $z1$4; break; } } } else { $all_a$3 = $all_a$064;$z1$5 = $z1$063; } } _stbi__skip($s,$136); $213 = (($j$162) + 1)|0; $214 = HEAP32[$3>>2]|0; $215 = ($213|0)<($214|0); if ($215) { $all_a$064 = $all_a$3;$j$162 = $213;$z1$063 = $z1$5; } else { $all_a$4 = $all_a$3; break; } } } else { $all_a$4 = $15; } } $216 = ($req_comp$|0)==(4); $217 = ($all_a$4|0)==(0); $or$cond15 = $216 & $217; if ($or$cond15) { $218 = HEAP32[$s>>2]|0; $219 = $218 << 2; $220 = HEAP32[$3>>2]|0; $221 = Math_imul($219, $220)|0; $222 = (($221) + -1)|0; $223 = ($222|0)>(-1); if ($223) { $i$435 = $222; while(1) { $224 = (($40) + ($i$435)|0); HEAP8[$224>>0] = -1; $225 = (($i$435) + -4)|0; $226 = ($225|0)>(-1); if ($226) { $i$435 = $225; } else { break; } } } } if ($5) { $227 = HEAP32[$3>>2]|0; $228 = $227 >> 1; $229 = ($228|0)>(0); if ($229) { $230 = HEAP32[$s>>2]|0; $231 = Math_imul($230, $req_comp$)|0; $232 = ($231|0)>(0); $233 = HEAP32[$3>>2]|0; $234 = $233 >> 1; $239 = $227;$j$233 = 0; while(1) { $235 = Math_imul($j$233, $req_comp$)|0; $236 = Math_imul($235, $230)|0; $237 = $j$233 ^ -1; $238 = (($239) + ($237))|0; $240 = Math_imul($238, $req_comp$)|0; $241 = Math_imul($240, $230)|0; if ($232) { $242 = HEAP32[$s>>2]|0; $243 = Math_imul($242, $req_comp$)|0; $i$532 = 0; while(1) { $$sum = (($i$532) + ($236))|0; $244 = (($40) + ($$sum)|0); $245 = HEAP8[$244>>0]|0; $$sum16 = (($i$532) + ($241))|0; $246 = (($40) + ($$sum16)|0); $247 = HEAP8[$246>>0]|0; HEAP8[$244>>0] = $247; HEAP8[$246>>0] = $245; $248 = (($i$532) + 1)|0; $249 = ($248|0)<($243|0); if ($249) { $i$532 = $248; } else { break; } } } $250 = (($j$233) + 1)|0; $251 = ($250|0)<($234|0); if ($251) { $239 = $233;$j$233 = $250; } else { break; } } } } $252 = ($req_comp$|0)==($req_comp|0); $or$cond = $34 | $252; if ($or$cond) { $out$0 = $40; } else { $253 = HEAP32[$s>>2]|0; $254 = HEAP32[$3>>2]|0; $255 = (_stbi__convert_format($40,$req_comp$,$req_comp,$253,$254)|0); $256 = ($255|0)==(0|0); if ($256) { $$0 = 0; STACKTOP = sp;return ($$0|0); } else { $out$0 = $255; } } $257 = HEAP32[$s>>2]|0; HEAP32[$x>>2] = $257; $258 = HEAP32[$3>>2]|0; HEAP32[$y>>2] = $258; $259 = ($comp|0)==(0|0); if ($259) { $$0 = $out$0; STACKTOP = sp;return ($$0|0); } $260 = HEAP32[$33>>2]|0; HEAP32[$comp>>2] = $260; $$0 = $out$0; STACKTOP = sp;return ($$0|0); } function _stbi__gif_test($s) { $s = $s|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__gif_test_raw($s)|0); _stbi__rewind($s); return ($0|0); } function _stbi__gif_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $g = 0, $u$0 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 18528|0; $g = sp; _memset(($g|0),0,18516)|0; $0 = (_stbi__gif_load_next($s,$g,$comp)|0); $1 = ($0|0)==($s|0); $$ = $1 ? 0 : $0; $2 = ($$|0)==(0|0); L1: do { if ($2) { $9 = ((($g)) + 8|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)==(0|0); if ($11) { $u$0 = 0; } else { _free($10); $u$0 = 0; } } else { $3 = HEAP32[$g>>2]|0; HEAP32[$x>>2] = $3; $4 = ((($g)) + 4|0); $5 = HEAP32[$4>>2]|0; HEAP32[$y>>2] = $5; switch ($req_comp|0) { case 0: case 4: { $u$0 = $$; break L1; break; } default: { } } $6 = HEAP32[$g>>2]|0; $7 = HEAP32[$4>>2]|0; $8 = (_stbi__convert_format($$,4,$req_comp,$6,$7)|0); $u$0 = $8; } } while(0); STACKTOP = sp;return ($u$0|0); } function _stbi__psd_test($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get32be($s)|0); $1 = ($0|0)==(943870035); $2 = $1&1; _stbi__rewind($s); return ($2|0); } function _stbi__psd_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$0 = 0, $$lcssa = 0, $$pn = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0; var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $channel$039 = 0, $count$0$ph$be = 0, $count$0$ph37 = 0, $exitcond = 0, $exitcond$1 = 0, $exitcond$2 = 0, $exitcond$3 = 0, $exitcond42 = 0; var $exitcond42$1 = 0, $exitcond42$2 = 0, $exitcond42$3 = 0, $exitcond43 = 0, $exitcond43$1 = 0, $exitcond43$2 = 0, $exitcond43$3 = 0, $exitcond46 = 0, $exitcond50 = 0, $i$028 = 0, $i$119 = 0, $i$119$1 = 0, $i$119$2 = 0, $i$119$3 = 0, $i$224 = 0, $i$224$1 = 0, $i$224$2 = 0, $i$224$3 = 0, $i$321 = 0, $i$321$1 = 0; var $i$321$2 = 0, $i$321$3 = 0, $len$035 = 0, $len$132 = 0, $out$0 = 0, $p$029 = 0, $p$1$ph$be = 0, $p$1$ph38 = 0, $p$236 = 0, $p$333 = 0, $p1$020 = 0, $p1$020$1 = 0, $p1$020$2 = 0, $p1$020$3 = 0, $p1$125 = 0, $p1$125$1 = 0, $p1$125$2 = 0, $p1$125$3 = 0, $p1$222 = 0, $p1$222$1 = 0; var $p1$222$2 = 0, $p1$222$3 = 0, $scevgep$sum = 0, $scevgep47 = 0, $scevgep48$sum = 0, $scevgep49 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get32be($s)|0); $1 = ($0|0)==(943870035); if (!($1)) { _stbi__err(19490); $$0 = 0; return ($$0|0); } $2 = (_stbi__get16be($s)|0); $3 = ($2|0)==(1); if (!($3)) { _stbi__err(19498); $$0 = 0; return ($$0|0); } _stbi__skip($s,6); $4 = (_stbi__get16be($s)|0); $5 = ($4>>>0)>(16); if ($5) { _stbi__err(19512); $$0 = 0; return ($$0|0); } $6 = (_stbi__get32be($s)|0); $7 = (_stbi__get32be($s)|0); $8 = (_stbi__get16be($s)|0); switch ($8|0) { case 8: case 16: { break; } default: { _stbi__err(19532); $$0 = 0; return ($$0|0); } } $9 = (_stbi__get16be($s)|0); $10 = ($9|0)==(3); if (!($10)) { _stbi__err(19554); $$0 = 0; return ($$0|0); } $11 = (_stbi__get32be($s)|0); _stbi__skip($s,$11); $12 = (_stbi__get32be($s)|0); _stbi__skip($s,$12); $13 = (_stbi__get32be($s)|0); _stbi__skip($s,$13); $14 = (_stbi__get16be($s)|0); $15 = ($14|0)>(1); if ($15) { _stbi__err(19347); $$0 = 0; return ($$0|0); } $16 = $6 << 2; $17 = Math_imul($16, $7)|0; $18 = (_stbi__malloc($17)|0); $19 = ($18|0)==(0|0); if ($19) { _stbi__err(18059); $$0 = 0; return ($$0|0); } $20 = Math_imul($7, $6)|0; $21 = ($14|0)==(0); L29: do { if ($21) { $54 = ($8|0)==(16); $55 = ($20|0)>(0); $56 = ($20|0)>(0); $57 = ($20|0)>(0); $58 = Math_imul($7, $6)|0; $59 = ($4|0)>(0); do { if ($59) { if ($54) { if ($55) { $i$224 = 0;$p1$125 = $18; } else { break; } while(1) { $62 = (_stbi__get16be($s)|0); $63 = $62 >>> 8; $64 = $63&255; HEAP8[$p1$125>>0] = $64; $65 = (($i$224) + 1)|0; $66 = ((($p1$125)) + 4|0); $exitcond43 = ($65|0)==($58|0); if ($exitcond43) { break; } else { $i$224 = $65;$p1$125 = $66; } } } else { if ($56) { $i$321 = 0;$p1$222 = $18; } else { break; } while(1) { $67 = (_stbi__get8($s)|0); HEAP8[$p1$222>>0] = $67; $68 = (($i$321) + 1)|0; $69 = ((($p1$222)) + 4|0); $exitcond42 = ($68|0)==($58|0); if ($exitcond42) { break; } else { $i$321 = $68;$p1$222 = $69; } } } } else { if ($57) { $i$119 = 0;$p1$020 = $18; } else { break L29; } while(1) { HEAP8[$p1$020>>0] = 0; $60 = (($i$119) + 1)|0; $61 = ((($p1$020)) + 4|0); $exitcond = ($60|0)==($58|0); if ($exitcond) { break; } else { $i$119 = $60;$p1$020 = $61; } } } } while(0); $70 = ((($18)) + 1|0); $71 = ($4|0)>(1); do { if ($71) { if ($54) { if ($55) { $i$224$1 = 0;$p1$125$1 = $70; } else { break; } while(1) { $80 = (_stbi__get16be($s)|0); $81 = $80 >>> 8; $82 = $81&255; HEAP8[$p1$125$1>>0] = $82; $83 = (($i$224$1) + 1)|0; $84 = ((($p1$125$1)) + 4|0); $exitcond43$1 = ($83|0)==($58|0); if ($exitcond43$1) { break; } else { $i$224$1 = $83;$p1$125$1 = $84; } } } else { if ($56) { $i$321$1 = 0;$p1$222$1 = $70; } else { break; } while(1) { $77 = (_stbi__get8($s)|0); HEAP8[$p1$222$1>>0] = $77; $78 = (($i$321$1) + 1)|0; $79 = ((($p1$222$1)) + 4|0); $exitcond42$1 = ($78|0)==($58|0); if ($exitcond42$1) { break; } else { $i$321$1 = $78;$p1$222$1 = $79; } } } } else { if ($57) { $i$119$1 = 0;$p1$020$1 = $70; } else { break L29; } while(1) { HEAP8[$p1$020$1>>0] = 0; $75 = (($i$119$1) + 1)|0; $76 = ((($p1$020$1)) + 4|0); $exitcond$1 = ($75|0)==($58|0); if ($exitcond$1) { break; } else { $i$119$1 = $75;$p1$020$1 = $76; } } } } while(0); $85 = ((($18)) + 2|0); $86 = ($4|0)>(2); do { if ($86) { if ($54) { if ($55) { $i$224$2 = 0;$p1$125$2 = $85; } else { break; } while(1) { $92 = (_stbi__get16be($s)|0); $93 = $92 >>> 8; $94 = $93&255; HEAP8[$p1$125$2>>0] = $94; $95 = (($i$224$2) + 1)|0; $96 = ((($p1$125$2)) + 4|0); $exitcond43$2 = ($95|0)==($58|0); if ($exitcond43$2) { break; } else { $i$224$2 = $95;$p1$125$2 = $96; } } } else { if ($56) { $i$321$2 = 0;$p1$222$2 = $85; } else { break; } while(1) { $89 = (_stbi__get8($s)|0); HEAP8[$p1$222$2>>0] = $89; $90 = (($i$321$2) + 1)|0; $91 = ((($p1$222$2)) + 4|0); $exitcond42$2 = ($90|0)==($58|0); if ($exitcond42$2) { break; } else { $i$321$2 = $90;$p1$222$2 = $91; } } } } else { if ($57) { $i$119$2 = 0;$p1$020$2 = $85; } else { break L29; } while(1) { HEAP8[$p1$020$2>>0] = 0; $87 = (($i$119$2) + 1)|0; $88 = ((($p1$020$2)) + 4|0); $exitcond$2 = ($87|0)==($58|0); if ($exitcond$2) { break; } else { $i$119$2 = $87;$p1$020$2 = $88; } } } } while(0); $97 = ((($18)) + 3|0); $98 = ($4|0)>(3); if (!($98)) { if ($57) { $i$119$3 = 0;$p1$020$3 = $97; } else { break; } while(1) { HEAP8[$p1$020$3>>0] = -1; $99 = (($i$119$3) + 1)|0; $100 = ((($p1$020$3)) + 4|0); $exitcond$3 = ($99|0)==($58|0); if ($exitcond$3) { break L29; } else { $i$119$3 = $99;$p1$020$3 = $100; } } } if ($54) { if ($55) { $i$224$3 = 0;$p1$125$3 = $97; } else { break; } while(1) { $104 = (_stbi__get16be($s)|0); $105 = $104 >>> 8; $106 = $105&255; HEAP8[$p1$125$3>>0] = $106; $107 = (($i$224$3) + 1)|0; $108 = ((($p1$125$3)) + 4|0); $exitcond43$3 = ($107|0)==($58|0); if ($exitcond43$3) { break; } else { $i$224$3 = $107;$p1$125$3 = $108; } } } else { if ($56) { $i$321$3 = 0;$p1$222$3 = $97; } else { break; } while(1) { $101 = (_stbi__get8($s)|0); HEAP8[$p1$222$3>>0] = $101; $102 = (($i$321$3) + 1)|0; $103 = ((($p1$222$3)) + 4|0); $exitcond42$3 = ($102|0)==($58|0); if ($exitcond42$3) { break; } else { $i$321$3 = $102;$p1$222$3 = $103; } } } } else { $22 = $4 << 1; $23 = Math_imul($22, $6)|0; _stbi__skip($s,$23); $24 = ($20|0)>(0); $25 = ($20|0)>(0); $26 = Math_imul($7, $6)|0; $channel$039 = 0; while(1) { $27 = (($18) + ($channel$039)|0); $28 = ($channel$039|0)<($4|0); if ($28) { if ($24) { $count$0$ph37 = 0;$p$1$ph38 = $27; while(1) { while(1) { $36 = (_stbi__get8($s)|0); $37 = ($36<<24>>24)==(-128); if (!($37)) { $$lcssa = $36; break; } } $38 = $$lcssa&255; $39 = ($$lcssa<<24>>24)>(-1); if ($39) { $40 = (($38) + 1)|0; $41 = $$lcssa&255; $33 = $41 << 2; $len$035 = $40;$p$236 = $p$1$ph38; while(1) { $42 = (_stbi__get8($s)|0); HEAP8[$p$236>>0] = $42; $43 = ((($p$236)) + 4|0); $44 = (($len$035) + -1)|0; $45 = ($44|0)==(0); if ($45) { break; } else { $len$035 = $44;$p$236 = $43; } } $scevgep48$sum = (($33) + 4)|0; $scevgep49 = (($p$1$ph38) + ($scevgep48$sum)|0); $$pn = $40;$p$1$ph$be = $scevgep49; } else { $46 = (257 - ($38))|0; $47 = (_stbi__get8($s)|0); $48 = ($46|0)==(0); if ($48) { $$pn = 0;$p$1$ph$be = $p$1$ph38; } else { $49 = $$lcssa&255; $35 = Math_imul($49, -4)|0; $len$132 = $46;$p$333 = $p$1$ph38; while(1) { HEAP8[$p$333>>0] = $47; $50 = ((($p$333)) + 4|0); $51 = (($len$132) + -1)|0; $52 = ($51|0)==(0); if ($52) { break; } else { $len$132 = $51;$p$333 = $50; } } $scevgep$sum = (($35) + 1028)|0; $scevgep47 = (($p$1$ph38) + ($scevgep$sum)|0); $$pn = $46;$p$1$ph$be = $scevgep47; } } $count$0$ph$be = (($$pn) + ($count$0$ph37))|0; $34 = ($count$0$ph$be|0)<($20|0); if ($34) { $count$0$ph37 = $count$0$ph$be;$p$1$ph38 = $p$1$ph$be; } else { break; } } } } else { if ($25) { $29 = ($channel$039|0)==(3); $30 = $29 << 31 >> 31; $i$028 = 0;$p$029 = $27; while(1) { HEAP8[$p$029>>0] = $30; $31 = (($i$028) + 1)|0; $32 = ((($p$029)) + 4|0); $exitcond46 = ($31|0)==($26|0); if ($exitcond46) { break; } else { $i$028 = $31;$p$029 = $32; } } } } $53 = (($channel$039) + 1)|0; $exitcond50 = ($53|0)==(4); if ($exitcond50) { break; } else { $channel$039 = $53; } } } } while(0); switch ($req_comp|0) { case 0: case 4: { $out$0 = $18; break; } default: { $72 = (_stbi__convert_format($18,4,$req_comp,$7,$6)|0); $73 = ($72|0)==(0|0); if ($73) { $$0 = 0; return ($$0|0); } else { $out$0 = $72; } } } $74 = ($comp|0)==(0|0); if (!($74)) { HEAP32[$comp>>2] = 4; } HEAP32[$y>>2] = $6; HEAP32[$x>>2] = $7; $$0 = $out$0; return ($$0|0); } function _stbi__pic_test($s) { $s = $s|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__pic_test_core($s)|0); _stbi__rewind($s); return ($0|0); } function _stbi__pic_load($s,$px,$py,$comp,$req_comp) { $s = $s|0; $px = $px|0; $py = $py|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $result$0 = 0; var label = 0, sp = 0; sp = STACKTOP; $i$02 = 0; while(1) { (_stbi__get8($s)|0); $0 = (($i$02) + 1)|0; $exitcond = ($0|0)==(92); if ($exitcond) { break; } else { $i$02 = $0; } } $1 = (_stbi__get16be($s)|0); $2 = (_stbi__get16be($s)|0); $3 = (_stbi__at_eof($s)|0); $4 = ($3|0)==(0); if (!($4)) { _stbi__err(19476); $$0 = 0; return ($$0|0); } $5 = (268435456 / ($1|0))&-1; $6 = ($5|0)<($2|0); if ($6) { _stbi__err(17846); $$0 = 0; return ($$0|0); } (_stbi__get32be($s)|0); (_stbi__get16be($s)|0); (_stbi__get16be($s)|0); $7 = $1 << 2; $8 = Math_imul($7, $2)|0; $9 = (_stbi__malloc($8)|0); _memset(($9|0),-1,($8|0))|0; $10 = (_stbi__pic_load_core($s,$1,$2,$comp,$9)|0); $11 = ($10|0)==(0|0); if ($11) { _free($9); $result$0 = 0; } else { $result$0 = $9; } HEAP32[$px>>2] = $1; HEAP32[$py>>2] = $2; $12 = ($req_comp|0)==(0); if ($12) { $13 = HEAP32[$comp>>2]|0; $$01 = $13; } else { $$01 = $req_comp; } $14 = (_stbi__convert_format($result$0,4,$$01,$1,$2)|0); $$0 = $14; return ($$0|0); } function _stbi__pnm_test($s) { $s = $s|0; var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = (_stbi__get8($s)|0); $2 = ($0<<24>>24)==(80); $$off = (($1) + -53)<<24>>24; $switch = ($$off&255)<(2); $or$cond = $2 & $switch; if ($or$cond) { $$0 = 1; return ($$0|0); } _stbi__rewind($s); $$0 = 0; return ($$0|0); } function _stbi__pnm_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($s)) + 4|0); $1 = ((($s)) + 8|0); $2 = (_stbi__pnm_info($s,$s,$0,$1)|0); $3 = ($2|0)==(0); if ($3) { $$0 = 0; return ($$0|0); } $4 = HEAP32[$s>>2]|0; HEAP32[$x>>2] = $4; $5 = HEAP32[$0>>2]|0; HEAP32[$y>>2] = $5; $6 = HEAP32[$1>>2]|0; HEAP32[$comp>>2] = $6; $7 = HEAP32[$1>>2]|0; $8 = HEAP32[$s>>2]|0; $9 = Math_imul($8, $7)|0; $10 = HEAP32[$0>>2]|0; $11 = Math_imul($9, $10)|0; $12 = (_stbi__malloc($11)|0); $13 = ($12|0)==(0|0); if ($13) { _stbi__err(18059); $$0 = 0; return ($$0|0); } $14 = HEAP32[$1>>2]|0; $15 = HEAP32[$s>>2]|0; $16 = Math_imul($15, $14)|0; $17 = HEAP32[$0>>2]|0; $18 = Math_imul($16, $17)|0; (_stbi__getn($s,$12,$18)|0); $19 = ($req_comp|0)==(0); if ($19) { $$0 = $12; return ($$0|0); } $20 = HEAP32[$1>>2]|0; $21 = ($20|0)==($req_comp|0); if ($21) { $$0 = $12; return ($$0|0); } else { $22 = HEAP32[$s>>2]|0; $23 = HEAP32[$0>>2]|0; $24 = (_stbi__convert_format($12,$20,$req_comp,$22,$23)|0); return ($24|0); } return (0)|0; } function _stbi__tga_test($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $res$0 = 0, label = 0, sp = 0; sp = STACKTOP; (_stbi__get8($s)|0); $0 = (_stbi__get8($s)|0); $1 = ($0&255)>(1); L1: do { if ($1) { $res$0 = 0; } else { $2 = (_stbi__get8($s)|0); $3 = ($0<<24>>24)==(1); if ($3) { switch ($2<<24>>24) { case 1: case 9: { break; } default: { $res$0 = 0; break L1; } } _stbi__skip($s,4); $4 = (_stbi__get8($s)|0); switch ($4<<24>>24) { case 8: case 15: case 16: case 24: case 32: { break; } default: { $res$0 = 0; break L1; } } _stbi__skip($s,4); } else { switch ($2<<24>>24) { case 2: case 3: case 10: case 11: { break; } default: { $res$0 = 0; break L1; } } _stbi__skip($s,9); } $5 = (_stbi__get16le($s)|0); $6 = ($5|0)<(1); if ($6) { $res$0 = 0; } else { $7 = (_stbi__get16le($s)|0); $8 = ($7|0)<(1); if ($8) { $res$0 = 0; } else { $9 = (_stbi__get8($s)|0); if ($3) { switch ($9<<24>>24) { case 8: case 16: { break; } default: { $res$0 = 0; break L1; } } } else { switch ($9<<24>>24) { case 8: case 15: case 16: case 24: case 32: { break; } default: { $res$0 = 0; break L1; } } } $res$0 = 1; } } } } while(0); _stbi__rewind($s); return ($res$0|0); } function _stbi__tga_load($s,$x,$y,$comp,$req_comp) { $s = $s|0; $x = $x|0; $y = $y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$ = 0, $$0 = 0, $$6 = 0, $$7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; var $97 = 0, $98 = 0, $99 = 0, $RLE_count$039 = 0, $RLE_count$18 = 0, $RLE_count$19 = 0, $RLE_repeating$040 = 0, $RLE_repeating$110 = 0, $RLE_repeating$111 = 0, $exitcond = 0, $exitcond50 = 0, $exitcond55 = 0, $exitcond56 = 0, $i$048 = 0, $i$145 = 0, $i$238 = 0, $i$323 = 0, $i$421 = 0, $index1$024 = 0, $index2$025 = 0; var $j$129 = 0, $j$327 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond5$not = 0, $or$cond57 = 0, $or$cond59 = 0, $pal_entry$046 = 0, $raw_data = 0, $read_next_pixel$041 = 0, $scevgep = 0, $scevgep54 = 0, $tga_comp$0 = 0, $tga_palette$0 = 0, $tga_pixel$022 = 0, $tga_rgb16 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $tga_rgb16 = sp; $raw_data = sp + 4|0; $0 = (_stbi__get8($s)|0); $1 = $0&255; $2 = (_stbi__get8($s)|0); $3 = (_stbi__get8($s)|0); $4 = $3&255; $5 = (_stbi__get16le($s)|0); $6 = (_stbi__get16le($s)|0); $7 = (_stbi__get8($s)|0); (_stbi__get16le($s)|0); (_stbi__get16le($s)|0); $8 = (_stbi__get16le($s)|0); $9 = (_stbi__get16le($s)|0); $10 = (_stbi__get8($s)|0); HEAP32[$tga_rgb16>>2] = 0; $11 = (_stbi__get8($s)|0); $12 = $11&255; $13 = ($3&255)>(7); $$6 = $13&1; $14 = $12 >>> 5; $15 = $14 & 1; $16 = ($2<<24>>24)!=(0); if ($16) { $17 = $7&255; $18 = (_stbi__tga_get_comp($17,0,$tga_rgb16)|0); $tga_comp$0 = $18; } else { $19 = (($4) + -8)|0; $$7 = $13 ? $19 : $4; $20 = $10&255; $21 = ($$7|0)==(3); $22 = $21&1; $23 = (_stbi__tga_get_comp($20,$22,$tga_rgb16)|0); $tga_comp$0 = $23; } $24 = ($tga_comp$0|0)==(0); if ($24) { _stbi__err(19363); $$0 = 0; STACKTOP = sp;return ($$0|0); } HEAP32[$x>>2] = $8; HEAP32[$y>>2] = $9; $25 = ($comp|0)==(0|0); if (!($25)) { HEAP32[$comp>>2] = $tga_comp$0; } $26 = Math_imul($9, $8)|0; $27 = Math_imul($26, $tga_comp$0)|0; $28 = (_stbi__malloc($27)|0); $29 = ($28|0)==(0|0); if ($29) { _stbi__err(18059); $$0 = 0; STACKTOP = sp;return ($$0|0); } _stbi__skip($s,$1); $30 = HEAP32[$tga_rgb16>>2]|0; $31 = $30 | $$6; $32 = ($31|0)!=(0); $33 = $16 | $32; if ($33) { do { if ($16) { _stbi__skip($s,$5); $44 = Math_imul($tga_comp$0, $6)|0; $45 = (_stbi__malloc($44)|0); $46 = ($45|0)==(0|0); if ($46) { _free($28); _stbi__err(18059); $$0 = 0; STACKTOP = sp;return ($$0|0); } $47 = HEAP32[$tga_rgb16>>2]|0; $48 = ($47|0)==(0); if ($48) { $53 = (_stbi__getn($s,$45,$44)|0); $54 = ($53|0)==(0); if (!($54)) { $tga_palette$0 = $45; break; } _free($28); _free($45); _stbi__err(19410); $$0 = 0; STACKTOP = sp;return ($$0|0); } $49 = ($tga_comp$0|0)==(3); if (!($49)) { ___assert_fail((19374|0),(18129|0),5060,(19395|0)); // unreachable; } $50 = ($6|0)>(0); if ($50) { $i$145 = 0;$pal_entry$046 = $45; while(1) { _stbi__tga_read_rgb16($s,$pal_entry$046); $51 = (($pal_entry$046) + ($tga_comp$0)|0); $52 = (($i$145) + 1)|0; $exitcond55 = ($52|0)==($6|0); if ($exitcond55) { $tga_palette$0 = $45; break; } else { $i$145 = $52;$pal_entry$046 = $51; } } } else { $tga_palette$0 = $45; } } else { $tga_palette$0 = 0; } } while(0); $55 = Math_imul($9, $8)|0; $56 = ($55|0)>(0); L35: do { if ($56) { $57 = ($10<<24>>24)==(8); $58 = ($tga_comp$0|0)>(0); $59 = ($tga_comp$0|0)==(3); $60 = ($tga_comp$0|0)>(0); $61 = ($tga_comp$0|0)>(0); $RLE_count$039 = 0;$RLE_repeating$040 = 0;$i$238 = 0;$read_next_pixel$041 = 1; L37: while(1) { $62 = Math_imul($tga_comp$0, $i$238)|0; $scevgep54 = (($28) + ($62)|0); do { if ($13) { $63 = ($RLE_count$039|0)==(0); if ($63) { $64 = (_stbi__get8($s)|0); $65 = $64&255; $66 = $65 & 127; $67 = (($66) + 1)|0; $68 = $65 >>> 7; $RLE_count$18 = $67;$RLE_repeating$110 = $68; label = 31; break; } $69 = ($RLE_repeating$040|0)==(0); if ($69) { $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = 0; label = 31; } else { $70 = ($read_next_pixel$041|0)==(0); if ($70) { $RLE_count$19 = $RLE_count$039;$RLE_repeating$111 = $RLE_repeating$040; } else { $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040; label = 31; } } } else { $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040; label = 31; } } while(0); do { if ((label|0) == 31) { label = 0; if ($16) { if ($57) { $71 = (_stbi__get8($s)|0); $72 = $71&255; $79 = $72; } else { $73 = (_stbi__get16le($s)|0); $79 = $73; } if (!($58)) { $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; break; } $80 = ($79|0)>=($6|0); $$ = $80 ? 0 : $79; $81 = Math_imul($tga_comp$0, $$)|0; $scevgep = (($tga_palette$0) + ($81)|0); _memcpy(($raw_data|0),($scevgep|0),($tga_comp$0|0))|0; $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; break; } else { $74 = HEAP32[$tga_rgb16>>2]|0; $75 = ($74|0)==(0); if ($75) { if ($60) { $j$129 = 0; } else { $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; break; } while(1) { $76 = (_stbi__get8($s)|0); $77 = (($raw_data) + ($j$129)|0); HEAP8[$77>>0] = $76; $78 = (($j$129) + 1)|0; $exitcond50 = ($78|0)==($tga_comp$0|0); if ($exitcond50) { $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; break; } else { $j$129 = $78; } } } else { if (!($59)) { break L37; } _stbi__tga_read_rgb16($s,$raw_data); $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; break; } } } } while(0); if ($61) { _memcpy(($scevgep54|0),($raw_data|0),($tga_comp$0|0))|0; } $82 = (($RLE_count$19) + -1)|0; $83 = (($i$238) + 1)|0; $84 = ($83|0)<($55|0); if ($84) { $RLE_count$039 = $82;$RLE_repeating$040 = $RLE_repeating$111;$i$238 = $83;$read_next_pixel$041 = 0; } else { break L35; } } ___assert_fail((19374|0),(18129|0),5109,(19395|0)); // unreachable; } } while(0); $85 = ($15|0)==(0); $86 = ($9|0)>(0); $or$cond57 = $85 & $86; if ($or$cond57) { $87 = Math_imul($tga_comp$0, $8)|0; $88 = (($9) + -1)|0; $89 = Math_imul($tga_comp$0, $8)|0; $90 = Math_imul($tga_comp$0, $8)|0; $91 = ($90|0)>(0); $j$327 = 0; while(1) { if ($91) { $92 = (($88) - ($j$327))|0; $93 = Math_imul($89, $92)|0; $94 = Math_imul($87, $j$327)|0; $i$323 = $90;$index1$024 = $94;$index2$025 = $93; while(1) { $95 = (($28) + ($index1$024)|0); $96 = HEAP8[$95>>0]|0; $97 = (($28) + ($index2$025)|0); $98 = HEAP8[$97>>0]|0; HEAP8[$95>>0] = $98; HEAP8[$97>>0] = $96; $99 = (($index1$024) + 1)|0; $100 = (($index2$025) + 1)|0; $101 = (($i$323) + -1)|0; $102 = ($i$323|0)>(1); if ($102) { $i$323 = $101;$index1$024 = $99;$index2$025 = $100; } else { break; } } } $103 = (($j$327) + 1)|0; $104 = $103 << 1; $105 = ($104|0)<($9|0); if ($105) { $j$327 = $103; } else { break; } } } $106 = ($tga_palette$0|0)==(0|0); if (!($106)) { _free($tga_palette$0); } } else { $34 = ($9|0)>(0); if ($34) { $35 = ($15|0)==(0); $36 = (($9) + -1)|0; $37 = Math_imul($tga_comp$0, $8)|0; $38 = Math_imul($tga_comp$0, $8)|0; $i$048 = 0; while(1) { $39 = (($36) - ($i$048))|0; $40 = $35 ? $39 : $i$048; $41 = Math_imul($37, $40)|0; $42 = (($28) + ($41)|0); (_stbi__getn($s,$42,$38)|0); $43 = (($i$048) + 1)|0; $exitcond56 = ($43|0)==($9|0); if ($exitcond56) { break; } else { $i$048 = $43; } } } } $107 = HEAP32[$tga_rgb16>>2]|0; $notlhs = ($tga_comp$0|0)>(2); $notrhs = ($107|0)==(0); $or$cond5$not = $notrhs & $notlhs; $108 = Math_imul($9, $8)|0; $109 = ($108|0)>(0); $or$cond59 = $or$cond5$not & $109; if ($or$cond59) { $110 = Math_imul($9, $8)|0; $i$421 = 0;$tga_pixel$022 = $28; while(1) { $111 = HEAP8[$tga_pixel$022>>0]|0; $112 = ((($tga_pixel$022)) + 2|0); $113 = HEAP8[$112>>0]|0; HEAP8[$tga_pixel$022>>0] = $113; HEAP8[$112>>0] = $111; $114 = (($tga_pixel$022) + ($tga_comp$0)|0); $115 = (($i$421) + 1)|0; $exitcond = ($115|0)==($110|0); if ($exitcond) { break; } else { $i$421 = $115;$tga_pixel$022 = $114; } } } $116 = ($req_comp|0)==(0); $117 = ($tga_comp$0|0)==($req_comp|0); $or$cond = $116 | $117; if ($or$cond) { $$0 = $28; STACKTOP = sp;return ($$0|0); } $118 = (_stbi__convert_format($28,$tga_comp$0,$req_comp,$8,$9)|0); $$0 = $118; STACKTOP = sp;return ($$0|0); } function _stbi__convert_format($data,$img_n,$req_comp,$x,$y) { $data = $data|0; $img_n = $img_n|0; $req_comp = $req_comp|0; $x = $x|0; $y = $y|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0; var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0; var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0; var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0; var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0; var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0; var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dest$081 = 0; var $dest$1031 = 0, $dest$1127 = 0, $dest$176 = 0, $dest$271 = 0, $dest$366 = 0, $dest$461 = 0, $dest$556 = 0, $dest$651 = 0, $dest$746 = 0, $dest$841 = 0, $dest$936 = 0, $i$0 = 0, $i$079 = 0, $i$082 = 0, $i$1 = 0, $i$10 = 0, $i$1029 = 0, $i$1032 = 0, $i$11 = 0, $i$1125 = 0; var $i$1128 = 0, $i$174 = 0, $i$177 = 0, $i$2 = 0, $i$269 = 0, $i$272 = 0, $i$3 = 0, $i$364 = 0, $i$367 = 0, $i$4 = 0, $i$459 = 0, $i$462 = 0, $i$5 = 0, $i$554 = 0, $i$557 = 0, $i$6 = 0, $i$649 = 0, $i$652 = 0, $i$7 = 0, $i$744 = 0; var $i$747 = 0, $i$8 = 0, $i$839 = 0, $i$842 = 0, $i$9 = 0, $i$934 = 0, $i$937 = 0, $j$084 = 0, $req_comp$off = 0, $src$080 = 0, $src$1030 = 0, $src$1126 = 0, $src$175 = 0, $src$270 = 0, $src$365 = 0, $src$460 = 0, $src$555 = 0, $src$650 = 0, $src$745 = 0, $src$840 = 0; var $src$935 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($req_comp|0)==($img_n|0); if ($0) { $$0 = $data; return ($$0|0); } $req_comp$off = (($req_comp) + -1)|0; $1 = ($req_comp$off>>>0)<(4); if (!($1)) { ___assert_fail((19422|0),(18129|0),1353,(19453|0)); // unreachable; } $2 = Math_imul($x, $req_comp)|0; $3 = Math_imul($2, $y)|0; $4 = (_stbi__malloc($3)|0); $5 = ($4|0)==(0|0); if ($5) { _free($data); _stbi__err(18059); $$0 = 0; return ($$0|0); } $6 = ($y|0)>(0); L11: do { if ($6) { $7 = $img_n << 3; $8 = (($7) + ($req_comp))|0; $i$079 = (($x) + -1)|0; $9 = ($i$079|0)>(-1); $i$174 = (($x) + -1)|0; $10 = ($i$174|0)>(-1); $i$269 = (($x) + -1)|0; $11 = ($i$269|0)>(-1); $i$364 = (($x) + -1)|0; $12 = ($i$364|0)>(-1); $i$459 = (($x) + -1)|0; $13 = ($i$459|0)>(-1); $i$554 = (($x) + -1)|0; $14 = ($i$554|0)>(-1); $i$649 = (($x) + -1)|0; $15 = ($i$649|0)>(-1); $i$744 = (($x) + -1)|0; $16 = ($i$744|0)>(-1); $i$839 = (($x) + -1)|0; $17 = ($i$839|0)>(-1); $i$934 = (($x) + -1)|0; $18 = ($i$934|0)>(-1); $i$1029 = (($x) + -1)|0; $19 = ($i$1029|0)>(-1); $i$1125 = (($x) + -1)|0; $20 = ($i$1125|0)>(-1); $j$084 = 0; L13: while(1) { $21 = Math_imul($j$084, $x)|0; $22 = Math_imul($21, $img_n)|0; $23 = (($data) + ($22)|0); $24 = Math_imul($21, $req_comp)|0; $25 = (($4) + ($24)|0); do { switch ($8|0) { case 10: { if ($9) { $dest$081 = $25;$i$082 = $i$079;$src$080 = $23; while(1) { $26 = HEAP8[$src$080>>0]|0; HEAP8[$dest$081>>0] = $26; $27 = ((($dest$081)) + 1|0); HEAP8[$27>>0] = -1; $28 = ((($src$080)) + 1|0); $29 = ((($dest$081)) + 2|0); $i$0 = (($i$082) + -1)|0; $30 = ($i$0|0)>(-1); if ($30) { $dest$081 = $29;$i$082 = $i$0;$src$080 = $28; } else { break; } } } break; } case 11: { if ($10) { $dest$176 = $25;$i$177 = $i$174;$src$175 = $23; while(1) { $31 = HEAP8[$src$175>>0]|0; $32 = ((($dest$176)) + 2|0); HEAP8[$32>>0] = $31; $33 = ((($dest$176)) + 1|0); HEAP8[$33>>0] = $31; HEAP8[$dest$176>>0] = $31; $34 = ((($src$175)) + 1|0); $35 = ((($dest$176)) + 3|0); $i$1 = (($i$177) + -1)|0; $36 = ($i$1|0)>(-1); if ($36) { $dest$176 = $35;$i$177 = $i$1;$src$175 = $34; } else { break; } } } break; } case 12: { if ($11) { $dest$271 = $25;$i$272 = $i$269;$src$270 = $23; while(1) { $37 = HEAP8[$src$270>>0]|0; $38 = ((($dest$271)) + 2|0); HEAP8[$38>>0] = $37; $39 = ((($dest$271)) + 1|0); HEAP8[$39>>0] = $37; HEAP8[$dest$271>>0] = $37; $40 = ((($dest$271)) + 3|0); HEAP8[$40>>0] = -1; $41 = ((($src$270)) + 1|0); $42 = ((($dest$271)) + 4|0); $i$2 = (($i$272) + -1)|0; $43 = ($i$2|0)>(-1); if ($43) { $dest$271 = $42;$i$272 = $i$2;$src$270 = $41; } else { break; } } } break; } case 17: { if ($12) { $dest$366 = $25;$i$367 = $i$364;$src$365 = $23; while(1) { $44 = HEAP8[$src$365>>0]|0; HEAP8[$dest$366>>0] = $44; $45 = ((($src$365)) + 2|0); $46 = ((($dest$366)) + 1|0); $i$3 = (($i$367) + -1)|0; $47 = ($i$3|0)>(-1); if ($47) { $dest$366 = $46;$i$367 = $i$3;$src$365 = $45; } else { break; } } } break; } case 19: { if ($13) { $dest$461 = $25;$i$462 = $i$459;$src$460 = $23; while(1) { $48 = HEAP8[$src$460>>0]|0; $49 = ((($dest$461)) + 2|0); HEAP8[$49>>0] = $48; $50 = ((($dest$461)) + 1|0); HEAP8[$50>>0] = $48; HEAP8[$dest$461>>0] = $48; $51 = ((($src$460)) + 2|0); $52 = ((($dest$461)) + 3|0); $i$4 = (($i$462) + -1)|0; $53 = ($i$4|0)>(-1); if ($53) { $dest$461 = $52;$i$462 = $i$4;$src$460 = $51; } else { break; } } } break; } case 20: { if ($14) { $dest$556 = $25;$i$557 = $i$554;$src$555 = $23; while(1) { $54 = HEAP8[$src$555>>0]|0; $55 = ((($dest$556)) + 2|0); HEAP8[$55>>0] = $54; $56 = ((($dest$556)) + 1|0); HEAP8[$56>>0] = $54; HEAP8[$dest$556>>0] = $54; $57 = ((($src$555)) + 1|0); $58 = HEAP8[$57>>0]|0; $59 = ((($dest$556)) + 3|0); HEAP8[$59>>0] = $58; $60 = ((($src$555)) + 2|0); $61 = ((($dest$556)) + 4|0); $i$5 = (($i$557) + -1)|0; $62 = ($i$5|0)>(-1); if ($62) { $dest$556 = $61;$i$557 = $i$5;$src$555 = $60; } else { break; } } } break; } case 28: { if ($15) { $dest$651 = $25;$i$652 = $i$649;$src$650 = $23; while(1) { $63 = HEAP8[$src$650>>0]|0; HEAP8[$dest$651>>0] = $63; $64 = ((($src$650)) + 1|0); $65 = HEAP8[$64>>0]|0; $66 = ((($dest$651)) + 1|0); HEAP8[$66>>0] = $65; $67 = ((($src$650)) + 2|0); $68 = HEAP8[$67>>0]|0; $69 = ((($dest$651)) + 2|0); HEAP8[$69>>0] = $68; $70 = ((($dest$651)) + 3|0); HEAP8[$70>>0] = -1; $71 = ((($src$650)) + 3|0); $72 = ((($dest$651)) + 4|0); $i$6 = (($i$652) + -1)|0; $73 = ($i$6|0)>(-1); if ($73) { $dest$651 = $72;$i$652 = $i$6;$src$650 = $71; } else { break; } } } break; } case 25: { if ($16) { $dest$746 = $25;$i$747 = $i$744;$src$745 = $23; while(1) { $74 = HEAP8[$src$745>>0]|0; $75 = $74&255; $76 = ((($src$745)) + 1|0); $77 = HEAP8[$76>>0]|0; $78 = $77&255; $79 = ((($src$745)) + 2|0); $80 = HEAP8[$79>>0]|0; $81 = $80&255; $82 = (_stbi__compute_y($75,$78,$81)|0); HEAP8[$dest$746>>0] = $82; $83 = ((($src$745)) + 3|0); $84 = ((($dest$746)) + 1|0); $i$7 = (($i$747) + -1)|0; $85 = ($i$7|0)>(-1); if ($85) { $dest$746 = $84;$i$747 = $i$7;$src$745 = $83; } else { break; } } } break; } case 26: { if ($17) { $dest$841 = $25;$i$842 = $i$839;$src$840 = $23; while(1) { $86 = HEAP8[$src$840>>0]|0; $87 = $86&255; $88 = ((($src$840)) + 1|0); $89 = HEAP8[$88>>0]|0; $90 = $89&255; $91 = ((($src$840)) + 2|0); $92 = HEAP8[$91>>0]|0; $93 = $92&255; $94 = (_stbi__compute_y($87,$90,$93)|0); HEAP8[$dest$841>>0] = $94; $95 = ((($dest$841)) + 1|0); HEAP8[$95>>0] = -1; $96 = ((($src$840)) + 3|0); $97 = ((($dest$841)) + 2|0); $i$8 = (($i$842) + -1)|0; $98 = ($i$8|0)>(-1); if ($98) { $dest$841 = $97;$i$842 = $i$8;$src$840 = $96; } else { break; } } } break; } case 33: { if ($18) { $dest$936 = $25;$i$937 = $i$934;$src$935 = $23; while(1) { $99 = HEAP8[$src$935>>0]|0; $100 = $99&255; $101 = ((($src$935)) + 1|0); $102 = HEAP8[$101>>0]|0; $103 = $102&255; $104 = ((($src$935)) + 2|0); $105 = HEAP8[$104>>0]|0; $106 = $105&255; $107 = (_stbi__compute_y($100,$103,$106)|0); HEAP8[$dest$936>>0] = $107; $108 = ((($src$935)) + 4|0); $109 = ((($dest$936)) + 1|0); $i$9 = (($i$937) + -1)|0; $110 = ($i$9|0)>(-1); if ($110) { $dest$936 = $109;$i$937 = $i$9;$src$935 = $108; } else { break; } } } break; } case 34: { if ($19) { $dest$1031 = $25;$i$1032 = $i$1029;$src$1030 = $23; while(1) { $111 = HEAP8[$src$1030>>0]|0; $112 = $111&255; $113 = ((($src$1030)) + 1|0); $114 = HEAP8[$113>>0]|0; $115 = $114&255; $116 = ((($src$1030)) + 2|0); $117 = HEAP8[$116>>0]|0; $118 = $117&255; $119 = (_stbi__compute_y($112,$115,$118)|0); HEAP8[$dest$1031>>0] = $119; $120 = ((($src$1030)) + 3|0); $121 = HEAP8[$120>>0]|0; $122 = ((($dest$1031)) + 1|0); HEAP8[$122>>0] = $121; $123 = ((($src$1030)) + 4|0); $124 = ((($dest$1031)) + 2|0); $i$10 = (($i$1032) + -1)|0; $125 = ($i$10|0)>(-1); if ($125) { $dest$1031 = $124;$i$1032 = $i$10;$src$1030 = $123; } else { break; } } } break; } case 35: { if ($20) { $dest$1127 = $25;$i$1128 = $i$1125;$src$1126 = $23; while(1) { $126 = HEAP8[$src$1126>>0]|0; HEAP8[$dest$1127>>0] = $126; $127 = ((($src$1126)) + 1|0); $128 = HEAP8[$127>>0]|0; $129 = ((($dest$1127)) + 1|0); HEAP8[$129>>0] = $128; $130 = ((($src$1126)) + 2|0); $131 = HEAP8[$130>>0]|0; $132 = ((($dest$1127)) + 2|0); HEAP8[$132>>0] = $131; $133 = ((($src$1126)) + 4|0); $134 = ((($dest$1127)) + 3|0); $i$11 = (($i$1128) + -1)|0; $135 = ($i$11|0)>(-1); if ($135) { $dest$1127 = $134;$i$1128 = $i$11;$src$1126 = $133; } else { break; } } } break; } default: { break L13; } } } while(0); $136 = (($j$084) + 1)|0; $137 = ($136|0)<($y|0); if ($137) { $j$084 = $136; } else { break L11; } } ___assert_fail((19474|0),(18129|0),1382,(19453|0)); // unreachable; } } while(0); _free($data); $$0 = $4; return ($$0|0); } function _stbi__compute_y($r,$g,$b) { $r = $r|0; $g = $g|0; $b = $b|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($r*77)|0; $1 = ($g*150)|0; $2 = (($1) + ($0))|0; $3 = ($b*29)|0; $4 = (($2) + ($3))|0; $5 = $4 >>> 8; $6 = $5&255; return ($6|0); } function _stbi__pic_load_core($s,$width,$height,$comp,$result) { $s = $s|0; $width = $width|0; $height = $height|0; $comp = $comp|0; $result = $result|0; var $$ = 0, $$0 = 0, $$lcssa108 = 0, $$lcssa111 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $act_comp$0 = 0; var $count3$0 = 0, $count3$1 = 0, $dest$038 = 0, $dest$135 = 0, $dest$2$lcssa = 0, $dest$230 = 0, $dest$327 = 0, $dest$425 = 0, $dest$523 = 0, $dest$6 = 0, $exitcond = 0, $exitcond57 = 0, $i$031 = 0, $i4$026 = 0, $i4$124 = 0, $left$036 = 0, $left2$028 = 0, $num_packets$0 = 0, $num_packets$0$lcssa105 = 0, $packet_idx$041 = 0; var $packets = 0, $scevgep = 0, $scevgep56 = 0, $value = 0, $value5 = 0, $x$039 = 0, $y$044 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $packets = sp + 8|0; $value = sp + 4|0; $value5 = sp; $act_comp$0 = 0;$num_packets$0 = 0; while(1) { $0 = ($num_packets$0|0)==(10); if ($0) { label = 3; break; } $1 = (($num_packets$0) + 1)|0; $2 = (_stbi__get8($s)|0); $3 = (_stbi__get8($s)|0); $4 = (($packets) + (($num_packets$0*3)|0)|0); HEAP8[$4>>0] = $3; $5 = (_stbi__get8($s)|0); $6 = (((($packets) + (($num_packets$0*3)|0)|0)) + 1|0); HEAP8[$6>>0] = $5; $7 = (_stbi__get8($s)|0); $8 = (((($packets) + (($num_packets$0*3)|0)|0)) + 2|0); HEAP8[$8>>0] = $7; $9 = $7&255; $10 = $9 | $act_comp$0; $11 = (_stbi__at_eof($s)|0); $12 = ($11|0)==(0); if (!($12)) { label = 5; break; } $13 = HEAP8[$4>>0]|0; $14 = ($13<<24>>24)==(8); if (!($14)) { label = 7; break; } $15 = ($2<<24>>24)==(0); if ($15) { $$lcssa108 = $1;$$lcssa111 = $10;$num_packets$0$lcssa105 = $num_packets$0; label = 9; break; } else { $act_comp$0 = $10;$num_packets$0 = $1; } } if ((label|0) == 3) { _stbi__err(19363); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 5) { _stbi__err(19476); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 7) { _stbi__err(19363); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 9) { $16 = $$lcssa111 >>> 4; $17 = $16 & 1; $18 = (($17) + 3)|0; HEAP32[$comp>>2] = $18; $19 = ($height|0)>(0); if (!($19)) { $$0 = $result; STACKTOP = sp;return ($$0|0); } $20 = ($num_packets$0$lcssa105|0)>(-1); $21 = $width << 2; $22 = ($width|0)>(0); $23 = ($width|0)>(0); $24 = ($width|0)>(0); $y$044 = 0; L13: while(1) { L15: do { if ($20) { $25 = Math_imul($21, $y$044)|0; $26 = (($result) + ($25)|0); $packet_idx$041 = 0; while(1) { $27 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 1|0); $28 = HEAP8[$27>>0]|0; $29 = $28&255; switch ($29|0) { case 0: { if ($22) { $33 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); $34 = HEAP8[$33>>0]|0; $35 = $34&255; $dest$038 = $26;$x$039 = 0; while(1) { $36 = (_stbi__readval($s,$35,$dest$038)|0); $37 = ($36|0)==(0|0); if ($37) { $$0 = 0; label = 52; break L13; } $38 = (($x$039) + 1)|0; $39 = ((($dest$038)) + 4|0); $40 = ($38|0)<($width|0); if ($40) { $dest$038 = $39;$x$039 = $38; } else { break; } } } break; } case 1: { if ($23) { $32 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); $dest$135 = $26;$left$036 = $width; while(1) { $41 = (_stbi__get8($s)|0); $42 = (_stbi__at_eof($s)|0); $43 = ($42|0)==(0); if (!($43)) { label = 24; break L13; } $44 = HEAP8[$32>>0]|0; $45 = $44&255; $46 = (_stbi__readval($s,$45,$value)|0); $47 = ($46|0)==(0|0); if ($47) { $$0 = 0; label = 52; break L13; } $48 = $41&255; $49 = ($48|0)>($left$036|0); $50 = $left$036&255; $$ = $49 ? $50 : $41; $51 = $$&255; $52 = ($$<<24>>24)==(0); if ($52) { $dest$2$lcssa = $dest$135; } else { $53 = $$&255; $54 = $53 << 2; $dest$230 = $dest$135;$i$031 = 0; while(1) { $55 = HEAP8[$32>>0]|0; $56 = $55&255; _stbi__copyval($56,$dest$230,$value); $57 = (($i$031) + 1)|0; $58 = ((($dest$230)) + 4|0); $exitcond57 = ($57|0)==($53|0); if ($exitcond57) { break; } else { $dest$230 = $58;$i$031 = $57; } } $scevgep56 = (($dest$135) + ($54)|0); $dest$2$lcssa = $scevgep56; } $59 = (($left$036) - ($51))|0; $60 = ($59|0)>(0); if ($60) { $dest$135 = $dest$2$lcssa;$left$036 = $59; } else { break; } } } break; } case 2: { if ($24) { $30 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); $31 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); $dest$327 = $26;$left2$028 = $width; while(1) { $61 = (_stbi__get8($s)|0); $62 = $61&255; $63 = (_stbi__at_eof($s)|0); $64 = ($63|0)==(0); if (!($64)) { label = 32; break L13; } $65 = ($61<<24>>24)<(0); if ($65) { $66 = ($61<<24>>24)==(-128); if ($66) { $67 = (_stbi__get16be($s)|0); $count3$0 = $67; } else { $68 = (($62) + -127)|0; $count3$0 = $68; } $69 = ($count3$0|0)>($left2$028|0); if ($69) { label = 38; break L13; } $70 = HEAP8[$30>>0]|0; $71 = $70&255; $72 = (_stbi__readval($s,$71,$value5)|0); $73 = ($72|0)==(0|0); if ($73) { $$0 = 0; label = 52; break L13; } $74 = ($count3$0|0)>(0); if ($74) { $75 = $count3$0 << 2; $dest$425 = $dest$327;$i4$026 = 0; while(1) { $76 = HEAP8[$30>>0]|0; $77 = $76&255; _stbi__copyval($77,$dest$425,$value5); $78 = (($i4$026) + 1)|0; $79 = ((($dest$425)) + 4|0); $exitcond = ($78|0)==($count3$0|0); if ($exitcond) { break; } else { $dest$425 = $79;$i4$026 = $78; } } $scevgep = (($dest$327) + ($75)|0); $count3$1 = $count3$0;$dest$6 = $scevgep; } else { $count3$1 = $count3$0;$dest$6 = $dest$327; } } else { $80 = (($62) + 1)|0; $81 = ($62|0)<($left2$028|0); if (!($81)) { label = 45; break L13; } $82 = HEAP8[$31>>0]|0; $83 = $82&255; $dest$523 = $dest$327;$i4$124 = 0; while(1) { $84 = (_stbi__readval($s,$83,$dest$523)|0); $85 = ($84|0)==(0|0); if ($85) { $$0 = 0; label = 52; break L13; } $86 = (($i4$124) + 1)|0; $87 = ((($dest$523)) + 4|0); $88 = ($86|0)<($80|0); if ($88) { $dest$523 = $87;$i4$124 = $86; } else { $count3$1 = $80;$dest$6 = $87; break; } } } $89 = (($left2$028) - ($count3$1))|0; $90 = ($89|0)>(0); if ($90) { $dest$327 = $dest$6;$left2$028 = $89; } else { break; } } } break; } default: { label = 20; break L13; } } $91 = (($packet_idx$041) + 1)|0; $92 = ($91|0)<($$lcssa108|0); if ($92) { $packet_idx$041 = $91; } else { break L15; } } } } while(0); $93 = (($y$044) + 1)|0; $94 = ($93|0)<($height|0); if ($94) { $y$044 = $93; } else { $$0 = $result; label = 52; break; } } if ((label|0) == 20) { _stbi__err(19363); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 24) { _stbi__err(19476); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 32) { _stbi__err(19476); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 38) { _stbi__err(19476); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 45) { _stbi__err(19476); $$0 = 0; STACKTOP = sp;return ($$0|0); } else if ((label|0) == 52) { STACKTOP = sp;return ($$0|0); } } return (0)|0; } function _stbi__readval($s,$channel,$dest) { $s = $s|0; $channel = $channel|0; $dest = $dest|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $channel & 128; $1 = ($0|0)==(0); if ($1) { label = 5; } else { $2 = (_stbi__at_eof($s)|0); $3 = ($2|0)==(0); if ($3) { $4 = (_stbi__get8($s)|0); HEAP8[$dest>>0] = $4; label = 5; } } do { if ((label|0) == 5) { $5 = $channel & 64; $6 = ($5|0)==(0); if (!($6)) { $7 = (_stbi__at_eof($s)|0); $8 = ($7|0)==(0); if (!($8)) { break; } $9 = (_stbi__get8($s)|0); $10 = ((($dest)) + 1|0); HEAP8[$10>>0] = $9; } $11 = $channel & 32; $12 = ($11|0)==(0); if (!($12)) { $13 = (_stbi__at_eof($s)|0); $14 = ($13|0)==(0); if (!($14)) { break; } $15 = (_stbi__get8($s)|0); $16 = ((($dest)) + 2|0); HEAP8[$16>>0] = $15; } $17 = $channel & 16; $18 = ($17|0)==(0); if ($18) { $$0 = $dest; return ($$0|0); } $19 = (_stbi__at_eof($s)|0); $20 = ($19|0)==(0); if ($20) { $21 = (_stbi__get8($s)|0); $22 = ((($dest)) + 3|0); HEAP8[$22>>0] = $21; $$0 = $dest; return ($$0|0); } } } while(0); _stbi__err(19476); $$0 = 0; return ($$0|0); } function _stbi__copyval($channel,$dest,$src) { $channel = $channel|0; $dest = $dest|0; $src = $src|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $channel & 128; $1 = ($0|0)==(0); if (!($1)) { $2 = HEAP8[$src>>0]|0; HEAP8[$dest>>0] = $2; } $3 = $channel & 64; $4 = ($3|0)==(0); if (!($4)) { $5 = ((($src)) + 1|0); $6 = HEAP8[$5>>0]|0; $7 = ((($dest)) + 1|0); HEAP8[$7>>0] = $6; } $8 = $channel & 32; $9 = ($8|0)==(0); if (!($9)) { $10 = ((($src)) + 2|0); $11 = HEAP8[$10>>0]|0; $12 = ((($dest)) + 2|0); HEAP8[$12>>0] = $11; } $13 = $channel & 16; $14 = ($13|0)==(0); if ($14) { return; } $15 = ((($src)) + 3|0); $16 = HEAP8[$15>>0]|0; $17 = ((($dest)) + 3|0); HEAP8[$17>>0] = $16; return; } function _stbi__pic_test_core($s) { $s = $s|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__pic_is4($s,17758)|0); $1 = ($0|0)==(0); if ($1) { $$0 = 0; return ($$0|0); } else { $i$01 = 0; } while(1) { (_stbi__get8($s)|0); $2 = (($i$01) + 1)|0; $exitcond = ($2|0)==(84); if ($exitcond) { break; } else { $i$01 = $2; } } $3 = (_stbi__pic_is4($s,19485)|0); $not$ = ($3|0)!=(0); $$ = $not$&1; $$0 = $$; return ($$0|0); } function _stbi__gif_load_next($s,$g,$comp) { $s = $s|0; $g = $g|0; $comp = $comp|0; var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0; var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0; var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0; var $99 = 0, $i$02 = 0, $prev_trans$0 = 0, $prev_trans$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($g)) + 8|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); do { if ($2) { $3 = (_stbi__gif_header($s,$g,$comp,0)|0); $4 = ($3|0)==(0); if ($4) { $$0 = 0; return ($$0|0); } else { $$pr = HEAP32[$0>>2]|0; $20 = $$pr; break; } } else { $20 = $1; } } while(0); $5 = HEAP32[$g>>2]|0; $6 = $5 << 2; $7 = ((($g)) + 4|0); $8 = HEAP32[$7>>2]|0; $9 = Math_imul($6, $8)|0; $10 = (_stbi__malloc($9)|0); HEAP32[$0>>2] = $10; $11 = ($10|0)==(0|0); if ($11) { _stbi__err(18059); $$0 = 0; return ($$0|0); } $12 = ((($g)) + 32|0); $13 = HEAP32[$12>>2]|0; $14 = $13 >>> 2; $15 = $14 & 7; switch ($15|0) { case 0: { $16 = HEAP32[$g>>2]|0; $17 = $16 << 2; $18 = HEAP32[$7>>2]|0; $19 = Math_imul($17, $18)|0; _stbi__fill_gif_background($g,0,0,$17,$19); break; } case 1: { $21 = ($20|0)==(0|0); if (!($21)) { $22 = HEAP32[$g>>2]|0; $23 = $22 << 2; $24 = HEAP32[$7>>2]|0; $25 = Math_imul($23, $24)|0; _memcpy(($10|0),($20|0),($25|0))|0; } $26 = ((($g)) + 12|0); HEAP32[$26>>2] = $20; break; } case 2: { $27 = ($20|0)==(0|0); if (!($27)) { $28 = HEAP32[$g>>2]|0; $29 = $28 << 2; $30 = HEAP32[$7>>2]|0; $31 = Math_imul($29, $30)|0; _memcpy(($10|0),($20|0),($31|0))|0; } $32 = ((($g)) + 18488|0); $33 = HEAP32[$32>>2]|0; $34 = ((($g)) + 18492|0); $35 = HEAP32[$34>>2]|0; $36 = ((($g)) + 18496|0); $37 = HEAP32[$36>>2]|0; $38 = ((($g)) + 18500|0); $39 = HEAP32[$38>>2]|0; _stbi__fill_gif_background($g,$33,$35,$37,$39); break; } case 3: { $40 = ((($g)) + 12|0); $41 = HEAP32[$40>>2]|0; $42 = ($41|0)==(0|0); if (!($42)) { $45 = ((($g)) + 18492|0); $46 = HEAP32[$45>>2]|0; $47 = ((($g)) + 18500|0); $48 = HEAP32[$47>>2]|0; $49 = ($46|0)<($48|0); if ($49) { $50 = ((($g)) + 18488|0); $51 = ((($g)) + 18496|0); $i$02 = $46; while(1) { $52 = HEAP32[$50>>2]|0; $53 = (($52) + ($i$02))|0; $54 = HEAP32[$0>>2]|0; $55 = (($54) + ($53)|0); $56 = HEAP32[$40>>2]|0; $57 = (($56) + ($53)|0); $58 = HEAP32[$51>>2]|0; $59 = (($58) - ($52))|0; _memcpy(($55|0),($57|0),($59|0))|0; $60 = HEAP32[$g>>2]|0; $61 = $60 << 2; $62 = (($61) + ($i$02))|0; $63 = HEAP32[$47>>2]|0; $64 = ($62|0)<($63|0); if ($64) { $i$02 = $62; } else { break; } } } } break; } default: { } } $43 = ((($g)) + 36|0); $44 = ((($g)) + 28|0); L27: while(1) { $65 = (_stbi__get8($s)|0); $66 = $65&255; switch ($66|0) { case 44: { label = 20; break L27; break; } case 59: { label = 45; break L27; break; } case 33: { break; } default: { label = 46; break L27; } } $143 = (_stbi__get8($s)|0); $144 = ($143<<24>>24)==(-7); do { if ($144) { $147 = (_stbi__get8($s)|0); $148 = ($147<<24>>24)==(4); if ($148) { $149 = (_stbi__get8($s)|0); $150 = $149&255; HEAP32[$12>>2] = $150; $151 = (_stbi__get16le($s)|0); HEAP32[$43>>2] = $151; $152 = (_stbi__get8($s)|0); $153 = $152&255; HEAP32[$44>>2] = $153; break; } else { $154 = $147&255; _stbi__skip($s,$154); continue L27; } } } while(0); $145 = (_stbi__get8($s)|0); $146 = ($145<<24>>24)==(0); if ($146) { continue; } else { $156 = $145; } while(1) { $155 = $156&255; _stbi__skip($s,$155); $157 = (_stbi__get8($s)|0); $158 = ($157<<24>>24)==(0); if ($158) { continue L27; } else { $156 = $157; } } } if ((label|0) == 20) { $67 = (_stbi__get16le($s)|0); $68 = (_stbi__get16le($s)|0); $69 = (_stbi__get16le($s)|0); $70 = (_stbi__get16le($s)|0); $71 = (($69) + ($67))|0; $72 = HEAP32[$g>>2]|0; $73 = ($71|0)>($72|0); if (!($73)) { $74 = (($70) + ($68))|0; $75 = HEAP32[$7>>2]|0; $76 = ($74|0)>($75|0); if (!($76)) { $77 = $72 << 2; $78 = ((($g)) + 18512|0); HEAP32[$78>>2] = $77; $79 = $67 << 2; $80 = ((($g)) + 18488|0); HEAP32[$80>>2] = $79; $81 = HEAP32[$78>>2]|0; $82 = Math_imul($81, $68)|0; $83 = ((($g)) + 18492|0); HEAP32[$83>>2] = $82; $84 = HEAP32[$80>>2]|0; $85 = $69 << 2; $86 = (($84) + ($85))|0; $87 = ((($g)) + 18496|0); HEAP32[$87>>2] = $86; $88 = HEAP32[$83>>2]|0; $89 = HEAP32[$78>>2]|0; $90 = Math_imul($89, $70)|0; $91 = (($90) + ($88))|0; $92 = ((($g)) + 18500|0); HEAP32[$92>>2] = $91; $93 = HEAP32[$80>>2]|0; $94 = ((($g)) + 18504|0); HEAP32[$94>>2] = $93; $95 = HEAP32[$83>>2]|0; $96 = ((($g)) + 18508|0); HEAP32[$96>>2] = $95; $97 = (_stbi__get8($s)|0); $98 = $97&255; $99 = ((($g)) + 18484|0); HEAP32[$99>>2] = $98; $100 = $98 & 64; $101 = ($100|0)==(0); $102 = HEAP32[$78>>2]|0; if ($101) { $106 = ((($g)) + 18480|0); HEAP32[$106>>2] = $102; $107 = ((($g)) + 18476|0); HEAP32[$107>>2] = 0; } else { $103 = $102 << 3; $104 = ((($g)) + 18480|0); HEAP32[$104>>2] = $103; $105 = ((($g)) + 18476|0); HEAP32[$105>>2] = 3; } $108 = HEAP32[$99>>2]|0; $109 = $108 & 128; $110 = ($109|0)==(0); if ($110) { $121 = ((($g)) + 16|0); $122 = HEAP32[$121>>2]|0; $123 = $122 & 128; $124 = ($123|0)==(0); if ($124) { _stbi__err(19594); $$0 = 0; return ($$0|0); } $125 = ((($g)) + 28|0); $126 = HEAP32[$125>>2]|0; $127 = ($126|0)>(-1); if ($127) { $128 = HEAP32[$12>>2]|0; $129 = $128 & 1; $130 = ($129|0)==(0); if ($130) { $prev_trans$0 = -1; } else { $131 = (((((($g)) + 40|0) + ($126<<2)|0)) + 3|0); $132 = HEAP8[$131>>0]|0; $133 = $132&255; HEAP8[$131>>0] = 0; $prev_trans$0 = $133; } } else { $prev_trans$0 = -1; } $134 = ((($g)) + 40|0); $135 = ((($g)) + 18472|0); HEAP32[$135>>2] = $134; $prev_trans$1 = $prev_trans$0; } else { $111 = ((($g)) + 1064|0); $112 = $108 & 7; $113 = 2 << $112; $114 = HEAP32[$12>>2]|0; $115 = $114 & 1; $116 = ($115|0)==(0); if ($116) { $119 = -1; } else { $117 = ((($g)) + 28|0); $118 = HEAP32[$117>>2]|0; $119 = $118; } _stbi__gif_parse_colortable($s,$111,$113,$119); $120 = ((($g)) + 18472|0); HEAP32[$120>>2] = $111; $prev_trans$1 = -1; } $136 = (_stbi__process_gif_raster($s,$g)|0); $137 = ($136|0)==(0|0); if ($137) { $$0 = 0; return ($$0|0); } $138 = ($prev_trans$1|0)==(-1); if ($138) { $$0 = $136; return ($$0|0); } $139 = $prev_trans$1&255; $140 = ((($g)) + 28|0); $141 = HEAP32[$140>>2]|0; $142 = (((((($g)) + 40|0) + ($141<<2)|0)) + 3|0); HEAP8[$142>>0] = $139; $$0 = $136; return ($$0|0); } } _stbi__err(19573); $$0 = 0; return ($$0|0); } else if ((label|0) == 45) { $$0 = $s; return ($$0|0); } else if ((label|0) == 46) { _stbi__err(19614); $$0 = 0; return ($$0|0); } return (0)|0; } function _stbi__fill_gif_background($g,$x0,$y0,$x1,$y1) { $g = $g|0; $x0 = $x0|0; $y0 = $y0|0; $x1 = $x1|0; $y1 = $y1|0; var $$sum = 0, $$sum1 = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $x$03 = 0, $y$04 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($g)) + 20|0); $1 = HEAP32[$0>>2]|0; $2 = (((($g)) + 40|0) + ($1<<2)|0); $3 = ($y0|0)<($y1|0); if (!($3)) { return; } $4 = ($x0|0)<($x1|0); $5 = ((($g)) + 8|0); $6 = (((((($g)) + 40|0) + ($1<<2)|0)) + 2|0); $7 = (((((($g)) + 40|0) + ($1<<2)|0)) + 1|0); $y$04 = $y0; while(1) { if ($4) { $x$03 = $x0; while(1) { $8 = (($x$03) + ($y$04))|0; $9 = HEAP32[$5>>2]|0; $10 = (($9) + ($8)|0); $11 = HEAP8[$6>>0]|0; HEAP8[$10>>0] = $11; $12 = HEAP8[$7>>0]|0; $$sum = (($8) + 1)|0; $13 = (($9) + ($$sum)|0); HEAP8[$13>>0] = $12; $14 = HEAP8[$2>>0]|0; $$sum1 = (($8) + 2)|0; $15 = (($9) + ($$sum1)|0); HEAP8[$15>>0] = $14; $$sum2 = (($8) + 3)|0; $16 = (($9) + ($$sum2)|0); HEAP8[$16>>0] = 0; $17 = (($x$03) + 4)|0; $18 = ($17|0)<($x1|0); if ($18) { $x$03 = $17; } else { break; } } } $19 = HEAP32[$g>>2]|0; $20 = $19 << 2; $21 = (($20) + ($y$04))|0; $22 = ($21|0)<($y1|0); if ($22) { $y$04 = $21; } else { break; } } return; } function _stbi__process_gif_raster($s,$g) { $s = $s|0; $g = $g|0; var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $avail$0$ph = 0; var $avail$0$ph7 = 0, $avail$1 = 0, $bits$0$lcssa = 0, $bits$0$ph = 0, $bits$0$ph3 = 0, $bits$0$ph9 = 0, $bits$040 = 0, $codemask$0$ph = 0, $codemask$0$ph$in = 0, $codesize$0$ph = 0, $codesize$0$ph$in = 0, $first$0$ph = 0, $init_code$047 = 0, $len$0$lcssa = 0, $len$0$lcssa$lcssa169 = 0, $len$0$ph = 0, $len$0$ph11 = 0, $len$0$ph5 = 0, $len$042 = 0, $len$1 = 0; var $oldcode$0$ph = 0, $oldcode$0$ph8 = 0, $or$cond = 0, $valid_bits$0$lcssa = 0, $valid_bits$0$ph = 0, $valid_bits$0$ph10 = 0, $valid_bits$0$ph4 = 0, $valid_bits$041 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = $0&255; $2 = ($0&255)>(12); if ($2) { $$0 = 0; return ($$0|0); } $3 = 1 << $1; $init_code$047 = 0; while(1) { $4 = (((($g)) + 2088|0) + ($init_code$047<<2)|0); HEAP16[$4>>1] = -1; $5 = $init_code$047&255; $6 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 2|0); HEAP8[$6>>0] = $5; $7 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 3|0); HEAP8[$7>>0] = $5; $8 = (($init_code$047) + 1)|0; $9 = ($8|0)<($3|0); if ($9) { $init_code$047 = $8; } else { break; } } $10 = (($3) + 2)|0; $11 = (($3) + 1)|0; $bits$0$ph = 0;$first$0$ph = 0;$len$0$ph = 0;$valid_bits$0$ph = 0; L7: while(1) { $avail$0$ph = $10;$bits$0$ph3 = $bits$0$ph;$codesize$0$ph$in = $1;$len$0$ph5 = $len$0$ph;$oldcode$0$ph = -1;$valid_bits$0$ph4 = $valid_bits$0$ph; L9: while(1) { $codesize$0$ph = (($codesize$0$ph$in) + 1)|0; $codemask$0$ph$in = 1 << $codesize$0$ph; $codemask$0$ph = (($codemask$0$ph$in) + -1)|0; $avail$0$ph7 = $avail$0$ph;$bits$0$ph9 = $bits$0$ph3;$len$0$ph11 = $len$0$ph5;$oldcode$0$ph8 = $oldcode$0$ph;$valid_bits$0$ph10 = $valid_bits$0$ph4; while(1) { $12 = ($valid_bits$0$ph10|0)<($codesize$0$ph|0); if ($12) { $bits$040 = $bits$0$ph9;$len$042 = $len$0$ph11;$valid_bits$041 = $valid_bits$0$ph10; while(1) { $13 = ($len$042|0)==(0); if ($13) { $14 = (_stbi__get8($s)|0); $15 = $14&255; $16 = ($14<<24>>24)==(0); if ($16) { label = 10; break L7; } else { $len$1 = $15; } } else { $len$1 = $len$042; } $19 = (($len$1) + -1)|0; $20 = (_stbi__get8($s)|0); $21 = $20&255; $22 = $21 << $valid_bits$041; $23 = $22 | $bits$040; $24 = (($valid_bits$041) + 8)|0; $25 = ($24|0)<($codesize$0$ph|0); if ($25) { $bits$040 = $23;$len$042 = $19;$valid_bits$041 = $24; } else { $bits$0$lcssa = $23;$len$0$lcssa = $19;$valid_bits$0$lcssa = $24; break; } } } else { $bits$0$lcssa = $bits$0$ph9;$len$0$lcssa = $len$0$ph11;$valid_bits$0$lcssa = $valid_bits$0$ph10; } $26 = $bits$0$lcssa & $codemask$0$ph; $27 = $bits$0$lcssa >> $codesize$0$ph; $28 = (($valid_bits$0$lcssa) - ($codesize$0$ph))|0; $29 = ($26|0)==($3|0); if ($29) { $bits$0$ph = $27;$first$0$ph = 1;$len$0$ph = $len$0$lcssa;$valid_bits$0$ph = $28; continue L7; } $30 = ($26|0)==($11|0); if ($30) { $len$0$lcssa$lcssa169 = $len$0$lcssa; label = 14; break L7; } $39 = ($26|0)>($avail$0$ph7|0); if ($39) { label = 29; break L7; } if (!($first$0$ph)) { label = 19; break L7; } $40 = ($oldcode$0$ph8|0)>(-1); if ($40) { $41 = (($avail$0$ph7) + 1)|0; $42 = ($avail$0$ph7|0)>(4095); if ($42) { label = 22; break L7; } $43 = $oldcode$0$ph8&65535; $44 = (((($g)) + 2088|0) + ($avail$0$ph7<<2)|0); HEAP16[$44>>1] = $43; $45 = (((((($g)) + 2088|0) + ($oldcode$0$ph8<<2)|0)) + 2|0); $46 = HEAP8[$45>>0]|0; $47 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 2|0); HEAP8[$47>>0] = $46; $48 = ($26|0)==($41|0); if ($48) { $$sink = $46; } else { $49 = (((((($g)) + 2088|0) + ($26<<2)|0)) + 2|0); $50 = HEAP8[$49>>0]|0; $$sink = $50; } $51 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 3|0); HEAP8[$51>>0] = $$sink; $avail$1 = $41; } else { $52 = ($26|0)==($avail$0$ph7|0); if ($52) { label = 27; break L7; } else { $avail$1 = $avail$0$ph7; } } $53 = $26&65535; _stbi__out_gif_code($g,$53); $54 = $avail$1 & $codemask$0$ph; $55 = ($54|0)==(0); $56 = ($avail$1|0)<(4096); $or$cond = $56 & $55; if ($or$cond) { $avail$0$ph = $avail$1;$bits$0$ph3 = $27;$codesize$0$ph$in = $codesize$0$ph;$len$0$ph5 = $len$0$lcssa;$oldcode$0$ph = $26;$valid_bits$0$ph4 = $28; continue L9; } else { $avail$0$ph7 = $avail$1;$bits$0$ph9 = $27;$len$0$ph11 = $len$0$lcssa;$oldcode$0$ph8 = $26;$valid_bits$0$ph10 = $28; } } } } if ((label|0) == 10) { $17 = ((($g)) + 8|0); $18 = HEAP32[$17>>2]|0; $$0 = $18; return ($$0|0); } else if ((label|0) == 14) { _stbi__skip($s,$len$0$lcssa$lcssa169); $31 = (_stbi__get8($s)|0); $32 = ($31<<24>>24)==(0); if (!($32)) { $34 = $31; while(1) { $33 = $34&255; _stbi__skip($s,$33); $35 = (_stbi__get8($s)|0); $36 = ($35<<24>>24)==(0); if ($36) { break; } else { $34 = $35; } } } $37 = ((($g)) + 8|0); $38 = HEAP32[$37>>2]|0; $$0 = $38; return ($$0|0); } else if ((label|0) == 19) { _stbi__err(19627); $$0 = 0; return ($$0|0); } else if ((label|0) == 22) { _stbi__err(19641); $$0 = 0; return ($$0|0); } else if ((label|0) == 27) { _stbi__err(19656); $$0 = 0; return ($$0|0); } else if ((label|0) == 29) { _stbi__err(19656); $$0 = 0; return ($$0|0); } return (0)|0; } function _stbi__out_gif_code($g,$code) { $g = $g|0; $code = $code|0; var $$pr = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0; var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $code&65535; $1 = (((($g)) + 2088|0) + ($0<<2)|0); $2 = HEAP16[$1>>1]|0; $3 = ($2<<16>>16)>(-1); if ($3) { _stbi__out_gif_code($g,$2); } $4 = ((($g)) + 18508|0); $5 = HEAP32[$4>>2]|0; $6 = ((($g)) + 18500|0); $7 = HEAP32[$6>>2]|0; $8 = ($5|0)<($7|0); if (!($8)) { return; } $9 = ((($g)) + 18504|0); $10 = HEAP32[$9>>2]|0; $11 = (($10) + ($5))|0; $12 = ((($g)) + 8|0); $13 = HEAP32[$12>>2]|0; $14 = (((((($g)) + 2088|0) + ($0<<2)|0)) + 3|0); $15 = HEAP8[$14>>0]|0; $16 = $15&255; $17 = $16 << 2; $18 = ((($g)) + 18472|0); $19 = HEAP32[$18>>2]|0; $$sum1 = $17 | 3; $20 = (($19) + ($$sum1)|0); $21 = HEAP8[$20>>0]|0; $22 = ($21<<24>>24)<(0); if ($22) { $23 = (($19) + ($17)|0); $24 = (($13) + ($11)|0); $$sum2 = $17 | 2; $25 = (($19) + ($$sum2)|0); $26 = HEAP8[$25>>0]|0; HEAP8[$24>>0] = $26; $$sum3 = $17 | 1; $27 = (($19) + ($$sum3)|0); $28 = HEAP8[$27>>0]|0; $$sum = (($11) + 1)|0; $29 = (($13) + ($$sum)|0); HEAP8[$29>>0] = $28; $30 = HEAP8[$23>>0]|0; $$sum4 = (($11) + 2)|0; $31 = (($13) + ($$sum4)|0); HEAP8[$31>>0] = $30; $32 = HEAP8[$20>>0]|0; $$sum5 = (($11) + 3)|0; $33 = (($13) + ($$sum5)|0); HEAP8[$33>>0] = $32; } $34 = HEAP32[$9>>2]|0; $35 = (($34) + 4)|0; HEAP32[$9>>2] = $35; $36 = ((($g)) + 18496|0); $37 = HEAP32[$36>>2]|0; $38 = ($35|0)<($37|0); if ($38) { return; } $39 = ((($g)) + 18488|0); $40 = HEAP32[$39>>2]|0; HEAP32[$9>>2] = $40; $41 = ((($g)) + 18480|0); $42 = HEAP32[$41>>2]|0; $43 = HEAP32[$4>>2]|0; $44 = (($43) + ($42))|0; HEAP32[$4>>2] = $44; $45 = ((($g)) + 18476|0); $46 = HEAP32[$6>>2]|0; $47 = ($44|0)<($46|0); if ($47) { return; } $48 = ((($g)) + 18512|0); $49 = ((($g)) + 18492|0); $$pr = HEAP32[$45>>2]|0; $50 = $$pr; while(1) { $51 = ($50|0)>(0); if (!($51)) { label = 11; break; } $52 = HEAP32[$48>>2]|0; $53 = $52 << $50; HEAP32[$41>>2] = $53; $54 = HEAP32[$49>>2]|0; $55 = $53 >> 1; $56 = (($55) + ($54))|0; HEAP32[$4>>2] = $56; $57 = HEAP32[$45>>2]|0; $58 = (($57) + -1)|0; HEAP32[$45>>2] = $58; $59 = HEAP32[$4>>2]|0; $60 = HEAP32[$6>>2]|0; $61 = ($59|0)<($60|0); if ($61) { label = 11; break; } else { $50 = $58; } } if ((label|0) == 11) { return; } } function _stbi__gif_test_raw($s) { $s = $s|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = ($0<<24>>24)==(71); L1: do { if ($1) { $2 = (_stbi__get8($s)|0); $3 = ($2<<24>>24)==(73); if ($3) { $4 = (_stbi__get8($s)|0); $5 = ($4<<24>>24)==(70); if ($5) { $6 = (_stbi__get8($s)|0); $7 = ($6<<24>>24)==(56); if ($7) { $8 = (_stbi__get8($s)|0); switch ($8<<24>>24) { case 55: case 57: { break; } default: { $$0 = 0; break L1; } } $9 = (_stbi__get8($s)|0); $10 = ($9<<24>>24)==(97); $$ = $10&1; $$0 = $$; } else { $$0 = 0; } } else { $$0 = 0; } } else { $$0 = 0; } } else { $$0 = 0; } } while(0); return ($$0|0); } function _stbi__high_bit($z) { $z = $z|0; var $$ = 0, $$01 = 0, $$1 = 0, $$2 = 0, $$3 = 0, $$n$3 = 0, $$z = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $n$1 = 0, $n$2 = 0, $n$3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($z|0)==(0); if ($0) { $$01 = -1; return ($$01|0); } $1 = ($z>>>0)>(65535); $2 = $z >>> 16; $$z = $1 ? $2 : $z; $$ = $1 ? 16 : 0; $3 = ($$z>>>0)>(255); $4 = $$ | 8; $5 = $$z >>> 8; $$1 = $3 ? $5 : $$z; $n$1 = $3 ? $4 : $$; $6 = ($$1>>>0)>(15); $7 = $n$1 | 4; $8 = $$1 >>> 4; $$2 = $6 ? $8 : $$1; $n$2 = $6 ? $7 : $n$1; $9 = ($$2>>>0)>(3); $10 = $n$2 | 2; $11 = $$2 >>> 2; $$3 = $9 ? $11 : $$2; $n$3 = $9 ? $10 : $n$2; $12 = ($$3>>>0)>(1); $13 = $12&1; $$n$3 = (($13) + ($n$3))|0; $$01 = $$n$3; return ($$01|0); } function _stbi__bitcount($a) { $a = $a|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $a & 1431655765; $1 = $a >>> 1; $2 = $1 & 1431655765; $3 = (($2) + ($0))|0; $4 = $3 & 858993459; $5 = $3 >>> 2; $6 = $5 & 858993459; $7 = (($6) + ($4))|0; $8 = $7 >>> 4; $9 = (($8) + ($7))|0; $10 = $9 & 252645135; $11 = $10 >>> 8; $12 = (($11) + ($10))|0; $13 = $12 >>> 16; $14 = (($13) + ($12))|0; $15 = $14 & 255; return ($15|0); } function _stbi__shiftsigned($v,$shift,$bits) { $v = $v|0; $shift = $shift|0; $bits = $bits|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $result$0$lcssa = 0, $result$01 = 0, $z$02 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($shift|0)<(0); $1 = (0 - ($shift))|0; $2 = $v << $1; $3 = $v >> $shift; $$0 = $0 ? $2 : $3; $4 = ($bits|0)<(8); if ($4) { $result$01 = $$0;$z$02 = $bits; } else { $result$0$lcssa = $$0; return ($result$0$lcssa|0); } while(1) { $5 = $$0 >> $z$02; $6 = (($5) + ($result$01))|0; $7 = (($z$02) + ($bits))|0; $8 = ($7|0)<(8); if ($8) { $result$01 = $6;$z$02 = $7; } else { $result$0$lcssa = $6; break; } } return ($result$0$lcssa|0); } function _stbi__bmp_test_raw($s) { $s = $s|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbi__get8($s)|0); $1 = ($0<<24>>24)==(66); if (!($1)) { $$0 = 0; return ($$0|0); } $2 = (_stbi__get8($s)|0); $3 = ($2<<24>>24)==(77); if (!($3)) { $$0 = 0; return ($$0|0); } (_stbi__get32le($s)|0); (_stbi__get16le($s)|0); (_stbi__get16le($s)|0); (_stbi__get32le($s)|0); $4 = (_stbi__get32le($s)|0); switch ($4|0) { case 124: case 12: case 40: case 56: case 108: { $$0 = 1; return ($$0|0); break; } default: { } } $$0 = 0; return ($$0|0); } function _stbi__do_png($p,$x,$y,$n,$req_comp) { $p = $p|0; $x = $x|0; $y = $y|0; $n = $n|0; $req_comp = $req_comp|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $result$0 = 0, $result$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($req_comp>>>0)>(4); if ($0) { _stbi__err(19705); $$0 = 0; return ($$0|0); } $1 = (_stbi__parse_png_file($p,0,$req_comp)|0); $2 = ($1|0)==(0); if ($2) { $result$1 = 0; } else { $3 = ((($p)) + 12|0); $4 = HEAP32[$3>>2]|0; HEAP32[$3>>2] = 0; $5 = ($req_comp|0)==(0); if ($5) { $result$0 = $4; } else { $6 = HEAP32[$p>>2]|0; $7 = ((($6)) + 12|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)==($req_comp|0); if ($9) { $result$0 = $4; } else { $10 = HEAP32[$6>>2]|0; $11 = ((($6)) + 4|0); $12 = HEAP32[$11>>2]|0; $13 = (_stbi__convert_format($4,$8,$req_comp,$10,$12)|0); $14 = HEAP32[$p>>2]|0; $15 = ((($14)) + 12|0); HEAP32[$15>>2] = $req_comp; $16 = ($13|0)==(0|0); if ($16) { $$0 = 0; return ($$0|0); } else { $result$0 = $13; } } } $17 = HEAP32[$p>>2]|0; $18 = HEAP32[$17>>2]|0; HEAP32[$x>>2] = $18; $19 = HEAP32[$p>>2]|0; $20 = ((($19)) + 4|0); $21 = HEAP32[$20>>2]|0; HEAP32[$y>>2] = $21; $22 = ($n|0)==(0|0); if ($22) { $result$1 = $result$0; } else { $23 = HEAP32[$p>>2]|0; $24 = ((($23)) + 12|0); $25 = HEAP32[$24>>2]|0; HEAP32[$n>>2] = $25; $result$1 = $result$0; } } $26 = ((($p)) + 12|0); $27 = HEAP32[$26>>2]|0; _free($27); HEAP32[$26>>2] = 0; $28 = ((($p)) + 8|0); $29 = HEAP32[$28>>2]|0; _free($29); HEAP32[$28>>2] = 0; $30 = ((($p)) + 4|0); $31 = HEAP32[$30>>2]|0; _free($31); HEAP32[$30>>2] = 0; $$0 = $result$1; return ($$0|0); } function _stbi__setup_jpeg($j) { $j = $j|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18176|0); HEAP32[$0>>2] = 2; $1 = ((($j)) + 18180|0); HEAP32[$1>>2] = 1; $2 = ((($j)) + 18184|0); HEAP32[$2>>2] = 1; return; } function _load_jpeg_image($z,$out_x,$out_y,$comp,$req_comp) { $z = $z|0; $out_x = $out_x|0; $out_y = $out_y|0; $comp = $comp|0; $req_comp = $req_comp|0; var $$ = 0, $$0 = 0, $$1 = 0, $$in = 0, $$in4 = 0, $$pr = 0, $$pr5 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0; var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0; var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0; var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0; var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0; var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0; var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0; var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0; var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $coutput = 0, $exitcond = 0, $i$018 = 0, $i$115 = 0, $i$213 = 0, $j$020 = 0, $k$023 = 0, $k$111 = 0, $or$cond3 = 0, $out$017 = 0, $out$112 = 0; var $res_comp = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; $coutput = sp + 128|0; $res_comp = sp; $0 = HEAP32[$z>>2]|0; $1 = ((($0)) + 8|0); HEAP32[$1>>2] = 0; $2 = ($req_comp>>>0)>(4); if ($2) { _stbi__err(19705); $$1 = 0; STACKTOP = sp;return ($$1|0); } $3 = (_stbi__decode_jpeg_image($z)|0); $4 = ($3|0)==(0); if ($4) { _stbi__cleanup_jpeg($z); $$1 = 0; STACKTOP = sp;return ($$1|0); } $5 = ($req_comp|0)==(0); if ($5) { $6 = HEAP32[$z>>2]|0; $7 = ((($6)) + 8|0); $8 = HEAP32[$7>>2]|0; $13 = $8; } else { $13 = $req_comp; } $9 = HEAP32[$z>>2]|0; $10 = ((($9)) + 8|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)==(3); $14 = ($13|0)<(3); $or$cond3 = $14 & $12; $$ = $or$cond3 ? 1 : $11; $15 = ($$|0)>(0); L12: do { if ($15) { $16 = ((($z)) + 17796|0); $17 = ((($z)) + 17800|0); $18 = ((($z)) + 18184|0); $k$023 = 0; while(1) { $19 = (($res_comp) + ($k$023<<5)|0); $20 = HEAP32[$z>>2]|0; $21 = HEAP32[$20>>2]|0; $22 = (($21) + 3)|0; $23 = (_stbi__malloc($22)|0); $24 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 56|0); HEAP32[$24>>2] = $23; $25 = ($23|0)==(0|0); if ($25) { break; } $26 = HEAP32[$16>>2]|0; $27 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 4|0); $28 = HEAP32[$27>>2]|0; $29 = (($26|0) / ($28|0))&-1; $30 = (((($res_comp) + ($k$023<<5)|0)) + 12|0); HEAP32[$30>>2] = $29; $31 = HEAP32[$17>>2]|0; $32 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 8|0); $33 = HEAP32[$32>>2]|0; $34 = (($31|0) / ($33|0))&-1; $35 = (((($res_comp) + ($k$023<<5)|0)) + 16|0); HEAP32[$35>>2] = $34; $36 = $34 >> 1; $37 = (((($res_comp) + ($k$023<<5)|0)) + 24|0); HEAP32[$37>>2] = $36; $38 = HEAP32[$z>>2]|0; $39 = HEAP32[$38>>2]|0; $40 = HEAP32[$30>>2]|0; $41 = (($39) + -1)|0; $42 = (($41) + ($40))|0; $43 = (($42>>>0) / ($40>>>0))&-1; $44 = (((($res_comp) + ($k$023<<5)|0)) + 20|0); HEAP32[$44>>2] = $43; $45 = (((($res_comp) + ($k$023<<5)|0)) + 28|0); HEAP32[$45>>2] = 0; $46 = (((((($z)) + 17820|0) + (($k$023*72)|0)|0)) + 44|0); $47 = HEAP32[$46>>2]|0; $48 = (((($res_comp) + ($k$023<<5)|0)) + 8|0); HEAP32[$48>>2] = $47; $49 = (((($res_comp) + ($k$023<<5)|0)) + 4|0); HEAP32[$49>>2] = $47; $50 = HEAP32[$30>>2]|0; $51 = ($50|0)==(1); do { if ($51) { $52 = HEAP32[$35>>2]|0; $53 = ($52|0)==(1); if ($53) { HEAP32[$19>>2] = 2; break; } $$pr = HEAP32[$30>>2]|0; $54 = ($$pr|0)==(1); if ($54) { $55 = HEAP32[$35>>2]|0; $56 = ($55|0)==(2); if ($56) { HEAP32[$19>>2] = 3; } else { label = 17; } } else { $57 = $$pr; label = 18; } } else { label = 17; } } while(0); if ((label|0) == 17) { label = 0; $$pr5 = HEAP32[$30>>2]|0; $57 = $$pr5; label = 18; } do { if ((label|0) == 18) { label = 0; $58 = ($57|0)==(2); if ($58) { $59 = HEAP32[$35>>2]|0; $60 = ($59|0)==(1); if ($60) { HEAP32[$19>>2] = 4; break; } } $61 = HEAP32[$30>>2]|0; $62 = ($61|0)==(2); if ($62) { $63 = HEAP32[$35>>2]|0; $64 = ($63|0)==(2); if ($64) { $65 = HEAP32[$18>>2]|0; HEAP32[$19>>2] = $65; break; } } HEAP32[$19>>2] = 5; } } while(0); $66 = (($k$023) + 1)|0; $67 = ($66|0)<($$|0); if ($67) { $k$023 = $66; } else { label = 26; break L12; } } _stbi__cleanup_jpeg($z); _stbi__err(18059); $$0 = 0; } else { label = 26; } } while(0); do { if ((label|0) == 26) { $68 = HEAP32[$z>>2]|0; $69 = HEAP32[$68>>2]|0; $70 = Math_imul($69, $13)|0; $71 = ((($68)) + 4|0); $72 = HEAP32[$71>>2]|0; $73 = Math_imul($70, $72)|0; $74 = (($73) + 1)|0; $75 = (_stbi__malloc($74)|0); $76 = ($75|0)==(0|0); if ($76) { _stbi__cleanup_jpeg($z); _stbi__err(18059); $$0 = 0; break; } $77 = HEAP32[$z>>2]|0; $78 = ((($77)) + 4|0); $79 = HEAP32[$78>>2]|0; $80 = ($79|0)==(0); if (!($80)) { $81 = ($$|0)>(0); $82 = ($13|0)>(2); $83 = ((($z)) + 18180|0); $84 = ((($coutput)) + 4|0); $85 = ((($coutput)) + 8|0); $86 = ($13|0)==(1); $88 = $77;$j$020 = 0; while(1) { $87 = HEAP32[$88>>2]|0; $89 = Math_imul($j$020, $13)|0; $90 = Math_imul($89, $87)|0; $91 = (($75) + ($90)|0); if ($81) { $k$111 = 0; while(1) { $92 = (((($res_comp) + ($k$111<<5)|0)) + 24|0); $93 = HEAP32[$92>>2]|0; $94 = (((($res_comp) + ($k$111<<5)|0)) + 16|0); $95 = HEAP32[$94>>2]|0; $96 = $95 >> 1; $97 = ($93|0)>=($96|0); $98 = (($res_comp) + ($k$111<<5)|0); $99 = HEAP32[$98>>2]|0; $100 = (((((($z)) + 17820|0) + (($k$111*72)|0)|0)) + 56|0); $101 = HEAP32[$100>>2]|0; $102 = (((($res_comp) + ($k$111<<5)|0)) + 8|0); $103 = (((($res_comp) + ($k$111<<5)|0)) + 4|0); $$in = $97 ? $102 : $103; $104 = HEAP32[$$in>>2]|0; $$in4 = $97 ? $103 : $102; $105 = HEAP32[$$in4>>2]|0; $106 = (((($res_comp) + ($k$111<<5)|0)) + 20|0); $107 = HEAP32[$106>>2]|0; $108 = (((($res_comp) + ($k$111<<5)|0)) + 12|0); $109 = HEAP32[$108>>2]|0; $110 = (FUNCTION_TABLE_iiiiii[$99 & 7]($101,$104,$105,$107,$109)|0); $111 = (($coutput) + ($k$111<<2)|0); HEAP32[$111>>2] = $110; $112 = HEAP32[$92>>2]|0; $113 = (($112) + 1)|0; HEAP32[$92>>2] = $113; $114 = HEAP32[$94>>2]|0; $115 = ($113|0)<($114|0); if (!($115)) { HEAP32[$92>>2] = 0; $116 = HEAP32[$102>>2]|0; HEAP32[$103>>2] = $116; $117 = (((($res_comp) + ($k$111<<5)|0)) + 28|0); $118 = HEAP32[$117>>2]|0; $119 = (($118) + 1)|0; HEAP32[$117>>2] = $119; $120 = (((((($z)) + 17820|0) + (($k$111*72)|0)|0)) + 32|0); $121 = HEAP32[$120>>2]|0; $122 = ($119|0)<($121|0); if ($122) { $123 = (((((($z)) + 17820|0) + (($k$111*72)|0)|0)) + 36|0); $124 = HEAP32[$123>>2]|0; $125 = HEAP32[$102>>2]|0; $126 = (($125) + ($124)|0); HEAP32[$102>>2] = $126; } } $127 = (($k$111) + 1)|0; $exitcond = ($127|0)==($$|0); if ($exitcond) { break; } else { $k$111 = $127; } } } $128 = HEAP32[$coutput>>2]|0; $129 = HEAP32[$z>>2]|0; do { if ($82) { $130 = ((($129)) + 8|0); $131 = HEAP32[$130>>2]|0; $132 = ($131|0)==(3); if ($132) { $136 = HEAP32[$83>>2]|0; $137 = HEAP32[$84>>2]|0; $138 = HEAP32[$85>>2]|0; $139 = HEAP32[$129>>2]|0; FUNCTION_TABLE_viiiiii[$136 & 3]($91,$128,$137,$138,$139,$13); break; } $133 = HEAP32[$z>>2]|0; $134 = HEAP32[$133>>2]|0; $135 = ($134|0)==(0); if (!($135)) { $i$018 = 0;$out$017 = $91; while(1) { $140 = (($128) + ($i$018)|0); $141 = HEAP8[$140>>0]|0; $142 = ((($out$017)) + 2|0); HEAP8[$142>>0] = $141; $143 = ((($out$017)) + 1|0); HEAP8[$143>>0] = $141; HEAP8[$out$017>>0] = $141; $144 = ((($out$017)) + 3|0); HEAP8[$144>>0] = -1; $145 = (($out$017) + ($13)|0); $146 = (($i$018) + 1)|0; $147 = HEAP32[$z>>2]|0; $148 = HEAP32[$147>>2]|0; $149 = ($146>>>0)<($148>>>0); if ($149) { $i$018 = $146;$out$017 = $145; } else { break; } } } } else { $150 = HEAP32[$129>>2]|0; $151 = ($150|0)==(0); if ($86) { if ($151) { break; } else { $i$115 = 0; } while(1) { $152 = (($128) + ($i$115)|0); $153 = HEAP8[$152>>0]|0; $$sum = (($i$115) + ($90))|0; $154 = (($75) + ($$sum)|0); HEAP8[$154>>0] = $153; $155 = (($i$115) + 1)|0; $156 = HEAP32[$z>>2]|0; $157 = HEAP32[$156>>2]|0; $158 = ($155>>>0)<($157>>>0); if ($158) { $i$115 = $155; } else { break; } } } else { if ($151) { break; } else { $i$213 = 0;$out$112 = $91; } while(1) { $159 = (($128) + ($i$213)|0); $160 = HEAP8[$159>>0]|0; $161 = ((($out$112)) + 1|0); HEAP8[$out$112>>0] = $160; $162 = ((($out$112)) + 2|0); HEAP8[$161>>0] = -1; $163 = (($i$213) + 1)|0; $164 = HEAP32[$z>>2]|0; $165 = HEAP32[$164>>2]|0; $166 = ($163>>>0)<($165>>>0); if ($166) { $i$213 = $163;$out$112 = $162; } else { break; } } } } } while(0); $167 = (($j$020) + 1)|0; $168 = HEAP32[$z>>2]|0; $169 = ((($168)) + 4|0); $170 = HEAP32[$169>>2]|0; $171 = ($167>>>0)<($170>>>0); if ($171) { $88 = $168;$j$020 = $167; } else { break; } } } _stbi__cleanup_jpeg($z); $172 = HEAP32[$z>>2]|0; $173 = HEAP32[$172>>2]|0; HEAP32[$out_x>>2] = $173; $174 = HEAP32[$z>>2]|0; $175 = ((($174)) + 4|0); $176 = HEAP32[$175>>2]|0; HEAP32[$out_y>>2] = $176; $177 = ($comp|0)==(0|0); if ($177) { $$0 = $75; } else { $178 = HEAP32[$z>>2]|0; $179 = ((($178)) + 8|0); $180 = HEAP32[$179>>2]|0; HEAP32[$comp>>2] = $180; $$0 = $75; } } } while(0); $$1 = $$0; STACKTOP = sp;return ($$1|0); } function _stbi__decode_jpeg_image($j) { $j = $j|0; var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 17868|0); HEAP32[$0>>2] = 0; $1 = ((($j)) + 17872|0); HEAP32[$1>>2] = 0; $2 = ((($j)) + 17940|0); HEAP32[$2>>2] = 0; $3 = ((($j)) + 17944|0); HEAP32[$3>>2] = 0; $4 = ((($j)) + 18012|0); HEAP32[$4>>2] = 0; $5 = ((($j)) + 18016|0); HEAP32[$5>>2] = 0; $6 = ((($j)) + 18084|0); HEAP32[$6>>2] = 0; $7 = ((($j)) + 18088|0); HEAP32[$7>>2] = 0; $8 = ((($j)) + 18168|0); HEAP32[$8>>2] = 0; $9 = (_stbi__decode_jpeg_header($j,0)|0); $10 = ($9|0)==(0); if ($10) { $$0 = 0; return ($$0|0); } $11 = (_stbi__get_marker($j)|0); $12 = ((($j)) + 18116|0); $$sink = $11; L4: while(1) { $13 = $$sink&255; L6: do { switch ($13|0) { case 217: { label = 13; break L4; break; } case 218: { $14 = (_stbi__process_scan_header($j)|0); $15 = ($14|0)==(0); if ($15) { $$0 = 0; label = 15; break L4; } $16 = (_stbi__parse_entropy_coded_data($j)|0); $17 = ($16|0)==(0); if ($17) { $$0 = 0; label = 15; break L4; } $18 = HEAP8[$12>>0]|0; $19 = ($18<<24>>24)==(-1); if ($19) { L11: while(1) { $20 = HEAP32[$j>>2]|0; $21 = (_stbi__at_eof($20)|0); $22 = ($21|0)==(0); if (!($22)) { break L6; } $23 = HEAP32[$j>>2]|0; $24 = (_stbi__get8($23)|0); switch ($24<<24>>24) { case 0: { break; } case -1: { break L11; break; } default: { label = 10; break L4; } } } $25 = HEAP32[$j>>2]|0; $26 = (_stbi__get8($25)|0); HEAP8[$12>>0] = $26; } break; } default: { $27 = (_stbi__process_marker($j,$13)|0); $28 = ($27|0)==(0); if ($28) { $$0 = 0; label = 15; break L4; } } } } while(0); $29 = (_stbi__get_marker($j)|0); $$sink = $29; } if ((label|0) == 10) { _stbi__err(19718); $$0 = 0; return ($$0|0); } else if ((label|0) == 13) { $30 = ((($j)) + 18124|0); $31 = HEAP32[$30>>2]|0; $32 = ($31|0)==(0); if ($32) { $$0 = 1; return ($$0|0); } _stbi__jpeg_finish($j); $$0 = 1; return ($$0|0); } else if ((label|0) == 15) { return ($$0|0); } return (0)|0; } function _stbi__cleanup_jpeg($j) { $j = $j|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$j>>2]|0; $1 = ((($0)) + 8|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(0); if ($3) { $i$01 = 0; } else { return; } while(1) { $4 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 48|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)==(0|0); if (!($6)) { _free($5); HEAP32[$4>>2] = 0; $7 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 44|0); HEAP32[$7>>2] = 0; } $8 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 52|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)==(0|0); if (!($10)) { _free($9); HEAP32[$8>>2] = 0; $11 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 60|0); HEAP32[$11>>2] = 0; } $12 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 56|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)==(0|0); if (!($14)) { _free($13); HEAP32[$12>>2] = 0; } $15 = (($i$01) + 1)|0; $16 = HEAP32[$j>>2]|0; $17 = ((($16)) + 8|0); $18 = HEAP32[$17>>2]|0; $19 = ($15|0)<($18|0); if ($19) { $i$01 = $15; } else { break; } } return; } function _resample_row_1($out,$in_near,$in_far,$w,$hs) { $out = $out|0; $in_near = $in_near|0; $in_far = $in_far|0; $w = $w|0; $hs = $hs|0; var label = 0, sp = 0; sp = STACKTOP; return ($in_near|0); } function _stbi__resample_row_v_2($out,$in_near,$in_far,$w,$hs) { $out = $out|0; $in_near = $in_near|0; $in_far = $in_far|0; $w = $w|0; $hs = $hs|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($w|0)>(0); if ($0) { $i$01 = 0; } else { return ($out|0); } while(1) { $1 = (($in_near) + ($i$01)|0); $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = ($3*3)|0; $5 = (($in_far) + ($i$01)|0); $6 = HEAP8[$5>>0]|0; $7 = $6&255; $8 = (($7) + 2)|0; $9 = (($8) + ($4))|0; $10 = $9 >>> 2; $11 = $10&255; $12 = (($out) + ($i$01)|0); HEAP8[$12>>0] = $11; $13 = (($i$01) + 1)|0; $exitcond = ($13|0)==($w|0); if ($exitcond) { break; } else { $i$01 = $13; } } return ($out|0); } function _stbi__resample_row_h_2($out,$in_near,$in_far,$w,$hs) { $out = $out|0; $in_near = $in_near|0; $in_far = $in_far|0; $w = $w|0; $hs = $hs|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$0$lcssa = 0, $i$01 = 0, $phitmp = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = ($w|0)==(1); $1 = HEAP8[$in_near>>0]|0; if ($0) { $2 = ((($out)) + 1|0); HEAP8[$2>>0] = $1; HEAP8[$out>>0] = $1; return ($out|0); } HEAP8[$out>>0] = $1; $3 = HEAP8[$in_near>>0]|0; $4 = $3&255; $5 = ($4*3)|0; $6 = ((($in_near)) + 1|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = (($8) + 2)|0; $10 = (($9) + ($5))|0; $11 = $10 >>> 2; $12 = $11&255; $13 = ((($out)) + 1|0); HEAP8[$13>>0] = $12; $14 = (($w) + -1)|0; $15 = ($14|0)>(1); if ($15) { $16 = (($w) + -1)|0; $i$01 = 1; while(1) { $17 = (($in_near) + ($i$01)|0); $18 = HEAP8[$17>>0]|0; $19 = $18&255; $20 = ($19*3)|0; $21 = (($20) + 2)|0; $22 = (($i$01) + -1)|0; $23 = (($in_near) + ($22)|0); $24 = HEAP8[$23>>0]|0; $25 = $24&255; $26 = (($21) + ($25))|0; $27 = $26 >>> 2; $28 = $27&255; $29 = $i$01 << 1; $30 = (($out) + ($29)|0); HEAP8[$30>>0] = $28; $31 = (($i$01) + 1)|0; $32 = (($in_near) + ($31)|0); $33 = HEAP8[$32>>0]|0; $34 = $33&255; $35 = (($21) + ($34))|0; $36 = $35 >>> 2; $37 = $36&255; $38 = $29 | 1; $39 = (($out) + ($38)|0); HEAP8[$39>>0] = $37; $exitcond = ($31|0)==($16|0); if ($exitcond) { break; } else { $i$01 = $31; } } $phitmp = $16 << 1; $i$0$lcssa = $phitmp; } else { $i$0$lcssa = 2; } $40 = (($w) + -2)|0; $41 = (($in_near) + ($40)|0); $42 = HEAP8[$41>>0]|0; $43 = $42&255; $44 = ($43*3)|0; $45 = (($in_near) + ($14)|0); $46 = HEAP8[$45>>0]|0; $47 = $46&255; $48 = (($47) + 2)|0; $49 = (($48) + ($44))|0; $50 = $49 >>> 2; $51 = $50&255; $52 = (($out) + ($i$0$lcssa)|0); HEAP8[$52>>0] = $51; $53 = HEAP8[$45>>0]|0; $54 = $i$0$lcssa | 1; $55 = (($out) + ($54)|0); HEAP8[$55>>0] = $53; return ($out|0); } function _stbi__resample_row_generic($out,$in_near,$in_far,$w,$hs) { $out = $out|0; $in_near = $in_near|0; $in_far = $in_far|0; $w = $w|0; $hs = $hs|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $exitcond4 = 0, $i$02 = 0, $j$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($w|0)>(0); if (!($0)) { return ($out|0); } $1 = ($hs|0)>(0); $i$02 = 0; while(1) { if ($1) { $2 = (($in_near) + ($i$02)|0); $3 = Math_imul($i$02, $hs)|0; $j$01 = 0; while(1) { $4 = HEAP8[$2>>0]|0; $5 = (($j$01) + ($3))|0; $6 = (($out) + ($5)|0); HEAP8[$6>>0] = $4; $7 = (($j$01) + 1)|0; $exitcond = ($7|0)==($hs|0); if ($exitcond) { break; } else { $j$01 = $7; } } } $8 = (($i$02) + 1)|0; $exitcond4 = ($8|0)==($w|0); if ($exitcond4) { break; } else { $i$02 = $8; } } return ($out|0); } function _stbi__process_scan_header($z) { $z = $z|0; var $$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $9 = 0, $i$010 = 0, $or$cond1 = 0, $or$cond2 = 0, $which$0$lcssa = 0, $which$07 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$z>>2]|0; $1 = (_stbi__get16be($0)|0); $2 = HEAP32[$z>>2]|0; $3 = (_stbi__get8($2)|0); $4 = $3&255; $5 = ((($z)) + 18148|0); HEAP32[$5>>2] = $4; $6 = (($3) + -1)<<24>>24; $7 = ($6&255)>(3); if (!($7)) { $8 = HEAP32[$z>>2]|0; $9 = ((($8)) + 8|0); $10 = HEAP32[$9>>2]|0; $11 = ($4|0)>($10|0); if (!($11)) { $12 = $4 << 1; $13 = (($12) + 6)|0; $14 = ($1|0)==($13|0); if (!($14)) { _stbi__err(19972); $$0 = 0; return ($$0|0); } $15 = HEAP32[$5>>2]|0; $16 = ($15|0)>(0); $17 = HEAP32[$z>>2]|0; $18 = (_stbi__get8($17)|0); $19 = $18&255; L8: do { if ($16) { $30 = $19;$i$010 = 0; while(1) { $20 = HEAP32[$z>>2]|0; $21 = (_stbi__get8($20)|0); $22 = $21&255; $23 = HEAP32[$z>>2]|0; $24 = ((($23)) + 8|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)>(0); L11: do { if ($26) { $which$07 = 0; while(1) { $27 = (((($z)) + 17820|0) + (($which$07*72)|0)|0); $28 = HEAP32[$27>>2]|0; $29 = ($28|0)==($30|0); if ($29) { $which$0$lcssa = $which$07; break L11; } $31 = (($which$07) + 1)|0; $32 = HEAP32[$z>>2]|0; $33 = ((($32)) + 8|0); $34 = HEAP32[$33>>2]|0; $35 = ($31|0)<($34|0); if ($35) { $which$07 = $31; } else { $which$0$lcssa = $31; break; } } } else { $which$0$lcssa = 0; } } while(0); $36 = HEAP32[$z>>2]|0; $37 = ((($36)) + 8|0); $38 = HEAP32[$37>>2]|0; $39 = ($which$0$lcssa|0)==($38|0); if ($39) { $$0 = 0; label = 26; break; } $40 = $22 >>> 4; $41 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 16|0); HEAP32[$41>>2] = $40; $42 = ($21&255)>(63); if ($42) { label = 12; break; } $43 = $22 & 15; $44 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 20|0); HEAP32[$44>>2] = $43; $45 = ($43>>>0)>(3); if ($45) { label = 14; break; } $46 = (((($z)) + 18152|0) + ($i$010<<2)|0); HEAP32[$46>>2] = $which$0$lcssa; $47 = (($i$010) + 1)|0; $48 = HEAP32[$5>>2]|0; $49 = ($47|0)<($48|0); $50 = HEAP32[$z>>2]|0; $51 = (_stbi__get8($50)|0); $52 = $51&255; if ($49) { $30 = $52;$i$010 = $47; } else { $$lcssa = $52; break L8; } } if ((label|0) == 12) { _stbi__err(19984); $$0 = 0; return ($$0|0); } else if ((label|0) == 14) { _stbi__err(19996); $$0 = 0; return ($$0|0); } else if ((label|0) == 26) { return ($$0|0); } } else { $$lcssa = $19; } } while(0); $53 = ((($z)) + 18128|0); HEAP32[$53>>2] = $$lcssa; $54 = HEAP32[$z>>2]|0; $55 = (_stbi__get8($54)|0); $56 = $55&255; $57 = ((($z)) + 18132|0); HEAP32[$57>>2] = $56; $58 = HEAP32[$z>>2]|0; $59 = (_stbi__get8($58)|0); $60 = $59&255; $61 = $60 >>> 4; $62 = ((($z)) + 18136|0); HEAP32[$62>>2] = $61; $63 = $60 & 15; $64 = ((($z)) + 18140|0); HEAP32[$64>>2] = $63; $65 = ((($z)) + 18124|0); $66 = HEAP32[$65>>2]|0; $67 = ($66|0)==(0); $68 = HEAP32[$53>>2]|0; if (!($67)) { $69 = ($68|0)>(63); if (!($69)) { $70 = HEAP32[$57>>2]|0; $71 = ($70|0)>(63); $72 = ($68|0)>($70|0); $or$cond1 = $71 | $72; if (!($or$cond1)) { $73 = HEAP32[$62>>2]|0; $74 = ($73|0)>(13); $75 = ($63>>>0)>(13); $or$cond2 = $75 | $74; if (!($or$cond2)) { $$0 = 1; return ($$0|0); } } } _stbi__err(20008); $$0 = 0; return ($$0|0); } $76 = ($68|0)==(0); if (!($76)) { _stbi__err(20008); $$0 = 0; return ($$0|0); } $77 = HEAP32[$62>>2]|0; $78 = $77 | $63; $79 = ($78|0)==(0); if ($79) { HEAP32[$57>>2] = 63; $$0 = 1; return ($$0|0); } else { _stbi__err(20008); $$0 = 0; return ($$0|0); } } } _stbi__err(19948); $$0 = 0; return ($$0|0); } function _stbi__parse_entropy_coded_data($z) { $z = $z|0; var $$0 = 0, $$1 = 0, $$2 = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0; var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0; var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0; var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $data = 0, $i$023 = 0, $i1$035 = 0, $i13$054 = 0; var $i6$040 = 0, $j$024 = 0, $j14$057 = 0, $j2$038 = 0, $j7$043 = 0, $k$032 = 0, $k15$051 = 0, $tmp = 0, $tmp5 = 0, $x$026 = 0, $x16$045 = 0, $y$029 = 0, $y17$048 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; $data = sp; _stbi__jpeg_reset($z); $0 = ((($z)) + 18124|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); $3 = ((($z)) + 18148|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(1); if ($2) { if ($5) { $6 = ((($z)) + 18152|0); $7 = HEAP32[$6>>2]|0; $8 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 28|0); $9 = HEAP32[$8>>2]|0; $10 = (($9) + 7)|0; $11 = $10 >> 3; $12 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 32|0); $13 = HEAP32[$12>>2]|0; $14 = (($13) + 7)|0; $15 = $14 >> 3; $16 = ($15|0)>(0); L5: do { if ($16) { $17 = ($11|0)>(0); $18 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 20|0); $19 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 16|0); $20 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 12|0); $21 = ((($z)) + 18176|0); $22 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 44|0); $23 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 36|0); $24 = ((($z)) + 18172|0); $25 = ((($z)) + 18112|0); $26 = ((($z)) + 18116|0); $j$024 = 0; while(1) { if ($17) { $i$023 = 0; while(1) { $27 = HEAP32[$18>>2]|0; $28 = HEAP32[$19>>2]|0; $29 = (((($z)) + 4|0) + (($28*1680)|0)|0); $30 = (((($z)) + 6724|0) + (($27*1680)|0)|0); $31 = (((($z)) + 13700|0) + ($27<<10)|0); $32 = HEAP32[$20>>2]|0; $33 = (((($z)) + 13444|0) + ($32<<6)|0); $34 = (_stbi__jpeg_decode_block($z,$data,$29,$30,$31,$7,$33)|0); $35 = ($34|0)==(0); if ($35) { $$0 = 0; break L5; } $36 = HEAP32[$21>>2]|0; $37 = HEAP32[$22>>2]|0; $38 = HEAP32[$23>>2]|0; $39 = Math_imul($38, $j$024)|0; $40 = (($39) + ($i$023))|0; $$sum1 = $40 << 3; $41 = (($37) + ($$sum1)|0); FUNCTION_TABLE_viii[$36 & 31]($41,$38,$data); $42 = HEAP32[$24>>2]|0; $43 = (($42) + -1)|0; HEAP32[$24>>2] = $43; $44 = ($42|0)<(2); if ($44) { $45 = HEAP32[$25>>2]|0; $46 = ($45|0)<(24); if ($46) { _stbi__grow_buffer_unsafe($z); } $47 = HEAP8[$26>>0]|0; $48 = $47 & -8; $49 = ($48<<24>>24)==(-48); if (!($49)) { $$0 = 1; break L5; } _stbi__jpeg_reset($z); } $50 = (($i$023) + 1)|0; $51 = ($50|0)<($11|0); if ($51) { $i$023 = $50; } else { break; } } } $52 = (($j$024) + 1)|0; $53 = ($52|0)<($15|0); if ($53) { $j$024 = $52; } else { $$0 = 1; break; } } } else { $$0 = 1; } } while(0); $$2 = $$0; STACKTOP = sp;return ($$2|0); } $54 = ((($z)) + 17808|0); $55 = HEAP32[$54>>2]|0; $56 = ($55|0)>(0); L24: do { if ($56) { $57 = ((($z)) + 17804|0); $58 = ((($z)) + 18172|0); $59 = ((($z)) + 18112|0); $60 = ((($z)) + 18116|0); $61 = ((($z)) + 18176|0); $j2$038 = 0; while(1) { $62 = HEAP32[$57>>2]|0; $63 = ($62|0)>(0); if ($63) { $i1$035 = 0; while(1) { $64 = HEAP32[$3>>2]|0; $65 = ($64|0)>(0); if ($65) { $k$032 = 0; while(1) { $66 = (((($z)) + 18152|0) + ($k$032<<2)|0); $67 = HEAP32[$66>>2]|0; $68 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 8|0); $69 = HEAP32[$68>>2]|0; $70 = ($69|0)>(0); if ($70) { $71 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 4|0); $72 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 20|0); $73 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 16|0); $74 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 12|0); $75 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 44|0); $76 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 36|0); $y$029 = 0; while(1) { $77 = HEAP32[$71>>2]|0; $78 = ($77|0)>(0); if ($78) { $92 = $77;$x$026 = 0; while(1) { $79 = HEAP32[$68>>2]|0; $80 = HEAP32[$72>>2]|0; $81 = HEAP32[$73>>2]|0; $82 = (((($z)) + 4|0) + (($81*1680)|0)|0); $83 = (((($z)) + 6724|0) + (($80*1680)|0)|0); $84 = (((($z)) + 13700|0) + ($80<<10)|0); $85 = HEAP32[$74>>2]|0; $86 = (((($z)) + 13444|0) + ($85<<6)|0); $87 = (_stbi__jpeg_decode_block($z,$data,$82,$83,$84,$67,$86)|0); $88 = ($87|0)==(0); if ($88) { $$1 = 0; break L24; } $89 = Math_imul($79, $j2$038)|0; $90 = (($89) + ($y$029))|0; $91 = Math_imul($92, $i1$035)|0; $93 = (($91) + ($x$026))|0; $94 = HEAP32[$61>>2]|0; $95 = HEAP32[$75>>2]|0; $96 = HEAP32[$76>>2]|0; $97 = Math_imul($96, $90)|0; $tmp = (($93) + ($97))|0; $tmp5 = $tmp << 3; $98 = (($95) + ($tmp5)|0); FUNCTION_TABLE_viii[$94 & 31]($98,$96,$data); $99 = (($x$026) + 1)|0; $100 = HEAP32[$71>>2]|0; $101 = ($99|0)<($100|0); if ($101) { $92 = $100;$x$026 = $99; } else { break; } } } $102 = (($y$029) + 1)|0; $103 = HEAP32[$68>>2]|0; $104 = ($102|0)<($103|0); if ($104) { $y$029 = $102; } else { break; } } } $105 = (($k$032) + 1)|0; $106 = HEAP32[$3>>2]|0; $107 = ($105|0)<($106|0); if ($107) { $k$032 = $105; } else { break; } } } $108 = HEAP32[$58>>2]|0; $109 = (($108) + -1)|0; HEAP32[$58>>2] = $109; $110 = ($108|0)<(2); if ($110) { $111 = HEAP32[$59>>2]|0; $112 = ($111|0)<(24); if ($112) { _stbi__grow_buffer_unsafe($z); } $113 = HEAP8[$60>>0]|0; $114 = $113 & -8; $115 = ($114<<24>>24)==(-48); if (!($115)) { $$1 = 1; break L24; } _stbi__jpeg_reset($z); } $116 = (($i1$035) + 1)|0; $117 = HEAP32[$57>>2]|0; $118 = ($116|0)<($117|0); if ($118) { $i1$035 = $116; } else { break; } } } $119 = (($j2$038) + 1)|0; $120 = HEAP32[$54>>2]|0; $121 = ($119|0)<($120|0); if ($121) { $j2$038 = $119; } else { $$1 = 1; break; } } } else { $$1 = 1; } } while(0); $$2 = $$1; STACKTOP = sp;return ($$2|0); } if ($5) { $129 = ((($z)) + 18152|0); $130 = HEAP32[$129>>2]|0; $131 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 28|0); $132 = HEAP32[$131>>2]|0; $133 = (($132) + 7)|0; $134 = $133 >> 3; $135 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 32|0); $136 = HEAP32[$135>>2]|0; $137 = (($136) + 7)|0; $138 = $137 >> 3; $139 = ($138|0)>(0); if (!($139)) { $$2 = 1; STACKTOP = sp;return ($$2|0); } $140 = ($134|0)>(0); $141 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 60|0); $142 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 64|0); $143 = ((($z)) + 18128|0); $144 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 16|0); $145 = ((($z)) + 18172|0); $146 = ((($z)) + 18112|0); $147 = ((($z)) + 18116|0); $148 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 20|0); $j7$043 = 0; L61: while(1) { if ($140) { $i6$040 = 0; while(1) { $149 = HEAP32[$141>>2]|0; $150 = HEAP32[$142>>2]|0; $151 = Math_imul($150, $j7$043)|0; $152 = (($151) + ($i6$040))|0; $153 = $152 << 6; $154 = (($149) + ($153<<1)|0); $155 = HEAP32[$143>>2]|0; $156 = ($155|0)==(0); if ($156) { $157 = HEAP32[$144>>2]|0; $158 = (((($z)) + 4|0) + (($157*1680)|0)|0); $159 = (_stbi__jpeg_decode_block_prog_dc($z,$154,$158,$130)|0); $160 = ($159|0)==(0); if ($160) { $$2 = 0; label = 66; break L61; } } else { $161 = HEAP32[$148>>2]|0; $162 = (((($z)) + 6724|0) + (($161*1680)|0)|0); $163 = (((($z)) + 13700|0) + ($161<<10)|0); $164 = (_stbi__jpeg_decode_block_prog_ac($z,$154,$162,$163)|0); $165 = ($164|0)==(0); if ($165) { $$2 = 0; label = 66; break L61; } } $166 = HEAP32[$145>>2]|0; $167 = (($166) + -1)|0; HEAP32[$145>>2] = $167; $168 = ($166|0)<(2); if ($168) { $169 = HEAP32[$146>>2]|0; $170 = ($169|0)<(24); if ($170) { _stbi__grow_buffer_unsafe($z); } $171 = HEAP8[$147>>0]|0; $172 = $171 & -8; $173 = ($172<<24>>24)==(-48); if (!($173)) { $$2 = 1; label = 66; break L61; } _stbi__jpeg_reset($z); } $174 = (($i6$040) + 1)|0; $175 = ($174|0)<($134|0); if ($175) { $i6$040 = $174; } else { break; } } } $176 = (($j7$043) + 1)|0; $177 = ($176|0)<($138|0); if ($177) { $j7$043 = $176; } else { $$2 = 1; label = 66; break; } } if ((label|0) == 66) { STACKTOP = sp;return ($$2|0); } } $122 = ((($z)) + 17808|0); $123 = HEAP32[$122>>2]|0; $124 = ($123|0)>(0); if (!($124)) { $$2 = 1; STACKTOP = sp;return ($$2|0); } $125 = ((($z)) + 17804|0); $126 = ((($z)) + 18172|0); $127 = ((($z)) + 18112|0); $128 = ((($z)) + 18116|0); $j14$057 = 0; L87: while(1) { $178 = HEAP32[$125>>2]|0; $179 = ($178|0)>(0); if ($179) { $i13$054 = 0; while(1) { $180 = HEAP32[$3>>2]|0; $181 = ($180|0)>(0); if ($181) { $k15$051 = 0; while(1) { $182 = (((($z)) + 18152|0) + ($k15$051<<2)|0); $183 = HEAP32[$182>>2]|0; $184 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 8|0); $185 = HEAP32[$184>>2]|0; $186 = ($185|0)>(0); if ($186) { $187 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 4|0); $188 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 60|0); $189 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 64|0); $190 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 16|0); $y17$048 = 0; while(1) { $191 = HEAP32[$187>>2]|0; $192 = ($191|0)>(0); if ($192) { $197 = $191;$x16$045 = 0; while(1) { $196 = Math_imul($197, $i13$054)|0; $198 = (($196) + ($x16$045))|0; $199 = HEAP32[$184>>2]|0; $200 = Math_imul($199, $j14$057)|0; $201 = (($200) + ($y17$048))|0; $202 = HEAP32[$188>>2]|0; $203 = HEAP32[$189>>2]|0; $204 = Math_imul($201, $203)|0; $205 = (($198) + ($204))|0; $206 = $205 << 6; $207 = (($202) + ($206<<1)|0); $208 = HEAP32[$190>>2]|0; $209 = (((($z)) + 4|0) + (($208*1680)|0)|0); $210 = (_stbi__jpeg_decode_block_prog_dc($z,$207,$209,$183)|0); $211 = ($210|0)==(0); $194 = (($x16$045) + 1)|0; if ($211) { $$2 = 0; label = 66; break L87; } $193 = HEAP32[$187>>2]|0; $195 = ($194|0)<($193|0); if ($195) { $197 = $193;$x16$045 = $194; } else { break; } } } $212 = (($y17$048) + 1)|0; $213 = HEAP32[$184>>2]|0; $214 = ($212|0)<($213|0); if ($214) { $y17$048 = $212; } else { break; } } } $215 = (($k15$051) + 1)|0; $216 = HEAP32[$3>>2]|0; $217 = ($215|0)<($216|0); if ($217) { $k15$051 = $215; } else { break; } } } $218 = HEAP32[$126>>2]|0; $219 = (($218) + -1)|0; HEAP32[$126>>2] = $219; $220 = ($218|0)<(2); if ($220) { $221 = HEAP32[$127>>2]|0; $222 = ($221|0)<(24); if ($222) { _stbi__grow_buffer_unsafe($z); } $223 = HEAP8[$128>>0]|0; $224 = $223 & -8; $225 = ($224<<24>>24)==(-48); if (!($225)) { $$2 = 1; label = 66; break L87; } _stbi__jpeg_reset($z); } $226 = (($i13$054) + 1)|0; $227 = HEAP32[$125>>2]|0; $228 = ($226|0)<($227|0); if ($228) { $i13$054 = $226; } else { break; } } } $229 = (($j14$057) + 1)|0; $230 = HEAP32[$122>>2]|0; $231 = ($229|0)<($230|0); if ($231) { $j14$057 = $229; } else { $$2 = 1; label = 66; break; } } if ((label|0) == 66) { STACKTOP = sp;return ($$2|0); } return (0)|0; } function _stbi__jpeg_finish($z) { $z = $z|0; var $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$02 = 0, $j$03 = 0, $n$06 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($z)) + 18124|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { return; } $3 = HEAP32[$z>>2]|0; $4 = ((($3)) + 8|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)>(0); if (!($6)) { return; } $7 = ((($z)) + 18176|0); $n$06 = 0; while(1) { $8 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 28|0); $9 = HEAP32[$8>>2]|0; $10 = (($9) + 7)|0; $11 = $10 >> 3; $12 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 32|0); $13 = HEAP32[$12>>2]|0; $14 = (($13) + 7)|0; $15 = $14 >> 3; $16 = ($15|0)>(0); if ($16) { $17 = ($11|0)>(0); $18 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 60|0); $19 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 64|0); $20 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 12|0); $21 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 44|0); $22 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 36|0); $j$03 = 0; while(1) { if ($17) { $i$02 = 0; while(1) { $23 = HEAP32[$18>>2]|0; $24 = HEAP32[$19>>2]|0; $25 = Math_imul($24, $j$03)|0; $26 = (($25) + ($i$02))|0; $27 = $26 << 6; $28 = (($23) + ($27<<1)|0); $29 = HEAP32[$20>>2]|0; $30 = (((($z)) + 13444|0) + ($29<<6)|0); _stbi__jpeg_dequantize($28,$30); $31 = HEAP32[$7>>2]|0; $32 = HEAP32[$21>>2]|0; $33 = HEAP32[$22>>2]|0; $34 = Math_imul($33, $j$03)|0; $35 = (($34) + ($i$02))|0; $$sum = $35 << 3; $36 = (($32) + ($$sum)|0); FUNCTION_TABLE_viii[$31 & 31]($36,$33,$28); $37 = (($i$02) + 1)|0; $exitcond = ($37|0)==($11|0); if ($exitcond) { break; } else { $i$02 = $37; } } } $38 = (($j$03) + 1)|0; $exitcond8 = ($38|0)==($15|0); if ($exitcond8) { break; } else { $j$03 = $38; } } } $39 = (($n$06) + 1)|0; $40 = HEAP32[$z>>2]|0; $41 = ((($40)) + 8|0); $42 = HEAP32[$41>>2]|0; $43 = ($39|0)<($42|0); if ($43) { $n$06 = $39; } else { break; } } return; } function _stbi__jpeg_dequantize($data,$dequant) { $data = $data|0; $dequant = $dequant|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0; sp = STACKTOP; $i$01 = 0; while(1) { $0 = (($dequant) + ($i$01)|0); $1 = HEAP8[$0>>0]|0; $2 = $1&255; $3 = (($data) + ($i$01<<1)|0); $4 = HEAP16[$3>>1]|0; $5 = $4 << 16 >> 16; $6 = Math_imul($5, $2)|0; $7 = $6&65535; HEAP16[$3>>1] = $7; $8 = (($i$01) + 1)|0; $exitcond = ($8|0)==(64); if ($exitcond) { break; } else { $i$01 = $8; } } return; } function _stbi__jpeg_reset($j) { $j = $j|0; var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18112|0); HEAP32[$0>>2] = 0; $1 = ((($j)) + 18108|0); HEAP32[$1>>2] = 0; $2 = ((($j)) + 18120|0); HEAP32[$2>>2] = 0; $3 = ((($j)) + 17988|0); HEAP32[$3>>2] = 0; $4 = ((($j)) + 17916|0); HEAP32[$4>>2] = 0; $5 = ((($j)) + 17844|0); HEAP32[$5>>2] = 0; $6 = ((($j)) + 18116|0); HEAP8[$6>>0] = -1; $7 = ((($j)) + 18168|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)==(0); $$ = $9 ? 2147483647 : $8; $10 = ((($j)) + 18172|0); HEAP32[$10>>2] = $$; $11 = ((($j)) + 18144|0); HEAP32[$11>>2] = 0; return; } function _stbi__jpeg_decode_block($j,$data,$hdc,$hac,$fac,$b,$dequant) { $j = $j|0; $data = $data|0; $hdc = $hdc|0; $hac = $hac|0; $fac = $fac|0; $b = $b|0; $dequant = $dequant|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$1 = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; $0 = ((($j)) + 18112|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(16); if ($2) { _stbi__grow_buffer_unsafe($j); } $3 = (_stbi__jpeg_huff_decode($j,$hdc)|0); $4 = ($3|0)<(0); if ($4) { _stbi__err(18982); $$0 = 0; return ($$0|0); } dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0)); $5 = ($3|0)==(0); if ($5) { $10 = 0; } else { $6 = (_stbi__extend_receive($j,$3)|0); $10 = $6; } $7 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0); $8 = HEAP32[$7>>2]|0; $9 = (($8) + ($10))|0; HEAP32[$7>>2] = $9; $11 = HEAP8[$dequant>>0]|0; $12 = $11&255; $13 = Math_imul($12, $9)|0; $14 = $13&65535; HEAP16[$data>>1] = $14; $15 = ((($j)) + 18108|0); $k$0 = 1; L11: while(1) { $16 = HEAP32[$0>>2]|0; $17 = ($16|0)<(16); if ($17) { _stbi__grow_buffer_unsafe($j); } $18 = HEAP32[$15>>2]|0; $19 = $18 >>> 23; $20 = (($fac) + ($19<<1)|0); $21 = HEAP16[$20>>1]|0; $22 = $21 << 16 >> 16; $23 = ($21<<16>>16)==(0); do { if ($23) { $42 = (_stbi__jpeg_huff_decode($j,$hac)|0); $43 = ($42|0)<(0); if ($43) { label = 13; break L11; } $44 = $42 & 15; $45 = ($44|0)==(0); if (!($45)) { $48 = $42 >> 4; $49 = (($48) + ($k$0))|0; $50 = (($49) + 1)|0; $51 = (18551 + ($49)|0); $52 = HEAP8[$51>>0]|0; $53 = $52&255; $54 = (_stbi__extend_receive($j,$44)|0); $55 = (($dequant) + ($53)|0); $56 = HEAP8[$55>>0]|0; $57 = $56&255; $58 = Math_imul($57, $54)|0; $59 = $58&65535; $60 = (($data) + ($53<<1)|0); HEAP16[$60>>1] = $59; $k$1 = $50; break; } $46 = ($42|0)==(240); if (!($46)) { $$0 = 1; label = 19; break L11; } $47 = (($k$0) + 16)|0; $k$1 = $47; } else { $24 = $22 >>> 4; $25 = $24 & 15; $26 = (($25) + ($k$0))|0; $27 = $22 & 15; $28 = $18 << $27; HEAP32[$15>>2] = $28; $29 = HEAP32[$0>>2]|0; $30 = (($29) - ($27))|0; HEAP32[$0>>2] = $30; $31 = (($26) + 1)|0; $32 = (18551 + ($26)|0); $33 = HEAP8[$32>>0]|0; $34 = $33&255; $35 = $22 >> 8; $36 = (($dequant) + ($34)|0); $37 = HEAP8[$36>>0]|0; $38 = $37&255; $39 = Math_imul($38, $35)|0; $40 = $39&65535; $41 = (($data) + ($34<<1)|0); HEAP16[$41>>1] = $40; $k$1 = $31; } } while(0); $61 = ($k$1|0)<(64); if ($61) { $k$0 = $k$1; } else { $$0 = 1; label = 19; break; } } if ((label|0) == 13) { _stbi__err(18982); $$0 = 0; return ($$0|0); } else if ((label|0) == 19) { return ($$0|0); } return (0)|0; } function _stbi__grow_buffer_unsafe($j) { $j = $j|0; var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18120|0); $1 = ((($j)) + 18112|0); $2 = ((($j)) + 18108|0); while(1) { $3 = HEAP32[$0>>2]|0; $4 = ($3|0)==(0); if ($4) { $5 = HEAP32[$j>>2]|0; $6 = (_stbi__get8($5)|0); $7 = $6&255; $8 = ($6<<24>>24)==(-1); if ($8) { $9 = HEAP32[$j>>2]|0; $10 = (_stbi__get8($9)|0); $11 = ($10<<24>>24)==(0); if ($11) { $16 = 255; } else { $$lcssa = $10; break; } } else { $16 = $7; } } else { $16 = 0; } $13 = HEAP32[$1>>2]|0; $14 = (24 - ($13))|0; $15 = $16 << $14; $17 = HEAP32[$2>>2]|0; $18 = $15 | $17; HEAP32[$2>>2] = $18; $19 = HEAP32[$1>>2]|0; $20 = (($19) + 8)|0; HEAP32[$1>>2] = $20; $21 = ($20|0)<(25); if (!($21)) { label = 7; break; } } if ((label|0) == 7) { return; } $12 = ((($j)) + 18116|0); HEAP8[$12>>0] = $$lcssa; HEAP32[$0>>2] = 1; return; } function _stbi__jpeg_decode_block_prog_dc($j,$data,$hdc,$b) { $j = $j|0; $data = $data|0; $hdc = $hdc|0; $b = $b|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; $0 = ((($j)) + 18132|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if (!($2)) { _stbi__err(19737); $$0 = 0; return ($$0|0); } $3 = ((($j)) + 18112|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)<(16); if ($5) { _stbi__grow_buffer_unsafe($j); } $6 = ((($j)) + 18136|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)==(0); if ($8) { dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0)); $9 = (_stbi__jpeg_huff_decode($j,$hdc)|0); $10 = ($9|0)==(0); if ($10) { $15 = 0; } else { $11 = (_stbi__extend_receive($j,$9)|0); $15 = $11; } $12 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0); $13 = HEAP32[$12>>2]|0; $14 = (($13) + ($15))|0; HEAP32[$12>>2] = $14; $16 = ((($j)) + 18140|0); $17 = HEAP32[$16>>2]|0; $18 = $14 << $17; $19 = $18&65535; HEAP16[$data>>1] = $19; $$0 = 1; return ($$0|0); } else { $20 = (_stbi__jpeg_get_bit($j)|0); $21 = ($20|0)==(0); if ($21) { $$0 = 1; return ($$0|0); } $22 = ((($j)) + 18140|0); $23 = HEAP32[$22>>2]|0; $sext = 65536 << $23; $24 = $sext >>> 16; $25 = HEAP16[$data>>1]|0; $26 = $25&65535; $27 = (($26) + ($24))|0; $28 = $27&65535; HEAP16[$data>>1] = $28; $$0 = 1; return ($$0|0); } return (0)|0; } function _stbi__jpeg_decode_block_prog_ac($j,$data,$hac,$fac) { $j = $j|0; $data = $data|0; $hac = $hac|0; $fac = $fac|0; var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa63 = 0, $$lcssa63$lcssa = 0, $$lcssa66 = 0, $$lcssa66$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0; var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0; var $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $k$0 = 0, $k$1 = 0, $k$223 = 0, $k$3 = 0, $k$4$ph20 = 0, $k$415 = 0, $k$415$lcssa = 0, $k$5 = 0, $r1$0$ph = 0, $r1$0$ph519 = 0, $s2$0$ph = 0, $sext = 0, $sext1 = 0, $sext2 = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18128|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { _stbi__err(19737); $$0 = 0; return ($$0|0); } $3 = ((($j)) + 18136|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)==(0); $6 = ((($j)) + 18140|0); $7 = HEAP32[$6>>2]|0; if ($5) { $8 = ((($j)) + 18144|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)==(0); if (!($10)) { $14 = (($9) + -1)|0; HEAP32[$8>>2] = $14; $$0 = 1; return ($$0|0); } $11 = ((($j)) + 18112|0); $12 = ((($j)) + 18108|0); $13 = ((($j)) + 18132|0); $k$0 = $1; L11: while(1) { $15 = HEAP32[$11>>2]|0; $16 = ($15|0)<(16); if ($16) { _stbi__grow_buffer_unsafe($j); } $17 = HEAP32[$12>>2]|0; $18 = $17 >>> 23; $19 = (($fac) + ($18<<1)|0); $20 = HEAP16[$19>>1]|0; $21 = $20 << 16 >> 16; $22 = ($20<<16>>16)==(0); do { if ($22) { $38 = (_stbi__jpeg_huff_decode($j,$hac)|0); $39 = ($38|0)<(0); if ($39) { label = 12; break L11; } $40 = $38 & 15; $41 = $38 >> 4; $42 = ($40|0)==(0); if (!($42)) { $52 = (($41) + ($k$0))|0; $53 = (($52) + 1)|0; $54 = (18551 + ($52)|0); $55 = HEAP8[$54>>0]|0; $56 = $55&255; $57 = (_stbi__extend_receive($j,$40)|0); $58 = $57 << $7; $59 = $58&65535; $60 = (($data) + ($56<<1)|0); HEAP16[$60>>1] = $59; $k$1 = $53; break; } $43 = ($41|0)<(15); if ($43) { $$lcssa = $41; label = 15; break L11; } $51 = (($k$0) + 16)|0; $k$1 = $51; } else { $23 = $21 >>> 4; $24 = $23 & 15; $25 = (($24) + ($k$0))|0; $26 = $21 & 15; $27 = $17 << $26; HEAP32[$12>>2] = $27; $28 = HEAP32[$11>>2]|0; $29 = (($28) - ($26))|0; HEAP32[$11>>2] = $29; $30 = (($25) + 1)|0; $31 = (18551 + ($25)|0); $32 = HEAP8[$31>>0]|0; $33 = $32&255; $34 = $21 >> 8; $35 = $34 << $7; $36 = $35&65535; $37 = (($data) + ($33<<1)|0); HEAP16[$37>>1] = $36; $k$1 = $30; } } while(0); $61 = HEAP32[$13>>2]|0; $62 = ($k$1|0)>($61|0); if ($62) { $$0 = 1; label = 53; break; } else { $k$0 = $k$1; } } if ((label|0) == 12) { _stbi__err(18982); $$0 = 0; return ($$0|0); } else if ((label|0) == 15) { $44 = 1 << $$lcssa; HEAP32[$8>>2] = $44; $45 = ($$lcssa|0)==(0); if (!($45)) { $46 = (_stbi__jpeg_get_bits($j,$$lcssa)|0); $47 = HEAP32[$8>>2]|0; $48 = (($47) + ($46))|0; HEAP32[$8>>2] = $48; } $49 = HEAP32[$8>>2]|0; $50 = (($49) + -1)|0; HEAP32[$8>>2] = $50; $$0 = 1; return ($$0|0); } else if ((label|0) == 53) { return ($$0|0); } } $63 = 1 << $7; $64 = ((($j)) + 18144|0); $65 = HEAP32[$64>>2]|0; $66 = ($65|0)==(0); if (!($66)) { $71 = (($65) + -1)|0; HEAP32[$64>>2] = $71; $72 = HEAP32[$0>>2]|0; $73 = ((($j)) + 18132|0); $74 = HEAP32[$73>>2]|0; $75 = ($72|0)>($74|0); if ($75) { $$0 = 1; return ($$0|0); } $sext2 = $63 << 16; $76 = $sext2 >> 16; $k$223 = $72; while(1) { $77 = (18551 + ($k$223)|0); $78 = HEAP8[$77>>0]|0; $79 = $78&255; $80 = (($data) + ($79<<1)|0); $81 = HEAP16[$80>>1]|0; $82 = ($81<<16>>16)==(0); do { if (!($82)) { $83 = (_stbi__jpeg_get_bit($j)|0); $84 = ($83|0)==(0); if (!($84)) { $85 = HEAP16[$80>>1]|0; $86 = $85 << 16 >> 16; $87 = $86 & $76; $88 = ($87|0)==(0); if ($88) { $89 = ($85<<16>>16)>(0); if ($89) { $90 = (($86) + ($76))|0; $91 = $90&65535; HEAP16[$80>>1] = $91; break; } else { $92 = (($86) - ($76))|0; $93 = $92&65535; HEAP16[$80>>1] = $93; break; } } } } } while(0); $94 = (($k$223) + 1)|0; $95 = HEAP32[$73>>2]|0; $96 = ($k$223|0)<($95|0); if ($96) { $k$223 = $94; } else { $$0 = 1; break; } } return ($$0|0); } $sext = $63 << 16; $67 = $sext >> 16; $68 = (0 - ($67))|0; $69 = ((($j)) + 18132|0); $sext1 = $63 << 16; $70 = $sext1 >> 16; $k$3 = $1; L52: while(1) { $97 = (_stbi__jpeg_huff_decode($j,$hac)|0); $98 = ($97|0)<(0); if ($98) { label = 33; break; } $99 = $97 & 15; $100 = $97 >> 4; switch ($99|0) { case 0: { $101 = ($100|0)<(15); if ($101) { $102 = 1 << $100; $103 = (($102) + -1)|0; HEAP32[$64>>2] = $103; $104 = ($100|0)==(0); if ($104) { $r1$0$ph = 64;$s2$0$ph = 0; } else { $105 = (_stbi__jpeg_get_bits($j,$100)|0); $106 = HEAP32[$64>>2]|0; $107 = (($106) + ($105))|0; HEAP32[$64>>2] = $107; $r1$0$ph = 64;$s2$0$ph = 0; } } else { $r1$0$ph = $100;$s2$0$ph = 0; } break; } case 1: { $108 = (_stbi__jpeg_get_bit($j)|0); $109 = ($108|0)==(0); $$ = $109 ? $68 : $67; $r1$0$ph = $100;$s2$0$ph = $$; break; } default: { label = 38; break L52; } } $110 = HEAP32[$69>>2]|0; $111 = ($k$3|0)>($110|0); L61: do { if ($111) { $k$5 = $k$3; } else { $k$4$ph20 = $k$3;$r1$0$ph519 = $r1$0$ph; while(1) { $k$415 = $k$4$ph20; while(1) { $115 = (($k$415) + 1)|0; $116 = (18551 + ($k$415)|0); $117 = HEAP8[$116>>0]|0; $118 = $117&255; $119 = (($data) + ($118<<1)|0); $120 = HEAP16[$119>>1]|0; $121 = ($120<<16>>16)==(0); if ($121) { $$lcssa63 = $115;$$lcssa66 = $119;$k$415$lcssa = $k$415; break; } $122 = (_stbi__jpeg_get_bit($j)|0); $123 = ($122|0)==(0); do { if (!($123)) { $124 = HEAP16[$119>>1]|0; $125 = $124 << 16 >> 16; $126 = $125 & $70; $127 = ($126|0)==(0); if ($127) { $128 = ($124<<16>>16)>(0); if ($128) { $129 = (($125) + ($70))|0; $130 = $129&65535; HEAP16[$119>>1] = $130; break; } else { $133 = (($125) - ($70))|0; $134 = $133&65535; HEAP16[$119>>1] = $134; break; } } } } while(0); $131 = HEAP32[$69>>2]|0; $132 = ($k$415|0)<($131|0); if ($132) { $k$415 = $115; } else { $k$5 = $115; break L61; } } $135 = ($r1$0$ph519|0)==(0); if ($135) { $$lcssa63$lcssa = $$lcssa63;$$lcssa66$lcssa = $$lcssa66; break; } $112 = (($r1$0$ph519) + -1)|0; $113 = HEAP32[$69>>2]|0; $114 = ($k$415$lcssa|0)<($113|0); if ($114) { $k$4$ph20 = $$lcssa63;$r1$0$ph519 = $112; } else { $k$5 = $$lcssa63; break L61; } } $136 = $s2$0$ph&65535; HEAP16[$$lcssa66$lcssa>>1] = $136; $k$5 = $$lcssa63$lcssa; } } while(0); $137 = HEAP32[$69>>2]|0; $138 = ($k$5|0)>($137|0); if ($138) { $$0 = 1; label = 53; break; } else { $k$3 = $k$5; } } if ((label|0) == 33) { _stbi__err(18982); $$0 = 0; return ($$0|0); } else if ((label|0) == 38) { _stbi__err(18982); $$0 = 0; return ($$0|0); } else if ((label|0) == 53) { return ($$0|0); } return (0)|0; } function _stbi__jpeg_huff_decode($j,$h) { $j = $j|0; $h = $h|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$0$lcssa = 0; var label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18112|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(16); if ($2) { _stbi__grow_buffer_unsafe($j); } $3 = ((($j)) + 18108|0); $4 = HEAP32[$3>>2]|0; $5 = $4 >>> 23; $6 = (($h) + ($5)|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = ($7<<24>>24)==(-1); if (!($9)) { $10 = (((($h)) + 1280|0) + ($8)|0); $11 = HEAP8[$10>>0]|0; $12 = $11&255; $13 = HEAP32[$0>>2]|0; $14 = ($12|0)>($13|0); if ($14) { $$0 = -1; return ($$0|0); } $15 = $4 << $12; HEAP32[$3>>2] = $15; $16 = HEAP32[$0>>2]|0; $17 = (($16) - ($12))|0; HEAP32[$0>>2] = $17; $18 = (((($h)) + 1024|0) + ($8)|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $$0 = $20; return ($$0|0); } $21 = $4 >>> 16; $k$0 = 10; while(1) { $22 = (((($h)) + 1540|0) + ($k$0<<2)|0); $23 = HEAP32[$22>>2]|0; $24 = ($21>>>0)<($23>>>0); $25 = (($k$0) + 1)|0; if ($24) { $k$0$lcssa = $k$0; break; } else { $k$0 = $25; } } $26 = ($k$0$lcssa|0)==(17); $27 = HEAP32[$0>>2]|0; if ($26) { $28 = (($27) + -16)|0; HEAP32[$0>>2] = $28; $$0 = -1; return ($$0|0); } $29 = ($27|0)<($k$0$lcssa|0); if ($29) { $$0 = -1; return ($$0|0); } $30 = HEAP32[$3>>2]|0; $31 = (32 - ($k$0$lcssa))|0; $32 = $30 >>> $31; $33 = (8504 + ($k$0$lcssa<<2)|0); $34 = HEAP32[$33>>2]|0; $35 = $32 & $34; $36 = (((($h)) + 1612|0) + ($k$0$lcssa<<2)|0); $37 = HEAP32[$36>>2]|0; $38 = (($35) + ($37))|0; $39 = (((($h)) + 1280|0) + ($38)|0); $40 = HEAP8[$39>>0]|0; $41 = $40&255; $42 = (32 - ($41))|0; $43 = $30 >>> $42; $44 = (8504 + ($41<<2)|0); $45 = HEAP32[$44>>2]|0; $46 = $43 & $45; $47 = (((($h)) + 512|0) + ($38<<1)|0); $48 = HEAP16[$47>>1]|0; $49 = $48&65535; $50 = ($46|0)==($49|0); if (!($50)) { ___assert_fail((19843|0),(18129|0),1656,(19925|0)); // unreachable; } $51 = (($27) - ($k$0$lcssa))|0; HEAP32[$0>>2] = $51; $52 = HEAP32[$3>>2]|0; $53 = $52 << $k$0$lcssa; HEAP32[$3>>2] = $53; $54 = (((($h)) + 1024|0) + ($38)|0); $55 = HEAP8[$54>>0]|0; $56 = $55&255; $$0 = $56; return ($$0|0); } function _stbi__jpeg_get_bits($j,$n) { $j = $j|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18112|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<($n|0); if ($2) { _stbi__grow_buffer_unsafe($j); } $3 = ((($j)) + 18108|0); $4 = HEAP32[$3>>2]|0; $5 = $4 << $n; $6 = (32 - ($n))|0; $7 = $4 >>> $6; $8 = $5 | $7; $9 = (8504 + ($n<<2)|0); $10 = HEAP32[$9>>2]|0; $11 = $10 ^ -1; $12 = $8 & $11; HEAP32[$3>>2] = $12; $13 = HEAP32[$9>>2]|0; $14 = $8 & $13; $15 = HEAP32[$0>>2]|0; $16 = (($15) - ($n))|0; HEAP32[$0>>2] = $16; return ($14|0); } function _stbi__extend_receive($j,$n) { $j = $j|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18112|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<($n|0); if ($2) { _stbi__grow_buffer_unsafe($j); } $3 = ((($j)) + 18108|0); $4 = HEAP32[$3>>2]|0; $5 = $4 << $n; $6 = (32 - ($n))|0; $7 = $4 >>> $6; $8 = $5 | $7; $9 = ($n>>>0)<(17); if ($9) { $10 = $4 >> 31; $11 = (8504 + ($n<<2)|0); $12 = HEAP32[$11>>2]|0; $13 = $12 ^ -1; $14 = $8 & $13; HEAP32[$3>>2] = $14; $15 = HEAP32[$11>>2]|0; $16 = $15 & $8; $17 = HEAP32[$0>>2]|0; $18 = (($17) - ($n))|0; HEAP32[$0>>2] = $18; $19 = (8572 + ($n<<2)|0); $20 = HEAP32[$19>>2]|0; $21 = $10 ^ -1; $22 = $20 & $21; $23 = (($22) + ($16))|0; return ($23|0); } else { ___assert_fail((19759|0),(18129|0),1677,(19822|0)); // unreachable; } return (0)|0; } function _stbi__jpeg_get_bit($j) { $j = $j|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($j)) + 18112|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(1); if ($2) { _stbi__grow_buffer_unsafe($j); } $3 = ((($j)) + 18108|0); $4 = HEAP32[$3>>2]|0; $5 = $4 << 1; HEAP32[$3>>2] = $5; $6 = HEAP32[$0>>2]|0; $7 = (($6) + -1)|0; HEAP32[$0>>2] = $7; $8 = $4 & -2147483648; return ($8|0); } function _stbi__idct_block($out,$out_stride,$data) { $out = $out|0; $out_stride = $out_stride|0; $data = $data|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $d$04 = 0, $exitcond = 0, $exitcond9 = 0, $i$08 = 0, $i$13 = 0, $o$01 = 0, $v$06 = 0, $v$12 = 0; var $val = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $val = sp; $d$04 = $data;$i$08 = 0;$v$06 = $val; while(1) { $0 = ((($d$04)) + 16|0); $1 = HEAP16[$0>>1]|0; $2 = ($1<<16>>16)==(0); if ($2) { $3 = ((($d$04)) + 32|0); $4 = HEAP16[$3>>1]|0; $5 = ($4<<16>>16)==(0); if ($5) { $6 = ((($d$04)) + 48|0); $7 = HEAP16[$6>>1]|0; $8 = ($7<<16>>16)==(0); if ($8) { $9 = ((($d$04)) + 64|0); $10 = HEAP16[$9>>1]|0; $11 = ($10<<16>>16)==(0); if ($11) { $12 = ((($d$04)) + 80|0); $13 = HEAP16[$12>>1]|0; $14 = ($13<<16>>16)==(0); if ($14) { $15 = ((($d$04)) + 96|0); $16 = HEAP16[$15>>1]|0; $17 = ($16<<16>>16)==(0); if ($17) { $18 = ((($d$04)) + 112|0); $19 = HEAP16[$18>>1]|0; $20 = ($19<<16>>16)==(0); if ($20) { $21 = HEAP16[$d$04>>1]|0; $22 = $21 << 16 >> 16; $23 = $22 << 2; $24 = ((($v$06)) + 224|0); HEAP32[$24>>2] = $23; $25 = ((($v$06)) + 192|0); HEAP32[$25>>2] = $23; $26 = ((($v$06)) + 160|0); HEAP32[$26>>2] = $23; $27 = ((($v$06)) + 128|0); HEAP32[$27>>2] = $23; $28 = ((($v$06)) + 96|0); HEAP32[$28>>2] = $23; $29 = ((($v$06)) + 64|0); HEAP32[$29>>2] = $23; $30 = ((($v$06)) + 32|0); HEAP32[$30>>2] = $23; HEAP32[$v$06>>2] = $23; } else { label = 10; } } else { label = 10; } } else { label = 10; } } else { label = 10; } } else { label = 10; } } else { label = 10; } } else { label = 10; } if ((label|0) == 10) { label = 0; $31 = ((($d$04)) + 32|0); $32 = HEAP16[$31>>1]|0; $33 = $32 << 16 >> 16; $34 = ((($d$04)) + 96|0); $35 = HEAP16[$34>>1]|0; $36 = $35 << 16 >> 16; $37 = (($36) + ($33))|0; $38 = ($37*2217)|0; $39 = Math_imul($36, -7567)|0; $40 = (($38) + ($39))|0; $41 = ($33*3135)|0; $42 = (($38) + ($41))|0; $43 = HEAP16[$d$04>>1]|0; $44 = $43 << 16 >> 16; $45 = ((($d$04)) + 64|0); $46 = HEAP16[$45>>1]|0; $47 = $46 << 16 >> 16; $48 = (($47) + ($44))|0; $49 = $48 << 12; $50 = (($44) - ($47))|0; $51 = $50 << 12; $52 = (($49) - ($42))|0; $53 = (($51) - ($40))|0; $54 = ((($d$04)) + 112|0); $55 = HEAP16[$54>>1]|0; $56 = $55 << 16 >> 16; $57 = ((($d$04)) + 80|0); $58 = HEAP16[$57>>1]|0; $59 = $58 << 16 >> 16; $60 = ((($d$04)) + 48|0); $61 = HEAP16[$60>>1]|0; $62 = $61 << 16 >> 16; $63 = HEAP16[$0>>1]|0; $64 = $63 << 16 >> 16; $65 = (($62) + ($56))|0; $66 = (($64) + ($59))|0; $67 = (($64) + ($56))|0; $68 = (($62) + ($59))|0; $69 = (($66) + ($65))|0; $70 = ($69*4816)|0; $71 = ($56*1223)|0; $72 = ($59*8410)|0; $73 = ($62*12586)|0; $74 = ($64*6149)|0; $75 = Math_imul($67, -3685)|0; $76 = (($70) + ($75))|0; $77 = Math_imul($68, -10497)|0; $78 = (($70) + ($77))|0; $79 = Math_imul($65, -8034)|0; $80 = Math_imul($66, -1597)|0; $81 = (($80) + ($74))|0; $82 = (($81) + ($76))|0; $83 = (($79) + ($73))|0; $84 = (($83) + ($78))|0; $85 = (($80) + ($72))|0; $86 = (($85) + ($78))|0; $87 = (($79) + ($71))|0; $88 = (($87) + ($76))|0; $89 = (($42) + 512)|0; $90 = (($89) + ($49))|0; $91 = (($40) + 512)|0; $92 = (($91) + ($51))|0; $93 = (($53) + 512)|0; $94 = (($52) + 512)|0; $95 = (($82) + ($90))|0; $96 = $95 >> 10; HEAP32[$v$06>>2] = $96; $97 = (($90) - ($82))|0; $98 = $97 >> 10; $99 = ((($v$06)) + 224|0); HEAP32[$99>>2] = $98; $100 = (($84) + ($92))|0; $101 = $100 >> 10; $102 = ((($v$06)) + 32|0); HEAP32[$102>>2] = $101; $103 = (($92) - ($84))|0; $104 = $103 >> 10; $105 = ((($v$06)) + 192|0); HEAP32[$105>>2] = $104; $106 = (($86) + ($93))|0; $107 = $106 >> 10; $108 = ((($v$06)) + 64|0); HEAP32[$108>>2] = $107; $109 = (($93) - ($86))|0; $110 = $109 >> 10; $111 = ((($v$06)) + 160|0); HEAP32[$111>>2] = $110; $112 = (($88) + ($94))|0; $113 = $112 >> 10; $114 = ((($v$06)) + 96|0); HEAP32[$114>>2] = $113; $115 = (($94) - ($88))|0; $116 = $115 >> 10; $117 = ((($v$06)) + 128|0); HEAP32[$117>>2] = $116; } $118 = (($i$08) + 1)|0; $119 = ((($d$04)) + 2|0); $120 = ((($v$06)) + 4|0); $exitcond9 = ($118|0)==(8); if ($exitcond9) { $i$13 = 0;$o$01 = $out;$v$12 = $val; break; } else { $d$04 = $119;$i$08 = $118;$v$06 = $120; } } while(1) { $121 = ((($v$12)) + 8|0); $122 = HEAP32[$121>>2]|0; $123 = ((($v$12)) + 24|0); $124 = HEAP32[$123>>2]|0; $125 = (($124) + ($122))|0; $126 = ($125*2217)|0; $127 = Math_imul($124, -7567)|0; $128 = (($126) + ($127))|0; $129 = ($122*3135)|0; $130 = (($126) + ($129))|0; $131 = HEAP32[$v$12>>2]|0; $132 = ((($v$12)) + 16|0); $133 = HEAP32[$132>>2]|0; $134 = (($133) + ($131))|0; $135 = $134 << 12; $136 = (($131) - ($133))|0; $137 = $136 << 12; $138 = (($135) - ($130))|0; $139 = (($137) - ($128))|0; $140 = ((($v$12)) + 28|0); $141 = HEAP32[$140>>2]|0; $142 = ((($v$12)) + 20|0); $143 = HEAP32[$142>>2]|0; $144 = ((($v$12)) + 12|0); $145 = HEAP32[$144>>2]|0; $146 = ((($v$12)) + 4|0); $147 = HEAP32[$146>>2]|0; $148 = (($145) + ($141))|0; $149 = (($147) + ($143))|0; $150 = (($147) + ($141))|0; $151 = (($145) + ($143))|0; $152 = (($149) + ($148))|0; $153 = ($152*4816)|0; $154 = ($141*1223)|0; $155 = ($143*8410)|0; $156 = ($145*12586)|0; $157 = ($147*6149)|0; $158 = Math_imul($150, -3685)|0; $159 = (($153) + ($158))|0; $160 = Math_imul($151, -10497)|0; $161 = (($153) + ($160))|0; $162 = Math_imul($148, -8034)|0; $163 = Math_imul($149, -1597)|0; $164 = (($163) + ($157))|0; $165 = (($164) + ($159))|0; $166 = (($162) + ($156))|0; $167 = (($166) + ($161))|0; $168 = (($163) + ($155))|0; $169 = (($168) + ($161))|0; $170 = (($162) + ($154))|0; $171 = (($170) + ($159))|0; $172 = (($130) + 16842752)|0; $173 = (($172) + ($135))|0; $174 = (($128) + 16842752)|0; $175 = (($174) + ($137))|0; $176 = (($139) + 16842752)|0; $177 = (($138) + 16842752)|0; $178 = (($165) + ($173))|0; $179 = $178 >> 17; $180 = (_stbi__clamp($179)|0); HEAP8[$o$01>>0] = $180; $181 = (($173) - ($165))|0; $182 = $181 >> 17; $183 = (_stbi__clamp($182)|0); $184 = ((($o$01)) + 7|0); HEAP8[$184>>0] = $183; $185 = (($167) + ($175))|0; $186 = $185 >> 17; $187 = (_stbi__clamp($186)|0); $188 = ((($o$01)) + 1|0); HEAP8[$188>>0] = $187; $189 = (($175) - ($167))|0; $190 = $189 >> 17; $191 = (_stbi__clamp($190)|0); $192 = ((($o$01)) + 6|0); HEAP8[$192>>0] = $191; $193 = (($169) + ($176))|0; $194 = $193 >> 17; $195 = (_stbi__clamp($194)|0); $196 = ((($o$01)) + 2|0); HEAP8[$196>>0] = $195; $197 = (($176) - ($169))|0; $198 = $197 >> 17; $199 = (_stbi__clamp($198)|0); $200 = ((($o$01)) + 5|0); HEAP8[$200>>0] = $199; $201 = (($171) + ($177))|0; $202 = $201 >> 17; $203 = (_stbi__clamp($202)|0); $204 = ((($o$01)) + 3|0); HEAP8[$204>>0] = $203; $205 = (($177) - ($171))|0; $206 = $205 >> 17; $207 = (_stbi__clamp($206)|0); $208 = ((($o$01)) + 4|0); HEAP8[$208>>0] = $207; $209 = (($i$13) + 1)|0; $210 = ((($v$12)) + 32|0); $211 = (($o$01) + ($out_stride)|0); $exitcond = ($209|0)==(8); if ($exitcond) { break; } else { $i$13 = $209;$o$01 = $211;$v$12 = $210; } } STACKTOP = sp;return; } function _stbi__YCbCr_to_RGB_row($out,$y,$pcb,$pcr,$count,$step) { $out = $out|0; $y = $y|0; $pcb = $pcb|0; $pcr = $pcr|0; $count = $count|0; $step = $step|0; var $$04 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b$0 = 0, $exitcond = 0, $g$0 = 0, $i$03 = 0, $r$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($count|0)>(0); if ($0) { $$04 = $out;$i$03 = 0; } else { return; } while(1) { $1 = (($y) + ($i$03)|0); $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = $3 << 20; $5 = $4 | 524288; $6 = (($pcr) + ($i$03)|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = (($8) + -128)|0; $10 = (($pcb) + ($i$03)|0); $11 = HEAP8[$10>>0]|0; $12 = $11&255; $13 = (($12) + -128)|0; $14 = Math_imul($9, 1470208)|0; $15 = (($14) + ($5))|0; $16 = Math_imul($9, -748800)|0; $17 = (($5) + ($16))|0; $18 = Math_imul($13, -360960)|0; $19 = $18 & -65536; $20 = (($19) + ($17))|0; $21 = Math_imul($13, 1858048)|0; $22 = (($21) + ($5))|0; $23 = $15 >> 20; $24 = $20 >> 20; $25 = $22 >> 20; $26 = ($23>>>0)>(255); $27 = $15 >>> 31; $28 = (($27) + 255)|0; $r$0 = $26 ? $28 : $23; $29 = ($24>>>0)>(255); $30 = $20 >>> 31; $31 = (($30) + 255)|0; $g$0 = $29 ? $31 : $24; $32 = ($25>>>0)>(255); $33 = $22 >>> 31; $34 = (($33) + 255)|0; $b$0 = $32 ? $34 : $25; $35 = $r$0&255; HEAP8[$$04>>0] = $35; $36 = $g$0&255; $37 = ((($$04)) + 1|0); HEAP8[$37>>0] = $36; $38 = $b$0&255; $39 = ((($$04)) + 2|0); HEAP8[$39>>0] = $38; $40 = ((($$04)) + 3|0); HEAP8[$40>>0] = -1; $41 = (($$04) + ($step)|0); $42 = (($i$03) + 1)|0; $exitcond = ($42|0)==($count|0); if ($exitcond) { break; } else { $$04 = $41;$i$03 = $42; } } return; } function _stbi__resample_row_hv_2($out,$in_near,$in_far,$w,$hs) { $out = $out|0; $in_near = $in_near|0; $in_far = $in_far|0; $w = $w|0; $hs = $hs|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $exitcond = 0, $i$01 = 0, $t1$0$lcssa = 0, $t1$02 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($w|0)==(1); $1 = HEAP8[$in_near>>0]|0; $2 = $1&255; $3 = ($2*3)|0; $4 = HEAP8[$in_far>>0]|0; $5 = $4&255; $6 = (($3) + ($5))|0; $7 = (($6) + 2)|0; $8 = $7 >>> 2; $9 = $8&255; if ($0) { $10 = ((($out)) + 1|0); HEAP8[$10>>0] = $9; HEAP8[$out>>0] = $9; return ($out|0); } HEAP8[$out>>0] = $9; $11 = ($w|0)>(1); if ($11) { $i$01 = 1;$t1$02 = $6; while(1) { $12 = (($in_near) + ($i$01)|0); $13 = HEAP8[$12>>0]|0; $14 = $13&255; $15 = ($14*3)|0; $16 = (($in_far) + ($i$01)|0); $17 = HEAP8[$16>>0]|0; $18 = $17&255; $19 = (($15) + ($18))|0; $20 = ($t1$02*3)|0; $21 = (($20) + 8)|0; $22 = (($21) + ($19))|0; $23 = $22 >>> 4; $24 = $23&255; $25 = $i$01 << 1; $26 = (($25) + -1)|0; $27 = (($out) + ($26)|0); HEAP8[$27>>0] = $24; $28 = ($19*3)|0; $29 = (($t1$02) + 8)|0; $30 = (($29) + ($28))|0; $31 = $30 >>> 4; $32 = $31&255; $33 = (($out) + ($25)|0); HEAP8[$33>>0] = $32; $34 = (($i$01) + 1)|0; $exitcond = ($34|0)==($w|0); if ($exitcond) { $t1$0$lcssa = $19; break; } else { $i$01 = $34;$t1$02 = $19; } } } else { $t1$0$lcssa = $6; } $35 = (($t1$0$lcssa) + 2)|0; $36 = $35 >>> 2; $37 = $36&255; $38 = $w << 1; $39 = (($38) + -1)|0; $40 = (($out) + ($39)|0); HEAP8[$40>>0] = $37; return ($out|0); } function _stbi__clamp($x) { $x = $x|0; var $$not = 0, $0 = 0, $1 = 0, $2 = 0, $x$lobit = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($x>>>0)>(255); if ($0) { $x$lobit = $x >> 31; $1 = $x$lobit&255; $$not = $1 ^ -1; return ($$not|0); } else { $2 = $x&255; return ($2|0); } return (0)|0; } function _stbi__stdio_read($user,$data,$size) { $user = $user|0; $data = $data|0; $size = $size|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_fread($data,1,$size,$user)|0); return ($0|0); } function _stbi__stdio_skip($user,$n) { $user = $user|0; $n = $n|0; var label = 0, sp = 0; sp = STACKTOP; (_fseek($user,$n,1)|0); return; } function _stbi__stdio_eof($user) { $user = $user|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_feof($user)|0); return ($0|0); } function _PixelIsMagenta($p) { $p = $p|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP8[$p>>0]|0; $1 = ($0<<24>>24)==(-1); if ($1) { $2 = ((($p)) + 1|0); $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)==(0); if ($4) { $5 = ((($p)) + 2|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)==(-1); if ($7) { $8 = ((($p)) + 3|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(-1); $12 = $10; } else { $12 = 0; } } else { $12 = 0; } } else { $12 = 0; } $11 = $12&1; return ($11|0); } function _stbtt__sort_edges($p,$n) { $p = $p|0; $n = $n|0; var label = 0, sp = 0; sp = STACKTOP; _stbtt__sort_edges_quicksort($p,$n); _stbtt__sort_edges_ins_sort($p,$n); return; } function _stbtt__rasterize_sorted_edges($result,$e,$n,$off_x,$off_y) { $result = $result|0; $e = $e|0; $n = $n|0; $off_x = $off_x|0; $off_y = $off_y|0; var $$019 = 0, $$1$lcssa = 0, $$18 = 0, $$lcssa = 0, $$sum = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $active$sroa$0 = 0, $fabsf = 0.0, $hh = 0, $i$010 = 0, $j$016 = 0, $scanline$0 = 0, $scanline_data = 0, $step$0$ph7 = 0, $step$113 = 0, $sum$011 = 0.0, $y$018 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 544|0; $hh = sp + 520|0; $active$sroa$0 = sp; $scanline_data = sp + 4|0; ;HEAP32[$hh>>2]=0|0;HEAP32[$hh+4>>2]=0|0;HEAP32[$hh+8>>2]=0|0; HEAP32[$active$sroa$0>>2] = 0; $0 = HEAP32[$result>>2]|0; $1 = ($0|0)>(64); if ($1) { $2 = $0 << 3; $3 = $2 | 4; $4 = (_malloc($3)|0); $scanline$0 = $4; } else { $scanline$0 = $scanline_data; } $5 = HEAP32[$result>>2]|0; $6 = ((($result)) + 4|0); $7 = HEAP32[$6>>2]|0; $8 = (($7) + ($off_y))|0; $9 = (+($8|0)); $10 = $9 + 1.0; $11 = (((($e) + (($n*20)|0)|0)) + 4|0); HEAPF32[$11>>2] = $10; $12 = HEAP32[$6>>2]|0; $13 = ($12|0)>(0); L5: do { if ($13) { $14 = (($scanline$0) + ($5<<2)|0); $$sum1 = (($5) + 1)|0; $15 = (($scanline$0) + ($$sum1<<2)|0); $16 = ((($result)) + 8|0); $17 = ((($result)) + 12|0); $$019 = $e;$j$016 = 0;$y$018 = $off_y; L7: while(1) { $18 = (+($y$018|0)); $19 = $18 + 1.0; $20 = HEAP32[$result>>2]|0; $21 = $20 << 2; _memset(($scanline$0|0),0,($21|0))|0; $22 = HEAP32[$result>>2]|0; $23 = $22 << 2; $24 = (($23) + 4)|0; _memset(($14|0),0,($24|0))|0; $25 = HEAP32[$active$sroa$0>>2]|0; $26 = ($25|0)==(0|0); L9: do { if (!($26)) { $99 = $25;$step$0$ph7 = $active$sroa$0; while(1) { $31 = $99; while(1) { $30 = ((($31)) + 24|0); $32 = +HEAPF32[$30>>2]; $33 = !($32 <= $18); if ($33) { $$lcssa = $31; break; } $34 = HEAP32[$31>>2]|0; HEAP32[$step$0$ph7>>2] = $34; $35 = ((($31)) + 16|0); $36 = +HEAPF32[$35>>2]; $37 = $36 != 0.0; if (!($37)) { label = 11; break L7; } HEAPF32[$35>>2] = 0.0; _stbtt__hheap_free($hh,$31); $38 = HEAP32[$step$0$ph7>>2]|0; $39 = ($38|0)==(0|0); if ($39) { break L9; } else { $31 = $38; } } $40 = HEAP32[$$lcssa>>2]|0; $41 = ($40|0)==(0|0); if ($41) { break; } else { $99 = $40;$step$0$ph7 = $$lcssa; } } } } while(0); $27 = ((($$019)) + 4|0); $28 = +HEAPF32[$27>>2]; $29 = !($28 <= $19); if ($29) { $$1$lcssa = $$019; } else { $$18 = $$019;$45 = $28; while(1) { $42 = ((($$18)) + 12|0); $43 = +HEAPF32[$42>>2]; $44 = $45 != $43; if ($44) { $46 = (_stbtt__new_active($hh,$$18,$off_x,$18)|0); $47 = ($46|0)==(0|0); if (!($47)) { $48 = ((($46)) + 24|0); $49 = +HEAPF32[$48>>2]; $50 = !($49 >= $18); if ($50) { label = 17; break L7; } $51 = HEAP32[$active$sroa$0>>2]|0; HEAP32[$46>>2] = $51; $52 = $46; HEAP32[$active$sroa$0>>2] = $52; } } $53 = ((($$18)) + 20|0); $54 = ((($$18)) + 24|0); $55 = +HEAPF32[$54>>2]; $56 = !($55 <= $19); if ($56) { $$1$lcssa = $53; break; } else { $$18 = $53;$45 = $55; } } } $57 = HEAP32[$active$sroa$0>>2]|0; $58 = ($57|0)==(0); if (!($58)) { $59 = $57; $60 = HEAP32[$result>>2]|0; _stbtt__fill_active_edges_new($scanline$0,$15,$60,$59,$18); } $61 = HEAP32[$result>>2]|0; $62 = ($61|0)>(0); if ($62) { $i$010 = 0;$sum$011 = 0.0; while(1) { $$sum = (($i$010) + ($5))|0; $65 = (($scanline$0) + ($$sum<<2)|0); $66 = +HEAPF32[$65>>2]; $67 = $sum$011 + $66; $68 = (($scanline$0) + ($i$010<<2)|0); $69 = +HEAPF32[$68>>2]; $70 = $69 + $67; $fabsf = (+Math_abs((+$70))); $71 = $fabsf * 255.0; $72 = $71 + 0.5; $73 = (~~(($72))); $74 = ($73|0)>(255); $75 = $73&255; $76 = $74 ? -1 : $75; $77 = HEAP32[$16>>2]|0; $78 = Math_imul($77, $j$016)|0; $79 = (($78) + ($i$010))|0; $80 = HEAP32[$17>>2]|0; $81 = (($80) + ($79)|0); HEAP8[$81>>0] = $76; $82 = (($i$010) + 1)|0; $83 = HEAP32[$result>>2]|0; $84 = ($82|0)<($83|0); if ($84) { $i$010 = $82;$sum$011 = $67; } else { break; } } } $63 = HEAP32[$active$sroa$0>>2]|0; $64 = ($63|0)==(0|0); if (!($64)) { $86 = $63;$step$113 = $active$sroa$0; while(1) { $85 = ((($86)) + 8|0); $87 = +HEAPF32[$85>>2]; $88 = ((($86)) + 4|0); $89 = +HEAPF32[$88>>2]; $90 = $87 + $89; HEAPF32[$88>>2] = $90; $91 = HEAP32[$step$113>>2]|0; $92 = HEAP32[$91>>2]|0; $93 = ($92|0)==(0|0); if ($93) { break; } else { $86 = $92;$step$113 = $91; } } } $94 = (($y$018) + 1)|0; $95 = (($j$016) + 1)|0; $96 = HEAP32[$6>>2]|0; $97 = ($95|0)<($96|0); if ($97) { $$019 = $$1$lcssa;$j$016 = $95;$y$018 = $94; } else { break L5; } } if ((label|0) == 11) { ___assert_fail((20632|0),(14173|0),2099,(20645|0)); // unreachable; } else if ((label|0) == 17) { ___assert_fail((20675|0),(14173|0),2112,(20645|0)); // unreachable; } } } while(0); _stbtt__hheap_cleanup($hh); $98 = ($scanline$0|0)==($scanline_data|0); if ($98) { STACKTOP = sp;return; } _free($scanline$0); STACKTOP = sp;return; } function _stbtt__hheap_free($hh,$p) { $hh = $hh|0; $p = $p|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($hh)) + 4|0); $1 = HEAP32[$0>>2]|0; HEAP32[$p>>2] = $1; HEAP32[$0>>2] = $p; return; } function _stbtt__new_active($hh,$e,$off_x,$start_point) { $hh = $hh|0; $e = $e|0; $off_x = $off_x|0; $start_point = +$start_point; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (_stbtt__hheap_alloc($hh)|0); $1 = ((($e)) + 8|0); $2 = +HEAPF32[$1>>2]; $3 = +HEAPF32[$e>>2]; $4 = $2 - $3; $5 = ((($e)) + 12|0); $6 = +HEAPF32[$5>>2]; $7 = ((($e)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = $6 - $8; $10 = $4 / $9; $11 = ($0|0)==(0|0); if ($11) { ___assert_fail((20965|0),(14173|0),1700,(20981|0)); // unreachable; } else { $12 = ((($0)) + 8|0); HEAPF32[$12>>2] = $10; $13 = $10 != 0.0; $14 = 1.0 / $10; $15 = $13 ? $14 : 0.0; $16 = ((($0)) + 12|0); HEAPF32[$16>>2] = $15; $17 = +HEAPF32[$e>>2]; $18 = +HEAPF32[$7>>2]; $19 = $start_point - $18; $20 = $10 * $19; $21 = $17 + $20; $22 = ((($0)) + 4|0); $23 = (+($off_x|0)); $24 = $21 - $23; HEAPF32[$22>>2] = $24; $25 = ((($e)) + 16|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)!=(0); $28 = $27 ? 1.0 : -1.0; $29 = ((($0)) + 16|0); HEAPF32[$29>>2] = $28; $30 = HEAP32[$7>>2]|0; $31 = ((($0)) + 20|0); HEAP32[$31>>2] = $30; $32 = HEAP32[$5>>2]|0; $33 = ((($0)) + 24|0); HEAP32[$33>>2] = $32; HEAP32[$0>>2] = 0; return ($0|0); } return (0)|0; } function _stbtt__fill_active_edges_new($scanline,$scanline_fill,$len,$e,$y_top) { $scanline = $scanline|0; $scanline_fill = $scanline_fill|0; $len = $len|0; $e = $e|0; $y_top = +$y_top; var $$014 = 0, $$not = 0, $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0.0; var $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0; var $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0; var $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0; var $area$0$lcssa = 0.0, $area$012 = 0.0, $brmerge = 0, $dy$0 = 0.0, $exitcond = 0, $exitcond20 = 0, $fabsf = 0.0, $or$cond = 0, $or$cond2 = 0, $or$cond3 = 0, $or$cond4 = 0, $or$cond5 = 0, $or$cond6 = 0, $or$cond7 = 0, $or$cond8 = 0, $or$cond9 = 0, $sy0$0 = 0.0, $sy0$1 = 0.0, $sy1$0 = 0.0, $sy1$1 = 0.0; var $x01$0 = 0.0, $x2$011 = 0, $x4$010 = 0, $x_bottom$0 = 0.0, $x_bottom$1 = 0.0, $x_top$0 = 0.0, $x_top$1 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = $y_top + 1.0; $1 = ($e|0)==(0|0); if ($1) { return; } $2 = (+($len|0)); $3 = ((($scanline_fill)) + -4|0); $4 = ((($scanline_fill)) + -4|0); $5 = (+($len|0)); $6 = ($len|0)>(0); $$014 = $e; L4: while(1) { $7 = ((($$014)) + 24|0); $8 = +HEAPF32[$7>>2]; $9 = $8 >= $y_top; if (!($9)) { label = 4; break; } $10 = ((($$014)) + 8|0); $11 = +HEAPF32[$10>>2]; $12 = $11 == 0.0; $13 = ((($$014)) + 4|0); $14 = +HEAPF32[$13>>2]; do { if ($12) { $15 = $14 < $2; if ($15) { $16 = !($14 >= 0.0); if ($16) { _stbtt__handle_clipped_edge($3,0,$$014,$14,$y_top,$14,$0); break; } else { $17 = (~~(($14))); _stbtt__handle_clipped_edge($scanline,$17,$$014,$14,$y_top,$14,$0); $18 = (($17) + 1)|0; _stbtt__handle_clipped_edge($4,$18,$$014,$14,$y_top,$14,$0); break; } } } else { $19 = $11 + $14; $20 = ((($$014)) + 12|0); $21 = +HEAPF32[$20>>2]; $22 = ((($$014)) + 20|0); $23 = +HEAPF32[$22>>2]; $24 = !($23 <= $0); $$not = $9 ^ 1; $brmerge = $24 | $$not; if ($brmerge) { label = 11; break L4; } $25 = $23 > $y_top; if ($25) { $26 = $23 - $y_top; $27 = $11 * $26; $28 = $14 + $27; $sy0$0 = $23;$x_top$0 = $28; } else { $sy0$0 = $y_top;$x_top$0 = $14; } $29 = +HEAPF32[$7>>2]; $30 = $29 < $0; if ($30) { $31 = $29 - $y_top; $32 = $11 * $31; $33 = $14 + $32; $sy1$0 = $29;$x_bottom$0 = $33; } else { $sy1$0 = $0;$x_bottom$0 = $19; } $34 = $x_top$0 >= 0.0; $35 = $x_bottom$0 >= 0.0; $or$cond = $34 & $35; if ($or$cond) { $36 = $x_top$0 < $5; $37 = $x_bottom$0 < $5; $or$cond2 = $36 & $37; if ($or$cond2) { $38 = (~~(($x_top$0))); $39 = (~~(($x_bottom$0))); $40 = ($38|0)==($39|0); if ($40) { $41 = $sy1$0 - $sy0$0; $42 = ($38|0)>(-1); $43 = ($38|0)<($len|0); $or$cond3 = $42 & $43; if (!($or$cond3)) { label = 21; break L4; } $44 = ((($$014)) + 16|0); $45 = +HEAPF32[$44>>2]; $46 = (+($38|0)); $47 = $x_top$0 - $46; $48 = $x_bottom$0 - $46; $49 = $47 + $48; $50 = $49 * 0.5; $51 = 1.0 - $50; $52 = $51 * $45; $53 = $41 * $52; $54 = (($scanline) + ($38<<2)|0); $55 = +HEAPF32[$54>>2]; $56 = $55 + $53; HEAPF32[$54>>2] = $56; $57 = +HEAPF32[$44>>2]; $58 = $41 * $57; $59 = (($scanline_fill) + ($38<<2)|0); $60 = +HEAPF32[$59>>2]; $61 = $60 + $58; HEAPF32[$59>>2] = $61; break; } $62 = $x_top$0 > $x_bottom$0; if ($62) { $63 = $sy0$0 - $y_top; $64 = $0 - $63; $65 = $sy1$0 - $y_top; $66 = $0 - $65; $67 = -$21; $dy$0 = $67;$sy0$1 = $66;$sy1$1 = $64;$x01$0 = $19;$x_bottom$1 = $x_top$0;$x_top$1 = $x_bottom$0; } else { $dy$0 = $21;$sy0$1 = $sy0$0;$sy1$1 = $sy1$0;$x01$0 = $14;$x_bottom$1 = $x_bottom$0;$x_top$1 = $x_top$0; } $68 = (~~(($x_top$1))); $69 = (~~(($x_bottom$1))); $70 = (($68) + 1)|0; $71 = (+($70|0)); $72 = $71 - $x01$0; $73 = $dy$0 * $72; $74 = $73 + $y_top; $75 = ((($$014)) + 16|0); $76 = +HEAPF32[$75>>2]; $77 = $74 - $sy0$1; $78 = $76 * $77; $79 = (+($68|0)); $80 = $x_top$1 - $79; $81 = $80 + 1.0; $82 = $81 * 0.5; $83 = 1.0 - $82; $84 = $83 * $78; $85 = (($scanline) + ($68<<2)|0); $86 = +HEAPF32[$85>>2]; $87 = $86 + $84; HEAPF32[$85>>2] = $87; $88 = $dy$0 * $76; $89 = ($69|0)>($70|0); if ($89) { $90 = $88 * 0.5; $area$012 = $78;$x2$011 = $70; while(1) { $91 = $90 + $area$012; $92 = (($scanline) + ($x2$011<<2)|0); $93 = +HEAPF32[$92>>2]; $94 = $91 + $93; HEAPF32[$92>>2] = $94; $95 = $88 + $area$012; $96 = (($x2$011) + 1)|0; $exitcond20 = ($96|0)==($69|0); if ($exitcond20) { $area$0$lcssa = $95; break; } else { $area$012 = $95;$x2$011 = $96; } } } else { $area$0$lcssa = $78; } $fabsf = (+Math_abs((+$area$0$lcssa))); $97 = !($fabsf <= 1.0099999904632568); if ($97) { label = 29; break L4; } $98 = (($69) - ($70))|0; $99 = (+($98|0)); $100 = $dy$0 * $99; $101 = $100 + $74; $102 = (+($69|0)); $103 = $x_bottom$1 - $102; $104 = $103 + 0.0; $105 = $104 * 0.5; $106 = 1.0 - $105; $107 = $76 * $106; $108 = $sy1$1 - $101; $109 = $107 * $108; $110 = $109 + $area$0$lcssa; $111 = (($scanline) + ($69<<2)|0); $112 = +HEAPF32[$111>>2]; $113 = $110 + $112; HEAPF32[$111>>2] = $113; $114 = $sy1$1 - $sy0$1; $115 = $114 * $76; $116 = (($scanline_fill) + ($69<<2)|0); $117 = +HEAPF32[$116>>2]; $118 = $115 + $117; HEAPF32[$116>>2] = $118; break; } } if ($6) { $x4$010 = 0; while(1) { $119 = (+($x4$010|0)); $120 = (($x4$010) + 1)|0; $121 = (+($120|0)); $122 = $119 - $14; $123 = $122 / $11; $124 = $123 + $y_top; $125 = $121 - $14; $126 = $125 / $11; $127 = $126 + $y_top; $128 = $14 < $119; $129 = $19 > $121; $or$cond4 = $128 & $129; do { if ($or$cond4) { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$119,$124); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$121,$127); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$19,$0); } else { $130 = $19 < $119; $131 = $14 > $121; $or$cond5 = $130 & $131; if ($or$cond5) { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$121,$127); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$119,$124); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$19,$0); break; } $132 = $19 > $119; $or$cond6 = $128 & $132; if ($or$cond6) { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$119,$124); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$19,$0); break; } $133 = $14 > $119; $or$cond7 = $130 & $133; if ($or$cond7) { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$119,$124); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$119,$124,$19,$0); break; } $134 = $14 < $121; $or$cond8 = $134 & $129; if ($or$cond8) { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$121,$127); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$19,$0); break; } $135 = $19 < $121; $or$cond9 = $135 & $131; if ($or$cond9) { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$121,$127); _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$121,$127,$19,$0); break; } else { _stbtt__handle_clipped_edge($scanline,$x4$010,$$014,$14,$y_top,$19,$0); break; } } } while(0); $exitcond = ($120|0)==($len|0); if ($exitcond) { break; } else { $x4$010 = $120; } } } } } while(0); $136 = HEAP32[$$014>>2]|0; $137 = ($136|0)==(0|0); if ($137) { label = 46; break; } else { $$014 = $136; } } if ((label|0) == 4) { ___assert_fail((20695|0),(14173|0),1912,(20710|0)); // unreachable; } else if ((label|0) == 11) { ___assert_fail((20739|0),(14173|0),1931,(20710|0)); // unreachable; } else if ((label|0) == 21) { ___assert_fail((20775|0),(14173|0),1959,(20710|0)); // unreachable; } else if ((label|0) == 29) { ___assert_fail((20793|0),(14173|0),1996,(20710|0)); // unreachable; } else if ((label|0) == 46) { return; } } function _stbtt__hheap_cleanup($hh) { $hh = $hh|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $c$01 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[$hh>>2]|0; $1 = ($0|0)==(0|0); if ($1) { return; } else { $c$01 = $0; } while(1) { $2 = HEAP32[$c$01>>2]|0; _free($c$01); $3 = ($2|0)==(0|0); if ($3) { break; } else { $c$01 = $2; } } return; } function _stbtt__handle_clipped_edge($scanline,$x,$e,$x0,$y0,$x1,$y1) { $scanline = $scanline|0; $x = $x|0; $e = $e|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; var $$0 = 0.0, $$01 = 0.0, $$02 = 0.0, $$03 = 0.0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0; var $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0; var $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0; var $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond4 = 0, $or$cond5 = 0, $or$cond6 = 0, $or$cond7 = 0, $or$cond8 = 0, $or$cond9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $y0 == $y1; if ($0) { return; } $1 = $y0 < $y1; if (!($1)) { ___assert_fail((20813|0),(14173|0),1870,(20821|0)); // unreachable; } $2 = ((($e)) + 20|0); $3 = +HEAPF32[$2>>2]; $4 = ((($e)) + 24|0); $5 = +HEAPF32[$4>>2]; $6 = !($3 <= $5); if ($6) { ___assert_fail((20848|0),(14173|0),1871,(20821|0)); // unreachable; } $7 = $5 < $y0; $8 = $3 > $y1; $or$cond = $8 | $7; if ($or$cond) { return; } $9 = $3 > $y0; if ($9) { $10 = $x1 - $x0; $11 = $3 - $y0; $12 = $10 * $11; $13 = $y1 - $y0; $14 = $12 / $13; $15 = $14 + $x0; $$02 = $3;$$03 = $15; } else { $$02 = $y0;$$03 = $x0; } $16 = +HEAPF32[$4>>2]; $17 = $16 < $y1; if ($17) { $18 = $x1 - $$03; $19 = $16 - $y1; $20 = $18 * $19; $21 = $y1 - $$02; $22 = $20 / $21; $23 = $22 + $x1; $$0 = $16;$$01 = $23; } else { $$0 = $y1;$$01 = $x1; } $24 = (+($x|0)); $25 = $$03 == $24; $26 = (($x) + 1)|0; $27 = (+($26|0)); do { if ($25) { $28 = !($$01 <= $27); if ($28) { ___assert_fail((20863|0),(14173|0),1884,(20821|0)); // unreachable; } } else { $29 = $$03 == $27; if ($29) { $30 = !($$01 >= $24); if (!($30)) { break; } ___assert_fail((20873|0),(14173|0),1886,(20821|0)); // unreachable; } $31 = !($$03 <= $24); if (!($31)) { $32 = !($$01 <= $24); if (!($32)) { break; } ___assert_fail((20881|0),(14173|0),1888,(20821|0)); // unreachable; } $33 = !($$03 >= $27); if ($33) { $35 = !($$01 >= $24); $36 = !($$01 <= $27); $or$cond4 = $35 | $36; if (!($or$cond4)) { break; } ___assert_fail((20899|0),(14173|0),1892,(20821|0)); // unreachable; } else { $34 = !($$01 >= $27); if (!($34)) { break; } ___assert_fail((20889|0),(14173|0),1890,(20821|0)); // unreachable; } } } while(0); $37 = !($$03 <= $24); $38 = !($$01 <= $24); $or$cond5 = $37 | $38; if (!($or$cond5)) { $39 = ((($e)) + 16|0); $40 = +HEAPF32[$39>>2]; $41 = $$0 - $$02; $42 = $41 * $40; $43 = (($scanline) + ($x<<2)|0); $44 = +HEAPF32[$43>>2]; $45 = $44 + $42; HEAPF32[$43>>2] = $45; return; } $46 = !($$03 >= $27); $47 = !($$01 >= $27); $or$cond6 = $46 | $47; if (!($or$cond6)) { return; } $48 = !($$03 >= $24); $49 = !($$03 <= $27); $or$cond7 = $48 | $49; $50 = !($$01 >= $24); $or$cond8 = $or$cond7 | $50; $51 = !($$01 <= $27); $or$cond9 = $51 | $or$cond8; if ($or$cond9) { ___assert_fail((20920|0),(14173|0),1899,(20821|0)); // unreachable; } $52 = ((($e)) + 16|0); $53 = +HEAPF32[$52>>2]; $54 = $$0 - $$02; $55 = $54 * $53; $56 = $$03 - $24; $57 = $$01 - $24; $58 = $56 + $57; $59 = $58 * 0.5; $60 = 1.0 - $59; $61 = $60 * $55; $62 = (($scanline) + ($x<<2)|0); $63 = +HEAPF32[$62>>2]; $64 = $63 + $61; HEAPF32[$62>>2] = $64; return; } function _stbtt__hheap_alloc($hh) { $hh = $hh|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($hh)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if (!($2)) { $3 = HEAP32[$1>>2]|0; HEAP32[$0>>2] = $3; $$0 = $1; return ($$0|0); } $4 = ((($hh)) + 8|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)==(0); do { if ($6) { $7 = (_malloc(56004)|0); $8 = ($7|0)==(0|0); if ($8) { $$0 = 0; return ($$0|0); } else { $9 = HEAP32[$hh>>2]|0; HEAP32[$7>>2] = $9; HEAP32[$hh>>2] = $7; HEAP32[$4>>2] = 2000; break; } } } while(0); $10 = HEAP32[$4>>2]|0; $11 = (($10) + -1)|0; HEAP32[$4>>2] = $11; $12 = HEAP32[$hh>>2]|0; $13 = ($11*28)|0; $14 = (($12) + ($13)|0); $$0 = $14; return ($$0|0); } function _stbtt__sort_edges_quicksort($p,$n) { $p = $p|0; $n = $n|0; var $$0$ph9 = 0, $$01$ph8 = 0, $$017 = 0, $$lcssa = 0, $$lcssa$lcssa = 0, $$lcssa31 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0; var $9 = 0, $i$0 = 0, $i$0$lcssa = 0, $i$0$lcssa$lcssa = 0, $i$0$ph = 0, $j$0$ph = 0, $j$1 = 0, $j$1$lcssa = 0, $j$1$lcssa$lcssa = 0, $j$1$lcssa$lcssa$lcssa = 0, $t = 0, $tmp = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $t = sp; $0 = ($n|0)>(12); if (!($0)) { STACKTOP = sp;return; } $$0$ph9 = $p;$$01$ph8 = $n; L4: while(1) { $1 = ((($$0$ph9)) + 4|0); $$017 = $$01$ph8; while(1) { $2 = $$017 >> 1; $3 = +HEAPF32[$1>>2]; $4 = (($$0$ph9) + (($2*20)|0)|0); $5 = (((($$0$ph9) + (($2*20)|0)|0)) + 4|0); $6 = +HEAPF32[$5>>2]; $7 = $3 < $6; $8 = (($$017) + -1)|0; $9 = (((($$0$ph9) + (($8*20)|0)|0)) + 4|0); $10 = +HEAPF32[$9>>2]; $11 = $6 < $10; $12 = $7 ^ $11; if ($12) { $13 = $3 < $10; $tmp = $13 ^ $11; $14 = $tmp ? $8 : 0; $15 = (($$0$ph9) + (($14*20)|0)|0); ;HEAP32[$t>>2]=HEAP32[$15>>2]|0;HEAP32[$t+4>>2]=HEAP32[$15+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$15+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$15+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$15+16>>2]|0; ;HEAP32[$15>>2]=HEAP32[$4>>2]|0;HEAP32[$15+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$15+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$15+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$15+16>>2]=HEAP32[$4+16>>2]|0; ;HEAP32[$4>>2]=HEAP32[$t>>2]|0;HEAP32[$4+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$4+16>>2]=HEAP32[$t+16>>2]|0; } ;HEAP32[$t>>2]=HEAP32[$$0$ph9>>2]|0;HEAP32[$t+4>>2]=HEAP32[$$0$ph9+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$$0$ph9+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$$0$ph9+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$$0$ph9+16>>2]|0; ;HEAP32[$$0$ph9>>2]=HEAP32[$4>>2]|0;HEAP32[$$0$ph9+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$0$ph9+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$0$ph9+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$$0$ph9+16>>2]=HEAP32[$4+16>>2]|0; ;HEAP32[$4>>2]=HEAP32[$t>>2]|0;HEAP32[$4+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$4+16>>2]=HEAP32[$t+16>>2]|0; $i$0$ph = 1;$j$0$ph = $8; while(1) { $16 = +HEAPF32[$1>>2]; $i$0 = $i$0$ph; while(1) { $17 = (((($$0$ph9) + (($i$0*20)|0)|0)) + 4|0); $18 = +HEAPF32[$17>>2]; $19 = $18 < $16; $20 = (($i$0) + 1)|0; if ($19) { $i$0 = $20; } else { $i$0$lcssa = $i$0; break; } } $21 = +HEAPF32[$1>>2]; $j$1 = $j$0$ph; while(1) { $22 = (((($$0$ph9) + (($j$1*20)|0)|0)) + 4|0); $23 = +HEAPF32[$22>>2]; $24 = $21 < $23; $25 = (($j$1) + -1)|0; if ($24) { $j$1 = $25; } else { $j$1$lcssa = $j$1; break; } } $26 = (($$0$ph9) + (($i$0$lcssa*20)|0)|0); $27 = ($i$0$lcssa|0)<($j$1$lcssa|0); if (!($27)) { $$lcssa = $26;$i$0$lcssa$lcssa = $i$0$lcssa;$j$1$lcssa$lcssa = $j$1$lcssa; break; } $28 = (($$0$ph9) + (($j$1$lcssa*20)|0)|0); ;HEAP32[$t>>2]=HEAP32[$26>>2]|0;HEAP32[$t+4>>2]=HEAP32[$26+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$26+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$26+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$26+16>>2]|0; ;HEAP32[$26>>2]=HEAP32[$28>>2]|0;HEAP32[$26+4>>2]=HEAP32[$28+4>>2]|0;HEAP32[$26+8>>2]=HEAP32[$28+8>>2]|0;HEAP32[$26+12>>2]=HEAP32[$28+12>>2]|0;HEAP32[$26+16>>2]=HEAP32[$28+16>>2]|0; ;HEAP32[$28>>2]=HEAP32[$t>>2]|0;HEAP32[$28+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$28+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$28+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$28+16>>2]=HEAP32[$t+16>>2]|0; $29 = (($i$0$lcssa) + 1)|0; $30 = (($j$1$lcssa) + -1)|0; $i$0$ph = $29;$j$0$ph = $30; } $31 = (($$017) - ($i$0$lcssa$lcssa))|0; $32 = ($j$1$lcssa$lcssa|0)<($31|0); if ($32) { $$lcssa$lcssa = $$lcssa;$$lcssa31 = $31;$j$1$lcssa$lcssa$lcssa = $j$1$lcssa$lcssa; break; } _stbtt__sort_edges_quicksort($$lcssa,$31); $34 = ($j$1$lcssa$lcssa|0)>(12); if ($34) { $$017 = $j$1$lcssa$lcssa; } else { label = 16; break L4; } } _stbtt__sort_edges_quicksort($$0$ph9,$j$1$lcssa$lcssa$lcssa); $33 = ($$lcssa31|0)>(12); if ($33) { $$0$ph9 = $$lcssa$lcssa;$$01$ph8 = $$lcssa31; } else { label = 16; break; } } if ((label|0) == 16) { STACKTOP = sp;return; } } function _stbtt__sort_edges_ins_sort($p,$n) { $p = $p|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, $exitcond = 0, $i$04 = 0; var $j$0$lcssa = 0, $j$01 = 0, $t$sroa$3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $t$sroa$3 = sp; $0 = ($n|0)>(1); if (!($0)) { STACKTOP = sp;return; } $i$04 = 1; while(1) { $1 = (($p) + (($i$04*20)|0)|0); $2 = HEAP32[$1>>2]|0; $3 = (((($p) + (($i$04*20)|0)|0)) + 4|0); $4 = +HEAPF32[$3>>2]; $5 = (((($p) + (($i$04*20)|0)|0)) + 8|0); ;HEAP32[$t$sroa$3>>2]=HEAP32[$5>>2]|0;HEAP32[$t$sroa$3+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$t$sroa$3+8>>2]=HEAP32[$5+8>>2]|0; $j$01 = $i$04; while(1) { $6 = (($j$01) + -1)|0; $7 = (((($p) + (($6*20)|0)|0)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = $4 < $8; if (!($9)) { $j$0$lcssa = $j$01; break; } $10 = (($p) + (($6*20)|0)|0); $11 = (($p) + (($j$01*20)|0)|0); ;HEAP32[$11>>2]=HEAP32[$10>>2]|0;HEAP32[$11+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[$11+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[$11+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[$11+16>>2]=HEAP32[$10+16>>2]|0; $12 = ($j$01|0)>(1); if ($12) { $j$01 = $6; } else { $j$0$lcssa = $6; break; } } $13 = ($i$04|0)==($j$0$lcssa|0); if (!($13)) { $14 = (($p) + (($j$0$lcssa*20)|0)|0); HEAP32[$14>>2] = $2; $15 = (((($p) + (($j$0$lcssa*20)|0)|0)) + 4|0); HEAPF32[$15>>2] = $4; $16 = (((($p) + (($j$0$lcssa*20)|0)|0)) + 8|0); ;HEAP32[$16>>2]=HEAP32[$t$sroa$3>>2]|0;HEAP32[$16+4>>2]=HEAP32[$t$sroa$3+4>>2]|0;HEAP32[$16+8>>2]=HEAP32[$t$sroa$3+8>>2]|0; } $17 = (($i$04) + 1)|0; $exitcond = ($17|0)==($n|0); if ($exitcond) { break; } else { $i$04 = $17; } } STACKTOP = sp;return; } function _stbtt__add_point($points,$n,$x,$y) { $points = $points|0; $n = $n|0; $x = +$x; $y = +$y; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($points|0)==(0|0); if ($0) { return; } $1 = (($points) + ($n<<3)|0); HEAPF32[$1>>2] = $x; $2 = (((($points) + ($n<<3)|0)) + 4|0); HEAPF32[$2>>2] = $y; return; } function _stbtt__tesselate_curve($points,$num_points,$x0,$y0,$x1,$y1,$x2,$y2,$objspace_flatness_squared,$n) { $points = $points|0; $num_points = $num_points|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; $x2 = +$x2; $y2 = +$y2; $objspace_flatness_squared = +$objspace_flatness_squared; $n = $n|0; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0; var $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $n$tr5 = 0, $x0$tr1 = 0.0, $x0$tr1$phi = 0.0, $x1$tr3 = 0.0, $y0$tr2 = 0.0, $y0$tr2$phi = 0.0, $y1$tr4 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = $x1 * 2.0; $1 = $0 + $x0; $2 = $1 + $x2; $3 = $2 * 0.25; $4 = $y1 * 2.0; $5 = $4 + $y0; $6 = $5 + $y2; $7 = $6 * 0.25; $8 = ($n|0)>(16); if ($8) { return; } $9 = $y2 + $y0; $10 = $9 * 0.5; $11 = $10 - $7; $12 = $x2 + $x0; $13 = $12 * 0.5; $14 = $13 - $3; $16 = $14;$18 = $11;$26 = $3;$27 = $7;$n$tr5 = $n;$x0$tr1 = $x0;$x1$tr3 = $x1;$y0$tr2 = $y0;$y1$tr4 = $y1; while(1) { $15 = $16 * $16; $17 = $18 * $18; $19 = $15 + $17; $20 = $19 > $objspace_flatness_squared; if (!($20)) { break; } $21 = $x0$tr1 + $x1$tr3; $22 = $21 * 0.5; $23 = $y0$tr2 + $y1$tr4; $24 = $23 * 0.5; $25 = (($n$tr5) + 1)|0; _stbtt__tesselate_curve($points,$num_points,$x0$tr1,$y0$tr2,$22,$24,$26,$27,$objspace_flatness_squared,$25); $28 = $x1$tr3 + $x2; $29 = $28 * 0.5; $30 = $y1$tr4 + $y2; $31 = $30 * 0.5; $32 = $29 * 2.0; $33 = $26 + $32; $34 = $33 + $x2; $35 = $34 * 0.25; $36 = $31 * 2.0; $37 = $27 + $36; $38 = $37 + $y2; $39 = $38 * 0.25; $40 = $26 + $x2; $41 = $40 * 0.5; $42 = $41 - $35; $43 = $27 + $y2; $44 = $43 * 0.5; $45 = $44 - $39; $46 = ($n$tr5|0)>(15); if ($46) { label = 6; break; } else { $y0$tr2$phi = $27;$x0$tr1$phi = $26;$16 = $42;$18 = $45;$26 = $35;$27 = $39;$n$tr5 = $25;$x1$tr3 = $29;$y1$tr4 = $31;$y0$tr2 = $y0$tr2$phi;$x0$tr1 = $x0$tr1$phi; } } if ((label|0) == 6) { return; } $47 = HEAP32[$num_points>>2]|0; _stbtt__add_point($points,$47,$x2,$y2); $48 = HEAP32[$num_points>>2]|0; $49 = (($48) + 1)|0; HEAP32[$num_points>>2] = $49; return; } function _ErrorCallback($error,$description) { $error = $error|0; $description = $description|0; var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; HEAP32[$vararg_buffer>>2] = $error; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $description; _TraceLog(2,23792,$vararg_buffer); STACKTOP = sp;return; } function _SetupFramebufferSize($displayWidth,$displayHeight) { $displayWidth = $displayWidth|0; $displayHeight = $displayHeight|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0; var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, $or$cond = 0, $roundf = 0.0, $roundf1 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $storemerge = 0, $vararg_buffer = 0, $vararg_buffer4 = 0; var $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $vararg_buffer8 = sp + 24|0; $vararg_buffer4 = sp + 16|0; $vararg_buffer = sp; $0 = sp + 40|0; $1 = HEAP32[816>>2]|0; $2 = ($1|0)>($displayWidth|0); if (!($2)) { $3 = HEAP32[820>>2]|0; $4 = ($3|0)>($displayHeight|0); if (!($4)) { $29 = ($1|0)<($displayWidth|0); $30 = ($3|0)<($displayHeight|0); $or$cond = $29 | $30; if (!($or$cond)) { HEAP32[996>>2] = $1; $51 = HEAP32[820>>2]|0; HEAP32[1000>>2] = $51; HEAP32[988>>2] = 0; HEAP32[992>>2] = 0; STACKTOP = sp;return; } HEAP32[$vararg_buffer8>>2] = $1; $vararg_ptr11 = ((($vararg_buffer8)) + 4|0); HEAP32[$vararg_ptr11>>2] = $3; $vararg_ptr12 = ((($vararg_buffer8)) + 8|0); HEAP32[$vararg_ptr12>>2] = $displayWidth; $vararg_ptr13 = ((($vararg_buffer8)) + 12|0); HEAP32[$vararg_ptr13>>2] = $displayHeight; _TraceLog(0,23726,$vararg_buffer8); $31 = (+($displayWidth|0)); $32 = (+($displayHeight|0)); $33 = $31 / $32; $34 = HEAP32[816>>2]|0; $35 = (+($34|0)); $36 = HEAP32[820>>2]|0; $37 = (+($36|0)); $38 = $35 / $37; $39 = !($33 <= $38); if ($39) { $46 = $33 * $37; $roundf = (+_roundf($46)); $47 = (~~(($roundf))); HEAP32[996>>2] = $47; $48 = HEAP32[820>>2]|0; HEAP32[1000>>2] = $48; $49 = HEAP32[816>>2]|0; $50 = (($47) - ($49))|0; HEAP32[988>>2] = $50; HEAP32[992>>2] = 0; STACKTOP = sp;return; } else { HEAP32[996>>2] = $34; $40 = HEAP32[816>>2]|0; $41 = (+($40|0)); $42 = $41 / $33; $roundf1 = (+_roundf($42)); $43 = (~~(($roundf1))); HEAP32[1000>>2] = $43; HEAP32[988>>2] = 0; $44 = HEAP32[820>>2]|0; $45 = (($43) - ($44))|0; HEAP32[992>>2] = $45; STACKTOP = sp;return; } } } $5 = HEAP32[816>>2]|0; $6 = HEAP32[820>>2]|0; HEAP32[$vararg_buffer>>2] = $5; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $6; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $displayWidth; $vararg_ptr3 = ((($vararg_buffer)) + 12|0); HEAP32[$vararg_ptr3>>2] = $displayHeight; _TraceLog(2,23583,$vararg_buffer); $7 = (+($displayWidth|0)); $8 = HEAP32[816>>2]|0; $9 = (+($8|0)); $10 = $7 / $9; $11 = (+($displayHeight|0)); $12 = HEAP32[820>>2]|0; $13 = (+($12|0)); $14 = $11 / $13; $15 = !($10 <= $14); if ($15) { $21 = $9 * $14; $roundf2 = (+_roundf($21)); $22 = (~~(($roundf2))); HEAP32[996>>2] = $22; HEAP32[1000>>2] = $displayHeight; $23 = (($displayWidth) - ($22))|0; HEAP32[988>>2] = $23; $storemerge = 0; } else { HEAP32[996>>2] = $displayWidth; $16 = HEAP32[820>>2]|0; $17 = (+($16|0)); $18 = $10 * $17; $roundf3 = (+_roundf($18)); $19 = (~~(($roundf3))); HEAP32[1000>>2] = $19; HEAP32[988>>2] = 0; $20 = (($displayHeight) - ($19))|0; $storemerge = $20; } HEAP32[992>>2] = $storemerge; $24 = HEAP32[996>>2]|0; $25 = (+($24|0)); $26 = HEAP32[816>>2]|0; $27 = (+($26|0)); $28 = $25 / $27; _MatrixScale($0,$28,$28,$28); dest=840; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); HEAP32[996>>2] = $displayWidth; HEAP32[1000>>2] = $displayHeight; HEAP32[$vararg_buffer4>>2] = $displayWidth; $vararg_ptr7 = ((($vararg_buffer4)) + 4|0); HEAP32[$vararg_ptr7>>2] = $displayHeight; _TraceLog(2,23661,$vararg_buffer4); STACKTOP = sp;return; } function _WindowSizeCallback($window,$width,$height) { $window = $window|0; $width = $width|0; $height = $height|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $$byval_copy = sp + 4|0; $0 = sp; $1 = HEAP32[988>>2]|0; $2 = HEAP32[992>>2]|0; $3 = HEAP32[996>>2]|0; $4 = HEAP32[1000>>2]|0; _rlglInitGraphics($1,$2,$3,$4); HEAP8[$0>>0] = -11; $5 = ((($0)) + 1|0); HEAP8[$5>>0] = -11; $6 = ((($0)) + 2|0); HEAP8[$6>>0] = -11; $7 = ((($0)) + 3|0); HEAP8[$7>>0] = -1; ;HEAP8[$$byval_copy>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$0+3>>0]|0; _ClearBackground($$byval_copy); STACKTOP = sp;return; } function _CursorEnterCallback($window,$enter) { $window = $window|0; $enter = $enter|0; var label = 0, sp = 0; sp = STACKTOP; return; } function _KeyCallback($window,$key,$scancode,$action,$mods) { $window = $window|0; $key = $key|0; $scancode = $scancode|0; $action = $action|0; $mods = $mods|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[836>>2]|0; $1 = ($0|0)==($key|0); $2 = ($action|0)==(1); $or$cond = $2 & $1; if ($or$cond) { _glfwSetWindowShouldClose(($window|0),1); } else { $3 = $action&255; $4 = (10888 + ($key)|0); HEAP8[$4>>0] = $3; } $5 = ($key|0)==(259); $or$cond3 = $5 & $2; if (!($or$cond3)) { return; } HEAP32[972>>2] = 3; return; } function _MouseButtonCallback($window,$button,$action,$mods) { $window = $window|0; $button = $button|0; $action = $action|0; $mods = $mods|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0; var $27 = 0.0, $28 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; $gestureEvent$byval_copy = sp + 40|0; $gestureEvent = sp + 8|0; $0 = sp; $1 = $action&255; $2 = (11912 + ($button)|0); HEAP8[$2>>0] = $1; $3 = (_IsMouseButtonPressed(0)|0); $4 = ($3|0)==(0); if ($4) { $5 = (_IsMouseButtonReleased(0)|0); $6 = ($5|0)==(0); if (!($6)) { HEAP32[$gestureEvent>>2] = 0; } } else { HEAP32[$gestureEvent>>2] = 1; } $7 = ((($gestureEvent)) + 8|0); HEAP32[$7>>2] = 0; $8 = ((($gestureEvent)) + 4|0); HEAP32[$8>>2] = 1; $9 = ((($gestureEvent)) + 16|0); _GetMousePosition($0); $10 = $0; $11 = $10; $12 = HEAP32[$11>>2]|0; $13 = (($10) + 4)|0; $14 = $13; $15 = HEAP32[$14>>2]|0; $16 = $9; $17 = $16; HEAP32[$17>>2] = $12; $18 = (($16) + 4)|0; $19 = $18; HEAP32[$19>>2] = $15; $20 = (_GetScreenWidth()|0); $21 = (+($20|0)); $22 = +HEAPF32[$9>>2]; $23 = $22 / $21; HEAPF32[$9>>2] = $23; $24 = (_GetScreenHeight()|0); $25 = (+($24|0)); $26 = ((($gestureEvent)) + 20|0); $27 = +HEAPF32[$26>>2]; $28 = $27 / $25; HEAPF32[$26>>2] = $28; ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0; _ProcessGestureEvent($gestureEvent$byval_copy); STACKTOP = sp;return; } function _MouseCursorPosCallback($window,$x,$y) { $window = $window|0; $x = +$x; $y = +$y; var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; $gestureEvent$byval_copy = sp + 32|0; $gestureEvent = sp; HEAP32[$gestureEvent>>2] = 2; $0 = ((($gestureEvent)) + 4|0); HEAP32[$0>>2] = 1; $1 = $x; $2 = $y; $3 = ((($gestureEvent)) + 16|0); HEAPF32[$3>>2] = $1; $4 = ((($gestureEvent)) + 20|0); HEAPF32[$4>>2] = $2; $5 = (_GetScreenWidth()|0); $6 = (+($5|0)); $7 = +HEAPF32[$3>>2]; $8 = $7 / $6; HEAPF32[$3>>2] = $8; $9 = (_GetScreenHeight()|0); $10 = (+($9|0)); $11 = +HEAPF32[$4>>2]; $12 = $11 / $10; HEAPF32[$4>>2] = $12; ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0; _ProcessGestureEvent($gestureEvent$byval_copy); STACKTOP = sp;return; } function _CharCallback($window,$key) { $window = $window|0; $key = $key|0; var label = 0, sp = 0; sp = STACKTOP; HEAP32[972>>2] = $key; return; } function _ScrollCallback($window,$xoffset,$yoffset) { $window = $window|0; $xoffset = +$xoffset; $yoffset = +$yoffset; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (~~(($yoffset))); HEAP32[8648>>2] = $0; return; } function _WindowIconifyCallback($window,$iconified) { $window = $window|0; $iconified = $iconified|0; var $$ = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $not$ = ($iconified|0)!=(0); $$ = $not$&1; HEAP32[832>>2] = $$; return; } function _emscripten_GetProcAddress($name_) { $name_ = $name_|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0; var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0; var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0; var $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0; var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0; var $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0; var $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0; var $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0; var $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0; var $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0; var $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0; var $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0; var $549 = 0, $55 = 0, $550 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0; var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0; var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $end = 0, $name = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $0 = sp + 12|0; $1 = sp + 8|0; $name = sp + 4|0; $end = sp; HEAP32[$1>>2] = $name_; $2 = HEAP32[$1>>2]|0; $3 = (_strlen($2)|0); $4 = (($3) + 1)|0; $5 = (_malloc($4)|0); HEAP32[$name>>2] = $5; $6 = HEAP32[$name>>2]|0; $7 = HEAP32[$1>>2]|0; (_strcpy($6,$7)|0); $8 = HEAP32[$name>>2]|0; $9 = (_strstr($8,23830)|0); HEAP32[$end>>2] = $9; $10 = HEAP32[$end>>2]|0; $11 = ($10|0)!=(0|0); if ($11) { $12 = HEAP32[$end>>2]|0; HEAP8[$12>>0] = 0; } $13 = HEAP32[$name>>2]|0; $14 = (_strstr($13,23834)|0); HEAP32[$end>>2] = $14; $15 = HEAP32[$end>>2]|0; $16 = ($15|0)!=(0|0); if ($16) { $17 = HEAP32[$end>>2]|0; HEAP8[$17>>0] = 0; } $18 = HEAP32[$name>>2]|0; $19 = (_strstr($18,23838)|0); HEAP32[$end>>2] = $19; $20 = HEAP32[$end>>2]|0; $21 = ($20|0)!=(0|0); if ($21) { $22 = HEAP32[$end>>2]|0; HEAP8[$22>>0] = 0; } $23 = HEAP32[$name>>2]|0; $24 = (_strstr($23,23842)|0); HEAP32[$end>>2] = $24; $25 = HEAP32[$end>>2]|0; $26 = ($25|0)!=(0|0); if ($26) { $27 = HEAP32[$end>>2]|0; HEAP8[$27>>0] = 0; } $28 = HEAP32[$name>>2]|0; $29 = (_strcmp($28,23848)|0); $30 = ($29|0)!=(0); do { if ($30) { $31 = HEAP32[$name>>2]|0; $32 = (_strcmp($31,23886)|0); $33 = ($32|0)!=(0); if (!($33)) { HEAP32[$name>>2] = 23905; break; } $34 = HEAP32[$name>>2]|0; $35 = (_strcmp($34,23918)|0); $36 = ($35|0)!=(0); if (!($36)) { HEAP32[$name>>2] = 23939; break; } $37 = HEAP32[$name>>2]|0; $38 = (_strcmp($37,23954)|0); $39 = ($38|0)!=(0); if (!($39)) { HEAP32[$name>>2] = 23969; break; } $40 = HEAP32[$name>>2]|0; $41 = (_strcmp($40,23984)|0); $42 = ($41|0)!=(0); if (!($42)) { HEAP32[$name>>2] = 23999; } } else { HEAP32[$name>>2] = 23870; } } while(0); $43 = HEAP32[$name>>2]|0; $44 = (_strcmp($43,24014)|0); $45 = ($44|0)!=(0); do { if ($45) { $46 = HEAP32[$name>>2]|0; $47 = (_strcmp($46,24028)|0); $48 = ($47|0)!=(0); if (!($48)) { HEAP32[$0>>2] = 3; break; } $49 = HEAP32[$name>>2]|0; $50 = (_strcmp($49,24040)|0); $51 = ($50|0)!=(0); if (!($51)) { HEAP32[$0>>2] = 7; break; } $52 = HEAP32[$name>>2]|0; $53 = (_strcmp($52,24054)|0); $54 = ($53|0)!=(0); if (!($54)) { HEAP32[$0>>2] = 8; break; } $55 = HEAP32[$name>>2]|0; $56 = (_strcmp($55,24066)|0); $57 = ($56|0)!=(0); if (!($57)) { HEAP32[$0>>2] = 9; break; } $58 = HEAP32[$name>>2]|0; $59 = (_strcmp($58,24080)|0); $60 = ($59|0)!=(0); if (!($60)) { HEAP32[$0>>2] = 10; break; } $61 = HEAP32[$name>>2]|0; $62 = (_strcmp($61,24094)|0); $63 = ($62|0)!=(0); if (!($63)) { HEAP32[$0>>2] = 11; break; } $64 = HEAP32[$name>>2]|0; $65 = (_strcmp($64,24111)|0); $66 = ($65|0)!=(0); if (!($66)) { HEAP32[$0>>2] = 1; break; } $67 = HEAP32[$name>>2]|0; $68 = (_strcmp($67,24134)|0); $69 = ($68|0)!=(0); if (!($69)) { HEAP32[$0>>2] = 1; break; } $70 = HEAP32[$name>>2]|0; $71 = (_strcmp($70,24160)|0); $72 = ($71|0)!=(0); if (!($72)) { HEAP32[$0>>2] = 2; break; } $73 = HEAP32[$name>>2]|0; $74 = (_strcmp($73,24173)|0); $75 = ($74|0)!=(0); if (!($75)) { HEAP32[$0>>2] = 3; break; } $76 = HEAP32[$name>>2]|0; $77 = (_strcmp($76,24189)|0); $78 = ($77|0)!=(0); if (!($78)) { HEAP32[$0>>2] = 1; break; } $79 = HEAP32[$name>>2]|0; $80 = (_strcmp($79,24202)|0); $81 = ($80|0)!=(0); if (!($81)) { HEAP32[$0>>2] = 12; break; } $82 = HEAP32[$name>>2]|0; $83 = (_strcmp($82,24216)|0); $84 = ($83|0)!=(0); if (!($84)) { HEAP32[$0>>2] = 3; break; } $85 = HEAP32[$name>>2]|0; $86 = (_strcmp($85,24236)|0); $87 = ($86|0)!=(0); if (!($87)) { HEAP32[$0>>2] = 4; break; } $88 = HEAP32[$name>>2]|0; $89 = (_strcmp($88,24256)|0); $90 = ($89|0)!=(0); if (!($90)) { HEAP32[$0>>2] = 5; break; } $91 = HEAP32[$name>>2]|0; $92 = (_strcmp($91,24273)|0); $93 = ($92|0)!=(0); if (!($93)) { HEAP32[$0>>2] = 6; break; } $94 = HEAP32[$name>>2]|0; $95 = (_strcmp($94,24290)|0); $96 = ($95|0)!=(0); if (!($96)) { HEAP32[$0>>2] = 4; break; } $97 = HEAP32[$name>>2]|0; $98 = (_strcmp($97,24302)|0); $99 = ($98|0)!=(0); if (!($99)) { HEAP32[$0>>2] = 13; break; } $100 = HEAP32[$name>>2]|0; $101 = (_strcmp($100,24315)|0); $102 = ($101|0)!=(0); if (!($102)) { HEAP32[$0>>2] = 14; break; } $103 = HEAP32[$name>>2]|0; $104 = (_strcmp($103,24331)|0); $105 = ($104|0)!=(0); if (!($105)) { HEAP32[$0>>2] = 7; break; } $106 = HEAP32[$name>>2]|0; $107 = (_strcmp($106,24354)|0); $108 = ($107|0)!=(0); if (!($108)) { HEAP32[$0>>2] = 2; break; } $109 = HEAP32[$name>>2]|0; $110 = (_strcmp($109,24367)|0); $111 = ($110|0)!=(0); if (!($111)) { HEAP32[$0>>2] = 3; break; } $112 = HEAP32[$name>>2]|0; $113 = (_strcmp($112,24383)|0); $114 = ($113|0)!=(0); if (!($114)) { HEAP32[$0>>2] = 5; break; } $115 = HEAP32[$name>>2]|0; $116 = (_strcmp($115,24394)|0); $117 = ($116|0)!=(0); if (!($117)) { HEAP32[$0>>2] = 15; break; } $118 = HEAP32[$name>>2]|0; $119 = (_strcmp($118,24413)|0); $120 = ($119|0)!=(0); if (!($120)) { HEAP32[$0>>2] = 16; break; } $121 = HEAP32[$name>>2]|0; $122 = (_strcmp($121,24435)|0); $123 = ($122|0)!=(0); if (!($123)) { HEAP32[$0>>2] = 17; break; } $124 = HEAP32[$name>>2]|0; $125 = (_strcmp($124,24454)|0); $126 = ($125|0)!=(0); if (!($126)) { HEAP32[$0>>2] = 8; break; } $127 = HEAP32[$name>>2]|0; $128 = (_strcmp($127,24483)|0); $129 = ($128|0)!=(0); if (!($129)) { HEAP32[$0>>2] = 6; break; } $130 = HEAP32[$name>>2]|0; $131 = (_strcmp($130,24500)|0); $132 = ($131|0)!=(0); if (!($132)) { HEAP32[$0>>2] = 9; break; } $133 = HEAP32[$name>>2]|0; $134 = (_strcmp($133,24515)|0); $135 = ($134|0)!=(0); if (!($135)) { HEAP32[$0>>2] = 10; break; } $136 = HEAP32[$name>>2]|0; $137 = (_strcmp($136,24530)|0); $138 = ($137|0)!=(0); if (!($138)) { HEAP32[$0>>2] = 3; break; } $139 = HEAP32[$name>>2]|0; $140 = (_strcmp($139,24551)|0); $141 = ($140|0)!=(0); if (!($141)) { HEAP32[$0>>2] = 11; break; } $142 = HEAP32[$name>>2]|0; $143 = (_strcmp($142,24571)|0); $144 = ($143|0)!=(0); if (!($144)) { HEAP32[$0>>2] = 12; break; } $145 = HEAP32[$name>>2]|0; $146 = (_strcmp($145,24591)|0); $147 = ($146|0)!=(0); if (!($147)) { HEAP32[$0>>2] = 13; break; } $148 = HEAP32[$name>>2]|0; $149 = (_strcmp($148,24617)|0); $150 = ($149|0)!=(0); if (!($150)) { HEAP32[$0>>2] = 2; break; } $151 = HEAP32[$name>>2]|0; $152 = (_strcmp($151,24636)|0); $153 = ($152|0)!=(0); if (!($153)) { HEAP32[$0>>2] = 1; break; } $154 = HEAP32[$name>>2]|0; $155 = (_strcmp($154,24648)|0); $156 = ($155|0)!=(0); if (!($156)) { HEAP32[$0>>2] = 3; break; } $157 = HEAP32[$name>>2]|0; $158 = (_strcmp($157,24660)|0); $159 = ($158|0)!=(0); if (!($159)) { HEAP32[$0>>2] = 1; break; } $160 = HEAP32[$name>>2]|0; $161 = (_strcmp($160,24672)|0); $162 = ($161|0)!=(0); if (!($162)) { HEAP32[$0>>2] = 1; break; } $163 = HEAP32[$name>>2]|0; $164 = (_strcmp($163,24684)|0); $165 = ($164|0)!=(0); if (!($165)) { HEAP32[$0>>2] = 18; break; } $166 = HEAP32[$name>>2]|0; $167 = (_strcmp($166,24696)|0); $168 = ($167|0)!=(0); if (!($168)) { HEAP32[$0>>2] = 14; break; } $169 = HEAP32[$name>>2]|0; $170 = (_strcmp($169,24708)|0); $171 = ($170|0)!=(0); if (!($171)) { HEAP32[$0>>2] = 4; break; } $172 = HEAP32[$name>>2]|0; $173 = (_strcmp($172,24720)|0); $174 = ($173|0)!=(0); if (!($174)) { HEAP32[$0>>2] = 2; break; } $175 = HEAP32[$name>>2]|0; $176 = (_strcmp($175,24732)|0); $177 = ($176|0)!=(0); if (!($177)) { HEAP32[$0>>2] = 15; break; } $178 = HEAP32[$name>>2]|0; $179 = (_strcmp($178,24745)|0); $180 = ($179|0)!=(0); if (!($180)) { HEAP32[$0>>2] = 16; break; } $181 = HEAP32[$name>>2]|0; $182 = (_strcmp($181,24758)|0); $183 = ($182|0)!=(0); if (!($183)) { HEAP32[$0>>2] = 17; break; } $184 = HEAP32[$name>>2]|0; $185 = (_strcmp($184,24771)|0); $186 = ($185|0)!=(0); if (!($186)) { HEAP32[$0>>2] = 18; break; } $187 = HEAP32[$name>>2]|0; $188 = (_strcmp($187,24784)|0); $189 = ($188|0)!=(0); if (!($189)) { HEAP32[$0>>2] = 19; break; } $190 = HEAP32[$name>>2]|0; $191 = (_strcmp($190,24797)|0); $192 = ($191|0)!=(0); if (!($192)) { HEAP32[$0>>2] = 20; break; } $193 = HEAP32[$name>>2]|0; $194 = (_strcmp($193,24810)|0); $195 = ($194|0)!=(0); if (!($195)) { HEAP32[$0>>2] = 21; break; } $196 = HEAP32[$name>>2]|0; $197 = (_strcmp($196,24823)|0); $198 = ($197|0)!=(0); if (!($198)) { HEAP32[$0>>2] = 22; break; } $199 = HEAP32[$name>>2]|0; $200 = (_strcmp($199,24836)|0); $201 = ($200|0)!=(0); if (!($201)) { HEAP32[$0>>2] = 5; break; } $202 = HEAP32[$name>>2]|0; $203 = (_strcmp($202,24855)|0); $204 = ($203|0)!=(0); if (!($204)) { HEAP32[$0>>2] = 6; break; } $205 = HEAP32[$name>>2]|0; $206 = (_strcmp($205,24874)|0); $207 = ($206|0)!=(0); if (!($207)) { HEAP32[$0>>2] = 7; break; } $208 = HEAP32[$name>>2]|0; $209 = (_strcmp($208,24893)|0); $210 = ($209|0)!=(0); if (!($210)) { HEAP32[$0>>2] = 19; break; } $211 = HEAP32[$name>>2]|0; $212 = (_strcmp($211,24906)|0); $213 = ($212|0)!=(0); if (!($213)) { HEAP32[$0>>2] = 20; break; } $214 = HEAP32[$name>>2]|0; $215 = (_strcmp($214,24924)|0); $216 = ($215|0)!=(0); if (!($216)) { HEAP32[$0>>2] = 21; break; } $217 = HEAP32[$name>>2]|0; $218 = (_strcmp($217,24942)|0); $219 = ($218|0)!=(0); if (!($219)) { HEAP32[$0>>2] = 22; break; } $220 = HEAP32[$name>>2]|0; $221 = (_strcmp($220,24960)|0); $222 = ($221|0)!=(0); if (!($222)) { HEAP32[$0>>2] = 23; break; } $223 = HEAP32[$name>>2]|0; $224 = (_strcmp($223,24978)|0); $225 = ($224|0)!=(0); if (!($225)) { HEAP32[$0>>2] = 4; break; } $226 = HEAP32[$name>>2]|0; $227 = (_strcmp($226,24998)|0); $228 = ($227|0)!=(0); if (!($228)) { HEAP32[$0>>2] = 3; break; } $229 = HEAP32[$name>>2]|0; $230 = (_strcmp($229,23939)|0); $231 = ($230|0)!=(0); if (!($231)) { HEAP32[$0>>2] = 7; break; } $232 = HEAP32[$name>>2]|0; $233 = (_strcmp($232,25016)|0); $234 = ($233|0)!=(0); if (!($234)) { HEAP32[$0>>2] = 1; break; } $235 = HEAP32[$name>>2]|0; $236 = (_strcmp($235,25031)|0); $237 = ($236|0)!=(0); if (!($237)) { HEAP32[$0>>2] = 8; break; } $238 = HEAP32[$name>>2]|0; $239 = (_strcmp($238,25052)|0); $240 = ($239|0)!=(0); if (!($240)) { HEAP32[$0>>2] = 9; break; } $241 = HEAP32[$name>>2]|0; $242 = (_strcmp($241,25067)|0); $243 = ($242|0)!=(0); if (!($243)) { HEAP32[$0>>2] = 10; break; } $244 = HEAP32[$name>>2]|0; $245 = (_strcmp($244,25085)|0); $246 = ($245|0)!=(0); if (!($246)) { HEAP32[$0>>2] = 2; break; } $247 = HEAP32[$name>>2]|0; $248 = (_strcmp($247,25101)|0); $249 = ($248|0)!=(0); if (!($249)) { HEAP32[$0>>2] = 11; break; } $250 = HEAP32[$name>>2]|0; $251 = (_strcmp($250,25120)|0); $252 = ($251|0)!=(0); if (!($252)) { HEAP32[$0>>2] = 23; break; } $253 = HEAP32[$name>>2]|0; $254 = (_strcmp($253,25134)|0); $255 = ($254|0)!=(0); if (!($255)) { HEAP32[$0>>2] = 24; break; } $256 = HEAP32[$name>>2]|0; $257 = (_strcmp($256,25149)|0); $258 = ($257|0)!=(0); if (!($258)) { HEAP32[$0>>2] = 8; break; } $259 = HEAP32[$name>>2]|0; $260 = (_strcmp($259,23870)|0); $261 = ($260|0)!=(0); if (!($261)) { HEAP32[$0>>2] = 1; break; } $262 = HEAP32[$name>>2]|0; $263 = (_strcmp($262,25160)|0); $264 = ($263|0)!=(0); if (!($264)) { HEAP32[$0>>2] = 3; break; } $265 = HEAP32[$name>>2]|0; $266 = (_strcmp($265,23969)|0); $267 = ($266|0)!=(0); if (!($267)) { HEAP32[$0>>2] = 24; break; } $268 = HEAP32[$name>>2]|0; $269 = (_strcmp($268,23999)|0); $270 = ($269|0)!=(0); if (!($270)) { HEAP32[$0>>2] = 25; break; } $271 = HEAP32[$name>>2]|0; $272 = (_strcmp($271,25176)|0); $273 = ($272|0)!=(0); if (!($273)) { HEAP32[$0>>2] = 12; break; } $274 = HEAP32[$name>>2]|0; $275 = (_strcmp($274,25203)|0); $276 = ($275|0)!=(0); if (!($276)) { HEAP32[$0>>2] = 4; break; } $277 = HEAP32[$name>>2]|0; $278 = (_strcmp($277,25217)|0); $279 = ($278|0)!=(0); if (!($279)) { HEAP32[$0>>2] = 13; break; } $280 = HEAP32[$name>>2]|0; $281 = (_strcmp($280,23905)|0); $282 = ($281|0)!=(0); if (!($282)) { HEAP32[$0>>2] = 5; break; } $283 = HEAP32[$name>>2]|0; $284 = (_strcmp($283,25237)|0); $285 = ($284|0)!=(0); if (!($285)) { HEAP32[$0>>2] = 6; break; } $286 = HEAP32[$name>>2]|0; $287 = (_strcmp($286,25255)|0); $288 = ($287|0)!=(0); if (!($288)) { HEAP32[$0>>2] = 9; break; } $289 = HEAP32[$name>>2]|0; $290 = (_strcmp($289,25267)|0); $291 = ($290|0)!=(0); if (!($291)) { HEAP32[$0>>2] = 25; break; } $292 = HEAP32[$name>>2]|0; $293 = (_strcmp($292,25288)|0); $294 = ($293|0)!=(0); if (!($294)) { HEAP32[$0>>2] = 26; break; } $295 = HEAP32[$name>>2]|0; $296 = (_strcmp($295,25306)|0); $297 = ($296|0)!=(0); if (!($297)) { HEAP32[$0>>2] = 27; break; } $298 = HEAP32[$name>>2]|0; $299 = (_strcmp($298,25324)|0); $300 = ($299|0)!=(0); if (!($300)) { HEAP32[$0>>2] = 28; break; } $301 = HEAP32[$name>>2]|0; $302 = (_strcmp($301,25345)|0); $303 = ($302|0)!=(0); if (!($303)) { HEAP32[$0>>2] = 14; break; } $304 = HEAP32[$name>>2]|0; $305 = (_strcmp($304,25371)|0); $306 = ($305|0)!=(0); if (!($306)) { HEAP32[$0>>2] = 3; break; } $307 = HEAP32[$name>>2]|0; $308 = (_strcmp($307,25394)|0); $309 = ($308|0)!=(0); if (!($309)) { HEAP32[$0>>2] = 15; break; } $310 = HEAP32[$name>>2]|0; $311 = (_strcmp($310,25432)|0); $312 = ($311|0)!=(0); if (!($312)) { HEAP32[$0>>2] = 10; break; } $313 = HEAP32[$name>>2]|0; $314 = (_strcmp($313,25448)|0); $315 = ($314|0)!=(0); if (!($315)) { HEAP32[$0>>2] = 7; break; } $316 = HEAP32[$name>>2]|0; $317 = (_strcmp($316,25463)|0); $318 = ($317|0)!=(0); if (!($318)) { HEAP32[$0>>2] = 26; break; } $319 = HEAP32[$name>>2]|0; $320 = (_strcmp($319,25486)|0); $321 = ($320|0)!=(0); if (!($321)) { HEAP32[$0>>2] = 16; break; } $322 = HEAP32[$name>>2]|0; $323 = (_strcmp($322,25499)|0); $324 = ($323|0)!=(0); if (!($324)) { HEAP32[$0>>2] = 29; break; } $325 = HEAP32[$name>>2]|0; $326 = (_strcmp($325,25513)|0); $327 = ($326|0)!=(0); if (!($327)) { HEAP32[$0>>2] = 30; break; } $328 = HEAP32[$name>>2]|0; $329 = (_strcmp($328,25527)|0); $330 = ($329|0)!=(0); if (!($330)) { HEAP32[$0>>2] = 2; break; } $331 = HEAP32[$name>>2]|0; $332 = (_strcmp($331,25547)|0); $333 = ($332|0)!=(0); if (!($333)) { HEAP32[$0>>2] = 8; break; } $334 = HEAP32[$name>>2]|0; $335 = (_strcmp($334,25567)|0); $336 = ($335|0)!=(0); if (!($336)) { HEAP32[$0>>2] = 17; break; } $337 = HEAP32[$name>>2]|0; $338 = (_strcmp($337,25583)|0); $339 = ($338|0)!=(0); if (!($339)) { HEAP32[$0>>2] = 18; break; } $340 = HEAP32[$name>>2]|0; $341 = (_strcmp($340,25601)|0); $342 = ($341|0)!=(0); if (!($342)) { HEAP32[$0>>2] = 27; break; } $343 = HEAP32[$name>>2]|0; $344 = (_strcmp($343,25617)|0); $345 = ($344|0)!=(0); if (!($345)) { HEAP32[$0>>2] = 19; break; } $346 = HEAP32[$name>>2]|0; $347 = (_strcmp($346,25632)|0); $348 = ($347|0)!=(0); if (!($348)) { HEAP32[$0>>2] = 9; break; } $349 = HEAP32[$name>>2]|0; $350 = (_strcmp($349,25654)|0); $351 = ($350|0)!=(0); if (!($351)) { HEAP32[$0>>2] = 31; break; } $352 = HEAP32[$name>>2]|0; $353 = (_strcmp($352,25672)|0); $354 = ($353|0)!=(0); if (!($354)) { HEAP32[$0>>2] = 32; break; } $355 = HEAP32[$name>>2]|0; $356 = (_strcmp($355,25693)|0); $357 = ($356|0)!=(0); if (!($357)) { HEAP32[$0>>2] = 10; break; } $358 = HEAP32[$name>>2]|0; $359 = (_strcmp($358,25711)|0); $360 = ($359|0)!=(0); if (!($360)) { HEAP32[$0>>2] = 11; break; } $361 = HEAP32[$name>>2]|0; $362 = (_strcmp($361,25724)|0); $363 = ($362|0)!=(0); if (!($363)) { HEAP32[$0>>2] = 2; break; } $364 = HEAP32[$name>>2]|0; $365 = (_strcmp($364,25739)|0); $366 = ($365|0)!=(0); if (!($366)) { HEAP32[$0>>2] = 12; break; } $367 = HEAP32[$name>>2]|0; $368 = (_strcmp($367,25753)|0); $369 = ($368|0)!=(0); if (!($369)) { HEAP32[$0>>2] = 1; break; } $370 = HEAP32[$name>>2]|0; $371 = (_strcmp($370,25763)|0); $372 = ($371|0)!=(0); if (!($372)) { HEAP32[$0>>2] = 1; break; } $373 = HEAP32[$name>>2]|0; $374 = (_strcmp($373,25773)|0); $375 = ($374|0)!=(0); if (!($375)) { HEAP32[$0>>2] = 3; break; } $376 = HEAP32[$name>>2]|0; $377 = (_strcmp($376,25795)|0); $378 = ($377|0)!=(0); if (!($378)) { HEAP32[$0>>2] = 13; break; } $379 = HEAP32[$name>>2]|0; $380 = (_strcmp($379,25821)|0); $381 = ($380|0)!=(0); if (!($381)) { HEAP32[$0>>2] = 14; break; } $382 = HEAP32[$name>>2]|0; $383 = (_strcmp($382,25848)|0); $384 = ($383|0)!=(0); if (!($384)) { HEAP32[$0>>2] = 28; break; } $385 = HEAP32[$name>>2]|0; $386 = (_strcmp($385,25861)|0); $387 = ($386|0)!=(0); if (!($387)) { HEAP32[$0>>2] = 20; break; } $388 = HEAP32[$name>>2]|0; $389 = (_strcmp($388,25876)|0); $390 = ($389|0)!=(0); if (!($390)) { HEAP32[$0>>2] = 4; break; } $391 = HEAP32[$name>>2]|0; $392 = (_strcmp($391,25891)|0); $393 = ($392|0)!=(0); if (!($393)) { HEAP32[$0>>2] = 3; break; } $394 = HEAP32[$name>>2]|0; $395 = (_strcmp($394,25915)|0); $396 = ($395|0)!=(0); if (!($396)) { HEAP32[$0>>2] = 2; break; } $397 = HEAP32[$name>>2]|0; $398 = (_strcmp($397,25926)|0); $399 = ($398|0)!=(0); if (!($399)) { HEAP32[$0>>2] = 33; break; } $400 = HEAP32[$name>>2]|0; $401 = (_strcmp($400,25948)|0); $402 = ($401|0)!=(0); if (!($402)) { HEAP32[$0>>2] = 21; break; } $403 = HEAP32[$name>>2]|0; $404 = (_strcmp($403,25970)|0); $405 = ($404|0)!=(0); if (!($405)) { HEAP32[$0>>2] = 5; break; } $406 = HEAP32[$name>>2]|0; $407 = (_strcmp($406,25994)|0); $408 = ($407|0)!=(0); if (!($408)) { HEAP32[$0>>2] = 4; break; } $409 = HEAP32[$name>>2]|0; $410 = (_strcmp($409,26003)|0); $411 = ($410|0)!=(0); if (!($411)) { HEAP32[$0>>2] = 5; break; } $412 = HEAP32[$name>>2]|0; $413 = (_strcmp($412,26011)|0); $414 = ($413|0)!=(0); if (!($414)) { HEAP32[$0>>2] = 1; break; } $415 = HEAP32[$name>>2]|0; $416 = (_strcmp($415,26024)|0); $417 = ($416|0)!=(0); if (!($417)) { HEAP32[$0>>2] = 2; break; } $418 = HEAP32[$name>>2]|0; $419 = (_strcmp($418,26038)|0); $420 = ($419|0)!=(0); if (!($420)) { HEAP32[$0>>2] = 15; break; } $421 = HEAP32[$name>>2]|0; $422 = (_strcmp($421,26050)|0); $423 = ($422|0)!=(0); if (!($423)) { HEAP32[$0>>2] = 16; break; } $424 = HEAP32[$name>>2]|0; $425 = (_strcmp($424,26059)|0); $426 = ($425|0)!=(0); if (!($426)) { HEAP32[$0>>2] = 17; break; } $427 = HEAP32[$name>>2]|0; $428 = (_strcmp($427,26069)|0); $429 = ($428|0)!=(0); if (!($429)) { HEAP32[$0>>2] = 18; break; } $430 = HEAP32[$name>>2]|0; $431 = (_strcmp($430,26081)|0); $432 = ($431|0)!=(0); if (!($432)) { HEAP32[$0>>2] = 19; break; } $433 = HEAP32[$name>>2]|0; $434 = (_strcmp($433,26092)|0); $435 = ($434|0)!=(0); if (!($435)) { HEAP32[$0>>2] = 20; break; } $436 = HEAP32[$name>>2]|0; $437 = (_strcmp($436,26100)|0); $438 = ($437|0)!=(0); if (!($438)) { HEAP32[$0>>2] = 3; break; } $439 = HEAP32[$name>>2]|0; $440 = (_strcmp($439,26112)|0); $441 = ($440|0)!=(0); if (!($441)) { HEAP32[$0>>2] = 21; break; } $442 = HEAP32[$name>>2]|0; $443 = (_strcmp($442,26127)|0); $444 = ($443|0)!=(0); if (!($444)) { HEAP32[$0>>2] = 22; break; } $445 = HEAP32[$name>>2]|0; $446 = (_strcmp($445,26139)|0); $447 = ($446|0)!=(0); if (!($447)) { HEAP32[$0>>2] = 23; break; } $448 = HEAP32[$name>>2]|0; $449 = (_strcmp($448,26153)|0); $450 = ($449|0)!=(0); if (!($450)) { HEAP32[$0>>2] = 11; break; } $451 = HEAP32[$name>>2]|0; $452 = (_strcmp($451,26178)|0); $453 = ($452|0)!=(0); if (!($453)) { HEAP32[$0>>2] = 24; break; } $454 = HEAP32[$name>>2]|0; $455 = (_strcmp($454,26195)|0); $456 = ($455|0)!=(0); if (!($456)) { HEAP32[$0>>2] = 25; break; } $457 = HEAP32[$name>>2]|0; $458 = (_strcmp($457,26211)|0); $459 = ($458|0)!=(0); if (!($459)) { HEAP32[$0>>2] = 26; break; } $460 = HEAP32[$name>>2]|0; $461 = (_strcmp($460,26227)|0); $462 = ($461|0)!=(0); if (!($462)) { HEAP32[$0>>2] = 12; break; } $463 = HEAP32[$name>>2]|0; $464 = (_strcmp($463,26239)|0); $465 = ($464|0)!=(0); if (!($465)) { HEAP32[$0>>2] = 34; break; } $466 = HEAP32[$name>>2]|0; $467 = (_strcmp($466,26251)|0); $468 = ($467|0)!=(0); if (!($468)) { HEAP32[$0>>2] = 35; break; } $469 = HEAP32[$name>>2]|0; $470 = (_strcmp($469,26275)|0); $471 = ($470|0)!=(0); if (!($471)) { HEAP32[$0>>2] = 1; break; } $472 = HEAP32[$name>>2]|0; $473 = (_strcmp($472,26288)|0); $474 = ($473|0)!=(0); if (!($474)) { HEAP32[$0>>2] = 2; break; } $475 = HEAP32[$name>>2]|0; $476 = (_strcmp($475,26302)|0); $477 = ($476|0)!=(0); if (!($477)) { HEAP32[$0>>2] = 36; break; } $478 = HEAP32[$name>>2]|0; $479 = (_strcmp($478,26324)|0); $480 = ($479|0)!=(0); if (!($480)) { HEAP32[$0>>2] = 37; break; } $481 = HEAP32[$name>>2]|0; $482 = (_strcmp($481,26331)|0); $483 = ($482|0)!=(0); if (!($483)) { HEAP32[$0>>2] = 3; break; } $484 = HEAP32[$name>>2]|0; $485 = (_strcmp($484,26347)|0); $486 = ($485|0)!=(0); if (!($486)) { HEAP32[$0>>2] = 2; break; } $487 = HEAP32[$name>>2]|0; $488 = (_strcmp($487,26364)|0); $489 = ($488|0)!=(0); if (!($489)) { HEAP32[$0>>2] = 1; break; } $490 = HEAP32[$name>>2]|0; $491 = (_strcmp($490,26381)|0); $492 = ($491|0)!=(0); if (!($492)) { HEAP32[$0>>2] = 29; break; } $493 = HEAP32[$name>>2]|0; $494 = (_strcmp($493,26397)|0); $495 = ($494|0)!=(0); if (!($495)) { HEAP32[$0>>2] = 1; break; } $496 = HEAP32[$name>>2]|0; $497 = (_strcmp($496,26413)|0); $498 = ($497|0)!=(0); if (!($498)) { HEAP32[$0>>2] = 4; break; } $499 = HEAP32[$name>>2]|0; $500 = (_strcmp($499,26430)|0); $501 = ($500|0)!=(0); if (!($501)) { HEAP32[$0>>2] = 30; break; } $502 = HEAP32[$name>>2]|0; $503 = (_strcmp($502,26444)|0); $504 = ($503|0)!=(0); if (!($504)) { HEAP32[$0>>2] = 31; break; } $505 = HEAP32[$name>>2]|0; $506 = (_strcmp($505,26456)|0); $507 = ($506|0)!=(0); if (!($507)) { HEAP32[$0>>2] = 22; break; } $508 = HEAP32[$name>>2]|0; $509 = (_strcmp($508,26467)|0); $510 = ($509|0)!=(0); if (!($510)) { HEAP32[$0>>2] = 2; break; } $511 = HEAP32[$name>>2]|0; $512 = (_strcmp($511,26480)|0); $513 = ($512|0)!=(0); if (!($513)) { HEAP32[$0>>2] = 23; break; } $514 = HEAP32[$name>>2]|0; $515 = (_strcmp($514,26490)|0); $516 = ($515|0)!=(0); if (!($516)) { HEAP32[$0>>2] = 2; break; } $517 = HEAP32[$name>>2]|0; $518 = (_strcmp($517,26507)|0); $519 = ($518|0)!=(0); if (!($519)) { HEAP32[$0>>2] = 24; break; } $520 = HEAP32[$name>>2]|0; $521 = (_strcmp($520,26519)|0); $522 = ($521|0)!=(0); if (!($522)) { HEAP32[$0>>2] = 25; break; } $523 = HEAP32[$name>>2]|0; $524 = (_strcmp($523,26541)|0); $525 = ($524|0)!=(0); if (!($525)) { HEAP32[$0>>2] = 26; break; } $526 = HEAP32[$name>>2]|0; $527 = (_strcmp($526,26561)|0); $528 = ($527|0)!=(0); if (!($528)) { HEAP32[$0>>2] = 3; break; } $529 = HEAP32[$name>>2]|0; $530 = (_strcmp($529,26574)|0); $531 = ($530|0)!=(0); if (!($531)) { HEAP32[$0>>2] = 27; break; } $532 = HEAP32[$name>>2]|0; $533 = (_strcmp($532,26596)|0); $534 = ($533|0)!=(0); if (!($534)) { HEAP32[$0>>2] = 28; break; } $535 = HEAP32[$name>>2]|0; $536 = (_strcmp($535,26616)|0); $537 = ($536|0)!=(0); if (!($537)) { HEAP32[$0>>2] = 2; break; } $538 = HEAP32[$name>>2]|0; $539 = (_strcmp($538,26633)|0); $540 = ($539|0)!=(0); if (!($540)) { HEAP32[$0>>2] = 2; break; } $541 = HEAP32[$name>>2]|0; $542 = (_strcmp($541,26650)|0); $543 = ($542|0)!=(0); if (!($543)) { HEAP32[$0>>2] = 3; break; } $544 = HEAP32[$name>>2]|0; $545 = (_strcmp($544,26670)|0); $546 = ($545|0)!=(0); if ($546) { $547 = HEAP32[$1>>2]|0; $548 = HEAP32[$name>>2]|0; $549 = _emscripten_asm_const_2(0, ($547|0), ($548|0))|0; HEAP32[$0>>2] = 0; break; } else { HEAP32[$0>>2] = 38; break; } } else { HEAP32[$0>>2] = 6; } } while(0); $550 = HEAP32[$0>>2]|0; STACKTOP = sp;return ($550|0); } function _isspace($c) { $c = $c|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($c|0)==(32); $1 = (($c) + -9)|0; $2 = ($1>>>0)<(5); $3 = $0 | $2; $4 = $3&1; return ($4|0); } function _strerror($e) { $e = $e|0; var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$03 = 0, $i$03$lcssa = 0, $i$12 = 0, $s$0$lcssa = 0, $s$01 = 0, $s$1 = 0, label = 0; var sp = 0; sp = STACKTOP; $i$03 = 0; while(1) { $1 = (26786 + ($i$03)|0); $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = ($3|0)==($e|0); if ($4) { $i$03$lcssa = $i$03; label = 2; break; } $5 = (($i$03) + 1)|0; $6 = ($5|0)==(87); if ($6) { $i$12 = 87;$s$01 = 26874; label = 5; break; } else { $i$03 = $5; } } if ((label|0) == 2) { $0 = ($i$03$lcssa|0)==(0); if ($0) { $s$0$lcssa = 26874; } else { $i$12 = $i$03$lcssa;$s$01 = 26874; label = 5; } } if ((label|0) == 5) { while(1) { label = 0; $s$1 = $s$01; while(1) { $7 = HEAP8[$s$1>>0]|0; $8 = ($7<<24>>24)==(0); $9 = ((($s$1)) + 1|0); if ($8) { $$lcssa = $9; break; } else { $s$1 = $9; } } $10 = (($i$12) + -1)|0; $11 = ($10|0)==(0); if ($11) { $s$0$lcssa = $$lcssa; break; } else { $i$12 = $10;$s$01 = $$lcssa; label = 5; } } } return ($s$0$lcssa|0); } function ___errno_location() { var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[8652>>2]|0; $1 = ($0|0)==(0|0); if ($1) { $$0 = 8908; } else { $2 = (_pthread_self()|0); $3 = ((($2)) + 60|0); $4 = HEAP32[$3>>2]|0; $$0 = $4; } return ($$0|0); } function ___floatscan($f,$prec,$pok) { $f = $f|0; $prec = $prec|0; $pok = $pok|0; var $$$i = 0, $$0 = 0.0, $$0$i27 = 0.0, $$010$i = 0, $$07$i = 0, $$0710$i = 0, $$0711$i = 0, $$09$i = 0, $$1$be$i = 0, $$1$ph$i = 0, $$11$i = 0, $$18$i = 0, $$2$i = 0, $$3$be$i = 0, $$3$lcssa$i = 0, $$3105$i = 0, $$in = 0, $$k$0$i = 0, $$lcssa = 0, $$lcssa256 = 0; var $$lcssa256$lcssa = 0, $$lcssa257 = 0, $$lcssa257$lcssa = 0, $$lcssa263 = 0, $$lcssa264 = 0, $$lcssa265 = 0, $$lcssa275 = 0, $$lnz$0$i = 0, $$neg32$i = 0, $$not$i = 0, $$old8 = 0, $$pn$i = 0.0, $$pre$i = 0, $$pre$i17 = 0, $$pre$phi42$iZ2D = 0.0, $$pre41$i = 0.0, $$promoted$i = 0, $$sink$off0$i = 0, $0 = 0, $1 = 0; var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0; var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0; var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0; var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0; var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0, $187 = 0, $188 = 0.0, $189 = 0.0, $19 = 0; var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0; var $208 = 0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0; var $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0; var $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0; var $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0.0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0; var $280 = 0.0, $281 = 0.0, $282 = 0.0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0; var $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0.0, $312 = 0, $313 = 0, $314 = 0, $315 = 0; var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0.0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0, $324 = 0, $325 = 0.0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0; var $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0; var $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0; var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0; var $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0; var $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0; var $424 = 0.0, $425 = 0.0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0.0; var $442 = 0.0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0.0, $454 = 0.0, $455 = 0.0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0; var $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0.0, $466 = 0.0, $467 = 0.0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0; var $479 = 0.0, $48 = 0, $480 = 0, $481 = 0.0, $482 = 0.0, $483 = 0, $484 = 0.0, $485 = 0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0.0, $492 = 0.0, $493 = 0, $494 = 0, $495 = 0, $496 = 0; var $497 = 0, $498 = 0.0, $499 = 0.0, $5 = 0, $50 = 0.0, $500 = 0.0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0.0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0.0, $510 = 0, $511 = 0, $512 = 0, $513 = 0; var $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0.0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0; var $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0; var $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0; var $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0; var $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0; var $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0.0, $62 = 0, $620 = 0, $621 = 0; var $622 = 0, $623 = 0, $624 = 0.0, $625 = 0.0, $626 = 0.0, $627 = 0, $628 = 0.0, $629 = 0.0, $63 = 0, $630 = 0.0, $631 = 0.0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0; var $640 = 0, $641 = 0, $642 = 0.0, $643 = 0.0, $644 = 0.0, $645 = 0, $646 = 0.0, $647 = 0.0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0.0, $652 = 0.0, $653 = 0.0, $654 = 0.0, $655 = 0, $656 = 0, $657 = 0.0, $658 = 0; var $659 = 0.0, $66 = 0, $660 = 0.0, $661 = 0.0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0.0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0.0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0; var $677 = 0, $678 = 0.0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0.0, $684 = 0, $685 = 0, $686 = 0.0, $687 = 0.0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0; var $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0; var $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $a$0$lcssa151$i = 0, $a$085$i = 0, $a$1$i = 0, $a$1$i$lcssa = 0, $a$2$ph38$i = 0, $a$3$i = 0, $a$3$i$lcssa248 = 0, $a$3$i249 = 0, $a$3$ph$i = 0, $a$3$ph157$i = 0, $a$478$i = 0, $a$5$i = 0, $a$5$i$lcssa = 0, $a$5$i$lcssa$lcssa = 0, $bias$0$i = 0.0, $bias$0$i25 = 0.0, $bits$0$ph = 0, $brmerge$i28 = 0; var $c$0 = 0, $c$0$i = 0, $c$1$lcssa = 0, $c$1$ph$i = 0, $c$179 = 0, $c$2 = 0, $c$2$i = 0, $c$2$lcssa$i = 0, $c$377 = 0, $c$4 = 0, $c$5 = 0, $c$6 = 0, $carry$087$i = 0, $carry1$0$i = 0, $carry1$1$i = 0, $carry1$1$i$lcssa = 0, $carry1$1$i$lcssa$lcssa = 0, $carry3$081$i = 0, $cond$i = 0, $d$0$i = 0; var $denormal$0$i = 0, $denormal$1$i = 0, $denormal$2$i = 0, $e2$0$i19 = 0, $e2$0$ph$i = 0, $e2$1$i = 0, $e2$1$i246 = 0, $e2$1$ph$i = 0, $e2$1$ph156$i = 0, $e2$2$i = 0, $e2$3$i = 0, $emin$0$ph = 0, $exitcond$i = 0, $frac$0$i = 0.0, $frac$1$i = 0.0, $frac$2$i = 0.0, $gotdig$0$i = 0, $gotdig$0$i$lcssa242 = 0, $gotdig$0$i12 = 0, $gotdig$0$i12$lcssa273 = 0; var $gotdig$2$i = 0, $gotdig$2$i$lcssa = 0, $gotdig$2$i13 = 0, $gotdig$3$i = 0, $gotdig$3$lcssa$i = 0, $gotdig$3101$i = 0, $gotdig$3101$i$lcssa = 0, $gotdig$4$i = 0, $gotrad$0$i = 0, $gotrad$0$i$lcssa = 0, $gotrad$0$i14 = 0, $gotrad$1$i = 0, $gotrad$1$lcssa$i = 0, $gotrad$1102$i = 0, $gotrad$2$i = 0, $gottail$0$i = 0, $gottail$1$i = 0, $gottail$2$i = 0, $i$0$lcssa = 0, $i$078 = 0; var $i$1 = 0, $i$276 = 0, $i$3 = 0, $i$4 = 0, $i$4$lcssa = 0, $j$0$lcssa$i = 0, $j$0104$i = 0, $j$0104$i$lcssa = 0, $j$067$i = 0, $j$068$i = 0, $j$069$i = 0, $j$2$i = 0, $j$394$i = 0, $k$0$lcssa$i = 0, $k$0103$i = 0, $k$0103$i$lcssa = 0, $k$063$i = 0, $k$064$i = 0, $k$065$i = 0, $k$2$i = 0; var $k$3$i = 0, $k$486$i = 0, $k$5$i = 0, $k$5$in$i = 0, $k$5$z$2$i = 0, $k$679$i = 0, $lnz$0$lcssa$i = 0, $lnz$0100$i = 0, $lnz$0100$i$lcssa = 0, $lnz$057$i = 0, $lnz$058$i = 0, $lnz$059$i = 0, $lnz$2$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond$i16 = 0, $or$cond13$i = 0, $or$cond15$i = 0, $or$cond16$i = 0, $or$cond17$i = 0; var $or$cond182$i = 0, $or$cond19$i = 0, $or$cond20$i = 0, $or$cond3$i = 0, $or$cond4$i = 0, $or$cond5 = 0, $or$cond6$i = 0, $or$cond7 = 0, $or$cond8$i = 0, $or$cond9 = 0, $or$cond9$i = 0, $rp$0$lcssa152$i = 0, $rp$084$i = 0, $rp$1$i18 = 0, $rp$1$i18$lcssa = 0, $rp$2$ph36$i = 0, $rp$3$ph$i = 0, $rp$3$ph34$i = 0, $rp$477$i = 0, $rp$5$i = 0; var $rp$5$i$lcssa = 0, $rp$5$i$lcssa$lcssa = 0, $scale$0$i = 0.0, $scale$1$i = 0.0, $scale$2$i = 0.0, $sign$0 = 0, $storemerge$i = 0, $sum$i = 0, $x$0$i = 0, $x$0$i$lcssa = 0, $x$1$i = 0, $x$2$i = 0, $x$3$lcssa$i = 0, $x$324$i = 0, $x$4$lcssa$i = 0, $x$419$i = 0, $x$5$i = 0, $x$6$i = 0, $x$i = 0, $y$0$i = 0.0; var $y$0$i$lcssa = 0.0, $y$1$i = 0.0, $y$1$i24 = 0.0, $y$2$i = 0.0, $y$2$i26 = 0.0, $y$3$i = 0.0, $y$3$lcssa$i = 0.0, $y$320$i = 0.0, $y$4$i = 0.0, $y$5$i = 0.0, $z$0$i = 0, $z$1$i = 0, $z$1$ph37$i = 0, $z$2$i = 0, $z$3$i = 0, $z$3$i$lcssa = 0, $z$3$i$lcssa$lcssa = 0, $z$4$i = 0, $z$5$ph$i = 0, $z$7$1$i = 0; var $z$7$i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 512|0; $x$i = sp; switch ($prec|0) { case 0: { $bits$0$ph = 24;$emin$0$ph = -149; label = 4; break; } case 1: { $bits$0$ph = 53;$emin$0$ph = -1074; label = 4; break; } case 2: { $bits$0$ph = 53;$emin$0$ph = -1074; label = 4; break; } default: { $$0 = 0.0; } } L4: do { if ((label|0) == 4) { $0 = ((($f)) + 4|0); $1 = ((($f)) + 100|0); while(1) { $2 = HEAP32[$0>>2]|0; $3 = HEAP32[$1>>2]|0; $4 = ($2>>>0)<($3>>>0); if ($4) { $5 = ((($2)) + 1|0); HEAP32[$0>>2] = $5; $6 = HEAP8[$2>>0]|0; $7 = $6&255; $9 = $7; } else { $8 = (___shgetc($f)|0); $9 = $8; } $10 = (_isspace($9)|0); $11 = ($10|0)==(0); if ($11) { $$lcssa275 = $9; break; } } $12 = ($$lcssa275|0)==(45); L13: do { switch ($$lcssa275|0) { case 43: case 45: { $13 = $12&1; $14 = $13 << 1; $15 = (1 - ($14))|0; $16 = HEAP32[$0>>2]|0; $17 = HEAP32[$1>>2]|0; $18 = ($16>>>0)<($17>>>0); if ($18) { $19 = ((($16)) + 1|0); HEAP32[$0>>2] = $19; $20 = HEAP8[$16>>0]|0; $21 = $20&255; $c$0 = $21;$sign$0 = $15; break L13; } else { $22 = (___shgetc($f)|0); $c$0 = $22;$sign$0 = $15; break L13; } break; } default: { $c$0 = $$lcssa275;$sign$0 = 1; } } } while(0); $c$179 = $c$0;$i$078 = 0; while(1) { $23 = $c$179 | 32; $24 = (28678 + ($i$078)|0); $25 = HEAP8[$24>>0]|0; $26 = $25 << 24 >> 24; $27 = ($23|0)==($26|0); if (!($27)) { $c$1$lcssa = $c$179;$i$0$lcssa = $i$078; break; } $28 = ($i$078>>>0)<(7); do { if ($28) { $29 = HEAP32[$0>>2]|0; $30 = HEAP32[$1>>2]|0; $31 = ($29>>>0)<($30>>>0); if ($31) { $32 = ((($29)) + 1|0); HEAP32[$0>>2] = $32; $33 = HEAP8[$29>>0]|0; $34 = $33&255; $c$2 = $34; break; } else { $35 = (___shgetc($f)|0); $c$2 = $35; break; } } else { $c$2 = $c$179; } } while(0); $36 = (($i$078) + 1)|0; $37 = ($36>>>0)<(8); if ($37) { $c$179 = $c$2;$i$078 = $36; } else { $c$1$lcssa = $c$2;$i$0$lcssa = $36; break; } } L29: do { switch ($i$0$lcssa|0) { case 8: { break; } case 3: { label = 23; break; } default: { $38 = ($i$0$lcssa>>>0)>(3); $39 = ($pok|0)!=(0); $or$cond5 = $39 & $38; if ($or$cond5) { $40 = ($i$0$lcssa|0)==(8); if ($40) { break L29; } else { label = 23; break L29; } } $53 = ($i$0$lcssa|0)==(0); L34: do { if ($53) { $c$377 = $c$1$lcssa;$i$276 = 0; while(1) { $54 = $c$377 | 32; $55 = (30513 + ($i$276)|0); $56 = HEAP8[$55>>0]|0; $57 = $56 << 24 >> 24; $58 = ($54|0)==($57|0); if (!($58)) { $c$5 = $c$377;$i$3 = $i$276; break L34; } $59 = ($i$276>>>0)<(2); do { if ($59) { $60 = HEAP32[$0>>2]|0; $61 = HEAP32[$1>>2]|0; $62 = ($60>>>0)<($61>>>0); if ($62) { $63 = ((($60)) + 1|0); HEAP32[$0>>2] = $63; $64 = HEAP8[$60>>0]|0; $65 = $64&255; $c$4 = $65; break; } else { $66 = (___shgetc($f)|0); $c$4 = $66; break; } } else { $c$4 = $c$377; } } while(0); $67 = (($i$276) + 1)|0; $68 = ($67>>>0)<(3); if ($68) { $c$377 = $c$4;$i$276 = $67; } else { $c$5 = $c$4;$i$3 = $67; break; } } } else { $c$5 = $c$1$lcssa;$i$3 = $i$0$lcssa; } } while(0); switch ($i$3|0) { case 3: { $69 = HEAP32[$0>>2]|0; $70 = HEAP32[$1>>2]|0; $71 = ($69>>>0)<($70>>>0); if ($71) { $72 = ((($69)) + 1|0); HEAP32[$0>>2] = $72; $73 = HEAP8[$69>>0]|0; $74 = $73&255; $76 = $74; } else { $75 = (___shgetc($f)|0); $76 = $75; } $77 = ($76|0)==(40); if ($77) { $i$4 = 1; } else { $78 = HEAP32[$1>>2]|0; $79 = ($78|0)==(0|0); if ($79) { $$0 = nan; break L4; } $80 = HEAP32[$0>>2]|0; $81 = ((($80)) + -1|0); HEAP32[$0>>2] = $81; $$0 = nan; break L4; } while(1) { $82 = HEAP32[$0>>2]|0; $83 = HEAP32[$1>>2]|0; $84 = ($82>>>0)<($83>>>0); if ($84) { $85 = ((($82)) + 1|0); HEAP32[$0>>2] = $85; $86 = HEAP8[$82>>0]|0; $87 = $86&255; $90 = $87; } else { $88 = (___shgetc($f)|0); $90 = $88; } $89 = (($90) + -48)|0; $91 = ($89>>>0)<(10); $92 = (($90) + -65)|0; $93 = ($92>>>0)<(26); $or$cond = $91 | $93; if (!($or$cond)) { $94 = (($90) + -97)|0; $95 = ($94>>>0)<(26); $96 = ($90|0)==(95); $or$cond7 = $96 | $95; if (!($or$cond7)) { $$lcssa = $90;$i$4$lcssa = $i$4; break; } } $108 = (($i$4) + 1)|0; $i$4 = $108; } $97 = ($$lcssa|0)==(41); if ($97) { $$0 = nan; break L4; } $98 = HEAP32[$1>>2]|0; $99 = ($98|0)==(0|0); if (!($99)) { $100 = HEAP32[$0>>2]|0; $101 = ((($100)) + -1|0); HEAP32[$0>>2] = $101; } if (!($39)) { $103 = (___errno_location()|0); HEAP32[$103>>2] = 22; ___shlim($f,0); $$0 = 0.0; break L4; } $102 = ($i$4$lcssa|0)==(0); if ($102) { $$0 = nan; break L4; } else { $$in = $i$4$lcssa; } while(1) { $104 = (($$in) + -1)|0; if (!($99)) { $105 = HEAP32[$0>>2]|0; $106 = ((($105)) + -1|0); HEAP32[$0>>2] = $106; } $107 = ($104|0)==(0); if ($107) { $$0 = nan; break L4; } else { $$in = $104; } } break; } case 0: { $114 = ($c$5|0)==(48); do { if ($114) { $115 = HEAP32[$0>>2]|0; $116 = HEAP32[$1>>2]|0; $117 = ($115>>>0)<($116>>>0); if ($117) { $118 = ((($115)) + 1|0); HEAP32[$0>>2] = $118; $119 = HEAP8[$115>>0]|0; $120 = $119&255; $123 = $120; } else { $121 = (___shgetc($f)|0); $123 = $121; } $122 = $123 | 32; $124 = ($122|0)==(120); if (!($124)) { $326 = HEAP32[$1>>2]|0; $327 = ($326|0)==(0|0); if ($327) { $c$6 = 48; break; } $328 = HEAP32[$0>>2]|0; $329 = ((($328)) + -1|0); HEAP32[$0>>2] = $329; $c$6 = 48; break; } $125 = HEAP32[$0>>2]|0; $126 = HEAP32[$1>>2]|0; $127 = ($125>>>0)<($126>>>0); if ($127) { $128 = ((($125)) + 1|0); HEAP32[$0>>2] = $128; $129 = HEAP8[$125>>0]|0; $130 = $129&255; $c$0$i = $130;$gotdig$0$i = 0; } else { $131 = (___shgetc($f)|0); $c$0$i = $131;$gotdig$0$i = 0; } L94: while(1) { switch ($c$0$i|0) { case 46: { $gotdig$0$i$lcssa242 = $gotdig$0$i; label = 74; break L94; break; } case 48: { break; } default: { $168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$0$i;$gotdig$2$i = $gotdig$0$i;$gotrad$0$i = 0;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0; break L94; } } $132 = HEAP32[$0>>2]|0; $133 = HEAP32[$1>>2]|0; $134 = ($132>>>0)<($133>>>0); if ($134) { $135 = ((($132)) + 1|0); HEAP32[$0>>2] = $135; $136 = HEAP8[$132>>0]|0; $137 = $136&255; $c$0$i = $137;$gotdig$0$i = 1; continue; } else { $138 = (___shgetc($f)|0); $c$0$i = $138;$gotdig$0$i = 1; continue; } } if ((label|0) == 74) { $139 = HEAP32[$0>>2]|0; $140 = HEAP32[$1>>2]|0; $141 = ($139>>>0)<($140>>>0); if ($141) { $142 = ((($139)) + 1|0); HEAP32[$0>>2] = $142; $143 = HEAP8[$139>>0]|0; $144 = $143&255; $c$1$ph$i = $144; } else { $145 = (___shgetc($f)|0); $c$1$ph$i = $145; } $146 = ($c$1$ph$i|0)==(48); if ($146) { $154 = 0;$155 = 0; while(1) { $147 = HEAP32[$0>>2]|0; $148 = HEAP32[$1>>2]|0; $149 = ($147>>>0)<($148>>>0); if ($149) { $150 = ((($147)) + 1|0); HEAP32[$0>>2] = $150; $151 = HEAP8[$147>>0]|0; $152 = $151&255; $158 = $152; } else { $153 = (___shgetc($f)|0); $158 = $153; } $156 = (_i64Add(($154|0),($155|0),-1,-1)|0); $157 = tempRet0; $159 = ($158|0)==(48); if ($159) { $154 = $156;$155 = $157; } else { $168 = 0;$170 = 0;$694 = $156;$695 = $157;$c$2$i = $158;$gotdig$2$i = 1;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0; break; } } } else { $168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$1$ph$i;$gotdig$2$i = $gotdig$0$i$lcssa242;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0; } } while(1) { $160 = (($c$2$i) + -48)|0; $161 = ($160>>>0)<(10); $$pre$i = $c$2$i | 32; if ($161) { label = 86; } else { $162 = (($$pre$i) + -97)|0; $163 = ($162>>>0)<(6); $164 = ($c$2$i|0)==(46); $or$cond6$i = $164 | $163; if (!($or$cond6$i)) { $212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = $c$2$i;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i; break; } if ($164) { $165 = ($gotrad$0$i|0)==(0); if ($165) { $696 = $170;$697 = $168;$698 = $170;$699 = $168;$gotdig$3$i = $gotdig$2$i;$gotrad$1$i = 1;$gottail$2$i = $gottail$0$i;$scale$2$i = $scale$0$i;$x$2$i = $x$0$i;$y$2$i = $y$0$i; } else { $212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = 46;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i; break; } } else { label = 86; } } if ((label|0) == 86) { label = 0; $166 = ($c$2$i|0)>(57); $167 = (($$pre$i) + -87)|0; $d$0$i = $166 ? $167 : $160; $169 = ($168|0)<(0); $171 = ($170>>>0)<(8); $172 = ($168|0)==(0); $173 = $172 & $171; $174 = $169 | $173; do { if ($174) { $175 = $x$0$i << 4; $176 = (($d$0$i) + ($175))|0; $gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $176;$y$1$i = $y$0$i; } else { $177 = ($168|0)<(0); $178 = ($170>>>0)<(14); $179 = ($168|0)==(0); $180 = $179 & $178; $181 = $177 | $180; if ($181) { $182 = (+($d$0$i|0)); $183 = $scale$0$i * 0.0625; $184 = $183 * $182; $185 = $y$0$i + $184; $gottail$1$i = $gottail$0$i;$scale$1$i = $183;$x$1$i = $x$0$i;$y$1$i = $185; break; } $186 = ($d$0$i|0)==(0); $187 = ($gottail$0$i|0)!=(0); $or$cond$i = $187 | $186; if ($or$cond$i) { $gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $y$0$i; } else { $188 = $scale$0$i * 0.5; $189 = $y$0$i + $188; $gottail$1$i = 1;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $189; } } } while(0); $190 = (_i64Add(($170|0),($168|0),1,0)|0); $191 = tempRet0; $696 = $694;$697 = $695;$698 = $190;$699 = $191;$gotdig$3$i = 1;$gotrad$1$i = $gotrad$0$i;$gottail$2$i = $gottail$1$i;$scale$2$i = $scale$1$i;$x$2$i = $x$1$i;$y$2$i = $y$1$i; } $192 = HEAP32[$0>>2]|0; $193 = HEAP32[$1>>2]|0; $194 = ($192>>>0)<($193>>>0); if ($194) { $195 = ((($192)) + 1|0); HEAP32[$0>>2] = $195; $196 = HEAP8[$192>>0]|0; $197 = $196&255; $168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $197;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i; continue; } else { $198 = (___shgetc($f)|0); $168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $198;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i; continue; } } $199 = ($gotdig$2$i$lcssa|0)==(0); if ($199) { $200 = HEAP32[$1>>2]|0; $201 = ($200|0)==(0|0); if (!($201)) { $202 = HEAP32[$0>>2]|0; $203 = ((($202)) + -1|0); HEAP32[$0>>2] = $203; } $204 = ($pok|0)==(0); if ($204) { ___shlim($f,0); } else { if (!($201)) { $205 = HEAP32[$0>>2]|0; $206 = ((($205)) + -1|0); HEAP32[$0>>2] = $206; $207 = ($gotrad$0$i$lcssa|0)==(0); if (!($207)) { $208 = ((($205)) + -2|0); HEAP32[$0>>2] = $208; } } } $209 = (+($sign$0|0)); $210 = $209 * 0.0; $$0 = $210; break L4; } $211 = ($gotrad$0$i$lcssa|0)==(0); $214 = $211 ? $213 : $212; $217 = $211 ? $216 : $215; $218 = ($216|0)<(0); $219 = ($213>>>0)<(8); $220 = ($216|0)==(0); $221 = $220 & $219; $222 = $218 | $221; if ($222) { $224 = $213;$225 = $216;$x$324$i = $x$0$i$lcssa; while(1) { $223 = $x$324$i << 4; $226 = (_i64Add(($224|0),($225|0),1,0)|0); $227 = tempRet0; $228 = ($227|0)<(0); $229 = ($226>>>0)<(8); $230 = ($227|0)==(0); $231 = $230 & $229; $232 = $228 | $231; if ($232) { $224 = $226;$225 = $227;$x$324$i = $223; } else { $x$3$lcssa$i = $223; break; } } } else { $x$3$lcssa$i = $x$0$i$lcssa; } $233 = $c$2$lcssa$i | 32; $234 = ($233|0)==(112); if ($234) { $235 = (_scanexp($f,$pok)|0); $236 = tempRet0; $237 = ($235|0)==(0); $238 = ($236|0)==(-2147483648); $239 = $237 & $238; if ($239) { $240 = ($pok|0)==(0); if ($240) { ___shlim($f,0); $$0 = 0.0; break L4; } $241 = HEAP32[$1>>2]|0; $242 = ($241|0)==(0|0); if ($242) { $253 = 0;$254 = 0; } else { $243 = HEAP32[$0>>2]|0; $244 = ((($243)) + -1|0); HEAP32[$0>>2] = $244; $253 = 0;$254 = 0; } } else { $253 = $235;$254 = $236; } } else { $245 = HEAP32[$1>>2]|0; $246 = ($245|0)==(0|0); if ($246) { $253 = 0;$254 = 0; } else { $247 = HEAP32[$0>>2]|0; $248 = ((($247)) + -1|0); HEAP32[$0>>2] = $248; $253 = 0;$254 = 0; } } $249 = (_bitshift64Shl(($214|0),($217|0),2)|0); $250 = tempRet0; $251 = (_i64Add(($249|0),($250|0),-32,-1)|0); $252 = tempRet0; $255 = (_i64Add(($251|0),($252|0),($253|0),($254|0))|0); $256 = tempRet0; $257 = ($x$3$lcssa$i|0)==(0); if ($257) { $258 = (+($sign$0|0)); $259 = $258 * 0.0; $$0 = $259; break L4; } $260 = (0 - ($emin$0$ph))|0; $261 = ($256|0)>(0); $262 = ($255>>>0)>($260>>>0); $263 = ($256|0)==(0); $264 = $263 & $262; $265 = $261 | $264; if ($265) { $266 = (___errno_location()|0); HEAP32[$266>>2] = 34; $267 = (+($sign$0|0)); $268 = $267 * 1.7976931348623157E+308; $269 = $268 * 1.7976931348623157E+308; $$0 = $269; break L4; } $270 = (($emin$0$ph) + -106)|0; $271 = ($270|0)<(0); $272 = $271 << 31 >> 31; $273 = ($256|0)<($272|0); $274 = ($255>>>0)<($270>>>0); $275 = ($256|0)==($272|0); $276 = $275 & $274; $277 = $273 | $276; if ($277) { $279 = (___errno_location()|0); HEAP32[$279>>2] = 34; $280 = (+($sign$0|0)); $281 = $280 * 2.2250738585072014E-308; $282 = $281 * 2.2250738585072014E-308; $$0 = $282; break L4; } $278 = ($x$3$lcssa$i|0)>(-1); if ($278) { $288 = $255;$289 = $256;$x$419$i = $x$3$lcssa$i;$y$320$i = $y$0$i$lcssa; while(1) { $283 = !($y$320$i >= 0.5); $284 = $x$419$i << 1; $285 = $y$320$i + -1.0; $286 = $283&1; $287 = $286 | $284; $x$5$i = $287 ^ 1; $$pn$i = $283 ? $y$320$i : $285; $y$4$i = $y$320$i + $$pn$i; $290 = (_i64Add(($288|0),($289|0),-1,-1)|0); $291 = tempRet0; $292 = ($287|0)>(-1); if ($292) { $288 = $290;$289 = $291;$x$419$i = $x$5$i;$y$320$i = $y$4$i; } else { $297 = $290;$298 = $291;$x$4$lcssa$i = $x$5$i;$y$3$lcssa$i = $y$4$i; break; } } } else { $297 = $255;$298 = $256;$x$4$lcssa$i = $x$3$lcssa$i;$y$3$lcssa$i = $y$0$i$lcssa; } $293 = ($emin$0$ph|0)<(0); $294 = $293 << 31 >> 31; $295 = (_i64Subtract(32,0,($emin$0$ph|0),($294|0))|0); $296 = tempRet0; $299 = (_i64Add(($297|0),($298|0),($295|0),($296|0))|0); $300 = tempRet0; $301 = (0)>($300|0); $302 = ($bits$0$ph>>>0)>($299>>>0); $303 = (0)==($300|0); $304 = $303 & $302; $305 = $301 | $304; if ($305) { $306 = ($299|0)<(0); if ($306) { $$0710$i = 0; label = 127; } else { $$07$i = $299; label = 125; } } else { $$07$i = $bits$0$ph; label = 125; } if ((label|0) == 125) { $307 = ($$07$i|0)<(53); if ($307) { $$0710$i = $$07$i; label = 127; } else { $$pre41$i = (+($sign$0|0)); $$0711$i = $$07$i;$$pre$phi42$iZ2D = $$pre41$i;$bias$0$i = 0.0; } } if ((label|0) == 127) { $308 = (84 - ($$0710$i))|0; $309 = (+_scalbn(1.0,$308)); $310 = (+($sign$0|0)); $311 = (+_copysignl($309,$310)); $$0711$i = $$0710$i;$$pre$phi42$iZ2D = $310;$bias$0$i = $311; } $312 = ($$0711$i|0)<(32); $313 = $y$3$lcssa$i != 0.0; $or$cond4$i = $313 & $312; $314 = $x$4$lcssa$i & 1; $315 = ($314|0)==(0); $or$cond9$i = $315 & $or$cond4$i; $316 = $or$cond9$i&1; $x$6$i = (($316) + ($x$4$lcssa$i))|0; $y$5$i = $or$cond9$i ? 0.0 : $y$3$lcssa$i; $317 = (+($x$6$i>>>0)); $318 = $$pre$phi42$iZ2D * $317; $319 = $bias$0$i + $318; $320 = $$pre$phi42$iZ2D * $y$5$i; $321 = $320 + $319; $322 = $321 - $bias$0$i; $323 = $322 != 0.0; if (!($323)) { $324 = (___errno_location()|0); HEAP32[$324>>2] = 34; } $325 = (+_scalbnl($322,$297)); $$0 = $325; break L4; } else { $c$6 = $c$5; } } while(0); $sum$i = (($emin$0$ph) + ($bits$0$ph))|0; $330 = (0 - ($sum$i))|0; $$09$i = $c$6;$gotdig$0$i12 = 0; L184: while(1) { switch ($$09$i|0) { case 46: { $gotdig$0$i12$lcssa273 = $gotdig$0$i12; label = 138; break L184; break; } case 48: { break; } default: { $$2$i = $$09$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12;$gotrad$0$i14 = 0; break L184; } } $331 = HEAP32[$0>>2]|0; $332 = HEAP32[$1>>2]|0; $333 = ($331>>>0)<($332>>>0); if ($333) { $334 = ((($331)) + 1|0); HEAP32[$0>>2] = $334; $335 = HEAP8[$331>>0]|0; $336 = $335&255; $$09$i = $336;$gotdig$0$i12 = 1; continue; } else { $337 = (___shgetc($f)|0); $$09$i = $337;$gotdig$0$i12 = 1; continue; } } if ((label|0) == 138) { $338 = HEAP32[$0>>2]|0; $339 = HEAP32[$1>>2]|0; $340 = ($338>>>0)<($339>>>0); if ($340) { $341 = ((($338)) + 1|0); HEAP32[$0>>2] = $341; $342 = HEAP8[$338>>0]|0; $343 = $342&255; $$1$ph$i = $343; } else { $344 = (___shgetc($f)|0); $$1$ph$i = $344; } $345 = ($$1$ph$i|0)==(48); if ($345) { $346 = 0;$347 = 0; while(1) { $348 = (_i64Add(($346|0),($347|0),-1,-1)|0); $349 = tempRet0; $350 = HEAP32[$0>>2]|0; $351 = HEAP32[$1>>2]|0; $352 = ($350>>>0)<($351>>>0); if ($352) { $353 = ((($350)) + 1|0); HEAP32[$0>>2] = $353; $354 = HEAP8[$350>>0]|0; $355 = $354&255; $$1$be$i = $355; } else { $356 = (___shgetc($f)|0); $$1$be$i = $356; } $357 = ($$1$be$i|0)==(48); if ($357) { $346 = $348;$347 = $349; } else { $$2$i = $$1$be$i;$700 = $348;$701 = $349;$gotdig$2$i13 = 1;$gotrad$0$i14 = 1; break; } } } else { $$2$i = $$1$ph$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12$lcssa273;$gotrad$0$i14 = 1; } } HEAP32[$x$i>>2] = 0; $358 = (($$2$i) + -48)|0; $359 = ($358>>>0)<(10); $360 = ($$2$i|0)==(46); $361 = $360 | $359; L203: do { if ($361) { $362 = ((($x$i)) + 496|0); $$3105$i = $$2$i;$365 = 0;$366 = 0;$702 = $360;$703 = $358;$704 = $700;$705 = $701;$gotdig$3101$i = $gotdig$2$i13;$gotrad$1102$i = $gotrad$0$i14;$j$0104$i = 0;$k$0103$i = 0;$lnz$0100$i = 0; L205: while(1) { do { if ($702) { $cond$i = ($gotrad$1102$i|0)==(0); if ($cond$i) { $706 = $365;$707 = $366;$708 = $365;$709 = $366;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = 1;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i; } else { $710 = $704;$711 = $705;$712 = $365;$713 = $366;$gotdig$3101$i$lcssa = $gotdig$3101$i;$j$0104$i$lcssa = $j$0104$i;$k$0103$i$lcssa = $k$0103$i;$lnz$0100$i$lcssa = $lnz$0100$i; break L205; } } else { $364 = ($k$0103$i|0)<(125); $367 = (_i64Add(($365|0),($366|0),1,0)|0); $368 = tempRet0; $369 = ($$3105$i|0)!=(48); if (!($364)) { if (!($369)) { $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i; break; } $379 = HEAP32[$362>>2]|0; $380 = $379 | 1; HEAP32[$362>>2] = $380; $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i; break; } $$lnz$0$i = $369 ? $367 : $lnz$0100$i; $370 = ($j$0104$i|0)==(0); $371 = (($x$i) + ($k$0103$i<<2)|0); if ($370) { $storemerge$i = $703; } else { $372 = HEAP32[$371>>2]|0; $373 = ($372*10)|0; $374 = (($$3105$i) + -48)|0; $375 = (($374) + ($373))|0; $storemerge$i = $375; } HEAP32[$371>>2] = $storemerge$i; $376 = (($j$0104$i) + 1)|0; $377 = ($376|0)==(9); $378 = $377&1; $$k$0$i = (($378) + ($k$0103$i))|0; $$11$i = $377 ? 0 : $376; $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = 1;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $$11$i;$k$2$i = $$k$0$i;$lnz$2$i = $$lnz$0$i; } } while(0); $381 = HEAP32[$0>>2]|0; $382 = HEAP32[$1>>2]|0; $383 = ($381>>>0)<($382>>>0); if ($383) { $384 = ((($381)) + 1|0); HEAP32[$0>>2] = $384; $385 = HEAP8[$381>>0]|0; $386 = $385&255; $$3$be$i = $386; } else { $387 = (___shgetc($f)|0); $$3$be$i = $387; } $388 = (($$3$be$i) + -48)|0; $389 = ($388>>>0)<(10); $390 = ($$3$be$i|0)==(46); $391 = $390 | $389; if ($391) { $$3105$i = $$3$be$i;$365 = $708;$366 = $709;$702 = $390;$703 = $388;$704 = $706;$705 = $707;$gotdig$3101$i = $gotdig$4$i;$gotrad$1102$i = $gotrad$2$i;$j$0104$i = $j$2$i;$k$0103$i = $k$2$i;$lnz$0100$i = $lnz$2$i; } else { $$3$lcssa$i = $$3$be$i;$393 = $706;$394 = $708;$396 = $707;$397 = $709;$gotdig$3$lcssa$i = $gotdig$4$i;$gotrad$1$lcssa$i = $gotrad$2$i;$j$0$lcssa$i = $j$2$i;$k$0$lcssa$i = $k$2$i;$lnz$0$lcssa$i = $lnz$2$i; label = 161; break L203; } } $363 = ($gotdig$3101$i$lcssa|0)!=(0); $714 = $712;$715 = $713;$716 = $710;$717 = $711;$718 = $363;$j$069$i = $j$0104$i$lcssa;$k$065$i = $k$0103$i$lcssa;$lnz$059$i = $lnz$0100$i$lcssa; label = 169; } else { $$3$lcssa$i = $$2$i;$393 = $700;$394 = 0;$396 = $701;$397 = 0;$gotdig$3$lcssa$i = $gotdig$2$i13;$gotrad$1$lcssa$i = $gotrad$0$i14;$j$0$lcssa$i = 0;$k$0$lcssa$i = 0;$lnz$0$lcssa$i = 0; label = 161; } } while(0); do { if ((label|0) == 161) { $392 = ($gotrad$1$lcssa$i|0)==(0); $395 = $392 ? $394 : $393; $398 = $392 ? $397 : $396; $399 = ($gotdig$3$lcssa$i|0)!=(0); $400 = $$3$lcssa$i | 32; $401 = ($400|0)==(101); $or$cond13$i = $401 & $399; if (!($or$cond13$i)) { $416 = ($$3$lcssa$i|0)>(-1); if ($416) { $714 = $394;$715 = $397;$716 = $395;$717 = $398;$718 = $399;$j$069$i = $j$0$lcssa$i;$k$065$i = $k$0$lcssa$i;$lnz$059$i = $lnz$0$lcssa$i; label = 169; break; } else { $719 = $394;$720 = $397;$721 = $399;$722 = $395;$723 = $398;$j$068$i = $j$0$lcssa$i;$k$064$i = $k$0$lcssa$i;$lnz$058$i = $lnz$0$lcssa$i; label = 171; break; } } $402 = (_scanexp($f,$pok)|0); $403 = tempRet0; $404 = ($402|0)==(0); $405 = ($403|0)==(-2147483648); $406 = $404 & $405; if ($406) { $407 = ($pok|0)==(0); if ($407) { ___shlim($f,0); $$0$i27 = 0.0; break; } $408 = HEAP32[$1>>2]|0; $409 = ($408|0)==(0|0); if ($409) { $412 = 0;$413 = 0; } else { $410 = HEAP32[$0>>2]|0; $411 = ((($410)) + -1|0); HEAP32[$0>>2] = $411; $412 = 0;$413 = 0; } } else { $412 = $402;$413 = $403; } $414 = (_i64Add(($412|0),($413|0),($395|0),($398|0))|0); $415 = tempRet0; $426 = $414;$428 = $394;$429 = $415;$431 = $397;$j$067$i = $j$0$lcssa$i;$k$063$i = $k$0$lcssa$i;$lnz$057$i = $lnz$0$lcssa$i; label = 173; } } while(0); if ((label|0) == 169) { $417 = HEAP32[$1>>2]|0; $418 = ($417|0)==(0|0); if ($418) { $719 = $714;$720 = $715;$721 = $718;$722 = $716;$723 = $717;$j$068$i = $j$069$i;$k$064$i = $k$065$i;$lnz$058$i = $lnz$059$i; label = 171; } else { $419 = HEAP32[$0>>2]|0; $420 = ((($419)) + -1|0); HEAP32[$0>>2] = $420; if ($718) { $426 = $716;$428 = $714;$429 = $717;$431 = $715;$j$067$i = $j$069$i;$k$063$i = $k$065$i;$lnz$057$i = $lnz$059$i; label = 173; } else { label = 172; } } } if ((label|0) == 171) { if ($721) { $426 = $722;$428 = $719;$429 = $723;$431 = $720;$j$067$i = $j$068$i;$k$063$i = $k$064$i;$lnz$057$i = $lnz$058$i; label = 173; } else { label = 172; } } do { if ((label|0) == 172) { $421 = (___errno_location()|0); HEAP32[$421>>2] = 22; ___shlim($f,0); $$0$i27 = 0.0; } else if ((label|0) == 173) { $422 = HEAP32[$x$i>>2]|0; $423 = ($422|0)==(0); if ($423) { $424 = (+($sign$0|0)); $425 = $424 * 0.0; $$0$i27 = $425; break; } $427 = ($426|0)==($428|0); $430 = ($429|0)==($431|0); $432 = $427 & $430; $433 = ($431|0)<(0); $434 = ($428>>>0)<(10); $435 = ($431|0)==(0); $436 = $435 & $434; $437 = $433 | $436; $or$cond$i16 = $437 & $432; if ($or$cond$i16) { $438 = ($bits$0$ph>>>0)>(30); $439 = $422 >>> $bits$0$ph; $440 = ($439|0)==(0); $or$cond15$i = $438 | $440; if ($or$cond15$i) { $441 = (+($sign$0|0)); $442 = (+($422>>>0)); $443 = $441 * $442; $$0$i27 = $443; break; } } $444 = (($emin$0$ph|0) / -2)&-1; $445 = ($444|0)<(0); $446 = $445 << 31 >> 31; $447 = ($429|0)>($446|0); $448 = ($426>>>0)>($444>>>0); $449 = ($429|0)==($446|0); $450 = $449 & $448; $451 = $447 | $450; if ($451) { $452 = (___errno_location()|0); HEAP32[$452>>2] = 34; $453 = (+($sign$0|0)); $454 = $453 * 1.7976931348623157E+308; $455 = $454 * 1.7976931348623157E+308; $$0$i27 = $455; break; } $456 = (($emin$0$ph) + -106)|0; $457 = ($456|0)<(0); $458 = $457 << 31 >> 31; $459 = ($429|0)<($458|0); $460 = ($426>>>0)<($456>>>0); $461 = ($429|0)==($458|0); $462 = $461 & $460; $463 = $459 | $462; if ($463) { $464 = (___errno_location()|0); HEAP32[$464>>2] = 34; $465 = (+($sign$0|0)); $466 = $465 * 2.2250738585072014E-308; $467 = $466 * 2.2250738585072014E-308; $$0$i27 = $467; break; } $468 = ($j$067$i|0)==(0); if ($468) { $k$3$i = $k$063$i; } else { $469 = ($j$067$i|0)<(9); if ($469) { $470 = (($x$i) + ($k$063$i<<2)|0); $$promoted$i = HEAP32[$470>>2]|0; $472 = $$promoted$i;$j$394$i = $j$067$i; while(1) { $471 = ($472*10)|0; $473 = (($j$394$i) + 1)|0; $exitcond$i = ($473|0)==(9); if ($exitcond$i) { $$lcssa265 = $471; break; } else { $472 = $471;$j$394$i = $473; } } HEAP32[$470>>2] = $$lcssa265; } $474 = (($k$063$i) + 1)|0; $k$3$i = $474; } $475 = ($lnz$057$i|0)<(9); if ($475) { $476 = ($lnz$057$i|0)<=($426|0); $477 = ($426|0)<(18); $or$cond3$i = $476 & $477; if ($or$cond3$i) { $478 = ($426|0)==(9); if ($478) { $479 = (+($sign$0|0)); $480 = HEAP32[$x$i>>2]|0; $481 = (+($480>>>0)); $482 = $479 * $481; $$0$i27 = $482; break; } $483 = ($426|0)<(9); if ($483) { $484 = (+($sign$0|0)); $485 = HEAP32[$x$i>>2]|0; $486 = (+($485>>>0)); $487 = $484 * $486; $488 = (8 - ($426))|0; $489 = (8912 + ($488<<2)|0); $490 = HEAP32[$489>>2]|0; $491 = (+($490|0)); $492 = $487 / $491; $$0$i27 = $492; break; } $$neg32$i = (($bits$0$ph) + 27)|0; $493 = Math_imul($426, -3)|0; $494 = (($$neg32$i) + ($493))|0; $495 = ($494|0)>(30); $$pre$i17 = HEAP32[$x$i>>2]|0; $496 = $$pre$i17 >>> $494; $497 = ($496|0)==(0); $or$cond182$i = $495 | $497; if ($or$cond182$i) { $498 = (+($sign$0|0)); $499 = (+($$pre$i17>>>0)); $500 = $498 * $499; $501 = (($426) + -10)|0; $502 = (8912 + ($501<<2)|0); $503 = HEAP32[$502>>2]|0; $504 = (+($503|0)); $505 = $500 * $504; $$0$i27 = $505; break; } } } $506 = (($426|0) % 9)&-1; $507 = ($506|0)==(0); if ($507) { $a$2$ph38$i = 0;$e2$0$ph$i = 0;$rp$2$ph36$i = $426;$z$1$ph37$i = $k$3$i; } else { $508 = ($426|0)>(-1); $509 = (($506) + 9)|0; $510 = $508 ? $506 : $509; $511 = (8 - ($510))|0; $512 = (8912 + ($511<<2)|0); $513 = HEAP32[$512>>2]|0; $514 = ($k$3$i|0)==(0); if ($514) { $a$0$lcssa151$i = 0;$rp$0$lcssa152$i = $426;$z$0$i = 0; } else { $515 = (1000000000 / ($513|0))&-1; $a$085$i = 0;$carry$087$i = 0;$k$486$i = 0;$rp$084$i = $426; while(1) { $516 = (($x$i) + ($k$486$i<<2)|0); $517 = HEAP32[$516>>2]|0; $518 = (($517>>>0) % ($513>>>0))&-1; $519 = (($517>>>0) / ($513>>>0))&-1; $520 = (($519) + ($carry$087$i))|0; HEAP32[$516>>2] = $520; $521 = Math_imul($518, $515)|0; $522 = ($k$486$i|0)==($a$085$i|0); $523 = ($520|0)==(0); $or$cond16$i = $522 & $523; $524 = (($k$486$i) + 1)|0; $525 = $524 & 127; $526 = (($rp$084$i) + -9)|0; $rp$1$i18 = $or$cond16$i ? $526 : $rp$084$i; $a$1$i = $or$cond16$i ? $525 : $a$085$i; $527 = ($524|0)==($k$3$i|0); if ($527) { $$lcssa264 = $521;$a$1$i$lcssa = $a$1$i;$rp$1$i18$lcssa = $rp$1$i18; break; } else { $a$085$i = $a$1$i;$carry$087$i = $521;$k$486$i = $524;$rp$084$i = $rp$1$i18; } } $528 = ($$lcssa264|0)==(0); if ($528) { $a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $k$3$i; } else { $529 = (($k$3$i) + 1)|0; $530 = (($x$i) + ($k$3$i<<2)|0); HEAP32[$530>>2] = $$lcssa264; $a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $529; } } $531 = (9 - ($510))|0; $532 = (($531) + ($rp$0$lcssa152$i))|0; $a$2$ph38$i = $a$0$lcssa151$i;$e2$0$ph$i = 0;$rp$2$ph36$i = $532;$z$1$ph37$i = $z$0$i; } L284: while(1) { $533 = ($rp$2$ph36$i|0)<(18); $534 = ($rp$2$ph36$i|0)==(18); $535 = (($x$i) + ($a$2$ph38$i<<2)|0); $e2$0$i19 = $e2$0$ph$i;$z$1$i = $z$1$ph37$i; while(1) { if (!($533)) { if (!($534)) { $a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = $rp$2$ph36$i;$z$5$ph$i = $z$1$i; break L284; } $536 = HEAP32[$535>>2]|0; $537 = ($536>>>0)<(9007199); if (!($537)) { $a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = 18;$z$5$ph$i = $z$1$i; break L284; } } $538 = (($z$1$i) + 127)|0; $carry1$0$i = 0;$k$5$in$i = $538;$z$2$i = $z$1$i; while(1) { $k$5$i = $k$5$in$i & 127; $539 = (($x$i) + ($k$5$i<<2)|0); $540 = HEAP32[$539>>2]|0; $541 = (_bitshift64Shl(($540|0),0,29)|0); $542 = tempRet0; $543 = (_i64Add(($541|0),($542|0),($carry1$0$i|0),0)|0); $544 = tempRet0; $545 = ($544>>>0)>(0); $546 = ($543>>>0)>(1000000000); $547 = ($544|0)==(0); $548 = $547 & $546; $549 = $545 | $548; if ($549) { $550 = (___udivdi3(($543|0),($544|0),1000000000,0)|0); $551 = tempRet0; $552 = (___uremdi3(($543|0),($544|0),1000000000,0)|0); $553 = tempRet0; $$sink$off0$i = $552;$carry1$1$i = $550; } else { $$sink$off0$i = $543;$carry1$1$i = 0; } HEAP32[$539>>2] = $$sink$off0$i; $554 = (($z$2$i) + 127)|0; $555 = $554 & 127; $556 = ($k$5$i|0)!=($555|0); $557 = ($k$5$i|0)==($a$2$ph38$i|0); $or$cond17$i = $556 | $557; $558 = ($$sink$off0$i|0)==(0); $k$5$z$2$i = $558 ? $k$5$i : $z$2$i; $z$3$i = $or$cond17$i ? $z$2$i : $k$5$z$2$i; $559 = (($k$5$i) + -1)|0; if ($557) { $carry1$1$i$lcssa = $carry1$1$i;$z$3$i$lcssa = $z$3$i; break; } else { $carry1$0$i = $carry1$1$i;$k$5$in$i = $559;$z$2$i = $z$3$i; } } $560 = (($e2$0$i19) + -29)|0; $561 = ($carry1$1$i$lcssa|0)==(0); if ($561) { $e2$0$i19 = $560;$z$1$i = $z$3$i$lcssa; } else { $$lcssa263 = $560;$carry1$1$i$lcssa$lcssa = $carry1$1$i$lcssa;$z$3$i$lcssa$lcssa = $z$3$i$lcssa; break; } } $562 = (($rp$2$ph36$i) + 9)|0; $563 = (($a$2$ph38$i) + 127)|0; $564 = $563 & 127; $565 = ($564|0)==($z$3$i$lcssa$lcssa|0); if ($565) { $566 = (($z$3$i$lcssa$lcssa) + 127)|0; $567 = $566 & 127; $568 = (($x$i) + ($567<<2)|0); $569 = HEAP32[$568>>2]|0; $570 = (($z$3$i$lcssa$lcssa) + 126)|0; $571 = $570 & 127; $572 = (($x$i) + ($571<<2)|0); $573 = HEAP32[$572>>2]|0; $574 = $573 | $569; HEAP32[$572>>2] = $574; $z$4$i = $567; } else { $z$4$i = $z$3$i$lcssa$lcssa; } $575 = (($x$i) + ($564<<2)|0); HEAP32[$575>>2] = $carry1$1$i$lcssa$lcssa; $a$2$ph38$i = $564;$e2$0$ph$i = $$lcssa263;$rp$2$ph36$i = $562;$z$1$ph37$i = $z$4$i; } L302: while(1) { $606 = (($z$5$ph$i) + 1)|0; $603 = $606 & 127; $607 = (($z$5$ph$i) + 127)|0; $608 = $607 & 127; $609 = (($x$i) + ($608<<2)|0); $a$3$ph157$i = $a$3$ph$i;$e2$1$ph156$i = $e2$1$ph$i;$rp$3$ph$i = $rp$3$ph34$i; while(1) { $610 = ($rp$3$ph$i|0)==(18); $611 = ($rp$3$ph$i|0)>(27); $$18$i = $611 ? 9 : 1; $$not$i = $610 ^ 1; $a$3$i = $a$3$ph157$i;$e2$1$i = $e2$1$ph156$i; while(1) { $576 = $a$3$i & 127; $577 = ($576|0)==($z$5$ph$i|0); do { if ($577) { label = 219; } else { $578 = (($x$i) + ($576<<2)|0); $579 = HEAP32[$578>>2]|0; $580 = ($579>>>0)<(9007199); if ($580) { label = 219; break; } $581 = ($579>>>0)>(9007199); if ($581) { break; } $582 = (($a$3$i) + 1)|0; $583 = $582 & 127; $584 = ($583|0)==($z$5$ph$i|0); if ($584) { label = 219; break; } $690 = (($x$i) + ($583<<2)|0); $691 = HEAP32[$690>>2]|0; $692 = ($691>>>0)<(254740991); if ($692) { label = 219; break; } $693 = ($691>>>0)>(254740991); $brmerge$i28 = $693 | $$not$i; if (!($brmerge$i28)) { $617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i; break L302; } } } while(0); if ((label|0) == 219) { label = 0; if ($610) { label = 220; break L302; } } $585 = (($e2$1$i) + ($$18$i))|0; $586 = ($a$3$i|0)==($z$5$ph$i|0); if ($586) { $a$3$i = $z$5$ph$i;$e2$1$i = $585; } else { $$lcssa256 = $585;$a$3$i$lcssa248 = $a$3$i; break; } } $587 = 1 << $$18$i; $588 = (($587) + -1)|0; $589 = 1000000000 >>> $$18$i; $a$478$i = $a$3$i$lcssa248;$carry3$081$i = 0;$k$679$i = $a$3$i$lcssa248;$rp$477$i = $rp$3$ph$i; while(1) { $590 = (($x$i) + ($k$679$i<<2)|0); $591 = HEAP32[$590>>2]|0; $592 = $591 & $588; $593 = $591 >>> $$18$i; $594 = (($593) + ($carry3$081$i))|0; HEAP32[$590>>2] = $594; $595 = Math_imul($592, $589)|0; $596 = ($k$679$i|0)==($a$478$i|0); $597 = ($594|0)==(0); $or$cond19$i = $596 & $597; $598 = (($k$679$i) + 1)|0; $599 = $598 & 127; $600 = (($rp$477$i) + -9)|0; $rp$5$i = $or$cond19$i ? $600 : $rp$477$i; $a$5$i = $or$cond19$i ? $599 : $a$478$i; $601 = ($599|0)==($z$5$ph$i|0); if ($601) { $$lcssa257 = $595;$a$5$i$lcssa = $a$5$i;$rp$5$i$lcssa = $rp$5$i; break; } else { $a$478$i = $a$5$i;$carry3$081$i = $595;$k$679$i = $599;$rp$477$i = $rp$5$i; } } $602 = ($$lcssa257|0)==(0); if ($602) { $a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa; continue; } $604 = ($603|0)==($a$5$i$lcssa|0); if (!($604)) { $$lcssa256$lcssa = $$lcssa256;$$lcssa257$lcssa = $$lcssa257;$a$5$i$lcssa$lcssa = $a$5$i$lcssa;$rp$5$i$lcssa$lcssa = $rp$5$i$lcssa; break; } $612 = HEAP32[$609>>2]|0; $613 = $612 | 1; HEAP32[$609>>2] = $613; $a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa; } $605 = (($x$i) + ($z$5$ph$i<<2)|0); HEAP32[$605>>2] = $$lcssa257$lcssa; $a$3$ph$i = $a$5$i$lcssa$lcssa;$e2$1$ph$i = $$lcssa256$lcssa;$rp$3$ph34$i = $rp$5$i$lcssa$lcssa;$z$5$ph$i = $603; } if ((label|0) == 220) { if ($577) { $614 = (($603) + -1)|0; $615 = (($x$i) + ($614<<2)|0); HEAP32[$615>>2] = 0; $617 = $z$5$ph$i;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $603; } else { $617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i; } } $616 = (($x$i) + ($617<<2)|0); $618 = HEAP32[$616>>2]|0; $619 = (+($618>>>0)); $620 = (($a$3$i249) + 1)|0; $621 = $620 & 127; $622 = ($621|0)==($z$7$i|0); if ($622) { $679 = (($a$3$i249) + 2)|0; $680 = $679 & 127; $681 = (($680) + -1)|0; $682 = (($x$i) + ($681<<2)|0); HEAP32[$682>>2] = 0; $z$7$1$i = $680; } else { $z$7$1$i = $z$7$i; } $683 = $619 * 1.0E+9; $684 = (($x$i) + ($621<<2)|0); $685 = HEAP32[$684>>2]|0; $686 = (+($685>>>0)); $687 = $683 + $686; $643 = (+($sign$0|0)); $625 = $643 * $687; $663 = (($e2$1$i246) + 53)|0; $669 = (($663) - ($emin$0$ph))|0; $670 = ($669|0)<($bits$0$ph|0); $688 = ($669|0)<(0); $$$i = $688 ? 0 : $669; $denormal$0$i = $670&1; $$010$i = $670 ? $$$i : $bits$0$ph; $689 = ($$010$i|0)<(53); if ($689) { $623 = (105 - ($$010$i))|0; $624 = (+_scalbn(1.0,$623)); $626 = (+_copysignl($624,$625)); $627 = (53 - ($$010$i))|0; $628 = (+_scalbn(1.0,$627)); $629 = (+_fmodl($625,$628)); $630 = $625 - $629; $631 = $626 + $630; $bias$0$i25 = $626;$frac$0$i = $629;$y$1$i24 = $631; } else { $bias$0$i25 = 0.0;$frac$0$i = 0.0;$y$1$i24 = $625; } $632 = (($a$3$i249) + 2)|0; $633 = $632 & 127; $634 = ($633|0)==($z$7$1$i|0); do { if ($634) { $frac$2$i = $frac$0$i; } else { $635 = (($x$i) + ($633<<2)|0); $636 = HEAP32[$635>>2]|0; $637 = ($636>>>0)<(500000000); do { if ($637) { $638 = ($636|0)==(0); if ($638) { $639 = (($a$3$i249) + 3)|0; $640 = $639 & 127; $641 = ($640|0)==($z$7$1$i|0); if ($641) { $frac$1$i = $frac$0$i; break; } } $642 = $643 * 0.25; $644 = $642 + $frac$0$i; $frac$1$i = $644; } else { $645 = ($636>>>0)>(500000000); if ($645) { $646 = $643 * 0.75; $647 = $646 + $frac$0$i; $frac$1$i = $647; break; } $648 = (($a$3$i249) + 3)|0; $649 = $648 & 127; $650 = ($649|0)==($z$7$1$i|0); if ($650) { $651 = $643 * 0.5; $652 = $651 + $frac$0$i; $frac$1$i = $652; break; } else { $653 = $643 * 0.75; $654 = $653 + $frac$0$i; $frac$1$i = $654; break; } } } while(0); $655 = (53 - ($$010$i))|0; $656 = ($655|0)>(1); if (!($656)) { $frac$2$i = $frac$1$i; break; } $657 = (+_fmodl($frac$1$i,1.0)); $658 = $657 != 0.0; if ($658) { $frac$2$i = $frac$1$i; break; } $659 = $frac$1$i + 1.0; $frac$2$i = $659; } } while(0); $660 = $y$1$i24 + $frac$2$i; $661 = $660 - $bias$0$i25; $662 = $663 & 2147483647; $664 = (-2 - ($sum$i))|0; $665 = ($662|0)>($664|0); do { if ($665) { $666 = (+Math_abs((+$661))); $667 = !($666 >= 9007199254740992.0); if ($667) { $denormal$2$i = $denormal$0$i;$e2$2$i = $e2$1$i246;$y$2$i26 = $661; } else { $668 = ($$010$i|0)==($669|0); $or$cond20$i = $670 & $668; $denormal$1$i = $or$cond20$i ? 0 : $denormal$0$i; $671 = $661 * 0.5; $672 = (($e2$1$i246) + 1)|0; $denormal$2$i = $denormal$1$i;$e2$2$i = $672;$y$2$i26 = $671; } $673 = (($e2$2$i) + 50)|0; $674 = ($673|0)>($330|0); if (!($674)) { $675 = ($denormal$2$i|0)!=(0); $676 = $frac$2$i != 0.0; $or$cond8$i = $676 & $675; if (!($or$cond8$i)) { $e2$3$i = $e2$2$i;$y$3$i = $y$2$i26; break; } } $677 = (___errno_location()|0); HEAP32[$677>>2] = 34; $e2$3$i = $e2$2$i;$y$3$i = $y$2$i26; } else { $e2$3$i = $e2$1$i246;$y$3$i = $661; } } while(0); $678 = (+_scalbnl($y$3$i,$e2$3$i)); $$0$i27 = $678; } } while(0); $$0 = $$0$i27; break L4; break; } default: { $109 = HEAP32[$1>>2]|0; $110 = ($109|0)==(0|0); if (!($110)) { $111 = HEAP32[$0>>2]|0; $112 = ((($111)) + -1|0); HEAP32[$0>>2] = $112; } $113 = (___errno_location()|0); HEAP32[$113>>2] = 22; ___shlim($f,0); $$0 = 0.0; break L4; } } } } } while(0); if ((label|0) == 23) { $41 = HEAP32[$1>>2]|0; $42 = ($41|0)==(0|0); if (!($42)) { $43 = HEAP32[$0>>2]|0; $44 = ((($43)) + -1|0); HEAP32[$0>>2] = $44; } $45 = ($pok|0)!=(0); $46 = ($i$0$lcssa>>>0)>(3); $or$cond9 = $45 & $46; if ($or$cond9) { $i$1 = $i$0$lcssa; while(1) { if (!($42)) { $47 = HEAP32[$0>>2]|0; $48 = ((($47)) + -1|0); HEAP32[$0>>2] = $48; } $49 = (($i$1) + -1)|0; $$old8 = ($49>>>0)>(3); if ($$old8) { $i$1 = $49; } else { break; } } } } $50 = (+($sign$0|0)); $51 = $50 * inf; $52 = $51; $$0 = $52; } } while(0); STACKTOP = sp;return (+$$0); } function ___intscan($f,$base,$pok,$0,$1) { $f = $f|0; $base = $base|0; $pok = $pok|0; $0 = $0|0; $1 = $1|0; var $$1 = 0, $$122 = 0, $$123 = 0, $$base21 = 0, $$lcssa = 0, $$lcssa130 = 0, $$lcssa131 = 0, $$lcssa132 = 0, $$lcssa133 = 0, $$lcssa134 = 0, $$lcssa135 = 0, $$sum = 0, $$sum14 = 0, $$sum1445 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0, $$sum1865 = 0, $$sum19 = 0; var $$sum20 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0; var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0; var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0; var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0; var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0; var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0; var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0; var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0; var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0; var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0; var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $3 = 0, $30 = 0; var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0; var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0; var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0; var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c$0 = 0, $c$1 = 0, $c$124 = 0, $c$2$be = 0, $c$2$be$lcssa = 0; var $c$2$lcssa = 0, $c$3$be = 0, $c$3$lcssa = 0, $c$371 = 0, $c$4$be = 0, $c$4$be$lcssa = 0, $c$4$lcssa = 0, $c$5$be = 0, $c$6$be = 0, $c$6$be$lcssa = 0, $c$6$lcssa = 0, $c$7$be = 0, $c$753 = 0, $c$8 = 0, $c$9$be = 0, $neg$0 = 0, $neg$0$ = 0, $neg$1 = 0, $or$cond = 0, $or$cond12 = 0; var $or$cond40 = 0, $or$cond5 = 0, $or$cond7 = 0, $x$082 = 0, $x$146 = 0, $x$266 = 0, label = 0, sp = 0; sp = STACKTOP; $2 = ($base>>>0)>(36); L1: do { if ($2) { $5 = (___errno_location()|0); HEAP32[$5>>2] = 22; $286 = 0;$287 = 0; } else { $3 = ((($f)) + 4|0); $4 = ((($f)) + 100|0); while(1) { $6 = HEAP32[$3>>2]|0; $7 = HEAP32[$4>>2]|0; $8 = ($6>>>0)<($7>>>0); if ($8) { $9 = ((($6)) + 1|0); HEAP32[$3>>2] = $9; $10 = HEAP8[$6>>0]|0; $11 = $10&255; $13 = $11; } else { $12 = (___shgetc($f)|0); $13 = $12; } $14 = (_isspace($13)|0); $15 = ($14|0)==(0); if ($15) { $$lcssa135 = $13; break; } } $16 = ($$lcssa135|0)==(45); L11: do { switch ($$lcssa135|0) { case 43: case 45: { $17 = $16 << 31 >> 31; $18 = HEAP32[$3>>2]|0; $19 = HEAP32[$4>>2]|0; $20 = ($18>>>0)<($19>>>0); if ($20) { $21 = ((($18)) + 1|0); HEAP32[$3>>2] = $21; $22 = HEAP8[$18>>0]|0; $23 = $22&255; $c$0 = $23;$neg$0 = $17; break L11; } else { $24 = (___shgetc($f)|0); $c$0 = $24;$neg$0 = $17; break L11; } break; } default: { $c$0 = $$lcssa135;$neg$0 = 0; } } } while(0); $25 = ($base|0)==(0); $26 = $base & -17; $27 = ($26|0)==(0); $28 = ($c$0|0)==(48); $or$cond5 = $27 & $28; do { if ($or$cond5) { $29 = HEAP32[$3>>2]|0; $30 = HEAP32[$4>>2]|0; $31 = ($29>>>0)<($30>>>0); if ($31) { $32 = ((($29)) + 1|0); HEAP32[$3>>2] = $32; $33 = HEAP8[$29>>0]|0; $34 = $33&255; $37 = $34; } else { $35 = (___shgetc($f)|0); $37 = $35; } $36 = $37 | 32; $38 = ($36|0)==(120); if (!($38)) { if ($25) { $$123 = 8;$c$124 = $37; label = 46; break; } else { $$1 = $base;$c$1 = $37; label = 32; break; } } $39 = HEAP32[$3>>2]|0; $40 = HEAP32[$4>>2]|0; $41 = ($39>>>0)<($40>>>0); if ($41) { $42 = ((($39)) + 1|0); HEAP32[$3>>2] = $42; $43 = HEAP8[$39>>0]|0; $44 = $43&255; $46 = $44; } else { $45 = (___shgetc($f)|0); $46 = $45; } $$sum20 = (($46) + 1)|0; $47 = (28687 + ($$sum20)|0); $48 = HEAP8[$47>>0]|0; $49 = ($48&255)>(15); if ($49) { $50 = HEAP32[$4>>2]|0; $51 = ($50|0)==(0|0); if (!($51)) { $52 = HEAP32[$3>>2]|0; $53 = ((($52)) + -1|0); HEAP32[$3>>2] = $53; } $54 = ($pok|0)==(0); if ($54) { ___shlim($f,0); $286 = 0;$287 = 0; break L1; } if ($51) { $286 = 0;$287 = 0; break L1; } $55 = HEAP32[$3>>2]|0; $56 = ((($55)) + -1|0); HEAP32[$3>>2] = $56; $286 = 0;$287 = 0; break L1; } else { $$123 = 16;$c$124 = $46; label = 46; } } else { $$base21 = $25 ? 10 : $base; $$sum = (($c$0) + 1)|0; $57 = (28687 + ($$sum)|0); $58 = HEAP8[$57>>0]|0; $59 = $58&255; $60 = ($59>>>0)<($$base21>>>0); if ($60) { $$1 = $$base21;$c$1 = $c$0; label = 32; } else { $61 = HEAP32[$4>>2]|0; $62 = ($61|0)==(0|0); if (!($62)) { $63 = HEAP32[$3>>2]|0; $64 = ((($63)) + -1|0); HEAP32[$3>>2] = $64; } ___shlim($f,0); $65 = (___errno_location()|0); HEAP32[$65>>2] = 22; $286 = 0;$287 = 0; break L1; } } } while(0); if ((label|0) == 32) { $66 = ($$1|0)==(10); if ($66) { $67 = (($c$1) + -48)|0; $68 = ($67>>>0)<(10); if ($68) { $71 = $67;$x$082 = 0; while(1) { $69 = ($x$082*10)|0; $70 = (($69) + ($71))|0; $72 = HEAP32[$3>>2]|0; $73 = HEAP32[$4>>2]|0; $74 = ($72>>>0)<($73>>>0); if ($74) { $75 = ((($72)) + 1|0); HEAP32[$3>>2] = $75; $76 = HEAP8[$72>>0]|0; $77 = $76&255; $c$2$be = $77; } else { $78 = (___shgetc($f)|0); $c$2$be = $78; } $79 = (($c$2$be) + -48)|0; $80 = ($79>>>0)<(10); $81 = ($70>>>0)<(429496729); $82 = $80 & $81; if ($82) { $71 = $79;$x$082 = $70; } else { $$lcssa134 = $70;$c$2$be$lcssa = $c$2$be; break; } } $288 = $$lcssa134;$289 = 0;$c$2$lcssa = $c$2$be$lcssa; } else { $288 = 0;$289 = 0;$c$2$lcssa = $c$1; } $83 = (($c$2$lcssa) + -48)|0; $84 = ($83>>>0)<(10); if ($84) { $85 = $288;$86 = $289;$89 = $83;$c$371 = $c$2$lcssa; while(1) { $87 = (___muldi3(($85|0),($86|0),10,0)|0); $88 = tempRet0; $90 = ($89|0)<(0); $91 = $90 << 31 >> 31; $92 = $89 ^ -1; $93 = $91 ^ -1; $94 = ($88>>>0)>($93>>>0); $95 = ($87>>>0)>($92>>>0); $96 = ($88|0)==($93|0); $97 = $96 & $95; $98 = $94 | $97; if ($98) { $$lcssa = $89;$290 = $85;$291 = $86;$c$3$lcssa = $c$371; break; } $99 = (_i64Add(($87|0),($88|0),($89|0),($91|0))|0); $100 = tempRet0; $101 = HEAP32[$3>>2]|0; $102 = HEAP32[$4>>2]|0; $103 = ($101>>>0)<($102>>>0); if ($103) { $104 = ((($101)) + 1|0); HEAP32[$3>>2] = $104; $105 = HEAP8[$101>>0]|0; $106 = $105&255; $c$3$be = $106; } else { $107 = (___shgetc($f)|0); $c$3$be = $107; } $108 = (($c$3$be) + -48)|0; $109 = ($108>>>0)<(10); $110 = ($100>>>0)<(429496729); $111 = ($99>>>0)<(2576980378); $112 = ($100|0)==(429496729); $113 = $112 & $111; $114 = $110 | $113; $or$cond7 = $109 & $114; if ($or$cond7) { $85 = $99;$86 = $100;$89 = $108;$c$371 = $c$3$be; } else { $$lcssa = $108;$290 = $99;$291 = $100;$c$3$lcssa = $c$3$be; break; } } $115 = ($$lcssa>>>0)>(9); if ($115) { $259 = $291;$261 = $290;$neg$1 = $neg$0; } else { $$122 = 10;$292 = $290;$293 = $291;$c$8 = $c$3$lcssa; label = 72; } } else { $259 = $289;$261 = $288;$neg$1 = $neg$0; } } else { $$123 = $$1;$c$124 = $c$1; label = 46; } } L63: do { if ((label|0) == 46) { $116 = (($$123) + -1)|0; $117 = $116 & $$123; $118 = ($117|0)==(0); if ($118) { $123 = ($$123*23)|0; $124 = $123 >>> 5; $125 = $124 & 7; $126 = (28944 + ($125)|0); $127 = HEAP8[$126>>0]|0; $128 = $127 << 24 >> 24; $$sum1445 = (($c$124) + 1)|0; $129 = (28687 + ($$sum1445)|0); $130 = HEAP8[$129>>0]|0; $131 = $130&255; $132 = ($131>>>0)<($$123>>>0); if ($132) { $135 = $131;$x$146 = 0; while(1) { $133 = $x$146 << $128; $134 = $135 | $133; $136 = HEAP32[$3>>2]|0; $137 = HEAP32[$4>>2]|0; $138 = ($136>>>0)<($137>>>0); if ($138) { $139 = ((($136)) + 1|0); HEAP32[$3>>2] = $139; $140 = HEAP8[$136>>0]|0; $141 = $140&255; $c$4$be = $141; } else { $142 = (___shgetc($f)|0); $c$4$be = $142; } $$sum14 = (($c$4$be) + 1)|0; $143 = (28687 + ($$sum14)|0); $144 = HEAP8[$143>>0]|0; $145 = $144&255; $146 = ($145>>>0)<($$123>>>0); $147 = ($134>>>0)<(134217728); $148 = $147 & $146; if ($148) { $135 = $145;$x$146 = $134; } else { $$lcssa130 = $134;$$lcssa131 = $144;$c$4$be$lcssa = $c$4$be; break; } } $152 = $$lcssa131;$154 = 0;$156 = $$lcssa130;$c$4$lcssa = $c$4$be$lcssa; } else { $152 = $130;$154 = 0;$156 = 0;$c$4$lcssa = $c$124; } $149 = (_bitshift64Lshr(-1,-1,($128|0))|0); $150 = tempRet0; $151 = $152&255; $153 = ($151>>>0)>=($$123>>>0); $155 = ($154>>>0)>($150>>>0); $157 = ($156>>>0)>($149>>>0); $158 = ($154|0)==($150|0); $159 = $158 & $157; $160 = $155 | $159; $or$cond40 = $153 | $160; if ($or$cond40) { $$122 = $$123;$292 = $156;$293 = $154;$c$8 = $c$4$lcssa; label = 72; break; } else { $161 = $156;$162 = $154;$166 = $152; } while(1) { $163 = (_bitshift64Shl(($161|0),($162|0),($128|0))|0); $164 = tempRet0; $165 = $166&255; $167 = $165 | $163; $168 = HEAP32[$3>>2]|0; $169 = HEAP32[$4>>2]|0; $170 = ($168>>>0)<($169>>>0); if ($170) { $171 = ((($168)) + 1|0); HEAP32[$3>>2] = $171; $172 = HEAP8[$168>>0]|0; $173 = $172&255; $c$5$be = $173; } else { $174 = (___shgetc($f)|0); $c$5$be = $174; } $$sum15 = (($c$5$be) + 1)|0; $175 = (28687 + ($$sum15)|0); $176 = HEAP8[$175>>0]|0; $177 = $176&255; $178 = ($177>>>0)>=($$123>>>0); $179 = ($164>>>0)>($150>>>0); $180 = ($167>>>0)>($149>>>0); $181 = ($164|0)==($150|0); $182 = $181 & $180; $183 = $179 | $182; $or$cond = $178 | $183; if ($or$cond) { $$122 = $$123;$292 = $167;$293 = $164;$c$8 = $c$5$be; label = 72; break L63; } else { $161 = $167;$162 = $164;$166 = $176; } } } $$sum1865 = (($c$124) + 1)|0; $119 = (28687 + ($$sum1865)|0); $120 = HEAP8[$119>>0]|0; $121 = $120&255; $122 = ($121>>>0)<($$123>>>0); if ($122) { $186 = $121;$x$266 = 0; while(1) { $184 = Math_imul($x$266, $$123)|0; $185 = (($186) + ($184))|0; $187 = HEAP32[$3>>2]|0; $188 = HEAP32[$4>>2]|0; $189 = ($187>>>0)<($188>>>0); if ($189) { $190 = ((($187)) + 1|0); HEAP32[$3>>2] = $190; $191 = HEAP8[$187>>0]|0; $192 = $191&255; $c$6$be = $192; } else { $193 = (___shgetc($f)|0); $c$6$be = $193; } $$sum18 = (($c$6$be) + 1)|0; $194 = (28687 + ($$sum18)|0); $195 = HEAP8[$194>>0]|0; $196 = $195&255; $197 = ($196>>>0)<($$123>>>0); $198 = ($185>>>0)<(119304647); $199 = $198 & $197; if ($199) { $186 = $196;$x$266 = $185; } else { $$lcssa132 = $185;$$lcssa133 = $195;$c$6$be$lcssa = $c$6$be; break; } } $201 = $$lcssa133;$294 = $$lcssa132;$295 = 0;$c$6$lcssa = $c$6$be$lcssa; } else { $201 = $120;$294 = 0;$295 = 0;$c$6$lcssa = $c$124; } $200 = $201&255; $202 = ($200>>>0)<($$123>>>0); if ($202) { $203 = (___udivdi3(-1,-1,($$123|0),0)|0); $204 = tempRet0; $205 = $295;$207 = $294;$215 = $201;$c$753 = $c$6$lcssa; while(1) { $206 = ($205>>>0)>($204>>>0); $208 = ($207>>>0)>($203>>>0); $209 = ($205|0)==($204|0); $210 = $209 & $208; $211 = $206 | $210; if ($211) { $$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753; label = 72; break L63; } $212 = (___muldi3(($207|0),($205|0),($$123|0),0)|0); $213 = tempRet0; $214 = $215&255; $216 = $214 ^ -1; $217 = ($213>>>0)>(4294967295); $218 = ($212>>>0)>($216>>>0); $219 = ($213|0)==(-1); $220 = $219 & $218; $221 = $217 | $220; if ($221) { $$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753; label = 72; break L63; } $222 = (_i64Add(($214|0),0,($212|0),($213|0))|0); $223 = tempRet0; $224 = HEAP32[$3>>2]|0; $225 = HEAP32[$4>>2]|0; $226 = ($224>>>0)<($225>>>0); if ($226) { $227 = ((($224)) + 1|0); HEAP32[$3>>2] = $227; $228 = HEAP8[$224>>0]|0; $229 = $228&255; $c$7$be = $229; } else { $230 = (___shgetc($f)|0); $c$7$be = $230; } $$sum19 = (($c$7$be) + 1)|0; $231 = (28687 + ($$sum19)|0); $232 = HEAP8[$231>>0]|0; $233 = $232&255; $234 = ($233>>>0)<($$123>>>0); if ($234) { $205 = $223;$207 = $222;$215 = $232;$c$753 = $c$7$be; } else { $$122 = $$123;$292 = $222;$293 = $223;$c$8 = $c$7$be; label = 72; break; } } } else { $$122 = $$123;$292 = $294;$293 = $295;$c$8 = $c$6$lcssa; label = 72; } } } while(0); if ((label|0) == 72) { $$sum16 = (($c$8) + 1)|0; $235 = (28687 + ($$sum16)|0); $236 = HEAP8[$235>>0]|0; $237 = $236&255; $238 = ($237>>>0)<($$122>>>0); if ($238) { while(1) { $239 = HEAP32[$3>>2]|0; $240 = HEAP32[$4>>2]|0; $241 = ($239>>>0)<($240>>>0); if ($241) { $242 = ((($239)) + 1|0); HEAP32[$3>>2] = $242; $243 = HEAP8[$239>>0]|0; $244 = $243&255; $c$9$be = $244; } else { $245 = (___shgetc($f)|0); $c$9$be = $245; } $$sum17 = (($c$9$be) + 1)|0; $246 = (28687 + ($$sum17)|0); $247 = HEAP8[$246>>0]|0; $248 = $247&255; $249 = ($248>>>0)<($$122>>>0); if (!($249)) { break; } } $250 = (___errno_location()|0); HEAP32[$250>>2] = 34; $251 = $0 & 1; $252 = ($251|0)==(0); $253 = (0)==(0); $254 = $252 & $253; $neg$0$ = $254 ? $neg$0 : 0; $259 = $1;$261 = $0;$neg$1 = $neg$0$; } else { $259 = $293;$261 = $292;$neg$1 = $neg$0; } } $255 = HEAP32[$4>>2]|0; $256 = ($255|0)==(0|0); if (!($256)) { $257 = HEAP32[$3>>2]|0; $258 = ((($257)) + -1|0); HEAP32[$3>>2] = $258; } $260 = ($259>>>0)<($1>>>0); $262 = ($261>>>0)<($0>>>0); $263 = ($259|0)==($1|0); $264 = $263 & $262; $265 = $260 | $264; if (!($265)) { $266 = $0 & 1; $267 = ($266|0)!=(0); $268 = (0)!=(0); $269 = $267 | $268; $270 = ($neg$1|0)!=(0); $or$cond12 = $269 | $270; if (!($or$cond12)) { $271 = (___errno_location()|0); HEAP32[$271>>2] = 34; $272 = (_i64Add(($0|0),($1|0),-1,-1)|0); $273 = tempRet0; $286 = $273;$287 = $272; break; } $274 = ($259>>>0)>($1>>>0); $275 = ($261>>>0)>($0>>>0); $276 = ($259|0)==($1|0); $277 = $276 & $275; $278 = $274 | $277; if ($278) { $279 = (___errno_location()|0); HEAP32[$279>>2] = 34; $286 = $1;$287 = $0; break; } } $280 = ($neg$1|0)<(0); $281 = $280 << 31 >> 31; $282 = $261 ^ $neg$1; $283 = $259 ^ $281; $284 = (_i64Subtract(($282|0),($283|0),($neg$1|0),($281|0))|0); $285 = tempRet0; $286 = $285;$287 = $284; } } while(0); tempRet0 = ($286); return ($287|0); } function ___shlim($f,$lim) { $f = $f|0; $lim = $lim|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 104|0); HEAP32[$0>>2] = $lim; $1 = ((($f)) + 8|0); $2 = HEAP32[$1>>2]|0; $3 = ((($f)) + 4|0); $4 = HEAP32[$3>>2]|0; $5 = $2; $6 = $4; $7 = (($5) - ($6))|0; $8 = ((($f)) + 108|0); HEAP32[$8>>2] = $7; $9 = ($lim|0)!=(0); $10 = ($7|0)>($lim|0); $or$cond = $9 & $10; if ($or$cond) { $11 = (($4) + ($lim)|0); $12 = ((($f)) + 100|0); HEAP32[$12>>2] = $11; } else { $13 = ((($f)) + 100|0); HEAP32[$13>>2] = $5; } return; } function ___shgetc($f) { $f = $f|0; var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert3 = 0, $$pre = 0, $$pre4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 104|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { label = 3; } else { $3 = ((($f)) + 108|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)<($1|0); if ($5) { label = 3; } else { label = 4; } } if ((label|0) == 3) { $6 = (___uflow($f)|0); $7 = ($6|0)<(0); if ($7) { label = 4; } else { $9 = HEAP32[$0>>2]|0; $10 = ($9|0)==(0); $$phi$trans$insert = ((($f)) + 8|0); if ($10) { $$pre = HEAP32[$$phi$trans$insert>>2]|0; $11 = $$pre; $26 = $$pre;$41 = $11; label = 9; } else { $12 = HEAP32[$$phi$trans$insert>>2]|0; $13 = ((($f)) + 4|0); $14 = HEAP32[$13>>2]|0; $15 = $12; $16 = $14; $17 = (($15) - ($16))|0; $18 = ((($f)) + 108|0); $19 = HEAP32[$18>>2]|0; $20 = (($9) - ($19))|0; $21 = (($20) + -1)|0; $22 = ($17|0)>($21|0); if ($22) { $23 = (($14) + ($21)|0); $24 = ((($f)) + 100|0); HEAP32[$24>>2] = $23; $27 = $12; } else { $26 = $15;$41 = $12; label = 9; } } if ((label|0) == 9) { $25 = ((($f)) + 100|0); HEAP32[$25>>2] = $26; $27 = $41; } $28 = ($27|0)==(0|0); $$phi$trans$insert3 = ((($f)) + 4|0); $$pre4 = HEAP32[$$phi$trans$insert3>>2]|0; if (!($28)) { $29 = $27; $30 = $$pre4; $31 = ((($f)) + 108|0); $32 = HEAP32[$31>>2]|0; $33 = (($29) + 1)|0; $34 = (($33) - ($30))|0; $35 = (($34) + ($32))|0; HEAP32[$31>>2] = $35; } $36 = ((($$pre4)) + -1|0); $37 = HEAP8[$36>>0]|0; $38 = $37&255; $39 = ($38|0)==($6|0); if ($39) { $$0 = $6; } else { $40 = $6&255; HEAP8[$36>>0] = $40; $$0 = $6; } } } if ((label|0) == 4) { $8 = ((($f)) + 100|0); HEAP32[$8>>2] = 0; $$0 = -1; } return ($$0|0); } function ___syscall_ret($r) { $r = $r|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($r>>>0)>(4294963200); if ($0) { $1 = (0 - ($r))|0; $2 = (___errno_location()|0); HEAP32[$2>>2] = $1; $$0 = -1; } else { $$0 = $r; } return ($$0|0); } function _copysign($x,$y) { $x = +$x; $y = +$y; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, label = 0, sp = 0; sp = STACKTOP; HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; $1 = HEAP32[tempDoublePtr+4>>2]|0; HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0; $3 = HEAP32[tempDoublePtr+4>>2]|0; $4 = $1 & 2147483647; $5 = $3 & -2147483648; $6 = $5 | $4; HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $6;$7 = +HEAPF64[tempDoublePtr>>3]; return (+$7); } function _copysignl($x,$y) { $x = +$x; $y = +$y; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_copysign($x,$y)); return (+$0); } function _fmod($x,$y) { $x = +$x; $y = +$y; var $$0 = 0.0, $$lcssa7 = 0, $$x = 0.0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; var $15 = 0, $150 = 0.0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0; var $ex$0$lcssa = 0, $ex$026 = 0, $ex$1 = 0, $ex$2$lcssa = 0, $ex$212 = 0, $ex$3$lcssa = 0, $ex$39 = 0, $ey$0$lcssa = 0, $ey$020 = 0, $ey$1$ph = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; $1 = HEAP32[tempDoublePtr+4>>2]|0; HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0; $3 = HEAP32[tempDoublePtr+4>>2]|0; $4 = (_bitshift64Lshr(($0|0),($1|0),52)|0); $5 = tempRet0; $6 = $4 & 2047; $7 = (_bitshift64Lshr(($2|0),($3|0),52)|0); $8 = tempRet0; $9 = $7 & 2047; $10 = $1 & -2147483648; $11 = (_bitshift64Shl(($2|0),($3|0),1)|0); $12 = tempRet0; $13 = ($11|0)==(0); $14 = ($12|0)==(0); $15 = $13 & $14; L1: do { if ($15) { label = 3; } else { $16 = $3 & 2147483647; $17 = ($16>>>0)>(2146435072); $18 = ($2>>>0)>(0); $19 = ($16|0)==(2146435072); $20 = $19 & $18; $21 = $17 | $20; $22 = ($6|0)==(2047); $or$cond = $21 | $22; if ($or$cond) { label = 3; } else { $25 = (_bitshift64Shl(($0|0),($1|0),1)|0); $26 = tempRet0; $27 = ($26>>>0)>($12>>>0); $28 = ($25>>>0)>($11>>>0); $29 = ($26|0)==($12|0); $30 = $29 & $28; $31 = $27 | $30; if (!($31)) { $32 = ($25|0)==($11|0); $33 = ($26|0)==($12|0); $34 = $32 & $33; $35 = $x * 0.0; $$x = $34 ? $35 : $x; return (+$$x); } $36 = ($6|0)==(0); if ($36) { $37 = (_bitshift64Shl(($0|0),($1|0),12)|0); $38 = tempRet0; $39 = ($38|0)>(-1); $40 = ($37>>>0)>(4294967295); $41 = ($38|0)==(-1); $42 = $41 & $40; $43 = $39 | $42; if ($43) { $45 = $37;$46 = $38;$ex$026 = 0; while(1) { $44 = (($ex$026) + -1)|0; $47 = (_bitshift64Shl(($45|0),($46|0),1)|0); $48 = tempRet0; $49 = ($48|0)>(-1); $50 = ($47>>>0)>(4294967295); $51 = ($48|0)==(-1); $52 = $51 & $50; $53 = $49 | $52; if ($53) { $45 = $47;$46 = $48;$ex$026 = $44; } else { $ex$0$lcssa = $44; break; } } } else { $ex$0$lcssa = 0; } $54 = (1 - ($ex$0$lcssa))|0; $55 = (_bitshift64Shl(($0|0),($1|0),($54|0))|0); $56 = tempRet0; $83 = $55;$84 = $56;$ex$1 = $ex$0$lcssa; } else { $57 = $1 & 1048575; $58 = $57 | 1048576; $83 = $0;$84 = $58;$ex$1 = $6; } $59 = ($9|0)==(0); if ($59) { $60 = (_bitshift64Shl(($2|0),($3|0),12)|0); $61 = tempRet0; $62 = ($61|0)>(-1); $63 = ($60>>>0)>(4294967295); $64 = ($61|0)==(-1); $65 = $64 & $63; $66 = $62 | $65; if ($66) { $68 = $60;$69 = $61;$ey$020 = 0; while(1) { $67 = (($ey$020) + -1)|0; $70 = (_bitshift64Shl(($68|0),($69|0),1)|0); $71 = tempRet0; $72 = ($71|0)>(-1); $73 = ($70>>>0)>(4294967295); $74 = ($71|0)==(-1); $75 = $74 & $73; $76 = $72 | $75; if ($76) { $68 = $70;$69 = $71;$ey$020 = $67; } else { $ey$0$lcssa = $67; break; } } } else { $ey$0$lcssa = 0; } $77 = (1 - ($ey$0$lcssa))|0; $78 = (_bitshift64Shl(($2|0),($3|0),($77|0))|0); $79 = tempRet0; $85 = $78;$86 = $79;$ey$1$ph = $ey$0$lcssa; } else { $80 = $3 & 1048575; $81 = $80 | 1048576; $85 = $2;$86 = $81;$ey$1$ph = $9; } $82 = ($ex$1|0)>($ey$1$ph|0); $87 = (_i64Subtract(($83|0),($84|0),($85|0),($86|0))|0); $88 = tempRet0; $89 = ($88|0)>(-1); $90 = ($87>>>0)>(4294967295); $91 = ($88|0)==(-1); $92 = $91 & $90; $93 = $89 | $92; L23: do { if ($82) { $152 = $93;$153 = $87;$154 = $88;$94 = $83;$96 = $84;$ex$212 = $ex$1; while(1) { if ($152) { $95 = ($94|0)==($85|0); $97 = ($96|0)==($86|0); $98 = $95 & $97; if ($98) { break; } else { $100 = $153;$101 = $154; } } else { $100 = $94;$101 = $96; } $102 = (_bitshift64Shl(($100|0),($101|0),1)|0); $103 = tempRet0; $104 = (($ex$212) + -1)|0; $105 = ($104|0)>($ey$1$ph|0); $106 = (_i64Subtract(($102|0),($103|0),($85|0),($86|0))|0); $107 = tempRet0; $108 = ($107|0)>(-1); $109 = ($106>>>0)>(4294967295); $110 = ($107|0)==(-1); $111 = $110 & $109; $112 = $108 | $111; if ($105) { $152 = $112;$153 = $106;$154 = $107;$94 = $102;$96 = $103;$ex$212 = $104; } else { $$lcssa7 = $112;$113 = $102;$115 = $103;$155 = $106;$156 = $107;$ex$2$lcssa = $104; break L23; } } $99 = $x * 0.0; $$0 = $99; break L1; } else { $$lcssa7 = $93;$113 = $83;$115 = $84;$155 = $87;$156 = $88;$ex$2$lcssa = $ex$1; } } while(0); if ($$lcssa7) { $114 = ($113|0)==($85|0); $116 = ($115|0)==($86|0); $117 = $114 & $116; if ($117) { $125 = $x * 0.0; $$0 = $125; break; } else { $118 = $156;$120 = $155; } } else { $118 = $115;$120 = $113; } $119 = ($118>>>0)<(1048576); $121 = ($120>>>0)<(0); $122 = ($118|0)==(1048576); $123 = $122 & $121; $124 = $119 | $123; if ($124) { $126 = $120;$127 = $118;$ex$39 = $ex$2$lcssa; while(1) { $128 = (_bitshift64Shl(($126|0),($127|0),1)|0); $129 = tempRet0; $130 = (($ex$39) + -1)|0; $131 = ($129>>>0)<(1048576); $132 = ($128>>>0)<(0); $133 = ($129|0)==(1048576); $134 = $133 & $132; $135 = $131 | $134; if ($135) { $126 = $128;$127 = $129;$ex$39 = $130; } else { $137 = $128;$138 = $129;$ex$3$lcssa = $130; break; } } } else { $137 = $120;$138 = $118;$ex$3$lcssa = $ex$2$lcssa; } $136 = ($ex$3$lcssa|0)>(0); if ($136) { $139 = (_i64Add(($137|0),($138|0),0,-1048576)|0); $140 = tempRet0; $141 = (_bitshift64Shl(($ex$3$lcssa|0),0,52)|0); $142 = tempRet0; $143 = $139 | $141; $144 = $140 | $142; $149 = $144;$151 = $143; } else { $145 = (1 - ($ex$3$lcssa))|0; $146 = (_bitshift64Lshr(($137|0),($138|0),($145|0))|0); $147 = tempRet0; $149 = $147;$151 = $146; } $148 = $149 | $10; HEAP32[tempDoublePtr>>2] = $151;HEAP32[tempDoublePtr+4>>2] = $148;$150 = +HEAPF64[tempDoublePtr>>3]; $$0 = $150; } } } while(0); if ((label|0) == 3) { $23 = $x * $y; $24 = $23 / $23; $$0 = $24; } return (+$$0); } function _fmodl($x,$y) { $x = +$x; $y = +$y; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_fmod($x,$y)); return (+$0); } function _frexp($x,$e) { $x = +$x; $e = $e|0; var $$0 = 0.0, $$01 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $storemerge = 0, label = 0, sp = 0; sp = STACKTOP; HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; $1 = HEAP32[tempDoublePtr+4>>2]|0; $2 = (_bitshift64Lshr(($0|0),($1|0),52)|0); $3 = tempRet0; $4 = $2 & 2047; switch ($4|0) { case 0: { $5 = $x != 0.0; if ($5) { $6 = $x * 1.8446744073709552E+19; $7 = (+_frexp($6,$e)); $8 = HEAP32[$e>>2]|0; $9 = (($8) + -64)|0; $$01 = $7;$storemerge = $9; } else { $$01 = $x;$storemerge = 0; } HEAP32[$e>>2] = $storemerge; $$0 = $$01; break; } case 2047: { $$0 = $x; break; } default: { $10 = (($4) + -1022)|0; HEAP32[$e>>2] = $10; $11 = $1 & -2146435073; $12 = $11 | 1071644672; HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $12;$13 = +HEAPF64[tempDoublePtr>>3]; $$0 = $13; } } return (+$$0); } function _frexpl($x,$e) { $x = +$x; $e = $e|0; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_frexp($x,$e)); return (+$0); } function _ldexp($x,$n) { $x = +$x; $n = $n|0; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_scalbn($x,$n)); return (+$0); } function _roundf($x) { $x = +$x; var $$0 = 0.0, $$x = 0.0, $$y$0 = 0.0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0; var $9 = 0.0, $y$0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (HEAPF32[tempDoublePtr>>2]=$x,HEAP32[tempDoublePtr>>2]|0); $1 = $0 >>> 23; $2 = $1 & 255; $3 = ($2>>>0)>(149); do { if ($3) { $$0 = $x; } else { $4 = ($0|0)<(0); $5 = -$x; $$x = $4 ? $5 : $x; $6 = ($2>>>0)<(126); if ($6) { $7 = $x * 0.0; $$0 = $7; break; } $8 = $$x + 8388608.0; $9 = $8 + -8388608.0; $10 = $9 - $$x; $11 = $10 > 0.5; if ($11) { $12 = $$x + $10; $13 = $12 + -1.0; $y$0 = $13; } else { $14 = !($10 <= -0.5); $15 = $$x + $10; if ($14) { $y$0 = $15; } else { $16 = $15 + 1.0; $y$0 = $16; } } $17 = -$y$0; $$y$0 = $4 ? $17 : $y$0; $$0 = $$y$0; } } while(0); return (+$$0); } function _scalbn($x,$n) { $x = +$x; $n = $n|0; var $$ = 0, $$0 = 0, $$1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0.0, $9 = 0, $y$0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = ($n|0)>(1023); if ($0) { $1 = $x * 8.9884656743115795E+307; $2 = (($n) + -1023)|0; $3 = ($2|0)>(1023); if ($3) { $4 = $1 * 8.9884656743115795E+307; $5 = (($n) + -2046)|0; $6 = ($5|0)>(1023); $$ = $6 ? 1023 : $5; $$0 = $$;$y$0 = $4; } else { $$0 = $2;$y$0 = $1; } } else { $7 = ($n|0)<(-1022); if ($7) { $8 = $x * 2.2250738585072014E-308; $9 = (($n) + 1022)|0; $10 = ($9|0)<(-1022); if ($10) { $11 = $8 * 2.2250738585072014E-308; $12 = (($n) + 2044)|0; $13 = ($12|0)<(-1022); $$1 = $13 ? -1022 : $12; $$0 = $$1;$y$0 = $11; } else { $$0 = $9;$y$0 = $8; } } else { $$0 = $n;$y$0 = $x; } } $14 = (($$0) + 1023)|0; $15 = (_bitshift64Shl(($14|0),0,52)|0); $16 = tempRet0; HEAP32[tempDoublePtr>>2] = $15;HEAP32[tempDoublePtr+4>>2] = $16;$17 = +HEAPF64[tempDoublePtr>>3]; $18 = $y$0 * $17; return (+$18); } function _scalbnl($x,$n) { $x = +$x; $n = $n|0; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_scalbn($x,$n)); return (+$0); } function _mbrtowc($wc,$src,$n,$st) { $wc = $wc|0; $src = $src|0; $n = $n|0; $st = $st|0; var $$0 = 0, $$024 = 0, $$1 = 0, $$lcssa = 0, $$lcssa35 = 0, $$st = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$05 = 0, $c$1 = 0, $c$2 = 0, $dummy = 0, $dummy$wc = 0, $s$06 = 0, $s$1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $dummy = sp; $0 = ($st|0)==(0|0); $$st = $0 ? 8944 : $st; $1 = HEAP32[$$st>>2]|0; $2 = ($src|0)==(0|0); L1: do { if ($2) { $3 = ($1|0)==(0); if ($3) { $$0 = 0; } else { label = 15; } } else { $4 = ($wc|0)==(0|0); $dummy$wc = $4 ? $dummy : $wc; $5 = ($n|0)==(0); if ($5) { $$0 = -2; } else { $6 = ($1|0)==(0); if ($6) { $7 = HEAP8[$src>>0]|0; $8 = $7&255; $9 = ($7<<24>>24)>(-1); if ($9) { HEAP32[$dummy$wc>>2] = $8; $10 = ($7<<24>>24)!=(0); $11 = $10&1; $$0 = $11; break; } $12 = (($8) + -194)|0; $13 = ($12>>>0)>(50); if ($13) { label = 15; break; } $14 = ((($src)) + 1|0); $15 = (8696 + ($12<<2)|0); $16 = HEAP32[$15>>2]|0; $17 = (($n) + -1)|0; $18 = ($17|0)==(0); if ($18) { $c$2 = $16; } else { $$024 = $17;$c$05 = $16;$s$06 = $14; label = 9; } } else { $$024 = $n;$c$05 = $1;$s$06 = $src; label = 9; } L11: do { if ((label|0) == 9) { $19 = HEAP8[$s$06>>0]|0; $20 = $19&255; $21 = $20 >>> 3; $22 = (($21) + -16)|0; $23 = $c$05 >> 26; $24 = (($21) + ($23))|0; $25 = $22 | $24; $26 = ($25>>>0)>(7); if ($26) { label = 15; break L1; } else { $$1 = $$024;$30 = $19;$c$1 = $c$05;$s$1 = $s$06; } while(1) { $27 = $c$1 << 6; $28 = ((($s$1)) + 1|0); $29 = $30&255; $31 = (($29) + -128)|0; $32 = $31 | $27; $33 = (($$1) + -1)|0; $34 = ($32|0)<(0); if (!($34)) { $$lcssa = $32;$$lcssa35 = $33; break; } $36 = ($33|0)==(0); if ($36) { $c$2 = $32; break L11; } $37 = HEAP8[$28>>0]|0; $38 = $37 & -64; $39 = ($38<<24>>24)==(-128); if ($39) { $$1 = $33;$30 = $37;$c$1 = $32;$s$1 = $28; } else { label = 15; break L1; } } HEAP32[$$st>>2] = 0; HEAP32[$dummy$wc>>2] = $$lcssa; $35 = (($n) - ($$lcssa35))|0; $$0 = $35; break L1; } } while(0); HEAP32[$$st>>2] = $c$2; $$0 = -2; } } } while(0); if ((label|0) == 15) { HEAP32[$$st>>2] = 0; $40 = (___errno_location()|0); HEAP32[$40>>2] = 84; $$0 = -1; } STACKTOP = sp;return ($$0|0); } function _mbsinit($st) { $st = $st|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($st|0)==(0|0); if ($0) { $4 = 1; } else { $1 = HEAP32[$st>>2]|0; $2 = ($1|0)==(0); $4 = $2; } $3 = $4&1; return ($3|0); } function _wcrtomb($s,$wc,$st) { $s = $s|0; $wc = $wc|0; $st = $st|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($s|0)==(0|0); do { if ($0) { $$0 = 1; } else { $1 = ($wc>>>0)<(128); if ($1) { $2 = $wc&255; HEAP8[$s>>0] = $2; $$0 = 1; break; } $3 = ($wc>>>0)<(2048); if ($3) { $4 = $wc >>> 6; $5 = $4 | 192; $6 = $5&255; $7 = ((($s)) + 1|0); HEAP8[$s>>0] = $6; $8 = $wc & 63; $9 = $8 | 128; $10 = $9&255; HEAP8[$7>>0] = $10; $$0 = 2; break; } $11 = ($wc>>>0)<(55296); $12 = $wc & -8192; $13 = ($12|0)==(57344); $or$cond = $11 | $13; if ($or$cond) { $14 = $wc >>> 12; $15 = $14 | 224; $16 = $15&255; $17 = ((($s)) + 1|0); HEAP8[$s>>0] = $16; $18 = $wc >>> 6; $19 = $18 & 63; $20 = $19 | 128; $21 = $20&255; $22 = ((($s)) + 2|0); HEAP8[$17>>0] = $21; $23 = $wc & 63; $24 = $23 | 128; $25 = $24&255; HEAP8[$22>>0] = $25; $$0 = 3; break; } $26 = (($wc) + -65536)|0; $27 = ($26>>>0)<(1048576); if ($27) { $28 = $wc >>> 18; $29 = $28 | 240; $30 = $29&255; $31 = ((($s)) + 1|0); HEAP8[$s>>0] = $30; $32 = $wc >>> 12; $33 = $32 & 63; $34 = $33 | 128; $35 = $34&255; $36 = ((($s)) + 2|0); HEAP8[$31>>0] = $35; $37 = $wc >>> 6; $38 = $37 & 63; $39 = $38 | 128; $40 = $39&255; $41 = ((($s)) + 3|0); HEAP8[$36>>0] = $40; $42 = $wc & 63; $43 = $42 | 128; $44 = $43&255; HEAP8[$41>>0] = $44; $$0 = 4; break; } else { $45 = (___errno_location()|0); HEAP32[$45>>2] = 84; $$0 = -1; break; } } } while(0); return ($$0|0); } function _wctomb($s,$wc) { $s = $s|0; $wc = $wc|0; var $$0 = 0, $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($s|0)==(0|0); if ($0) { $$0 = 0; } else { $1 = (_wcrtomb($s,$wc,0)|0); $$0 = $1; } return ($$0|0); } function _srand($s) { $s = $s|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (($s) + -1)|0; $1 = 144; $2 = $1; HEAP32[$2>>2] = $0; $3 = (($1) + 4)|0; $4 = $3; HEAP32[$4>>2] = 0; return; } function _fclose($f) { $f = $f|0; var $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>(-1); if ($2) { (___lockfile($f)|0); } $3 = HEAP32[$f>>2]|0; $4 = $3 & 1; $5 = ($4|0)!=(0); if (!($5)) { ___lock(((8680)|0)); $6 = ((($f)) + 52|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)==(0|0); $9 = $7; $$pre = ((($f)) + 56|0); if (!($8)) { $10 = HEAP32[$$pre>>2]|0; $11 = ((($7)) + 56|0); HEAP32[$11>>2] = $10; } $12 = HEAP32[$$pre>>2]|0; $13 = ($12|0)==(0|0); $14 = $12; if (!($13)) { $15 = ((($12)) + 52|0); HEAP32[$15>>2] = $9; } $16 = HEAP32[(8676)>>2]|0; $17 = ($16|0)==($f|0); if ($17) { HEAP32[(8676)>>2] = $14; } ___unlock(((8680)|0)); } $18 = (_fflush($f)|0); $19 = ((($f)) + 12|0); $20 = HEAP32[$19>>2]|0; $21 = (FUNCTION_TABLE_ii[$20 & 15]($f)|0); $22 = $21 | $18; $23 = ((($f)) + 92|0); $24 = HEAP32[$23>>2]|0; $25 = ($24|0)==(0|0); if (!($25)) { _free($24); } if (!($5)) { _free($f); } return ($22|0); } function _feof($f) { $f = $f|0; var $$lobit = 0, $$lobit1 = 0, $$lobit2 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>(-1); if ($2) { $5 = (___lockfile($f)|0); $phitmp = ($5|0)==(0); $6 = HEAP32[$f>>2]|0; $7 = $6 >>> 4; $$lobit = $7 & 1; if ($phitmp) { $$lobit2 = $$lobit; } else { ___unlockfile($f); $$lobit2 = $$lobit; } } else { $3 = HEAP32[$f>>2]|0; $4 = $3 >>> 4; $$lobit1 = $4 & 1; $$lobit2 = $$lobit1; } return ($$lobit2|0); } function _fflush($f) { $f = $f|0; var $$0 = 0, $$01 = 0, $$012 = 0, $$014 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, $r$0$lcssa = 0, $r$03 = 0, $r$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($f|0)==(0|0); do { if ($0) { $7 = HEAP32[8904>>2]|0; $8 = ($7|0)==(0|0); if ($8) { $27 = 0; } else { $9 = HEAP32[8904>>2]|0; $10 = (_fflush($9)|0); $27 = $10; } ___lock(((8680)|0)); $$012 = HEAP32[(8676)>>2]|0; $11 = ($$012|0)==(0|0); if ($11) { $r$0$lcssa = $27; } else { $$014 = $$012;$r$03 = $27; while(1) { $12 = ((($$014)) + 76|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)>(-1); if ($14) { $15 = (___lockfile($$014)|0); $23 = $15; } else { $23 = 0; } $16 = ((($$014)) + 20|0); $17 = HEAP32[$16>>2]|0; $18 = ((($$014)) + 28|0); $19 = HEAP32[$18>>2]|0; $20 = ($17>>>0)>($19>>>0); if ($20) { $21 = (___fflush_unlocked($$014)|0); $22 = $21 | $r$03; $r$1 = $22; } else { $r$1 = $r$03; } $24 = ($23|0)==(0); if (!($24)) { ___unlockfile($$014); } $25 = ((($$014)) + 56|0); $$01 = HEAP32[$25>>2]|0; $26 = ($$01|0)==(0|0); if ($26) { $r$0$lcssa = $r$1; break; } else { $$014 = $$01;$r$03 = $r$1; } } } ___unlock(((8680)|0)); $$0 = $r$0$lcssa; } else { $1 = ((($f)) + 76|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(-1); if (!($3)) { $4 = (___fflush_unlocked($f)|0); $$0 = $4; break; } $5 = (___lockfile($f)|0); $phitmp = ($5|0)==(0); $6 = (___fflush_unlocked($f)|0); if ($phitmp) { $$0 = $6; } else { ___unlockfile($f); $$0 = $6; } } } while(0); return ($$0|0); } function _fgetc($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(0); if ($2) { label = 3; } else { $3 = (___lockfile($f)|0); $4 = ($3|0)==(0); if ($4) { label = 3; } else { $14 = ((($f)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = ((($f)) + 8|0); $17 = HEAP32[$16>>2]|0; $18 = ($15>>>0)<($17>>>0); if ($18) { $19 = ((($15)) + 1|0); HEAP32[$14>>2] = $19; $20 = HEAP8[$15>>0]|0; $21 = $20&255; $23 = $21; } else { $22 = (___uflow($f)|0); $23 = $22; } ___unlockfile($f); $$0 = $23; } } do { if ((label|0) == 3) { $5 = ((($f)) + 4|0); $6 = HEAP32[$5>>2]|0; $7 = ((($f)) + 8|0); $8 = HEAP32[$7>>2]|0; $9 = ($6>>>0)<($8>>>0); if ($9) { $10 = ((($6)) + 1|0); HEAP32[$5>>2] = $10; $11 = HEAP8[$6>>0]|0; $12 = $11&255; $$0 = $12; break; } else { $13 = (___uflow($f)|0); $$0 = $13; break; } } } while(0); return ($$0|0); } function _fgets($s,$n,$f) { $s = $s|0; $n = $n|0; $f = $f|0; var $$0 = 0, $$048 = 0, $$05 = 0, $$lcssa14 = 0, $$old2 = 0, $$pre = 0, $$sum$pre$phiZZ2D = 0, $$sum6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $or$cond = 0, $or$cond3 = 0, $p$0 = 0, $p$1 = 0, $sext$mask = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>(-1); if ($2) { $3 = (___lockfile($f)|0); $12 = $3; } else { $12 = 0; } $4 = (($n) + -1)|0; $5 = ($n|0)<(2); if ($5) { $6 = ((($f)) + 74|0); $7 = HEAP8[$6>>0]|0; $8 = $7 << 24 >> 24; $9 = (($8) + 255)|0; $10 = $9 | $8; $11 = $10&255; HEAP8[$6>>0] = $11; $13 = ($12|0)==(0); if (!($13)) { ___unlockfile($f); } $14 = ($4|0)==(0); if ($14) { HEAP8[$s>>0] = 0; $$0 = $s; } else { $$0 = 0; } } else { $$old2 = ($4|0)==(0); L11: do { if ($$old2) { $p$1 = $s; label = 18; } else { $15 = ((($f)) + 4|0); $16 = ((($f)) + 8|0); $$05 = $4;$p$0 = $s; while(1) { $17 = HEAP32[$15>>2]|0; $18 = HEAP32[$16>>2]|0; $19 = $18; $20 = $17; $21 = (($19) - ($20))|0; $22 = (_memchr($17,10,$21)|0); $23 = ($22|0)==(0|0); $24 = $22; $25 = (1 - ($20))|0; $26 = (($25) + ($24))|0; $27 = $23 ? $21 : $26; $28 = ($27>>>0)<($$05>>>0); $29 = $28 ? $27 : $$05; _memcpy(($p$0|0),($17|0),($29|0))|0; $30 = HEAP32[$15>>2]|0; $31 = (($30) + ($29)|0); HEAP32[$15>>2] = $31; $32 = (($p$0) + ($29)|0); $33 = (($$05) - ($29))|0; $or$cond = $23 & $28; if (!($or$cond)) { $p$1 = $32; label = 18; break L11; } $34 = HEAP32[$16>>2]|0; $35 = ($31>>>0)<($34>>>0); if ($35) { $$sum6 = (($29) + 1)|0; $36 = (($30) + ($$sum6)|0); HEAP32[$15>>2] = $36; $37 = HEAP8[$31>>0]|0; $38 = $37&255; $$sum$pre$phiZZ2D = $$sum6;$47 = $38; } else { $39 = (___uflow($f)|0); $40 = ($39|0)<(0); if ($40) { $$lcssa14 = $32; break; } $$pre = (($29) + 1)|0; $$sum$pre$phiZZ2D = $$pre;$47 = $39; } $45 = (($33) + -1)|0; $46 = $47&255; $48 = (($p$0) + ($$sum$pre$phiZZ2D)|0); HEAP8[$32>>0] = $46; $sext$mask = $47 & 255; $49 = ($sext$mask|0)!=(10); $50 = ($45|0)!=(0); $or$cond3 = $50 & $49; if ($or$cond3) { $$05 = $45;$p$0 = $48; } else { $p$1 = $48; label = 18; break L11; } } $41 = ($$lcssa14|0)==($s|0); if ($41) { $$048 = 0; } else { $42 = HEAP32[$f>>2]|0; $43 = $42 & 16; $44 = ($43|0)==(0); if ($44) { $$048 = 0; } else { $p$1 = $$lcssa14; label = 18; } } } } while(0); if ((label|0) == 18) { $51 = ($s|0)==(0|0); if ($51) { $$048 = 0; } else { HEAP8[$p$1>>0] = 0; $$048 = $s; } } $52 = ($12|0)==(0); if ($52) { $$0 = $$048; } else { ___unlockfile($f); $$0 = $$048; } } return ($$0|0); } function _fopen($filename,$mode) { $filename = $filename|0; $mode = $mode|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer = sp; $0 = HEAP8[$mode>>0]|0; $1 = $0 << 24 >> 24; $memchr = (_memchr(28953,$1,4)|0); $2 = ($memchr|0)==(0|0); if ($2) { $3 = (___errno_location()|0); HEAP32[$3>>2] = 22; $$0 = 0; } else { $4 = (___fmodeflags($mode)|0); $5 = $4 | 32768; HEAP32[$vararg_buffer>>2] = $filename; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $5; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = 438; $6 = (___syscall5(5,($vararg_buffer|0))|0); $7 = (___syscall_ret($6)|0); $8 = ($7|0)<(0); if ($8) { $$0 = 0; } else { $9 = (___fdopen($7,$mode)|0); $10 = ($9|0)==(0|0); if ($10) { HEAP32[$vararg_buffer3>>2] = $7; (___syscall6(6,($vararg_buffer3|0))|0); $$0 = 0; } else { $$0 = $9; } } } STACKTOP = sp;return ($$0|0); } function _fputc($c,$f) { $c = $c|0; $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)<(0); if ($2) { label = 3; } else { $3 = (___lockfile($f)|0); $4 = ($3|0)==(0); if ($4) { label = 3; } else { $18 = ((($f)) + 75|0); $19 = HEAP8[$18>>0]|0; $20 = $19 << 24 >> 24; $21 = ($20|0)==($c|0); if ($21) { label = 10; } else { $22 = ((($f)) + 20|0); $23 = HEAP32[$22>>2]|0; $24 = ((($f)) + 16|0); $25 = HEAP32[$24>>2]|0; $26 = ($23>>>0)<($25>>>0); if ($26) { $27 = $c&255; $28 = ((($23)) + 1|0); HEAP32[$22>>2] = $28; HEAP8[$23>>0] = $27; $29 = $c & 255; $31 = $29; } else { label = 10; } } if ((label|0) == 10) { $30 = (___overflow($f,$c)|0); $31 = $30; } ___unlockfile($f); $$0 = $31; } } do { if ((label|0) == 3) { $5 = ((($f)) + 75|0); $6 = HEAP8[$5>>0]|0; $7 = $6 << 24 >> 24; $8 = ($7|0)==($c|0); if (!($8)) { $9 = ((($f)) + 20|0); $10 = HEAP32[$9>>2]|0; $11 = ((($f)) + 16|0); $12 = HEAP32[$11>>2]|0; $13 = ($10>>>0)<($12>>>0); if ($13) { $14 = $c&255; $15 = ((($10)) + 1|0); HEAP32[$9>>2] = $15; HEAP8[$10>>0] = $14; $16 = $c & 255; $$0 = $16; break; } } $17 = (___overflow($f,$c)|0); $$0 = $17; } } while(0); return ($$0|0); } function _fread($destv,$size,$nmemb,$f) { $destv = $destv|0; $size = $size|0; $nmemb = $nmemb|0; $f = $f|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $dest$0$ph = 0, $dest$02 = 0, $l$0$ph = 0, $l$03 = 0, $l$03$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = Math_imul($nmemb, $size)|0; $1 = ((($f)) + 76|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(-1); if ($3) { $4 = (___lockfile($f)|0); $31 = $4; } else { $31 = 0; } $5 = ((($f)) + 74|0); $6 = HEAP8[$5>>0]|0; $7 = $6 << 24 >> 24; $8 = (($7) + 255)|0; $9 = $8 | $7; $10 = $9&255; HEAP8[$5>>0] = $10; $11 = ((($f)) + 8|0); $12 = HEAP32[$11>>2]|0; $13 = ((($f)) + 4|0); $14 = HEAP32[$13>>2]|0; $15 = $12; $16 = $14; $17 = (($15) - ($16))|0; $18 = ($17|0)>(0); if ($18) { $19 = ($17>>>0)<($0>>>0); $$ = $19 ? $17 : $0; _memcpy(($destv|0),($14|0),($$|0))|0; $20 = (($14) + ($$)|0); HEAP32[$13>>2] = $20; $21 = (($destv) + ($$)|0); $22 = (($0) - ($$))|0; $dest$0$ph = $21;$l$0$ph = $22; } else { $dest$0$ph = $destv;$l$0$ph = $0; } $23 = ($l$0$ph|0)==(0); L7: do { if ($23) { label = 13; } else { $24 = ((($f)) + 32|0); $dest$02 = $dest$0$ph;$l$03 = $l$0$ph; while(1) { $25 = (___toread($f)|0); $26 = ($25|0)==(0); if (!($26)) { $l$03$lcssa = $l$03; break; } $27 = HEAP32[$24>>2]|0; $28 = (FUNCTION_TABLE_iiii[$27 & 15]($f,$dest$02,$l$03)|0); $29 = (($28) + 1)|0; $30 = ($29>>>0)<(2); if ($30) { $l$03$lcssa = $l$03; break; } $35 = (($l$03) - ($28))|0; $36 = (($dest$02) + ($28)|0); $37 = ($l$03|0)==($28|0); if ($37) { label = 13; break L7; } else { $dest$02 = $36;$l$03 = $35; } } $32 = ($31|0)==(0); if (!($32)) { ___unlockfile($f); } $33 = (($0) - ($l$03$lcssa))|0; $34 = (($33>>>0) / ($size>>>0))&-1; $$0 = $34; } } while(0); if ((label|0) == 13) { $38 = ($31|0)==(0); if ($38) { $$0 = $nmemb; } else { ___unlockfile($f); $$0 = $nmemb; } } return ($$0|0); } function _fscanf($f,$fmt,$varargs) { $f = $f|0; $fmt = $fmt|0; $varargs = $varargs|0; var $0 = 0, $ap = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $ap = sp; HEAP32[$ap>>2] = $varargs; $0 = (_vfscanf($f,$fmt,$ap)|0); STACKTOP = sp;return ($0|0); } function ___fseeko_unlocked($f,$off,$whence) { $f = $f|0; $off = $off|0; $whence = $whence|0; var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($whence|0)==(1); if ($0) { $1 = ((($f)) + 8|0); $2 = HEAP32[$1>>2]|0; $3 = ((($f)) + 4|0); $4 = HEAP32[$3>>2]|0; $5 = $2; $6 = $4; $7 = (($off) - ($5))|0; $8 = (($7) + ($6))|0; $$01 = $8; } else { $$01 = $off; } $9 = ((($f)) + 20|0); $10 = HEAP32[$9>>2]|0; $11 = ((($f)) + 28|0); $12 = HEAP32[$11>>2]|0; $13 = ($10>>>0)>($12>>>0); if ($13) { $14 = ((($f)) + 36|0); $15 = HEAP32[$14>>2]|0; (FUNCTION_TABLE_iiii[$15 & 15]($f,0,0)|0); $16 = HEAP32[$9>>2]|0; $17 = ($16|0)==(0|0); if ($17) { $$0 = -1; } else { label = 5; } } else { label = 5; } if ((label|0) == 5) { $18 = ((($f)) + 16|0); HEAP32[$18>>2] = 0; HEAP32[$11>>2] = 0; HEAP32[$9>>2] = 0; $19 = ((($f)) + 40|0); $20 = HEAP32[$19>>2]|0; $21 = (FUNCTION_TABLE_iiii[$20 & 15]($f,$$01,$whence)|0); $22 = ($21|0)<(0); if ($22) { $$0 = -1; } else { $23 = ((($f)) + 8|0); HEAP32[$23>>2] = 0; $24 = ((($f)) + 4|0); HEAP32[$24>>2] = 0; $25 = HEAP32[$f>>2]|0; $26 = $25 & -17; HEAP32[$f>>2] = $26; $$0 = 0; } } return ($$0|0); } function ___fseeko($f,$off,$whence) { $f = $f|0; $off = $off|0; $whence = $whence|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>(-1); if ($2) { $4 = (___lockfile($f)|0); $phitmp = ($4|0)==(0); $5 = (___fseeko_unlocked($f,$off,$whence)|0); if ($phitmp) { $6 = $5; } else { ___unlockfile($f); $6 = $5; } } else { $3 = (___fseeko_unlocked($f,$off,$whence)|0); $6 = $3; } return ($6|0); } function _fseek($f,$off,$whence) { $f = $f|0; $off = $off|0; $whence = $whence|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (___fseeko($f,$off,$whence)|0); return ($0|0); } function ___ftello_unlocked($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 40|0); $1 = HEAP32[$0>>2]|0; $2 = HEAP32[$f>>2]|0; $3 = $2 & 128; $4 = ($3|0)==(0); if ($4) { $10 = 1; } else { $5 = ((($f)) + 20|0); $6 = HEAP32[$5>>2]|0; $7 = ((($f)) + 28|0); $8 = HEAP32[$7>>2]|0; $9 = ($6>>>0)>($8>>>0); $phitmp = $9 ? 2 : 1; $10 = $phitmp; } $11 = (FUNCTION_TABLE_iiii[$1 & 15]($f,0,$10)|0); $12 = ($11|0)<(0); if ($12) { $$0 = $11; } else { $13 = ((($f)) + 8|0); $14 = HEAP32[$13>>2]|0; $15 = ((($f)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = $14; $18 = $16; $19 = ((($f)) + 20|0); $20 = HEAP32[$19>>2]|0; $21 = ((($f)) + 28|0); $22 = HEAP32[$21>>2]|0; $23 = $20; $24 = $22; $25 = (($11) - ($17))|0; $26 = (($25) + ($18))|0; $27 = (($26) + ($23))|0; $28 = (($27) - ($24))|0; $$0 = $28; } return ($$0|0); } function ___ftello($f) { $f = $f|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>(-1); if ($2) { $4 = (___lockfile($f)|0); $phitmp = ($4|0)==(0); $5 = (___ftello_unlocked($f)|0); if ($phitmp) { $6 = $5; } else { ___unlockfile($f); $6 = $5; } } else { $3 = (___ftello_unlocked($f)|0); $6 = $3; } return ($6|0); } function _ftell($f) { $f = $f|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (___ftello($f)|0); return ($0|0); } function ___fwritex($s,$l,$f) { $s = $s|0; $l = $l|0; $f = $f|0; var $$0 = 0, $$01 = 0, $$02 = 0, $$pre = 0, $$pre6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$lcssa10 = 0; var $i$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $3 = (___towrite($f)|0); $4 = ($3|0)==(0); if ($4) { $$pre = HEAP32[$0>>2]|0; $7 = $$pre; label = 4; } else { $$0 = 0; } } else { $7 = $1; label = 4; } L4: do { if ((label|0) == 4) { $5 = ((($f)) + 20|0); $6 = HEAP32[$5>>2]|0; $8 = $7; $9 = $6; $10 = (($8) - ($9))|0; $11 = ($10>>>0)<($l>>>0); if ($11) { $12 = ((($f)) + 36|0); $13 = HEAP32[$12>>2]|0; $14 = (FUNCTION_TABLE_iiii[$13 & 15]($f,$s,$l)|0); $$0 = $14; break; } $15 = ((($f)) + 75|0); $16 = HEAP8[$15>>0]|0; $17 = ($16<<24>>24)>(-1); L9: do { if ($17) { $i$0 = $l; while(1) { $18 = ($i$0|0)==(0); if ($18) { $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0; break L9; } $19 = (($i$0) + -1)|0; $20 = (($s) + ($19)|0); $21 = HEAP8[$20>>0]|0; $22 = ($21<<24>>24)==(10); if ($22) { $i$0$lcssa10 = $i$0; break; } else { $i$0 = $19; } } $23 = ((($f)) + 36|0); $24 = HEAP32[$23>>2]|0; $25 = (FUNCTION_TABLE_iiii[$24 & 15]($f,$s,$i$0$lcssa10)|0); $26 = ($25>>>0)<($i$0$lcssa10>>>0); if ($26) { $$0 = $i$0$lcssa10; break L4; } $27 = (($s) + ($i$0$lcssa10)|0); $28 = (($l) - ($i$0$lcssa10))|0; $$pre6 = HEAP32[$5>>2]|0; $$01 = $28;$$02 = $27;$29 = $$pre6;$i$1 = $i$0$lcssa10; } else { $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0; } } while(0); _memcpy(($29|0),($$02|0),($$01|0))|0; $30 = HEAP32[$5>>2]|0; $31 = (($30) + ($$01)|0); HEAP32[$5>>2] = $31; $32 = (($i$1) + ($$01))|0; $$0 = $32; } } while(0); return ($$0|0); } function _fwrite($src,$size,$nmemb,$f) { $src = $src|0; $size = $size|0; $nmemb = $nmemb|0; $f = $f|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = Math_imul($nmemb, $size)|0; $1 = ((($f)) + 76|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(-1); if ($3) { $5 = (___lockfile($f)|0); $phitmp = ($5|0)==(0); $6 = (___fwritex($src,$0,$f)|0); if ($phitmp) { $7 = $6; } else { ___unlockfile($f); $7 = $6; } } else { $4 = (___fwritex($src,$0,$f)|0); $7 = $4; } $8 = ($7|0)==($0|0); if ($8) { $10 = $nmemb; } else { $9 = (($7>>>0) / ($size>>>0))&-1; $10 = $9; } return ($10|0); } function _rewind($f) { $f = $f|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 76|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)>(-1); if ($2) { $3 = (___lockfile($f)|0); $phitmp = ($3|0)==(0); (___fseeko_unlocked($f,0,0)|0); $4 = HEAP32[$f>>2]|0; $5 = $4 & -33; HEAP32[$f>>2] = $5; if (!($phitmp)) { ___unlockfile($f); } } else { (___fseeko_unlocked($f,0,0)|0); $6 = HEAP32[$f>>2]|0; $7 = $6 & -33; HEAP32[$f>>2] = $7; } return; } function _sscanf($s,$fmt,$varargs) { $s = $s|0; $fmt = $fmt|0; $varargs = $varargs|0; var $0 = 0, $ap = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $ap = sp; HEAP32[$ap>>2] = $varargs; $0 = (_vsscanf($s,$fmt,$ap)|0); STACKTOP = sp;return ($0|0); } function _vfprintf($f,$fmt,$ap) { $f = $f|0; $fmt = $fmt|0; $ap = $ap|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ap2 = 0, $internal_buf = 0, $nl_arg = 0, $nl_type = 0; var $ret$1 = 0, $ret$1$ = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 224|0; $ap2 = sp + 120|0; $nl_type = sp + 80|0; $nl_arg = sp; $internal_buf = sp + 136|0; dest=$nl_type; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $vacopy_currentptr = HEAP32[$ap>>2]|0; HEAP32[$ap2>>2] = $vacopy_currentptr; $0 = (_printf_core(0,$fmt,$ap2,$nl_arg,$nl_type)|0); $1 = ($0|0)<(0); if ($1) { $$0 = -1; } else { $2 = ((($f)) + 76|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)>(-1); if ($4) { $5 = (___lockfile($f)|0); $32 = $5; } else { $32 = 0; } $6 = HEAP32[$f>>2]|0; $7 = $6 & 32; $8 = ((($f)) + 74|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)<(1); if ($10) { $11 = $6 & -33; HEAP32[$f>>2] = $11; } $12 = ((($f)) + 48|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)==(0); if ($14) { $16 = ((($f)) + 44|0); $17 = HEAP32[$16>>2]|0; HEAP32[$16>>2] = $internal_buf; $18 = ((($f)) + 28|0); HEAP32[$18>>2] = $internal_buf; $19 = ((($f)) + 20|0); HEAP32[$19>>2] = $internal_buf; HEAP32[$12>>2] = 80; $20 = ((($internal_buf)) + 80|0); $21 = ((($f)) + 16|0); HEAP32[$21>>2] = $20; $22 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0); $23 = ($17|0)==(0|0); if ($23) { $ret$1 = $22; } else { $24 = ((($f)) + 36|0); $25 = HEAP32[$24>>2]|0; (FUNCTION_TABLE_iiii[$25 & 15]($f,0,0)|0); $26 = HEAP32[$19>>2]|0; $27 = ($26|0)==(0|0); $$ = $27 ? -1 : $22; HEAP32[$16>>2] = $17; HEAP32[$12>>2] = 0; HEAP32[$21>>2] = 0; HEAP32[$18>>2] = 0; HEAP32[$19>>2] = 0; $ret$1 = $$; } } else { $15 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0); $ret$1 = $15; } $28 = HEAP32[$f>>2]|0; $29 = $28 & 32; $30 = ($29|0)==(0); $ret$1$ = $30 ? $ret$1 : -1; $31 = $28 | $7; HEAP32[$f>>2] = $31; $33 = ($32|0)==(0); if (!($33)) { ___unlockfile($f); } $$0 = $ret$1$; } STACKTOP = sp;return ($$0|0); } function _vfscanf($f,$fmt,$ap) { $f = $f|0; $fmt = $fmt|0; $ap = $ap|0; var $$ = 0, $$10 = 0, $$11 = 0, $$12 = 0, $$9 = 0, $$lcssa = 0, $$lcssa38 = 0, $$lcssa384 = 0, $$not = 0, $$old4 = 0, $$pre = 0, $$pre$phi182Z2D = 0, $$pre168 = 0, $$pre170 = 0, $$pre172 = 0, $$pre174 = 0, $$pre176 = 0, $$pre178 = 0, $$pre180 = 0, $$pre181 = 0; var $$size$0 = 0, $$width$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0; var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0; var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0; var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0; var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0; var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0; var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0; var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0; var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0; var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0; var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0; var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0; var $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0; var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0; var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0; var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $alloc$0 = 0, $alloc$0400 = 0, $alloc$1 = 0; var $alloc$2 = 0, $ap2$i = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $base$0 = 0, $c$0100 = 0, $dest$0 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $factor = 0; var $factor16 = 0, $i$0$i = 0, $i$0$ph = 0, $i$0$ph$phi = 0, $i$0$ph20 = 0, $i$0$ph20$lcssa = 0, $i$1 = 0, $i$2 = 0, $i$2$ph = 0, $i$2$ph$phi = 0, $i$3 = 0, $i$4 = 0, $invert$0 = 0, $isdigit = 0, $isdigit7 = 0, $isdigit795 = 0, $isdigittmp = 0, $isdigittmp6 = 0, $isdigittmp694 = 0, $k$0$ph = 0; var $k$1$ph = 0, $matches$0$ = 0, $matches$0104 = 0, $matches$0104$lcssa = 0, $matches$0104376 = 0, $matches$1 = 0, $matches$2 = 0, $matches$3 = 0, $not$ = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond8 = 0, $p$0109 = 0, $p$1 = 0, $p$1$lcssa = 0, $p$10 = 0, $p$11 = 0, $p$2 = 0, $p$3$lcssa = 0; var $p$396 = 0, $p$4 = 0, $p$5 = 0, $p$6 = 0, $p$7 = 0, $p$7$ph = 0, $p$8 = 0, $p$9 = 0, $pos$0108 = 0, $pos$1 = 0, $pos$2 = 0, $s$0107 = 0, $s$0107$lcssa = 0, $s$1 = 0, $s$2$ph = 0, $s$3 = 0, $s$4 = 0, $s$5 = 0, $s$6 = 0, $s$7 = 0; var $s$8 = 0, $scanset = 0, $size$0 = 0, $st = 0, $vacopy_currentptr = 0, $wc = 0, $wcs$0103 = 0, $wcs$0103$lcssa = 0, $wcs$1 = 0, $wcs$2 = 0, $wcs$3$ph = 0, $wcs$3$ph$lcssa = 0, $wcs$4 = 0, $wcs$5 = 0, $wcs$6 = 0, $wcs$7 = 0, $wcs$8 = 0, $wcs$9 = 0, $width$0$lcssa = 0, $width$097 = 0; var $width$1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 304|0; $ap2$i = sp + 16|0; $st = sp + 8|0; $scanset = sp + 33|0; $wc = sp; $0 = sp + 32|0; $1 = ((($f)) + 76|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(-1); if ($3) { $4 = (___lockfile($f)|0); $333 = $4; } else { $333 = 0; } $5 = HEAP8[$fmt>>0]|0; $6 = ($5<<24>>24)==(0); L4: do { if ($6) { $matches$3 = 0; } else { $7 = ((($f)) + 4|0); $8 = ((($f)) + 100|0); $9 = ((($f)) + 108|0); $10 = ((($f)) + 8|0); $11 = ((($scanset)) + 10|0); $12 = ((($scanset)) + 33|0); $13 = ((($st)) + 4|0); $14 = ((($scanset)) + 46|0); $15 = ((($scanset)) + 94|0); $17 = $5;$matches$0104 = 0;$p$0109 = $fmt;$pos$0108 = 0;$s$0107 = 0;$wcs$0103 = 0; L6: while(1) { $16 = $17&255; $18 = (_isspace($16)|0); $19 = ($18|0)==(0); L8: do { if ($19) { $46 = HEAP8[$p$0109>>0]|0; $47 = ($46<<24>>24)==(37); L10: do { if ($47) { $48 = ((($p$0109)) + 1|0); $49 = HEAP8[$48>>0]|0; L12: do { switch ($49<<24>>24) { case 37: { break L10; break; } case 42: { $70 = ((($p$0109)) + 2|0); $dest$0 = 0;$p$2 = $70; break; } default: { $71 = $49&255; $isdigittmp = (($71) + -48)|0; $isdigit = ($isdigittmp>>>0)<(10); if ($isdigit) { $72 = ((($p$0109)) + 2|0); $73 = HEAP8[$72>>0]|0; $74 = ($73<<24>>24)==(36); if ($74) { $vacopy_currentptr = HEAP32[$ap>>2]|0; HEAP32[$ap2$i>>2] = $vacopy_currentptr; $i$0$i = $isdigittmp; while(1) { $75 = ($i$0$i>>>0)>(1); $arglist_current = HEAP32[$ap2$i>>2]|0; $76 = $arglist_current; $77 = ((0) + 4|0); $expanded4 = $77; $expanded = (($expanded4) - 1)|0; $78 = (($76) + ($expanded))|0; $79 = ((0) + 4|0); $expanded8 = $79; $expanded7 = (($expanded8) - 1)|0; $expanded6 = $expanded7 ^ -1; $80 = $78 & $expanded6; $81 = $80; $82 = HEAP32[$81>>2]|0; $arglist_next = ((($81)) + 4|0); HEAP32[$ap2$i>>2] = $arglist_next; $83 = (($i$0$i) + -1)|0; if ($75) { $i$0$i = $83; } else { $$lcssa = $82; break; } } $84 = ((($p$0109)) + 3|0); $dest$0 = $$lcssa;$p$2 = $84; break L12; } } $arglist_current2 = HEAP32[$ap>>2]|0; $85 = $arglist_current2; $86 = ((0) + 4|0); $expanded11 = $86; $expanded10 = (($expanded11) - 1)|0; $87 = (($85) + ($expanded10))|0; $88 = ((0) + 4|0); $expanded15 = $88; $expanded14 = (($expanded15) - 1)|0; $expanded13 = $expanded14 ^ -1; $89 = $87 & $expanded13; $90 = $89; $91 = HEAP32[$90>>2]|0; $arglist_next3 = ((($90)) + 4|0); HEAP32[$ap>>2] = $arglist_next3; $dest$0 = $91;$p$2 = $48; } } } while(0); $92 = HEAP8[$p$2>>0]|0; $93 = $92&255; $isdigittmp694 = (($93) + -48)|0; $isdigit795 = ($isdigittmp694>>>0)<(10); if ($isdigit795) { $97 = $93;$p$396 = $p$2;$width$097 = 0; while(1) { $94 = ($width$097*10)|0; $95 = (($94) + -48)|0; $96 = (($95) + ($97))|0; $98 = ((($p$396)) + 1|0); $99 = HEAP8[$98>>0]|0; $100 = $99&255; $isdigittmp6 = (($100) + -48)|0; $isdigit7 = ($isdigittmp6>>>0)<(10); if ($isdigit7) { $97 = $100;$p$396 = $98;$width$097 = $96; } else { $$lcssa38 = $99;$p$3$lcssa = $98;$width$0$lcssa = $96; break; } } } else { $$lcssa38 = $92;$p$3$lcssa = $p$2;$width$0$lcssa = 0; } $101 = ($$lcssa38<<24>>24)==(109); if ($101) { $102 = ($dest$0|0)!=(0|0); $103 = $102&1; $104 = ((($p$3$lcssa)) + 1|0); $$pre168 = HEAP8[$104>>0]|0; $107 = $$pre168;$alloc$0 = $103;$p$4 = $104;$s$1 = 0;$wcs$1 = 0; } else { $107 = $$lcssa38;$alloc$0 = 0;$p$4 = $p$3$lcssa;$s$1 = $s$0107;$wcs$1 = $wcs$0103; } $105 = ((($p$4)) + 1|0); $106 = $107&255; switch ($106|0) { case 104: { $108 = HEAP8[$105>>0]|0; $109 = ($108<<24>>24)==(104); $110 = ((($p$4)) + 2|0); $$9 = $109 ? $110 : $105; $$10 = $109 ? -2 : -1; $p$5 = $$9;$size$0 = $$10; break; } case 108: { $111 = HEAP8[$105>>0]|0; $112 = ($111<<24>>24)==(108); $113 = ((($p$4)) + 2|0); $$11 = $112 ? $113 : $105; $$12 = $112 ? 3 : 1; $p$5 = $$11;$size$0 = $$12; break; } case 106: { $p$5 = $105;$size$0 = 3; break; } case 116: case 122: { $p$5 = $105;$size$0 = 1; break; } case 76: { $p$5 = $105;$size$0 = 2; break; } case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100: { $p$5 = $p$4;$size$0 = 0; break; } default: { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1; label = 152; break L6; } } $114 = HEAP8[$p$5>>0]|0; $115 = $114&255; $116 = $115 & 47; $117 = ($116|0)==(3); $118 = $115 | 32; $$ = $117 ? $118 : $115; $$size$0 = $117 ? 1 : $size$0; switch ($$|0) { case 99: { $119 = ($width$0$lcssa|0)<(1); $$width$0 = $119 ? 1 : $width$0$lcssa; $pos$1 = $pos$0108;$width$1 = $$width$0; break; } case 91: { $pos$1 = $pos$0108;$width$1 = $width$0$lcssa; break; } case 110: { $120 = ($pos$0108|0)<(0); $121 = $120 << 31 >> 31; $122 = ($dest$0|0)==(0|0); if ($122) { $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; } switch ($$size$0|0) { case -2: { $123 = $pos$0108&255; HEAP8[$dest$0>>0] = $123; $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; break; } case -1: { $124 = $pos$0108&65535; HEAP16[$dest$0>>1] = $124; $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; break; } case 0: { HEAP32[$dest$0>>2] = $pos$0108; $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; break; } case 1: { HEAP32[$dest$0>>2] = $pos$0108; $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; break; } case 3: { $125 = $dest$0; $126 = $125; HEAP32[$126>>2] = $pos$0108; $127 = (($125) + 4)|0; $128 = $127; HEAP32[$128>>2] = $121; $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; break; } default: { $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; break L8; } } break; } default: { ___shlim($f,0); while(1) { $129 = HEAP32[$7>>2]|0; $130 = HEAP32[$8>>2]|0; $131 = ($129>>>0)<($130>>>0); if ($131) { $132 = ((($129)) + 1|0); HEAP32[$7>>2] = $132; $133 = HEAP8[$129>>0]|0; $134 = $133&255; $136 = $134; } else { $135 = (___shgetc($f)|0); $136 = $135; } $137 = (_isspace($136)|0); $138 = ($137|0)==(0); if ($138) { break; } } $139 = HEAP32[$8>>2]|0; $140 = ($139|0)==(0|0); $$pre170 = HEAP32[$7>>2]|0; if ($140) { $144 = $$pre170; } else { $141 = ((($$pre170)) + -1|0); HEAP32[$7>>2] = $141; $144 = $141; } $142 = HEAP32[$9>>2]|0; $143 = HEAP32[$10>>2]|0; $145 = $144; $146 = $143; $147 = (($142) + ($pos$0108))|0; $148 = (($147) + ($145))|0; $149 = (($148) - ($146))|0; $pos$1 = $149;$width$1 = $width$0$lcssa; } } ___shlim($f,$width$1); $150 = HEAP32[$7>>2]|0; $151 = HEAP32[$8>>2]|0; $152 = ($150>>>0)<($151>>>0); if ($152) { $153 = ((($150)) + 1|0); HEAP32[$7>>2] = $153; $156 = $151; } else { $154 = (___shgetc($f)|0); $155 = ($154|0)<(0); if ($155) { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1; label = 152; break L6; } $$pre172 = HEAP32[$8>>2]|0; $156 = $$pre172; } $157 = ($156|0)==(0|0); if (!($157)) { $158 = HEAP32[$7>>2]|0; $159 = ((($158)) + -1|0); HEAP32[$7>>2] = $159; } L67: do { switch ($$|0) { case 91: case 99: case 115: { $160 = ($$|0)==(99); $161 = $$ & 239; $162 = ($161|0)==(99); L69: do { if ($162) { $163 = ($$|0)==(115); _memset(($scanset|0),-1,257)|0; HEAP8[$scanset>>0] = 0; if ($163) { HEAP8[$12>>0] = 0; ;HEAP8[$11>>0]=0|0;HEAP8[$11+1>>0]=0|0;HEAP8[$11+2>>0]=0|0;HEAP8[$11+3>>0]=0|0;HEAP8[$11+4>>0]=0|0; $p$9 = $p$5; } else { $p$9 = $p$5; } } else { $164 = ((($p$5)) + 1|0); $165 = HEAP8[$164>>0]|0; $166 = ($165<<24>>24)==(94); $167 = ((($p$5)) + 2|0); $invert$0 = $166&1; $168 = $166 ? $164 : $p$5; $p$6 = $166 ? $167 : $164; $169 = $166&1; _memset(($scanset|0),($169|0),257)|0; HEAP8[$scanset>>0] = 0; $170 = HEAP8[$p$6>>0]|0; switch ($170<<24>>24) { case 45: { $171 = ((($168)) + 2|0); $172 = $invert$0 ^ 1; $173 = $172&255; HEAP8[$14>>0] = $173; $$pre$phi182Z2D = $173;$p$7$ph = $171; break; } case 93: { $174 = ((($168)) + 2|0); $175 = $invert$0 ^ 1; $176 = $175&255; HEAP8[$15>>0] = $176; $$pre$phi182Z2D = $176;$p$7$ph = $174; break; } default: { $$pre180 = $invert$0 ^ 1; $$pre181 = $$pre180&255; $$pre$phi182Z2D = $$pre181;$p$7$ph = $p$6; } } $p$7 = $p$7$ph; while(1) { $177 = HEAP8[$p$7>>0]|0; L80: do { switch ($177<<24>>24) { case 0: { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1; label = 152; break L6; break; } case 93: { $p$9 = $p$7; break L69; break; } case 45: { $178 = ((($p$7)) + 1|0); $179 = HEAP8[$178>>0]|0; switch ($179<<24>>24) { case 93: case 0: { $190 = 45;$p$8 = $p$7; break L80; break; } default: { } } $180 = ((($p$7)) + -1|0); $181 = HEAP8[$180>>0]|0; $182 = ($181&255)<($179&255); if ($182) { $183 = $181&255; $c$0100 = $183; while(1) { $184 = (($c$0100) + 1)|0; $185 = (($scanset) + ($184)|0); HEAP8[$185>>0] = $$pre$phi182Z2D; $186 = HEAP8[$178>>0]|0; $187 = $186&255; $188 = ($184|0)<($187|0); if ($188) { $c$0100 = $184; } else { $190 = $186;$p$8 = $178; break; } } } else { $190 = $179;$p$8 = $178; } break; } default: { $190 = $177;$p$8 = $p$7; } } } while(0); $189 = $190&255; $191 = (($189) + 1)|0; $192 = (($scanset) + ($191)|0); HEAP8[$192>>0] = $$pre$phi182Z2D; $193 = ((($p$8)) + 1|0); $p$7 = $193; } } } while(0); $194 = (($width$1) + 1)|0; $195 = $160 ? $194 : 31; $196 = ($$size$0|0)==(1); $197 = ($alloc$0|0)!=(0); L88: do { if ($196) { if ($197) { $198 = $195 << 2; $199 = (_malloc($198)|0); $200 = ($199|0)==(0|0); if ($200) { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $199; label = 152; break L6; } else { $wcs$2 = $199; } } else { $wcs$2 = $dest$0; } HEAP32[$st>>2] = 0; HEAP32[$13>>2] = 0; $i$0$ph = 0;$k$0$ph = $195;$wcs$3$ph = $wcs$2; L94: while(1) { $201 = ($wcs$3$ph|0)==(0|0); $i$0$ph20 = $i$0$ph; while(1) { L98: while(1) { $202 = HEAP32[$7>>2]|0; $203 = HEAP32[$8>>2]|0; $204 = ($202>>>0)<($203>>>0); if ($204) { $205 = ((($202)) + 1|0); HEAP32[$7>>2] = $205; $206 = HEAP8[$202>>0]|0; $207 = $206&255; $210 = $207; } else { $208 = (___shgetc($f)|0); $210 = $208; } $209 = (($210) + 1)|0; $211 = (($scanset) + ($209)|0); $212 = HEAP8[$211>>0]|0; $213 = ($212<<24>>24)==(0); if ($213) { $i$0$ph20$lcssa = $i$0$ph20;$wcs$3$ph$lcssa = $wcs$3$ph; break L94; } $214 = $210&255; HEAP8[$0>>0] = $214; $215 = (_mbrtowc($wc,$0,1,$st)|0); switch ($215|0) { case -1: { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph; label = 152; break L6; break; } case -2: { break; } default: { break L98; } } } if ($201) { $i$1 = $i$0$ph20; } else { $216 = HEAP32[$wc>>2]|0; $217 = (($i$0$ph20) + 1)|0; $218 = (($wcs$3$ph) + ($i$0$ph20<<2)|0); HEAP32[$218>>2] = $216; $i$1 = $217; } $219 = ($i$1|0)==($k$0$ph|0); $or$cond = $197 & $219; if ($or$cond) { break; } else { $i$0$ph20 = $i$1; } } $factor = $k$0$ph << 1; $220 = $factor | 1; $221 = $220 << 2; $222 = (_realloc($wcs$3$ph,$221)|0); $223 = ($222|0)==(0|0); if ($223) { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph; label = 152; break L6; } $i$0$ph$phi = $k$0$ph;$k$0$ph = $220;$wcs$3$ph = $222;$i$0$ph = $i$0$ph$phi; } $224 = (_mbsinit($st)|0); $225 = ($224|0)==(0); if ($225) { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph$lcssa; label = 152; break L6; } else { $i$4 = $i$0$ph20$lcssa;$s$3 = 0;$wcs$4 = $wcs$3$ph$lcssa; } } else { if ($197) { $226 = (_malloc($195)|0); $227 = ($226|0)==(0|0); if ($227) { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = 0; label = 152; break L6; } else { $i$2$ph = 0;$k$1$ph = $195;$s$2$ph = $226; } while(1) { $i$2 = $i$2$ph; while(1) { $228 = HEAP32[$7>>2]|0; $229 = HEAP32[$8>>2]|0; $230 = ($228>>>0)<($229>>>0); if ($230) { $231 = ((($228)) + 1|0); HEAP32[$7>>2] = $231; $232 = HEAP8[$228>>0]|0; $233 = $232&255; $236 = $233; } else { $234 = (___shgetc($f)|0); $236 = $234; } $235 = (($236) + 1)|0; $237 = (($scanset) + ($235)|0); $238 = HEAP8[$237>>0]|0; $239 = ($238<<24>>24)==(0); if ($239) { $i$4 = $i$2;$s$3 = $s$2$ph;$wcs$4 = 0; break L88; } $240 = $236&255; $241 = (($i$2) + 1)|0; $242 = (($s$2$ph) + ($i$2)|0); HEAP8[$242>>0] = $240; $243 = ($241|0)==($k$1$ph|0); if ($243) { break; } else { $i$2 = $241; } } $factor16 = $k$1$ph << 1; $244 = $factor16 | 1; $245 = (_realloc($s$2$ph,$244)|0); $246 = ($245|0)==(0|0); if ($246) { $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$2$ph;$wcs$7 = 0; label = 152; break L6; } else { $i$2$ph$phi = $k$1$ph;$k$1$ph = $244;$s$2$ph = $245;$i$2$ph = $i$2$ph$phi; } } } $247 = ($dest$0|0)==(0|0); if ($247) { $265 = $156; while(1) { $263 = HEAP32[$7>>2]|0; $264 = ($263>>>0)<($265>>>0); if ($264) { $266 = ((($263)) + 1|0); HEAP32[$7>>2] = $266; $267 = HEAP8[$263>>0]|0; $268 = $267&255; $271 = $268; } else { $269 = (___shgetc($f)|0); $271 = $269; } $270 = (($271) + 1)|0; $272 = (($scanset) + ($270)|0); $273 = HEAP8[$272>>0]|0; $274 = ($273<<24>>24)==(0); if ($274) { $i$4 = 0;$s$3 = 0;$wcs$4 = 0; break L88; } $$pre176 = HEAP32[$8>>2]|0; $265 = $$pre176; } } else { $250 = $156;$i$3 = 0; while(1) { $248 = HEAP32[$7>>2]|0; $249 = ($248>>>0)<($250>>>0); if ($249) { $251 = ((($248)) + 1|0); HEAP32[$7>>2] = $251; $252 = HEAP8[$248>>0]|0; $253 = $252&255; $256 = $253; } else { $254 = (___shgetc($f)|0); $256 = $254; } $255 = (($256) + 1)|0; $257 = (($scanset) + ($255)|0); $258 = HEAP8[$257>>0]|0; $259 = ($258<<24>>24)==(0); if ($259) { $i$4 = $i$3;$s$3 = $dest$0;$wcs$4 = 0; break L88; } $260 = $256&255; $261 = (($i$3) + 1)|0; $262 = (($dest$0) + ($i$3)|0); HEAP8[$262>>0] = $260; $$pre174 = HEAP32[$8>>2]|0; $250 = $$pre174;$i$3 = $261; } } } } while(0); $275 = HEAP32[$8>>2]|0; $276 = ($275|0)==(0|0); $$pre178 = HEAP32[$7>>2]|0; if ($276) { $280 = $$pre178; } else { $277 = ((($$pre178)) + -1|0); HEAP32[$7>>2] = $277; $280 = $277; } $278 = HEAP32[$9>>2]|0; $279 = HEAP32[$10>>2]|0; $281 = $280; $282 = $279; $283 = (($281) - ($282))|0; $284 = (($283) + ($278))|0; $285 = ($284|0)==(0); if ($285) { $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4; break L6; } $$not = $160 ^ 1; $286 = ($284|0)==($width$1|0); $or$cond8 = $286 | $$not; if (!($or$cond8)) { $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4; break L6; } do { if ($197) { if ($196) { HEAP32[$dest$0>>2] = $wcs$4; break; } else { HEAP32[$dest$0>>2] = $s$3; break; } } } while(0); if ($160) { $p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4; } else { $287 = ($wcs$4|0)==(0|0); if (!($287)) { $288 = (($wcs$4) + ($i$4<<2)|0); HEAP32[$288>>2] = 0; } $289 = ($s$3|0)==(0|0); if ($289) { $p$10 = $p$9;$s$4 = 0;$wcs$5 = $wcs$4; break L67; } $290 = (($s$3) + ($i$4)|0); HEAP8[$290>>0] = 0; $p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4; } break; } case 120: case 88: case 112: { $base$0 = 16; label = 134; break; } case 111: { $base$0 = 8; label = 134; break; } case 117: case 100: { $base$0 = 10; label = 134; break; } case 105: { $base$0 = 0; label = 134; break; } case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97: { $310 = (+___floatscan($f,$$size$0,0)); $311 = HEAP32[$9>>2]|0; $312 = HEAP32[$7>>2]|0; $313 = HEAP32[$10>>2]|0; $314 = $312; $315 = $313; $316 = (($315) - ($314))|0; $317 = ($311|0)==($316|0); if ($317) { $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1; break L6; } $318 = ($dest$0|0)==(0|0); if ($318) { $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; } else { switch ($$size$0|0) { case 0: { $319 = $310; HEAPF32[$dest$0>>2] = $319; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L67; break; } case 1: { HEAPF64[$dest$0>>3] = $310; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L67; break; } case 2: { HEAPF64[$dest$0>>3] = $310; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L67; break; } default: { $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L67; } } } break; } default: { $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; } } } while(0); L168: do { if ((label|0) == 134) { label = 0; $291 = (___intscan($f,$base$0,0,-1,-1)|0); $292 = tempRet0; $293 = HEAP32[$9>>2]|0; $294 = HEAP32[$7>>2]|0; $295 = HEAP32[$10>>2]|0; $296 = $294; $297 = $295; $298 = (($297) - ($296))|0; $299 = ($293|0)==($298|0); if ($299) { $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1; break L6; } $300 = ($$|0)==(112); $301 = ($dest$0|0)!=(0|0); $or$cond3 = $301 & $300; if ($or$cond3) { $302 = $291; HEAP32[$dest$0>>2] = $302; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break; } $303 = ($dest$0|0)==(0|0); if ($303) { $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; } else { switch ($$size$0|0) { case -2: { $304 = $291&255; HEAP8[$dest$0>>0] = $304; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L168; break; } case -1: { $305 = $291&65535; HEAP16[$dest$0>>1] = $305; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L168; break; } case 0: { HEAP32[$dest$0>>2] = $291; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L168; break; } case 1: { HEAP32[$dest$0>>2] = $291; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L168; break; } case 3: { $306 = $dest$0; $307 = $306; HEAP32[$307>>2] = $291; $308 = (($306) + 4)|0; $309 = $308; HEAP32[$309>>2] = $292; $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L168; break; } default: { $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; break L168; } } } } } while(0); $320 = HEAP32[$9>>2]|0; $321 = HEAP32[$7>>2]|0; $322 = HEAP32[$10>>2]|0; $323 = $321; $324 = $322; $325 = (($320) + ($pos$1))|0; $326 = (($325) + ($323))|0; $327 = (($326) - ($324))|0; $not$ = ($dest$0|0)!=(0|0); $328 = $not$&1; $matches$0$ = (($328) + ($matches$0104))|0; $matches$1 = $matches$0$;$p$11 = $p$10;$pos$2 = $327;$s$5 = $s$4;$wcs$6 = $wcs$5; break L8; } } while(0); $50 = $47&1; $51 = (($p$0109) + ($50)|0); ___shlim($f,0); $52 = HEAP32[$7>>2]|0; $53 = HEAP32[$8>>2]|0; $54 = ($52>>>0)<($53>>>0); if ($54) { $55 = ((($52)) + 1|0); HEAP32[$7>>2] = $55; $56 = HEAP8[$52>>0]|0; $57 = $56&255; $61 = $57; } else { $58 = (___shgetc($f)|0); $61 = $58; } $59 = HEAP8[$51>>0]|0; $60 = $59&255; $62 = ($61|0)==($60|0); if (!($62)) { $$lcssa384 = $61;$matches$0104$lcssa = $matches$0104;$s$0107$lcssa = $s$0107;$wcs$0103$lcssa = $wcs$0103; label = 21; break L6; } $69 = (($pos$0108) + 1)|0; $matches$1 = $matches$0104;$p$11 = $51;$pos$2 = $69;$s$5 = $s$0107;$wcs$6 = $wcs$0103; } else { $p$1 = $p$0109; while(1) { $20 = ((($p$1)) + 1|0); $21 = HEAP8[$20>>0]|0; $22 = $21&255; $23 = (_isspace($22)|0); $24 = ($23|0)==(0); if ($24) { $p$1$lcssa = $p$1; break; } else { $p$1 = $20; } } ___shlim($f,0); while(1) { $25 = HEAP32[$7>>2]|0; $26 = HEAP32[$8>>2]|0; $27 = ($25>>>0)<($26>>>0); if ($27) { $28 = ((($25)) + 1|0); HEAP32[$7>>2] = $28; $29 = HEAP8[$25>>0]|0; $30 = $29&255; $32 = $30; } else { $31 = (___shgetc($f)|0); $32 = $31; } $33 = (_isspace($32)|0); $34 = ($33|0)==(0); if ($34) { break; } } $35 = HEAP32[$8>>2]|0; $36 = ($35|0)==(0|0); $$pre = HEAP32[$7>>2]|0; if ($36) { $40 = $$pre; } else { $37 = ((($$pre)) + -1|0); HEAP32[$7>>2] = $37; $40 = $37; } $38 = HEAP32[$9>>2]|0; $39 = HEAP32[$10>>2]|0; $41 = $40; $42 = $39; $43 = (($38) + ($pos$0108))|0; $44 = (($43) + ($41))|0; $45 = (($44) - ($42))|0; $matches$1 = $matches$0104;$p$11 = $p$1$lcssa;$pos$2 = $45;$s$5 = $s$0107;$wcs$6 = $wcs$0103; } } while(0); $329 = ((($p$11)) + 1|0); $330 = HEAP8[$329>>0]|0; $331 = ($330<<24>>24)==(0); if ($331) { $matches$3 = $matches$1; break L4; } else { $17 = $330;$matches$0104 = $matches$1;$p$0109 = $329;$pos$0108 = $pos$2;$s$0107 = $s$5;$wcs$0103 = $wcs$6; } } if ((label|0) == 21) { $63 = HEAP32[$8>>2]|0; $64 = ($63|0)==(0|0); if (!($64)) { $65 = HEAP32[$7>>2]|0; $66 = ((($65)) + -1|0); HEAP32[$7>>2] = $66; } $67 = ($$lcssa384|0)>(-1); $68 = ($matches$0104$lcssa|0)!=(0); $or$cond5 = $68 | $67; if ($or$cond5) { $matches$3 = $matches$0104$lcssa; break; } else { $alloc$1 = 0;$s$7 = $s$0107$lcssa;$wcs$8 = $wcs$0103$lcssa; label = 153; } } else if ((label|0) == 152) { $$old4 = ($matches$0104376|0)==(0); if ($$old4) { $alloc$1 = $alloc$0400;$s$7 = $s$6;$wcs$8 = $wcs$7; label = 153; } else { $alloc$2 = $alloc$0400;$matches$2 = $matches$0104376;$s$8 = $s$6;$wcs$9 = $wcs$7; } } if ((label|0) == 153) { $alloc$2 = $alloc$1;$matches$2 = -1;$s$8 = $s$7;$wcs$9 = $wcs$8; } $332 = ($alloc$2|0)==(0); if ($332) { $matches$3 = $matches$2; } else { _free($s$8); _free($wcs$9); $matches$3 = $matches$2; } } } while(0); $334 = ($333|0)==(0); if (!($334)) { ___unlockfile($f); } STACKTOP = sp;return ($matches$3|0); } function _vsscanf($s,$fmt,$ap) { $s = $s|0; $fmt = $fmt|0; $ap = $ap|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $f = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $f = sp; dest=$f; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $0 = ((($f)) + 32|0); HEAP32[$0>>2] = 6; $1 = ((($f)) + 44|0); HEAP32[$1>>2] = $s; $2 = ((($f)) + 76|0); HEAP32[$2>>2] = -1; $3 = ((($f)) + 84|0); HEAP32[$3>>2] = $s; $4 = (_vfscanf($f,$fmt,$ap)|0); STACKTOP = sp;return ($4|0); } function ___fdopen($fd,$mode) { $fd = $fd|0; $mode = $mode|0; var $$0 = 0, $$pre = 0, $$pre1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $tio = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0; var sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; $vararg_buffer12 = sp + 40|0; $vararg_buffer7 = sp + 24|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer = sp; $tio = sp + 52|0; $0 = HEAP8[$mode>>0]|0; $1 = $0 << 24 >> 24; $memchr = (_memchr(28953,$1,4)|0); $2 = ($memchr|0)==(0|0); if ($2) { $3 = (___errno_location()|0); HEAP32[$3>>2] = 22; $$0 = 0; } else { $4 = (_malloc(1144)|0); $5 = ($4|0)==(0|0); if ($5) { $$0 = 0; } else { dest=$4; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $6 = (_strchr($mode,43)|0); $7 = ($6|0)==(0|0); if ($7) { $8 = ($0<<24>>24)==(114); $9 = $8 ? 8 : 4; HEAP32[$4>>2] = $9; } $10 = (_strchr($mode,101)|0); $11 = ($10|0)==(0|0); if ($11) { $12 = $0; } else { HEAP32[$vararg_buffer>>2] = $fd; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = 2; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = 1; (___syscall221(221,($vararg_buffer|0))|0); $$pre = HEAP8[$mode>>0]|0; $12 = $$pre; } $13 = ($12<<24>>24)==(97); if ($13) { HEAP32[$vararg_buffer3>>2] = $fd; $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); HEAP32[$vararg_ptr6>>2] = 3; $14 = (___syscall221(221,($vararg_buffer3|0))|0); $15 = $14 & 1024; $16 = ($15|0)==(0); if ($16) { $17 = $14 | 1024; HEAP32[$vararg_buffer7>>2] = $fd; $vararg_ptr10 = ((($vararg_buffer7)) + 4|0); HEAP32[$vararg_ptr10>>2] = 4; $vararg_ptr11 = ((($vararg_buffer7)) + 8|0); HEAP32[$vararg_ptr11>>2] = $17; (___syscall221(221,($vararg_buffer7|0))|0); } $18 = HEAP32[$4>>2]|0; $19 = $18 | 128; HEAP32[$4>>2] = $19; $26 = $19; } else { $$pre1 = HEAP32[$4>>2]|0; $26 = $$pre1; } $20 = ((($4)) + 60|0); HEAP32[$20>>2] = $fd; $21 = ((($4)) + 120|0); $22 = ((($4)) + 44|0); HEAP32[$22>>2] = $21; $23 = ((($4)) + 48|0); HEAP32[$23>>2] = 1024; $24 = ((($4)) + 75|0); HEAP8[$24>>0] = -1; $25 = $26 & 8; $27 = ($25|0)==(0); if ($27) { HEAP32[$vararg_buffer12>>2] = $fd; $vararg_ptr15 = ((($vararg_buffer12)) + 4|0); HEAP32[$vararg_ptr15>>2] = 21505; $vararg_ptr16 = ((($vararg_buffer12)) + 8|0); HEAP32[$vararg_ptr16>>2] = $tio; $28 = (___syscall54(54,($vararg_buffer12|0))|0); $29 = ($28|0)==(0); if ($29) { HEAP8[$24>>0] = 10; } } $30 = ((($4)) + 32|0); HEAP32[$30>>2] = 7; $31 = ((($4)) + 36|0); HEAP32[$31>>2] = 8; $32 = ((($4)) + 40|0); HEAP32[$32>>2] = 3; $33 = ((($4)) + 12|0); HEAP32[$33>>2] = 2; $34 = HEAP32[(8656)>>2]|0; $35 = ($34|0)==(0); if ($35) { $36 = ((($4)) + 76|0); HEAP32[$36>>2] = -1; } ___lock(((8680)|0)); $37 = HEAP32[(8676)>>2]|0; $38 = ((($4)) + 56|0); HEAP32[$38>>2] = $37; $39 = ($37|0)==(0); if (!($39)) { $40 = $37; $41 = ((($40)) + 52|0); HEAP32[$41>>2] = $4; } HEAP32[(8676)>>2] = $4; ___unlock(((8680)|0)); $$0 = $4; } } STACKTOP = sp;return ($$0|0); } function ___fmodeflags($mode) { $mode = $mode|0; var $$ = 0, $$flags$4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $flags$0 = 0, $flags$0$ = 0, $flags$2 = 0; var $flags$2$ = 0, $flags$4 = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_strchr($mode,43)|0); $1 = ($0|0)==(0|0); $2 = HEAP8[$mode>>0]|0; $not$ = ($2<<24>>24)!=(114); $$ = $not$&1; $flags$0 = $1 ? $$ : 2; $3 = (_strchr($mode,120)|0); $4 = ($3|0)==(0|0); $5 = $flags$0 | 128; $flags$0$ = $4 ? $flags$0 : $5; $6 = (_strchr($mode,101)|0); $7 = ($6|0)==(0|0); $8 = $flags$0$ | 524288; $flags$2 = $7 ? $flags$0$ : $8; $9 = ($2<<24>>24)==(114); $10 = $flags$2 | 64; $flags$2$ = $9 ? $flags$2 : $10; $11 = ($2<<24>>24)==(119); $12 = $flags$2$ | 512; $flags$4 = $11 ? $12 : $flags$2$; $13 = ($2<<24>>24)==(97); $14 = $flags$4 | 1024; $$flags$4 = $13 ? $14 : $flags$4; return ($$flags$4|0); } function ___lockfile($f) { $f = $f|0; var label = 0, sp = 0; sp = STACKTOP; return 0; } function ___unlockfile($f) { $f = $f|0; var label = 0, sp = 0; sp = STACKTOP; return; } function ___overflow($f,$_c) { $f = $f|0; $_c = $_c|0; var $$0 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $c = sp; $0 = $_c&255; HEAP8[$c>>0] = $0; $1 = ((($f)) + 16|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)==(0|0); if ($3) { $4 = (___towrite($f)|0); $5 = ($4|0)==(0); if ($5) { $$pre = HEAP32[$1>>2]|0; $9 = $$pre; label = 4; } else { $$0 = -1; } } else { $9 = $2; label = 4; } do { if ((label|0) == 4) { $6 = ((($f)) + 20|0); $7 = HEAP32[$6>>2]|0; $8 = ($7>>>0)<($9>>>0); if ($8) { $10 = $_c & 255; $11 = ((($f)) + 75|0); $12 = HEAP8[$11>>0]|0; $13 = $12 << 24 >> 24; $14 = ($10|0)==($13|0); if (!($14)) { $15 = ((($7)) + 1|0); HEAP32[$6>>2] = $15; HEAP8[$7>>0] = $0; $$0 = $10; break; } } $16 = ((($f)) + 36|0); $17 = HEAP32[$16>>2]|0; $18 = (FUNCTION_TABLE_iiii[$17 & 15]($f,$c,1)|0); $19 = ($18|0)==(1); if ($19) { $20 = HEAP8[$c>>0]|0; $21 = $20&255; $$0 = $21; } else { $$0 = -1; } } } while(0); STACKTOP = sp;return ($$0|0); } function ___stdio_close($f) { $f = $f|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $vararg_buffer = sp; $0 = ((($f)) + 60|0); $1 = HEAP32[$0>>2]|0; HEAP32[$vararg_buffer>>2] = $1; $2 = (___syscall6(6,($vararg_buffer|0))|0); $3 = (___syscall_ret($2)|0); STACKTOP = sp;return ($3|0); } function ___stdio_read($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $cnt$0 = 0, $iov = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer = sp; $iov = sp + 32|0; HEAP32[$iov>>2] = $buf; $0 = ((($iov)) + 4|0); $1 = ((($f)) + 48|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)!=(0); $4 = $3&1; $5 = (($len) - ($4))|0; HEAP32[$0>>2] = $5; $6 = ((($iov)) + 8|0); $7 = ((($f)) + 44|0); $8 = HEAP32[$7>>2]|0; HEAP32[$6>>2] = $8; $9 = ((($iov)) + 12|0); HEAP32[$9>>2] = $2; $10 = HEAP32[8652>>2]|0; $11 = ($10|0)==(0|0); if ($11) { $16 = ((($f)) + 60|0); $17 = HEAP32[$16>>2]|0; HEAP32[$vararg_buffer3>>2] = $17; $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); HEAP32[$vararg_ptr6>>2] = $iov; $vararg_ptr7 = ((($vararg_buffer3)) + 8|0); HEAP32[$vararg_ptr7>>2] = 2; $18 = (___syscall145(145,($vararg_buffer3|0))|0); $19 = (___syscall_ret($18)|0); $cnt$0 = $19; } else { _pthread_cleanup_push((27|0),($f|0)); $12 = ((($f)) + 60|0); $13 = HEAP32[$12>>2]|0; HEAP32[$vararg_buffer>>2] = $13; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $iov; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = 2; $14 = (___syscall145(145,($vararg_buffer|0))|0); $15 = (___syscall_ret($14)|0); _pthread_cleanup_pop(0); $cnt$0 = $15; } $20 = ($cnt$0|0)<(1); if ($20) { $21 = $cnt$0 & 48; $22 = $21 ^ 16; $23 = HEAP32[$f>>2]|0; $24 = $23 | $22; HEAP32[$f>>2] = $24; $25 = ((($f)) + 8|0); HEAP32[$25>>2] = 0; $26 = ((($f)) + 4|0); HEAP32[$26>>2] = 0; $$0 = $cnt$0; } else { $27 = HEAP32[$0>>2]|0; $28 = ($cnt$0>>>0)>($27>>>0); if ($28) { $29 = (($cnt$0) - ($27))|0; $30 = HEAP32[$7>>2]|0; $31 = ((($f)) + 4|0); HEAP32[$31>>2] = $30; $32 = $30; $33 = (($32) + ($29)|0); $34 = ((($f)) + 8|0); HEAP32[$34>>2] = $33; $35 = HEAP32[$1>>2]|0; $36 = ($35|0)==(0); if ($36) { $$0 = $len; } else { $37 = ((($32)) + 1|0); HEAP32[$31>>2] = $37; $38 = HEAP8[$32>>0]|0; $39 = (($len) + -1)|0; $40 = (($buf) + ($39)|0); HEAP8[$40>>0] = $38; $$0 = $len; } } else { $$0 = $cnt$0; } } STACKTOP = sp;return ($$0|0); } function ___stdio_seek($f,$off,$whence) { $f = $f|0; $off = $off|0; $whence = $whence|0; var $$pre = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $ret = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $vararg_buffer = sp; $ret = sp + 20|0; $0 = ((($f)) + 60|0); $1 = HEAP32[$0>>2]|0; HEAP32[$vararg_buffer>>2] = $1; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = 0; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $off; $vararg_ptr3 = ((($vararg_buffer)) + 12|0); HEAP32[$vararg_ptr3>>2] = $ret; $vararg_ptr4 = ((($vararg_buffer)) + 16|0); HEAP32[$vararg_ptr4>>2] = $whence; $2 = (___syscall140(140,($vararg_buffer|0))|0); $3 = (___syscall_ret($2)|0); $4 = ($3|0)<(0); if ($4) { HEAP32[$ret>>2] = -1; $5 = -1; } else { $$pre = HEAP32[$ret>>2]|0; $5 = $$pre; } STACKTOP = sp;return ($5|0); } function ___stdio_write($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $$0 = 0, $$phi$trans$insert = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cnt$0 = 0, $cnt$1 = 0, $iov$0 = 0, $iov$0$lcssa11 = 0, $iov$1 = 0, $iovcnt$0 = 0; var $iovcnt$0$lcssa12 = 0, $iovcnt$1 = 0, $iovs = 0, $rem$0 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; $vararg_buffer3 = sp + 16|0; $vararg_buffer = sp; $iovs = sp + 32|0; $0 = ((($f)) + 28|0); $1 = HEAP32[$0>>2]|0; HEAP32[$iovs>>2] = $1; $2 = ((($iovs)) + 4|0); $3 = ((($f)) + 20|0); $4 = HEAP32[$3>>2]|0; $5 = $4; $6 = (($5) - ($1))|0; HEAP32[$2>>2] = $6; $7 = ((($iovs)) + 8|0); HEAP32[$7>>2] = $buf; $8 = ((($iovs)) + 12|0); HEAP32[$8>>2] = $len; $9 = (($6) + ($len))|0; $10 = ((($f)) + 60|0); $11 = ((($f)) + 44|0); $iov$0 = $iovs;$iovcnt$0 = 2;$rem$0 = $9; while(1) { $12 = HEAP32[8652>>2]|0; $13 = ($12|0)==(0|0); if ($13) { $17 = HEAP32[$10>>2]|0; HEAP32[$vararg_buffer3>>2] = $17; $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); HEAP32[$vararg_ptr6>>2] = $iov$0; $vararg_ptr7 = ((($vararg_buffer3)) + 8|0); HEAP32[$vararg_ptr7>>2] = $iovcnt$0; $18 = (___syscall146(146,($vararg_buffer3|0))|0); $19 = (___syscall_ret($18)|0); $cnt$0 = $19; } else { _pthread_cleanup_push((28|0),($f|0)); $14 = HEAP32[$10>>2]|0; HEAP32[$vararg_buffer>>2] = $14; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $iov$0; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $iovcnt$0; $15 = (___syscall146(146,($vararg_buffer|0))|0); $16 = (___syscall_ret($15)|0); _pthread_cleanup_pop(0); $cnt$0 = $16; } $20 = ($rem$0|0)==($cnt$0|0); if ($20) { label = 6; break; } $27 = ($cnt$0|0)<(0); if ($27) { $iov$0$lcssa11 = $iov$0;$iovcnt$0$lcssa12 = $iovcnt$0; label = 8; break; } $35 = (($rem$0) - ($cnt$0))|0; $36 = ((($iov$0)) + 4|0); $37 = HEAP32[$36>>2]|0; $38 = ($cnt$0>>>0)>($37>>>0); if ($38) { $39 = HEAP32[$11>>2]|0; HEAP32[$0>>2] = $39; HEAP32[$3>>2] = $39; $40 = (($cnt$0) - ($37))|0; $41 = ((($iov$0)) + 8|0); $42 = (($iovcnt$0) + -1)|0; $$phi$trans$insert = ((($iov$0)) + 12|0); $$pre = HEAP32[$$phi$trans$insert>>2]|0; $50 = $$pre;$cnt$1 = $40;$iov$1 = $41;$iovcnt$1 = $42; } else { $43 = ($iovcnt$0|0)==(2); if ($43) { $44 = HEAP32[$0>>2]|0; $45 = (($44) + ($cnt$0)|0); HEAP32[$0>>2] = $45; $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = 2; } else { $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = $iovcnt$0; } } $46 = HEAP32[$iov$1>>2]|0; $47 = (($46) + ($cnt$1)|0); HEAP32[$iov$1>>2] = $47; $48 = ((($iov$1)) + 4|0); $49 = (($50) - ($cnt$1))|0; HEAP32[$48>>2] = $49; $iov$0 = $iov$1;$iovcnt$0 = $iovcnt$1;$rem$0 = $35; } if ((label|0) == 6) { $21 = HEAP32[$11>>2]|0; $22 = ((($f)) + 48|0); $23 = HEAP32[$22>>2]|0; $24 = (($21) + ($23)|0); $25 = ((($f)) + 16|0); HEAP32[$25>>2] = $24; $26 = $21; HEAP32[$0>>2] = $26; HEAP32[$3>>2] = $26; $$0 = $len; } else if ((label|0) == 8) { $28 = ((($f)) + 16|0); HEAP32[$28>>2] = 0; HEAP32[$0>>2] = 0; HEAP32[$3>>2] = 0; $29 = HEAP32[$f>>2]|0; $30 = $29 | 32; HEAP32[$f>>2] = $30; $31 = ($iovcnt$0$lcssa12|0)==(2); if ($31) { $$0 = 0; } else { $32 = ((($iov$0$lcssa11)) + 4|0); $33 = HEAP32[$32>>2]|0; $34 = (($len) - ($33))|0; $$0 = $34; } } STACKTOP = sp;return ($$0|0); } function ___stdout_write($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tio = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; $vararg_buffer = sp; $tio = sp + 12|0; $0 = ((($f)) + 36|0); HEAP32[$0>>2] = 8; $1 = HEAP32[$f>>2]|0; $2 = $1 & 64; $3 = ($2|0)==(0); if ($3) { $4 = ((($f)) + 60|0); $5 = HEAP32[$4>>2]|0; HEAP32[$vararg_buffer>>2] = $5; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = 21505; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $tio; $6 = (___syscall54(54,($vararg_buffer|0))|0); $7 = ($6|0)==(0); if (!($7)) { $8 = ((($f)) + 75|0); HEAP8[$8>>0] = -1; } } $9 = (___stdio_write($f,$buf,$len)|0); STACKTOP = sp;return ($9|0); } function ___string_read($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$0$len = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 84|0); $1 = HEAP32[$0>>2]|0; $2 = (($len) + 256)|0; $3 = (_memchr($1,0,$2)|0); $4 = ($3|0)==(0|0); $5 = $3; $6 = $1; $7 = (($5) - ($6))|0; $k$0 = $4 ? $2 : $7; $8 = ($k$0>>>0)<($len>>>0); $k$0$len = $8 ? $k$0 : $len; _memcpy(($buf|0),($1|0),($k$0$len|0))|0; $9 = (($1) + ($k$0$len)|0); $10 = ((($f)) + 4|0); HEAP32[$10>>2] = $9; $11 = (($1) + ($k$0)|0); $12 = ((($f)) + 8|0); HEAP32[$12>>2] = $11; HEAP32[$0>>2] = $11; return ($k$0$len|0); } function ___toread($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 74|0); $1 = HEAP8[$0>>0]|0; $2 = $1 << 24 >> 24; $3 = (($2) + 255)|0; $4 = $3 | $2; $5 = $4&255; HEAP8[$0>>0] = $5; $6 = ((($f)) + 20|0); $7 = HEAP32[$6>>2]|0; $8 = ((($f)) + 44|0); $9 = HEAP32[$8>>2]|0; $10 = ($7>>>0)>($9>>>0); if ($10) { $11 = ((($f)) + 36|0); $12 = HEAP32[$11>>2]|0; (FUNCTION_TABLE_iiii[$12 & 15]($f,0,0)|0); } $13 = ((($f)) + 16|0); HEAP32[$13>>2] = 0; $14 = ((($f)) + 28|0); HEAP32[$14>>2] = 0; HEAP32[$6>>2] = 0; $15 = HEAP32[$f>>2]|0; $16 = $15 & 20; $17 = ($16|0)==(0); if ($17) { $21 = HEAP32[$8>>2]|0; $22 = ((($f)) + 8|0); HEAP32[$22>>2] = $21; $23 = ((($f)) + 4|0); HEAP32[$23>>2] = $21; $$0 = 0; } else { $18 = $15 & 4; $19 = ($18|0)==(0); if ($19) { $$0 = -1; } else { $20 = $15 | 32; HEAP32[$f>>2] = $20; $$0 = -1; } } return ($$0|0); } function ___towrite($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 74|0); $1 = HEAP8[$0>>0]|0; $2 = $1 << 24 >> 24; $3 = (($2) + 255)|0; $4 = $3 | $2; $5 = $4&255; HEAP8[$0>>0] = $5; $6 = HEAP32[$f>>2]|0; $7 = $6 & 8; $8 = ($7|0)==(0); if ($8) { $10 = ((($f)) + 8|0); HEAP32[$10>>2] = 0; $11 = ((($f)) + 4|0); HEAP32[$11>>2] = 0; $12 = ((($f)) + 44|0); $13 = HEAP32[$12>>2]|0; $14 = ((($f)) + 28|0); HEAP32[$14>>2] = $13; $15 = ((($f)) + 20|0); HEAP32[$15>>2] = $13; $16 = $13; $17 = ((($f)) + 48|0); $18 = HEAP32[$17>>2]|0; $19 = (($16) + ($18)|0); $20 = ((($f)) + 16|0); HEAP32[$20>>2] = $19; $$0 = 0; } else { $9 = $6 | 32; HEAP32[$f>>2] = $9; $$0 = -1; } return ($$0|0); } function ___uflow($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; $c = sp; $0 = ((($f)) + 8|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $3 = (___toread($f)|0); $4 = ($3|0)==(0); if ($4) { label = 3; } else { $$0 = -1; } } else { label = 3; } if ((label|0) == 3) { $5 = ((($f)) + 32|0); $6 = HEAP32[$5>>2]|0; $7 = (FUNCTION_TABLE_iiii[$6 & 15]($f,$c,1)|0); $8 = ($7|0)==(1); if ($8) { $9 = HEAP8[$c>>0]|0; $10 = $9&255; $$0 = $10; } else { $$0 = -1; } } STACKTOP = sp;return ($$0|0); } function _qsort($base,$nel,$width,$cmp) { $base = $base|0; $nel = $nel|0; $width = $width|0; $cmp = $cmp|0; var $$0$i = 0, $$0$i30 = 0, $$02$i$i = 0, $$02$i3$i = 0, $$lcssa = 0, $$lcssa57 = 0, $$phi$trans$insert$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i11 = 0, $$pre$i20 = 0, $$pre$i5 = 0, $$pre$i8 = 0, $$pre1$i = 0, $$pre1$i12 = 0, $$pre1$i27$pre = 0, $$pre1$i6 = 0, $$pre1$i9 = 0, $$sum = 0, $$sum2 = 0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0; var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0; var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0; var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $8$phi = 0, $80 = 0, $81 = 0, $82 = 0; var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $head$0$lcssa = 0, $head$036 = 0; var $head$1$be = 0, $head$153 = 0, $i$0 = 0, $lp = 0, $nTrailingZeros$03$i$i = 0, $nTrailingZeros$03$i2$i = 0, $nTrailingZeros$03$i2$i$lcssa = 0, $or$cond = 0, $or$cond48 = 0, $or$cond4852 = 0, $or$cond51 = 0, $p = 0, $pshift$0$lcssa = 0, $pshift$037 = 0, $pshift$1 = 0, $pshift$2$be = 0, $pshift$254 = 0, $sum = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 208|0; $lp = sp + 8|0; $p = sp; $0 = Math_imul($width, $nel)|0; $1 = $p; $2 = $1; HEAP32[$2>>2] = 1; $3 = (($1) + 4)|0; $4 = $3; HEAP32[$4>>2] = 0; $5 = ($0|0)==(0); if (!($5)) { $$sum = (($0) - ($width))|0; $6 = ((($lp)) + 4|0); HEAP32[$6>>2] = $width; HEAP32[$lp>>2] = $width; $10 = $width;$8 = $width;$i$0 = 2; while(1) { $7 = (($8) + ($width))|0; $9 = (($7) + ($10))|0; $11 = (($lp) + ($i$0<<2)|0); HEAP32[$11>>2] = $9; $12 = ($9>>>0)<($0>>>0); $13 = (($i$0) + 1)|0; if ($12) { $8$phi = $10;$10 = $9;$i$0 = $13;$8 = $8$phi; } else { break; } } $14 = (0 - ($width))|0; $15 = (($base) + ($$sum)|0); $16 = ($$sum|0)>(0); $$phi$trans$insert$i = ((($p)) + 4|0); if ($16) { $17 = $15; $19 = 1;$head$036 = $base;$pshift$037 = 1; while(1) { $18 = $19 & 3; $20 = ($18|0)==(3); do { if ($20) { _sift($head$036,$width,$cmp,$pshift$037,$lp); $$pre$i = HEAP32[$p>>2]|0; $$pre1$i = HEAP32[$$phi$trans$insert$i>>2]|0; $21 = $$pre$i >>> 2; $22 = $$pre1$i << 30; $23 = $22 | $21; HEAP32[$p>>2] = $23; $24 = $$pre1$i >>> 2; HEAP32[$$phi$trans$insert$i>>2] = $24; $25 = (($pshift$037) + 2)|0; $48 = $23;$pshift$1 = $25; } else { $26 = (($pshift$037) + -1)|0; $27 = (($lp) + ($26<<2)|0); $28 = HEAP32[$27>>2]|0; $29 = $head$036; $30 = (($17) - ($29))|0; $31 = ($28>>>0)<($30>>>0); if ($31) { _sift($head$036,$width,$cmp,$pshift$037,$lp); } else { _trinkle($head$036,$width,$cmp,$p,$pshift$037,0,$lp); } $32 = ($pshift$037|0)==(1); if ($32) { $$pre$i5 = HEAP32[$$phi$trans$insert$i>>2]|0; $$pre1$i6 = HEAP32[$p>>2]|0; $33 = $$pre$i5 << 1; $34 = $$pre1$i6 >>> 31; $35 = $34 | $33; HEAP32[$$phi$trans$insert$i>>2] = $35; $36 = $$pre1$i6 << 1; HEAP32[$p>>2] = $36; $48 = $36;$pshift$1 = 0; break; } $37 = ($26>>>0)>(31); if ($37) { $38 = (($pshift$037) + -33)|0; $39 = HEAP32[$p>>2]|0; HEAP32[$$phi$trans$insert$i>>2] = $39; HEAP32[$p>>2] = 0; $$0$i = $38;$41 = $39;$44 = 0; } else { $$pre$i11 = HEAP32[$$phi$trans$insert$i>>2]|0; $$pre1$i12 = HEAP32[$p>>2]|0; $$0$i = $26;$41 = $$pre$i11;$44 = $$pre1$i12; } $40 = $41 << $$0$i; $42 = (32 - ($$0$i))|0; $43 = $44 >>> $42; $45 = $43 | $40; HEAP32[$$phi$trans$insert$i>>2] = $45; $46 = $44 << $$0$i; HEAP32[$p>>2] = $46; $48 = $46;$pshift$1 = 1; } } while(0); $47 = $48 | 1; HEAP32[$p>>2] = $47; $49 = (($head$036) + ($width)|0); $50 = ($49>>>0)<($15>>>0); if ($50) { $19 = $47;$head$036 = $49;$pshift$037 = $pshift$1; } else { $head$0$lcssa = $49;$pshift$0$lcssa = $pshift$1; break; } } } else { $head$0$lcssa = $base;$pshift$0$lcssa = 1; } _trinkle($head$0$lcssa,$width,$cmp,$p,$pshift$0$lcssa,0,$lp); $51 = ((($p)) + 4|0); $52 = ($pshift$0$lcssa|0)==(1); $53 = HEAP32[$p>>2]|0; $54 = ($53|0)==(1); $or$cond51 = $52 & $54; $55 = HEAP32[$51>>2]|0; $56 = ($55|0)==(0); $or$cond4852 = $or$cond51 & $56; if (!($or$cond4852)) { $59 = $53;$head$153 = $head$0$lcssa;$pshift$254 = $pshift$0$lcssa; while(1) { $57 = ($pshift$254|0)<(2); if ($57) { $58 = (($59) + -1)|0; $60 = ($58|0)==(0); do { if ($60) { $81 = 32; label = 30; } else { $61 = $58 & 1; $62 = ($61|0)==(0); if ($62) { $$02$i$i = $58;$nTrailingZeros$03$i$i = 0; while(1) { $63 = (($nTrailingZeros$03$i$i) + 1)|0; $64 = $$02$i$i >>> 1; $65 = $64 & 1; $66 = ($65|0)==(0); if ($66) { $$02$i$i = $64;$nTrailingZeros$03$i$i = $63; } else { $$lcssa = $63; break; } } $67 = ($$lcssa|0)==(0); if ($67) { label = 24; } else { $78 = $$lcssa; } } else { label = 24; } if ((label|0) == 24) { label = 0; $68 = HEAP32[$$phi$trans$insert$i>>2]|0; $69 = ($68|0)==(0); if ($69) { $81 = 64; label = 30; break; } $70 = $68 & 1; $71 = ($70|0)==(0); if ($71) { $$02$i3$i = $68;$nTrailingZeros$03$i2$i = 0; } else { $$0$i30 = 0;$84 = $59;$87 = $68;$91 = 0; break; } while(1) { $72 = (($nTrailingZeros$03$i2$i) + 1)|0; $73 = $$02$i3$i >>> 1; $74 = $73 & 1; $75 = ($74|0)==(0); if ($75) { $$02$i3$i = $73;$nTrailingZeros$03$i2$i = $72; } else { $$lcssa57 = $72;$nTrailingZeros$03$i2$i$lcssa = $nTrailingZeros$03$i2$i; break; } } $76 = (($nTrailingZeros$03$i2$i$lcssa) + 33)|0; $77 = ($$lcssa57|0)==(0); if ($77) { $$0$i30 = 0;$84 = $59;$87 = $68;$91 = 0; break; } else { $78 = $76; } } $79 = ($78>>>0)>(31); if ($79) { $81 = $78; label = 30; } else { $$pre1$i27$pre = HEAP32[$$phi$trans$insert$i>>2]|0; $$0$i30 = $78;$84 = $59;$87 = $$pre1$i27$pre;$91 = $78; } } } while(0); if ((label|0) == 30) { label = 0; $80 = (($81) + -32)|0; $82 = HEAP32[$$phi$trans$insert$i>>2]|0; HEAP32[$p>>2] = $82; HEAP32[$$phi$trans$insert$i>>2] = 0; $$0$i30 = $80;$84 = $82;$87 = 0;$91 = $81; } $83 = $84 >>> $$0$i30; $85 = (32 - ($$0$i30))|0; $86 = $87 << $85; $88 = $86 | $83; HEAP32[$p>>2] = $88; $89 = $87 >>> $$0$i30; HEAP32[$$phi$trans$insert$i>>2] = $89; $90 = (($91) + ($pshift$254))|0; $$pre = (($head$153) + ($14)|0); $head$1$be = $$pre;$pshift$2$be = $90; } else { $$pre$i20 = HEAP32[$$phi$trans$insert$i>>2]|0; $92 = $$pre$i20 << 2; $93 = $59 >>> 30; $94 = $93 | $92; $95 = (($pshift$254) + -2)|0; $96 = $59 << 1; $97 = $96 & 2147483646; $98 = $93 << 31; $99 = $97 | $98; $100 = $99 ^ 3; HEAP32[$p>>2] = $100; $101 = $94 >>> 1; HEAP32[$$phi$trans$insert$i>>2] = $101; $102 = (($lp) + ($95<<2)|0); $103 = HEAP32[$102>>2]|0; $sum = (($103) + ($width))|0; $$sum2 = (0 - ($sum))|0; $104 = (($head$153) + ($$sum2)|0); $105 = (($pshift$254) + -1)|0; _trinkle($104,$width,$cmp,$p,$105,1,$lp); $$pre$i8 = HEAP32[$$phi$trans$insert$i>>2]|0; $$pre1$i9 = HEAP32[$p>>2]|0; $106 = $$pre$i8 << 1; $107 = $$pre1$i9 >>> 31; $108 = $107 | $106; HEAP32[$$phi$trans$insert$i>>2] = $108; $109 = $$pre1$i9 << 1; $110 = $109 | 1; HEAP32[$p>>2] = $110; $111 = (($head$153) + ($14)|0); _trinkle($111,$width,$cmp,$p,$95,1,$lp); $head$1$be = $111;$pshift$2$be = $95; } $112 = ($pshift$2$be|0)==(1); $113 = HEAP32[$p>>2]|0; $114 = ($113|0)==(1); $or$cond = $112 & $114; $115 = HEAP32[$51>>2]|0; $116 = ($115|0)==(0); $or$cond48 = $or$cond & $116; if ($or$cond48) { break; } else { $59 = $113;$head$153 = $head$1$be;$pshift$254 = $pshift$2$be; } } } } STACKTOP = sp;return; } function _memchr($src,$c,$n) { $src = $src|0; $c = $c|0; $n = $n|0; var $$0$lcssa = 0, $$0$lcssa44 = 0, $$019 = 0, $$1$lcssa = 0, $$110 = 0, $$110$lcssa = 0, $$24 = 0, $$3 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, $s$0$lcssa = 0, $s$0$lcssa43 = 0, $s$020 = 0, $s$15 = 0, $s$2 = 0, $w$0$lcssa = 0, $w$011 = 0, $w$011$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $c & 255; $1 = $src; $2 = $1 & 3; $3 = ($2|0)!=(0); $4 = ($n|0)!=(0); $or$cond18 = $4 & $3; L1: do { if ($or$cond18) { $5 = $c&255; $$019 = $n;$s$020 = $src; while(1) { $6 = HEAP8[$s$020>>0]|0; $7 = ($6<<24>>24)==($5<<24>>24); if ($7) { $$0$lcssa44 = $$019;$s$0$lcssa43 = $s$020; label = 6; break L1; } $8 = ((($s$020)) + 1|0); $9 = (($$019) + -1)|0; $10 = $8; $11 = $10 & 3; $12 = ($11|0)!=(0); $13 = ($9|0)!=(0); $or$cond = $13 & $12; if ($or$cond) { $$019 = $9;$s$020 = $8; } else { $$0$lcssa = $9;$$lcssa = $13;$s$0$lcssa = $8; label = 5; break; } } } else { $$0$lcssa = $n;$$lcssa = $4;$s$0$lcssa = $src; label = 5; } } while(0); if ((label|0) == 5) { if ($$lcssa) { $$0$lcssa44 = $$0$lcssa;$s$0$lcssa43 = $s$0$lcssa; label = 6; } else { $$3 = 0;$s$2 = $s$0$lcssa; } } L8: do { if ((label|0) == 6) { $14 = HEAP8[$s$0$lcssa43>>0]|0; $15 = $c&255; $16 = ($14<<24>>24)==($15<<24>>24); if ($16) { $$3 = $$0$lcssa44;$s$2 = $s$0$lcssa43; } else { $17 = Math_imul($0, 16843009)|0; $18 = ($$0$lcssa44>>>0)>(3); L11: do { if ($18) { $$110 = $$0$lcssa44;$w$011 = $s$0$lcssa43; while(1) { $19 = HEAP32[$w$011>>2]|0; $20 = $19 ^ $17; $21 = (($20) + -16843009)|0; $22 = $20 & -2139062144; $23 = $22 ^ -2139062144; $24 = $23 & $21; $25 = ($24|0)==(0); if (!($25)) { $$110$lcssa = $$110;$w$011$lcssa = $w$011; break; } $26 = ((($w$011)) + 4|0); $27 = (($$110) + -4)|0; $28 = ($27>>>0)>(3); if ($28) { $$110 = $27;$w$011 = $26; } else { $$1$lcssa = $27;$w$0$lcssa = $26; label = 11; break L11; } } $$24 = $$110$lcssa;$s$15 = $w$011$lcssa; } else { $$1$lcssa = $$0$lcssa44;$w$0$lcssa = $s$0$lcssa43; label = 11; } } while(0); if ((label|0) == 11) { $29 = ($$1$lcssa|0)==(0); if ($29) { $$3 = 0;$s$2 = $w$0$lcssa; break; } else { $$24 = $$1$lcssa;$s$15 = $w$0$lcssa; } } while(1) { $30 = HEAP8[$s$15>>0]|0; $31 = ($30<<24>>24)==($15<<24>>24); if ($31) { $$3 = $$24;$s$2 = $s$15; break L8; } $32 = ((($s$15)) + 1|0); $33 = (($$24) + -1)|0; $34 = ($33|0)==(0); if ($34) { $$3 = 0;$s$2 = $32; break; } else { $$24 = $33;$s$15 = $32; } } } } } while(0); $35 = ($$3|0)!=(0); $36 = $35 ? $s$2 : 0; return ($36|0); } function _memcmp($vl,$vr,$n) { $vl = $vl|0; $vr = $vr|0; $n = $n|0; var $$03 = 0, $$lcssa = 0, $$lcssa19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $l$04 = 0, $r$05 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($n|0)==(0); L1: do { if ($0) { $11 = 0; } else { $$03 = $n;$l$04 = $vl;$r$05 = $vr; while(1) { $1 = HEAP8[$l$04>>0]|0; $2 = HEAP8[$r$05>>0]|0; $3 = ($1<<24>>24)==($2<<24>>24); if (!($3)) { $$lcssa = $1;$$lcssa19 = $2; break; } $4 = (($$03) + -1)|0; $5 = ((($l$04)) + 1|0); $6 = ((($r$05)) + 1|0); $7 = ($4|0)==(0); if ($7) { $11 = 0; break L1; } else { $$03 = $4;$l$04 = $5;$r$05 = $6; } } $8 = $$lcssa&255; $9 = $$lcssa19&255; $10 = (($8) - ($9))|0; $11 = $10; } } while(0); return ($11|0); } function ___memrchr($m,$c,$n) { $m = $m|0; $c = $c|0; $n = $n|0; var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $c&255; $$01 = $n; while(1) { $1 = (($$01) + -1)|0; $2 = ($$01|0)==(0); if ($2) { $$0 = 0; break; } $3 = (($m) + ($1)|0); $4 = HEAP8[$3>>0]|0; $5 = ($4<<24>>24)==($0<<24>>24); if ($5) { $$0 = $3; break; } else { $$01 = $1; } } return ($$0|0); } function ___stpcpy($d,$s) { $d = $d|0; $s = $s|0; var $$0$lcssa = 0, $$01$lcssa = 0, $$0115 = 0, $$016 = 0, $$03 = 0, $$1$ph = 0, $$12$ph = 0, $$128 = 0, $$19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $wd$0$lcssa = 0, $wd$010 = 0, $ws$0$lcssa = 0, $ws$011 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $s; $1 = $d; $2 = $0 ^ $1; $3 = $2 & 3; $4 = ($3|0)==(0); L1: do { if ($4) { $5 = $0 & 3; $6 = ($5|0)==(0); if ($6) { $$0$lcssa = $s;$$01$lcssa = $d; } else { $$0115 = $d;$$016 = $s; while(1) { $7 = HEAP8[$$016>>0]|0; HEAP8[$$0115>>0] = $7; $8 = ($7<<24>>24)==(0); if ($8) { $$03 = $$0115; break L1; } $9 = ((($$016)) + 1|0); $10 = ((($$0115)) + 1|0); $11 = $9; $12 = $11 & 3; $13 = ($12|0)==(0); if ($13) { $$0$lcssa = $9;$$01$lcssa = $10; break; } else { $$0115 = $10;$$016 = $9; } } } $14 = HEAP32[$$0$lcssa>>2]|0; $15 = (($14) + -16843009)|0; $16 = $14 & -2139062144; $17 = $16 ^ -2139062144; $18 = $17 & $15; $19 = ($18|0)==(0); if ($19) { $22 = $14;$wd$010 = $$01$lcssa;$ws$011 = $$0$lcssa; while(1) { $20 = ((($ws$011)) + 4|0); $21 = ((($wd$010)) + 4|0); HEAP32[$wd$010>>2] = $22; $23 = HEAP32[$20>>2]|0; $24 = (($23) + -16843009)|0; $25 = $23 & -2139062144; $26 = $25 ^ -2139062144; $27 = $26 & $24; $28 = ($27|0)==(0); if ($28) { $22 = $23;$wd$010 = $21;$ws$011 = $20; } else { $wd$0$lcssa = $21;$ws$0$lcssa = $20; break; } } } else { $wd$0$lcssa = $$01$lcssa;$ws$0$lcssa = $$0$lcssa; } $$1$ph = $ws$0$lcssa;$$12$ph = $wd$0$lcssa; label = 8; } else { $$1$ph = $s;$$12$ph = $d; label = 8; } } while(0); if ((label|0) == 8) { $29 = HEAP8[$$1$ph>>0]|0; HEAP8[$$12$ph>>0] = $29; $30 = ($29<<24>>24)==(0); if ($30) { $$03 = $$12$ph; } else { $$128 = $$12$ph;$$19 = $$1$ph; while(1) { $31 = ((($$19)) + 1|0); $32 = ((($$128)) + 1|0); $33 = HEAP8[$31>>0]|0; HEAP8[$32>>0] = $33; $34 = ($33<<24>>24)==(0); if ($34) { $$03 = $32; break; } else { $$128 = $32;$$19 = $31; } } } } return ($$03|0); } function _strcat($dest,$src) { $dest = $dest|0; $src = $src|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_strlen($dest)|0); $1 = (($dest) + ($0)|0); (_strcpy($1,$src)|0); return ($dest|0); } function _strchr($s,$c) { $s = $s|0; $c = $c|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (___strchrnul($s,$c)|0); $1 = HEAP8[$0>>0]|0; $2 = $c&255; $3 = ($1<<24>>24)==($2<<24>>24); $4 = $3 ? $0 : 0; return ($4|0); } function ___strchrnul($s,$c) { $s = $s|0; $c = $c|0; var $$0 = 0, $$02$lcssa = 0, $$0211 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond5 = 0, $w$0$lcssa = 0, $w$08 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $c & 255; $1 = ($0|0)==(0); L1: do { if ($1) { $6 = (_strlen($s)|0); $7 = (($s) + ($6)|0); $$0 = $7; } else { $2 = $s; $3 = $2 & 3; $4 = ($3|0)==(0); if ($4) { $$02$lcssa = $s; } else { $5 = $c&255; $$0211 = $s; while(1) { $8 = HEAP8[$$0211>>0]|0; $9 = ($8<<24>>24)==(0); $10 = ($8<<24>>24)==($5<<24>>24); $or$cond = $9 | $10; if ($or$cond) { $$0 = $$0211; break L1; } $11 = ((($$0211)) + 1|0); $12 = $11; $13 = $12 & 3; $14 = ($13|0)==(0); if ($14) { $$02$lcssa = $11; break; } else { $$0211 = $11; } } } $15 = Math_imul($0, 16843009)|0; $16 = HEAP32[$$02$lcssa>>2]|0; $17 = (($16) + -16843009)|0; $18 = $16 & -2139062144; $19 = $18 ^ -2139062144; $20 = $19 & $17; $21 = ($20|0)==(0); L10: do { if ($21) { $23 = $16;$w$08 = $$02$lcssa; while(1) { $22 = $23 ^ $15; $24 = (($22) + -16843009)|0; $25 = $22 & -2139062144; $26 = $25 ^ -2139062144; $27 = $26 & $24; $28 = ($27|0)==(0); if (!($28)) { $w$0$lcssa = $w$08; break L10; } $29 = ((($w$08)) + 4|0); $30 = HEAP32[$29>>2]|0; $31 = (($30) + -16843009)|0; $32 = $30 & -2139062144; $33 = $32 ^ -2139062144; $34 = $33 & $31; $35 = ($34|0)==(0); if ($35) { $23 = $30;$w$08 = $29; } else { $w$0$lcssa = $29; break; } } } else { $w$0$lcssa = $$02$lcssa; } } while(0); $36 = $c&255; $$1 = $w$0$lcssa; while(1) { $37 = HEAP8[$$1>>0]|0; $38 = ($37<<24>>24)==(0); $39 = ($37<<24>>24)==($36<<24>>24); $or$cond5 = $38 | $39; $40 = ((($$1)) + 1|0); if ($or$cond5) { $$0 = $$1; break; } else { $$1 = $40; } } } } while(0); return ($$0|0); } function _strcmp($l,$r) { $l = $l|0; $r = $r|0; var $$014 = 0, $$05 = 0, $$lcssa = 0, $$lcssa2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0; var sp = 0; sp = STACKTOP; $0 = HEAP8[$l>>0]|0; $1 = HEAP8[$r>>0]|0; $2 = ($0<<24>>24)!=($1<<24>>24); $3 = ($0<<24>>24)==(0); $or$cond3 = $3 | $2; if ($or$cond3) { $$lcssa = $0;$$lcssa2 = $1; } else { $$014 = $l;$$05 = $r; while(1) { $4 = ((($$014)) + 1|0); $5 = ((($$05)) + 1|0); $6 = HEAP8[$4>>0]|0; $7 = HEAP8[$5>>0]|0; $8 = ($6<<24>>24)!=($7<<24>>24); $9 = ($6<<24>>24)==(0); $or$cond = $9 | $8; if ($or$cond) { $$lcssa = $6;$$lcssa2 = $7; break; } else { $$014 = $4;$$05 = $5; } } } $10 = $$lcssa&255; $11 = $$lcssa2&255; $12 = (($10) - ($11))|0; return ($12|0); } function _strcpy($dest,$src) { $dest = $dest|0; $src = $src|0; var label = 0, sp = 0; sp = STACKTOP; (___stpcpy($dest,$src)|0); return ($dest|0); } function _strcspn($s,$c) { $s = $s|0; $c = $c|0; var $$0 = 0, $$027 = 0, $$03$lcssa = 0, $$035 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $byteset = sp; $0 = HEAP8[$c>>0]|0; $1 = ($0<<24>>24)==(0); if ($1) { label = 3; } else { $2 = ((($c)) + 1|0); $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)==(0); if ($4) { label = 3; } else { ;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0; $$027 = $c;$13 = $0; while(1) { $12 = $13 & 31; $14 = $12&255; $15 = 1 << $14; $div4 = ($13&255) >>> 5; $16 = $div4&255; $17 = (($byteset) + ($16<<2)|0); $18 = HEAP32[$17>>2]|0; $19 = $18 | $15; HEAP32[$17>>2] = $19; $20 = ((($$027)) + 1|0); $21 = HEAP8[$20>>0]|0; $22 = ($21<<24>>24)==(0); if ($22) { break; } else { $$027 = $20;$13 = $21; } } $10 = HEAP8[$s>>0]|0; $11 = ($10<<24>>24)==(0); L7: do { if ($11) { $$03$lcssa = $s; } else { $$035 = $s;$23 = $10; while(1) { $div = ($23&255) >>> 5; $24 = $div&255; $25 = (($byteset) + ($24<<2)|0); $26 = HEAP32[$25>>2]|0; $27 = $23 & 31; $28 = $27&255; $29 = 1 << $28; $30 = $26 & $29; $31 = ($30|0)==(0); if (!($31)) { $$03$lcssa = $$035; break L7; } $32 = ((($$035)) + 1|0); $33 = HEAP8[$32>>0]|0; $34 = ($33<<24>>24)==(0); if ($34) { $$03$lcssa = $32; break; } else { $$035 = $32;$23 = $33; } } } } while(0); $35 = $$03$lcssa; $36 = $s; $37 = (($35) - ($36))|0; $$0 = $37; } } if ((label|0) == 3) { $5 = $0 << 24 >> 24; $6 = (___strchrnul($s,$5)|0); $7 = $6; $8 = $s; $9 = (($7) - ($8))|0; $$0 = $9; } STACKTOP = sp;return ($$0|0); } function _strlen($s) { $s = $s|0; var $$0 = 0, $$01$lcssa = 0, $$014 = 0, $$1$lcssa = 0, $$lcssa20 = 0, $$pn = 0, $$pn15 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $w$0 = 0, $w$0$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $s; $1 = $0 & 3; $2 = ($1|0)==(0); L1: do { if ($2) { $$01$lcssa = $s; label = 4; } else { $$014 = $s;$21 = $0; while(1) { $3 = HEAP8[$$014>>0]|0; $4 = ($3<<24>>24)==(0); if ($4) { $$pn = $21; break L1; } $5 = ((($$014)) + 1|0); $6 = $5; $7 = $6 & 3; $8 = ($7|0)==(0); if ($8) { $$01$lcssa = $5; label = 4; break; } else { $$014 = $5;$21 = $6; } } } } while(0); if ((label|0) == 4) { $w$0 = $$01$lcssa; while(1) { $9 = HEAP32[$w$0>>2]|0; $10 = (($9) + -16843009)|0; $11 = $9 & -2139062144; $12 = $11 ^ -2139062144; $13 = $12 & $10; $14 = ($13|0)==(0); $15 = ((($w$0)) + 4|0); if ($14) { $w$0 = $15; } else { $$lcssa20 = $9;$w$0$lcssa = $w$0; break; } } $16 = $$lcssa20&255; $17 = ($16<<24>>24)==(0); if ($17) { $$1$lcssa = $w$0$lcssa; } else { $$pn15 = $w$0$lcssa; while(1) { $18 = ((($$pn15)) + 1|0); $$pre = HEAP8[$18>>0]|0; $19 = ($$pre<<24>>24)==(0); if ($19) { $$1$lcssa = $18; break; } else { $$pn15 = $18; } } } $20 = $$1$lcssa; $$pn = $20; } $$0 = (($$pn) - ($0))|0; return ($$0|0); } function _strncmp($_l,$_r,$n) { $_l = $_l|0; $_r = $_r|0; $n = $n|0; var $$03 = 0, $$08 = 0, $$08$in = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $l$06 = 0, $or$cond = 0, $or$cond4 = 0, $r$0$lcssa = 0, $r$07 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($n|0)==(0); if ($0) { $$03 = 0; } else { $1 = HEAP8[$_l>>0]|0; $2 = ($1<<24>>24)==(0); L3: do { if ($2) { $13 = 0;$r$0$lcssa = $_r; } else { $$08$in = $n;$6 = $1;$l$06 = $_l;$r$07 = $_r; while(1) { $$08 = (($$08$in) + -1)|0; $3 = HEAP8[$r$07>>0]|0; $4 = ($3<<24>>24)!=(0); $5 = ($$08|0)!=(0); $or$cond = $5 & $4; $7 = ($6<<24>>24)==($3<<24>>24); $or$cond4 = $7 & $or$cond; if (!($or$cond4)) { $13 = $6;$r$0$lcssa = $r$07; break L3; } $8 = ((($l$06)) + 1|0); $9 = ((($r$07)) + 1|0); $10 = HEAP8[$8>>0]|0; $11 = ($10<<24>>24)==(0); if ($11) { $13 = 0;$r$0$lcssa = $9; break; } else { $$08$in = $$08;$6 = $10;$l$06 = $8;$r$07 = $9; } } } } while(0); $12 = $13&255; $14 = HEAP8[$r$0$lcssa>>0]|0; $15 = $14&255; $16 = (($12) - ($15))|0; $$03 = $16; } return ($$03|0); } function _strrchr($s,$c) { $s = $s|0; $c = $c|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (_strlen($s)|0); $1 = (($0) + 1)|0; $2 = (___memrchr($s,$c,$1)|0); return ($2|0); } function _strspn($s,$c) { $s = $s|0; $c = $c|0; var $$0 = 0, $$028 = 0, $$03 = 0, $$03$lcssa = 0, $$1$lcssa = 0, $$16 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; $byteset = sp; ;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0; $0 = HEAP8[$c>>0]|0; $1 = ($0<<24>>24)==(0); do { if ($1) { $$0 = 0; } else { $2 = ((($c)) + 1|0); $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)==(0); if ($4) { $$03 = $s; while(1) { $5 = HEAP8[$$03>>0]|0; $6 = ($5<<24>>24)==($0<<24>>24); $7 = ((($$03)) + 1|0); if ($6) { $$03 = $7; } else { $$03$lcssa = $$03; break; } } $8 = $$03$lcssa; $9 = $s; $10 = (($8) - ($9))|0; $$0 = $10; break; } else { $$028 = $c;$14 = $0; } while(1) { $13 = $14 & 31; $15 = $13&255; $16 = 1 << $15; $div4 = ($14&255) >>> 5; $17 = $div4&255; $18 = (($byteset) + ($17<<2)|0); $19 = HEAP32[$18>>2]|0; $20 = $19 | $16; HEAP32[$18>>2] = $20; $21 = ((($$028)) + 1|0); $22 = HEAP8[$21>>0]|0; $23 = ($22<<24>>24)==(0); if ($23) { break; } else { $$028 = $21;$14 = $22; } } $11 = HEAP8[$s>>0]|0; $12 = ($11<<24>>24)==(0); L10: do { if ($12) { $$1$lcssa = $s; } else { $$16 = $s;$24 = $11; while(1) { $div = ($24&255) >>> 5; $25 = $div&255; $26 = (($byteset) + ($25<<2)|0); $27 = HEAP32[$26>>2]|0; $28 = $24 & 31; $29 = $28&255; $30 = 1 << $29; $31 = $27 & $30; $32 = ($31|0)==(0); if ($32) { $$1$lcssa = $$16; break L10; } $33 = ((($$16)) + 1|0); $34 = HEAP8[$33>>0]|0; $35 = ($34<<24>>24)==(0); if ($35) { $$1$lcssa = $33; break; } else { $$16 = $33;$24 = $34; } } } } while(0); $36 = $$1$lcssa; $37 = $s; $38 = (($36) - ($37))|0; $$0 = $38; } } while(0); STACKTOP = sp;return ($$0|0); } function _strstr($h,$n) { $h = $h|0; $n = $n|0; var $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$0$lcssa$i11 = 0, $$01$i = 0, $$02$i = 0, $$02$i7 = 0, $$03$i = 0, $$lcssa$i = 0, $$lcssa$i10 = 0, $$lcssa$i4 = 0, $$lcssa281 = 0, $$lcssa284 = 0, $$lcssa287 = 0, $$lcssa301 = 0, $$lcssa304 = 0, $$lcssa307 = 0, $$lcssa322 = 0, $$pr$i = 0, $0 = 0; var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0; var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0; var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0; var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0; var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0; var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0; var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0; var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $233$phi = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0; var $byteset$i = 0, $div$i = 0, $div4$i = 0, $hw$0$in2$i = 0, $hw$03$i = 0, $hw$03$i6 = 0, $ip$0$ph$lcssa$i = 0, $ip$0$ph$lcssa143$i = 0, $ip$0$ph76$i = 0, $ip$1$ip$0$$i = 0, $ip$1$ip$0$i = 0, $ip$1$ph$lcssa$i = 0, $ip$1$ph55$i = 0, $jp$0$ph13$ph70$i = 0, $jp$0$ph1365$i = 0, $jp$0$ph1365$i$lcssa = 0, $jp$0$ph1365$i$lcssa$lcssa = 0, $jp$0$ph77$i = 0, $jp$1$ph56$i = 0, $jp$1$ph9$ph49$i = 0; var $jp$1$ph944$i = 0, $jp$1$ph944$i$lcssa = 0, $jp$1$ph944$i$lcssa$lcssa = 0, $k$059$i = 0, $k$139$i = 0, $k$2$i = 0, $k$338$i = 0, $k$338$i$lcssa = 0, $k$4$i = 0, $l$080$i = 0, $l$080$i$lcssa321 = 0, $mem$0$i = 0, $mem0$0$i = 0, $or$cond$i = 0, $or$cond$i2 = 0, $or$cond$i8 = 0, $or$cond5$i = 0, $p$0$ph$ph$lcssa32$i = 0, $p$0$ph$ph$lcssa32147$i = 0, $p$0$ph$ph71$i = 0; var $p$1$p$0$i = 0, $p$1$ph$ph$lcssa23$i = 0, $p$1$ph$ph50$i = 0, $p$3$i = 0, $shift$i = 0, $z$0$i = 0, $z$1$i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 1056|0; $byteset$i = sp + 1024|0; $shift$i = sp; $0 = HEAP8[$n>>0]|0; $1 = ($0<<24>>24)==(0); do { if ($1) { $$0 = $h; } else { $2 = $0 << 24 >> 24; $3 = (_strchr($h,$2)|0); $4 = ($3|0)==(0|0); if ($4) { $$0 = 0; } else { $5 = ((($n)) + 1|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)==(0); if ($7) { $$0 = $3; } else { $8 = ((($3)) + 1|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(0); if ($10) { $$0 = 0; } else { $11 = ((($n)) + 2|0); $12 = HEAP8[$11>>0]|0; $13 = ($12<<24>>24)==(0); if ($13) { $14 = $0&255; $15 = $14 << 8; $16 = $6&255; $17 = $16 | $15; $18 = HEAP8[$3>>0]|0; $19 = $18&255; $20 = $19 << 8; $21 = $9&255; $22 = $20 | $21; $$01$i = $8;$232 = $9;$233 = $3;$hw$0$in2$i = $22; while(1) { $23 = $hw$0$in2$i & 65535; $24 = ($23|0)==($17|0); if ($24) { $$lcssa$i = $233;$31 = $232; break; } $25 = $23 << 8; $26 = ((($$01$i)) + 1|0); $27 = HEAP8[$26>>0]|0; $28 = $27&255; $29 = $28 | $25; $30 = ($27<<24>>24)==(0); if ($30) { $$lcssa$i = $$01$i;$31 = 0; break; } else { $233$phi = $$01$i;$$01$i = $26;$232 = $27;$hw$0$in2$i = $29;$233 = $233$phi; } } $32 = ($31<<24>>24)!=(0); $33 = $32 ? $$lcssa$i : 0; $$0 = $33; break; } $34 = ((($3)) + 2|0); $35 = HEAP8[$34>>0]|0; $36 = ($35<<24>>24)==(0); if ($36) { $$0 = 0; } else { $37 = ((($n)) + 3|0); $38 = HEAP8[$37>>0]|0; $39 = ($38<<24>>24)==(0); if ($39) { $40 = $0&255; $41 = $40 << 24; $42 = $6&255; $43 = $42 << 16; $44 = $43 | $41; $45 = $12&255; $46 = $45 << 8; $47 = $44 | $46; $48 = HEAP8[$3>>0]|0; $49 = $48&255; $50 = $49 << 24; $51 = $9&255; $52 = $51 << 16; $53 = $35&255; $54 = $53 << 8; $55 = $54 | $52; $56 = $55 | $50; $57 = ($56|0)==($47|0); if ($57) { $$0$lcssa$i = $34;$$lcssa$i4 = $35; } else { $$02$i = $34;$hw$03$i = $56; while(1) { $58 = ((($$02$i)) + 1|0); $59 = HEAP8[$58>>0]|0; $60 = $59&255; $61 = $60 | $hw$03$i; $62 = $61 << 8; $63 = ($59<<24>>24)==(0); $64 = ($62|0)==($47|0); $or$cond$i2 = $63 | $64; if ($or$cond$i2) { $$0$lcssa$i = $58;$$lcssa$i4 = $59; break; } else { $$02$i = $58;$hw$03$i = $62; } } } $65 = ($$lcssa$i4<<24>>24)!=(0); $66 = ((($$0$lcssa$i)) + -2|0); $67 = $65 ? $66 : 0; $$0 = $67; break; } $68 = ((($3)) + 3|0); $69 = HEAP8[$68>>0]|0; $70 = ($69<<24>>24)==(0); if ($70) { $$0 = 0; } else { $71 = ((($n)) + 4|0); $72 = HEAP8[$71>>0]|0; $73 = ($72<<24>>24)==(0); if ($73) { $74 = $0&255; $75 = $74 << 24; $76 = $6&255; $77 = $76 << 16; $78 = $77 | $75; $79 = $12&255; $80 = $79 << 8; $81 = $78 | $80; $82 = $38&255; $83 = $81 | $82; $84 = HEAP8[$3>>0]|0; $85 = $84&255; $86 = $85 << 24; $87 = $9&255; $88 = $87 << 16; $89 = $35&255; $90 = $89 << 8; $91 = $69&255; $92 = $90 | $88; $93 = $92 | $91; $94 = $93 | $86; $95 = ($94|0)==($83|0); if ($95) { $$0$lcssa$i11 = $68;$$lcssa$i10 = $69; } else { $$02$i7 = $68;$hw$03$i6 = $94; while(1) { $96 = $hw$03$i6 << 8; $97 = ((($$02$i7)) + 1|0); $98 = HEAP8[$97>>0]|0; $99 = $98&255; $100 = $99 | $96; $101 = ($98<<24>>24)==(0); $102 = ($100|0)==($83|0); $or$cond$i8 = $101 | $102; if ($or$cond$i8) { $$0$lcssa$i11 = $97;$$lcssa$i10 = $98; break; } else { $$02$i7 = $97;$hw$03$i6 = $100; } } } $103 = ($$lcssa$i10<<24>>24)!=(0); $104 = ((($$0$lcssa$i11)) + -3|0); $105 = $103 ? $104 : 0; $$0 = $105; break; } ;HEAP32[$byteset$i>>2]=0|0;HEAP32[$byteset$i+4>>2]=0|0;HEAP32[$byteset$i+8>>2]=0|0;HEAP32[$byteset$i+12>>2]=0|0;HEAP32[$byteset$i+16>>2]=0|0;HEAP32[$byteset$i+20>>2]=0|0;HEAP32[$byteset$i+24>>2]=0|0;HEAP32[$byteset$i+28>>2]=0|0; $110 = $0;$l$080$i = 0; while(1) { $106 = (($3) + ($l$080$i)|0); $107 = HEAP8[$106>>0]|0; $108 = ($107<<24>>24)==(0); if ($108) { $$0$i = 0; break; } $109 = $110 & 31; $111 = $109&255; $112 = 1 << $111; $div4$i = ($110&255) >>> 5; $113 = $div4$i&255; $114 = (($byteset$i) + ($113<<2)|0); $115 = HEAP32[$114>>2]|0; $116 = $115 | $112; HEAP32[$114>>2] = $116; $117 = (($l$080$i) + 1)|0; $118 = $110&255; $119 = (($shift$i) + ($118<<2)|0); HEAP32[$119>>2] = $117; $120 = (($n) + ($117)|0); $121 = HEAP8[$120>>0]|0; $122 = ($121<<24>>24)==(0); if ($122) { $$lcssa322 = $117;$l$080$i$lcssa321 = $l$080$i; label = 23; break; } else { $110 = $121;$l$080$i = $117; } } L32: do { if ((label|0) == 23) { $123 = ($$lcssa322>>>0)>(1); L34: do { if ($123) { $234 = 1;$ip$0$ph76$i = -1;$jp$0$ph77$i = 0; L35: while(1) { $235 = $234;$jp$0$ph13$ph70$i = $jp$0$ph77$i;$p$0$ph$ph71$i = 1; while(1) { $236 = $235;$jp$0$ph1365$i = $jp$0$ph13$ph70$i; L39: while(1) { $133 = $236;$k$059$i = 1; while(1) { $129 = (($k$059$i) + ($ip$0$ph76$i))|0; $130 = (($n) + ($129)|0); $131 = HEAP8[$130>>0]|0; $132 = (($n) + ($133)|0); $134 = HEAP8[$132>>0]|0; $135 = ($131<<24>>24)==($134<<24>>24); if (!($135)) { $$lcssa301 = $133;$$lcssa304 = $131;$$lcssa307 = $134;$jp$0$ph1365$i$lcssa = $jp$0$ph1365$i; break L39; } $136 = ($k$059$i|0)==($p$0$ph$ph71$i|0); $127 = (($k$059$i) + 1)|0; if ($136) { break; } $126 = (($127) + ($jp$0$ph1365$i))|0; $128 = ($126>>>0)<($$lcssa322>>>0); if ($128) { $133 = $126;$k$059$i = $127; } else { $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i; break L35; } } $137 = (($jp$0$ph1365$i) + ($p$0$ph$ph71$i))|0; $138 = (($137) + 1)|0; $139 = ($138>>>0)<($$lcssa322>>>0); if ($139) { $236 = $138;$jp$0$ph1365$i = $137; } else { $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i; break L35; } } $140 = ($$lcssa304&255)>($$lcssa307&255); $141 = (($$lcssa301) - ($ip$0$ph76$i))|0; if (!($140)) { $jp$0$ph1365$i$lcssa$lcssa = $jp$0$ph1365$i$lcssa; break; } $124 = (($$lcssa301) + 1)|0; $125 = ($124>>>0)<($$lcssa322>>>0); if ($125) { $235 = $124;$jp$0$ph13$ph70$i = $$lcssa301;$p$0$ph$ph71$i = $141; } else { $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $141; break L35; } } $142 = (($jp$0$ph1365$i$lcssa$lcssa) + 1)|0; $143 = (($jp$0$ph1365$i$lcssa$lcssa) + 2)|0; $144 = ($143>>>0)<($$lcssa322>>>0); if ($144) { $234 = $143;$ip$0$ph76$i = $jp$0$ph1365$i$lcssa$lcssa;$jp$0$ph77$i = $142; } else { $ip$0$ph$lcssa$i = $jp$0$ph1365$i$lcssa$lcssa;$p$0$ph$ph$lcssa32$i = 1; break; } } $237 = 1;$ip$1$ph55$i = -1;$jp$1$ph56$i = 0; while(1) { $239 = $237;$jp$1$ph9$ph49$i = $jp$1$ph56$i;$p$1$ph$ph50$i = 1; while(1) { $238 = $239;$jp$1$ph944$i = $jp$1$ph9$ph49$i; L54: while(1) { $152 = $238;$k$139$i = 1; while(1) { $148 = (($k$139$i) + ($ip$1$ph55$i))|0; $149 = (($n) + ($148)|0); $150 = HEAP8[$149>>0]|0; $151 = (($n) + ($152)|0); $153 = HEAP8[$151>>0]|0; $154 = ($150<<24>>24)==($153<<24>>24); if (!($154)) { $$lcssa281 = $152;$$lcssa284 = $150;$$lcssa287 = $153;$jp$1$ph944$i$lcssa = $jp$1$ph944$i; break L54; } $155 = ($k$139$i|0)==($p$1$ph$ph50$i|0); $146 = (($k$139$i) + 1)|0; if ($155) { break; } $145 = (($146) + ($jp$1$ph944$i))|0; $147 = ($145>>>0)<($$lcssa322>>>0); if ($147) { $152 = $145;$k$139$i = $146; } else { $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i; break L34; } } $156 = (($jp$1$ph944$i) + ($p$1$ph$ph50$i))|0; $157 = (($156) + 1)|0; $158 = ($157>>>0)<($$lcssa322>>>0); if ($158) { $238 = $157;$jp$1$ph944$i = $156; } else { $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i; break L34; } } $159 = ($$lcssa284&255)<($$lcssa287&255); $160 = (($$lcssa281) - ($ip$1$ph55$i))|0; if (!($159)) { $jp$1$ph944$i$lcssa$lcssa = $jp$1$ph944$i$lcssa; break; } $164 = (($$lcssa281) + 1)|0; $165 = ($164>>>0)<($$lcssa322>>>0); if ($165) { $239 = $164;$jp$1$ph9$ph49$i = $$lcssa281;$p$1$ph$ph50$i = $160; } else { $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $160; break L34; } } $161 = (($jp$1$ph944$i$lcssa$lcssa) + 1)|0; $162 = (($jp$1$ph944$i$lcssa$lcssa) + 2)|0; $163 = ($162>>>0)<($$lcssa322>>>0); if ($163) { $237 = $162;$ip$1$ph55$i = $jp$1$ph944$i$lcssa$lcssa;$jp$1$ph56$i = $161; } else { $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $jp$1$ph944$i$lcssa$lcssa;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = 1; break; } } } else { $ip$0$ph$lcssa143$i = -1;$ip$1$ph$lcssa$i = -1;$p$0$ph$ph$lcssa32147$i = 1;$p$1$ph$ph$lcssa23$i = 1; } } while(0); $166 = (($ip$1$ph$lcssa$i) + 1)|0; $167 = (($ip$0$ph$lcssa143$i) + 1)|0; $168 = ($166>>>0)>($167>>>0); $p$1$p$0$i = $168 ? $p$1$ph$ph$lcssa23$i : $p$0$ph$ph$lcssa32147$i; $ip$1$ip$0$i = $168 ? $ip$1$ph$lcssa$i : $ip$0$ph$lcssa143$i; $169 = (($n) + ($p$1$p$0$i)|0); $170 = (($ip$1$ip$0$i) + 1)|0; $171 = (_memcmp($n,$169,$170)|0); $172 = ($171|0)==(0); if ($172) { $177 = (($$lcssa322) - ($p$1$p$0$i))|0; $mem0$0$i = $177;$p$3$i = $p$1$p$0$i; } else { $173 = (($$lcssa322) - ($ip$1$ip$0$i))|0; $174 = (($173) + -1)|0; $175 = ($ip$1$ip$0$i>>>0)>($174>>>0); $ip$1$ip$0$$i = $175 ? $ip$1$ip$0$i : $174; $176 = (($ip$1$ip$0$$i) + 1)|0; $mem0$0$i = 0;$p$3$i = $176; } $178 = $$lcssa322 | 63; $179 = ($mem0$0$i|0)!=(0); $180 = (($$lcssa322) - ($p$3$i))|0; $$03$i = $3;$mem$0$i = 0;$z$0$i = $3; L69: while(1) { $181 = $z$0$i; $182 = $$03$i; $183 = (($181) - ($182))|0; $184 = ($183>>>0)<($$lcssa322>>>0); do { if ($184) { $185 = (_memchr($z$0$i,0,$178)|0); $186 = ($185|0)==(0|0); if ($186) { $190 = (($z$0$i) + ($178)|0); $z$1$i = $190; break; } else { $187 = $185; $188 = (($187) - ($182))|0; $189 = ($188>>>0)<($$lcssa322>>>0); if ($189) { $$0$i = 0; break L32; } else { $z$1$i = $185; break; } } } else { $z$1$i = $z$0$i; } } while(0); $191 = (($$03$i) + ($l$080$i$lcssa321)|0); $192 = HEAP8[$191>>0]|0; $div$i = ($192&255) >>> 5; $193 = $div$i&255; $194 = (($byteset$i) + ($193<<2)|0); $195 = HEAP32[$194>>2]|0; $196 = $192 & 31; $197 = $196&255; $198 = 1 << $197; $199 = $198 & $195; $200 = ($199|0)==(0); if ($200) { $209 = (($$03$i) + ($$lcssa322)|0); $$03$i = $209;$mem$0$i = 0;$z$0$i = $z$1$i; continue; } $201 = $192&255; $202 = (($shift$i) + ($201<<2)|0); $203 = HEAP32[$202>>2]|0; $204 = (($$lcssa322) - ($203))|0; $205 = ($$lcssa322|0)==($203|0); if (!($205)) { $206 = ($mem$0$i|0)!=(0); $or$cond$i = $179 & $206; $207 = ($204>>>0)<($p$3$i>>>0); $or$cond5$i = $or$cond$i & $207; $k$2$i = $or$cond5$i ? $180 : $204; $208 = (($$03$i) + ($k$2$i)|0); $$03$i = $208;$mem$0$i = 0;$z$0$i = $z$1$i; continue; } $210 = ($170>>>0)>($mem$0$i>>>0); $211 = $210 ? $170 : $mem$0$i; $212 = (($n) + ($211)|0); $213 = HEAP8[$212>>0]|0; $214 = ($213<<24>>24)==(0); L83: do { if ($214) { $k$4$i = $170; } else { $$pr$i = $213;$k$338$i = $211; while(1) { $215 = (($$03$i) + ($k$338$i)|0); $216 = HEAP8[$215>>0]|0; $217 = ($$pr$i<<24>>24)==($216<<24>>24); if (!($217)) { $k$338$i$lcssa = $k$338$i; break; } $218 = (($k$338$i) + 1)|0; $219 = (($n) + ($218)|0); $220 = HEAP8[$219>>0]|0; $221 = ($220<<24>>24)==(0); if ($221) { $k$4$i = $170; break L83; } else { $$pr$i = $220;$k$338$i = $218; } } $222 = (($k$338$i$lcssa) - ($ip$1$ip$0$i))|0; $223 = (($$03$i) + ($222)|0); $$03$i = $223;$mem$0$i = 0;$z$0$i = $z$1$i; continue L69; } } while(0); while(1) { $224 = ($k$4$i>>>0)>($mem$0$i>>>0); if (!($224)) { $$0$i = $$03$i; break L32; } $225 = (($k$4$i) + -1)|0; $226 = (($n) + ($225)|0); $227 = HEAP8[$226>>0]|0; $228 = (($$03$i) + ($225)|0); $229 = HEAP8[$228>>0]|0; $230 = ($227<<24>>24)==($229<<24>>24); if ($230) { $k$4$i = $225; } else { break; } } $231 = (($$03$i) + ($p$3$i)|0); $$03$i = $231;$mem$0$i = $mem0$0$i;$z$0$i = $z$1$i; } } } while(0); $$0 = $$0$i; } } } } } } } while(0); STACKTOP = sp;return ($$0|0); } function _strtok($s,$sep) { $s = $s|0; $sep = $sep|0; var $$0 = 0, $$01 = 0, $$sum = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($s|0)==(0|0); if ($0) { $1 = HEAP32[8948>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $$0 = 0; } else { $$01 = $1; label = 3; } } else { $$01 = $s; label = 3; } do { if ((label|0) == 3) { $3 = (_strspn($$01,$sep)|0); $4 = (($$01) + ($3)|0); $5 = HEAP8[$4>>0]|0; $6 = ($5<<24>>24)==(0); if ($6) { HEAP32[8948>>2] = 0; $$0 = 0; break; } $7 = (_strcspn($4,$sep)|0); $$sum = (($7) + ($3))|0; $8 = (($$01) + ($$sum)|0); HEAP32[8948>>2] = $8; $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)==(0); if ($10) { HEAP32[8948>>2] = 0; $$0 = $4; break; } else { $$sum2 = (($$sum) + 1)|0; $11 = (($$01) + ($$sum2)|0); HEAP32[8948>>2] = $11; HEAP8[$8>>0] = 0; $$0 = $4; break; } } } while(0); return ($$0|0); } function _scanexp($f,$pok) { $f = $f|0; $pok = $pok|0; var $$lcssa22 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0; var $99 = 0, $c$0 = 0, $c$1$be = 0, $c$1$be$lcssa = 0, $c$112 = 0, $c$2$be = 0, $c$2$lcssa = 0, $c$27 = 0, $c$3$be = 0, $neg$0 = 0, $or$cond3 = 0, $x$013 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = ((($f)) + 100|0); $3 = HEAP32[$2>>2]|0; $4 = ($1>>>0)<($3>>>0); if ($4) { $5 = ((($1)) + 1|0); HEAP32[$0>>2] = $5; $6 = HEAP8[$1>>0]|0; $7 = $6&255; $9 = $7; } else { $8 = (___shgetc($f)|0); $9 = $8; } $10 = ($9|0)==(45); switch ($9|0) { case 43: case 45: { $11 = $10&1; $12 = HEAP32[$0>>2]|0; $13 = HEAP32[$2>>2]|0; $14 = ($12>>>0)<($13>>>0); if ($14) { $15 = ((($12)) + 1|0); HEAP32[$0>>2] = $15; $16 = HEAP8[$12>>0]|0; $17 = $16&255; $20 = $17; } else { $18 = (___shgetc($f)|0); $20 = $18; } $19 = (($20) + -48)|0; $21 = ($19>>>0)>(9); $22 = ($pok|0)!=(0); $or$cond3 = $22 & $21; if ($or$cond3) { $23 = HEAP32[$2>>2]|0; $24 = ($23|0)==(0|0); if ($24) { $c$0 = $20;$neg$0 = $11; } else { $25 = HEAP32[$0>>2]|0; $26 = ((($25)) + -1|0); HEAP32[$0>>2] = $26; $c$0 = $20;$neg$0 = $11; } } else { $c$0 = $20;$neg$0 = $11; } break; } default: { $c$0 = $9;$neg$0 = 0; } } $27 = (($c$0) + -48)|0; $28 = ($27>>>0)>(9); if ($28) { $29 = HEAP32[$2>>2]|0; $30 = ($29|0)==(0|0); if ($30) { $98 = -2147483648;$99 = 0; } else { $31 = HEAP32[$0>>2]|0; $32 = ((($31)) + -1|0); HEAP32[$0>>2] = $32; $98 = -2147483648;$99 = 0; } } else { $c$112 = $c$0;$x$013 = 0; while(1) { $33 = ($x$013*10)|0; $34 = (($c$112) + -48)|0; $35 = (($34) + ($33))|0; $36 = HEAP32[$0>>2]|0; $37 = HEAP32[$2>>2]|0; $38 = ($36>>>0)<($37>>>0); if ($38) { $39 = ((($36)) + 1|0); HEAP32[$0>>2] = $39; $40 = HEAP8[$36>>0]|0; $41 = $40&255; $c$1$be = $41; } else { $42 = (___shgetc($f)|0); $c$1$be = $42; } $43 = (($c$1$be) + -48)|0; $44 = ($43>>>0)<(10); $45 = ($35|0)<(214748364); $46 = $44 & $45; if ($46) { $c$112 = $c$1$be;$x$013 = $35; } else { $$lcssa22 = $35;$c$1$be$lcssa = $c$1$be; break; } } $47 = ($$lcssa22|0)<(0); $48 = $47 << 31 >> 31; $49 = (($c$1$be$lcssa) + -48)|0; $50 = ($49>>>0)<(10); if ($50) { $53 = $$lcssa22;$54 = $48;$c$27 = $c$1$be$lcssa; while(1) { $55 = (___muldi3(($53|0),($54|0),10,0)|0); $56 = tempRet0; $57 = ($c$27|0)<(0); $58 = $57 << 31 >> 31; $59 = (_i64Add(($c$27|0),($58|0),-48,-1)|0); $60 = tempRet0; $61 = (_i64Add(($59|0),($60|0),($55|0),($56|0))|0); $62 = tempRet0; $63 = HEAP32[$0>>2]|0; $64 = HEAP32[$2>>2]|0; $65 = ($63>>>0)<($64>>>0); if ($65) { $66 = ((($63)) + 1|0); HEAP32[$0>>2] = $66; $67 = HEAP8[$63>>0]|0; $68 = $67&255; $c$2$be = $68; } else { $69 = (___shgetc($f)|0); $c$2$be = $69; } $70 = (($c$2$be) + -48)|0; $71 = ($70>>>0)<(10); $72 = ($62|0)<(21474836); $73 = ($61>>>0)<(2061584302); $74 = ($62|0)==(21474836); $75 = $74 & $73; $76 = $72 | $75; $77 = $71 & $76; if ($77) { $53 = $61;$54 = $62;$c$27 = $c$2$be; } else { $92 = $61;$93 = $62;$c$2$lcssa = $c$2$be; break; } } } else { $92 = $$lcssa22;$93 = $48;$c$2$lcssa = $c$1$be$lcssa; } $51 = (($c$2$lcssa) + -48)|0; $52 = ($51>>>0)<(10); if ($52) { while(1) { $78 = HEAP32[$0>>2]|0; $79 = HEAP32[$2>>2]|0; $80 = ($78>>>0)<($79>>>0); if ($80) { $81 = ((($78)) + 1|0); HEAP32[$0>>2] = $81; $82 = HEAP8[$78>>0]|0; $83 = $82&255; $c$3$be = $83; } else { $84 = (___shgetc($f)|0); $c$3$be = $84; } $85 = (($c$3$be) + -48)|0; $86 = ($85>>>0)<(10); if (!($86)) { break; } } } $87 = HEAP32[$2>>2]|0; $88 = ($87|0)==(0|0); if (!($88)) { $89 = HEAP32[$0>>2]|0; $90 = ((($89)) + -1|0); HEAP32[$0>>2] = $90; } $91 = ($neg$0|0)!=(0); $94 = (_i64Subtract(0,0,($92|0),($93|0))|0); $95 = tempRet0; $96 = $91 ? $94 : $92; $97 = $91 ? $95 : $93; $98 = $97;$99 = $96; } tempRet0 = ($98); return ($99|0); } function ___fflush_unlocked($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 20|0); $1 = HEAP32[$0>>2]|0; $2 = ((($f)) + 28|0); $3 = HEAP32[$2>>2]|0; $4 = ($1>>>0)>($3>>>0); if ($4) { $5 = ((($f)) + 36|0); $6 = HEAP32[$5>>2]|0; (FUNCTION_TABLE_iiii[$6 & 15]($f,0,0)|0); $7 = HEAP32[$0>>2]|0; $8 = ($7|0)==(0|0); if ($8) { $$0 = -1; } else { label = 3; } } else { label = 3; } if ((label|0) == 3) { $9 = ((($f)) + 4|0); $10 = HEAP32[$9>>2]|0; $11 = ((($f)) + 8|0); $12 = HEAP32[$11>>2]|0; $13 = ($10>>>0)<($12>>>0); if ($13) { $14 = ((($f)) + 40|0); $15 = HEAP32[$14>>2]|0; $16 = $10; $17 = $12; $18 = (($16) - ($17))|0; (FUNCTION_TABLE_iiii[$15 & 15]($f,$18,1)|0); } $19 = ((($f)) + 16|0); HEAP32[$19>>2] = 0; HEAP32[$2>>2] = 0; HEAP32[$0>>2] = 0; HEAP32[$11>>2] = 0; HEAP32[$9>>2] = 0; $$0 = 0; } return ($$0|0); } function _printf_core($f,$fmt,$ap,$nl_arg,$nl_type) { $f = $f|0; $fmt = $fmt|0; $ap = $ap|0; $nl_arg = $nl_arg|0; $nl_type = $nl_type|0; var $$ = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$012$i = 0, $$013$i = 0, $$03$i33 = 0, $$07$i = 0.0, $$1$i = 0.0, $$114$i = 0, $$2$i = 0.0, $$20$i = 0.0, $$21$i = 0, $$210$$22$i = 0, $$210$$24$i = 0, $$210$i = 0, $$23$i = 0, $$3$i = 0.0, $$31$i = 0; var $$311$i = 0, $$4$i = 0.0, $$412$lcssa$i = 0, $$41276$i = 0, $$5$lcssa$i = 0, $$51 = 0, $$587$i = 0, $$a$3$i = 0, $$a$3185$i = 0, $$a$3186$i = 0, $$fl$4 = 0, $$l10n$0 = 0, $$lcssa = 0, $$lcssa159$i = 0, $$lcssa318 = 0, $$lcssa323 = 0, $$lcssa324 = 0, $$lcssa325 = 0, $$lcssa326 = 0, $$lcssa327 = 0; var $$lcssa329 = 0, $$lcssa339 = 0, $$lcssa342 = 0.0, $$lcssa344 = 0, $$neg52$i = 0, $$neg53$i = 0, $$p$$i = 0, $$p$0 = 0, $$p$5 = 0, $$p$i = 0, $$pn$i = 0, $$pr$i = 0, $$pr47$i = 0, $$pre = 0, $$pre$i = 0, $$pre$phi184$iZ2D = 0, $$pre179$i = 0, $$pre182$i = 0, $$pre183$i = 0, $$pre193 = 0; var $$sum$i = 0, $$sum15$i = 0, $$sum16$i = 0, $$z$3$i = 0, $$z$4$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0; var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0; var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0; var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0; var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0; var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0; var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0; var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0; var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0; var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0; var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0; var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0; var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0; var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0; var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0.0; var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0; var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0.0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0; var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0.0, $413 = 0.0, $414 = 0.0, $415 = 0.0, $416 = 0.0, $417 = 0; var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0; var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0.0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0; var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0; var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0.0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0.0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0; var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0; var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0; var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0; var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0; var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0; var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0.0, $597 = 0.0, $598 = 0; var $599 = 0.0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0; var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0; var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0; var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0; var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0; var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0; var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0; var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0; var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0; var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0; var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $a$0 = 0, $a$1 = 0, $a$1$lcssa$i = 0, $a$1147$i = 0, $a$2 = 0, $a$2$ph$i = 0, $a$3$lcssa$i = 0, $a$3134$i = 0, $a$5$lcssa$i = 0, $a$5109$i = 0, $a$6$i = 0, $a$7$i = 0, $a$8$ph$i = 0, $arg = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0; var $argpos$0 = 0, $big$i = 0, $buf = 0, $buf$i = 0, $carry$0140$i = 0, $carry3$0128$i = 0, $cnt$0 = 0, $cnt$1 = 0, $cnt$1$lcssa = 0, $d$0$i = 0, $d$0139$i = 0, $d$0141$i = 0, $d$1127$i = 0, $d$2$lcssa$i = 0, $d$2108$i = 0, $d$3$i = 0, $d$482$i = 0, $d$575$i = 0, $d$686$i = 0, $e$0123$i = 0; var $e$1$i = 0, $e$2104$i = 0, $e$3$i = 0, $e$4$ph$i = 0, $e2$i = 0, $ebuf0$i = 0, $estr$0$i = 0, $estr$1$lcssa$i = 0, $estr$193$i = 0, $estr$2$i = 0, $exitcond$i = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0; var $expanded8 = 0, $fl$0109 = 0, $fl$062 = 0, $fl$1 = 0, $fl$1$ = 0, $fl$3 = 0, $fl$4 = 0, $fl$6 = 0, $fmt39$lcssa = 0, $fmt39101 = 0, $fmt40 = 0, $fmt41 = 0, $fmt42 = 0, $fmt44 = 0, $fmt44$lcssa321 = 0, $fmt45 = 0, $i$0$lcssa = 0, $i$0$lcssa200 = 0, $i$0114 = 0, $i$0122$i = 0; var $i$03$i = 0, $i$03$i25 = 0, $i$1$lcssa$i = 0, $i$1116$i = 0, $i$1125 = 0, $i$2100 = 0, $i$2100$lcssa = 0, $i$2103$i = 0, $i$398 = 0, $i$399$i = 0, $isdigit = 0, $isdigit$i = 0, $isdigit$i27 = 0, $isdigit10 = 0, $isdigit12 = 0, $isdigit2$i = 0, $isdigit2$i23 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp$i = 0; var $isdigittmp$i26 = 0, $isdigittmp1$i = 0, $isdigittmp1$i22 = 0, $isdigittmp11 = 0, $isdigittmp4$i = 0, $isdigittmp4$i24 = 0, $isdigittmp9 = 0, $j$0$i = 0, $j$0115$i = 0, $j$0117$i = 0, $j$1100$i = 0, $j$2$i = 0, $l$0 = 0, $l$0$i = 0, $l$1$i = 0, $l$1113 = 0, $l$2 = 0, $l10n$0 = 0, $l10n$0$lcssa = 0, $l10n$0$phi = 0; var $l10n$1 = 0, $l10n$2 = 0, $l10n$3 = 0, $mb = 0, $notlhs$i = 0, $notrhs$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond15 = 0, $or$cond17 = 0, $or$cond20 = 0, $or$cond240 = 0, $or$cond29$i = 0, $or$cond3$not$i = 0, $or$cond6$i = 0, $p$0 = 0, $p$1 = 0, $p$2 = 0, $p$2$ = 0, $p$3 = 0; var $p$4198 = 0, $p$5 = 0, $pl$0 = 0, $pl$0$i = 0, $pl$1 = 0, $pl$1$i = 0, $pl$2 = 0, $prefix$0 = 0, $prefix$0$$i = 0, $prefix$0$i = 0, $prefix$1 = 0, $prefix$2 = 0, $r$0$a$8$i = 0, $re$169$i = 0, $round$068$i = 0.0, $round6$1$i = 0.0, $s$0$i = 0, $s$1$i = 0, $s$1$i$lcssa = 0, $s1$0$i = 0; var $s7$079$i = 0, $s7$1$i = 0, $s8$0$lcssa$i = 0, $s8$070$i = 0, $s9$0$i = 0, $s9$183$i = 0, $s9$2$i = 0, $small$0$i = 0.0, $small$1$i = 0.0, $st$0 = 0, $st$0$lcssa322 = 0, $storemerge = 0, $storemerge13 = 0, $storemerge8108 = 0, $storemerge860 = 0, $sum = 0, $t$0 = 0, $t$1 = 0, $w$$i = 0, $w$0 = 0; var $w$1 = 0, $w$2 = 0, $w$30$i = 0, $wc = 0, $ws$0115 = 0, $ws$1126 = 0, $z$0$i = 0, $z$0$lcssa = 0, $z$0102 = 0, $z$1 = 0, $z$1$lcssa$i = 0, $z$1146$i = 0, $z$2 = 0, $z$2$i = 0, $z$2$i$lcssa = 0, $z$3$lcssa$i = 0, $z$3133$i = 0, $z$4$i = 0, $z$6$$i = 0, $z$6$i = 0; var $z$6$i$lcssa = 0, $z$6$ph$i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 624|0; $big$i = sp + 24|0; $e2$i = sp + 16|0; $buf$i = sp + 588|0; $ebuf0$i = sp + 576|0; $arg = sp; $buf = sp + 536|0; $wc = sp + 8|0; $mb = sp + 528|0; $0 = ($f|0)!=(0|0); $1 = ((($buf)) + 40|0); $2 = $1; $3 = ((($buf)) + 39|0); $4 = ((($wc)) + 4|0); $5 = ((($ebuf0$i)) + 12|0); $6 = ((($ebuf0$i)) + 11|0); $7 = $buf$i; $8 = $5; $9 = (($8) - ($7))|0; $10 = (-2 - ($7))|0; $11 = (($8) + 2)|0; $12 = ((($big$i)) + 288|0); $13 = ((($buf$i)) + 9|0); $14 = $13; $15 = ((($buf$i)) + 8|0); $cnt$0 = 0;$fmt41 = $fmt;$l$0 = 0;$l10n$0 = 0; L1: while(1) { $16 = ($cnt$0|0)>(-1); do { if ($16) { $17 = (2147483647 - ($cnt$0))|0; $18 = ($l$0|0)>($17|0); if ($18) { $19 = (___errno_location()|0); HEAP32[$19>>2] = 75; $cnt$1 = -1; break; } else { $20 = (($l$0) + ($cnt$0))|0; $cnt$1 = $20; break; } } else { $cnt$1 = $cnt$0; } } while(0); $21 = HEAP8[$fmt41>>0]|0; $22 = ($21<<24>>24)==(0); if ($22) { $cnt$1$lcssa = $cnt$1;$l10n$0$lcssa = $l10n$0; label = 245; break; } else { $23 = $21;$fmt40 = $fmt41; } L9: while(1) { switch ($23<<24>>24) { case 37: { $fmt39101 = $fmt40;$z$0102 = $fmt40; label = 9; break L9; break; } case 0: { $fmt39$lcssa = $fmt40;$z$0$lcssa = $fmt40; break L9; break; } default: { } } $24 = ((($fmt40)) + 1|0); $$pre = HEAP8[$24>>0]|0; $23 = $$pre;$fmt40 = $24; } L12: do { if ((label|0) == 9) { while(1) { label = 0; $25 = ((($fmt39101)) + 1|0); $26 = HEAP8[$25>>0]|0; $27 = ($26<<24>>24)==(37); if (!($27)) { $fmt39$lcssa = $fmt39101;$z$0$lcssa = $z$0102; break L12; } $28 = ((($z$0102)) + 1|0); $29 = ((($fmt39101)) + 2|0); $30 = HEAP8[$29>>0]|0; $31 = ($30<<24>>24)==(37); if ($31) { $fmt39101 = $29;$z$0102 = $28; label = 9; } else { $fmt39$lcssa = $29;$z$0$lcssa = $28; break; } } } } while(0); $32 = $z$0$lcssa; $33 = $fmt41; $34 = (($32) - ($33))|0; if ($0) { $35 = HEAP32[$f>>2]|0; $36 = $35 & 32; $37 = ($36|0)==(0); if ($37) { (___fwritex($fmt41,$34,$f)|0); } } $38 = ($z$0$lcssa|0)==($fmt41|0); if (!($38)) { $l10n$0$phi = $l10n$0;$cnt$0 = $cnt$1;$fmt41 = $fmt39$lcssa;$l$0 = $34;$l10n$0 = $l10n$0$phi; continue; } $39 = ((($fmt39$lcssa)) + 1|0); $40 = HEAP8[$39>>0]|0; $41 = $40 << 24 >> 24; $isdigittmp = (($41) + -48)|0; $isdigit = ($isdigittmp>>>0)<(10); if ($isdigit) { $42 = ((($fmt39$lcssa)) + 2|0); $43 = HEAP8[$42>>0]|0; $44 = ($43<<24>>24)==(36); $45 = ((($fmt39$lcssa)) + 3|0); $$51 = $44 ? $45 : $39; $$l10n$0 = $44 ? 1 : $l10n$0; $isdigittmp$ = $44 ? $isdigittmp : -1; $$pre193 = HEAP8[$$51>>0]|0; $47 = $$pre193;$argpos$0 = $isdigittmp$;$l10n$1 = $$l10n$0;$storemerge = $$51; } else { $47 = $40;$argpos$0 = -1;$l10n$1 = $l10n$0;$storemerge = $39; } $46 = $47 << 24 >> 24; $48 = $46 & -32; $49 = ($48|0)==(32); L25: do { if ($49) { $51 = $46;$56 = $47;$fl$0109 = 0;$storemerge8108 = $storemerge; while(1) { $50 = (($51) + -32)|0; $52 = 1 << $50; $53 = $52 & 75913; $54 = ($53|0)==(0); if ($54) { $65 = $56;$fl$062 = $fl$0109;$storemerge860 = $storemerge8108; break L25; } $55 = $56 << 24 >> 24; $57 = (($55) + -32)|0; $58 = 1 << $57; $59 = $58 | $fl$0109; $60 = ((($storemerge8108)) + 1|0); $61 = HEAP8[$60>>0]|0; $62 = $61 << 24 >> 24; $63 = $62 & -32; $64 = ($63|0)==(32); if ($64) { $51 = $62;$56 = $61;$fl$0109 = $59;$storemerge8108 = $60; } else { $65 = $61;$fl$062 = $59;$storemerge860 = $60; break; } } } else { $65 = $47;$fl$062 = 0;$storemerge860 = $storemerge; } } while(0); $66 = ($65<<24>>24)==(42); do { if ($66) { $67 = ((($storemerge860)) + 1|0); $68 = HEAP8[$67>>0]|0; $69 = $68 << 24 >> 24; $isdigittmp11 = (($69) + -48)|0; $isdigit12 = ($isdigittmp11>>>0)<(10); if ($isdigit12) { $70 = ((($storemerge860)) + 2|0); $71 = HEAP8[$70>>0]|0; $72 = ($71<<24>>24)==(36); if ($72) { $73 = (($nl_type) + ($isdigittmp11<<2)|0); HEAP32[$73>>2] = 10; $74 = HEAP8[$67>>0]|0; $75 = $74 << 24 >> 24; $76 = (($75) + -48)|0; $77 = (($nl_arg) + ($76<<3)|0); $78 = $77; $79 = $78; $80 = HEAP32[$79>>2]|0; $81 = (($78) + 4)|0; $82 = $81; $83 = HEAP32[$82>>2]|0; $84 = ((($storemerge860)) + 3|0); $l10n$2 = 1;$storemerge13 = $84;$w$0 = $80; } else { label = 24; } } else { label = 24; } if ((label|0) == 24) { label = 0; $85 = ($l10n$1|0)==(0); if (!($85)) { $$0 = -1; break L1; } if (!($0)) { $fl$1 = $fl$062;$fmt42 = $67;$l10n$3 = 0;$w$1 = 0; break; } $arglist_current = HEAP32[$ap>>2]|0; $86 = $arglist_current; $87 = ((0) + 4|0); $expanded4 = $87; $expanded = (($expanded4) - 1)|0; $88 = (($86) + ($expanded))|0; $89 = ((0) + 4|0); $expanded8 = $89; $expanded7 = (($expanded8) - 1)|0; $expanded6 = $expanded7 ^ -1; $90 = $88 & $expanded6; $91 = $90; $92 = HEAP32[$91>>2]|0; $arglist_next = ((($91)) + 4|0); HEAP32[$ap>>2] = $arglist_next; $l10n$2 = 0;$storemerge13 = $67;$w$0 = $92; } $93 = ($w$0|0)<(0); if ($93) { $94 = $fl$062 | 8192; $95 = (0 - ($w$0))|0; $fl$1 = $94;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $95; } else { $fl$1 = $fl$062;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $w$0; } } else { $96 = $65 << 24 >> 24; $isdigittmp1$i = (($96) + -48)|0; $isdigit2$i = ($isdigittmp1$i>>>0)<(10); if ($isdigit2$i) { $100 = $storemerge860;$i$03$i = 0;$isdigittmp4$i = $isdigittmp1$i; while(1) { $97 = ($i$03$i*10)|0; $98 = (($97) + ($isdigittmp4$i))|0; $99 = ((($100)) + 1|0); $101 = HEAP8[$99>>0]|0; $102 = $101 << 24 >> 24; $isdigittmp$i = (($102) + -48)|0; $isdigit$i = ($isdigittmp$i>>>0)<(10); if ($isdigit$i) { $100 = $99;$i$03$i = $98;$isdigittmp4$i = $isdigittmp$i; } else { $$lcssa = $98;$$lcssa318 = $99; break; } } $103 = ($$lcssa|0)<(0); if ($103) { $$0 = -1; break L1; } else { $fl$1 = $fl$062;$fmt42 = $$lcssa318;$l10n$3 = $l10n$1;$w$1 = $$lcssa; } } else { $fl$1 = $fl$062;$fmt42 = $storemerge860;$l10n$3 = $l10n$1;$w$1 = 0; } } } while(0); $104 = HEAP8[$fmt42>>0]|0; $105 = ($104<<24>>24)==(46); L46: do { if ($105) { $106 = ((($fmt42)) + 1|0); $107 = HEAP8[$106>>0]|0; $108 = ($107<<24>>24)==(42); if (!($108)) { $135 = $107 << 24 >> 24; $isdigittmp1$i22 = (($135) + -48)|0; $isdigit2$i23 = ($isdigittmp1$i22>>>0)<(10); if ($isdigit2$i23) { $139 = $106;$i$03$i25 = 0;$isdigittmp4$i24 = $isdigittmp1$i22; } else { $fmt45 = $106;$p$0 = 0; break; } while(1) { $136 = ($i$03$i25*10)|0; $137 = (($136) + ($isdigittmp4$i24))|0; $138 = ((($139)) + 1|0); $140 = HEAP8[$138>>0]|0; $141 = $140 << 24 >> 24; $isdigittmp$i26 = (($141) + -48)|0; $isdigit$i27 = ($isdigittmp$i26>>>0)<(10); if ($isdigit$i27) { $139 = $138;$i$03$i25 = $137;$isdigittmp4$i24 = $isdigittmp$i26; } else { $fmt45 = $138;$p$0 = $137; break L46; } } } $109 = ((($fmt42)) + 2|0); $110 = HEAP8[$109>>0]|0; $111 = $110 << 24 >> 24; $isdigittmp9 = (($111) + -48)|0; $isdigit10 = ($isdigittmp9>>>0)<(10); if ($isdigit10) { $112 = ((($fmt42)) + 3|0); $113 = HEAP8[$112>>0]|0; $114 = ($113<<24>>24)==(36); if ($114) { $115 = (($nl_type) + ($isdigittmp9<<2)|0); HEAP32[$115>>2] = 10; $116 = HEAP8[$109>>0]|0; $117 = $116 << 24 >> 24; $118 = (($117) + -48)|0; $119 = (($nl_arg) + ($118<<3)|0); $120 = $119; $121 = $120; $122 = HEAP32[$121>>2]|0; $123 = (($120) + 4)|0; $124 = $123; $125 = HEAP32[$124>>2]|0; $126 = ((($fmt42)) + 4|0); $fmt45 = $126;$p$0 = $122; break; } } $127 = ($l10n$3|0)==(0); if (!($127)) { $$0 = -1; break L1; } if ($0) { $arglist_current2 = HEAP32[$ap>>2]|0; $128 = $arglist_current2; $129 = ((0) + 4|0); $expanded11 = $129; $expanded10 = (($expanded11) - 1)|0; $130 = (($128) + ($expanded10))|0; $131 = ((0) + 4|0); $expanded15 = $131; $expanded14 = (($expanded15) - 1)|0; $expanded13 = $expanded14 ^ -1; $132 = $130 & $expanded13; $133 = $132; $134 = HEAP32[$133>>2]|0; $arglist_next3 = ((($133)) + 4|0); HEAP32[$ap>>2] = $arglist_next3; $fmt45 = $109;$p$0 = $134; } else { $fmt45 = $109;$p$0 = 0; } } else { $fmt45 = $fmt42;$p$0 = -1; } } while(0); $fmt44 = $fmt45;$st$0 = 0; while(1) { $142 = HEAP8[$fmt44>>0]|0; $143 = $142 << 24 >> 24; $144 = (($143) + -65)|0; $145 = ($144>>>0)>(57); if ($145) { $$0 = -1; break L1; } $146 = ((($fmt44)) + 1|0); $147 = ((29989 + (($st$0*58)|0)|0) + ($144)|0); $148 = HEAP8[$147>>0]|0; $149 = $148&255; $150 = (($149) + -1)|0; $151 = ($150>>>0)<(8); if ($151) { $fmt44 = $146;$st$0 = $149; } else { $$lcssa323 = $146;$$lcssa324 = $148;$$lcssa325 = $149;$fmt44$lcssa321 = $fmt44;$st$0$lcssa322 = $st$0; break; } } $152 = ($$lcssa324<<24>>24)==(0); if ($152) { $$0 = -1; break; } $153 = ($$lcssa324<<24>>24)==(19); $154 = ($argpos$0|0)>(-1); do { if ($153) { if ($154) { $$0 = -1; break L1; } else { label = 52; } } else { if ($154) { $155 = (($nl_type) + ($argpos$0<<2)|0); HEAP32[$155>>2] = $$lcssa325; $156 = (($nl_arg) + ($argpos$0<<3)|0); $157 = $156; $158 = $157; $159 = HEAP32[$158>>2]|0; $160 = (($157) + 4)|0; $161 = $160; $162 = HEAP32[$161>>2]|0; $163 = $arg; $164 = $163; HEAP32[$164>>2] = $159; $165 = (($163) + 4)|0; $166 = $165; HEAP32[$166>>2] = $162; label = 52; break; } if (!($0)) { $$0 = 0; break L1; } _pop_arg($arg,$$lcssa325,$ap); } } while(0); if ((label|0) == 52) { label = 0; if (!($0)) { $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue; } } $167 = HEAP8[$fmt44$lcssa321>>0]|0; $168 = $167 << 24 >> 24; $169 = ($st$0$lcssa322|0)!=(0); $170 = $168 & 15; $171 = ($170|0)==(3); $or$cond15 = $169 & $171; $172 = $168 & -33; $t$0 = $or$cond15 ? $172 : $168; $173 = $fl$1 & 8192; $174 = ($173|0)==(0); $175 = $fl$1 & -65537; $fl$1$ = $174 ? $fl$1 : $175; L75: do { switch ($t$0|0) { case 110: { switch ($st$0$lcssa322|0) { case 0: { $182 = HEAP32[$arg>>2]|0; HEAP32[$182>>2] = $cnt$1; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 1: { $183 = HEAP32[$arg>>2]|0; HEAP32[$183>>2] = $cnt$1; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 2: { $184 = ($cnt$1|0)<(0); $185 = $184 << 31 >> 31; $186 = HEAP32[$arg>>2]|0; $187 = $186; $188 = $187; HEAP32[$188>>2] = $cnt$1; $189 = (($187) + 4)|0; $190 = $189; HEAP32[$190>>2] = $185; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 3: { $191 = $cnt$1&65535; $192 = HEAP32[$arg>>2]|0; HEAP16[$192>>1] = $191; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 4: { $193 = $cnt$1&255; $194 = HEAP32[$arg>>2]|0; HEAP8[$194>>0] = $193; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 6: { $195 = HEAP32[$arg>>2]|0; HEAP32[$195>>2] = $cnt$1; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 7: { $196 = ($cnt$1|0)<(0); $197 = $196 << 31 >> 31; $198 = HEAP32[$arg>>2]|0; $199 = $198; $200 = $199; HEAP32[$200>>2] = $cnt$1; $201 = (($199) + 4)|0; $202 = $201; HEAP32[$202>>2] = $197; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } default: { $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; } } break; } case 112: { $203 = ($p$0>>>0)>(8); $204 = $203 ? $p$0 : 8; $205 = $fl$1$ | 8; $fl$3 = $205;$p$1 = $204;$t$1 = 120; label = 64; break; } case 88: case 120: { $fl$3 = $fl$1$;$p$1 = $p$0;$t$1 = $t$0; label = 64; break; } case 111: { $243 = $arg; $244 = $243; $245 = HEAP32[$244>>2]|0; $246 = (($243) + 4)|0; $247 = $246; $248 = HEAP32[$247>>2]|0; $249 = ($245|0)==(0); $250 = ($248|0)==(0); $251 = $249 & $250; if ($251) { $$0$lcssa$i = $1; } else { $$03$i33 = $1;$253 = $245;$257 = $248; while(1) { $252 = $253 & 7; $254 = $252 | 48; $255 = $254&255; $256 = ((($$03$i33)) + -1|0); HEAP8[$256>>0] = $255; $258 = (_bitshift64Lshr(($253|0),($257|0),3)|0); $259 = tempRet0; $260 = ($258|0)==(0); $261 = ($259|0)==(0); $262 = $260 & $261; if ($262) { $$0$lcssa$i = $256; break; } else { $$03$i33 = $256;$253 = $258;$257 = $259; } } } $263 = $fl$1$ & 8; $264 = ($263|0)==(0); if ($264) { $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = 0;$prefix$1 = 30469; label = 77; } else { $265 = $$0$lcssa$i; $266 = (($2) - ($265))|0; $267 = (($266) + 1)|0; $268 = ($p$0|0)<($267|0); $$p$0 = $268 ? $267 : $p$0; $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $$p$0;$pl$1 = 0;$prefix$1 = 30469; label = 77; } break; } case 105: case 100: { $269 = $arg; $270 = $269; $271 = HEAP32[$270>>2]|0; $272 = (($269) + 4)|0; $273 = $272; $274 = HEAP32[$273>>2]|0; $275 = ($274|0)<(0); if ($275) { $276 = (_i64Subtract(0,0,($271|0),($274|0))|0); $277 = tempRet0; $278 = $arg; $279 = $278; HEAP32[$279>>2] = $276; $280 = (($278) + 4)|0; $281 = $280; HEAP32[$281>>2] = $277; $286 = $276;$287 = $277;$pl$0 = 1;$prefix$0 = 30469; label = 76; break L75; } $282 = $fl$1$ & 2048; $283 = ($282|0)==(0); if ($283) { $284 = $fl$1$ & 1; $285 = ($284|0)==(0); $$ = $285 ? 30469 : (30471); $286 = $271;$287 = $274;$pl$0 = $284;$prefix$0 = $$; label = 76; } else { $286 = $271;$287 = $274;$pl$0 = 1;$prefix$0 = (30470); label = 76; } break; } case 117: { $176 = $arg; $177 = $176; $178 = HEAP32[$177>>2]|0; $179 = (($176) + 4)|0; $180 = $179; $181 = HEAP32[$180>>2]|0; $286 = $178;$287 = $181;$pl$0 = 0;$prefix$0 = 30469; label = 76; break; } case 99: { $307 = $arg; $308 = $307; $309 = HEAP32[$308>>2]|0; $310 = (($307) + 4)|0; $311 = $310; $312 = HEAP32[$311>>2]|0; $313 = $309&255; HEAP8[$3>>0] = $313; $a$2 = $3;$fl$6 = $175;$p$5 = 1;$pl$2 = 0;$prefix$2 = 30469;$z$2 = $1; break; } case 109: { $314 = (___errno_location()|0); $315 = HEAP32[$314>>2]|0; $316 = (_strerror($315)|0); $a$1 = $316; label = 82; break; } case 115: { $317 = HEAP32[$arg>>2]|0; $318 = ($317|0)!=(0|0); $319 = $318 ? $317 : 30479; $a$1 = $319; label = 82; break; } case 67: { $326 = $arg; $327 = $326; $328 = HEAP32[$327>>2]|0; $329 = (($326) + 4)|0; $330 = $329; $331 = HEAP32[$330>>2]|0; HEAP32[$wc>>2] = $328; HEAP32[$4>>2] = 0; HEAP32[$arg>>2] = $wc; $p$4198 = -1; label = 86; break; } case 83: { $332 = ($p$0|0)==(0); if ($332) { _pad($f,32,$w$1,0,$fl$1$); $i$0$lcssa200 = 0; label = 98; } else { $p$4198 = $p$0; label = 86; } break; } case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: { $359 = +HEAPF64[$arg>>3]; HEAP32[$e2$i>>2] = 0; HEAPF64[tempDoublePtr>>3] = $359;$360 = HEAP32[tempDoublePtr>>2]|0; $361 = HEAP32[tempDoublePtr+4>>2]|0; $362 = ($361|0)<(0); if ($362) { $363 = -$359; $$07$i = $363;$pl$0$i = 1;$prefix$0$i = 30486; } else { $364 = $fl$1$ & 2048; $365 = ($364|0)==(0); if ($365) { $366 = $fl$1$ & 1; $367 = ($366|0)==(0); $$$i = $367 ? (30487) : (30492); $$07$i = $359;$pl$0$i = $366;$prefix$0$i = $$$i; } else { $$07$i = $359;$pl$0$i = 1;$prefix$0$i = (30489); } } HEAPF64[tempDoublePtr>>3] = $$07$i;$368 = HEAP32[tempDoublePtr>>2]|0; $369 = HEAP32[tempDoublePtr+4>>2]|0; $370 = $369 & 2146435072; $371 = ($370>>>0)<(2146435072); $372 = (0)<(0); $373 = ($370|0)==(2146435072); $374 = $373 & $372; $375 = $371 | $374; do { if ($375) { $391 = (+_frexpl($$07$i,$e2$i)); $392 = $391 * 2.0; $393 = $392 != 0.0; if ($393) { $394 = HEAP32[$e2$i>>2]|0; $395 = (($394) + -1)|0; HEAP32[$e2$i>>2] = $395; } $396 = $t$0 | 32; $397 = ($396|0)==(97); if ($397) { $398 = $t$0 & 32; $399 = ($398|0)==(0); $400 = ((($prefix$0$i)) + 9|0); $prefix$0$$i = $399 ? $prefix$0$i : $400; $401 = $pl$0$i | 2; $402 = ($p$0>>>0)>(11); $403 = (12 - ($p$0))|0; $404 = ($403|0)==(0); $405 = $402 | $404; do { if ($405) { $$1$i = $392; } else { $re$169$i = $403;$round$068$i = 8.0; while(1) { $406 = (($re$169$i) + -1)|0; $407 = $round$068$i * 16.0; $408 = ($406|0)==(0); if ($408) { $$lcssa342 = $407; break; } else { $re$169$i = $406;$round$068$i = $407; } } $409 = HEAP8[$prefix$0$$i>>0]|0; $410 = ($409<<24>>24)==(45); if ($410) { $411 = -$392; $412 = $411 - $$lcssa342; $413 = $$lcssa342 + $412; $414 = -$413; $$1$i = $414; break; } else { $415 = $392 + $$lcssa342; $416 = $415 - $$lcssa342; $$1$i = $416; break; } } } while(0); $417 = HEAP32[$e2$i>>2]|0; $418 = ($417|0)<(0); $419 = (0 - ($417))|0; $420 = $418 ? $419 : $417; $421 = ($420|0)<(0); $422 = $421 << 31 >> 31; $423 = (_fmt_u($420,$422,$5)|0); $424 = ($423|0)==($5|0); if ($424) { HEAP8[$6>>0] = 48; $estr$0$i = $6; } else { $estr$0$i = $423; } $425 = $417 >> 31; $426 = $425 & 2; $427 = (($426) + 43)|0; $428 = $427&255; $429 = ((($estr$0$i)) + -1|0); HEAP8[$429>>0] = $428; $430 = (($t$0) + 15)|0; $431 = $430&255; $432 = ((($estr$0$i)) + -2|0); HEAP8[$432>>0] = $431; $notrhs$i = ($p$0|0)<(1); $433 = $fl$1$ & 8; $434 = ($433|0)==(0); $$2$i = $$1$i;$s$0$i = $buf$i; while(1) { $435 = (~~(($$2$i))); $436 = (30453 + ($435)|0); $437 = HEAP8[$436>>0]|0; $438 = $437&255; $439 = $438 | $398; $440 = $439&255; $441 = ((($s$0$i)) + 1|0); HEAP8[$s$0$i>>0] = $440; $442 = (+($435|0)); $443 = $$2$i - $442; $444 = $443 * 16.0; $445 = $441; $446 = (($445) - ($7))|0; $447 = ($446|0)==(1); do { if ($447) { $notlhs$i = $444 == 0.0; $or$cond3$not$i = $notrhs$i & $notlhs$i; $or$cond$i = $434 & $or$cond3$not$i; if ($or$cond$i) { $s$1$i = $441; break; } $448 = ((($s$0$i)) + 2|0); HEAP8[$441>>0] = 46; $s$1$i = $448; } else { $s$1$i = $441; } } while(0); $449 = $444 != 0.0; if ($449) { $$2$i = $444;$s$0$i = $s$1$i; } else { $s$1$i$lcssa = $s$1$i; break; } } $450 = ($p$0|0)!=(0); $$pre182$i = $s$1$i$lcssa; $451 = (($10) + ($$pre182$i))|0; $452 = ($451|0)<($p$0|0); $or$cond240 = $450 & $452; $453 = $432; $454 = (($11) + ($p$0))|0; $455 = (($454) - ($453))|0; $456 = $432; $457 = (($9) - ($456))|0; $458 = (($457) + ($$pre182$i))|0; $l$0$i = $or$cond240 ? $455 : $458; $459 = (($l$0$i) + ($401))|0; _pad($f,32,$w$1,$459,$fl$1$); $460 = HEAP32[$f>>2]|0; $461 = $460 & 32; $462 = ($461|0)==(0); if ($462) { (___fwritex($prefix$0$$i,$401,$f)|0); } $463 = $fl$1$ ^ 65536; _pad($f,48,$w$1,$459,$463); $464 = (($$pre182$i) - ($7))|0; $465 = HEAP32[$f>>2]|0; $466 = $465 & 32; $467 = ($466|0)==(0); if ($467) { (___fwritex($buf$i,$464,$f)|0); } $468 = $432; $469 = (($8) - ($468))|0; $sum = (($464) + ($469))|0; $470 = (($l$0$i) - ($sum))|0; _pad($f,48,$470,0,0); $471 = HEAP32[$f>>2]|0; $472 = $471 & 32; $473 = ($472|0)==(0); if ($473) { (___fwritex($432,$469,$f)|0); } $474 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$459,$474); $475 = ($459|0)<($w$1|0); $w$$i = $475 ? $w$1 : $459; $$0$i = $w$$i; break; } $476 = ($p$0|0)<(0); $$p$i = $476 ? 6 : $p$0; if ($393) { $477 = $392 * 268435456.0; $478 = HEAP32[$e2$i>>2]|0; $479 = (($478) + -28)|0; HEAP32[$e2$i>>2] = $479; $$3$i = $477;$480 = $479; } else { $$pre179$i = HEAP32[$e2$i>>2]|0; $$3$i = $392;$480 = $$pre179$i; } $481 = ($480|0)<(0); $$31$i = $481 ? $big$i : $12; $482 = $$31$i; $$4$i = $$3$i;$z$0$i = $$31$i; while(1) { $483 = (~~(($$4$i))>>>0); HEAP32[$z$0$i>>2] = $483; $484 = ((($z$0$i)) + 4|0); $485 = (+($483>>>0)); $486 = $$4$i - $485; $487 = $486 * 1.0E+9; $488 = $487 != 0.0; if ($488) { $$4$i = $487;$z$0$i = $484; } else { $$lcssa326 = $484; break; } } $$pr$i = HEAP32[$e2$i>>2]|0; $489 = ($$pr$i|0)>(0); if ($489) { $490 = $$pr$i;$a$1147$i = $$31$i;$z$1146$i = $$lcssa326; while(1) { $491 = ($490|0)>(29); $492 = $491 ? 29 : $490; $d$0139$i = ((($z$1146$i)) + -4|0); $493 = ($d$0139$i>>>0)<($a$1147$i>>>0); do { if ($493) { $a$2$ph$i = $a$1147$i; } else { $carry$0140$i = 0;$d$0141$i = $d$0139$i; while(1) { $494 = HEAP32[$d$0141$i>>2]|0; $495 = (_bitshift64Shl(($494|0),0,($492|0))|0); $496 = tempRet0; $497 = (_i64Add(($495|0),($496|0),($carry$0140$i|0),0)|0); $498 = tempRet0; $499 = (___uremdi3(($497|0),($498|0),1000000000,0)|0); $500 = tempRet0; HEAP32[$d$0141$i>>2] = $499; $501 = (___udivdi3(($497|0),($498|0),1000000000,0)|0); $502 = tempRet0; $d$0$i = ((($d$0141$i)) + -4|0); $503 = ($d$0$i>>>0)<($a$1147$i>>>0); if ($503) { $$lcssa327 = $501; break; } else { $carry$0140$i = $501;$d$0141$i = $d$0$i; } } $504 = ($$lcssa327|0)==(0); if ($504) { $a$2$ph$i = $a$1147$i; break; } $505 = ((($a$1147$i)) + -4|0); HEAP32[$505>>2] = $$lcssa327; $a$2$ph$i = $505; } } while(0); $z$2$i = $z$1146$i; while(1) { $506 = ($z$2$i>>>0)>($a$2$ph$i>>>0); if (!($506)) { $z$2$i$lcssa = $z$2$i; break; } $507 = ((($z$2$i)) + -4|0); $508 = HEAP32[$507>>2]|0; $509 = ($508|0)==(0); if ($509) { $z$2$i = $507; } else { $z$2$i$lcssa = $z$2$i; break; } } $510 = HEAP32[$e2$i>>2]|0; $511 = (($510) - ($492))|0; HEAP32[$e2$i>>2] = $511; $512 = ($511|0)>(0); if ($512) { $490 = $511;$a$1147$i = $a$2$ph$i;$z$1146$i = $z$2$i$lcssa; } else { $$pr47$i = $511;$a$1$lcssa$i = $a$2$ph$i;$z$1$lcssa$i = $z$2$i$lcssa; break; } } } else { $$pr47$i = $$pr$i;$a$1$lcssa$i = $$31$i;$z$1$lcssa$i = $$lcssa326; } $513 = ($$pr47$i|0)<(0); if ($513) { $514 = (($$p$i) + 25)|0; $515 = (($514|0) / 9)&-1; $516 = (($515) + 1)|0; $517 = ($396|0)==(102); $519 = $$pr47$i;$a$3134$i = $a$1$lcssa$i;$z$3133$i = $z$1$lcssa$i; while(1) { $518 = (0 - ($519))|0; $520 = ($518|0)>(9); $521 = $520 ? 9 : $518; $522 = ($a$3134$i>>>0)<($z$3133$i>>>0); do { if ($522) { $526 = 1 << $521; $527 = (($526) + -1)|0; $528 = 1000000000 >>> $521; $carry3$0128$i = 0;$d$1127$i = $a$3134$i; while(1) { $529 = HEAP32[$d$1127$i>>2]|0; $530 = $529 & $527; $531 = $529 >>> $521; $532 = (($531) + ($carry3$0128$i))|0; HEAP32[$d$1127$i>>2] = $532; $533 = Math_imul($530, $528)|0; $534 = ((($d$1127$i)) + 4|0); $535 = ($534>>>0)<($z$3133$i>>>0); if ($535) { $carry3$0128$i = $533;$d$1127$i = $534; } else { $$lcssa329 = $533; break; } } $536 = HEAP32[$a$3134$i>>2]|0; $537 = ($536|0)==(0); $538 = ((($a$3134$i)) + 4|0); $$a$3$i = $537 ? $538 : $a$3134$i; $539 = ($$lcssa329|0)==(0); if ($539) { $$a$3186$i = $$a$3$i;$z$4$i = $z$3133$i; break; } $540 = ((($z$3133$i)) + 4|0); HEAP32[$z$3133$i>>2] = $$lcssa329; $$a$3186$i = $$a$3$i;$z$4$i = $540; } else { $523 = HEAP32[$a$3134$i>>2]|0; $524 = ($523|0)==(0); $525 = ((($a$3134$i)) + 4|0); $$a$3185$i = $524 ? $525 : $a$3134$i; $$a$3186$i = $$a$3185$i;$z$4$i = $z$3133$i; } } while(0); $541 = $517 ? $$31$i : $$a$3186$i; $542 = $z$4$i; $543 = $541; $544 = (($542) - ($543))|0; $545 = $544 >> 2; $546 = ($545|0)>($516|0); $547 = (($541) + ($516<<2)|0); $$z$4$i = $546 ? $547 : $z$4$i; $548 = HEAP32[$e2$i>>2]|0; $549 = (($548) + ($521))|0; HEAP32[$e2$i>>2] = $549; $550 = ($549|0)<(0); if ($550) { $519 = $549;$a$3134$i = $$a$3186$i;$z$3133$i = $$z$4$i; } else { $a$3$lcssa$i = $$a$3186$i;$z$3$lcssa$i = $$z$4$i; break; } } } else { $a$3$lcssa$i = $a$1$lcssa$i;$z$3$lcssa$i = $z$1$lcssa$i; } $551 = ($a$3$lcssa$i>>>0)<($z$3$lcssa$i>>>0); do { if ($551) { $552 = $a$3$lcssa$i; $553 = (($482) - ($552))|0; $554 = $553 >> 2; $555 = ($554*9)|0; $556 = HEAP32[$a$3$lcssa$i>>2]|0; $557 = ($556>>>0)<(10); if ($557) { $e$1$i = $555; break; } else { $e$0123$i = $555;$i$0122$i = 10; } while(1) { $558 = ($i$0122$i*10)|0; $559 = (($e$0123$i) + 1)|0; $560 = ($556>>>0)<($558>>>0); if ($560) { $e$1$i = $559; break; } else { $e$0123$i = $559;$i$0122$i = $558; } } } else { $e$1$i = 0; } } while(0); $561 = ($396|0)!=(102); $562 = $561 ? $e$1$i : 0; $563 = (($$p$i) - ($562))|0; $564 = ($396|0)==(103); $565 = ($$p$i|0)!=(0); $566 = $565 & $564; $$neg52$i = $566 << 31 >> 31; $567 = (($563) + ($$neg52$i))|0; $568 = $z$3$lcssa$i; $569 = (($568) - ($482))|0; $570 = $569 >> 2; $571 = ($570*9)|0; $572 = (($571) + -9)|0; $573 = ($567|0)<($572|0); if ($573) { $574 = (($567) + 9216)|0; $575 = (($574|0) / 9)&-1; $$sum$i = (($575) + -1023)|0; $576 = (($$31$i) + ($$sum$i<<2)|0); $577 = (($574|0) % 9)&-1; $j$0115$i = (($577) + 1)|0; $578 = ($j$0115$i|0)<(9); if ($578) { $i$1116$i = 10;$j$0117$i = $j$0115$i; while(1) { $579 = ($i$1116$i*10)|0; $j$0$i = (($j$0117$i) + 1)|0; $exitcond$i = ($j$0$i|0)==(9); if ($exitcond$i) { $i$1$lcssa$i = $579; break; } else { $i$1116$i = $579;$j$0117$i = $j$0$i; } } } else { $i$1$lcssa$i = 10; } $580 = HEAP32[$576>>2]|0; $581 = (($580>>>0) % ($i$1$lcssa$i>>>0))&-1; $582 = ($581|0)==(0); if ($582) { $$sum15$i = (($575) + -1022)|0; $583 = (($$31$i) + ($$sum15$i<<2)|0); $584 = ($583|0)==($z$3$lcssa$i|0); if ($584) { $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i; } else { label = 163; } } else { label = 163; } do { if ((label|0) == 163) { label = 0; $585 = (($580>>>0) / ($i$1$lcssa$i>>>0))&-1; $586 = $585 & 1; $587 = ($586|0)==(0); $$20$i = $587 ? 9007199254740992.0 : 9007199254740994.0; $588 = (($i$1$lcssa$i|0) / 2)&-1; $589 = ($581>>>0)<($588>>>0); do { if ($589) { $small$0$i = 0.5; } else { $590 = ($581|0)==($588|0); if ($590) { $$sum16$i = (($575) + -1022)|0; $591 = (($$31$i) + ($$sum16$i<<2)|0); $592 = ($591|0)==($z$3$lcssa$i|0); if ($592) { $small$0$i = 1.0; break; } } $small$0$i = 1.5; } } while(0); $593 = ($pl$0$i|0)==(0); do { if ($593) { $round6$1$i = $$20$i;$small$1$i = $small$0$i; } else { $594 = HEAP8[$prefix$0$i>>0]|0; $595 = ($594<<24>>24)==(45); if (!($595)) { $round6$1$i = $$20$i;$small$1$i = $small$0$i; break; } $596 = -$$20$i; $597 = -$small$0$i; $round6$1$i = $596;$small$1$i = $597; } } while(0); $598 = (($580) - ($581))|0; HEAP32[$576>>2] = $598; $599 = $round6$1$i + $small$1$i; $600 = $599 != $round6$1$i; if (!($600)) { $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i; break; } $601 = (($598) + ($i$1$lcssa$i))|0; HEAP32[$576>>2] = $601; $602 = ($601>>>0)>(999999999); if ($602) { $a$5109$i = $a$3$lcssa$i;$d$2108$i = $576; while(1) { $603 = ((($d$2108$i)) + -4|0); HEAP32[$d$2108$i>>2] = 0; $604 = ($603>>>0)<($a$5109$i>>>0); if ($604) { $605 = ((($a$5109$i)) + -4|0); HEAP32[$605>>2] = 0; $a$6$i = $605; } else { $a$6$i = $a$5109$i; } $606 = HEAP32[$603>>2]|0; $607 = (($606) + 1)|0; HEAP32[$603>>2] = $607; $608 = ($607>>>0)>(999999999); if ($608) { $a$5109$i = $a$6$i;$d$2108$i = $603; } else { $a$5$lcssa$i = $a$6$i;$d$2$lcssa$i = $603; break; } } } else { $a$5$lcssa$i = $a$3$lcssa$i;$d$2$lcssa$i = $576; } $609 = $a$5$lcssa$i; $610 = (($482) - ($609))|0; $611 = $610 >> 2; $612 = ($611*9)|0; $613 = HEAP32[$a$5$lcssa$i>>2]|0; $614 = ($613>>>0)<(10); if ($614) { $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $612; break; } else { $e$2104$i = $612;$i$2103$i = 10; } while(1) { $615 = ($i$2103$i*10)|0; $616 = (($e$2104$i) + 1)|0; $617 = ($613>>>0)<($615>>>0); if ($617) { $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $616; break; } else { $e$2104$i = $616;$i$2103$i = $615; } } } } while(0); $618 = ((($d$3$i)) + 4|0); $619 = ($z$3$lcssa$i>>>0)>($618>>>0); $$z$3$i = $619 ? $618 : $z$3$lcssa$i; $a$8$ph$i = $a$7$i;$e$4$ph$i = $e$3$i;$z$6$ph$i = $$z$3$i; } else { $a$8$ph$i = $a$3$lcssa$i;$e$4$ph$i = $e$1$i;$z$6$ph$i = $z$3$lcssa$i; } $620 = (0 - ($e$4$ph$i))|0; $z$6$i = $z$6$ph$i; while(1) { $621 = ($z$6$i>>>0)>($a$8$ph$i>>>0); if (!($621)) { $$lcssa159$i = 0;$z$6$i$lcssa = $z$6$i; break; } $622 = ((($z$6$i)) + -4|0); $623 = HEAP32[$622>>2]|0; $624 = ($623|0)==(0); if ($624) { $z$6$i = $622; } else { $$lcssa159$i = 1;$z$6$i$lcssa = $z$6$i; break; } } do { if ($564) { $625 = $565&1; $626 = $625 ^ 1; $$p$$i = (($626) + ($$p$i))|0; $627 = ($$p$$i|0)>($e$4$ph$i|0); $628 = ($e$4$ph$i|0)>(-5); $or$cond6$i = $627 & $628; if ($or$cond6$i) { $629 = (($t$0) + -1)|0; $$neg53$i = (($$p$$i) + -1)|0; $630 = (($$neg53$i) - ($e$4$ph$i))|0; $$013$i = $629;$$210$i = $630; } else { $631 = (($t$0) + -2)|0; $632 = (($$p$$i) + -1)|0; $$013$i = $631;$$210$i = $632; } $633 = $fl$1$ & 8; $634 = ($633|0)==(0); if (!($634)) { $$114$i = $$013$i;$$311$i = $$210$i;$$pre$phi184$iZ2D = $633; break; } do { if ($$lcssa159$i) { $635 = ((($z$6$i$lcssa)) + -4|0); $636 = HEAP32[$635>>2]|0; $637 = ($636|0)==(0); if ($637) { $j$2$i = 9; break; } $638 = (($636>>>0) % 10)&-1; $639 = ($638|0)==(0); if ($639) { $i$399$i = 10;$j$1100$i = 0; } else { $j$2$i = 0; break; } while(1) { $640 = ($i$399$i*10)|0; $641 = (($j$1100$i) + 1)|0; $642 = (($636>>>0) % ($640>>>0))&-1; $643 = ($642|0)==(0); if ($643) { $i$399$i = $640;$j$1100$i = $641; } else { $j$2$i = $641; break; } } } else { $j$2$i = 9; } } while(0); $644 = $$013$i | 32; $645 = ($644|0)==(102); $646 = $z$6$i$lcssa; $647 = (($646) - ($482))|0; $648 = $647 >> 2; $649 = ($648*9)|0; $650 = (($649) + -9)|0; if ($645) { $651 = (($650) - ($j$2$i))|0; $652 = ($651|0)<(0); $$21$i = $652 ? 0 : $651; $653 = ($$210$i|0)<($$21$i|0); $$210$$22$i = $653 ? $$210$i : $$21$i; $$114$i = $$013$i;$$311$i = $$210$$22$i;$$pre$phi184$iZ2D = 0; break; } else { $654 = (($650) + ($e$4$ph$i))|0; $655 = (($654) - ($j$2$i))|0; $656 = ($655|0)<(0); $$23$i = $656 ? 0 : $655; $657 = ($$210$i|0)<($$23$i|0); $$210$$24$i = $657 ? $$210$i : $$23$i; $$114$i = $$013$i;$$311$i = $$210$$24$i;$$pre$phi184$iZ2D = 0; break; } } else { $$pre183$i = $fl$1$ & 8; $$114$i = $t$0;$$311$i = $$p$i;$$pre$phi184$iZ2D = $$pre183$i; } } while(0); $658 = $$311$i | $$pre$phi184$iZ2D; $659 = ($658|0)!=(0); $660 = $659&1; $661 = $$114$i | 32; $662 = ($661|0)==(102); if ($662) { $663 = ($e$4$ph$i|0)>(0); $664 = $663 ? $e$4$ph$i : 0; $$pn$i = $664;$estr$2$i = 0; } else { $665 = ($e$4$ph$i|0)<(0); $666 = $665 ? $620 : $e$4$ph$i; $667 = ($666|0)<(0); $668 = $667 << 31 >> 31; $669 = (_fmt_u($666,$668,$5)|0); $670 = $669; $671 = (($8) - ($670))|0; $672 = ($671|0)<(2); if ($672) { $estr$193$i = $669; while(1) { $673 = ((($estr$193$i)) + -1|0); HEAP8[$673>>0] = 48; $674 = $673; $675 = (($8) - ($674))|0; $676 = ($675|0)<(2); if ($676) { $estr$193$i = $673; } else { $estr$1$lcssa$i = $673; break; } } } else { $estr$1$lcssa$i = $669; } $677 = $e$4$ph$i >> 31; $678 = $677 & 2; $679 = (($678) + 43)|0; $680 = $679&255; $681 = ((($estr$1$lcssa$i)) + -1|0); HEAP8[$681>>0] = $680; $682 = $$114$i&255; $683 = ((($estr$1$lcssa$i)) + -2|0); HEAP8[$683>>0] = $682; $684 = $683; $685 = (($8) - ($684))|0; $$pn$i = $685;$estr$2$i = $683; } $686 = (($pl$0$i) + 1)|0; $687 = (($686) + ($$311$i))|0; $l$1$i = (($687) + ($660))|0; $688 = (($l$1$i) + ($$pn$i))|0; _pad($f,32,$w$1,$688,$fl$1$); $689 = HEAP32[$f>>2]|0; $690 = $689 & 32; $691 = ($690|0)==(0); if ($691) { (___fwritex($prefix$0$i,$pl$0$i,$f)|0); } $692 = $fl$1$ ^ 65536; _pad($f,48,$w$1,$688,$692); do { if ($662) { $693 = ($a$8$ph$i>>>0)>($$31$i>>>0); $r$0$a$8$i = $693 ? $$31$i : $a$8$ph$i; $d$482$i = $r$0$a$8$i; while(1) { $694 = HEAP32[$d$482$i>>2]|0; $695 = (_fmt_u($694,0,$13)|0); $696 = ($d$482$i|0)==($r$0$a$8$i|0); do { if ($696) { $700 = ($695|0)==($13|0); if (!($700)) { $s7$1$i = $695; break; } HEAP8[$15>>0] = 48; $s7$1$i = $15; } else { $697 = ($695>>>0)>($buf$i>>>0); if ($697) { $s7$079$i = $695; } else { $s7$1$i = $695; break; } while(1) { $698 = ((($s7$079$i)) + -1|0); HEAP8[$698>>0] = 48; $699 = ($698>>>0)>($buf$i>>>0); if ($699) { $s7$079$i = $698; } else { $s7$1$i = $698; break; } } } } while(0); $701 = HEAP32[$f>>2]|0; $702 = $701 & 32; $703 = ($702|0)==(0); if ($703) { $704 = $s7$1$i; $705 = (($14) - ($704))|0; (___fwritex($s7$1$i,$705,$f)|0); } $706 = ((($d$482$i)) + 4|0); $707 = ($706>>>0)>($$31$i>>>0); if ($707) { $$lcssa339 = $706; break; } else { $d$482$i = $706; } } $708 = ($658|0)==(0); do { if (!($708)) { $709 = HEAP32[$f>>2]|0; $710 = $709 & 32; $711 = ($710|0)==(0); if (!($711)) { break; } (___fwritex(30521,1,$f)|0); } } while(0); $712 = ($$lcssa339>>>0)<($z$6$i$lcssa>>>0); $713 = ($$311$i|0)>(0); $714 = $713 & $712; if ($714) { $$41276$i = $$311$i;$d$575$i = $$lcssa339; while(1) { $715 = HEAP32[$d$575$i>>2]|0; $716 = (_fmt_u($715,0,$13)|0); $717 = ($716>>>0)>($buf$i>>>0); if ($717) { $s8$070$i = $716; while(1) { $718 = ((($s8$070$i)) + -1|0); HEAP8[$718>>0] = 48; $719 = ($718>>>0)>($buf$i>>>0); if ($719) { $s8$070$i = $718; } else { $s8$0$lcssa$i = $718; break; } } } else { $s8$0$lcssa$i = $716; } $720 = HEAP32[$f>>2]|0; $721 = $720 & 32; $722 = ($721|0)==(0); if ($722) { $723 = ($$41276$i|0)>(9); $724 = $723 ? 9 : $$41276$i; (___fwritex($s8$0$lcssa$i,$724,$f)|0); } $725 = ((($d$575$i)) + 4|0); $726 = (($$41276$i) + -9)|0; $727 = ($725>>>0)<($z$6$i$lcssa>>>0); $728 = ($$41276$i|0)>(9); $729 = $728 & $727; if ($729) { $$41276$i = $726;$d$575$i = $725; } else { $$412$lcssa$i = $726; break; } } } else { $$412$lcssa$i = $$311$i; } $730 = (($$412$lcssa$i) + 9)|0; _pad($f,48,$730,9,0); } else { $731 = ((($a$8$ph$i)) + 4|0); $z$6$$i = $$lcssa159$i ? $z$6$i$lcssa : $731; $732 = ($$311$i|0)>(-1); if ($732) { $733 = ($$pre$phi184$iZ2D|0)==(0); $$587$i = $$311$i;$d$686$i = $a$8$ph$i; while(1) { $734 = HEAP32[$d$686$i>>2]|0; $735 = (_fmt_u($734,0,$13)|0); $736 = ($735|0)==($13|0); if ($736) { HEAP8[$15>>0] = 48; $s9$0$i = $15; } else { $s9$0$i = $735; } $737 = ($d$686$i|0)==($a$8$ph$i|0); do { if ($737) { $741 = ((($s9$0$i)) + 1|0); $742 = HEAP32[$f>>2]|0; $743 = $742 & 32; $744 = ($743|0)==(0); if ($744) { (___fwritex($s9$0$i,1,$f)|0); } $745 = ($$587$i|0)<(1); $or$cond29$i = $733 & $745; if ($or$cond29$i) { $s9$2$i = $741; break; } $746 = HEAP32[$f>>2]|0; $747 = $746 & 32; $748 = ($747|0)==(0); if (!($748)) { $s9$2$i = $741; break; } (___fwritex(30521,1,$f)|0); $s9$2$i = $741; } else { $738 = ($s9$0$i>>>0)>($buf$i>>>0); if ($738) { $s9$183$i = $s9$0$i; } else { $s9$2$i = $s9$0$i; break; } while(1) { $739 = ((($s9$183$i)) + -1|0); HEAP8[$739>>0] = 48; $740 = ($739>>>0)>($buf$i>>>0); if ($740) { $s9$183$i = $739; } else { $s9$2$i = $739; break; } } } } while(0); $749 = $s9$2$i; $750 = (($14) - ($749))|0; $751 = HEAP32[$f>>2]|0; $752 = $751 & 32; $753 = ($752|0)==(0); if ($753) { $754 = ($$587$i|0)>($750|0); $755 = $754 ? $750 : $$587$i; (___fwritex($s9$2$i,$755,$f)|0); } $756 = (($$587$i) - ($750))|0; $757 = ((($d$686$i)) + 4|0); $758 = ($757>>>0)<($z$6$$i>>>0); $759 = ($756|0)>(-1); $760 = $758 & $759; if ($760) { $$587$i = $756;$d$686$i = $757; } else { $$5$lcssa$i = $756; break; } } } else { $$5$lcssa$i = $$311$i; } $761 = (($$5$lcssa$i) + 18)|0; _pad($f,48,$761,18,0); $762 = HEAP32[$f>>2]|0; $763 = $762 & 32; $764 = ($763|0)==(0); if (!($764)) { break; } $765 = $estr$2$i; $766 = (($8) - ($765))|0; (___fwritex($estr$2$i,$766,$f)|0); } } while(0); $767 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$688,$767); $768 = ($688|0)<($w$1|0); $w$30$i = $768 ? $w$1 : $688; $$0$i = $w$30$i; } else { $376 = $t$0 & 32; $377 = ($376|0)!=(0); $378 = $377 ? 30505 : 30509; $379 = ($$07$i != $$07$i) | (0.0 != 0.0); $380 = $377 ? 30513 : 30517; $pl$1$i = $379 ? 0 : $pl$0$i; $s1$0$i = $379 ? $380 : $378; $381 = (($pl$1$i) + 3)|0; _pad($f,32,$w$1,$381,$175); $382 = HEAP32[$f>>2]|0; $383 = $382 & 32; $384 = ($383|0)==(0); if ($384) { (___fwritex($prefix$0$i,$pl$1$i,$f)|0); $$pre$i = HEAP32[$f>>2]|0; $386 = $$pre$i; } else { $386 = $382; } $385 = $386 & 32; $387 = ($385|0)==(0); if ($387) { (___fwritex($s1$0$i,3,$f)|0); } $388 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$381,$388); $389 = ($381|0)<($w$1|0); $390 = $389 ? $w$1 : $381; $$0$i = $390; } } while(0); $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $$0$i;$l10n$0 = $l10n$3; continue L1; break; } default: { $a$2 = $fmt41;$fl$6 = $fl$1$;$p$5 = $p$0;$pl$2 = 0;$prefix$2 = 30469;$z$2 = $1; } } } while(0); L313: do { if ((label|0) == 64) { label = 0; $206 = $arg; $207 = $206; $208 = HEAP32[$207>>2]|0; $209 = (($206) + 4)|0; $210 = $209; $211 = HEAP32[$210>>2]|0; $212 = $t$1 & 32; $213 = ($208|0)==(0); $214 = ($211|0)==(0); $215 = $213 & $214; if ($215) { $a$0 = $1;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 30469; label = 77; } else { $$012$i = $1;$217 = $208;$224 = $211; while(1) { $216 = $217 & 15; $218 = (30453 + ($216)|0); $219 = HEAP8[$218>>0]|0; $220 = $219&255; $221 = $220 | $212; $222 = $221&255; $223 = ((($$012$i)) + -1|0); HEAP8[$223>>0] = $222; $225 = (_bitshift64Lshr(($217|0),($224|0),4)|0); $226 = tempRet0; $227 = ($225|0)==(0); $228 = ($226|0)==(0); $229 = $227 & $228; if ($229) { $$lcssa344 = $223; break; } else { $$012$i = $223;$217 = $225;$224 = $226; } } $230 = $arg; $231 = $230; $232 = HEAP32[$231>>2]|0; $233 = (($230) + 4)|0; $234 = $233; $235 = HEAP32[$234>>2]|0; $236 = ($232|0)==(0); $237 = ($235|0)==(0); $238 = $236 & $237; $239 = $fl$3 & 8; $240 = ($239|0)==(0); $or$cond17 = $240 | $238; if ($or$cond17) { $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 30469; label = 77; } else { $241 = $t$1 >> 4; $242 = (30469 + ($241)|0); $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 2;$prefix$1 = $242; label = 77; } } } else if ((label|0) == 76) { label = 0; $288 = (_fmt_u($286,$287,$1)|0); $a$0 = $288;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = $pl$0;$prefix$1 = $prefix$0; label = 77; } else if ((label|0) == 82) { label = 0; $320 = (_memchr($a$1,0,$p$0)|0); $321 = ($320|0)==(0|0); $322 = $320; $323 = $a$1; $324 = (($322) - ($323))|0; $325 = (($a$1) + ($p$0)|0); $z$1 = $321 ? $325 : $320; $p$3 = $321 ? $p$0 : $324; $a$2 = $a$1;$fl$6 = $175;$p$5 = $p$3;$pl$2 = 0;$prefix$2 = 30469;$z$2 = $z$1; } else if ((label|0) == 86) { label = 0; $333 = HEAP32[$arg>>2]|0; $i$0114 = 0;$l$1113 = 0;$ws$0115 = $333; while(1) { $334 = HEAP32[$ws$0115>>2]|0; $335 = ($334|0)==(0); if ($335) { $i$0$lcssa = $i$0114;$l$2 = $l$1113; break; } $336 = (_wctomb($mb,$334)|0); $337 = ($336|0)<(0); $338 = (($p$4198) - ($i$0114))|0; $339 = ($336>>>0)>($338>>>0); $or$cond20 = $337 | $339; if ($or$cond20) { $i$0$lcssa = $i$0114;$l$2 = $336; break; } $340 = ((($ws$0115)) + 4|0); $341 = (($336) + ($i$0114))|0; $342 = ($p$4198>>>0)>($341>>>0); if ($342) { $i$0114 = $341;$l$1113 = $336;$ws$0115 = $340; } else { $i$0$lcssa = $341;$l$2 = $336; break; } } $343 = ($l$2|0)<(0); if ($343) { $$0 = -1; break L1; } _pad($f,32,$w$1,$i$0$lcssa,$fl$1$); $344 = ($i$0$lcssa|0)==(0); if ($344) { $i$0$lcssa200 = 0; label = 98; } else { $345 = HEAP32[$arg>>2]|0; $i$1125 = 0;$ws$1126 = $345; while(1) { $346 = HEAP32[$ws$1126>>2]|0; $347 = ($346|0)==(0); if ($347) { $i$0$lcssa200 = $i$0$lcssa; label = 98; break L313; } $348 = ((($ws$1126)) + 4|0); $349 = (_wctomb($mb,$346)|0); $350 = (($349) + ($i$1125))|0; $351 = ($350|0)>($i$0$lcssa|0); if ($351) { $i$0$lcssa200 = $i$0$lcssa; label = 98; break L313; } $352 = HEAP32[$f>>2]|0; $353 = $352 & 32; $354 = ($353|0)==(0); if ($354) { (___fwritex($mb,$349,$f)|0); } $355 = ($350>>>0)<($i$0$lcssa>>>0); if ($355) { $i$1125 = $350;$ws$1126 = $348; } else { $i$0$lcssa200 = $i$0$lcssa; label = 98; break; } } } } } while(0); if ((label|0) == 98) { label = 0; $356 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$i$0$lcssa200,$356); $357 = ($w$1|0)>($i$0$lcssa200|0); $358 = $357 ? $w$1 : $i$0$lcssa200; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $358;$l10n$0 = $l10n$3; continue; } if ((label|0) == 77) { label = 0; $289 = ($p$2|0)>(-1); $290 = $fl$4 & -65537; $$fl$4 = $289 ? $290 : $fl$4; $291 = $arg; $292 = $291; $293 = HEAP32[$292>>2]|0; $294 = (($291) + 4)|0; $295 = $294; $296 = HEAP32[$295>>2]|0; $297 = ($293|0)!=(0); $298 = ($296|0)!=(0); $299 = $297 | $298; $300 = ($p$2|0)!=(0); $or$cond = $300 | $299; if ($or$cond) { $301 = $a$0; $302 = (($2) - ($301))|0; $303 = $299&1; $304 = $303 ^ 1; $305 = (($304) + ($302))|0; $306 = ($p$2|0)>($305|0); $p$2$ = $306 ? $p$2 : $305; $a$2 = $a$0;$fl$6 = $$fl$4;$p$5 = $p$2$;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1; } else { $a$2 = $1;$fl$6 = $$fl$4;$p$5 = 0;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1; } } $769 = $z$2; $770 = $a$2; $771 = (($769) - ($770))|0; $772 = ($p$5|0)<($771|0); $$p$5 = $772 ? $771 : $p$5; $773 = (($pl$2) + ($$p$5))|0; $774 = ($w$1|0)<($773|0); $w$2 = $774 ? $773 : $w$1; _pad($f,32,$w$2,$773,$fl$6); $775 = HEAP32[$f>>2]|0; $776 = $775 & 32; $777 = ($776|0)==(0); if ($777) { (___fwritex($prefix$2,$pl$2,$f)|0); } $778 = $fl$6 ^ 65536; _pad($f,48,$w$2,$773,$778); _pad($f,48,$$p$5,$771,0); $779 = HEAP32[$f>>2]|0; $780 = $779 & 32; $781 = ($780|0)==(0); if ($781) { (___fwritex($a$2,$771,$f)|0); } $782 = $fl$6 ^ 8192; _pad($f,32,$w$2,$773,$782); $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $w$2;$l10n$0 = $l10n$3; } L348: do { if ((label|0) == 245) { $783 = ($f|0)==(0|0); if ($783) { $784 = ($l10n$0$lcssa|0)==(0); if ($784) { $$0 = 0; } else { $i$2100 = 1; while(1) { $785 = (($nl_type) + ($i$2100<<2)|0); $786 = HEAP32[$785>>2]|0; $787 = ($786|0)==(0); if ($787) { $i$2100$lcssa = $i$2100; break; } $789 = (($nl_arg) + ($i$2100<<3)|0); _pop_arg($789,$786,$ap); $790 = (($i$2100) + 1)|0; $791 = ($790|0)<(10); if ($791) { $i$2100 = $790; } else { $$0 = 1; break L348; } } $788 = ($i$2100$lcssa|0)<(10); if ($788) { $i$398 = $i$2100$lcssa; while(1) { $794 = (($nl_type) + ($i$398<<2)|0); $795 = HEAP32[$794>>2]|0; $796 = ($795|0)==(0); $792 = (($i$398) + 1)|0; if (!($796)) { $$0 = -1; break L348; } $793 = ($792|0)<(10); if ($793) { $i$398 = $792; } else { $$0 = 1; break; } } } else { $$0 = 1; } } } else { $$0 = $cnt$1$lcssa; } } } while(0); STACKTOP = sp;return ($$0|0); } function _do_read($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (___string_read($f,$buf,$len)|0); return ($0|0); } function _cleanup521($p) { $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($p)) + 68|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { ___unlockfile($p); } return; } function _cleanup526($p) { $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($p)) + 68|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { ___unlockfile($p); } return; } function _sift($head,$width,$cmp,$pshift,$lp) { $head = $head|0; $width = $width|0; $cmp = $cmp|0; $pshift = $pshift|0; $lp = $lp|0; var $$0$be = 0, $$01$be = 0, $$012 = 0, $$03 = 0, $$pre = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ar = 0, $i$0$lcssa = 0, $i$04 = 0, $sum = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 240|0; $ar = sp; HEAP32[$ar>>2] = $head; $0 = ($pshift|0)>(1); L1: do { if ($0) { $1 = (0 - ($width))|0; $$012 = $pshift;$$03 = $head;$7 = $head;$i$04 = 1; while(1) { $2 = (($$03) + ($1)|0); $3 = (($$012) + -2)|0; $4 = (($lp) + ($3<<2)|0); $5 = HEAP32[$4>>2]|0; $sum = (($5) + ($width))|0; $$sum = (0 - ($sum))|0; $6 = (($$03) + ($$sum)|0); $8 = (FUNCTION_TABLE_iii[$cmp & 7]($7,$6)|0); $9 = ($8|0)>(-1); if ($9) { $10 = (FUNCTION_TABLE_iii[$cmp & 7]($7,$2)|0); $11 = ($10|0)>(-1); if ($11) { $i$0$lcssa = $i$04; break L1; } } $12 = (FUNCTION_TABLE_iii[$cmp & 7]($6,$2)|0); $13 = ($12|0)>(-1); $14 = (($i$04) + 1)|0; $15 = (($ar) + ($i$04<<2)|0); if ($13) { HEAP32[$15>>2] = $6; $16 = (($$012) + -1)|0; $$0$be = $6;$$01$be = $16; } else { HEAP32[$15>>2] = $2; $$0$be = $2;$$01$be = $3; } $17 = ($$01$be|0)>(1); if (!($17)) { $i$0$lcssa = $14; break L1; } $$pre = HEAP32[$ar>>2]|0; $$012 = $$01$be;$$03 = $$0$be;$7 = $$pre;$i$04 = $14; } } else { $i$0$lcssa = 1; } } while(0); _cycle($width,$ar,$i$0$lcssa); STACKTOP = sp;return; } function _trinkle($head,$width,$cmp,$pp,$pshift,$trusty,$lp) { $head = $head|0; $width = $width|0; $cmp = $cmp|0; $pp = $pp|0; $pshift = $pshift|0; $trusty = $trusty|0; $lp = $lp|0; var $$0$i = 0, $$0$lcssa = 0, $$0$lcssa49 = 0, $$01162 = 0, $$01162$phi = 0, $$02$i$i = 0, $$02$i3$i = 0, $$02$lcssa = 0, $$02$lcssa51 = 0, $$02964 = 0, $$03$lcssa = 0, $$03865 = 0, $$lcssa = 0, $$lcssa75 = 0, $$pre = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0; var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $7 = 0, $8 = 0, $9 = 0, $ar = 0, $i$0$lcssa = 0, $i$0$lcssa50 = 0, $i$01063 = 0, $nTrailingZeros$03$i$i = 0, $nTrailingZeros$03$i2$i = 0, $nTrailingZeros$03$i2$i$lcssa = 0, $or$cond = 0, $phitmp = 0, $sum = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 240|0; $ar = sp; $0 = HEAP32[$pp>>2]|0; $1 = ((($pp)) + 4|0); $2 = HEAP32[$1>>2]|0; HEAP32[$ar>>2] = $head; $3 = (0 - ($width))|0; $4 = ($0|0)!=(1); $5 = ($2|0)!=(0); $6 = $5 | $4; L1: do { if ($6) { $7 = (($lp) + ($pshift<<2)|0); $8 = HEAP32[$7>>2]|0; $9 = (0 - ($8))|0; $10 = (($head) + ($9)|0); $11 = (FUNCTION_TABLE_iii[$cmp & 7]($10,$head)|0); $12 = ($11|0)<(1); if ($12) { $$0$lcssa = $head;$$02$lcssa = $pshift;$$03$lcssa = $trusty;$i$0$lcssa = 1; label = 19; } else { $phitmp = ($trusty|0)==(0); $$01162 = $head;$$02964 = $pshift;$$03865 = $phitmp;$18 = $10;$27 = $0;$36 = $2;$i$01063 = 1; while(1) { $13 = ($$02964|0)>(1); $or$cond = $$03865 & $13; if ($or$cond) { $14 = (($$01162) + ($3)|0); $15 = (($$02964) + -2)|0; $16 = (($lp) + ($15<<2)|0); $17 = HEAP32[$16>>2]|0; $19 = (FUNCTION_TABLE_iii[$cmp & 7]($14,$18)|0); $20 = ($19|0)>(-1); if ($20) { $$0$lcssa49 = $$01162;$$02$lcssa51 = $$02964;$i$0$lcssa50 = $i$01063; label = 20; break L1; } $sum = (($17) + ($width))|0; $$sum = (0 - ($sum))|0; $21 = (($$01162) + ($$sum)|0); $22 = (FUNCTION_TABLE_iii[$cmp & 7]($21,$18)|0); $23 = ($22|0)>(-1); if ($23) { $$0$lcssa49 = $$01162;$$02$lcssa51 = $$02964;$i$0$lcssa50 = $i$01063; label = 20; break L1; } } $24 = (($i$01063) + 1)|0; $25 = (($ar) + ($i$01063<<2)|0); HEAP32[$25>>2] = $18; $26 = (($27) + -1)|0; $28 = ($26|0)==(0); do { if ($28) { $49 = 32; label = 16; } else { $29 = $26 & 1; $30 = ($29|0)==(0); if ($30) { $$02$i$i = $26;$nTrailingZeros$03$i$i = 0; while(1) { $31 = (($nTrailingZeros$03$i$i) + 1)|0; $32 = $$02$i$i >>> 1; $33 = $32 & 1; $34 = ($33|0)==(0); if ($34) { $$02$i$i = $32;$nTrailingZeros$03$i$i = $31; } else { $$lcssa = $31; break; } } $35 = ($$lcssa|0)==(0); if ($35) { label = 11; } else { $46 = $$lcssa; } } else { label = 11; } if ((label|0) == 11) { label = 0; $37 = ($36|0)==(0); if ($37) { $49 = 64; label = 16; break; } $38 = $36 & 1; $39 = ($38|0)==(0); if ($39) { $$02$i3$i = $36;$nTrailingZeros$03$i2$i = 0; } else { $$0$i = 0;$51 = $27;$54 = $36;$58 = 0; break; } while(1) { $40 = (($nTrailingZeros$03$i2$i) + 1)|0; $41 = $$02$i3$i >>> 1; $42 = $41 & 1; $43 = ($42|0)==(0); if ($43) { $$02$i3$i = $41;$nTrailingZeros$03$i2$i = $40; } else { $$lcssa75 = $40;$nTrailingZeros$03$i2$i$lcssa = $nTrailingZeros$03$i2$i; break; } } $44 = (($nTrailingZeros$03$i2$i$lcssa) + 33)|0; $45 = ($$lcssa75|0)==(0); if ($45) { $$0$i = 0;$51 = $27;$54 = $36;$58 = 0; break; } else { $46 = $44; } } $47 = ($46>>>0)>(31); if ($47) { $49 = $46; label = 16; } else { $$0$i = $46;$51 = $27;$54 = $36;$58 = $46; } } } while(0); if ((label|0) == 16) { label = 0; $48 = (($49) + -32)|0; $$0$i = $48;$51 = $36;$54 = 0;$58 = $49; } $50 = $51 >>> $$0$i; $52 = (32 - ($$0$i))|0; $53 = $54 << $52; $55 = $53 | $50; $56 = $54 >>> $$0$i; $57 = (($58) + ($$02964))|0; $59 = ($55|0)!=(1); $60 = ($56|0)!=(0); $61 = $60 | $59; if (!($61)) { $$0$lcssa49 = $18;$$02$lcssa51 = $57;$i$0$lcssa50 = $24; label = 20; break L1; } $$pre = HEAP32[$ar>>2]|0; $62 = (($lp) + ($57<<2)|0); $63 = HEAP32[$62>>2]|0; $64 = (0 - ($63))|0; $65 = (($18) + ($64)|0); $66 = (FUNCTION_TABLE_iii[$cmp & 7]($65,$$pre)|0); $67 = ($66|0)<(1); if ($67) { $$0$lcssa = $18;$$02$lcssa = $57;$$03$lcssa = 0;$i$0$lcssa = $24; label = 19; break; } else { $$01162$phi = $18;$$02964 = $57;$$03865 = 1;$18 = $65;$27 = $55;$36 = $56;$i$01063 = $24;$$01162 = $$01162$phi; } } } } else { $$0$lcssa = $head;$$02$lcssa = $pshift;$$03$lcssa = $trusty;$i$0$lcssa = 1; label = 19; } } while(0); if ((label|0) == 19) { $68 = ($$03$lcssa|0)==(0); if ($68) { $$0$lcssa49 = $$0$lcssa;$$02$lcssa51 = $$02$lcssa;$i$0$lcssa50 = $i$0$lcssa; label = 20; } } if ((label|0) == 20) { _cycle($width,$ar,$i$0$lcssa50); _sift($$0$lcssa49,$width,$cmp,$$02$lcssa51,$lp); } STACKTOP = sp;return; } function _cycle($width,$ar,$n) { $width = $width|0; $ar = $ar|0; $n = $n|0; var $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0; var $tmp = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $tmp = sp; $0 = ($n|0)<(2); L1: do { if (!($0)) { $1 = (($ar) + ($n<<2)|0); HEAP32[$1>>2] = $tmp; $2 = ($width|0)==(0); if (!($2)) { $$02 = $width;$6 = $tmp; while(1) { $3 = ($$02>>>0)>(256); $4 = $3 ? 256 : $$02; $5 = HEAP32[$ar>>2]|0; _memcpy(($6|0),($5|0),($4|0))|0; $i$01 = 0; while(1) { $7 = (($ar) + ($i$01<<2)|0); $8 = HEAP32[$7>>2]|0; $9 = (($i$01) + 1)|0; $10 = (($ar) + ($9<<2)|0); $11 = HEAP32[$10>>2]|0; _memcpy(($8|0),($11|0),($4|0))|0; $12 = HEAP32[$7>>2]|0; $13 = (($12) + ($4)|0); HEAP32[$7>>2] = $13; $exitcond = ($9|0)==($n|0); if ($exitcond) { break; } else { $i$01 = $9; } } $14 = ($$02|0)==($4|0); if ($14) { break L1; } $15 = (($$02) - ($4))|0; $$pre = HEAP32[$1>>2]|0; $$02 = $15;$6 = $$pre; } } } } while(0); STACKTOP = sp;return; } function _pop_arg($arg,$type,$ap) { $arg = $arg|0; $type = $type|0; $ap = $ap|0; var $$mask = 0, $$mask1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0; var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0; var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0; var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0; var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0; var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($type>>>0)>(20); L1: do { if (!($0)) { do { switch ($type|0) { case 9: { $arglist_current = HEAP32[$ap>>2]|0; $1 = $arglist_current; $2 = ((0) + 4|0); $expanded28 = $2; $expanded = (($expanded28) - 1)|0; $3 = (($1) + ($expanded))|0; $4 = ((0) + 4|0); $expanded32 = $4; $expanded31 = (($expanded32) - 1)|0; $expanded30 = $expanded31 ^ -1; $5 = $3 & $expanded30; $6 = $5; $7 = HEAP32[$6>>2]|0; $arglist_next = ((($6)) + 4|0); HEAP32[$ap>>2] = $arglist_next; HEAP32[$arg>>2] = $7; break L1; break; } case 10: { $arglist_current2 = HEAP32[$ap>>2]|0; $8 = $arglist_current2; $9 = ((0) + 4|0); $expanded35 = $9; $expanded34 = (($expanded35) - 1)|0; $10 = (($8) + ($expanded34))|0; $11 = ((0) + 4|0); $expanded39 = $11; $expanded38 = (($expanded39) - 1)|0; $expanded37 = $expanded38 ^ -1; $12 = $10 & $expanded37; $13 = $12; $14 = HEAP32[$13>>2]|0; $arglist_next3 = ((($13)) + 4|0); HEAP32[$ap>>2] = $arglist_next3; $15 = ($14|0)<(0); $16 = $15 << 31 >> 31; $17 = $arg; $18 = $17; HEAP32[$18>>2] = $14; $19 = (($17) + 4)|0; $20 = $19; HEAP32[$20>>2] = $16; break L1; break; } case 11: { $arglist_current5 = HEAP32[$ap>>2]|0; $21 = $arglist_current5; $22 = ((0) + 4|0); $expanded42 = $22; $expanded41 = (($expanded42) - 1)|0; $23 = (($21) + ($expanded41))|0; $24 = ((0) + 4|0); $expanded46 = $24; $expanded45 = (($expanded46) - 1)|0; $expanded44 = $expanded45 ^ -1; $25 = $23 & $expanded44; $26 = $25; $27 = HEAP32[$26>>2]|0; $arglist_next6 = ((($26)) + 4|0); HEAP32[$ap>>2] = $arglist_next6; $28 = $arg; $29 = $28; HEAP32[$29>>2] = $27; $30 = (($28) + 4)|0; $31 = $30; HEAP32[$31>>2] = 0; break L1; break; } case 12: { $arglist_current8 = HEAP32[$ap>>2]|0; $32 = $arglist_current8; $33 = ((0) + 8|0); $expanded49 = $33; $expanded48 = (($expanded49) - 1)|0; $34 = (($32) + ($expanded48))|0; $35 = ((0) + 8|0); $expanded53 = $35; $expanded52 = (($expanded53) - 1)|0; $expanded51 = $expanded52 ^ -1; $36 = $34 & $expanded51; $37 = $36; $38 = $37; $39 = $38; $40 = HEAP32[$39>>2]|0; $41 = (($38) + 4)|0; $42 = $41; $43 = HEAP32[$42>>2]|0; $arglist_next9 = ((($37)) + 8|0); HEAP32[$ap>>2] = $arglist_next9; $44 = $arg; $45 = $44; HEAP32[$45>>2] = $40; $46 = (($44) + 4)|0; $47 = $46; HEAP32[$47>>2] = $43; break L1; break; } case 13: { $arglist_current11 = HEAP32[$ap>>2]|0; $48 = $arglist_current11; $49 = ((0) + 4|0); $expanded56 = $49; $expanded55 = (($expanded56) - 1)|0; $50 = (($48) + ($expanded55))|0; $51 = ((0) + 4|0); $expanded60 = $51; $expanded59 = (($expanded60) - 1)|0; $expanded58 = $expanded59 ^ -1; $52 = $50 & $expanded58; $53 = $52; $54 = HEAP32[$53>>2]|0; $arglist_next12 = ((($53)) + 4|0); HEAP32[$ap>>2] = $arglist_next12; $55 = $54&65535; $56 = $55 << 16 >> 16; $57 = ($56|0)<(0); $58 = $57 << 31 >> 31; $59 = $arg; $60 = $59; HEAP32[$60>>2] = $56; $61 = (($59) + 4)|0; $62 = $61; HEAP32[$62>>2] = $58; break L1; break; } case 14: { $arglist_current14 = HEAP32[$ap>>2]|0; $63 = $arglist_current14; $64 = ((0) + 4|0); $expanded63 = $64; $expanded62 = (($expanded63) - 1)|0; $65 = (($63) + ($expanded62))|0; $66 = ((0) + 4|0); $expanded67 = $66; $expanded66 = (($expanded67) - 1)|0; $expanded65 = $expanded66 ^ -1; $67 = $65 & $expanded65; $68 = $67; $69 = HEAP32[$68>>2]|0; $arglist_next15 = ((($68)) + 4|0); HEAP32[$ap>>2] = $arglist_next15; $$mask1 = $69 & 65535; $70 = $arg; $71 = $70; HEAP32[$71>>2] = $$mask1; $72 = (($70) + 4)|0; $73 = $72; HEAP32[$73>>2] = 0; break L1; break; } case 15: { $arglist_current17 = HEAP32[$ap>>2]|0; $74 = $arglist_current17; $75 = ((0) + 4|0); $expanded70 = $75; $expanded69 = (($expanded70) - 1)|0; $76 = (($74) + ($expanded69))|0; $77 = ((0) + 4|0); $expanded74 = $77; $expanded73 = (($expanded74) - 1)|0; $expanded72 = $expanded73 ^ -1; $78 = $76 & $expanded72; $79 = $78; $80 = HEAP32[$79>>2]|0; $arglist_next18 = ((($79)) + 4|0); HEAP32[$ap>>2] = $arglist_next18; $81 = $80&255; $82 = $81 << 24 >> 24; $83 = ($82|0)<(0); $84 = $83 << 31 >> 31; $85 = $arg; $86 = $85; HEAP32[$86>>2] = $82; $87 = (($85) + 4)|0; $88 = $87; HEAP32[$88>>2] = $84; break L1; break; } case 16: { $arglist_current20 = HEAP32[$ap>>2]|0; $89 = $arglist_current20; $90 = ((0) + 4|0); $expanded77 = $90; $expanded76 = (($expanded77) - 1)|0; $91 = (($89) + ($expanded76))|0; $92 = ((0) + 4|0); $expanded81 = $92; $expanded80 = (($expanded81) - 1)|0; $expanded79 = $expanded80 ^ -1; $93 = $91 & $expanded79; $94 = $93; $95 = HEAP32[$94>>2]|0; $arglist_next21 = ((($94)) + 4|0); HEAP32[$ap>>2] = $arglist_next21; $$mask = $95 & 255; $96 = $arg; $97 = $96; HEAP32[$97>>2] = $$mask; $98 = (($96) + 4)|0; $99 = $98; HEAP32[$99>>2] = 0; break L1; break; } case 17: { $arglist_current23 = HEAP32[$ap>>2]|0; $100 = $arglist_current23; $101 = ((0) + 8|0); $expanded84 = $101; $expanded83 = (($expanded84) - 1)|0; $102 = (($100) + ($expanded83))|0; $103 = ((0) + 8|0); $expanded88 = $103; $expanded87 = (($expanded88) - 1)|0; $expanded86 = $expanded87 ^ -1; $104 = $102 & $expanded86; $105 = $104; $106 = +HEAPF64[$105>>3]; $arglist_next24 = ((($105)) + 8|0); HEAP32[$ap>>2] = $arglist_next24; HEAPF64[$arg>>3] = $106; break L1; break; } case 18: { $arglist_current26 = HEAP32[$ap>>2]|0; $107 = $arglist_current26; $108 = ((0) + 8|0); $expanded91 = $108; $expanded90 = (($expanded91) - 1)|0; $109 = (($107) + ($expanded90))|0; $110 = ((0) + 8|0); $expanded95 = $110; $expanded94 = (($expanded95) - 1)|0; $expanded93 = $expanded94 ^ -1; $111 = $109 & $expanded93; $112 = $111; $113 = +HEAPF64[$112>>3]; $arglist_next27 = ((($112)) + 8|0); HEAP32[$ap>>2] = $arglist_next27; HEAPF64[$arg>>3] = $113; break L1; break; } default: { break L1; } } } while(0); } } while(0); return; } function _fmt_u($0,$1,$s) { $0 = $0|0; $1 = $1|0; $s = $s|0; var $$0$lcssa = 0, $$01$lcssa$off0 = 0, $$05 = 0, $$1$lcssa = 0, $$12 = 0, $$lcssa20 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $y$03 = 0, label = 0, sp = 0; sp = STACKTOP; $2 = ($1>>>0)>(0); $3 = ($0>>>0)>(4294967295); $4 = ($1|0)==(0); $5 = $4 & $3; $6 = $2 | $5; if ($6) { $$05 = $s;$7 = $0;$8 = $1; while(1) { $9 = (___uremdi3(($7|0),($8|0),10,0)|0); $10 = tempRet0; $11 = $9 | 48; $12 = $11&255; $13 = ((($$05)) + -1|0); HEAP8[$13>>0] = $12; $14 = (___udivdi3(($7|0),($8|0),10,0)|0); $15 = tempRet0; $16 = ($8>>>0)>(9); $17 = ($7>>>0)>(4294967295); $18 = ($8|0)==(9); $19 = $18 & $17; $20 = $16 | $19; if ($20) { $$05 = $13;$7 = $14;$8 = $15; } else { $$lcssa20 = $13;$28 = $14;$29 = $15; break; } } $$0$lcssa = $$lcssa20;$$01$lcssa$off0 = $28; } else { $$0$lcssa = $s;$$01$lcssa$off0 = $0; } $21 = ($$01$lcssa$off0|0)==(0); if ($21) { $$1$lcssa = $$0$lcssa; } else { $$12 = $$0$lcssa;$y$03 = $$01$lcssa$off0; while(1) { $22 = (($y$03>>>0) % 10)&-1; $23 = $22 | 48; $24 = $23&255; $25 = ((($$12)) + -1|0); HEAP8[$25>>0] = $24; $26 = (($y$03>>>0) / 10)&-1; $27 = ($y$03>>>0)<(10); if ($27) { $$1$lcssa = $25; break; } else { $$12 = $25;$y$03 = $26; } } } return ($$1$lcssa|0); } function _pad($f,$c,$w,$l,$fl) { $f = $f|0; $c = $c|0; $w = $w|0; $l = $l|0; $fl = $fl|0; var $$0$lcssa6 = 0, $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $or$cond = 0, $pad = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; $pad = sp; $0 = $fl & 73728; $1 = ($0|0)==(0); $2 = ($w|0)>($l|0); $or$cond = $2 & $1; do { if ($or$cond) { $3 = (($w) - ($l))|0; $4 = ($3>>>0)>(256); $5 = $4 ? 256 : $3; _memset(($pad|0),($c|0),($5|0))|0; $6 = ($3>>>0)>(255); $7 = HEAP32[$f>>2]|0; $8 = $7 & 32; $9 = ($8|0)==(0); if ($6) { $10 = (($w) - ($l))|0; $$02 = $3;$17 = $7;$18 = $9; while(1) { if ($18) { (___fwritex($pad,256,$f)|0); $$pre = HEAP32[$f>>2]|0; $14 = $$pre; } else { $14 = $17; } $11 = (($$02) + -256)|0; $12 = ($11>>>0)>(255); $13 = $14 & 32; $15 = ($13|0)==(0); if ($12) { $$02 = $11;$17 = $14;$18 = $15; } else { break; } } $16 = $10 & 255; if ($15) { $$0$lcssa6 = $16; } else { break; } } else { if ($9) { $$0$lcssa6 = $3; } else { break; } } (___fwritex($pad,$$0$lcssa6,$f)|0); } } while(0); STACKTOP = sp;return; } function _malloc($bytes) { $bytes = $bytes|0; var $$3$i = 0, $$lcssa = 0, $$lcssa211 = 0, $$lcssa215 = 0, $$lcssa216 = 0, $$lcssa217 = 0, $$lcssa219 = 0, $$lcssa222 = 0, $$lcssa224 = 0, $$lcssa226 = 0, $$lcssa228 = 0, $$lcssa230 = 0, $$lcssa232 = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i22$i = 0, $$pre$i25 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i23$iZ2D = 0; var $$pre$phi$i26Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi58$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre105 = 0, $$pre106 = 0, $$pre14$i$i = 0, $$pre43$i = 0, $$pre56$i$i = 0, $$pre57$i$i = 0, $$pre8$i = 0, $$rsize$0$i = 0, $$rsize$3$i = 0, $$sum = 0, $$sum$i$i = 0, $$sum$i$i$i = 0, $$sum$i13$i = 0, $$sum$i14$i = 0, $$sum$i17$i = 0, $$sum$i19$i = 0; var $$sum$i2334 = 0, $$sum$i32 = 0, $$sum$i35 = 0, $$sum1 = 0, $$sum1$i = 0, $$sum1$i$i = 0, $$sum1$i15$i = 0, $$sum1$i20$i = 0, $$sum1$i24 = 0, $$sum10 = 0, $$sum10$i = 0, $$sum10$i$i = 0, $$sum11$i = 0, $$sum11$i$i = 0, $$sum1112 = 0, $$sum112$i = 0, $$sum113$i = 0, $$sum114$i = 0, $$sum115$i = 0, $$sum116$i = 0; var $$sum117$i = 0, $$sum118$i = 0, $$sum119$i = 0, $$sum12$i = 0, $$sum12$i$i = 0, $$sum120$i = 0, $$sum121$i = 0, $$sum122$i = 0, $$sum123$i = 0, $$sum124$i = 0, $$sum125$i = 0, $$sum13$i = 0, $$sum13$i$i = 0, $$sum14$i$i = 0, $$sum15$i = 0, $$sum15$i$i = 0, $$sum16$i = 0, $$sum16$i$i = 0, $$sum17$i = 0, $$sum17$i$i = 0; var $$sum18$i = 0, $$sum1819$i$i = 0, $$sum2 = 0, $$sum2$i = 0, $$sum2$i$i = 0, $$sum2$i$i$i = 0, $$sum2$i16$i = 0, $$sum2$i18$i = 0, $$sum2$i21$i = 0, $$sum20$i$i = 0, $$sum21$i$i = 0, $$sum22$i$i = 0, $$sum23$i$i = 0, $$sum24$i$i = 0, $$sum25$i$i = 0, $$sum27$i$i = 0, $$sum28$i$i = 0, $$sum29$i$i = 0, $$sum3$i = 0, $$sum3$i27 = 0; var $$sum30$i$i = 0, $$sum3132$i$i = 0, $$sum34$i$i = 0, $$sum3536$i$i = 0, $$sum3738$i$i = 0, $$sum39$i$i = 0, $$sum4 = 0, $$sum4$i = 0, $$sum4$i$i = 0, $$sum4$i28 = 0, $$sum40$i$i = 0, $$sum41$i$i = 0, $$sum42$i$i = 0, $$sum5$i = 0, $$sum5$i$i = 0, $$sum56 = 0, $$sum6$i = 0, $$sum67$i$i = 0, $$sum7$i = 0, $$sum8$i = 0; var $$sum9 = 0, $$sum9$i = 0, $$sum9$i$i = 0, $$tsize$1$i = 0, $$v$0$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0; var $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0; var $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0; var $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0; var $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0; var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0; var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0; var $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0; var $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0; var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0; var $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0; var $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0; var $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0; var $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0; var $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0; var $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0; var $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0; var $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0; var $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0; var $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0; var $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0; var $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0; var $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0; var $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0; var $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0; var $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0; var $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0; var $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0; var $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0; var $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0; var $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0; var $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0; var $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0; var $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0; var $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0; var $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0; var $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0; var $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0; var $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0; var $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0; var $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0; var $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0; var $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0; var $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0; var $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0; var $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0; var $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0; var $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0; var $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0; var $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0; var $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0; var $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0; var $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0; var $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $F$0$i$i = 0, $F1$0$i = 0, $F4$0 = 0, $F4$0$i$i = 0; var $F5$0$i = 0, $I1$0$i$i = 0, $I7$0$i = 0, $I7$0$i$i = 0, $K12$029$i = 0, $K2$07$i$i = 0, $K8$051$i$i = 0, $R$0$i = 0, $R$0$i$i = 0, $R$0$i$i$lcssa = 0, $R$0$i$lcssa = 0, $R$0$i18 = 0, $R$0$i18$lcssa = 0, $R$1$i = 0, $R$1$i$i = 0, $R$1$i20 = 0, $RP$0$i = 0, $RP$0$i$i = 0, $RP$0$i$i$lcssa = 0, $RP$0$i$lcssa = 0; var $RP$0$i17 = 0, $RP$0$i17$lcssa = 0, $T$0$lcssa$i = 0, $T$0$lcssa$i$i = 0, $T$0$lcssa$i25$i = 0, $T$028$i = 0, $T$028$i$lcssa = 0, $T$050$i$i = 0, $T$050$i$i$lcssa = 0, $T$06$i$i = 0, $T$06$i$i$lcssa = 0, $br$0$ph$i = 0, $cond$i = 0, $cond$i$i = 0, $cond$i21 = 0, $exitcond$i$i = 0, $i$02$i$i = 0, $idx$0$i = 0, $mem$0 = 0, $nb$0 = 0; var $not$$i = 0, $not$$i$i = 0, $not$$i26$i = 0, $oldfirst$0$i$i = 0, $or$cond$i = 0, $or$cond$i30 = 0, $or$cond1$i = 0, $or$cond19$i = 0, $or$cond2$i = 0, $or$cond3$i = 0, $or$cond5$i = 0, $or$cond57$i = 0, $or$cond6$i = 0, $or$cond8$i = 0, $or$cond9$i = 0, $qsize$0$i$i = 0, $rsize$0$i = 0, $rsize$0$i$lcssa = 0, $rsize$0$i15 = 0, $rsize$1$i = 0; var $rsize$2$i = 0, $rsize$3$lcssa$i = 0, $rsize$331$i = 0, $rst$0$i = 0, $rst$1$i = 0, $sizebits$0$i = 0, $sp$0$i$i = 0, $sp$0$i$i$i = 0, $sp$084$i = 0, $sp$084$i$lcssa = 0, $sp$183$i = 0, $sp$183$i$lcssa = 0, $ssize$0$$i = 0, $ssize$0$i = 0, $ssize$1$ph$i = 0, $ssize$2$i = 0, $t$0$i = 0, $t$0$i14 = 0, $t$1$i = 0, $t$2$ph$i = 0; var $t$2$v$3$i = 0, $t$230$i = 0, $tbase$255$i = 0, $tsize$0$ph$i = 0, $tsize$0323944$i = 0, $tsize$1$i = 0, $tsize$254$i = 0, $v$0$i = 0, $v$0$i$lcssa = 0, $v$0$i16 = 0, $v$1$i = 0, $v$2$i = 0, $v$3$lcssa$i = 0, $v$3$ph$i = 0, $v$332$i = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($bytes>>>0)<(245); do { if ($0) { $1 = ($bytes>>>0)<(11); $2 = (($bytes) + 11)|0; $3 = $2 & -8; $4 = $1 ? 16 : $3; $5 = $4 >>> 3; $6 = HEAP32[9064>>2]|0; $7 = $6 >>> $5; $8 = $7 & 3; $9 = ($8|0)==(0); if (!($9)) { $10 = $7 & 1; $11 = $10 ^ 1; $12 = (($11) + ($5))|0; $13 = $12 << 1; $14 = (9104 + ($13<<2)|0); $$sum10 = (($13) + 2)|0; $15 = (9104 + ($$sum10<<2)|0); $16 = HEAP32[$15>>2]|0; $17 = ((($16)) + 8|0); $18 = HEAP32[$17>>2]|0; $19 = ($14|0)==($18|0); do { if ($19) { $20 = 1 << $12; $21 = $20 ^ -1; $22 = $6 & $21; HEAP32[9064>>2] = $22; } else { $23 = HEAP32[(9080)>>2]|0; $24 = ($18>>>0)<($23>>>0); if ($24) { _abort(); // unreachable; } $25 = ((($18)) + 12|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)==($16|0); if ($27) { HEAP32[$25>>2] = $14; HEAP32[$15>>2] = $18; break; } else { _abort(); // unreachable; } } } while(0); $28 = $12 << 3; $29 = $28 | 3; $30 = ((($16)) + 4|0); HEAP32[$30>>2] = $29; $$sum1112 = $28 | 4; $31 = (($16) + ($$sum1112)|0); $32 = HEAP32[$31>>2]|0; $33 = $32 | 1; HEAP32[$31>>2] = $33; $mem$0 = $17; return ($mem$0|0); } $34 = HEAP32[(9072)>>2]|0; $35 = ($4>>>0)>($34>>>0); if ($35) { $36 = ($7|0)==(0); if (!($36)) { $37 = $7 << $5; $38 = 2 << $5; $39 = (0 - ($38))|0; $40 = $38 | $39; $41 = $37 & $40; $42 = (0 - ($41))|0; $43 = $41 & $42; $44 = (($43) + -1)|0; $45 = $44 >>> 12; $46 = $45 & 16; $47 = $44 >>> $46; $48 = $47 >>> 5; $49 = $48 & 8; $50 = $49 | $46; $51 = $47 >>> $49; $52 = $51 >>> 2; $53 = $52 & 4; $54 = $50 | $53; $55 = $51 >>> $53; $56 = $55 >>> 1; $57 = $56 & 2; $58 = $54 | $57; $59 = $55 >>> $57; $60 = $59 >>> 1; $61 = $60 & 1; $62 = $58 | $61; $63 = $59 >>> $61; $64 = (($62) + ($63))|0; $65 = $64 << 1; $66 = (9104 + ($65<<2)|0); $$sum4 = (($65) + 2)|0; $67 = (9104 + ($$sum4<<2)|0); $68 = HEAP32[$67>>2]|0; $69 = ((($68)) + 8|0); $70 = HEAP32[$69>>2]|0; $71 = ($66|0)==($70|0); do { if ($71) { $72 = 1 << $64; $73 = $72 ^ -1; $74 = $6 & $73; HEAP32[9064>>2] = $74; $88 = $34; } else { $75 = HEAP32[(9080)>>2]|0; $76 = ($70>>>0)<($75>>>0); if ($76) { _abort(); // unreachable; } $77 = ((($70)) + 12|0); $78 = HEAP32[$77>>2]|0; $79 = ($78|0)==($68|0); if ($79) { HEAP32[$77>>2] = $66; HEAP32[$67>>2] = $70; $$pre = HEAP32[(9072)>>2]|0; $88 = $$pre; break; } else { _abort(); // unreachable; } } } while(0); $80 = $64 << 3; $81 = (($80) - ($4))|0; $82 = $4 | 3; $83 = ((($68)) + 4|0); HEAP32[$83>>2] = $82; $84 = (($68) + ($4)|0); $85 = $81 | 1; $$sum56 = $4 | 4; $86 = (($68) + ($$sum56)|0); HEAP32[$86>>2] = $85; $87 = (($68) + ($80)|0); HEAP32[$87>>2] = $81; $89 = ($88|0)==(0); if (!($89)) { $90 = HEAP32[(9084)>>2]|0; $91 = $88 >>> 3; $92 = $91 << 1; $93 = (9104 + ($92<<2)|0); $94 = HEAP32[9064>>2]|0; $95 = 1 << $91; $96 = $94 & $95; $97 = ($96|0)==(0); if ($97) { $98 = $94 | $95; HEAP32[9064>>2] = $98; $$pre105 = (($92) + 2)|0; $$pre106 = (9104 + ($$pre105<<2)|0); $$pre$phiZ2D = $$pre106;$F4$0 = $93; } else { $$sum9 = (($92) + 2)|0; $99 = (9104 + ($$sum9<<2)|0); $100 = HEAP32[$99>>2]|0; $101 = HEAP32[(9080)>>2]|0; $102 = ($100>>>0)<($101>>>0); if ($102) { _abort(); // unreachable; } else { $$pre$phiZ2D = $99;$F4$0 = $100; } } HEAP32[$$pre$phiZ2D>>2] = $90; $103 = ((($F4$0)) + 12|0); HEAP32[$103>>2] = $90; $104 = ((($90)) + 8|0); HEAP32[$104>>2] = $F4$0; $105 = ((($90)) + 12|0); HEAP32[$105>>2] = $93; } HEAP32[(9072)>>2] = $81; HEAP32[(9084)>>2] = $84; $mem$0 = $69; return ($mem$0|0); } $106 = HEAP32[(9068)>>2]|0; $107 = ($106|0)==(0); if ($107) { $nb$0 = $4; } else { $108 = (0 - ($106))|0; $109 = $106 & $108; $110 = (($109) + -1)|0; $111 = $110 >>> 12; $112 = $111 & 16; $113 = $110 >>> $112; $114 = $113 >>> 5; $115 = $114 & 8; $116 = $115 | $112; $117 = $113 >>> $115; $118 = $117 >>> 2; $119 = $118 & 4; $120 = $116 | $119; $121 = $117 >>> $119; $122 = $121 >>> 1; $123 = $122 & 2; $124 = $120 | $123; $125 = $121 >>> $123; $126 = $125 >>> 1; $127 = $126 & 1; $128 = $124 | $127; $129 = $125 >>> $127; $130 = (($128) + ($129))|0; $131 = (9368 + ($130<<2)|0); $132 = HEAP32[$131>>2]|0; $133 = ((($132)) + 4|0); $134 = HEAP32[$133>>2]|0; $135 = $134 & -8; $136 = (($135) - ($4))|0; $rsize$0$i = $136;$t$0$i = $132;$v$0$i = $132; while(1) { $137 = ((($t$0$i)) + 16|0); $138 = HEAP32[$137>>2]|0; $139 = ($138|0)==(0|0); if ($139) { $140 = ((($t$0$i)) + 20|0); $141 = HEAP32[$140>>2]|0; $142 = ($141|0)==(0|0); if ($142) { $rsize$0$i$lcssa = $rsize$0$i;$v$0$i$lcssa = $v$0$i; break; } else { $144 = $141; } } else { $144 = $138; } $143 = ((($144)) + 4|0); $145 = HEAP32[$143>>2]|0; $146 = $145 & -8; $147 = (($146) - ($4))|0; $148 = ($147>>>0)<($rsize$0$i>>>0); $$rsize$0$i = $148 ? $147 : $rsize$0$i; $$v$0$i = $148 ? $144 : $v$0$i; $rsize$0$i = $$rsize$0$i;$t$0$i = $144;$v$0$i = $$v$0$i; } $149 = HEAP32[(9080)>>2]|0; $150 = ($v$0$i$lcssa>>>0)<($149>>>0); if ($150) { _abort(); // unreachable; } $151 = (($v$0$i$lcssa) + ($4)|0); $152 = ($v$0$i$lcssa>>>0)<($151>>>0); if (!($152)) { _abort(); // unreachable; } $153 = ((($v$0$i$lcssa)) + 24|0); $154 = HEAP32[$153>>2]|0; $155 = ((($v$0$i$lcssa)) + 12|0); $156 = HEAP32[$155>>2]|0; $157 = ($156|0)==($v$0$i$lcssa|0); do { if ($157) { $167 = ((($v$0$i$lcssa)) + 20|0); $168 = HEAP32[$167>>2]|0; $169 = ($168|0)==(0|0); if ($169) { $170 = ((($v$0$i$lcssa)) + 16|0); $171 = HEAP32[$170>>2]|0; $172 = ($171|0)==(0|0); if ($172) { $R$1$i = 0; break; } else { $R$0$i = $171;$RP$0$i = $170; } } else { $R$0$i = $168;$RP$0$i = $167; } while(1) { $173 = ((($R$0$i)) + 20|0); $174 = HEAP32[$173>>2]|0; $175 = ($174|0)==(0|0); if (!($175)) { $R$0$i = $174;$RP$0$i = $173; continue; } $176 = ((($R$0$i)) + 16|0); $177 = HEAP32[$176>>2]|0; $178 = ($177|0)==(0|0); if ($178) { $R$0$i$lcssa = $R$0$i;$RP$0$i$lcssa = $RP$0$i; break; } else { $R$0$i = $177;$RP$0$i = $176; } } $179 = ($RP$0$i$lcssa>>>0)<($149>>>0); if ($179) { _abort(); // unreachable; } else { HEAP32[$RP$0$i$lcssa>>2] = 0; $R$1$i = $R$0$i$lcssa; break; } } else { $158 = ((($v$0$i$lcssa)) + 8|0); $159 = HEAP32[$158>>2]|0; $160 = ($159>>>0)<($149>>>0); if ($160) { _abort(); // unreachable; } $161 = ((($159)) + 12|0); $162 = HEAP32[$161>>2]|0; $163 = ($162|0)==($v$0$i$lcssa|0); if (!($163)) { _abort(); // unreachable; } $164 = ((($156)) + 8|0); $165 = HEAP32[$164>>2]|0; $166 = ($165|0)==($v$0$i$lcssa|0); if ($166) { HEAP32[$161>>2] = $156; HEAP32[$164>>2] = $159; $R$1$i = $156; break; } else { _abort(); // unreachable; } } } while(0); $180 = ($154|0)==(0|0); do { if (!($180)) { $181 = ((($v$0$i$lcssa)) + 28|0); $182 = HEAP32[$181>>2]|0; $183 = (9368 + ($182<<2)|0); $184 = HEAP32[$183>>2]|0; $185 = ($v$0$i$lcssa|0)==($184|0); if ($185) { HEAP32[$183>>2] = $R$1$i; $cond$i = ($R$1$i|0)==(0|0); if ($cond$i) { $186 = 1 << $182; $187 = $186 ^ -1; $188 = HEAP32[(9068)>>2]|0; $189 = $188 & $187; HEAP32[(9068)>>2] = $189; break; } } else { $190 = HEAP32[(9080)>>2]|0; $191 = ($154>>>0)<($190>>>0); if ($191) { _abort(); // unreachable; } $192 = ((($154)) + 16|0); $193 = HEAP32[$192>>2]|0; $194 = ($193|0)==($v$0$i$lcssa|0); if ($194) { HEAP32[$192>>2] = $R$1$i; } else { $195 = ((($154)) + 20|0); HEAP32[$195>>2] = $R$1$i; } $196 = ($R$1$i|0)==(0|0); if ($196) { break; } } $197 = HEAP32[(9080)>>2]|0; $198 = ($R$1$i>>>0)<($197>>>0); if ($198) { _abort(); // unreachable; } $199 = ((($R$1$i)) + 24|0); HEAP32[$199>>2] = $154; $200 = ((($v$0$i$lcssa)) + 16|0); $201 = HEAP32[$200>>2]|0; $202 = ($201|0)==(0|0); do { if (!($202)) { $203 = ($201>>>0)<($197>>>0); if ($203) { _abort(); // unreachable; } else { $204 = ((($R$1$i)) + 16|0); HEAP32[$204>>2] = $201; $205 = ((($201)) + 24|0); HEAP32[$205>>2] = $R$1$i; break; } } } while(0); $206 = ((($v$0$i$lcssa)) + 20|0); $207 = HEAP32[$206>>2]|0; $208 = ($207|0)==(0|0); if (!($208)) { $209 = HEAP32[(9080)>>2]|0; $210 = ($207>>>0)<($209>>>0); if ($210) { _abort(); // unreachable; } else { $211 = ((($R$1$i)) + 20|0); HEAP32[$211>>2] = $207; $212 = ((($207)) + 24|0); HEAP32[$212>>2] = $R$1$i; break; } } } } while(0); $213 = ($rsize$0$i$lcssa>>>0)<(16); if ($213) { $214 = (($rsize$0$i$lcssa) + ($4))|0; $215 = $214 | 3; $216 = ((($v$0$i$lcssa)) + 4|0); HEAP32[$216>>2] = $215; $$sum4$i = (($214) + 4)|0; $217 = (($v$0$i$lcssa) + ($$sum4$i)|0); $218 = HEAP32[$217>>2]|0; $219 = $218 | 1; HEAP32[$217>>2] = $219; } else { $220 = $4 | 3; $221 = ((($v$0$i$lcssa)) + 4|0); HEAP32[$221>>2] = $220; $222 = $rsize$0$i$lcssa | 1; $$sum$i35 = $4 | 4; $223 = (($v$0$i$lcssa) + ($$sum$i35)|0); HEAP32[$223>>2] = $222; $$sum1$i = (($rsize$0$i$lcssa) + ($4))|0; $224 = (($v$0$i$lcssa) + ($$sum1$i)|0); HEAP32[$224>>2] = $rsize$0$i$lcssa; $225 = HEAP32[(9072)>>2]|0; $226 = ($225|0)==(0); if (!($226)) { $227 = HEAP32[(9084)>>2]|0; $228 = $225 >>> 3; $229 = $228 << 1; $230 = (9104 + ($229<<2)|0); $231 = HEAP32[9064>>2]|0; $232 = 1 << $228; $233 = $231 & $232; $234 = ($233|0)==(0); if ($234) { $235 = $231 | $232; HEAP32[9064>>2] = $235; $$pre$i = (($229) + 2)|0; $$pre8$i = (9104 + ($$pre$i<<2)|0); $$pre$phi$iZ2D = $$pre8$i;$F1$0$i = $230; } else { $$sum3$i = (($229) + 2)|0; $236 = (9104 + ($$sum3$i<<2)|0); $237 = HEAP32[$236>>2]|0; $238 = HEAP32[(9080)>>2]|0; $239 = ($237>>>0)<($238>>>0); if ($239) { _abort(); // unreachable; } else { $$pre$phi$iZ2D = $236;$F1$0$i = $237; } } HEAP32[$$pre$phi$iZ2D>>2] = $227; $240 = ((($F1$0$i)) + 12|0); HEAP32[$240>>2] = $227; $241 = ((($227)) + 8|0); HEAP32[$241>>2] = $F1$0$i; $242 = ((($227)) + 12|0); HEAP32[$242>>2] = $230; } HEAP32[(9072)>>2] = $rsize$0$i$lcssa; HEAP32[(9084)>>2] = $151; } $243 = ((($v$0$i$lcssa)) + 8|0); $mem$0 = $243; return ($mem$0|0); } } else { $nb$0 = $4; } } else { $244 = ($bytes>>>0)>(4294967231); if ($244) { $nb$0 = -1; } else { $245 = (($bytes) + 11)|0; $246 = $245 & -8; $247 = HEAP32[(9068)>>2]|0; $248 = ($247|0)==(0); if ($248) { $nb$0 = $246; } else { $249 = (0 - ($246))|0; $250 = $245 >>> 8; $251 = ($250|0)==(0); if ($251) { $idx$0$i = 0; } else { $252 = ($246>>>0)>(16777215); if ($252) { $idx$0$i = 31; } else { $253 = (($250) + 1048320)|0; $254 = $253 >>> 16; $255 = $254 & 8; $256 = $250 << $255; $257 = (($256) + 520192)|0; $258 = $257 >>> 16; $259 = $258 & 4; $260 = $259 | $255; $261 = $256 << $259; $262 = (($261) + 245760)|0; $263 = $262 >>> 16; $264 = $263 & 2; $265 = $260 | $264; $266 = (14 - ($265))|0; $267 = $261 << $264; $268 = $267 >>> 15; $269 = (($266) + ($268))|0; $270 = $269 << 1; $271 = (($269) + 7)|0; $272 = $246 >>> $271; $273 = $272 & 1; $274 = $273 | $270; $idx$0$i = $274; } } $275 = (9368 + ($idx$0$i<<2)|0); $276 = HEAP32[$275>>2]|0; $277 = ($276|0)==(0|0); L123: do { if ($277) { $rsize$2$i = $249;$t$1$i = 0;$v$2$i = 0; label = 86; } else { $278 = ($idx$0$i|0)==(31); $279 = $idx$0$i >>> 1; $280 = (25 - ($279))|0; $281 = $278 ? 0 : $280; $282 = $246 << $281; $rsize$0$i15 = $249;$rst$0$i = 0;$sizebits$0$i = $282;$t$0$i14 = $276;$v$0$i16 = 0; while(1) { $283 = ((($t$0$i14)) + 4|0); $284 = HEAP32[$283>>2]|0; $285 = $284 & -8; $286 = (($285) - ($246))|0; $287 = ($286>>>0)<($rsize$0$i15>>>0); if ($287) { $288 = ($285|0)==($246|0); if ($288) { $rsize$331$i = $286;$t$230$i = $t$0$i14;$v$332$i = $t$0$i14; label = 90; break L123; } else { $rsize$1$i = $286;$v$1$i = $t$0$i14; } } else { $rsize$1$i = $rsize$0$i15;$v$1$i = $v$0$i16; } $289 = ((($t$0$i14)) + 20|0); $290 = HEAP32[$289>>2]|0; $291 = $sizebits$0$i >>> 31; $292 = (((($t$0$i14)) + 16|0) + ($291<<2)|0); $293 = HEAP32[$292>>2]|0; $294 = ($290|0)==(0|0); $295 = ($290|0)==($293|0); $or$cond19$i = $294 | $295; $rst$1$i = $or$cond19$i ? $rst$0$i : $290; $296 = ($293|0)==(0|0); $297 = $sizebits$0$i << 1; if ($296) { $rsize$2$i = $rsize$1$i;$t$1$i = $rst$1$i;$v$2$i = $v$1$i; label = 86; break; } else { $rsize$0$i15 = $rsize$1$i;$rst$0$i = $rst$1$i;$sizebits$0$i = $297;$t$0$i14 = $293;$v$0$i16 = $v$1$i; } } } } while(0); if ((label|0) == 86) { $298 = ($t$1$i|0)==(0|0); $299 = ($v$2$i|0)==(0|0); $or$cond$i = $298 & $299; if ($or$cond$i) { $300 = 2 << $idx$0$i; $301 = (0 - ($300))|0; $302 = $300 | $301; $303 = $247 & $302; $304 = ($303|0)==(0); if ($304) { $nb$0 = $246; break; } $305 = (0 - ($303))|0; $306 = $303 & $305; $307 = (($306) + -1)|0; $308 = $307 >>> 12; $309 = $308 & 16; $310 = $307 >>> $309; $311 = $310 >>> 5; $312 = $311 & 8; $313 = $312 | $309; $314 = $310 >>> $312; $315 = $314 >>> 2; $316 = $315 & 4; $317 = $313 | $316; $318 = $314 >>> $316; $319 = $318 >>> 1; $320 = $319 & 2; $321 = $317 | $320; $322 = $318 >>> $320; $323 = $322 >>> 1; $324 = $323 & 1; $325 = $321 | $324; $326 = $322 >>> $324; $327 = (($325) + ($326))|0; $328 = (9368 + ($327<<2)|0); $329 = HEAP32[$328>>2]|0; $t$2$ph$i = $329;$v$3$ph$i = 0; } else { $t$2$ph$i = $t$1$i;$v$3$ph$i = $v$2$i; } $330 = ($t$2$ph$i|0)==(0|0); if ($330) { $rsize$3$lcssa$i = $rsize$2$i;$v$3$lcssa$i = $v$3$ph$i; } else { $rsize$331$i = $rsize$2$i;$t$230$i = $t$2$ph$i;$v$332$i = $v$3$ph$i; label = 90; } } if ((label|0) == 90) { while(1) { label = 0; $331 = ((($t$230$i)) + 4|0); $332 = HEAP32[$331>>2]|0; $333 = $332 & -8; $334 = (($333) - ($246))|0; $335 = ($334>>>0)<($rsize$331$i>>>0); $$rsize$3$i = $335 ? $334 : $rsize$331$i; $t$2$v$3$i = $335 ? $t$230$i : $v$332$i; $336 = ((($t$230$i)) + 16|0); $337 = HEAP32[$336>>2]|0; $338 = ($337|0)==(0|0); if (!($338)) { $rsize$331$i = $$rsize$3$i;$t$230$i = $337;$v$332$i = $t$2$v$3$i; label = 90; continue; } $339 = ((($t$230$i)) + 20|0); $340 = HEAP32[$339>>2]|0; $341 = ($340|0)==(0|0); if ($341) { $rsize$3$lcssa$i = $$rsize$3$i;$v$3$lcssa$i = $t$2$v$3$i; break; } else { $rsize$331$i = $$rsize$3$i;$t$230$i = $340;$v$332$i = $t$2$v$3$i; label = 90; } } } $342 = ($v$3$lcssa$i|0)==(0|0); if ($342) { $nb$0 = $246; } else { $343 = HEAP32[(9072)>>2]|0; $344 = (($343) - ($246))|0; $345 = ($rsize$3$lcssa$i>>>0)<($344>>>0); if ($345) { $346 = HEAP32[(9080)>>2]|0; $347 = ($v$3$lcssa$i>>>0)<($346>>>0); if ($347) { _abort(); // unreachable; } $348 = (($v$3$lcssa$i) + ($246)|0); $349 = ($v$3$lcssa$i>>>0)<($348>>>0); if (!($349)) { _abort(); // unreachable; } $350 = ((($v$3$lcssa$i)) + 24|0); $351 = HEAP32[$350>>2]|0; $352 = ((($v$3$lcssa$i)) + 12|0); $353 = HEAP32[$352>>2]|0; $354 = ($353|0)==($v$3$lcssa$i|0); do { if ($354) { $364 = ((($v$3$lcssa$i)) + 20|0); $365 = HEAP32[$364>>2]|0; $366 = ($365|0)==(0|0); if ($366) { $367 = ((($v$3$lcssa$i)) + 16|0); $368 = HEAP32[$367>>2]|0; $369 = ($368|0)==(0|0); if ($369) { $R$1$i20 = 0; break; } else { $R$0$i18 = $368;$RP$0$i17 = $367; } } else { $R$0$i18 = $365;$RP$0$i17 = $364; } while(1) { $370 = ((($R$0$i18)) + 20|0); $371 = HEAP32[$370>>2]|0; $372 = ($371|0)==(0|0); if (!($372)) { $R$0$i18 = $371;$RP$0$i17 = $370; continue; } $373 = ((($R$0$i18)) + 16|0); $374 = HEAP32[$373>>2]|0; $375 = ($374|0)==(0|0); if ($375) { $R$0$i18$lcssa = $R$0$i18;$RP$0$i17$lcssa = $RP$0$i17; break; } else { $R$0$i18 = $374;$RP$0$i17 = $373; } } $376 = ($RP$0$i17$lcssa>>>0)<($346>>>0); if ($376) { _abort(); // unreachable; } else { HEAP32[$RP$0$i17$lcssa>>2] = 0; $R$1$i20 = $R$0$i18$lcssa; break; } } else { $355 = ((($v$3$lcssa$i)) + 8|0); $356 = HEAP32[$355>>2]|0; $357 = ($356>>>0)<($346>>>0); if ($357) { _abort(); // unreachable; } $358 = ((($356)) + 12|0); $359 = HEAP32[$358>>2]|0; $360 = ($359|0)==($v$3$lcssa$i|0); if (!($360)) { _abort(); // unreachable; } $361 = ((($353)) + 8|0); $362 = HEAP32[$361>>2]|0; $363 = ($362|0)==($v$3$lcssa$i|0); if ($363) { HEAP32[$358>>2] = $353; HEAP32[$361>>2] = $356; $R$1$i20 = $353; break; } else { _abort(); // unreachable; } } } while(0); $377 = ($351|0)==(0|0); do { if (!($377)) { $378 = ((($v$3$lcssa$i)) + 28|0); $379 = HEAP32[$378>>2]|0; $380 = (9368 + ($379<<2)|0); $381 = HEAP32[$380>>2]|0; $382 = ($v$3$lcssa$i|0)==($381|0); if ($382) { HEAP32[$380>>2] = $R$1$i20; $cond$i21 = ($R$1$i20|0)==(0|0); if ($cond$i21) { $383 = 1 << $379; $384 = $383 ^ -1; $385 = HEAP32[(9068)>>2]|0; $386 = $385 & $384; HEAP32[(9068)>>2] = $386; break; } } else { $387 = HEAP32[(9080)>>2]|0; $388 = ($351>>>0)<($387>>>0); if ($388) { _abort(); // unreachable; } $389 = ((($351)) + 16|0); $390 = HEAP32[$389>>2]|0; $391 = ($390|0)==($v$3$lcssa$i|0); if ($391) { HEAP32[$389>>2] = $R$1$i20; } else { $392 = ((($351)) + 20|0); HEAP32[$392>>2] = $R$1$i20; } $393 = ($R$1$i20|0)==(0|0); if ($393) { break; } } $394 = HEAP32[(9080)>>2]|0; $395 = ($R$1$i20>>>0)<($394>>>0); if ($395) { _abort(); // unreachable; } $396 = ((($R$1$i20)) + 24|0); HEAP32[$396>>2] = $351; $397 = ((($v$3$lcssa$i)) + 16|0); $398 = HEAP32[$397>>2]|0; $399 = ($398|0)==(0|0); do { if (!($399)) { $400 = ($398>>>0)<($394>>>0); if ($400) { _abort(); // unreachable; } else { $401 = ((($R$1$i20)) + 16|0); HEAP32[$401>>2] = $398; $402 = ((($398)) + 24|0); HEAP32[$402>>2] = $R$1$i20; break; } } } while(0); $403 = ((($v$3$lcssa$i)) + 20|0); $404 = HEAP32[$403>>2]|0; $405 = ($404|0)==(0|0); if (!($405)) { $406 = HEAP32[(9080)>>2]|0; $407 = ($404>>>0)<($406>>>0); if ($407) { _abort(); // unreachable; } else { $408 = ((($R$1$i20)) + 20|0); HEAP32[$408>>2] = $404; $409 = ((($404)) + 24|0); HEAP32[$409>>2] = $R$1$i20; break; } } } } while(0); $410 = ($rsize$3$lcssa$i>>>0)<(16); L199: do { if ($410) { $411 = (($rsize$3$lcssa$i) + ($246))|0; $412 = $411 | 3; $413 = ((($v$3$lcssa$i)) + 4|0); HEAP32[$413>>2] = $412; $$sum18$i = (($411) + 4)|0; $414 = (($v$3$lcssa$i) + ($$sum18$i)|0); $415 = HEAP32[$414>>2]|0; $416 = $415 | 1; HEAP32[$414>>2] = $416; } else { $417 = $246 | 3; $418 = ((($v$3$lcssa$i)) + 4|0); HEAP32[$418>>2] = $417; $419 = $rsize$3$lcssa$i | 1; $$sum$i2334 = $246 | 4; $420 = (($v$3$lcssa$i) + ($$sum$i2334)|0); HEAP32[$420>>2] = $419; $$sum1$i24 = (($rsize$3$lcssa$i) + ($246))|0; $421 = (($v$3$lcssa$i) + ($$sum1$i24)|0); HEAP32[$421>>2] = $rsize$3$lcssa$i; $422 = $rsize$3$lcssa$i >>> 3; $423 = ($rsize$3$lcssa$i>>>0)<(256); if ($423) { $424 = $422 << 1; $425 = (9104 + ($424<<2)|0); $426 = HEAP32[9064>>2]|0; $427 = 1 << $422; $428 = $426 & $427; $429 = ($428|0)==(0); if ($429) { $430 = $426 | $427; HEAP32[9064>>2] = $430; $$pre$i25 = (($424) + 2)|0; $$pre43$i = (9104 + ($$pre$i25<<2)|0); $$pre$phi$i26Z2D = $$pre43$i;$F5$0$i = $425; } else { $$sum17$i = (($424) + 2)|0; $431 = (9104 + ($$sum17$i<<2)|0); $432 = HEAP32[$431>>2]|0; $433 = HEAP32[(9080)>>2]|0; $434 = ($432>>>0)<($433>>>0); if ($434) { _abort(); // unreachable; } else { $$pre$phi$i26Z2D = $431;$F5$0$i = $432; } } HEAP32[$$pre$phi$i26Z2D>>2] = $348; $435 = ((($F5$0$i)) + 12|0); HEAP32[$435>>2] = $348; $$sum15$i = (($246) + 8)|0; $436 = (($v$3$lcssa$i) + ($$sum15$i)|0); HEAP32[$436>>2] = $F5$0$i; $$sum16$i = (($246) + 12)|0; $437 = (($v$3$lcssa$i) + ($$sum16$i)|0); HEAP32[$437>>2] = $425; break; } $438 = $rsize$3$lcssa$i >>> 8; $439 = ($438|0)==(0); if ($439) { $I7$0$i = 0; } else { $440 = ($rsize$3$lcssa$i>>>0)>(16777215); if ($440) { $I7$0$i = 31; } else { $441 = (($438) + 1048320)|0; $442 = $441 >>> 16; $443 = $442 & 8; $444 = $438 << $443; $445 = (($444) + 520192)|0; $446 = $445 >>> 16; $447 = $446 & 4; $448 = $447 | $443; $449 = $444 << $447; $450 = (($449) + 245760)|0; $451 = $450 >>> 16; $452 = $451 & 2; $453 = $448 | $452; $454 = (14 - ($453))|0; $455 = $449 << $452; $456 = $455 >>> 15; $457 = (($454) + ($456))|0; $458 = $457 << 1; $459 = (($457) + 7)|0; $460 = $rsize$3$lcssa$i >>> $459; $461 = $460 & 1; $462 = $461 | $458; $I7$0$i = $462; } } $463 = (9368 + ($I7$0$i<<2)|0); $$sum2$i = (($246) + 28)|0; $464 = (($v$3$lcssa$i) + ($$sum2$i)|0); HEAP32[$464>>2] = $I7$0$i; $$sum3$i27 = (($246) + 16)|0; $465 = (($v$3$lcssa$i) + ($$sum3$i27)|0); $$sum4$i28 = (($246) + 20)|0; $466 = (($v$3$lcssa$i) + ($$sum4$i28)|0); HEAP32[$466>>2] = 0; HEAP32[$465>>2] = 0; $467 = HEAP32[(9068)>>2]|0; $468 = 1 << $I7$0$i; $469 = $467 & $468; $470 = ($469|0)==(0); if ($470) { $471 = $467 | $468; HEAP32[(9068)>>2] = $471; HEAP32[$463>>2] = $348; $$sum5$i = (($246) + 24)|0; $472 = (($v$3$lcssa$i) + ($$sum5$i)|0); HEAP32[$472>>2] = $463; $$sum6$i = (($246) + 12)|0; $473 = (($v$3$lcssa$i) + ($$sum6$i)|0); HEAP32[$473>>2] = $348; $$sum7$i = (($246) + 8)|0; $474 = (($v$3$lcssa$i) + ($$sum7$i)|0); HEAP32[$474>>2] = $348; break; } $475 = HEAP32[$463>>2]|0; $476 = ((($475)) + 4|0); $477 = HEAP32[$476>>2]|0; $478 = $477 & -8; $479 = ($478|0)==($rsize$3$lcssa$i|0); L217: do { if ($479) { $T$0$lcssa$i = $475; } else { $480 = ($I7$0$i|0)==(31); $481 = $I7$0$i >>> 1; $482 = (25 - ($481))|0; $483 = $480 ? 0 : $482; $484 = $rsize$3$lcssa$i << $483; $K12$029$i = $484;$T$028$i = $475; while(1) { $491 = $K12$029$i >>> 31; $492 = (((($T$028$i)) + 16|0) + ($491<<2)|0); $487 = HEAP32[$492>>2]|0; $493 = ($487|0)==(0|0); if ($493) { $$lcssa232 = $492;$T$028$i$lcssa = $T$028$i; break; } $485 = $K12$029$i << 1; $486 = ((($487)) + 4|0); $488 = HEAP32[$486>>2]|0; $489 = $488 & -8; $490 = ($489|0)==($rsize$3$lcssa$i|0); if ($490) { $T$0$lcssa$i = $487; break L217; } else { $K12$029$i = $485;$T$028$i = $487; } } $494 = HEAP32[(9080)>>2]|0; $495 = ($$lcssa232>>>0)<($494>>>0); if ($495) { _abort(); // unreachable; } else { HEAP32[$$lcssa232>>2] = $348; $$sum11$i = (($246) + 24)|0; $496 = (($v$3$lcssa$i) + ($$sum11$i)|0); HEAP32[$496>>2] = $T$028$i$lcssa; $$sum12$i = (($246) + 12)|0; $497 = (($v$3$lcssa$i) + ($$sum12$i)|0); HEAP32[$497>>2] = $348; $$sum13$i = (($246) + 8)|0; $498 = (($v$3$lcssa$i) + ($$sum13$i)|0); HEAP32[$498>>2] = $348; break L199; } } } while(0); $499 = ((($T$0$lcssa$i)) + 8|0); $500 = HEAP32[$499>>2]|0; $501 = HEAP32[(9080)>>2]|0; $502 = ($500>>>0)>=($501>>>0); $not$$i = ($T$0$lcssa$i>>>0)>=($501>>>0); $503 = $502 & $not$$i; if ($503) { $504 = ((($500)) + 12|0); HEAP32[$504>>2] = $348; HEAP32[$499>>2] = $348; $$sum8$i = (($246) + 8)|0; $505 = (($v$3$lcssa$i) + ($$sum8$i)|0); HEAP32[$505>>2] = $500; $$sum9$i = (($246) + 12)|0; $506 = (($v$3$lcssa$i) + ($$sum9$i)|0); HEAP32[$506>>2] = $T$0$lcssa$i; $$sum10$i = (($246) + 24)|0; $507 = (($v$3$lcssa$i) + ($$sum10$i)|0); HEAP32[$507>>2] = 0; break; } else { _abort(); // unreachable; } } } while(0); $508 = ((($v$3$lcssa$i)) + 8|0); $mem$0 = $508; return ($mem$0|0); } else { $nb$0 = $246; } } } } } } while(0); $509 = HEAP32[(9072)>>2]|0; $510 = ($509>>>0)<($nb$0>>>0); if (!($510)) { $511 = (($509) - ($nb$0))|0; $512 = HEAP32[(9084)>>2]|0; $513 = ($511>>>0)>(15); if ($513) { $514 = (($512) + ($nb$0)|0); HEAP32[(9084)>>2] = $514; HEAP32[(9072)>>2] = $511; $515 = $511 | 1; $$sum2 = (($nb$0) + 4)|0; $516 = (($512) + ($$sum2)|0); HEAP32[$516>>2] = $515; $517 = (($512) + ($509)|0); HEAP32[$517>>2] = $511; $518 = $nb$0 | 3; $519 = ((($512)) + 4|0); HEAP32[$519>>2] = $518; } else { HEAP32[(9072)>>2] = 0; HEAP32[(9084)>>2] = 0; $520 = $509 | 3; $521 = ((($512)) + 4|0); HEAP32[$521>>2] = $520; $$sum1 = (($509) + 4)|0; $522 = (($512) + ($$sum1)|0); $523 = HEAP32[$522>>2]|0; $524 = $523 | 1; HEAP32[$522>>2] = $524; } $525 = ((($512)) + 8|0); $mem$0 = $525; return ($mem$0|0); } $526 = HEAP32[(9076)>>2]|0; $527 = ($526>>>0)>($nb$0>>>0); if ($527) { $528 = (($526) - ($nb$0))|0; HEAP32[(9076)>>2] = $528; $529 = HEAP32[(9088)>>2]|0; $530 = (($529) + ($nb$0)|0); HEAP32[(9088)>>2] = $530; $531 = $528 | 1; $$sum = (($nb$0) + 4)|0; $532 = (($529) + ($$sum)|0); HEAP32[$532>>2] = $531; $533 = $nb$0 | 3; $534 = ((($529)) + 4|0); HEAP32[$534>>2] = $533; $535 = ((($529)) + 8|0); $mem$0 = $535; return ($mem$0|0); } $536 = HEAP32[9536>>2]|0; $537 = ($536|0)==(0); do { if ($537) { $538 = (_sysconf(30)|0); $539 = (($538) + -1)|0; $540 = $539 & $538; $541 = ($540|0)==(0); if ($541) { HEAP32[(9544)>>2] = $538; HEAP32[(9540)>>2] = $538; HEAP32[(9548)>>2] = -1; HEAP32[(9552)>>2] = -1; HEAP32[(9556)>>2] = 0; HEAP32[(9508)>>2] = 0; $542 = (_time((0|0))|0); $543 = $542 & -16; $544 = $543 ^ 1431655768; HEAP32[9536>>2] = $544; break; } else { _abort(); // unreachable; } } } while(0); $545 = (($nb$0) + 48)|0; $546 = HEAP32[(9544)>>2]|0; $547 = (($nb$0) + 47)|0; $548 = (($546) + ($547))|0; $549 = (0 - ($546))|0; $550 = $548 & $549; $551 = ($550>>>0)>($nb$0>>>0); if (!($551)) { $mem$0 = 0; return ($mem$0|0); } $552 = HEAP32[(9504)>>2]|0; $553 = ($552|0)==(0); if (!($553)) { $554 = HEAP32[(9496)>>2]|0; $555 = (($554) + ($550))|0; $556 = ($555>>>0)<=($554>>>0); $557 = ($555>>>0)>($552>>>0); $or$cond1$i = $556 | $557; if ($or$cond1$i) { $mem$0 = 0; return ($mem$0|0); } } $558 = HEAP32[(9508)>>2]|0; $559 = $558 & 4; $560 = ($559|0)==(0); L258: do { if ($560) { $561 = HEAP32[(9088)>>2]|0; $562 = ($561|0)==(0|0); L260: do { if ($562) { label = 174; } else { $sp$0$i$i = (9512); while(1) { $563 = HEAP32[$sp$0$i$i>>2]|0; $564 = ($563>>>0)>($561>>>0); if (!($564)) { $565 = ((($sp$0$i$i)) + 4|0); $566 = HEAP32[$565>>2]|0; $567 = (($563) + ($566)|0); $568 = ($567>>>0)>($561>>>0); if ($568) { $$lcssa228 = $sp$0$i$i;$$lcssa230 = $565; break; } } $569 = ((($sp$0$i$i)) + 8|0); $570 = HEAP32[$569>>2]|0; $571 = ($570|0)==(0|0); if ($571) { label = 174; break L260; } else { $sp$0$i$i = $570; } } $594 = HEAP32[(9076)>>2]|0; $595 = (($548) - ($594))|0; $596 = $595 & $549; $597 = ($596>>>0)<(2147483647); if ($597) { $598 = (_sbrk(($596|0))|0); $599 = HEAP32[$$lcssa228>>2]|0; $600 = HEAP32[$$lcssa230>>2]|0; $601 = (($599) + ($600)|0); $602 = ($598|0)==($601|0); $$3$i = $602 ? $596 : 0; if ($602) { $603 = ($598|0)==((-1)|0); if ($603) { $tsize$0323944$i = $$3$i; } else { $tbase$255$i = $598;$tsize$254$i = $$3$i; label = 194; break L258; } } else { $br$0$ph$i = $598;$ssize$1$ph$i = $596;$tsize$0$ph$i = $$3$i; label = 184; } } else { $tsize$0323944$i = 0; } } } while(0); do { if ((label|0) == 174) { $572 = (_sbrk(0)|0); $573 = ($572|0)==((-1)|0); if ($573) { $tsize$0323944$i = 0; } else { $574 = $572; $575 = HEAP32[(9540)>>2]|0; $576 = (($575) + -1)|0; $577 = $576 & $574; $578 = ($577|0)==(0); if ($578) { $ssize$0$i = $550; } else { $579 = (($576) + ($574))|0; $580 = (0 - ($575))|0; $581 = $579 & $580; $582 = (($550) - ($574))|0; $583 = (($582) + ($581))|0; $ssize$0$i = $583; } $584 = HEAP32[(9496)>>2]|0; $585 = (($584) + ($ssize$0$i))|0; $586 = ($ssize$0$i>>>0)>($nb$0>>>0); $587 = ($ssize$0$i>>>0)<(2147483647); $or$cond$i30 = $586 & $587; if ($or$cond$i30) { $588 = HEAP32[(9504)>>2]|0; $589 = ($588|0)==(0); if (!($589)) { $590 = ($585>>>0)<=($584>>>0); $591 = ($585>>>0)>($588>>>0); $or$cond2$i = $590 | $591; if ($or$cond2$i) { $tsize$0323944$i = 0; break; } } $592 = (_sbrk(($ssize$0$i|0))|0); $593 = ($592|0)==($572|0); $ssize$0$$i = $593 ? $ssize$0$i : 0; if ($593) { $tbase$255$i = $572;$tsize$254$i = $ssize$0$$i; label = 194; break L258; } else { $br$0$ph$i = $592;$ssize$1$ph$i = $ssize$0$i;$tsize$0$ph$i = $ssize$0$$i; label = 184; } } else { $tsize$0323944$i = 0; } } } } while(0); L280: do { if ((label|0) == 184) { $604 = (0 - ($ssize$1$ph$i))|0; $605 = ($br$0$ph$i|0)!=((-1)|0); $606 = ($ssize$1$ph$i>>>0)<(2147483647); $or$cond5$i = $606 & $605; $607 = ($545>>>0)>($ssize$1$ph$i>>>0); $or$cond6$i = $607 & $or$cond5$i; do { if ($or$cond6$i) { $608 = HEAP32[(9544)>>2]|0; $609 = (($547) - ($ssize$1$ph$i))|0; $610 = (($609) + ($608))|0; $611 = (0 - ($608))|0; $612 = $610 & $611; $613 = ($612>>>0)<(2147483647); if ($613) { $614 = (_sbrk(($612|0))|0); $615 = ($614|0)==((-1)|0); if ($615) { (_sbrk(($604|0))|0); $tsize$0323944$i = $tsize$0$ph$i; break L280; } else { $616 = (($612) + ($ssize$1$ph$i))|0; $ssize$2$i = $616; break; } } else { $ssize$2$i = $ssize$1$ph$i; } } else { $ssize$2$i = $ssize$1$ph$i; } } while(0); $617 = ($br$0$ph$i|0)==((-1)|0); if ($617) { $tsize$0323944$i = $tsize$0$ph$i; } else { $tbase$255$i = $br$0$ph$i;$tsize$254$i = $ssize$2$i; label = 194; break L258; } } } while(0); $618 = HEAP32[(9508)>>2]|0; $619 = $618 | 4; HEAP32[(9508)>>2] = $619; $tsize$1$i = $tsize$0323944$i; label = 191; } else { $tsize$1$i = 0; label = 191; } } while(0); if ((label|0) == 191) { $620 = ($550>>>0)<(2147483647); if ($620) { $621 = (_sbrk(($550|0))|0); $622 = (_sbrk(0)|0); $623 = ($621|0)!=((-1)|0); $624 = ($622|0)!=((-1)|0); $or$cond3$i = $623 & $624; $625 = ($621>>>0)<($622>>>0); $or$cond8$i = $625 & $or$cond3$i; if ($or$cond8$i) { $626 = $622; $627 = $621; $628 = (($626) - ($627))|0; $629 = (($nb$0) + 40)|0; $630 = ($628>>>0)>($629>>>0); $$tsize$1$i = $630 ? $628 : $tsize$1$i; if ($630) { $tbase$255$i = $621;$tsize$254$i = $$tsize$1$i; label = 194; } } } } if ((label|0) == 194) { $631 = HEAP32[(9496)>>2]|0; $632 = (($631) + ($tsize$254$i))|0; HEAP32[(9496)>>2] = $632; $633 = HEAP32[(9500)>>2]|0; $634 = ($632>>>0)>($633>>>0); if ($634) { HEAP32[(9500)>>2] = $632; } $635 = HEAP32[(9088)>>2]|0; $636 = ($635|0)==(0|0); L299: do { if ($636) { $637 = HEAP32[(9080)>>2]|0; $638 = ($637|0)==(0|0); $639 = ($tbase$255$i>>>0)<($637>>>0); $or$cond9$i = $638 | $639; if ($or$cond9$i) { HEAP32[(9080)>>2] = $tbase$255$i; } HEAP32[(9512)>>2] = $tbase$255$i; HEAP32[(9516)>>2] = $tsize$254$i; HEAP32[(9524)>>2] = 0; $640 = HEAP32[9536>>2]|0; HEAP32[(9100)>>2] = $640; HEAP32[(9096)>>2] = -1; $i$02$i$i = 0; while(1) { $641 = $i$02$i$i << 1; $642 = (9104 + ($641<<2)|0); $$sum$i$i = (($641) + 3)|0; $643 = (9104 + ($$sum$i$i<<2)|0); HEAP32[$643>>2] = $642; $$sum1$i$i = (($641) + 2)|0; $644 = (9104 + ($$sum1$i$i<<2)|0); HEAP32[$644>>2] = $642; $645 = (($i$02$i$i) + 1)|0; $exitcond$i$i = ($645|0)==(32); if ($exitcond$i$i) { break; } else { $i$02$i$i = $645; } } $646 = (($tsize$254$i) + -40)|0; $647 = ((($tbase$255$i)) + 8|0); $648 = $647; $649 = $648 & 7; $650 = ($649|0)==(0); $651 = (0 - ($648))|0; $652 = $651 & 7; $653 = $650 ? 0 : $652; $654 = (($tbase$255$i) + ($653)|0); $655 = (($646) - ($653))|0; HEAP32[(9088)>>2] = $654; HEAP32[(9076)>>2] = $655; $656 = $655 | 1; $$sum$i13$i = (($653) + 4)|0; $657 = (($tbase$255$i) + ($$sum$i13$i)|0); HEAP32[$657>>2] = $656; $$sum2$i$i = (($tsize$254$i) + -36)|0; $658 = (($tbase$255$i) + ($$sum2$i$i)|0); HEAP32[$658>>2] = 40; $659 = HEAP32[(9552)>>2]|0; HEAP32[(9092)>>2] = $659; } else { $sp$084$i = (9512); while(1) { $660 = HEAP32[$sp$084$i>>2]|0; $661 = ((($sp$084$i)) + 4|0); $662 = HEAP32[$661>>2]|0; $663 = (($660) + ($662)|0); $664 = ($tbase$255$i|0)==($663|0); if ($664) { $$lcssa222 = $660;$$lcssa224 = $661;$$lcssa226 = $662;$sp$084$i$lcssa = $sp$084$i; label = 204; break; } $665 = ((($sp$084$i)) + 8|0); $666 = HEAP32[$665>>2]|0; $667 = ($666|0)==(0|0); if ($667) { break; } else { $sp$084$i = $666; } } if ((label|0) == 204) { $668 = ((($sp$084$i$lcssa)) + 12|0); $669 = HEAP32[$668>>2]|0; $670 = $669 & 8; $671 = ($670|0)==(0); if ($671) { $672 = ($635>>>0)>=($$lcssa222>>>0); $673 = ($635>>>0)<($tbase$255$i>>>0); $or$cond57$i = $673 & $672; if ($or$cond57$i) { $674 = (($$lcssa226) + ($tsize$254$i))|0; HEAP32[$$lcssa224>>2] = $674; $675 = HEAP32[(9076)>>2]|0; $676 = (($675) + ($tsize$254$i))|0; $677 = ((($635)) + 8|0); $678 = $677; $679 = $678 & 7; $680 = ($679|0)==(0); $681 = (0 - ($678))|0; $682 = $681 & 7; $683 = $680 ? 0 : $682; $684 = (($635) + ($683)|0); $685 = (($676) - ($683))|0; HEAP32[(9088)>>2] = $684; HEAP32[(9076)>>2] = $685; $686 = $685 | 1; $$sum$i17$i = (($683) + 4)|0; $687 = (($635) + ($$sum$i17$i)|0); HEAP32[$687>>2] = $686; $$sum2$i18$i = (($676) + 4)|0; $688 = (($635) + ($$sum2$i18$i)|0); HEAP32[$688>>2] = 40; $689 = HEAP32[(9552)>>2]|0; HEAP32[(9092)>>2] = $689; break; } } } $690 = HEAP32[(9080)>>2]|0; $691 = ($tbase$255$i>>>0)<($690>>>0); if ($691) { HEAP32[(9080)>>2] = $tbase$255$i; $755 = $tbase$255$i; } else { $755 = $690; } $692 = (($tbase$255$i) + ($tsize$254$i)|0); $sp$183$i = (9512); while(1) { $693 = HEAP32[$sp$183$i>>2]|0; $694 = ($693|0)==($692|0); if ($694) { $$lcssa219 = $sp$183$i;$sp$183$i$lcssa = $sp$183$i; label = 212; break; } $695 = ((($sp$183$i)) + 8|0); $696 = HEAP32[$695>>2]|0; $697 = ($696|0)==(0|0); if ($697) { $sp$0$i$i$i = (9512); break; } else { $sp$183$i = $696; } } if ((label|0) == 212) { $698 = ((($sp$183$i$lcssa)) + 12|0); $699 = HEAP32[$698>>2]|0; $700 = $699 & 8; $701 = ($700|0)==(0); if ($701) { HEAP32[$$lcssa219>>2] = $tbase$255$i; $702 = ((($sp$183$i$lcssa)) + 4|0); $703 = HEAP32[$702>>2]|0; $704 = (($703) + ($tsize$254$i))|0; HEAP32[$702>>2] = $704; $705 = ((($tbase$255$i)) + 8|0); $706 = $705; $707 = $706 & 7; $708 = ($707|0)==(0); $709 = (0 - ($706))|0; $710 = $709 & 7; $711 = $708 ? 0 : $710; $712 = (($tbase$255$i) + ($711)|0); $$sum112$i = (($tsize$254$i) + 8)|0; $713 = (($tbase$255$i) + ($$sum112$i)|0); $714 = $713; $715 = $714 & 7; $716 = ($715|0)==(0); $717 = (0 - ($714))|0; $718 = $717 & 7; $719 = $716 ? 0 : $718; $$sum113$i = (($719) + ($tsize$254$i))|0; $720 = (($tbase$255$i) + ($$sum113$i)|0); $721 = $720; $722 = $712; $723 = (($721) - ($722))|0; $$sum$i19$i = (($711) + ($nb$0))|0; $724 = (($tbase$255$i) + ($$sum$i19$i)|0); $725 = (($723) - ($nb$0))|0; $726 = $nb$0 | 3; $$sum1$i20$i = (($711) + 4)|0; $727 = (($tbase$255$i) + ($$sum1$i20$i)|0); HEAP32[$727>>2] = $726; $728 = ($720|0)==($635|0); L324: do { if ($728) { $729 = HEAP32[(9076)>>2]|0; $730 = (($729) + ($725))|0; HEAP32[(9076)>>2] = $730; HEAP32[(9088)>>2] = $724; $731 = $730 | 1; $$sum42$i$i = (($$sum$i19$i) + 4)|0; $732 = (($tbase$255$i) + ($$sum42$i$i)|0); HEAP32[$732>>2] = $731; } else { $733 = HEAP32[(9084)>>2]|0; $734 = ($720|0)==($733|0); if ($734) { $735 = HEAP32[(9072)>>2]|0; $736 = (($735) + ($725))|0; HEAP32[(9072)>>2] = $736; HEAP32[(9084)>>2] = $724; $737 = $736 | 1; $$sum40$i$i = (($$sum$i19$i) + 4)|0; $738 = (($tbase$255$i) + ($$sum40$i$i)|0); HEAP32[$738>>2] = $737; $$sum41$i$i = (($736) + ($$sum$i19$i))|0; $739 = (($tbase$255$i) + ($$sum41$i$i)|0); HEAP32[$739>>2] = $736; break; } $$sum2$i21$i = (($tsize$254$i) + 4)|0; $$sum114$i = (($$sum2$i21$i) + ($719))|0; $740 = (($tbase$255$i) + ($$sum114$i)|0); $741 = HEAP32[$740>>2]|0; $742 = $741 & 3; $743 = ($742|0)==(1); if ($743) { $744 = $741 & -8; $745 = $741 >>> 3; $746 = ($741>>>0)<(256); L332: do { if ($746) { $$sum3738$i$i = $719 | 8; $$sum124$i = (($$sum3738$i$i) + ($tsize$254$i))|0; $747 = (($tbase$255$i) + ($$sum124$i)|0); $748 = HEAP32[$747>>2]|0; $$sum39$i$i = (($tsize$254$i) + 12)|0; $$sum125$i = (($$sum39$i$i) + ($719))|0; $749 = (($tbase$255$i) + ($$sum125$i)|0); $750 = HEAP32[$749>>2]|0; $751 = $745 << 1; $752 = (9104 + ($751<<2)|0); $753 = ($748|0)==($752|0); do { if (!($753)) { $754 = ($748>>>0)<($755>>>0); if ($754) { _abort(); // unreachable; } $756 = ((($748)) + 12|0); $757 = HEAP32[$756>>2]|0; $758 = ($757|0)==($720|0); if ($758) { break; } _abort(); // unreachable; } } while(0); $759 = ($750|0)==($748|0); if ($759) { $760 = 1 << $745; $761 = $760 ^ -1; $762 = HEAP32[9064>>2]|0; $763 = $762 & $761; HEAP32[9064>>2] = $763; break; } $764 = ($750|0)==($752|0); do { if ($764) { $$pre57$i$i = ((($750)) + 8|0); $$pre$phi58$i$iZ2D = $$pre57$i$i; } else { $765 = ($750>>>0)<($755>>>0); if ($765) { _abort(); // unreachable; } $766 = ((($750)) + 8|0); $767 = HEAP32[$766>>2]|0; $768 = ($767|0)==($720|0); if ($768) { $$pre$phi58$i$iZ2D = $766; break; } _abort(); // unreachable; } } while(0); $769 = ((($748)) + 12|0); HEAP32[$769>>2] = $750; HEAP32[$$pre$phi58$i$iZ2D>>2] = $748; } else { $$sum34$i$i = $719 | 24; $$sum115$i = (($$sum34$i$i) + ($tsize$254$i))|0; $770 = (($tbase$255$i) + ($$sum115$i)|0); $771 = HEAP32[$770>>2]|0; $$sum5$i$i = (($tsize$254$i) + 12)|0; $$sum116$i = (($$sum5$i$i) + ($719))|0; $772 = (($tbase$255$i) + ($$sum116$i)|0); $773 = HEAP32[$772>>2]|0; $774 = ($773|0)==($720|0); do { if ($774) { $$sum67$i$i = $719 | 16; $$sum122$i = (($$sum2$i21$i) + ($$sum67$i$i))|0; $784 = (($tbase$255$i) + ($$sum122$i)|0); $785 = HEAP32[$784>>2]|0; $786 = ($785|0)==(0|0); if ($786) { $$sum123$i = (($$sum67$i$i) + ($tsize$254$i))|0; $787 = (($tbase$255$i) + ($$sum123$i)|0); $788 = HEAP32[$787>>2]|0; $789 = ($788|0)==(0|0); if ($789) { $R$1$i$i = 0; break; } else { $R$0$i$i = $788;$RP$0$i$i = $787; } } else { $R$0$i$i = $785;$RP$0$i$i = $784; } while(1) { $790 = ((($R$0$i$i)) + 20|0); $791 = HEAP32[$790>>2]|0; $792 = ($791|0)==(0|0); if (!($792)) { $R$0$i$i = $791;$RP$0$i$i = $790; continue; } $793 = ((($R$0$i$i)) + 16|0); $794 = HEAP32[$793>>2]|0; $795 = ($794|0)==(0|0); if ($795) { $R$0$i$i$lcssa = $R$0$i$i;$RP$0$i$i$lcssa = $RP$0$i$i; break; } else { $R$0$i$i = $794;$RP$0$i$i = $793; } } $796 = ($RP$0$i$i$lcssa>>>0)<($755>>>0); if ($796) { _abort(); // unreachable; } else { HEAP32[$RP$0$i$i$lcssa>>2] = 0; $R$1$i$i = $R$0$i$i$lcssa; break; } } else { $$sum3536$i$i = $719 | 8; $$sum117$i = (($$sum3536$i$i) + ($tsize$254$i))|0; $775 = (($tbase$255$i) + ($$sum117$i)|0); $776 = HEAP32[$775>>2]|0; $777 = ($776>>>0)<($755>>>0); if ($777) { _abort(); // unreachable; } $778 = ((($776)) + 12|0); $779 = HEAP32[$778>>2]|0; $780 = ($779|0)==($720|0); if (!($780)) { _abort(); // unreachable; } $781 = ((($773)) + 8|0); $782 = HEAP32[$781>>2]|0; $783 = ($782|0)==($720|0); if ($783) { HEAP32[$778>>2] = $773; HEAP32[$781>>2] = $776; $R$1$i$i = $773; break; } else { _abort(); // unreachable; } } } while(0); $797 = ($771|0)==(0|0); if ($797) { break; } $$sum30$i$i = (($tsize$254$i) + 28)|0; $$sum118$i = (($$sum30$i$i) + ($719))|0; $798 = (($tbase$255$i) + ($$sum118$i)|0); $799 = HEAP32[$798>>2]|0; $800 = (9368 + ($799<<2)|0); $801 = HEAP32[$800>>2]|0; $802 = ($720|0)==($801|0); do { if ($802) { HEAP32[$800>>2] = $R$1$i$i; $cond$i$i = ($R$1$i$i|0)==(0|0); if (!($cond$i$i)) { break; } $803 = 1 << $799; $804 = $803 ^ -1; $805 = HEAP32[(9068)>>2]|0; $806 = $805 & $804; HEAP32[(9068)>>2] = $806; break L332; } else { $807 = HEAP32[(9080)>>2]|0; $808 = ($771>>>0)<($807>>>0); if ($808) { _abort(); // unreachable; } $809 = ((($771)) + 16|0); $810 = HEAP32[$809>>2]|0; $811 = ($810|0)==($720|0); if ($811) { HEAP32[$809>>2] = $R$1$i$i; } else { $812 = ((($771)) + 20|0); HEAP32[$812>>2] = $R$1$i$i; } $813 = ($R$1$i$i|0)==(0|0); if ($813) { break L332; } } } while(0); $814 = HEAP32[(9080)>>2]|0; $815 = ($R$1$i$i>>>0)<($814>>>0); if ($815) { _abort(); // unreachable; } $816 = ((($R$1$i$i)) + 24|0); HEAP32[$816>>2] = $771; $$sum3132$i$i = $719 | 16; $$sum119$i = (($$sum3132$i$i) + ($tsize$254$i))|0; $817 = (($tbase$255$i) + ($$sum119$i)|0); $818 = HEAP32[$817>>2]|0; $819 = ($818|0)==(0|0); do { if (!($819)) { $820 = ($818>>>0)<($814>>>0); if ($820) { _abort(); // unreachable; } else { $821 = ((($R$1$i$i)) + 16|0); HEAP32[$821>>2] = $818; $822 = ((($818)) + 24|0); HEAP32[$822>>2] = $R$1$i$i; break; } } } while(0); $$sum120$i = (($$sum2$i21$i) + ($$sum3132$i$i))|0; $823 = (($tbase$255$i) + ($$sum120$i)|0); $824 = HEAP32[$823>>2]|0; $825 = ($824|0)==(0|0); if ($825) { break; } $826 = HEAP32[(9080)>>2]|0; $827 = ($824>>>0)<($826>>>0); if ($827) { _abort(); // unreachable; } else { $828 = ((($R$1$i$i)) + 20|0); HEAP32[$828>>2] = $824; $829 = ((($824)) + 24|0); HEAP32[$829>>2] = $R$1$i$i; break; } } } while(0); $$sum9$i$i = $744 | $719; $$sum121$i = (($$sum9$i$i) + ($tsize$254$i))|0; $830 = (($tbase$255$i) + ($$sum121$i)|0); $831 = (($744) + ($725))|0; $oldfirst$0$i$i = $830;$qsize$0$i$i = $831; } else { $oldfirst$0$i$i = $720;$qsize$0$i$i = $725; } $832 = ((($oldfirst$0$i$i)) + 4|0); $833 = HEAP32[$832>>2]|0; $834 = $833 & -2; HEAP32[$832>>2] = $834; $835 = $qsize$0$i$i | 1; $$sum10$i$i = (($$sum$i19$i) + 4)|0; $836 = (($tbase$255$i) + ($$sum10$i$i)|0); HEAP32[$836>>2] = $835; $$sum11$i$i = (($qsize$0$i$i) + ($$sum$i19$i))|0; $837 = (($tbase$255$i) + ($$sum11$i$i)|0); HEAP32[$837>>2] = $qsize$0$i$i; $838 = $qsize$0$i$i >>> 3; $839 = ($qsize$0$i$i>>>0)<(256); if ($839) { $840 = $838 << 1; $841 = (9104 + ($840<<2)|0); $842 = HEAP32[9064>>2]|0; $843 = 1 << $838; $844 = $842 & $843; $845 = ($844|0)==(0); do { if ($845) { $846 = $842 | $843; HEAP32[9064>>2] = $846; $$pre$i22$i = (($840) + 2)|0; $$pre56$i$i = (9104 + ($$pre$i22$i<<2)|0); $$pre$phi$i23$iZ2D = $$pre56$i$i;$F4$0$i$i = $841; } else { $$sum29$i$i = (($840) + 2)|0; $847 = (9104 + ($$sum29$i$i<<2)|0); $848 = HEAP32[$847>>2]|0; $849 = HEAP32[(9080)>>2]|0; $850 = ($848>>>0)<($849>>>0); if (!($850)) { $$pre$phi$i23$iZ2D = $847;$F4$0$i$i = $848; break; } _abort(); // unreachable; } } while(0); HEAP32[$$pre$phi$i23$iZ2D>>2] = $724; $851 = ((($F4$0$i$i)) + 12|0); HEAP32[$851>>2] = $724; $$sum27$i$i = (($$sum$i19$i) + 8)|0; $852 = (($tbase$255$i) + ($$sum27$i$i)|0); HEAP32[$852>>2] = $F4$0$i$i; $$sum28$i$i = (($$sum$i19$i) + 12)|0; $853 = (($tbase$255$i) + ($$sum28$i$i)|0); HEAP32[$853>>2] = $841; break; } $854 = $qsize$0$i$i >>> 8; $855 = ($854|0)==(0); do { if ($855) { $I7$0$i$i = 0; } else { $856 = ($qsize$0$i$i>>>0)>(16777215); if ($856) { $I7$0$i$i = 31; break; } $857 = (($854) + 1048320)|0; $858 = $857 >>> 16; $859 = $858 & 8; $860 = $854 << $859; $861 = (($860) + 520192)|0; $862 = $861 >>> 16; $863 = $862 & 4; $864 = $863 | $859; $865 = $860 << $863; $866 = (($865) + 245760)|0; $867 = $866 >>> 16; $868 = $867 & 2; $869 = $864 | $868; $870 = (14 - ($869))|0; $871 = $865 << $868; $872 = $871 >>> 15; $873 = (($870) + ($872))|0; $874 = $873 << 1; $875 = (($873) + 7)|0; $876 = $qsize$0$i$i >>> $875; $877 = $876 & 1; $878 = $877 | $874; $I7$0$i$i = $878; } } while(0); $879 = (9368 + ($I7$0$i$i<<2)|0); $$sum12$i$i = (($$sum$i19$i) + 28)|0; $880 = (($tbase$255$i) + ($$sum12$i$i)|0); HEAP32[$880>>2] = $I7$0$i$i; $$sum13$i$i = (($$sum$i19$i) + 16)|0; $881 = (($tbase$255$i) + ($$sum13$i$i)|0); $$sum14$i$i = (($$sum$i19$i) + 20)|0; $882 = (($tbase$255$i) + ($$sum14$i$i)|0); HEAP32[$882>>2] = 0; HEAP32[$881>>2] = 0; $883 = HEAP32[(9068)>>2]|0; $884 = 1 << $I7$0$i$i; $885 = $883 & $884; $886 = ($885|0)==(0); if ($886) { $887 = $883 | $884; HEAP32[(9068)>>2] = $887; HEAP32[$879>>2] = $724; $$sum15$i$i = (($$sum$i19$i) + 24)|0; $888 = (($tbase$255$i) + ($$sum15$i$i)|0); HEAP32[$888>>2] = $879; $$sum16$i$i = (($$sum$i19$i) + 12)|0; $889 = (($tbase$255$i) + ($$sum16$i$i)|0); HEAP32[$889>>2] = $724; $$sum17$i$i = (($$sum$i19$i) + 8)|0; $890 = (($tbase$255$i) + ($$sum17$i$i)|0); HEAP32[$890>>2] = $724; break; } $891 = HEAP32[$879>>2]|0; $892 = ((($891)) + 4|0); $893 = HEAP32[$892>>2]|0; $894 = $893 & -8; $895 = ($894|0)==($qsize$0$i$i|0); L418: do { if ($895) { $T$0$lcssa$i25$i = $891; } else { $896 = ($I7$0$i$i|0)==(31); $897 = $I7$0$i$i >>> 1; $898 = (25 - ($897))|0; $899 = $896 ? 0 : $898; $900 = $qsize$0$i$i << $899; $K8$051$i$i = $900;$T$050$i$i = $891; while(1) { $907 = $K8$051$i$i >>> 31; $908 = (((($T$050$i$i)) + 16|0) + ($907<<2)|0); $903 = HEAP32[$908>>2]|0; $909 = ($903|0)==(0|0); if ($909) { $$lcssa = $908;$T$050$i$i$lcssa = $T$050$i$i; break; } $901 = $K8$051$i$i << 1; $902 = ((($903)) + 4|0); $904 = HEAP32[$902>>2]|0; $905 = $904 & -8; $906 = ($905|0)==($qsize$0$i$i|0); if ($906) { $T$0$lcssa$i25$i = $903; break L418; } else { $K8$051$i$i = $901;$T$050$i$i = $903; } } $910 = HEAP32[(9080)>>2]|0; $911 = ($$lcssa>>>0)<($910>>>0); if ($911) { _abort(); // unreachable; } else { HEAP32[$$lcssa>>2] = $724; $$sum23$i$i = (($$sum$i19$i) + 24)|0; $912 = (($tbase$255$i) + ($$sum23$i$i)|0); HEAP32[$912>>2] = $T$050$i$i$lcssa; $$sum24$i$i = (($$sum$i19$i) + 12)|0; $913 = (($tbase$255$i) + ($$sum24$i$i)|0); HEAP32[$913>>2] = $724; $$sum25$i$i = (($$sum$i19$i) + 8)|0; $914 = (($tbase$255$i) + ($$sum25$i$i)|0); HEAP32[$914>>2] = $724; break L324; } } } while(0); $915 = ((($T$0$lcssa$i25$i)) + 8|0); $916 = HEAP32[$915>>2]|0; $917 = HEAP32[(9080)>>2]|0; $918 = ($916>>>0)>=($917>>>0); $not$$i26$i = ($T$0$lcssa$i25$i>>>0)>=($917>>>0); $919 = $918 & $not$$i26$i; if ($919) { $920 = ((($916)) + 12|0); HEAP32[$920>>2] = $724; HEAP32[$915>>2] = $724; $$sum20$i$i = (($$sum$i19$i) + 8)|0; $921 = (($tbase$255$i) + ($$sum20$i$i)|0); HEAP32[$921>>2] = $916; $$sum21$i$i = (($$sum$i19$i) + 12)|0; $922 = (($tbase$255$i) + ($$sum21$i$i)|0); HEAP32[$922>>2] = $T$0$lcssa$i25$i; $$sum22$i$i = (($$sum$i19$i) + 24)|0; $923 = (($tbase$255$i) + ($$sum22$i$i)|0); HEAP32[$923>>2] = 0; break; } else { _abort(); // unreachable; } } } while(0); $$sum1819$i$i = $711 | 8; $924 = (($tbase$255$i) + ($$sum1819$i$i)|0); $mem$0 = $924; return ($mem$0|0); } else { $sp$0$i$i$i = (9512); } } while(1) { $925 = HEAP32[$sp$0$i$i$i>>2]|0; $926 = ($925>>>0)>($635>>>0); if (!($926)) { $927 = ((($sp$0$i$i$i)) + 4|0); $928 = HEAP32[$927>>2]|0; $929 = (($925) + ($928)|0); $930 = ($929>>>0)>($635>>>0); if ($930) { $$lcssa215 = $925;$$lcssa216 = $928;$$lcssa217 = $929; break; } } $931 = ((($sp$0$i$i$i)) + 8|0); $932 = HEAP32[$931>>2]|0; $sp$0$i$i$i = $932; } $$sum$i14$i = (($$lcssa216) + -47)|0; $$sum1$i15$i = (($$lcssa216) + -39)|0; $933 = (($$lcssa215) + ($$sum1$i15$i)|0); $934 = $933; $935 = $934 & 7; $936 = ($935|0)==(0); $937 = (0 - ($934))|0; $938 = $937 & 7; $939 = $936 ? 0 : $938; $$sum2$i16$i = (($$sum$i14$i) + ($939))|0; $940 = (($$lcssa215) + ($$sum2$i16$i)|0); $941 = ((($635)) + 16|0); $942 = ($940>>>0)<($941>>>0); $943 = $942 ? $635 : $940; $944 = ((($943)) + 8|0); $945 = (($tsize$254$i) + -40)|0; $946 = ((($tbase$255$i)) + 8|0); $947 = $946; $948 = $947 & 7; $949 = ($948|0)==(0); $950 = (0 - ($947))|0; $951 = $950 & 7; $952 = $949 ? 0 : $951; $953 = (($tbase$255$i) + ($952)|0); $954 = (($945) - ($952))|0; HEAP32[(9088)>>2] = $953; HEAP32[(9076)>>2] = $954; $955 = $954 | 1; $$sum$i$i$i = (($952) + 4)|0; $956 = (($tbase$255$i) + ($$sum$i$i$i)|0); HEAP32[$956>>2] = $955; $$sum2$i$i$i = (($tsize$254$i) + -36)|0; $957 = (($tbase$255$i) + ($$sum2$i$i$i)|0); HEAP32[$957>>2] = 40; $958 = HEAP32[(9552)>>2]|0; HEAP32[(9092)>>2] = $958; $959 = ((($943)) + 4|0); HEAP32[$959>>2] = 27; ;HEAP32[$944>>2]=HEAP32[(9512)>>2]|0;HEAP32[$944+4>>2]=HEAP32[(9512)+4>>2]|0;HEAP32[$944+8>>2]=HEAP32[(9512)+8>>2]|0;HEAP32[$944+12>>2]=HEAP32[(9512)+12>>2]|0; HEAP32[(9512)>>2] = $tbase$255$i; HEAP32[(9516)>>2] = $tsize$254$i; HEAP32[(9524)>>2] = 0; HEAP32[(9520)>>2] = $944; $960 = ((($943)) + 28|0); HEAP32[$960>>2] = 7; $961 = ((($943)) + 32|0); $962 = ($961>>>0)<($$lcssa217>>>0); if ($962) { $964 = $960; while(1) { $963 = ((($964)) + 4|0); HEAP32[$963>>2] = 7; $965 = ((($964)) + 8|0); $966 = ($965>>>0)<($$lcssa217>>>0); if ($966) { $964 = $963; } else { break; } } } $967 = ($943|0)==($635|0); if (!($967)) { $968 = $943; $969 = $635; $970 = (($968) - ($969))|0; $971 = HEAP32[$959>>2]|0; $972 = $971 & -2; HEAP32[$959>>2] = $972; $973 = $970 | 1; $974 = ((($635)) + 4|0); HEAP32[$974>>2] = $973; HEAP32[$943>>2] = $970; $975 = $970 >>> 3; $976 = ($970>>>0)<(256); if ($976) { $977 = $975 << 1; $978 = (9104 + ($977<<2)|0); $979 = HEAP32[9064>>2]|0; $980 = 1 << $975; $981 = $979 & $980; $982 = ($981|0)==(0); if ($982) { $983 = $979 | $980; HEAP32[9064>>2] = $983; $$pre$i$i = (($977) + 2)|0; $$pre14$i$i = (9104 + ($$pre$i$i<<2)|0); $$pre$phi$i$iZ2D = $$pre14$i$i;$F$0$i$i = $978; } else { $$sum4$i$i = (($977) + 2)|0; $984 = (9104 + ($$sum4$i$i<<2)|0); $985 = HEAP32[$984>>2]|0; $986 = HEAP32[(9080)>>2]|0; $987 = ($985>>>0)<($986>>>0); if ($987) { _abort(); // unreachable; } else { $$pre$phi$i$iZ2D = $984;$F$0$i$i = $985; } } HEAP32[$$pre$phi$i$iZ2D>>2] = $635; $988 = ((($F$0$i$i)) + 12|0); HEAP32[$988>>2] = $635; $989 = ((($635)) + 8|0); HEAP32[$989>>2] = $F$0$i$i; $990 = ((($635)) + 12|0); HEAP32[$990>>2] = $978; break; } $991 = $970 >>> 8; $992 = ($991|0)==(0); if ($992) { $I1$0$i$i = 0; } else { $993 = ($970>>>0)>(16777215); if ($993) { $I1$0$i$i = 31; } else { $994 = (($991) + 1048320)|0; $995 = $994 >>> 16; $996 = $995 & 8; $997 = $991 << $996; $998 = (($997) + 520192)|0; $999 = $998 >>> 16; $1000 = $999 & 4; $1001 = $1000 | $996; $1002 = $997 << $1000; $1003 = (($1002) + 245760)|0; $1004 = $1003 >>> 16; $1005 = $1004 & 2; $1006 = $1001 | $1005; $1007 = (14 - ($1006))|0; $1008 = $1002 << $1005; $1009 = $1008 >>> 15; $1010 = (($1007) + ($1009))|0; $1011 = $1010 << 1; $1012 = (($1010) + 7)|0; $1013 = $970 >>> $1012; $1014 = $1013 & 1; $1015 = $1014 | $1011; $I1$0$i$i = $1015; } } $1016 = (9368 + ($I1$0$i$i<<2)|0); $1017 = ((($635)) + 28|0); HEAP32[$1017>>2] = $I1$0$i$i; $1018 = ((($635)) + 20|0); HEAP32[$1018>>2] = 0; HEAP32[$941>>2] = 0; $1019 = HEAP32[(9068)>>2]|0; $1020 = 1 << $I1$0$i$i; $1021 = $1019 & $1020; $1022 = ($1021|0)==(0); if ($1022) { $1023 = $1019 | $1020; HEAP32[(9068)>>2] = $1023; HEAP32[$1016>>2] = $635; $1024 = ((($635)) + 24|0); HEAP32[$1024>>2] = $1016; $1025 = ((($635)) + 12|0); HEAP32[$1025>>2] = $635; $1026 = ((($635)) + 8|0); HEAP32[$1026>>2] = $635; break; } $1027 = HEAP32[$1016>>2]|0; $1028 = ((($1027)) + 4|0); $1029 = HEAP32[$1028>>2]|0; $1030 = $1029 & -8; $1031 = ($1030|0)==($970|0); L459: do { if ($1031) { $T$0$lcssa$i$i = $1027; } else { $1032 = ($I1$0$i$i|0)==(31); $1033 = $I1$0$i$i >>> 1; $1034 = (25 - ($1033))|0; $1035 = $1032 ? 0 : $1034; $1036 = $970 << $1035; $K2$07$i$i = $1036;$T$06$i$i = $1027; while(1) { $1043 = $K2$07$i$i >>> 31; $1044 = (((($T$06$i$i)) + 16|0) + ($1043<<2)|0); $1039 = HEAP32[$1044>>2]|0; $1045 = ($1039|0)==(0|0); if ($1045) { $$lcssa211 = $1044;$T$06$i$i$lcssa = $T$06$i$i; break; } $1037 = $K2$07$i$i << 1; $1038 = ((($1039)) + 4|0); $1040 = HEAP32[$1038>>2]|0; $1041 = $1040 & -8; $1042 = ($1041|0)==($970|0); if ($1042) { $T$0$lcssa$i$i = $1039; break L459; } else { $K2$07$i$i = $1037;$T$06$i$i = $1039; } } $1046 = HEAP32[(9080)>>2]|0; $1047 = ($$lcssa211>>>0)<($1046>>>0); if ($1047) { _abort(); // unreachable; } else { HEAP32[$$lcssa211>>2] = $635; $1048 = ((($635)) + 24|0); HEAP32[$1048>>2] = $T$06$i$i$lcssa; $1049 = ((($635)) + 12|0); HEAP32[$1049>>2] = $635; $1050 = ((($635)) + 8|0); HEAP32[$1050>>2] = $635; break L299; } } } while(0); $1051 = ((($T$0$lcssa$i$i)) + 8|0); $1052 = HEAP32[$1051>>2]|0; $1053 = HEAP32[(9080)>>2]|0; $1054 = ($1052>>>0)>=($1053>>>0); $not$$i$i = ($T$0$lcssa$i$i>>>0)>=($1053>>>0); $1055 = $1054 & $not$$i$i; if ($1055) { $1056 = ((($1052)) + 12|0); HEAP32[$1056>>2] = $635; HEAP32[$1051>>2] = $635; $1057 = ((($635)) + 8|0); HEAP32[$1057>>2] = $1052; $1058 = ((($635)) + 12|0); HEAP32[$1058>>2] = $T$0$lcssa$i$i; $1059 = ((($635)) + 24|0); HEAP32[$1059>>2] = 0; break; } else { _abort(); // unreachable; } } } } while(0); $1060 = HEAP32[(9076)>>2]|0; $1061 = ($1060>>>0)>($nb$0>>>0); if ($1061) { $1062 = (($1060) - ($nb$0))|0; HEAP32[(9076)>>2] = $1062; $1063 = HEAP32[(9088)>>2]|0; $1064 = (($1063) + ($nb$0)|0); HEAP32[(9088)>>2] = $1064; $1065 = $1062 | 1; $$sum$i32 = (($nb$0) + 4)|0; $1066 = (($1063) + ($$sum$i32)|0); HEAP32[$1066>>2] = $1065; $1067 = $nb$0 | 3; $1068 = ((($1063)) + 4|0); HEAP32[$1068>>2] = $1067; $1069 = ((($1063)) + 8|0); $mem$0 = $1069; return ($mem$0|0); } } $1070 = (___errno_location()|0); HEAP32[$1070>>2] = 12; $mem$0 = 0; return ($mem$0|0); } function _free($mem) { $mem = $mem|0; var $$lcssa = 0, $$pre = 0, $$pre$phi59Z2D = 0, $$pre$phi61Z2D = 0, $$pre$phiZ2D = 0, $$pre57 = 0, $$pre58 = 0, $$pre60 = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum1718 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0; var $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum5 = 0, $$sum67 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0; var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0; var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0; var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0; var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0; var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0; var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0; var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0; var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0; var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0; var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0; var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0; var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0; var $321 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0; var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0; var $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0; var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I18$0 = 0, $K19$052 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0; var $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$051 = 0, $T$051$lcssa = 0, $cond = 0, $cond47 = 0, $not$ = 0, $p$0 = 0, $psize$0 = 0, $psize$1 = 0, $sp$0$i = 0, $sp$0$in$i = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($mem|0)==(0|0); if ($0) { return; } $1 = ((($mem)) + -8|0); $2 = HEAP32[(9080)>>2]|0; $3 = ($1>>>0)<($2>>>0); if ($3) { _abort(); // unreachable; } $4 = ((($mem)) + -4|0); $5 = HEAP32[$4>>2]|0; $6 = $5 & 3; $7 = ($6|0)==(1); if ($7) { _abort(); // unreachable; } $8 = $5 & -8; $$sum = (($8) + -8)|0; $9 = (($mem) + ($$sum)|0); $10 = $5 & 1; $11 = ($10|0)==(0); do { if ($11) { $12 = HEAP32[$1>>2]|0; $13 = ($6|0)==(0); if ($13) { return; } $$sum2 = (-8 - ($12))|0; $14 = (($mem) + ($$sum2)|0); $15 = (($12) + ($8))|0; $16 = ($14>>>0)<($2>>>0); if ($16) { _abort(); // unreachable; } $17 = HEAP32[(9084)>>2]|0; $18 = ($14|0)==($17|0); if ($18) { $$sum3 = (($8) + -4)|0; $103 = (($mem) + ($$sum3)|0); $104 = HEAP32[$103>>2]|0; $105 = $104 & 3; $106 = ($105|0)==(3); if (!($106)) { $p$0 = $14;$psize$0 = $15; break; } HEAP32[(9072)>>2] = $15; $107 = $104 & -2; HEAP32[$103>>2] = $107; $108 = $15 | 1; $$sum20 = (($$sum2) + 4)|0; $109 = (($mem) + ($$sum20)|0); HEAP32[$109>>2] = $108; HEAP32[$9>>2] = $15; return; } $19 = $12 >>> 3; $20 = ($12>>>0)<(256); if ($20) { $$sum30 = (($$sum2) + 8)|0; $21 = (($mem) + ($$sum30)|0); $22 = HEAP32[$21>>2]|0; $$sum31 = (($$sum2) + 12)|0; $23 = (($mem) + ($$sum31)|0); $24 = HEAP32[$23>>2]|0; $25 = $19 << 1; $26 = (9104 + ($25<<2)|0); $27 = ($22|0)==($26|0); if (!($27)) { $28 = ($22>>>0)<($2>>>0); if ($28) { _abort(); // unreachable; } $29 = ((($22)) + 12|0); $30 = HEAP32[$29>>2]|0; $31 = ($30|0)==($14|0); if (!($31)) { _abort(); // unreachable; } } $32 = ($24|0)==($22|0); if ($32) { $33 = 1 << $19; $34 = $33 ^ -1; $35 = HEAP32[9064>>2]|0; $36 = $35 & $34; HEAP32[9064>>2] = $36; $p$0 = $14;$psize$0 = $15; break; } $37 = ($24|0)==($26|0); if ($37) { $$pre60 = ((($24)) + 8|0); $$pre$phi61Z2D = $$pre60; } else { $38 = ($24>>>0)<($2>>>0); if ($38) { _abort(); // unreachable; } $39 = ((($24)) + 8|0); $40 = HEAP32[$39>>2]|0; $41 = ($40|0)==($14|0); if ($41) { $$pre$phi61Z2D = $39; } else { _abort(); // unreachable; } } $42 = ((($22)) + 12|0); HEAP32[$42>>2] = $24; HEAP32[$$pre$phi61Z2D>>2] = $22; $p$0 = $14;$psize$0 = $15; break; } $$sum22 = (($$sum2) + 24)|0; $43 = (($mem) + ($$sum22)|0); $44 = HEAP32[$43>>2]|0; $$sum23 = (($$sum2) + 12)|0; $45 = (($mem) + ($$sum23)|0); $46 = HEAP32[$45>>2]|0; $47 = ($46|0)==($14|0); do { if ($47) { $$sum25 = (($$sum2) + 20)|0; $57 = (($mem) + ($$sum25)|0); $58 = HEAP32[$57>>2]|0; $59 = ($58|0)==(0|0); if ($59) { $$sum24 = (($$sum2) + 16)|0; $60 = (($mem) + ($$sum24)|0); $61 = HEAP32[$60>>2]|0; $62 = ($61|0)==(0|0); if ($62) { $R$1 = 0; break; } else { $R$0 = $61;$RP$0 = $60; } } else { $R$0 = $58;$RP$0 = $57; } while(1) { $63 = ((($R$0)) + 20|0); $64 = HEAP32[$63>>2]|0; $65 = ($64|0)==(0|0); if (!($65)) { $R$0 = $64;$RP$0 = $63; continue; } $66 = ((($R$0)) + 16|0); $67 = HEAP32[$66>>2]|0; $68 = ($67|0)==(0|0); if ($68) { $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; break; } else { $R$0 = $67;$RP$0 = $66; } } $69 = ($RP$0$lcssa>>>0)<($2>>>0); if ($69) { _abort(); // unreachable; } else { HEAP32[$RP$0$lcssa>>2] = 0; $R$1 = $R$0$lcssa; break; } } else { $$sum29 = (($$sum2) + 8)|0; $48 = (($mem) + ($$sum29)|0); $49 = HEAP32[$48>>2]|0; $50 = ($49>>>0)<($2>>>0); if ($50) { _abort(); // unreachable; } $51 = ((($49)) + 12|0); $52 = HEAP32[$51>>2]|0; $53 = ($52|0)==($14|0); if (!($53)) { _abort(); // unreachable; } $54 = ((($46)) + 8|0); $55 = HEAP32[$54>>2]|0; $56 = ($55|0)==($14|0); if ($56) { HEAP32[$51>>2] = $46; HEAP32[$54>>2] = $49; $R$1 = $46; break; } else { _abort(); // unreachable; } } } while(0); $70 = ($44|0)==(0|0); if ($70) { $p$0 = $14;$psize$0 = $15; } else { $$sum26 = (($$sum2) + 28)|0; $71 = (($mem) + ($$sum26)|0); $72 = HEAP32[$71>>2]|0; $73 = (9368 + ($72<<2)|0); $74 = HEAP32[$73>>2]|0; $75 = ($14|0)==($74|0); if ($75) { HEAP32[$73>>2] = $R$1; $cond = ($R$1|0)==(0|0); if ($cond) { $76 = 1 << $72; $77 = $76 ^ -1; $78 = HEAP32[(9068)>>2]|0; $79 = $78 & $77; HEAP32[(9068)>>2] = $79; $p$0 = $14;$psize$0 = $15; break; } } else { $80 = HEAP32[(9080)>>2]|0; $81 = ($44>>>0)<($80>>>0); if ($81) { _abort(); // unreachable; } $82 = ((($44)) + 16|0); $83 = HEAP32[$82>>2]|0; $84 = ($83|0)==($14|0); if ($84) { HEAP32[$82>>2] = $R$1; } else { $85 = ((($44)) + 20|0); HEAP32[$85>>2] = $R$1; } $86 = ($R$1|0)==(0|0); if ($86) { $p$0 = $14;$psize$0 = $15; break; } } $87 = HEAP32[(9080)>>2]|0; $88 = ($R$1>>>0)<($87>>>0); if ($88) { _abort(); // unreachable; } $89 = ((($R$1)) + 24|0); HEAP32[$89>>2] = $44; $$sum27 = (($$sum2) + 16)|0; $90 = (($mem) + ($$sum27)|0); $91 = HEAP32[$90>>2]|0; $92 = ($91|0)==(0|0); do { if (!($92)) { $93 = ($91>>>0)<($87>>>0); if ($93) { _abort(); // unreachable; } else { $94 = ((($R$1)) + 16|0); HEAP32[$94>>2] = $91; $95 = ((($91)) + 24|0); HEAP32[$95>>2] = $R$1; break; } } } while(0); $$sum28 = (($$sum2) + 20)|0; $96 = (($mem) + ($$sum28)|0); $97 = HEAP32[$96>>2]|0; $98 = ($97|0)==(0|0); if ($98) { $p$0 = $14;$psize$0 = $15; } else { $99 = HEAP32[(9080)>>2]|0; $100 = ($97>>>0)<($99>>>0); if ($100) { _abort(); // unreachable; } else { $101 = ((($R$1)) + 20|0); HEAP32[$101>>2] = $97; $102 = ((($97)) + 24|0); HEAP32[$102>>2] = $R$1; $p$0 = $14;$psize$0 = $15; break; } } } } else { $p$0 = $1;$psize$0 = $8; } } while(0); $110 = ($p$0>>>0)<($9>>>0); if (!($110)) { _abort(); // unreachable; } $$sum19 = (($8) + -4)|0; $111 = (($mem) + ($$sum19)|0); $112 = HEAP32[$111>>2]|0; $113 = $112 & 1; $114 = ($113|0)==(0); if ($114) { _abort(); // unreachable; } $115 = $112 & 2; $116 = ($115|0)==(0); if ($116) { $117 = HEAP32[(9088)>>2]|0; $118 = ($9|0)==($117|0); if ($118) { $119 = HEAP32[(9076)>>2]|0; $120 = (($119) + ($psize$0))|0; HEAP32[(9076)>>2] = $120; HEAP32[(9088)>>2] = $p$0; $121 = $120 | 1; $122 = ((($p$0)) + 4|0); HEAP32[$122>>2] = $121; $123 = HEAP32[(9084)>>2]|0; $124 = ($p$0|0)==($123|0); if (!($124)) { return; } HEAP32[(9084)>>2] = 0; HEAP32[(9072)>>2] = 0; return; } $125 = HEAP32[(9084)>>2]|0; $126 = ($9|0)==($125|0); if ($126) { $127 = HEAP32[(9072)>>2]|0; $128 = (($127) + ($psize$0))|0; HEAP32[(9072)>>2] = $128; HEAP32[(9084)>>2] = $p$0; $129 = $128 | 1; $130 = ((($p$0)) + 4|0); HEAP32[$130>>2] = $129; $131 = (($p$0) + ($128)|0); HEAP32[$131>>2] = $128; return; } $132 = $112 & -8; $133 = (($132) + ($psize$0))|0; $134 = $112 >>> 3; $135 = ($112>>>0)<(256); do { if ($135) { $136 = (($mem) + ($8)|0); $137 = HEAP32[$136>>2]|0; $$sum1718 = $8 | 4; $138 = (($mem) + ($$sum1718)|0); $139 = HEAP32[$138>>2]|0; $140 = $134 << 1; $141 = (9104 + ($140<<2)|0); $142 = ($137|0)==($141|0); if (!($142)) { $143 = HEAP32[(9080)>>2]|0; $144 = ($137>>>0)<($143>>>0); if ($144) { _abort(); // unreachable; } $145 = ((($137)) + 12|0); $146 = HEAP32[$145>>2]|0; $147 = ($146|0)==($9|0); if (!($147)) { _abort(); // unreachable; } } $148 = ($139|0)==($137|0); if ($148) { $149 = 1 << $134; $150 = $149 ^ -1; $151 = HEAP32[9064>>2]|0; $152 = $151 & $150; HEAP32[9064>>2] = $152; break; } $153 = ($139|0)==($141|0); if ($153) { $$pre58 = ((($139)) + 8|0); $$pre$phi59Z2D = $$pre58; } else { $154 = HEAP32[(9080)>>2]|0; $155 = ($139>>>0)<($154>>>0); if ($155) { _abort(); // unreachable; } $156 = ((($139)) + 8|0); $157 = HEAP32[$156>>2]|0; $158 = ($157|0)==($9|0); if ($158) { $$pre$phi59Z2D = $156; } else { _abort(); // unreachable; } } $159 = ((($137)) + 12|0); HEAP32[$159>>2] = $139; HEAP32[$$pre$phi59Z2D>>2] = $137; } else { $$sum5 = (($8) + 16)|0; $160 = (($mem) + ($$sum5)|0); $161 = HEAP32[$160>>2]|0; $$sum67 = $8 | 4; $162 = (($mem) + ($$sum67)|0); $163 = HEAP32[$162>>2]|0; $164 = ($163|0)==($9|0); do { if ($164) { $$sum9 = (($8) + 12)|0; $175 = (($mem) + ($$sum9)|0); $176 = HEAP32[$175>>2]|0; $177 = ($176|0)==(0|0); if ($177) { $$sum8 = (($8) + 8)|0; $178 = (($mem) + ($$sum8)|0); $179 = HEAP32[$178>>2]|0; $180 = ($179|0)==(0|0); if ($180) { $R7$1 = 0; break; } else { $R7$0 = $179;$RP9$0 = $178; } } else { $R7$0 = $176;$RP9$0 = $175; } while(1) { $181 = ((($R7$0)) + 20|0); $182 = HEAP32[$181>>2]|0; $183 = ($182|0)==(0|0); if (!($183)) { $R7$0 = $182;$RP9$0 = $181; continue; } $184 = ((($R7$0)) + 16|0); $185 = HEAP32[$184>>2]|0; $186 = ($185|0)==(0|0); if ($186) { $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0; break; } else { $R7$0 = $185;$RP9$0 = $184; } } $187 = HEAP32[(9080)>>2]|0; $188 = ($RP9$0$lcssa>>>0)<($187>>>0); if ($188) { _abort(); // unreachable; } else { HEAP32[$RP9$0$lcssa>>2] = 0; $R7$1 = $R7$0$lcssa; break; } } else { $165 = (($mem) + ($8)|0); $166 = HEAP32[$165>>2]|0; $167 = HEAP32[(9080)>>2]|0; $168 = ($166>>>0)<($167>>>0); if ($168) { _abort(); // unreachable; } $169 = ((($166)) + 12|0); $170 = HEAP32[$169>>2]|0; $171 = ($170|0)==($9|0); if (!($171)) { _abort(); // unreachable; } $172 = ((($163)) + 8|0); $173 = HEAP32[$172>>2]|0; $174 = ($173|0)==($9|0); if ($174) { HEAP32[$169>>2] = $163; HEAP32[$172>>2] = $166; $R7$1 = $163; break; } else { _abort(); // unreachable; } } } while(0); $189 = ($161|0)==(0|0); if (!($189)) { $$sum12 = (($8) + 20)|0; $190 = (($mem) + ($$sum12)|0); $191 = HEAP32[$190>>2]|0; $192 = (9368 + ($191<<2)|0); $193 = HEAP32[$192>>2]|0; $194 = ($9|0)==($193|0); if ($194) { HEAP32[$192>>2] = $R7$1; $cond47 = ($R7$1|0)==(0|0); if ($cond47) { $195 = 1 << $191; $196 = $195 ^ -1; $197 = HEAP32[(9068)>>2]|0; $198 = $197 & $196; HEAP32[(9068)>>2] = $198; break; } } else { $199 = HEAP32[(9080)>>2]|0; $200 = ($161>>>0)<($199>>>0); if ($200) { _abort(); // unreachable; } $201 = ((($161)) + 16|0); $202 = HEAP32[$201>>2]|0; $203 = ($202|0)==($9|0); if ($203) { HEAP32[$201>>2] = $R7$1; } else { $204 = ((($161)) + 20|0); HEAP32[$204>>2] = $R7$1; } $205 = ($R7$1|0)==(0|0); if ($205) { break; } } $206 = HEAP32[(9080)>>2]|0; $207 = ($R7$1>>>0)<($206>>>0); if ($207) { _abort(); // unreachable; } $208 = ((($R7$1)) + 24|0); HEAP32[$208>>2] = $161; $$sum13 = (($8) + 8)|0; $209 = (($mem) + ($$sum13)|0); $210 = HEAP32[$209>>2]|0; $211 = ($210|0)==(0|0); do { if (!($211)) { $212 = ($210>>>0)<($206>>>0); if ($212) { _abort(); // unreachable; } else { $213 = ((($R7$1)) + 16|0); HEAP32[$213>>2] = $210; $214 = ((($210)) + 24|0); HEAP32[$214>>2] = $R7$1; break; } } } while(0); $$sum14 = (($8) + 12)|0; $215 = (($mem) + ($$sum14)|0); $216 = HEAP32[$215>>2]|0; $217 = ($216|0)==(0|0); if (!($217)) { $218 = HEAP32[(9080)>>2]|0; $219 = ($216>>>0)<($218>>>0); if ($219) { _abort(); // unreachable; } else { $220 = ((($R7$1)) + 20|0); HEAP32[$220>>2] = $216; $221 = ((($216)) + 24|0); HEAP32[$221>>2] = $R7$1; break; } } } } } while(0); $222 = $133 | 1; $223 = ((($p$0)) + 4|0); HEAP32[$223>>2] = $222; $224 = (($p$0) + ($133)|0); HEAP32[$224>>2] = $133; $225 = HEAP32[(9084)>>2]|0; $226 = ($p$0|0)==($225|0); if ($226) { HEAP32[(9072)>>2] = $133; return; } else { $psize$1 = $133; } } else { $227 = $112 & -2; HEAP32[$111>>2] = $227; $228 = $psize$0 | 1; $229 = ((($p$0)) + 4|0); HEAP32[$229>>2] = $228; $230 = (($p$0) + ($psize$0)|0); HEAP32[$230>>2] = $psize$0; $psize$1 = $psize$0; } $231 = $psize$1 >>> 3; $232 = ($psize$1>>>0)<(256); if ($232) { $233 = $231 << 1; $234 = (9104 + ($233<<2)|0); $235 = HEAP32[9064>>2]|0; $236 = 1 << $231; $237 = $235 & $236; $238 = ($237|0)==(0); if ($238) { $239 = $235 | $236; HEAP32[9064>>2] = $239; $$pre = (($233) + 2)|0; $$pre57 = (9104 + ($$pre<<2)|0); $$pre$phiZ2D = $$pre57;$F16$0 = $234; } else { $$sum11 = (($233) + 2)|0; $240 = (9104 + ($$sum11<<2)|0); $241 = HEAP32[$240>>2]|0; $242 = HEAP32[(9080)>>2]|0; $243 = ($241>>>0)<($242>>>0); if ($243) { _abort(); // unreachable; } else { $$pre$phiZ2D = $240;$F16$0 = $241; } } HEAP32[$$pre$phiZ2D>>2] = $p$0; $244 = ((($F16$0)) + 12|0); HEAP32[$244>>2] = $p$0; $245 = ((($p$0)) + 8|0); HEAP32[$245>>2] = $F16$0; $246 = ((($p$0)) + 12|0); HEAP32[$246>>2] = $234; return; } $247 = $psize$1 >>> 8; $248 = ($247|0)==(0); if ($248) { $I18$0 = 0; } else { $249 = ($psize$1>>>0)>(16777215); if ($249) { $I18$0 = 31; } else { $250 = (($247) + 1048320)|0; $251 = $250 >>> 16; $252 = $251 & 8; $253 = $247 << $252; $254 = (($253) + 520192)|0; $255 = $254 >>> 16; $256 = $255 & 4; $257 = $256 | $252; $258 = $253 << $256; $259 = (($258) + 245760)|0; $260 = $259 >>> 16; $261 = $260 & 2; $262 = $257 | $261; $263 = (14 - ($262))|0; $264 = $258 << $261; $265 = $264 >>> 15; $266 = (($263) + ($265))|0; $267 = $266 << 1; $268 = (($266) + 7)|0; $269 = $psize$1 >>> $268; $270 = $269 & 1; $271 = $270 | $267; $I18$0 = $271; } } $272 = (9368 + ($I18$0<<2)|0); $273 = ((($p$0)) + 28|0); HEAP32[$273>>2] = $I18$0; $274 = ((($p$0)) + 16|0); $275 = ((($p$0)) + 20|0); HEAP32[$275>>2] = 0; HEAP32[$274>>2] = 0; $276 = HEAP32[(9068)>>2]|0; $277 = 1 << $I18$0; $278 = $276 & $277; $279 = ($278|0)==(0); L199: do { if ($279) { $280 = $276 | $277; HEAP32[(9068)>>2] = $280; HEAP32[$272>>2] = $p$0; $281 = ((($p$0)) + 24|0); HEAP32[$281>>2] = $272; $282 = ((($p$0)) + 12|0); HEAP32[$282>>2] = $p$0; $283 = ((($p$0)) + 8|0); HEAP32[$283>>2] = $p$0; } else { $284 = HEAP32[$272>>2]|0; $285 = ((($284)) + 4|0); $286 = HEAP32[$285>>2]|0; $287 = $286 & -8; $288 = ($287|0)==($psize$1|0); L202: do { if ($288) { $T$0$lcssa = $284; } else { $289 = ($I18$0|0)==(31); $290 = $I18$0 >>> 1; $291 = (25 - ($290))|0; $292 = $289 ? 0 : $291; $293 = $psize$1 << $292; $K19$052 = $293;$T$051 = $284; while(1) { $300 = $K19$052 >>> 31; $301 = (((($T$051)) + 16|0) + ($300<<2)|0); $296 = HEAP32[$301>>2]|0; $302 = ($296|0)==(0|0); if ($302) { $$lcssa = $301;$T$051$lcssa = $T$051; break; } $294 = $K19$052 << 1; $295 = ((($296)) + 4|0); $297 = HEAP32[$295>>2]|0; $298 = $297 & -8; $299 = ($298|0)==($psize$1|0); if ($299) { $T$0$lcssa = $296; break L202; } else { $K19$052 = $294;$T$051 = $296; } } $303 = HEAP32[(9080)>>2]|0; $304 = ($$lcssa>>>0)<($303>>>0); if ($304) { _abort(); // unreachable; } else { HEAP32[$$lcssa>>2] = $p$0; $305 = ((($p$0)) + 24|0); HEAP32[$305>>2] = $T$051$lcssa; $306 = ((($p$0)) + 12|0); HEAP32[$306>>2] = $p$0; $307 = ((($p$0)) + 8|0); HEAP32[$307>>2] = $p$0; break L199; } } } while(0); $308 = ((($T$0$lcssa)) + 8|0); $309 = HEAP32[$308>>2]|0; $310 = HEAP32[(9080)>>2]|0; $311 = ($309>>>0)>=($310>>>0); $not$ = ($T$0$lcssa>>>0)>=($310>>>0); $312 = $311 & $not$; if ($312) { $313 = ((($309)) + 12|0); HEAP32[$313>>2] = $p$0; HEAP32[$308>>2] = $p$0; $314 = ((($p$0)) + 8|0); HEAP32[$314>>2] = $309; $315 = ((($p$0)) + 12|0); HEAP32[$315>>2] = $T$0$lcssa; $316 = ((($p$0)) + 24|0); HEAP32[$316>>2] = 0; break; } else { _abort(); // unreachable; } } } while(0); $317 = HEAP32[(9096)>>2]|0; $318 = (($317) + -1)|0; HEAP32[(9096)>>2] = $318; $319 = ($318|0)==(0); if ($319) { $sp$0$in$i = (9520); } else { return; } while(1) { $sp$0$i = HEAP32[$sp$0$in$i>>2]|0; $320 = ($sp$0$i|0)==(0|0); $321 = ((($sp$0$i)) + 8|0); if ($320) { break; } else { $sp$0$in$i = $321; } } HEAP32[(9096)>>2] = -1; return; } function _realloc($oldmem,$bytes) { $oldmem = $oldmem|0; $bytes = $bytes|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $mem$0 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($oldmem|0)==(0|0); if ($0) { $1 = (_malloc($bytes)|0); $mem$0 = $1; return ($mem$0|0); } $2 = ($bytes>>>0)>(4294967231); if ($2) { $3 = (___errno_location()|0); HEAP32[$3>>2] = 12; $mem$0 = 0; return ($mem$0|0); } $4 = ($bytes>>>0)<(11); $5 = (($bytes) + 11)|0; $6 = $5 & -8; $7 = $4 ? 16 : $6; $8 = ((($oldmem)) + -8|0); $9 = (_try_realloc_chunk($8,$7)|0); $10 = ($9|0)==(0|0); if (!($10)) { $11 = ((($9)) + 8|0); $mem$0 = $11; return ($mem$0|0); } $12 = (_malloc($bytes)|0); $13 = ($12|0)==(0|0); if ($13) { $mem$0 = 0; return ($mem$0|0); } $14 = ((($oldmem)) + -4|0); $15 = HEAP32[$14>>2]|0; $16 = $15 & -8; $17 = $15 & 3; $18 = ($17|0)==(0); $19 = $18 ? 8 : 4; $20 = (($16) - ($19))|0; $21 = ($20>>>0)<($bytes>>>0); $22 = $21 ? $20 : $bytes; _memcpy(($12|0),($oldmem|0),($22|0))|0; _free($oldmem); $mem$0 = $12; return ($mem$0|0); } function _try_realloc_chunk($p,$nb) { $p = $p|0; $nb = $nb|0; var $$pre = 0, $$pre$phiZ2D = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum2728 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum78 = 0; var $$sum910 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0; var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0; var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0; var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0; var $17 = 0, $170 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $cond = 0, $newp$0 = 0, $notlhs = 0; var $notrhs = 0, $or$cond$not = 0, $or$cond30 = 0, $storemerge = 0, $storemerge21 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($p)) + 4|0); $1 = HEAP32[$0>>2]|0; $2 = $1 & -8; $3 = (($p) + ($2)|0); $4 = HEAP32[(9080)>>2]|0; $5 = $1 & 3; $notlhs = ($p>>>0)>=($4>>>0); $notrhs = ($5|0)!=(1); $or$cond$not = $notrhs & $notlhs; $6 = ($p>>>0)<($3>>>0); $or$cond30 = $or$cond$not & $6; if (!($or$cond30)) { _abort(); // unreachable; } $$sum2728 = $2 | 4; $7 = (($p) + ($$sum2728)|0); $8 = HEAP32[$7>>2]|0; $9 = $8 & 1; $10 = ($9|0)==(0); if ($10) { _abort(); // unreachable; } $11 = ($5|0)==(0); if ($11) { $12 = ($nb>>>0)<(256); if ($12) { $newp$0 = 0; return ($newp$0|0); } $13 = (($nb) + 4)|0; $14 = ($2>>>0)<($13>>>0); if (!($14)) { $15 = (($2) - ($nb))|0; $16 = HEAP32[(9544)>>2]|0; $17 = $16 << 1; $18 = ($15>>>0)>($17>>>0); if (!($18)) { $newp$0 = $p; return ($newp$0|0); } } $newp$0 = 0; return ($newp$0|0); } $19 = ($2>>>0)<($nb>>>0); if (!($19)) { $20 = (($2) - ($nb))|0; $21 = ($20>>>0)>(15); if (!($21)) { $newp$0 = $p; return ($newp$0|0); } $22 = (($p) + ($nb)|0); $23 = $1 & 1; $24 = $23 | $nb; $25 = $24 | 2; HEAP32[$0>>2] = $25; $$sum23 = (($nb) + 4)|0; $26 = (($p) + ($$sum23)|0); $27 = $20 | 3; HEAP32[$26>>2] = $27; $28 = HEAP32[$7>>2]|0; $29 = $28 | 1; HEAP32[$7>>2] = $29; _dispose_chunk($22,$20); $newp$0 = $p; return ($newp$0|0); } $30 = HEAP32[(9088)>>2]|0; $31 = ($3|0)==($30|0); if ($31) { $32 = HEAP32[(9076)>>2]|0; $33 = (($32) + ($2))|0; $34 = ($33>>>0)>($nb>>>0); if (!($34)) { $newp$0 = 0; return ($newp$0|0); } $35 = (($33) - ($nb))|0; $36 = (($p) + ($nb)|0); $37 = $1 & 1; $38 = $37 | $nb; $39 = $38 | 2; HEAP32[$0>>2] = $39; $$sum22 = (($nb) + 4)|0; $40 = (($p) + ($$sum22)|0); $41 = $35 | 1; HEAP32[$40>>2] = $41; HEAP32[(9088)>>2] = $36; HEAP32[(9076)>>2] = $35; $newp$0 = $p; return ($newp$0|0); } $42 = HEAP32[(9084)>>2]|0; $43 = ($3|0)==($42|0); if ($43) { $44 = HEAP32[(9072)>>2]|0; $45 = (($44) + ($2))|0; $46 = ($45>>>0)<($nb>>>0); if ($46) { $newp$0 = 0; return ($newp$0|0); } $47 = (($45) - ($nb))|0; $48 = ($47>>>0)>(15); if ($48) { $49 = (($p) + ($nb)|0); $50 = (($p) + ($45)|0); $51 = $1 & 1; $52 = $51 | $nb; $53 = $52 | 2; HEAP32[$0>>2] = $53; $$sum19 = (($nb) + 4)|0; $54 = (($p) + ($$sum19)|0); $55 = $47 | 1; HEAP32[$54>>2] = $55; HEAP32[$50>>2] = $47; $$sum20 = (($45) + 4)|0; $56 = (($p) + ($$sum20)|0); $57 = HEAP32[$56>>2]|0; $58 = $57 & -2; HEAP32[$56>>2] = $58; $storemerge = $49;$storemerge21 = $47; } else { $59 = $1 & 1; $60 = $59 | $45; $61 = $60 | 2; HEAP32[$0>>2] = $61; $$sum17 = (($45) + 4)|0; $62 = (($p) + ($$sum17)|0); $63 = HEAP32[$62>>2]|0; $64 = $63 | 1; HEAP32[$62>>2] = $64; $storemerge = 0;$storemerge21 = 0; } HEAP32[(9072)>>2] = $storemerge21; HEAP32[(9084)>>2] = $storemerge; $newp$0 = $p; return ($newp$0|0); } $65 = $8 & 2; $66 = ($65|0)==(0); if (!($66)) { $newp$0 = 0; return ($newp$0|0); } $67 = $8 & -8; $68 = (($67) + ($2))|0; $69 = ($68>>>0)<($nb>>>0); if ($69) { $newp$0 = 0; return ($newp$0|0); } $70 = (($68) - ($nb))|0; $71 = $8 >>> 3; $72 = ($8>>>0)<(256); do { if ($72) { $$sum15 = (($2) + 8)|0; $73 = (($p) + ($$sum15)|0); $74 = HEAP32[$73>>2]|0; $$sum16 = (($2) + 12)|0; $75 = (($p) + ($$sum16)|0); $76 = HEAP32[$75>>2]|0; $77 = $71 << 1; $78 = (9104 + ($77<<2)|0); $79 = ($74|0)==($78|0); if (!($79)) { $80 = ($74>>>0)<($4>>>0); if ($80) { _abort(); // unreachable; } $81 = ((($74)) + 12|0); $82 = HEAP32[$81>>2]|0; $83 = ($82|0)==($3|0); if (!($83)) { _abort(); // unreachable; } } $84 = ($76|0)==($74|0); if ($84) { $85 = 1 << $71; $86 = $85 ^ -1; $87 = HEAP32[9064>>2]|0; $88 = $87 & $86; HEAP32[9064>>2] = $88; break; } $89 = ($76|0)==($78|0); if ($89) { $$pre = ((($76)) + 8|0); $$pre$phiZ2D = $$pre; } else { $90 = ($76>>>0)<($4>>>0); if ($90) { _abort(); // unreachable; } $91 = ((($76)) + 8|0); $92 = HEAP32[$91>>2]|0; $93 = ($92|0)==($3|0); if ($93) { $$pre$phiZ2D = $91; } else { _abort(); // unreachable; } } $94 = ((($74)) + 12|0); HEAP32[$94>>2] = $76; HEAP32[$$pre$phiZ2D>>2] = $74; } else { $$sum = (($2) + 24)|0; $95 = (($p) + ($$sum)|0); $96 = HEAP32[$95>>2]|0; $$sum2 = (($2) + 12)|0; $97 = (($p) + ($$sum2)|0); $98 = HEAP32[$97>>2]|0; $99 = ($98|0)==($3|0); do { if ($99) { $$sum4 = (($2) + 20)|0; $109 = (($p) + ($$sum4)|0); $110 = HEAP32[$109>>2]|0; $111 = ($110|0)==(0|0); if ($111) { $$sum3 = (($2) + 16)|0; $112 = (($p) + ($$sum3)|0); $113 = HEAP32[$112>>2]|0; $114 = ($113|0)==(0|0); if ($114) { $R$1 = 0; break; } else { $R$0 = $113;$RP$0 = $112; } } else { $R$0 = $110;$RP$0 = $109; } while(1) { $115 = ((($R$0)) + 20|0); $116 = HEAP32[$115>>2]|0; $117 = ($116|0)==(0|0); if (!($117)) { $R$0 = $116;$RP$0 = $115; continue; } $118 = ((($R$0)) + 16|0); $119 = HEAP32[$118>>2]|0; $120 = ($119|0)==(0|0); if ($120) { $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; break; } else { $R$0 = $119;$RP$0 = $118; } } $121 = ($RP$0$lcssa>>>0)<($4>>>0); if ($121) { _abort(); // unreachable; } else { HEAP32[$RP$0$lcssa>>2] = 0; $R$1 = $R$0$lcssa; break; } } else { $$sum14 = (($2) + 8)|0; $100 = (($p) + ($$sum14)|0); $101 = HEAP32[$100>>2]|0; $102 = ($101>>>0)<($4>>>0); if ($102) { _abort(); // unreachable; } $103 = ((($101)) + 12|0); $104 = HEAP32[$103>>2]|0; $105 = ($104|0)==($3|0); if (!($105)) { _abort(); // unreachable; } $106 = ((($98)) + 8|0); $107 = HEAP32[$106>>2]|0; $108 = ($107|0)==($3|0); if ($108) { HEAP32[$103>>2] = $98; HEAP32[$106>>2] = $101; $R$1 = $98; break; } else { _abort(); // unreachable; } } } while(0); $122 = ($96|0)==(0|0); if (!($122)) { $$sum11 = (($2) + 28)|0; $123 = (($p) + ($$sum11)|0); $124 = HEAP32[$123>>2]|0; $125 = (9368 + ($124<<2)|0); $126 = HEAP32[$125>>2]|0; $127 = ($3|0)==($126|0); if ($127) { HEAP32[$125>>2] = $R$1; $cond = ($R$1|0)==(0|0); if ($cond) { $128 = 1 << $124; $129 = $128 ^ -1; $130 = HEAP32[(9068)>>2]|0; $131 = $130 & $129; HEAP32[(9068)>>2] = $131; break; } } else { $132 = HEAP32[(9080)>>2]|0; $133 = ($96>>>0)<($132>>>0); if ($133) { _abort(); // unreachable; } $134 = ((($96)) + 16|0); $135 = HEAP32[$134>>2]|0; $136 = ($135|0)==($3|0); if ($136) { HEAP32[$134>>2] = $R$1; } else { $137 = ((($96)) + 20|0); HEAP32[$137>>2] = $R$1; } $138 = ($R$1|0)==(0|0); if ($138) { break; } } $139 = HEAP32[(9080)>>2]|0; $140 = ($R$1>>>0)<($139>>>0); if ($140) { _abort(); // unreachable; } $141 = ((($R$1)) + 24|0); HEAP32[$141>>2] = $96; $$sum12 = (($2) + 16)|0; $142 = (($p) + ($$sum12)|0); $143 = HEAP32[$142>>2]|0; $144 = ($143|0)==(0|0); do { if (!($144)) { $145 = ($143>>>0)<($139>>>0); if ($145) { _abort(); // unreachable; } else { $146 = ((($R$1)) + 16|0); HEAP32[$146>>2] = $143; $147 = ((($143)) + 24|0); HEAP32[$147>>2] = $R$1; break; } } } while(0); $$sum13 = (($2) + 20)|0; $148 = (($p) + ($$sum13)|0); $149 = HEAP32[$148>>2]|0; $150 = ($149|0)==(0|0); if (!($150)) { $151 = HEAP32[(9080)>>2]|0; $152 = ($149>>>0)<($151>>>0); if ($152) { _abort(); // unreachable; } else { $153 = ((($R$1)) + 20|0); HEAP32[$153>>2] = $149; $154 = ((($149)) + 24|0); HEAP32[$154>>2] = $R$1; break; } } } } } while(0); $155 = ($70>>>0)<(16); if ($155) { $156 = $1 & 1; $157 = $68 | $156; $158 = $157 | 2; HEAP32[$0>>2] = $158; $$sum910 = $68 | 4; $159 = (($p) + ($$sum910)|0); $160 = HEAP32[$159>>2]|0; $161 = $160 | 1; HEAP32[$159>>2] = $161; $newp$0 = $p; return ($newp$0|0); } else { $162 = (($p) + ($nb)|0); $163 = $1 & 1; $164 = $163 | $nb; $165 = $164 | 2; HEAP32[$0>>2] = $165; $$sum5 = (($nb) + 4)|0; $166 = (($p) + ($$sum5)|0); $167 = $70 | 3; HEAP32[$166>>2] = $167; $$sum78 = $68 | 4; $168 = (($p) + ($$sum78)|0); $169 = HEAP32[$168>>2]|0; $170 = $169 | 1; HEAP32[$168>>2] = $170; _dispose_chunk($162,$70); $newp$0 = $p; return ($newp$0|0); } return (0)|0; } function _dispose_chunk($p,$psize) { $p = $p|0; $psize = $psize|0; var $$0 = 0, $$02 = 0, $$1 = 0, $$lcssa = 0, $$pre = 0, $$pre$phi50Z2D = 0, $$pre$phi52Z2D = 0, $$pre$phiZ2D = 0, $$pre48 = 0, $$pre49 = 0, $$pre51 = 0, $$sum = 0, $$sum1 = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum16 = 0, $$sum17 = 0; var $$sum18 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0; var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0; var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0; var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0; var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0; var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0; var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0; var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0; var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0; var $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0; var $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0; var $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0; var $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; var $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I19$0 = 0, $K20$043 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$042 = 0, $T$042$lcssa = 0, $cond = 0; var $cond39 = 0, $not$ = 0, label = 0, sp = 0; sp = STACKTOP; $0 = (($p) + ($psize)|0); $1 = ((($p)) + 4|0); $2 = HEAP32[$1>>2]|0; $3 = $2 & 1; $4 = ($3|0)==(0); do { if ($4) { $5 = HEAP32[$p>>2]|0; $6 = $2 & 3; $7 = ($6|0)==(0); if ($7) { return; } $8 = (0 - ($5))|0; $9 = (($p) + ($8)|0); $10 = (($5) + ($psize))|0; $11 = HEAP32[(9080)>>2]|0; $12 = ($9>>>0)<($11>>>0); if ($12) { _abort(); // unreachable; } $13 = HEAP32[(9084)>>2]|0; $14 = ($9|0)==($13|0); if ($14) { $$sum = (($psize) + 4)|0; $99 = (($p) + ($$sum)|0); $100 = HEAP32[$99>>2]|0; $101 = $100 & 3; $102 = ($101|0)==(3); if (!($102)) { $$0 = $9;$$02 = $10; break; } HEAP32[(9072)>>2] = $10; $103 = $100 & -2; HEAP32[$99>>2] = $103; $104 = $10 | 1; $$sum14 = (4 - ($5))|0; $105 = (($p) + ($$sum14)|0); HEAP32[$105>>2] = $104; HEAP32[$0>>2] = $10; return; } $15 = $5 >>> 3; $16 = ($5>>>0)<(256); if ($16) { $$sum24 = (8 - ($5))|0; $17 = (($p) + ($$sum24)|0); $18 = HEAP32[$17>>2]|0; $$sum25 = (12 - ($5))|0; $19 = (($p) + ($$sum25)|0); $20 = HEAP32[$19>>2]|0; $21 = $15 << 1; $22 = (9104 + ($21<<2)|0); $23 = ($18|0)==($22|0); if (!($23)) { $24 = ($18>>>0)<($11>>>0); if ($24) { _abort(); // unreachable; } $25 = ((($18)) + 12|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)==($9|0); if (!($27)) { _abort(); // unreachable; } } $28 = ($20|0)==($18|0); if ($28) { $29 = 1 << $15; $30 = $29 ^ -1; $31 = HEAP32[9064>>2]|0; $32 = $31 & $30; HEAP32[9064>>2] = $32; $$0 = $9;$$02 = $10; break; } $33 = ($20|0)==($22|0); if ($33) { $$pre51 = ((($20)) + 8|0); $$pre$phi52Z2D = $$pre51; } else { $34 = ($20>>>0)<($11>>>0); if ($34) { _abort(); // unreachable; } $35 = ((($20)) + 8|0); $36 = HEAP32[$35>>2]|0; $37 = ($36|0)==($9|0); if ($37) { $$pre$phi52Z2D = $35; } else { _abort(); // unreachable; } } $38 = ((($18)) + 12|0); HEAP32[$38>>2] = $20; HEAP32[$$pre$phi52Z2D>>2] = $18; $$0 = $9;$$02 = $10; break; } $$sum16 = (24 - ($5))|0; $39 = (($p) + ($$sum16)|0); $40 = HEAP32[$39>>2]|0; $$sum17 = (12 - ($5))|0; $41 = (($p) + ($$sum17)|0); $42 = HEAP32[$41>>2]|0; $43 = ($42|0)==($9|0); do { if ($43) { $$sum18 = (16 - ($5))|0; $$sum19 = (($$sum18) + 4)|0; $53 = (($p) + ($$sum19)|0); $54 = HEAP32[$53>>2]|0; $55 = ($54|0)==(0|0); if ($55) { $56 = (($p) + ($$sum18)|0); $57 = HEAP32[$56>>2]|0; $58 = ($57|0)==(0|0); if ($58) { $R$1 = 0; break; } else { $R$0 = $57;$RP$0 = $56; } } else { $R$0 = $54;$RP$0 = $53; } while(1) { $59 = ((($R$0)) + 20|0); $60 = HEAP32[$59>>2]|0; $61 = ($60|0)==(0|0); if (!($61)) { $R$0 = $60;$RP$0 = $59; continue; } $62 = ((($R$0)) + 16|0); $63 = HEAP32[$62>>2]|0; $64 = ($63|0)==(0|0); if ($64) { $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; break; } else { $R$0 = $63;$RP$0 = $62; } } $65 = ($RP$0$lcssa>>>0)<($11>>>0); if ($65) { _abort(); // unreachable; } else { HEAP32[$RP$0$lcssa>>2] = 0; $R$1 = $R$0$lcssa; break; } } else { $$sum23 = (8 - ($5))|0; $44 = (($p) + ($$sum23)|0); $45 = HEAP32[$44>>2]|0; $46 = ($45>>>0)<($11>>>0); if ($46) { _abort(); // unreachable; } $47 = ((($45)) + 12|0); $48 = HEAP32[$47>>2]|0; $49 = ($48|0)==($9|0); if (!($49)) { _abort(); // unreachable; } $50 = ((($42)) + 8|0); $51 = HEAP32[$50>>2]|0; $52 = ($51|0)==($9|0); if ($52) { HEAP32[$47>>2] = $42; HEAP32[$50>>2] = $45; $R$1 = $42; break; } else { _abort(); // unreachable; } } } while(0); $66 = ($40|0)==(0|0); if ($66) { $$0 = $9;$$02 = $10; } else { $$sum20 = (28 - ($5))|0; $67 = (($p) + ($$sum20)|0); $68 = HEAP32[$67>>2]|0; $69 = (9368 + ($68<<2)|0); $70 = HEAP32[$69>>2]|0; $71 = ($9|0)==($70|0); if ($71) { HEAP32[$69>>2] = $R$1; $cond = ($R$1|0)==(0|0); if ($cond) { $72 = 1 << $68; $73 = $72 ^ -1; $74 = HEAP32[(9068)>>2]|0; $75 = $74 & $73; HEAP32[(9068)>>2] = $75; $$0 = $9;$$02 = $10; break; } } else { $76 = HEAP32[(9080)>>2]|0; $77 = ($40>>>0)<($76>>>0); if ($77) { _abort(); // unreachable; } $78 = ((($40)) + 16|0); $79 = HEAP32[$78>>2]|0; $80 = ($79|0)==($9|0); if ($80) { HEAP32[$78>>2] = $R$1; } else { $81 = ((($40)) + 20|0); HEAP32[$81>>2] = $R$1; } $82 = ($R$1|0)==(0|0); if ($82) { $$0 = $9;$$02 = $10; break; } } $83 = HEAP32[(9080)>>2]|0; $84 = ($R$1>>>0)<($83>>>0); if ($84) { _abort(); // unreachable; } $85 = ((($R$1)) + 24|0); HEAP32[$85>>2] = $40; $$sum21 = (16 - ($5))|0; $86 = (($p) + ($$sum21)|0); $87 = HEAP32[$86>>2]|0; $88 = ($87|0)==(0|0); do { if (!($88)) { $89 = ($87>>>0)<($83>>>0); if ($89) { _abort(); // unreachable; } else { $90 = ((($R$1)) + 16|0); HEAP32[$90>>2] = $87; $91 = ((($87)) + 24|0); HEAP32[$91>>2] = $R$1; break; } } } while(0); $$sum22 = (($$sum21) + 4)|0; $92 = (($p) + ($$sum22)|0); $93 = HEAP32[$92>>2]|0; $94 = ($93|0)==(0|0); if ($94) { $$0 = $9;$$02 = $10; } else { $95 = HEAP32[(9080)>>2]|0; $96 = ($93>>>0)<($95>>>0); if ($96) { _abort(); // unreachable; } else { $97 = ((($R$1)) + 20|0); HEAP32[$97>>2] = $93; $98 = ((($93)) + 24|0); HEAP32[$98>>2] = $R$1; $$0 = $9;$$02 = $10; break; } } } } else { $$0 = $p;$$02 = $psize; } } while(0); $106 = HEAP32[(9080)>>2]|0; $107 = ($0>>>0)<($106>>>0); if ($107) { _abort(); // unreachable; } $$sum1 = (($psize) + 4)|0; $108 = (($p) + ($$sum1)|0); $109 = HEAP32[$108>>2]|0; $110 = $109 & 2; $111 = ($110|0)==(0); if ($111) { $112 = HEAP32[(9088)>>2]|0; $113 = ($0|0)==($112|0); if ($113) { $114 = HEAP32[(9076)>>2]|0; $115 = (($114) + ($$02))|0; HEAP32[(9076)>>2] = $115; HEAP32[(9088)>>2] = $$0; $116 = $115 | 1; $117 = ((($$0)) + 4|0); HEAP32[$117>>2] = $116; $118 = HEAP32[(9084)>>2]|0; $119 = ($$0|0)==($118|0); if (!($119)) { return; } HEAP32[(9084)>>2] = 0; HEAP32[(9072)>>2] = 0; return; } $120 = HEAP32[(9084)>>2]|0; $121 = ($0|0)==($120|0); if ($121) { $122 = HEAP32[(9072)>>2]|0; $123 = (($122) + ($$02))|0; HEAP32[(9072)>>2] = $123; HEAP32[(9084)>>2] = $$0; $124 = $123 | 1; $125 = ((($$0)) + 4|0); HEAP32[$125>>2] = $124; $126 = (($$0) + ($123)|0); HEAP32[$126>>2] = $123; return; } $127 = $109 & -8; $128 = (($127) + ($$02))|0; $129 = $109 >>> 3; $130 = ($109>>>0)<(256); do { if ($130) { $$sum12 = (($psize) + 8)|0; $131 = (($p) + ($$sum12)|0); $132 = HEAP32[$131>>2]|0; $$sum13 = (($psize) + 12)|0; $133 = (($p) + ($$sum13)|0); $134 = HEAP32[$133>>2]|0; $135 = $129 << 1; $136 = (9104 + ($135<<2)|0); $137 = ($132|0)==($136|0); if (!($137)) { $138 = ($132>>>0)<($106>>>0); if ($138) { _abort(); // unreachable; } $139 = ((($132)) + 12|0); $140 = HEAP32[$139>>2]|0; $141 = ($140|0)==($0|0); if (!($141)) { _abort(); // unreachable; } } $142 = ($134|0)==($132|0); if ($142) { $143 = 1 << $129; $144 = $143 ^ -1; $145 = HEAP32[9064>>2]|0; $146 = $145 & $144; HEAP32[9064>>2] = $146; break; } $147 = ($134|0)==($136|0); if ($147) { $$pre49 = ((($134)) + 8|0); $$pre$phi50Z2D = $$pre49; } else { $148 = ($134>>>0)<($106>>>0); if ($148) { _abort(); // unreachable; } $149 = ((($134)) + 8|0); $150 = HEAP32[$149>>2]|0; $151 = ($150|0)==($0|0); if ($151) { $$pre$phi50Z2D = $149; } else { _abort(); // unreachable; } } $152 = ((($132)) + 12|0); HEAP32[$152>>2] = $134; HEAP32[$$pre$phi50Z2D>>2] = $132; } else { $$sum2 = (($psize) + 24)|0; $153 = (($p) + ($$sum2)|0); $154 = HEAP32[$153>>2]|0; $$sum3 = (($psize) + 12)|0; $155 = (($p) + ($$sum3)|0); $156 = HEAP32[$155>>2]|0; $157 = ($156|0)==($0|0); do { if ($157) { $$sum5 = (($psize) + 20)|0; $167 = (($p) + ($$sum5)|0); $168 = HEAP32[$167>>2]|0; $169 = ($168|0)==(0|0); if ($169) { $$sum4 = (($psize) + 16)|0; $170 = (($p) + ($$sum4)|0); $171 = HEAP32[$170>>2]|0; $172 = ($171|0)==(0|0); if ($172) { $R7$1 = 0; break; } else { $R7$0 = $171;$RP9$0 = $170; } } else { $R7$0 = $168;$RP9$0 = $167; } while(1) { $173 = ((($R7$0)) + 20|0); $174 = HEAP32[$173>>2]|0; $175 = ($174|0)==(0|0); if (!($175)) { $R7$0 = $174;$RP9$0 = $173; continue; } $176 = ((($R7$0)) + 16|0); $177 = HEAP32[$176>>2]|0; $178 = ($177|0)==(0|0); if ($178) { $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0; break; } else { $R7$0 = $177;$RP9$0 = $176; } } $179 = ($RP9$0$lcssa>>>0)<($106>>>0); if ($179) { _abort(); // unreachable; } else { HEAP32[$RP9$0$lcssa>>2] = 0; $R7$1 = $R7$0$lcssa; break; } } else { $$sum11 = (($psize) + 8)|0; $158 = (($p) + ($$sum11)|0); $159 = HEAP32[$158>>2]|0; $160 = ($159>>>0)<($106>>>0); if ($160) { _abort(); // unreachable; } $161 = ((($159)) + 12|0); $162 = HEAP32[$161>>2]|0; $163 = ($162|0)==($0|0); if (!($163)) { _abort(); // unreachable; } $164 = ((($156)) + 8|0); $165 = HEAP32[$164>>2]|0; $166 = ($165|0)==($0|0); if ($166) { HEAP32[$161>>2] = $156; HEAP32[$164>>2] = $159; $R7$1 = $156; break; } else { _abort(); // unreachable; } } } while(0); $180 = ($154|0)==(0|0); if (!($180)) { $$sum8 = (($psize) + 28)|0; $181 = (($p) + ($$sum8)|0); $182 = HEAP32[$181>>2]|0; $183 = (9368 + ($182<<2)|0); $184 = HEAP32[$183>>2]|0; $185 = ($0|0)==($184|0); if ($185) { HEAP32[$183>>2] = $R7$1; $cond39 = ($R7$1|0)==(0|0); if ($cond39) { $186 = 1 << $182; $187 = $186 ^ -1; $188 = HEAP32[(9068)>>2]|0; $189 = $188 & $187; HEAP32[(9068)>>2] = $189; break; } } else { $190 = HEAP32[(9080)>>2]|0; $191 = ($154>>>0)<($190>>>0); if ($191) { _abort(); // unreachable; } $192 = ((($154)) + 16|0); $193 = HEAP32[$192>>2]|0; $194 = ($193|0)==($0|0); if ($194) { HEAP32[$192>>2] = $R7$1; } else { $195 = ((($154)) + 20|0); HEAP32[$195>>2] = $R7$1; } $196 = ($R7$1|0)==(0|0); if ($196) { break; } } $197 = HEAP32[(9080)>>2]|0; $198 = ($R7$1>>>0)<($197>>>0); if ($198) { _abort(); // unreachable; } $199 = ((($R7$1)) + 24|0); HEAP32[$199>>2] = $154; $$sum9 = (($psize) + 16)|0; $200 = (($p) + ($$sum9)|0); $201 = HEAP32[$200>>2]|0; $202 = ($201|0)==(0|0); do { if (!($202)) { $203 = ($201>>>0)<($197>>>0); if ($203) { _abort(); // unreachable; } else { $204 = ((($R7$1)) + 16|0); HEAP32[$204>>2] = $201; $205 = ((($201)) + 24|0); HEAP32[$205>>2] = $R7$1; break; } } } while(0); $$sum10 = (($psize) + 20)|0; $206 = (($p) + ($$sum10)|0); $207 = HEAP32[$206>>2]|0; $208 = ($207|0)==(0|0); if (!($208)) { $209 = HEAP32[(9080)>>2]|0; $210 = ($207>>>0)<($209>>>0); if ($210) { _abort(); // unreachable; } else { $211 = ((($R7$1)) + 20|0); HEAP32[$211>>2] = $207; $212 = ((($207)) + 24|0); HEAP32[$212>>2] = $R7$1; break; } } } } } while(0); $213 = $128 | 1; $214 = ((($$0)) + 4|0); HEAP32[$214>>2] = $213; $215 = (($$0) + ($128)|0); HEAP32[$215>>2] = $128; $216 = HEAP32[(9084)>>2]|0; $217 = ($$0|0)==($216|0); if ($217) { HEAP32[(9072)>>2] = $128; return; } else { $$1 = $128; } } else { $218 = $109 & -2; HEAP32[$108>>2] = $218; $219 = $$02 | 1; $220 = ((($$0)) + 4|0); HEAP32[$220>>2] = $219; $221 = (($$0) + ($$02)|0); HEAP32[$221>>2] = $$02; $$1 = $$02; } $222 = $$1 >>> 3; $223 = ($$1>>>0)<(256); if ($223) { $224 = $222 << 1; $225 = (9104 + ($224<<2)|0); $226 = HEAP32[9064>>2]|0; $227 = 1 << $222; $228 = $226 & $227; $229 = ($228|0)==(0); if ($229) { $230 = $226 | $227; HEAP32[9064>>2] = $230; $$pre = (($224) + 2)|0; $$pre48 = (9104 + ($$pre<<2)|0); $$pre$phiZ2D = $$pre48;$F16$0 = $225; } else { $$sum7 = (($224) + 2)|0; $231 = (9104 + ($$sum7<<2)|0); $232 = HEAP32[$231>>2]|0; $233 = HEAP32[(9080)>>2]|0; $234 = ($232>>>0)<($233>>>0); if ($234) { _abort(); // unreachable; } else { $$pre$phiZ2D = $231;$F16$0 = $232; } } HEAP32[$$pre$phiZ2D>>2] = $$0; $235 = ((($F16$0)) + 12|0); HEAP32[$235>>2] = $$0; $236 = ((($$0)) + 8|0); HEAP32[$236>>2] = $F16$0; $237 = ((($$0)) + 12|0); HEAP32[$237>>2] = $225; return; } $238 = $$1 >>> 8; $239 = ($238|0)==(0); if ($239) { $I19$0 = 0; } else { $240 = ($$1>>>0)>(16777215); if ($240) { $I19$0 = 31; } else { $241 = (($238) + 1048320)|0; $242 = $241 >>> 16; $243 = $242 & 8; $244 = $238 << $243; $245 = (($244) + 520192)|0; $246 = $245 >>> 16; $247 = $246 & 4; $248 = $247 | $243; $249 = $244 << $247; $250 = (($249) + 245760)|0; $251 = $250 >>> 16; $252 = $251 & 2; $253 = $248 | $252; $254 = (14 - ($253))|0; $255 = $249 << $252; $256 = $255 >>> 15; $257 = (($254) + ($256))|0; $258 = $257 << 1; $259 = (($257) + 7)|0; $260 = $$1 >>> $259; $261 = $260 & 1; $262 = $261 | $258; $I19$0 = $262; } } $263 = (9368 + ($I19$0<<2)|0); $264 = ((($$0)) + 28|0); HEAP32[$264>>2] = $I19$0; $265 = ((($$0)) + 16|0); $266 = ((($$0)) + 20|0); HEAP32[$266>>2] = 0; HEAP32[$265>>2] = 0; $267 = HEAP32[(9068)>>2]|0; $268 = 1 << $I19$0; $269 = $267 & $268; $270 = ($269|0)==(0); if ($270) { $271 = $267 | $268; HEAP32[(9068)>>2] = $271; HEAP32[$263>>2] = $$0; $272 = ((($$0)) + 24|0); HEAP32[$272>>2] = $263; $273 = ((($$0)) + 12|0); HEAP32[$273>>2] = $$0; $274 = ((($$0)) + 8|0); HEAP32[$274>>2] = $$0; return; } $275 = HEAP32[$263>>2]|0; $276 = ((($275)) + 4|0); $277 = HEAP32[$276>>2]|0; $278 = $277 & -8; $279 = ($278|0)==($$1|0); L191: do { if ($279) { $T$0$lcssa = $275; } else { $280 = ($I19$0|0)==(31); $281 = $I19$0 >>> 1; $282 = (25 - ($281))|0; $283 = $280 ? 0 : $282; $284 = $$1 << $283; $K20$043 = $284;$T$042 = $275; while(1) { $291 = $K20$043 >>> 31; $292 = (((($T$042)) + 16|0) + ($291<<2)|0); $287 = HEAP32[$292>>2]|0; $293 = ($287|0)==(0|0); if ($293) { $$lcssa = $292;$T$042$lcssa = $T$042; break; } $285 = $K20$043 << 1; $286 = ((($287)) + 4|0); $288 = HEAP32[$286>>2]|0; $289 = $288 & -8; $290 = ($289|0)==($$1|0); if ($290) { $T$0$lcssa = $287; break L191; } else { $K20$043 = $285;$T$042 = $287; } } $294 = HEAP32[(9080)>>2]|0; $295 = ($$lcssa>>>0)<($294>>>0); if ($295) { _abort(); // unreachable; } HEAP32[$$lcssa>>2] = $$0; $296 = ((($$0)) + 24|0); HEAP32[$296>>2] = $T$042$lcssa; $297 = ((($$0)) + 12|0); HEAP32[$297>>2] = $$0; $298 = ((($$0)) + 8|0); HEAP32[$298>>2] = $$0; return; } } while(0); $299 = ((($T$0$lcssa)) + 8|0); $300 = HEAP32[$299>>2]|0; $301 = HEAP32[(9080)>>2]|0; $302 = ($300>>>0)>=($301>>>0); $not$ = ($T$0$lcssa>>>0)>=($301>>>0); $303 = $302 & $not$; if (!($303)) { _abort(); // unreachable; } $304 = ((($300)) + 12|0); HEAP32[$304>>2] = $$0; HEAP32[$299>>2] = $$0; $305 = ((($$0)) + 8|0); HEAP32[$305>>2] = $300; $306 = ((($$0)) + 12|0); HEAP32[$306>>2] = $T$0$lcssa; $307 = ((($$0)) + 24|0); HEAP32[$307>>2] = 0; return; } function runPostSets() { } function _memcpy(dest, src, num) { dest = dest|0; src = src|0; num = num|0; var ret = 0; if ((num|0) >= 4096) return _emscripten_memcpy_big(dest|0, src|0, num|0)|0; ret = dest|0; if ((dest&3) == (src&3)) { while (dest & 3) { if ((num|0) == 0) return ret|0; HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); dest = (dest+1)|0; src = (src+1)|0; num = (num-1)|0; } while ((num|0) >= 4) { HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0); dest = (dest+4)|0; src = (src+4)|0; num = (num-4)|0; } } while ((num|0) > 0) { HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); dest = (dest+1)|0; src = (src+1)|0; num = (num-1)|0; } return ret|0; } function _memset(ptr, value, num) { ptr = ptr|0; value = value|0; num = num|0; var stop = 0, value4 = 0, stop4 = 0, unaligned = 0; stop = (ptr + num)|0; if ((num|0) >= 20) { // This is unaligned, but quite large, so work hard to get to aligned settings value = value & 0xff; unaligned = ptr & 3; value4 = value | (value << 8) | (value << 16) | (value << 24); stop4 = stop & ~3; if (unaligned) { unaligned = (ptr + 4 - unaligned)|0; while ((ptr|0) < (unaligned|0)) { // no need to check for stop, since we have large num HEAP8[((ptr)>>0)]=value; ptr = (ptr+1)|0; } } while ((ptr|0) < (stop4|0)) { HEAP32[((ptr)>>2)]=value4; ptr = (ptr+4)|0; } } while ((ptr|0) < (stop|0)) { HEAP8[((ptr)>>0)]=value; ptr = (ptr+1)|0; } return (ptr-num)|0; } function _i64Subtract(a, b, c, d) { a = a|0; b = b|0; c = c|0; d = d|0; var l = 0, h = 0; l = (a - c)>>>0; h = (b - d)>>>0; h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow. return ((tempRet0 = h,l|0)|0); } function _i64Add(a, b, c, d) { /* x = a + b*2^32 y = c + d*2^32 result = l + h*2^32 */ a = a|0; b = b|0; c = c|0; d = d|0; var l = 0, h = 0; l = (a + c)>>>0; h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow. return ((tempRet0 = h,l|0)|0); } function _memmove(dest, src, num) { dest = dest|0; src = src|0; num = num|0; var ret = 0; if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) { // Unlikely case: Copy backwards in a safe manner ret = dest; src = (src + num)|0; dest = (dest + num)|0; while ((num|0) > 0) { dest = (dest - 1)|0; src = (src - 1)|0; num = (num - 1)|0; HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); } dest = ret; } else { _memcpy(dest, src, num) | 0; } return dest | 0; } function _bitshift64Lshr(low, high, bits) { low = low|0; high = high|0; bits = bits|0; var ander = 0; if ((bits|0) < 32) { ander = ((1 << bits) - 1)|0; tempRet0 = high >>> bits; return (low >>> bits) | ((high&ander) << (32 - bits)); } tempRet0 = 0; return (high >>> (bits - 32))|0; } function _bitshift64Shl(low, high, bits) { low = low|0; high = high|0; bits = bits|0; var ander = 0; if ((bits|0) < 32) { ander = ((1 << bits) - 1)|0; tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits)); return low << bits; } tempRet0 = low << (bits - 32); return 0; } function _bitshift64Ashr(low, high, bits) { low = low|0; high = high|0; bits = bits|0; var ander = 0; if ((bits|0) < 32) { ander = ((1 << bits) - 1)|0; tempRet0 = high >> bits; return (low >>> bits) | ((high&ander) << (32 - bits)); } tempRet0 = (high|0) < 0 ? -1 : 0; return (high >> (bits - 32))|0; } function _llvm_cttz_i32(x) { x = x|0; var ret = 0; ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0); if ((ret|0) < 8) return ret|0; ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0); if ((ret|0) < 8) return (ret + 8)|0; ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0); if ((ret|0) < 8) return (ret + 16)|0; return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0; } // ======== compiled code from system/lib/compiler-rt , see readme therein function ___muldsi3($a, $b) { $a = $a | 0; $b = $b | 0; var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0; $1 = $a & 65535; $2 = $b & 65535; $3 = Math_imul($2, $1) | 0; $6 = $a >>> 16; $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0; $11 = $b >>> 16; $12 = Math_imul($11, $1) | 0; return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0; } function ___divdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $7$0 = 0, $7$1 = 0, $8$0 = 0, $10$0 = 0; $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0; $4$1 = tempRet0; $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0; $7$0 = $2$0 ^ $1$0; $7$1 = $2$1 ^ $1$1; $8$0 = ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, 0) | 0; $10$0 = _i64Subtract($8$0 ^ $7$0, tempRet0 ^ $7$1, $7$0, $7$1) | 0; return $10$0 | 0; } function ___remdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $rem = 0, $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $10$0 = 0, $10$1 = 0, __stackBase__ = 0; __stackBase__ = STACKTOP; STACKTOP = STACKTOP + 16 | 0; $rem = __stackBase__ | 0; $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0; $4$1 = tempRet0; $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0; ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, $rem) | 0; $10$0 = _i64Subtract(HEAP32[$rem >> 2] ^ $1$0, HEAP32[$rem + 4 >> 2] ^ $1$1, $1$0, $1$1) | 0; $10$1 = tempRet0; STACKTOP = __stackBase__; return (tempRet0 = $10$1, $10$0) | 0; } function ___muldi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0; $x_sroa_0_0_extract_trunc = $a$0; $y_sroa_0_0_extract_trunc = $b$0; $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0; $1$1 = tempRet0; $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0; return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0; } function ___udivdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $1$0 = 0; $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0; return $1$0 | 0; } function ___uremdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $rem = 0, __stackBase__ = 0; __stackBase__ = STACKTOP; STACKTOP = STACKTOP + 16 | 0; $rem = __stackBase__ | 0; ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0; STACKTOP = __stackBase__; return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0; } function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; $rem = $rem | 0; var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0; $n_sroa_0_0_extract_trunc = $a$0; $n_sroa_1_4_extract_shift$0 = $a$1; $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0; $d_sroa_0_0_extract_trunc = $b$0; $d_sroa_1_4_extract_shift$0 = $b$1; $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0; if (($n_sroa_1_4_extract_trunc | 0) == 0) { $4 = ($rem | 0) != 0; if (($d_sroa_1_4_extract_trunc | 0) == 0) { if ($4) { HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0); HEAP32[$rem + 4 >> 2] = 0; } $_0$1 = 0; $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0; return (tempRet0 = $_0$1, $_0$0) | 0; } else { if (!$4) { $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } HEAP32[$rem >> 2] = $a$0 & -1; HEAP32[$rem + 4 >> 2] = $a$1 & 0; $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } } $17 = ($d_sroa_1_4_extract_trunc | 0) == 0; do { if (($d_sroa_0_0_extract_trunc | 0) == 0) { if ($17) { if (($rem | 0) != 0) { HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0); HEAP32[$rem + 4 >> 2] = 0; } $_0$1 = 0; $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0; return (tempRet0 = $_0$1, $_0$0) | 0; } if (($n_sroa_0_0_extract_trunc | 0) == 0) { if (($rem | 0) != 0) { HEAP32[$rem >> 2] = 0; HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0); } $_0$1 = 0; $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0; return (tempRet0 = $_0$1, $_0$0) | 0; } $37 = $d_sroa_1_4_extract_trunc - 1 | 0; if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) { if (($rem | 0) != 0) { HEAP32[$rem >> 2] = 0 | $a$0 & -1; HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0; } $_0$1 = 0; $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0); return (tempRet0 = $_0$1, $_0$0) | 0; } $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0; $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; if ($51 >>> 0 <= 30) { $57 = $51 + 1 | 0; $58 = 31 - $51 | 0; $sr_1_ph = $57; $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0); $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0); $q_sroa_0_1_ph = 0; $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58; break; } if (($rem | 0) == 0) { $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } HEAP32[$rem >> 2] = 0 | $a$0 & -1; HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } else { if (!$17) { $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0; $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; if ($119 >>> 0 <= 31) { $125 = $119 + 1 | 0; $126 = 31 - $119 | 0; $130 = $119 - 31 >> 31; $sr_1_ph = $125; $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126; $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130; $q_sroa_0_1_ph = 0; $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126; break; } if (($rem | 0) == 0) { $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } HEAP32[$rem >> 2] = 0 | $a$0 & -1; HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } $66 = $d_sroa_0_0_extract_trunc - 1 | 0; if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) { $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0; $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; $89 = 64 - $88 | 0; $91 = 32 - $88 | 0; $92 = $91 >> 31; $95 = $88 - 32 | 0; $105 = $95 >> 31; $sr_1_ph = $88; $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105; $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0); $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92; $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31; break; } if (($rem | 0) != 0) { HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc; HEAP32[$rem + 4 >> 2] = 0; } if (($d_sroa_0_0_extract_trunc | 0) == 1) { $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; $_0$0 = 0 | $a$0 & -1; return (tempRet0 = $_0$1, $_0$0) | 0; } else { $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0; $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0); $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0; return (tempRet0 = $_0$1, $_0$0) | 0; } } } while (0); if (($sr_1_ph | 0) == 0) { $q_sroa_1_1_lcssa = $q_sroa_1_1_ph; $q_sroa_0_1_lcssa = $q_sroa_0_1_ph; $r_sroa_1_1_lcssa = $r_sroa_1_1_ph; $r_sroa_0_1_lcssa = $r_sroa_0_1_ph; $carry_0_lcssa$1 = 0; $carry_0_lcssa$0 = 0; } else { $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1; $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0; $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0; $137$1 = tempRet0; $q_sroa_1_1198 = $q_sroa_1_1_ph; $q_sroa_0_1199 = $q_sroa_0_1_ph; $r_sroa_1_1200 = $r_sroa_1_1_ph; $r_sroa_0_1201 = $r_sroa_0_1_ph; $sr_1202 = $sr_1_ph; $carry_0203 = 0; while (1) { $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1; $149 = $carry_0203 | $q_sroa_0_1199 << 1; $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31); $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0; _i64Subtract($137$0, $137$1, $r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1) | 0; $150$1 = tempRet0; $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1; $152 = $151$0 & 1; $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1, $151$0 & $d_sroa_0_0_insert_insert99$0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1) | 0; $r_sroa_0_0_extract_trunc = $154$0; $r_sroa_1_4_extract_trunc = tempRet0; $155 = $sr_1202 - 1 | 0; if (($155 | 0) == 0) { break; } else { $q_sroa_1_1198 = $147; $q_sroa_0_1199 = $149; $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc; $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc; $sr_1202 = $155; $carry_0203 = $152; } } $q_sroa_1_1_lcssa = $147; $q_sroa_0_1_lcssa = $149; $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc; $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc; $carry_0_lcssa$1 = 0; $carry_0_lcssa$0 = $152; } $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa; $q_sroa_0_0_insert_ext75$1 = 0; $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1; if (($rem | 0) != 0) { HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa; HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0; } $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1; $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0; return (tempRet0 = $_0$1, $_0$0) | 0; } // ======================================================================= function dynCall_viiiii(index,a1,a2,a3,a4,a5) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0); } function dynCall_vd(index,a1) { index = index|0; a1=+a1; FUNCTION_TABLE_vd[index&3](+a1); } function dynCall_vid(index,a1,a2) { index = index|0; a1=a1|0; a2=+a2; FUNCTION_TABLE_vid[index&3](a1|0,+a2); } function dynCall_vi(index,a1) { index = index|0; a1=a1|0; FUNCTION_TABLE_vi[index&31](a1|0); } function dynCall_vii(index,a1,a2) { index = index|0; a1=a1|0; a2=a2|0; FUNCTION_TABLE_vii[index&63](a1|0,a2|0); } function dynCall_ii(index,a1) { index = index|0; a1=a1|0; return FUNCTION_TABLE_ii[index&15](a1|0)|0; } function dynCall_viddd(index,a1,a2,a3,a4) { index = index|0; a1=a1|0; a2=+a2; a3=+a3; a4=+a4; FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4); } function dynCall_vidd(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=+a2; a3=+a3; FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3); } function dynCall_iiii(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0; } function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0); } function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0); } function dynCall_viii(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0); } function dynCall_vidddd(index,a1,a2,a3,a4,a5) { index = index|0; a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5; FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5); } function dynCall_vdi(index,a1,a2) { index = index|0; a1=+a1; a2=a2|0; FUNCTION_TABLE_vdi[index&1](+a1,a2|0); } function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0); } function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0; FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0); } function dynCall_iii(index,a1,a2) { index = index|0; a1=a1|0; a2=a2|0; return FUNCTION_TABLE_iii[index&7](a1|0,a2|0)|0; } function dynCall_i(index) { index = index|0; return FUNCTION_TABLE_i[index&3]()|0; } function dynCall_iiiiii(index,a1,a2,a3,a4,a5) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; return FUNCTION_TABLE_iiiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0)|0; } function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) { index = index|0; a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6; FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6); } function dynCall_vdddd(index,a1,a2,a3,a4) { index = index|0; a1=+a1; a2=+a2; a3=+a3; a4=+a4; FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4); } function dynCall_vdd(index,a1,a2) { index = index|0; a1=+a1; a2=+a2; FUNCTION_TABLE_vdd[index&3](+a1,+a2); } function dynCall_v(index) { index = index|0; FUNCTION_TABLE_v[index&7](); } function dynCall_viid(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=a2|0; a3=+a3; FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3); } function dynCall_viiii(index,a1,a2,a3,a4) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0); } function b0(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(0); } function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0); } function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0); } function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0); } function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0); } function b1(p0) { p0 = +p0; abort(1); } function _emscripten_glClearDepth__wrapper(p0) { p0 = +p0; _emscripten_glClearDepth(+p0); } function _emscripten_glClearDepthf__wrapper(p0) { p0 = +p0; _emscripten_glClearDepthf(+p0); } function _emscripten_glLineWidth__wrapper(p0) { p0 = +p0; _emscripten_glLineWidth(+p0); } function b2(p0,p1) { p0 = p0|0;p1 = +p1; abort(2); } function _emscripten_glUniform1f__wrapper(p0,p1) { p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1); } function _emscripten_glVertexAttrib1f__wrapper(p0,p1) { p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1); } function b3(p0) { p0 = p0|0; abort(3); } function _emscripten_glDeleteShader__wrapper(p0) { p0 = p0|0; _emscripten_glDeleteShader(p0|0); } function _emscripten_glCompileShader__wrapper(p0) { p0 = p0|0; _emscripten_glCompileShader(p0|0); } function _emscripten_glDeleteProgram__wrapper(p0) { p0 = p0|0; _emscripten_glDeleteProgram(p0|0); } function _emscripten_glLinkProgram__wrapper(p0) { p0 = p0|0; _emscripten_glLinkProgram(p0|0); } function _emscripten_glUseProgram__wrapper(p0) { p0 = p0|0; _emscripten_glUseProgram(p0|0); } function _emscripten_glValidateProgram__wrapper(p0) { p0 = p0|0; _emscripten_glValidateProgram(p0|0); } function _emscripten_glDeleteObjectARB__wrapper(p0) { p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0); } function _emscripten_glEnableClientState__wrapper(p0) { p0 = p0|0; _emscripten_glEnableClientState(p0|0); } function _emscripten_glClientActiveTexture__wrapper(p0) { p0 = p0|0; _emscripten_glClientActiveTexture(p0|0); } function _emscripten_glBindVertexArray__wrapper(p0) { p0 = p0|0; _emscripten_glBindVertexArray(p0|0); } function _emscripten_glMatrixMode__wrapper(p0) { p0 = p0|0; _emscripten_glMatrixMode(p0|0); } function _emscripten_glLoadMatrixf__wrapper(p0) { p0 = p0|0; _emscripten_glLoadMatrixf(p0|0); } function _emscripten_glEnableVertexAttribArray__wrapper(p0) { p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0); } function _emscripten_glDisableVertexAttribArray__wrapper(p0) { p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0); } function _emscripten_glDepthFunc__wrapper(p0) { p0 = p0|0; _emscripten_glDepthFunc(p0|0); } function _emscripten_glEnable__wrapper(p0) { p0 = p0|0; _emscripten_glEnable(p0|0); } function _emscripten_glDisable__wrapper(p0) { p0 = p0|0; _emscripten_glDisable(p0|0); } function _emscripten_glFrontFace__wrapper(p0) { p0 = p0|0; _emscripten_glFrontFace(p0|0); } function _emscripten_glCullFace__wrapper(p0) { p0 = p0|0; _emscripten_glCullFace(p0|0); } function _emscripten_glClear__wrapper(p0) { p0 = p0|0; _emscripten_glClear(p0|0); } function _emscripten_glClearStencil__wrapper(p0) { p0 = p0|0; _emscripten_glClearStencil(p0|0); } function _emscripten_glDepthMask__wrapper(p0) { p0 = p0|0; _emscripten_glDepthMask(p0|0); } function _emscripten_glStencilMask__wrapper(p0) { p0 = p0|0; _emscripten_glStencilMask(p0|0); } function _emscripten_glGenerateMipmap__wrapper(p0) { p0 = p0|0; _emscripten_glGenerateMipmap(p0|0); } function _emscripten_glActiveTexture__wrapper(p0) { p0 = p0|0; _emscripten_glActiveTexture(p0|0); } function _emscripten_glBlendEquation__wrapper(p0) { p0 = p0|0; _emscripten_glBlendEquation(p0|0); } function b4(p0,p1) { p0 = p0|0;p1 = p1|0; abort(4); } function _emscripten_glPixelStorei__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0); } function _emscripten_glGetIntegerv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0); } function _emscripten_glGetFloatv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0); } function _emscripten_glGetBooleanv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0); } function _emscripten_glGenTextures__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0); } function _emscripten_glDeleteTextures__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0); } function _emscripten_glBindTexture__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0); } function _emscripten_glGenBuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0); } function _emscripten_glDeleteBuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0); } function _emscripten_glGenRenderbuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0); } function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0); } function _emscripten_glBindRenderbuffer__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0); } function _emscripten_glUniform1i__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0); } function _emscripten_glBindBuffer__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0); } function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0); } function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0); } function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0); } function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0); } function _emscripten_glAttachShader__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0); } function _emscripten_glDetachShader__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0); } function _emscripten_glBindFramebuffer__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0); } function _emscripten_glGenFramebuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0); } function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0); } function _emscripten_glBindProgramARB__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0); } function _emscripten_glGetPointerv__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0); } function _emscripten_glGenVertexArrays__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0); } function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0); } function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0); } function _emscripten_glBlendFunc__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0); } function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0); } function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0); } function _emscripten_glHint__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0); } function _emscripten_glDrawBuffers__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0); } function b5(p0) { p0 = p0|0; abort(5);return 0; } function _emscripten_glGetString__wrapper(p0) { p0 = p0|0; return _emscripten_glGetString(p0|0)|0; } function _emscripten_glIsTexture__wrapper(p0) { p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0; } function _emscripten_glIsBuffer__wrapper(p0) { p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0; } function _emscripten_glIsRenderbuffer__wrapper(p0) { p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0; } function _emscripten_glCreateShader__wrapper(p0) { p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0; } function _emscripten_glIsShader__wrapper(p0) { p0 = p0|0; return _emscripten_glIsShader(p0|0)|0; } function _emscripten_glIsProgram__wrapper(p0) { p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0; } function _emscripten_glIsFramebuffer__wrapper(p0) { p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0; } function _emscripten_glCheckFramebufferStatus__wrapper(p0) { p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0; } function _emscripten_glIsEnabled__wrapper(p0) { p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0; } function b6(p0,p1,p2,p3) { p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; abort(6); } function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3); } function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3); } function b7(p0,p1,p2) { p0 = p0|0;p1 = +p1;p2 = +p2; abort(7); } function _emscripten_glUniform2f__wrapper(p0,p1,p2) { p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2); } function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) { p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2); } function b8(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(8);return 0; } function b9(p0,p1,p2,p3,p4,p5,p6,p7) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; abort(9); } function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0); } function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0); } function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0); } function b10(p0,p1,p2,p3,p4,p5) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; abort(10); } function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0); } function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0); } function b11(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(11); } function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0); } function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0); } function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0); } function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0); } function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0); } function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0); } function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0); } function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0); } function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0); } function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0); } function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0); } function _emscripten_glUniform2i__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0); } function _emscripten_glUniform1iv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0); } function _emscripten_glUniform2iv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0); } function _emscripten_glUniform3iv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0); } function _emscripten_glUniform4iv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0); } function _emscripten_glUniform1fv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0); } function _emscripten_glUniform2fv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0); } function _emscripten_glUniform3fv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0); } function _emscripten_glUniform4fv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0); } function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0); } function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0); } function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0); } function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0); } function _emscripten_glNormalPointer__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0); } function _emscripten_glDrawArrays__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0); } function _emscripten_glTexParameteri__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0); } function _emscripten_glStencilFunc__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0); } function _emscripten_glStencilOp__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0); } function b12(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; abort(12); } function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4); } function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4); } function b13(p0,p1) { p0 = +p0;p1 = p1|0; abort(13); } function _emscripten_glSampleCoverage__wrapper(p0,p1) { p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0); } function b14(p0,p1,p2,p3,p4,p5,p6) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; abort(14); } function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0); } function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0); } function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0); } function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; abort(15); } function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0); } function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0); } function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0); } function b16(p0,p1) { p0 = p0|0;p1 = p1|0; abort(16);return 0; } function _emscripten_glGetUniformLocation__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0; } function _emscripten_glGetAttribLocation__wrapper(p0,p1) { p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0; } function b17() { ; abort(17);return 0; } function _emscripten_glCreateProgram__wrapper() { ; return _emscripten_glCreateProgram()|0; } function _emscripten_glGetError__wrapper() { ; return _emscripten_glGetError()|0; } function b18(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(18);return 0; } function b19(p0,p1,p2,p3,p4,p5) { p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; abort(19); } function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) { p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5); } function b20(p0,p1,p2,p3) { p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; abort(20); } function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) { p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3); } function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) { p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3); } function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) { p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3); } function b21(p0,p1) { p0 = +p0;p1 = +p1; abort(21); } function _emscripten_glDepthRange__wrapper(p0,p1) { p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1); } function _emscripten_glDepthRangef__wrapper(p0,p1) { p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1); } function _emscripten_glPolygonOffset__wrapper(p0,p1) { p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1); } function b22() { ; abort(22); } function _emscripten_glLoadIdentity__wrapper() { ; _emscripten_glLoadIdentity(); } function _emscripten_glReleaseShaderCompiler__wrapper() { ; _emscripten_glReleaseShaderCompiler(); } function _emscripten_glFinish__wrapper() { ; _emscripten_glFinish(); } function _emscripten_glFlush__wrapper() { ; _emscripten_glFlush(); } function b23(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = +p2; abort(23); } function _emscripten_glTexParameterf__wrapper(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2); } function b24(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; abort(24); } function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glViewport__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glScissor__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0); } function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) { p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0); } // EMSCRIPTEN_END_FUNCS var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0]; var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper]; var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2]; var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,_cleanup521,_cleanup526 ,b3,b3,b3]; var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4 ,b4,b4,b4,b4,b4]; var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5]; var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6]; var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7]; var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,___stdout_write,___stdio_seek,_EmscriptenFullscreenChangeCallback,_EmscriptenInputCallback,_do_read,___stdio_read,___stdio_write,b8,b8,b8,b8,b8,b8,b8]; var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper]; var FUNCTION_TABLE_viiiiii = [b10,_stbi__YCbCr_to_RGB_row,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper]; var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_stbi__idct_block,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper]; var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12]; var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper]; var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper]; var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper]; var FUNCTION_TABLE_iii = [b16,_point_compare,_uint32_compare,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16,b16,b16]; var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17]; var FUNCTION_TABLE_iiiiii = [b18,_stbi__resample_row_hv_2,_resample_row_1,_stbi__resample_row_v_2,_stbi__resample_row_h_2,_stbi__resample_row_generic,b18,b18]; var FUNCTION_TABLE_vdddddd = [b19,_emscripten_glFrustum__wrapper]; var FUNCTION_TABLE_vdddd = [b20,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper]; var FUNCTION_TABLE_vdd = [b21,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper]; var FUNCTION_TABLE_v = [b22,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b22,b22]; var FUNCTION_TABLE_viid = [b23,_emscripten_glTexParameterf__wrapper]; var FUNCTION_TABLE_viiii = [b24,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b24,b24,b24]; return { _i64Subtract: _i64Subtract, _fflush: _fflush, _main: _main, _i64Add: _i64Add, _memmove: _memmove, _strstr: _strstr, _memset: _memset, _malloc: _malloc, _memcpy: _memcpy, _bitshift64Lshr: _bitshift64Lshr, _free: _free, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___errno_location: ___errno_location, _bitshift64Shl: _bitshift64Shl, runPostSets: runPostSets, _emscripten_replace_memory: _emscripten_replace_memory, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_iiiiii: dynCall_iiiiii, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii }; }) // EMSCRIPTEN_END_ASM (Module.asmGlobalArg, Module.asmLibraryArg, buffer); var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"]; var _fflush = Module["_fflush"] = asm["_fflush"]; var _main = Module["_main"] = asm["_main"]; var _i64Add = Module["_i64Add"] = asm["_i64Add"]; var _memmove = Module["_memmove"] = asm["_memmove"]; var _strstr = Module["_strstr"] = asm["_strstr"]; var _memset = Module["_memset"] = asm["_memset"]; var runPostSets = Module["runPostSets"] = asm["runPostSets"]; var _malloc = Module["_malloc"] = asm["_malloc"]; var _memcpy = Module["_memcpy"] = asm["_memcpy"]; var _emscripten_replace_memory = Module["_emscripten_replace_memory"] = asm["_emscripten_replace_memory"]; var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"]; var _free = Module["_free"] = asm["_free"]; var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"]; var ___errno_location = Module["___errno_location"] = asm["___errno_location"]; var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"]; var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"]; var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"]; var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"]; var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"]; var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"]; var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"]; var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"]; var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"]; var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"]; var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"]; var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"]; var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"]; var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"]; var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"]; var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"]; var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"]; var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"]; var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"]; var dynCall_iiiiii = Module["dynCall_iiiiii"] = asm["dynCall_iiiiii"]; var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"]; var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"]; var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"]; var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"]; var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"]; var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"]; ; Runtime.stackAlloc = asm['stackAlloc']; Runtime.stackSave = asm['stackSave']; Runtime.stackRestore = asm['stackRestore']; Runtime.establishStackSpace = asm['establishStackSpace']; Runtime.setTempRet0 = asm['setTempRet0']; Runtime.getTempRet0 = asm['getTempRet0']; // === Auto-generated postamble setup entry stuff === function ExitStatus(status) { this.name = "ExitStatus"; this.message = "Program terminated with exit(" + status + ")"; this.status = status; }; ExitStatus.prototype = new Error(); ExitStatus.prototype.constructor = ExitStatus; var initialStackTop; var preloadStartTime = null; var calledMain = false; dependenciesFulfilled = function runCaller() { // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) if (!Module['calledRun']) run(); if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled } Module['callMain'] = Module.callMain = function callMain(args) { assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)'); assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called'); args = args || []; ensureInitRuntime(); var argc = args.length+1; function pad() { for (var i = 0; i < 4-1; i++) { argv.push(0); } } var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ]; pad(); for (var i = 0; i < argc-1; i = i + 1) { argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL)); pad(); } argv.push(0); argv = allocate(argv, 'i32', ALLOC_NORMAL); try { var ret = Module['_main'](argc, argv, 0); // if we're not running an evented main loop, it's time to exit exit(ret, /* implicit = */ true); } catch(e) { if (e instanceof ExitStatus) { // exit() throws this once it's done to make sure execution // has been stopped completely return; } else if (e == 'SimulateInfiniteLoop') { // running an evented main loop, don't immediately exit Module['noExitRuntime'] = true; return; } else { if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); throw e; } } finally { calledMain = true; } } function run(args) { args = args || Module['arguments']; if (preloadStartTime === null) preloadStartTime = Date.now(); if (runDependencies > 0) { return; } preRun(); if (runDependencies > 0) return; // a preRun added a dependency, run will be called later if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame function doRun() { if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening Module['calledRun'] = true; if (ABORT) return; ensureInitRuntime(); preMain(); if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); if (Module['_main'] && shouldRunNow) Module['callMain'](args); postRun(); } if (Module['setStatus']) { Module['setStatus']('Running...'); setTimeout(function() { setTimeout(function() { Module['setStatus'](''); }, 1); doRun(); }, 1); } else { doRun(); } } Module['run'] = Module.run = run; function exit(status, implicit) { if (implicit && Module['noExitRuntime']) { return; } if (Module['noExitRuntime']) { } else { ABORT = true; EXITSTATUS = status; STACKTOP = initialStackTop; exitRuntime(); if (Module['onExit']) Module['onExit'](status); } if (ENVIRONMENT_IS_NODE) { // Work around a node.js bug where stdout buffer is not flushed at process exit: // Instead of process.exit() directly, wait for stdout flush event. // See https://github.com/joyent/node/issues/1669 and https://github.com/kripken/emscripten/issues/2582 // Workaround is based on https://github.com/RReverser/acorn/commit/50ab143cecc9ed71a2d66f78b4aec3bb2e9844f6 process['stdout']['once']('drain', function () { process['exit'](status); }); console.log(' '); // Make sure to print something to force the drain event to occur, in case the stdout buffer was empty. // Work around another node bug where sometimes 'drain' is never fired - make another effort // to emit the exit status, after a significant delay (if node hasn't fired drain by then, give up) setTimeout(function() { process['exit'](status); }, 500); } else if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') { quit(status); } // if we reach here, we must throw an exception to halt the current execution throw new ExitStatus(status); } Module['exit'] = Module.exit = exit; var abortDecorators = []; function abort(what) { if (what !== undefined) { Module.print(what); Module.printErr(what); what = JSON.stringify(what) } else { what = ''; } ABORT = true; EXITSTATUS = 1; var extra = '\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.'; var output = 'abort(' + what + ') at ' + stackTrace() + extra; if (abortDecorators) { abortDecorators.forEach(function(decorator) { output = decorator(output, what); }); } throw output; } Module['abort'] = Module.abort = abort; // {{PRE_RUN_ADDITIONS}} if (Module['preInit']) { if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; while (Module['preInit'].length > 0) { Module['preInit'].pop()(); } } // shouldRunNow refers to calling main(), not run(). var shouldRunNow = true; if (Module['noInitialRun']) { shouldRunNow = false; } run(); // {{POST_RUN_ADDITIONS}} // {{MODULE_ADDITIONS}}