// The Module object: Our interface to the outside world. We import // and export values on it, and do the work to get that through // closure compiler if necessary. There are various ways Module can be used: // 1. Not defined. We create it here // 2. A function parameter, function(Module) { ..generated code.. } // 3. pre-run appended it, var Module = {}; ..generated code.. // 4. External script tag defines var Module. // We need to do an eval in order to handle the closure compiler // case, where this code here is minified but Module was defined // elsewhere (e.g. case 4 above). We also need to check if Module // already exists (e.g. case 3 above). // Note that if you want to run closure, and also to use Module // after the generated code, you will need to define var Module = {}; // before the code. Then that object will be used in the code, and you // can continue to use Module afterwards as well. var Module; if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {}; // Sometimes an existing Module object exists with properties // meant to overwrite the default module functionality. Here // we collect those properties and reapply _after_ we configure // the current environment's defaults to avoid having to be so // defensive during initialization. var moduleOverrides = {}; for (var key in Module) { if (Module.hasOwnProperty(key)) { moduleOverrides[key] = Module[key]; } } // The environment setup code below is customized to use Module. // *** Environment setup code *** var ENVIRONMENT_IS_WEB = typeof window === 'object'; // Three configurations we can be running in: // 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) // 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) // 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) var ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; var ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; if (ENVIRONMENT_IS_NODE) { // Expose functionality in the same simple way that the shells work // Note that we pollute the global namespace here, otherwise we break in node if (!Module['print']) Module['print'] = function print(x) { process['stdout'].write(x + '\n'); }; if (!Module['printErr']) Module['printErr'] = function printErr(x) { process['stderr'].write(x + '\n'); }; var nodeFS = require('fs'); var nodePath = require('path'); Module['read'] = function read(filename, binary) { filename = nodePath['normalize'](filename); var ret = nodeFS['readFileSync'](filename); // The path is absolute if the normalized version is the same as the resolved. if (!ret && filename != nodePath['resolve'](filename)) { filename = path.join(__dirname, '..', 'src', filename); ret = nodeFS['readFileSync'](filename); } if (ret && !binary) ret = ret.toString(); return ret; }; Module['readBinary'] = function readBinary(filename) { var ret = Module['read'](filename, true); if (!ret.buffer) { ret = new Uint8Array(ret); } assert(ret.buffer); return ret; }; Module['load'] = function load(f) { globalEval(read(f)); }; if (!Module['thisProgram']) { if (process['argv'].length > 1) { Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); } else { Module['thisProgram'] = 'unknown-program'; } } Module['arguments'] = process['argv'].slice(2); if (typeof module !== 'undefined') { module['exports'] = Module; } process['on']('uncaughtException', function(ex) { // suppress ExitStatus exceptions from showing an error if (!(ex instanceof ExitStatus)) { throw ex; } }); Module['inspect'] = function () { return '[Emscripten Module object]'; }; } else if (ENVIRONMENT_IS_SHELL) { if (!Module['print']) Module['print'] = print; if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm if (typeof read != 'undefined') { Module['read'] = read; } else { Module['read'] = function read() { throw 'no read() available (jsc?)' }; } Module['readBinary'] = function readBinary(f) { if (typeof readbuffer === 'function') { return new Uint8Array(readbuffer(f)); } var data = read(f, 'binary'); assert(typeof data === 'object'); return data; }; if (typeof scriptArgs != 'undefined') { Module['arguments'] = scriptArgs; } else if (typeof arguments != 'undefined') { Module['arguments'] = arguments; } } else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { Module['read'] = function read(url) { var xhr = new XMLHttpRequest(); xhr.open('GET', url, false); xhr.send(null); return xhr.responseText; }; if (typeof arguments != 'undefined') { Module['arguments'] = arguments; } if (typeof console !== 'undefined') { if (!Module['print']) Module['print'] = function print(x) { console.log(x); }; if (!Module['printErr']) Module['printErr'] = function printErr(x) { console.log(x); }; } else { // Probably a worker, and without console.log. We can do very little here... var TRY_USE_DUMP = false; if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) { dump(x); }) : (function(x) { // self.postMessage(x); // enable this if you want stdout to be sent as messages })); } if (ENVIRONMENT_IS_WORKER) { Module['load'] = importScripts; } if (typeof Module['setWindowTitle'] === 'undefined') { Module['setWindowTitle'] = function(title) { document.title = title }; } } else { // Unreachable because SHELL is dependant on the others throw 'Unknown runtime environment. Where are we?'; } function globalEval(x) { eval.call(null, x); } if (!Module['load'] && Module['read']) { Module['load'] = function load(f) { globalEval(Module['read'](f)); }; } if (!Module['print']) { Module['print'] = function(){}; } if (!Module['printErr']) { Module['printErr'] = Module['print']; } if (!Module['arguments']) { Module['arguments'] = []; } if (!Module['thisProgram']) { Module['thisProgram'] = './this.program'; } // *** Environment setup code *** // Closure helpers Module.print = Module['print']; Module.printErr = Module['printErr']; // Callbacks Module['preRun'] = []; Module['postRun'] = []; // Merge back in the overrides for (var key in moduleOverrides) { if (moduleOverrides.hasOwnProperty(key)) { Module[key] = moduleOverrides[key]; } } // === Preamble library stuff === // Documentation for the public APIs defined in this file must be updated in: // site/source/docs/api_reference/preamble.js.rst // A prebuilt local version of the documentation is available at: // site/build/text/docs/api_reference/preamble.js.txt // You can also build docs locally as HTML or other formats in site/ // An online HTML version (which may be of a different version of Emscripten) // is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html //======================================== // Runtime code shared with compiler //======================================== var Runtime = { setTempRet0: function (value) { tempRet0 = value; }, getTempRet0: function () { return tempRet0; }, stackSave: function () { return STACKTOP; }, stackRestore: function (stackTop) { STACKTOP = stackTop; }, getNativeTypeSize: function (type) { switch (type) { case 'i1': case 'i8': return 1; case 'i16': return 2; case 'i32': return 4; case 'i64': return 8; case 'float': return 4; case 'double': return 8; default: { if (type[type.length-1] === '*') { return Runtime.QUANTUM_SIZE; // A pointer } else if (type[0] === 'i') { var bits = parseInt(type.substr(1)); assert(bits % 8 === 0); return bits/8; } else { return 0; } } } }, getNativeFieldSize: function (type) { return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE); }, STACK_ALIGN: 16, prepVararg: function (ptr, type) { if (type === 'double' || type === 'i64') { // move so the load is aligned if (ptr & 7) { assert((ptr & 7) === 4); ptr += 4; } } else { assert((ptr & 3) === 0); } return ptr; }, getAlignSize: function (type, size, vararg) { // we align i64s and doubles on 64-bit boundaries, unlike x86 if (!vararg && (type == 'i64' || type == 'double')) return 8; if (!type) return Math.min(size, 8); // align structures internally to 64 bits return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE); }, dynCall: function (sig, ptr, args) { if (args && args.length) { assert(args.length == sig.length-1); if (!args.splice) args = Array.prototype.slice.call(args); args.splice(0, 0, ptr); assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); return Module['dynCall_' + sig].apply(null, args); } else { assert(sig.length == 1); assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); return Module['dynCall_' + sig].call(null, ptr); } }, functionPointers: [], addFunction: function (func) { for (var i = 0; i < Runtime.functionPointers.length; i++) { if (!Runtime.functionPointers[i]) { Runtime.functionPointers[i] = func; return 2*(1 + i); } } throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; }, removeFunction: function (index) { Runtime.functionPointers[(index-2)/2] = null; }, warnOnce: function (text) { if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {}; if (!Runtime.warnOnce.shown[text]) { Runtime.warnOnce.shown[text] = 1; Module.printErr(text); } }, funcWrappers: {}, getFuncWrapper: function (func, sig) { assert(sig); if (!Runtime.funcWrappers[sig]) { Runtime.funcWrappers[sig] = {}; } var sigCache = Runtime.funcWrappers[sig]; if (!sigCache[func]) { sigCache[func] = function dynCall_wrapper() { return Runtime.dynCall(sig, func, arguments); }; } return sigCache[func]; }, getCompilerSetting: function (name) { throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work'; }, stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; }, staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; }, dynamicAlloc: function (size) { var ret = DYNAMICTOP;DYNAMICTOP = (DYNAMICTOP + (assert(DYNAMICTOP > 0),size))|0;DYNAMICTOP = (((DYNAMICTOP)+15)&-16); if (DYNAMICTOP >= TOTAL_MEMORY) { var success = enlargeMemory(); if (!success) { DYNAMICTOP = ret; return 0; } }; return ret; }, alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; }, makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; }, GLOBAL_BASE: 8, QUANTUM_SIZE: 4, __dummy__: 0 } Module["Runtime"] = Runtime; //======================================== // Runtime essentials //======================================== var __THREW__ = 0; // Used in checking for thrown exceptions. var ABORT = false; // whether we are quitting the application. no code should run after this. set in exit() and abort() var EXITSTATUS = 0; var undef = 0; // tempInt is used for 32-bit signed values or smaller. tempBigInt is used // for 32-bit unsigned values or more than 32 bits. TODO: audit all uses of tempInt var tempValue, tempInt, tempBigInt, tempInt2, tempBigInt2, tempPair, tempBigIntI, tempBigIntR, tempBigIntS, tempBigIntP, tempBigIntD, tempDouble, tempFloat; var tempI64, tempI64b; var tempRet0, tempRet1, tempRet2, tempRet3, tempRet4, tempRet5, tempRet6, tempRet7, tempRet8, tempRet9; function assert(condition, text) { if (!condition) { abort('Assertion failed: ' + text); } } var globalScope = this; // Returns the C function with a specified identifier (for C++, you need to do manual name mangling) function getCFunc(ident) { var func = Module['_' + ident]; // closure exported function if (!func) { try { func = eval('_' + ident); // explicit lookup } catch(e) {} } assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)'); return func; } var cwrap, ccall; (function(){ var JSfuncs = { // Helpers for cwrap -- it can't refer to Runtime directly because it might // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find // out what the minified function name is. 'stackSave': function() { Runtime.stackSave() }, 'stackRestore': function() { Runtime.stackRestore() }, // type conversion from js to c 'arrayToC' : function(arr) { var ret = Runtime.stackAlloc(arr.length); writeArrayToMemory(arr, ret); return ret; }, 'stringToC' : function(str) { var ret = 0; if (str !== null && str !== undefined && str !== 0) { // null string // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' ret = Runtime.stackAlloc((str.length << 2) + 1); writeStringToMemory(str, ret); } return ret; } }; // For fast lookup of conversion functions var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']}; // C calling interface. ccall = function ccallFunc(ident, returnType, argTypes, args, opts) { var func = getCFunc(ident); var cArgs = []; var stack = 0; assert(returnType !== 'array', 'Return type should not be "array".'); if (args) { for (var i = 0; i < args.length; i++) { var converter = toC[argTypes[i]]; if (converter) { if (stack === 0) stack = Runtime.stackSave(); cArgs[i] = converter(args[i]); } else { cArgs[i] = args[i]; } } } var ret = func.apply(null, cArgs); if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall'); } if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values'); if (returnType === 'string') ret = Pointer_stringify(ret); if (stack !== 0) { if (opts && opts.async) { EmterpreterAsync.asyncFinalizers.push(function() { Runtime.stackRestore(stack); }); return; } Runtime.stackRestore(stack); } return ret; } var sourceRegex = /^function\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/; function parseJSFunc(jsfunc) { // Match the body and the return value of a javascript function source var parsed = jsfunc.toString().match(sourceRegex).slice(1); return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]} } var JSsource = {}; for (var fun in JSfuncs) { if (JSfuncs.hasOwnProperty(fun)) { // Elements of toCsource are arrays of three items: // the code, and the return value JSsource[fun] = parseJSFunc(JSfuncs[fun]); } } cwrap = function cwrap(ident, returnType, argTypes) { argTypes = argTypes || []; var cfunc = getCFunc(ident); // When the function takes numbers and returns a number, we can just return // the original function var numericArgs = argTypes.every(function(type){ return type === 'number'}); var numericRet = (returnType !== 'string'); if ( numericRet && numericArgs) { return cfunc; } // Creation of the arguments list (["$1","$2",...,"$nargs"]) var argNames = argTypes.map(function(x,i){return '$'+i}); var funcstr = "(function(" + argNames.join(',') + ") {"; var nargs = argTypes.length; if (!numericArgs) { // Generate the code needed to convert the arguments from javascript // values to pointers funcstr += 'var stack = ' + JSsource['stackSave'].body + ';'; for (var i = 0; i < nargs; i++) { var arg = argNames[i], type = argTypes[i]; if (type === 'number') continue; var convertCode = JSsource[type + 'ToC']; // [code, return] funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';'; funcstr += convertCode.body + ';'; funcstr += arg + '=' + convertCode.returnValue + ';'; } } // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore var cfuncname = parseJSFunc(function(){return cfunc}).returnValue; // Call the function funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');'; if (!numericRet) { // Return type can only by 'string' or 'number' // Convert the result to a string var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue; funcstr += 'ret = ' + strgfy + '(ret);'; } funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }"; if (!numericArgs) { // If we had a stack, restore it funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';'; } funcstr += 'return ret})'; return eval(funcstr); }; })(); Module["ccall"] = ccall; Module["cwrap"] = cwrap; function setValue(ptr, value, type, noSafe) { type = type || 'i8'; if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit switch(type) { case 'i1': HEAP8[((ptr)>>0)]=value; break; case 'i8': HEAP8[((ptr)>>0)]=value; break; case 'i16': HEAP16[((ptr)>>1)]=value; break; case 'i32': HEAP32[((ptr)>>2)]=value; break; case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; case 'float': HEAPF32[((ptr)>>2)]=value; break; case 'double': HEAPF64[((ptr)>>3)]=value; break; default: abort('invalid type for setValue: ' + type); } } Module["setValue"] = setValue; function getValue(ptr, type, noSafe) { type = type || 'i8'; if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit switch(type) { case 'i1': return HEAP8[((ptr)>>0)]; case 'i8': return HEAP8[((ptr)>>0)]; case 'i16': return HEAP16[((ptr)>>1)]; case 'i32': return HEAP32[((ptr)>>2)]; case 'i64': return HEAP32[((ptr)>>2)]; case 'float': return HEAPF32[((ptr)>>2)]; case 'double': return HEAPF64[((ptr)>>3)]; default: abort('invalid type for setValue: ' + type); } return null; } Module["getValue"] = getValue; var ALLOC_NORMAL = 0; // Tries to use _malloc() var ALLOC_STACK = 1; // Lives for the duration of the current function call var ALLOC_STATIC = 2; // Cannot be freed var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk var ALLOC_NONE = 4; // Do not allocate Module["ALLOC_NORMAL"] = ALLOC_NORMAL; Module["ALLOC_STACK"] = ALLOC_STACK; Module["ALLOC_STATIC"] = ALLOC_STATIC; Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC; Module["ALLOC_NONE"] = ALLOC_NONE; // allocate(): This is for internal use. You can use it yourself as well, but the interface // is a little tricky (see docs right below). The reason is that it is optimized // for multiple syntaxes to save space in generated code. So you should // normally not use allocate(), and instead allocate memory using _malloc(), // initialize it with setValue(), and so forth. // @slab: An array of data, or a number. If a number, then the size of the block to allocate, // in *bytes* (note that this is sometimes confusing: the next parameter does not // affect this!) // @types: Either an array of types, one for each byte (or 0 if no type at that position), // or a single type which is used for the entire block. This only matters if there // is initial data - if @slab is a number, then this does not matter at all and is // ignored. // @allocator: How to allocate memory, see ALLOC_* function allocate(slab, types, allocator, ptr) { var zeroinit, size; if (typeof slab === 'number') { zeroinit = true; size = slab; } else { zeroinit = false; size = slab.length; } var singleType = typeof types === 'string' ? types : null; var ret; if (allocator == ALLOC_NONE) { ret = ptr; } else { ret = [_malloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); } if (zeroinit) { var ptr = ret, stop; assert((ret & 3) == 0); stop = ret + (size & ~3); for (; ptr < stop; ptr += 4) { HEAP32[((ptr)>>2)]=0; } stop = ret + size; while (ptr < stop) { HEAP8[((ptr++)>>0)]=0; } return ret; } if (singleType === 'i8') { if (slab.subarray || slab.slice) { HEAPU8.set(slab, ret); } else { HEAPU8.set(new Uint8Array(slab), ret); } return ret; } var i = 0, type, typeSize, previousType; while (i < size) { var curr = slab[i]; if (typeof curr === 'function') { curr = Runtime.getFunctionIndex(curr); } type = singleType || types[i]; if (type === 0) { i++; continue; } assert(type, 'Must know what type to store in allocate!'); if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later setValue(ret+i, curr, type); // no need to look up size unless type changes, so cache it if (previousType !== type) { typeSize = Runtime.getNativeTypeSize(type); previousType = type; } i += typeSize; } return ret; } Module["allocate"] = allocate; // Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready function getMemory(size) { if (!staticSealed) return Runtime.staticAlloc(size); if ((typeof _sbrk !== 'undefined' && !_sbrk.called) || !runtimeInitialized) return Runtime.dynamicAlloc(size); return _malloc(size); } Module["getMemory"] = getMemory; function Pointer_stringify(ptr, /* optional */ length) { if (length === 0 || !ptr) return ''; // TODO: use TextDecoder // Find the length, and check for UTF while doing so var hasUtf = 0; var t; var i = 0; while (1) { assert(ptr + i < TOTAL_MEMORY); t = HEAPU8[(((ptr)+(i))>>0)]; hasUtf |= t; if (t == 0 && !length) break; i++; if (length && i == length) break; } if (!length) length = i; var ret = ''; if (hasUtf < 128) { var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack var curr; while (length > 0) { curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); ret = ret ? ret + curr : curr; ptr += MAX_CHUNK; length -= MAX_CHUNK; } return ret; } return Module['UTF8ToString'](ptr); } Module["Pointer_stringify"] = Pointer_stringify; // Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns // a copy of that string as a Javascript String object. function AsciiToString(ptr) { var str = ''; while (1) { var ch = HEAP8[((ptr++)>>0)]; if (!ch) return str; str += String.fromCharCode(ch); } } Module["AsciiToString"] = AsciiToString; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. function stringToAscii(str, outPtr) { return writeAsciiToMemory(str, outPtr, false); } Module["stringToAscii"] = stringToAscii; // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns // a copy of that string as a Javascript String object. function UTF8ArrayToString(u8Array, idx) { var u0, u1, u2, u3, u4, u5; var str = ''; while (1) { // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 u0 = u8Array[idx++]; if (!u0) return str; if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } u1 = u8Array[idx++] & 63; if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } u2 = u8Array[idx++] & 63; if ((u0 & 0xF0) == 0xE0) { u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; } else { u3 = u8Array[idx++] & 63; if ((u0 & 0xF8) == 0xF0) { u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; } else { u4 = u8Array[idx++] & 63; if ((u0 & 0xFC) == 0xF8) { u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; } else { u5 = u8Array[idx++] & 63; u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; } } } if (u0 < 0x10000) { str += String.fromCharCode(u0); } else { var ch = u0 - 0x10000; str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); } } } Module["UTF8ArrayToString"] = UTF8ArrayToString; // Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns // a copy of that string as a Javascript String object. function UTF8ToString(ptr) { return UTF8ArrayToString(HEAPU8,ptr); } Module["UTF8ToString"] = UTF8ToString; // Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', // encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. // Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write. // Parameters: // str: the Javascript string to copy. // outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. // outIdx: The starting offset in the array to begin the copying. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null // terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. // maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. return 0; var startIdx = outIdx; var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. // See http://unicode.org/faq/utf_bom.html#utf16-3 // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 var u = str.charCodeAt(i); // possibly a lead surrogate if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); if (u <= 0x7F) { if (outIdx >= endIdx) break; outU8Array[outIdx++] = u; } else if (u <= 0x7FF) { if (outIdx + 1 >= endIdx) break; outU8Array[outIdx++] = 0xC0 | (u >> 6); outU8Array[outIdx++] = 0x80 | (u & 63); } else if (u <= 0xFFFF) { if (outIdx + 2 >= endIdx) break; outU8Array[outIdx++] = 0xE0 | (u >> 12); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } else if (u <= 0x1FFFFF) { if (outIdx + 3 >= endIdx) break; outU8Array[outIdx++] = 0xF0 | (u >> 18); outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } else if (u <= 0x3FFFFFF) { if (outIdx + 4 >= endIdx) break; outU8Array[outIdx++] = 0xF8 | (u >> 24); outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } else { if (outIdx + 5 >= endIdx) break; outU8Array[outIdx++] = 0xFC | (u >> 30); outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); outU8Array[outIdx++] = 0x80 | (u & 63); } } // Null-terminate the pointer to the buffer. outU8Array[outIdx] = 0; return outIdx - startIdx; } Module["stringToUTF8Array"] = stringToUTF8Array; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. // Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF8(str, outPtr, maxBytesToWrite) { assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); } Module["stringToUTF8"] = stringToUTF8; // Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. function lengthBytesUTF8(str) { var len = 0; for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. // See http://unicode.org/faq/utf_bom.html#utf16-3 var u = str.charCodeAt(i); // possibly a lead surrogate if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); if (u <= 0x7F) { ++len; } else if (u <= 0x7FF) { len += 2; } else if (u <= 0xFFFF) { len += 3; } else if (u <= 0x1FFFFF) { len += 4; } else if (u <= 0x3FFFFFF) { len += 5; } else { len += 6; } } return len; } Module["lengthBytesUTF8"] = lengthBytesUTF8; // Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns // a copy of that string as a Javascript String object. function UTF16ToString(ptr) { var i = 0; var str = ''; while (1) { var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; if (codeUnit == 0) return str; ++i; // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. str += String.fromCharCode(codeUnit); } } Module["UTF16ToString"] = UTF16ToString; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. // Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. // Parameters: // str: the Javascript string to copy. // outPtr: Byte address in Emscripten HEAP where to write the string to. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null // terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. // maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF16(str, outPtr, maxBytesToWrite) { assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. if (maxBytesToWrite === undefined) { maxBytesToWrite = 0x7FFFFFFF; } if (maxBytesToWrite < 2) return 0; maxBytesToWrite -= 2; // Null terminator. var startPtr = outPtr; var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; for (var i = 0; i < numCharsToWrite; ++i) { // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. var codeUnit = str.charCodeAt(i); // possibly a lead surrogate HEAP16[((outPtr)>>1)]=codeUnit; outPtr += 2; } // Null-terminate the pointer to the HEAP. HEAP16[((outPtr)>>1)]=0; return outPtr - startPtr; } Module["stringToUTF16"] = stringToUTF16; // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. function lengthBytesUTF16(str) { return str.length*2; } Module["lengthBytesUTF16"] = lengthBytesUTF16; function UTF32ToString(ptr) { var i = 0; var str = ''; while (1) { var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; if (utf32 == 0) return str; ++i; // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. // See http://unicode.org/faq/utf_bom.html#utf16-3 if (utf32 >= 0x10000) { var ch = utf32 - 0x10000; str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); } else { str += String.fromCharCode(utf32); } } } Module["UTF32ToString"] = UTF32ToString; // Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', // null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. // Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. // Parameters: // str: the Javascript string to copy. // outPtr: Byte address in Emscripten HEAP where to write the string to. // maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null // terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. // maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. // Returns the number of bytes written, EXCLUDING the null terminator. function stringToUTF32(str, outPtr, maxBytesToWrite) { assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. if (maxBytesToWrite === undefined) { maxBytesToWrite = 0x7FFFFFFF; } if (maxBytesToWrite < 4) return 0; var startPtr = outPtr; var endPtr = startPtr + maxBytesToWrite - 4; for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. // See http://unicode.org/faq/utf_bom.html#utf16-3 var codeUnit = str.charCodeAt(i); // possibly a lead surrogate if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { var trailSurrogate = str.charCodeAt(++i); codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); } HEAP32[((outPtr)>>2)]=codeUnit; outPtr += 4; if (outPtr + 4 > endPtr) break; } // Null-terminate the pointer to the HEAP. HEAP32[((outPtr)>>2)]=0; return outPtr - startPtr; } Module["stringToUTF32"] = stringToUTF32; // Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. function lengthBytesUTF32(str) { var len = 0; for (var i = 0; i < str.length; ++i) { // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. // See http://unicode.org/faq/utf_bom.html#utf16-3 var codeUnit = str.charCodeAt(i); if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. len += 4; } return len; } Module["lengthBytesUTF32"] = lengthBytesUTF32; function demangle(func) { var hasLibcxxabi = !!Module['___cxa_demangle']; if (hasLibcxxabi) { try { var buf = _malloc(func.length); writeStringToMemory(func.substr(1), buf); var status = _malloc(4); var ret = Module['___cxa_demangle'](buf, 0, 0, status); if (getValue(status, 'i32') === 0 && ret) { return Pointer_stringify(ret); } // otherwise, libcxxabi failed, we can try ours which may return a partial result } catch(e) { // failure when using libcxxabi, we can try ours which may return a partial result } finally { if (buf) _free(buf); if (status) _free(status); if (ret) _free(ret); } } var i = 3; // params, etc. var basicTypes = { 'v': 'void', 'b': 'bool', 'c': 'char', 's': 'short', 'i': 'int', 'l': 'long', 'f': 'float', 'd': 'double', 'w': 'wchar_t', 'a': 'signed char', 'h': 'unsigned char', 't': 'unsigned short', 'j': 'unsigned int', 'm': 'unsigned long', 'x': 'long long', 'y': 'unsigned long long', 'z': '...' }; var subs = []; var first = true; function dump(x) { //return; if (x) Module.print(x); Module.print(func); var pre = ''; for (var a = 0; a < i; a++) pre += ' '; Module.print (pre + '^'); } function parseNested() { i++; if (func[i] === 'K') i++; // ignore const var parts = []; while (func[i] !== 'E') { if (func[i] === 'S') { // substitution i++; var next = func.indexOf('_', i); var num = func.substring(i, next) || 0; parts.push(subs[num] || '?'); i = next+1; continue; } if (func[i] === 'C') { // constructor parts.push(parts[parts.length-1]); i += 2; continue; } var size = parseInt(func.substr(i)); var pre = size.toString().length; if (!size || !pre) { i--; break; } // counter i++ below us var curr = func.substr(i + pre, size); parts.push(curr); subs.push(curr); i += pre + size; } i++; // skip E return parts; } function parse(rawList, limit, allowVoid) { // main parser limit = limit || Infinity; var ret = '', list = []; function flushList() { return '(' + list.join(', ') + ')'; } var name; if (func[i] === 'N') { // namespaced N-E name = parseNested().join('::'); limit--; if (limit === 0) return rawList ? [name] : name; } else { // not namespaced if (func[i] === 'K' || (first && func[i] === 'L')) i++; // ignore const and first 'L' var size = parseInt(func.substr(i)); if (size) { var pre = size.toString().length; name = func.substr(i + pre, size); i += pre + size; } } first = false; if (func[i] === 'I') { i++; var iList = parse(true); var iRet = parse(true, 1, true); ret += iRet[0] + ' ' + name + '<' + iList.join(', ') + '>'; } else { ret = name; } paramLoop: while (i < func.length && limit-- > 0) { //dump('paramLoop'); var c = func[i++]; if (c in basicTypes) { list.push(basicTypes[c]); } else { switch (c) { case 'P': list.push(parse(true, 1, true)[0] + '*'); break; // pointer case 'R': list.push(parse(true, 1, true)[0] + '&'); break; // reference case 'L': { // literal i++; // skip basic type var end = func.indexOf('E', i); var size = end - i; list.push(func.substr(i, size)); i += size + 2; // size + 'EE' break; } case 'A': { // array var size = parseInt(func.substr(i)); i += size.toString().length; if (func[i] !== '_') throw '?'; i++; // skip _ list.push(parse(true, 1, true)[0] + ' [' + size + ']'); break; } case 'E': break paramLoop; default: ret += '?' + c; break paramLoop; } } } if (!allowVoid && list.length === 1 && list[0] === 'void') list = []; // avoid (void) if (rawList) { if (ret) { list.push(ret + '?'); } return list; } else { return ret + flushList(); } } var parsed = func; try { // Special-case the entry point, since its name differs from other name mangling. if (func == 'Object._main' || func == '_main') { return 'main()'; } if (typeof func === 'number') func = Pointer_stringify(func); if (func[0] !== '_') return func; if (func[1] !== '_') return func; // C function if (func[2] !== 'Z') return func; switch (func[3]) { case 'n': return 'operator new()'; case 'd': return 'operator delete()'; } parsed = parse(); } catch(e) { parsed += '?'; } if (parsed.indexOf('?') >= 0 && !hasLibcxxabi) { Runtime.warnOnce('warning: a problem occurred in builtin C++ name demangling; build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling'); } return parsed; } function demangleAll(text) { return text.replace(/__Z[\w\d_]+/g, function(x) { var y = demangle(x); return x === y ? x : (x + ' [' + y + ']') }); } function jsStackTrace() { var err = new Error(); if (!err.stack) { // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, // so try that as a special-case. try { throw new Error(0); } catch(e) { err = e; } if (!err.stack) { return '(no stack trace available)'; } } return err.stack.toString(); } function stackTrace() { return demangleAll(jsStackTrace()); } Module["stackTrace"] = stackTrace; // Memory management var PAGE_SIZE = 4096; function alignMemoryPage(x) { if (x % 4096 > 0) { x += (4096 - (x % 4096)); } return x; } var HEAP; var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; var STATIC_BASE = 0, STATICTOP = 0, staticSealed = false; // static area var STACK_BASE = 0, STACKTOP = 0, STACK_MAX = 0; // stack area var DYNAMIC_BASE = 0, DYNAMICTOP = 0; // dynamic area handled by sbrk function abortOnCannotGrowMemory() { abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); } function enlargeMemory() { abortOnCannotGrowMemory(); } var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216; var totalMemory = 64*1024; while (totalMemory < TOTAL_MEMORY || totalMemory < 2*TOTAL_STACK) { if (totalMemory < 16*1024*1024) { totalMemory *= 2; } else { totalMemory += 16*1024*1024 } } if (totalMemory !== TOTAL_MEMORY) { Module.printErr('increasing TOTAL_MEMORY to ' + totalMemory + ' to be compliant with the asm.js spec (and given that TOTAL_STACK=' + TOTAL_STACK + ')'); TOTAL_MEMORY = totalMemory; } // Initialize the runtime's memory // check for full engine support (use string 'subarray' to avoid closure compiler confusion) assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']), 'JS engine does not provide full typed array support'); var buffer; buffer = new ArrayBuffer(TOTAL_MEMORY); HEAP8 = new Int8Array(buffer); HEAP16 = new Int16Array(buffer); HEAP32 = new Int32Array(buffer); HEAPU8 = new Uint8Array(buffer); HEAPU16 = new Uint16Array(buffer); HEAPU32 = new Uint32Array(buffer); HEAPF32 = new Float32Array(buffer); HEAPF64 = new Float64Array(buffer); // Endianness check (note: assumes compiler arch was little-endian) HEAP32[0] = 255; assert(HEAPU8[0] === 255 && HEAPU8[3] === 0, 'Typed arrays 2 must be run on a little-endian system'); Module['HEAP'] = HEAP; Module['buffer'] = buffer; Module['HEAP8'] = HEAP8; Module['HEAP16'] = HEAP16; Module['HEAP32'] = HEAP32; Module['HEAPU8'] = HEAPU8; Module['HEAPU16'] = HEAPU16; Module['HEAPU32'] = HEAPU32; Module['HEAPF32'] = HEAPF32; Module['HEAPF64'] = HEAPF64; function callRuntimeCallbacks(callbacks) { while(callbacks.length > 0) { var callback = callbacks.shift(); if (typeof callback == 'function') { callback(); continue; } var func = callback.func; if (typeof func === 'number') { if (callback.arg === undefined) { Runtime.dynCall('v', func); } else { Runtime.dynCall('vi', func, [callback.arg]); } } else { func(callback.arg === undefined ? null : callback.arg); } } } var __ATPRERUN__ = []; // functions called before the runtime is initialized var __ATINIT__ = []; // functions called during startup var __ATMAIN__ = []; // functions called when main() is to be run var __ATEXIT__ = []; // functions called during shutdown var __ATPOSTRUN__ = []; // functions called after the runtime has exited var runtimeInitialized = false; var runtimeExited = false; function preRun() { // compatibility - merge in anything from Module['preRun'] at this time if (Module['preRun']) { if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; while (Module['preRun'].length) { addOnPreRun(Module['preRun'].shift()); } } callRuntimeCallbacks(__ATPRERUN__); } function ensureInitRuntime() { if (runtimeInitialized) return; runtimeInitialized = true; callRuntimeCallbacks(__ATINIT__); } function preMain() { callRuntimeCallbacks(__ATMAIN__); } function exitRuntime() { callRuntimeCallbacks(__ATEXIT__); runtimeExited = true; } function postRun() { // compatibility - merge in anything from Module['postRun'] at this time if (Module['postRun']) { if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; while (Module['postRun'].length) { addOnPostRun(Module['postRun'].shift()); } } callRuntimeCallbacks(__ATPOSTRUN__); } function addOnPreRun(cb) { __ATPRERUN__.unshift(cb); } Module["addOnPreRun"] = addOnPreRun; function addOnInit(cb) { __ATINIT__.unshift(cb); } Module["addOnInit"] = addOnInit; function addOnPreMain(cb) { __ATMAIN__.unshift(cb); } Module["addOnPreMain"] = addOnPreMain; function addOnExit(cb) { __ATEXIT__.unshift(cb); } Module["addOnExit"] = addOnExit; function addOnPostRun(cb) { __ATPOSTRUN__.unshift(cb); } Module["addOnPostRun"] = addOnPostRun; // Tools function intArrayFromString(stringy, dontAddNull, length /* optional */) { var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; var u8array = new Array(len); var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); if (dontAddNull) u8array.length = numBytesWritten; return u8array; } Module["intArrayFromString"] = intArrayFromString; function intArrayToString(array) { var ret = []; for (var i = 0; i < array.length; i++) { var chr = array[i]; if (chr > 0xFF) { assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.'); chr &= 0xFF; } ret.push(String.fromCharCode(chr)); } return ret.join(''); } Module["intArrayToString"] = intArrayToString; function writeStringToMemory(string, buffer, dontAddNull) { var array = intArrayFromString(string, dontAddNull); var i = 0; while (i < array.length) { var chr = array[i]; HEAP8[(((buffer)+(i))>>0)]=chr; i = i + 1; } } Module["writeStringToMemory"] = writeStringToMemory; function writeArrayToMemory(array, buffer) { for (var i = 0; i < array.length; i++) { HEAP8[((buffer++)>>0)]=array[i]; } } Module["writeArrayToMemory"] = writeArrayToMemory; function writeAsciiToMemory(str, buffer, dontAddNull) { for (var i = 0; i < str.length; ++i) { assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff); HEAP8[((buffer++)>>0)]=str.charCodeAt(i); } // Null-terminate the pointer to the HEAP. if (!dontAddNull) HEAP8[((buffer)>>0)]=0; } Module["writeAsciiToMemory"] = writeAsciiToMemory; function unSign(value, bits, ignore) { if (value >= 0) { return value; } return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts : Math.pow(2, bits) + value; } function reSign(value, bits, ignore) { if (value <= 0) { return value; } var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 : Math.pow(2, bits-1); if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors // TODO: In i64 mode 1, resign the two parts separately and safely value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts } return value; } // check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 ) if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) { var ah = a >>> 16; var al = a & 0xffff; var bh = b >>> 16; var bl = b & 0xffff; return (al*bl + ((ah*bl + al*bh) << 16))|0; }; Math.imul = Math['imul']; if (!Math['clz32']) Math['clz32'] = function(x) { x = x >>> 0; for (var i = 0; i < 32; i++) { if (x & (1 << (31 - i))) return i; } return 32; }; Math.clz32 = Math['clz32'] var Math_abs = Math.abs; var Math_cos = Math.cos; var Math_sin = Math.sin; var Math_tan = Math.tan; var Math_acos = Math.acos; var Math_asin = Math.asin; var Math_atan = Math.atan; var Math_atan2 = Math.atan2; var Math_exp = Math.exp; var Math_log = Math.log; var Math_sqrt = Math.sqrt; var Math_ceil = Math.ceil; var Math_floor = Math.floor; var Math_pow = Math.pow; var Math_imul = Math.imul; var Math_fround = Math.fround; var Math_min = Math.min; var Math_clz32 = Math.clz32; // A counter of dependencies for calling run(). If we need to // do asynchronous work before running, increment this and // decrement it. Incrementing must happen in a place like // PRE_RUN_ADDITIONS (used by emcc to add file preloading). // Note that you can add dependencies in preRun, even though // it happens right before run - run will be postponed until // the dependencies are met. var runDependencies = 0; var runDependencyWatcher = null; var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled var runDependencyTracking = {}; function getUniqueRunDependency(id) { var orig = id; while (1) { if (!runDependencyTracking[id]) return id; id = orig + Math.random(); } return id; } function addRunDependency(id) { runDependencies++; if (Module['monitorRunDependencies']) { Module['monitorRunDependencies'](runDependencies); } if (id) { assert(!runDependencyTracking[id]); runDependencyTracking[id] = 1; if (runDependencyWatcher === null && typeof setInterval !== 'undefined') { // Check for missing dependencies every few seconds runDependencyWatcher = setInterval(function() { if (ABORT) { clearInterval(runDependencyWatcher); runDependencyWatcher = null; return; } var shown = false; for (var dep in runDependencyTracking) { if (!shown) { shown = true; Module.printErr('still waiting on run dependencies:'); } Module.printErr('dependency: ' + dep); } if (shown) { Module.printErr('(end of list)'); } }, 10000); } } else { Module.printErr('warning: run dependency added without ID'); } } Module["addRunDependency"] = addRunDependency; function removeRunDependency(id) { runDependencies--; if (Module['monitorRunDependencies']) { Module['monitorRunDependencies'](runDependencies); } if (id) { assert(runDependencyTracking[id]); delete runDependencyTracking[id]; } else { Module.printErr('warning: run dependency removed without ID'); } if (runDependencies == 0) { if (runDependencyWatcher !== null) { clearInterval(runDependencyWatcher); runDependencyWatcher = null; } if (dependenciesFulfilled) { var callback = dependenciesFulfilled; dependenciesFulfilled = null; callback(); // can add another dependenciesFulfilled } } } Module["removeRunDependency"] = removeRunDependency; Module["preloadedImages"] = {}; // maps url to image data Module["preloadedAudios"] = {}; // maps url to audio data var memoryInitializer = null; // === Body === var ASM_CONSTS = [function() { return !!(document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement) }]; function _emscripten_asm_const_0(code) { return ASM_CONSTS[code](); } STATIC_BASE = 8; STATICTOP = STATIC_BASE + 35488; /* global initializers */ __ATINIT__.push(); /* memory initializer */ allocate([0,0,0,198,0,0,0,198,0,0,128,70,0,0,128,70,32,0,0,0,255,0,0,0,0,0,0,0,98,112,0,0,111,113], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE); /* memory initializer */ allocate([1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,20,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,8,0,0,0,0,1,0,255,255,16,0,127,0,0,0,255,7,0,0,255,255,0,0,255,255,16,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,132,49,0,0,244,49,0,0,244,49,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,5,0,0,0,131,136,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,6,0,0,0,5,0,0,0,123,132,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,115,116,114,0,46,47,46,46,47,46,46,47,110,117,107,108,101,97,114,46,104,0,110,107,95,115,116,114,108,101,110,0,110,117,109,98,101,114,0,110,107,95,115,116,114,116,111,102,0,98,117,102,102,101,114,0,112,116,114,0,105,109,103,0,110,107,95,105,109,97,103,101,95,105,115,95,115,117,98,105,109,97,103,101,0,114,101,115,117,108,116,0,110,107,95,116,114,105,97,110,103,108,101,95,102,114,111,109,95,100,105,114,101,99,116,105,111,110,0,99,0,110,107,95,117,116,102,95,100,101,99,111,100,101,0,117,0,110,107,95,117,116,102,95,108,101,110,0,117,110,105,99,111,100,101,0,108,101,110,0,98,0,110,107,95,98,117,102,102,101,114,95,105,110,105,116,0,97,0,105,110,105,116,105,97,108,95,115,105,122,101,0,110,107,95,98,117,102,102,101,114,95,105,110,105,116,95,102,105,120,101,100,0,109,0,115,105,122,101,0,110,107,95,98,117,102,102,101,114,95,109,97,114,107,0,110,107,95,98,117,102,102,101,114,95,114,101,115,101,116,0,110,107,95,98,117,102,102,101,114,95,99,108,101,97,114,0,110,107,95,98,117,102,102,101,114,95,102,114,101,101,0,98,45,62,112,111,111,108,46,102,114,101,101,0,115,0,110,107,95,98,117,102,102,101,114,95,109,101,109,111,114,121,0,110,107,95,98,117,102,102,101,114,95,116,111,116,97,108,0,110,107,95,115,116,114,95,97,112,112,101,110,100,95,116,101,120,116,95,99,104,97,114,0,110,107,95,115,116,114,95,105,110,115,101,114,116,95,97,116,95,99,104,97,114,0,108,101,110,32,62,61,32,48,0,40,40,105,110,116,41,112,111,115,32,43,32,40,105,110,116,41,108,101,110,32,43,32,40,40,105,110,116,41,99,111,112,121,108,101,110,32,45,32,49,41,41,32,62,61,32,48,0,40,40,105,110,116,41,112,111,115,32,43,32,40,40,105,110,116,41,99,111,112,121,108,101,110,32,45,32,49,41,41,32,62,61,32,48,0,110,107,95,115,116,114,95,105,110,115,101,114,116,95,97,116,95,114,117,110,101,0,99,115,116,114,0,116,101,120,116,0,110,107,95,115,116,114,95,105,110,115,101,114,116,95,116,101,120,116,95,114,117,110,101,115,0,110,107,95,115,116,114,95,114,101,109,111,118,101,95,99,104,97,114,115,0,40,40,105,110,116,41,115,45,62,98,117,102,102,101,114,46,97,108,108,111,99,97,116,101,100,32,45,32,40,105,110,116,41,108,101,110,41,32,62,61,32,48,0,110,107,95,115,116,114,95,100,101,108,101,116,101,95,99,104,97,114,115,0,110,107,95,115,116,114,95,100,101,108,101,116,101,95,114,117,110,101,115,0,115,45,62,108,101,110,32,62,61,32,112,111,115,32,43,32,108,101,110,0,110,107,95,115,116,114,95,97,116,95,114,117,110,101,0,110,107,95,115,116,114,95,97,116,95,99,111,110,115,116,0,110,107,95,115,116,114,95,103,101,116,95,99,111,110,115,116,0,110,107,95,115,116,114,95,108,101,110,0,110,107,95,115,116,114,95,108,101,110,95,99,104,97,114,0,110,107,95,112,117,115,104,95,115,99,105,115,115,111,114,0,110,107,95,115,116,114,111,107,101,95,108,105,110,101,0,110,107,95,102,105,108,108,95,114,101,99,116,0,110,107,95,102,105,108,108,95,114,101,99,116,95,109,117,108,116,105,95,99,111,108,111,114,0,110,107,95,102,105,108,108,95,99,105,114,99,108,101,0,110,107,95,102,105,108,108,95,116,114,105,97,110,103,108,101,0,110,107,95,100,114,97,119,95,105,109,97,103,101,0,110,107,95,100,114,97,119,95,116,101,120,116,0,102,111,110,116,0,110,107,95,95,100,114,97,119,95,108,105,115,116,95,98,101,103,105,110,0,110,107,95,95,100,114,97,119,95,108,105,115,116,95,110,101,120,116,0,99,97,110,118,97,115,0,108,105,115,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,99,108,101,97,114,0,110,107,95,100,114,97,119,95,108,105,115,116,95,115,116,114,111,107,101,95,112,111,108,121,95,108,105,110,101,0,118,116,120,32,38,38,32,105,100,115,0,110,111,114,109,97,108,115,0,110,107,95,100,114,97,119,95,108,105,115,116,95,102,105,108,108,95,112,111,108,121,95,99,111,110,118,101,120,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,99,108,101,97,114,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,108,105,110,101,95,116,111,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,97,114,99,95,116,111,95,102,97,115,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,97,114,99,95,116,111,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,114,101,99,116,95,116,111,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,99,117,114,118,101,95,116,111,0,108,105,115,116,45,62,112,97,116,104,95,99,111,117,110,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,102,105,108,108,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,115,116,114,111,107,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,115,116,114,111,107,101,95,108,105,110,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,102,105,108,108,95,114,101,99,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,115,116,114,111,107,101,95,114,101,99,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,102,105,108,108,95,114,101,99,116,95,109,117,108,116,105,95,99,111,108,111,114,0,110,107,95,100,114,97,119,95,108,105,115,116,95,102,105,108,108,95,116,114,105,97,110,103,108,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,115,116,114,111,107,101,95,116,114,105,97,110,103,108,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,102,105,108,108,95,99,105,114,99,108,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,115,116,114,111,107,101,95,99,105,114,99,108,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,115,116,114,111,107,101,95,99,117,114,118,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,97,100,100,95,105,109,97,103,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,97,100,100,95,116,101,120,116,0,99,116,120,0,110,107,95,99,111,110,118,101,114,116,0,99,109,100,115,0,118,101,114,116,105,99,101,115,0,101,108,101,109,101,110,116,115,0,99,111,110,102,105,103,0,110,107,95,102,111,110,116,95,98,97,107,101,95,109,101,109,111,114,121,0,103,108,121,112,104,95,99,111,117,110,116,0,105,109,97,103,101,95,109,101,109,111,114,121,0,110,107,95,102,111,110,116,95,98,97,107,101,95,112,97,99,107,0,119,105,100,116,104,0,104,101,105,103,104,116,0,116,101,109,112,0,116,101,109,112,95,115,105,122,101,0,99,111,117,110,116,0,97,108,108,111,99,0,114,101,99,116,95,110,32,61,61,32,116,111,116,97,108,95,103,108,121,112,104,95,99,111,117,110,116,0,99,104,97,114,95,110,32,61,61,32,116,111,116,97,108,95,103,108,121,112,104,95,99,111,117,110,116,0,114,97,110,103,101,95,110,32,61,61,32,116,111,116,97,108,95,114,97,110,103,101,95,99,111,117,110,116,0,110,107,95,102,111,110,116,95,98,97,107,101,0,102,111,110,116,95,99,111,117,110,116,0,103,108,121,112,104,115,95,99,111,117,110,116,0,105,109,103,95,109,101,109,111,114,121,0,110,107,95,102,111,110,116,95,98,97,107,101,95,99,117,115,116,111,109,95,100,97,116,97,0,105,109,103,95,119,105,100,116,104,0,105,109,103,95,104,101,105,103,104,116,0,116,101,120,116,117,114,101,95,100,97,116,97,95,109,97,115,107,0,111,117,116,95,109,101,109,111,114,121,0,110,107,95,102,111,110,116,95,98,97,107,101,95,99,111,110,118,101,114,116,0,105,110,95,109,101,109,111,114,121,0,110,107,95,102,111,110,116,95,102,105,110,100,95,103,108,121,112,104,0,102,111,110,116,45,62,103,108,121,112,104,115,0,110,107,95,102,111,110,116,95,105,110,105,116,0,103,108,121,112,104,115,0,98,97,107,101,100,95,102,111,110,116,0,97,116,108,97,115,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,105,110,105,116,95,100,101,102,97,117,108,116,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,98,101,103,105,110,0,97,116,108,97,115,45,62,116,101,109,112,111,114,97,114,121,46,97,108,108,111,99,32,38,38,32,97,116,108,97,115,45,62,116,101,109,112,111,114,97,114,121,46,102,114,101,101,0,97,116,108,97,115,45,62,112,101,114,109,97,110,101,110,116,46,97,108,108,111,99,32,38,38,32,97,116,108,97,115,45,62,112,101,114,109,97,110,101,110,116,46,102,114,101,101,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,97,100,100,0,97,116,108,97,115,45,62,112,101,114,109,97,110,101,110,116,46,97,108,108,111,99,0,97,116,108,97,115,45,62,112,101,114,109,97,110,101,110,116,46,102,114,101,101,0,97,116,108,97,115,45,62,116,101,109,112,111,114,97,114,121,46,97,108,108,111,99,0,97,116,108,97,115,45,62,116,101,109,112,111,114,97,114,121,46,102,114,101,101,0,99,111,110,102,105,103,45,62,116,116,102,95,98,108,111,98,0,99,111,110,102,105,103,45,62,116,116,102,95,115,105,122,101,0,99,111,110,102,105,103,45,62,115,105,122,101,32,62,32,48,46,48,102,0,97,116,108,97,115,45,62,102,111,110,116,95,110,117,109,0,99,45,62,116,116,102,95,98,108,111,98,0,99,111,109,112,114,101,115,115,101,100,95,100,97,116,97,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,97,100,100,95,99,111,109,112,114,101,115,115,101,100,0,99,111,109,112,114,101,115,115,101,100,95,115,105,122,101,0,100,101,99,111,109,112,114,101,115,115,101,100,95,100,97,116,97,0,100,97,116,97,95,98,97,115,101,56,53,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,97,100,100,95,99,111,109,112,114,101,115,115,101,100,95,98,97,115,101,56,53,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,97,100,100,95,100,101,102,97,117,108,116,0,55,93,41,35,35,35,35,35,35,35,104,86,48,113,115,39,47,35,35,35,91,41,44,35,35,47,108,58,36,35,81,54,62,35,35,53,91,110,52,50,62,99,45,84,72,96,45,62,62,35,47,101,62,49,49,78,78,86,61,66,118,40,42,58,46,70,63,117,117,35,40,103,82,85,46,111,48,88,71,72,96,36,118,104,76,71,49,104,120,116,57,63,87,96,35,44,53,76,115,67,112,35,45,105,62,46,114,36,60,36,54,112,68,62,76,98,39,59,57,67,114,99,54,116,103,88,109,75,86,101,85,50,99,68,52,69,111,51,82,47,50,42,62,93,98,40,77,67,59,36,106,80,102,89,46,59,104,94,96,73,87,77,57,60,76,104,50,84,108,83,43,102,45,115,36,111,54,81,60,66,87,72,96,89,105,85,46,120,102,76,113,36,78,59,36,48,105,82,47,71,88,58,85,40,106,99,87,50,112,47,87,42,113,63,45,113,109,110,85,67,73,59,106,72,83,65,105,70,87,77,46,82,42,107,85,64,67,61,71,72,63,97,57,119,112,56,102,36,101,46,45,52,94,81,103,49,41,81,45,71,76,40,108,102,40,114,47,55,71,114,82,103,119,86,37,77,83,61,67,35,96,56,78,68,62,81,111,35,116,39,88,35,40,118,35,89,57,119,48,35,49,68,36,67,73,102,59,87,39,35,112,87,85,80,88,79,117,120,88,117,85,40,72,57,77,40,49,60,113,45,85,69,51,49,35,94,45,86,39,56,73,82,85,111,55,81,102,46,47,76,62,61,75,101,36,36,39,53,70,37,41,93,48,94,35,48,88,64,85,46,97,60,114,58,81,76,116,70,115,76,99,76,54,35,35,108,79,106,41,35,46,89,53,60,45,82,38,75,103,76,119,113,74,102,76,103,78,38,59,81,63,103,73,94,35,68,89,50,117,76,105,64,94,114,77,108,57,116,61,99,87,113,54,35,35,119,101,103,62,36,70,66,106,86,81,84,83,68,103,69,75,110,73,83,55,69,77,57,62,90,89,57,119,48,35,76,59,62,62,35,77,120,38,52,77,118,116,47,47,76,91,77,107,65,35,87,64,108,75,46,78,39,91,48,35,55,82,76,95,38,35,119,43,70,37,72,116,71,57,77,35,88,76,96,78,38,46,44,71,77,52,80,103,59,45,60,110,76,69,78,104,118,120,62,45,86,115,77,46,77,48,114,74,102,76,72,50,101,84,77,96,42,111,74,77,72,82,67,96,78,107,102,105,109,77,50,74,44,87,45,106,88,83,58,41,114,48,119,75,35,64,70,103,101,36,85,62,96,119,39,78,55,71,35,36,35,102,66,35,36,69,94,36,35,58,57,58,104,107,43,101,79,101,45,45,54,120,41,70,55,42,69,37,63,55,54,37,94,71,77,72,101,80,87,45,90,53,108,39,38,71,105,70,35,36,57,53,54,58,114,83,63,100,65,35,102,105,75,58,41,89,114,43,96,38,35,48,106,64,39,68,98,71,38,35,94,36,80,71,46,76,108,43,68,78,97,60,88,67,77,75,69,86,42,78,41,76,78,47,78,42,98,61,37,81,54,112,105,97,45,88,103,56,73,36,60,77,82,38,44,86,100,74,101,36,60,40,55,71,59,67,107,108,39,38,104,70,59,59,36,60,95,61,88,40,98,46,82,83,37,37,41,35,35,35,77,80,66,117,117,69,49,86,58,118,38,99,88,38,35,50,109,35,40,38,99,86,93,96,107,57,79,104,76,77,98,110,37,115,36,71,50,44,66,36,66,102,68,51,88,42,115,112,53,35,108,44,36,82,35,93,120,95,88,49,120,75,88,37,98,53,85,42,91,114,53,105,77,102,85,111,57,85,96,78,57,57,104,71,41,116,109,43,47,85,115,57,112,71,41,88,80,117,96,60,48,115,45,41,87,84,116,40,103,67,82,120,73,103,40,37,54,115,102,104,61,107,116,77,75,110,51,106,41,60,54,60,98,53,83,107,95,47,48,40,94,93,65,97,78,35,40,112,47,76,62,38,86,90,62,49,105,37,104,49,83,57,117,53,111,64,89,97,97,87,36,101,43,98,60,84,87,70,110,47,90,58,79,104,40,67,120,50,36,108,78,69,111,78,94,101,41,35,67,70,89,64,64,73,59,66,79,81,42,115,82,119,90,116,90,120,82,99,85,55,117,87,54,67,88,111,119,48,105,40,63,36,81,91,99,106,79,100,91,80,52,100,41,93,62,82,79,80,79,112,120,84,79,55,83,116,119,105,49,58,58,105,66,49,113,41,67,95,61,100,86,50,54,74,59,50,44,93,55,111,112,36,93,117,81,114,64,95,86,55,36,113,94,37,108,81,119,116,117,72,89,93,61,68,88,44,110,51,76,35,48,80,72,68,79,52,102,57,62,100,67,64,79,62,72,66,117,75,80,112,80,42,69,44,78,43,98,51,76,35,108,112,82,47,77,114,84,69,72,46,73,65,81,107,46,97,62,68,91,46,101,59,109,99,46,120,93,73,112,46,80,72,94,39,47,97,113,85,79,47,36,49,87,120,76,111,87,48,91,105,76,65,60,81,84,59,53,72,75,68,43,64,113,81,39,78,81,40,51,95,80,76,104,69,52,56,82,46,113,65,80,83,119,81,48,47,87,75,63,90,44,91,120,63,45,74,59,106,81,84,87,65,48,88,64,75,74,40,95,89,56,78,45,58,47,77,55,52,58,47,45,90,112,75,114,85,115,115,63,100,35,100,90,113,93,68,65,98,107,85,42,74,113,107,76,43,110,119,88,64,64,52,55,96,53,62,119,61,52,104,40,57,46,96,71,67,82,85,120,72,80,101,82,96,53,77,106,111,108,40,100,85,87,120,90,97,40,62,83,84,114,80,107,114,74,105,87,120,96,53,85,55,70,35,46,103,42,106,114,111,104,71,103,96,99,103,58,108,83,84,118,69,89,47,69,86,95,55,72,52,81,57,91,90,37,99,110,118,59,74,81,89,90,53,113,46,108,55,90,101,97,115,58,72,79,73,90,79,66,63,71,60,78,97,108,100,36,113,115,93,64,93,76,60,74,55,98,82,42,62,103,118,58,91,55,77,73,50,107,41,46,39,50,40,36,53,70,78,80,38,69,81,40,44,41,85,93,87,93,43,102,104,49,56,46,118,115,97,105,48,48,41,59,68,51,64,52,107,117,53,80,63,68,80,56,97,74,116,43,59,113,85,77,93,61,43,98,39,56,64,59,109,86,105,66,75,120,48,68,69,91,45,97,117,71,108,56,58,80,74,38,68,106,43,77,54,79,67,93,79,94,40,40,35,35,93,96,48,105,41,100,114,84,59,45,55,88,96,61,45,72,51,91,105,103,85,110,80,71,45,78,90,108,111,46,35,107,64,104,35,61,79,114,107,36,109,62,97,62,36,45,63,84,109,36,85,86,40,63,35,80,54,89,89,35,39,47,35,35,35,120,101,55,113,46,55,51,114,73,51,42,112,80,47,36,49,62,115,57,41,87,44,74,114,77,55,83,78,93,39,47,52,67,35,118,36,85,96,48,35,86,46,91,48,62,120,81,115,72,36,102,69,109,80,77,103,89,50,117,55,75,104,40,71,37,115,105,73,102,76,83,111,83,43,77,75,50,101,84,77,36,61,53,44,77,56,112,96,65,46,59,95,82,37,35,117,91,75,35,36,120,52,65,71,56,46,107,75,47,72,83,66,61,61,45,39,73,101,47,81,84,116,71,63,45,46,42,94,78,45,52,66,47,90,77,95,51,89,108,81,67,55,40,112,55,113,41,38,93,40,96,54,95,99,41,36,47,42,74,76,40,76,45,94,40,93,36,119,73,77,96,100,80,116,79,100,71,65,44,85,51,58,119,50,77,45,48,60,113,45,93,76,95,63,94,41,49,118,119,39,46,44,77,82,115,113,86,114,46,76,59,97,78,38,35,47,69,103,74,41,80,66,99,91,45,102,62,43,87,111,109,88,50,117,55,108,113,77,50,105,69,117,109,77,84,99,115,70,63,45,97,84,61,90,45,57,55,85,69,110,88,103,108,69,110,49,75,45,98,110,69,79,96,103,117,70,116,40,99,37,61,59,65,109,95,81,115,64,106,76,111,111,73,38,78,88,59,93,48,35,106,52,35,70,49,52,59,103,108,56,45,71,81,112,103,119,104,114,113,56,39,61,108,95,102,45,98,52,57,39,85,79,113,107,76,117,55,45,35,35,111,68,89,50,76,40,116,101,43,77,99,104,38,103,76,89,116,74,44,77,69,116,74,102,76,104,39,120,39,77,61,36,67,83,45,90,90,37,80,93,56,98,90,62,35,83,63,89,89,35,37,81,38,113,39,51,94,70,119,38,63,68,41,85,68,78,114,111,99,77,51,65,55,54,47,47,111,76,63,35,104,55,103,108,56,53,91,113,87,47,78,68,79,107,37,49,54,105,106,59,43,58,49,97,39,105,78,73,100,98,45,111,117,56,46,80,42,119,44,118,53,35,69,73,36,84,87,83,62,80,111,116,45,82,42,72,39,45,83,69,112,65,58,103,41,102,43,79,36,37,37,96,107,65,35,71,61,56,82,77,109,71,49,38,79,96,62,116,111,56,98,67,93,84,38,36,44,110,46,76,111,79,62,50,57,115,112,51,100,116,45,53,50,85,37,86,77,35,113,55,39,68,72,112,103,43,35,90,57,37,72,91,75,60,76,37,97,50,69,45,103,114,87,86,77,51,64,50,61,45,107,50,50,116,76,93,52,36,35,35,54,87,101,39,56,85,74,67,75,69,91,100,95,61,37,119,73,59,39,54,88,45,71,115,76,88,52,106,94,83,103,74,36,35,35,82,42,119,44,118,80,51,119,75,35,105,105,87,38,35,42,104,94,68,38,82,63,106,112,55,43,47,117,38,35,40,65,80,35,35,88,85,56,99,36,102,83,89,87,45,74,57,53,95,45,68,112,91,103,57,119,99,79,38,35,77,45,104,49,79,99,74,108,99,45,42,118,112,119,48,120,85,88,38,35,79,81,70,75,78,88,64,81,73,39,73,111,80,112,55,110,98,44,81,85,47,47,77,81,38,90,68,107,75,80,41,88,60,87,83,86,76,40,54,56,117,86,108,38,35,99,39,91,48,35,40,115,49,88,38,120,109,36,89,37,66,55,42,75,58,101,68,65,51,50,51,106,57,57,56,71,88,98,65,35,112,119,77,115,45,106,103,68,36,57,81,73,83,66,45,65,95,40,97,78,52,120,111,70,77,94,64,67,53,56,68,48,43,81,43,113,51,110,48,35,51,85,49,73,110,68,106,70,54,56,50,45,83,106,77,88,74,75,41,40,104,36,104,120,117,97,95,75,93,117,108,57,50,37,39,66,79,85,38,35,66,82,82,104,45,115,108,103,56,75,68,108,114,58,37,76,55,49,75,97,58,46,65,59,37,89,85,76,106,68,80,109,76,60,76,89,115,56,105,35,88,119,74,79,89,97,75,80,75,99,49,104,58,39,57,75,101,44,103,41,98,41,44,55,56,61,73,51,57,66,59,120,105,89,36,98,103,71,119,45,38,46,90,105,57,73,110,88,68,117,89,97,37,71,42,102,50,66,113,55,109,110,57,94,35,112,49,118,118,37,35,40,87,105,45,59,47,90,53,104,111,59,35,50,58,59,37,100,38,35,120,57,118,54,56,67,53,103,63,110,116,88,48,88,41,112,84,96,59,37,112,66,51,113,55,109,103,71,78,41,51,37,40,80,56,110,84,100,53,76,55,71,101,65,45,71,76,64,43,37,74,51,117,50,58,40,89,102,62,101,116,96,101,59,41,102,35,75,109,56,38,43,68,67,36,73,52,54,62,35,75,114,93,93,117,45,91,61,57,57,116,116,115,49,46,113,98,35,113,55,50,103,49,87,74,79,56,49,113,43,101,78,39,48,51,39,101,77,62,38,49,88,120,89,45,99,97,69,110,79,106,37,50,110,56,41,41,44,63,73,76,82,53,94,46,73,98,110,60,45,88,45,77,113,55,91,97,56,50,76,113,58,70,38,35,99,101,43,83,57,119,115,67,75,42,120,96,53,54,57,69,56,101,119,39,72,101,93,104,58,115,73,91,50,76,77,36,91,103,117,107,97,51,90,82,100,54,58,116,37,73,71,58,59,36,37,89,105,74,58,78,113,61,63,101,65,119,59,47,58,110,110,68,113,48,40,67,89,99,77,112,71,41,113,76,78,52,36,35,35,38,74,60,106,36,85,112,75,60,81,52,97,49,93,77,117,112,87,94,45,115,106,95,36,37,91,72,75,37,39,70,35,35,35,35,81,82,90,74,58,58,89,51,69,71,108,52,39,64,37,70,107,105,65,79,103,35,112,91,35,35,79,96,103,117,107,84,102,66,72,97,103,76,60,76,72,119,37,113,38,79,86,48,35,35,70,61,54,47,58,99,104,73,109,48,64,101,67,80,56,88,93,58,107,70,73,37,104,108,56,104,103,79,64,82,99,66,104,83,45,64,81,98,36,37,43,109,61,104,80,68,76,103,42,37,75,56,108,110,40,119,99,102,51,47,39,68,87,45,36,46,108,82,63,110,91,110,67,72,45,101,88,79,79,78,84,74,108,104,58,46,82,89,70,37,51,39,112,54,115,113,58,85,73,77,65,57,52,53,38,94,72,70,83,56,55,64,36,69,80,50,105,71,60,45,108,67,79,36,37,99,96,117,75,71,68,51,114,67,36,120,48,66,76,56,97,70,110,45,45,96,107,101,37,35,72,77,80,39,118,104,49,47,82,38,79,95,74,57,39,117,109,44,46,60,116,120,91,64,37,119,115,74,107,38,98,85,84,50,96,48,117,77,118,55,103,103,35,113,112,47,105,106,46,76,53,54,39,104,108,59,46,115,53,67,85,114,120,106,79,77,55,45,35,35,46,108,43,65,117,39,65,38,79,58,45,84,55,50,76,93,80,96,38,61,59,99,116,112,39,88,83,99,88,42,114,85,46,62,45,88,84,116,44,37,79,86,85,52,41,83,49,43,82,45,35,100,103,48,47,78,110,63,75,117,49,94,48,102,36,66,42,80,58,82,111,119,119,109,45,96,48,80,75,106,89,68,68,77,39,51,93,100,51,57,86,90,72,69,108,52,44,46,106,39,93,80,107,45,77,46,104,94,38,58,48,70,65,67,109,36,109,97,113,45,38,115,103,119,48,116,55,47,54,40,94,120,116,107,37,76,117,72,56,56,70,106,45,101,107,109,62,71,65,35,95,62,53,54,56,120,54,40,79,70,82,108,45,73,90,112,96,38,98,44,95,80,39,36,77,60,74,110,113,55,57,86,115,74,87,47,109,87,83,42,80,85,105,113,55,54,59,93,47,78,77,95,62,104,76,98,120,102,99,36,109,106,96,44,79,59,38,37,87,50,109,96,90,104,58,47,41,85,101,116,119,58,97,74,37,93,75,57,104,58,84,99,70,93,117,95,45,83,106,57,44,86,75,51,77,46,42,39,38,48,68,91,67,97,93,74,57,103,112,56,44,107,65,87,93,37,40,63,65,37,82,36,102,60,45,62,90,116,115,39,94,107,110,61,45,94,64,99,52,37,45,112,89,54,113,73,37,74,37,49,73,71,120,102,76,85,57,67,80,56,99,98,80,108,88,118,41,59,67,61,98,41,44,60,50,109,79,118,80,56,117,112,44,85,86,102,51,56,51,57,97,99,65,87,65,87,45,87,63,35,97,111,47,94,35,37,75,89,111,56,102,82,85,76,78,100,50,46,62,37,109,93,85,75,58,110,37,114,36,39,115,119,93,74,59,53,112,65,111,79,95,35,50,109,79,51,110,44,39,61,72,53,40,101,116,72,103,42,96,43,82,76,103,118,62,61,52,85,56,103,117,68,36,73,37,68,58,87,62,45,114,53,86,42,37,106,42,87,58,75,118,101,106,46,76,112,36,60,77,45,83,71,90,39,58,43,81,95,107,43,117,118,79,83,76,105,69,111,40,60,97,68,47,75,60,67,67,99,96,39,76,120,62,39,63,59,43,43,79,39,62,40,41,106,76,82,45,94,117,54,56,80,72,109,56,90,70,87,101,43,101,106,56,104,58,57,114,54,76,42,48,47,47,99,38,105,72,38,82,56,112,82,98,65,35,75,106,109,37,117,112,86,49,103,58,97,95,35,85,114,55,70,117,65,35,40,116,82,104,35,46,89,53,75,43,64,63,51,60,45,56,109,48,36,80,69,110,59,74,58,114,104,54,63,73,54,117,71,60,45,96,119,77,85,39,105,114,99,112,48,76,97,69,95,79,116,108,77,98,38,49,35,54,84,46,35,70,68,75,117,35,49,76,119,37,117,37,43,71,77,43,88,39,101,63,89,76,102,106,77,91,86,79,48,77,98,117,70,112,55,59,62,81,38,35,87,73,111,41,48,64,70,37,113,55,99,35,52,88,65,88,78,45,85,38,86,66,60,72,70,70,42,113,76,40,36,47,86,44,59,40,107,88,90,101,106,87,79,96,60,91,53,63,63,101,119,89,40,42,57,61,37,119,68,99,59,44,117,60,39,57,116,51,87,45,40,72,49,116,104,51,43,71,93,117,99,81,93,107,76,115,55,100,102,40,36,47,42,74,76,93,64,42,116,55,66,117,95,71,51,95,55,109,112,55,60,105,97,81,106,79,64,46,107,76,103,59,120,51,66,48,108,113,112,55,72,102,44,94,90,101,55,45,35,35,64,47,99,53,56,77,111,40,51,59,107,110,112,48,37,41,65,55,63,45,87,43,101,73,39,111,56,41,98,60,110,75,110,119,39,72,111,56,67,61,89,62,112,113,66,62,48,105,101,38,106,104,90,91,63,105,76,82,64,64,95,65,118,65,45,105,81,67,40,61,107,115,82,90,82,86,112,55,96,46,61,43,78,112,66,67,37,114,104,38,51,93,82,58,56,88,68,109,69,53,94,86,56,79,40,120,60,60,97,71,47,49,78,36,35,70,88,36,48,86,53,89,54,120,39,97,69,114,73,51,73,36,55,120,37,69,96,118,60,45,66,89,44,41,37,45,63,80,115,102,42,108,63,37,67,51,46,109,77,40,61,47,77,48,58,74,120,71,39,63,55,87,104,72,37,111,39,97,60,45,56,48,103,48,78,66,120,111,79,40,71,72,60,100,77,93,110,46,43,37,113,64,106,72,63,102,46,85,115,74,50,71,103,115,38,52,60,45,101,52,55,38,75,108,43,102,47,47,57,64,96,98,43,63,46,84,101,78,95,38,66,56,83,115,63,118,59,94,84,114,107,59,102,35,89,118,74,107,108,38,119,36,93,62,45,43,107,63,39,40,60,83,58,54,56,116,113,42,87,111,68,102,90,117,39,59,109,77,63,56,88,91,109,97,56,87,37,42,96,45,61,59,68,46,40,110,99,55,47,59,41,103,58,84,49,61,94,74,36,38,66,82,86,40,45,108,84,109,78,66,54,120,113,66,91,64,48,42,111,46,101,114,77,42,60,83,87,70,93,117,50,61,115,116,45,42,40,54,118,62,94,93,40,72,46,97,82,69,90,83,105,44,35,49,58,91,73,88,97,90,70,79,109,60,45,117,105,35,113,85,113,50,36,35,35,82,105,59,117,55,53,79,75,35,40,82,116,97,87,45,75,45,70,96,83,43,99,70,93,117,78,96,45,75,77,81,37,114,80,47,88,114,105,46,76,82,99,66,35,35,61,89,76,51,66,103,77,47,51,77,68,63,64,102,38,49,39,66,87,45,41,74,117,60,76,50,53,103,108,56,117,104,86,109,49,104,76,36,35,35,42,56,35,35,35,39,65,51,47,76,107,75,87,43,40,94,114,87,88,63,53,87,95,56,103,41,97,40,109,38,75,56,80,62,35,98,109,109,87,67,77,107,107,38,35,84,82,96,67,44,53,100,62,103,41,70,59,116,44,52,58,64,95,108,56,71,47,53,104,52,118,85,100,37,38,37,57,53,48,58,86,88,68,39,81,100,87,111,89,45,70,36,66,116,85,119,109,102,101,36,89,113,76,39,56,40,80,87,88,40,80,63,94,64,80,111,51,36,35,35,96,77,83,115,63,68,87,66,90,47,83,62,43,52,37,62,102,88,44,86,87,118,47,119,39,75,68,96,76,80,53,73,98,72,59,114,84,86,62,110,51,99,69,75,56,85,35,98,88,93,108,45,47,86,43,94,108,106,51,59,118,108,77,98,38,91,53,89,81,56,35,112,101,107,88,57,74,80,51,88,85,67,55,50,76,44,44,63,43,78,105,38,99,111,55,65,112,110,79,42,53,78,75,44,40,40,87,45,105,58,36,44,107,112,39,85,68,65,79,40,71,48,83,113,55,77,86,106,74,115,98,73,117,41,39,90,44,42,91,62,98,114,53,102,88,94,58,70,80,65,87,114,45,109,50,75,103,76,60,76,85,78,48,57,56,107,84,70,38,35,108,118,111,53,56,61,47,118,106,68,111,59,46,59,41,75,97,42,104,76,82,35,47,107,61,114,75,98,120,117,86,96,62,81,95,110,78,54,39,56,117,84,71,38,35,49,84,53,103,41,117,76,118,58,56,55,51,85,112,84,76,103,72,43,35,70,103,112,72,39,95,111,49,55,56,48,80,104,56,75,109,120,81,74,56,35,72,55,50,76,52,64,55,54,56,64,84,109,38,81,104,52,67,66,47,53,79,118,109,65,38,44,81,38,81,98,85,111,105,36,97,95,37,51,77,48,49,72,41,52,120,55,73,94,38,75,81,86,103,116,70,110,86,43,59,91,80,99,62,91,109,52,107,47,47,44,93,49,63,35,96,86,89,91,74,114,42,51,38,38,115,108,82,102,76,105,86,90,74,58,93,63,61,75,51,83,119,61,91,36,61,117,82,66,63,51,120,107,52,56,64,97,101,103,60,90,39,60,36,35,52,72,41,54,44,62,101,48,106,84,54,39,78,35,40,113,37,46,79,61,63,50,83,93,117,42,40,109,60,45,86,56,74,39,40,49,41,71,93,91,54,56,104,87,36,53,39,113,91,71,67,38,53,106,96,84,69,63,109,39,101,115,70,71,78,82,77,41,106,44,102,102,90,63,45,113,120,56,59,45,62,103,52,116,42,58,67,73,80,47,91,81,97,112,55,47,57,39,35,40,49,115,97,111,55,119,45,46,113,78,85,100,107,74,41,116,67,70,38,35,66,94,59,120,71,118,110,50,114,57,70,69,80,70,70,70,99,76,64,46,105,70,78,107,84,118,101,36,109,37,35,81,118,81,83,56,85,64,41,50,90,43,51,75,58,65,75,77,53,105,115,90,56,56,43,100,75,81,41,87,54,62,74,37,67,76,60,75,69,62,96,46,100,42,40,66,96,45,110,56,68,57,111,75,60,85,112,93,99,36,88,36,40,44,41,77,56,90,116,55,47,91,114,100,107,113,84,103,108,45,48,99,117,71,77,118,39,63,62,45,88,86,49,113,91,39,45,53,107,39,99,65,90,54,57,101,59,68,95,63,36,90,80,80,38,115,94,43,55,93,41,36,42,36,35,64,81,89,105,57,44,53,80,38,35,57,114,43,36,37,67,69,61,54,56,62,75,56,114,48,61,100,83,67,37,37,40,64,112,55,46,109,55,106,105,108,81,48,50,39,48,45,86,87,65,103,60,97,47,39,39,51,117,46,61,52,76,36,89,41,54,107,47,75,58,95,91,51,61,38,106,118,76,60,76,48,67,47,50,39,118,58,94,59,45,68,73,66,87,44,66,52,69,54,56,58,107,90,59,37,63,56,40,81,56,66,72,61,107,79,54,53,66,87,63,120,83,71,38,35,64,117,85,44,68,83,42,44,63,46,43,40,111,40,35,49,118,67,83,56,35,67,72,70,62,84,108,71,87,39,98,41,84,113,55,86,84,57,113,94,42,94,36,36,46,58,38,78,64,64,36,38,41,87,72,116,80,109,42,53,95,114,79,48,38,101,37,75,38,35,45,51,48,106,40,69,52,35,39,90,98,46,111,47,40,84,112,109,36,62,75,39,102,64,91,80,118,70,108,44,104,102,73,78,84,78,85,54,117,39,48,112,97,111,55,37,88,85,112,57,93,53,46,62,37,104,96,56,95,61,86,89,98,120,117,101,108,46,78,84,83,115,74,102,76,97,99,70,117,51,66,39,108,81,83,117,47,109,54,45,79,113,101,109,56,84,43,111,69,45,45,36,48,97,47,107,93,117,106,57,69,119,115,71,62,37,118,101,82,42,104,118,94,66,70,112,81,106,58,75,39,35,83,74,44,115,66,45,39,35,93,40,106,46,76,103,57,50,114,84,119,45,42,110,37,64,47,59,51,57,114,114,74,70,44,108,35,113,86,37,79,114,116,66,101,67,54,47,44,59,113,66,51,101,98,78,87,91,63,44,72,113,106,50,76,46,49,78,80,38,71,106,85,82,61,49,68,56,81,97,83,51,85,112,38,64,42,57,119,80,63,43,108,111,55,98,63,64,37,39,107,52,96,112,48,90,36,50,50,37,75,51,43,105,67,90,106,63,88,74,78,52,78,109,38,43,89,70,93,117,64,45,87,36,85,37,86,69,81,47,44,44,62,62,35,41,68,60,104,35,96,41,104,48,58,60,81,54,57,48,57,117,97,43,38,86,85,37,110,50,58,99,71,51,70,74,45,37,64,66,106,45,68,103,76,114,96,72,119,38,72,65,75,106,75,106,115,101,75,60,47,120,75,84,42,41,66,44,78,57,88,51,93,107,114,99,49,50,116,39,112,103,84,86,40,76,118,45,116,76,91,120,103,95,37,61,77,95,113,55,97,94,120,63,55,85,98,100,62,35,37,56,99,89,35,89,90,63,61,44,96,87,100,120,117,47,97,101,38,35,119,54,41,82,56,57,116,73,35,54,64,115,39,40,54,66,102,55,97,38,63,83,61,94,90,73,95,107,83,38,97,105,96,38,61,116,69,55,50,76,95,68,44,59,94,82,41,55,91,36,115,60,69,104,35,99,38,41,113,46,77,88,73,37,35,118,57,82,79,97,53,70,90,79,37,115,70,55,113,55,78,119,98,38,35,112,116,85,74,58,97,113,74,101,36,83,108,54,56,37,46,68,35,35,35,69,67,62,60,63,45,97,70,38,35,82,78,81,118,62,111,56,108,75,78,37,53,47,36,40,118,100,102,113,55,43,101,98,65,35,117,49,112,93,111,118,85,75,87,38,89,37,113,93,39,62,36,49,64,45,91,120,102,110,36,55,90,84,112,55,109,77,44,71,44,75,111,55,97,38,71,117,37,71,91,82,77,120,74,115,91,48,77,77,37,119,99,105,46,76,70,68,75,41,40,60,99,96,81,56,78,41,106,69,73,70,42,43,63,80,50,97,56,103,37,41,36,113,93,111,50,97,72,56,67,38,60,83,105,98,67,47,113,44,40,101,58,118,59,45,98,35,54,91,36,78,116,68,90,56,52,74,101,50,75,78,118,66,35,36,80,53,63,116,81,51,110,116,40,48,100,61,106,46,76,81,102,46,47,76,108,51,51,43,40,59,113,51,76,45,119,61,56,100,88,36,35,87,70,38,117,73,74,64,45,98,102,73,62,37,58,95,105,50,66,53,67,115,82,56,38,57,90,38,35,61,109,80,69,110,109,48,102,96,60,38,99,41,81,76,53,117,74,35,37,117,37,108,74,106,43,68,45,114,59,66,111,70,38,35,52,68,111,83,57,55,104,53,103,41,69,35,111,58,38,83,52,119,101,68,70,44,57,94,72,111,101,96,104,42,76,43,95,97,42,78,114,76,87,45,49,112,71,95,38,50,85,100,66,56,54,101,37,66,47,58,61,62,41,78,52,120,101,87,46,42,119,102,116,45,59,36,39,53,56,45,69,83,113,114,60,98,63,85,73,40,95,37,64,91,80,52,54,62,35,85,96,39,54,65,81,93,109,38,54,47,96,90,62,35,83,63,89,89,35,86,99,59,114,55,85,50,38,51,50,54,100,61,119,38,72,35,35,35,35,63,84,90,96,42,52,63,38,46,77,75,63,76,80,56,86,120,103,62,36,91,81,88,99,37,81,74,118,57,50,46,40,68,98,42,66,41,103,98,42,66,77,57,100,77,42,104,74,77,65,111,42,99,38,35,98,48,118,61,80,106,101,114,93,36,103,71,38,74,88,68,102,45,62,39,83,116,118,85,55,53,48,53,108,57,36,65,70,118,103,89,82,73,94,38,60,94,98,54,56,63,106,35,113,57,81,88,52,83,77,39,82,79,35,38,115,76,49,73,77,46,114,74,102,76,85,65,106,50,50,49,93,100,35,35,68,87,61,109,56,51,117,53,59,39,98,89,120,44,42,83,108,48,104,76,40,87,59,59,36,100,111,66,38,79,47,84,81,58,40,90,94,120,66,100,76,106,76,60,76,110,105,59,39,39,88,46,96,36,35,56,43,49,71,68,58,107,36,89,85,87,115,98,110,56,111,103,104,54,114,120,90,50,90,57,93,37,110,100,43,62,86,35,42,56,85,95,55,50,76,104,43,50,81,56,67,106,48,105,58,54,104,112,38,36,67,47,58,112,40,72,75,62,84,56,89,91,103,72,81,52,96,52,41,39,36,65,98,40,78,111,102,37,86,39,56,104,76,38,35,60,78,69,100,116,103,40,110,39,61,83,49,65,40,81,49,47,73,38,52,40,91,37,100,77,96,44,73,117,39,49,58,95,104,76,62,83,102,68,48,55,38,54,68,60,102,112,56,100,72,77,55,47,103,43,116,108,80,78,57,74,42,114,75,97,80,99,116,38,63,39,117,66,67,101,109,94,106,110,37,57,95,75,41,60,44,67,53,75,51,115,61,53,103,38,71,109,74,98,42,91,83,89,113,55,75,59,84,82,76,71,67,115,77,45,36,36,59,83,37,58,89,64,114,55,65,75,48,112,112,114,112,76,60,76,114,104,44,113,55,101,47,37,75,87,75,58,53,48,73,94,43,109,39,118,105,96,51,63,37,90,112,43,60,45,100,43,36,76,45,83,118,58,64,46,111,49,57,110,36,115,48,38,51,57,59,107,110,59,83,37,66,83,113,42,36,51,87,111,74,83,67,76,119,101,86,91,97,90,39,77,81,73,106,79,60,55,59,88,45,88,59,38,43,100,77,76,118,117,35,94,85,115,71,69,67,57,87,69,99,91,88,40,119,73,55,35,50,46,40,70,48,106,86,42,101,90,102,60,45,81,118,51,74,45,99,43,74,53,65,108,114,66,35,36,112,40,72,54,56,76,118,69,65,39,113,51,110,48,35,109,44,91,96,42,56,70,116,41,70,99,89,103,69,117,100,93,67,87,102,109,54,56,44,40,97,76,65,36,64,69,70,84,103,76,88,111,66,113,47,85,80,108,112,55,58,100,91,47,59,114,95,105,120,61,58,84,70,96,83,53,72], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+12484); /* memory initializer */ allocate([45,98,60,76,73,38,72,89,40,75,61,104,35,41,93,76,107,36,75,49,52,108,86,102,109,58,120,36,72,60,51,94,81,108,60,77,96,36,79,104,97,112,66,110,107,117,112,39,68,35,76,36,80,98,95,96,78,42,103,93,50,101,59,88,47,68,116,103,44,98,115,106,38,75,35,50,91,45,58,105,89,114,39,95,119,103,72,41,78,85,73,82,56,97,49,110,35,83,63,89,101,106,39,104,56,94,53,56,85,98,90,100,43,94,70,75,68,42,84,64,59,54,65,55,97,81,67,91,75,56,100,45,40,118,54,71,73,36,120,58,84,60,38,39,71,112,53,85,102,62,64,77,46,42,74,58,59,36,45,114,118,50,57,39,77,93,56,113,77,118,45,116,76,112,44,39,56,56,54,105,97,67,61,72,98,42,89,74,111,75,74,44,40,106,37,75,61,72,96,75,46,118,57,72,103,103,113,66,73,105,90,117,39,81,118,66,84,46,35,61,41,48,117,107,114,117,86,38,46,41,51,61,40,94,49,96,111,42,80,106,52,60,45,60,97,78,40,40,94,55,40,39,35,90,48,119,75,35,53,71,88,64,55,117,93,91,96,42,83,94,52,51,57,51,51,65,52,114,108,93,91,96,42,79,52,67,103,76,69,108,93,118,36,49,81,51,65,101,70,51,55,100,98,88,107,44,46,41,118,106,35,120,39,100,96,59,113,103,98,81,82,37,70,87,44,50,40,63,76,79,61,115,37,83,99,54,56,37,78,80,39,35,35,65,111,116,108,56,120,61,66,69,35,106,49,85,68,40,91,51,36,77,40,93,85,73,50,76,88,51,82,112,75,78,64,59,47,35,102,39,102,47,38,95,109,116,38,70,41,88,100,70,60,57,116,52,41,81,97,46,42,107,84,76,119,81,39,40,84,84,66,57,46,120,72,39,62,35,77,74,43,103,76,113,57,45,35,35,64,72,117,90,80,78,48,93,117,58,104,55,46,84,46,46,71,58,59,36,47,85,115,106,40,84,55,96,81,56,116,84,55,50,76,110,89,108,60,45,113,120,56,59,45,72,86,55,81,45,38,88,100,120,37,49,97,44,104,67,61,48,117,43,72,108,115,86,62,110,117,73,81,76,45,53,60,78,63,41,78,66,83,41,81,78,42,95,73,44,63,38,41,50,39,73,77,37,76,51,73,41,88,40,40,101,47,100,108,50,38,56,39,60,77,58,94,35,77,42,81,43,91,84,46,88,114,105,46,76,89,83,51,118,37,102,70,96,54,56,104,59,98,45,88,91,47,69,110,39,67,82,46,113,55,69,41,112,39,47,107,108,101,50,72,77,44,117,59,94,37,79,75,67,45,78,43,76,108,37,70,57,67,70,60,78,102,39,94,35,116,50,76,44,59,50,55,87,58,48,79,64,54,35,35,85,54,87,55,58,36,114,74,102,76,87,72,106,36,35,41,119,111,113,66,101,102,73,90,46,80,75,60,98,42,116,55,101,100,59,112,42,95,109,59,52,69,120,75,35,104,64,38,93,62,95,62,64,107,88,81,116,77,97,99,102,68,46,109,45,86,65,98,56,59,73,82,101,77,51,36,119,102,48,39,39,104,114,97,42,115,111,53,54,56,39,73,112,38,118,82,115,56,52,57,39,77,82,89,83,112,37,58,116,58,104,53,113,83,103,119,112,69,114,36,66,62,81,44,59,115,40,67,35,36,41,96,115,118,81,117,70,36,35,35,45,68,44,35,35,44,103,54,56,64,50,91,84,59,46,88,83,100,78,57,81,101,41,114,112,116,46,95,75,45,35,53,119,70,41,115,80,39,35,35,112,35,67,48,99,37,45,71,98,37,104,100,43,60,45,106,39,65,105,42,120,38,38,72,77,107,84,93,67,39,79,83,108,35,35,53,82,71,91,74,88,97,72,78,59,100,39,117,65,35,120,46,95,85,59,46,96,80,85,64,40,90,51,100,116,52,114,49,53,50,64,58,118,44,39,82,46,83,106,39,119,35,48,60,45,59,107,80,73,41,70,102,74,38,35,65,89,74,38,35,47,47,41,62,45,107,61,109,61,42,88,110,75,36,62,61,41,55,50,76,93,48,73,37,62,46,71,54,57,48,97,58,36,35,35,60,44,41,59,63,59,55,50,35,63,120,57,43,100,59,94,86,39,57,59,106,89,64,59,41,98,114,35,113,94,89,81,112,120,58,88,35,84,101,36,90,94,39,61,45,61,98,71,104,76,102,58,68,54,38,98,78,119,90,57,45,90,68,35,110,94,57,72,104,76,77,114,53,71,59,39,93,100,38,54,39,119,89,109,84,70,109,76,60,76,68,41,70,94,37,91,116,67,39,56,59,43,57,69,35,67,36,103,37,35,53,89,62,113,57,119,73,62,80,40,57,109,73,91,62,107,67,45,101,107,76,67,47,82,38,67,72,43,115,39,66,59,75,45,77,54,36,69,66,37,105,115,48,48,58,43,65,52,91,55,120,107,115,46,76,114,78,107,48,38,69,41,119,73,76,89,70,64,50,76,39,48,78,98,36,43,112,118,60,40,50,46,55,54,56,47,70,114,89,38,104,36,94,51,105,38,64,43,71,37,74,84,39,60,45,44,118,96,51,59,95,41,73,57,77,94,65,69,93,67,78,63,67,108,50,65,90,103,43,37,52,105,84,112,84,51,60,110,45,38,37,72,37,98,60,70,68,106,50,77,60,104,72,61,38,69,104,60,50,76,101,110,36,98,42,97,84,88,61,45,56,81,120,78,41,107,49,49,73,77,49,99,94,106,37,57,115,60,76,60,78,70,83,111,41,66,63,43,60,45,40,71,120,115,70,44,94,45,69,104,64,36,52,100,88,104,78,36,43,35,114,120,75,56,39,106,101,39,68,55,107,96,101,59,41,50,112,89,119,80,65,39,95,112,57,38,64,94,49,56,109,108,49,94,91,64,103,52,116,42,91,74,79,97,42,91,61,81,112,55,40,113,74,95,111,79,76,94,40,39,55,102,66,38,72,113,45,58,115,102,44,115,78,106,56,120,113,94,62,36,85,52,79,93,71,75,120,39,109,57,41,98,64,112,55,89,115,118,75,51,119,94,89,82,45,67,100,81,42,58,73,114,60,40,36,117,38,41,35,40,38,63,76,57,82,103,51,72,41,52,102,105,69,112,94,105,73,57,79,56,75,110,84,106,44,93,72,63,68,42,114,55,39,77,59,80,119,90,57,75,48,69,94,107,38,45,99,112,73,59,46,112,47,54,95,118,119,111,70,77,86,60,45,62,35,37,88,105,46,76,120,86,110,114,85,40,52,38,56,47,80,43,58,104,76,83,75,106,36,35,85,37,93,52,57,116,39,73,58,114,103,77,105,39,70,76,64,97,58,48,89,45,117,65,91,51,57,39,44,40,118,98,109,97,42,104,85,37,60,45,83,82,70,96,84,116,58,53,52,50,82,95,86,86,36,112,64,91,112,56,68,86,91,65,44,63,49,56,51,57,70,87,100,70,60,84,100,100,70,60,57,65,104,45,54,38,57,116,87,111,68,108,104,93,38,49,83,112,71,77,113,62,84,105,49,79,42,72,38,35,40,65,76,56,91,95,80,37,46,77,62,118,94,45,41,41,113,79,84,42,70,53,67,113,48,96,89,101,37,43,36,66,54,105,58,55,64,48,73,88,60,78,43,84,43,48,77,108,77,66,80,81,42,86,106,62,83,115,68,60,85,52,74,72,89,56,107,68,50,41,50,102,85,47,77,35,36,101,46,41,84,52,44,95,61,56,104,76,105,109,91,38,41,59,63,85,107,75,39,45,120,63,39,40,58,115,105,73,102,76,60,36,112,70,77,96,105,60,63,37,87,40,109,71,68,72,77,37,62,105,87,80,44,35,35,80,96,37,47,76,60,101,88,105,58,64,90,57,67,46,55,111,61,64,40,112,88,100,65,79,47,78,76,81,56,108,80,108,43,72,80,79,81,97,56,119,68,56,61,94,71,108,80,97,56,84,75,73,49,67,106,104,115,67,84,83,76,74,77,39,47,87,108,62,45,83,40,113,119,37,115,102,47,64,37,35,66,54,59,47,85,55,75,93,117,90,98,105,94,79,99,94,50,110,60,98,104,80,109,85,107,77,119,62,37,116,60,41,39,109,69,86,69,39,39,110,96,87,110,74,114,97,36,94,84,75,118,88,53,66,62,59,95,97,83,69,75,39,44,40,104,119,97,48,58,105,52,71,63,46,66,99,105,46,40,88,91,63,98,42,40,36,44,61,45,110,60,46,81,37,96,40,88,61,63,43,64,65,109,42,74,115,48,38,61,51,98,104,56,75,93,109,76,60,76,111,78,115,39,54,44,39,56,53,96,48,63,116,47,39,95,85,53,57,64,93,100,100,70,60,35,76,100,70,60,101,87,100,70,60,79,117,78,47,52,53,114,89,60,45,76,64,38,35,43,102,109,62,54,57,61,76,98,44,79,99,90,86,47,41,59,84,84,109,56,86,73,59,63,37,79,116,74,60,40,98,52,109,113,55,77,54,58,117,63,75,82,100,70,60,103,82,64,50,76,61,70,78,85,45,60,98,91,40,57,99,47,77,76,51,109,59,90,91,36,111,70,51,103,41,71,65,87,113,112,65,82,99,61,60,82,79,117,55,99,76,53,108,59,45,91,65,93,37,47,43,102,115,100,59,108,35,83,97,102,84,47,102,42,87,93,48,61,79,39,36,40,84,98,60,91,41,42,64,101,55,55,53,82,45,58,89,111,98,37,103,42,62,108,42,58,120,80,63,89,98,46,53,41,37,119,95,73,63,55,117,107,53,74,67,43,70,83,40,109,35,105,39,107,46,39,97,48,105,41,57,60,55,98,39,102,115,39,53,57,104,113,36,42,53,85,104,118,35,35,112,105,94,56,43,104,73,69,66,70,96,110,118,111,96,59,39,108,48,46,94,83,49,60,45,119,85,75,50,47,67,111,104,53,56,75,75,104,76,106,77,61,83,79,42,114,102,79,96,43,113,67,96,87,45,79,110,46,61,65,74,53,54,62,62,105,50,64,50,76,72,54,65,58,38,53,113,96,63,57,73,51,64,64,39,48,52,38,112,50,47,76,86,97,42,84,45,52,60,45,105,51,59,77,57,85,118,90,100,43,78,55,62,98,42,101,73,119,103,58,67,67,41,99,60,62,110,79,38,35,60,73,71,101,59,95,95,46,116,104,106,90,108,60,37,119,40,87,107,50,120,109,112,52,81,64,73,35,73,57,44,68,70,93,117,55,45,80,61,46,45,95,58,89,74,93,97,83,64,86,63,54,42,67,40,41,100,79,112,55,58,87,76,44,98,38,51,82,103,47,46,99,109,77,57,38,114,94,62,36,40,62,46,90,45,73,38,74,40,81,48,72,100,53,81,37,55,67,111,45,98,96,45,99,60,78,40,54,114,64,105,112,43,65,117,114,75,60,109,56,54,81,73,116,104,42,35,118,59,45,79,66,113,105,43,76,55,119,68,69,45,73,114,56,75,91,39,109,43,68,68,83,76,119,75,38,47,46,63,45,86,37,85,95,37,51,58,113,75,78,117,36,95,98,42,66,45,107,112,55,78,97,68,39,81,100,87,81,80,75,89,113,91,64,62,80,41,104,73,59,42,95,70,93,117,96,82,98,91,46,106,56,95,81,47,60,38,62,117,117,43,86,115,72,36,115,77,57,84,65,37,63,41,40,118,109,74,56,48,41,44,80,55,69,62,41,116,106,68,37,50,76,61,45,116,35,102,75,91,37,96,118,61,81,56,60,70,102,78,107,103,103,94,111,73,98,97,104,42,35,56,47,81,116,36,70,38,58,75,42,45,40,78,47,39,43,49,118,77,66,44,117,40,41,45,97,46,86,85,85,42,35,91,101,37,103,65,65,79,40,83,62,87,108,65,50,41,59,83,97,62,103,88,109,56,89,66,96,49,100,64,75,35,110,93,55,54,45,97,36,85,44,109,70,60,102,88,93,105,100,113,100,41,60,51,44,93,74,55,74,109,87,52,96,54,93,117,107,115,61,52,45,55,50,76,40,106,69,107,43,58,98,74,48,77,94,113,45,56,68,109,95,90,63,48,111,108,80,49,67,57,83,97,38,72,91,100,38,99,36,111,111,81,85,106,93,69,120,100,42,51,90,77,64,45,87,71,87,50,37,115,39,44,66,45,95,77,37,62,37,85,108,58,35,47,39,120,111,70,77,57,81,88,45,36,46,81,78,39,62,91,37,36,90,36,117,70,54,112,65,54,75,105,50,79,53,58,56,119,42,118,80,49,60,45,49,96,91,71,44,41,45,109,35,62,48,96,80,38,35,101,98,35,46,51,105,41,114,116,66,54,49,40,111,39,36,63,88,51,66,60,47,82,57,48,59,101,90,93,37,78,99,113,59,45,84,108,93,35,70,62,50,81,102,116,94,97,101,95,53,116,75,76,57,77,85,101,57,98,42,115,76,69,81,57,53,67,38,96,61,71,63,64,77,106,61,119,104,42,39,51,69,62,61,45,60,41,71,116,42,73,119,41,39,81,71,58,96,64,73,119,79,102,55,38,93,49,105,39,83,48,49,66,43,69,118,47,78,97,99,35,57,83,59,61,59,89,81,112,103,95,54,85,96,42,107,86,89,51,57,120,75,44,91,47,54,65,106,55,58,39,49,66,109,45,95,49,69,89,102,97,49,43,111,38,111,52,104,112,55,75,78,95,81,40,79,108,73,111,64,83,37,59,106,86,100,110,48,39,49,60,86,99,53,50,61,117,96,51,94,111,45,110,49,39,103,52,118,53,56,72,106,38,54,95,116,55,36,35,35,63,77,41,99,60,36,98,103,81,95,39,83,89,40,40,45,120,107,65,35,89,40,44,112,39,72,57,114,73,86,89,45,98,44,39,37,98,67,80,70,55,46,74,60,85,112,94,44,40,100,85,49,86,89,42,53,35,87,107,84,85,62,104,49,57,119,44,87,81,104,76,73,41,51,83,35,102,36,50,40,101,98,44,106,114,42,98,59,51,86,119,93,42,55,78,72,37,36,99,52,86,115,44,101,68,57,62,88,87,56,63,78,93,111,43,40,42,112,103,67,37,47,55,50,76,86,45,117,60,72,112,44,51,64,101,94,57,85,66,49,74,43,97,107,57,45,84,78,47,109,104,75,80,103,43,65,74,89,100,36,77,108,118,65,70,95,106,67,75,42,46,79,45,94,40,54,51,97,100,77,84,45,62,87,37,105,101,119,83,56,87,54,109,50,114,116,67,112,111,39,82,83,49,82,56,52,61,64,112,97,84,75,116,41,62,61,37,38,49,91,41,42,118,112,39,117,43,120,44,86,114,119,78,59,38,93,107,117,79,57,74,68,98,103,61,112,79,36,74,42,46,106,86,101,59,117,39,109,48,100,114,57,108,44,60,42,119,77,75,42,79,101,61,103,56,108,86,95,75,69,66,70,107,79,39,111,85,93,94,61,91,45,55,57,50,35,111,107,44,41,105,93,108,82,56,113,81,50,111,65,56,119,99,82,67,90,94,55,119,47,78,106,104,59,63,46,115,116,88,63,81,49,62,83,49,113,52,66,110,36,41,75,49,60,45,114,71,100,79,39,36,87,114,46,76,99,46,67,71,41,36,47,42,74,76,52,116,78,82,47,44,83,86,79,51,44,97,85,119,39,68,74,78,58,41,83,115,59,119,71,110,57,65,51,50,105,106,119,37,70,76,43,90,48,70,110,46,85,57,59,114,101,83,113,41,98,109,73,51,50,85,61,61,53,65,76,117,71,38,35,86,102,49,51,57,56,47,112,86,111,49,42,99,45,40,97,89,49,54,56,111,60,96,74,115,83,98,107,45,44,49,78,59,36,62,48,58,79,85,97,115,40,51,58,56,90,57,55,50,76,83,102,70,56,101,98,61,99,45,59,62,83,80,119,55,46,54,104,110,51,109,96,57,94,88,107,110,40,114,46,113,83,91,48,59,84,37,38,81,99,61,43,83,84,82,120,88,39,113,49,66,78,107,51,38,42,101,117,50,59,38,56,113,36,38,120,62,81,35,81,55,94,84,102,43,54,60,40,100,37,90,86,109,106,50,98,68,105,37,46,51,76,50,110,43,52,87,39,36,80,105,68,68,71,41,103,44,114,37,43,63,44,36,64,63,117,111,117,53,116,83,101,50,97,78,95,65,81,85,42,60,104,96,101,45,71,73,55,41,63,79,75,50,65,46,100,55,95,99,41,63,119,81,53,65,83,64,68,76,51,114,35,55,102,83,107,103,108,54,45,43,43,68,58,39,65,44,117,113,55,83,118,108,66,36,112,99,112,72,39,113,51,110,48,35,95,37,100,89,35,120,67,112,114,45,108,60,70,48,78,82,64,45,35,35,70,69,86,54,78,84,70,54,35,35,36,108,56,52,78,49,119,63,65,79,62,39,73,65,79,85,82,81,35,35,86,94,70,118,45,88,70,98,71,77,55,70,108,40,78,60,51,68,104,76,71,70,37,113,46,49,114,67,36,35,58,84,95,95,38,80,105,54,56,37,48,120,105,95,38,91,113,70,74,40,55,55,106,95,38,74,87,111,70,46,86,55,51,53,38,84,44,91,82,42,58,120,70,82,42,75,53,62,62,35,96,98,87,45,63,52,78,101,95,38,54,78,101,95,38,54,78,101,95,38,110,96,107,114,45,35,71,74,99,77,54,88,59,117,77,54,88,59,117,77,40,46,97,46,46,94,50,84,107,76,37,111,82,40,35,59,117,46,84,37,102,65,114,37,52,116,74,56,38,62,60,49,61,71,72,90,95,43,109,57,47,35,72,49,70,94,82,35,83,67,35,42,78,61,66,65,57,40,68,63,118,91,85,105,70,89,62,62,94,56,112,44,75,75,70,46,87,93,76,50,57,117,76,107,76,108,117,47,43,52,84,60,88,111,73,66,38,104,120,61,84,49,80,99,68,97,66,38,59,72,72,43,45,65,70,114,63,40,109,57,72,90,86,41,70,75,83,56,74,67,119,59,83,68,61,54,91,94,47,68,90,85,76,96,69,85,68,102,93,71,71,108,71,38,62,119,36,41,70,46,47,94,110,51,43,114,108,111,43,68,66,59,53,115,73,89,71,78,107,43,105,49,116,45,54,57,74,103,45,45,48,112,97,111,55,83,109,35,75,41,112,100,72,87,38,59,76,117,68,78,72,64,72,62,35,47,88,45,84,73,40,59,80,62,35,44,71,99,62,35,48,83,117,62,35,52,96,49,63,35,56,108,67,63,35,60,120,85,63,35,64,46,105,63,35,68,58,37,64,35,72,70,55,64,35,76,82,73,64,35,80,95,91,64,35,84,107,110,64,35,88,119,42,65,35,93,45,61,65,35,97,57,79,65,35,100,60,70,38,35,42,59,71,35,35,46,71,89,35,35,50,83,108,35,35,54,96,40,36,35,58,108,58,36,35,62,120,76,36,35,66,46,96,36,35,70,58,114,36,35,74,70,46,37,35,78,82,64,37,35,82,95,82,37,35,86,107,101,37,35,90,119,119,37,35,95,45,52,38,35,51,94,82,104,37,83,102,108,114,45,107,39,77,83,46,111,63,46,53,47,115,87,101,108,47,119,112,69,77,48,37,51,39,47,49,41,75,94,102,49,45,100,62,71,50,49,38,118,40,51,53,62,86,96,51,57,86,55,65,52,61,111,110,120,52,65,49,79,89,53,69,73,48,59,54,73,98,103,114,54,77,36,72,83,55,81,60,41,53,56,67,53,119,44,59,87,111,65,42,35,91,37,84,42,35,96,49,103,42,35,100,61,35,43,35,104,73,53,43,35,108,85,71,43,35,112,98,89,43,35,116,110,108,43,35,120,36,41,44,35,38,49,59,44,35,42,61,77,44,35,46,73,96,44,35,50,85,114,44,35,54,98,46,45,35,59,119,91,72,35,105,81,116,65,35,109,94,48,66,35,113,106,66,66,35,117,118,84,66,35,35,45,104,66,35,39,57,36,67,35,43,69,54,67,35,47,81,72,67,35,51,94,90,67,35,55,106,109,67,35,59,118,41,68,35,63,44,60,68,35,67,56,78,68,35,71,68,97,68,35,75,80,115,68,35,79,93,47,69,35,103,49,65,53,35,75,65,42,49,35,103,67,49,55,35,77,71,100,59,35,56,40,48,50,35,76,45,100,51,35,114,87,77,52,35,72,103,97,49,35,44,60,119,48,35,84,46,106,60,35,79,35,39,50,35,67,89,78,49,35,113,97,94,58,35,95,52,109,51,35,111,64,47,61,35,101,71,56,61,35,116,56,74,53,35,96,43,55,56,35,52,117,73,45,35,109,51,66,50,35,83,66,91,56,35,81,48,64,56,35,105,91,42,57,35,105,79,110,56,35,49,78,109,59,35,94,115,78,57,35,113,104,60,57,35,58,61,120,45,35,80,59,75,50,35,36,37,88,57,35,98,67,43,46,35,82,103,59,60,35,109,78,61,46,35,77,84,70,46,35,82,90,79,46,35,50,63,41,52,35,89,35,40,47,35,91,41,49,47,35,98,59,76,47,35,100,65,85,47,35,48,83,118,59,35,108,89,36,48,35,110,96,45,48,35,115,102,54,48,35,40,70,50,52,35,119,114,72,48,35,37,47,101,48,35,84,109,68,60,35,37,74,83,77,70,111,118,101,58,67,84,66,69,88,73,58,60,101,104,50,103,41,66,44,51,104,50,94,71,51,105,59,35,100,51,106,68,62,41,52,107,77,89,68,52,108,86,117,96,52,109,96,58,38,53,110,105,85,65,53,64,40,65,53,66,65,49,93,80,66,66,58,120,108,66,67,67,61,50,67,68,76,88,77,67,69,85,116,105,67,102,38,48,103,50,39,116,78,63,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,71,84,52,67,80,45,113,101,107,67,96,46,57,107,69,103,94,43,70,36,107,119,86,105,70,74,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,75,84,66,38,53,111,44,94,60,45,50,56,90,73,39,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,79,63,59,120,112,59,55,113,45,35,108,76,89,73,58,120,118,68,61,35,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,98,97,107,101,0,116,109,112,0,97,116,108,97,115,45,62,103,108,121,112,104,115,0,97,116,108,97,115,45,62,112,105,120,101,108,0,46,46,46,46,0,105,109,103,95,114,103,98,97,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,101,110,100,0,110,107,95,102,111,110,116,95,97,116,108,97,115,95,99,108,101,97,114,0,110,107,95,105,110,112,117,116,95,98,101,103,105,110,0,110,107,95,105,110,112,117,116,95,101,110,100,0,110,107,95,105,110,112,117,116,95,109,111,116,105,111,110,0,110,107,95,105,110,112,117,116,95,107,101,121,0,110,107,95,105,110,112,117,116,95,98,117,116,116,111,110,0,110,107,95,105,110,112,117,116,95,115,99,114,111,108,108,0,110,107,95,105,110,112,117,116,95,103,108,121,112,104,0,110,107,95,105,110,112,117,116,95,117,110,105,99,111,100,101,0,115,116,97,116,101,0,110,107,95,116,101,120,116,101,100,105,116,95,116,101,120,116,0,110,107,95,116,101,120,116,101,100,105,116,95,115,101,108,101,99,116,95,97,108,108,0,110,107,95,115,116,121,108,101,95,102,114,111,109,95,116,97,98,108,101,0,175,175,175,255,45,45,45,255,40,40,40,255,65,65,65,255,50,50,50,255,40,40,40,255,35,35,35,255,100,100,100,255,120,120,120,255,45,45,45,255,45,45,45,255,35,35,35,255,38,38,38,255,100,100,100,255,120,120,120,255,150,150,150,255,38,38,38,255,38,38,38,255,175,175,175,255,45,45,45,255,120,120,120,255,45,45,45,255,255,0,0,255,40,40,40,255,100,100,100,255,120,120,120,255,150,150,150,255,40,40,40,255,110,107,95,115,116,121,108,101,95,115,101,116,95,102,111,110,116,0,110,107,95,105,110,105,116,0,110,107,95,102,114,101,101,0,110,107,95,99,108,101,97,114,0,110,107,95,95,98,101,103,105,110,0,110,107,95,95,110,101,120,116,0,110,107,95,98,101,103,105,110,0,99,116,120,45,62,115,116,121,108,101,46,102,111,110,116,46,119,105,100,116,104,32,38,38,32,34,105,102,32,116,104,105,115,32,116,114,105,103,103,101,114,115,32,121,111,117,32,102,111,114,103,111,116,32,116,111,32,97,100,100,32,97,32,102,111,110,116,34,0,33,99,116,120,45,62,99,117,114,114,101,110,116,32,38,38,32,34,105,102,32,116,104,105,115,32,116,114,105,103,103,101,114,115,32,121,111,117,32,109,105,115,115,101,100,32,97,32,96,110,107,95,101,110,100,96,32,99,97,108,108,34,0,119,105,110,0,110,107,95,101,110,100,0,99,116,120,45,62,99,117,114,114,101,110,116,32,38,38,32,34,105,102,32,116,104,105,115,32,116,114,105,103,103,101,114,115,32,121,111,117,32,102,111,114,103,111,116,32,116,111,32,99,97,108,108,32,96,110,107,95,98,101,103,105,110,96,34,0,99,116,120,45,62,99,117,114,114,101,110,116,45,62,108,97,121,111,117,116,0,99,116,120,45,62,99,117,114,114,101,110,116,0,110,107,95,119,105,100,103,101,116,0,110,107,95,116,101,120,116,95,99,111,108,111,114,101,100,0,110,107,95,116,101,120,116,0,110,107,95,98,117,116,116,111,110,95,116,101,120,116,0,110,107,95,111,112,116,105,111,110,95,116,101,120,116,0,110,97,109,101,0,118,97,108,0,110,107,95,112,114,111,112,101,114,116,121,95,105,110,116,0,110,107,95,112,114,111,112,101,114,116,121,105,0,110,107,95,99,111,108,111,114,95,112,105,99,107,0,99,111,108,111,114,0,33,40,119,105,110,45,62,102,108,97,103,115,32,38,32,78,75,95,87,73,78,68,79,87,95,80,79,80,85,80,41,0,112,111,112,117,112,45,62,112,97,114,101,110,116,0,110,107,95,112,111,112,117,112,95,101,110,100,0,110,107,95,99,111,110,116,101,120,116,117,97,108,95,101,110,100,0,110,107,95,99,111,109,98,111,95,98,101,103,105,110,95,99,111,108,111,114,0,35,118,101,114,115,105,111,110,32,49,48,48,10,117,110,105,102,111,114,109,32,109,97,116,52,32,80,114,111,106,77,116,120,59,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,80,111,115,105,116,105,111,110,59,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,84,101,120,67,111,111,114,100,59,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,67,111,108,111,114,59,10,118,97,114,121,105,110,103,32,118,101,99,50,32,70,114,97,103,95,85,86,59,10,118,97,114,121,105,110,103,32,118,101,99,52,32,70,114,97,103,95,67,111,108,111,114,59,10,118,111,105,100,32,109,97,105,110,40,41,32,123,10,32,32,32,70,114,97,103,95,85,86,32,61,32,84,101,120,67,111,111,114,100,59,10,32,32,32,70,114,97,103,95,67,111,108,111,114,32,61,32,67,111,108,111,114,59,10,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,80,114,111,106,77,116,120,32,42,32,118,101,99,52,40,80,111,115,105,116,105,111,110,46,120,121,44,32,48,44,32,49,41,59,10,125,10,0,35,118,101,114,115,105,111,110,32,49,48,48,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,84,101,120,116,117,114,101,59,10,118,97,114,121,105,110,103,32,118,101,99,50,32,70,114,97,103,95,85,86,59,10,118,97,114,121,105,110,103,32,118,101,99,52,32,70,114,97,103,95,67,111,108,111,114,59,10,118,111,105,100,32,109,97,105,110,40,41,123,10,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,70,114,97,103,95,67,111,108,111,114,32,42,32,116,101,120,116,117,114,101,50,68,40,84,101,120,116,117,114,101,44,32,70,114,97,103,95,85,86,41,59,10,125,10,0,115,116,97,116,117,115,32,61,61,32,71,76,95,84,82,85,69,0,46,47,110,117,107,108,101,97,114,95,103,108,102,119,95,103,108,51,46,104,0,110,107,95,103,108,102,119,51,95,100,101,118,105,99,101,95,99,114,101,97,116,101,0,84,101,120,116,117,114,101,0,80,114,111,106,77,116,120,0,80,111,115,105,116,105,111,110,0,84,101,120,67,111,111,114,100,0,67,111,108,111,114,0,68,101,109,111,0,98,117,116,116,111,110,0,98,117,116,116,111,110,32,112,114,101,115,115,101,100,10,0,101,97,115,121,0,104,97,114,100,0,67,111,109,112,114,101,115,115,105,111,110,58,0,98,97,99,107,103,114,111,117,110,100,58,0,0,0,0,0,35,82,58,0,35,71,58,0,35,66,58,0,35,65,58,0,69,114,114,111,114,32,37,100,58,32,37,115,10,0,114,101,116,117,114,110,32,33,33,40,100,111,99,117,109,101,110,116,46,102,117,108,108,115,99,114,101,101,110,69,108,101,109,101,110,116,32,124,124,32,100,111,99,117,109,101,110,116,46,109,111,122,70,117,108,108,83,99,114,101,101,110,69,108,101,109,101,110,116,32,124,124,32,100,111,99,117,109,101,110,116,46,119,101,98,107,105,116,70,117,108,108,115,99,114,101,101,110,69,108,101,109,101,110,116,32,124,124,32,100,111,99,117,109,101,110,116,46,109,115,70,117,108,108,115,99,114,101,101,110,69,108,101,109,101,110,116,41,0,83,117,99,99,101,115,115,102,117,108,108,121,32,116,114,97,110,115,105,116,105,111,110,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,32,109,111,100,101,33,10,0,69,120,105,116,101,100,32,102,117,108,108,115,99,114,101,101,110,46,32,84,101,115,116,32,115,117,99,99,101,101,100,101,100,46,10,0,67,111,117,108,100,32,110,111,116,32,99,114,101,97,116,101,32,119,105,110,100,111,119,46,32,84,101,115,116,32,102,97,105,108,101,100,46,10,0,71,76,70,87,32,114,101,115,105,122,105,110,103,32,116,101,115,116,32,45,32,119,105,110,100,111,119,101,100,0,110,107,95,122,101,114,111,0,105,0,110,107,95,117,116,102,95,100,101,99,111,100,101,95,98,121,116,101,0,192,128,224,240,248,128,0,192,224,240,110,107,95,117,116,102,95,118,97,108,105,100,97,116,101,0,110,107,95,98,117,102,102,101,114,95,97,108,108,111,99,0,98,45,62,116,121,112,101,32,61,61,32,78,75,95,66,85,70,70,69,82,95,68,89,78,65,77,73,67,0,98,45,62,112,111,111,108,46,97,108,108,111,99,32,38,38,32,98,45,62,112,111,111,108,46,102,114,101,101,0,110,107,95,98,117,102,102,101,114,95,114,101,97,108,108,111,99,0,110,107,95,99,111,109,109,97,110,100,95,98,117,102,102,101,114,95,112,117,115,104,0,98,45,62,98,97,115,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,97,108,108,111,99,95,118,101,114,116,105,99,101,115,0,110,107,95,100,114,97,119,95,108,105,115,116,95,97,108,108,111,99,95,101,108,101,109,101,110,116,115,0,110,107,95,100,114,97,119,95,108,105,115,116,95,97,100,100,95,99,108,105,112,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,117,115,104,95,99,111,109,109,97,110,100,0,108,105,115,116,45,62,99,109,100,95,99,111,117,110,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,99,111,109,109,97,110,100,95,108,97,115,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,117,115,104,95,105,109,97,103,101,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,97,116,104,95,108,97,115,116,0,110,107,95,100,114,97,119,95,108,105,115,116,95,112,117,115,104,95,114,101,99,116,95,117,118,0,114,97,110,103,101,0,110,107,95,114,97,110,103,101,95,99,111,117,110,116,0,116,32,62,61,32,102,0,110,107,95,114,97,110,103,101,95,103,108,121,112,104,95,99,111,117,110,116,0,99,109,97,112,0,108,111,99,97,0,104,101,97,100,0,103,108,121,102,0,104,104,101,97,0,104,109,116,120,0,107,101,114,110,0,109,97,120,112,0,119,105,100,116,104,32,60,61,32,48,120,102,102,102,102,32,38,38,32,104,101,105,103,104,116,32,60,61,32,48,120,102,102,102,102,0,110,107,95,114,112,95,105,110,105,116,95,116,97,114,103,101,116,0,104,95,111,118,101,114,115,97,109,112,108,101,32,60,61,32,56,0,110,107,95,116,116,95,80,97,99,107,83,101,116,79,118,101,114,115,97,109,112,108,105,110,103,0,118,95,111,118,101,114,115,97,109,112,108,101,32,60,61,32,56,0,119,105,100,116,104,32,37,32,99,45,62,97,108,105,103,110,32,61,61,32,48,0,110,107,95,114,112,95,95,115,107,121,108,105,110,101,95,102,105,110,100,95,98,101,115,116,95,112,111,115,0,120,112,111,115,32,62,61,32,48,0,110,111,100,101,45,62,110,101,120,116,45,62,120,32,62,32,120,112,111,115,32,38,38,32,110,111,100,101,45,62,120,32,60,61,32,120,112,111,115,0,121,32,60,61,32,98,101,115,116,95,121,0,102,105,114,115,116,45,62,120,32,60,61,32,120,48,0,110,107,95,114,112,95,95,115,107,121,108,105,110,101,95,102,105,110,100,95,109,105,110,95,121,0,110,111,100,101,45,62,110,101,120,116,45,62,120,32,62,32,120,48,0,110,111,100,101,45,62,120,32,60,61,32,120,48,0,48,0,110,107,95,116,116,95,70,105,110,100,71,108,121,112,104,73,110,100,101,120,0,117,110,105,99,111,100,101,95,99,111,100,101,112,111,105,110,116,32,60,61,32,110,107,95,116,116,85,83,72,79,82,84,40,100,97,116,97,32,43,32,101,110,100,67,111,117,110,116,32,43,32,50,42,105,116,101,109,41,0,110,107,95,116,116,95,71,101,116,71,108,121,112,104,83,104,97,112,101,0,110,107,95,116,116,95,82,97,115,116,101,114,105,122,101,0,122,45,62,100,105,114,101,99,116,105,111,110,0,110,107,95,116,116,95,95,114,97,115,116,101,114,105,122,101,95,115,111,114,116,101,100,95,101,100,103,101,115,0,122,45,62,101,121,32,62,61,32,115,99,97,110,95,121,95,116,111,112,0,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,110,107,95,116,116,95,95,102,105,108,108,95,97,99,116,105,118,101,95,101,100,103,101,115,95,110,101,119,0,101,45,62,115,121,32,60,61,32,121,95,98,111,116,116,111,109,32,38,38,32,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,120,32,62,61,32,48,32,38,38,32,120,32,60,32,108,101,110,0,121,48,32,60,32,121,49,0,110,107,95,116,116,95,95,104,97,110,100,108,101,95,99,108,105,112,112,101,100,95,101,100,103,101,0,101,45,62,115,121,32,60,61,32,101,45,62,101,121,0,120,49,32,60,61,32,120,43,49,0,120,49,32,62,61,32,120,0,120,49,32,60,61,32,120,0,120,49,32,62,61,32,120,43,49,0,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,120,48,32,62,61,32,120,32,38,38,32,120,48,32,60,61,32,120,43,49,32,38,38,32,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,112,105,120,101,108,115,91,105,93,32,61,61,32,48,0,110,107,95,116,116,95,95,104,95,112,114,101,102,105,108,116,101,114,0,112,105,120,101,108,115,91,105,42,115,116,114,105,100,101,95,105,110,95,98,121,116,101,115,93,32,61,61,32,48,0,110,107,95,116,116,95,95,118,95,112,114,101,102,105,108,116,101,114,0,110,107,95,102,111,110,116,95,116,101,120,116,95,119,105,100,116,104,0,103,108,121,112,104,0,110,107,95,102,111,110,116,95,113,117,101,114,121,95,102,111,110,116,95,103,108,121,112,104,0,110,107,95,95,100,111,117,116,32,61,61,32,111,117,116,112,117,116,32,43,32,111,108,101,110,0,110,107,95,100,101,99,111,109,112,114,101,115,115,0,110,107,95,95,100,111,117,116,32,60,61,32,111,117,116,112,117,116,32,43,32,111,108,101,110,0,110,107,95,95,100,111,117,116,32,43,32,108,101,110,103,116,104,32,60,61,32,110,107,95,95,98,97,114,114,105,101,114,0,110,107,95,95,109,97,116,99,104,0,110,107,95,95,108,105,116,0,110,107,95,115,101,116,117,112,0,105,116,101,114,32,33,61,32,105,116,101,114,45,62,110,101,120,116,0,110,107,95,102,105,110,100,95,119,105,110,100,111,119,0,101,108,101,109,0,110,107,95,99,114,101,97,116,101,95,112,97,103,101,95,101,108,101,109,101,110,116,0,112,111,111,108,45,62,112,97,103,101,115,0,110,107,95,112,111,111,108,95,97,108,108,111,99,0,112,111,111,108,45,62,112,97,103,101,115,45,62,115,105,122,101,32,60,32,112,111,111,108,45,62,99,97,112,97,99,105,116,121,0,110,107,95,105,110,115,101,114,116,95,119,105,110,100,111,119,0,105,116,101,114,32,33,61,32,119,105,110,0,99,109,100,98,117,102,0,110,107,95,99,111,109,109,97,110,100,95,98,117,102,102,101,114,95,105,110,105,116,0,110,107,95,115,116,97,114,116,0,110,107,95,112,97,110,101,108,95,98,101,103,105,110,0,110,107,95,112,97,110,101,108,95,101,110,100,0,33,108,97,121,111,117,116,45,62,114,111,119,46,116,114,101,101,95,100,101,112,116,104,0,111,117,116,0,110,107,95,100,111,95,115,99,114,111,108,108,98,97,114,118,0,115,116,121,108,101,0,110,107,95,100,111,95,115,99,114,111,108,108,98,97,114,104,0,110,107,95,99,111,109,109,97,110,100,95,98,117,102,102,101,114,95,114,101,115,101,116,0,110,107,95,102,105,110,105,115,104,0,110,107,95,114,111,119,95,108,97,121,111,117,116,0,110,107,95,112,97,110,101,108,95,108,97,121,111,117,116,0,110,107,95,108,97,121,111,117,116,95,119,105,100,103,101,116,95,115,112,97,99,101,0,98,111,117,110,100,115,0,108,97,121,111,117,116,45,62,114,111,119,46,114,97,116,105,111,0,110,107,95,112,97,110,101,108,95,97,108,108,111,99,95,115,112,97,99,101,0,111,0,110,107,95,119,105,100,103,101,116,95,116,101,120,116,0,116,0,110,107,95,100,111,95,98,117,116,116,111,110,95,116,101,120,116,0,115,116,114,105,110,103,0,110,107,95,100,111,95,98,117,116,116,111,110,0,110,107,95,100,111,95,98,117,116,116,111,110,95,115,121,109,98,111,108,0,110,107,95,100,111,95,116,111,103,103,108,101,0,110,107,95,100,111,95,101,100,105,116,0,10,0,32,32,32,32,0,115,101,108,101,99,116,95,98,101,103,105,110,95,112,116,114,0,115,101,108,101,99,116,95,101,110,100,95,112,116,114,0,99,117,114,115,111,114,95,112,116,114,0,110,107,95,101,100,105,116,95,100,114,97,119,95,116,101,120,116,0,110,107,95,112,114,111,112,101,114,116,121,0,110,107,95,100,111,95,99,111,108,111,114,95,112,105,99,107,101,114,0,110,107,95,99,111,108,111,114,95,112,105,99,107,101,114,95,98,101,104,97,118,105,111,114,0,109,97,116,114,105,120,0,104,117,101,95,98,97,114,0,0,0,0,255,255,255,255,255,0,0,0,0,110,107,95,100,114,97,119,95,99,111,108,111,114,95,112,105,99,107,101,114,0,97,108,112,104,97,95,98,97,114,0,255,0,0,255,255,255,0,255,0,255,0,255,0,255,255,255,0,0,255,255,255,0,255,255,255,0,0,255,110,107,95,117,110,105,102,121,0,99,108,105,112,0,110,107,95,115,116,97,114,116,95,112,111,112,117,112,0,110,107,95,102,105,110,105,115,104,95,112,111,112,117,112,0,110,107,95,110,111,110,98,108,111,99,107,95,98,101,103,105,110,0,110,107,95,99,111,109,98,111,95,98,101,103,105,110,0,120,0,95,0,43,0,45,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+22724); /* memory initializer */ allocate([97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+32964); /* memory initializer */ allocate([17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,46,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+34939); /* no memory initializer */ var tempDoublePtr = Runtime.alignMemory(allocate(12, "i8", ALLOC_STATIC), 8); assert(tempDoublePtr % 8 == 0); function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much HEAP8[tempDoublePtr] = HEAP8[ptr]; HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; } function copyTempDouble(ptr) { HEAP8[tempDoublePtr] = HEAP8[ptr]; HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; } // {{PRE_LIBRARY}} Module["_i64Subtract"] = _i64Subtract; var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},packAlignment:4,unpackAlignment:4,init:function () { GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE); for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) { GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1); } },recordError:function recordError(errorCode) { if (!GL.lastError) { GL.lastError = errorCode; } },getNewId:function (table) { var ret = GL.counter++; for (var i = table.length; i < ret; i++) { table[i] = null; } return ret; },MINI_TEMP_BUFFER_SIZE:16,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) { var source = ''; for (var i = 0; i < count; ++i) { var frag; if (length) { var len = HEAP32[(((length)+(i*4))>>2)]; if (len < 0) { frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); } else { frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len); } } else { frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); } source += frag; } return source; },createContext:function (canvas, webGLContextAttributes) { if (typeof webGLContextAttributes.majorVersion === 'undefined' && typeof webGLContextAttributes.minorVersion === 'undefined') { webGLContextAttributes.majorVersion = 1; webGLContextAttributes.minorVersion = 0; } var ctx; var errorInfo = '?'; function onContextCreationError(event) { errorInfo = event.statusMessage || errorInfo; } try { canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false); try { if (webGLContextAttributes.majorVersion == 1 && webGLContextAttributes.minorVersion == 0) { ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes); } else if (webGLContextAttributes.majorVersion == 2 && webGLContextAttributes.minorVersion == 0) { ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes); } else { throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!' } } finally { canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false); } if (!ctx) throw ':('; } catch (e) { Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]); return 0; } // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx); if (!ctx) return 0; return GL.registerContext(ctx, webGLContextAttributes); },registerContext:function (ctx, webGLContextAttributes) { var handle = GL.getNewId(GL.contexts); var context = { handle: handle, version: webGLContextAttributes.majorVersion, GLctx: ctx }; // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. if (ctx.canvas) ctx.canvas.GLctxObject = context; GL.contexts[handle] = context; if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) { GL.initExtensions(context); } return handle; },makeContextCurrent:function (contextHandle) { var context = GL.contexts[contextHandle]; if (!context) return false; GLctx = Module.ctx = context.GLctx; // Active WebGL context object. GL.currentContext = context; // Active Emscripten GL layer context object. return true; },getContext:function (contextHandle) { return GL.contexts[contextHandle]; },deleteContext:function (contextHandle) { if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. GL.contexts[contextHandle] = null; },initExtensions:function (context) { // If this function is called without a specific context object, init the extensions of the currently active context. if (!context) context = GL.currentContext; if (context.initExtensionsDone) return; context.initExtensionsDone = true; var GLctx = context.GLctx; context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS); // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. if (context.version < 2) { // Extension available from Firefox 26 and Google Chrome 30 var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays'); if (instancedArraysExt) { GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); }; GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); }; GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; } // Extension available from Firefox 25 and WebKit var vaoExt = GLctx.getExtension('OES_vertex_array_object'); if (vaoExt) { GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); }; GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); }; GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); }; GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); }; } var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers'); if (drawBuffersExt) { GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); }; } } // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working. // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions // here, as long as they don't produce a performance impact for users that might not be using those extensions. // E.g. debugging-related extensions should probably be off by default. var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays", "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc", "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources", "EXT_shader_texture_lod" ]; function shouldEnableAutomatically(extension) { var ret = false; automaticallyEnabledExtensions.forEach(function(include) { if (ext.indexOf(include) != -1) { ret = true; } }); return ret; } var exts = GLctx.getSupportedExtensions(); if (exts && exts.length > 0) { GLctx.getSupportedExtensions().forEach(function(ext) { if (automaticallyEnabledExtensions.indexOf(ext) != -1) { GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled. } }); } },populateUniformTable:function (program) { var p = GL.programs[program]; GL.programInfos[program] = { uniforms: {}, maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway. maxAttributeLength: -1 // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet. }; var ptable = GL.programInfos[program]; var utable = ptable.uniforms; // A program's uniform table maps the string name of an uniform to an integer location of that uniform. // The global GL.uniforms map maps integer locations to WebGLUniformLocations. var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS); for (var i = 0; i < numUniforms; ++i) { var u = GLctx.getActiveUniform(p, i); var name = u.name; ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1); // Strip off any trailing array specifier we might have got, e.g. "[0]". if (name.indexOf(']', name.length-1) !== -1) { var ls = name.lastIndexOf('['); name = name.slice(0, ls); } // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i. // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices. var loc = GLctx.getUniformLocation(p, name); var id = GL.getNewId(GL.uniforms); utable[name] = [u.size, id]; GL.uniforms[id] = loc; for (var j = 1; j < u.size; ++j) { var n = name + '['+j+']'; loc = GLctx.getUniformLocation(p, n); id = GL.getNewId(GL.uniforms); GL.uniforms[id] = loc; } } }};function _glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) } Module["_i64Add"] = _i64Add; function _emscripten_get_now() { if (!_emscripten_get_now.actual) { if (ENVIRONMENT_IS_NODE) { _emscripten_get_now.actual = function _emscripten_get_now_actual() { var t = process['hrtime'](); return t[0] * 1e3 + t[1] / 1e6; } } else if (typeof dateNow !== 'undefined') { _emscripten_get_now.actual = dateNow; } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') { _emscripten_get_now.actual = function _emscripten_get_now_actual() { return self['performance']['now'](); }; } else if (typeof performance === 'object' && typeof performance['now'] === 'function') { _emscripten_get_now.actual = function _emscripten_get_now_actual() { return performance['now'](); }; } else { _emscripten_get_now.actual = Date.now; } } return _emscripten_get_now.actual(); }var GLFW={Window:function (id, width, height, title, monitor, share) { this.id = id; this.x = 0; this.y = 0; this.storedX = 0; // Used to store X before fullscreen this.storedY = 0; // Used to store Y before fullscreen this.width = width; this.height = height; this.storedWidth = width; // Used to store width before fullscreen this.storedHeight = height; // Used to store height before fullscreen this.title = title; this.monitor = monitor; this.share = share; this.attributes = GLFW.hints; this.inputModes = { 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL) 0x00033002:0, // GLFW_STICKY_KEYS 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS }; this.buttons = 0; this.keys = new Array(); this.shouldClose = 0; this.title = null; this.windowPosFunc = null; // GLFWwindowposfun this.windowSizeFunc = null; // GLFWwindowsizefun this.windowCloseFunc = null; // GLFWwindowclosefun this.windowRefreshFunc = null; // GLFWwindowrefreshfun this.windowFocusFunc = null; // GLFWwindowfocusfun this.windowIconifyFunc = null; // GLFWwindowiconifyfun this.framebufferSizeFunc = null; // GLFWframebuffersizefun this.mouseButtonFunc = null; // GLFWmousebuttonfun this.cursorPosFunc = null; // GLFWcursorposfun this.cursorEnterFunc = null; // GLFWcursorenterfun this.scrollFunc = null; // GLFWscrollfun this.keyFunc = null; // GLFWkeyfun this.charFunc = null; // GLFWcharfun this.userptr = null; },WindowFromId:function (id) { if (id <= 0 || !GLFW.windows) return null; return GLFW.windows[id - 1]; },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) { switch (keycode) { case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0 case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1 case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2 case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3 case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4 case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5 case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6 case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7 case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8 case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9 case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON case 0x61:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1 case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2 case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3 case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4 case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5 case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6 case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7 case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8 case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9 case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10 case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11 case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12 case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13 case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14 case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15 case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16 case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17 case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18 case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19 case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20 case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21 case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22 case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23 case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24 case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25 case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0 case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1 case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2 case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3 case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4 case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5 case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6 case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7 case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8 case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9 case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT) // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT) case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT) // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT) // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT) // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT) case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these? default:return -1; // GLFW_KEY_UNKNOWN }; },getModBits:function (win) { var mod = 0; if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER return mod; },onKeyPress:function (event) { if (!GLFW.active || !GLFW.active.charFunc) return; // correct unicode charCode is only available with onKeyPress event var charCode = event.charCode; if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return; Runtime.dynCall('vii', GLFW.active.charFunc, [GLFW.active.id, charCode]); },onKeyChanged:function (event, status) { if (!GLFW.active) return; var key = GLFW.DOMToGLFWKeyCode(event.keyCode); if (key == -1) return; GLFW.active.keys[key] = status; if (!GLFW.active.keyFunc) return; Runtime.dynCall('viiiii', GLFW.active.keyFunc, [GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active)]); },onKeydown:function (event) { GLFW.onKeyChanged(event, 1); // GLFW_PRESS // This logic comes directly from the sdl implementation. We cannot // call preventDefault on all keydown events otherwise onKeyPress will // not get called if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) { event.preventDefault(); } },onKeyup:function (event) { GLFW.onKeyChanged(event, 0); // GLFW_RELEASE },onMousemove:function (event) { if (!GLFW.active) return; Browser.calculateMouseEvent(event); if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return; Runtime.dynCall('vidd', GLFW.active.cursorPosFunc, [GLFW.active.id, Browser.mouseX, Browser.mouseY]); },onMouseButtonChanged:function (event, status) { if (!GLFW.active || !GLFW.active.mouseButtonFunc) return; Browser.calculateMouseEvent(event); if (event.target != Module["canvas"]) return; if (status == 1) { // GLFW_PRESS try { event.target.setCapture(); } catch (e) {} } // DOM and glfw have different button codes var eventButton = event['button']; if (eventButton > 0) { if (eventButton == 1) { eventButton = 2; } else { eventButton = 1; } } Runtime.dynCall('viiii', GLFW.active.mouseButtonFunc, [GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)]); },onMouseButtonDown:function (event) { if (!GLFW.active) return; GLFW.active.buttons |= (1 << event['button']); GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS },onMouseButtonUp:function (event) { if (!GLFW.active) return; GLFW.active.buttons &= ~(1 << event['button']); GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE },onMouseWheel:function (event) { // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up) var delta = -Browser.getMouseWheelDelta(event); delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1. GLFW.wheelPos += delta; if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return; var sx = 0; var sy = 0; if (event.type == 'mousewheel') { sx = event.wheelDeltaX; sy = event.wheelDeltaY; } else { sx = event.deltaX; sy = event.deltaY; } Runtime.dynCall('vidd', GLFW.active.scrollFunc, [GLFW.active.id, sx, sy]); event.preventDefault(); },onFullScreenEventChange:function () { if (!GLFW.active) return; if (document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) { GLFW.active.storedX = GLFW.active.x; GLFW.active.storedY = GLFW.active.y; GLFW.active.storedWidth = GLFW.active.width; GLFW.active.storedHeight = GLFW.active.height; GLFW.active.x = GLFW.active.y = 0; GLFW.active.width = screen.width; GLFW.active.height = screen.height; } else { GLFW.active.x = GLFW.active.storedX; GLFW.active.y = GLFW.active.storedY; GLFW.active.width = GLFW.active.storedWidth; GLFW.active.height = GLFW.active.storedHeight; } Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions if (!GLFW.active.windowSizeFunc) return; Runtime.dynCall('viii', GLFW.active.windowSizeFunc, [GLFW.active.id, GLFW.active.width, GLFW.active.height]); },requestFullScreen:function () { var RFS = Module["canvas"]['requestFullscreen'] || Module["canvas"]['requestFullScreen'] || Module["canvas"]['mozRequestFullScreen'] || Module["canvas"]['webkitRequestFullScreen'] || (function() {}); RFS.apply(Module["canvas"], []); },cancelFullScreen:function () { var CFS = document['exitFullscreen'] || document['cancelFullScreen'] || document['mozCancelFullScreen'] || document['webkitCancelFullScreen'] || (function() {}); CFS.apply(document, []); },getTime:function () { return _emscripten_get_now() / 1000; },setWindowTitle:function (winid, title) { var win = GLFW.WindowFromId(winid); if (!win) return; win.title = Pointer_stringify(title); if (GLFW.active.id == win.id) { document.title = win.title; } },setKeyCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.keyFunc = cbfun; },setCharCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.charFunc = cbfun; },setMouseButtonCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.mouseButtonFunc = cbfun; },setCursorPosCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.cursorPosFunc = cbfun; },setScrollCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.scrollFunc = cbfun; },setWindowSizeCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowSizeFunc = cbfun; },setWindowCloseCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowCloseFunc = cbfun; },setWindowRefreshCallback:function (winid, cbfun) { var win = GLFW.WindowFromId(winid); if (!win) return; win.windowRefreshFunc = cbfun; },getKey:function (winid, key) { var win = GLFW.WindowFromId(winid); if (!win) return 0; return win.keys[key]; },getMouseButton:function (winid, button) { var win = GLFW.WindowFromId(winid); if (!win) return 0; return (win.buttons & (1 << button)) > 0; },getCursorPos:function (winid, x, y) { setValue(x, Browser.mouseX, 'double'); setValue(y, Browser.mouseY, 'double'); },getMousePos:function (winid, x, y) { setValue(x, Browser.mouseX, 'i32'); setValue(y, Browser.mouseY, 'i32'); },setCursorPos:function (winid, x, y) { },getWindowPos:function (winid, x, y) { var wx = 0; var wy = 0; var win = GLFW.WindowFromId(winid); if (win) { wx = win.x; wy = win.y; } setValue(x, wx, 'i32'); setValue(y, wy, 'i32'); },setWindowPos:function (winid, x, y) { var win = GLFW.WindowFromId(winid); if (!win) return; win.x = x; win.y = y; },getWindowSize:function (winid, width, height) { var ww = 0; var wh = 0; var win = GLFW.WindowFromId(winid); if (win) { ww = win.width; wh = win.height; } setValue(width, ww, 'i32'); setValue(height, wh, 'i32'); },setWindowSize:function (winid, width, height) { var win = GLFW.WindowFromId(winid); if (!win) return; if (GLFW.active.id == win.id) { if (width == screen.width && height == screen.height) { GLFW.requestFullScreen(); } else { GLFW.cancelFullScreen(); Browser.setCanvasSize(width, height); win.width = width; win.height = height; } } if (!win.windowResizeFunc) return; Runtime.dynCall('viii', win.windowResizeFunc, [win.id, width, height]); },createWindow:function (width, height, title, monitor, share) { var i, id; for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++); if (i > 0) throw "glfwCreateWindow only supports one window at time currently"; // id for window id = i + 1; // not valid if (width <= 0 || height <= 0) return 0; if (monitor) { GLFW.requestFullScreen(); } else { Browser.setCanvasSize(width, height); } // Create context when there are no existing alive windows for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++); if (i == GLFW.windows.length) { var contextAttributes = { antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS stencil: (GLFW.hints[0x00021006] > 0) // GLFW_STENCIL_BITS } Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes); } // If context creation failed, do not return a valid window if (!Module.ctx) return 0; // Get non alive id var win = new GLFW.Window(id, width, height, title, monitor, share); // Set window to array if (id - 1 == GLFW.windows.length) { GLFW.windows.push(win); } else { GLFW.windows[id - 1] = win; } GLFW.active = win; return win.id; },destroyWindow:function (winid) { var win = GLFW.WindowFromId(winid); if (!win) return; if (win.windowCloseFunc) Runtime.dynCall('vi', win.windowCloseFunc, [win.id]); GLFW.windows[win.id - 1] = null; if (GLFW.active.id == win.id) GLFW.active = null; // Destroy context when no alive windows for (var i = 0; i < GLFW.windows.length; i++) if (GLFW.windows[i] !== null) return; Module.ctx = Browser.destroyContext(Module['canvas'], true, true); },swapBuffers:function (winid) { },GLFW2ParamToGLFW3Param:function (param) { table = { 0x00030001:0, // GLFW_MOUSE_CURSOR 0x00030002:0, // GLFW_STICKY_KEYS 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS 0x00030004:0, // GLFW_SYSTEM_KEYS 0x00030005:0, // GLFW_KEY_REPEAT 0x00030006:0, // GLFW_AUTO_POLL_EVENTS 0x00020001:0, // GLFW_OPENED 0x00020002:0, // GLFW_ACTIVE 0x00020003:0, // GLFW_ICONIFIED 0x00020004:0, // GLFW_ACCELERATED 0x00020005:0x00021001, // GLFW_RED_BITS 0x00020006:0x00021002, // GLFW_GREEN_BITS 0x00020007:0x00021003, // GLFW_BLUE_BITS 0x00020008:0x00021004, // GLFW_ALPHA_BITS 0x00020009:0x00021005, // GLFW_DEPTH_BITS 0x0002000A:0x00021006, // GLFW_STENCIL_BITS 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS 0x00020011:0x0002100C, // GLFW_STEREO 0x00020012:0, // GLFW_WINDOW_NO_RESIZE 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE }; return table[param]; }};function _glfwGetCursorPos(winid, x, y) { GLFW.getCursorPos(winid, x, y); } function _glfwSetCursorPos(winid, x, y) { GLFW.setCursorPos(winid, x, y); } function _glLinkProgram(program) { GLctx.linkProgram(GL.programs[program]); GL.programInfos[program] = null; // uniforms no longer keep the same names after linking GL.populateUniformTable(program); } function _glShaderSource(shader, count, string, length) { var source = GL.getSource(shader, count, string, length); GLctx.shaderSource(GL.shaders[shader], source); } function _glBindTexture(target, texture) { GLctx.bindTexture(target, texture ? GL.textures[texture] : null); } function ___setErrNo(value) { if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; else Module.printErr('failed to set errno from JS'); return value; } var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};function _sysconf(name) { // long sysconf(int name); // http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html switch(name) { case 30: return PAGE_SIZE; case 85: return totalMemory / PAGE_SIZE; case 132: case 133: case 12: case 137: case 138: case 15: case 235: case 16: case 17: case 18: case 19: case 20: case 149: case 13: case 10: case 236: case 153: case 9: case 21: case 22: case 159: case 154: case 14: case 77: case 78: case 139: case 80: case 81: case 82: case 68: case 67: case 164: case 11: case 29: case 47: case 48: case 95: case 52: case 51: case 46: return 200809; case 79: return 0; case 27: case 246: case 127: case 128: case 23: case 24: case 160: case 161: case 181: case 182: case 242: case 183: case 184: case 243: case 244: case 245: case 165: case 178: case 179: case 49: case 50: case 168: case 169: case 175: case 170: case 171: case 172: case 97: case 76: case 32: case 173: case 35: return -1; case 176: case 177: case 7: case 155: case 8: case 157: case 125: case 126: case 92: case 93: case 129: case 130: case 131: case 94: case 91: return 1; case 74: case 60: case 69: case 70: case 4: return 1024; case 31: case 42: case 72: return 32; case 87: case 26: case 33: return 2147483647; case 34: case 1: return 47839; case 38: case 36: return 99; case 43: case 37: return 2048; case 0: return 2097152; case 3: return 65536; case 28: return 32768; case 44: return 32767; case 75: return 16384; case 39: return 1000; case 89: return 700; case 71: return 256; case 40: return 255; case 2: return 100; case 180: return 64; case 25: return 20; case 5: return 16; case 6: return 6; case 73: return 4; case 84: { if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1; return 1; } } ___setErrNo(ERRNO_CODES.EINVAL); return -1; } function _glDetachShader(program, shader) { GLctx.detachShader(GL.programs[program], GL.shaders[shader]); } function _glClear(x0) { GLctx.clear(x0) } function _glfwSetCharCallback(winid, cbfun) { GLFW.setCharCallback(winid, cbfun); } function _glDeleteProgram(id) { if (!id) return; var program = GL.programs[id]; if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } GLctx.deleteProgram(program); program.name = 0; GL.programs[id] = null; GL.programInfos[id] = null; } function _glEnableVertexAttribArray(index) { GLctx.enableVertexAttribArray(index); } function _glBindBuffer(target, buffer) { var bufferObj = buffer ? GL.buffers[buffer] : null; GLctx.bindBuffer(target, bufferObj); } function _glCompileShader(shader) { GLctx.compileShader(GL.shaders[shader]); } function _emscripten_cancel_main_loop() { Browser.mainLoop.pause(); Browser.mainLoop.func = null; } function _glDeleteTextures(n, textures) { for (var i = 0; i < n; i++) { var id = HEAP32[(((textures)+(i*4))>>2)]; var texture = GL.textures[id]; if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". GLctx.deleteTexture(texture); texture.name = 0; GL.textures[id] = null; } } Module["_bitshift64Lshr"] = _bitshift64Lshr; function _glBufferData(target, size, data, usage) { switch (usage) { // fix usages, WebGL only has *_DRAW case 0x88E1: // GL_STREAM_READ case 0x88E2: // GL_STREAM_COPY usage = 0x88E0; // GL_STREAM_DRAW break; case 0x88E5: // GL_STATIC_READ case 0x88E6: // GL_STATIC_COPY usage = 0x88E4; // GL_STATIC_DRAW break; case 0x88E9: // GL_DYNAMIC_READ case 0x88EA: // GL_DYNAMIC_COPY usage = 0x88E8; // GL_DYNAMIC_DRAW break; } if (!data) { GLctx.bufferData(target, size, usage); } else { GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); } } function _glfwCreateWindow(width, height, title, monitor, share) { return GLFW.createWindow(width, height, title, monitor, share); } function _glfwSetWindowSizeCallback(winid, cbfun) { GLFW.setWindowSizeCallback(winid, cbfun); } function _pthread_cleanup_push(routine, arg) { __ATEXIT__.push(function() { Runtime.dynCall('vi', routine, [arg]) }) _pthread_cleanup_push.level = __ATEXIT__.length; } function _pthread_cleanup_pop() { assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!'); __ATEXIT__.pop(); _pthread_cleanup_push.level = __ATEXIT__.length; } function _emscripten_memcpy_big(dest, src, num) { HEAPU8.set(HEAPU8.subarray(src, src+num), dest); return dest; } Module["_memcpy"] = _memcpy; function _glfwGetFramebufferSize(winid, width, height) { var ww = 0; var wh = 0; var win = GLFW.WindowFromId(winid); if (win) { ww = win.width; wh = win.height; } setValue(width, ww, 'i32'); setValue(height, wh, 'i32'); } function _sbrk(bytes) { // Implement a Linux-like 'memory area' for our 'process'. // Changes the size of the memory area by |bytes|; returns the // address of the previous top ('break') of the memory area // We control the "dynamic" memory - DYNAMIC_BASE to DYNAMICTOP var self = _sbrk; if (!self.called) { DYNAMICTOP = alignMemoryPage(DYNAMICTOP); // make sure we start out aligned self.called = true; assert(Runtime.dynamicAlloc); self.alloc = Runtime.dynamicAlloc; Runtime.dynamicAlloc = function() { abort('cannot dynamically allocate, sbrk now has control') }; } var ret = DYNAMICTOP; if (bytes != 0) { var success = self.alloc(bytes); if (!success) return -1 >>> 0; // sbrk failure code } return ret; // Previous break location. } function _glGenTextures(n, textures) { for (var i = 0; i < n; i++) { var texture = GLctx.createTexture(); if (!texture) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.textures); texture.name = id; GL.textures[id] = texture; HEAP32[(((textures)+(i*4))>>2)]=id; } } var _BItoD=true; function _glfwInit() { if (GLFW.windows) return 1; // GL_TRUE GLFW.initialTime = GLFW.getTime(); GLFW.hints = GLFW.defaultHints; GLFW.windows = new Array() GLFW.active = null; window.addEventListener("keydown", GLFW.onKeydown, true); window.addEventListener("keypress", GLFW.onKeyPress, true); window.addEventListener("keyup", GLFW.onKeyup, true); Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true); Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true); Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true); Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true); Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true); Browser.resizeListeners.push(function(width, height) { GLFW.onFullScreenEventChange(); }); return 1; // GL_TRUE } function _glfwSetInputMode(winid, mode, value) {} function _glfwSwapBuffers(winid) { GLFW.swapBuffers(winid); } function _glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) } function _glCreateShader(shaderType) { var id = GL.getNewId(GL.shaders); GL.shaders[id] = GLctx.createShader(shaderType); return id; } function _glUniform1i(location, v0) { location = GL.uniforms[location]; GLctx.uniform1i(location, v0); } function _glUseProgram(program) { GLctx.useProgram(program ? GL.programs[program] : null); } function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) { function roundedToNextMultipleOf(x, y) { return Math.floor((x + y - 1) / y) * y } var plainRowSize = width * sizePerPixel; var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); return (height <= 0) ? 0 : ((height - 1) * alignedRowSize + plainRowSize); }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { var sizePerPixel; var numChannels; switch(format) { case 0x1906 /* GL_ALPHA */: case 0x1909 /* GL_LUMINANCE */: case 0x1902 /* GL_DEPTH_COMPONENT */: case 0x1903 /* GL_RED */: numChannels = 1; break; case 0x190A /* GL_LUMINANCE_ALPHA */: case 0x8227 /* GL_RG */: numChannels = 2; break; case 0x1907 /* GL_RGB */: case 0x8C40 /* GL_SRGB_EXT */: numChannels = 3; break; case 0x1908 /* GL_RGBA */: case 0x8C42 /* GL_SRGB_ALPHA_EXT */: numChannels = 4; break; default: GL.recordError(0x0500); // GL_INVALID_ENUM return { pixels: null, internalFormat: 0x0 }; } switch (type) { case 0x1401 /* GL_UNSIGNED_BYTE */: sizePerPixel = numChannels*1; break; case 0x1403 /* GL_UNSIGNED_SHORT */: case 0x8D61 /* GL_HALF_FLOAT_OES */: sizePerPixel = numChannels*2; break; case 0x1405 /* GL_UNSIGNED_INT */: case 0x1406 /* GL_FLOAT */: sizePerPixel = numChannels*4; break; case 0x84FA /* UNSIGNED_INT_24_8_WEBGL/UNSIGNED_INT_24_8 */: sizePerPixel = 4; break; case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */: case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */: case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */: sizePerPixel = 2; break; default: GL.recordError(0x0500); // GL_INVALID_ENUM return { pixels: null, internalFormat: 0x0 }; } var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment); if (type == 0x1401 /* GL_UNSIGNED_BYTE */) { pixels = HEAPU8.subarray((pixels),(pixels+bytes)); } else if (type == 0x1406 /* GL_FLOAT */) { pixels = HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2); } else if (type == 0x1405 /* GL_UNSIGNED_INT */ || type == 0x84FA /* UNSIGNED_INT_24_8_WEBGL */) { pixels = HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2); } else { pixels = HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1); } return { pixels: pixels, internalFormat: internalFormat }; }function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { var pixelData; if (pixels) { var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); pixelData = data.pixels; internalFormat = data.internalFormat; } else { pixelData = null; } GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); } function _glDisable(x0) { GLctx.disable(x0) } function _glfwGetMouseButton(winid, button) { return GLFW.getMouseButton(winid, button); } function _glfwGetWindowSize(winid, width, height) { GLFW.getWindowSize(winid, width, height); } Module["_memset"] = _memset; var _BDtoILow=true; function _glGetProgramiv(program, pname, p) { if (!p) { // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH var log = GLctx.getProgramInfoLog(GL.programs[program]); if (log === null) log = '(unknown error)'; HEAP32[((p)>>2)]=log.length + 1; } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { var ptable = GL.programInfos[program]; if (ptable) { HEAP32[((p)>>2)]=ptable.maxUniformLength; return; } else if (program < GL.counter) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); } else { GL.recordError(0x0501 /* GL_INVALID_VALUE */); } } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { var ptable = GL.programInfos[program]; if (ptable) { if (ptable.maxAttributeLength == -1) { var program = GL.programs[program]; var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. for(var i = 0; i < numAttribs; ++i) { var activeAttrib = GLctx.getActiveAttrib(program, i); ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); } } HEAP32[((p)>>2)]=ptable.maxAttributeLength; return; } else if (program < GL.counter) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); } else { GL.recordError(0x0501 /* GL_INVALID_VALUE */); } } else { HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); } } function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr); } function _glfwPollEvents() {} Module["_bitshift64Shl"] = _bitshift64Shl; function _abort() { Module['abort'](); } function ___assert_fail(condition, filename, line, func) { ABORT = true; throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace(); } function _glBlendEquation(x0) { GLctx.blendEquation(x0) } function _glGetUniformLocation(program, name) { name = Pointer_stringify(name); var arrayOffset = 0; // If user passed an array accessor "[index]", parse the array index off the accessor. if (name.indexOf(']', name.length-1) !== -1) { var ls = name.lastIndexOf('['); var arrayIndex = name.slice(ls+1, -1); if (arrayIndex.length > 0) { arrayOffset = parseInt(arrayIndex); if (arrayOffset < 0) { return -1; } } name = name.slice(0, ls); } var ptable = GL.programInfos[program]; if (!ptable) { return -1; } var utable = ptable.uniforms; var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. return uniformInfo[1]+arrayOffset; } else { return -1; } } function _glfwMakeContextCurrent(winid) {} function ___lock() {} function ___unlock() {} function _glfwSetClipboardString(win, string) {} function _glEnable(x0) { GLctx.enable(x0) } var _emscripten_asm_const_int=true; function _glGenBuffers(n, buffers) { for (var i = 0; i < n; i++) { var buffer = GLctx.createBuffer(); if (!buffer) { GL.recordError(0x0502 /* GL_INVALID_OPERATION */); while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; return; } var id = GL.getNewId(GL.buffers); buffer.name = id; GL.buffers[id] = buffer; HEAP32[(((buffers)+(i*4))>>2)]=id; } } function _glfwSetScrollCallback(winid, cbfun) { GLFW.setScrollCallback(winid, cbfun); } var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; var TTY={ttys:[],init:function () { // https://github.com/kripken/emscripten/pull/1555 // if (ENVIRONMENT_IS_NODE) { // // currently, FS.init does not distinguish if process.stdin is a file or TTY // // device, it always assumes it's a TTY device. because of this, we're forcing // // process.stdin to UTF8 encoding to at least make stdin reading compatible // // with text files until FS.init can be refactored. // process['stdin']['setEncoding']('utf8'); // } },shutdown:function () { // https://github.com/kripken/emscripten/pull/1555 // if (ENVIRONMENT_IS_NODE) { // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call // process['stdin']['pause'](); // } },register:function (dev, ops) { TTY.ttys[dev] = { input: [], output: [], ops: ops }; FS.registerDevice(dev, TTY.stream_ops); },stream_ops:{open:function (stream) { var tty = TTY.ttys[stream.node.rdev]; if (!tty) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } stream.tty = tty; stream.seekable = false; },close:function (stream) { // flush any pending line data stream.tty.ops.flush(stream.tty); },flush:function (stream) { stream.tty.ops.flush(stream.tty); },read:function (stream, buffer, offset, length, pos /* ignored */) { if (!stream.tty || !stream.tty.ops.get_char) { throw new FS.ErrnoError(ERRNO_CODES.ENXIO); } var bytesRead = 0; for (var i = 0; i < length; i++) { var result; try { result = stream.tty.ops.get_char(stream.tty); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } if (result === undefined && bytesRead === 0) { throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); } if (result === null || result === undefined) break; bytesRead++; buffer[offset+i] = result; } if (bytesRead) { stream.node.timestamp = Date.now(); } return bytesRead; },write:function (stream, buffer, offset, length, pos) { if (!stream.tty || !stream.tty.ops.put_char) { throw new FS.ErrnoError(ERRNO_CODES.ENXIO); } for (var i = 0; i < length; i++) { try { stream.tty.ops.put_char(stream.tty, buffer[offset+i]); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } } if (length) { stream.node.timestamp = Date.now(); } return i; }},default_tty_ops:{get_char:function (tty) { if (!tty.input.length) { var result = null; if (ENVIRONMENT_IS_NODE) { // we will read data by chunks of BUFSIZE var BUFSIZE = 256; var buf = new Buffer(BUFSIZE); var bytesRead = 0; var fd = process.stdin.fd; // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) var usingDevice = false; try { fd = fs.openSync('/dev/stdin', 'r'); usingDevice = true; } catch (e) {} bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); if (usingDevice) { fs.closeSync(fd); } if (bytesRead > 0) { result = buf.slice(0, bytesRead).toString('utf-8'); } else { result = null; } } else if (typeof window != 'undefined' && typeof window.prompt == 'function') { // Browser. result = window.prompt('Input: '); // returns null on cancel if (result !== null) { result += '\n'; } } else if (typeof readline == 'function') { // Command line. result = readline(); if (result !== null) { result += '\n'; } } if (!result) { return null; } tty.input = intArrayFromString(result, true); } return tty.input.shift(); },put_char:function (tty, val) { if (val === null || val === 10) { Module['print'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } else { if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. } },flush:function (tty) { if (tty.output && tty.output.length > 0) { Module['print'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } }},default_tty1_ops:{put_char:function (tty, val) { if (val === null || val === 10) { Module['printErr'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } else { if (val != 0) tty.output.push(val); } },flush:function (tty) { if (tty.output && tty.output.length > 0) { Module['printErr'](UTF8ArrayToString(tty.output, 0)); tty.output = []; } }}}; var MEMFS={ops_table:null,mount:function (mount) { return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); },createNode:function (parent, name, mode, dev) { if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { // no supported throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (!MEMFS.ops_table) { MEMFS.ops_table = { dir: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, lookup: MEMFS.node_ops.lookup, mknod: MEMFS.node_ops.mknod, rename: MEMFS.node_ops.rename, unlink: MEMFS.node_ops.unlink, rmdir: MEMFS.node_ops.rmdir, readdir: MEMFS.node_ops.readdir, symlink: MEMFS.node_ops.symlink }, stream: { llseek: MEMFS.stream_ops.llseek } }, file: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: { llseek: MEMFS.stream_ops.llseek, read: MEMFS.stream_ops.read, write: MEMFS.stream_ops.write, allocate: MEMFS.stream_ops.allocate, mmap: MEMFS.stream_ops.mmap, msync: MEMFS.stream_ops.msync } }, link: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, readlink: MEMFS.node_ops.readlink }, stream: {} }, chrdev: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: FS.chrdev_stream_ops } }; } var node = FS.createNode(parent, name, mode, dev); if (FS.isDir(node.mode)) { node.node_ops = MEMFS.ops_table.dir.node; node.stream_ops = MEMFS.ops_table.dir.stream; node.contents = {}; } else if (FS.isFile(node.mode)) { node.node_ops = MEMFS.ops_table.file.node; node.stream_ops = MEMFS.ops_table.file.stream; node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.buffer.byteLength which gives the whole capacity. // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. node.contents = null; } else if (FS.isLink(node.mode)) { node.node_ops = MEMFS.ops_table.link.node; node.stream_ops = MEMFS.ops_table.link.stream; } else if (FS.isChrdev(node.mode)) { node.node_ops = MEMFS.ops_table.chrdev.node; node.stream_ops = MEMFS.ops_table.chrdev.stream; } node.timestamp = Date.now(); // add the new node to the parent if (parent) { parent.contents[name] = node; } return node; },getFileDataAsRegularArray:function (node) { if (node.contents && node.contents.subarray) { var arr = []; for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); return arr; // Returns a copy of the original data. } return node.contents; // No-op, the file contents are already in a JS array. Return as-is. },getFileDataAsTypedArray:function (node) { if (!node.contents) return new Uint8Array; if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. return new Uint8Array(node.contents); },expandFileStorage:function (node, newCapacity) { // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to // increase the size. if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { node.contents = MEMFS.getFileDataAsRegularArray(node); node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. } if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. var prevCapacity = node.contents ? node.contents.buffer.byteLength : 0; if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to // avoid overshooting the allocation cap by a very large margin. var CAPACITY_DOUBLING_MAX = 1024 * 1024; newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. var oldContents = node.contents; node.contents = new Uint8Array(newCapacity); // Allocate new storage. if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. return; } // Not using a typed array to back the file storage. Use a standard JS array instead. if (!node.contents && newCapacity > 0) node.contents = []; while (node.contents.length < newCapacity) node.contents.push(0); },resizeFileStorage:function (node, newSize) { if (node.usedBytes == newSize) return; if (newSize == 0) { node.contents = null; // Fully decommit when requesting a resize to zero. node.usedBytes = 0; return; } if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. var oldContents = node.contents; node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. if (oldContents) { node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. } node.usedBytes = newSize; return; } // Backing with a JS array. if (!node.contents) node.contents = []; if (node.contents.length > newSize) node.contents.length = newSize; else while (node.contents.length < newSize) node.contents.push(0); node.usedBytes = newSize; },node_ops:{getattr:function (node) { var attr = {}; // device numbers reuse inode numbers. attr.dev = FS.isChrdev(node.mode) ? node.id : 1; attr.ino = node.id; attr.mode = node.mode; attr.nlink = 1; attr.uid = 0; attr.gid = 0; attr.rdev = node.rdev; if (FS.isDir(node.mode)) { attr.size = 4096; } else if (FS.isFile(node.mode)) { attr.size = node.usedBytes; } else if (FS.isLink(node.mode)) { attr.size = node.link.length; } else { attr.size = 0; } attr.atime = new Date(node.timestamp); attr.mtime = new Date(node.timestamp); attr.ctime = new Date(node.timestamp); // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), // but this is not required by the standard. attr.blksize = 4096; attr.blocks = Math.ceil(attr.size / attr.blksize); return attr; },setattr:function (node, attr) { if (attr.mode !== undefined) { node.mode = attr.mode; } if (attr.timestamp !== undefined) { node.timestamp = attr.timestamp; } if (attr.size !== undefined) { MEMFS.resizeFileStorage(node, attr.size); } },lookup:function (parent, name) { throw FS.genericErrors[ERRNO_CODES.ENOENT]; },mknod:function (parent, name, mode, dev) { return MEMFS.createNode(parent, name, mode, dev); },rename:function (old_node, new_dir, new_name) { // if we're overwriting a directory at new_name, make sure it's empty. if (FS.isDir(old_node.mode)) { var new_node; try { new_node = FS.lookupNode(new_dir, new_name); } catch (e) { } if (new_node) { for (var i in new_node.contents) { throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); } } } // do the internal rewiring delete old_node.parent.contents[old_node.name]; old_node.name = new_name; new_dir.contents[new_name] = old_node; old_node.parent = new_dir; },unlink:function (parent, name) { delete parent.contents[name]; },rmdir:function (parent, name) { var node = FS.lookupNode(parent, name); for (var i in node.contents) { throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); } delete parent.contents[name]; },readdir:function (node) { var entries = ['.', '..'] for (var key in node.contents) { if (!node.contents.hasOwnProperty(key)) { continue; } entries.push(key); } return entries; },symlink:function (parent, newname, oldpath) { var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); node.link = oldpath; return node; },readlink:function (node) { if (!FS.isLink(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return node.link; }},stream_ops:{read:function (stream, buffer, offset, length, position) { var contents = stream.node.contents; if (position >= stream.node.usedBytes) return 0; var size = Math.min(stream.node.usedBytes - position, length); assert(size >= 0); if (size > 8 && contents.subarray) { // non-trivial, and typed array buffer.set(contents.subarray(position, position + size), offset); } else { for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; } return size; },write:function (stream, buffer, offset, length, position, canOwn) { if (!length) return 0; var node = stream.node; node.timestamp = Date.now(); if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? if (canOwn) { // Can we just reuse the buffer we are given? assert(position === 0, 'canOwn must imply no weird position inside the file'); node.contents = buffer.subarray(offset, offset + length); node.usedBytes = length; return length; } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); node.usedBytes = length; return length; } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? node.contents.set(buffer.subarray(offset, offset + length), position); return length; } } // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. MEMFS.expandFileStorage(node, position+length); if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. else { for (var i = 0; i < length; i++) { node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. } } node.usedBytes = Math.max(node.usedBytes, position+length); return length; },llseek:function (stream, offset, whence) { var position = offset; if (whence === 1) { // SEEK_CUR. position += stream.position; } else if (whence === 2) { // SEEK_END. if (FS.isFile(stream.node.mode)) { position += stream.node.usedBytes; } } if (position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return position; },allocate:function (stream, offset, length) { MEMFS.expandFileStorage(stream.node, offset + length); stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); },mmap:function (stream, buffer, offset, length, position, prot, flags) { if (!FS.isFile(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } var ptr; var allocated; var contents = stream.node.contents; // Only make a new copy when MAP_PRIVATE is specified. if ( !(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer) ) { // We can't emulate MAP_SHARED when the file is not backed by the buffer // we're mapping to (e.g. the HEAP buffer). allocated = false; ptr = contents.byteOffset; } else { // Try to avoid unnecessary slices. if (position > 0 || position + length < stream.node.usedBytes) { if (contents.subarray) { contents = contents.subarray(position, position + length); } else { contents = Array.prototype.slice.call(contents, position, position + length); } } allocated = true; ptr = _malloc(length); if (!ptr) { throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); } buffer.set(contents, ptr); } return { ptr: ptr, allocated: allocated }; },msync:function (stream, buffer, offset, length, mmapFlags) { if (!FS.isFile(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } if (mmapFlags & 2) { // MAP_PRIVATE calls need not to be synced back to underlying fs return 0; } var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); // should we check if bytesWritten and length are the same? return 0; }}}; var IDBFS={dbs:{},indexedDB:function () { if (typeof indexedDB !== 'undefined') return indexedDB; var ret = null; if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; assert(ret, 'IDBFS used, but indexedDB not supported'); return ret; },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { // reuse all of the core MEMFS functionality return MEMFS.mount.apply(null, arguments); },syncfs:function (mount, populate, callback) { IDBFS.getLocalSet(mount, function(err, local) { if (err) return callback(err); IDBFS.getRemoteSet(mount, function(err, remote) { if (err) return callback(err); var src = populate ? remote : local; var dst = populate ? local : remote; IDBFS.reconcile(src, dst, callback); }); }); },getDB:function (name, callback) { // check the cache first var db = IDBFS.dbs[name]; if (db) { return callback(null, db); } var req; try { req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); } catch (e) { return callback(e); } req.onupgradeneeded = function(e) { var db = e.target.result; var transaction = e.target.transaction; var fileStore; if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); } else { fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); } if (!fileStore.indexNames.contains('timestamp')) { fileStore.createIndex('timestamp', 'timestamp', { unique: false }); } }; req.onsuccess = function() { db = req.result; // add to the cache IDBFS.dbs[name] = db; callback(null, db); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },getLocalSet:function (mount, callback) { var entries = {}; function isRealDir(p) { return p !== '.' && p !== '..'; }; function toAbsolute(root) { return function(p) { return PATH.join2(root, p); } }; var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); while (check.length) { var path = check.pop(); var stat; try { stat = FS.stat(path); } catch (e) { return callback(e); } if (FS.isDir(stat.mode)) { check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); } entries[path] = { timestamp: stat.mtime }; } return callback(null, { type: 'local', entries: entries }); },getRemoteSet:function (mount, callback) { var entries = {}; IDBFS.getDB(mount.mountpoint, function(err, db) { if (err) return callback(err); var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); transaction.onerror = function(e) { callback(this.error); e.preventDefault(); }; var store = transaction.objectStore(IDBFS.DB_STORE_NAME); var index = store.index('timestamp'); index.openKeyCursor().onsuccess = function(event) { var cursor = event.target.result; if (!cursor) { return callback(null, { type: 'remote', db: db, entries: entries }); } entries[cursor.primaryKey] = { timestamp: cursor.key }; cursor.continue(); }; }); },loadLocalEntry:function (path, callback) { var stat, node; try { var lookup = FS.lookupPath(path); node = lookup.node; stat = FS.stat(path); } catch (e) { return callback(e); } if (FS.isDir(stat.mode)) { return callback(null, { timestamp: stat.mtime, mode: stat.mode }); } else if (FS.isFile(stat.mode)) { // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. node.contents = MEMFS.getFileDataAsTypedArray(node); return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); } else { return callback(new Error('node type not supported')); } },storeLocalEntry:function (path, entry, callback) { try { if (FS.isDir(entry.mode)) { FS.mkdir(path, entry.mode); } else if (FS.isFile(entry.mode)) { FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true }); } else { return callback(new Error('node type not supported')); } FS.chmod(path, entry.mode); FS.utime(path, entry.timestamp, entry.timestamp); } catch (e) { return callback(e); } callback(null); },removeLocalEntry:function (path, callback) { try { var lookup = FS.lookupPath(path); var stat = FS.stat(path); if (FS.isDir(stat.mode)) { FS.rmdir(path); } else if (FS.isFile(stat.mode)) { FS.unlink(path); } } catch (e) { return callback(e); } callback(null); },loadRemoteEntry:function (store, path, callback) { var req = store.get(path); req.onsuccess = function(event) { callback(null, event.target.result); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },storeRemoteEntry:function (store, path, entry, callback) { var req = store.put(entry, path); req.onsuccess = function() { callback(null); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },removeRemoteEntry:function (store, path, callback) { var req = store.delete(path); req.onsuccess = function() { callback(null); }; req.onerror = function(e) { callback(this.error); e.preventDefault(); }; },reconcile:function (src, dst, callback) { var total = 0; var create = []; Object.keys(src.entries).forEach(function (key) { var e = src.entries[key]; var e2 = dst.entries[key]; if (!e2 || e.timestamp > e2.timestamp) { create.push(key); total++; } }); var remove = []; Object.keys(dst.entries).forEach(function (key) { var e = dst.entries[key]; var e2 = src.entries[key]; if (!e2) { remove.push(key); total++; } }); if (!total) { return callback(null); } var errored = false; var completed = 0; var db = src.type === 'remote' ? src.db : dst.db; var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); var store = transaction.objectStore(IDBFS.DB_STORE_NAME); function done(err) { if (err) { if (!done.errored) { done.errored = true; return callback(err); } return; } if (++completed >= total) { return callback(null); } }; transaction.onerror = function(e) { done(this.error); e.preventDefault(); }; // sort paths in ascending order so directory entries are created // before the files inside them create.sort().forEach(function (path) { if (dst.type === 'local') { IDBFS.loadRemoteEntry(store, path, function (err, entry) { if (err) return done(err); IDBFS.storeLocalEntry(path, entry, done); }); } else { IDBFS.loadLocalEntry(path, function (err, entry) { if (err) return done(err); IDBFS.storeRemoteEntry(store, path, entry, done); }); } }); // sort paths in descending order so files are deleted before their // parent directories remove.sort().reverse().forEach(function(path) { if (dst.type === 'local') { IDBFS.removeLocalEntry(path, done); } else { IDBFS.removeRemoteEntry(store, path, done); } }); }}; var NODEFS={isWindows:false,staticInit:function () { NODEFS.isWindows = !!process.platform.match(/^win/); },mount:function (mount) { assert(ENVIRONMENT_IS_NODE); return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); },createNode:function (parent, name, mode, dev) { if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var node = FS.createNode(parent, name, mode); node.node_ops = NODEFS.node_ops; node.stream_ops = NODEFS.stream_ops; return node; },getMode:function (path) { var stat; try { stat = fs.lstatSync(path); if (NODEFS.isWindows) { // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so // propagate write bits to execute bits. stat.mode = stat.mode | ((stat.mode & 146) >> 1); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } return stat.mode; },realPath:function (node) { var parts = []; while (node.parent !== node) { parts.push(node.name); node = node.parent; } parts.push(node.mount.opts.root); parts.reverse(); return PATH.join.apply(null, parts); },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) { flags &= ~0100000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. if (flags in NODEFS.flagsToPermissionStringMap) { return NODEFS.flagsToPermissionStringMap[flags]; } else { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } },node_ops:{getattr:function (node) { var path = NODEFS.realPath(node); var stat; try { stat = fs.lstatSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. // See http://support.microsoft.com/kb/140365 if (NODEFS.isWindows && !stat.blksize) { stat.blksize = 4096; } if (NODEFS.isWindows && !stat.blocks) { stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; } return { dev: stat.dev, ino: stat.ino, mode: stat.mode, nlink: stat.nlink, uid: stat.uid, gid: stat.gid, rdev: stat.rdev, size: stat.size, atime: stat.atime, mtime: stat.mtime, ctime: stat.ctime, blksize: stat.blksize, blocks: stat.blocks }; },setattr:function (node, attr) { var path = NODEFS.realPath(node); try { if (attr.mode !== undefined) { fs.chmodSync(path, attr.mode); // update the common node structure mode as well node.mode = attr.mode; } if (attr.timestamp !== undefined) { var date = new Date(attr.timestamp); fs.utimesSync(path, date, date); } if (attr.size !== undefined) { fs.truncateSync(path, attr.size); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },lookup:function (parent, name) { var path = PATH.join2(NODEFS.realPath(parent), name); var mode = NODEFS.getMode(path); return NODEFS.createNode(parent, name, mode); },mknod:function (parent, name, mode, dev) { var node = NODEFS.createNode(parent, name, mode, dev); // create the backing node for this in the fs root as well var path = NODEFS.realPath(node); try { if (FS.isDir(node.mode)) { fs.mkdirSync(path, node.mode); } else { fs.writeFileSync(path, '', { mode: node.mode }); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } return node; },rename:function (oldNode, newDir, newName) { var oldPath = NODEFS.realPath(oldNode); var newPath = PATH.join2(NODEFS.realPath(newDir), newName); try { fs.renameSync(oldPath, newPath); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },unlink:function (parent, name) { var path = PATH.join2(NODEFS.realPath(parent), name); try { fs.unlinkSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },rmdir:function (parent, name) { var path = PATH.join2(NODEFS.realPath(parent), name); try { fs.rmdirSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },readdir:function (node) { var path = NODEFS.realPath(node); try { return fs.readdirSync(path); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },symlink:function (parent, newName, oldPath) { var newPath = PATH.join2(NODEFS.realPath(parent), newName); try { fs.symlinkSync(oldPath, newPath); } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },readlink:function (node) { var path = NODEFS.realPath(node); try { path = fs.readlinkSync(path); path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); return path; } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } }},stream_ops:{open:function (stream) { var path = NODEFS.realPath(stream.node); try { if (FS.isFile(stream.node.mode)) { stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags)); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },close:function (stream) { try { if (FS.isFile(stream.node.mode) && stream.nfd) { fs.closeSync(stream.nfd); } } catch (e) { if (!e.code) throw e; throw new FS.ErrnoError(ERRNO_CODES[e.code]); } },read:function (stream, buffer, offset, length, position) { if (length === 0) return 0; // node errors on 0 length reads // FIXME this is terrible. var nbuffer = new Buffer(length); var res; try { res = fs.readSync(stream.nfd, nbuffer, 0, length, position); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES[e.code]); } if (res > 0) { for (var i = 0; i < res; i++) { buffer[offset + i] = nbuffer[i]; } } return res; },write:function (stream, buffer, offset, length, position) { // FIXME this is terrible. var nbuffer = new Buffer(buffer.subarray(offset, offset + length)); var res; try { res = fs.writeSync(stream.nfd, nbuffer, 0, length, position); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES[e.code]); } return res; },llseek:function (stream, offset, whence) { var position = offset; if (whence === 1) { // SEEK_CUR. position += stream.position; } else if (whence === 2) { // SEEK_END. if (FS.isFile(stream.node.mode)) { try { var stat = fs.fstatSync(stream.nfd); position += stat.size; } catch (e) { throw new FS.ErrnoError(ERRNO_CODES[e.code]); } } } if (position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return position; }}}; var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { assert(ENVIRONMENT_IS_WORKER); if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); var createdParents = {}; function ensureParent(path) { // return the parent node, creating subdirs as necessary var parts = path.split('/'); var parent = root; for (var i = 0; i < parts.length-1; i++) { var curr = parts.slice(0, i+1).join('/'); if (!createdParents[curr]) { createdParents[curr] = WORKERFS.createNode(parent, curr, WORKERFS.DIR_MODE, 0); } parent = createdParents[curr]; } return parent; } function base(path) { var parts = path.split('/'); return parts[parts.length-1]; } // We also accept FileList here, by using Array.prototype Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); }); (mount.opts["blobs"] || []).forEach(function(obj) { WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); }); (mount.opts["packages"] || []).forEach(function(pack) { pack['metadata'].files.forEach(function(file) { var name = file.filename.substr(1); // remove initial slash WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); }); }); return root; },createNode:function (parent, name, mode, dev, contents, mtime) { var node = FS.createNode(parent, name, mode); node.mode = mode; node.node_ops = WORKERFS.node_ops; node.stream_ops = WORKERFS.stream_ops; node.timestamp = (mtime || new Date).getTime(); assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); if (mode === WORKERFS.FILE_MODE) { node.size = contents.size; node.contents = contents; } else { node.size = 4096; node.contents = {}; } if (parent) { parent.contents[name] = node; } return node; },node_ops:{getattr:function (node) { return { dev: 1, ino: undefined, mode: node.mode, nlink: 1, uid: 0, gid: 0, rdev: undefined, size: node.size, atime: new Date(node.timestamp), mtime: new Date(node.timestamp), ctime: new Date(node.timestamp), blksize: 4096, blocks: Math.ceil(node.size / 4096), }; },setattr:function (node, attr) { if (attr.mode !== undefined) { node.mode = attr.mode; } if (attr.timestamp !== undefined) { node.timestamp = attr.timestamp; } },lookup:function (parent, name) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); },mknod:function (parent, name, mode, dev) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },rename:function (oldNode, newDir, newName) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },unlink:function (parent, name) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },rmdir:function (parent, name) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },readdir:function (node) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },symlink:function (parent, newName, oldPath) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); },readlink:function (node) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); }},stream_ops:{read:function (stream, buffer, offset, length, position) { if (position >= stream.node.size) return 0; var chunk = stream.node.contents.slice(position, position + length); var ab = WORKERFS.reader.readAsArrayBuffer(chunk); buffer.set(new Uint8Array(ab), offset); return chunk.size; },write:function (stream, buffer, offset, length, position) { throw new FS.ErrnoError(ERRNO_CODES.EIO); },llseek:function (stream, offset, whence) { var position = offset; if (whence === 1) { // SEEK_CUR. position += stream.position; } else if (whence === 2) { // SEEK_END. if (FS.isFile(stream.node.mode)) { position += stream.node.size; } } if (position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return position; }}}; var _stdin=allocate(1, "i32*", ALLOC_STATIC); var _stdout=allocate(1, "i32*", ALLOC_STATIC); var _stderr=allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,handleFSError:function (e) { if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); return ___setErrNo(e.errno); },lookupPath:function (path, opts) { path = PATH.resolve(FS.cwd(), path); opts = opts || {}; if (!path) return { path: '', node: null }; var defaults = { follow_mount: true, recurse_count: 0 }; for (var key in defaults) { if (opts[key] === undefined) { opts[key] = defaults[key]; } } if (opts.recurse_count > 8) { // max recursive lookup of 8 throw new FS.ErrnoError(ERRNO_CODES.ELOOP); } // split the path var parts = PATH.normalizeArray(path.split('/').filter(function(p) { return !!p; }), false); // start at the root var current = FS.root; var current_path = '/'; for (var i = 0; i < parts.length; i++) { var islast = (i === parts.length-1); if (islast && opts.parent) { // stop resolving break; } current = FS.lookupNode(current, parts[i]); current_path = PATH.join2(current_path, parts[i]); // jump to the mount's root node if this is a mountpoint if (FS.isMountpoint(current)) { if (!islast || (islast && opts.follow_mount)) { current = current.mounted.root; } } // by default, lookupPath will not follow a symlink if it is the final path component. // setting opts.follow = true will override this behavior. if (!islast || opts.follow) { var count = 0; while (FS.isLink(current.mode)) { var link = FS.readlink(current_path); current_path = PATH.resolve(PATH.dirname(current_path), link); var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); current = lookup.node; if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). throw new FS.ErrnoError(ERRNO_CODES.ELOOP); } } } } return { path: current_path, node: current }; },getPath:function (node) { var path; while (true) { if (FS.isRoot(node)) { var mount = node.mount.mountpoint; if (!path) return mount; return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; } path = path ? node.name + '/' + path : node.name; node = node.parent; } },hashName:function (parentid, name) { var hash = 0; for (var i = 0; i < name.length; i++) { hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; } return ((parentid + hash) >>> 0) % FS.nameTable.length; },hashAddNode:function (node) { var hash = FS.hashName(node.parent.id, node.name); node.name_next = FS.nameTable[hash]; FS.nameTable[hash] = node; },hashRemoveNode:function (node) { var hash = FS.hashName(node.parent.id, node.name); if (FS.nameTable[hash] === node) { FS.nameTable[hash] = node.name_next; } else { var current = FS.nameTable[hash]; while (current) { if (current.name_next === node) { current.name_next = node.name_next; break; } current = current.name_next; } } },lookupNode:function (parent, name) { var err = FS.mayLookup(parent); if (err) { throw new FS.ErrnoError(err, parent); } var hash = FS.hashName(parent.id, name); for (var node = FS.nameTable[hash]; node; node = node.name_next) { var nodeName = node.name; if (node.parent.id === parent.id && nodeName === name) { return node; } } // if we failed to find it in the cache, call into the VFS return FS.lookup(parent, name); },createNode:function (parent, name, mode, rdev) { if (!FS.FSNode) { FS.FSNode = function(parent, name, mode, rdev) { if (!parent) { parent = this; // root node sets parent to itself } this.parent = parent; this.mount = parent.mount; this.mounted = null; this.id = FS.nextInode++; this.name = name; this.mode = mode; this.node_ops = {}; this.stream_ops = {}; this.rdev = rdev; }; FS.FSNode.prototype = {}; // compatibility var readMode = 292 | 73; var writeMode = 146; // NOTE we must use Object.defineProperties instead of individual calls to // Object.defineProperty in order to make closure compiler happy Object.defineProperties(FS.FSNode.prototype, { read: { get: function() { return (this.mode & readMode) === readMode; }, set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } }, write: { get: function() { return (this.mode & writeMode) === writeMode; }, set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } }, isFolder: { get: function() { return FS.isDir(this.mode); } }, isDevice: { get: function() { return FS.isChrdev(this.mode); } } }); } var node = new FS.FSNode(parent, name, mode, rdev); FS.hashAddNode(node); return node; },destroyNode:function (node) { FS.hashRemoveNode(node); },isRoot:function (node) { return node === node.parent; },isMountpoint:function (node) { return !!node.mounted; },isFile:function (mode) { return (mode & 61440) === 32768; },isDir:function (mode) { return (mode & 61440) === 16384; },isLink:function (mode) { return (mode & 61440) === 40960; },isChrdev:function (mode) { return (mode & 61440) === 8192; },isBlkdev:function (mode) { return (mode & 61440) === 24576; },isFIFO:function (mode) { return (mode & 61440) === 4096; },isSocket:function (mode) { return (mode & 49152) === 49152; },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { var flags = FS.flagModes[str]; if (typeof flags === 'undefined') { throw new Error('Unknown file open mode: ' + str); } return flags; },flagsToPermissionString:function (flag) { var perms = ['r', 'w', 'rw'][flag & 3]; if ((flag & 512)) { perms += 'w'; } return perms; },nodePermissions:function (node, perms) { if (FS.ignorePermissions) { return 0; } // return 0 if any user, group or owner bits are set. if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { return ERRNO_CODES.EACCES; } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { return ERRNO_CODES.EACCES; } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { return ERRNO_CODES.EACCES; } return 0; },mayLookup:function (dir) { var err = FS.nodePermissions(dir, 'x'); if (err) return err; if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; return 0; },mayCreate:function (dir, name) { try { var node = FS.lookupNode(dir, name); return ERRNO_CODES.EEXIST; } catch (e) { } return FS.nodePermissions(dir, 'wx'); },mayDelete:function (dir, name, isdir) { var node; try { node = FS.lookupNode(dir, name); } catch (e) { return e.errno; } var err = FS.nodePermissions(dir, 'wx'); if (err) { return err; } if (isdir) { if (!FS.isDir(node.mode)) { return ERRNO_CODES.ENOTDIR; } if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { return ERRNO_CODES.EBUSY; } } else { if (FS.isDir(node.mode)) { return ERRNO_CODES.EISDIR; } } return 0; },mayOpen:function (node, flags) { if (!node) { return ERRNO_CODES.ENOENT; } if (FS.isLink(node.mode)) { return ERRNO_CODES.ELOOP; } else if (FS.isDir(node.mode)) { if ((flags & 2097155) !== 0 || // opening for write (flags & 512)) { return ERRNO_CODES.EISDIR; } } return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { fd_start = fd_start || 0; fd_end = fd_end || FS.MAX_OPEN_FDS; for (var fd = fd_start; fd <= fd_end; fd++) { if (!FS.streams[fd]) { return fd; } } throw new FS.ErrnoError(ERRNO_CODES.EMFILE); },getStream:function (fd) { return FS.streams[fd]; },createStream:function (stream, fd_start, fd_end) { if (!FS.FSStream) { FS.FSStream = function(){}; FS.FSStream.prototype = {}; // compatibility Object.defineProperties(FS.FSStream.prototype, { object: { get: function() { return this.node; }, set: function(val) { this.node = val; } }, isRead: { get: function() { return (this.flags & 2097155) !== 1; } }, isWrite: { get: function() { return (this.flags & 2097155) !== 0; } }, isAppend: { get: function() { return (this.flags & 1024); } } }); } // clone it, so we can return an instance of FSStream var newStream = new FS.FSStream(); for (var p in stream) { newStream[p] = stream[p]; } stream = newStream; var fd = FS.nextfd(fd_start, fd_end); stream.fd = fd; FS.streams[fd] = stream; return stream; },closeStream:function (fd) { FS.streams[fd] = null; },chrdev_stream_ops:{open:function (stream) { var device = FS.getDevice(stream.node.rdev); // override node's stream ops with the device's stream.stream_ops = device.stream_ops; // forward the open call if (stream.stream_ops.open) { stream.stream_ops.open(stream); } },llseek:function () { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); }},major:function (dev) { return ((dev) >> 8); },minor:function (dev) { return ((dev) & 0xff); },makedev:function (ma, mi) { return ((ma) << 8 | (mi)); },registerDevice:function (dev, ops) { FS.devices[dev] = { stream_ops: ops }; },getDevice:function (dev) { return FS.devices[dev]; },getMounts:function (mount) { var mounts = []; var check = [mount]; while (check.length) { var m = check.pop(); mounts.push(m); check.push.apply(check, m.mounts); } return mounts; },syncfs:function (populate, callback) { if (typeof(populate) === 'function') { callback = populate; populate = false; } var mounts = FS.getMounts(FS.root.mount); var completed = 0; function done(err) { if (err) { if (!done.errored) { done.errored = true; return callback(err); } return; } if (++completed >= mounts.length) { callback(null); } }; // sync all mounts mounts.forEach(function (mount) { if (!mount.type.syncfs) { return done(null); } mount.type.syncfs(mount, populate, done); }); },mount:function (type, opts, mountpoint) { var root = mountpoint === '/'; var pseudo = !mountpoint; var node; if (root && FS.root) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } else if (!root && !pseudo) { var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); mountpoint = lookup.path; // use the absolute path node = lookup.node; if (FS.isMountpoint(node)) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } if (!FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } } var mount = { type: type, opts: opts, mountpoint: mountpoint, mounts: [] }; // create a root node for the fs var mountRoot = type.mount(mount); mountRoot.mount = mount; mount.root = mountRoot; if (root) { FS.root = mountRoot; } else if (node) { // set as a mountpoint node.mounted = mount; // add the new mount to the current mount's children if (node.mount) { node.mount.mounts.push(mount); } } return mountRoot; },unmount:function (mountpoint) { var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); if (!FS.isMountpoint(lookup.node)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } // destroy the nodes for this mount, and all its child mounts var node = lookup.node; var mount = node.mounted; var mounts = FS.getMounts(mount); Object.keys(FS.nameTable).forEach(function (hash) { var current = FS.nameTable[hash]; while (current) { var next = current.name_next; if (mounts.indexOf(current.mount) !== -1) { FS.destroyNode(current); } current = next; } }); // no longer a mountpoint node.mounted = null; // remove this mount from the child mounts var idx = node.mount.mounts.indexOf(mount); assert(idx !== -1); node.mount.mounts.splice(idx, 1); },lookup:function (parent, name) { return parent.node_ops.lookup(parent, name); },mknod:function (path, mode, dev) { var lookup = FS.lookupPath(path, { parent: true }); var parent = lookup.node; var name = PATH.basename(path); if (!name || name === '.' || name === '..') { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var err = FS.mayCreate(parent, name); if (err) { throw new FS.ErrnoError(err); } if (!parent.node_ops.mknod) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } return parent.node_ops.mknod(parent, name, mode, dev); },create:function (path, mode) { mode = mode !== undefined ? mode : 438 /* 0666 */; mode &= 4095; mode |= 32768; return FS.mknod(path, mode, 0); },mkdir:function (path, mode) { mode = mode !== undefined ? mode : 511 /* 0777 */; mode &= 511 | 512; mode |= 16384; return FS.mknod(path, mode, 0); },mkdev:function (path, mode, dev) { if (typeof(dev) === 'undefined') { dev = mode; mode = 438 /* 0666 */; } mode |= 8192; return FS.mknod(path, mode, dev); },symlink:function (oldpath, newpath) { if (!PATH.resolve(oldpath)) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } var lookup = FS.lookupPath(newpath, { parent: true }); var parent = lookup.node; if (!parent) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } var newname = PATH.basename(newpath); var err = FS.mayCreate(parent, newname); if (err) { throw new FS.ErrnoError(err); } if (!parent.node_ops.symlink) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } return parent.node_ops.symlink(parent, newname, oldpath); },rename:function (old_path, new_path) { var old_dirname = PATH.dirname(old_path); var new_dirname = PATH.dirname(new_path); var old_name = PATH.basename(old_path); var new_name = PATH.basename(new_path); // parents must exist var lookup, old_dir, new_dir; try { lookup = FS.lookupPath(old_path, { parent: true }); old_dir = lookup.node; lookup = FS.lookupPath(new_path, { parent: true }); new_dir = lookup.node; } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); // need to be part of the same mount if (old_dir.mount !== new_dir.mount) { throw new FS.ErrnoError(ERRNO_CODES.EXDEV); } // source must exist var old_node = FS.lookupNode(old_dir, old_name); // old path should not be an ancestor of the new path var relative = PATH.relative(old_path, new_dirname); if (relative.charAt(0) !== '.') { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } // new path should not be an ancestor of the old path relative = PATH.relative(new_path, old_dirname); if (relative.charAt(0) !== '.') { throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); } // see if the new path already exists var new_node; try { new_node = FS.lookupNode(new_dir, new_name); } catch (e) { // not fatal } // early out if nothing needs to change if (old_node === new_node) { return; } // we'll need to delete the old entry var isdir = FS.isDir(old_node.mode); var err = FS.mayDelete(old_dir, old_name, isdir); if (err) { throw new FS.ErrnoError(err); } // need delete permissions if we'll be overwriting. // need create permissions if new doesn't already exist. err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name); if (err) { throw new FS.ErrnoError(err); } if (!old_dir.node_ops.rename) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } // if we are going to change the parent, check write permissions if (new_dir !== old_dir) { err = FS.nodePermissions(old_dir, 'w'); if (err) { throw new FS.ErrnoError(err); } } try { if (FS.trackingDelegate['willMovePath']) { FS.trackingDelegate['willMovePath'](old_path, new_path); } } catch(e) { console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); } // remove the node from the lookup hash FS.hashRemoveNode(old_node); // do the underlying fs rename try { old_dir.node_ops.rename(old_node, new_dir, new_name); } catch (e) { throw e; } finally { // add the node back to the hash (in case node_ops.rename // changed its name) FS.hashAddNode(old_node); } try { if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); } catch(e) { console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); } },rmdir:function (path) { var lookup = FS.lookupPath(path, { parent: true }); var parent = lookup.node; var name = PATH.basename(path); var node = FS.lookupNode(parent, name); var err = FS.mayDelete(parent, name, true); if (err) { throw new FS.ErrnoError(err); } if (!parent.node_ops.rmdir) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isMountpoint(node)) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } try { if (FS.trackingDelegate['willDeletePath']) { FS.trackingDelegate['willDeletePath'](path); } } catch(e) { console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); } parent.node_ops.rmdir(parent, name); FS.destroyNode(node); try { if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); } catch(e) { console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); } },readdir:function (path) { var lookup = FS.lookupPath(path, { follow: true }); var node = lookup.node; if (!node.node_ops.readdir) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } return node.node_ops.readdir(node); },unlink:function (path) { var lookup = FS.lookupPath(path, { parent: true }); var parent = lookup.node; var name = PATH.basename(path); var node = FS.lookupNode(parent, name); var err = FS.mayDelete(parent, name, false); if (err) { // POSIX says unlink should set EPERM, not EISDIR if (err === ERRNO_CODES.EISDIR) err = ERRNO_CODES.EPERM; throw new FS.ErrnoError(err); } if (!parent.node_ops.unlink) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isMountpoint(node)) { throw new FS.ErrnoError(ERRNO_CODES.EBUSY); } try { if (FS.trackingDelegate['willDeletePath']) { FS.trackingDelegate['willDeletePath'](path); } } catch(e) { console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); } parent.node_ops.unlink(parent, name); FS.destroyNode(node); try { if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); } catch(e) { console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); } },readlink:function (path) { var lookup = FS.lookupPath(path); var link = lookup.node; if (!link) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } if (!link.node_ops.readlink) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); },stat:function (path, dontFollow) { var lookup = FS.lookupPath(path, { follow: !dontFollow }); var node = lookup.node; if (!node) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } if (!node.node_ops.getattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } return node.node_ops.getattr(node); },lstat:function (path) { return FS.stat(path, true); },chmod:function (path, mode, dontFollow) { var node; if (typeof path === 'string') { var lookup = FS.lookupPath(path, { follow: !dontFollow }); node = lookup.node; } else { node = path; } if (!node.node_ops.setattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } node.node_ops.setattr(node, { mode: (mode & 4095) | (node.mode & ~4095), timestamp: Date.now() }); },lchmod:function (path, mode) { FS.chmod(path, mode, true); },fchmod:function (fd, mode) { var stream = FS.getStream(fd); if (!stream) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } FS.chmod(stream.node, mode); },chown:function (path, uid, gid, dontFollow) { var node; if (typeof path === 'string') { var lookup = FS.lookupPath(path, { follow: !dontFollow }); node = lookup.node; } else { node = path; } if (!node.node_ops.setattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } node.node_ops.setattr(node, { timestamp: Date.now() // we ignore the uid / gid for now }); },lchown:function (path, uid, gid) { FS.chown(path, uid, gid, true); },fchown:function (fd, uid, gid) { var stream = FS.getStream(fd); if (!stream) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } FS.chown(stream.node, uid, gid); },truncate:function (path, len) { if (len < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var node; if (typeof path === 'string') { var lookup = FS.lookupPath(path, { follow: true }); node = lookup.node; } else { node = path; } if (!node.node_ops.setattr) { throw new FS.ErrnoError(ERRNO_CODES.EPERM); } if (FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EISDIR); } if (!FS.isFile(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var err = FS.nodePermissions(node, 'w'); if (err) { throw new FS.ErrnoError(err); } node.node_ops.setattr(node, { size: len, timestamp: Date.now() }); },ftruncate:function (fd, len) { var stream = FS.getStream(fd); if (!stream) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if ((stream.flags & 2097155) === 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } FS.truncate(stream.node, len); },utime:function (path, atime, mtime) { var lookup = FS.lookupPath(path, { follow: true }); var node = lookup.node; node.node_ops.setattr(node, { timestamp: Math.max(atime, mtime) }); },open:function (path, flags, mode, fd_start, fd_end) { if (path === "") { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; if ((flags & 64)) { mode = (mode & 4095) | 32768; } else { mode = 0; } var node; if (typeof path === 'object') { node = path; } else { path = PATH.normalize(path); try { var lookup = FS.lookupPath(path, { follow: !(flags & 131072) }); node = lookup.node; } catch (e) { // ignore } } // perhaps we need to create the node var created = false; if ((flags & 64)) { if (node) { // if O_CREAT and O_EXCL are set, error out if the node already exists if ((flags & 128)) { throw new FS.ErrnoError(ERRNO_CODES.EEXIST); } } else { // node doesn't exist, try to create it node = FS.mknod(path, mode, 0); created = true; } } if (!node) { throw new FS.ErrnoError(ERRNO_CODES.ENOENT); } // can't truncate a device if (FS.isChrdev(node.mode)) { flags &= ~512; } // if asked only for a directory, then this must be one if ((flags & 65536) && !FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } // check permissions, if this is not a file we just created now (it is ok to // create and write to a file with read-only permissions; it is read-only // for later use) if (!created) { var err = FS.mayOpen(node, flags); if (err) { throw new FS.ErrnoError(err); } } // do truncation if necessary if ((flags & 512)) { FS.truncate(node, 0); } // we've already handled these, don't pass down to the underlying vfs flags &= ~(128 | 512); // register the stream with the filesystem var stream = FS.createStream({ node: node, path: FS.getPath(node), // we want the absolute path to the node flags: flags, seekable: true, position: 0, stream_ops: node.stream_ops, // used by the file family libc calls (fopen, fwrite, ferror, etc.) ungotten: [], error: false }, fd_start, fd_end); // call the new stream's open function if (stream.stream_ops.open) { stream.stream_ops.open(stream); } if (Module['logReadFiles'] && !(flags & 1)) { if (!FS.readFiles) FS.readFiles = {}; if (!(path in FS.readFiles)) { FS.readFiles[path] = 1; Module['printErr']('read file: ' + path); } } try { if (FS.trackingDelegate['onOpenFile']) { var trackingFlags = 0; if ((flags & 2097155) !== 1) { trackingFlags |= FS.tracking.openFlags.READ; } if ((flags & 2097155) !== 0) { trackingFlags |= FS.tracking.openFlags.WRITE; } FS.trackingDelegate['onOpenFile'](path, trackingFlags); } } catch(e) { console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); } return stream; },close:function (stream) { if (stream.getdents) stream.getdents = null; // free readdir state try { if (stream.stream_ops.close) { stream.stream_ops.close(stream); } } catch (e) { throw e; } finally { FS.closeStream(stream.fd); } },llseek:function (stream, offset, whence) { if (!stream.seekable || !stream.stream_ops.llseek) { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); } stream.position = stream.stream_ops.llseek(stream, offset, whence); stream.ungotten = []; return stream.position; },read:function (stream, buffer, offset, length, position) { if (length < 0 || position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if ((stream.flags & 2097155) === 1) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if (FS.isDir(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EISDIR); } if (!stream.stream_ops.read) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } var seeking = true; if (typeof position === 'undefined') { position = stream.position; seeking = false; } else if (!stream.seekable) { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); } var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); if (!seeking) stream.position += bytesRead; return bytesRead; },write:function (stream, buffer, offset, length, position, canOwn) { if (length < 0 || position < 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if ((stream.flags & 2097155) === 0) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if (FS.isDir(stream.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.EISDIR); } if (!stream.stream_ops.write) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if (stream.flags & 1024) { // seek to the end before writing in append mode FS.llseek(stream, 0, 2); } var seeking = true; if (typeof position === 'undefined') { position = stream.position; seeking = false; } else if (!stream.seekable) { throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); } var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); if (!seeking) stream.position += bytesWritten; try { if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); } catch(e) { console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); } return bytesWritten; },allocate:function (stream, offset, length) { if (offset < 0 || length <= 0) { throw new FS.ErrnoError(ERRNO_CODES.EINVAL); } if ((stream.flags & 2097155) === 0) { throw new FS.ErrnoError(ERRNO_CODES.EBADF); } if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } if (!stream.stream_ops.allocate) { throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); } stream.stream_ops.allocate(stream, offset, length); },mmap:function (stream, buffer, offset, length, position, prot, flags) { // TODO if PROT is PROT_WRITE, make sure we have write access if ((stream.flags & 2097155) === 1) { throw new FS.ErrnoError(ERRNO_CODES.EACCES); } if (!stream.stream_ops.mmap) { throw new FS.ErrnoError(ERRNO_CODES.ENODEV); } return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); },msync:function (stream, buffer, offset, length, mmapFlags) { if (!stream || !stream.stream_ops.msync) { return 0; } return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); },munmap:function (stream) { return 0; },ioctl:function (stream, cmd, arg) { if (!stream.stream_ops.ioctl) { throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); } return stream.stream_ops.ioctl(stream, cmd, arg); },readFile:function (path, opts) { opts = opts || {}; opts.flags = opts.flags || 'r'; opts.encoding = opts.encoding || 'binary'; if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { throw new Error('Invalid encoding type "' + opts.encoding + '"'); } var ret; var stream = FS.open(path, opts.flags); var stat = FS.stat(path); var length = stat.size; var buf = new Uint8Array(length); FS.read(stream, buf, 0, length, 0); if (opts.encoding === 'utf8') { ret = UTF8ArrayToString(buf, 0); } else if (opts.encoding === 'binary') { ret = buf; } FS.close(stream); return ret; },writeFile:function (path, data, opts) { opts = opts || {}; opts.flags = opts.flags || 'w'; opts.encoding = opts.encoding || 'utf8'; if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { throw new Error('Invalid encoding type "' + opts.encoding + '"'); } var stream = FS.open(path, opts.flags, opts.mode); if (opts.encoding === 'utf8') { var buf = new Uint8Array(lengthBytesUTF8(data)+1); var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn); } else if (opts.encoding === 'binary') { FS.write(stream, data, 0, data.length, 0, opts.canOwn); } FS.close(stream); },cwd:function () { return FS.currentPath; },chdir:function (path) { var lookup = FS.lookupPath(path, { follow: true }); if (!FS.isDir(lookup.node.mode)) { throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); } var err = FS.nodePermissions(lookup.node, 'x'); if (err) { throw new FS.ErrnoError(err); } FS.currentPath = lookup.path; },createDefaultDirectories:function () { FS.mkdir('/tmp'); FS.mkdir('/home'); FS.mkdir('/home/web_user'); },createDefaultDevices:function () { // create /dev FS.mkdir('/dev'); // setup /dev/null FS.registerDevice(FS.makedev(1, 3), { read: function() { return 0; }, write: function(stream, buffer, offset, length, pos) { return length; } }); FS.mkdev('/dev/null', FS.makedev(1, 3)); // setup /dev/tty and /dev/tty1 // stderr needs to print output using Module['printErr'] // so we register a second tty just for it. TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); FS.mkdev('/dev/tty', FS.makedev(5, 0)); FS.mkdev('/dev/tty1', FS.makedev(6, 0)); // setup /dev/[u]random var random_device; if (typeof crypto !== 'undefined') { // for modern web browsers var randomBuffer = new Uint8Array(1); random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; } else if (ENVIRONMENT_IS_NODE) { // for nodejs random_device = function() { return require('crypto').randomBytes(1)[0]; }; } else { // default for ES5 platforms random_device = function() { return (Math.random()*256)|0; }; } FS.createDevice('/dev', 'random', random_device); FS.createDevice('/dev', 'urandom', random_device); // we're not going to emulate the actual shm device, // just create the tmp dirs that reside in it commonly FS.mkdir('/dev/shm'); FS.mkdir('/dev/shm/tmp'); },createSpecialDirectories:function () { // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) FS.mkdir('/proc'); FS.mkdir('/proc/self'); FS.mkdir('/proc/self/fd'); FS.mount({ mount: function() { var node = FS.createNode('/proc/self', 'fd', 16384 | 0777, 73); node.node_ops = { lookup: function(parent, name) { var fd = +name; var stream = FS.getStream(fd); if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); var ret = { parent: null, mount: { mountpoint: 'fake' }, node_ops: { readlink: function() { return stream.path } } }; ret.parent = ret; // make it look like a simple root node return ret; } }; return node; } }, {}, '/proc/self/fd'); },createStandardStreams:function () { // TODO deprecate the old functionality of a single // input / output callback and that utilizes FS.createDevice // and instead require a unique set of stream ops // by default, we symlink the standard streams to the // default tty devices. however, if the standard streams // have been overwritten we create a unique device for // them instead. if (Module['stdin']) { FS.createDevice('/dev', 'stdin', Module['stdin']); } else { FS.symlink('/dev/tty', '/dev/stdin'); } if (Module['stdout']) { FS.createDevice('/dev', 'stdout', null, Module['stdout']); } else { FS.symlink('/dev/tty', '/dev/stdout'); } if (Module['stderr']) { FS.createDevice('/dev', 'stderr', null, Module['stderr']); } else { FS.symlink('/dev/tty1', '/dev/stderr'); } // open default streams for the stdin, stdout and stderr devices var stdin = FS.open('/dev/stdin', 'r'); assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); var stdout = FS.open('/dev/stdout', 'w'); assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); var stderr = FS.open('/dev/stderr', 'w'); assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); },ensureErrnoError:function () { if (FS.ErrnoError) return; FS.ErrnoError = function ErrnoError(errno, node) { //Module.printErr(stackTrace()); // useful for debugging this.node = node; this.setErrno = function(errno) { this.errno = errno; for (var key in ERRNO_CODES) { if (ERRNO_CODES[key] === errno) { this.code = key; break; } } }; this.setErrno(errno); this.message = ERRNO_MESSAGES[errno]; if (this.stack) this.stack = demangleAll(this.stack); }; FS.ErrnoError.prototype = new Error(); FS.ErrnoError.prototype.constructor = FS.ErrnoError; // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) [ERRNO_CODES.ENOENT].forEach(function(code) { FS.genericErrors[code] = new FS.ErrnoError(code); FS.genericErrors[code].stack = ''; }); },staticInit:function () { FS.ensureErrnoError(); FS.nameTable = new Array(4096); FS.mount(MEMFS, {}, '/'); FS.createDefaultDirectories(); FS.createDefaultDevices(); FS.createSpecialDirectories(); FS.filesystems = { 'MEMFS': MEMFS, 'IDBFS': IDBFS, 'NODEFS': NODEFS, 'WORKERFS': WORKERFS, }; },init:function (input, output, error) { assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); FS.init.initialized = true; FS.ensureErrnoError(); // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here Module['stdin'] = input || Module['stdin']; Module['stdout'] = output || Module['stdout']; Module['stderr'] = error || Module['stderr']; FS.createStandardStreams(); },quit:function () { FS.init.initialized = false; // force-flush all streams, so we get musl std streams printed out var fflush = Module['_fflush']; if (fflush) fflush(0); // close all of our streams for (var i = 0; i < FS.streams.length; i++) { var stream = FS.streams[i]; if (!stream) { continue; } FS.close(stream); } },getMode:function (canRead, canWrite) { var mode = 0; if (canRead) mode |= 292 | 73; if (canWrite) mode |= 146; return mode; },joinPath:function (parts, forceRelative) { var path = PATH.join.apply(null, parts); if (forceRelative && path[0] == '/') path = path.substr(1); return path; },absolutePath:function (relative, base) { return PATH.resolve(base, relative); },standardizePath:function (path) { return PATH.normalize(path); },findObject:function (path, dontResolveLastLink) { var ret = FS.analyzePath(path, dontResolveLastLink); if (ret.exists) { return ret.object; } else { ___setErrNo(ret.error); return null; } },analyzePath:function (path, dontResolveLastLink) { // operate from within the context of the symlink's target try { var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); path = lookup.path; } catch (e) { } var ret = { isRoot: false, exists: false, error: 0, name: null, path: null, object: null, parentExists: false, parentPath: null, parentObject: null }; try { var lookup = FS.lookupPath(path, { parent: true }); ret.parentExists = true; ret.parentPath = lookup.path; ret.parentObject = lookup.node; ret.name = PATH.basename(path); lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); ret.exists = true; ret.path = lookup.path; ret.object = lookup.node; ret.name = lookup.node.name; ret.isRoot = lookup.path === '/'; } catch (e) { ret.error = e.errno; }; return ret; },createFolder:function (parent, name, canRead, canWrite) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); var mode = FS.getMode(canRead, canWrite); return FS.mkdir(path, mode); },createPath:function (parent, path, canRead, canWrite) { parent = typeof parent === 'string' ? parent : FS.getPath(parent); var parts = path.split('/').reverse(); while (parts.length) { var part = parts.pop(); if (!part) continue; var current = PATH.join2(parent, part); try { FS.mkdir(current); } catch (e) { // ignore EEXIST } parent = current; } return current; },createFile:function (parent, name, properties, canRead, canWrite) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); var mode = FS.getMode(canRead, canWrite); return FS.create(path, mode); },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; var mode = FS.getMode(canRead, canWrite); var node = FS.create(path, mode); if (data) { if (typeof data === 'string') { var arr = new Array(data.length); for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); data = arr; } // make sure we can write to the file FS.chmod(node, mode | 146); var stream = FS.open(node, 'w'); FS.write(stream, data, 0, data.length, 0, canOwn); FS.close(stream); FS.chmod(node, mode); } return node; },createDevice:function (parent, name, input, output) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); var mode = FS.getMode(!!input, !!output); if (!FS.createDevice.major) FS.createDevice.major = 64; var dev = FS.makedev(FS.createDevice.major++, 0); // Create a fake device that a set of stream ops to emulate // the old behavior. FS.registerDevice(dev, { open: function(stream) { stream.seekable = false; }, close: function(stream) { // flush any pending line data if (output && output.buffer && output.buffer.length) { output(10); } }, read: function(stream, buffer, offset, length, pos /* ignored */) { var bytesRead = 0; for (var i = 0; i < length; i++) { var result; try { result = input(); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } if (result === undefined && bytesRead === 0) { throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); } if (result === null || result === undefined) break; bytesRead++; buffer[offset+i] = result; } if (bytesRead) { stream.node.timestamp = Date.now(); } return bytesRead; }, write: function(stream, buffer, offset, length, pos) { for (var i = 0; i < length; i++) { try { output(buffer[offset+i]); } catch (e) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } } if (length) { stream.node.timestamp = Date.now(); } return i; } }); return FS.mkdev(path, mode, dev); },createLink:function (parent, name, target, canRead, canWrite) { var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); return FS.symlink(target, path); },forceLoadFile:function (obj) { if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; var success = true; if (typeof XMLHttpRequest !== 'undefined') { throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); } else if (Module['read']) { // Command-line. try { // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as // read() will try to parse UTF8. obj.contents = intArrayFromString(Module['read'](obj.url), true); obj.usedBytes = obj.contents.length; } catch (e) { success = false; } } else { throw new Error('Cannot load without read() or XMLHttpRequest.'); } if (!success) ___setErrNo(ERRNO_CODES.EIO); return success; },createLazyFile:function (parent, name, url, canRead, canWrite) { // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. function LazyUint8Array() { this.lengthKnown = false; this.chunks = []; // Loaded chunks. Index is the chunk number } LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { if (idx > this.length-1 || idx < 0) { return undefined; } var chunkOffset = idx % this.chunkSize; var chunkNum = (idx / this.chunkSize)|0; return this.getter(chunkNum)[chunkOffset]; } LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { this.getter = getter; } LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { // Find length var xhr = new XMLHttpRequest(); xhr.open('HEAD', url, false); xhr.send(null); if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); var datalength = Number(xhr.getResponseHeader("Content-length")); var header; var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; var chunkSize = 1024*1024; // Chunk size in bytes if (!hasByteServing) chunkSize = datalength; // Function to get a range from the remote URL. var doXHR = (function(from, to) { if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. var xhr = new XMLHttpRequest(); xhr.open('GET', url, false); if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); // Some hints to the browser that we want binary data. if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; if (xhr.overrideMimeType) { xhr.overrideMimeType('text/plain; charset=x-user-defined'); } xhr.send(null); if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); if (xhr.response !== undefined) { return new Uint8Array(xhr.response || []); } else { return intArrayFromString(xhr.responseText || '', true); } }); var lazyArray = this; lazyArray.setDataGetter(function(chunkNum) { var start = chunkNum * chunkSize; var end = (chunkNum+1) * chunkSize - 1; // including this byte end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { lazyArray.chunks[chunkNum] = doXHR(start, end); } if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); return lazyArray.chunks[chunkNum]; }); this._length = datalength; this._chunkSize = chunkSize; this.lengthKnown = true; } if (typeof XMLHttpRequest !== 'undefined') { if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; var lazyArray = new LazyUint8Array(); Object.defineProperty(lazyArray, "length", { get: function() { if(!this.lengthKnown) { this.cacheLength(); } return this._length; } }); Object.defineProperty(lazyArray, "chunkSize", { get: function() { if(!this.lengthKnown) { this.cacheLength(); } return this._chunkSize; } }); var properties = { isDevice: false, contents: lazyArray }; } else { var properties = { isDevice: false, url: url }; } var node = FS.createFile(parent, name, properties, canRead, canWrite); // This is a total hack, but I want to get this lazy file code out of the // core of MEMFS. If we want to keep this lazy file concept I feel it should // be its own thin LAZYFS proxying calls to MEMFS. if (properties.contents) { node.contents = properties.contents; } else if (properties.url) { node.contents = null; node.url = properties.url; } // Add a function that defers querying the file size until it is asked the first time. Object.defineProperty(node, "usedBytes", { get: function() { return this.contents.length; } }); // override each stream op with one that tries to force load the lazy file first var stream_ops = {}; var keys = Object.keys(node.stream_ops); keys.forEach(function(key) { var fn = node.stream_ops[key]; stream_ops[key] = function forceLoadLazyFile() { if (!FS.forceLoadFile(node)) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } return fn.apply(null, arguments); }; }); // use a custom read function stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { if (!FS.forceLoadFile(node)) { throw new FS.ErrnoError(ERRNO_CODES.EIO); } var contents = stream.node.contents; if (position >= contents.length) return 0; var size = Math.min(contents.length - position, length); assert(size >= 0); if (contents.slice) { // normal array for (var i = 0; i < size; i++) { buffer[offset + i] = contents[position + i]; } } else { for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR buffer[offset + i] = contents.get(position + i); } } return size; }; node.stream_ops = stream_ops; return node; },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { Browser.init(); // TODO we should allow people to just pass in a complete filename instead // of parent and name being that we just join them anyways var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname function processData(byteArray) { function finish(byteArray) { if (preFinish) preFinish(); if (!dontCreateFile) { FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); } if (onload) onload(); removeRunDependency(dep); } var handled = false; Module['preloadPlugins'].forEach(function(plugin) { if (handled) return; if (plugin['canHandle'](fullname)) { plugin['handle'](byteArray, fullname, finish, function() { if (onerror) onerror(); removeRunDependency(dep); }); handled = true; } }); if (!handled) finish(byteArray); } addRunDependency(dep); if (typeof url == 'string') { Browser.asyncLoad(url, function(byteArray) { processData(byteArray); }, onerror); } else { processData(url); } },indexedDB:function () { return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; },DB_NAME:function () { return 'EM_FS_' + window.location.pathname; },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { onload = onload || function(){}; onerror = onerror || function(){}; var indexedDB = FS.indexedDB(); try { var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); } catch (e) { return onerror(e); } openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { console.log('creating db'); var db = openRequest.result; db.createObjectStore(FS.DB_STORE_NAME); }; openRequest.onsuccess = function openRequest_onsuccess() { var db = openRequest.result; var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); var files = transaction.objectStore(FS.DB_STORE_NAME); var ok = 0, fail = 0, total = paths.length; function finish() { if (fail == 0) onload(); else onerror(); } paths.forEach(function(path) { var putRequest = files.put(FS.analyzePath(path).object.contents, path); putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; }); transaction.onerror = onerror; }; openRequest.onerror = onerror; },loadFilesFromDB:function (paths, onload, onerror) { onload = onload || function(){}; onerror = onerror || function(){}; var indexedDB = FS.indexedDB(); try { var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); } catch (e) { return onerror(e); } openRequest.onupgradeneeded = onerror; // no database to load from openRequest.onsuccess = function openRequest_onsuccess() { var db = openRequest.result; try { var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); } catch(e) { onerror(e); return; } var files = transaction.objectStore(FS.DB_STORE_NAME); var ok = 0, fail = 0, total = paths.length; function finish() { if (fail == 0) onload(); else onerror(); } paths.forEach(function(path) { var getRequest = files.get(path); getRequest.onsuccess = function getRequest_onsuccess() { if (FS.analyzePath(path).exists) { FS.unlink(path); } FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); ok++; if (ok + fail == total) finish(); }; getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; }); transaction.onerror = onerror; }; openRequest.onerror = onerror; }};var PATH={splitPath:function (filename) { var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; return splitPathRe.exec(filename).slice(1); },normalizeArray:function (parts, allowAboveRoot) { // if the path tries to go above the root, `up` ends up > 0 var up = 0; for (var i = parts.length - 1; i >= 0; i--) { var last = parts[i]; if (last === '.') { parts.splice(i, 1); } else if (last === '..') { parts.splice(i, 1); up++; } else if (up) { parts.splice(i, 1); up--; } } // if the path is allowed to go above the root, restore leading ..s if (allowAboveRoot) { for (; up--; up) { parts.unshift('..'); } } return parts; },normalize:function (path) { var isAbsolute = path.charAt(0) === '/', trailingSlash = path.substr(-1) === '/'; // Normalize the path path = PATH.normalizeArray(path.split('/').filter(function(p) { return !!p; }), !isAbsolute).join('/'); if (!path && !isAbsolute) { path = '.'; } if (path && trailingSlash) { path += '/'; } return (isAbsolute ? '/' : '') + path; },dirname:function (path) { var result = PATH.splitPath(path), root = result[0], dir = result[1]; if (!root && !dir) { // No dirname whatsoever return '.'; } if (dir) { // It has a dirname, strip trailing slash dir = dir.substr(0, dir.length - 1); } return root + dir; },basename:function (path) { // EMSCRIPTEN return '/'' for '/', not an empty string if (path === '/') return '/'; var lastSlash = path.lastIndexOf('/'); if (lastSlash === -1) return path; return path.substr(lastSlash+1); },extname:function (path) { return PATH.splitPath(path)[3]; },join:function () { var paths = Array.prototype.slice.call(arguments, 0); return PATH.normalize(paths.join('/')); },join2:function (l, r) { return PATH.normalize(l + '/' + r); },resolve:function () { var resolvedPath = '', resolvedAbsolute = false; for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { var path = (i >= 0) ? arguments[i] : FS.cwd(); // Skip empty and invalid entries if (typeof path !== 'string') { throw new TypeError('Arguments to path.resolve must be strings'); } else if (!path) { return ''; // an invalid portion invalidates the whole thing } resolvedPath = path + '/' + resolvedPath; resolvedAbsolute = path.charAt(0) === '/'; } // At this point the path should be resolved to a full absolute path, but // handle relative paths to be safe (might happen when process.cwd() fails) resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { return !!p; }), !resolvedAbsolute).join('/'); return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; },relative:function (from, to) { from = PATH.resolve(from).substr(1); to = PATH.resolve(to).substr(1); function trim(arr) { var start = 0; for (; start < arr.length; start++) { if (arr[start] !== '') break; } var end = arr.length - 1; for (; end >= 0; end--) { if (arr[end] !== '') break; } if (start > end) return []; return arr.slice(start, end - start + 1); } var fromParts = trim(from.split('/')); var toParts = trim(to.split('/')); var length = Math.min(fromParts.length, toParts.length); var samePartsLength = length; for (var i = 0; i < length; i++) { if (fromParts[i] !== toParts[i]) { samePartsLength = i; break; } } var outputParts = []; for (var i = samePartsLength; i < fromParts.length; i++) { outputParts.push('..'); } outputParts = outputParts.concat(toParts.slice(samePartsLength)); return outputParts.join('/'); }}; function _emscripten_set_main_loop_timing(mode, value) { Browser.mainLoop.timingMode = mode; Browser.mainLoop.timingValue = value; if (!Browser.mainLoop.func) { console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.'); return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. } if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { setTimeout(Browser.mainLoop.runner, value); // doing this each time means that on exception, we stop }; Browser.mainLoop.method = 'timeout'; } else if (mode == 1 /*EM_TIMING_RAF*/) { Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { Browser.requestAnimationFrame(Browser.mainLoop.runner); }; Browser.mainLoop.method = 'rAF'; } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { if (!window['setImmediate']) { // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) var setImmediates = []; var emscriptenMainLoopMessageId = '__emcc'; function Browser_setImmediate_messageHandler(event) { if (event.source === window && event.data === emscriptenMainLoopMessageId) { event.stopPropagation(); setImmediates.shift()(); } } window.addEventListener("message", Browser_setImmediate_messageHandler, true); window['setImmediate'] = function Browser_emulated_setImmediate(func) { setImmediates.push(func); window.postMessage(emscriptenMainLoopMessageId, "*"); } } Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { window['setImmediate'](Browser.mainLoop.runner); }; Browser.mainLoop.method = 'immediate'; } return 0; }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { Module['noExitRuntime'] = true; assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); Browser.mainLoop.func = func; Browser.mainLoop.arg = arg; var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; Browser.mainLoop.runner = function Browser_mainLoop_runner() { if (ABORT) return; if (Browser.mainLoop.queue.length > 0) { var start = Date.now(); var blocker = Browser.mainLoop.queue.shift(); blocker.func(blocker.arg); if (Browser.mainLoop.remainingBlockers) { var remaining = Browser.mainLoop.remainingBlockers; var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); if (blocker.counted) { Browser.mainLoop.remainingBlockers = next; } else { // not counted, but move the progress along a tiny bit next = next + 0.5; // do not steal all the next one's progress Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; } } console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); Browser.mainLoop.updateStatus(); setTimeout(Browser.mainLoop.runner, 0); return; } // catch pauses from non-main loop sources if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; // Implement very basic swap interval control Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { // Not the scheduled time to render this frame - skip. Browser.mainLoop.scheduler(); return; } // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize // VBO double-buffering and reduce GPU stalls. if (Browser.mainLoop.method === 'timeout' && Module.ctx) { Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); Browser.mainLoop.method = ''; // just warn once per call to set main loop } Browser.mainLoop.runIter(function() { if (typeof arg !== 'undefined') { Runtime.dynCall('vi', func, [arg]); } else { Runtime.dynCall('v', func); } }); // catch pauses from the main loop itself if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able // to queue the newest produced audio samples. // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() // do not need to be hardcoded into this function, but can be more generic. if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); Browser.mainLoop.scheduler(); } if (!noSetTiming) { if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) Browser.mainLoop.scheduler(); } if (simulateInfiniteLoop) { throw 'SimulateInfiniteLoop'; } }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () { Browser.mainLoop.scheduler = null; Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. },resume:function () { Browser.mainLoop.currentlyRunningMainloop++; var timingMode = Browser.mainLoop.timingMode; var timingValue = Browser.mainLoop.timingValue; var func = Browser.mainLoop.func; Browser.mainLoop.func = null; _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); _emscripten_set_main_loop_timing(timingMode, timingValue); Browser.mainLoop.scheduler(); },updateStatus:function () { if (Module['setStatus']) { var message = Module['statusMessage'] || 'Please wait...'; var remaining = Browser.mainLoop.remainingBlockers; var expected = Browser.mainLoop.expectedBlockers; if (remaining) { if (remaining < expected) { Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); } else { Module['setStatus'](message); } } else { Module['setStatus'](''); } } },runIter:function (func) { if (ABORT) return; if (Module['preMainLoop']) { var preRet = Module['preMainLoop'](); if (preRet === false) { return; // |return false| skips a frame } } try { func(); } catch (e) { if (e instanceof ExitStatus) { return; } else { if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); throw e; } } if (Module['postMainLoop']) Module['postMainLoop'](); }},isFullScreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () { if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers if (Browser.initted) return; Browser.initted = true; try { new Blob(); Browser.hasBlobConstructor = true; } catch(e) { Browser.hasBlobConstructor = false; console.log("warning: no blob constructor, cannot create blobs with mimetypes"); } Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); Module.noImageDecoding = true; } // Support for plugins that can process preloaded files. You can add more of these to // your app by creating and appending to Module.preloadPlugins. // // Each plugin is asked if it can handle a file based on the file's name. If it can, // it is given the file's raw data. When it is done, it calls a callback with the file's // (possibly modified) data. For example, a plugin might decompress a file, or it // might create some side data structure for use later (like an Image element, etc.). var imagePlugin = {}; imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); }; imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { var b = null; if (Browser.hasBlobConstructor) { try { b = new Blob([byteArray], { type: Browser.getMimetype(name) }); if (b.size !== byteArray.length) { // Safari bug #118630 // Safari's Blob can only take an ArrayBuffer b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); } } catch(e) { Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); } } if (!b) { var bb = new Browser.BlobBuilder(); bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range b = bb.getBlob(); } var url = Browser.URLObject.createObjectURL(b); assert(typeof url == 'string', 'createObjectURL must return a url as a string'); var img = new Image(); img.onload = function img_onload() { assert(img.complete, 'Image ' + name + ' could not be decoded'); var canvas = document.createElement('canvas'); canvas.width = img.width; canvas.height = img.height; var ctx = canvas.getContext('2d'); ctx.drawImage(img, 0, 0); Module["preloadedImages"][name] = canvas; Browser.URLObject.revokeObjectURL(url); if (onload) onload(byteArray); }; img.onerror = function img_onerror(event) { console.log('Image ' + url + ' could not be decoded'); if (onerror) onerror(); }; img.src = url; }; Module['preloadPlugins'].push(imagePlugin); var audioPlugin = {}; audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; }; audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { var done = false; function finish(audio) { if (done) return; done = true; Module["preloadedAudios"][name] = audio; if (onload) onload(byteArray); } function fail() { if (done) return; done = true; Module["preloadedAudios"][name] = new Audio(); // empty shim if (onerror) onerror(); } if (Browser.hasBlobConstructor) { try { var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); } catch(e) { return fail(); } var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! assert(typeof url == 'string', 'createObjectURL must return a url as a string'); var audio = new Audio(); audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 audio.onerror = function audio_onerror(event) { if (done) return; console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); function encode64(data) { var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; var PAD = '='; var ret = ''; var leftchar = 0; var leftbits = 0; for (var i = 0; i < data.length; i++) { leftchar = (leftchar << 8) | data[i]; leftbits += 8; while (leftbits >= 6) { var curr = (leftchar >> (leftbits-6)) & 0x3f; leftbits -= 6; ret += BASE[curr]; } } if (leftbits == 2) { ret += BASE[(leftchar&3) << 4]; ret += PAD + PAD; } else if (leftbits == 4) { ret += BASE[(leftchar&0xf) << 2]; ret += PAD; } return ret; } audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); finish(audio); // we don't wait for confirmation this worked - but it's worth trying }; audio.src = url; // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror Browser.safeSetTimeout(function() { finish(audio); // try to use it even though it is not necessarily ready to play }, 10000); } else { return fail(); } }; Module['preloadPlugins'].push(audioPlugin); // Canvas event setup var canvas = Module['canvas']; function pointerLockChange() { Browser.pointerLock = document['pointerLockElement'] === canvas || document['mozPointerLockElement'] === canvas || document['webkitPointerLockElement'] === canvas || document['msPointerLockElement'] === canvas; } if (canvas) { // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module // Module['forcedAspectRatio'] = 4 / 3; canvas.requestPointerLock = canvas['requestPointerLock'] || canvas['mozRequestPointerLock'] || canvas['webkitRequestPointerLock'] || canvas['msRequestPointerLock'] || function(){}; canvas.exitPointerLock = document['exitPointerLock'] || document['mozExitPointerLock'] || document['webkitExitPointerLock'] || document['msExitPointerLock'] || function(){}; // no-op if function does not exist canvas.exitPointerLock = canvas.exitPointerLock.bind(document); document.addEventListener('pointerlockchange', pointerLockChange, false); document.addEventListener('mozpointerlockchange', pointerLockChange, false); document.addEventListener('webkitpointerlockchange', pointerLockChange, false); document.addEventListener('mspointerlockchange', pointerLockChange, false); if (Module['elementPointerLock']) { canvas.addEventListener("click", function(ev) { if (!Browser.pointerLock && canvas.requestPointerLock) { canvas.requestPointerLock(); ev.preventDefault(); } }, false); } } },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) { if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. var ctx; var contextHandle; if (useWebGL) { // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. var contextAttributes = { antialias: false, alpha: false }; if (webGLContextAttributes) { for (var attribute in webGLContextAttributes) { contextAttributes[attribute] = webGLContextAttributes[attribute]; } } contextHandle = GL.createContext(canvas, contextAttributes); if (contextHandle) { ctx = GL.getContext(contextHandle).GLctx; } // Set the background of the WebGL canvas to black canvas.style.backgroundColor = "black"; } else { ctx = canvas.getContext('2d'); } if (!ctx) return null; if (setInModule) { if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); Module.ctx = ctx; if (useWebGL) GL.makeContextCurrent(contextHandle); Module.useWebGL = useWebGL; Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); Browser.init(); } return ctx; },destroyContext:function (canvas, useWebGL, setInModule) {},fullScreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) { Browser.lockPointer = lockPointer; Browser.resizeCanvas = resizeCanvas; Browser.vrDevice = vrDevice; if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null; var canvas = Module['canvas']; function fullScreenChange() { Browser.isFullScreen = false; var canvasContainer = canvas.parentNode; if ((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] || document['mozFullScreenElement'] || document['mozFullscreenElement'] || document['fullScreenElement'] || document['fullscreenElement'] || document['msFullScreenElement'] || document['msFullscreenElement'] || document['webkitCurrentFullScreenElement']) === canvasContainer) { canvas.cancelFullScreen = document['cancelFullScreen'] || document['mozCancelFullScreen'] || document['webkitCancelFullScreen'] || document['msExitFullscreen'] || document['exitFullscreen'] || function() {}; canvas.cancelFullScreen = canvas.cancelFullScreen.bind(document); if (Browser.lockPointer) canvas.requestPointerLock(); Browser.isFullScreen = true; if (Browser.resizeCanvas) Browser.setFullScreenCanvasSize(); } else { // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen canvasContainer.parentNode.insertBefore(canvas, canvasContainer); canvasContainer.parentNode.removeChild(canvasContainer); if (Browser.resizeCanvas) Browser.setWindowedCanvasSize(); } if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullScreen); Browser.updateCanvasDimensions(canvas); } if (!Browser.fullScreenHandlersInstalled) { Browser.fullScreenHandlersInstalled = true; document.addEventListener('fullscreenchange', fullScreenChange, false); document.addEventListener('mozfullscreenchange', fullScreenChange, false); document.addEventListener('webkitfullscreenchange', fullScreenChange, false); document.addEventListener('MSFullscreenChange', fullScreenChange, false); } // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root var canvasContainer = document.createElement("div"); canvas.parentNode.insertBefore(canvasContainer, canvas); canvasContainer.appendChild(canvas); // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) canvasContainer.requestFullScreen = canvasContainer['requestFullScreen'] || canvasContainer['mozRequestFullScreen'] || canvasContainer['msRequestFullscreen'] || (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); if (vrDevice) { canvasContainer.requestFullScreen({ vrDisplay: vrDevice }); } else { canvasContainer.requestFullScreen(); } },nextRAF:0,fakeRequestAnimationFrame:function (func) { // try to keep 60fps between calls to here var now = Date.now(); if (Browser.nextRAF === 0) { Browser.nextRAF = now + 1000/60; } else { while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 Browser.nextRAF += 1000/60; } } var delay = Math.max(Browser.nextRAF - now, 0); setTimeout(func, delay); },requestAnimationFrame:function requestAnimationFrame(func) { if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js) Browser.fakeRequestAnimationFrame(func); } else { if (!window.requestAnimationFrame) { window.requestAnimationFrame = window['requestAnimationFrame'] || window['mozRequestAnimationFrame'] || window['webkitRequestAnimationFrame'] || window['msRequestAnimationFrame'] || window['oRequestAnimationFrame'] || Browser.fakeRequestAnimationFrame; } window.requestAnimationFrame(func); } },safeCallback:function (func) { return function() { if (!ABORT) return func.apply(null, arguments); }; },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () { Browser.allowAsyncCallbacks = false; },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now Browser.allowAsyncCallbacks = true; if (Browser.queuedAsyncCallbacks.length > 0) { var callbacks = Browser.queuedAsyncCallbacks; Browser.queuedAsyncCallbacks = []; callbacks.forEach(function(func) { func(); }); } },safeRequestAnimationFrame:function (func) { return Browser.requestAnimationFrame(function() { if (ABORT) return; if (Browser.allowAsyncCallbacks) { func(); } else { Browser.queuedAsyncCallbacks.push(func); } }); },safeSetTimeout:function (func, timeout) { Module['noExitRuntime'] = true; return setTimeout(function() { if (ABORT) return; if (Browser.allowAsyncCallbacks) { func(); } else { Browser.queuedAsyncCallbacks.push(func); } }, timeout); },safeSetInterval:function (func, timeout) { Module['noExitRuntime'] = true; return setInterval(function() { if (ABORT) return; if (Browser.allowAsyncCallbacks) { func(); } // drop it on the floor otherwise, next interval will kick in }, timeout); },getMimetype:function (name) { return { 'jpg': 'image/jpeg', 'jpeg': 'image/jpeg', 'png': 'image/png', 'bmp': 'image/bmp', 'ogg': 'audio/ogg', 'wav': 'audio/wav', 'mp3': 'audio/mpeg' }[name.substr(name.lastIndexOf('.')+1)]; },getUserMedia:function (func) { if(!window.getUserMedia) { window.getUserMedia = navigator['getUserMedia'] || navigator['mozGetUserMedia']; } window.getUserMedia(func); },getMovementX:function (event) { return event['movementX'] || event['mozMovementX'] || event['webkitMovementX'] || 0; },getMovementY:function (event) { return event['movementY'] || event['mozMovementY'] || event['webkitMovementY'] || 0; },getMouseWheelDelta:function (event) { var delta = 0; switch (event.type) { case 'DOMMouseScroll': delta = event.detail; break; case 'mousewheel': delta = event.wheelDelta; break; case 'wheel': delta = event['deltaY']; break; default: throw 'unrecognized mouse wheel event: ' + event.type; } return delta; },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup if (Browser.pointerLock) { // When the pointer is locked, calculate the coordinates // based on the movement of the mouse. // Workaround for Firefox bug 764498 if (event.type != 'mousemove' && ('mozMovementX' in event)) { Browser.mouseMovementX = Browser.mouseMovementY = 0; } else { Browser.mouseMovementX = Browser.getMovementX(event); Browser.mouseMovementY = Browser.getMovementY(event); } // check if SDL is available if (typeof SDL != "undefined") { Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; } else { // just add the mouse delta to the current absolut mouse position // FIXME: ideally this should be clamped against the canvas size and zero Browser.mouseX += Browser.mouseMovementX; Browser.mouseY += Browser.mouseMovementY; } } else { // Otherwise, calculate the movement based on the changes // in the coordinates. var rect = Module["canvas"].getBoundingClientRect(); var cw = Module["canvas"].width; var ch = Module["canvas"].height; // Neither .scrollX or .pageXOffset are defined in a spec, but // we prefer .scrollX because it is currently in a spec draft. // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset // and we have no viable fallback. assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.'); if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { var touch = event.touch; if (touch === undefined) { return; // the "touch" property is only defined in SDL } var adjustedX = touch.pageX - (scrollX + rect.left); var adjustedY = touch.pageY - (scrollY + rect.top); adjustedX = adjustedX * (cw / rect.width); adjustedY = adjustedY * (ch / rect.height); var coords = { x: adjustedX, y: adjustedY }; if (event.type === 'touchstart') { Browser.lastTouches[touch.identifier] = coords; Browser.touches[touch.identifier] = coords; } else if (event.type === 'touchend' || event.type === 'touchmove') { var last = Browser.touches[touch.identifier]; if (!last) last = coords; Browser.lastTouches[touch.identifier] = last; Browser.touches[touch.identifier] = coords; } return; } var x = event.pageX - (scrollX + rect.left); var y = event.pageY - (scrollY + rect.top); // the canvas might be CSS-scaled compared to its backbuffer; // SDL-using content will want mouse coordinates in terms // of backbuffer units. x = x * (cw / rect.width); y = y * (ch / rect.height); Browser.mouseMovementX = x - Browser.mouseX; Browser.mouseMovementY = y - Browser.mouseY; Browser.mouseX = x; Browser.mouseY = y; } },xhrLoad:function (url, onload, onerror) { var xhr = new XMLHttpRequest(); xhr.open('GET', url, true); xhr.responseType = 'arraybuffer'; xhr.onload = function xhr_onload() { if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 onload(xhr.response); } else { onerror(); } }; xhr.onerror = onerror; xhr.send(null); },asyncLoad:function (url, onload, onerror, noRunDep) { Browser.xhrLoad(url, function(arrayBuffer) { assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); onload(new Uint8Array(arrayBuffer)); if (!noRunDep) removeRunDependency('al ' + url); }, function(event) { if (onerror) { onerror(); } else { throw 'Loading data file "' + url + '" failed.'; } }); if (!noRunDep) addRunDependency('al ' + url); },resizeListeners:[],updateResizeListeners:function () { var canvas = Module['canvas']; Browser.resizeListeners.forEach(function(listener) { listener(canvas.width, canvas.height); }); },setCanvasSize:function (width, height, noUpdates) { var canvas = Module['canvas']; Browser.updateCanvasDimensions(canvas, width, height); if (!noUpdates) Browser.updateResizeListeners(); },windowedWidth:0,windowedHeight:0,setFullScreenCanvasSize:function () { // check if SDL is available if (typeof SDL != "undefined") { var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; flags = flags | 0x00800000; // set SDL_FULLSCREEN flag HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags } Browser.updateResizeListeners(); },setWindowedCanvasSize:function () { // check if SDL is available if (typeof SDL != "undefined") { var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags } Browser.updateResizeListeners(); },updateCanvasDimensions:function (canvas, wNative, hNative) { if (wNative && hNative) { canvas.widthNative = wNative; canvas.heightNative = hNative; } else { wNative = canvas.widthNative; hNative = canvas.heightNative; } var w = wNative; var h = hNative; if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { if (w/h < Module['forcedAspectRatio']) { w = Math.round(h * Module['forcedAspectRatio']); } else { h = Math.round(w / Module['forcedAspectRatio']); } } if (((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] || document['mozFullScreenElement'] || document['mozFullscreenElement'] || document['fullScreenElement'] || document['fullscreenElement'] || document['msFullScreenElement'] || document['msFullscreenElement'] || document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { var factor = Math.min(screen.width / w, screen.height / h); w = Math.round(w * factor); h = Math.round(h * factor); } if (Browser.resizeCanvas) { if (canvas.width != w) canvas.width = w; if (canvas.height != h) canvas.height = h; if (typeof canvas.style != 'undefined') { canvas.style.removeProperty( "width"); canvas.style.removeProperty("height"); } } else { if (canvas.width != wNative) canvas.width = wNative; if (canvas.height != hNative) canvas.height = hNative; if (typeof canvas.style != 'undefined') { if (w != wNative || h != hNative) { canvas.style.setProperty( "width", w + "px", "important"); canvas.style.setProperty("height", h + "px", "important"); } else { canvas.style.removeProperty( "width"); canvas.style.removeProperty("height"); } } } },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () { var handle = Browser.nextWgetRequestHandle; Browser.nextWgetRequestHandle++; return handle; }}; function _glGetAttribLocation(program, name) { program = GL.programs[program]; name = Pointer_stringify(name); return GLctx.getAttribLocation(program, name); } function _glfwWindowHint(target, hint) { GLFW.hints[target] = hint; } function _glAttachShader(program, shader) { GLctx.attachShader(GL.programs[program], GL.shaders[shader]); } function _glDeleteShader(id) { if (!id) return; var shader = GL.shaders[id]; if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } GLctx.deleteShader(shader); GL.shaders[id] = null; } function _glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) } function _glCreateProgram() { var id = GL.getNewId(GL.programs); var program = GLctx.createProgram(); program.name = id; GL.programs[id] = program; return id; } var _BDtoIHigh=true; function _glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) } function _time(ptr) { var ret = (Date.now()/1000)|0; if (ptr) { HEAP32[((ptr)>>2)]=ret; } return ret; } var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { if (path[0] !== '/') { // relative path var dir; if (dirfd === -100) { dir = FS.cwd(); } else { var dirstream = FS.getStream(dirfd); if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); dir = dirstream.path; } path = PATH.join2(dir, path); } return path; },doStat:function (func, path, buf) { try { var stat = func(path); } catch (e) { if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { // an error occurred while trying to look up the path; we should just report ENOTDIR return -ERRNO_CODES.ENOTDIR; } throw e; } HEAP32[((buf)>>2)]=stat.dev; HEAP32[(((buf)+(4))>>2)]=0; HEAP32[(((buf)+(8))>>2)]=stat.ino; HEAP32[(((buf)+(12))>>2)]=stat.mode; HEAP32[(((buf)+(16))>>2)]=stat.nlink; HEAP32[(((buf)+(20))>>2)]=stat.uid; HEAP32[(((buf)+(24))>>2)]=stat.gid; HEAP32[(((buf)+(28))>>2)]=stat.rdev; HEAP32[(((buf)+(32))>>2)]=0; HEAP32[(((buf)+(36))>>2)]=stat.size; HEAP32[(((buf)+(40))>>2)]=4096; HEAP32[(((buf)+(44))>>2)]=stat.blocks; HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; HEAP32[(((buf)+(52))>>2)]=0; HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; HEAP32[(((buf)+(60))>>2)]=0; HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; HEAP32[(((buf)+(68))>>2)]=0; HEAP32[(((buf)+(72))>>2)]=stat.ino; return 0; },doMsync:function (addr, stream, len, flags) { var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); FS.msync(stream, buffer, 0, len, flags); },doMkdir:function (path, mode) { // remove a trailing slash, if one - /a/b/ has basename of '', but // we want to create b in the context of this function path = PATH.normalize(path); if (path[path.length-1] === '/') path = path.substr(0, path.length-1); FS.mkdir(path, mode, 0); return 0; },doMknod:function (path, mode, dev) { // we don't want this in the JS API as it uses mknod to create all nodes. switch (mode & 61440) { case 32768: case 8192: case 24576: case 4096: case 49152: break; default: return -ERRNO_CODES.EINVAL; } FS.mknod(path, mode, dev); return 0; },doReadlink:function (path, buf, bufsize) { if (bufsize <= 0) return -ERRNO_CODES.EINVAL; var ret = FS.readlink(path); ret = ret.slice(0, Math.max(0, bufsize)); writeStringToMemory(ret, buf, true); return ret.length; },doAccess:function (path, amode) { if (amode & ~7) { // need a valid mode return -ERRNO_CODES.EINVAL; } var node; var lookup = FS.lookupPath(path, { follow: true }); node = lookup.node; var perms = ''; if (amode & 4) perms += 'r'; if (amode & 2) perms += 'w'; if (amode & 1) perms += 'x'; if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { return -ERRNO_CODES.EACCES; } return 0; },doDup:function (path, flags, suggestFD) { var suggest = FS.getStream(suggestFD); if (suggest) FS.close(suggest); return FS.open(path, flags, 0, suggestFD, suggestFD).fd; },doReadv:function (stream, iov, iovcnt, offset) { var ret = 0; for (var i = 0; i < iovcnt; i++) { var ptr = HEAP32[(((iov)+(i*8))>>2)]; var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; var curr = FS.read(stream, HEAP8,ptr, len, offset); if (curr < 0) return -1; ret += curr; if (curr < len) break; // nothing more to read } return ret; },doWritev:function (stream, iov, iovcnt, offset) { var ret = 0; for (var i = 0; i < iovcnt; i++) { var ptr = HEAP32[(((iov)+(i*8))>>2)]; var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; var curr = FS.write(stream, HEAP8,ptr, len, offset); if (curr < 0) return -1; ret += curr; } return ret; },varargs:0,get:function (varargs) { SYSCALLS.varargs += 4; var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; return ret; },getStr:function () { var ret = Pointer_stringify(SYSCALLS.get()); return ret; },getStreamFromFD:function () { var stream = FS.getStream(SYSCALLS.get()); if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); return stream; },getSocketFromFD:function () { var socket = SOCKFS.getSocket(SYSCALLS.get()); if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); return socket; },getSocketAddress:function (allowNull) { var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); if (allowNull && addrp === 0) return null; var info = __read_sockaddr(addrp, addrlen); if (info.errno) throw new FS.ErrnoError(info.errno); info.addr = DNS.lookup_addr(info.addr) || info.addr; return info; },get64:function () { var low = SYSCALLS.get(), high = SYSCALLS.get(); if (low >= 0) assert(high === 0); else assert(high === -1); return low; },getZero:function () { assert(SYSCALLS.get() === 0); }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; try { // ioctl var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); switch (op) { case 21505: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; return 0; } case 21506: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; return 0; // no-op, not actually adjusting terminal settings } case 21519: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; var argp = SYSCALLS.get(); HEAP32[((argp)>>2)]=0; return 0; } case 21520: { if (!stream.tty) return -ERRNO_CODES.ENOTTY; return -ERRNO_CODES.EINVAL; // not supported } case 21531: { var argp = SYSCALLS.get(); return FS.ioctl(stream, op, argp); } default: abort('bad ioctl syscall ' + op); } } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function _glDrawElements(mode, count, type, indices) { GLctx.drawElements(mode, count, type, indices); } function _glfwSetErrorCallback(cbfun) { GLFW.errorFunc = cbfun; } function _glfwTerminate() { window.removeEventListener("keydown", GLFW.onKeydown, true); window.removeEventListener("keypress", GLFW.onKeyPress, true); window.removeEventListener("keyup", GLFW.onKeyup, true); Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true); Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true); Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true); Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true); Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true); Module["canvas"].width = Module["canvas"].height = 1; GLFW.windows = null; GLFW.active = null; } function _glUniformMatrix4fv(location, count, transpose, value) { location = GL.uniforms[location]; var view; if (count === 1) { // avoid allocation for the common case of uploading one uniform matrix view = GL.miniTempBufferViews[15]; for (var i = 0; i < 16; i++) { view[i] = HEAPF32[(((value)+(i*4))>>2)]; } } else { view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); } GLctx.uniformMatrix4fv(location, transpose, view); } function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs; try { // close var stream = SYSCALLS.getStreamFromFD(); FS.close(stream); return 0; } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function _glBufferSubData(target, offset, size, data) { GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); } function _glActiveTexture(x0) { GLctx.activeTexture(x0) } function _glDeleteBuffers(n, buffers) { for (var i = 0; i < n; i++) { var id = HEAP32[(((buffers)+(i*4))>>2)]; var buffer = GL.buffers[id]; // From spec: "glDeleteBuffers silently ignores 0's and names that do not // correspond to existing buffer objects." if (!buffer) continue; GLctx.deleteBuffer(buffer); buffer.name = 0; GL.buffers[id] = null; if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; } } function _glScissor(x0, x1, x2, x3) { GLctx.scissor(x0, x1, x2, x3) } function _glfwGetKey(winid, key) { return GLFW.getKey(winid, key); } function _glfwGetClipboardString(win) {} function _glGetShaderiv(shader, pname, p) { if (!p) { // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense // if p == null, issue a GL error to notify user about it. GL.recordError(0x0501 /* GL_INVALID_VALUE */); return; } if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH var log = GLctx.getShaderInfoLog(GL.shaders[shader]); if (log === null) log = '(unknown error)'; HEAP32[((p)>>2)]=log.length + 1; } else { HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); } } function _pthread_self() { //FIXME: assumes only a single thread return 0; } function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs; try { // llseek var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); var offset = offset_low; assert(offset_high === 0); FS.llseek(stream, offset, whence); HEAP32[((result)>>2)]=stream.position; if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state return 0; } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs; try { // writev var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); return SYSCALLS.doWritev(stream, iov, iovcnt); } catch (e) { if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); return -e.errno; } } var GLctx; GL.init() Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) }; Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) } FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink; __ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() }); if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); } STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP); staticSealed = true; // seal the static portion of memory STACK_MAX = STACK_BASE + TOTAL_STACK; DYNAMIC_BASE = DYNAMICTOP = Runtime.alignMemory(STACK_MAX); assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack"); var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_DYNAMIC); function nullFunc_iiii(x) { Module["printErr"]("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_vi(x) { Module["printErr"]("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_vii(x) { Module["printErr"]("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_vidd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_ii(x) { Module["printErr"]("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_didii(x) { Module["printErr"]("Invalid function pointer called with signature 'didii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_viii(x) { Module["printErr"]("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_v(x) { Module["printErr"]("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_iii(x) { Module["printErr"]("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function nullFunc_vidiii(x) { Module["printErr"]("Invalid function pointer called with signature 'vidiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) } function invoke_iiii(index,a1,a2,a3) { try { return Module["dynCall_iiii"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vi(index,a1) { try { Module["dynCall_vi"](index,a1); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vii(index,a1,a2) { try { Module["dynCall_vii"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vidd(index,a1,a2,a3) { try { Module["dynCall_vidd"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_ii(index,a1) { try { return Module["dynCall_ii"](index,a1); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_didii(index,a1,a2,a3,a4) { try { return Module["dynCall_didii"](index,a1,a2,a3,a4); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_viii(index,a1,a2,a3) { try { Module["dynCall_viii"](index,a1,a2,a3); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_v(index) { try { Module["dynCall_v"](index); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_iii(index,a1,a2) { try { return Module["dynCall_iii"](index,a1,a2); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } function invoke_vidiii(index,a1,a2,a3,a4,a5) { try { Module["dynCall_vidiii"](index,a1,a2,a3,a4,a5); } catch(e) { if (typeof e !== 'number' && e !== 'longjmp') throw e; asm["setThrew"](1, 0); } } Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity }; Module.asmLibraryArg = { "abort": abort, "assert": assert, "nullFunc_iiii": nullFunc_iiii, "nullFunc_vi": nullFunc_vi, "nullFunc_vii": nullFunc_vii, "nullFunc_vidd": nullFunc_vidd, "nullFunc_ii": nullFunc_ii, "nullFunc_didii": nullFunc_didii, "nullFunc_viii": nullFunc_viii, "nullFunc_v": nullFunc_v, "nullFunc_iii": nullFunc_iii, "nullFunc_vidiii": nullFunc_vidiii, "invoke_iiii": invoke_iiii, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_vidd": invoke_vidd, "invoke_ii": invoke_ii, "invoke_didii": invoke_didii, "invoke_viii": invoke_viii, "invoke_v": invoke_v, "invoke_iii": invoke_iii, "invoke_vidiii": invoke_vidiii, "_glUseProgram": _glUseProgram, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_glDeleteShader": _glDeleteShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_glfwCreateWindow": _glfwCreateWindow, "_glShaderSource": _glShaderSource, "_glGetProgramiv": _glGetProgramiv, "_glLinkProgram": _glLinkProgram, "_glfwPollEvents": _glfwPollEvents, "_glfwSetClipboardString": _glfwSetClipboardString, "_glScissor": _glScissor, "_glGetUniformLocation": _glGetUniformLocation, "_glUniformMatrix4fv": _glUniformMatrix4fv, "___unlock": ___unlock, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_glfwGetClipboardString": _glfwGetClipboardString, "_glfwGetWindowSize": _glfwGetWindowSize, "_glfwSetInputMode": _glfwSetInputMode, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_glBlendEquation": _glBlendEquation, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_glBindBuffer": _glBindBuffer, "_glCreateProgram": _glCreateProgram, "_glfwGetFramebufferSize": _glfwGetFramebufferSize, "_glViewport": _glViewport, "_glBindTexture": _glBindTexture, "_glGetShaderiv": _glGetShaderiv, "_glClearColor": _glClearColor, "_sbrk": _sbrk, "_glBlendFunc": _glBlendFunc, "_glDeleteTextures": _glDeleteTextures, "_glGetAttribLocation": _glGetAttribLocation, "_glClear": _glClear, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_glfwSetCharCallback": _glfwSetCharCallback, "_emscripten_cancel_main_loop": _emscripten_cancel_main_loop, "_sysconf": _sysconf, "_glfwSetScrollCallback": _glfwSetScrollCallback, "___setErrNo": ___setErrNo, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_glfwSetCursorPos": _glfwSetCursorPos, "_glfwGetKey": _glfwGetKey, "_pthread_self": _pthread_self, "_glfwGetMouseButton": _glfwGetMouseButton, "_glEnable": _glEnable, "_abort": _abort, "_glGenTextures": _glGenTextures, "_glDrawElements": _glDrawElements, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "___syscall54": ___syscall54, "_glfwInit": _glfwInit, "_glActiveTexture": _glActiveTexture, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_get_now": _emscripten_get_now, "_glfwWindowHint": _glfwWindowHint, "_glGenBuffers": _glGenBuffers, "_glAttachShader": _glAttachShader, "_glfwTerminate": _glfwTerminate, "_glBufferSubData": _glBufferSubData, "_glCompileShader": _glCompileShader, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "___lock": ___lock, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "___syscall6": ___syscall6, "_pthread_cleanup_push": _pthread_cleanup_push, "_glTexParameteri": _glTexParameteri, "_glDisable": _glDisable, "_time": _time, "_glDetachShader": _glDetachShader, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glfwGetCursorPos": _glfwGetCursorPos, "_glTexImage2D": _glTexImage2D, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glCreateShader": _glCreateShader, "___syscall146": ___syscall146, "_emscripten_asm_const_0": _emscripten_asm_const_0, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "cttz_i8": cttz_i8 }; // EMSCRIPTEN_START_ASM var asm = (function(global, env, buffer) { 'almost asm'; var HEAP8 = new global.Int8Array(buffer); var HEAP16 = new global.Int16Array(buffer); var HEAP32 = new global.Int32Array(buffer); var HEAPU8 = new global.Uint8Array(buffer); var HEAPU16 = new global.Uint16Array(buffer); var HEAPU32 = new global.Uint32Array(buffer); var HEAPF32 = new global.Float32Array(buffer); var HEAPF64 = new global.Float64Array(buffer); var STACKTOP=env.STACKTOP|0; var STACK_MAX=env.STACK_MAX|0; var tempDoublePtr=env.tempDoublePtr|0; var ABORT=env.ABORT|0; var cttz_i8=env.cttz_i8|0; var __THREW__ = 0; var threwValue = 0; var setjmpId = 0; var undef = 0; var nan = global.NaN, inf = global.Infinity; var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0; var tempRet0 = 0; var tempRet1 = 0; var tempRet2 = 0; var tempRet3 = 0; var tempRet4 = 0; var tempRet5 = 0; var tempRet6 = 0; var tempRet7 = 0; var tempRet8 = 0; var tempRet9 = 0; var Math_floor=global.Math.floor; var Math_abs=global.Math.abs; var Math_sqrt=global.Math.sqrt; var Math_pow=global.Math.pow; var Math_cos=global.Math.cos; var Math_sin=global.Math.sin; var Math_tan=global.Math.tan; var Math_acos=global.Math.acos; var Math_asin=global.Math.asin; var Math_atan=global.Math.atan; var Math_atan2=global.Math.atan2; var Math_exp=global.Math.exp; var Math_log=global.Math.log; var Math_ceil=global.Math.ceil; var Math_imul=global.Math.imul; var Math_min=global.Math.min; var Math_clz32=global.Math.clz32; var abort=env.abort; var assert=env.assert; var nullFunc_iiii=env.nullFunc_iiii; var nullFunc_vi=env.nullFunc_vi; var nullFunc_vii=env.nullFunc_vii; var nullFunc_vidd=env.nullFunc_vidd; var nullFunc_ii=env.nullFunc_ii; var nullFunc_didii=env.nullFunc_didii; var nullFunc_viii=env.nullFunc_viii; var nullFunc_v=env.nullFunc_v; var nullFunc_iii=env.nullFunc_iii; var nullFunc_vidiii=env.nullFunc_vidiii; var invoke_iiii=env.invoke_iiii; var invoke_vi=env.invoke_vi; var invoke_vii=env.invoke_vii; var invoke_vidd=env.invoke_vidd; var invoke_ii=env.invoke_ii; var invoke_didii=env.invoke_didii; var invoke_viii=env.invoke_viii; var invoke_v=env.invoke_v; var invoke_iii=env.invoke_iii; var invoke_vidiii=env.invoke_vidiii; var _glUseProgram=env._glUseProgram; var _pthread_cleanup_pop=env._pthread_cleanup_pop; var _glDeleteShader=env._glDeleteShader; var _glVertexAttribPointer=env._glVertexAttribPointer; var _glfwCreateWindow=env._glfwCreateWindow; var _glShaderSource=env._glShaderSource; var _glGetProgramiv=env._glGetProgramiv; var _glLinkProgram=env._glLinkProgram; var _glfwPollEvents=env._glfwPollEvents; var _glfwSetClipboardString=env._glfwSetClipboardString; var _glScissor=env._glScissor; var _glGetUniformLocation=env._glGetUniformLocation; var _glUniformMatrix4fv=env._glUniformMatrix4fv; var ___unlock=env.___unlock; var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing; var _glfwGetClipboardString=env._glfwGetClipboardString; var _glfwGetWindowSize=env._glfwGetWindowSize; var _glfwSetInputMode=env._glfwSetInputMode; var ___assert_fail=env.___assert_fail; var _glDeleteProgram=env._glDeleteProgram; var _glBlendEquation=env._glBlendEquation; var _glfwMakeContextCurrent=env._glfwMakeContextCurrent; var _glBindBuffer=env._glBindBuffer; var _glCreateProgram=env._glCreateProgram; var _glfwGetFramebufferSize=env._glfwGetFramebufferSize; var _glViewport=env._glViewport; var _glBindTexture=env._glBindTexture; var _glGetShaderiv=env._glGetShaderiv; var _glClearColor=env._glClearColor; var _sbrk=env._sbrk; var _glBlendFunc=env._glBlendFunc; var _glDeleteTextures=env._glDeleteTextures; var _glGetAttribLocation=env._glGetAttribLocation; var _glClear=env._glClear; var _emscripten_memcpy_big=env._emscripten_memcpy_big; var _glfwSetCharCallback=env._glfwSetCharCallback; var _emscripten_cancel_main_loop=env._emscripten_cancel_main_loop; var _sysconf=env._sysconf; var _glfwSetScrollCallback=env._glfwSetScrollCallback; var ___setErrNo=env.___setErrNo; var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize; var _glfwSetCursorPos=env._glfwSetCursorPos; var _glfwGetKey=env._glfwGetKey; var _pthread_self=env._pthread_self; var _glfwGetMouseButton=env._glfwGetMouseButton; var _glEnable=env._glEnable; var _abort=env._abort; var _glGenTextures=env._glGenTextures; var _glDrawElements=env._glDrawElements; var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback; var ___syscall54=env.___syscall54; var _glfwInit=env._glfwInit; var _glActiveTexture=env._glActiveTexture; var _glfwSwapBuffers=env._glfwSwapBuffers; var _emscripten_set_main_loop=env._emscripten_set_main_loop; var _emscripten_get_now=env._emscripten_get_now; var _glfwWindowHint=env._glfwWindowHint; var _glGenBuffers=env._glGenBuffers; var _glAttachShader=env._glAttachShader; var _glfwTerminate=env._glfwTerminate; var _glBufferSubData=env._glBufferSubData; var _glCompileShader=env._glCompileShader; var _glUniform1i=env._glUniform1i; var _glEnableVertexAttribArray=env._glEnableVertexAttribArray; var ___lock=env.___lock; var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData; var ___syscall6=env.___syscall6; var _pthread_cleanup_push=env._pthread_cleanup_push; var _glTexParameteri=env._glTexParameteri; var _glDisable=env._glDisable; var _time=env._time; var _glDetachShader=env._glDetachShader; var _glDeleteBuffers=env._glDeleteBuffers; var _glBufferData=env._glBufferData; var _glfwGetCursorPos=env._glfwGetCursorPos; var _glTexImage2D=env._glTexImage2D; var ___syscall140=env.___syscall140; var _glfwSetErrorCallback=env._glfwSetErrorCallback; var _glCreateShader=env._glCreateShader; var ___syscall146=env.___syscall146; var _emscripten_asm_const_0=env._emscripten_asm_const_0; var tempFloat = 0.0; // EMSCRIPTEN_START_FUNCS function stackAlloc(size) { size = size|0; var ret = 0; ret = STACKTOP; STACKTOP = (STACKTOP + size)|0; STACKTOP = (STACKTOP + 15)&-16; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); return ret|0; } function stackSave() { return STACKTOP|0; } function stackRestore(top) { top = top|0; STACKTOP = top; } function establishStackSpace(stackBase, stackMax) { stackBase = stackBase|0; stackMax = stackMax|0; STACKTOP = stackBase; STACK_MAX = stackMax; } function setThrew(threw, value) { threw = threw|0; value = value|0; if ((__THREW__|0) == 0) { __THREW__ = threw; threwValue = value; } } function copyTempFloat(ptr) { ptr = ptr|0; HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0]; HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0]; HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0]; HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0]; } function copyTempDouble(ptr) { ptr = ptr|0; HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0]; HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0]; HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0]; HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0]; HEAP8[tempDoublePtr+4>>0] = HEAP8[ptr+4>>0]; HEAP8[tempDoublePtr+5>>0] = HEAP8[ptr+5>>0]; HEAP8[tempDoublePtr+6>>0] = HEAP8[ptr+6>>0]; HEAP8[tempDoublePtr+7>>0] = HEAP8[ptr+7>>0]; } function setTempRet0(value) { value = value|0; tempRet0 = value; } function getTempRet0() { return tempRet0|0; } function _nk_rect($agg$result,$x,$y,$w,$h) { $agg$result = $agg$result|0; $x = +$x; $y = +$y; $w = +$w; $h = +$h; var $0 = 0.0, $1 = 0.0, $10 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, $r = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $r = sp; $0 = $x; $1 = $y; $2 = $w; $3 = $h; $4 = $0; HEAPF32[$r>>2] = $4; $5 = $1; $6 = ((($r)) + 4|0); HEAPF32[$6>>2] = $5; $7 = $2; $8 = ((($r)) + 8|0); HEAPF32[$8>>2] = $7; $9 = $3; $10 = ((($r)) + 12|0); HEAPF32[$10>>2] = $9; ;HEAP32[$agg$result>>2]=HEAP32[$r>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$r+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$r+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$r+12>>2]|0; STACKTOP = sp;return; } function _nk_rect_size($agg$result,$r) { $agg$result = $agg$result|0; $r = $r|0; var $0 = 0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ret = sp; $0 = ((($r)) + 8|0); $1 = +HEAPF32[$0>>2]; HEAPF32[$ret>>2] = $1; $2 = ((($r)) + 12|0); $3 = +HEAPF32[$2>>2]; $4 = ((($ret)) + 4|0); HEAPF32[$4>>2] = $3; ;HEAP32[$agg$result>>2]=HEAP32[$ret>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$ret+4>>2]|0; STACKTOP = sp;return; } function _nk_vec2($agg$result,$x,$y) { $agg$result = $agg$result|0; $x = +$x; $y = +$y; var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ret = sp; $0 = $x; $1 = $y; $2 = $0; HEAPF32[$ret>>2] = $2; $3 = $1; $4 = ((($ret)) + 4|0); HEAPF32[$4>>2] = $3; ;HEAP32[$agg$result>>2]=HEAP32[$ret>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$ret+4>>2]|0; STACKTOP = sp;return; } function _nk_strlen($str) { $str = $str|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $siz = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $str; $siz = 0; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13396|0),(13400|0),2885,(13418|0)); // unreachable; } while(1) { $3 = $0; $4 = ($3|0)!=(0|0); if ($4) { $5 = $0; $6 = ((($5)) + 1|0); $0 = $6; $7 = HEAP8[$5>>0]|0; $8 = $7 << 24 >> 24; $9 = ($8|0)!=(0); $12 = $9; } else { $12 = 0; } $10 = $siz; if (!($12)) { break; } $11 = (($10) + 1)|0; $siz = $11; } STACKTOP = sp;return ($10|0); } function _nk_strtof($number,$buffer) { $number = $number|0; $buffer = $buffer|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0, $124 = 0, $125 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $div = 0, $floatvalue = 0.0, $i = 0, $m = 0.0, $neg = 0.0, $or$cond = 0, $p = 0, $pow = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $number; $2 = $buffer; $neg = 1.0; $3 = $2; $p = $3; $floatvalue = 0.0; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13428|0),(13400|0),2898,(13435|0)); // unreachable; } $6 = $2; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((13445|0),(13400|0),2899,(13435|0)); // unreachable; } $8 = $1; $9 = ($8|0)!=(0|0); $10 = $2; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; if (!($or$cond)) { $0 = 0; $124 = $0; STACKTOP = sp;return ($124|0); } $12 = $1; HEAPF32[$12>>2] = 0.0; while(1) { $13 = $p; $14 = HEAP8[$13>>0]|0; $15 = $14 << 24 >> 24; $16 = ($15|0)!=(0); if ($16) { $17 = $p; $18 = HEAP8[$17>>0]|0; $19 = $18 << 24 >> 24; $20 = ($19|0)==(32); $125 = $20; } else { $125 = 0; } $21 = $p; if (!($125)) { break; } $22 = ((($21)) + 1|0); $p = $22; } $23 = HEAP8[$21>>0]|0; $24 = $23 << 24 >> 24; $25 = ($24|0)==(45); if ($25) { $neg = -1.0; $26 = $p; $27 = ((($26)) + 1|0); $p = $27; } while(1) { $28 = $p; $29 = HEAP8[$28>>0]|0; $30 = $29 << 24 >> 24; $31 = ($30|0)!=(0); if (!($31)) { break; } $32 = $p; $33 = HEAP8[$32>>0]|0; $34 = $33 << 24 >> 24; $35 = ($34|0)!=(46); if (!($35)) { break; } $36 = $p; $37 = HEAP8[$36>>0]|0; $38 = $37 << 24 >> 24; $39 = ($38|0)!=(101); if (!($39)) { break; } $40 = $floatvalue; $41 = $40 * 10.0; $42 = $p; $43 = HEAP8[$42>>0]|0; $44 = $43 << 24 >> 24; $45 = (($44) - 48)|0; $46 = (+($45|0)); $47 = $41 + $46; $floatvalue = $47; $48 = $p; $49 = ((($48)) + 1|0); $p = $49; } $50 = $p; $51 = HEAP8[$50>>0]|0; $52 = $51 << 24 >> 24; $53 = ($52|0)==(46); L26: do { if ($53) { $54 = $p; $55 = ((($54)) + 1|0); $p = $55; $m = 0.10000000149011612; while(1) { $56 = $p; $57 = HEAP8[$56>>0]|0; $58 = $57 << 24 >> 24; $59 = ($58|0)!=(0); if (!($59)) { break L26; } $60 = $p; $61 = HEAP8[$60>>0]|0; $62 = $61 << 24 >> 24; $63 = ($62|0)!=(101); if (!($63)) { break L26; } $64 = $floatvalue; $65 = $p; $66 = HEAP8[$65>>0]|0; $67 = $66 << 24 >> 24; $68 = (($67) - 48)|0; $69 = (+($68|0)); $70 = $m; $71 = $69 * $70; $72 = $64 + $71; $floatvalue = $72; $73 = $m; $74 = $73 * 0.10000000149011612; $m = $74; $75 = $p; $76 = ((($75)) + 1|0); $p = $76; } } } while(0); $77 = $p; $78 = HEAP8[$77>>0]|0; $79 = $78 << 24 >> 24; $80 = ($79|0)==(101); do { if ($80) { $81 = $p; $82 = ((($81)) + 1|0); $p = $82; $83 = $p; $84 = HEAP8[$83>>0]|0; $85 = $84 << 24 >> 24; $86 = ($85|0)==(45); if ($86) { $div = 1; $87 = $p; $88 = ((($87)) + 1|0); $p = $88; } else { $89 = $p; $90 = HEAP8[$89>>0]|0; $91 = $90 << 24 >> 24; $92 = ($91|0)==(43); $div = 0; if ($92) { $93 = $p; $94 = ((($93)) + 1|0); $p = $94; } } $pow = 0; while(1) { $95 = $p; $96 = HEAP8[$95>>0]|0; $97 = ($96<<24>>24)!=(0); if (!($97)) { break; } $98 = $pow; $99 = ($98*10)|0; $100 = $p; $101 = HEAP8[$100>>0]|0; $102 = $101 << 24 >> 24; $103 = (($102) - 48)|0; $104 = (($99) + ($103))|0; $pow = $104; $105 = $p; $106 = ((($105)) + 1|0); $p = $106; } $m = 1.0; $i = 0; while(1) { $107 = $i; $108 = $pow; $109 = ($107|0)<($108|0); if (!($109)) { break; } $110 = $m; $111 = $110 * 10.0; $m = $111; $112 = $i; $113 = (($112) + 1)|0; $i = $113; } $114 = $div; $115 = ($114|0)!=(0); $116 = $m; $117 = $floatvalue; if ($115) { $118 = $117 / $116; $floatvalue = $118; break; } else { $119 = $117 * $116; $floatvalue = $119; break; } } } while(0); $120 = $floatvalue; $121 = $neg; $122 = $120 * $121; $123 = $1; HEAPF32[$123>>2] = $122; $0 = 1; $124 = $0; STACKTOP = sp;return ($124|0); } function _nk_murmur_hash($key,$len,$seed) { $key = $key|0; $len = $len|0; $seed = $seed|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; var $97 = 0, $98 = 0, $99 = 0, $blocks = 0, $c1 = 0, $c2 = 0, $conv = 0, $data = 0, $h1 = 0, $i = 0, $k1 = 0, $nblocks = 0, $tail = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $conv = sp + 36|0; $1 = $key; $2 = $len; $3 = $seed; ;HEAP32[$conv>>2]=0|0; $4 = $1; $data = $4; $5 = $2; $6 = (($5|0) / 4)&-1; $nblocks = $6; $7 = $3; $h1 = $7; $c1 = -862048943; $c2 = 461845907; $8 = $1; $9 = ($8|0)!=(0|0); if (!($9)) { $0 = 0; $102 = $0; STACKTOP = sp;return ($102|0); } $10 = $data; $11 = $nblocks; $12 = $11<<2; $13 = (($10) + ($12)|0); HEAP32[$conv>>2] = $13; $14 = HEAP32[$conv>>2]|0; $blocks = $14; $15 = $nblocks; $16 = (0 - ($15))|0; $i = $16; while(1) { $17 = $i; $18 = ($17|0)!=(0); if (!($18)) { break; } $19 = $i; $20 = $blocks; $21 = (($20) + ($19<<2)|0); $22 = HEAP32[$21>>2]|0; $k1 = $22; $23 = $k1; $24 = Math_imul($23, -862048943)|0; $k1 = $24; $25 = $k1; $26 = $25 << 15; $27 = $k1; $28 = $27 >>> 17; $29 = $26 | $28; $k1 = $29; $30 = $k1; $31 = Math_imul($30, 461845907)|0; $k1 = $31; $32 = $k1; $33 = $h1; $34 = $33 ^ $32; $h1 = $34; $35 = $h1; $36 = $35 << 13; $37 = $h1; $38 = $37 >>> 19; $39 = $36 | $38; $h1 = $39; $40 = $h1; $41 = ($40*5)|0; $42 = (($41) + -430675100)|0; $h1 = $42; $43 = $i; $44 = (($43) + 1)|0; $i = $44; } $45 = $data; $46 = $nblocks; $47 = $46<<2; $48 = (($45) + ($47)|0); $tail = $48; $k1 = 0; $49 = $2; $50 = $49 & 3; switch ($50|0) { case 3: { $51 = $tail; $52 = ((($51)) + 2|0); $53 = HEAP8[$52>>0]|0; $54 = $53&255; $55 = $54 << 16; $56 = $k1; $57 = $56 ^ $55; $k1 = $57; label = 8; break; } case 2: { label = 8; break; } case 1: { label = 9; break; } default: { } } if ((label|0) == 8) { $58 = $tail; $59 = ((($58)) + 1|0); $60 = HEAP8[$59>>0]|0; $61 = $60&255; $62 = $61 << 8; $63 = $k1; $64 = $63 ^ $62; $k1 = $64; label = 9; } if ((label|0) == 9) { $65 = $tail; $66 = HEAP8[$65>>0]|0; $67 = $66&255; $68 = $k1; $69 = $68 ^ $67; $k1 = $69; $70 = $k1; $71 = Math_imul($70, -862048943)|0; $k1 = $71; $72 = $k1; $73 = $72 << 15; $74 = $k1; $75 = $74 >>> 17; $76 = $73 | $75; $k1 = $76; $77 = $k1; $78 = Math_imul($77, 461845907)|0; $k1 = $78; $79 = $k1; $80 = $h1; $81 = $80 ^ $79; $h1 = $81; } $82 = $2; $83 = $h1; $84 = $83 ^ $82; $h1 = $84; $85 = $h1; $86 = $85 >>> 16; $87 = $h1; $88 = $87 ^ $86; $h1 = $88; $89 = $h1; $90 = Math_imul($89, -2048144789)|0; $h1 = $90; $91 = $h1; $92 = $91 >>> 13; $93 = $h1; $94 = $93 ^ $92; $h1 = $94; $95 = $h1; $96 = Math_imul($95, -1028477387)|0; $h1 = $96; $97 = $h1; $98 = $97 >>> 16; $99 = $h1; $100 = $99 ^ $98; $h1 = $100; $101 = $h1; $0 = $101; $102 = $0; STACKTOP = sp;return ($102|0); } function _nk_rgba($agg$result,$r,$g,$b,$a) { $agg$result = $agg$result|0; $r = $r|0; $g = $g|0; $b = $b|0; $a = $a|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ret = sp + 16|0; $0 = $r; $1 = $g; $2 = $b; $3 = $a; $4 = $0; $5 = ($4|0)<(255); $6 = $0; $7 = $5 ? $6 : 255; $8 = ($7|0)<(0); if ($8) { $14 = 0; } else { $9 = $0; $10 = ($9|0)<(255); $11 = $0; $12 = $10 ? $11 : 255; $14 = $12; } $13 = $14&255; HEAP8[$ret>>0] = $13; $15 = $1; $16 = ($15|0)<(255); $17 = $1; $18 = $16 ? $17 : 255; $19 = ($18|0)<(0); if ($19) { $25 = 0; } else { $20 = $1; $21 = ($20|0)<(255); $22 = $1; $23 = $21 ? $22 : 255; $25 = $23; } $24 = $25&255; $26 = ((($ret)) + 1|0); HEAP8[$26>>0] = $24; $27 = $2; $28 = ($27|0)<(255); $29 = $2; $30 = $28 ? $29 : 255; $31 = ($30|0)<(0); if ($31) { $37 = 0; } else { $32 = $2; $33 = ($32|0)<(255); $34 = $2; $35 = $33 ? $34 : 255; $37 = $35; } $36 = $37&255; $38 = ((($ret)) + 2|0); HEAP8[$38>>0] = $36; $39 = $3; $40 = ($39|0)<(255); $41 = $3; $42 = $40 ? $41 : 255; $43 = ($42|0)<(0); if ($43) { $49 = 0; } else { $44 = $3; $45 = ($44|0)<(255); $46 = $3; $47 = $45 ? $46 : 255; $49 = $47; } $48 = $49&255; $50 = ((($ret)) + 3|0); HEAP8[$50>>0] = $48; ;HEAP8[$agg$result>>0]=HEAP8[$ret>>0]|0;HEAP8[$agg$result+1>>0]=HEAP8[$ret+1>>0]|0;HEAP8[$agg$result+2>>0]=HEAP8[$ret+2>>0]|0;HEAP8[$agg$result+3>>0]=HEAP8[$ret+3>>0]|0; STACKTOP = sp;return; } function _nk_rgb($agg$result,$r,$g,$b) { $agg$result = $agg$result|0; $r = $r|0; $g = $g|0; $b = $b|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ret = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ret = sp + 12|0; $0 = $r; $1 = $g; $2 = $b; $3 = $0; $4 = ($3|0)<(255); $5 = $0; $6 = $4 ? $5 : 255; $7 = ($6|0)<(0); if ($7) { $13 = 0; } else { $8 = $0; $9 = ($8|0)<(255); $10 = $0; $11 = $9 ? $10 : 255; $13 = $11; } $12 = $13&255; HEAP8[$ret>>0] = $12; $14 = $1; $15 = ($14|0)<(255); $16 = $1; $17 = $15 ? $16 : 255; $18 = ($17|0)<(0); if ($18) { $24 = 0; } else { $19 = $1; $20 = ($19|0)<(255); $21 = $1; $22 = $20 ? $21 : 255; $24 = $22; } $23 = $24&255; $25 = ((($ret)) + 1|0); HEAP8[$25>>0] = $23; $26 = $2; $27 = ($26|0)<(255); $28 = $2; $29 = $27 ? $28 : 255; $30 = ($29|0)<(0); if ($30) { $36 = 0; } else { $31 = $2; $32 = ($31|0)<(255); $33 = $2; $34 = $32 ? $33 : 255; $36 = $34; } $35 = $36&255; $37 = ((($ret)) + 2|0); HEAP8[$37>>0] = $35; $38 = ((($ret)) + 3|0); HEAP8[$38>>0] = -1; ;HEAP8[$agg$result>>0]=HEAP8[$ret>>0]|0;HEAP8[$agg$result+1>>0]=HEAP8[$ret+1>>0]|0;HEAP8[$agg$result+2>>0]=HEAP8[$ret+2>>0]|0;HEAP8[$agg$result+3>>0]=HEAP8[$ret+3>>0]|0; STACKTOP = sp;return; } function _nk_rgba_f($agg$result,$r,$g,$b,$a) { $agg$result = $agg$result|0; $r = +$r; $g = +$g; $b = +$b; $a = +$a; var $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0, $28 = 0, $29 = 0.0, $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0; var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ret = sp + 16|0; $0 = $r; $1 = $g; $2 = $b; $3 = $a; $4 = $0; $5 = 1.0 < $4; $6 = $0; $7 = $5 ? 1.0 : $6; $8 = 0.0 < $7; if ($8) { $9 = $0; $10 = 1.0 < $9; $11 = $0; $12 = $10 ? 1.0 : $11; $14 = $12; } else { $14 = 0.0; } $13 = $14 * 255.0; $15 = (~~(($13))&255); HEAP8[$ret>>0] = $15; $16 = $1; $17 = 1.0 < $16; $18 = $1; $19 = $17 ? 1.0 : $18; $20 = 0.0 < $19; if ($20) { $21 = $1; $22 = 1.0 < $21; $23 = $1; $24 = $22 ? 1.0 : $23; $26 = $24; } else { $26 = 0.0; } $25 = $26 * 255.0; $27 = (~~(($25))&255); $28 = ((($ret)) + 1|0); HEAP8[$28>>0] = $27; $29 = $2; $30 = 1.0 < $29; $31 = $2; $32 = $30 ? 1.0 : $31; $33 = 0.0 < $32; if ($33) { $34 = $2; $35 = 1.0 < $34; $36 = $2; $37 = $35 ? 1.0 : $36; $39 = $37; } else { $39 = 0.0; } $38 = $39 * 255.0; $40 = (~~(($38))&255); $41 = ((($ret)) + 2|0); HEAP8[$41>>0] = $40; $42 = $3; $43 = 1.0 < $42; $44 = $3; $45 = $43 ? 1.0 : $44; $46 = 0.0 < $45; if ($46) { $47 = $3; $48 = 1.0 < $47; $49 = $3; $50 = $48 ? 1.0 : $49; $52 = $50; } else { $52 = 0.0; } $51 = $52 * 255.0; $53 = (~~(($51))&255); $54 = ((($ret)) + 3|0); HEAP8[$54>>0] = $53; ;HEAP8[$agg$result>>0]=HEAP8[$ret>>0]|0;HEAP8[$agg$result+1>>0]=HEAP8[$ret+1>>0]|0;HEAP8[$agg$result+2>>0]=HEAP8[$ret+2>>0]|0;HEAP8[$agg$result+3>>0]=HEAP8[$ret+3>>0]|0; STACKTOP = sp;return; } function _nk_rgb_f($agg$result,$r,$g,$b) { $agg$result = $agg$result|0; $r = +$r; $g = +$g; $b = +$b; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0; var $27 = 0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0.0, $6 = 0.0, $7 = 0; var $8 = 0.0, $9 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ret = sp + 12|0; $0 = $r; $1 = $g; $2 = $b; $3 = $0; $4 = 1.0 < $3; $5 = $0; $6 = $4 ? 1.0 : $5; $7 = 0.0 < $6; if ($7) { $8 = $0; $9 = 1.0 < $8; $10 = $0; $11 = $9 ? 1.0 : $10; $13 = $11; } else { $13 = 0.0; } $12 = $13 * 255.0; $14 = (~~(($12))&255); HEAP8[$ret>>0] = $14; $15 = $1; $16 = 1.0 < $15; $17 = $1; $18 = $16 ? 1.0 : $17; $19 = 0.0 < $18; if ($19) { $20 = $1; $21 = 1.0 < $20; $22 = $1; $23 = $21 ? 1.0 : $22; $25 = $23; } else { $25 = 0.0; } $24 = $25 * 255.0; $26 = (~~(($24))&255); $27 = ((($ret)) + 1|0); HEAP8[$27>>0] = $26; $28 = $2; $29 = 1.0 < $28; $30 = $2; $31 = $29 ? 1.0 : $30; $32 = 0.0 < $31; if ($32) { $33 = $2; $34 = 1.0 < $33; $35 = $2; $36 = $34 ? 1.0 : $35; $38 = $36; } else { $38 = 0.0; } $37 = $38 * 255.0; $39 = (~~(($37))&255); $40 = ((($ret)) + 2|0); HEAP8[$40>>0] = $39; $41 = ((($ret)) + 3|0); HEAP8[$41>>0] = -1; ;HEAP8[$agg$result>>0]=HEAP8[$ret>>0]|0;HEAP8[$agg$result+1>>0]=HEAP8[$ret+1>>0]|0;HEAP8[$agg$result+2>>0]=HEAP8[$ret+2>>0]|0;HEAP8[$agg$result+3>>0]=HEAP8[$ret+3>>0]|0; STACKTOP = sp;return; } function _nk_hsv_f($agg$result,$h,$s,$v) { $agg$result = $agg$result|0; $h = +$h; $s = +$s; $v = +$v; var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $h; $1 = $s; $2 = $v; $3 = $0; $4 = $1; $5 = $2; _nk_hsva_f($agg$result,$3,$4,$5,1.0); STACKTOP = sp;return; } function _nk_hsva_f($agg$result,$h,$s,$v,$a) { $agg$result = $agg$result|0; $h = +$h; $s = +$s; $v = +$v; $a = +$a; var $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0; var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0.0; var $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0, $72 = 0.0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $8 = 0, $9 = 0.0, $f = 0.0, $i = 0; var $out = 0, $p = 0.0, $q = 0.0, $t = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $out = sp + 20|0; $0 = $h; $1 = $s; $2 = $v; $3 = $a; ;HEAP32[$out>>2]=0|0;HEAP32[$out+4>>2]=0|0;HEAP32[$out+8>>2]=0|0; $4 = $1; $5 = $4 <= 0.0; if ($5) { $6 = $2; HEAPF32[$out>>2] = $6; $7 = $2; $8 = ((($out)) + 4|0); HEAPF32[$8>>2] = $7; $9 = $2; $10 = ((($out)) + 8|0); HEAPF32[$10>>2] = $9; $11 = +HEAPF32[$out>>2]; $12 = ((($out)) + 4|0); $13 = +HEAPF32[$12>>2]; $14 = ((($out)) + 8|0); $15 = +HEAPF32[$14>>2]; _nk_rgb_f($agg$result,$11,$13,$15); STACKTOP = sp;return; } $16 = $0; $17 = $16 / 0.1666666716337204; $0 = $17; $18 = $0; $19 = (~~(($18))); $i = $19; $20 = $0; $21 = $i; $22 = (+($21|0)); $23 = $20 - $22; $f = $23; $24 = $2; $25 = $1; $26 = 1.0 - $25; $27 = $24 * $26; $p = $27; $28 = $2; $29 = $1; $30 = $f; $31 = $29 * $30; $32 = 1.0 - $31; $33 = $28 * $32; $q = $33; $34 = $2; $35 = $1; $36 = $f; $37 = 1.0 - $36; $38 = $35 * $37; $39 = 1.0 - $38; $40 = $34 * $39; $t = $40; $41 = $i; switch ($41|0) { case 0: { $42 = $2; HEAPF32[$out>>2] = $42; $43 = $t; $44 = ((($out)) + 4|0); HEAPF32[$44>>2] = $43; $45 = $p; $46 = ((($out)) + 8|0); HEAPF32[$46>>2] = $45; break; } case 1: { $47 = $q; HEAPF32[$out>>2] = $47; $48 = $2; $49 = ((($out)) + 4|0); HEAPF32[$49>>2] = $48; $50 = $p; $51 = ((($out)) + 8|0); HEAPF32[$51>>2] = $50; break; } case 2: { $52 = $p; HEAPF32[$out>>2] = $52; $53 = $2; $54 = ((($out)) + 4|0); HEAPF32[$54>>2] = $53; $55 = $t; $56 = ((($out)) + 8|0); HEAPF32[$56>>2] = $55; break; } case 3: { $57 = $p; HEAPF32[$out>>2] = $57; $58 = $q; $59 = ((($out)) + 4|0); HEAPF32[$59>>2] = $58; $60 = $2; $61 = ((($out)) + 8|0); HEAPF32[$61>>2] = $60; break; } case 4: { $62 = $t; HEAPF32[$out>>2] = $62; $63 = $p; $64 = ((($out)) + 4|0); HEAPF32[$64>>2] = $63; $65 = $2; $66 = ((($out)) + 8|0); HEAPF32[$66>>2] = $65; break; } default: { $67 = $2; HEAPF32[$out>>2] = $67; $68 = $p; $69 = ((($out)) + 4|0); HEAPF32[$69>>2] = $68; $70 = $q; $71 = ((($out)) + 8|0); HEAPF32[$71>>2] = $70; } } $72 = +HEAPF32[$out>>2]; $73 = ((($out)) + 4|0); $74 = +HEAPF32[$73>>2]; $75 = ((($out)) + 8|0); $76 = +HEAPF32[$75>>2]; $77 = $3; _nk_rgba_f($agg$result,$72,$74,$76,$77); STACKTOP = sp;return; } function _nk_hsva_fv($agg$result,$c) { $agg$result = $agg$result|0; $c = $c|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $c; $1 = $0; $2 = +HEAPF32[$1>>2]; $3 = $0; $4 = ((($3)) + 4|0); $5 = +HEAPF32[$4>>2]; $6 = $0; $7 = ((($6)) + 8|0); $8 = +HEAPF32[$7>>2]; $9 = $0; $10 = ((($9)) + 12|0); $11 = +HEAPF32[$10>>2]; _nk_hsva_f($agg$result,$2,$5,$8,$11); STACKTOP = sp;return; } function _nk_color_u32($in) { $in = $in|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $out = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = HEAP8[$in>>0]|0; $1 = $0&255; $out = $1; $2 = ((($in)) + 1|0); $3 = HEAP8[$2>>0]|0; $4 = $3&255; $5 = $4 << 8; $6 = $out; $7 = $6 | $5; $out = $7; $8 = ((($in)) + 2|0); $9 = HEAP8[$8>>0]|0; $10 = $9&255; $11 = $10 << 16; $12 = $out; $13 = $12 | $11; $out = $13; $14 = ((($in)) + 3|0); $15 = HEAP8[$14>>0]|0; $16 = $15&255; $17 = $16 << 24; $18 = $out; $19 = $18 | $17; $out = $19; $20 = $out; STACKTOP = sp;return ($20|0); } function _nk_color_f($r,$g,$b,$a,$in) { $r = $r|0; $g = $g|0; $b = $b|0; $a = $a|0; $in = $in|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0.0; var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $r; $1 = $g; $2 = $b; $3 = $a; $4 = HEAP8[$in>>0]|0; $5 = (+($4&255)); $6 = $5 * 0.0039215688593685627; $7 = $0; HEAPF32[$7>>2] = $6; $8 = ((($in)) + 1|0); $9 = HEAP8[$8>>0]|0; $10 = (+($9&255)); $11 = $10 * 0.0039215688593685627; $12 = $1; HEAPF32[$12>>2] = $11; $13 = ((($in)) + 2|0); $14 = HEAP8[$13>>0]|0; $15 = (+($14&255)); $16 = $15 * 0.0039215688593685627; $17 = $2; HEAPF32[$17>>2] = $16; $18 = ((($in)) + 3|0); $19 = HEAP8[$18>>0]|0; $20 = (+($19&255)); $21 = $20 * 0.0039215688593685627; $22 = $3; HEAPF32[$22>>2] = $21; STACKTOP = sp;return; } function _nk_color_fv($c,$in) { $c = $c|0; $in = $in|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $in$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $in$byval_copy = sp + 4|0; $0 = $c; $1 = $0; $2 = $0; $3 = ((($2)) + 4|0); $4 = $0; $5 = ((($4)) + 8|0); $6 = $0; $7 = ((($6)) + 12|0); ;HEAP8[$in$byval_copy>>0]=HEAP8[$in>>0]|0;HEAP8[$in$byval_copy+1>>0]=HEAP8[$in+1>>0]|0;HEAP8[$in$byval_copy+2>>0]=HEAP8[$in+2>>0]|0;HEAP8[$in$byval_copy+3>>0]=HEAP8[$in+3>>0]|0; _nk_color_f($1,$3,$5,$7,$in$byval_copy); STACKTOP = sp;return; } function _nk_color_hsva_f($out_h,$out_s,$out_v,$out_a,$in) { $out_h = $out_h|0; $out_s = $out_s|0; $out_v = $out_v|0; $out_a = $out_a|0; $in = $in|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0; var $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0; var $K = 0.0, $a = 0, $b = 0, $chroma = 0.0, $g = 0, $in$byval_copy = 0, $r = 0, $t = 0.0, $t1 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $in$byval_copy = sp + 48|0; $r = sp + 20|0; $g = sp + 16|0; $b = sp + 12|0; $a = sp + 8|0; $0 = $out_h; $1 = $out_s; $2 = $out_v; $3 = $out_a; $K = 0.0; ;HEAP8[$in$byval_copy>>0]=HEAP8[$in>>0]|0;HEAP8[$in$byval_copy+1>>0]=HEAP8[$in+1>>0]|0;HEAP8[$in$byval_copy+2>>0]=HEAP8[$in+2>>0]|0;HEAP8[$in$byval_copy+3>>0]=HEAP8[$in+3>>0]|0; _nk_color_f($r,$g,$b,$a,$in$byval_copy); $4 = +HEAPF32[$g>>2]; $5 = +HEAPF32[$b>>2]; $6 = $4 < $5; if ($6) { $7 = +HEAPF32[$g>>2]; $t = $7; $8 = +HEAPF32[$b>>2]; HEAPF32[$g>>2] = $8; $9 = $t; HEAPF32[$b>>2] = $9; $K = -1.0; } $10 = +HEAPF32[$r>>2]; $11 = +HEAPF32[$g>>2]; $12 = $10 < $11; if ($12) { $13 = +HEAPF32[$r>>2]; $t1 = $13; $14 = +HEAPF32[$g>>2]; HEAPF32[$r>>2] = $14; $15 = $t1; HEAPF32[$g>>2] = $15; $16 = $K; $17 = -0.3333333432674408 - $16; $K = $17; } $18 = +HEAPF32[$r>>2]; $19 = +HEAPF32[$g>>2]; $20 = +HEAPF32[$b>>2]; $21 = $19 < $20; $22 = +HEAPF32[$g>>2]; $23 = +HEAPF32[$b>>2]; $24 = $21 ? $22 : $23; $25 = $18 - $24; $chroma = $25; $26 = $K; $27 = +HEAPF32[$g>>2]; $28 = +HEAPF32[$b>>2]; $29 = $27 - $28; $30 = $chroma; $31 = 6.0 * $30; $32 = $31 + 9.9999996826552254E-21; $33 = $29 / $32; $34 = $26 + $33; $35 = $34 < 0.0; $36 = $K; $37 = +HEAPF32[$g>>2]; $38 = +HEAPF32[$b>>2]; $39 = $37 - $38; $40 = $chroma; $41 = 6.0 * $40; $42 = $41 + 9.9999996826552254E-21; $43 = $39 / $42; $44 = $36 + $43; $45 = -$44; $46 = $35 ? $45 : $44; $47 = $0; HEAPF32[$47>>2] = $46; $48 = $chroma; $49 = +HEAPF32[$r>>2]; $50 = $49 + 9.9999996826552254E-21; $51 = $48 / $50; $52 = $1; HEAPF32[$52>>2] = $51; $53 = +HEAPF32[$r>>2]; $54 = $2; HEAPF32[$54>>2] = $53; $55 = ((($in)) + 3|0); $56 = HEAP8[$55>>0]|0; $57 = (+($56&255)); $58 = $57 / 255.0; $59 = $3; HEAPF32[$59>>2] = $58; STACKTOP = sp;return; } function _nk_color_hsv_fv($out,$in) { $out = $out|0; $in = $in|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $a = 0, $in$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $in$byval_copy = sp + 8|0; $a = sp; $0 = $out; $1 = $0; $2 = $0; $3 = ((($2)) + 4|0); $4 = $0; $5 = ((($4)) + 8|0); ;HEAP8[$in$byval_copy>>0]=HEAP8[$in>>0]|0;HEAP8[$in$byval_copy+1>>0]=HEAP8[$in+1>>0]|0;HEAP8[$in$byval_copy+2>>0]=HEAP8[$in+2>>0]|0;HEAP8[$in$byval_copy+3>>0]=HEAP8[$in+3>>0]|0; _nk_color_hsva_f($1,$3,$5,$a,$in$byval_copy); STACKTOP = sp;return; } function _nk_color_hsva_fv($out,$in) { $out = $out|0; $in = $in|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $in$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $in$byval_copy = sp + 4|0; $0 = $out; $1 = $0; $2 = $0; $3 = ((($2)) + 4|0); $4 = $0; $5 = ((($4)) + 8|0); $6 = $0; $7 = ((($6)) + 12|0); ;HEAP8[$in$byval_copy>>0]=HEAP8[$in>>0]|0;HEAP8[$in$byval_copy+1>>0]=HEAP8[$in+1>>0]|0;HEAP8[$in$byval_copy+2>>0]=HEAP8[$in+2>>0]|0;HEAP8[$in$byval_copy+3>>0]=HEAP8[$in+3>>0]|0; _nk_color_hsva_f($1,$3,$5,$7,$in$byval_copy); STACKTOP = sp;return; } function _nk_handle_ptr($agg$result,$ptr) { $agg$result = $agg$result|0; $ptr = $ptr|0; var $0 = 0, $1 = 0, $handle = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $handle = sp; $0 = $ptr; ;HEAP32[$handle>>2]=0|0; $1 = $0; HEAP32[$handle>>2] = $1; ;HEAP32[$agg$result>>2]=HEAP32[$handle>>2]|0; STACKTOP = sp;return; } function _nk_handle_id($agg$result,$id) { $agg$result = $agg$result|0; $id = $id|0; var $0 = 0, $1 = 0, $handle = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $handle = sp; $0 = $id; _nk_zero($handle,4); $1 = $0; HEAP32[$handle>>2] = $1; ;HEAP32[$agg$result>>2]=HEAP32[$handle>>2]|0; STACKTOP = sp;return; } function _nk_zero($ptr,$size) { $ptr = $ptr|0; $size = $size|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ptr; $1 = $size; $2 = $0; $3 = ($2|0)!=(0|0); if ($3) { $4 = $0; $5 = $1; _nk_memset($4,0,$5); STACKTOP = sp;return; } else { ___assert_fail((13452|0),(13400|0),2877,(29717|0)); // unreachable; } } function _nk_image_is_subimage($img) { $img = $img|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $img; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13456|0),(13400|0),3922,(13460|0)); // unreachable; } $3 = $0; $4 = ((($3)) + 4|0); $5 = HEAP16[$4>>1]|0; $6 = $5&65535; $7 = ($6|0)==(0); if (!($7)) { $14 = 0; $13 = $14 ^ 1; $15 = $13&1; STACKTOP = sp;return ($15|0); } $8 = $0; $9 = ((($8)) + 6|0); $10 = HEAP16[$9>>1]|0; $11 = $10&65535; $12 = ($11|0)==(0); $14 = $12; $13 = $14 ^ 1; $15 = $13&1; STACKTOP = sp;return ($15|0); } function _nk_triangle_from_direction($result,$r,$pad_x,$pad_y,$direction) { $result = $result|0; $r = $r|0; $pad_x = +$pad_x; $pad_y = +$pad_y; $direction = $direction|0; var $0 = 0, $1 = 0.0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0, $115 = 0.0; var $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0.0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0.0; var $134 = 0.0, $135 = 0.0, $136 = 0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0, $144 = 0, $145 = 0.0, $146 = 0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0; var $152 = 0, $153 = 0.0, $154 = 0, $155 = 0.0, $156 = 0.0, $157 = 0, $158 = 0.0, $159 = 0, $16 = 0, $160 = 0.0, $161 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0; var $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0; var $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0.0, $62 = 0.0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0.0; var $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0.0, $97 = 0; var $98 = 0.0, $99 = 0, $h_half = 0.0, $w_half = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $4 = sp + 88|0; $5 = sp + 80|0; $6 = sp + 72|0; $7 = sp + 64|0; $8 = sp + 56|0; $9 = sp + 48|0; $10 = sp + 40|0; $11 = sp + 32|0; $12 = sp + 24|0; $13 = sp + 16|0; $14 = sp + 8|0; $15 = sp; $0 = $result; $1 = $pad_x; $2 = $pad_y; $3 = $direction; $16 = $0; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((13481|0),(13400|0),3945,(13488|0)); // unreachable; } $18 = $1; $19 = 2.0 * $18; $20 = ((($r)) + 8|0); $21 = +HEAPF32[$20>>2]; $22 = $19 < $21; $23 = ((($r)) + 8|0); $24 = +HEAPF32[$23>>2]; $25 = $1; $26 = 2.0 * $25; $27 = $22 ? $24 : $26; $28 = ((($r)) + 8|0); HEAPF32[$28>>2] = $27; $29 = $2; $30 = 2.0 * $29; $31 = ((($r)) + 12|0); $32 = +HEAPF32[$31>>2]; $33 = $30 < $32; $34 = ((($r)) + 12|0); $35 = +HEAPF32[$34>>2]; $36 = $2; $37 = 2.0 * $36; $38 = $33 ? $35 : $37; $39 = ((($r)) + 12|0); HEAPF32[$39>>2] = $38; $40 = ((($r)) + 8|0); $41 = +HEAPF32[$40>>2]; $42 = $1; $43 = 2.0 * $42; $44 = $41 - $43; $45 = ((($r)) + 8|0); HEAPF32[$45>>2] = $44; $46 = ((($r)) + 12|0); $47 = +HEAPF32[$46>>2]; $48 = $2; $49 = 2.0 * $48; $50 = $47 - $49; $51 = ((($r)) + 12|0); HEAPF32[$51>>2] = $50; $52 = +HEAPF32[$r>>2]; $53 = $1; $54 = $52 + $53; HEAPF32[$r>>2] = $54; $55 = ((($r)) + 4|0); $56 = +HEAPF32[$55>>2]; $57 = $2; $58 = $56 + $57; $59 = ((($r)) + 4|0); HEAPF32[$59>>2] = $58; $60 = ((($r)) + 8|0); $61 = +HEAPF32[$60>>2]; $62 = $61 / 2.0; $w_half = $62; $63 = ((($r)) + 12|0); $64 = +HEAPF32[$63>>2]; $65 = $64 / 2.0; $h_half = $65; $66 = $3; $67 = ($66|0)==(0); if ($67) { $68 = $0; $69 = +HEAPF32[$r>>2]; $70 = $w_half; $71 = $69 + $70; $72 = ((($r)) + 4|0); $73 = +HEAPF32[$72>>2]; _nk_vec2($4,$71,$73); ;HEAP32[$68>>2]=HEAP32[$4>>2]|0;HEAP32[$68+4>>2]=HEAP32[$4+4>>2]|0; $74 = $0; $75 = ((($74)) + 8|0); $76 = +HEAPF32[$r>>2]; $77 = ((($r)) + 8|0); $78 = +HEAPF32[$77>>2]; $79 = $76 + $78; $80 = ((($r)) + 4|0); $81 = +HEAPF32[$80>>2]; $82 = ((($r)) + 12|0); $83 = +HEAPF32[$82>>2]; $84 = $81 + $83; _nk_vec2($5,$79,$84); ;HEAP32[$75>>2]=HEAP32[$5>>2]|0;HEAP32[$75+4>>2]=HEAP32[$5+4>>2]|0; $85 = $0; $86 = ((($85)) + 16|0); $87 = +HEAPF32[$r>>2]; $88 = ((($r)) + 4|0); $89 = +HEAPF32[$88>>2]; $90 = ((($r)) + 12|0); $91 = +HEAPF32[$90>>2]; $92 = $89 + $91; _nk_vec2($6,$87,$92); ;HEAP32[$86>>2]=HEAP32[$6>>2]|0;HEAP32[$86+4>>2]=HEAP32[$6+4>>2]|0; STACKTOP = sp;return; } $93 = $3; $94 = ($93|0)==(1); if ($94) { $95 = $0; $96 = +HEAPF32[$r>>2]; $97 = ((($r)) + 4|0); $98 = +HEAPF32[$97>>2]; _nk_vec2($7,$96,$98); ;HEAP32[$95>>2]=HEAP32[$7>>2]|0;HEAP32[$95+4>>2]=HEAP32[$7+4>>2]|0; $99 = $0; $100 = ((($99)) + 8|0); $101 = +HEAPF32[$r>>2]; $102 = ((($r)) + 8|0); $103 = +HEAPF32[$102>>2]; $104 = $101 + $103; $105 = ((($r)) + 4|0); $106 = +HEAPF32[$105>>2]; $107 = $h_half; $108 = $106 + $107; _nk_vec2($8,$104,$108); ;HEAP32[$100>>2]=HEAP32[$8>>2]|0;HEAP32[$100+4>>2]=HEAP32[$8+4>>2]|0; $109 = $0; $110 = ((($109)) + 16|0); $111 = +HEAPF32[$r>>2]; $112 = ((($r)) + 4|0); $113 = +HEAPF32[$112>>2]; $114 = ((($r)) + 12|0); $115 = +HEAPF32[$114>>2]; $116 = $113 + $115; _nk_vec2($9,$111,$116); ;HEAP32[$110>>2]=HEAP32[$9>>2]|0;HEAP32[$110+4>>2]=HEAP32[$9+4>>2]|0; STACKTOP = sp;return; } $117 = $3; $118 = ($117|0)==(2); $119 = $0; $120 = +HEAPF32[$r>>2]; $121 = ((($r)) + 4|0); $122 = +HEAPF32[$121>>2]; if ($118) { _nk_vec2($10,$120,$122); ;HEAP32[$119>>2]=HEAP32[$10>>2]|0;HEAP32[$119+4>>2]=HEAP32[$10+4>>2]|0; $123 = $0; $124 = ((($123)) + 8|0); $125 = +HEAPF32[$r>>2]; $126 = ((($r)) + 8|0); $127 = +HEAPF32[$126>>2]; $128 = $125 + $127; $129 = ((($r)) + 4|0); $130 = +HEAPF32[$129>>2]; _nk_vec2($11,$128,$130); ;HEAP32[$124>>2]=HEAP32[$11>>2]|0;HEAP32[$124+4>>2]=HEAP32[$11+4>>2]|0; $131 = $0; $132 = ((($131)) + 16|0); $133 = +HEAPF32[$r>>2]; $134 = $w_half; $135 = $133 + $134; $136 = ((($r)) + 4|0); $137 = +HEAPF32[$136>>2]; $138 = ((($r)) + 12|0); $139 = +HEAPF32[$138>>2]; $140 = $137 + $139; _nk_vec2($12,$135,$140); ;HEAP32[$132>>2]=HEAP32[$12>>2]|0;HEAP32[$132+4>>2]=HEAP32[$12+4>>2]|0; STACKTOP = sp;return; } else { $141 = $h_half; $142 = $122 + $141; _nk_vec2($13,$120,$142); ;HEAP32[$119>>2]=HEAP32[$13>>2]|0;HEAP32[$119+4>>2]=HEAP32[$13+4>>2]|0; $143 = $0; $144 = ((($143)) + 8|0); $145 = +HEAPF32[$r>>2]; $146 = ((($r)) + 8|0); $147 = +HEAPF32[$146>>2]; $148 = $145 + $147; $149 = ((($r)) + 4|0); $150 = +HEAPF32[$149>>2]; _nk_vec2($14,$148,$150); ;HEAP32[$144>>2]=HEAP32[$14>>2]|0;HEAP32[$144+4>>2]=HEAP32[$14+4>>2]|0; $151 = $0; $152 = ((($151)) + 16|0); $153 = +HEAPF32[$r>>2]; $154 = ((($r)) + 8|0); $155 = +HEAPF32[$154>>2]; $156 = $153 + $155; $157 = ((($r)) + 4|0); $158 = +HEAPF32[$157>>2]; $159 = ((($r)) + 12|0); $160 = +HEAPF32[$159>>2]; $161 = $158 + $160; _nk_vec2($15,$156,$161); ;HEAP32[$152>>2]=HEAP32[$15>>2]|0;HEAP32[$152+4>>2]=HEAP32[$15+4>>2]|0; STACKTOP = sp;return; } } function _nk_utf_decode($c,$u,$clen) { $c = $c|0; $u = $u|0; $clen = $clen|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $j = 0, $len = 0, $or$cond = 0, $or$cond3 = 0, $type = 0, $udecoded = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $len = sp + 8|0; $type = sp + 4|0; $1 = $c; $2 = $u; $3 = $clen; HEAP32[$type>>2] = 0; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13515|0),(13400|0),4107,(13517|0)); // unreachable; } $6 = $2; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((13531|0),(13400|0),4108,(13517|0)); // unreachable; } $8 = $1; $9 = ($8|0)!=(0|0); $10 = $2; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; if (!($or$cond)) { $0 = 0; $51 = $0; STACKTOP = sp;return ($51|0); } $12 = $3; $13 = ($12|0)!=(0); if (!($13)) { $0 = 0; $51 = $0; STACKTOP = sp;return ($51|0); } $14 = $2; HEAP32[$14>>2] = 65533; $15 = $1; $16 = HEAP8[$15>>0]|0; $17 = (_nk_utf_decode_byte($16,$len)|0); $udecoded = $17; $18 = HEAP32[$len>>2]|0; $19 = (1)<=($18|0); $20 = HEAP32[$len>>2]|0; $21 = ($20|0)<=(4); $or$cond3 = $19 & $21; if (!($or$cond3)) { $0 = 1; $51 = $0; STACKTOP = sp;return ($51|0); } $i = 1; $j = 1; while(1) { $22 = $i; $23 = $3; $24 = ($22|0)<($23|0); if (!($24)) { break; } $25 = $j; $26 = HEAP32[$len>>2]|0; $27 = ($25|0)<($26|0); if (!($27)) { break; } $28 = $udecoded; $29 = $28 << 6; $30 = $i; $31 = $1; $32 = (($31) + ($30)|0); $33 = HEAP8[$32>>0]|0; $34 = (_nk_utf_decode_byte($33,$type)|0); $35 = $29 | $34; $udecoded = $35; $36 = HEAP32[$type>>2]|0; $37 = ($36|0)!=(0); if ($37) { label = 15; break; } $39 = $i; $40 = (($39) + 1)|0; $i = $40; $41 = $j; $42 = (($41) + 1)|0; $j = $42; } if ((label|0) == 15) { $38 = $j; $0 = $38; $51 = $0; STACKTOP = sp;return ($51|0); } $43 = $j; $44 = HEAP32[$len>>2]|0; $45 = ($43|0)<($44|0); if ($45) { $0 = 0; $51 = $0; STACKTOP = sp;return ($51|0); } else { $46 = $udecoded; $47 = $2; HEAP32[$47>>2] = $46; $48 = $2; $49 = HEAP32[$len>>2]|0; (_nk_utf_validate($48,$49)|0); $50 = HEAP32[$len>>2]|0; $0 = $50; $51 = $0; STACKTOP = sp;return ($51|0); } return (0)|0; } function _nk_utf_decode_byte($c,$i) { $c = $c|0; $i = $i|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $c; $2 = $i; $3 = $2; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((29725|0),(13400|0),4092,(29727|0)); // unreachable; } $5 = $2; $6 = ($5|0)!=(0|0); if (!($6)) { $0 = 0; $39 = $0; STACKTOP = sp;return ($39|0); } $7 = $2; HEAP32[$7>>2] = 0; while(1) { $8 = $2; $9 = HEAP32[$8>>2]|0; $10 = ($9|0)<(5); if (!($10)) { label = 10; break; } $11 = $1; $12 = $11&255; $13 = $2; $14 = HEAP32[$13>>2]|0; $15 = (29746 + ($14)|0); $16 = HEAP8[$15>>0]|0; $17 = $16&255; $18 = $12 & $17; $19 = $2; $20 = HEAP32[$19>>2]|0; $21 = (29751 + ($20)|0); $22 = HEAP8[$21>>0]|0; $23 = $22&255; $24 = ($18|0)==($23|0); if ($24) { label = 8; break; } $36 = $2; $37 = HEAP32[$36>>2]|0; $38 = (($37) + 1)|0; HEAP32[$36>>2] = $38; } if ((label|0) == 8) { $25 = $1; $26 = $25 << 24 >> 24; $27 = $2; $28 = HEAP32[$27>>2]|0; $29 = (29746 + ($28)|0); $30 = HEAP8[$29>>0]|0; $31 = $30&255; $32 = $31 ^ -1; $33 = $26 & $32; $34 = $33&255; $35 = $34&255; $0 = $35; $39 = $0; STACKTOP = sp;return ($39|0); } else if ((label|0) == 10) { $0 = 0; $39 = $0; STACKTOP = sp;return ($39|0); } return (0)|0; } function _nk_utf_validate($u,$i) { $u = $u|0; $i = $i|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $u; $2 = $i; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13531|0),(13400|0),4080,(29756|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { $0 = 0; $34 = $0; STACKTOP = sp;return ($34|0); } $7 = $2; $8 = (12524 + ($7<<2)|0); $9 = HEAP32[$8>>2]|0; $10 = $1; $11 = HEAP32[$10>>2]|0; $12 = ($9>>>0)<=($11>>>0); if ($12) { $13 = $1; $14 = HEAP32[$13>>2]|0; $15 = $2; $16 = (12544 + ($15<<2)|0); $17 = HEAP32[$16>>2]|0; $18 = ($14>>>0)<=($17>>>0); if ($18) { $19 = $1; $20 = HEAP32[$19>>2]|0; $21 = (55296)<=($20>>>0); if ($21) { $22 = $1; $23 = HEAP32[$22>>2]|0; $24 = ($23>>>0)<=(57343); if ($24) { label = 9; } } } else { label = 9; } } else { label = 9; } if ((label|0) == 9) { $25 = $1; HEAP32[$25>>2] = 65533; } $2 = 1; while(1) { $26 = $1; $27 = HEAP32[$26>>2]|0; $28 = $2; $29 = (12544 + ($28<<2)|0); $30 = HEAP32[$29>>2]|0; $31 = ($27>>>0)>($30>>>0); $32 = $2; if (!($31)) { break; } $33 = (($32) + 1)|0; $2 = $33; } $0 = $32; $34 = $0; STACKTOP = sp;return ($34|0); } function _nk_utf_encode($u,$c,$clen) { $u = $u|0; $c = $c|0; $clen = $clen|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $len = 0, $or$cond = 0, $or$cond$not = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = sp + 16|0; HEAP32[$1>>2] = $u; $2 = $c; $3 = $clen; $4 = (_nk_utf_validate($1,0)|0); $len = $4; $5 = $3; $6 = $len; $7 = ($5|0)>=($6|0); $8 = $len; $9 = ($8|0)!=(0); $or$cond = $7 & $9; $or$cond$not = $or$cond ^ 1; $10 = $len; $11 = ($10|0)>(4); $or$cond3 = $or$cond$not | $11; if ($or$cond3) { $0 = 0; $29 = $0; STACKTOP = sp;return ($29|0); } $12 = $len; $13 = (($12) - 1)|0; $i = $13; while(1) { $14 = $i; $15 = ($14|0)!=(0); $16 = HEAP32[$1>>2]|0; if (!($15)) { break; } $17 = (_nk_utf_encode_byte($16,0)|0); $18 = $i; $19 = $2; $20 = (($19) + ($18)|0); HEAP8[$20>>0] = $17; $21 = HEAP32[$1>>2]|0; $22 = $21 >>> 6; HEAP32[$1>>2] = $22; $23 = $i; $24 = (($23) + -1)|0; $i = $24; } $25 = $len; $26 = (_nk_utf_encode_byte($16,$25)|0); $27 = $2; HEAP8[$27>>0] = $26; $28 = $len; $0 = $28; $29 = $0; STACKTOP = sp;return ($29|0); } function _nk_utf_encode_byte($u,$i) { $u = $u|0; $i = $i|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $u; $1 = $i; $2 = $1; $3 = (29751 + ($2)|0); $4 = HEAP8[$3>>0]|0; $5 = $4&255; $6 = $0; $7 = $6&255; $8 = $7&255; $9 = $1; $10 = (29746 + ($9)|0); $11 = HEAP8[$10>>0]|0; $12 = $11&255; $13 = $12 ^ -1; $14 = $8 & $13; $15 = $5 | $14; $16 = $15&255; STACKTOP = sp;return ($16|0); } function _nk_utf_len($str,$len) { $str = $str|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $glyph_len = 0, $glyphs = 0, $or$cond = 0, $src_len = 0, $text = 0, $text_len = 0, $unicode = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $unicode = sp; $1 = $str; $2 = $len; $glyphs = 0; $src_len = 0; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13396|0),(13400|0),4162,(13533|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); $7 = $2; $8 = ($7|0)!=(0); $or$cond = $6 & $8; if (!($or$cond)) { $0 = 0; $31 = $0; STACKTOP = sp;return ($31|0); } $9 = $1; $text = $9; $10 = $2; $text_len = $10; $11 = $text; $12 = $text_len; $13 = (_nk_utf_decode($11,$unicode,$12)|0); $glyph_len = $13; while(1) { $14 = $glyph_len; $15 = ($14|0)!=(0); if ($15) { $16 = $src_len; $17 = $2; $18 = ($16|0)<($17|0); $32 = $18; } else { $32 = 0; } $19 = $glyphs; if (!($32)) { break; } $20 = (($19) + 1)|0; $glyphs = $20; $21 = $src_len; $22 = $glyph_len; $23 = (($21) + ($22))|0; $src_len = $23; $24 = $text; $25 = $src_len; $26 = (($24) + ($25)|0); $27 = $text_len; $28 = $src_len; $29 = (($27) - ($28))|0; $30 = (_nk_utf_decode($26,$unicode,$29)|0); $glyph_len = $30; } $0 = $19; $31 = $0; STACKTOP = sp;return ($31|0); } function _nk_buffer_init_default($buffer) { $buffer = $buffer|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $alloc = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $alloc = sp; $0 = $buffer; HEAP32[$alloc>>2] = 0; $1 = ((($alloc)) + 4|0); HEAP32[$1>>2] = 7; $2 = ((($alloc)) + 8|0); HEAP32[$2>>2] = 8; $3 = $0; _nk_buffer_init($3,$alloc,4096); STACKTOP = sp;return; } function _nk_malloc($unused,$old,$size) { $unused = $unused|0; $old = $old|0; $size = $size|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $old; $1 = $size; $2 = $1; $3 = (_malloc($2)|0); STACKTOP = sp;return ($3|0); } function _nk_mfree($unused,$ptr) { $unused = $unused|0; $ptr = $ptr|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ptr; $1 = $0; _free($1); STACKTOP = sp;return; } function _nk_buffer_init($b,$a,$initial_size) { $b = $b|0; $a = $a|0; $initial_size = $initial_size|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0; var $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 12|0; $0 = $b; $1 = $a; $2 = $initial_size; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13556|0),(13400|0),4240,(13558|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13573|0),(13400|0),4241,(13558|0)); // unreachable; } $7 = $2; $8 = ($7|0)!=(0); if (!($8)) { ___assert_fail((13575|0),(13400|0),4242,(13558|0)); // unreachable; } $9 = $0; $10 = ($9|0)!=(0|0); $11 = $1; $12 = ($11|0)!=(0|0); $or$cond = $10 & $12; $13 = $2; $14 = ($13|0)!=(0); $or$cond3 = $or$cond & $14; if (!($or$cond3)) { STACKTOP = sp;return; } $15 = $0; _nk_zero($15,60); $16 = $0; $17 = ((($16)) + 28|0); HEAP32[$17>>2] = 1; $18 = $1; $19 = ((($18)) + 4|0); $20 = HEAP32[$19>>2]|0; $21 = $1; $22 = $2; ;HEAP32[$$byval_copy>>2]=HEAP32[$21>>2]|0; $23 = (FUNCTION_TABLE_iiii[$20 & 7]($$byval_copy,0,$22)|0); $24 = $0; $25 = ((($24)) + 32|0); HEAP32[$25>>2] = $23; $26 = $2; $27 = $0; $28 = ((($27)) + 32|0); $29 = ((($28)) + 4|0); HEAP32[$29>>2] = $26; $30 = $2; $31 = $0; $32 = ((($31)) + 56|0); HEAP32[$32>>2] = $30; $33 = $0; $34 = ((($33)) + 40|0); HEAPF32[$34>>2] = 2.0; $35 = $0; $36 = ((($35)) + 16|0); $37 = $1; ;HEAP32[$36>>2]=HEAP32[$37>>2]|0;HEAP32[$36+4>>2]=HEAP32[$37+4>>2]|0;HEAP32[$36+8>>2]=HEAP32[$37+8>>2]|0; STACKTOP = sp;return; } function _nk_buffer_init_fixed($b,$m,$size) { $b = $b|0; $m = $m|0; $size = $size|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $m; $2 = $size; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13556|0),(13400|0),4257,(13588|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13609|0),(13400|0),4258,(13588|0)); // unreachable; } $7 = $2; $8 = ($7|0)!=(0); if (!($8)) { ___assert_fail((13611|0),(13400|0),4259,(13588|0)); // unreachable; } $9 = $0; $10 = ($9|0)!=(0|0); $11 = $1; $12 = ($11|0)!=(0|0); $or$cond = $10 & $12; $13 = $2; $14 = ($13|0)!=(0); $or$cond3 = $or$cond & $14; if (!($or$cond3)) { STACKTOP = sp;return; } $15 = $0; _nk_zero($15,60); $16 = $0; $17 = ((($16)) + 28|0); HEAP32[$17>>2] = 0; $18 = $1; $19 = $0; $20 = ((($19)) + 32|0); HEAP32[$20>>2] = $18; $21 = $2; $22 = $0; $23 = ((($22)) + 32|0); $24 = ((($23)) + 4|0); HEAP32[$24>>2] = $21; $25 = $2; $26 = $0; $27 = ((($26)) + 56|0); HEAP32[$27>>2] = $25; STACKTOP = sp;return; } function _nk_buffer_alloc($b,$type,$size,$align) { $b = $b|0; $type = $type|0; $size = $size|0; $align = $align|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0; var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0; var $92 = 0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $alignment = 0, $capacity = 0, $full = 0, $memory = 0, $or$cond = 0, $unaligned = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $alignment = sp + 12|0; $1 = $b; $2 = $type; $3 = $size; $4 = $align; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13556|0),(13400|0),4347,(29772|0)); // unreachable; } $7 = $3; $8 = ($7|0)!=(0); if (!($8)) { ___assert_fail((13611|0),(13400|0),4348,(29772|0)); // unreachable; } $9 = $1; $10 = ($9|0)!=(0|0); $11 = $3; $12 = ($11|0)!=(0); $or$cond = $10 & $12; if (!($or$cond)) { $0 = 0; $167 = $0; STACKTOP = sp;return ($167|0); } $13 = $3; $14 = $1; $15 = ((($14)) + 48|0); $16 = HEAP32[$15>>2]|0; $17 = (($16) + ($13))|0; HEAP32[$15>>2] = $17; $18 = $2; $19 = ($18|0)==(0); $20 = $1; $21 = ((($20)) + 32|0); $22 = HEAP32[$21>>2]|0; $23 = $1; if ($19) { $24 = ((($23)) + 44|0); $25 = HEAP32[$24>>2]|0; $26 = (($22) + ($25)|0); $unaligned = $26; } else { $27 = ((($23)) + 56|0); $28 = HEAP32[$27>>2]|0; $29 = $3; $30 = (($28) - ($29))|0; $31 = (($22) + ($30)|0); $unaligned = $31; } $32 = $unaligned; $33 = $4; $34 = $2; $35 = (_nk_buffer_align($32,$33,$alignment,$34)|0); $memory = $35; $36 = $2; $37 = ($36|0)==(0); $38 = $1; if ($37) { $39 = ((($38)) + 44|0); $40 = HEAP32[$39>>2]|0; $41 = $3; $42 = (($40) + ($41))|0; $43 = HEAP32[$alignment>>2]|0; $44 = (($42) + ($43))|0; $45 = $1; $46 = ((($45)) + 56|0); $47 = HEAP32[$46>>2]|0; $48 = ($44>>>0)>($47>>>0); $49 = $48&1; $full = $49; } else { $50 = ((($38)) + 56|0); $51 = HEAP32[$50>>2]|0; $52 = $3; $53 = HEAP32[$alignment>>2]|0; $54 = (($52) + ($53))|0; $55 = (($51) - ($54))|0; $56 = $1; $57 = ((($56)) + 44|0); $58 = HEAP32[$57>>2]|0; $59 = ($55>>>0)<=($58>>>0); $60 = $59&1; $full = $60; } $61 = $full; $62 = ($61|0)!=(0); do { if ($62) { $63 = $1; $64 = ((($63)) + 28|0); $65 = HEAP32[$64>>2]|0; $66 = ($65|0)==(1); if (!($66)) { ___assert_fail((29788|0),(13400|0),4365,(29772|0)); // unreachable; } $67 = $1; $68 = ((($67)) + 16|0); $69 = ((($68)) + 4|0); $70 = HEAP32[$69>>2]|0; $71 = ($70|0)!=(0|0); if (!($71)) { ___assert_fail((29817|0),(13400|0),4366,(29772|0)); // unreachable; } $72 = $1; $73 = ((($72)) + 16|0); $74 = ((($73)) + 8|0); $75 = HEAP32[$74>>2]|0; $76 = ($75|0)!=(0|0); if (!($76)) { ___assert_fail((29817|0),(13400|0),4366,(29772|0)); // unreachable; } $77 = $1; $78 = ((($77)) + 28|0); $79 = HEAP32[$78>>2]|0; $80 = ($79|0)!=(1); if (!($80)) { $81 = $1; $82 = ((($81)) + 16|0); $83 = ((($82)) + 4|0); $84 = HEAP32[$83>>2]|0; $85 = ($84|0)!=(0|0); if ($85) { $86 = $1; $87 = ((($86)) + 16|0); $88 = ((($87)) + 8|0); $89 = HEAP32[$88>>2]|0; $90 = ($89|0)!=(0|0); if ($90) { $91 = $1; $92 = ((($91)) + 32|0); $93 = ((($92)) + 4|0); $94 = HEAP32[$93>>2]|0; $95 = (+($94>>>0)); $96 = $1; $97 = ((($96)) + 40|0); $98 = +HEAPF32[$97>>2]; $99 = $95 * $98; $100 = (~~(($99))>>>0); $capacity = $100; $101 = $capacity; $102 = $1; $103 = ((($102)) + 44|0); $104 = HEAP32[$103>>2]|0; $105 = $3; $106 = (($104) + ($105))|0; $107 = (_nk_round_up_pow2($106)|0); $108 = ($101>>>0)<($107>>>0); if ($108) { $109 = $1; $110 = ((($109)) + 44|0); $111 = HEAP32[$110>>2]|0; $112 = $3; $113 = (($111) + ($112))|0; $114 = (_nk_round_up_pow2($113)|0); $116 = $114; } else { $115 = $capacity; $116 = $115; } $capacity = $116; $117 = $1; $118 = $capacity; $119 = $1; $120 = ((($119)) + 32|0); $121 = ((($120)) + 4|0); $122 = (_nk_buffer_realloc($117,$118,$121)|0); $123 = $1; $124 = ((($123)) + 32|0); HEAP32[$124>>2] = $122; $125 = $1; $126 = ((($125)) + 32|0); $127 = HEAP32[$126>>2]|0; $128 = ($127|0)!=(0|0); if (!($128)) { $0 = 0; $167 = $0; STACKTOP = sp;return ($167|0); } $129 = $2; $130 = ($129|0)==(0); $131 = $1; $132 = ((($131)) + 32|0); $133 = HEAP32[$132>>2]|0; $134 = $1; if ($130) { $135 = ((($134)) + 44|0); $136 = HEAP32[$135>>2]|0; $137 = (($133) + ($136)|0); $unaligned = $137; } else { $138 = ((($134)) + 56|0); $139 = HEAP32[$138>>2]|0; $140 = (($133) + ($139)|0); $unaligned = $140; } $141 = $unaligned; $142 = $4; $143 = $2; $144 = (_nk_buffer_align($141,$142,$alignment,$143)|0); $memory = $144; break; } } } $0 = 0; $167 = $0; STACKTOP = sp;return ($167|0); } } while(0); $145 = $2; $146 = ($145|0)==(0); $147 = $3; $148 = HEAP32[$alignment>>2]|0; $149 = (($147) + ($148))|0; $150 = $1; if ($146) { $151 = ((($150)) + 44|0); $152 = HEAP32[$151>>2]|0; $153 = (($152) + ($149))|0; HEAP32[$151>>2] = $153; } else { $154 = ((($150)) + 56|0); $155 = HEAP32[$154>>2]|0; $156 = (($155) - ($149))|0; HEAP32[$154>>2] = $156; } $157 = HEAP32[$alignment>>2]|0; $158 = $1; $159 = ((($158)) + 48|0); $160 = HEAP32[$159>>2]|0; $161 = (($160) + ($157))|0; HEAP32[$159>>2] = $161; $162 = $1; $163 = ((($162)) + 52|0); $164 = HEAP32[$163>>2]|0; $165 = (($164) + 1)|0; HEAP32[$163>>2] = $165; $166 = $memory; $0 = $166; $167 = $0; STACKTOP = sp;return ($167|0); } function _nk_memcopy($dst0,$src0,$length) { $dst0 = $dst0|0; $src0 = $src0|0; $length = $length|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $14 = 0; var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0; var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0; var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0; var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0; var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dst = 0, $or$cond = 0, $or$cond3 = 0, $src = 0, $t = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $dst0; $1 = $src0; $2 = $length; $3 = $0; $dst = $3; $4 = $1; $src = $4; $5 = $2; $6 = ($5|0)==(0); if ($6) { $132 = $0; STACKTOP = sp;return ($132|0); } $7 = $dst; $8 = $src; $9 = ($7|0)==($8|0); if ($9) { $132 = $0; STACKTOP = sp;return ($132|0); } $10 = $dst; $11 = $src; $12 = ($10>>>0)<($11>>>0); if ($12) { $13 = $src; $14 = $13; $t = $14; $15 = $t; $16 = $dst; $17 = $16; $18 = $15 | $17; $19 = $18 & 3; $20 = ($19|0)!=(0); if ($20) { $21 = $t; $22 = $dst; $23 = $22; $24 = $21 ^ $23; $25 = $24 & 3; $26 = ($25|0)!=(0); $27 = $2; $28 = ($27>>>0)<(4); $or$cond = $26 | $28; if ($or$cond) { $29 = $2; $t = $29; } else { $30 = $t; $31 = $30 & 3; $32 = (4 - ($31))|0; $t = $32; } $33 = $t; $34 = $2; $35 = (($34) - ($33))|0; $2 = $35; while(1) { $36 = $src; $37 = ((($36)) + 1|0); $src = $37; $38 = HEAP8[$36>>0]|0; $39 = $dst; $40 = ((($39)) + 1|0); $dst = $40; HEAP8[$39>>0] = $38; $41 = $t; $42 = (($41) + -1)|0; $t = $42; $43 = ($42|0)!=(0); if (!($43)) { break; } } } $44 = $2; $45 = (($44>>>0) / 4)&-1; $t = $45; $46 = $t; $47 = ($46|0)!=(0); if ($47) { while(1) { $48 = $src; $49 = HEAP32[$48>>2]|0; $50 = $dst; HEAP32[$50>>2] = $49; $51 = $src; $52 = ((($51)) + 4|0); $src = $52; $53 = $dst; $54 = ((($53)) + 4|0); $dst = $54; $55 = $t; $56 = (($55) + -1)|0; $t = $56; $57 = ($56|0)!=(0); if (!($57)) { break; } } } $58 = $2; $59 = $58 & 3; $t = $59; $60 = $t; $61 = ($60|0)!=(0); if (!($61)) { $132 = $0; STACKTOP = sp;return ($132|0); } while(1) { $62 = $src; $63 = ((($62)) + 1|0); $src = $63; $64 = HEAP8[$62>>0]|0; $65 = $dst; $66 = ((($65)) + 1|0); $dst = $66; HEAP8[$65>>0] = $64; $67 = $t; $68 = (($67) + -1)|0; $t = $68; $69 = ($68|0)!=(0); if (!($69)) { break; } } $132 = $0; STACKTOP = sp;return ($132|0); } else { $70 = $2; $71 = $src; $72 = (($71) + ($70)|0); $src = $72; $73 = $2; $74 = $dst; $75 = (($74) + ($73)|0); $dst = $75; $76 = $src; $77 = $76; $t = $77; $78 = $t; $79 = $dst; $80 = $79; $81 = $78 | $80; $82 = $81 & 3; $83 = ($82|0)!=(0); if ($83) { $84 = $t; $85 = $dst; $86 = $85; $87 = $84 ^ $86; $88 = $87 & 3; $89 = ($88|0)!=(0); $90 = $2; $91 = ($90>>>0)<=(4); $or$cond3 = $89 | $91; if ($or$cond3) { $92 = $2; $t = $92; } else { $93 = $t; $94 = $93 & 3; $t = $94; } $95 = $t; $96 = $2; $97 = (($96) - ($95))|0; $2 = $97; while(1) { $98 = $src; $99 = ((($98)) + -1|0); $src = $99; $100 = HEAP8[$99>>0]|0; $101 = $dst; $102 = ((($101)) + -1|0); $dst = $102; HEAP8[$102>>0] = $100; $103 = $t; $104 = (($103) + -1)|0; $t = $104; $105 = ($104|0)!=(0); if (!($105)) { break; } } } $106 = $2; $107 = (($106>>>0) / 4)&-1; $t = $107; $108 = $t; $109 = ($108|0)!=(0); if ($109) { while(1) { $110 = $src; $111 = ((($110)) + -4|0); $src = $111; $112 = $dst; $113 = ((($112)) + -4|0); $dst = $113; $114 = $src; $115 = HEAP32[$114>>2]|0; $116 = $dst; HEAP32[$116>>2] = $115; $117 = $t; $118 = (($117) + -1)|0; $t = $118; $119 = ($118|0)!=(0); if (!($119)) { break; } } } $120 = $2; $121 = $120 & 3; $t = $121; $122 = $t; $123 = ($122|0)!=(0); if (!($123)) { $132 = $0; STACKTOP = sp;return ($132|0); } while(1) { $124 = $src; $125 = ((($124)) + -1|0); $src = $125; $126 = HEAP8[$125>>0]|0; $127 = $dst; $128 = ((($127)) + -1|0); $dst = $128; HEAP8[$128>>0] = $126; $129 = $t; $130 = (($129) + -1)|0; $t = $130; $131 = ($130|0)!=(0); if (!($131)) { break; } } $132 = $0; STACKTOP = sp;return ($132|0); } return (0)|0; } function _nk_buffer_mark($buffer,$type) { $buffer = $buffer|0; $type = $type|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $buffer; $1 = $type; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13445|0),(13400|0),4403,(13616|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $1; $7 = $0; $8 = (($7) + ($6<<3)|0); HEAP32[$8>>2] = 1; $9 = $1; $10 = ($9|0)==(1); $11 = $0; if ($10) { $12 = ((($11)) + 56|0); $13 = HEAP32[$12>>2]|0; $14 = $1; $15 = $0; $16 = (($15) + ($14<<3)|0); $17 = ((($16)) + 4|0); HEAP32[$17>>2] = $13; STACKTOP = sp;return; } else { $18 = ((($11)) + 44|0); $19 = HEAP32[$18>>2]|0; $20 = $1; $21 = $0; $22 = (($21) + ($20<<3)|0); $23 = ((($22)) + 4|0); HEAP32[$23>>2] = $19; STACKTOP = sp;return; } } function _nk_buffer_reset($buffer,$type) { $buffer = $buffer|0; $type = $type|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $buffer; $1 = $type; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13445|0),(13400|0),4414,(13631|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $1; $7 = ($6|0)==(1); $8 = $0; if ($7) { $9 = ((($8)) + 32|0); $10 = ((($9)) + 4|0); $11 = HEAP32[$10>>2]|0; $12 = $1; $13 = $0; $14 = (($13) + ($12<<3)|0); $15 = ((($14)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = (($11) - ($16))|0; $18 = $0; $19 = ((($18)) + 48|0); $20 = HEAP32[$19>>2]|0; $21 = (($20) - ($17))|0; HEAP32[$19>>2] = $21; $22 = $1; $23 = $0; $24 = (($23) + ($22<<3)|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0); if ($26) { $27 = $1; $28 = $0; $29 = (($28) + ($27<<3)|0); $30 = ((($29)) + 4|0); $31 = HEAP32[$30>>2]|0; $32 = $0; $33 = ((($32)) + 56|0); HEAP32[$33>>2] = $31; } else { $34 = $0; $35 = ((($34)) + 32|0); $36 = ((($35)) + 4|0); $37 = HEAP32[$36>>2]|0; $38 = $0; $39 = ((($38)) + 56|0); HEAP32[$39>>2] = $37; } $40 = $1; $41 = $0; $42 = (($41) + ($40<<3)|0); HEAP32[$42>>2] = 0; STACKTOP = sp;return; } else { $43 = ((($8)) + 44|0); $44 = HEAP32[$43>>2]|0; $45 = $1; $46 = $0; $47 = (($46) + ($45<<3)|0); $48 = ((($47)) + 4|0); $49 = HEAP32[$48>>2]|0; $50 = (($44) - ($49))|0; $51 = $0; $52 = ((($51)) + 48|0); $53 = HEAP32[$52>>2]|0; $54 = (($53) - ($50))|0; HEAP32[$52>>2] = $54; $55 = $1; $56 = $0; $57 = (($56) + ($55<<3)|0); $58 = HEAP32[$57>>2]|0; $59 = ($58|0)!=(0); if ($59) { $60 = $1; $61 = $0; $62 = (($61) + ($60<<3)|0); $63 = ((($62)) + 4|0); $64 = HEAP32[$63>>2]|0; $65 = $0; $66 = ((($65)) + 44|0); HEAP32[$66>>2] = $64; } else { $67 = $0; $68 = ((($67)) + 44|0); HEAP32[$68>>2] = 0; } $69 = $1; $70 = $0; $71 = (($70) + ($69<<3)|0); HEAP32[$71>>2] = 0; STACKTOP = sp;return; } } function _nk_buffer_clear($b) { $b = $b|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13556|0),(13400|0),4436,(13647|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 44|0); HEAP32[$6>>2] = 0; $7 = $0; $8 = ((($7)) + 32|0); $9 = ((($8)) + 4|0); $10 = HEAP32[$9>>2]|0; $11 = $0; $12 = ((($11)) + 56|0); HEAP32[$12>>2] = $10; $13 = $0; $14 = ((($13)) + 52|0); HEAP32[$14>>2] = 0; $15 = $0; $16 = ((($15)) + 48|0); HEAP32[$16>>2] = 0; STACKTOP = sp;return; } function _nk_buffer_free($b) { $b = $b|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 4|0; $0 = $b; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13556|0),(13400|0),4447,(13663|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 32|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); if (!($8)) { STACKTOP = sp;return; } $9 = $0; $10 = ((($9)) + 28|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)==(0); if ($12) { STACKTOP = sp;return; } $13 = $0; $14 = ((($13)) + 16|0); $15 = ((($14)) + 8|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)!=(0|0); if (!($17)) { STACKTOP = sp;return; } $18 = $0; $19 = ((($18)) + 16|0); $20 = ((($19)) + 8|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { ___assert_fail((13678|0),(13400|0),4451,(13663|0)); // unreachable; } $23 = $0; $24 = ((($23)) + 16|0); $25 = ((($24)) + 8|0); $26 = HEAP32[$25>>2]|0; $27 = $0; $28 = ((($27)) + 16|0); $29 = $0; $30 = ((($29)) + 32|0); $31 = HEAP32[$30>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$28>>2]|0; FUNCTION_TABLE_vii[$26 & 31]($$byval_copy,$31); STACKTOP = sp;return; } function _nk_buffer_memory($buffer) { $buffer = $buffer|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $buffer; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13445|0),(13400|0),4471,(13693|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 32|0); $8 = HEAP32[$7>>2]|0; $0 = $8; $9 = $0; STACKTOP = sp;return ($9|0); } else { $0 = 0; $9 = $0; STACKTOP = sp;return ($9|0); } return (0)|0; } function _nk_buffer_total($buffer) { $buffer = $buffer|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $buffer; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13445|0),(13400|0),4487,(13710|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 32|0); $8 = ((($7)) + 4|0); $9 = HEAP32[$8>>2]|0; $0 = $9; $10 = $0; STACKTOP = sp;return ($10|0); } else { $0 = 0; $10 = $0; STACKTOP = sp;return ($10|0); } return (0)|0; } function _nk_str_append_text_char($s,$str,$len) { $s = $s|0; $str = $str|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $mem = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $s; $2 = $str; $3 = $len; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13691|0),(13400|0),4530,(13726|0)); // unreachable; } $6 = $2; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((13396|0),(13400|0),4531,(13726|0)); // unreachable; } $8 = $1; $9 = ($8|0)!=(0|0); $10 = $2; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; $12 = $3; $13 = ($12|0)!=(0); $or$cond3 = $or$cond & $13; if (!($or$cond3)) { $0 = 0; $32 = $0; STACKTOP = sp;return ($32|0); } $14 = $1; $15 = $3; $16 = $15; $17 = (_nk_buffer_alloc($14,0,$16,0)|0); $mem = $17; $18 = $mem; $19 = ($18|0)!=(0|0); if ($19) { $20 = $mem; $21 = $2; $22 = $3; $23 = $22; (_nk_memcopy($20,$21,$23)|0); $24 = $2; $25 = $3; $26 = (_nk_utf_len($24,$25)|0); $27 = $1; $28 = ((($27)) + 60|0); $29 = HEAP32[$28>>2]|0; $30 = (($29) + ($26))|0; HEAP32[$28>>2] = $30; $31 = $3; $0 = $31; $32 = $0; STACKTOP = sp;return ($32|0); } else { $0 = 0; $32 = $0; STACKTOP = sp;return ($32|0); } return (0)|0; } function _nk_str_insert_at_char($s,$pos,$str,$len) { $s = $s|0; $pos = $pos|0; $str = $str|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0; var $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0; var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0; var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $copylen = 0, $dst = 0, $i = 0, $mem = 0, $or$cond = 0, $or$cond3 = 0, $src = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $s; $2 = $pos; $3 = $str; $4 = $len; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13691|0),(13400|0),4621,(13750|0)); // unreachable; } $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((13396|0),(13400|0),4622,(13750|0)); // unreachable; } $9 = $4; $10 = ($9|0)>=(0); if (!($10)) { ___assert_fail((13772|0),(13400|0),4623,(13750|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0|0); $13 = $3; $14 = ($13|0)!=(0|0); $or$cond = $12 & $14; $15 = $4; $16 = ($15|0)!=(0); $or$cond3 = $or$cond & $16; if ($or$cond3) { $17 = $2; $18 = $1; $19 = ((($18)) + 44|0); $20 = HEAP32[$19>>2]|0; $21 = ($17>>>0)>($20>>>0); if (!($21)) { $22 = $1; $23 = ((($22)) + 44|0); $24 = HEAP32[$23>>2]|0; $25 = $4; $26 = (($24) + ($25))|0; $27 = $1; $28 = ((($27)) + 32|0); $29 = ((($28)) + 4|0); $30 = HEAP32[$29>>2]|0; $31 = ($26>>>0)>=($30>>>0); if ($31) { $32 = $1; $33 = ((($32)) + 28|0); $34 = HEAP32[$33>>2]|0; $35 = ($34|0)==(0); if ($35) { $0 = 0; $109 = $0; STACKTOP = sp;return ($109|0); } } $36 = $1; $37 = ((($36)) + 44|0); $38 = HEAP32[$37>>2]|0; $39 = $2; $40 = (($38) - ($39))|0; $copylen = $40; $41 = $copylen; $42 = ($41|0)!=(0); $43 = $1; if (!($42)) { $44 = $3; $45 = $4; (_nk_str_append_text_char($43,$44,$45)|0); $0 = 1; $109 = $0; STACKTOP = sp;return ($109|0); } $46 = $4; $47 = $46; $48 = (_nk_buffer_alloc($43,0,$47,0)|0); $mem = $48; $49 = $mem; $50 = ($49|0)!=(0|0); if (!($50)) { $0 = 0; $109 = $0; STACKTOP = sp;return ($109|0); } $51 = $2; $52 = $4; $53 = (($51) + ($52))|0; $54 = $copylen; $55 = (($54) - 1)|0; $56 = (($53) + ($55))|0; $57 = ($56|0)>=(0); if (!($57)) { ___assert_fail((13781|0),(13400|0),4637,(13750|0)); // unreachable; } $58 = $2; $59 = $copylen; $60 = (($59) - 1)|0; $61 = (($58) + ($60))|0; $62 = ($61|0)>=(0); if (!($62)) { ___assert_fail((13829|0),(13400|0),4638,(13750|0)); // unreachable; } $63 = $1; $64 = ((($63)) + 32|0); $65 = HEAP32[$64>>2]|0; $66 = $2; $67 = $4; $68 = (($66) + ($67))|0; $69 = $copylen; $70 = (($69) - 1)|0; $71 = (($68) + ($70))|0; $72 = (($65) + ($71)|0); $dst = $72; $73 = $1; $74 = ((($73)) + 32|0); $75 = HEAP32[$74>>2]|0; $76 = $2; $77 = $copylen; $78 = (($77) - 1)|0; $79 = (($76) + ($78))|0; $80 = (($75) + ($79)|0); $src = $80; $i = 0; while(1) { $81 = $i; $82 = $copylen; $83 = ($81|0)<($82|0); if (!($83)) { break; } $84 = $src; $85 = ((($84)) + -1|0); $src = $85; $86 = HEAP8[$84>>0]|0; $87 = $dst; $88 = ((($87)) + -1|0); $dst = $88; HEAP8[$87>>0] = $86; $89 = $i; $90 = (($89) + 1)|0; $i = $90; } $91 = $1; $92 = ((($91)) + 32|0); $93 = HEAP32[$92>>2]|0; $94 = $2; $95 = (($93) + ($94)|0); $mem = $95; $96 = $mem; $97 = $3; $98 = $4; $99 = $98; (_nk_memcopy($96,$97,$99)|0); $100 = $1; $101 = ((($100)) + 32|0); $102 = HEAP32[$101>>2]|0; $103 = $1; $104 = ((($103)) + 44|0); $105 = HEAP32[$104>>2]|0; $106 = (_nk_utf_len($102,$105)|0); $107 = $1; $108 = ((($107)) + 60|0); HEAP32[$108>>2] = $106; $0 = 1; $109 = $0; STACKTOP = sp;return ($109|0); } } $0 = 0; $109 = $0; STACKTOP = sp;return ($109|0); } function _nk_str_insert_at_rune($str,$pos,$cstr,$len) { $str = $str|0; $pos = $pos|0; $cstr = $cstr|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $begin = 0, $buffer = 0, $glyph_len = 0, $or$cond = 0, $or$cond3 = 0, $unicode = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $glyph_len = sp + 12|0; $unicode = sp + 8|0; $1 = $str; $2 = $pos; $3 = $cstr; $4 = $len; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13396|0),(13400|0),4656,(13866|0)); // unreachable; } $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((13888|0),(13400|0),4657,(13866|0)); // unreachable; } $9 = $4; $10 = ($9|0)!=(0); if (!($10)) { ___assert_fail((13552|0),(13400|0),4658,(13866|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0|0); $13 = $3; $14 = ($13|0)!=(0|0); $or$cond = $12 & $14; $15 = $4; $16 = ($15|0)!=(0); $or$cond3 = $or$cond & $16; if (!($or$cond3)) { $0 = 0; $33 = $0; STACKTOP = sp;return ($33|0); } $17 = $1; $18 = $2; $19 = (_nk_str_at_rune($17,$18,$unicode,$glyph_len)|0); $begin = $19; $20 = $1; $21 = (_nk_str_get_const($20)|0); $buffer = $21; $22 = $begin; $23 = ($22|0)!=(0|0); if ($23) { $24 = $1; $25 = $begin; $26 = $buffer; $27 = $25; $28 = $26; $29 = (($27) - ($28))|0; $30 = $3; $31 = $4; $32 = (_nk_str_insert_text_char($24,$29,$30,$31)|0); $0 = $32; $33 = $0; STACKTOP = sp;return ($33|0); } else { $0 = 0; $33 = $0; STACKTOP = sp;return ($33|0); } return (0)|0; } function _nk_str_at_rune($str,$pos,$unicode,$len) { $str = $str|0; $pos = $pos|0; $unicode = $unicode|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $glyph_len = 0, $i = 0; var $or$cond = 0, $or$cond3 = 0, $src_len = 0, $text = 0, $text_len = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $str; $2 = $pos; $3 = $unicode; $4 = $len; $i = 0; $src_len = 0; $glyph_len = 0; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13396|0),(13400|0),4834,(14046|0)); // unreachable; } $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((13544|0),(13400|0),4835,(14046|0)); // unreachable; } $9 = $4; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((13552|0),(13400|0),4836,(14046|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0|0); $13 = $3; $14 = ($13|0)!=(0|0); $or$cond = $12 & $14; $15 = $4; $16 = ($15|0)!=(0|0); $or$cond3 = $or$cond & $16; if (!($or$cond3)) { $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } $17 = $2; $18 = ($17|0)<(0); if ($18) { $19 = $3; HEAP32[$19>>2] = 0; $20 = $4; HEAP32[$20>>2] = 0; $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } $21 = $1; $22 = ((($21)) + 32|0); $23 = HEAP32[$22>>2]|0; $text = $23; $24 = $1; $25 = ((($24)) + 44|0); $26 = HEAP32[$25>>2]|0; $text_len = $26; $27 = $text; $28 = $3; $29 = $text_len; $30 = (_nk_utf_decode($27,$28,$29)|0); $glyph_len = $30; while(1) { $31 = $glyph_len; $32 = ($31|0)!=(0); if (!($32)) { break; } $33 = $i; $34 = $2; $35 = ($33|0)==($34|0); $36 = $glyph_len; if ($35) { label = 14; break; } $38 = $i; $39 = (($38) + ($36))|0; $i = $39; $40 = $src_len; $41 = $glyph_len; $42 = (($40) + ($41))|0; $src_len = $42; $43 = $text; $44 = $src_len; $45 = (($43) + ($44)|0); $46 = $3; $47 = $text_len; $48 = $src_len; $49 = (($47) - ($48))|0; $50 = (_nk_utf_decode($45,$46,$49)|0); $glyph_len = $50; } if ((label|0) == 14) { $37 = $4; HEAP32[$37>>2] = $36; } $51 = $i; $52 = $2; $53 = ($51|0)!=($52|0); if ($53) { $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } else { $54 = $text; $55 = $src_len; $56 = (($54) + ($55)|0); $0 = $56; $57 = $0; STACKTOP = sp;return ($57|0); } return (0)|0; } function _nk_str_get_const($s) { $s = $s|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $s; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13691|0),(13400|0),4927,(14077|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 60|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); if ($9) { $10 = $1; $11 = ((($10)) + 44|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0); if ($13) { $14 = $1; $15 = ((($14)) + 32|0); $16 = HEAP32[$15>>2]|0; $0 = $16; $17 = $0; STACKTOP = sp;return ($17|0); } } } $0 = 0; $17 = $0; STACKTOP = sp;return ($17|0); } function _nk_str_insert_text_char($str,$pos,$text,$len) { $str = $str|0; $pos = $pos|0; $text = $text|0; $len = $len|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $str; $1 = $pos; $2 = $text; $3 = $len; $4 = $0; $5 = $1; $6 = $2; $7 = $3; $8 = (_nk_str_insert_at_char($4,$5,$6,$7)|0); STACKTOP = sp;return ($8|0); } function _nk_str_insert_text_runes($str,$pos,$runes,$len) { $str = $str|0; $pos = $pos|0; $runes = $runes|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $byte_len = 0, $glyph = 0, $i = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $glyph = sp + 28|0; $1 = $str; $2 = $pos; $3 = $runes; $4 = $len; $i = 0; $byte_len = 0; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13396|0),(13400|0),4715,(13898|0)); // unreachable; } $7 = $1; $8 = ($7|0)!=(0|0); $9 = $3; $10 = ($9|0)!=(0|0); $or$cond = $8 & $10; $11 = $4; $12 = ($11|0)!=(0); $or$cond3 = $or$cond & $12; if (!($or$cond3)) { $0 = 0; $31 = $0; STACKTOP = sp;return ($31|0); } $i = 0; while(1) { $13 = $i; $14 = $4; $15 = ($13|0)<($14|0); if (!($15)) { break; } $16 = $i; $17 = $3; $18 = (($17) + ($16<<2)|0); $19 = HEAP32[$18>>2]|0; $20 = (_nk_utf_encode($19,$glyph,4)|0); $byte_len = $20; $21 = $byte_len; $22 = ($21|0)!=(0); if (!($22)) { break; } $23 = $1; $24 = $2; $25 = $i; $26 = (($24) + ($25))|0; $27 = $byte_len; (_nk_str_insert_at_rune($23,$26,$glyph,$27)|0); $28 = $i; $29 = (($28) + 1)|0; $i = $29; } $30 = $4; $0 = $30; $31 = $0; STACKTOP = sp;return ($31|0); } function _nk_str_remove_chars($s,$len) { $s = $s|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $s; $1 = $len; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13691|0),(13400|0),4744,(13923|0)); // unreachable; } $4 = $1; $5 = ($4|0)>=(0); if (!($5)) { ___assert_fail((13772|0),(13400|0),4745,(13923|0)); // unreachable; } $6 = $0; $7 = ($6|0)==(0|0); $8 = $1; $9 = ($8|0)<(0); $or$cond = $7 | $9; if ($or$cond) { STACKTOP = sp;return; } $10 = $1; $11 = $0; $12 = ((($11)) + 44|0); $13 = HEAP32[$12>>2]|0; $14 = ($10>>>0)>($13>>>0); if ($14) { STACKTOP = sp;return; } $15 = $0; $16 = ((($15)) + 44|0); $17 = HEAP32[$16>>2]|0; $18 = $1; $19 = (($17) - ($18))|0; $20 = ($19|0)>=(0); if (!($20)) { ___assert_fail((13943|0),(13400|0),4747,(13923|0)); // unreachable; } $21 = $1; $22 = $0; $23 = ((($22)) + 44|0); $24 = HEAP32[$23>>2]|0; $25 = (($24) - ($21))|0; HEAP32[$23>>2] = $25; $26 = $0; $27 = ((($26)) + 32|0); $28 = HEAP32[$27>>2]|0; $29 = $0; $30 = ((($29)) + 44|0); $31 = HEAP32[$30>>2]|0; $32 = (_nk_utf_len($28,$31)|0); $33 = $0; $34 = ((($33)) + 60|0); HEAP32[$34>>2] = $32; STACKTOP = sp;return; } function _nk_str_delete_chars($s,$pos,$len) { $s = $s|0; $pos = $pos|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $8 = 0, $9 = 0, $dst = 0, $or$cond = 0, $src = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $s; $1 = $pos; $2 = $len; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13691|0),(13400|0),4777,(13986|0)); // unreachable; } $5 = $0; $6 = ($5|0)!=(0|0); $7 = $2; $8 = ($7|0)!=(0); $or$cond = $6 & $8; if (!($or$cond)) { STACKTOP = sp;return; } $9 = $1; $10 = $0; $11 = ((($10)) + 44|0); $12 = HEAP32[$11>>2]|0; $13 = ($9>>>0)>($12>>>0); if ($13) { STACKTOP = sp;return; } $14 = $1; $15 = $2; $16 = (($14) + ($15))|0; $17 = $0; $18 = ((($17)) + 44|0); $19 = HEAP32[$18>>2]|0; $20 = ($16>>>0)>($19>>>0); if ($20) { STACKTOP = sp;return; } $21 = $1; $22 = $2; $23 = (($21) + ($22))|0; $24 = $0; $25 = ((($24)) + 44|0); $26 = HEAP32[$25>>2]|0; $27 = ($23>>>0)<($26>>>0); $28 = $0; do { if ($27) { $29 = ((($28)) + 32|0); $30 = HEAP32[$29>>2]|0; $31 = $1; $32 = (($30) + ($31)|0); $dst = $32; $33 = $0; $34 = ((($33)) + 32|0); $35 = HEAP32[$34>>2]|0; $36 = $1; $37 = $2; $38 = (($36) + ($37))|0; $39 = (($35) + ($38)|0); $src = $39; $40 = $dst; $41 = $src; $42 = $0; $43 = ((($42)) + 44|0); $44 = HEAP32[$43>>2]|0; $45 = $1; $46 = $2; $47 = (($45) + ($46))|0; $48 = (($44) - ($47))|0; (_nk_memcopy($40,$41,$48)|0); $49 = $0; $50 = ((($49)) + 44|0); $51 = HEAP32[$50>>2]|0; $52 = $2; $53 = (($51) - ($52))|0; $54 = ($53|0)>=(0); if ($54) { $55 = $2; $56 = $0; $57 = ((($56)) + 44|0); $58 = HEAP32[$57>>2]|0; $59 = (($58) - ($55))|0; HEAP32[$57>>2] = $59; break; } else { ___assert_fail((13943|0),(13400|0),4786,(13986|0)); // unreachable; } } else { $60 = $2; _nk_str_remove_chars($28,$60); } } while(0); $61 = $0; $62 = ((($61)) + 32|0); $63 = HEAP32[$62>>2]|0; $64 = $0; $65 = ((($64)) + 44|0); $66 = HEAP32[$65>>2]|0; $67 = (_nk_utf_len($63,$66)|0); $68 = $0; $69 = ((($68)) + 60|0); HEAP32[$69>>2] = $67; STACKTOP = sp;return; } function _nk_str_delete_runes($s,$pos,$len) { $s = $s|0; $pos = $pos|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $9 = 0, $begin = 0, $end = 0, $temp = 0, $unicode = 0, $unused = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $unicode = sp + 12|0; $unused = sp; $0 = $s; $1 = $pos; $2 = $len; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13691|0),(13400|0),4801,(14006|0)); // unreachable; } $5 = $0; $6 = ((($5)) + 60|0); $7 = HEAP32[$6>>2]|0; $8 = $1; $9 = $2; $10 = (($8) + ($9))|0; $11 = ($7|0)>=($10|0); if (!($11)) { ___assert_fail((14026|0),(13400|0),4802,(14006|0)); // unreachable; } $12 = $0; $13 = ((($12)) + 60|0); $14 = HEAP32[$13>>2]|0; $15 = $1; $16 = $2; $17 = (($15) + ($16))|0; $18 = ($14|0)<($17|0); if ($18) { $19 = $0; $20 = ((($19)) + 60|0); $21 = HEAP32[$20>>2]|0; $22 = $1; $23 = (($21) - ($22))|0; $24 = $0; $25 = ((($24)) + 60|0); $26 = HEAP32[$25>>2]|0; $27 = ($23|0)<($26|0); $28 = $0; $29 = ((($28)) + 60|0); $30 = HEAP32[$29>>2]|0; $31 = $1; $32 = (($30) - ($31))|0; $33 = $27 ? $32 : $30; $34 = ($33|0)<(0); if ($34) { $50 = 0; } else { $35 = $0; $36 = ((($35)) + 60|0); $37 = HEAP32[$36>>2]|0; $38 = $1; $39 = (($37) - ($38))|0; $40 = $0; $41 = ((($40)) + 60|0); $42 = HEAP32[$41>>2]|0; $43 = ($39|0)<($42|0); $44 = $0; $45 = ((($44)) + 60|0); $46 = HEAP32[$45>>2]|0; $47 = $1; $48 = (($46) - ($47))|0; $49 = $43 ? $48 : $46; $50 = $49; } $2 = $50; } $51 = $2; $52 = ($51|0)!=(0); if (!($52)) { STACKTOP = sp;return; } $53 = $0; $54 = ((($53)) + 32|0); $55 = HEAP32[$54>>2]|0; $temp = $55; $56 = $0; $57 = $1; $58 = (_nk_str_at_rune($56,$57,$unicode,$unused)|0); $begin = $58; $59 = $begin; $60 = ($59|0)!=(0|0); if (!($60)) { STACKTOP = sp;return; } $61 = $begin; $62 = $0; $63 = ((($62)) + 32|0); HEAP32[$63>>2] = $61; $64 = $0; $65 = $2; $66 = (_nk_str_at_rune($64,$65,$unicode,$unused)|0); $end = $66; $67 = $temp; $68 = $0; $69 = ((($68)) + 32|0); HEAP32[$69>>2] = $67; $70 = $end; $71 = ($70|0)!=(0|0); if (!($71)) { STACKTOP = sp;return; } $72 = $0; $73 = $begin; $74 = $temp; $75 = $73; $76 = $74; $77 = (($75) - ($76))|0; $78 = $end; $79 = $begin; $80 = $78; $81 = $79; $82 = (($80) - ($81))|0; _nk_str_delete_chars($72,$77,$82); STACKTOP = sp;return; } function _nk_str_at_const($str,$pos,$unicode,$len) { $str = $str|0; $pos = $pos|0; $unicode = $unicode|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $glyph_len = 0, $i = 0; var $or$cond = 0, $or$cond3 = 0, $src_len = 0, $text = 0, $text_len = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $str; $2 = $pos; $3 = $unicode; $4 = $len; $i = 0; $src_len = 0; $glyph_len = 0; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13396|0),(13400|0),4879,(14061|0)); // unreachable; } $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((13544|0),(13400|0),4880,(14061|0)); // unreachable; } $9 = $4; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((13552|0),(13400|0),4881,(14061|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0|0); $13 = $3; $14 = ($13|0)!=(0|0); $or$cond = $12 & $14; $15 = $4; $16 = ($15|0)!=(0|0); $or$cond3 = $or$cond & $16; if (!($or$cond3)) { $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } $17 = $2; $18 = ($17|0)<(0); if ($18) { $19 = $3; HEAP32[$19>>2] = 0; $20 = $4; HEAP32[$20>>2] = 0; $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } $21 = $1; $22 = ((($21)) + 32|0); $23 = HEAP32[$22>>2]|0; $text = $23; $24 = $1; $25 = ((($24)) + 44|0); $26 = HEAP32[$25>>2]|0; $text_len = $26; $27 = $text; $28 = $3; $29 = $text_len; $30 = (_nk_utf_decode($27,$28,$29)|0); $glyph_len = $30; while(1) { $31 = $glyph_len; $32 = ($31|0)!=(0); if (!($32)) { break; } $33 = $i; $34 = $2; $35 = ($33|0)==($34|0); if ($35) { label = 14; break; } $38 = $i; $39 = (($38) + 1)|0; $i = $39; $40 = $src_len; $41 = $glyph_len; $42 = (($40) + ($41))|0; $src_len = $42; $43 = $text; $44 = $src_len; $45 = (($43) + ($44)|0); $46 = $3; $47 = $text_len; $48 = $src_len; $49 = (($47) - ($48))|0; $50 = (_nk_utf_decode($45,$46,$49)|0); $glyph_len = $50; } if ((label|0) == 14) { $36 = $glyph_len; $37 = $4; HEAP32[$37>>2] = $36; } $51 = $i; $52 = $2; $53 = ($51|0)!=($52|0); if ($53) { $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } else { $54 = $text; $55 = $src_len; $56 = (($54) + ($55)|0); $0 = $56; $57 = $0; STACKTOP = sp;return ($57|0); } return (0)|0; } function _nk_str_rune_at($str,$pos) { $str = $str|0; $pos = $pos|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $len = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $len = sp + 4|0; $unicode = sp; $0 = $str; $1 = $pos; HEAP32[$unicode>>2] = 0; $2 = $0; $3 = $1; (_nk_str_at_const($2,$3,$unicode,$len)|0); $4 = HEAP32[$unicode>>2]|0; STACKTOP = sp;return ($4|0); } function _nk_str_len($s) { $s = $s|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $s; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13691|0),(13400|0),4935,(14094|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 60|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); if ($9) { $10 = $1; $11 = ((($10)) + 44|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0); if ($13) { $14 = $1; $15 = ((($14)) + 60|0); $16 = HEAP32[$15>>2]|0; $0 = $16; $17 = $0; STACKTOP = sp;return ($17|0); } } } $0 = 0; $17 = $0; STACKTOP = sp;return ($17|0); } function _nk_str_len_char($s) { $s = $s|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $s; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13691|0),(13400|0),4943,(14105|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 60|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); if ($9) { $10 = $1; $11 = ((($10)) + 44|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0); if ($13) { $14 = $1; $15 = ((($14)) + 44|0); $16 = HEAP32[$15>>2]|0; $0 = $16; $17 = $0; STACKTOP = sp;return ($17|0); } } } $0 = 0; $17 = $0; STACKTOP = sp;return ($17|0); } function _nk_push_scissor($b,$r) { $b = $b|0; $r = $r|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, $cmd = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13556|0),(13400|0),5035,(14121|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = +HEAPF32[$r>>2]; $6 = $0; $7 = ((($6)) + 4|0); HEAPF32[$7>>2] = $5; $8 = ((($r)) + 4|0); $9 = +HEAPF32[$8>>2]; $10 = $0; $11 = ((($10)) + 4|0); $12 = ((($11)) + 4|0); HEAPF32[$12>>2] = $9; $13 = ((($r)) + 8|0); $14 = +HEAPF32[$13>>2]; $15 = $0; $16 = ((($15)) + 4|0); $17 = ((($16)) + 8|0); HEAPF32[$17>>2] = $14; $18 = ((($r)) + 12|0); $19 = +HEAPF32[$18>>2]; $20 = $0; $21 = ((($20)) + 4|0); $22 = ((($21)) + 12|0); HEAPF32[$22>>2] = $19; $23 = $0; $24 = (_nk_command_buffer_push($23,1,16)|0); $cmd = $24; $25 = $cmd; $26 = ($25|0)!=(0|0); if (!($26)) { STACKTOP = sp;return; } $27 = +HEAPF32[$r>>2]; $28 = (~~(($27))); $29 = $cmd; $30 = ((($29)) + 8|0); HEAP16[$30>>1] = $28; $31 = ((($r)) + 4|0); $32 = +HEAPF32[$31>>2]; $33 = (~~(($32))); $34 = $cmd; $35 = ((($34)) + 10|0); HEAP16[$35>>1] = $33; $36 = ((($r)) + 8|0); $37 = +HEAPF32[$36>>2]; $38 = 0.0 < $37; $39 = ((($r)) + 8|0); $40 = +HEAPF32[$39>>2]; $41 = $38 ? $40 : 0.0; $42 = (~~(($41))&65535); $43 = $cmd; $44 = ((($43)) + 12|0); HEAP16[$44>>1] = $42; $45 = ((($r)) + 12|0); $46 = +HEAPF32[$45>>2]; $47 = 0.0 < $46; $48 = ((($r)) + 12|0); $49 = +HEAPF32[$48>>2]; $50 = $47 ? $49 : 0.0; $51 = (~~(($50))&65535); $52 = $cmd; $53 = ((($52)) + 14|0); HEAP16[$53>>1] = $51; STACKTOP = sp;return; } function _nk_command_buffer_push($b,$t,$size) { $b = $b|0; $t = $t|0; $size = $size|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $alignment = 0, $cmd = 0, $memory = 0; var $unaligned = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $b; $2 = $t; $3 = $size; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13556|0),(13400|0),5009,(29865|0)); // unreachable; } $6 = $1; $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((29888|0),(13400|0),5010,(29865|0)); // unreachable; } $9 = $1; $10 = ($9|0)!=(0|0); if (!($10)) { $0 = 0; $56 = $0; STACKTOP = sp;return ($56|0); } $11 = $1; $12 = HEAP32[$11>>2]|0; $13 = $3; $14 = (_nk_buffer_alloc($12,0,$13,4)|0); $cmd = $14; $15 = $cmd; $16 = ($15|0)!=(0|0); if ($16) { $17 = $cmd; $18 = $1; $19 = HEAP32[$18>>2]|0; $20 = ((($19)) + 32|0); $21 = HEAP32[$20>>2]|0; $22 = $17; $23 = $21; $24 = (($22) - ($23))|0; $25 = $1; $26 = ((($25)) + 36|0); HEAP32[$26>>2] = $24; $27 = $cmd; $28 = $3; $29 = (($27) + ($28)|0); $unaligned = $29; $30 = $unaligned; $31 = ((($30)) + 3|0); $32 = $31; $33 = $32 & -4; $34 = $33; $memory = $34; $35 = $memory; $36 = $unaligned; $37 = $35; $38 = $36; $39 = (($37) - ($38))|0; $alignment = $39; $40 = $2; $41 = $cmd; HEAP32[$41>>2] = $40; $42 = $1; $43 = HEAP32[$42>>2]|0; $44 = ((($43)) + 44|0); $45 = HEAP32[$44>>2]|0; $46 = $alignment; $47 = (($45) + ($46))|0; $48 = $cmd; $49 = ((($48)) + 4|0); HEAP32[$49>>2] = $47; $50 = $cmd; $51 = ((($50)) + 4|0); $52 = HEAP32[$51>>2]|0; $53 = $1; $54 = ((($53)) + 32|0); HEAP32[$54>>2] = $52; $55 = $cmd; $0 = $55; $56 = $0; STACKTOP = sp;return ($56|0); } else { $0 = 0; $56 = $0; STACKTOP = sp;return ($56|0); } return (0)|0; } function _nk_stroke_line($b,$x0,$y0,$x1,$y1,$line_thickness,$c) { $b = $b|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; $line_thickness = +$line_thickness; $c = $c|0; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cmd = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $x0; $2 = $y0; $3 = $x1; $4 = $y1; $5 = $line_thickness; $6 = $0; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((13556|0),(13400|0),5057,(14137|0)); // unreachable; } $8 = $0; $9 = ($8|0)!=(0|0); if (!($9)) { STACKTOP = sp;return; } $10 = $0; $11 = (_nk_command_buffer_push($10,2,24)|0); $cmd = $11; $12 = $cmd; $13 = ($12|0)!=(0|0); if (!($13)) { STACKTOP = sp;return; } $14 = $5; $15 = (~~(($14))&65535); $16 = $cmd; $17 = ((($16)) + 8|0); HEAP16[$17>>1] = $15; $18 = $1; $19 = (~~(($18))); $20 = $cmd; $21 = ((($20)) + 10|0); HEAP16[$21>>1] = $19; $22 = $2; $23 = (~~(($22))); $24 = $cmd; $25 = ((($24)) + 10|0); $26 = ((($25)) + 2|0); HEAP16[$26>>1] = $23; $27 = $3; $28 = (~~(($27))); $29 = $cmd; $30 = ((($29)) + 14|0); HEAP16[$30>>1] = $28; $31 = $4; $32 = (~~(($31))); $33 = $cmd; $34 = ((($33)) + 14|0); $35 = ((($34)) + 2|0); HEAP16[$35>>1] = $32; $36 = $cmd; $37 = ((($36)) + 18|0); ;HEAP8[$37>>0]=HEAP8[$c>>0]|0;HEAP8[$37+1>>0]=HEAP8[$c+1>>0]|0;HEAP8[$37+2>>0]=HEAP8[$c+2>>0]|0;HEAP8[$37+3>>0]=HEAP8[$c+3>>0]|0; STACKTOP = sp;return; } function _nk_fill_rect($b,$rect,$rounding,$c) { $b = $b|0; $rect = $rect|0; $rounding = +$rounding; $c = $c|0; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0; var $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0; var $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $clip = 0, $cmd = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $rounding; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13556|0),(13400|0),5124,(14152|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = ((($c)) + 3|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = ($8|0)==(0); if ($9) { STACKTOP = sp;return; } $10 = $0; $11 = ((($10)) + 20|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0); if ($13) { $14 = $0; $15 = ((($14)) + 4|0); $clip = $15; $16 = $clip; $17 = +HEAPF32[$16>>2]; $18 = +HEAPF32[$rect>>2]; $19 = ((($rect)) + 8|0); $20 = +HEAPF32[$19>>2]; $21 = $18 + $20; $22 = $17 > $21; if ($22) { STACKTOP = sp;return; } $23 = $clip; $24 = +HEAPF32[$23>>2]; $25 = $clip; $26 = ((($25)) + 8|0); $27 = +HEAPF32[$26>>2]; $28 = $24 + $27; $29 = +HEAPF32[$rect>>2]; $30 = $28 < $29; if ($30) { STACKTOP = sp;return; } $31 = $clip; $32 = ((($31)) + 4|0); $33 = +HEAPF32[$32>>2]; $34 = ((($rect)) + 4|0); $35 = +HEAPF32[$34>>2]; $36 = ((($rect)) + 12|0); $37 = +HEAPF32[$36>>2]; $38 = $35 + $37; $39 = $33 > $38; if ($39) { STACKTOP = sp;return; } $40 = $clip; $41 = ((($40)) + 4|0); $42 = +HEAPF32[$41>>2]; $43 = $clip; $44 = ((($43)) + 12|0); $45 = +HEAPF32[$44>>2]; $46 = $42 + $45; $47 = ((($rect)) + 4|0); $48 = +HEAPF32[$47>>2]; $49 = $46 < $48; if ($49) { STACKTOP = sp;return; } } $50 = $0; $51 = (_nk_command_buffer_push($50,5,24)|0); $cmd = $51; $52 = $cmd; $53 = ($52|0)!=(0|0); if (!($53)) { STACKTOP = sp;return; } $54 = $1; $55 = (~~(($54))&65535); $56 = $cmd; $57 = ((($56)) + 8|0); HEAP16[$57>>1] = $55; $58 = +HEAPF32[$rect>>2]; $59 = (~~(($58))); $60 = $cmd; $61 = ((($60)) + 10|0); HEAP16[$61>>1] = $59; $62 = ((($rect)) + 4|0); $63 = +HEAPF32[$62>>2]; $64 = (~~(($63))); $65 = $cmd; $66 = ((($65)) + 12|0); HEAP16[$66>>1] = $64; $67 = ((($rect)) + 8|0); $68 = +HEAPF32[$67>>2]; $69 = 0.0 < $68; $70 = ((($rect)) + 8|0); $71 = +HEAPF32[$70>>2]; $72 = $69 ? $71 : 0.0; $73 = (~~(($72))&65535); $74 = $cmd; $75 = ((($74)) + 14|0); HEAP16[$75>>1] = $73; $76 = ((($rect)) + 12|0); $77 = +HEAPF32[$76>>2]; $78 = 0.0 < $77; $79 = ((($rect)) + 12|0); $80 = +HEAPF32[$79>>2]; $81 = $78 ? $80 : 0.0; $82 = (~~(($81))&65535); $83 = $cmd; $84 = ((($83)) + 16|0); HEAP16[$84>>1] = $82; $85 = $cmd; $86 = ((($85)) + 18|0); ;HEAP8[$86>>0]=HEAP8[$c>>0]|0;HEAP8[$86+1>>0]=HEAP8[$c+1>>0]|0;HEAP8[$86+2>>0]=HEAP8[$c+2>>0]|0;HEAP8[$86+3>>0]=HEAP8[$c+3>>0]|0; STACKTOP = sp;return; } function _nk_fill_rect_multi_color($b,$rect,$left,$top,$right,$bottom) { $b = $b|0; $rect = $rect|0; $left = $left|0; $top = $top|0; $right = $right|0; $bottom = $bottom|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0; var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $9 = 0, $clip = 0, $cmd = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13556|0),(13400|0),5149,(14165|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 20|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0); if ($8) { $9 = $0; $10 = ((($9)) + 4|0); $clip = $10; $11 = $clip; $12 = +HEAPF32[$11>>2]; $13 = +HEAPF32[$rect>>2]; $14 = ((($rect)) + 8|0); $15 = +HEAPF32[$14>>2]; $16 = $13 + $15; $17 = $12 > $16; if ($17) { STACKTOP = sp;return; } $18 = $clip; $19 = +HEAPF32[$18>>2]; $20 = $clip; $21 = ((($20)) + 8|0); $22 = +HEAPF32[$21>>2]; $23 = $19 + $22; $24 = +HEAPF32[$rect>>2]; $25 = $23 < $24; if ($25) { STACKTOP = sp;return; } $26 = $clip; $27 = ((($26)) + 4|0); $28 = +HEAPF32[$27>>2]; $29 = ((($rect)) + 4|0); $30 = +HEAPF32[$29>>2]; $31 = ((($rect)) + 12|0); $32 = +HEAPF32[$31>>2]; $33 = $30 + $32; $34 = $28 > $33; if ($34) { STACKTOP = sp;return; } $35 = $clip; $36 = ((($35)) + 4|0); $37 = +HEAPF32[$36>>2]; $38 = $clip; $39 = ((($38)) + 12|0); $40 = +HEAPF32[$39>>2]; $41 = $37 + $40; $42 = ((($rect)) + 4|0); $43 = +HEAPF32[$42>>2]; $44 = $41 < $43; if ($44) { STACKTOP = sp;return; } } $45 = $0; $46 = (_nk_command_buffer_push($45,6,32)|0); $cmd = $46; $47 = $cmd; $48 = ($47|0)!=(0|0); if (!($48)) { STACKTOP = sp;return; } $49 = +HEAPF32[$rect>>2]; $50 = (~~(($49))); $51 = $cmd; $52 = ((($51)) + 8|0); HEAP16[$52>>1] = $50; $53 = ((($rect)) + 4|0); $54 = +HEAPF32[$53>>2]; $55 = (~~(($54))); $56 = $cmd; $57 = ((($56)) + 10|0); HEAP16[$57>>1] = $55; $58 = ((($rect)) + 8|0); $59 = +HEAPF32[$58>>2]; $60 = 0.0 < $59; $61 = ((($rect)) + 8|0); $62 = +HEAPF32[$61>>2]; $63 = $60 ? $62 : 0.0; $64 = (~~(($63))&65535); $65 = $cmd; $66 = ((($65)) + 12|0); HEAP16[$66>>1] = $64; $67 = ((($rect)) + 12|0); $68 = +HEAPF32[$67>>2]; $69 = 0.0 < $68; $70 = ((($rect)) + 12|0); $71 = +HEAPF32[$70>>2]; $72 = $69 ? $71 : 0.0; $73 = (~~(($72))&65535); $74 = $cmd; $75 = ((($74)) + 14|0); HEAP16[$75>>1] = $73; $76 = $cmd; $77 = ((($76)) + 16|0); ;HEAP8[$77>>0]=HEAP8[$left>>0]|0;HEAP8[$77+1>>0]=HEAP8[$left+1>>0]|0;HEAP8[$77+2>>0]=HEAP8[$left+2>>0]|0;HEAP8[$77+3>>0]=HEAP8[$left+3>>0]|0; $78 = $cmd; $79 = ((($78)) + 20|0); ;HEAP8[$79>>0]=HEAP8[$top>>0]|0;HEAP8[$79+1>>0]=HEAP8[$top+1>>0]|0;HEAP8[$79+2>>0]=HEAP8[$top+2>>0]|0;HEAP8[$79+3>>0]=HEAP8[$top+3>>0]|0; $80 = $cmd; $81 = ((($80)) + 28|0); ;HEAP8[$81>>0]=HEAP8[$right>>0]|0;HEAP8[$81+1>>0]=HEAP8[$right+1>>0]|0;HEAP8[$81+2>>0]=HEAP8[$right+2>>0]|0;HEAP8[$81+3>>0]=HEAP8[$right+3>>0]|0; $82 = $cmd; $83 = ((($82)) + 24|0); ;HEAP8[$83>>0]=HEAP8[$bottom>>0]|0;HEAP8[$83+1>>0]=HEAP8[$bottom+1>>0]|0;HEAP8[$83+2>>0]=HEAP8[$bottom+2>>0]|0;HEAP8[$83+3>>0]=HEAP8[$bottom+3>>0]|0; STACKTOP = sp;return; } function _nk_fill_circle($b,$r,$c) { $b = $b|0; $r = $r|0; $c = $c|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0; var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $9 = 0, $clip = 0, $cmd = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13556|0),(13400|0),5197,(14190|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = ((($c)) + 3|0); $6 = HEAP8[$5>>0]|0; $7 = $6&255; $8 = ($7|0)==(0); if ($8) { STACKTOP = sp;return; } $9 = $0; $10 = ((($9)) + 20|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0); if ($12) { $13 = $0; $14 = ((($13)) + 4|0); $clip = $14; $15 = $clip; $16 = +HEAPF32[$15>>2]; $17 = +HEAPF32[$r>>2]; $18 = ((($r)) + 8|0); $19 = +HEAPF32[$18>>2]; $20 = $17 + $19; $21 = $16 > $20; if ($21) { STACKTOP = sp;return; } $22 = $clip; $23 = +HEAPF32[$22>>2]; $24 = $clip; $25 = ((($24)) + 8|0); $26 = +HEAPF32[$25>>2]; $27 = $23 + $26; $28 = +HEAPF32[$r>>2]; $29 = $27 < $28; if ($29) { STACKTOP = sp;return; } $30 = $clip; $31 = ((($30)) + 4|0); $32 = +HEAPF32[$31>>2]; $33 = ((($r)) + 4|0); $34 = +HEAPF32[$33>>2]; $35 = ((($r)) + 12|0); $36 = +HEAPF32[$35>>2]; $37 = $34 + $36; $38 = $32 > $37; if ($38) { STACKTOP = sp;return; } $39 = $clip; $40 = ((($39)) + 4|0); $41 = +HEAPF32[$40>>2]; $42 = $clip; $43 = ((($42)) + 12|0); $44 = +HEAPF32[$43>>2]; $45 = $41 + $44; $46 = ((($r)) + 4|0); $47 = +HEAPF32[$46>>2]; $48 = $45 < $47; if ($48) { STACKTOP = sp;return; } } $49 = $0; $50 = (_nk_command_buffer_push($49,8,20)|0); $cmd = $50; $51 = $cmd; $52 = ($51|0)!=(0|0); if (!($52)) { STACKTOP = sp;return; } $53 = +HEAPF32[$r>>2]; $54 = (~~(($53))); $55 = $cmd; $56 = ((($55)) + 8|0); HEAP16[$56>>1] = $54; $57 = ((($r)) + 4|0); $58 = +HEAPF32[$57>>2]; $59 = (~~(($58))); $60 = $cmd; $61 = ((($60)) + 10|0); HEAP16[$61>>1] = $59; $62 = ((($r)) + 8|0); $63 = +HEAPF32[$62>>2]; $64 = $63 < 0.0; $65 = ((($r)) + 8|0); $66 = +HEAPF32[$65>>2]; $67 = $64 ? 0.0 : $66; $68 = (~~(($67))&65535); $69 = $cmd; $70 = ((($69)) + 12|0); HEAP16[$70>>1] = $68; $71 = ((($r)) + 12|0); $72 = +HEAPF32[$71>>2]; $73 = $72 < 0.0; $74 = ((($r)) + 12|0); $75 = +HEAPF32[$74>>2]; $76 = $73 ? 0.0 : $75; $77 = (~~(($76))&65535); $78 = $cmd; $79 = ((($78)) + 14|0); HEAP16[$79>>1] = $77; $80 = $cmd; $81 = ((($80)) + 16|0); ;HEAP8[$81>>0]=HEAP8[$c>>0]|0;HEAP8[$81+1>>0]=HEAP8[$c+1>>0]|0;HEAP8[$81+2>>0]=HEAP8[$c+2>>0]|0;HEAP8[$81+3>>0]=HEAP8[$c+3>>0]|0; STACKTOP = sp;return; } function _nk_fill_triangle($b,$x0,$y0,$x1,$y1,$x2,$y2,$c) { $b = $b|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; $x2 = +$x2; $y2 = +$y2; $c = $c|0; var $0 = 0, $1 = 0.0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0.0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0.0, $124 = 0, $125 = 0, $126 = 0, $127 = 0.0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0.0, $30 = 0, $31 = 0; var $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0.0; var $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0; var $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0; var $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $clip = 0, $cmd = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $x0; $2 = $y0; $3 = $x1; $4 = $y1; $5 = $x2; $6 = $y2; $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((13556|0),(13400|0),5284,(14205|0)); // unreachable; } $9 = $0; $10 = ($9|0)!=(0|0); if (!($10)) { STACKTOP = sp;return; } $11 = ((($c)) + 3|0); $12 = HEAP8[$11>>0]|0; $13 = $12&255; $14 = ($13|0)!=(0); $15 = $0; $16 = ($15|0)!=(0|0); $or$cond = $14 & $16; if (!($or$cond)) { STACKTOP = sp;return; } $17 = $0; $18 = ((($17)) + 20|0); $19 = HEAP32[$18>>2]|0; $20 = ($19|0)!=(0); do { if ($20) { $21 = $0; $22 = ((($21)) + 4|0); $clip = $22; $23 = $clip; $24 = +HEAPF32[$23>>2]; $25 = $1; $26 = $24 <= $25; if ($26) { $27 = $1; $28 = $clip; $29 = +HEAPF32[$28>>2]; $30 = $clip; $31 = ((($30)) + 8|0); $32 = +HEAPF32[$31>>2]; $33 = $29 + $32; $34 = $27 <= $33; if ($34) { $35 = $clip; $36 = ((($35)) + 4|0); $37 = +HEAPF32[$36>>2]; $38 = $2; $39 = $37 <= $38; if ($39) { $40 = $2; $41 = $clip; $42 = ((($41)) + 4|0); $43 = +HEAPF32[$42>>2]; $44 = $clip; $45 = ((($44)) + 12|0); $46 = +HEAPF32[$45>>2]; $47 = $43 + $46; $48 = $40 <= $47; if ($48) { break; } } } } $49 = $clip; $50 = +HEAPF32[$49>>2]; $51 = $3; $52 = $50 <= $51; if ($52) { $53 = $3; $54 = $clip; $55 = +HEAPF32[$54>>2]; $56 = $clip; $57 = ((($56)) + 8|0); $58 = +HEAPF32[$57>>2]; $59 = $55 + $58; $60 = $53 <= $59; if ($60) { $61 = $clip; $62 = ((($61)) + 4|0); $63 = +HEAPF32[$62>>2]; $64 = $4; $65 = $63 <= $64; if ($65) { $66 = $4; $67 = $clip; $68 = ((($67)) + 4|0); $69 = +HEAPF32[$68>>2]; $70 = $clip; $71 = ((($70)) + 12|0); $72 = +HEAPF32[$71>>2]; $73 = $69 + $72; $74 = $66 <= $73; if ($74) { break; } } } } $75 = $clip; $76 = +HEAPF32[$75>>2]; $77 = $5; $78 = $76 <= $77; if (!($78)) { STACKTOP = sp;return; } $79 = $5; $80 = $clip; $81 = +HEAPF32[$80>>2]; $82 = $clip; $83 = ((($82)) + 8|0); $84 = +HEAPF32[$83>>2]; $85 = $81 + $84; $86 = $79 <= $85; if (!($86)) { STACKTOP = sp;return; } $87 = $clip; $88 = ((($87)) + 4|0); $89 = +HEAPF32[$88>>2]; $90 = $6; $91 = $89 <= $90; if (!($91)) { STACKTOP = sp;return; } $92 = $6; $93 = $clip; $94 = ((($93)) + 4|0); $95 = +HEAPF32[$94>>2]; $96 = $clip; $97 = ((($96)) + 12|0); $98 = +HEAPF32[$97>>2]; $99 = $95 + $98; $100 = $92 <= $99; if (!($100)) { STACKTOP = sp;return; } } } while(0); $101 = $0; $102 = (_nk_command_buffer_push($101,12,24)|0); $cmd = $102; $103 = $cmd; $104 = ($103|0)!=(0|0); if (!($104)) { STACKTOP = sp;return; } $105 = $1; $106 = (~~(($105))); $107 = $cmd; $108 = ((($107)) + 8|0); HEAP16[$108>>1] = $106; $109 = $2; $110 = (~~(($109))); $111 = $cmd; $112 = ((($111)) + 8|0); $113 = ((($112)) + 2|0); HEAP16[$113>>1] = $110; $114 = $3; $115 = (~~(($114))); $116 = $cmd; $117 = ((($116)) + 12|0); HEAP16[$117>>1] = $115; $118 = $4; $119 = (~~(($118))); $120 = $cmd; $121 = ((($120)) + 12|0); $122 = ((($121)) + 2|0); HEAP16[$122>>1] = $119; $123 = $5; $124 = (~~(($123))); $125 = $cmd; $126 = ((($125)) + 16|0); HEAP16[$126>>1] = $124; $127 = $6; $128 = (~~(($127))); $129 = $cmd; $130 = ((($129)) + 16|0); $131 = ((($130)) + 2|0); HEAP16[$131>>1] = $128; $132 = $cmd; $133 = ((($132)) + 20|0); ;HEAP8[$133>>0]=HEAP8[$c>>0]|0;HEAP8[$133+1>>0]=HEAP8[$c+1>>0]|0;HEAP8[$133+2>>0]=HEAP8[$c+2>>0]|0;HEAP8[$133+3>>0]=HEAP8[$c+3>>0]|0; STACKTOP = sp;return; } function _nk_draw_image($b,$r,$img) { $b = $b|0; $r = $r|0; $img = $img|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0; var $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0; var $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $9 = 0, $c = 0, $cmd = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $b; $1 = $img; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((13556|0),(13400|0),5378,(14222|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $0; $7 = ((($6)) + 20|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); if ($9) { $10 = $0; $11 = ((($10)) + 4|0); $c = $11; $12 = $c; $13 = ((($12)) + 8|0); $14 = +HEAPF32[$13>>2]; $15 = $14 != 0.0; if (!($15)) { STACKTOP = sp;return; } $16 = $c; $17 = ((($16)) + 12|0); $18 = +HEAPF32[$17>>2]; $19 = $18 != 0.0; if (!($19)) { STACKTOP = sp;return; } $20 = $c; $21 = +HEAPF32[$20>>2]; $22 = +HEAPF32[$r>>2]; $23 = ((($r)) + 8|0); $24 = +HEAPF32[$23>>2]; $25 = $22 + $24; $26 = $21 > $25; if ($26) { STACKTOP = sp;return; } $27 = $c; $28 = +HEAPF32[$27>>2]; $29 = $c; $30 = ((($29)) + 8|0); $31 = +HEAPF32[$30>>2]; $32 = $28 + $31; $33 = +HEAPF32[$r>>2]; $34 = $32 < $33; if ($34) { STACKTOP = sp;return; } $35 = $c; $36 = ((($35)) + 4|0); $37 = +HEAPF32[$36>>2]; $38 = ((($r)) + 4|0); $39 = +HEAPF32[$38>>2]; $40 = ((($r)) + 12|0); $41 = +HEAPF32[$40>>2]; $42 = $39 + $41; $43 = $37 > $42; if ($43) { STACKTOP = sp;return; } $44 = $c; $45 = ((($44)) + 4|0); $46 = +HEAPF32[$45>>2]; $47 = $c; $48 = ((($47)) + 12|0); $49 = +HEAPF32[$48>>2]; $50 = $46 + $49; $51 = ((($r)) + 4|0); $52 = +HEAPF32[$51>>2]; $53 = $50 < $52; if ($53) { STACKTOP = sp;return; } } $54 = $0; $55 = (_nk_command_buffer_push($54,17,32)|0); $cmd = $55; $56 = $cmd; $57 = ($56|0)!=(0|0); if (!($57)) { STACKTOP = sp;return; } $58 = +HEAPF32[$r>>2]; $59 = (~~(($58))); $60 = $cmd; $61 = ((($60)) + 8|0); HEAP16[$61>>1] = $59; $62 = ((($r)) + 4|0); $63 = +HEAPF32[$62>>2]; $64 = (~~(($63))); $65 = $cmd; $66 = ((($65)) + 10|0); HEAP16[$66>>1] = $64; $67 = ((($r)) + 8|0); $68 = +HEAPF32[$67>>2]; $69 = 0.0 < $68; $70 = ((($r)) + 8|0); $71 = +HEAPF32[$70>>2]; $72 = $69 ? $71 : 0.0; $73 = (~~(($72))&65535); $74 = $cmd; $75 = ((($74)) + 12|0); HEAP16[$75>>1] = $73; $76 = ((($r)) + 12|0); $77 = +HEAPF32[$76>>2]; $78 = 0.0 < $77; $79 = ((($r)) + 12|0); $80 = +HEAPF32[$79>>2]; $81 = $78 ? $80 : 0.0; $82 = (~~(($81))&65535); $83 = $cmd; $84 = ((($83)) + 14|0); HEAP16[$84>>1] = $82; $85 = $cmd; $86 = ((($85)) + 16|0); $87 = $1; ;HEAP32[$86>>2]=HEAP32[$87>>2]|0;HEAP32[$86+4>>2]=HEAP32[$87+4>>2]|0;HEAP32[$86+8>>2]=HEAP32[$87+8>>2]|0;HEAP32[$86+12>>2]=HEAP32[$87+12>>2]|0; STACKTOP = sp;return; } function _nk_draw_text($b,$r,$string,$length,$font,$bg,$fg) { $b = $b|0; $r = $r|0; $string = $string|0; $length = $length|0; $font = $font|0; $bg = $bg|0; $fg = $fg|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0, $113 = 0, $114 = 0; var $115 = 0.0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0; var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0; var $42 = 0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0; var $60 = 0, $61 = 0, $62 = 0.0, $63 = 0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0, $78 = 0; var $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0.0, $83 = 0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; var $97 = 0, $98 = 0, $99 = 0, $c = 0, $cmd = 0, $glyphs = 0, $or$cond = 0, $or$cond3 = 0, $text_width = 0.0, $txt_width = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 36|0; $glyphs = sp + 4|0; $txt_width = sp; $0 = $b; $1 = $string; $2 = $length; $3 = $font; $text_width = 0.0; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13556|0),(13400|0),5404,(14236|0)); // unreachable; } $6 = $3; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((14249|0),(13400|0),5405,(14236|0)); // unreachable; } $8 = $0; $9 = ($8|0)!=(0|0); $10 = $1; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; $12 = $2; $13 = ($12|0)!=(0); $or$cond3 = $or$cond & $13; if (!($or$cond3)) { STACKTOP = sp;return; } $14 = ((($bg)) + 3|0); $15 = HEAP8[$14>>0]|0; $16 = $15&255; $17 = ($16|0)==(0); if ($17) { $18 = ((($fg)) + 3|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $21 = ($20|0)==(0); if ($21) { STACKTOP = sp;return; } } $22 = $0; $23 = ((($22)) + 20|0); $24 = HEAP32[$23>>2]|0; $25 = ($24|0)!=(0); if ($25) { $26 = $0; $27 = ((($26)) + 4|0); $c = $27; $28 = $c; $29 = ((($28)) + 8|0); $30 = +HEAPF32[$29>>2]; $31 = $30 != 0.0; if (!($31)) { STACKTOP = sp;return; } $32 = $c; $33 = ((($32)) + 12|0); $34 = +HEAPF32[$33>>2]; $35 = $34 != 0.0; if (!($35)) { STACKTOP = sp;return; } $36 = $c; $37 = +HEAPF32[$36>>2]; $38 = +HEAPF32[$r>>2]; $39 = ((($r)) + 8|0); $40 = +HEAPF32[$39>>2]; $41 = $38 + $40; $42 = $37 > $41; if ($42) { STACKTOP = sp;return; } $43 = $c; $44 = +HEAPF32[$43>>2]; $45 = $c; $46 = ((($45)) + 8|0); $47 = +HEAPF32[$46>>2]; $48 = $44 + $47; $49 = +HEAPF32[$r>>2]; $50 = $48 < $49; if ($50) { STACKTOP = sp;return; } $51 = $c; $52 = ((($51)) + 4|0); $53 = +HEAPF32[$52>>2]; $54 = ((($r)) + 4|0); $55 = +HEAPF32[$54>>2]; $56 = ((($r)) + 12|0); $57 = +HEAPF32[$56>>2]; $58 = $55 + $57; $59 = $53 > $58; if ($59) { STACKTOP = sp;return; } $60 = $c; $61 = ((($60)) + 4|0); $62 = +HEAPF32[$61>>2]; $63 = $c; $64 = ((($63)) + 12|0); $65 = +HEAPF32[$64>>2]; $66 = $62 + $65; $67 = ((($r)) + 4|0); $68 = +HEAPF32[$67>>2]; $69 = $66 < $68; if ($69) { STACKTOP = sp;return; } } $70 = $3; $71 = ((($70)) + 8|0); $72 = HEAP32[$71>>2]|0; $73 = $3; $74 = $3; $75 = ((($74)) + 4|0); $76 = +HEAPF32[$75>>2]; $77 = $1; $78 = $2; ;HEAP32[$$byval_copy>>2]=HEAP32[$73>>2]|0; $79 = (+FUNCTION_TABLE_didii[$72 & 15]($$byval_copy,$76,$77,$78)); $text_width = $79; $80 = $text_width; $81 = ((($r)) + 8|0); $82 = +HEAPF32[$81>>2]; $83 = $80 > $82; if ($83) { HEAP32[$glyphs>>2] = 0; $84 = $text_width; HEAPF32[$txt_width>>2] = $84; $85 = $3; $86 = $1; $87 = $2; $88 = ((($r)) + 8|0); $89 = +HEAPF32[$88>>2]; $90 = (_nk_text_clamp($85,$86,$87,$89,$glyphs,$txt_width)|0); $2 = $90; } $91 = $2; $92 = ($91|0)!=(0); if (!($92)) { STACKTOP = sp;return; } $93 = $0; $94 = $2; $95 = (($94) + 1)|0; $96 = (40 + ($95))|0; $97 = (_nk_command_buffer_push($93,16,$96)|0); $cmd = $97; $98 = $cmd; $99 = ($98|0)!=(0|0); if (!($99)) { STACKTOP = sp;return; } $100 = +HEAPF32[$r>>2]; $101 = (~~(($100))); $102 = $cmd; $103 = ((($102)) + 20|0); HEAP16[$103>>1] = $101; $104 = ((($r)) + 4|0); $105 = +HEAPF32[$104>>2]; $106 = (~~(($105))); $107 = $cmd; $108 = ((($107)) + 22|0); HEAP16[$108>>1] = $106; $109 = ((($r)) + 8|0); $110 = +HEAPF32[$109>>2]; $111 = (~~(($110))&65535); $112 = $cmd; $113 = ((($112)) + 24|0); HEAP16[$113>>1] = $111; $114 = ((($r)) + 12|0); $115 = +HEAPF32[$114>>2]; $116 = (~~(($115))&65535); $117 = $cmd; $118 = ((($117)) + 26|0); HEAP16[$118>>1] = $116; $119 = $cmd; $120 = ((($119)) + 12|0); ;HEAP8[$120>>0]=HEAP8[$bg>>0]|0;HEAP8[$120+1>>0]=HEAP8[$bg+1>>0]|0;HEAP8[$120+2>>0]=HEAP8[$bg+2>>0]|0;HEAP8[$120+3>>0]=HEAP8[$bg+3>>0]|0; $121 = $cmd; $122 = ((($121)) + 16|0); ;HEAP8[$122>>0]=HEAP8[$fg>>0]|0;HEAP8[$122+1>>0]=HEAP8[$fg+1>>0]|0;HEAP8[$122+2>>0]=HEAP8[$fg+2>>0]|0;HEAP8[$122+3>>0]=HEAP8[$fg+3>>0]|0; $123 = $3; $124 = $cmd; $125 = ((($124)) + 8|0); HEAP32[$125>>2] = $123; $126 = $2; $127 = $cmd; $128 = ((($127)) + 32|0); HEAP32[$128>>2] = $126; $129 = $3; $130 = ((($129)) + 4|0); $131 = +HEAPF32[$130>>2]; $132 = $cmd; $133 = ((($132)) + 28|0); HEAPF32[$133>>2] = $131; $134 = $cmd; $135 = ((($134)) + 36|0); $136 = $1; $137 = $2; (_nk_memcopy($135,$136,$137)|0); $138 = $2; $139 = $cmd; $140 = ((($139)) + 36|0); $141 = (($140) + ($138)|0); HEAP8[$141>>0] = 0; STACKTOP = sp;return; } function _nk_text_clamp($font,$text,$text_len,$space,$glyphs,$text_width) { $font = $font|0; $text = $text|0; $text_len = $text_len|0; $space = +$space; $glyphs = $glyphs|0; $text_width = $text_width|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0.0, $27 = 0, $28 = 0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0.0; var $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $g = 0, $glyph_len = 0, $last_width = 0.0, $len = 0, $s = 0.0, $unicode = 0, $width = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 52|0; $unicode = sp + 16|0; $0 = $font; $1 = $text; $2 = $text_len; $3 = $space; $4 = $glyphs; $5 = $text_width; $glyph_len = 0; $last_width = 0.0; HEAP32[$unicode>>2] = 0; $width = 0.0; $len = 0; $g = 0; $6 = $1; $7 = $2; $8 = (_nk_utf_decode($6,$unicode,$7)|0); $glyph_len = $8; while(1) { $9 = $glyph_len; $10 = ($9|0)!=(0); if (!($10)) { break; } $11 = $width; $12 = $3; $13 = $11 < $12; if (!($13)) { break; } $14 = $len; $15 = $2; $16 = ($14|0)<($15|0); if (!($16)) { break; } $17 = $glyph_len; $18 = $len; $19 = (($18) + ($17))|0; $len = $19; $20 = $0; $21 = ((($20)) + 8|0); $22 = HEAP32[$21>>2]|0; $23 = $0; $24 = $0; $25 = ((($24)) + 4|0); $26 = +HEAPF32[$25>>2]; $27 = $1; $28 = $len; ;HEAP32[$$byval_copy>>2]=HEAP32[$23>>2]|0; $29 = (+FUNCTION_TABLE_didii[$22 & 15]($$byval_copy,$26,$27,$28)); $s = $29; $30 = $width; $last_width = $30; $31 = $s; $width = $31; $32 = $len; $33 = $1; $34 = (($33) + ($32)|0); $35 = $2; $36 = $len; $37 = (($35) - ($36))|0; $38 = (_nk_utf_decode($34,$unicode,$37)|0); $glyph_len = $38; $39 = $g; $40 = (($39) + 1)|0; $g = $40; } $41 = $g; $42 = $4; HEAP32[$42>>2] = $41; $43 = $last_width; $44 = $5; HEAPF32[$44>>2] = $43; $45 = $len; STACKTOP = sp;return ($45|0); } function _nk_draw_list_init($list) { $list = $list|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0.0; var $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $a = 0.0, $i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $list; $i = 0; $1 = $0; _nk_zero($1,172); $i = 0; while(1) { $2 = $i; $3 = ($2>>>0)<(12); if (!($3)) { break; } $4 = $i; $5 = (+($4>>>0)); $6 = $5 / 12.0; $7 = $6 * 2.0; $8 = $7 * 3.1415927410125732; $a = $8; $9 = $a; $10 = (+_nk_cos($9)); $11 = $i; $12 = $0; $13 = ((($12)) + 76|0); $14 = (($13) + ($11<<3)|0); HEAPF32[$14>>2] = $10; $15 = $a; $16 = (+_nk_sin($15)); $17 = $i; $18 = $0; $19 = ((($18)) + 76|0); $20 = (($19) + ($17<<3)|0); $21 = ((($20)) + 4|0); HEAPF32[$21>>2] = $16; $22 = $i; $23 = (($22) + 1)|0; $i = $23; } STACKTOP = sp;return; } function _nk_cos($x) { $x = +$x; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0; var $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $x; $1 = $0; $2 = $0; $3 = $0; $4 = $0; $5 = $0; $6 = $0; $7 = $0; $8 = $7 * -5.2302214344429956E-14; $9 = 9.9014095030725002E-4 + $8; $10 = $6 * $9; $11 = -0.018663715571165085 + $10; $12 = $5 * $11; $13 = 0.10712379962205887 + $12; $14 = $4 * $13; $15 = -0.1181340366601944 + $14; $16 = $3 * $15; $17 = -0.39438232779502869 + $16; $18 = $2 * $17; $19 = -0.038191996514797211 + $18; $20 = $1 * $19; $21 = 1.0023859739303589 + $20; STACKTOP = sp;return (+$21); } function _nk_sin($x) { $x = +$x; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0; var $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $x; $1 = $0; $2 = $0; $3 = $0; $4 = $0; $5 = $0; $6 = $0; $7 = $0; $8 = $7 * 1.3823564222548157E-4; $9 = -0.0030399605166167021 + $8; $10 = $6 * $9; $11 = 0.020802659913897514 + $10; $12 = $5 * $11; $13 = -0.026735339313745499 + $12; $14 = $4 * $13; $15 = -0.13807877898216248 + $14; $16 = $3 * $15; $17 = -0.012127612717449665 + $16; $18 = $2 * $17; $19 = 1.0008676052093506 + $18; $20 = $1 * $19; $21 = 1.9105930344931873E-31 + $20; STACKTOP = sp;return (+$21); } function _nk_draw_list_setup($canvas,$global_alpha,$line_AA,$shape_AA,$null,$cmds,$vertices,$elements) { $canvas = $canvas|0; $global_alpha = +$global_alpha; $line_AA = $line_AA|0; $shape_AA = $shape_AA|0; $null = $null|0; $cmds = $cmds|0; $vertices = $vertices|0; $elements = $elements|0; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $canvas; $1 = $global_alpha; $2 = $line_AA; $3 = $shape_AA; $4 = $cmds; $5 = $vertices; $6 = $elements; $7 = $0; $8 = ((($7)) + 12|0); ;HEAP32[$8>>2]=HEAP32[$null>>2]|0;HEAP32[$8+4>>2]=HEAP32[$null+4>>2]|0;HEAP32[$8+8>>2]=HEAP32[$null+8>>2]|0; $9 = $0; $10 = ((($9)) + 24|0); ;HEAP32[$10>>2]=HEAP32[8>>2]|0;HEAP32[$10+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$10+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$10+12>>2]=HEAP32[8+12>>2]|0; $11 = $5; $12 = $0; $13 = ((($12)) + 44|0); HEAP32[$13>>2] = $11; $14 = $6; $15 = $0; $16 = ((($15)) + 48|0); HEAP32[$16>>2] = $14; $17 = $4; $18 = $0; $19 = ((($18)) + 40|0); HEAP32[$19>>2] = $17; $20 = $2; $21 = $0; $22 = ((($21)) + 8|0); HEAP32[$22>>2] = $20; $23 = $3; $24 = $0; $25 = ((($24)) + 4|0); HEAP32[$25>>2] = $23; $26 = $1; $27 = $0; HEAPF32[$27>>2] = $26; STACKTOP = sp;return; } function _nk__draw_list_begin($canvas,$buffer) { $canvas = $canvas|0; $buffer = $buffer|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cmd = 0, $memory = 0, $offset = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $canvas; $2 = $buffer; $3 = $2; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((13445|0),(13400|0),5479,(14254|0)); // unreachable; } $5 = $2; $6 = ($5|0)!=(0|0); if ($6) { $7 = $2; $8 = ((($7)) + 56|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0); if ($10) { $11 = $1; $12 = ((($11)) + 64|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)!=(0); if ($14) { $15 = $2; $16 = ((($15)) + 32|0); $17 = HEAP32[$16>>2]|0; $memory = $17; $18 = $2; $19 = ((($18)) + 32|0); $20 = ((($19)) + 4|0); $21 = HEAP32[$20>>2]|0; $22 = $1; $23 = ((($22)) + 60|0); $24 = HEAP32[$23>>2]|0; $25 = (($21) - ($24))|0; $offset = $25; $26 = $memory; $27 = $offset; $28 = (($26) + ($27)|0); $cmd = $28; $29 = $cmd; $0 = $29; $30 = $0; STACKTOP = sp;return ($30|0); } } } $0 = 0; $30 = $0; STACKTOP = sp;return ($30|0); } function _nk__draw_list_next($cmd,$buffer,$canvas) { $cmd = $cmd|0; $buffer = $buffer|0; $canvas = $canvas|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $end = 0, $memory = 0, $offset = 0, $or$cond = 0, $or$cond3 = 0, $size = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $cmd; $2 = $buffer; $3 = $canvas; $4 = $2; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13445|0),(13400|0),5498,(14274|0)); // unreachable; } $6 = $3; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((14293|0),(13400|0),5499,(14274|0)); // unreachable; } $8 = $1; $9 = ($8|0)!=(0|0); $10 = $2; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; $12 = $3; $13 = ($12|0)!=(0|0); $or$cond3 = $or$cond & $13; if (!($or$cond3)) { $0 = 0; $41 = $0; STACKTOP = sp;return ($41|0); } $14 = $2; $15 = ((($14)) + 32|0); $16 = HEAP32[$15>>2]|0; $memory = $16; $17 = $2; $18 = ((($17)) + 32|0); $19 = ((($18)) + 4|0); $20 = HEAP32[$19>>2]|0; $size = $20; $21 = $size; $22 = $3; $23 = ((($22)) + 60|0); $24 = HEAP32[$23>>2]|0; $25 = (($21) - ($24))|0; $offset = $25; $26 = $memory; $27 = $offset; $28 = (($26) + ($27)|0); $end = $28; $29 = $3; $30 = ((($29)) + 64|0); $31 = HEAP32[$30>>2]|0; $32 = (($31) - 1)|0; $33 = $end; $34 = (0 - ($32))|0; $35 = (($33) + (($34*24)|0)|0); $end = $35; $36 = $1; $37 = $end; $38 = ($36>>>0)<=($37>>>0); if ($38) { $0 = 0; $41 = $0; STACKTOP = sp;return ($41|0); } else { $39 = $1; $40 = ((($39)) + -24|0); $0 = $40; $41 = $0; STACKTOP = sp;return ($41|0); } return (0)|0; } function _nk_draw_list_clear($list) { $list = $list|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $list; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),5516,(14305|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 40|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); if ($8) { $9 = $0; $10 = ((($9)) + 40|0); $11 = HEAP32[$10>>2]|0; _nk_buffer_clear($11); } $12 = $0; $13 = ((($12)) + 48|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if ($15) { $16 = $0; $17 = ((($16)) + 44|0); $18 = HEAP32[$17>>2]|0; _nk_buffer_clear($18); } $19 = $0; $20 = ((($19)) + 44|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if ($22) { $23 = $0; $24 = ((($23)) + 48|0); $25 = HEAP32[$24>>2]|0; _nk_buffer_clear($25); } $26 = $0; $27 = ((($26)) + 52|0); HEAP32[$27>>2] = 0; $28 = $0; $29 = ((($28)) + 56|0); HEAP32[$29>>2] = 0; $30 = $0; $31 = ((($30)) + 60|0); HEAP32[$31>>2] = 0; $32 = $0; $33 = ((($32)) + 64|0); HEAP32[$33>>2] = 0; $34 = $0; $35 = ((($34)) + 68|0); HEAP32[$35>>2] = 0; $36 = $0; $37 = ((($36)) + 44|0); HEAP32[$37>>2] = 0; $38 = $0; $39 = ((($38)) + 48|0); HEAP32[$39>>2] = 0; $40 = $0; $41 = ((($40)) + 24|0); ;HEAP32[$41>>2]=HEAP32[8>>2]|0;HEAP32[$41+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$41+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$41+12>>2]=HEAP32[8+12>>2]|0; STACKTOP = sp;return; } function _nk_draw_list_stroke_poly_line($list,$points,$points_count,$color,$closed,$thickness,$aliasing) { $list = $list|0; $points = $points|0; $points_count = $points_count|0; $color = $color|0; $closed = $closed|0; $thickness = +$thickness; $aliasing = $aliasing|0; var $$byval_copy = 0, $$byval_copy10 = 0, $$byval_copy12 = 0, $$byval_copy13 = 0, $$byval_copy15 = 0, $$byval_copy17 = 0, $$byval_copy19 = 0, $$byval_copy20 = 0, $$byval_copy22 = 0, $$byval_copy24 = 0, $$byval_copy8 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0; var $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0; var $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0; var $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0; var $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0, $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $1071 = 0, $1072 = 0, $1073 = 0, $1074 = 0, $1075 = 0, $1076 = 0, $1077 = 0; var $1078 = 0, $1079 = 0, $108 = 0, $1080 = 0, $1081 = 0, $1082 = 0, $1083 = 0, $1084 = 0, $1085 = 0, $1086 = 0, $1087 = 0, $1088 = 0, $1089 = 0, $109 = 0, $1090 = 0, $1091 = 0, $1092 = 0, $1093 = 0, $1094 = 0, $1095 = 0; var $1096 = 0, $1097 = 0, $1098 = 0, $1099 = 0, $11 = 0, $110 = 0, $1100 = 0, $1101 = 0, $1102 = 0, $1103 = 0, $1104 = 0, $1105 = 0, $1106 = 0, $1107 = 0, $1108 = 0.0, $1109 = 0.0, $111 = 0, $1110 = 0.0, $1111 = 0, $1112 = 0.0; var $1113 = 0, $1114 = 0.0, $1115 = 0.0, $1116 = 0.0, $1117 = 0.0, $1118 = 0.0, $1119 = 0, $112 = 0, $1120 = 0.0, $1121 = 0, $1122 = 0.0, $1123 = 0.0, $1124 = 0.0, $1125 = 0.0, $1126 = 0, $1127 = 0.0, $1128 = 0.0, $1129 = 0.0, $113 = 0, $1130 = 0.0; var $1131 = 0.0, $1132 = 0, $1133 = 0.0, $1134 = 0.0, $1135 = 0.0, $1136 = 0.0, $1137 = 0.0, $1138 = 0.0, $1139 = 0.0, $114 = 0, $1140 = 0, $1141 = 0.0, $1142 = 0.0, $1143 = 0.0, $1144 = 0.0, $1145 = 0, $1146 = 0.0, $1147 = 0.0, $1148 = 0.0, $1149 = 0; var $115 = 0, $1150 = 0.0, $1151 = 0.0, $1152 = 0.0, $1153 = 0, $1154 = 0, $1155 = 0, $1156 = 0.0, $1157 = 0.0, $1158 = 0.0, $1159 = 0, $116 = 0, $1160 = 0.0, $1161 = 0.0, $1162 = 0.0, $1163 = 0, $1164 = 0, $1165 = 0, $1166 = 0.0, $1167 = 0.0; var $1168 = 0.0, $1169 = 0, $117 = 0, $1170 = 0.0, $1171 = 0.0, $1172 = 0.0, $1173 = 0, $1174 = 0, $1175 = 0, $1176 = 0.0, $1177 = 0.0, $1178 = 0.0, $1179 = 0, $118 = 0, $1180 = 0.0, $1181 = 0.0, $1182 = 0.0, $1183 = 0, $1184 = 0, $1185 = 0; var $1186 = 0, $1187 = 0, $1188 = 0, $1189 = 0, $119 = 0, $1190 = 0, $1191 = 0, $1192 = 0, $1193 = 0, $1194 = 0, $1195 = 0, $1196 = 0, $1197 = 0, $1198 = 0, $1199 = 0, $12 = 0, $120 = 0, $1200 = 0, $1201 = 0, $1202 = 0; var $1203 = 0, $1204 = 0, $1205 = 0, $1206 = 0, $1207 = 0, $1208 = 0, $1209 = 0, $121 = 0, $1210 = 0, $1211 = 0, $1212 = 0, $1213 = 0, $1214 = 0, $1215 = 0, $1216 = 0, $1217 = 0, $1218 = 0, $1219 = 0, $122 = 0, $1220 = 0; var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0; var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0; var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0.0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0, $176 = 0, $177 = 0; var $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0.0, $186 = 0, $187 = 0.0, $188 = 0.0, $189 = 0.0, $19 = 0, $190 = 0.0, $191 = 0, $192 = 0.0, $193 = 0.0, $194 = 0.0, $195 = 0.0; var $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0, $202 = 0.0, $203 = 0, $204 = 0, $205 = 0, $206 = 0.0, $207 = 0.0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0; var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0.0; var $231 = 0, $232 = 0.0, $233 = 0.0, $234 = 0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0.0, $24 = 0, $240 = 0, $241 = 0, $242 = 0.0, $243 = 0, $244 = 0.0, $245 = 0.0, $246 = 0, $247 = 0, $248 = 0.0, $249 = 0.0; var $25 = 0, $250 = 0, $251 = 0.0, $252 = 0.0, $253 = 0, $254 = 0, $255 = 0, $256 = 0.0, $257 = 0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0, $262 = 0.0, $263 = 0.0, $264 = 0.0, $265 = 0.0, $266 = 0, $267 = 0; var $268 = 0.0, $269 = 0, $27 = 0, $270 = 0.0, $271 = 0.0, $272 = 0, $273 = 0, $274 = 0.0, $275 = 0.0, $276 = 0, $277 = 0.0, $278 = 0.0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0.0, $284 = 0.0, $285 = 0; var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0.0, $291 = 0.0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0.0; var $303 = 0.0, $304 = 0.0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0.0, $313 = 0.0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0; var $321 = 0, $322 = 0, $323 = 0, $324 = 0.0, $325 = 0.0, $326 = 0.0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0.0, $333 = 0, $334 = 0.0, $335 = 0.0, $336 = 0, $337 = 0, $338 = 0, $339 = 0; var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0; var $358 = 0.0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0.0, $363 = 0.0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0.0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0.0, $374 = 0.0, $375 = 0.0; var $376 = 0.0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0.0, $381 = 0, $382 = 0, $383 = 0, $384 = 0.0, $385 = 0.0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0.0, $391 = 0, $392 = 0, $393 = 0; var $394 = 0, $395 = 0.0, $396 = 0.0, $397 = 0, $398 = 0.0, $399 = 0.0, $4 = 0.0, $40 = 0, $400 = 0.0, $401 = 0.0, $402 = 0.0, $403 = 0, $404 = 0.0, $405 = 0, $406 = 0.0, $407 = 0.0, $408 = 0.0, $409 = 0.0, $41 = 0, $410 = 0; var $411 = 0.0, $412 = 0.0, $413 = 0.0, $414 = 0, $415 = 0.0, $416 = 0.0, $417 = 0.0, $418 = 0.0, $419 = 0.0, $42 = 0, $420 = 0, $421 = 0.0, $422 = 0.0, $423 = 0.0, $424 = 0.0, $425 = 0.0, $426 = 0, $427 = 0.0, $428 = 0.0, $429 = 0; var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0.0, $438 = 0.0, $439 = 0.0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0.0, $445 = 0, $446 = 0.0, $447 = 0.0; var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0.0, $457 = 0.0, $458 = 0.0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0.0, $464 = 0, $465 = 0.0; var $466 = 0.0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0; var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0; var $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0; var $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0; var $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0; var $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0.0, $563 = 0.0, $564 = 0.0, $565 = 0, $566 = 0, $567 = 0, $568 = 0.0, $569 = 0.0, $57 = 0, $570 = 0.0, $571 = 0.0, $572 = 0, $573 = 0; var $574 = 0.0, $575 = 0.0, $576 = 0.0, $577 = 0.0, $578 = 0, $579 = 0.0, $58 = 0, $580 = 0.0, $581 = 0.0, $582 = 0, $583 = 0, $584 = 0.0, $585 = 0.0, $586 = 0.0, $587 = 0, $588 = 0, $589 = 0.0, $59 = 0, $590 = 0.0, $591 = 0.0; var $592 = 0, $593 = 0, $594 = 0.0, $595 = 0, $596 = 0.0, $597 = 0.0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0.0, $602 = 0.0, $603 = 0.0, $604 = 0, $605 = 0, $606 = 0.0, $607 = 0, $608 = 0.0, $609 = 0.0; var $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0.0, $614 = 0.0, $615 = 0.0, $616 = 0, $617 = 0, $618 = 0.0, $619 = 0, $62 = 0, $620 = 0.0, $621 = 0.0, $622 = 0, $623 = 0, $624 = 0, $625 = 0.0, $626 = 0.0, $627 = 0.0; var $628 = 0, $629 = 0, $63 = 0, $630 = 0.0, $631 = 0, $632 = 0.0, $633 = 0.0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0.0, $639 = 0.0, $64 = 0, $640 = 0.0, $641 = 0.0, $642 = 0, $643 = 0, $644 = 0, $645 = 0; var $646 = 0, $647 = 0.0, $648 = 0.0, $649 = 0.0, $65 = 0, $650 = 0.0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0.0, $656 = 0.0, $657 = 0.0, $658 = 0, $659 = 0, $66 = 0.0, $660 = 0, $661 = 0, $662 = 0, $663 = 0.0; var $664 = 0.0, $665 = 0.0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0.0, $677 = 0.0, $678 = 0.0, $679 = 0, $68 = 0.0, $680 = 0, $681 = 0; var $682 = 0, $683 = 0, $684 = 0.0, $685 = 0, $686 = 0.0, $687 = 0.0, $688 = 0, $689 = 0, $69 = 0.0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0.0, $699 = 0.0, $7 = 0; var $70 = 0, $700 = 0.0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0.0, $707 = 0, $708 = 0.0, $709 = 0.0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0; var $718 = 0, $719 = 0, $72 = 0, $720 = 0.0, $721 = 0.0, $722 = 0.0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0.0, $729 = 0, $73 = 0, $730 = 0.0, $731 = 0.0, $732 = 0, $733 = 0, $734 = 0, $735 = 0; var $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0.0, $743 = 0.0, $744 = 0.0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0.0, $751 = 0, $752 = 0.0, $753 = 0.0; var $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0; var $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0.0, $777 = 0, $778 = 0, $779 = 0, $78 = 0.0, $780 = 0.0, $781 = 0.0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0.0, $787 = 0, $788 = 0, $789 = 0, $79 = 0; var $790 = 0, $791 = 0.0, $792 = 0.0, $793 = 0.0, $794 = 0.0, $795 = 0, $796 = 0, $797 = 0, $798 = 0.0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0.0, $803 = 0.0, $804 = 0, $805 = 0, $806 = 0, $807 = 0; var $808 = 0.0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0.0, $814 = 0.0, $815 = 0, $816 = 0.0, $817 = 0.0, $818 = 0.0, $819 = 0.0, $82 = 0, $820 = 0.0, $821 = 0, $822 = 0.0, $823 = 0, $824 = 0.0, $825 = 0.0; var $826 = 0.0, $827 = 0.0, $828 = 0, $829 = 0.0, $83 = 0, $830 = 0.0, $831 = 0.0, $832 = 0, $833 = 0.0, $834 = 0.0, $835 = 0.0, $836 = 0.0, $837 = 0.0, $838 = 0, $839 = 0.0, $84 = 0, $840 = 0.0, $841 = 0.0, $842 = 0.0, $843 = 0.0; var $844 = 0.0, $845 = 0.0, $846 = 0, $847 = 0.0, $848 = 0.0, $849 = 0.0, $85 = 0, $850 = 0.0, $851 = 0.0, $852 = 0.0, $853 = 0.0, $854 = 0, $855 = 0.0, $856 = 0.0, $857 = 0.0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0; var $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0.0, $867 = 0.0, $868 = 0.0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0.0, $874 = 0, $875 = 0.0, $876 = 0.0, $877 = 0, $878 = 0, $879 = 0, $88 = 0; var $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0.0, $886 = 0.0, $887 = 0.0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0.0, $893 = 0, $894 = 0.0, $895 = 0.0, $896 = 0, $897 = 0, $898 = 0; var $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0.0, $905 = 0.0, $906 = 0.0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0.0, $912 = 0, $913 = 0.0, $914 = 0.0, $915 = 0; var $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0.0, $924 = 0.0, $925 = 0.0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0.0, $931 = 0, $932 = 0.0, $933 = 0.0; var $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0; var $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0; var $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0; var $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $AA_SIZE = 0.0, $col = 0, $col_trans = 0, $color$byval_copy = 0, $count = 0, $d = 0, $d1 = 0, $d2 = 0; var $diff = 0, $diff17 = 0, $dm = 0, $dm6 = 0, $dm_in = 0, $dm_out = 0, $dmr2 = 0.0, $dmr27 = 0.0, $dx = 0.0, $dy = 0.0, $half_inner_thickness = 0.0, $i = 0, $i1 = 0, $i110 = 0, $i2 = 0, $i21 = 0, $i216 = 0, $i24 = 0, $i3 = 0, $ids = 0; var $ids14 = 0, $idx = 0, $idx1 = 0, $idx12 = 0, $idx2 = 0, $idx25 = 0, $idx_count = 0, $idx_count11 = 0, $index = 0, $len = 0.0, $len18 = 0.0, $normals = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $p1 = 0, $p2 = 0, $scale = 0.0, $scale8 = 0.0; var $size = 0, $temp = 0, $thick_line = 0, $uv = 0, $uv$byval_copy = 0, $uv$byval_copy11 = 0, $uv$byval_copy9 = 0, $uv15 = 0, $uv15$byval_copy = 0, $uv15$byval_copy21 = 0, $uv15$byval_copy23 = 0, $uv15$byval_copy25 = 0, $uv9 = 0, $uv9$byval_copy = 0, $uv9$byval_copy14 = 0, $uv9$byval_copy16 = 0, $uv9$byval_copy18 = 0, $vertex_offset = 0, $vtx = 0, $vtx13 = 0; var $vtx_count = 0, $vtx_count12 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 1072|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $uv15$byval_copy25 = sp + 1048|0; $$byval_copy24 = sp + 1040|0; $uv15$byval_copy23 = sp + 1032|0; $$byval_copy22 = sp + 1024|0; $uv15$byval_copy21 = sp + 1016|0; $$byval_copy20 = sp + 1008|0; $uv15$byval_copy = sp + 1000|0; $$byval_copy19 = sp + 992|0; $uv9$byval_copy18 = sp + 984|0; $$byval_copy17 = sp + 976|0; $uv9$byval_copy16 = sp + 968|0; $$byval_copy15 = sp + 960|0; $uv9$byval_copy14 = sp + 952|0; $$byval_copy13 = sp + 944|0; $uv9$byval_copy = sp + 936|0; $$byval_copy12 = sp + 928|0; $uv$byval_copy11 = sp + 920|0; $$byval_copy10 = sp + 912|0; $uv$byval_copy9 = sp + 904|0; $$byval_copy8 = sp + 896|0; $uv$byval_copy = sp + 888|0; $$byval_copy = sp + 880|0; $color$byval_copy = sp + 1056|0; $diff = sp + 784|0; $6 = sp + 768|0; $d = sp + 752|0; $7 = sp + 744|0; $8 = sp + 736|0; $9 = sp + 728|0; $10 = sp + 720|0; $11 = sp + 712|0; $12 = sp + 704|0; $13 = sp + 696|0; $14 = sp + 688|0; $15 = sp + 680|0; $dm = sp + 672|0; $16 = sp + 648|0; $17 = sp + 640|0; $18 = sp + 632|0; $19 = sp + 616|0; $20 = sp + 608|0; $21 = sp + 600|0; $22 = sp + 592|0; $uv = sp + 584|0; $23 = sp + 564|0; $24 = sp + 544|0; $25 = sp + 524|0; $d1 = sp + 504|0; $d2 = sp + 496|0; $26 = sp + 488|0; $27 = sp + 480|0; $28 = sp + 472|0; $29 = sp + 464|0; $30 = sp + 456|0; $31 = sp + 448|0; $32 = sp + 440|0; $33 = sp + 432|0; $34 = sp + 424|0; $35 = sp + 416|0; $dm_out = sp + 408|0; $dm_in = sp + 400|0; $dm6 = sp + 384|0; $36 = sp + 376|0; $37 = sp + 368|0; $38 = sp + 352|0; $39 = sp + 344|0; $40 = sp + 336|0; $41 = sp + 328|0; $42 = sp + 320|0; $43 = sp + 312|0; $44 = sp + 304|0; $uv9 = sp + 296|0; $45 = sp + 276|0; $46 = sp + 256|0; $47 = sp + 236|0; $48 = sp + 216|0; $uv15 = sp + 176|0; $p1 = sp + 160|0; $p2 = sp + 152|0; $diff17 = sp + 144|0; $49 = sp + 128|0; $50 = sp + 120|0; $51 = sp + 96|0; $52 = sp + 88|0; $53 = sp + 64|0; $54 = sp + 56|0; $55 = sp + 32|0; $56 = sp + 24|0; $57 = sp; $0 = $list; $1 = $points; $2 = $points_count; $3 = $closed; $4 = $thickness; $5 = $aliasing; $58 = $0; $59 = ($58|0)!=(0|0); if (!($59)) { ___assert_fail((14300|0),(13400|0),5717,(14324|0)); // unreachable; } $60 = $0; $61 = ($60|0)==(0|0); $62 = $2; $63 = ($62>>>0)<(2); $or$cond = $61 | $63; if ($or$cond) { STACKTOP = sp;return; } $64 = ((($color)) + 3|0); $65 = HEAP8[$64>>0]|0; $66 = (+($65&255)); $67 = $0; $68 = +HEAPF32[$67>>2]; $69 = $66 * $68; $70 = (~~(($69))&255); $71 = ((($color)) + 3|0); HEAP8[$71>>0] = $70; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; $72 = (_nk_color_u32($color$byval_copy)|0); $col = $72; $73 = $2; $count = $73; $74 = $3; $75 = ($74|0)!=(0); if (!($75)) { $76 = $2; $77 = (($76) - 1)|0; $count = $77; } $78 = $4; $79 = $78 > 1.0; $80 = $79&1; $thick_line = $80; $81 = $5; $82 = ($81|0)==(1); if (!($82)) { $i110 = 0; $1072 = $0; $1073 = ((($1072)) + 56|0); $1074 = HEAP32[$1073>>2]|0; $idx = $1074; $1075 = $count; $1076 = ($1075*6)|0; $idx_count11 = $1076; $1077 = $count; $1078 = $1077<<2; $vtx_count12 = $1078; $1079 = $0; $1080 = $vtx_count12; $1081 = (_nk_draw_list_alloc_vertices($1079,$1080)|0); $vtx13 = $1081; $1082 = $0; $1083 = $idx_count11; $1084 = (_nk_draw_list_alloc_elements($1082,$1083)|0); $ids14 = $1084; $1085 = $vtx13; $1086 = ($1085|0)!=(0|0); $1087 = $ids14; $1088 = ($1087|0)!=(0|0); $or$cond7 = $1086 & $1088; if (!($or$cond7)) { STACKTOP = sp;return; } $i110 = 0; while(1) { $1089 = $i110; $1090 = $count; $1091 = ($1089>>>0)<($1090>>>0); if (!($1091)) { break; } $1092 = $0; $1093 = ((($1092)) + 12|0); $1094 = ((($1093)) + 4|0); ;HEAP32[$uv15>>2]=HEAP32[$1094>>2]|0;HEAP32[$uv15+4>>2]=HEAP32[$1094+4>>2]|0; $1095 = $i110; $1096 = (($1095) + 1)|0; $1097 = $2; $1098 = ($1096|0)==($1097|0); $1099 = $i110; $1100 = (($1099) + 1)|0; $1101 = $1098 ? 0 : $1100; $i216 = $1101; $1102 = $i110; $1103 = $1; $1104 = (($1103) + ($1102<<3)|0); ;HEAP32[$p1>>2]=HEAP32[$1104>>2]|0;HEAP32[$p1+4>>2]=HEAP32[$1104+4>>2]|0; $1105 = $i216; $1106 = $1; $1107 = (($1106) + ($1105<<3)|0); ;HEAP32[$p2>>2]=HEAP32[$1107>>2]|0;HEAP32[$p2+4>>2]=HEAP32[$1107+4>>2]|0; $1108 = +HEAPF32[$p2>>2]; $1109 = +HEAPF32[$p1>>2]; $1110 = $1108 - $1109; $1111 = ((($p2)) + 4|0); $1112 = +HEAPF32[$1111>>2]; $1113 = ((($p1)) + 4|0); $1114 = +HEAPF32[$1113>>2]; $1115 = $1112 - $1114; _nk_vec2($diff17,$1110,$1115); $1116 = +HEAPF32[$diff17>>2]; $1117 = +HEAPF32[$diff17>>2]; $1118 = $1116 * $1117; $1119 = ((($diff17)) + 4|0); $1120 = +HEAPF32[$1119>>2]; $1121 = ((($diff17)) + 4|0); $1122 = +HEAPF32[$1121>>2]; $1123 = $1120 * $1122; $1124 = $1118 + $1123; $len18 = $1124; $1125 = $len18; $1126 = $1125 != 0.0; if ($1126) { $1127 = $len18; $1128 = (+_nk_inv_sqrt($1127)); $len18 = $1128; } else { $len18 = 1.0; } $1129 = +HEAPF32[$diff17>>2]; $1130 = $len18; $1131 = $1129 * $1130; $1132 = ((($diff17)) + 4|0); $1133 = +HEAPF32[$1132>>2]; $1134 = $len18; $1135 = $1133 * $1134; _nk_vec2($49,$1131,$1135); ;HEAP32[$diff17>>2]=HEAP32[$49>>2]|0;HEAP32[$diff17+4>>2]=HEAP32[$49+4>>2]|0; $1136 = +HEAPF32[$diff17>>2]; $1137 = $4; $1138 = $1137 * 0.5; $1139 = $1136 * $1138; $dx = $1139; $1140 = ((($diff17)) + 4|0); $1141 = +HEAPF32[$1140>>2]; $1142 = $4; $1143 = $1142 * 0.5; $1144 = $1141 * $1143; $dy = $1144; $1145 = $vtx13; $1146 = +HEAPF32[$p1>>2]; $1147 = $dy; $1148 = $1146 + $1147; $1149 = ((($p1)) + 4|0); $1150 = +HEAPF32[$1149>>2]; $1151 = $dx; $1152 = $1150 - $1151; _nk_vec2($50,$1148,$1152); $1153 = $col; ;HEAP32[$$byval_copy19>>2]=HEAP32[$50>>2]|0;HEAP32[$$byval_copy19+4>>2]=HEAP32[$50+4>>2]|0; ;HEAP32[$uv15$byval_copy>>2]=HEAP32[$uv15>>2]|0;HEAP32[$uv15$byval_copy+4>>2]=HEAP32[$uv15+4>>2]|0; _nk_draw_vertex($51,$$byval_copy19,$uv15$byval_copy,$1153); ;HEAP32[$1145>>2]=HEAP32[$51>>2]|0;HEAP32[$1145+4>>2]=HEAP32[$51+4>>2]|0;HEAP32[$1145+8>>2]=HEAP32[$51+8>>2]|0;HEAP32[$1145+12>>2]=HEAP32[$51+12>>2]|0;HEAP32[$1145+16>>2]=HEAP32[$51+16>>2]|0; $1154 = $vtx13; $1155 = ((($1154)) + 20|0); $1156 = +HEAPF32[$p2>>2]; $1157 = $dy; $1158 = $1156 + $1157; $1159 = ((($p2)) + 4|0); $1160 = +HEAPF32[$1159>>2]; $1161 = $dx; $1162 = $1160 - $1161; _nk_vec2($52,$1158,$1162); $1163 = $col; ;HEAP32[$$byval_copy20>>2]=HEAP32[$52>>2]|0;HEAP32[$$byval_copy20+4>>2]=HEAP32[$52+4>>2]|0; ;HEAP32[$uv15$byval_copy21>>2]=HEAP32[$uv15>>2]|0;HEAP32[$uv15$byval_copy21+4>>2]=HEAP32[$uv15+4>>2]|0; _nk_draw_vertex($53,$$byval_copy20,$uv15$byval_copy21,$1163); ;HEAP32[$1155>>2]=HEAP32[$53>>2]|0;HEAP32[$1155+4>>2]=HEAP32[$53+4>>2]|0;HEAP32[$1155+8>>2]=HEAP32[$53+8>>2]|0;HEAP32[$1155+12>>2]=HEAP32[$53+12>>2]|0;HEAP32[$1155+16>>2]=HEAP32[$53+16>>2]|0; $1164 = $vtx13; $1165 = ((($1164)) + 40|0); $1166 = +HEAPF32[$p2>>2]; $1167 = $dy; $1168 = $1166 - $1167; $1169 = ((($p2)) + 4|0); $1170 = +HEAPF32[$1169>>2]; $1171 = $dx; $1172 = $1170 + $1171; _nk_vec2($54,$1168,$1172); $1173 = $col; ;HEAP32[$$byval_copy22>>2]=HEAP32[$54>>2]|0;HEAP32[$$byval_copy22+4>>2]=HEAP32[$54+4>>2]|0; ;HEAP32[$uv15$byval_copy23>>2]=HEAP32[$uv15>>2]|0;HEAP32[$uv15$byval_copy23+4>>2]=HEAP32[$uv15+4>>2]|0; _nk_draw_vertex($55,$$byval_copy22,$uv15$byval_copy23,$1173); ;HEAP32[$1165>>2]=HEAP32[$55>>2]|0;HEAP32[$1165+4>>2]=HEAP32[$55+4>>2]|0;HEAP32[$1165+8>>2]=HEAP32[$55+8>>2]|0;HEAP32[$1165+12>>2]=HEAP32[$55+12>>2]|0;HEAP32[$1165+16>>2]=HEAP32[$55+16>>2]|0; $1174 = $vtx13; $1175 = ((($1174)) + 60|0); $1176 = +HEAPF32[$p1>>2]; $1177 = $dy; $1178 = $1176 - $1177; $1179 = ((($p1)) + 4|0); $1180 = +HEAPF32[$1179>>2]; $1181 = $dx; $1182 = $1180 + $1181; _nk_vec2($56,$1178,$1182); $1183 = $col; ;HEAP32[$$byval_copy24>>2]=HEAP32[$56>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$56+4>>2]|0; ;HEAP32[$uv15$byval_copy25>>2]=HEAP32[$uv15>>2]|0;HEAP32[$uv15$byval_copy25+4>>2]=HEAP32[$uv15+4>>2]|0; _nk_draw_vertex($57,$$byval_copy24,$uv15$byval_copy25,$1183); ;HEAP32[$1175>>2]=HEAP32[$57>>2]|0;HEAP32[$1175+4>>2]=HEAP32[$57+4>>2]|0;HEAP32[$1175+8>>2]=HEAP32[$57+8>>2]|0;HEAP32[$1175+12>>2]=HEAP32[$57+12>>2]|0;HEAP32[$1175+16>>2]=HEAP32[$57+16>>2]|0; $1184 = $vtx13; $1185 = ((($1184)) + 80|0); $vtx13 = $1185; $1186 = $idx; $1187 = (($1186) + 0)|0; $1188 = $1187&65535; $1189 = $ids14; HEAP16[$1189>>1] = $1188; $1190 = $idx; $1191 = (($1190) + 1)|0; $1192 = $1191&65535; $1193 = $ids14; $1194 = ((($1193)) + 2|0); HEAP16[$1194>>1] = $1192; $1195 = $idx; $1196 = (($1195) + 2)|0; $1197 = $1196&65535; $1198 = $ids14; $1199 = ((($1198)) + 4|0); HEAP16[$1199>>1] = $1197; $1200 = $idx; $1201 = (($1200) + 0)|0; $1202 = $1201&65535; $1203 = $ids14; $1204 = ((($1203)) + 6|0); HEAP16[$1204>>1] = $1202; $1205 = $idx; $1206 = (($1205) + 2)|0; $1207 = $1206&65535; $1208 = $ids14; $1209 = ((($1208)) + 8|0); HEAP16[$1209>>1] = $1207; $1210 = $idx; $1211 = (($1210) + 3)|0; $1212 = $1211&65535; $1213 = $ids14; $1214 = ((($1213)) + 10|0); HEAP16[$1214>>1] = $1212; $1215 = $ids14; $1216 = ((($1215)) + 12|0); $ids14 = $1216; $1217 = $idx; $1218 = (($1217) + 4)|0; $idx = $1218; $1219 = $i110; $1220 = (($1219) + 1)|0; $i110 = $1220; } STACKTOP = sp;return; } $AA_SIZE = 1.0; $83 = $col; $84 = $83 & 16777215; $col_trans = $84; $i1 = 0; $85 = $0; $86 = ((($85)) + 56|0); $87 = HEAP32[$86>>2]|0; $index = $87; $88 = $thick_line; $89 = ($88|0)!=(0); $90 = $count; $91 = ($90*18)|0; $92 = ($90*12)|0; $93 = $89 ? $91 : $92; $idx_count = $93; $94 = $thick_line; $95 = ($94|0)!=(0); $96 = $2; $97 = $96<<2; $98 = ($96*3)|0; $99 = $95 ? $97 : $98; $vtx_count = $99; $100 = $0; $101 = $vtx_count; $102 = (_nk_draw_list_alloc_vertices($100,$101)|0); $vtx = $102; $103 = $0; $104 = $idx_count; $105 = (_nk_draw_list_alloc_elements($103,$104)|0); $ids = $105; $106 = $vtx; $107 = ($106|0)!=(0|0); $108 = $ids; $109 = ($108|0)!=(0|0); $or$cond3 = $107 & $109; if (!($or$cond3)) { ___assert_fail((14354|0),(13400|0),5748,(14324|0)); // unreachable; } $110 = $vtx; $111 = ($110|0)!=(0|0); $112 = $ids; $113 = ($112|0)!=(0|0); $or$cond5 = $111 & $113; if (!($or$cond5)) { STACKTOP = sp;return; } $114 = $vtx; $115 = $0; $116 = ((($115)) + 44|0); $117 = HEAP32[$116>>2]|0; $118 = ((($117)) + 32|0); $119 = HEAP32[$118>>2]|0; $120 = $114; $121 = $119; $122 = (($120) - ($121))|0; $vertex_offset = $122; $123 = $0; $124 = ((($123)) + 44|0); $125 = HEAP32[$124>>2]|0; _nk_buffer_mark($125,0); $126 = $thick_line; $127 = ($126|0)!=(0); $128 = $127 ? 5 : 3; $129 = $128<<3; $130 = $2; $131 = Math_imul($129, $130)|0; $size = $131; $132 = $0; $133 = ((($132)) + 44|0); $134 = HEAP32[$133>>2]|0; $135 = $size; $136 = (_nk_buffer_alloc($134,0,$135,4)|0); $normals = $136; $137 = $normals; $138 = ($137|0)!=(0|0); if (!($138)) { ___assert_fail((14365|0),(13400|0),5757,(14324|0)); // unreachable; } $139 = $normals; $140 = ($139|0)!=(0|0); if (!($140)) { STACKTOP = sp;return; } $141 = $0; $142 = ((($141)) + 44|0); $143 = HEAP32[$142>>2]|0; $144 = ((($143)) + 32|0); $145 = HEAP32[$144>>2]|0; $146 = $vertex_offset; $147 = (($145) + ($146)|0); $vtx = $147; $148 = $normals; $149 = $2; $150 = (($148) + ($149<<3)|0); $temp = $150; $i1 = 0; while(1) { $151 = $i1; $152 = $count; $153 = ($151>>>0)<($152>>>0); if (!($153)) { break; } $154 = $i1; $155 = (($154) + 1)|0; $156 = $2; $157 = ($155|0)==($156|0); $158 = $i1; $159 = (($158) + 1)|0; $160 = $157 ? 0 : $159; $i2 = $160; $161 = $i2; $162 = $1; $163 = (($162) + ($161<<3)|0); $164 = +HEAPF32[$163>>2]; $165 = $i1; $166 = $1; $167 = (($166) + ($165<<3)|0); $168 = +HEAPF32[$167>>2]; $169 = $164 - $168; $170 = $i2; $171 = $1; $172 = (($171) + ($170<<3)|0); $173 = ((($172)) + 4|0); $174 = +HEAPF32[$173>>2]; $175 = $i1; $176 = $1; $177 = (($176) + ($175<<3)|0); $178 = ((($177)) + 4|0); $179 = +HEAPF32[$178>>2]; $180 = $174 - $179; _nk_vec2($diff,$169,$180); $181 = +HEAPF32[$diff>>2]; $182 = +HEAPF32[$diff>>2]; $183 = $181 * $182; $184 = ((($diff)) + 4|0); $185 = +HEAPF32[$184>>2]; $186 = ((($diff)) + 4|0); $187 = +HEAPF32[$186>>2]; $188 = $185 * $187; $189 = $183 + $188; $len = $189; $190 = $len; $191 = $190 != 0.0; if ($191) { $192 = $len; $193 = (+_nk_inv_sqrt($192)); $len = $193; } else { $len = 1.0; } $194 = +HEAPF32[$diff>>2]; $195 = $len; $196 = $194 * $195; $197 = ((($diff)) + 4|0); $198 = +HEAPF32[$197>>2]; $199 = $len; $200 = $198 * $199; _nk_vec2($6,$196,$200); ;HEAP32[$diff>>2]=HEAP32[$6>>2]|0;HEAP32[$diff+4>>2]=HEAP32[$6+4>>2]|0; $201 = ((($diff)) + 4|0); $202 = +HEAPF32[$201>>2]; $203 = $i1; $204 = $normals; $205 = (($204) + ($203<<3)|0); HEAPF32[$205>>2] = $202; $206 = +HEAPF32[$diff>>2]; $207 = -$206; $208 = $i1; $209 = $normals; $210 = (($209) + ($208<<3)|0); $211 = ((($210)) + 4|0); HEAPF32[$211>>2] = $207; $212 = $i1; $213 = (($212) + 1)|0; $i1 = $213; } $214 = $3; $215 = ($214|0)!=(0); if (!($215)) { $216 = $2; $217 = (($216) - 1)|0; $218 = $normals; $219 = (($218) + ($217<<3)|0); $220 = $2; $221 = (($220) - 2)|0; $222 = $normals; $223 = (($222) + ($221<<3)|0); ;HEAP32[$219>>2]=HEAP32[$223>>2]|0;HEAP32[$219+4>>2]=HEAP32[$223+4>>2]|0; } $224 = $thick_line; $225 = ($224|0)!=(0); L47: do { if ($225) { $562 = $4; $563 = $562 - 1.0; $564 = $563 * 0.5; $half_inner_thickness = $564; $565 = $3; $566 = ($565|0)!=(0); if (!($566)) { $567 = $normals; $568 = +HEAPF32[$567>>2]; $569 = $half_inner_thickness; $570 = $569 + 1.0; $571 = $568 * $570; $572 = $normals; $573 = ((($572)) + 4|0); $574 = +HEAPF32[$573>>2]; $575 = $half_inner_thickness; $576 = $575 + 1.0; $577 = $574 * $576; _nk_vec2($d1,$571,$577); $578 = $normals; $579 = +HEAPF32[$578>>2]; $580 = $half_inner_thickness; $581 = $579 * $580; $582 = $normals; $583 = ((($582)) + 4|0); $584 = +HEAPF32[$583>>2]; $585 = $half_inner_thickness; $586 = $584 * $585; _nk_vec2($d2,$581,$586); $587 = $temp; $588 = $1; $589 = +HEAPF32[$588>>2]; $590 = +HEAPF32[$d1>>2]; $591 = $589 + $590; $592 = $1; $593 = ((($592)) + 4|0); $594 = +HEAPF32[$593>>2]; $595 = ((($d1)) + 4|0); $596 = +HEAPF32[$595>>2]; $597 = $594 + $596; _nk_vec2($26,$591,$597); ;HEAP32[$587>>2]=HEAP32[$26>>2]|0;HEAP32[$587+4>>2]=HEAP32[$26+4>>2]|0; $598 = $temp; $599 = ((($598)) + 8|0); $600 = $1; $601 = +HEAPF32[$600>>2]; $602 = +HEAPF32[$d2>>2]; $603 = $601 + $602; $604 = $1; $605 = ((($604)) + 4|0); $606 = +HEAPF32[$605>>2]; $607 = ((($d2)) + 4|0); $608 = +HEAPF32[$607>>2]; $609 = $606 + $608; _nk_vec2($27,$603,$609); ;HEAP32[$599>>2]=HEAP32[$27>>2]|0;HEAP32[$599+4>>2]=HEAP32[$27+4>>2]|0; $610 = $temp; $611 = ((($610)) + 16|0); $612 = $1; $613 = +HEAPF32[$612>>2]; $614 = +HEAPF32[$d2>>2]; $615 = $613 - $614; $616 = $1; $617 = ((($616)) + 4|0); $618 = +HEAPF32[$617>>2]; $619 = ((($d2)) + 4|0); $620 = +HEAPF32[$619>>2]; $621 = $618 - $620; _nk_vec2($28,$615,$621); ;HEAP32[$611>>2]=HEAP32[$28>>2]|0;HEAP32[$611+4>>2]=HEAP32[$28+4>>2]|0; $622 = $temp; $623 = ((($622)) + 24|0); $624 = $1; $625 = +HEAPF32[$624>>2]; $626 = +HEAPF32[$d1>>2]; $627 = $625 - $626; $628 = $1; $629 = ((($628)) + 4|0); $630 = +HEAPF32[$629>>2]; $631 = ((($d1)) + 4|0); $632 = +HEAPF32[$631>>2]; $633 = $630 - $632; _nk_vec2($29,$627,$633); ;HEAP32[$623>>2]=HEAP32[$29>>2]|0;HEAP32[$623+4>>2]=HEAP32[$29+4>>2]|0; $634 = $2; $635 = (($634) - 1)|0; $636 = $normals; $637 = (($636) + ($635<<3)|0); $638 = +HEAPF32[$637>>2]; $639 = $half_inner_thickness; $640 = $639 + 1.0; $641 = $638 * $640; $642 = $2; $643 = (($642) - 1)|0; $644 = $normals; $645 = (($644) + ($643<<3)|0); $646 = ((($645)) + 4|0); $647 = +HEAPF32[$646>>2]; $648 = $half_inner_thickness; $649 = $648 + 1.0; $650 = $647 * $649; _nk_vec2($30,$641,$650); ;HEAP32[$d1>>2]=HEAP32[$30>>2]|0;HEAP32[$d1+4>>2]=HEAP32[$30+4>>2]|0; $651 = $2; $652 = (($651) - 1)|0; $653 = $normals; $654 = (($653) + ($652<<3)|0); $655 = +HEAPF32[$654>>2]; $656 = $half_inner_thickness; $657 = $655 * $656; $658 = $2; $659 = (($658) - 1)|0; $660 = $normals; $661 = (($660) + ($659<<3)|0); $662 = ((($661)) + 4|0); $663 = +HEAPF32[$662>>2]; $664 = $half_inner_thickness; $665 = $663 * $664; _nk_vec2($31,$657,$665); ;HEAP32[$d2>>2]=HEAP32[$31>>2]|0;HEAP32[$d2+4>>2]=HEAP32[$31+4>>2]|0; $666 = $2; $667 = (($666) - 1)|0; $668 = $667<<2; $669 = (($668) + 0)|0; $670 = $temp; $671 = (($670) + ($669<<3)|0); $672 = $2; $673 = (($672) - 1)|0; $674 = $1; $675 = (($674) + ($673<<3)|0); $676 = +HEAPF32[$675>>2]; $677 = +HEAPF32[$d1>>2]; $678 = $676 + $677; $679 = $2; $680 = (($679) - 1)|0; $681 = $1; $682 = (($681) + ($680<<3)|0); $683 = ((($682)) + 4|0); $684 = +HEAPF32[$683>>2]; $685 = ((($d1)) + 4|0); $686 = +HEAPF32[$685>>2]; $687 = $684 + $686; _nk_vec2($32,$678,$687); ;HEAP32[$671>>2]=HEAP32[$32>>2]|0;HEAP32[$671+4>>2]=HEAP32[$32+4>>2]|0; $688 = $2; $689 = (($688) - 1)|0; $690 = $689<<2; $691 = (($690) + 1)|0; $692 = $temp; $693 = (($692) + ($691<<3)|0); $694 = $2; $695 = (($694) - 1)|0; $696 = $1; $697 = (($696) + ($695<<3)|0); $698 = +HEAPF32[$697>>2]; $699 = +HEAPF32[$d2>>2]; $700 = $698 + $699; $701 = $2; $702 = (($701) - 1)|0; $703 = $1; $704 = (($703) + ($702<<3)|0); $705 = ((($704)) + 4|0); $706 = +HEAPF32[$705>>2]; $707 = ((($d2)) + 4|0); $708 = +HEAPF32[$707>>2]; $709 = $706 + $708; _nk_vec2($33,$700,$709); ;HEAP32[$693>>2]=HEAP32[$33>>2]|0;HEAP32[$693+4>>2]=HEAP32[$33+4>>2]|0; $710 = $2; $711 = (($710) - 1)|0; $712 = $711<<2; $713 = (($712) + 2)|0; $714 = $temp; $715 = (($714) + ($713<<3)|0); $716 = $2; $717 = (($716) - 1)|0; $718 = $1; $719 = (($718) + ($717<<3)|0); $720 = +HEAPF32[$719>>2]; $721 = +HEAPF32[$d2>>2]; $722 = $720 - $721; $723 = $2; $724 = (($723) - 1)|0; $725 = $1; $726 = (($725) + ($724<<3)|0); $727 = ((($726)) + 4|0); $728 = +HEAPF32[$727>>2]; $729 = ((($d2)) + 4|0); $730 = +HEAPF32[$729>>2]; $731 = $728 - $730; _nk_vec2($34,$722,$731); ;HEAP32[$715>>2]=HEAP32[$34>>2]|0;HEAP32[$715+4>>2]=HEAP32[$34+4>>2]|0; $732 = $2; $733 = (($732) - 1)|0; $734 = $733<<2; $735 = (($734) + 3)|0; $736 = $temp; $737 = (($736) + ($735<<3)|0); $738 = $2; $739 = (($738) - 1)|0; $740 = $1; $741 = (($740) + ($739<<3)|0); $742 = +HEAPF32[$741>>2]; $743 = +HEAPF32[$d1>>2]; $744 = $742 - $743; $745 = $2; $746 = (($745) - 1)|0; $747 = $1; $748 = (($747) + ($746<<3)|0); $749 = ((($748)) + 4|0); $750 = +HEAPF32[$749>>2]; $751 = ((($d1)) + 4|0); $752 = +HEAPF32[$751>>2]; $753 = $750 - $752; _nk_vec2($35,$744,$753); ;HEAP32[$737>>2]=HEAP32[$35>>2]|0;HEAP32[$737+4>>2]=HEAP32[$35+4>>2]|0; } $754 = $index; $idx12 = $754; $i1 = 0; while(1) { $755 = $i1; $756 = $count; $757 = ($755>>>0)<($756>>>0); if (!($757)) { break; } $758 = $i1; $759 = (($758) + 1)|0; $760 = $2; $761 = ($759|0)==($760|0); $762 = $i1; $763 = (($762) + 1)|0; $764 = $761 ? 0 : $763; $i24 = $764; $765 = $i1; $766 = (($765) + 1)|0; $767 = $2; $768 = ($766|0)==($767|0); $769 = $index; $770 = $idx12; $771 = (($770) + 4)|0; $772 = $768 ? $769 : $771; $idx25 = $772; $773 = $i1; $774 = $normals; $775 = (($774) + ($773<<3)|0); $776 = +HEAPF32[$775>>2]; $777 = $i24; $778 = $normals; $779 = (($778) + ($777<<3)|0); $780 = +HEAPF32[$779>>2]; $781 = $776 + $780; $782 = $i1; $783 = $normals; $784 = (($783) + ($782<<3)|0); $785 = ((($784)) + 4|0); $786 = +HEAPF32[$785>>2]; $787 = $i24; $788 = $normals; $789 = (($788) + ($787<<3)|0); $790 = ((($789)) + 4|0); $791 = +HEAPF32[$790>>2]; $792 = $786 + $791; _nk_vec2($36,$781,$792); $793 = +HEAPF32[$36>>2]; $794 = $793 * 0.5; $795 = $i1; $796 = $normals; $797 = (($796) + ($795<<3)|0); $798 = +HEAPF32[$797>>2]; $799 = $i24; $800 = $normals; $801 = (($800) + ($799<<3)|0); $802 = +HEAPF32[$801>>2]; $803 = $798 + $802; $804 = $i1; $805 = $normals; $806 = (($805) + ($804<<3)|0); $807 = ((($806)) + 4|0); $808 = +HEAPF32[$807>>2]; $809 = $i24; $810 = $normals; $811 = (($810) + ($809<<3)|0); $812 = ((($811)) + 4|0); $813 = +HEAPF32[$812>>2]; $814 = $808 + $813; _nk_vec2($37,$803,$814); $815 = ((($37)) + 4|0); $816 = +HEAPF32[$815>>2]; $817 = $816 * 0.5; _nk_vec2($dm6,$794,$817); $818 = +HEAPF32[$dm6>>2]; $819 = +HEAPF32[$dm6>>2]; $820 = $818 * $819; $821 = ((($dm6)) + 4|0); $822 = +HEAPF32[$821>>2]; $823 = ((($dm6)) + 4|0); $824 = +HEAPF32[$823>>2]; $825 = $822 * $824; $826 = $820 + $825; $dmr27 = $826; $827 = $dmr27; $828 = $827 > 9.9999999747524271E-7; if ($828) { $829 = $dmr27; $830 = 1.0 / $829; $scale8 = $830; $831 = $scale8; $832 = 100.0 < $831; $833 = $scale8; $834 = $832 ? 100.0 : $833; $scale8 = $834; $835 = +HEAPF32[$dm6>>2]; $836 = $scale8; $837 = $835 * $836; $838 = ((($dm6)) + 4|0); $839 = +HEAPF32[$838>>2]; $840 = $scale8; $841 = $839 * $840; _nk_vec2($38,$837,$841); ;HEAP32[$dm6>>2]=HEAP32[$38>>2]|0;HEAP32[$dm6+4>>2]=HEAP32[$38+4>>2]|0; } $842 = +HEAPF32[$dm6>>2]; $843 = $half_inner_thickness; $844 = $843 + 1.0; $845 = $842 * $844; $846 = ((($dm6)) + 4|0); $847 = +HEAPF32[$846>>2]; $848 = $half_inner_thickness; $849 = $848 + 1.0; $850 = $847 * $849; _nk_vec2($39,$845,$850); ;HEAP32[$dm_out>>2]=HEAP32[$39>>2]|0;HEAP32[$dm_out+4>>2]=HEAP32[$39+4>>2]|0; $851 = +HEAPF32[$dm6>>2]; $852 = $half_inner_thickness; $853 = $851 * $852; $854 = ((($dm6)) + 4|0); $855 = +HEAPF32[$854>>2]; $856 = $half_inner_thickness; $857 = $855 * $856; _nk_vec2($40,$853,$857); ;HEAP32[$dm_in>>2]=HEAP32[$40>>2]|0;HEAP32[$dm_in+4>>2]=HEAP32[$40+4>>2]|0; $858 = $i24; $859 = $858<<2; $860 = (($859) + 0)|0; $861 = $temp; $862 = (($861) + ($860<<3)|0); $863 = $i24; $864 = $1; $865 = (($864) + ($863<<3)|0); $866 = +HEAPF32[$865>>2]; $867 = +HEAPF32[$dm_out>>2]; $868 = $866 + $867; $869 = $i24; $870 = $1; $871 = (($870) + ($869<<3)|0); $872 = ((($871)) + 4|0); $873 = +HEAPF32[$872>>2]; $874 = ((($dm_out)) + 4|0); $875 = +HEAPF32[$874>>2]; $876 = $873 + $875; _nk_vec2($41,$868,$876); ;HEAP32[$862>>2]=HEAP32[$41>>2]|0;HEAP32[$862+4>>2]=HEAP32[$41+4>>2]|0; $877 = $i24; $878 = $877<<2; $879 = (($878) + 1)|0; $880 = $temp; $881 = (($880) + ($879<<3)|0); $882 = $i24; $883 = $1; $884 = (($883) + ($882<<3)|0); $885 = +HEAPF32[$884>>2]; $886 = +HEAPF32[$dm_in>>2]; $887 = $885 + $886; $888 = $i24; $889 = $1; $890 = (($889) + ($888<<3)|0); $891 = ((($890)) + 4|0); $892 = +HEAPF32[$891>>2]; $893 = ((($dm_in)) + 4|0); $894 = +HEAPF32[$893>>2]; $895 = $892 + $894; _nk_vec2($42,$887,$895); ;HEAP32[$881>>2]=HEAP32[$42>>2]|0;HEAP32[$881+4>>2]=HEAP32[$42+4>>2]|0; $896 = $i24; $897 = $896<<2; $898 = (($897) + 2)|0; $899 = $temp; $900 = (($899) + ($898<<3)|0); $901 = $i24; $902 = $1; $903 = (($902) + ($901<<3)|0); $904 = +HEAPF32[$903>>2]; $905 = +HEAPF32[$dm_in>>2]; $906 = $904 - $905; $907 = $i24; $908 = $1; $909 = (($908) + ($907<<3)|0); $910 = ((($909)) + 4|0); $911 = +HEAPF32[$910>>2]; $912 = ((($dm_in)) + 4|0); $913 = +HEAPF32[$912>>2]; $914 = $911 - $913; _nk_vec2($43,$906,$914); ;HEAP32[$900>>2]=HEAP32[$43>>2]|0;HEAP32[$900+4>>2]=HEAP32[$43+4>>2]|0; $915 = $i24; $916 = $915<<2; $917 = (($916) + 3)|0; $918 = $temp; $919 = (($918) + ($917<<3)|0); $920 = $i24; $921 = $1; $922 = (($921) + ($920<<3)|0); $923 = +HEAPF32[$922>>2]; $924 = +HEAPF32[$dm_out>>2]; $925 = $923 - $924; $926 = $i24; $927 = $1; $928 = (($927) + ($926<<3)|0); $929 = ((($928)) + 4|0); $930 = +HEAPF32[$929>>2]; $931 = ((($dm_out)) + 4|0); $932 = +HEAPF32[$931>>2]; $933 = $930 - $932; _nk_vec2($44,$925,$933); ;HEAP32[$919>>2]=HEAP32[$44>>2]|0;HEAP32[$919+4>>2]=HEAP32[$44+4>>2]|0; $934 = $idx25; $935 = (($934) + 1)|0; $936 = $935&65535; $937 = $ids; HEAP16[$937>>1] = $936; $938 = $idx12; $939 = (($938) + 1)|0; $940 = $939&65535; $941 = $ids; $942 = ((($941)) + 2|0); HEAP16[$942>>1] = $940; $943 = $idx12; $944 = (($943) + 2)|0; $945 = $944&65535; $946 = $ids; $947 = ((($946)) + 4|0); HEAP16[$947>>1] = $945; $948 = $idx12; $949 = (($948) + 2)|0; $950 = $949&65535; $951 = $ids; $952 = ((($951)) + 6|0); HEAP16[$952>>1] = $950; $953 = $idx25; $954 = (($953) + 2)|0; $955 = $954&65535; $956 = $ids; $957 = ((($956)) + 8|0); HEAP16[$957>>1] = $955; $958 = $idx25; $959 = (($958) + 1)|0; $960 = $959&65535; $961 = $ids; $962 = ((($961)) + 10|0); HEAP16[$962>>1] = $960; $963 = $idx25; $964 = (($963) + 1)|0; $965 = $964&65535; $966 = $ids; $967 = ((($966)) + 12|0); HEAP16[$967>>1] = $965; $968 = $idx12; $969 = (($968) + 1)|0; $970 = $969&65535; $971 = $ids; $972 = ((($971)) + 14|0); HEAP16[$972>>1] = $970; $973 = $idx12; $974 = (($973) + 0)|0; $975 = $974&65535; $976 = $ids; $977 = ((($976)) + 16|0); HEAP16[$977>>1] = $975; $978 = $idx12; $979 = (($978) + 0)|0; $980 = $979&65535; $981 = $ids; $982 = ((($981)) + 18|0); HEAP16[$982>>1] = $980; $983 = $idx25; $984 = (($983) + 0)|0; $985 = $984&65535; $986 = $ids; $987 = ((($986)) + 20|0); HEAP16[$987>>1] = $985; $988 = $idx25; $989 = (($988) + 1)|0; $990 = $989&65535; $991 = $ids; $992 = ((($991)) + 22|0); HEAP16[$992>>1] = $990; $993 = $idx25; $994 = (($993) + 2)|0; $995 = $994&65535; $996 = $ids; $997 = ((($996)) + 24|0); HEAP16[$997>>1] = $995; $998 = $idx12; $999 = (($998) + 2)|0; $1000 = $999&65535; $1001 = $ids; $1002 = ((($1001)) + 26|0); HEAP16[$1002>>1] = $1000; $1003 = $idx12; $1004 = (($1003) + 3)|0; $1005 = $1004&65535; $1006 = $ids; $1007 = ((($1006)) + 28|0); HEAP16[$1007>>1] = $1005; $1008 = $idx12; $1009 = (($1008) + 3)|0; $1010 = $1009&65535; $1011 = $ids; $1012 = ((($1011)) + 30|0); HEAP16[$1012>>1] = $1010; $1013 = $idx25; $1014 = (($1013) + 3)|0; $1015 = $1014&65535; $1016 = $ids; $1017 = ((($1016)) + 32|0); HEAP16[$1017>>1] = $1015; $1018 = $idx25; $1019 = (($1018) + 2)|0; $1020 = $1019&65535; $1021 = $ids; $1022 = ((($1021)) + 34|0); HEAP16[$1022>>1] = $1020; $1023 = $ids; $1024 = ((($1023)) + 36|0); $ids = $1024; $1025 = $idx25; $idx12 = $1025; $1026 = $i1; $1027 = (($1026) + 1)|0; $i1 = $1027; } $i3 = 0; while(1) { $1028 = $i3; $1029 = $2; $1030 = ($1028>>>0)<($1029>>>0); if (!($1030)) { break L47; } $1031 = $0; $1032 = ((($1031)) + 12|0); $1033 = ((($1032)) + 4|0); ;HEAP32[$uv9>>2]=HEAP32[$1033>>2]|0;HEAP32[$uv9+4>>2]=HEAP32[$1033+4>>2]|0; $1034 = $vtx; $1035 = $i3; $1036 = $1035<<2; $1037 = (($1036) + 0)|0; $1038 = $temp; $1039 = (($1038) + ($1037<<3)|0); $1040 = $col_trans; ;HEAP32[$$byval_copy12>>2]=HEAP32[$1039>>2]|0;HEAP32[$$byval_copy12+4>>2]=HEAP32[$1039+4>>2]|0; ;HEAP32[$uv9$byval_copy>>2]=HEAP32[$uv9>>2]|0;HEAP32[$uv9$byval_copy+4>>2]=HEAP32[$uv9+4>>2]|0; _nk_draw_vertex($45,$$byval_copy12,$uv9$byval_copy,$1040); ;HEAP32[$1034>>2]=HEAP32[$45>>2]|0;HEAP32[$1034+4>>2]=HEAP32[$45+4>>2]|0;HEAP32[$1034+8>>2]=HEAP32[$45+8>>2]|0;HEAP32[$1034+12>>2]=HEAP32[$45+12>>2]|0;HEAP32[$1034+16>>2]=HEAP32[$45+16>>2]|0; $1041 = $vtx; $1042 = ((($1041)) + 20|0); $1043 = $i3; $1044 = $1043<<2; $1045 = (($1044) + 1)|0; $1046 = $temp; $1047 = (($1046) + ($1045<<3)|0); $1048 = $col; ;HEAP32[$$byval_copy13>>2]=HEAP32[$1047>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$1047+4>>2]|0; ;HEAP32[$uv9$byval_copy14>>2]=HEAP32[$uv9>>2]|0;HEAP32[$uv9$byval_copy14+4>>2]=HEAP32[$uv9+4>>2]|0; _nk_draw_vertex($46,$$byval_copy13,$uv9$byval_copy14,$1048); ;HEAP32[$1042>>2]=HEAP32[$46>>2]|0;HEAP32[$1042+4>>2]=HEAP32[$46+4>>2]|0;HEAP32[$1042+8>>2]=HEAP32[$46+8>>2]|0;HEAP32[$1042+12>>2]=HEAP32[$46+12>>2]|0;HEAP32[$1042+16>>2]=HEAP32[$46+16>>2]|0; $1049 = $vtx; $1050 = ((($1049)) + 40|0); $1051 = $i3; $1052 = $1051<<2; $1053 = (($1052) + 2)|0; $1054 = $temp; $1055 = (($1054) + ($1053<<3)|0); $1056 = $col; ;HEAP32[$$byval_copy15>>2]=HEAP32[$1055>>2]|0;HEAP32[$$byval_copy15+4>>2]=HEAP32[$1055+4>>2]|0; ;HEAP32[$uv9$byval_copy16>>2]=HEAP32[$uv9>>2]|0;HEAP32[$uv9$byval_copy16+4>>2]=HEAP32[$uv9+4>>2]|0; _nk_draw_vertex($47,$$byval_copy15,$uv9$byval_copy16,$1056); ;HEAP32[$1050>>2]=HEAP32[$47>>2]|0;HEAP32[$1050+4>>2]=HEAP32[$47+4>>2]|0;HEAP32[$1050+8>>2]=HEAP32[$47+8>>2]|0;HEAP32[$1050+12>>2]=HEAP32[$47+12>>2]|0;HEAP32[$1050+16>>2]=HEAP32[$47+16>>2]|0; $1057 = $vtx; $1058 = ((($1057)) + 60|0); $1059 = $i3; $1060 = $1059<<2; $1061 = (($1060) + 3)|0; $1062 = $temp; $1063 = (($1062) + ($1061<<3)|0); $1064 = $col_trans; ;HEAP32[$$byval_copy17>>2]=HEAP32[$1063>>2]|0;HEAP32[$$byval_copy17+4>>2]=HEAP32[$1063+4>>2]|0; ;HEAP32[$uv9$byval_copy18>>2]=HEAP32[$uv9>>2]|0;HEAP32[$uv9$byval_copy18+4>>2]=HEAP32[$uv9+4>>2]|0; _nk_draw_vertex($48,$$byval_copy17,$uv9$byval_copy18,$1064); ;HEAP32[$1058>>2]=HEAP32[$48>>2]|0;HEAP32[$1058+4>>2]=HEAP32[$48+4>>2]|0;HEAP32[$1058+8>>2]=HEAP32[$48+8>>2]|0;HEAP32[$1058+12>>2]=HEAP32[$48+12>>2]|0;HEAP32[$1058+16>>2]=HEAP32[$48+16>>2]|0; $1065 = $vtx; $1066 = ((($1065)) + 80|0); $vtx = $1066; $1067 = $i3; $1068 = (($1067) + 1)|0; $i3 = $1068; } } else { $226 = $3; $227 = ($226|0)!=(0); if (!($227)) { $228 = $temp; $229 = $1; $230 = +HEAPF32[$229>>2]; $231 = $normals; $232 = +HEAPF32[$231>>2]; $233 = $232 * 1.0; $234 = $normals; $235 = ((($234)) + 4|0); $236 = +HEAPF32[$235>>2]; $237 = $236 * 1.0; _nk_vec2($7,$233,$237); $238 = +HEAPF32[$7>>2]; $239 = $230 + $238; $240 = $1; $241 = ((($240)) + 4|0); $242 = +HEAPF32[$241>>2]; $243 = $normals; $244 = +HEAPF32[$243>>2]; $245 = $244 * 1.0; $246 = $normals; $247 = ((($246)) + 4|0); $248 = +HEAPF32[$247>>2]; $249 = $248 * 1.0; _nk_vec2($8,$245,$249); $250 = ((($8)) + 4|0); $251 = +HEAPF32[$250>>2]; $252 = $242 + $251; _nk_vec2($9,$239,$252); ;HEAP32[$228>>2]=HEAP32[$9>>2]|0;HEAP32[$228+4>>2]=HEAP32[$9+4>>2]|0; $253 = $temp; $254 = ((($253)) + 8|0); $255 = $1; $256 = +HEAPF32[$255>>2]; $257 = $normals; $258 = +HEAPF32[$257>>2]; $259 = $258 * 1.0; $260 = $normals; $261 = ((($260)) + 4|0); $262 = +HEAPF32[$261>>2]; $263 = $262 * 1.0; _nk_vec2($10,$259,$263); $264 = +HEAPF32[$10>>2]; $265 = $256 - $264; $266 = $1; $267 = ((($266)) + 4|0); $268 = +HEAPF32[$267>>2]; $269 = $normals; $270 = +HEAPF32[$269>>2]; $271 = $270 * 1.0; $272 = $normals; $273 = ((($272)) + 4|0); $274 = +HEAPF32[$273>>2]; $275 = $274 * 1.0; _nk_vec2($11,$271,$275); $276 = ((($11)) + 4|0); $277 = +HEAPF32[$276>>2]; $278 = $268 - $277; _nk_vec2($12,$265,$278); ;HEAP32[$254>>2]=HEAP32[$12>>2]|0;HEAP32[$254+4>>2]=HEAP32[$12+4>>2]|0; $279 = $2; $280 = (($279) - 1)|0; $281 = $normals; $282 = (($281) + ($280<<3)|0); $283 = +HEAPF32[$282>>2]; $284 = $283 * 1.0; $285 = $2; $286 = (($285) - 1)|0; $287 = $normals; $288 = (($287) + ($286<<3)|0); $289 = ((($288)) + 4|0); $290 = +HEAPF32[$289>>2]; $291 = $290 * 1.0; _nk_vec2($13,$284,$291); ;HEAP32[$d>>2]=HEAP32[$13>>2]|0;HEAP32[$d+4>>2]=HEAP32[$13+4>>2]|0; $292 = $2; $293 = (($292) - 1)|0; $294 = $293<<1; $295 = (($294) + 0)|0; $296 = $temp; $297 = (($296) + ($295<<3)|0); $298 = $2; $299 = (($298) - 1)|0; $300 = $1; $301 = (($300) + ($299<<3)|0); $302 = +HEAPF32[$301>>2]; $303 = +HEAPF32[$d>>2]; $304 = $302 + $303; $305 = $2; $306 = (($305) - 1)|0; $307 = $1; $308 = (($307) + ($306<<3)|0); $309 = ((($308)) + 4|0); $310 = +HEAPF32[$309>>2]; $311 = ((($d)) + 4|0); $312 = +HEAPF32[$311>>2]; $313 = $310 + $312; _nk_vec2($14,$304,$313); ;HEAP32[$297>>2]=HEAP32[$14>>2]|0;HEAP32[$297+4>>2]=HEAP32[$14+4>>2]|0; $314 = $2; $315 = (($314) - 1)|0; $316 = $315<<1; $317 = (($316) + 1)|0; $318 = $temp; $319 = (($318) + ($317<<3)|0); $320 = $2; $321 = (($320) - 1)|0; $322 = $1; $323 = (($322) + ($321<<3)|0); $324 = +HEAPF32[$323>>2]; $325 = +HEAPF32[$d>>2]; $326 = $324 - $325; $327 = $2; $328 = (($327) - 1)|0; $329 = $1; $330 = (($329) + ($328<<3)|0); $331 = ((($330)) + 4|0); $332 = +HEAPF32[$331>>2]; $333 = ((($d)) + 4|0); $334 = +HEAPF32[$333>>2]; $335 = $332 - $334; _nk_vec2($15,$326,$335); ;HEAP32[$319>>2]=HEAP32[$15>>2]|0;HEAP32[$319+4>>2]=HEAP32[$15+4>>2]|0; } $336 = $index; $idx1 = $336; $i1 = 0; while(1) { $337 = $i1; $338 = $count; $339 = ($337>>>0)<($338>>>0); if (!($339)) { break; } $340 = $i1; $341 = (($340) + 1)|0; $342 = $2; $343 = ($341|0)==($342|0); $344 = $i1; $345 = (($344) + 1)|0; $346 = $343 ? 0 : $345; $i21 = $346; $347 = $i1; $348 = (($347) + 1)|0; $349 = $2; $350 = ($348|0)==($349|0); $351 = $index; $352 = $idx1; $353 = (($352) + 3)|0; $354 = $350 ? $351 : $353; $idx2 = $354; $355 = $i1; $356 = $normals; $357 = (($356) + ($355<<3)|0); $358 = +HEAPF32[$357>>2]; $359 = $i21; $360 = $normals; $361 = (($360) + ($359<<3)|0); $362 = +HEAPF32[$361>>2]; $363 = $358 + $362; $364 = $i1; $365 = $normals; $366 = (($365) + ($364<<3)|0); $367 = ((($366)) + 4|0); $368 = +HEAPF32[$367>>2]; $369 = $i21; $370 = $normals; $371 = (($370) + ($369<<3)|0); $372 = ((($371)) + 4|0); $373 = +HEAPF32[$372>>2]; $374 = $368 + $373; _nk_vec2($16,$363,$374); $375 = +HEAPF32[$16>>2]; $376 = $375 * 0.5; $377 = $i1; $378 = $normals; $379 = (($378) + ($377<<3)|0); $380 = +HEAPF32[$379>>2]; $381 = $i21; $382 = $normals; $383 = (($382) + ($381<<3)|0); $384 = +HEAPF32[$383>>2]; $385 = $380 + $384; $386 = $i1; $387 = $normals; $388 = (($387) + ($386<<3)|0); $389 = ((($388)) + 4|0); $390 = +HEAPF32[$389>>2]; $391 = $i21; $392 = $normals; $393 = (($392) + ($391<<3)|0); $394 = ((($393)) + 4|0); $395 = +HEAPF32[$394>>2]; $396 = $390 + $395; _nk_vec2($17,$385,$396); $397 = ((($17)) + 4|0); $398 = +HEAPF32[$397>>2]; $399 = $398 * 0.5; _nk_vec2($18,$376,$399); ;HEAP32[$dm>>2]=HEAP32[$18>>2]|0;HEAP32[$dm+4>>2]=HEAP32[$18+4>>2]|0; $400 = +HEAPF32[$dm>>2]; $401 = +HEAPF32[$dm>>2]; $402 = $400 * $401; $403 = ((($dm)) + 4|0); $404 = +HEAPF32[$403>>2]; $405 = ((($dm)) + 4|0); $406 = +HEAPF32[$405>>2]; $407 = $404 * $406; $408 = $402 + $407; $dmr2 = $408; $409 = $dmr2; $410 = $409 > 9.9999999747524271E-7; if ($410) { $411 = $dmr2; $412 = 1.0 / $411; $scale = $412; $413 = $scale; $414 = 100.0 < $413; $415 = $scale; $416 = $414 ? 100.0 : $415; $scale = $416; $417 = +HEAPF32[$dm>>2]; $418 = $scale; $419 = $417 * $418; $420 = ((($dm)) + 4|0); $421 = +HEAPF32[$420>>2]; $422 = $scale; $423 = $421 * $422; _nk_vec2($19,$419,$423); ;HEAP32[$dm>>2]=HEAP32[$19>>2]|0;HEAP32[$dm+4>>2]=HEAP32[$19+4>>2]|0; } $424 = +HEAPF32[$dm>>2]; $425 = $424 * 1.0; $426 = ((($dm)) + 4|0); $427 = +HEAPF32[$426>>2]; $428 = $427 * 1.0; _nk_vec2($20,$425,$428); ;HEAP32[$dm>>2]=HEAP32[$20>>2]|0;HEAP32[$dm+4>>2]=HEAP32[$20+4>>2]|0; $429 = $i21; $430 = $429<<1; $431 = (($430) + 0)|0; $432 = $temp; $433 = (($432) + ($431<<3)|0); $434 = $i21; $435 = $1; $436 = (($435) + ($434<<3)|0); $437 = +HEAPF32[$436>>2]; $438 = +HEAPF32[$dm>>2]; $439 = $437 + $438; $440 = $i21; $441 = $1; $442 = (($441) + ($440<<3)|0); $443 = ((($442)) + 4|0); $444 = +HEAPF32[$443>>2]; $445 = ((($dm)) + 4|0); $446 = +HEAPF32[$445>>2]; $447 = $444 + $446; _nk_vec2($21,$439,$447); ;HEAP32[$433>>2]=HEAP32[$21>>2]|0;HEAP32[$433+4>>2]=HEAP32[$21+4>>2]|0; $448 = $i21; $449 = $448<<1; $450 = (($449) + 1)|0; $451 = $temp; $452 = (($451) + ($450<<3)|0); $453 = $i21; $454 = $1; $455 = (($454) + ($453<<3)|0); $456 = +HEAPF32[$455>>2]; $457 = +HEAPF32[$dm>>2]; $458 = $456 - $457; $459 = $i21; $460 = $1; $461 = (($460) + ($459<<3)|0); $462 = ((($461)) + 4|0); $463 = +HEAPF32[$462>>2]; $464 = ((($dm)) + 4|0); $465 = +HEAPF32[$464>>2]; $466 = $463 - $465; _nk_vec2($22,$458,$466); ;HEAP32[$452>>2]=HEAP32[$22>>2]|0;HEAP32[$452+4>>2]=HEAP32[$22+4>>2]|0; $467 = $idx2; $468 = (($467) + 0)|0; $469 = $468&65535; $470 = $ids; HEAP16[$470>>1] = $469; $471 = $idx1; $472 = (($471) + 0)|0; $473 = $472&65535; $474 = $ids; $475 = ((($474)) + 2|0); HEAP16[$475>>1] = $473; $476 = $idx1; $477 = (($476) + 2)|0; $478 = $477&65535; $479 = $ids; $480 = ((($479)) + 4|0); HEAP16[$480>>1] = $478; $481 = $idx1; $482 = (($481) + 2)|0; $483 = $482&65535; $484 = $ids; $485 = ((($484)) + 6|0); HEAP16[$485>>1] = $483; $486 = $idx2; $487 = (($486) + 2)|0; $488 = $487&65535; $489 = $ids; $490 = ((($489)) + 8|0); HEAP16[$490>>1] = $488; $491 = $idx2; $492 = (($491) + 0)|0; $493 = $492&65535; $494 = $ids; $495 = ((($494)) + 10|0); HEAP16[$495>>1] = $493; $496 = $idx2; $497 = (($496) + 1)|0; $498 = $497&65535; $499 = $ids; $500 = ((($499)) + 12|0); HEAP16[$500>>1] = $498; $501 = $idx1; $502 = (($501) + 1)|0; $503 = $502&65535; $504 = $ids; $505 = ((($504)) + 14|0); HEAP16[$505>>1] = $503; $506 = $idx1; $507 = (($506) + 0)|0; $508 = $507&65535; $509 = $ids; $510 = ((($509)) + 16|0); HEAP16[$510>>1] = $508; $511 = $idx1; $512 = (($511) + 0)|0; $513 = $512&65535; $514 = $ids; $515 = ((($514)) + 18|0); HEAP16[$515>>1] = $513; $516 = $idx2; $517 = (($516) + 0)|0; $518 = $517&65535; $519 = $ids; $520 = ((($519)) + 20|0); HEAP16[$520>>1] = $518; $521 = $idx2; $522 = (($521) + 1)|0; $523 = $522&65535; $524 = $ids; $525 = ((($524)) + 22|0); HEAP16[$525>>1] = $523; $526 = $ids; $527 = ((($526)) + 24|0); $ids = $527; $528 = $idx2; $idx1 = $528; $529 = $i1; $530 = (($529) + 1)|0; $i1 = $530; } $i = 0; while(1) { $531 = $i; $532 = $2; $533 = ($531>>>0)<($532>>>0); if (!($533)) { break L47; } $534 = $0; $535 = ((($534)) + 12|0); $536 = ((($535)) + 4|0); ;HEAP32[$uv>>2]=HEAP32[$536>>2]|0;HEAP32[$uv+4>>2]=HEAP32[$536+4>>2]|0; $537 = $vtx; $538 = $i; $539 = $1; $540 = (($539) + ($538<<3)|0); $541 = $col; ;HEAP32[$$byval_copy>>2]=HEAP32[$540>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$540+4>>2]|0; ;HEAP32[$uv$byval_copy>>2]=HEAP32[$uv>>2]|0;HEAP32[$uv$byval_copy+4>>2]=HEAP32[$uv+4>>2]|0; _nk_draw_vertex($23,$$byval_copy,$uv$byval_copy,$541); ;HEAP32[$537>>2]=HEAP32[$23>>2]|0;HEAP32[$537+4>>2]=HEAP32[$23+4>>2]|0;HEAP32[$537+8>>2]=HEAP32[$23+8>>2]|0;HEAP32[$537+12>>2]=HEAP32[$23+12>>2]|0;HEAP32[$537+16>>2]=HEAP32[$23+16>>2]|0; $542 = $vtx; $543 = ((($542)) + 20|0); $544 = $i; $545 = $544<<1; $546 = (($545) + 0)|0; $547 = $temp; $548 = (($547) + ($546<<3)|0); $549 = $col_trans; ;HEAP32[$$byval_copy8>>2]=HEAP32[$548>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$548+4>>2]|0; ;HEAP32[$uv$byval_copy9>>2]=HEAP32[$uv>>2]|0;HEAP32[$uv$byval_copy9+4>>2]=HEAP32[$uv+4>>2]|0; _nk_draw_vertex($24,$$byval_copy8,$uv$byval_copy9,$549); ;HEAP32[$543>>2]=HEAP32[$24>>2]|0;HEAP32[$543+4>>2]=HEAP32[$24+4>>2]|0;HEAP32[$543+8>>2]=HEAP32[$24+8>>2]|0;HEAP32[$543+12>>2]=HEAP32[$24+12>>2]|0;HEAP32[$543+16>>2]=HEAP32[$24+16>>2]|0; $550 = $vtx; $551 = ((($550)) + 40|0); $552 = $i; $553 = $552<<1; $554 = (($553) + 1)|0; $555 = $temp; $556 = (($555) + ($554<<3)|0); $557 = $col_trans; ;HEAP32[$$byval_copy10>>2]=HEAP32[$556>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[$556+4>>2]|0; ;HEAP32[$uv$byval_copy11>>2]=HEAP32[$uv>>2]|0;HEAP32[$uv$byval_copy11+4>>2]=HEAP32[$uv+4>>2]|0; _nk_draw_vertex($25,$$byval_copy10,$uv$byval_copy11,$557); ;HEAP32[$551>>2]=HEAP32[$25>>2]|0;HEAP32[$551+4>>2]=HEAP32[$25+4>>2]|0;HEAP32[$551+8>>2]=HEAP32[$25+8>>2]|0;HEAP32[$551+12>>2]=HEAP32[$25+12>>2]|0;HEAP32[$551+16>>2]=HEAP32[$25+16>>2]|0; $558 = $vtx; $559 = ((($558)) + 60|0); $vtx = $559; $560 = $i; $561 = (($560) + 1)|0; $i = $561; } } } while(0); $1069 = $0; $1070 = ((($1069)) + 44|0); $1071 = HEAP32[$1070>>2]|0; _nk_buffer_reset($1071,0); STACKTOP = sp;return; } function _nk_draw_list_alloc_vertices($list,$count) { $list = $list|0; $count = $count|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $vtx = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $list; $2 = $count; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14300|0),(13400|0),5670,(29896|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { $0 = 0; $21 = $0; STACKTOP = sp;return ($21|0); } $7 = $1; $8 = ((($7)) + 44|0); $9 = HEAP32[$8>>2]|0; $10 = $2; $11 = ($10*20)|0; $12 = (_nk_buffer_alloc($9,0,$11,4)|0); $vtx = $12; $13 = $vtx; $14 = ($13|0)!=(0|0); if ($14) { $15 = $2; $16 = $1; $17 = ((($16)) + 56|0); $18 = HEAP32[$17>>2]|0; $19 = (($18) + ($15))|0; HEAP32[$17>>2] = $19; $20 = $vtx; $0 = $20; $21 = $0; STACKTOP = sp;return ($21|0); } else { $0 = 0; $21 = $0; STACKTOP = sp;return ($21|0); } return (0)|0; } function _nk_draw_list_alloc_elements($list,$count) { $list = $list|0; $count = $count|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cmd = 0, $ids = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $list; $2 = $count; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14300|0),(13400|0),5687,(29924|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { $0 = 0; $27 = $0; STACKTOP = sp;return ($27|0); } $7 = $1; $8 = ((($7)) + 48|0); $9 = HEAP32[$8>>2]|0; $10 = $2; $11 = $10<<1; $12 = (_nk_buffer_alloc($9,0,$11,2)|0); $ids = $12; $13 = $ids; $14 = ($13|0)!=(0|0); if ($14) { $15 = $1; $16 = (_nk_draw_list_command_last($15)|0); $cmd = $16; $17 = $2; $18 = $1; $19 = ((($18)) + 52|0); $20 = HEAP32[$19>>2]|0; $21 = (($20) + ($17))|0; HEAP32[$19>>2] = $21; $22 = $2; $23 = $cmd; $24 = HEAP32[$23>>2]|0; $25 = (($24) + ($22))|0; HEAP32[$23>>2] = $25; $26 = $ids; $0 = $26; $27 = $0; STACKTOP = sp;return ($27|0); } else { $0 = 0; $27 = $0; STACKTOP = sp;return ($27|0); } return (0)|0; } function _nk_inv_sqrt($number) { $number = +$number; var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $conv = 0, $threehalfs = 0.0, $x2 = 0.0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $conv = sp; $0 = $number; $threehalfs = 1.5; ;HEAP32[$conv>>2]=0|0; $1 = $0; HEAPF32[$conv>>2] = $1; $2 = $0; $3 = $2 * 0.5; $x2 = $3; $4 = HEAP32[$conv>>2]|0; $5 = $4 >>> 1; $6 = (1597463172 - ($5))|0; HEAP32[$conv>>2] = $6; $7 = +HEAPF32[$conv>>2]; $8 = $x2; $9 = +HEAPF32[$conv>>2]; $10 = $8 * $9; $11 = +HEAPF32[$conv>>2]; $12 = $10 * $11; $13 = 1.5 - $12; $14 = $7 * $13; HEAPF32[$conv>>2] = $14; $15 = +HEAPF32[$conv>>2]; STACKTOP = sp;return (+$15); } function _nk_draw_vertex($agg$result,$pos,$uv,$col) { $agg$result = $agg$result|0; $pos = $pos|0; $uv = $uv|0; $col = $col|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $out = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $out = sp; $0 = $col; ;HEAP32[$out>>2]=HEAP32[$pos>>2]|0;HEAP32[$out+4>>2]=HEAP32[$pos+4>>2]|0; $1 = ((($out)) + 8|0); ;HEAP32[$1>>2]=HEAP32[$uv>>2]|0;HEAP32[$1+4>>2]=HEAP32[$uv+4>>2]|0; $2 = $0; $3 = ((($out)) + 16|0); HEAP32[$3>>2] = $2; ;HEAP32[$agg$result>>2]=HEAP32[$out>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$out+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$out+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$out+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$out+16>>2]|0; STACKTOP = sp;return; } function _nk_draw_list_fill_poly_convex($list,$points,$points_count,$color,$aliasing) { $list = $list|0; $points = $points|0; $points_count = $points_count|0; $color = $color|0; $aliasing = $aliasing|0; var $$byval_copy = 0, $$byval_copy6 = 0, $$byval_copy8 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0; var $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0, $135 = 0, $136 = 0.0, $137 = 0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0; var $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0.0, $154 = 0, $155 = 0, $156 = 0, $157 = 0.0, $158 = 0.0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0.0, $184 = 0; var $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0.0, $189 = 0.0, $19 = 0, $190 = 0.0, $191 = 0.0, $192 = 0, $193 = 0.0, $194 = 0, $195 = 0.0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0.0; var $202 = 0.0, $203 = 0, $204 = 0.0, $205 = 0, $206 = 0.0, $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0, $211 = 0.0, $212 = 0.0, $213 = 0.0, $214 = 0, $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0.0, $22 = 0.0; var $220 = 0, $221 = 0.0, $222 = 0.0, $223 = 0.0, $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0.0, $228 = 0.0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0.0, $234 = 0.0, $235 = 0.0, $236 = 0, $237 = 0, $238 = 0; var $239 = 0, $24 = 0.0, $240 = 0.0, $241 = 0, $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0.0, $251 = 0.0, $252 = 0.0, $253 = 0, $254 = 0, $255 = 0, $256 = 0; var $257 = 0.0, $258 = 0, $259 = 0.0, $26 = 0, $260 = 0.0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0; var $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0; var $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0; var $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0; var $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0; var $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0; var $365 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0; var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $AA_SIZE = 0.0, $col = 0, $col_trans = 0, $color$byval_copy = 0, $diff = 0, $dm = 0, $dmr2 = 0.0, $i = 0, $i0 = 0, $i1 = 0; var $i2 = 0, $ids = 0, $ids7 = 0, $idx_count = 0, $idx_count4 = 0, $index = 0, $index3 = 0, $len = 0.0, $n0 = 0, $n1 = 0, $normals = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $p0 = 0, $p1 = 0, $scale = 0.0, $size = 0, $uv = 0, $uv$byval_copy = 0; var $uv$byval_copy7 = 0, $vertex_offset = 0, $vtx = 0, $vtx6 = 0, $vtx_count = 0, $vtx_count5 = 0, $vtx_inner_idx = 0, $vtx_outer_idx = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 352|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy9 = sp + 336|0; $$byval_copy8 = sp + 328|0; $uv$byval_copy7 = sp + 320|0; $$byval_copy6 = sp + 312|0; $uv$byval_copy = sp + 304|0; $$byval_copy = sp + 296|0; $color$byval_copy = sp + 344|0; $p0 = sp + 208|0; $p1 = sp + 200|0; $diff = sp + 192|0; $4 = sp + 176|0; $uv = sp + 168|0; $n0 = sp + 160|0; $n1 = sp + 152|0; $dm = sp + 144|0; $5 = sp + 136|0; $6 = sp + 128|0; $7 = sp + 112|0; $8 = sp + 104|0; $9 = sp + 96|0; $10 = sp + 72|0; $11 = sp + 64|0; $12 = sp + 44|0; $13 = sp; $0 = $list; $1 = $points; $2 = $points_count; $3 = $aliasing; $14 = $0; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((14300|0),(13400|0),5956,(14373|0)); // unreachable; } $16 = $0; $17 = ($16|0)==(0|0); $18 = $2; $19 = ($18>>>0)<(3); $or$cond = $17 | $19; if ($or$cond) { STACKTOP = sp;return; } $20 = ((($color)) + 3|0); $21 = HEAP8[$20>>0]|0; $22 = (+($21&255)); $23 = $0; $24 = +HEAPF32[$23>>2]; $25 = $22 * $24; $26 = (~~(($25))&255); $27 = ((($color)) + 3|0); HEAP8[$27>>0] = $26; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; $28 = (_nk_color_u32($color$byval_copy)|0); $col = $28; $29 = $3; $30 = ($29|0)==(1); if (!($30)) { $i2 = 0; $311 = $0; $312 = ((($311)) + 56|0); $313 = HEAP32[$312>>2]|0; $index3 = $313; $314 = $2; $315 = (($314) - 2)|0; $316 = ($315*3)|0; $idx_count4 = $316; $317 = $2; $vtx_count5 = $317; $318 = $0; $319 = $vtx_count5; $320 = (_nk_draw_list_alloc_vertices($318,$319)|0); $vtx6 = $320; $321 = $0; $322 = $idx_count4; $323 = (_nk_draw_list_alloc_elements($321,$322)|0); $ids7 = $323; $324 = $vtx6; $325 = ($324|0)!=(0|0); $326 = $ids7; $327 = ($326|0)!=(0|0); $or$cond5 = $325 & $327; if (!($or$cond5)) { STACKTOP = sp;return; } $i2 = 0; while(1) { $328 = $i2; $329 = $vtx_count5; $330 = ($328>>>0)<($329>>>0); if (!($330)) { break; } $331 = $vtx6; $332 = $i2; $333 = $1; $334 = (($333) + ($332<<3)|0); $335 = $0; $336 = ((($335)) + 12|0); $337 = ((($336)) + 4|0); $338 = $col; ;HEAP32[$$byval_copy8>>2]=HEAP32[$334>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$334+4>>2]|0; ;HEAP32[$$byval_copy9>>2]=HEAP32[$337>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$337+4>>2]|0; _nk_draw_vertex($13,$$byval_copy8,$$byval_copy9,$338); ;HEAP32[$331>>2]=HEAP32[$13>>2]|0;HEAP32[$331+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[$331+8>>2]=HEAP32[$13+8>>2]|0;HEAP32[$331+12>>2]=HEAP32[$13+12>>2]|0;HEAP32[$331+16>>2]=HEAP32[$13+16>>2]|0; $339 = $vtx6; $340 = ((($339)) + 20|0); $vtx6 = $340; $341 = $i2; $342 = (($341) + 1)|0; $i2 = $342; } $i2 = 2; while(1) { $343 = $i2; $344 = $2; $345 = ($343>>>0)<($344>>>0); if (!($345)) { break; } $346 = $index3; $347 = $346&65535; $348 = $ids7; HEAP16[$348>>1] = $347; $349 = $index3; $350 = $i2; $351 = (($349) + ($350))|0; $352 = (($351) - 1)|0; $353 = $352&65535; $354 = $ids7; $355 = ((($354)) + 2|0); HEAP16[$355>>1] = $353; $356 = $index3; $357 = $i2; $358 = (($356) + ($357))|0; $359 = $358&65535; $360 = $ids7; $361 = ((($360)) + 4|0); HEAP16[$361>>1] = $359; $362 = $ids7; $363 = ((($362)) + 6|0); $ids7 = $363; $364 = $i2; $365 = (($364) + 1)|0; $i2 = $365; } STACKTOP = sp;return; } $i = 0; $i0 = 0; $i1 = 0; $AA_SIZE = 1.0; $vertex_offset = 0; $31 = $col; $32 = $31 & 16777215; $col_trans = $32; $33 = $0; $34 = ((($33)) + 56|0); $35 = HEAP32[$34>>2]|0; $index = $35; $36 = $2; $37 = (($36) - 2)|0; $38 = ($37*3)|0; $39 = $2; $40 = ($39*6)|0; $41 = (($38) + ($40))|0; $idx_count = $41; $42 = $2; $43 = $42<<1; $vtx_count = $43; $44 = $0; $45 = $vtx_count; $46 = (_nk_draw_list_alloc_vertices($44,$45)|0); $vtx = $46; $47 = $0; $48 = $idx_count; $49 = (_nk_draw_list_alloc_elements($47,$48)|0); $ids = $49; $50 = $index; $51 = (($50) + 0)|0; $vtx_inner_idx = $51; $52 = $index; $53 = (($52) + 1)|0; $vtx_outer_idx = $53; $normals = 0; $size = 0; $54 = $vtx; $55 = ($54|0)!=(0|0); $56 = $ids; $57 = ($56|0)!=(0|0); $or$cond3 = $55 & $57; if (!($or$cond3)) { STACKTOP = sp;return; } $58 = $vtx; $59 = $0; $60 = ((($59)) + 44|0); $61 = HEAP32[$60>>2]|0; $62 = ((($61)) + 32|0); $63 = HEAP32[$62>>2]|0; $64 = $58; $65 = $63; $66 = (($64) - ($65))|0; $vertex_offset = $66; $67 = $0; $68 = ((($67)) + 44|0); $69 = HEAP32[$68>>2]|0; _nk_buffer_mark($69,0); $70 = $2; $71 = $70<<3; $size = $71; $72 = $0; $73 = ((($72)) + 44|0); $74 = HEAP32[$73>>2]|0; $75 = $size; $76 = (_nk_buffer_alloc($74,0,$75,4)|0); $normals = $76; $77 = $normals; $78 = ($77|0)!=(0|0); if (!($78)) { ___assert_fail((14365|0),(13400|0),5991,(14373|0)); // unreachable; } $79 = $normals; $80 = ($79|0)!=(0|0); if (!($80)) { STACKTOP = sp;return; } $81 = $0; $82 = ((($81)) + 44|0); $83 = HEAP32[$82>>2]|0; $84 = ((($83)) + 32|0); $85 = HEAP32[$84>>2]|0; $86 = $vertex_offset; $87 = (($85) + ($86)|0); $vtx = $87; $i = 2; while(1) { $88 = $i; $89 = $2; $90 = ($88>>>0)<($89>>>0); if (!($90)) { break; } $91 = $vtx_inner_idx; $92 = $91&65535; $93 = $ids; HEAP16[$93>>1] = $92; $94 = $vtx_inner_idx; $95 = $i; $96 = (($95) - 1)|0; $97 = $96 << 1; $98 = (($94) + ($97))|0; $99 = $98&65535; $100 = $ids; $101 = ((($100)) + 2|0); HEAP16[$101>>1] = $99; $102 = $vtx_inner_idx; $103 = $i; $104 = $103 << 1; $105 = (($102) + ($104))|0; $106 = $105&65535; $107 = $ids; $108 = ((($107)) + 4|0); HEAP16[$108>>1] = $106; $109 = $ids; $110 = ((($109)) + 6|0); $ids = $110; $111 = $i; $112 = (($111) + 1)|0; $i = $112; } $113 = $2; $114 = (($113) - 1)|0; $i0 = $114; $i1 = 0; while(1) { $115 = $i1; $116 = $2; $117 = ($115>>>0)<($116>>>0); if (!($117)) { break; } $118 = $i0; $119 = $1; $120 = (($119) + ($118<<3)|0); ;HEAP32[$p0>>2]=HEAP32[$120>>2]|0;HEAP32[$p0+4>>2]=HEAP32[$120+4>>2]|0; $121 = $i1; $122 = $1; $123 = (($122) + ($121<<3)|0); ;HEAP32[$p1>>2]=HEAP32[$123>>2]|0;HEAP32[$p1+4>>2]=HEAP32[$123+4>>2]|0; $124 = +HEAPF32[$p1>>2]; $125 = +HEAPF32[$p0>>2]; $126 = $124 - $125; $127 = ((($p1)) + 4|0); $128 = +HEAPF32[$127>>2]; $129 = ((($p0)) + 4|0); $130 = +HEAPF32[$129>>2]; $131 = $128 - $130; _nk_vec2($diff,$126,$131); $132 = +HEAPF32[$diff>>2]; $133 = +HEAPF32[$diff>>2]; $134 = $132 * $133; $135 = ((($diff)) + 4|0); $136 = +HEAPF32[$135>>2]; $137 = ((($diff)) + 4|0); $138 = +HEAPF32[$137>>2]; $139 = $136 * $138; $140 = $134 + $139; $len = $140; $141 = $len; $142 = $141 != 0.0; if ($142) { $143 = $len; $144 = (+_nk_inv_sqrt($143)); $len = $144; } else { $len = 1.0; } $145 = +HEAPF32[$diff>>2]; $146 = $len; $147 = $145 * $146; $148 = ((($diff)) + 4|0); $149 = +HEAPF32[$148>>2]; $150 = $len; $151 = $149 * $150; _nk_vec2($4,$147,$151); ;HEAP32[$diff>>2]=HEAP32[$4>>2]|0;HEAP32[$diff+4>>2]=HEAP32[$4+4>>2]|0; $152 = ((($diff)) + 4|0); $153 = +HEAPF32[$152>>2]; $154 = $i0; $155 = $normals; $156 = (($155) + ($154<<3)|0); HEAPF32[$156>>2] = $153; $157 = +HEAPF32[$diff>>2]; $158 = -$157; $159 = $i0; $160 = $normals; $161 = (($160) + ($159<<3)|0); $162 = ((($161)) + 4|0); HEAPF32[$162>>2] = $158; $163 = $i1; $164 = (($163) + 1)|0; $i1 = $164; $i0 = $163; } $165 = $2; $166 = (($165) - 1)|0; $i0 = $166; $i1 = 0; while(1) { $167 = $i1; $168 = $2; $169 = ($167>>>0)<($168>>>0); $170 = $0; if (!($169)) { break; } $171 = ((($170)) + 12|0); $172 = ((($171)) + 4|0); ;HEAP32[$uv>>2]=HEAP32[$172>>2]|0;HEAP32[$uv+4>>2]=HEAP32[$172+4>>2]|0; $173 = $i0; $174 = $normals; $175 = (($174) + ($173<<3)|0); ;HEAP32[$n0>>2]=HEAP32[$175>>2]|0;HEAP32[$n0+4>>2]=HEAP32[$175+4>>2]|0; $176 = $i1; $177 = $normals; $178 = (($177) + ($176<<3)|0); ;HEAP32[$n1>>2]=HEAP32[$178>>2]|0;HEAP32[$n1+4>>2]=HEAP32[$178+4>>2]|0; $179 = +HEAPF32[$n0>>2]; $180 = +HEAPF32[$n1>>2]; $181 = $179 + $180; $182 = ((($n0)) + 4|0); $183 = +HEAPF32[$182>>2]; $184 = ((($n1)) + 4|0); $185 = +HEAPF32[$184>>2]; $186 = $183 + $185; _nk_vec2($5,$181,$186); $187 = +HEAPF32[$5>>2]; $188 = $187 * 0.5; $189 = +HEAPF32[$n0>>2]; $190 = +HEAPF32[$n1>>2]; $191 = $189 + $190; $192 = ((($n0)) + 4|0); $193 = +HEAPF32[$192>>2]; $194 = ((($n1)) + 4|0); $195 = +HEAPF32[$194>>2]; $196 = $193 + $195; _nk_vec2($6,$191,$196); $197 = ((($6)) + 4|0); $198 = +HEAPF32[$197>>2]; $199 = $198 * 0.5; _nk_vec2($dm,$188,$199); $200 = +HEAPF32[$dm>>2]; $201 = +HEAPF32[$dm>>2]; $202 = $200 * $201; $203 = ((($dm)) + 4|0); $204 = +HEAPF32[$203>>2]; $205 = ((($dm)) + 4|0); $206 = +HEAPF32[$205>>2]; $207 = $204 * $206; $208 = $202 + $207; $dmr2 = $208; $209 = $dmr2; $210 = $209 > 9.9999999747524271E-7; if ($210) { $211 = $dmr2; $212 = 1.0 / $211; $scale = $212; $213 = $scale; $214 = $213 < 100.0; $215 = $scale; $216 = $214 ? $215 : 100.0; $scale = $216; $217 = +HEAPF32[$dm>>2]; $218 = $scale; $219 = $217 * $218; $220 = ((($dm)) + 4|0); $221 = +HEAPF32[$220>>2]; $222 = $scale; $223 = $221 * $222; _nk_vec2($7,$219,$223); ;HEAP32[$dm>>2]=HEAP32[$7>>2]|0;HEAP32[$dm+4>>2]=HEAP32[$7+4>>2]|0; } $224 = +HEAPF32[$dm>>2]; $225 = $224 * 0.5; $226 = ((($dm)) + 4|0); $227 = +HEAPF32[$226>>2]; $228 = $227 * 0.5; _nk_vec2($8,$225,$228); ;HEAP32[$dm>>2]=HEAP32[$8>>2]|0;HEAP32[$dm+4>>2]=HEAP32[$8+4>>2]|0; $229 = $vtx; $230 = $i1; $231 = $1; $232 = (($231) + ($230<<3)|0); $233 = +HEAPF32[$232>>2]; $234 = +HEAPF32[$dm>>2]; $235 = $233 - $234; $236 = $i1; $237 = $1; $238 = (($237) + ($236<<3)|0); $239 = ((($238)) + 4|0); $240 = +HEAPF32[$239>>2]; $241 = ((($dm)) + 4|0); $242 = +HEAPF32[$241>>2]; $243 = $240 - $242; _nk_vec2($9,$235,$243); $244 = $col; ;HEAP32[$$byval_copy>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$9+4>>2]|0; ;HEAP32[$uv$byval_copy>>2]=HEAP32[$uv>>2]|0;HEAP32[$uv$byval_copy+4>>2]=HEAP32[$uv+4>>2]|0; _nk_draw_vertex($10,$$byval_copy,$uv$byval_copy,$244); ;HEAP32[$229>>2]=HEAP32[$10>>2]|0;HEAP32[$229+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[$229+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[$229+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[$229+16>>2]=HEAP32[$10+16>>2]|0; $245 = $vtx; $246 = ((($245)) + 20|0); $247 = $i1; $248 = $1; $249 = (($248) + ($247<<3)|0); $250 = +HEAPF32[$249>>2]; $251 = +HEAPF32[$dm>>2]; $252 = $250 + $251; $253 = $i1; $254 = $1; $255 = (($254) + ($253<<3)|0); $256 = ((($255)) + 4|0); $257 = +HEAPF32[$256>>2]; $258 = ((($dm)) + 4|0); $259 = +HEAPF32[$258>>2]; $260 = $257 + $259; _nk_vec2($11,$252,$260); $261 = $col_trans; ;HEAP32[$$byval_copy6>>2]=HEAP32[$11>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$11+4>>2]|0; ;HEAP32[$uv$byval_copy7>>2]=HEAP32[$uv>>2]|0;HEAP32[$uv$byval_copy7+4>>2]=HEAP32[$uv+4>>2]|0; _nk_draw_vertex($12,$$byval_copy6,$uv$byval_copy7,$261); ;HEAP32[$246>>2]=HEAP32[$12>>2]|0;HEAP32[$246+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$246+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[$246+12>>2]=HEAP32[$12+12>>2]|0;HEAP32[$246+16>>2]=HEAP32[$12+16>>2]|0; $262 = $vtx; $263 = ((($262)) + 40|0); $vtx = $263; $264 = $vtx_inner_idx; $265 = $i1; $266 = $265 << 1; $267 = (($264) + ($266))|0; $268 = $267&65535; $269 = $ids; HEAP16[$269>>1] = $268; $270 = $vtx_inner_idx; $271 = $i0; $272 = $271 << 1; $273 = (($270) + ($272))|0; $274 = $273&65535; $275 = $ids; $276 = ((($275)) + 2|0); HEAP16[$276>>1] = $274; $277 = $vtx_outer_idx; $278 = $i0; $279 = $278 << 1; $280 = (($277) + ($279))|0; $281 = $280&65535; $282 = $ids; $283 = ((($282)) + 4|0); HEAP16[$283>>1] = $281; $284 = $vtx_outer_idx; $285 = $i0; $286 = $285 << 1; $287 = (($284) + ($286))|0; $288 = $287&65535; $289 = $ids; $290 = ((($289)) + 6|0); HEAP16[$290>>1] = $288; $291 = $vtx_outer_idx; $292 = $i1; $293 = $292 << 1; $294 = (($291) + ($293))|0; $295 = $294&65535; $296 = $ids; $297 = ((($296)) + 8|0); HEAP16[$297>>1] = $295; $298 = $vtx_inner_idx; $299 = $i1; $300 = $299 << 1; $301 = (($298) + ($300))|0; $302 = $301&65535; $303 = $ids; $304 = ((($303)) + 10|0); HEAP16[$304>>1] = $302; $305 = $ids; $306 = ((($305)) + 12|0); $ids = $306; $307 = $i1; $308 = (($307) + 1)|0; $i1 = $308; $i0 = $307; } $309 = ((($170)) + 44|0); $310 = HEAP32[$309>>2]|0; _nk_buffer_reset($310,0); STACKTOP = sp;return; } function _nk_draw_list_path_clear($list) { $list = $list|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $list; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),6075,(14403|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 40|0); $7 = HEAP32[$6>>2]|0; _nk_buffer_reset($7,0); $8 = $0; $9 = ((($8)) + 68|0); HEAP32[$9>>2] = 0; $10 = $0; $11 = ((($10)) + 72|0); HEAP32[$11>>2] = 0; STACKTOP = sp;return; } function _nk_draw_list_path_line_to($list,$pos) { $list = $list|0; $pos = $pos|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cmd = 0, $nk_null_rect$byval_copy = 0, $points = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 32|0; $nk_null_rect$byval_copy = sp + 16|0; $0 = $list; $points = 0; $cmd = 0; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),6087,(14427|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 64|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0); if (!($8)) { $9 = $0; ;HEAP32[$nk_null_rect$byval_copy>>2]=HEAP32[8>>2]|0;HEAP32[$nk_null_rect$byval_copy+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$nk_null_rect$byval_copy+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$nk_null_rect$byval_copy+12>>2]=HEAP32[8+12>>2]|0; _nk_draw_list_add_clip($9,$nk_null_rect$byval_copy); } $10 = $0; $11 = (_nk_draw_list_command_last($10)|0); $cmd = $11; $12 = $cmd; $13 = ($12|0)!=(0|0); if ($13) { $14 = $cmd; $15 = ((($14)) + 20|0); $16 = HEAP32[$15>>2]|0; $17 = $0; $18 = ((($17)) + 12|0); $19 = HEAP32[$18>>2]|0; $20 = ($16|0)!=($19|0); if ($20) { $21 = $0; $22 = $0; $23 = ((($22)) + 12|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$23>>2]|0; _nk_draw_list_push_image($21,$$byval_copy); } } $24 = $0; $25 = (_nk_draw_list_alloc_path($24,1)|0); $points = $25; $26 = $points; $27 = ($26|0)!=(0|0); if (!($27)) { STACKTOP = sp;return; } $28 = $points; ;HEAP32[$28>>2]=HEAP32[$pos>>2]|0;HEAP32[$28+4>>2]=HEAP32[$pos+4>>2]|0; STACKTOP = sp;return; } function _nk_draw_list_add_clip($list,$rect) { $list = $list|0; $rect = $rect|0; var $$byval_copy = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $prev = 0, $rect$byval_copy = 0, $rect$byval_copy1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy2 = sp + 48|0; $rect$byval_copy1 = sp + 32|0; $$byval_copy = sp + 24|0; $rect$byval_copy = sp + 8|0; $0 = $list; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),5612,(29952|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 64|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0); $9 = $0; if (!($8)) { $10 = $0; $11 = ((($10)) + 12|0); ;HEAP32[$rect$byval_copy>>2]=HEAP32[$rect>>2]|0;HEAP32[$rect$byval_copy+4>>2]=HEAP32[$rect+4>>2]|0;HEAP32[$rect$byval_copy+8>>2]=HEAP32[$rect+8>>2]|0;HEAP32[$rect$byval_copy+12>>2]=HEAP32[$rect+12>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$11>>2]|0; (_nk_draw_list_push_command($9,$rect$byval_copy,$$byval_copy)|0); STACKTOP = sp;return; } $12 = (_nk_draw_list_command_last($9)|0); $prev = $12; $13 = $prev; $14 = HEAP32[$13>>2]|0; $15 = ($14|0)==(0); if ($15) { $16 = $prev; $17 = ((($16)) + 4|0); ;HEAP32[$17>>2]=HEAP32[$rect>>2]|0;HEAP32[$17+4>>2]=HEAP32[$rect+4>>2]|0;HEAP32[$17+8>>2]=HEAP32[$rect+8>>2]|0;HEAP32[$17+12>>2]=HEAP32[$rect+12>>2]|0; } $18 = $0; $19 = $prev; $20 = ((($19)) + 20|0); ;HEAP32[$rect$byval_copy1>>2]=HEAP32[$rect>>2]|0;HEAP32[$rect$byval_copy1+4>>2]=HEAP32[$rect+4>>2]|0;HEAP32[$rect$byval_copy1+8>>2]=HEAP32[$rect+8>>2]|0;HEAP32[$rect$byval_copy1+12>>2]=HEAP32[$rect+12>>2]|0; ;HEAP32[$$byval_copy2>>2]=HEAP32[$20>>2]|0; (_nk_draw_list_push_command($18,$rect$byval_copy1,$$byval_copy2)|0); STACKTOP = sp;return; } function _nk_draw_list_command_last($list) { $list = $list|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cmd = 0, $memory = 0, $size = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $list; $1 = $0; $2 = ((($1)) + 64|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)!=(0); if ($4) { $5 = $0; $6 = ((($5)) + 40|0); $7 = HEAP32[$6>>2]|0; $8 = (_nk_buffer_memory($7)|0); $memory = $8; $9 = $0; $10 = ((($9)) + 40|0); $11 = HEAP32[$10>>2]|0; $12 = (_nk_buffer_total($11)|0); $size = $12; $13 = $memory; $14 = $size; $15 = $0; $16 = ((($15)) + 60|0); $17 = HEAP32[$16>>2]|0; $18 = (($14) - ($17))|0; $19 = (($13) + ($18)|0); $cmd = $19; $20 = $cmd; $21 = $0; $22 = ((($21)) + 64|0); $23 = HEAP32[$22>>2]|0; $24 = (($23) - 1)|0; $25 = (0 - ($24))|0; $26 = (($20) + (($25*24)|0)|0); STACKTOP = sp;return ($26|0); } else { ___assert_fail((30000|0),(13400|0),5601,(30016|0)); // unreachable; } return (0)|0; } function _nk_draw_list_push_image($list,$texture) { $list = $list|0; $texture = $texture|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $nk_null_rect$byval_copy = 0, $prev = 0, $texture$byval_copy = 0, $texture$byval_copy1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $texture$byval_copy1 = sp + 48|0; $$byval_copy = sp + 32|0; $texture$byval_copy = sp + 24|0; $nk_null_rect$byval_copy = sp + 8|0; $0 = $list; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),5627,(30042|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 64|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0); $9 = $0; if (!($8)) { ;HEAP32[$nk_null_rect$byval_copy>>2]=HEAP32[8>>2]|0;HEAP32[$nk_null_rect$byval_copy+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$nk_null_rect$byval_copy+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$nk_null_rect$byval_copy+12>>2]=HEAP32[8+12>>2]|0; ;HEAP32[$texture$byval_copy>>2]=HEAP32[$texture>>2]|0; (_nk_draw_list_push_command($9,$nk_null_rect$byval_copy,$texture$byval_copy)|0); STACKTOP = sp;return; } $10 = (_nk_draw_list_command_last($9)|0); $prev = $10; $11 = $prev; $12 = HEAP32[$11>>2]|0; $13 = ($12|0)==(0); $14 = $prev; $15 = ((($14)) + 20|0); if ($13) { ;HEAP32[$15>>2]=HEAP32[$texture>>2]|0; STACKTOP = sp;return; } $16 = HEAP32[$15>>2]|0; $17 = HEAP32[$texture>>2]|0; $18 = ($16|0)!=($17|0); if (!($18)) { STACKTOP = sp;return; } $19 = $0; $20 = $prev; $21 = ((($20)) + 4|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$21>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$21+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$21+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$21+12>>2]|0; ;HEAP32[$texture$byval_copy1>>2]=HEAP32[$texture>>2]|0; (_nk_draw_list_push_command($19,$$byval_copy,$texture$byval_copy1)|0); STACKTOP = sp;return; } function _nk_draw_list_alloc_path($list,$count) { $list = $list|0; $count = $count|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memory = 0, $points = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $list; $2 = $count; $3 = $1; $4 = ((($3)) + 40|0); $5 = HEAP32[$4>>2]|0; $6 = $2; $7 = $6<<3; $8 = (_nk_buffer_alloc($5,0,$7,4)|0); $points = $8; $9 = $points; $10 = ($9|0)!=(0|0); if (!($10)) { $0 = 0; $32 = $0; STACKTOP = sp;return ($32|0); } $11 = $1; $12 = ((($11)) + 72|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)!=(0); if (!($14)) { $15 = $1; $16 = ((($15)) + 40|0); $17 = HEAP32[$16>>2]|0; $18 = (_nk_buffer_memory($17)|0); $memory = $18; $19 = $points; $20 = $memory; $21 = $19; $22 = $20; $23 = (($21) - ($22))|0; $24 = $1; $25 = ((($24)) + 72|0); HEAP32[$25>>2] = $23; } $26 = $2; $27 = $1; $28 = ((($27)) + 68|0); $29 = HEAP32[$28>>2]|0; $30 = (($29) + ($26))|0; HEAP32[$28>>2] = $30; $31 = $points; $0 = $31; $32 = $0; STACKTOP = sp;return ($32|0); } function _nk_draw_list_path_arc_to_fast($list,$center,$radius,$a_min,$a_max) { $list = $list|0; $center = $center|0; $radius = +$radius; $a_min = $a_min|0; $a_max = $a_max|0; var $$byval_copy = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0; var $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a = 0; var $c = 0, $x = 0.0, $y = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 48|0; $c = sp + 16|0; $4 = sp; $0 = $list; $1 = $radius; $2 = $a_min; $3 = $a_max; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14300|0),(13400|0),6105,(14453|0)); // unreachable; } $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { STACKTOP = sp;return; } $9 = $2; $10 = $3; $11 = ($9|0)<=($10|0); if (!($11)) { STACKTOP = sp;return; } $a = 0; $12 = $2; $a = $12; while(1) { $13 = $a; $14 = $3; $15 = ($13|0)<=($14|0); if (!($15)) { break; } $16 = $a; $17 = (($16>>>0) % 12)&-1; $18 = $0; $19 = ((($18)) + 76|0); $20 = (($19) + ($17<<3)|0); ;HEAP32[$c>>2]=HEAP32[$20>>2]|0;HEAP32[$c+4>>2]=HEAP32[$20+4>>2]|0; $21 = +HEAPF32[$center>>2]; $22 = +HEAPF32[$c>>2]; $23 = $1; $24 = $22 * $23; $25 = $21 + $24; $x = $25; $26 = ((($center)) + 4|0); $27 = +HEAPF32[$26>>2]; $28 = ((($c)) + 4|0); $29 = +HEAPF32[$28>>2]; $30 = $1; $31 = $29 * $30; $32 = $27 + $31; $y = $32; $33 = $0; $34 = $x; $35 = $y; _nk_vec2($4,$34,$35); ;HEAP32[$$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$4+4>>2]|0; _nk_draw_list_path_line_to($33,$$byval_copy); $36 = $a; $37 = (($36) + 1)|0; $a = $37; } STACKTOP = sp;return; } function _nk_draw_list_path_arc_to($list,$center,$radius,$a_min,$a_max,$segments) { $list = $list|0; $center = $center|0; $radius = +$radius; $a_min = +$a_min; $a_max = +$a_max; $segments = $segments|0; var $$byval_copy = 0, $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0; var $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a = 0.0, $i = 0, $or$cond = 0, $x = 0.0, $y = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 48|0; $5 = sp; $0 = $list; $1 = $radius; $2 = $a_min; $3 = $a_max; $4 = $segments; $i = 0; $6 = $0; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((14300|0),(13400|0),6123,(14483|0)); // unreachable; } $8 = $0; $9 = ($8|0)==(0|0); $10 = $1; $11 = $10 == 0.0; $or$cond = $9 | $11; if ($or$cond) { STACKTOP = sp;return; } $i = 0; while(1) { $12 = $i; $13 = $4; $14 = ($12>>>0)<=($13>>>0); if (!($14)) { break; } $15 = $2; $16 = $i; $17 = (+($16>>>0)); $18 = $4; $19 = (+($18>>>0)); $20 = $17 / $19; $21 = $3; $22 = $2; $23 = $21 - $22; $24 = $20 * $23; $25 = $15 + $24; $a = $25; $26 = +HEAPF32[$center>>2]; $27 = $a; $28 = (+_nk_cos($27)); $29 = $1; $30 = $28 * $29; $31 = $26 + $30; $x = $31; $32 = ((($center)) + 4|0); $33 = +HEAPF32[$32>>2]; $34 = $a; $35 = (+_nk_sin($34)); $36 = $1; $37 = $35 * $36; $38 = $33 + $37; $y = $38; $39 = $0; $40 = $x; $41 = $y; _nk_vec2($5,$40,$41); ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$5+4>>2]|0; _nk_draw_list_path_line_to($39,$$byval_copy); $42 = $i; $43 = (($42) + 1)|0; $i = $43; } STACKTOP = sp;return; } function _nk_draw_list_path_rect_to($list,$a,$b,$rounding) { $list = $list|0; $a = $a|0; $b = $b|0; $rounding = +$rounding; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $0 = 0, $1 = 0.0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0.0, $109 = 0.0, $11 = 0; var $110 = 0.0, $111 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0; var $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0.0; var $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0; var $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0; var $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0.0, $a$byval_copy = 0, $b$byval_copy = 0; var $r = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy5 = sp + 120|0; $$byval_copy4 = sp + 112|0; $$byval_copy3 = sp + 104|0; $$byval_copy2 = sp + 96|0; $$byval_copy1 = sp + 88|0; $b$byval_copy = sp + 80|0; $$byval_copy = sp + 72|0; $a$byval_copy = sp + 64|0; $2 = sp + 40|0; $3 = sp + 32|0; $4 = sp + 24|0; $5 = sp + 16|0; $6 = sp + 8|0; $7 = sp; $0 = $list; $1 = $rounding; $8 = $0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((14300|0),(13400|0),6139,(14508|0)); // unreachable; } $10 = $0; $11 = ($10|0)!=(0|0); if (!($11)) { STACKTOP = sp;return; } $12 = $1; $r = $12; $13 = $r; $14 = +HEAPF32[$b>>2]; $15 = +HEAPF32[$a>>2]; $16 = $14 - $15; $17 = $16 < 0.0; $18 = +HEAPF32[$b>>2]; $19 = +HEAPF32[$a>>2]; $20 = $18 - $19; $21 = -$20; $22 = $17 ? $21 : $20; $23 = $13 < $22; if ($23) { $24 = $r; $34 = $24; } else { $25 = +HEAPF32[$b>>2]; $26 = +HEAPF32[$a>>2]; $27 = $25 - $26; $28 = $27 < 0.0; $29 = +HEAPF32[$b>>2]; $30 = +HEAPF32[$a>>2]; $31 = $29 - $30; $32 = -$31; $33 = $28 ? $32 : $31; $34 = $33; } $r = $34; $35 = $r; $36 = ((($b)) + 4|0); $37 = +HEAPF32[$36>>2]; $38 = ((($a)) + 4|0); $39 = +HEAPF32[$38>>2]; $40 = $37 - $39; $41 = $40 < 0.0; $42 = ((($b)) + 4|0); $43 = +HEAPF32[$42>>2]; $44 = ((($a)) + 4|0); $45 = +HEAPF32[$44>>2]; $46 = $43 - $45; $47 = -$46; $48 = $41 ? $47 : $46; $49 = $35 < $48; if ($49) { $50 = $r; $64 = $50; } else { $51 = ((($b)) + 4|0); $52 = +HEAPF32[$51>>2]; $53 = ((($a)) + 4|0); $54 = +HEAPF32[$53>>2]; $55 = $52 - $54; $56 = $55 < 0.0; $57 = ((($b)) + 4|0); $58 = +HEAPF32[$57>>2]; $59 = ((($a)) + 4|0); $60 = +HEAPF32[$59>>2]; $61 = $58 - $60; $62 = -$61; $63 = $56 ? $62 : $61; $64 = $63; } $r = $64; $65 = $r; $66 = $65 == 0.0; $67 = $0; if ($66) { ;HEAP32[$a$byval_copy>>2]=HEAP32[$a>>2]|0;HEAP32[$a$byval_copy+4>>2]=HEAP32[$a+4>>2]|0; _nk_draw_list_path_line_to($67,$a$byval_copy); $68 = $0; $69 = +HEAPF32[$b>>2]; $70 = ((($a)) + 4|0); $71 = +HEAPF32[$70>>2]; _nk_vec2($2,$69,$71); ;HEAP32[$$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$2+4>>2]|0; _nk_draw_list_path_line_to($68,$$byval_copy); $72 = $0; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0; _nk_draw_list_path_line_to($72,$b$byval_copy); $73 = $0; $74 = +HEAPF32[$a>>2]; $75 = ((($b)) + 4|0); $76 = +HEAPF32[$75>>2]; _nk_vec2($3,$74,$76); ;HEAP32[$$byval_copy1>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$3+4>>2]|0; _nk_draw_list_path_line_to($73,$$byval_copy1); STACKTOP = sp;return; } else { $77 = +HEAPF32[$a>>2]; $78 = $r; $79 = $77 + $78; $80 = ((($a)) + 4|0); $81 = +HEAPF32[$80>>2]; $82 = $r; $83 = $81 + $82; _nk_vec2($4,$79,$83); $84 = $r; ;HEAP32[$$byval_copy2>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$4+4>>2]|0; _nk_draw_list_path_arc_to_fast($67,$$byval_copy2,$84,6,9); $85 = $0; $86 = +HEAPF32[$b>>2]; $87 = $r; $88 = $86 - $87; $89 = ((($a)) + 4|0); $90 = +HEAPF32[$89>>2]; $91 = $r; $92 = $90 + $91; _nk_vec2($5,$88,$92); $93 = $r; ;HEAP32[$$byval_copy3>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$5+4>>2]|0; _nk_draw_list_path_arc_to_fast($85,$$byval_copy3,$93,9,12); $94 = $0; $95 = +HEAPF32[$b>>2]; $96 = $r; $97 = $95 - $96; $98 = ((($b)) + 4|0); $99 = +HEAPF32[$98>>2]; $100 = $r; $101 = $99 - $100; _nk_vec2($6,$97,$101); $102 = $r; ;HEAP32[$$byval_copy4>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$6+4>>2]|0; _nk_draw_list_path_arc_to_fast($94,$$byval_copy4,$102,0,3); $103 = $0; $104 = +HEAPF32[$a>>2]; $105 = $r; $106 = $104 + $105; $107 = ((($b)) + 4|0); $108 = +HEAPF32[$107>>2]; $109 = $r; $110 = $108 - $109; _nk_vec2($7,$106,$110); $111 = $r; ;HEAP32[$$byval_copy5>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$7+4>>2]|0; _nk_draw_list_path_arc_to_fast($103,$$byval_copy5,$111,3,6); STACKTOP = sp;return; } } function _nk_draw_list_path_curve_to($list,$p2,$p3,$p4,$num_segments) { $list = $list|0; $p2 = $p2|0; $p3 = $p3|0; $p4 = $p4|0; $num_segments = $num_segments|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0; var $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0; var $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0; var $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0, $i_step = 0, $p1 = 0, $t = 0.0, $t_step = 0.0, $u = 0.0; var $w1 = 0.0, $w2 = 0.0, $w3 = 0.0, $w4 = 0.0, $x = 0.0, $y = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 72|0; $p1 = sp + 48|0; $2 = sp + 40|0; $3 = sp; $0 = $list; $1 = $num_segments; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14300|0),(13400|0),6166,(14534|0)); // unreachable; } $6 = $0; $7 = ((($6)) + 68|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); if (!($9)) { ___assert_fail((14561|0),(13400|0),6167,(14534|0)); // unreachable; } $10 = $0; $11 = ($10|0)!=(0|0); if (!($11)) { STACKTOP = sp;return; } $12 = $0; $13 = ((($12)) + 68|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0); if (!($15)) { STACKTOP = sp;return; } $16 = $1; $17 = ($16>>>0)<(1); $18 = $1; $19 = $17 ? 1 : $18; $1 = $19; $20 = $0; _nk_draw_list_path_last($2,$20); ;HEAP32[$p1>>2]=HEAP32[$2>>2]|0;HEAP32[$p1+4>>2]=HEAP32[$2+4>>2]|0; $21 = $1; $22 = (+($21>>>0)); $23 = 1.0 / $22; $t_step = $23; $i_step = 1; while(1) { $24 = $i_step; $25 = $1; $26 = ($24>>>0)<=($25>>>0); if (!($26)) { break; } $27 = $t_step; $28 = $i_step; $29 = (+($28>>>0)); $30 = $27 * $29; $t = $30; $31 = $t; $32 = 1.0 - $31; $u = $32; $33 = $u; $34 = $u; $35 = $33 * $34; $36 = $u; $37 = $35 * $36; $w1 = $37; $38 = $u; $39 = 3.0 * $38; $40 = $u; $41 = $39 * $40; $42 = $t; $43 = $41 * $42; $w2 = $43; $44 = $u; $45 = 3.0 * $44; $46 = $t; $47 = $45 * $46; $48 = $t; $49 = $47 * $48; $w3 = $49; $50 = $t; $51 = $t; $52 = $50 * $51; $53 = $t; $54 = $52 * $53; $w4 = $54; $55 = $w1; $56 = +HEAPF32[$p1>>2]; $57 = $55 * $56; $58 = $w2; $59 = +HEAPF32[$p2>>2]; $60 = $58 * $59; $61 = $57 + $60; $62 = $w3; $63 = +HEAPF32[$p3>>2]; $64 = $62 * $63; $65 = $61 + $64; $66 = $w4; $67 = +HEAPF32[$p4>>2]; $68 = $66 * $67; $69 = $65 + $68; $x = $69; $70 = $w1; $71 = ((($p1)) + 4|0); $72 = +HEAPF32[$71>>2]; $73 = $70 * $72; $74 = $w2; $75 = ((($p2)) + 4|0); $76 = +HEAPF32[$75>>2]; $77 = $74 * $76; $78 = $73 + $77; $79 = $w3; $80 = ((($p3)) + 4|0); $81 = +HEAPF32[$80>>2]; $82 = $79 * $81; $83 = $78 + $82; $84 = $w4; $85 = ((($p4)) + 4|0); $86 = +HEAPF32[$85>>2]; $87 = $84 * $86; $88 = $83 + $87; $y = $88; $89 = $0; $90 = $x; $91 = $y; _nk_vec2($3,$90,$91); ;HEAP32[$$byval_copy>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$3+4>>2]|0; _nk_draw_list_path_line_to($89,$$byval_copy); $92 = $i_step; $93 = (($92) + 1)|0; $i_step = $93; } STACKTOP = sp;return; } function _nk_draw_list_path_last($agg$result,$list) { $agg$result = $agg$result|0; $list = $list|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $memory = 0, $point = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $list; $1 = $0; $2 = ((($1)) + 68|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)!=(0); if ($4) { $5 = $0; $6 = ((($5)) + 40|0); $7 = HEAP32[$6>>2]|0; $8 = (_nk_buffer_memory($7)|0); $memory = $8; $9 = $memory; $10 = $0; $11 = ((($10)) + 72|0); $12 = HEAP32[$11>>2]|0; $13 = (($9) + ($12)|0); $point = $13; $14 = $0; $15 = ((($14)) + 68|0); $16 = HEAP32[$15>>2]|0; $17 = (($16) - 1)|0; $18 = $point; $19 = (($18) + ($17<<3)|0); $point = $19; $20 = $point; ;HEAP32[$agg$result>>2]=HEAP32[$20>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$20+4>>2]|0; STACKTOP = sp;return; } else { ___assert_fail((14561|0),(13400|0),5559,(30066|0)); // unreachable; } } function _nk_draw_list_path_fill($list,$color) { $list = $list|0; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $color$byval_copy = 0, $points = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $color$byval_copy = sp + 8|0; $0 = $list; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),6190,(14578|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 40|0); $7 = HEAP32[$6>>2]|0; $8 = (_nk_buffer_memory($7)|0); $points = $8; $9 = $0; $10 = $points; $11 = $0; $12 = ((($11)) + 68|0); $13 = HEAP32[$12>>2]|0; $14 = $0; $15 = ((($14)) + 4|0); $16 = HEAP32[$15>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _nk_draw_list_fill_poly_convex($9,$10,$13,$color$byval_copy,$16); $17 = $0; _nk_draw_list_path_clear($17); STACKTOP = sp;return; } function _nk_draw_list_path_stroke($list,$color,$closed,$thickness) { $list = $list|0; $color = $color|0; $closed = $closed|0; $thickness = +$thickness; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $color$byval_copy = 0, $points = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $color$byval_copy = sp + 16|0; $0 = $list; $1 = $closed; $2 = $thickness; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14300|0),(13400|0),6202,(14601|0)); // unreachable; } $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { STACKTOP = sp;return; } $7 = $0; $8 = ((($7)) + 40|0); $9 = HEAP32[$8>>2]|0; $10 = (_nk_buffer_memory($9)|0); $points = $10; $11 = $0; $12 = $points; $13 = $0; $14 = ((($13)) + 68|0); $15 = HEAP32[$14>>2]|0; $16 = $1; $17 = $2; $18 = $0; $19 = ((($18)) + 8|0); $20 = HEAP32[$19>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _nk_draw_list_stroke_poly_line($11,$12,$15,$color$byval_copy,$16,$17,$20); $21 = $0; _nk_draw_list_path_clear($21); STACKTOP = sp;return; } function _nk_draw_list_stroke_line($list,$a,$b,$col,$thickness) { $list = $list|0; $a = $a|0; $b = $b|0; $col = $col|0; $thickness = +$thickness; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0; var $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 72|0; $$byval_copy1 = sp + 64|0; $$byval_copy = sp + 56|0; $2 = sp + 40|0; $3 = sp + 32|0; $4 = sp + 24|0; $5 = sp + 16|0; $6 = sp + 8|0; $7 = sp; $0 = $list; $1 = $thickness; $8 = $0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((14300|0),(13400|0),6214,(14626|0)); // unreachable; } $10 = $0; $11 = ($10|0)!=(0|0); if (!($11)) { STACKTOP = sp;return; } $12 = ((($col)) + 3|0); $13 = HEAP8[$12>>0]|0; $14 = ($13<<24>>24)!=(0); if (!($14)) { STACKTOP = sp;return; } $15 = $0; $16 = +HEAPF32[$a>>2]; _nk_vec2($3,0.5,0.5); $17 = +HEAPF32[$3>>2]; $18 = $16 + $17; $19 = ((($a)) + 4|0); $20 = +HEAPF32[$19>>2]; _nk_vec2($4,0.5,0.5); $21 = ((($4)) + 4|0); $22 = +HEAPF32[$21>>2]; $23 = $20 + $22; _nk_vec2($2,$18,$23); ;HEAP32[$$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$2+4>>2]|0; _nk_draw_list_path_line_to($15,$$byval_copy); $24 = $0; $25 = +HEAPF32[$b>>2]; _nk_vec2($6,0.5,0.5); $26 = +HEAPF32[$6>>2]; $27 = $25 + $26; $28 = ((($b)) + 4|0); $29 = +HEAPF32[$28>>2]; _nk_vec2($7,0.5,0.5); $30 = ((($7)) + 4|0); $31 = +HEAPF32[$30>>2]; $32 = $29 + $31; _nk_vec2($5,$27,$32); ;HEAP32[$$byval_copy1>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$5+4>>2]|0; _nk_draw_list_path_line_to($24,$$byval_copy1); $33 = $0; $34 = $1; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_stroke($33,$col$byval_copy,0,$34); STACKTOP = sp;return; } function _nk_draw_list_fill_rect($list,$rect,$col,$rounding) { $list = $list|0; $rect = $rect|0; $col = $col|0; $rounding = +$rounding; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0; var $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 40|0; $$byval_copy1 = sp + 32|0; $$byval_copy = sp + 24|0; $2 = sp + 8|0; $3 = sp; $0 = $list; $1 = $rounding; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14300|0),(13400|0),6225,(14651|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); if (!($7)) { STACKTOP = sp;return; } $8 = ((($col)) + 3|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)!=(0); if (!($10)) { STACKTOP = sp;return; } $11 = $0; $12 = +HEAPF32[$rect>>2]; $13 = $12 + 0.5; $14 = ((($rect)) + 4|0); $15 = +HEAPF32[$14>>2]; $16 = $15 + 0.5; _nk_vec2($2,$13,$16); $17 = +HEAPF32[$rect>>2]; $18 = ((($rect)) + 8|0); $19 = +HEAPF32[$18>>2]; $20 = $17 + $19; $21 = $20 + 0.5; $22 = ((($rect)) + 4|0); $23 = +HEAPF32[$22>>2]; $24 = ((($rect)) + 12|0); $25 = +HEAPF32[$24>>2]; $26 = $23 + $25; $27 = $26 + 0.5; _nk_vec2($3,$21,$27); $28 = $1; ;HEAP32[$$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$2+4>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$3+4>>2]|0; _nk_draw_list_path_rect_to($11,$$byval_copy,$$byval_copy1,$28); $29 = $0; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_fill($29,$col$byval_copy); STACKTOP = sp;return; } function _nk_draw_list_stroke_rect($list,$rect,$col,$rounding,$thickness) { $list = $list|0; $rect = $rect|0; $col = $col|0; $rounding = +$rounding; $thickness = +$thickness; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0; var $25 = 0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 48|0; $$byval_copy1 = sp + 40|0; $$byval_copy = sp + 32|0; $3 = sp + 8|0; $4 = sp; $0 = $list; $1 = $rounding; $2 = $thickness; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14300|0),(13400|0),6236,(14674|0)); // unreachable; } $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { STACKTOP = sp;return; } $9 = ((($col)) + 3|0); $10 = HEAP8[$9>>0]|0; $11 = ($10<<24>>24)!=(0); if (!($11)) { STACKTOP = sp;return; } $12 = $0; $13 = +HEAPF32[$rect>>2]; $14 = $13 + 0.5; $15 = ((($rect)) + 4|0); $16 = +HEAPF32[$15>>2]; $17 = $16 + 0.5; _nk_vec2($3,$14,$17); $18 = +HEAPF32[$rect>>2]; $19 = ((($rect)) + 8|0); $20 = +HEAPF32[$19>>2]; $21 = $18 + $20; $22 = $21 + 0.5; $23 = ((($rect)) + 4|0); $24 = +HEAPF32[$23>>2]; $25 = ((($rect)) + 12|0); $26 = +HEAPF32[$25>>2]; $27 = $24 + $26; $28 = $27 + 0.5; _nk_vec2($4,$22,$28); $29 = $1; ;HEAP32[$$byval_copy>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$3+4>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$4+4>>2]|0; _nk_draw_list_path_rect_to($12,$$byval_copy,$$byval_copy1,$29); $30 = $0; $31 = $2; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_stroke($30,$col$byval_copy,1,$31); STACKTOP = sp;return; } function _nk_draw_list_fill_rect_multi_color($list,$rect,$left,$top,$right,$bottom) { $list = $list|0; $rect = $rect|0; $left = $left|0; $top = $top|0; $right = $right|0; $bottom = $bottom|0; var $$byval_copy = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy8 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0; var $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0; var $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0.0; var $97 = 0.0, $98 = 0, $99 = 0, $bottom$byval_copy = 0, $col_bottom = 0, $col_left = 0, $col_right = 0, $col_top = 0, $idx = 0, $index = 0, $left$byval_copy = 0, $or$cond = 0, $right$byval_copy = 0, $top$byval_copy = 0, $vtx = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy9 = sp + 216|0; $$byval_copy8 = sp + 208|0; $$byval_copy7 = sp + 200|0; $$byval_copy6 = sp + 192|0; $$byval_copy5 = sp + 184|0; $$byval_copy4 = sp + 176|0; $$byval_copy3 = sp + 168|0; $$byval_copy2 = sp + 160|0; $$byval_copy = sp + 156|0; $bottom$byval_copy = sp + 240|0; $right$byval_copy = sp + 236|0; $top$byval_copy = sp + 232|0; $left$byval_copy = sp + 228|0; $1 = sp + 120|0; $2 = sp + 96|0; $3 = sp + 88|0; $4 = sp + 64|0; $5 = sp + 56|0; $6 = sp + 32|0; $7 = sp + 24|0; $8 = sp; $0 = $list; ;HEAP8[$left$byval_copy>>0]=HEAP8[$left>>0]|0;HEAP8[$left$byval_copy+1>>0]=HEAP8[$left+1>>0]|0;HEAP8[$left$byval_copy+2>>0]=HEAP8[$left+2>>0]|0;HEAP8[$left$byval_copy+3>>0]=HEAP8[$left+3>>0]|0; $9 = (_nk_color_u32($left$byval_copy)|0); $col_left = $9; ;HEAP8[$top$byval_copy>>0]=HEAP8[$top>>0]|0;HEAP8[$top$byval_copy+1>>0]=HEAP8[$top+1>>0]|0;HEAP8[$top$byval_copy+2>>0]=HEAP8[$top+2>>0]|0;HEAP8[$top$byval_copy+3>>0]=HEAP8[$top+3>>0]|0; $10 = (_nk_color_u32($top$byval_copy)|0); $col_top = $10; ;HEAP8[$right$byval_copy>>0]=HEAP8[$right>>0]|0;HEAP8[$right$byval_copy+1>>0]=HEAP8[$right+1>>0]|0;HEAP8[$right$byval_copy+2>>0]=HEAP8[$right+2>>0]|0;HEAP8[$right$byval_copy+3>>0]=HEAP8[$right+3>>0]|0; $11 = (_nk_color_u32($right$byval_copy)|0); $col_right = $11; ;HEAP8[$bottom$byval_copy>>0]=HEAP8[$bottom>>0]|0;HEAP8[$bottom$byval_copy+1>>0]=HEAP8[$bottom+1>>0]|0;HEAP8[$bottom$byval_copy+2>>0]=HEAP8[$bottom+2>>0]|0;HEAP8[$bottom$byval_copy+3>>0]=HEAP8[$bottom+3>>0]|0; $12 = (_nk_color_u32($bottom$byval_copy)|0); $col_bottom = $12; $13 = $0; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((14300|0),(13400|0),6256,(14699|0)); // unreachable; } $15 = $0; $16 = ($15|0)!=(0|0); if (!($16)) { STACKTOP = sp;return; } $17 = $0; $18 = $0; $19 = ((($18)) + 12|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$19>>2]|0; _nk_draw_list_push_image($17,$$byval_copy); $20 = $0; $21 = ((($20)) + 56|0); $22 = HEAP32[$21>>2]|0; $23 = $22&65535; $index = $23; $24 = $0; $25 = (_nk_draw_list_alloc_vertices($24,4)|0); $vtx = $25; $26 = $0; $27 = (_nk_draw_list_alloc_elements($26,6)|0); $idx = $27; $28 = $vtx; $29 = ($28|0)!=(0|0); $30 = $idx; $31 = ($30|0)!=(0|0); $or$cond = $29 & $31; if (!($or$cond)) { STACKTOP = sp;return; } $32 = $index; $33 = $32&65535; $34 = (($33) + 0)|0; $35 = $34&65535; $36 = $idx; HEAP16[$36>>1] = $35; $37 = $index; $38 = $37&65535; $39 = (($38) + 1)|0; $40 = $39&65535; $41 = $idx; $42 = ((($41)) + 2|0); HEAP16[$42>>1] = $40; $43 = $index; $44 = $43&65535; $45 = (($44) + 2)|0; $46 = $45&65535; $47 = $idx; $48 = ((($47)) + 4|0); HEAP16[$48>>1] = $46; $49 = $index; $50 = $49&65535; $51 = (($50) + 0)|0; $52 = $51&65535; $53 = $idx; $54 = ((($53)) + 6|0); HEAP16[$54>>1] = $52; $55 = $index; $56 = $55&65535; $57 = (($56) + 2)|0; $58 = $57&65535; $59 = $idx; $60 = ((($59)) + 8|0); HEAP16[$60>>1] = $58; $61 = $index; $62 = $61&65535; $63 = (($62) + 3)|0; $64 = $63&65535; $65 = $idx; $66 = ((($65)) + 10|0); HEAP16[$66>>1] = $64; $67 = $vtx; $68 = +HEAPF32[$rect>>2]; $69 = ((($rect)) + 4|0); $70 = +HEAPF32[$69>>2]; _nk_vec2($1,$68,$70); $71 = $0; $72 = ((($71)) + 12|0); $73 = ((($72)) + 4|0); $74 = $col_left; ;HEAP32[$$byval_copy2>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$1+4>>2]|0; ;HEAP32[$$byval_copy3>>2]=HEAP32[$73>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$73+4>>2]|0; _nk_draw_vertex($2,$$byval_copy2,$$byval_copy3,$74); ;HEAP32[$67>>2]=HEAP32[$2>>2]|0;HEAP32[$67+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$67+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$67+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$67+16>>2]=HEAP32[$2+16>>2]|0; $75 = $vtx; $76 = ((($75)) + 20|0); $77 = +HEAPF32[$rect>>2]; $78 = ((($rect)) + 8|0); $79 = +HEAPF32[$78>>2]; $80 = $77 + $79; $81 = ((($rect)) + 4|0); $82 = +HEAPF32[$81>>2]; _nk_vec2($3,$80,$82); $83 = $0; $84 = ((($83)) + 12|0); $85 = ((($84)) + 4|0); $86 = $col_top; ;HEAP32[$$byval_copy4>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$3+4>>2]|0; ;HEAP32[$$byval_copy5>>2]=HEAP32[$85>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$85+4>>2]|0; _nk_draw_vertex($4,$$byval_copy4,$$byval_copy5,$86); ;HEAP32[$76>>2]=HEAP32[$4>>2]|0;HEAP32[$76+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$76+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$76+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$76+16>>2]=HEAP32[$4+16>>2]|0; $87 = $vtx; $88 = ((($87)) + 40|0); $89 = +HEAPF32[$rect>>2]; $90 = ((($rect)) + 8|0); $91 = +HEAPF32[$90>>2]; $92 = $89 + $91; $93 = ((($rect)) + 4|0); $94 = +HEAPF32[$93>>2]; $95 = ((($rect)) + 12|0); $96 = +HEAPF32[$95>>2]; $97 = $94 + $96; _nk_vec2($5,$92,$97); $98 = $0; $99 = ((($98)) + 12|0); $100 = ((($99)) + 4|0); $101 = $col_right; ;HEAP32[$$byval_copy6>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$5+4>>2]|0; ;HEAP32[$$byval_copy7>>2]=HEAP32[$100>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$100+4>>2]|0; _nk_draw_vertex($6,$$byval_copy6,$$byval_copy7,$101); ;HEAP32[$88>>2]=HEAP32[$6>>2]|0;HEAP32[$88+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$88+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$88+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[$88+16>>2]=HEAP32[$6+16>>2]|0; $102 = $vtx; $103 = ((($102)) + 60|0); $104 = +HEAPF32[$rect>>2]; $105 = ((($rect)) + 4|0); $106 = +HEAPF32[$105>>2]; $107 = ((($rect)) + 12|0); $108 = +HEAPF32[$107>>2]; $109 = $106 + $108; _nk_vec2($7,$104,$109); $110 = $0; $111 = ((($110)) + 12|0); $112 = ((($111)) + 4|0); $113 = $col_bottom; ;HEAP32[$$byval_copy8>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$7+4>>2]|0; ;HEAP32[$$byval_copy9>>2]=HEAP32[$112>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$112+4>>2]|0; _nk_draw_vertex($8,$$byval_copy8,$$byval_copy9,$113); ;HEAP32[$103>>2]=HEAP32[$8>>2]|0;HEAP32[$103+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$103+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[$103+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[$103+16>>2]=HEAP32[$8+16>>2]|0; STACKTOP = sp;return; } function _nk_draw_list_fill_triangle($list,$a,$b,$c,$col) { $list = $list|0; $a = $a|0; $b = $b|0; $c = $c|0; $col = $col|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a$byval_copy = 0, $b$byval_copy = 0, $c$byval_copy = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 32|0; $c$byval_copy = sp + 24|0; $b$byval_copy = sp + 16|0; $a$byval_copy = sp + 8|0; $0 = $list; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14300|0),(13400|0),6279,(14734|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = ((($col)) + 3|0); $6 = HEAP8[$5>>0]|0; $7 = ($6<<24>>24)!=(0); if (!($7)) { STACKTOP = sp;return; } $8 = $0; ;HEAP32[$a$byval_copy>>2]=HEAP32[$a>>2]|0;HEAP32[$a$byval_copy+4>>2]=HEAP32[$a+4>>2]|0; _nk_draw_list_path_line_to($8,$a$byval_copy); $9 = $0; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0; _nk_draw_list_path_line_to($9,$b$byval_copy); $10 = $0; ;HEAP32[$c$byval_copy>>2]=HEAP32[$c>>2]|0;HEAP32[$c$byval_copy+4>>2]=HEAP32[$c+4>>2]|0; _nk_draw_list_path_line_to($10,$c$byval_copy); $11 = $0; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_fill($11,$col$byval_copy); STACKTOP = sp;return; } function _nk_draw_list_stroke_triangle($list,$a,$b,$c,$col,$thickness) { $list = $list|0; $a = $a|0; $b = $b|0; $c = $c|0; $col = $col|0; $thickness = +$thickness; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a$byval_copy = 0, $b$byval_copy = 0, $c$byval_copy = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 32|0; $c$byval_copy = sp + 24|0; $b$byval_copy = sp + 16|0; $a$byval_copy = sp + 8|0; $0 = $list; $1 = $thickness; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14300|0),(13400|0),6291,(14761|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = ((($col)) + 3|0); $7 = HEAP8[$6>>0]|0; $8 = ($7<<24>>24)!=(0); if (!($8)) { STACKTOP = sp;return; } $9 = $0; ;HEAP32[$a$byval_copy>>2]=HEAP32[$a>>2]|0;HEAP32[$a$byval_copy+4>>2]=HEAP32[$a+4>>2]|0; _nk_draw_list_path_line_to($9,$a$byval_copy); $10 = $0; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0; _nk_draw_list_path_line_to($10,$b$byval_copy); $11 = $0; ;HEAP32[$c$byval_copy>>2]=HEAP32[$c>>2]|0;HEAP32[$c$byval_copy+4>>2]=HEAP32[$c+4>>2]|0; _nk_draw_list_path_line_to($11,$c$byval_copy); $12 = $0; $13 = $1; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_stroke($12,$col$byval_copy,1,$13); STACKTOP = sp;return; } function _nk_draw_list_fill_circle($list,$center,$radius,$col,$segs) { $list = $list|0; $center = $center|0; $radius = +$radius; $col = $col|0; $segs = $segs|0; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $a_max = 0.0, $center$byval_copy = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 24|0; $center$byval_copy = sp + 16|0; $0 = $list; $1 = $radius; $2 = $segs; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14300|0),(13400|0),6304,(14790|0)); // unreachable; } $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { STACKTOP = sp;return; } $7 = ((($col)) + 3|0); $8 = HEAP8[$7>>0]|0; $9 = ($8<<24>>24)!=(0); if (!($9)) { STACKTOP = sp;return; } $10 = $2; $11 = (+($10>>>0)); $12 = $11 - 1.0; $13 = 6.2831854820251465 * $12; $14 = $2; $15 = (+($14>>>0)); $16 = $13 / $15; $a_max = $16; $17 = $0; $18 = $1; $19 = $a_max; $20 = $2; ;HEAP32[$center$byval_copy>>2]=HEAP32[$center>>2]|0;HEAP32[$center$byval_copy+4>>2]=HEAP32[$center+4>>2]|0; _nk_draw_list_path_arc_to($17,$center$byval_copy,$18,0.0,$19,$20); $21 = $0; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_fill($21,$col$byval_copy); STACKTOP = sp;return; } function _nk_draw_list_stroke_circle($list,$center,$radius,$col,$segs,$thickness) { $list = $list|0; $center = $center|0; $radius = +$radius; $col = $col|0; $segs = $segs|0; $thickness = +$thickness; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0, $3 = 0.0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a_max = 0.0, $center$byval_copy = 0, $col$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 32|0; $center$byval_copy = sp + 24|0; $0 = $list; $1 = $radius; $2 = $segs; $3 = $thickness; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14300|0),(13400|0),6316,(14815|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); if (!($7)) { STACKTOP = sp;return; } $8 = ((($col)) + 3|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)!=(0); if (!($10)) { STACKTOP = sp;return; } $11 = $2; $12 = (+($11>>>0)); $13 = $12 - 1.0; $14 = 6.2831854820251465 * $13; $15 = $2; $16 = (+($15>>>0)); $17 = $14 / $16; $a_max = $17; $18 = $0; $19 = $1; $20 = $a_max; $21 = $2; ;HEAP32[$center$byval_copy>>2]=HEAP32[$center>>2]|0;HEAP32[$center$byval_copy+4>>2]=HEAP32[$center+4>>2]|0; _nk_draw_list_path_arc_to($18,$center$byval_copy,$19,0.0,$20,$21); $22 = $0; $23 = $3; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_stroke($22,$col$byval_copy,1,$23); STACKTOP = sp;return; } function _nk_draw_list_stroke_curve($list,$p0,$cp0,$cp1,$p1,$col,$segments,$thickness) { $list = $list|0; $p0 = $p0|0; $cp0 = $cp0|0; $cp1 = $cp1|0; $p1 = $p1|0; $col = $col|0; $segments = $segments|0; $thickness = +$thickness; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $2 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$byval_copy = 0, $cp0$byval_copy = 0, $cp1$byval_copy = 0, $p0$byval_copy = 0, $p1$byval_copy = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $col$byval_copy = sp + 48|0; $p1$byval_copy = sp + 40|0; $cp1$byval_copy = sp + 32|0; $cp0$byval_copy = sp + 24|0; $p0$byval_copy = sp + 16|0; $0 = $list; $1 = $segments; $2 = $thickness; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14300|0),(13400|0),6328,(14842|0)); // unreachable; } $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { STACKTOP = sp;return; } $7 = ((($col)) + 3|0); $8 = HEAP8[$7>>0]|0; $9 = ($8<<24>>24)!=(0); if (!($9)) { STACKTOP = sp;return; } $10 = $0; ;HEAP32[$p0$byval_copy>>2]=HEAP32[$p0>>2]|0;HEAP32[$p0$byval_copy+4>>2]=HEAP32[$p0+4>>2]|0; _nk_draw_list_path_line_to($10,$p0$byval_copy); $11 = $0; $12 = $1; ;HEAP32[$cp0$byval_copy>>2]=HEAP32[$cp0>>2]|0;HEAP32[$cp0$byval_copy+4>>2]=HEAP32[$cp0+4>>2]|0; ;HEAP32[$cp1$byval_copy>>2]=HEAP32[$cp1>>2]|0;HEAP32[$cp1$byval_copy+4>>2]=HEAP32[$cp1+4>>2]|0; ;HEAP32[$p1$byval_copy>>2]=HEAP32[$p1>>2]|0;HEAP32[$p1$byval_copy+4>>2]=HEAP32[$p1+4>>2]|0; _nk_draw_list_path_curve_to($11,$cp0$byval_copy,$cp1$byval_copy,$p1$byval_copy,$12); $13 = $0; $14 = $2; ;HEAP8[$col$byval_copy>>0]=HEAP8[$col>>0]|0;HEAP8[$col$byval_copy+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$col$byval_copy+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$col$byval_copy+3>>0]=HEAP8[$col+3>>0]|0; _nk_draw_list_path_stroke($13,$col$byval_copy,0,$14); STACKTOP = sp;return; } function _nk_draw_list_add_image($list,$texture,$rect,$color) { $list = $list|0; $texture = $texture|0; $rect = $rect|0; $color = $color|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0; var $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; var $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0; var $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0; var $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0.0, $9 = 0, $color$byval_copy = 0, $color$byval_copy9 = 0, $uv = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $color$byval_copy9 = sp + 140|0; $$byval_copy8 = sp + 128|0; $$byval_copy7 = sp + 120|0; $$byval_copy6 = sp + 112|0; $$byval_copy5 = sp + 104|0; $color$byval_copy = sp + 136|0; $$byval_copy4 = sp + 96|0; $$byval_copy3 = sp + 88|0; $$byval_copy2 = sp + 80|0; $$byval_copy1 = sp + 72|0; $$byval_copy = sp + 68|0; $uv = sp + 48|0; $1 = sp + 40|0; $2 = sp + 32|0; $3 = sp + 24|0; $4 = sp + 16|0; $5 = sp + 8|0; $6 = sp; $0 = $list; $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((14300|0),(13400|0),6375,(14868|0)); // unreachable; } $9 = $0; $10 = ($9|0)!=(0|0); if (!($10)) { STACKTOP = sp;return; } $11 = $0; ;HEAP32[$$byval_copy>>2]=HEAP32[$texture>>2]|0; _nk_draw_list_push_image($11,$$byval_copy); $12 = (_nk_image_is_subimage($texture)|0); $13 = ($12|0)!=(0); if ($13) { $14 = ((($texture)) + 8|0); $15 = HEAP16[$14>>1]|0; $16 = (+($15&65535)); $17 = ((($texture)) + 4|0); $18 = HEAP16[$17>>1]|0; $19 = (+($18&65535)); $20 = $16 / $19; HEAPF32[$uv>>2] = $20; $21 = ((($texture)) + 8|0); $22 = ((($21)) + 2|0); $23 = HEAP16[$22>>1]|0; $24 = (+($23&65535)); $25 = ((($texture)) + 6|0); $26 = HEAP16[$25>>1]|0; $27 = (+($26&65535)); $28 = $24 / $27; $29 = ((($uv)) + 4|0); HEAPF32[$29>>2] = $28; $30 = ((($texture)) + 8|0); $31 = HEAP16[$30>>1]|0; $32 = $31&65535; $33 = ((($texture)) + 8|0); $34 = ((($33)) + 4|0); $35 = HEAP16[$34>>1]|0; $36 = $35&65535; $37 = (($32) + ($36))|0; $38 = (+($37|0)); $39 = ((($texture)) + 4|0); $40 = HEAP16[$39>>1]|0; $41 = (+($40&65535)); $42 = $38 / $41; $43 = ((($uv)) + 8|0); HEAPF32[$43>>2] = $42; $44 = ((($texture)) + 8|0); $45 = ((($44)) + 2|0); $46 = HEAP16[$45>>1]|0; $47 = $46&65535; $48 = ((($texture)) + 8|0); $49 = ((($48)) + 6|0); $50 = HEAP16[$49>>1]|0; $51 = $50&65535; $52 = (($47) + ($51))|0; $53 = (+($52|0)); $54 = ((($texture)) + 6|0); $55 = HEAP16[$54>>1]|0; $56 = (+($55&65535)); $57 = $53 / $56; $58 = ((($uv)) + 8|0); $59 = ((($58)) + 4|0); HEAPF32[$59>>2] = $57; $60 = $0; $61 = +HEAPF32[$rect>>2]; $62 = ((($rect)) + 4|0); $63 = +HEAPF32[$62>>2]; _nk_vec2($1,$61,$63); $64 = +HEAPF32[$rect>>2]; $65 = ((($rect)) + 8|0); $66 = +HEAPF32[$65>>2]; $67 = $64 + $66; $68 = ((($rect)) + 4|0); $69 = +HEAPF32[$68>>2]; $70 = ((($rect)) + 12|0); $71 = +HEAPF32[$70>>2]; $72 = $69 + $71; _nk_vec2($2,$67,$72); $73 = ((($uv)) + 8|0); ;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0; ;HEAP32[$$byval_copy2>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$2+4>>2]|0; ;HEAP32[$$byval_copy3>>2]=HEAP32[$uv>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$uv+4>>2]|0; ;HEAP32[$$byval_copy4>>2]=HEAP32[$73>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$73+4>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _nk_draw_list_push_rect_uv($60,$$byval_copy1,$$byval_copy2,$$byval_copy3,$$byval_copy4,$color$byval_copy); STACKTOP = sp;return; } else { $74 = $0; $75 = +HEAPF32[$rect>>2]; $76 = ((($rect)) + 4|0); $77 = +HEAPF32[$76>>2]; _nk_vec2($3,$75,$77); $78 = +HEAPF32[$rect>>2]; $79 = ((($rect)) + 8|0); $80 = +HEAPF32[$79>>2]; $81 = $78 + $80; $82 = ((($rect)) + 4|0); $83 = +HEAPF32[$82>>2]; $84 = ((($rect)) + 12|0); $85 = +HEAPF32[$84>>2]; $86 = $83 + $85; _nk_vec2($4,$81,$86); _nk_vec2($5,0.0,0.0); _nk_vec2($6,1.0,1.0); ;HEAP32[$$byval_copy5>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$3+4>>2]|0; ;HEAP32[$$byval_copy6>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$4+4>>2]|0; ;HEAP32[$$byval_copy7>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$5+4>>2]|0; ;HEAP32[$$byval_copy8>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$6+4>>2]|0; ;HEAP8[$color$byval_copy9>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy9+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy9+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy9+3>>0]=HEAP8[$color+3>>0]|0; _nk_draw_list_push_rect_uv($74,$$byval_copy5,$$byval_copy6,$$byval_copy7,$$byval_copy8,$color$byval_copy9); STACKTOP = sp;return; } } function _nk_draw_list_push_rect_uv($list,$a,$c,$uva,$uvc,$color) { $list = $list|0; $a = $a|0; $c = $c|0; $uva = $uva|0; $uvc = $uvc|0; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $9 = 0, $a$byval_copy = 0, $b = 0, $b$byval_copy = 0, $c$byval_copy = 0, $col = 0, $color$byval_copy = 0, $d = 0, $d$byval_copy = 0, $idx = 0, $index = 0, $or$cond = 0, $uva$byval_copy = 0, $uvb = 0, $uvb$byval_copy = 0, $uvc$byval_copy = 0, $uvd = 0; var $uvd$byval_copy = 0, $vtx = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 240|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $uvd$byval_copy = sp + 224|0; $d$byval_copy = sp + 216|0; $uvc$byval_copy = sp + 208|0; $c$byval_copy = sp + 200|0; $uvb$byval_copy = sp + 192|0; $b$byval_copy = sp + 184|0; $uva$byval_copy = sp + 176|0; $a$byval_copy = sp + 168|0; $color$byval_copy = sp + 236|0; $uvb = sp + 144|0; $uvd = sp + 136|0; $b = sp + 128|0; $d = sp + 120|0; $1 = sp + 104|0; $2 = sp + 96|0; $3 = sp + 88|0; $4 = sp + 80|0; $5 = sp + 60|0; $6 = sp + 40|0; $7 = sp + 20|0; $8 = sp; $0 = $list; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; $9 = (_nk_color_u32($color$byval_copy)|0); $col = $9; $10 = $0; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((14300|0),(13400|0),6348,(30089|0)); // unreachable; } $12 = $0; $13 = ($12|0)!=(0|0); if (!($13)) { STACKTOP = sp;return; } $14 = +HEAPF32[$uvc>>2]; $15 = ((($uva)) + 4|0); $16 = +HEAPF32[$15>>2]; _nk_vec2($1,$14,$16); ;HEAP32[$uvb>>2]=HEAP32[$1>>2]|0;HEAP32[$uvb+4>>2]=HEAP32[$1+4>>2]|0; $17 = +HEAPF32[$uva>>2]; $18 = ((($uvc)) + 4|0); $19 = +HEAPF32[$18>>2]; _nk_vec2($2,$17,$19); ;HEAP32[$uvd>>2]=HEAP32[$2>>2]|0;HEAP32[$uvd+4>>2]=HEAP32[$2+4>>2]|0; $20 = +HEAPF32[$c>>2]; $21 = ((($a)) + 4|0); $22 = +HEAPF32[$21>>2]; _nk_vec2($3,$20,$22); ;HEAP32[$b>>2]=HEAP32[$3>>2]|0;HEAP32[$b+4>>2]=HEAP32[$3+4>>2]|0; $23 = +HEAPF32[$a>>2]; $24 = ((($c)) + 4|0); $25 = +HEAPF32[$24>>2]; _nk_vec2($4,$23,$25); ;HEAP32[$d>>2]=HEAP32[$4>>2]|0;HEAP32[$d+4>>2]=HEAP32[$4+4>>2]|0; $26 = $0; $27 = ((($26)) + 56|0); $28 = HEAP32[$27>>2]|0; $29 = $28&65535; $index = $29; $30 = $0; $31 = (_nk_draw_list_alloc_vertices($30,4)|0); $vtx = $31; $32 = $0; $33 = (_nk_draw_list_alloc_elements($32,6)|0); $idx = $33; $34 = $vtx; $35 = ($34|0)!=(0|0); $36 = $idx; $37 = ($36|0)!=(0|0); $or$cond = $35 & $37; if (!($or$cond)) { STACKTOP = sp;return; } $38 = $index; $39 = $38&65535; $40 = (($39) + 0)|0; $41 = $40&65535; $42 = $idx; HEAP16[$42>>1] = $41; $43 = $index; $44 = $43&65535; $45 = (($44) + 1)|0; $46 = $45&65535; $47 = $idx; $48 = ((($47)) + 2|0); HEAP16[$48>>1] = $46; $49 = $index; $50 = $49&65535; $51 = (($50) + 2)|0; $52 = $51&65535; $53 = $idx; $54 = ((($53)) + 4|0); HEAP16[$54>>1] = $52; $55 = $index; $56 = $55&65535; $57 = (($56) + 0)|0; $58 = $57&65535; $59 = $idx; $60 = ((($59)) + 6|0); HEAP16[$60>>1] = $58; $61 = $index; $62 = $61&65535; $63 = (($62) + 2)|0; $64 = $63&65535; $65 = $idx; $66 = ((($65)) + 8|0); HEAP16[$66>>1] = $64; $67 = $index; $68 = $67&65535; $69 = (($68) + 3)|0; $70 = $69&65535; $71 = $idx; $72 = ((($71)) + 10|0); HEAP16[$72>>1] = $70; $73 = $vtx; $74 = $col; ;HEAP32[$a$byval_copy>>2]=HEAP32[$a>>2]|0;HEAP32[$a$byval_copy+4>>2]=HEAP32[$a+4>>2]|0; ;HEAP32[$uva$byval_copy>>2]=HEAP32[$uva>>2]|0;HEAP32[$uva$byval_copy+4>>2]=HEAP32[$uva+4>>2]|0; _nk_draw_vertex($5,$a$byval_copy,$uva$byval_copy,$74); ;HEAP32[$73>>2]=HEAP32[$5>>2]|0;HEAP32[$73+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$73+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$73+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$73+16>>2]=HEAP32[$5+16>>2]|0; $75 = $vtx; $76 = ((($75)) + 20|0); $77 = $col; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0; ;HEAP32[$uvb$byval_copy>>2]=HEAP32[$uvb>>2]|0;HEAP32[$uvb$byval_copy+4>>2]=HEAP32[$uvb+4>>2]|0; _nk_draw_vertex($6,$b$byval_copy,$uvb$byval_copy,$77); ;HEAP32[$76>>2]=HEAP32[$6>>2]|0;HEAP32[$76+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$76+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$76+12>>2]=HEAP32[$6+12>>2]|0;HEAP32[$76+16>>2]=HEAP32[$6+16>>2]|0; $78 = $vtx; $79 = ((($78)) + 40|0); $80 = $col; ;HEAP32[$c$byval_copy>>2]=HEAP32[$c>>2]|0;HEAP32[$c$byval_copy+4>>2]=HEAP32[$c+4>>2]|0; ;HEAP32[$uvc$byval_copy>>2]=HEAP32[$uvc>>2]|0;HEAP32[$uvc$byval_copy+4>>2]=HEAP32[$uvc+4>>2]|0; _nk_draw_vertex($7,$c$byval_copy,$uvc$byval_copy,$80); ;HEAP32[$79>>2]=HEAP32[$7>>2]|0;HEAP32[$79+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$79+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$79+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$79+16>>2]=HEAP32[$7+16>>2]|0; $81 = $vtx; $82 = ((($81)) + 60|0); $83 = $col; ;HEAP32[$d$byval_copy>>2]=HEAP32[$d>>2]|0;HEAP32[$d$byval_copy+4>>2]=HEAP32[$d+4>>2]|0; ;HEAP32[$uvd$byval_copy>>2]=HEAP32[$uvd>>2]|0;HEAP32[$uvd$byval_copy+4>>2]=HEAP32[$uvd+4>>2]|0; _nk_draw_vertex($8,$d$byval_copy,$uvd$byval_copy,$83); ;HEAP32[$82>>2]=HEAP32[$8>>2]|0;HEAP32[$82+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$82+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[$82+12>>2]=HEAP32[$8+12>>2]|0;HEAP32[$82+16>>2]=HEAP32[$8+16>>2]|0; STACKTOP = sp;return; } function _nk_draw_list_add_text($list,$font,$rect,$text,$len,$font_height,$fg) { $list = $list|0; $font = $font|0; $rect = $rect|0; $text = $text|0; $len = $len|0; $font_height = +$font_height; $fg = $fg|0; var $$byval_copy = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy8 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0, $108 = 0.0, $109 = 0.0, $11 = 0; var $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0, $124 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0; var $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0; var $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0; var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0; var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0; var $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0.0, $97 = 0, $98 = 0.0, $99 = 0, $char_width = 0.0, $fg$byval_copy = 0, $g = 0, $gh = 0.0, $glyph_len = 0, $gw = 0.0, $gx = 0.0, $gy = 0.0, $next = 0; var $next_glyph_len = 0, $or$cond = 0, $or$cond3 = 0, $text_len = 0, $unicode = 0, $x = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 176|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $fg$byval_copy = sp + 160|0; $$byval_copy8 = sp + 152|0; $$byval_copy7 = sp + 144|0; $$byval_copy6 = sp + 136|0; $$byval_copy5 = sp + 128|0; $$byval_copy4 = sp + 120|0; $$byval_copy = sp + 116|0; $unicode = sp + 84|0; $next = sp + 80|0; $g = sp + 36|0; $5 = sp + 8|0; $6 = sp; $0 = $list; $1 = $font; $2 = $text; $3 = $len; $4 = $font_height; $x = 0.0; $text_len = 0; HEAP32[$unicode>>2] = 0; HEAP32[$next>>2] = 0; $glyph_len = 0; $next_glyph_len = 0; $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((14300|0),(13400|0),6406,(14891|0)); // unreachable; } $9 = $0; $10 = ($9|0)!=(0|0); $11 = $3; $12 = ($11|0)!=(0); $or$cond = $10 & $12; $13 = $2; $14 = ($13|0)!=(0|0); $or$cond3 = $or$cond & $14; if (!($or$cond3)) { STACKTOP = sp;return; } $15 = +HEAPF32[$rect>>2]; $16 = $0; $17 = ((($16)) + 24|0); $18 = +HEAPF32[$17>>2]; $19 = $0; $20 = ((($19)) + 24|0); $21 = ((($20)) + 8|0); $22 = +HEAPF32[$21>>2]; $23 = $18 + $22; $24 = $15 > $23; if ($24) { STACKTOP = sp;return; } $25 = ((($rect)) + 4|0); $26 = +HEAPF32[$25>>2]; $27 = $0; $28 = ((($27)) + 24|0); $29 = ((($28)) + 4|0); $30 = +HEAPF32[$29>>2]; $31 = $0; $32 = ((($31)) + 24|0); $33 = ((($32)) + 12|0); $34 = +HEAPF32[$33>>2]; $35 = $30 + $34; $36 = $26 > $35; if ($36) { STACKTOP = sp;return; } $37 = +HEAPF32[$rect>>2]; $38 = $0; $39 = ((($38)) + 24|0); $40 = +HEAPF32[$39>>2]; $41 = $37 < $40; if ($41) { STACKTOP = sp;return; } $42 = ((($rect)) + 4|0); $43 = +HEAPF32[$42>>2]; $44 = $0; $45 = ((($44)) + 24|0); $46 = ((($45)) + 4|0); $47 = +HEAPF32[$46>>2]; $48 = $43 < $47; if ($48) { STACKTOP = sp;return; } $49 = $0; $50 = $1; $51 = ((($50)) + 16|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$51>>2]|0; _nk_draw_list_push_image($49,$$byval_copy); $52 = +HEAPF32[$rect>>2]; $x = $52; $53 = $2; $54 = $3; $55 = (_nk_utf_decode($53,$unicode,$54)|0); $text_len = $55; $glyph_len = $55; $56 = $glyph_len; $57 = ($56|0)!=(0); if (!($57)) { STACKTOP = sp;return; } while(1) { $58 = $text_len; $59 = $3; $60 = ($58|0)<=($59|0); $61 = $glyph_len; $62 = ($61|0)!=(0); $63 = $60 ? $62 : 0; if (!($63)) { label = 12; break; } $char_width = 0.0; $64 = HEAP32[$unicode>>2]|0; $65 = ($64|0)==(65533); if ($65) { label = 12; break; } $66 = $2; $67 = $text_len; $68 = (($66) + ($67)|0); $69 = $3; $70 = $text_len; $71 = (($69) - ($70))|0; $72 = (_nk_utf_decode($68,$next,$71)|0); $next_glyph_len = $72; $73 = $1; $74 = ((($73)) + 12|0); $75 = HEAP32[$74>>2]|0; $76 = $1; $77 = $4; $78 = HEAP32[$unicode>>2]|0; $79 = HEAP32[$next>>2]|0; $80 = ($79|0)==(65533); $81 = HEAP32[$next>>2]|0; $82 = $80 ? 0 : $81; ;HEAP32[$$byval_copy4>>2]=HEAP32[$76>>2]|0; FUNCTION_TABLE_vidiii[$75 & 15]($$byval_copy4,$77,$g,$78,$82); $83 = $x; $84 = ((($g)) + 16|0); $85 = +HEAPF32[$84>>2]; $86 = $83 + $85; $gx = $86; $87 = ((($rect)) + 4|0); $88 = +HEAPF32[$87>>2]; $89 = ((($g)) + 16|0); $90 = ((($89)) + 4|0); $91 = +HEAPF32[$90>>2]; $92 = $88 + $91; $gy = $92; $93 = ((($g)) + 24|0); $94 = +HEAPF32[$93>>2]; $gw = $94; $95 = ((($g)) + 28|0); $96 = +HEAPF32[$95>>2]; $gh = $96; $97 = ((($g)) + 32|0); $98 = +HEAPF32[$97>>2]; $char_width = $98; $99 = ((($fg)) + 3|0); $100 = HEAP8[$99>>0]|0; $101 = (+($100&255)); $102 = $0; $103 = +HEAPF32[$102>>2]; $104 = $101 * $103; $105 = (~~(($104))&255); $106 = ((($fg)) + 3|0); HEAP8[$106>>0] = $105; $107 = $0; $108 = $gx; $109 = $gy; _nk_vec2($5,$108,$109); $110 = $gx; $111 = $gw; $112 = $110 + $111; $113 = $gy; $114 = $gh; $115 = $113 + $114; _nk_vec2($6,$112,$115); $116 = ((($g)) + 8|0); ;HEAP32[$$byval_copy5>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$5+4>>2]|0; ;HEAP32[$$byval_copy6>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$6+4>>2]|0; ;HEAP32[$$byval_copy7>>2]=HEAP32[$g>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$g+4>>2]|0; ;HEAP32[$$byval_copy8>>2]=HEAP32[$116>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$116+4>>2]|0; ;HEAP8[$fg$byval_copy>>0]=HEAP8[$fg>>0]|0;HEAP8[$fg$byval_copy+1>>0]=HEAP8[$fg+1>>0]|0;HEAP8[$fg$byval_copy+2>>0]=HEAP8[$fg+2>>0]|0;HEAP8[$fg$byval_copy+3>>0]=HEAP8[$fg+3>>0]|0; _nk_draw_list_push_rect_uv($107,$$byval_copy5,$$byval_copy6,$$byval_copy7,$$byval_copy8,$fg$byval_copy); $117 = $glyph_len; $118 = $text_len; $119 = (($118) + ($117))|0; $text_len = $119; $120 = $char_width; $121 = $x; $122 = $121 + $120; $x = $122; $123 = $next_glyph_len; $glyph_len = $123; $124 = HEAP32[$next>>2]|0; HEAP32[$unicode>>2] = $124; } if ((label|0) == 12) { STACKTOP = sp;return; } } function _nk_convert($ctx,$cmds,$vertices,$elements,$config) { $ctx = $ctx|0; $cmds = $cmds|0; $vertices = $vertices|0; $elements = $elements|0; $config = $config|0; var $$byval_copy = 0, $$byval_copy10 = 0, $$byval_copy11 = 0, $$byval_copy12 = 0, $$byval_copy13 = 0, $$byval_copy14 = 0, $$byval_copy15 = 0, $$byval_copy16 = 0, $$byval_copy17 = 0, $$byval_copy18 = 0, $$byval_copy19 = 0, $$byval_copy20 = 0, $$byval_copy21 = 0, $$byval_copy22 = 0, $$byval_copy23 = 0, $$byval_copy24 = 0, $$byval_copy25 = 0, $$byval_copy26 = 0, $$byval_copy27 = 0, $$byval_copy28 = 0; var $$byval_copy29 = 0, $$byval_copy30 = 0, $$byval_copy31 = 0, $$byval_copy32 = 0, $$byval_copy33 = 0, $$byval_copy34 = 0, $$byval_copy35 = 0, $$byval_copy36 = 0, $$byval_copy37 = 0, $$byval_copy38 = 0, $$byval_copy39 = 0, $$byval_copy40 = 0, $$byval_copy41 = 0, $$byval_copy42 = 0, $$byval_copy43 = 0, $$byval_copy44 = 0, $$byval_copy45 = 0, $$byval_copy46 = 0, $$byval_copy47 = 0, $$byval_copy48 = 0; var $$byval_copy49 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy8 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0; var $111 = 0, $112 = 0.0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0.0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0; var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0.0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0.0, $145 = 0, $146 = 0, $147 = 0; var $148 = 0.0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0.0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0.0, $163 = 0, $164 = 0, $165 = 0; var $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0, $175 = 0, $176 = 0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0.0, $182 = 0, $183 = 0; var $184 = 0, $185 = 0, $186 = 0, $187 = 0.0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0.0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0.0, $199 = 0, $2 = 0, $20 = 0, $200 = 0; var $201 = 0, $202 = 0.0, $203 = 0, $204 = 0, $205 = 0, $206 = 0.0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0.0, $217 = 0, $218 = 0, $219 = 0; var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0.0, $224 = 0, $225 = 0, $226 = 0, $227 = 0.0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0.0, $236 = 0, $237 = 0; var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0.0, $251 = 0, $252 = 0, $253 = 0, $254 = 0.0, $255 = 0.0; var $256 = 0.0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0.0, $261 = 0, $262 = 0, $263 = 0, $264 = 0.0, $265 = 0.0, $266 = 0.0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0.0, $271 = 0.0, $272 = 0, $273 = 0; var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0.0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0.0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0.0; var $292 = 0.0, $293 = 0.0, $294 = 0, $295 = 0, $296 = 0, $297 = 0.0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0.0, $302 = 0.0, $303 = 0.0, $304 = 0, $305 = 0, $306 = 0, $307 = 0.0, $308 = 0.0, $309 = 0; var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0, $322 = 0, $323 = 0, $324 = 0.0, $325 = 0, $326 = 0, $327 = 0; var $328 = 0, $329 = 0, $33 = 0, $330 = 0.0, $331 = 0, $332 = 0, $333 = 0, $334 = 0.0, $335 = 0, $336 = 0, $337 = 0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0, $341 = 0.0, $342 = 0, $343 = 0, $344 = 0, $345 = 0.0; var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0.0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0.0; var $364 = 0, $365 = 0, $366 = 0, $367 = 0.0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0.0, $374 = 0, $375 = 0, $376 = 0, $377 = 0.0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0.0; var $382 = 0, $383 = 0, $384 = 0.0, $385 = 0, $386 = 0, $387 = 0, $388 = 0.0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0; var $40 = 0, $400 = 0, $401 = 0, $402 = 0.0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0.0, $417 = 0; var $418 = 0, $419 = 0, $42 = 0, $420 = 0.0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0.0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0.0, $432 = 0, $433 = 0, $434 = 0, $435 = 0; var $436 = 0, $437 = 0, $438 = 0.0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0.0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0.0, $453 = 0; var $454 = 0, $455 = 0, $456 = 0.0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0.0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0; var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0.0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0.0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0.0; var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0.0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0; var $508 = 0.0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0.0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0; var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0.0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0.0; var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0.0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0; var $562 = 0, $563 = 0, $564 = 0, $565 = 0.0, $566 = 0, $567 = 0, $568 = 0, $569 = 0.0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0.0, $574 = 0, $575 = 0, $576 = 0, $577 = 0.0, $578 = 0, $579 = 0, $58 = 0; var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0.0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0.0, $597 = 0, $598 = 0; var $599 = 0, $6 = 0, $60 = 0, $600 = 0.0, $601 = 0, $602 = 0, $603 = 0, $604 = 0.0, $605 = 0, $606 = 0, $607 = 0, $608 = 0.0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0; var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0; var $84 = 0, $85 = 0.0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0.0, $98 = 0, $99 = 0, $c = 0, $c3 = 0, $c4 = 0; var $c5 = 0, $cmd = 0, $i = 0, $i10 = 0, $i14 = 0, $i7 = 0, $l = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $p = 0, $p11 = 0, $p8 = 0, $pnt = 0, $pnt$byval_copy = 0, $pnt12 = 0, $pnt12$byval_copy = 0, $pnt9 = 0, $pnt9$byval_copy = 0, $q = 0; var $r = 0, $r1 = 0, $r2 = 0, $s = 0, $t = 0, $t13 = 0, $t6 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 800|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy49 = sp + 788|0; $$byval_copy48 = sp + 696|0; $$byval_copy47 = sp + 680|0; $$byval_copy46 = sp + 784|0; $$byval_copy45 = sp + 664|0; $$byval_copy44 = sp + 780|0; $pnt12$byval_copy = sp + 656|0; $$byval_copy43 = sp + 776|0; $pnt9$byval_copy = sp + 648|0; $$byval_copy42 = sp + 772|0; $pnt$byval_copy = sp + 640|0; $$byval_copy41 = sp + 768|0; $$byval_copy40 = sp + 632|0; $$byval_copy39 = sp + 624|0; $$byval_copy38 = sp + 616|0; $$byval_copy37 = sp + 764|0; $$byval_copy36 = sp + 608|0; $$byval_copy35 = sp + 600|0; $$byval_copy34 = sp + 592|0; $$byval_copy33 = sp + 760|0; $$byval_copy32 = sp + 584|0; $$byval_copy31 = sp + 576|0; $$byval_copy30 = sp + 756|0; $$byval_copy29 = sp + 568|0; $$byval_copy28 = sp + 560|0; $$byval_copy27 = sp + 752|0; $$byval_copy26 = sp + 552|0; $$byval_copy25 = sp + 748|0; $$byval_copy24 = sp + 544|0; $$byval_copy23 = sp + 744|0; $$byval_copy22 = sp + 740|0; $$byval_copy21 = sp + 736|0; $$byval_copy20 = sp + 732|0; $$byval_copy19 = sp + 528|0; $$byval_copy18 = sp + 728|0; $$byval_copy17 = sp + 512|0; $$byval_copy16 = sp + 724|0; $$byval_copy15 = sp + 496|0; $$byval_copy14 = sp + 720|0; $$byval_copy13 = sp + 488|0; $$byval_copy12 = sp + 480|0; $$byval_copy11 = sp + 472|0; $$byval_copy10 = sp + 464|0; $$byval_copy9 = sp + 716|0; $$byval_copy8 = sp + 456|0; $$byval_copy7 = sp + 448|0; $$byval_copy6 = sp + 432|0; $$byval_copy = sp + 420|0; $5 = sp + 376|0; $6 = sp + 360|0; $7 = sp + 352|0; $8 = sp + 336|0; $9 = sp + 328|0; $10 = sp + 320|0; $11 = sp + 312|0; $12 = sp + 288|0; $13 = sp + 264|0; $14 = sp + 240|0; $15 = sp + 224|0; $16 = sp + 208|0; $17 = sp + 192|0; $18 = sp + 184|0; $19 = sp + 168|0; $20 = sp + 160|0; $21 = sp + 144|0; $22 = sp + 136|0; $23 = sp + 128|0; $24 = sp + 112|0; $25 = sp + 104|0; $26 = sp + 96|0; $pnt = sp + 80|0; $pnt9 = sp + 64|0; $pnt12 = sp + 48|0; $27 = sp + 24|0; $28 = sp; $29 = sp + 712|0; $0 = $ctx; $1 = $cmds; $2 = $vertices; $3 = $elements; $4 = $config; $30 = $0; $31 = ($30|0)!=(0|0); if (!($31)) { ___assert_fail((14913|0),(13400|0),6453,(14917|0)); // unreachable; } $32 = $1; $33 = ($32|0)!=(0|0); if (!($33)) { ___assert_fail((14928|0),(13400|0),6454,(14917|0)); // unreachable; } $34 = $2; $35 = ($34|0)!=(0|0); if (!($35)) { ___assert_fail((14933|0),(13400|0),6455,(14917|0)); // unreachable; } $36 = $3; $37 = ($36|0)!=(0|0); if (!($37)) { ___assert_fail((14942|0),(13400|0),6456,(14917|0)); // unreachable; } $38 = $0; $39 = ($38|0)!=(0|0); $40 = $1; $41 = ($40|0)!=(0|0); $or$cond = $39 & $41; $42 = $2; $43 = ($42|0)!=(0|0); $or$cond3 = $or$cond & $43; $44 = $3; $45 = ($44|0)!=(0|0); $or$cond5 = $or$cond3 & $45; if (!($or$cond5)) { STACKTOP = sp;return; } $46 = $0; $47 = ((($46)) + 5672|0); $48 = $4; $49 = +HEAPF32[$48>>2]; $50 = $4; $51 = ((($50)) + 4|0); $52 = HEAP32[$51>>2]|0; $53 = $4; $54 = ((($53)) + 8|0); $55 = HEAP32[$54>>2]|0; $56 = $4; $57 = ((($56)) + 24|0); $58 = $1; $59 = $2; $60 = $3; ;HEAP32[$$byval_copy>>2]=HEAP32[$57>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$57+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$57+8>>2]|0; _nk_draw_list_setup($47,$49,$52,$55,$$byval_copy,$58,$59,$60); $61 = $0; $62 = (_nk__begin($61)|0); $cmd = $62; while(1) { $63 = $cmd; $64 = ($63|0)!=(0|0); if (!($64)) { break; } $65 = $cmd; $66 = HEAP32[$65>>2]|0; do { switch ($66|0) { case 17: { $588 = $cmd; $i14 = $588; $589 = $0; $590 = ((($589)) + 5672|0); $591 = $i14; $592 = ((($591)) + 16|0); $593 = $i14; $594 = ((($593)) + 8|0); $595 = HEAP16[$594>>1]|0; $596 = (+($595<<16>>16)); $597 = $i14; $598 = ((($597)) + 10|0); $599 = HEAP16[$598>>1]|0; $600 = (+($599<<16>>16)); $601 = $i14; $602 = ((($601)) + 12|0); $603 = HEAP16[$602>>1]|0; $604 = (+($603&65535)); $605 = $i14; $606 = ((($605)) + 14|0); $607 = HEAP16[$606>>1]|0; $608 = (+($607&65535)); _nk_rect($28,$596,$600,$604,$608); _nk_rgb($29,255,255,255); ;HEAP32[$$byval_copy47>>2]=HEAP32[$592>>2]|0;HEAP32[$$byval_copy47+4>>2]=HEAP32[$592+4>>2]|0;HEAP32[$$byval_copy47+8>>2]=HEAP32[$592+8>>2]|0;HEAP32[$$byval_copy47+12>>2]=HEAP32[$592+12>>2]|0; ;HEAP32[$$byval_copy48>>2]=HEAP32[$28>>2]|0;HEAP32[$$byval_copy48+4>>2]=HEAP32[$28+4>>2]|0;HEAP32[$$byval_copy48+8>>2]=HEAP32[$28+8>>2]|0;HEAP32[$$byval_copy48+12>>2]=HEAP32[$28+12>>2]|0; ;HEAP8[$$byval_copy49>>0]=HEAP8[$29>>0]|0;HEAP8[$$byval_copy49+1>>0]=HEAP8[$29+1>>0]|0;HEAP8[$$byval_copy49+2>>0]=HEAP8[$29+2>>0]|0;HEAP8[$$byval_copy49+3>>0]=HEAP8[$29+3>>0]|0; _nk_draw_list_add_image($590,$$byval_copy47,$$byval_copy48,$$byval_copy49); break; } case 1: { $67 = $cmd; $s = $67; $68 = $0; $69 = ((($68)) + 5672|0); $70 = $s; $71 = ((($70)) + 8|0); $72 = HEAP16[$71>>1]|0; $73 = (+($72<<16>>16)); $74 = $s; $75 = ((($74)) + 10|0); $76 = HEAP16[$75>>1]|0; $77 = (+($76<<16>>16)); $78 = $s; $79 = ((($78)) + 12|0); $80 = HEAP16[$79>>1]|0; $81 = (+($80&65535)); $82 = $s; $83 = ((($82)) + 14|0); $84 = HEAP16[$83>>1]|0; $85 = (+($84&65535)); _nk_rect($5,$73,$77,$81,$85); ;HEAP32[$$byval_copy6>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$5+12>>2]|0; _nk_draw_list_add_clip($69,$$byval_copy6); break; } case 2: { $86 = $cmd; $l = $86; $87 = $0; $88 = ((($87)) + 5672|0); $89 = $l; $90 = ((($89)) + 10|0); $91 = HEAP16[$90>>1]|0; $92 = (+($91<<16>>16)); $93 = $l; $94 = ((($93)) + 10|0); $95 = ((($94)) + 2|0); $96 = HEAP16[$95>>1]|0; $97 = (+($96<<16>>16)); _nk_vec2($6,$92,$97); $98 = $l; $99 = ((($98)) + 14|0); $100 = HEAP16[$99>>1]|0; $101 = (+($100<<16>>16)); $102 = $l; $103 = ((($102)) + 14|0); $104 = ((($103)) + 2|0); $105 = HEAP16[$104>>1]|0; $106 = (+($105<<16>>16)); _nk_vec2($7,$101,$106); $107 = $l; $108 = ((($107)) + 18|0); $109 = $l; $110 = ((($109)) + 8|0); $111 = HEAP16[$110>>1]|0; $112 = (+($111&65535)); ;HEAP32[$$byval_copy7>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$6+4>>2]|0; ;HEAP32[$$byval_copy8>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$7+4>>2]|0; ;HEAP8[$$byval_copy9>>0]=HEAP8[$108>>0]|0;HEAP8[$$byval_copy9+1>>0]=HEAP8[$108+1>>0]|0;HEAP8[$$byval_copy9+2>>0]=HEAP8[$108+2>>0]|0;HEAP8[$$byval_copy9+3>>0]=HEAP8[$108+3>>0]|0; _nk_draw_list_stroke_line($88,$$byval_copy7,$$byval_copy8,$$byval_copy9,$112); break; } case 3: { $113 = $cmd; $q = $113; $114 = $0; $115 = ((($114)) + 5672|0); $116 = $q; $117 = ((($116)) + 10|0); $118 = HEAP16[$117>>1]|0; $119 = (+($118<<16>>16)); $120 = $q; $121 = ((($120)) + 10|0); $122 = ((($121)) + 2|0); $123 = HEAP16[$122>>1]|0; $124 = (+($123<<16>>16)); _nk_vec2($8,$119,$124); $125 = $q; $126 = ((($125)) + 18|0); $127 = HEAP16[$126>>1]|0; $128 = (+($127<<16>>16)); $129 = $q; $130 = ((($129)) + 18|0); $131 = ((($130)) + 2|0); $132 = HEAP16[$131>>1]|0; $133 = (+($132<<16>>16)); _nk_vec2($9,$128,$133); $134 = $q; $135 = ((($134)) + 18|0); $136 = ((($135)) + 4|0); $137 = HEAP16[$136>>1]|0; $138 = (+($137<<16>>16)); $139 = $q; $140 = ((($139)) + 18|0); $141 = ((($140)) + 4|0); $142 = ((($141)) + 2|0); $143 = HEAP16[$142>>1]|0; $144 = (+($143<<16>>16)); _nk_vec2($10,$138,$144); $145 = $q; $146 = ((($145)) + 14|0); $147 = HEAP16[$146>>1]|0; $148 = (+($147<<16>>16)); $149 = $q; $150 = ((($149)) + 14|0); $151 = ((($150)) + 2|0); $152 = HEAP16[$151>>1]|0; $153 = (+($152<<16>>16)); _nk_vec2($11,$148,$153); $154 = $q; $155 = ((($154)) + 26|0); $156 = $4; $157 = ((($156)) + 20|0); $158 = HEAP32[$157>>2]|0; $159 = $q; $160 = ((($159)) + 8|0); $161 = HEAP16[$160>>1]|0; $162 = (+($161&65535)); ;HEAP32[$$byval_copy10>>2]=HEAP32[$8>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[$8+4>>2]|0; ;HEAP32[$$byval_copy11>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy11+4>>2]=HEAP32[$9+4>>2]|0; ;HEAP32[$$byval_copy12>>2]=HEAP32[$10>>2]|0;HEAP32[$$byval_copy12+4>>2]=HEAP32[$10+4>>2]|0; ;HEAP32[$$byval_copy13>>2]=HEAP32[$11>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$11+4>>2]|0; ;HEAP8[$$byval_copy14>>0]=HEAP8[$155>>0]|0;HEAP8[$$byval_copy14+1>>0]=HEAP8[$155+1>>0]|0;HEAP8[$$byval_copy14+2>>0]=HEAP8[$155+2>>0]|0;HEAP8[$$byval_copy14+3>>0]=HEAP8[$155+3>>0]|0; _nk_draw_list_stroke_curve($115,$$byval_copy10,$$byval_copy11,$$byval_copy12,$$byval_copy13,$$byval_copy14,$158,$162); break; } case 4: { $163 = $cmd; $r = $163; $164 = $0; $165 = ((($164)) + 5672|0); $166 = $r; $167 = ((($166)) + 12|0); $168 = HEAP16[$167>>1]|0; $169 = (+($168<<16>>16)); $170 = $r; $171 = ((($170)) + 14|0); $172 = HEAP16[$171>>1]|0; $173 = (+($172<<16>>16)); $174 = $r; $175 = ((($174)) + 16|0); $176 = HEAP16[$175>>1]|0; $177 = (+($176&65535)); $178 = $r; $179 = ((($178)) + 18|0); $180 = HEAP16[$179>>1]|0; $181 = (+($180&65535)); _nk_rect($12,$169,$173,$177,$181); $182 = $r; $183 = ((($182)) + 20|0); $184 = $r; $185 = ((($184)) + 8|0); $186 = HEAP16[$185>>1]|0; $187 = (+($186&65535)); $188 = $r; $189 = ((($188)) + 10|0); $190 = HEAP16[$189>>1]|0; $191 = (+($190&65535)); ;HEAP32[$$byval_copy15>>2]=HEAP32[$12>>2]|0;HEAP32[$$byval_copy15+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$$byval_copy15+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[$$byval_copy15+12>>2]=HEAP32[$12+12>>2]|0; ;HEAP8[$$byval_copy16>>0]=HEAP8[$183>>0]|0;HEAP8[$$byval_copy16+1>>0]=HEAP8[$183+1>>0]|0;HEAP8[$$byval_copy16+2>>0]=HEAP8[$183+2>>0]|0;HEAP8[$$byval_copy16+3>>0]=HEAP8[$183+3>>0]|0; _nk_draw_list_stroke_rect($165,$$byval_copy15,$$byval_copy16,$187,$191); break; } case 5: { $192 = $cmd; $r1 = $192; $193 = $0; $194 = ((($193)) + 5672|0); $195 = $r1; $196 = ((($195)) + 10|0); $197 = HEAP16[$196>>1]|0; $198 = (+($197<<16>>16)); $199 = $r1; $200 = ((($199)) + 12|0); $201 = HEAP16[$200>>1]|0; $202 = (+($201<<16>>16)); $203 = $r1; $204 = ((($203)) + 14|0); $205 = HEAP16[$204>>1]|0; $206 = (+($205&65535)); $207 = $r1; $208 = ((($207)) + 16|0); $209 = HEAP16[$208>>1]|0; $210 = (+($209&65535)); _nk_rect($13,$198,$202,$206,$210); $211 = $r1; $212 = ((($211)) + 18|0); $213 = $r1; $214 = ((($213)) + 8|0); $215 = HEAP16[$214>>1]|0; $216 = (+($215&65535)); ;HEAP32[$$byval_copy17>>2]=HEAP32[$13>>2]|0;HEAP32[$$byval_copy17+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[$$byval_copy17+8>>2]=HEAP32[$13+8>>2]|0;HEAP32[$$byval_copy17+12>>2]=HEAP32[$13+12>>2]|0; ;HEAP8[$$byval_copy18>>0]=HEAP8[$212>>0]|0;HEAP8[$$byval_copy18+1>>0]=HEAP8[$212+1>>0]|0;HEAP8[$$byval_copy18+2>>0]=HEAP8[$212+2>>0]|0;HEAP8[$$byval_copy18+3>>0]=HEAP8[$212+3>>0]|0; _nk_draw_list_fill_rect($194,$$byval_copy17,$$byval_copy18,$216); break; } case 6: { $217 = $cmd; $r2 = $217; $218 = $0; $219 = ((($218)) + 5672|0); $220 = $r2; $221 = ((($220)) + 8|0); $222 = HEAP16[$221>>1]|0; $223 = (+($222<<16>>16)); $224 = $r2; $225 = ((($224)) + 10|0); $226 = HEAP16[$225>>1]|0; $227 = (+($226<<16>>16)); $228 = $r2; $229 = ((($228)) + 12|0); $230 = HEAP16[$229>>1]|0; $231 = (+($230&65535)); $232 = $r2; $233 = ((($232)) + 14|0); $234 = HEAP16[$233>>1]|0; $235 = (+($234&65535)); _nk_rect($14,$223,$227,$231,$235); $236 = $r2; $237 = ((($236)) + 16|0); $238 = $r2; $239 = ((($238)) + 20|0); $240 = $r2; $241 = ((($240)) + 28|0); $242 = $r2; $243 = ((($242)) + 24|0); ;HEAP32[$$byval_copy19>>2]=HEAP32[$14>>2]|0;HEAP32[$$byval_copy19+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[$$byval_copy19+8>>2]=HEAP32[$14+8>>2]|0;HEAP32[$$byval_copy19+12>>2]=HEAP32[$14+12>>2]|0; ;HEAP8[$$byval_copy20>>0]=HEAP8[$237>>0]|0;HEAP8[$$byval_copy20+1>>0]=HEAP8[$237+1>>0]|0;HEAP8[$$byval_copy20+2>>0]=HEAP8[$237+2>>0]|0;HEAP8[$$byval_copy20+3>>0]=HEAP8[$237+3>>0]|0; ;HEAP8[$$byval_copy21>>0]=HEAP8[$239>>0]|0;HEAP8[$$byval_copy21+1>>0]=HEAP8[$239+1>>0]|0;HEAP8[$$byval_copy21+2>>0]=HEAP8[$239+2>>0]|0;HEAP8[$$byval_copy21+3>>0]=HEAP8[$239+3>>0]|0; ;HEAP8[$$byval_copy22>>0]=HEAP8[$241>>0]|0;HEAP8[$$byval_copy22+1>>0]=HEAP8[$241+1>>0]|0;HEAP8[$$byval_copy22+2>>0]=HEAP8[$241+2>>0]|0;HEAP8[$$byval_copy22+3>>0]=HEAP8[$241+3>>0]|0; ;HEAP8[$$byval_copy23>>0]=HEAP8[$243>>0]|0;HEAP8[$$byval_copy23+1>>0]=HEAP8[$243+1>>0]|0;HEAP8[$$byval_copy23+2>>0]=HEAP8[$243+2>>0]|0;HEAP8[$$byval_copy23+3>>0]=HEAP8[$243+3>>0]|0; _nk_draw_list_fill_rect_multi_color($219,$$byval_copy19,$$byval_copy20,$$byval_copy21,$$byval_copy22,$$byval_copy23); break; } case 7: { $244 = $cmd; $c = $244; $245 = $0; $246 = ((($245)) + 5672|0); $247 = $c; $248 = ((($247)) + 8|0); $249 = HEAP16[$248>>1]|0; $250 = (+($249<<16>>16)); $251 = $c; $252 = ((($251)) + 14|0); $253 = HEAP16[$252>>1]|0; $254 = (+($253&65535)); $255 = $254 / 2.0; $256 = $250 + $255; $257 = $c; $258 = ((($257)) + 10|0); $259 = HEAP16[$258>>1]|0; $260 = (+($259<<16>>16)); $261 = $c; $262 = ((($261)) + 16|0); $263 = HEAP16[$262>>1]|0; $264 = (+($263&65535)); $265 = $264 / 2.0; $266 = $260 + $265; _nk_vec2($15,$256,$266); $267 = $c; $268 = ((($267)) + 14|0); $269 = HEAP16[$268>>1]|0; $270 = (+($269&65535)); $271 = $270 / 2.0; $272 = $c; $273 = ((($272)) + 18|0); $274 = $4; $275 = ((($274)) + 12|0); $276 = HEAP32[$275>>2]|0; $277 = $c; $278 = ((($277)) + 12|0); $279 = HEAP16[$278>>1]|0; $280 = (+($279&65535)); ;HEAP32[$$byval_copy24>>2]=HEAP32[$15>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$15+4>>2]|0; ;HEAP8[$$byval_copy25>>0]=HEAP8[$273>>0]|0;HEAP8[$$byval_copy25+1>>0]=HEAP8[$273+1>>0]|0;HEAP8[$$byval_copy25+2>>0]=HEAP8[$273+2>>0]|0;HEAP8[$$byval_copy25+3>>0]=HEAP8[$273+3>>0]|0; _nk_draw_list_stroke_circle($246,$$byval_copy24,$271,$$byval_copy25,$276,$280); break; } case 8: { $281 = $cmd; $c3 = $281; $282 = $0; $283 = ((($282)) + 5672|0); $284 = $c3; $285 = ((($284)) + 8|0); $286 = HEAP16[$285>>1]|0; $287 = (+($286<<16>>16)); $288 = $c3; $289 = ((($288)) + 12|0); $290 = HEAP16[$289>>1]|0; $291 = (+($290&65535)); $292 = $291 / 2.0; $293 = $287 + $292; $294 = $c3; $295 = ((($294)) + 10|0); $296 = HEAP16[$295>>1]|0; $297 = (+($296<<16>>16)); $298 = $c3; $299 = ((($298)) + 14|0); $300 = HEAP16[$299>>1]|0; $301 = (+($300&65535)); $302 = $301 / 2.0; $303 = $297 + $302; _nk_vec2($16,$293,$303); $304 = $c3; $305 = ((($304)) + 12|0); $306 = HEAP16[$305>>1]|0; $307 = (+($306&65535)); $308 = $307 / 2.0; $309 = $c3; $310 = ((($309)) + 16|0); $311 = $4; $312 = ((($311)) + 12|0); $313 = HEAP32[$312>>2]|0; ;HEAP32[$$byval_copy26>>2]=HEAP32[$16>>2]|0;HEAP32[$$byval_copy26+4>>2]=HEAP32[$16+4>>2]|0; ;HEAP8[$$byval_copy27>>0]=HEAP8[$310>>0]|0;HEAP8[$$byval_copy27+1>>0]=HEAP8[$310+1>>0]|0;HEAP8[$$byval_copy27+2>>0]=HEAP8[$310+2>>0]|0;HEAP8[$$byval_copy27+3>>0]=HEAP8[$310+3>>0]|0; _nk_draw_list_fill_circle($283,$$byval_copy26,$308,$$byval_copy27,$313); break; } case 9: { $314 = $cmd; $c4 = $314; $315 = $0; $316 = ((($315)) + 5672|0); $317 = $c4; $318 = ((($317)) + 8|0); $319 = HEAP16[$318>>1]|0; $320 = (+($319<<16>>16)); $321 = $c4; $322 = ((($321)) + 10|0); $323 = HEAP16[$322>>1]|0; $324 = (+($323<<16>>16)); _nk_vec2($17,$320,$324); ;HEAP32[$$byval_copy28>>2]=HEAP32[$17>>2]|0;HEAP32[$$byval_copy28+4>>2]=HEAP32[$17+4>>2]|0; _nk_draw_list_path_line_to($316,$$byval_copy28); $325 = $0; $326 = ((($325)) + 5672|0); $327 = $c4; $328 = ((($327)) + 8|0); $329 = HEAP16[$328>>1]|0; $330 = (+($329<<16>>16)); $331 = $c4; $332 = ((($331)) + 10|0); $333 = HEAP16[$332>>1]|0; $334 = (+($333<<16>>16)); _nk_vec2($18,$330,$334); $335 = $c4; $336 = ((($335)) + 12|0); $337 = HEAP16[$336>>1]|0; $338 = (+($337&65535)); $339 = $c4; $340 = ((($339)) + 16|0); $341 = +HEAPF32[$340>>2]; $342 = $c4; $343 = ((($342)) + 16|0); $344 = ((($343)) + 4|0); $345 = +HEAPF32[$344>>2]; $346 = $4; $347 = ((($346)) + 16|0); $348 = HEAP32[$347>>2]|0; ;HEAP32[$$byval_copy29>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$18+4>>2]|0; _nk_draw_list_path_arc_to($326,$$byval_copy29,$338,$341,$345,$348); $349 = $0; $350 = ((($349)) + 5672|0); $351 = $c4; $352 = ((($351)) + 24|0); $353 = $c4; $354 = ((($353)) + 14|0); $355 = HEAP16[$354>>1]|0; $356 = (+($355&65535)); ;HEAP8[$$byval_copy30>>0]=HEAP8[$352>>0]|0;HEAP8[$$byval_copy30+1>>0]=HEAP8[$352+1>>0]|0;HEAP8[$$byval_copy30+2>>0]=HEAP8[$352+2>>0]|0;HEAP8[$$byval_copy30+3>>0]=HEAP8[$352+3>>0]|0; _nk_draw_list_path_stroke($350,$$byval_copy30,1,$356); break; } case 10: { $357 = $cmd; $c5 = $357; $358 = $0; $359 = ((($358)) + 5672|0); $360 = $c5; $361 = ((($360)) + 8|0); $362 = HEAP16[$361>>1]|0; $363 = (+($362<<16>>16)); $364 = $c5; $365 = ((($364)) + 10|0); $366 = HEAP16[$365>>1]|0; $367 = (+($366<<16>>16)); _nk_vec2($19,$363,$367); ;HEAP32[$$byval_copy31>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy31+4>>2]=HEAP32[$19+4>>2]|0; _nk_draw_list_path_line_to($359,$$byval_copy31); $368 = $0; $369 = ((($368)) + 5672|0); $370 = $c5; $371 = ((($370)) + 8|0); $372 = HEAP16[$371>>1]|0; $373 = (+($372<<16>>16)); $374 = $c5; $375 = ((($374)) + 10|0); $376 = HEAP16[$375>>1]|0; $377 = (+($376<<16>>16)); _nk_vec2($20,$373,$377); $378 = $c5; $379 = ((($378)) + 12|0); $380 = HEAP16[$379>>1]|0; $381 = (+($380&65535)); $382 = $c5; $383 = ((($382)) + 16|0); $384 = +HEAPF32[$383>>2]; $385 = $c5; $386 = ((($385)) + 16|0); $387 = ((($386)) + 4|0); $388 = +HEAPF32[$387>>2]; $389 = $4; $390 = ((($389)) + 16|0); $391 = HEAP32[$390>>2]|0; ;HEAP32[$$byval_copy32>>2]=HEAP32[$20>>2]|0;HEAP32[$$byval_copy32+4>>2]=HEAP32[$20+4>>2]|0; _nk_draw_list_path_arc_to($369,$$byval_copy32,$381,$384,$388,$391); $392 = $0; $393 = ((($392)) + 5672|0); $394 = $c5; $395 = ((($394)) + 24|0); ;HEAP8[$$byval_copy33>>0]=HEAP8[$395>>0]|0;HEAP8[$$byval_copy33+1>>0]=HEAP8[$395+1>>0]|0;HEAP8[$$byval_copy33+2>>0]=HEAP8[$395+2>>0]|0;HEAP8[$$byval_copy33+3>>0]=HEAP8[$395+3>>0]|0; _nk_draw_list_path_fill($393,$$byval_copy33); break; } case 11: { $396 = $cmd; $t = $396; $397 = $0; $398 = ((($397)) + 5672|0); $399 = $t; $400 = ((($399)) + 10|0); $401 = HEAP16[$400>>1]|0; $402 = (+($401<<16>>16)); $403 = $t; $404 = ((($403)) + 10|0); $405 = ((($404)) + 2|0); $406 = HEAP16[$405>>1]|0; $407 = (+($406<<16>>16)); _nk_vec2($21,$402,$407); $408 = $t; $409 = ((($408)) + 14|0); $410 = HEAP16[$409>>1]|0; $411 = (+($410<<16>>16)); $412 = $t; $413 = ((($412)) + 14|0); $414 = ((($413)) + 2|0); $415 = HEAP16[$414>>1]|0; $416 = (+($415<<16>>16)); _nk_vec2($22,$411,$416); $417 = $t; $418 = ((($417)) + 18|0); $419 = HEAP16[$418>>1]|0; $420 = (+($419<<16>>16)); $421 = $t; $422 = ((($421)) + 18|0); $423 = ((($422)) + 2|0); $424 = HEAP16[$423>>1]|0; $425 = (+($424<<16>>16)); _nk_vec2($23,$420,$425); $426 = $t; $427 = ((($426)) + 22|0); $428 = $t; $429 = ((($428)) + 8|0); $430 = HEAP16[$429>>1]|0; $431 = (+($430&65535)); ;HEAP32[$$byval_copy34>>2]=HEAP32[$21>>2]|0;HEAP32[$$byval_copy34+4>>2]=HEAP32[$21+4>>2]|0; ;HEAP32[$$byval_copy35>>2]=HEAP32[$22>>2]|0;HEAP32[$$byval_copy35+4>>2]=HEAP32[$22+4>>2]|0; ;HEAP32[$$byval_copy36>>2]=HEAP32[$23>>2]|0;HEAP32[$$byval_copy36+4>>2]=HEAP32[$23+4>>2]|0; ;HEAP8[$$byval_copy37>>0]=HEAP8[$427>>0]|0;HEAP8[$$byval_copy37+1>>0]=HEAP8[$427+1>>0]|0;HEAP8[$$byval_copy37+2>>0]=HEAP8[$427+2>>0]|0;HEAP8[$$byval_copy37+3>>0]=HEAP8[$427+3>>0]|0; _nk_draw_list_stroke_triangle($398,$$byval_copy34,$$byval_copy35,$$byval_copy36,$$byval_copy37,$431); break; } case 12: { $432 = $cmd; $t6 = $432; $433 = $0; $434 = ((($433)) + 5672|0); $435 = $t6; $436 = ((($435)) + 8|0); $437 = HEAP16[$436>>1]|0; $438 = (+($437<<16>>16)); $439 = $t6; $440 = ((($439)) + 8|0); $441 = ((($440)) + 2|0); $442 = HEAP16[$441>>1]|0; $443 = (+($442<<16>>16)); _nk_vec2($24,$438,$443); $444 = $t6; $445 = ((($444)) + 12|0); $446 = HEAP16[$445>>1]|0; $447 = (+($446<<16>>16)); $448 = $t6; $449 = ((($448)) + 12|0); $450 = ((($449)) + 2|0); $451 = HEAP16[$450>>1]|0; $452 = (+($451<<16>>16)); _nk_vec2($25,$447,$452); $453 = $t6; $454 = ((($453)) + 16|0); $455 = HEAP16[$454>>1]|0; $456 = (+($455<<16>>16)); $457 = $t6; $458 = ((($457)) + 16|0); $459 = ((($458)) + 2|0); $460 = HEAP16[$459>>1]|0; $461 = (+($460<<16>>16)); _nk_vec2($26,$456,$461); $462 = $t6; $463 = ((($462)) + 20|0); ;HEAP32[$$byval_copy38>>2]=HEAP32[$24>>2]|0;HEAP32[$$byval_copy38+4>>2]=HEAP32[$24+4>>2]|0; ;HEAP32[$$byval_copy39>>2]=HEAP32[$25>>2]|0;HEAP32[$$byval_copy39+4>>2]=HEAP32[$25+4>>2]|0; ;HEAP32[$$byval_copy40>>2]=HEAP32[$26>>2]|0;HEAP32[$$byval_copy40+4>>2]=HEAP32[$26+4>>2]|0; ;HEAP8[$$byval_copy41>>0]=HEAP8[$463>>0]|0;HEAP8[$$byval_copy41+1>>0]=HEAP8[$463+1>>0]|0;HEAP8[$$byval_copy41+2>>0]=HEAP8[$463+2>>0]|0;HEAP8[$$byval_copy41+3>>0]=HEAP8[$463+3>>0]|0; _nk_draw_list_fill_triangle($434,$$byval_copy38,$$byval_copy39,$$byval_copy40,$$byval_copy41); break; } case 13: { $464 = $cmd; $p = $464; $i = 0; while(1) { $465 = $i; $466 = $p; $467 = ((($466)) + 14|0); $468 = HEAP16[$467>>1]|0; $469 = $468&65535; $470 = ($465|0)<($469|0); if (!($470)) { break; } $471 = $i; $472 = $p; $473 = ((($472)) + 16|0); $474 = (($473) + ($471<<2)|0); $475 = HEAP16[$474>>1]|0; $476 = (+($475<<16>>16)); $477 = $i; $478 = $p; $479 = ((($478)) + 16|0); $480 = (($479) + ($477<<2)|0); $481 = ((($480)) + 2|0); $482 = HEAP16[$481>>1]|0; $483 = (+($482<<16>>16)); _nk_vec2($pnt,$476,$483); $484 = $0; $485 = ((($484)) + 5672|0); ;HEAP32[$pnt$byval_copy>>2]=HEAP32[$pnt>>2]|0;HEAP32[$pnt$byval_copy+4>>2]=HEAP32[$pnt+4>>2]|0; _nk_draw_list_path_line_to($485,$pnt$byval_copy); $486 = $i; $487 = (($486) + 1)|0; $i = $487; } $488 = $0; $489 = ((($488)) + 5672|0); $490 = $p; $491 = ((($490)) + 8|0); $492 = $p; $493 = ((($492)) + 12|0); $494 = HEAP16[$493>>1]|0; $495 = (+($494&65535)); ;HEAP8[$$byval_copy42>>0]=HEAP8[$491>>0]|0;HEAP8[$$byval_copy42+1>>0]=HEAP8[$491+1>>0]|0;HEAP8[$$byval_copy42+2>>0]=HEAP8[$491+2>>0]|0;HEAP8[$$byval_copy42+3>>0]=HEAP8[$491+3>>0]|0; _nk_draw_list_path_stroke($489,$$byval_copy42,1,$495); break; } case 14: { $496 = $cmd; $p8 = $496; $i7 = 0; while(1) { $497 = $i7; $498 = $p8; $499 = ((($498)) + 12|0); $500 = HEAP16[$499>>1]|0; $501 = $500&65535; $502 = ($497|0)<($501|0); if (!($502)) { break; } $503 = $i7; $504 = $p8; $505 = ((($504)) + 14|0); $506 = (($505) + ($503<<2)|0); $507 = HEAP16[$506>>1]|0; $508 = (+($507<<16>>16)); $509 = $i7; $510 = $p8; $511 = ((($510)) + 14|0); $512 = (($511) + ($509<<2)|0); $513 = ((($512)) + 2|0); $514 = HEAP16[$513>>1]|0; $515 = (+($514<<16>>16)); _nk_vec2($pnt9,$508,$515); $516 = $0; $517 = ((($516)) + 5672|0); ;HEAP32[$pnt9$byval_copy>>2]=HEAP32[$pnt9>>2]|0;HEAP32[$pnt9$byval_copy+4>>2]=HEAP32[$pnt9+4>>2]|0; _nk_draw_list_path_line_to($517,$pnt9$byval_copy); $518 = $i7; $519 = (($518) + 1)|0; $i7 = $519; } $520 = $0; $521 = ((($520)) + 5672|0); $522 = $p8; $523 = ((($522)) + 8|0); ;HEAP8[$$byval_copy43>>0]=HEAP8[$523>>0]|0;HEAP8[$$byval_copy43+1>>0]=HEAP8[$523+1>>0]|0;HEAP8[$$byval_copy43+2>>0]=HEAP8[$523+2>>0]|0;HEAP8[$$byval_copy43+3>>0]=HEAP8[$523+3>>0]|0; _nk_draw_list_path_fill($521,$$byval_copy43); break; } case 15: { $524 = $cmd; $p11 = $524; $i10 = 0; while(1) { $525 = $i10; $526 = $p11; $527 = ((($526)) + 14|0); $528 = HEAP16[$527>>1]|0; $529 = $528&65535; $530 = ($525|0)<($529|0); if (!($530)) { break; } $531 = $i10; $532 = $p11; $533 = ((($532)) + 16|0); $534 = (($533) + ($531<<2)|0); $535 = HEAP16[$534>>1]|0; $536 = (+($535<<16>>16)); $537 = $i10; $538 = $p11; $539 = ((($538)) + 16|0); $540 = (($539) + ($537<<2)|0); $541 = ((($540)) + 2|0); $542 = HEAP16[$541>>1]|0; $543 = (+($542<<16>>16)); _nk_vec2($pnt12,$536,$543); $544 = $0; $545 = ((($544)) + 5672|0); ;HEAP32[$pnt12$byval_copy>>2]=HEAP32[$pnt12>>2]|0;HEAP32[$pnt12$byval_copy+4>>2]=HEAP32[$pnt12+4>>2]|0; _nk_draw_list_path_line_to($545,$pnt12$byval_copy); $546 = $i10; $547 = (($546) + 1)|0; $i10 = $547; } $548 = $0; $549 = ((($548)) + 5672|0); $550 = $p11; $551 = ((($550)) + 8|0); $552 = $p11; $553 = ((($552)) + 12|0); $554 = HEAP16[$553>>1]|0; $555 = (+($554&65535)); ;HEAP8[$$byval_copy44>>0]=HEAP8[$551>>0]|0;HEAP8[$$byval_copy44+1>>0]=HEAP8[$551+1>>0]|0;HEAP8[$$byval_copy44+2>>0]=HEAP8[$551+2>>0]|0;HEAP8[$$byval_copy44+3>>0]=HEAP8[$551+3>>0]|0; _nk_draw_list_path_stroke($549,$$byval_copy44,0,$555); break; } case 16: { $556 = $cmd; $t13 = $556; $557 = $0; $558 = ((($557)) + 5672|0); $559 = $t13; $560 = ((($559)) + 8|0); $561 = HEAP32[$560>>2]|0; $562 = $t13; $563 = ((($562)) + 20|0); $564 = HEAP16[$563>>1]|0; $565 = (+($564<<16>>16)); $566 = $t13; $567 = ((($566)) + 22|0); $568 = HEAP16[$567>>1]|0; $569 = (+($568<<16>>16)); $570 = $t13; $571 = ((($570)) + 24|0); $572 = HEAP16[$571>>1]|0; $573 = (+($572&65535)); $574 = $t13; $575 = ((($574)) + 26|0); $576 = HEAP16[$575>>1]|0; $577 = (+($576&65535)); _nk_rect($27,$565,$569,$573,$577); $578 = $t13; $579 = ((($578)) + 36|0); $580 = $t13; $581 = ((($580)) + 32|0); $582 = HEAP32[$581>>2]|0; $583 = $t13; $584 = ((($583)) + 28|0); $585 = +HEAPF32[$584>>2]; $586 = $t13; $587 = ((($586)) + 16|0); ;HEAP32[$$byval_copy45>>2]=HEAP32[$27>>2]|0;HEAP32[$$byval_copy45+4>>2]=HEAP32[$27+4>>2]|0;HEAP32[$$byval_copy45+8>>2]=HEAP32[$27+8>>2]|0;HEAP32[$$byval_copy45+12>>2]=HEAP32[$27+12>>2]|0; ;HEAP8[$$byval_copy46>>0]=HEAP8[$587>>0]|0;HEAP8[$$byval_copy46+1>>0]=HEAP8[$587+1>>0]|0;HEAP8[$$byval_copy46+2>>0]=HEAP8[$587+2>>0]|0;HEAP8[$$byval_copy46+3>>0]=HEAP8[$587+3>>0]|0; _nk_draw_list_add_text($558,$561,$$byval_copy45,$579,$582,$585,$$byval_copy46); break; } default: { } } } while(0); $609 = $0; $610 = $cmd; $611 = (_nk__next($609,$610)|0); $cmd = $611; } STACKTOP = sp;return; } function _nk__begin($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $buffer = 0, $iter = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $ctx; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14686,(28280|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { $0 = 0; $50 = $0; STACKTOP = sp;return ($50|0); } $6 = $1; $7 = ((($6)) + 11176|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); if (!($9)) { $0 = 0; $50 = $0; STACKTOP = sp;return ($50|0); } $10 = $1; $11 = ((($10)) + 5596|0); $12 = ((($11)) + 32|0); $13 = HEAP32[$12>>2]|0; $buffer = $13; $14 = $1; $15 = ((($14)) + 11148|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)!=(0); if (!($17)) { $18 = $1; _nk_build($18); $19 = $1; $20 = ((($19)) + 11148|0); HEAP32[$20>>2] = 1; } $21 = $1; $22 = ((($21)) + 11156|0); $23 = HEAP32[$22>>2]|0; $iter = $23; while(1) { $24 = $iter; $25 = ($24|0)!=(0|0); if ($25) { $26 = $iter; $27 = ((($26)) + 32|0); $28 = ((($27)) + 28|0); $29 = HEAP32[$28>>2]|0; $30 = $iter; $31 = ((($30)) + 32|0); $32 = ((($31)) + 32|0); $33 = HEAP32[$32>>2]|0; $34 = ($29|0)==($33|0); if ($34) { $51 = 1; } else { $35 = $iter; $36 = ((($35)) + 8|0); $37 = HEAP32[$36>>2]|0; $38 = $37 & 2048; $39 = ($38|0)!=(0); $51 = $39; } } else { $51 = 0; } $40 = $iter; if (!($51)) { break; } $41 = ((($40)) + 264|0); $42 = HEAP32[$41>>2]|0; $iter = $42; } $43 = ($40|0)!=(0|0); if ($43) { $44 = $buffer; $45 = $iter; $46 = ((($45)) + 32|0); $47 = ((($46)) + 28|0); $48 = HEAP32[$47>>2]|0; $49 = (($44) + ($48)|0); $0 = $49; $50 = $0; STACKTOP = sp;return ($50|0); } else { $0 = 0; $50 = $0; STACKTOP = sp;return ($50|0); } return (0)|0; } function _nk__next($ctx,$cmd) { $ctx = $ctx|0; $cmd = $cmd|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $buffer = 0, $next = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $ctx; $2 = $cmd; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14913|0),(13400|0),14709,(28290|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); $7 = $2; $8 = ($7|0)!=(0|0); $or$cond = $6 & $8; if ($or$cond) { $9 = $1; $10 = ((($9)) + 11176|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0); if ($12) { $13 = $2; $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = $1; $17 = ((($16)) + 5596|0); $18 = ((($17)) + 44|0); $19 = HEAP32[$18>>2]|0; $20 = ($15>>>0)>=($19>>>0); if ($20) { $0 = 0; $31 = $0; STACKTOP = sp;return ($31|0); } else { $21 = $1; $22 = ((($21)) + 5596|0); $23 = ((($22)) + 32|0); $24 = HEAP32[$23>>2]|0; $buffer = $24; $25 = $buffer; $26 = $2; $27 = ((($26)) + 4|0); $28 = HEAP32[$27>>2]|0; $29 = (($25) + ($28)|0); $next = $29; $30 = $next; $0 = $30; $31 = $0; STACKTOP = sp;return ($31|0); } } } $0 = 0; $31 = $0; STACKTOP = sp;return ($31|0); } function _nk__draw_begin($ctx,$buffer) { $ctx = $ctx|0; $buffer = $buffer|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $buffer; $2 = $0; $3 = ((($2)) + 5672|0); $4 = $1; $5 = (_nk__draw_list_begin($3,$4)|0); STACKTOP = sp;return ($5|0); } function _nk__draw_next($cmd,$buffer,$ctx) { $cmd = $cmd|0; $buffer = $buffer|0; $ctx = $ctx|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $cmd; $1 = $buffer; $2 = $ctx; $3 = $0; $4 = $1; $5 = $2; $6 = ((($5)) + 5672|0); $7 = (_nk__draw_list_next($3,$4,$6)|0); STACKTOP = sp;return ($7|0); } function _nk_font_default_glyph_ranges() { var label = 0, sp = 0; sp = STACKTOP; return (24|0); } function _nk_font_bake_memory($temp,$glyph_count,$config,$count) { $temp = $temp|0; $glyph_count = $glyph_count|0; $config = $config|0; $count = $count|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $i = 0, $range_count = 0, $total_range_count = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $temp; $1 = $glyph_count; $2 = $config; $3 = $count; $range_count = 0; $total_range_count = 0; $4 = $2; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14951|0),(13400|0),8781,(14958|0)); // unreachable; } $6 = $1; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((14978|0),(13400|0),8782,(14958|0)); // unreachable; } $8 = $2; $9 = ($8|0)!=(0|0); if (!($9)) { $10 = $0; HEAP32[$10>>2] = 0; $11 = $1; HEAP32[$11>>2] = 0; STACKTOP = sp;return; } $12 = $1; HEAP32[$12>>2] = 0; $13 = $2; $14 = ((($13)) + 32|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { $17 = (_nk_font_default_glyph_ranges()|0); $18 = $2; $19 = ((($18)) + 32|0); HEAP32[$19>>2] = $17; } $i = 0; while(1) { $20 = $i; $21 = $3; $22 = ($20|0)<($21|0); if (!($22)) { break; } $23 = $i; $24 = $2; $25 = (($24) + (($23*44)|0)|0); $26 = ((($25)) + 32|0); $27 = HEAP32[$26>>2]|0; $28 = (_nk_range_count($27)|0); $range_count = $28; $29 = $range_count; $30 = $total_range_count; $31 = (($30) + ($29))|0; $total_range_count = $31; $32 = $i; $33 = $2; $34 = (($33) + (($32*44)|0)|0); $35 = ((($34)) + 32|0); $36 = HEAP32[$35>>2]|0; $37 = $range_count; $38 = (_nk_range_glyph_count($36,$37)|0); $39 = $1; $40 = HEAP32[$39>>2]|0; $41 = (($40) + ($38))|0; HEAP32[$39>>2] = $41; $42 = $i; $43 = (($42) + 1)|0; $i = $43; } $44 = $1; $45 = HEAP32[$44>>2]|0; $46 = $45<<4; $47 = $0; HEAP32[$47>>2] = $46; $48 = $total_range_count; $49 = ($48*24)|0; $50 = $0; $51 = HEAP32[$50>>2]|0; $52 = (($51) + ($49))|0; HEAP32[$50>>2] = $52; $53 = $1; $54 = HEAP32[$53>>2]|0; $55 = ($54*28)|0; $56 = $0; $57 = HEAP32[$56>>2]|0; $58 = (($57) + ($55))|0; HEAP32[$56>>2] = $58; $59 = $3; $60 = ($59*56)|0; $61 = $0; $62 = HEAP32[$61>>2]|0; $63 = (($62) + ($60))|0; HEAP32[$61>>2] = $63; $64 = $0; $65 = HEAP32[$64>>2]|0; $66 = (($65) + 64)|0; HEAP32[$64>>2] = $66; $67 = $0; $68 = HEAP32[$67>>2]|0; $69 = (($68) + 12)|0; HEAP32[$67>>2] = $69; $70 = $0; $71 = HEAP32[$70>>2]|0; $72 = (($71) + 8)|0; HEAP32[$70>>2] = $72; STACKTOP = sp;return; } function _nk_range_count($range) { $range = $range|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $iter = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $range; $2 = $1; $iter = $2; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((30115|0),(13400|0),8706,(30121|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { $0 = 0; $22 = $0; STACKTOP = sp;return ($22|0); } while(1) { $7 = $iter; $8 = ((($7)) + 4|0); $iter = $8; $9 = HEAP32[$7>>2]|0; $10 = ($9|0)!=(0); if (!($10)) { break; } } $11 = $iter; $12 = $1; $13 = ($11|0)==($12|0); if ($13) { $21 = 0; } else { $14 = $iter; $15 = $1; $16 = $14; $17 = $15; $18 = (($16) - ($17))|0; $19 = (($18|0) / 4)&-1; $20 = (($19|0) / 2)&-1; $21 = $20; } $0 = $21; $22 = $0; STACKTOP = sp;return ($22|0); } function _nk_range_glyph_count($range,$count) { $range = $range|0; $count = $count|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $diff = 0, $f = 0, $i = 0, $t = 0, $total_glyphs = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $range; $1 = $count; $i = 0; $total_glyphs = 0; $i = 0; while(1) { $2 = $i; $3 = $1; $4 = ($2|0)<($3|0); if (!($4)) { label = 6; break; } $5 = $i; $6 = $5<<1; $7 = (($6) + 0)|0; $8 = $0; $9 = (($8) + ($7<<2)|0); $10 = HEAP32[$9>>2]|0; $f = $10; $11 = $i; $12 = $11<<1; $13 = (($12) + 1)|0; $14 = $0; $15 = (($14) + ($13<<2)|0); $16 = HEAP32[$15>>2]|0; $t = $16; $17 = $t; $18 = $f; $19 = ($17>>>0)>=($18>>>0); if (!($19)) { label = 4; break; } $20 = $t; $21 = $f; $22 = (($20) - ($21))|0; $23 = (($22) + 1)|0; $diff = $23; $24 = $diff; $25 = $total_glyphs; $26 = (($25) + ($24))|0; $total_glyphs = $26; $27 = $i; $28 = (($27) + 1)|0; $i = $28; } if ((label|0) == 4) { ___assert_fail((30136|0),(13400|0),8721,(30143|0)); // unreachable; } else if ((label|0) == 6) { $29 = $total_glyphs; STACKTOP = sp;return ($29|0); } return (0)|0; } function _nk_font_bake_pack($image_memory,$width,$height,$custom,$temp,$temp_size,$config,$count,$alloc) { $image_memory = $image_memory|0; $width = $width|0; $height = $height|0; $custom = $custom|0; $temp = $temp|0; $temp_size = $temp_size|0; $config = $config|0; $count = $count|0; $alloc = $alloc|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0.0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0; var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0; var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0; var $baker = 0, $cfg = 0, $cfg1 = 0, $char_n = 0, $custom_space = 0, $glyph_count = 0, $i = 0, $in_range = 0, $input_i = 0, $n = 0, $or$cond = 0, $or$cond11 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $range_count = 0, $range_n = 0, $rect_n = 0, $tmp = 0; var $total_glyph_count = 0, $total_range_count = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $custom_space = sp + 24|0; $1 = $image_memory; $2 = $width; $3 = $height; $4 = $custom; $5 = $temp; $6 = $temp_size; $7 = $config; $8 = $count; $9 = $alloc; $total_glyph_count = 0; $total_range_count = 0; $range_count = 0; $i = 0; $10 = $1; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((14990|0),(13400|0),8835,(15003|0)); // unreachable; } $12 = $2; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((15021|0),(13400|0),8836,(15003|0)); // unreachable; } $14 = $3; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((15027|0),(13400|0),8837,(15003|0)); // unreachable; } $16 = $7; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((14951|0),(13400|0),8838,(15003|0)); // unreachable; } $18 = $5; $19 = ($18|0)!=(0|0); if (!($19)) { ___assert_fail((15034|0),(13400|0),8839,(15003|0)); // unreachable; } $20 = $6; $21 = ($20|0)!=(0); if (!($21)) { ___assert_fail((15039|0),(13400|0),8840,(15003|0)); // unreachable; } $22 = $8; $23 = ($22|0)!=(0); if (!($23)) { ___assert_fail((15049|0),(13400|0),8841,(15003|0)); // unreachable; } $24 = $9; $25 = ($24|0)!=(0|0); if (!($25)) { ___assert_fail((15055|0),(13400|0),8842,(15003|0)); // unreachable; } $26 = $1; $27 = ($26|0)!=(0|0); $28 = $2; $29 = ($28|0)!=(0|0); $or$cond = $27 & $29; $30 = $3; $31 = ($30|0)!=(0|0); $or$cond3 = $or$cond & $31; $32 = $7; $33 = ($32|0)!=(0|0); $or$cond5 = $or$cond3 & $33; $34 = $5; $35 = ($34|0)!=(0|0); $or$cond7 = $or$cond5 & $35; $36 = $6; $37 = ($36|0)!=(0); $or$cond9 = $or$cond7 & $37; $38 = $8; $39 = ($38|0)!=(0); $or$cond11 = $or$cond9 & $39; if (!($or$cond11)) { $0 = 0; $379 = $0; STACKTOP = sp;return ($379|0); } $i = 0; while(1) { $40 = $i; $41 = $8; $42 = ($40|0)<($41|0); if (!($42)) { break; } $43 = $i; $44 = $7; $45 = (($44) + (($43*44)|0)|0); $46 = ((($45)) + 32|0); $47 = HEAP32[$46>>2]|0; $48 = (_nk_range_count($47)|0); $range_count = $48; $49 = $range_count; $50 = $total_range_count; $51 = (($50) + ($49))|0; $total_range_count = $51; $52 = $i; $53 = $7; $54 = (($53) + (($52*44)|0)|0); $55 = ((($54)) + 32|0); $56 = HEAP32[$55>>2]|0; $57 = $range_count; $58 = (_nk_range_glyph_count($56,$57)|0); $59 = $total_glyph_count; $60 = (($59) + ($58))|0; $total_glyph_count = $60; $61 = $i; $62 = (($61) + 1)|0; $i = $62; } $63 = $5; $64 = $6; _nk_zero($63,$64); $65 = $5; $66 = $total_glyph_count; $67 = $8; $68 = $9; $69 = (_nk_font_baker($65,$66,$67,$68)|0); $baker = $69; $70 = $baker; $71 = ($70|0)!=(0|0); if (!($71)) { $0 = 0; $379 = $0; STACKTOP = sp;return ($379|0); } $i = 0; while(1) { $72 = $i; $73 = $8; $74 = ($72|0)<($73|0); if (!($74)) { break; } $75 = $i; $76 = $7; $77 = (($76) + (($75*44)|0)|0); $cfg = $77; $78 = $i; $79 = $baker; $80 = ((($79)) + 48|0); $81 = HEAP32[$80>>2]|0; $82 = (($81) + (($78*56)|0)|0); $83 = $cfg; $84 = HEAP32[$83>>2]|0; $85 = (_nk_tt_InitFont($82,$84,0)|0); $86 = ($85|0)!=(0); if (!($86)) { label = 27; break; } $87 = $i; $88 = (($87) + 1)|0; $i = $88; } if ((label|0) == 27) { $0 = 0; $379 = $0; STACKTOP = sp;return ($379|0); } $89 = $3; HEAP32[$89>>2] = 0; $90 = $total_glyph_count; $91 = ($90|0)>(1000); $92 = $91 ? 1024 : 512; $93 = $2; HEAP32[$93>>2] = $92; $94 = $baker; $95 = ((($94)) + 12|0); $96 = $2; $97 = HEAP32[$96>>2]|0; $98 = $9; (_nk_tt_PackBegin($95,0,$97,32768,0,1,$98)|0); $input_i = 0; $range_n = 0; $rect_n = 0; $char_n = 0; $99 = $4; $100 = ($99|0)!=(0|0); if ($100) { _nk_zero($custom_space,16); $101 = $4; $102 = ((($101)) + 4|0); $103 = HEAP16[$102>>1]|0; $104 = $103 << 16 >> 16; $105 = $104<<1; $106 = (($105) + 1)|0; $107 = $106&65535; $108 = ((($custom_space)) + 4|0); HEAP16[$108>>1] = $107; $109 = $4; $110 = ((($109)) + 6|0); $111 = HEAP16[$110>>1]|0; $112 = $111 << 16 >> 16; $113 = (($112) + 1)|0; $114 = $113&65535; $115 = ((($custom_space)) + 6|0); HEAP16[$115>>1] = $114; $116 = $baker; $117 = ((($116)) + 12|0); _nk_tt_PackSetOversampling($117,1,1); $118 = $baker; $119 = ((($118)) + 12|0); $120 = HEAP32[$119>>2]|0; _nk_rp_pack_rects($120,$custom_space,1); $121 = $3; $122 = HEAP32[$121>>2]|0; $123 = ((($custom_space)) + 10|0); $124 = HEAP16[$123>>1]|0; $125 = $124&65535; $126 = ((($custom_space)) + 6|0); $127 = HEAP16[$126>>1]|0; $128 = $127&65535; $129 = (($125) + ($128))|0; $130 = ($122|0)<($129|0); if ($130) { $131 = ((($custom_space)) + 10|0); $132 = HEAP16[$131>>1]|0; $133 = $132&65535; $134 = ((($custom_space)) + 6|0); $135 = HEAP16[$134>>1]|0; $136 = $135&65535; $137 = (($133) + ($136))|0; $141 = $137; } else { $138 = $3; $139 = HEAP32[$138>>2]|0; $141 = $139; } $140 = $3; HEAP32[$140>>2] = $141; $142 = ((($custom_space)) + 8|0); $143 = HEAP16[$142>>1]|0; $144 = $4; HEAP16[$144>>1] = $143; $145 = ((($custom_space)) + 10|0); $146 = HEAP16[$145>>1]|0; $147 = $4; $148 = ((($147)) + 2|0); HEAP16[$148>>1] = $146; $149 = ((($custom_space)) + 4|0); $150 = HEAP16[$149>>1]|0; $151 = $4; $152 = ((($151)) + 4|0); HEAP16[$152>>1] = $150; $153 = ((($custom_space)) + 6|0); $154 = HEAP16[$153>>1]|0; $155 = $4; $156 = ((($155)) + 6|0); HEAP16[$156>>1] = $154; } $input_i = 0; while(1) { $157 = $input_i; $158 = $8; $159 = ($157|0)<($158|0); if (!($159)) { break; } $n = 0; $160 = $input_i; $161 = $7; $162 = (($161) + (($160*44)|0)|0); $cfg1 = $162; $163 = $input_i; $164 = $baker; $165 = ((($164)) + 48|0); $166 = HEAP32[$165>>2]|0; $167 = (($166) + (($163*56)|0)|0); $tmp = $167; $glyph_count = 0; $range_count = 0; $168 = $cfg1; $169 = ((($168)) + 32|0); $170 = HEAP32[$169>>2]|0; $in_range = $170; while(1) { $171 = $in_range; $172 = HEAP32[$171>>2]|0; $173 = ($172|0)!=(0); if (!($173)) { break; } $174 = $in_range; $175 = ((($174)) + 4|0); $176 = HEAP32[$175>>2]|0; $177 = ($176|0)!=(0); if (!($177)) { break; } $178 = $in_range; $179 = ((($178)) + 4|0); $180 = HEAP32[$179>>2]|0; $181 = $in_range; $182 = HEAP32[$181>>2]|0; $183 = (($180) - ($182))|0; $184 = (($183) + 1)|0; $185 = $glyph_count; $186 = (($185) + ($184))|0; $glyph_count = $186; $187 = $range_count; $188 = (($187) + 1)|0; $range_count = $188; $189 = $in_range; $190 = ((($189)) + 8|0); $in_range = $190; } $191 = $baker; $192 = ((($191)) + 60|0); $193 = HEAP32[$192>>2]|0; $194 = $range_n; $195 = (($193) + (($194*24)|0)|0); $196 = $tmp; $197 = ((($196)) + 48|0); HEAP32[$197>>2] = $195; $198 = $range_count; $199 = $tmp; $200 = ((($199)) + 52|0); HEAP32[$200>>2] = $198; $201 = $range_count; $202 = $range_n; $203 = (($202) + ($201))|0; $range_n = $203; $i = 0; while(1) { $204 = $i; $205 = $range_count; $206 = ($204|0)<($205|0); if (!($206)) { break; } $207 = $i; $208 = $207<<1; $209 = $cfg1; $210 = ((($209)) + 32|0); $211 = HEAP32[$210>>2]|0; $212 = (($211) + ($208<<2)|0); $in_range = $212; $213 = $cfg1; $214 = ((($213)) + 16|0); $215 = +HEAPF32[$214>>2]; $216 = $i; $217 = $tmp; $218 = ((($217)) + 48|0); $219 = HEAP32[$218>>2]|0; $220 = (($219) + (($216*24)|0)|0); HEAPF32[$220>>2] = $215; $221 = $in_range; $222 = HEAP32[$221>>2]|0; $223 = $i; $224 = $tmp; $225 = ((($224)) + 48|0); $226 = HEAP32[$225>>2]|0; $227 = (($226) + (($223*24)|0)|0); $228 = ((($227)) + 4|0); HEAP32[$228>>2] = $222; $229 = $in_range; $230 = ((($229)) + 4|0); $231 = HEAP32[$230>>2]|0; $232 = $in_range; $233 = HEAP32[$232>>2]|0; $234 = (($231) - ($233))|0; $235 = (($234) + 1)|0; $236 = $i; $237 = $tmp; $238 = ((($237)) + 48|0); $239 = HEAP32[$238>>2]|0; $240 = (($239) + (($236*24)|0)|0); $241 = ((($240)) + 12|0); HEAP32[$241>>2] = $235; $242 = $baker; $243 = ((($242)) + 52|0); $244 = HEAP32[$243>>2]|0; $245 = $char_n; $246 = (($244) + (($245*28)|0)|0); $247 = $i; $248 = $tmp; $249 = ((($248)) + 48|0); $250 = HEAP32[$249>>2]|0; $251 = (($250) + (($247*24)|0)|0); $252 = ((($251)) + 16|0); HEAP32[$252>>2] = $246; $253 = $i; $254 = $tmp; $255 = ((($254)) + 48|0); $256 = HEAP32[$255>>2]|0; $257 = (($256) + (($253*24)|0)|0); $258 = ((($257)) + 12|0); $259 = HEAP32[$258>>2]|0; $260 = $char_n; $261 = (($260) + ($259))|0; $char_n = $261; $262 = $i; $263 = (($262) + 1)|0; $i = $263; } $264 = $baker; $265 = ((($264)) + 56|0); $266 = HEAP32[$265>>2]|0; $267 = $rect_n; $268 = (($266) + ($267<<4)|0); $269 = $tmp; $270 = ((($269)) + 44|0); HEAP32[$270>>2] = $268; $271 = $glyph_count; $272 = $rect_n; $273 = (($272) + ($271))|0; $rect_n = $273; $274 = $baker; $275 = ((($274)) + 12|0); $276 = $cfg1; $277 = ((($276)) + 12|0); $278 = HEAP8[$277>>0]|0; $279 = $278&255; $280 = $cfg1; $281 = ((($280)) + 11|0); $282 = HEAP8[$281>>0]|0; $283 = $282&255; _nk_tt_PackSetOversampling($275,$279,$283); $284 = $baker; $285 = ((($284)) + 12|0); $286 = $tmp; $287 = $tmp; $288 = ((($287)) + 48|0); $289 = HEAP32[$288>>2]|0; $290 = $tmp; $291 = ((($290)) + 52|0); $292 = HEAP32[$291>>2]|0; $293 = $tmp; $294 = ((($293)) + 44|0); $295 = HEAP32[$294>>2]|0; $296 = (_nk_tt_PackFontRangesGatherRects($285,$286,$289,$292,$295)|0); $n = $296; $297 = $baker; $298 = ((($297)) + 12|0); $299 = HEAP32[$298>>2]|0; $300 = $tmp; $301 = ((($300)) + 44|0); $302 = HEAP32[$301>>2]|0; $303 = $n; _nk_rp_pack_rects($299,$302,$303); $i = 0; while(1) { $304 = $i; $305 = $n; $306 = ($304|0)<($305|0); if (!($306)) { break; } $307 = $i; $308 = $tmp; $309 = ((($308)) + 44|0); $310 = HEAP32[$309>>2]|0; $311 = (($310) + ($307<<4)|0); $312 = ((($311)) + 12|0); $313 = HEAP32[$312>>2]|0; $314 = ($313|0)!=(0); if ($314) { $315 = $3; $316 = HEAP32[$315>>2]|0; $317 = $i; $318 = $tmp; $319 = ((($318)) + 44|0); $320 = HEAP32[$319>>2]|0; $321 = (($320) + ($317<<4)|0); $322 = ((($321)) + 10|0); $323 = HEAP16[$322>>1]|0; $324 = $323&65535; $325 = $i; $326 = $tmp; $327 = ((($326)) + 44|0); $328 = HEAP32[$327>>2]|0; $329 = (($328) + ($325<<4)|0); $330 = ((($329)) + 6|0); $331 = HEAP16[$330>>1]|0; $332 = $331&65535; $333 = (($324) + ($332))|0; $334 = ($316|0)<($333|0); if ($334) { $335 = $i; $336 = $tmp; $337 = ((($336)) + 44|0); $338 = HEAP32[$337>>2]|0; $339 = (($338) + ($335<<4)|0); $340 = ((($339)) + 10|0); $341 = HEAP16[$340>>1]|0; $342 = $341&65535; $343 = $i; $344 = $tmp; $345 = ((($344)) + 44|0); $346 = HEAP32[$345>>2]|0; $347 = (($346) + ($343<<4)|0); $348 = ((($347)) + 6|0); $349 = HEAP16[$348>>1]|0; $350 = $349&65535; $351 = (($342) + ($350))|0; $355 = $351; } else { $352 = $3; $353 = HEAP32[$352>>2]|0; $355 = $353; } $354 = $3; HEAP32[$354>>2] = $355; } $356 = $i; $357 = (($356) + 1)|0; $i = $357; } $358 = $input_i; $359 = (($358) + 1)|0; $input_i = $359; } $360 = $rect_n; $361 = $total_glyph_count; $362 = ($360|0)==($361|0); if (!($362)) { ___assert_fail((15061|0),(13400|0),8930,(15003|0)); // unreachable; } $363 = $char_n; $364 = $total_glyph_count; $365 = ($363|0)==($364|0); if (!($365)) { ___assert_fail((15089|0),(13400|0),8931,(15003|0)); // unreachable; } $366 = $range_n; $367 = $total_range_count; $368 = ($366|0)==($367|0); if (!($368)) { ___assert_fail((15117|0),(13400|0),8932,(15003|0)); // unreachable; } $369 = $3; $370 = HEAP32[$369>>2]|0; $371 = (_nk_round_up_pow2($370)|0); $372 = $3; HEAP32[$372>>2] = $371; $373 = $2; $374 = HEAP32[$373>>2]|0; $375 = $3; $376 = HEAP32[$375>>2]|0; $377 = Math_imul($374, $376)|0; $378 = $1; HEAP32[$378>>2] = $377; $0 = 1; $379 = $0; STACKTOP = sp;return ($379|0); } function _nk_font_baker($memory,$glyph_count,$count,$alloc) { $memory = $memory|0; $glyph_count = $glyph_count|0; $count = $count|0; $alloc = $alloc|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $baker = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $memory; $2 = $glyph_count; $3 = $count; $4 = $alloc; $5 = $1; $6 = ($5|0)!=(0|0); if ($6) { $7 = $1; $8 = ((($7)) + 3|0); $9 = $8; $10 = $9 & -4; $11 = $10; $baker = $11; $12 = $baker; $13 = ((($12)) + 64|0); $14 = ((($13)) + 3|0); $15 = $14; $16 = $15 & -4; $17 = $16; $18 = $baker; $19 = ((($18)) + 48|0); HEAP32[$19>>2] = $17; $20 = $baker; $21 = ((($20)) + 48|0); $22 = HEAP32[$21>>2]|0; $23 = $3; $24 = (($22) + (($23*56)|0)|0); $25 = ((($24)) + 3|0); $26 = $25; $27 = $26 & -4; $28 = $27; $29 = $baker; $30 = ((($29)) + 52|0); HEAP32[$30>>2] = $28; $31 = $baker; $32 = ((($31)) + 52|0); $33 = HEAP32[$32>>2]|0; $34 = $2; $35 = (($33) + (($34*28)|0)|0); $36 = ((($35)) + 3|0); $37 = $36; $38 = $37 & -4; $39 = $38; $40 = $baker; $41 = ((($40)) + 56|0); HEAP32[$41>>2] = $39; $42 = $baker; $43 = ((($42)) + 56|0); $44 = HEAP32[$43>>2]|0; $45 = $2; $46 = (($44) + ($45<<4)|0); $47 = ((($46)) + 3|0); $48 = $47; $49 = $48 & -4; $50 = $49; $51 = $baker; $52 = ((($51)) + 60|0); HEAP32[$52>>2] = $50; $53 = $baker; $54 = $4; ;HEAP32[$53>>2]=HEAP32[$54>>2]|0;HEAP32[$53+4>>2]=HEAP32[$54+4>>2]|0;HEAP32[$53+8>>2]=HEAP32[$54+8>>2]|0; $55 = $baker; $0 = $55; $56 = $0; STACKTOP = sp;return ($56|0); } else { $0 = 0; $56 = $0; STACKTOP = sp;return ($56|0); } return (0)|0; } function _nk_tt_InitFont($info,$data2,$fontstart) { $info = $info|0; $data2 = $data2|0; $fontstart = $fontstart|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $cmap = 0, $data = 0, $encoding_record = 0, $i = 0, $numTables = 0, $t = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $info; $2 = $data2; $3 = $fontstart; $4 = $2; $data = $4; $5 = $data; $6 = $1; HEAP32[$6>>2] = $5; $7 = $3; $8 = $1; $9 = ((($8)) + 4|0); HEAP32[$9>>2] = $7; $10 = $data; $11 = $3; $12 = (_nk_tt__find_table($10,$11,30164)|0); $cmap = $12; $13 = $data; $14 = $3; $15 = (_nk_tt__find_table($13,$14,30169)|0); $16 = $1; $17 = ((($16)) + 12|0); HEAP32[$17>>2] = $15; $18 = $data; $19 = $3; $20 = (_nk_tt__find_table($18,$19,30174)|0); $21 = $1; $22 = ((($21)) + 16|0); HEAP32[$22>>2] = $20; $23 = $data; $24 = $3; $25 = (_nk_tt__find_table($23,$24,30179)|0); $26 = $1; $27 = ((($26)) + 20|0); HEAP32[$27>>2] = $25; $28 = $data; $29 = $3; $30 = (_nk_tt__find_table($28,$29,30184)|0); $31 = $1; $32 = ((($31)) + 24|0); HEAP32[$32>>2] = $30; $33 = $data; $34 = $3; $35 = (_nk_tt__find_table($33,$34,30189)|0); $36 = $1; $37 = ((($36)) + 28|0); HEAP32[$37>>2] = $35; $38 = $data; $39 = $3; $40 = (_nk_tt__find_table($38,$39,30194)|0); $41 = $1; $42 = ((($41)) + 32|0); HEAP32[$42>>2] = $40; $43 = $cmap; $44 = ($43|0)!=(0); if ($44) { $45 = $1; $46 = ((($45)) + 12|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)!=(0); if ($48) { $49 = $1; $50 = ((($49)) + 16|0); $51 = HEAP32[$50>>2]|0; $52 = ($51|0)!=(0); if ($52) { $53 = $1; $54 = ((($53)) + 20|0); $55 = HEAP32[$54>>2]|0; $56 = ($55|0)!=(0); if ($56) { $57 = $1; $58 = ((($57)) + 24|0); $59 = HEAP32[$58>>2]|0; $60 = ($59|0)!=(0); if ($60) { $61 = $1; $62 = ((($61)) + 28|0); $63 = HEAP32[$62>>2]|0; $64 = ($63|0)!=(0); if ($64) { $65 = $data; $66 = $3; $67 = (_nk_tt__find_table($65,$66,30199)|0); $t = $67; $68 = $t; $69 = ($68|0)!=(0); if ($69) { $70 = $data; $71 = $t; $72 = (($70) + ($71)|0); $73 = ((($72)) + 4|0); $74 = (_nk_ttUSHORT($73)|0); $75 = $74&65535; $76 = $1; $77 = ((($76)) + 8|0); HEAP32[$77>>2] = $75; } else { $78 = $1; $79 = ((($78)) + 8|0); HEAP32[$79>>2] = 65535; } $80 = $data; $81 = $cmap; $82 = (($80) + ($81)|0); $83 = ((($82)) + 2|0); $84 = (_nk_ttUSHORT($83)|0); $85 = $84&65535; $numTables = $85; $86 = $1; $87 = ((($86)) + 36|0); HEAP32[$87>>2] = 0; $i = 0; while(1) { $88 = $i; $89 = $numTables; $90 = ($88|0)<($89|0); if (!($90)) { break; } $91 = $cmap; $92 = (($91) + 4)|0; $93 = $i; $94 = $93<<3; $95 = (($92) + ($94))|0; $encoding_record = $95; $96 = $data; $97 = $encoding_record; $98 = (($96) + ($97)|0); $99 = (_nk_ttUSHORT($98)|0); $100 = $99&65535; L15: do { switch ($100|0) { case 3: { $101 = $data; $102 = $encoding_record; $103 = (($101) + ($102)|0); $104 = ((($103)) + 2|0); $105 = (_nk_ttUSHORT($104)|0); $106 = $105&65535; switch ($106|0) { case 10: case 1: { break; } default: { break L15; } } $107 = $cmap; $108 = $data; $109 = $encoding_record; $110 = (($108) + ($109)|0); $111 = ((($110)) + 4|0); $112 = (_nk_ttULONG($111)|0); $113 = (($107) + ($112))|0; $114 = $1; $115 = ((($114)) + 36|0); HEAP32[$115>>2] = $113; break; } case 0: { $116 = $cmap; $117 = $data; $118 = $encoding_record; $119 = (($117) + ($118)|0); $120 = ((($119)) + 4|0); $121 = (_nk_ttULONG($120)|0); $122 = (($116) + ($121))|0; $123 = $1; $124 = ((($123)) + 36|0); HEAP32[$124>>2] = $122; break; } default: { } } } while(0); $125 = $i; $126 = (($125) + 1)|0; $i = $126; } $127 = $1; $128 = ((($127)) + 36|0); $129 = HEAP32[$128>>2]|0; $130 = ($129|0)==(0); if ($130) { $0 = 0; $141 = $0; STACKTOP = sp;return ($141|0); } else { $131 = $data; $132 = $1; $133 = ((($132)) + 16|0); $134 = HEAP32[$133>>2]|0; $135 = (($131) + ($134)|0); $136 = ((($135)) + 50|0); $137 = (_nk_ttUSHORT($136)|0); $138 = $137&65535; $139 = $1; $140 = ((($139)) + 40|0); HEAP32[$140>>2] = $138; $0 = 1; $141 = $0; STACKTOP = sp;return ($141|0); } } } } } } } $0 = 0; $141 = $0; STACKTOP = sp;return ($141|0); } function _nk_tt_PackBegin($spc,$pixels,$pw,$ph,$stride_in_bytes,$padding,$alloc) { $spc = $spc|0; $pixels = $pixels|0; $pw = $pw|0; $ph = $ph|0; $stride_in_bytes = $stride_in_bytes|0; $padding = $padding|0; $alloc = $alloc|0; var $$byval_copy = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $9 = 0, $context = 0, $nodes = 0, $num_nodes = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy4 = sp + 56|0; $$byval_copy3 = sp + 52|0; $$byval_copy2 = sp + 48|0; $$byval_copy = sp + 44|0; $1 = $spc; $2 = $pixels; $3 = $pw; $4 = $ph; $5 = $stride_in_bytes; $6 = $padding; $7 = $alloc; $8 = $3; $9 = $6; $10 = (($8) - ($9))|0; $num_nodes = $10; $11 = $7; $12 = ((($11)) + 4|0); $13 = HEAP32[$12>>2]|0; $14 = $7; ;HEAP32[$$byval_copy>>2]=HEAP32[$14>>2]|0; $15 = (FUNCTION_TABLE_iiii[$13 & 7]($$byval_copy,0,48)|0); $context = $15; $16 = $7; $17 = ((($16)) + 4|0); $18 = HEAP32[$17>>2]|0; $19 = $7; $20 = $num_nodes; $21 = $20<<3; ;HEAP32[$$byval_copy2>>2]=HEAP32[$19>>2]|0; $22 = (FUNCTION_TABLE_iiii[$18 & 7]($$byval_copy2,0,$21)|0); $nodes = $22; $23 = $context; $24 = ($23|0)==(0|0); $25 = $nodes; $26 = ($25|0)==(0|0); $or$cond = $24 | $26; if (!($or$cond)) { $41 = $3; $42 = $1; $43 = ((($42)) + 4|0); HEAP32[$43>>2] = $41; $44 = $4; $45 = $1; $46 = ((($45)) + 8|0); HEAP32[$46>>2] = $44; $47 = $2; $48 = $1; $49 = ((($48)) + 28|0); HEAP32[$49>>2] = $47; $50 = $context; $51 = $1; HEAP32[$51>>2] = $50; $52 = $nodes; $53 = $1; $54 = ((($53)) + 32|0); HEAP32[$54>>2] = $52; $55 = $6; $56 = $1; $57 = ((($56)) + 16|0); HEAP32[$57>>2] = $55; $58 = $5; $59 = ($58|0)!=(0); $60 = $5; $61 = $3; $62 = $59 ? $60 : $61; $63 = $1; $64 = ((($63)) + 12|0); HEAP32[$64>>2] = $62; $65 = $1; $66 = ((($65)) + 20|0); HEAP32[$66>>2] = 1; $67 = $1; $68 = ((($67)) + 24|0); HEAP32[$68>>2] = 1; $69 = $context; $70 = $3; $71 = $6; $72 = (($70) - ($71))|0; $73 = $4; $74 = $6; $75 = (($73) - ($74))|0; $76 = $nodes; $77 = $num_nodes; _nk_rp_init_target($69,$72,$75,$76,$77); $78 = $2; $79 = ($78|0)!=(0|0); if ($79) { $80 = $2; $81 = $3; $82 = $4; $83 = Math_imul($81, $82)|0; _nk_memset($80,0,$83); } $0 = 1; $84 = $0; STACKTOP = sp;return ($84|0); } $27 = $context; $28 = ($27|0)!=(0|0); if ($28) { $29 = $7; $30 = ((($29)) + 8|0); $31 = HEAP32[$30>>2]|0; $32 = $7; $33 = $context; ;HEAP32[$$byval_copy3>>2]=HEAP32[$32>>2]|0; FUNCTION_TABLE_vii[$31 & 31]($$byval_copy3,$33); } $34 = $nodes; $35 = ($34|0)!=(0|0); if ($35) { $36 = $7; $37 = ((($36)) + 8|0); $38 = HEAP32[$37>>2]|0; $39 = $7; $40 = $nodes; ;HEAP32[$$byval_copy4>>2]=HEAP32[$39>>2]|0; FUNCTION_TABLE_vii[$38 & 31]($$byval_copy4,$40); } $0 = 0; $84 = $0; STACKTOP = sp;return ($84|0); } function _nk_tt_PackSetOversampling($spc,$h_oversample,$v_oversample) { $spc = $spc|0; $h_oversample = $h_oversample|0; $v_oversample = $v_oversample|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $spc; $1 = $h_oversample; $2 = $v_oversample; $3 = $1; $4 = ($3>>>0)<=(8); if (!($4)) { ___assert_fail((30258|0),(13400|0),8379,(30276|0)); // unreachable; } $5 = $2; $6 = ($5>>>0)<=(8); if (!($6)) { ___assert_fail((30302|0),(13400|0),8380,(30276|0)); // unreachable; } $7 = $1; $8 = ($7>>>0)<=(8); if ($8) { $9 = $1; $10 = $0; $11 = ((($10)) + 20|0); HEAP32[$11>>2] = $9; } $12 = $2; $13 = ($12>>>0)<=(8); if (!($13)) { STACKTOP = sp;return; } $14 = $2; $15 = $0; $16 = ((($15)) + 24|0); HEAP32[$16>>2] = $14; STACKTOP = sp;return; } function _nk_rp_pack_rects($context,$rects,$num_rects) { $context = $context|0; $rects = $rects|0; $num_rects = $num_rects|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $9 = 0, $fr = 0, $i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $fr = sp; $0 = $context; $1 = $rects; $2 = $num_rects; $i = 0; while(1) { $3 = $i; $4 = $2; $5 = ($3|0)<($4|0); if (!($5)) { break; } $6 = $i; $7 = $i; $8 = $1; $9 = (($8) + ($7<<4)|0); $10 = ((($9)) + 12|0); HEAP32[$10>>2] = $6; $11 = $i; $12 = (($11) + 1)|0; $i = $12; } $13 = $1; $14 = $2; _nk_rp_qsort($13,$14,9); $i = 0; while(1) { $15 = $i; $16 = $2; $17 = ($15|0)<($16|0); if (!($17)) { break; } $18 = $0; $19 = $i; $20 = $1; $21 = (($20) + ($19<<4)|0); $22 = ((($21)) + 4|0); $23 = HEAP16[$22>>1]|0; $24 = $23&65535; $25 = $i; $26 = $1; $27 = (($26) + ($25<<4)|0); $28 = ((($27)) + 6|0); $29 = HEAP16[$28>>1]|0; $30 = $29&65535; _nk_rp__skyline_pack_rectangle($fr,$18,$24,$30); $31 = ((($fr)) + 8|0); $32 = HEAP32[$31>>2]|0; $33 = ($32|0)!=(0|0); if ($33) { $34 = HEAP32[$fr>>2]|0; $35 = $34&65535; $36 = $i; $37 = $1; $38 = (($37) + ($36<<4)|0); $39 = ((($38)) + 8|0); HEAP16[$39>>1] = $35; $40 = ((($fr)) + 4|0); $41 = HEAP32[$40>>2]|0; $42 = $41&65535; $43 = $i; $44 = $1; $45 = (($44) + ($43<<4)|0); $46 = ((($45)) + 10|0); HEAP16[$46>>1] = $42; } else { $47 = $i; $48 = $1; $49 = (($48) + ($47<<4)|0); $50 = ((($49)) + 10|0); HEAP16[$50>>1] = -1; $51 = $i; $52 = $1; $53 = (($52) + ($51<<4)|0); $54 = ((($53)) + 8|0); HEAP16[$54>>1] = -1; } $55 = $i; $56 = (($55) + 1)|0; $i = $56; } $57 = $1; $58 = $2; _nk_rp_qsort($57,$58,10); $i = 0; while(1) { $59 = $i; $60 = $2; $61 = ($59|0)<($60|0); if (!($61)) { break; } $62 = $i; $63 = $1; $64 = (($63) + ($62<<4)|0); $65 = ((($64)) + 8|0); $66 = HEAP16[$65>>1]|0; $67 = $66&65535; $68 = ($67|0)==(65535); if ($68) { $69 = $i; $70 = $1; $71 = (($70) + ($69<<4)|0); $72 = ((($71)) + 10|0); $73 = HEAP16[$72>>1]|0; $74 = $73&65535; $75 = ($74|0)==(65535); $77 = $75; } else { $77 = 0; } $76 = $77 ^ 1; $78 = $76&1; $79 = $i; $80 = $1; $81 = (($80) + ($79<<4)|0); $82 = ((($81)) + 12|0); HEAP32[$82>>2] = $78; $83 = $i; $84 = (($83) + 1)|0; $i = $84; } STACKTOP = sp;return; } function _nk_tt_PackFontRangesGatherRects($spc,$info,$ranges,$num_ranges,$rects) { $spc = $spc|0; $info = $info|0; $ranges = $ranges|0; $num_ranges = $num_ranges|0; $rects = $rects|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $codepoint = 0, $fh = 0.0, $glyph = 0, $i = 0, $j = 0, $k = 0, $scale = 0.0, $x0 = 0, $x1 = 0, $y0 = 0, $y1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $x0 = sp + 20|0; $y0 = sp + 16|0; $x1 = sp + 12|0; $y1 = sp + 8|0; $0 = $spc; $1 = $info; $2 = $ranges; $3 = $num_ranges; $4 = $rects; $k = 0; $i = 0; while(1) { $5 = $i; $6 = $3; $7 = ($5|0)<($6|0); if (!($7)) { break; } $8 = $i; $9 = $2; $10 = (($9) + (($8*24)|0)|0); $11 = +HEAPF32[$10>>2]; $fh = $11; $12 = $fh; $13 = $12 > 0.0; $14 = $1; $15 = $fh; if ($13) { $16 = (+_nk_tt_ScaleForPixelHeight($14,$15)); $19 = $16; } else { $17 = -$15; $18 = (+_nk_tt_ScaleForMappingEmToPixels($14,$17)); $19 = $18; } $scale = $19; $20 = $0; $21 = ((($20)) + 20|0); $22 = HEAP32[$21>>2]|0; $23 = $22&255; $24 = $i; $25 = $2; $26 = (($25) + (($24*24)|0)|0); $27 = ((($26)) + 20|0); HEAP8[$27>>0] = $23; $28 = $0; $29 = ((($28)) + 24|0); $30 = HEAP32[$29>>2]|0; $31 = $30&255; $32 = $i; $33 = $2; $34 = (($33) + (($32*24)|0)|0); $35 = ((($34)) + 21|0); HEAP8[$35>>0] = $31; $j = 0; while(1) { $36 = $j; $37 = $i; $38 = $2; $39 = (($38) + (($37*24)|0)|0); $40 = ((($39)) + 12|0); $41 = HEAP32[$40>>2]|0; $42 = ($36|0)<($41|0); $43 = $i; if (!($42)) { break; } $44 = $2; $45 = (($44) + (($43*24)|0)|0); $46 = ((($45)) + 4|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)!=(0); if ($48) { $49 = $i; $50 = $2; $51 = (($50) + (($49*24)|0)|0); $52 = ((($51)) + 4|0); $53 = HEAP32[$52>>2]|0; $54 = $j; $55 = (($53) + ($54))|0; $64 = $55; } else { $56 = $j; $57 = $i; $58 = $2; $59 = (($58) + (($57*24)|0)|0); $60 = ((($59)) + 8|0); $61 = HEAP32[$60>>2]|0; $62 = (($61) + ($56<<2)|0); $63 = HEAP32[$62>>2]|0; $64 = $63; } $codepoint = $64; $65 = $1; $66 = $codepoint; $67 = (_nk_tt_FindGlyphIndex($65,$66)|0); $glyph = $67; $68 = $1; $69 = $glyph; $70 = $scale; $71 = $0; $72 = ((($71)) + 20|0); $73 = HEAP32[$72>>2]|0; $74 = (+($73>>>0)); $75 = $70 * $74; $76 = $scale; $77 = $0; $78 = ((($77)) + 24|0); $79 = HEAP32[$78>>2]|0; $80 = (+($79>>>0)); $81 = $76 * $80; _nk_tt_GetGlyphBitmapBoxSubpixel($68,$69,$75,$81,0.0,0.0,$x0,$y0,$x1,$y1); $82 = HEAP32[$x1>>2]|0; $83 = HEAP32[$x0>>2]|0; $84 = (($82) - ($83))|0; $85 = $0; $86 = ((($85)) + 16|0); $87 = HEAP32[$86>>2]|0; $88 = (($84) + ($87))|0; $89 = $0; $90 = ((($89)) + 20|0); $91 = HEAP32[$90>>2]|0; $92 = (($88) + ($91))|0; $93 = (($92) - 1)|0; $94 = $93&65535; $95 = $k; $96 = $4; $97 = (($96) + ($95<<4)|0); $98 = ((($97)) + 4|0); HEAP16[$98>>1] = $94; $99 = HEAP32[$y1>>2]|0; $100 = HEAP32[$y0>>2]|0; $101 = (($99) - ($100))|0; $102 = $0; $103 = ((($102)) + 16|0); $104 = HEAP32[$103>>2]|0; $105 = (($101) + ($104))|0; $106 = $0; $107 = ((($106)) + 24|0); $108 = HEAP32[$107>>2]|0; $109 = (($105) + ($108))|0; $110 = (($109) - 1)|0; $111 = $110&65535; $112 = $k; $113 = $4; $114 = (($113) + ($112<<4)|0); $115 = ((($114)) + 6|0); HEAP16[$115>>1] = $111; $116 = $k; $117 = (($116) + 1)|0; $k = $117; $118 = $j; $119 = (($118) + 1)|0; $j = $119; } $120 = (($43) + 1)|0; $i = $120; } $121 = $k; STACKTOP = sp;return ($121|0); } function _nk_round_up_pow2($v) { $v = $v|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $v; $1 = $0; $2 = (($1) + -1)|0; $0 = $2; $3 = $0; $4 = $3 >>> 1; $5 = $0; $6 = $5 | $4; $0 = $6; $7 = $0; $8 = $7 >>> 2; $9 = $0; $10 = $9 | $8; $0 = $10; $11 = $0; $12 = $11 >>> 4; $13 = $0; $14 = $13 | $12; $0 = $14; $15 = $0; $16 = $15 >>> 8; $17 = $0; $18 = $17 | $16; $0 = $18; $19 = $0; $20 = $19 >>> 16; $21 = $0; $22 = $21 | $20; $0 = $22; $23 = $0; $24 = (($23) + 1)|0; $0 = $24; $25 = $0; STACKTOP = sp;return ($25|0); } function _nk_font_bake($image_memory,$width,$height,$temp,$temp_size,$glyphs,$glyphs_count,$config,$font_count) { $image_memory = $image_memory|0; $width = $width|0; $height = $height|0; $temp = $temp|0; $temp_size = $temp_size|0; $glyphs = $glyphs|0; $glyphs_count = $glyphs_count|0; $config = $config|0; $font_count = $font_count|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0.0; var $134 = 0.0, $135 = 0.0, $136 = 0, $137 = 0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0.0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0.0, $213 = 0, $214 = 0, $215 = 0, $216 = 0.0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0.0, $222 = 0.0, $223 = 0; var $224 = 0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0, $230 = 0.0, $231 = 0, $232 = 0, $233 = 0.0, $234 = 0.0, $235 = 0, $236 = 0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0, $240 = 0.0, $241 = 0.0; var $242 = 0.0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0, $249 = 0, $25 = 0, $250 = 0.0, $251 = 0.0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0.0, $26 = 0; var $260 = 0, $261 = 0.0, $262 = 0.0, $263 = 0, $264 = 0, $265 = 0, $266 = 0.0, $267 = 0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0.0, $274 = 0, $275 = 0.0, $276 = 0.0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0, $280 = 0.0, $281 = 0, $282 = 0.0, $283 = 0.0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0.0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0.0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0.0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0.0, $303 = 0, $304 = 0, $305 = 0.0, $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0, $315 = 0.0, $316 = 0.0, $317 = 0, $318 = 0.0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0; var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0; var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0; var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $baker = 0, $cfg = 0, $cfg1 = 0, $char_idx = 0, $codepoint = 0; var $dst_font = 0, $dummy_x = 0, $dummy_y = 0, $font_scale = 0.0, $glyph = 0, $glyph_count = 0, $glyph_n = 0, $i = 0, $input_i = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $pc = 0, $q = 0, $range = 0; var $tmp = 0, $tmp2 = 0, $unscaled_ascent = 0, $unscaled_descent = 0, $unscaled_line_gap = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 160|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $unscaled_ascent = sp + 64|0; $unscaled_descent = sp + 60|0; $unscaled_line_gap = sp + 56|0; $dummy_x = sp + 44|0; $dummy_y = sp + 40|0; $q = sp + 8|0; $0 = $image_memory; $1 = $width; $2 = $height; $3 = $temp; $4 = $temp_size; $5 = $glyphs; $6 = $glyphs_count; $7 = $config; $8 = $font_count; $input_i = 0; $glyph_n = 0; $9 = $0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((14990|0),(13400|0),8948,(15146|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0); if (!($12)) { ___assert_fail((15021|0),(13400|0),8949,(15146|0)); // unreachable; } $13 = $2; $14 = ($13|0)!=(0); if (!($14)) { ___assert_fail((15027|0),(13400|0),8950,(15146|0)); // unreachable; } $15 = $7; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((14951|0),(13400|0),8951,(15146|0)); // unreachable; } $17 = $3; $18 = ($17|0)!=(0|0); if (!($18)) { ___assert_fail((15034|0),(13400|0),8952,(15146|0)); // unreachable; } $19 = $4; $20 = ($19|0)!=(0); if (!($20)) { ___assert_fail((15039|0),(13400|0),8953,(15146|0)); // unreachable; } $21 = $8; $22 = ($21|0)!=(0); if (!($22)) { ___assert_fail((15159|0),(13400|0),8954,(15146|0)); // unreachable; } $23 = $6; $24 = ($23|0)!=(0); if (!($24)) { ___assert_fail((15170|0),(13400|0),8955,(15146|0)); // unreachable; } $25 = $0; $26 = ($25|0)!=(0|0); $27 = $1; $28 = ($27|0)!=(0); $or$cond = $26 & $28; $29 = $2; $30 = ($29|0)!=(0); $or$cond3 = $or$cond & $30; $31 = $7; $32 = ($31|0)!=(0|0); $or$cond5 = $or$cond3 & $32; $33 = $3; $34 = ($33|0)!=(0|0); $or$cond7 = $or$cond5 & $34; $35 = $4; $36 = ($35|0)!=(0); $or$cond9 = $or$cond7 & $36; $37 = $8; $38 = ($37|0)!=(0); $or$cond11 = $or$cond9 & $38; $39 = $5; $40 = ($39|0)!=(0|0); $or$cond13 = $or$cond11 & $40; $41 = $6; $42 = ($41|0)!=(0); $or$cond15 = $or$cond13 & $42; if (!($or$cond15)) { STACKTOP = sp;return; } $43 = $3; $44 = ((($43)) + 3|0); $45 = $44; $46 = $45 & -4; $47 = $46; $baker = $47; $48 = $0; $49 = $1; $50 = $2; $51 = Math_imul($49, $50)|0; _nk_zero($48,$51); $52 = $0; $53 = $baker; $54 = ((($53)) + 12|0); $55 = ((($54)) + 28|0); HEAP32[$55>>2] = $52; $56 = $2; $57 = $baker; $58 = ((($57)) + 12|0); $59 = ((($58)) + 8|0); HEAP32[$59>>2] = $56; $input_i = 0; while(1) { $60 = $input_i; $61 = $8; $62 = ($60|0)<($61|0); if (!($62)) { break; } $63 = $input_i; $64 = $7; $65 = (($64) + (($63*44)|0)|0); $cfg = $65; $66 = $input_i; $67 = $baker; $68 = ((($67)) + 48|0); $69 = HEAP32[$68>>2]|0; $70 = (($69) + (($66*56)|0)|0); $tmp = $70; $71 = $baker; $72 = ((($71)) + 12|0); $73 = $cfg; $74 = ((($73)) + 12|0); $75 = HEAP8[$74>>0]|0; $76 = $75&255; $77 = $cfg; $78 = ((($77)) + 11|0); $79 = HEAP8[$78>>0]|0; $80 = $79&255; _nk_tt_PackSetOversampling($72,$76,$80); $81 = $baker; $82 = ((($81)) + 12|0); $83 = $tmp; $84 = $tmp; $85 = ((($84)) + 48|0); $86 = HEAP32[$85>>2]|0; $87 = $tmp; $88 = ((($87)) + 52|0); $89 = HEAP32[$88>>2]|0; $90 = $tmp; $91 = ((($90)) + 44|0); $92 = HEAP32[$91>>2]|0; $93 = $baker; (_nk_tt_PackFontRangesRenderIntoRects($82,$83,$86,$89,$92,$93)|0); $94 = $input_i; $95 = (($94) + 1)|0; $input_i = $95; } $96 = $baker; $97 = ((($96)) + 12|0); $98 = $baker; _nk_tt_PackEnd($97,$98); $input_i = 0; while(1) { $99 = $input_i; $100 = $8; $101 = ($99|0)<($100|0); if (!($101)) { break; } $i = 0; $char_idx = 0; $glyph_count = 0; $102 = $input_i; $103 = $7; $104 = (($103) + (($102*44)|0)|0); $cfg1 = $104; $105 = $input_i; $106 = $baker; $107 = ((($106)) + 48|0); $108 = HEAP32[$107>>2]|0; $109 = (($108) + (($105*56)|0)|0); $tmp2 = $109; $110 = $cfg1; $111 = ((($110)) + 36|0); $112 = HEAP32[$111>>2]|0; $dst_font = $112; $113 = $tmp2; $114 = $cfg1; $115 = ((($114)) + 16|0); $116 = +HEAPF32[$115>>2]; $117 = (+_nk_tt_ScaleForPixelHeight($113,$116)); $font_scale = $117; $118 = $tmp2; _nk_tt_GetFontVMetrics($118,$unscaled_ascent,$unscaled_descent,$unscaled_line_gap); $119 = $cfg1; $120 = ((($119)) + 9|0); $121 = HEAP8[$120>>0]|0; $122 = ($121<<24>>24)!=(0); if (!($122)) { $123 = $cfg1; $124 = ((($123)) + 32|0); $125 = HEAP32[$124>>2]|0; $126 = $dst_font; $127 = ((($126)) + 20|0); HEAP32[$127>>2] = $125; $128 = $cfg1; $129 = ((($128)) + 16|0); $130 = +HEAPF32[$129>>2]; $131 = $dst_font; HEAPF32[$131>>2] = $130; $132 = HEAP32[$unscaled_ascent>>2]|0; $133 = (+($132|0)); $134 = $font_scale; $135 = $133 * $134; $136 = $dst_font; $137 = ((($136)) + 4|0); HEAPF32[$137>>2] = $135; $138 = HEAP32[$unscaled_descent>>2]|0; $139 = (+($138|0)); $140 = $font_scale; $141 = $139 * $140; $142 = $dst_font; $143 = ((($142)) + 8|0); HEAPF32[$143>>2] = $141; $144 = $glyph_n; $145 = $dst_font; $146 = ((($145)) + 12|0); HEAP32[$146>>2] = $144; } $i = 0; while(1) { $147 = $i; $148 = $tmp2; $149 = ((($148)) + 52|0); $150 = HEAP32[$149>>2]|0; $151 = ($147>>>0)<($150>>>0); if (!($151)) { break; } $152 = $i; $153 = $tmp2; $154 = ((($153)) + 48|0); $155 = HEAP32[$154>>2]|0; $156 = (($155) + (($152*24)|0)|0); $range = $156; $char_idx = 0; while(1) { $157 = $char_idx; $158 = $range; $159 = ((($158)) + 12|0); $160 = HEAP32[$159>>2]|0; $161 = ($157|0)<($160|0); if (!($161)) { break; } $codepoint = 0; HEAPF32[$dummy_x>>2] = 0.0; HEAPF32[$dummy_y>>2] = 0.0; $162 = $char_idx; $163 = $range; $164 = ((($163)) + 16|0); $165 = HEAP32[$164>>2]|0; $166 = (($165) + (($162*28)|0)|0); $pc = $166; $167 = $glyph_count; $168 = (($167) + 1)|0; $glyph_count = $168; $169 = $pc; $170 = HEAP16[$169>>1]|0; $171 = ($170<<16>>16)!=(0); if ($171) { label = 33; } else { $172 = $pc; $173 = ((($172)) + 4|0); $174 = HEAP16[$173>>1]|0; $175 = ($174<<16>>16)!=(0); if ($175) { label = 33; } else { $176 = $pc; $177 = ((($176)) + 2|0); $178 = HEAP16[$177>>1]|0; $179 = ($178<<16>>16)!=(0); if ($179) { label = 33; } else { $180 = $pc; $181 = ((($180)) + 6|0); $182 = HEAP16[$181>>1]|0; $183 = ($182<<16>>16)!=(0); if ($183) { label = 33; } } } } if ((label|0) == 33) { label = 0; $184 = $range; $185 = ((($184)) + 4|0); $186 = HEAP32[$185>>2]|0; $187 = $char_idx; $188 = (($186) + ($187))|0; $codepoint = $188; $189 = $range; $190 = ((($189)) + 16|0); $191 = HEAP32[$190>>2]|0; $192 = $1; $193 = $2; $194 = $char_idx; _nk_tt_GetPackedQuad($191,$192,$193,$194,$dummy_x,$dummy_y,$q,0); $195 = $dst_font; $196 = ((($195)) + 12|0); $197 = HEAP32[$196>>2]|0; $198 = $char_idx; $199 = (($197) + ($198))|0; $200 = $5; $201 = (($200) + (($199*48)|0)|0); $glyph = $201; $202 = $codepoint; $203 = $glyph; HEAP32[$203>>2] = $202; $204 = +HEAPF32[$q>>2]; $205 = $glyph; $206 = ((($205)) + 8|0); HEAPF32[$206>>2] = $204; $207 = ((($q)) + 4|0); $208 = +HEAPF32[$207>>2]; $209 = $glyph; $210 = ((($209)) + 12|0); HEAPF32[$210>>2] = $208; $211 = ((($q)) + 16|0); $212 = +HEAPF32[$211>>2]; $213 = $glyph; $214 = ((($213)) + 16|0); HEAPF32[$214>>2] = $212; $215 = ((($q)) + 20|0); $216 = +HEAPF32[$215>>2]; $217 = $glyph; $218 = ((($217)) + 20|0); HEAPF32[$218>>2] = $216; $219 = $dst_font; $220 = ((($219)) + 4|0); $221 = +HEAPF32[$220>>2]; $222 = $221 + 0.5; $223 = $glyph; $224 = ((($223)) + 12|0); $225 = +HEAPF32[$224>>2]; $226 = $225 + $222; HEAPF32[$224>>2] = $226; $227 = $dst_font; $228 = ((($227)) + 4|0); $229 = +HEAPF32[$228>>2]; $230 = $229 + 0.5; $231 = $glyph; $232 = ((($231)) + 20|0); $233 = +HEAPF32[$232>>2]; $234 = $233 + $230; HEAPF32[$232>>2] = $234; $235 = $glyph; $236 = ((($235)) + 16|0); $237 = +HEAPF32[$236>>2]; $238 = $glyph; $239 = ((($238)) + 8|0); $240 = +HEAPF32[$239>>2]; $241 = $237 - $240; $242 = $241 + 0.5; $243 = $glyph; $244 = ((($243)) + 24|0); HEAPF32[$244>>2] = $242; $245 = $glyph; $246 = ((($245)) + 20|0); $247 = +HEAPF32[$246>>2]; $248 = $glyph; $249 = ((($248)) + 12|0); $250 = +HEAPF32[$249>>2]; $251 = $247 - $250; $252 = $glyph; $253 = ((($252)) + 28|0); HEAPF32[$253>>2] = $251; $254 = $cfg1; $255 = ((($254)) + 20|0); $256 = HEAP32[$255>>2]|0; $257 = ($256|0)==(1); $258 = ((($q)) + 8|0); $259 = +HEAPF32[$258>>2]; if ($257) { $260 = $1; $261 = (+($260|0)); $262 = $259 * $261; $263 = $glyph; $264 = ((($263)) + 32|0); HEAPF32[$264>>2] = $262; $265 = ((($q)) + 12|0); $266 = +HEAPF32[$265>>2]; $267 = $2; $268 = (+($267|0)); $269 = $266 * $268; $270 = $glyph; $271 = ((($270)) + 36|0); HEAPF32[$271>>2] = $269; $272 = ((($q)) + 24|0); $273 = +HEAPF32[$272>>2]; $274 = $1; $275 = (+($274|0)); $276 = $273 * $275; $277 = $glyph; $278 = ((($277)) + 40|0); HEAPF32[$278>>2] = $276; $279 = ((($q)) + 28|0); $280 = +HEAPF32[$279>>2]; $281 = $2; $282 = (+($281|0)); $283 = $280 * $282; $284 = $glyph; $285 = ((($284)) + 44|0); HEAPF32[$285>>2] = $283; } else { $286 = $glyph; $287 = ((($286)) + 32|0); HEAPF32[$287>>2] = $259; $288 = ((($q)) + 12|0); $289 = +HEAPF32[$288>>2]; $290 = $glyph; $291 = ((($290)) + 36|0); HEAPF32[$291>>2] = $289; $292 = ((($q)) + 24|0); $293 = +HEAPF32[$292>>2]; $294 = $glyph; $295 = ((($294)) + 40|0); HEAPF32[$295>>2] = $293; $296 = ((($q)) + 28|0); $297 = +HEAPF32[$296>>2]; $298 = $glyph; $299 = ((($298)) + 44|0); HEAPF32[$299>>2] = $297; } $300 = $pc; $301 = ((($300)) + 16|0); $302 = +HEAPF32[$301>>2]; $303 = $cfg1; $304 = ((($303)) + 24|0); $305 = +HEAPF32[$304>>2]; $306 = $302 + $305; $307 = $glyph; $308 = ((($307)) + 4|0); HEAPF32[$308>>2] = $306; $309 = $cfg1; $310 = ((($309)) + 10|0); $311 = HEAP8[$310>>0]|0; $312 = ($311<<24>>24)!=(0); if ($312) { $313 = $glyph; $314 = ((($313)) + 4|0); $315 = +HEAPF32[$314>>2]; $316 = $315 + 0.5; $317 = (~~(($316))); $318 = (+($317|0)); $319 = $glyph; $320 = ((($319)) + 4|0); HEAPF32[$320>>2] = $318; } } $321 = $char_idx; $322 = (($321) + 1)|0; $char_idx = $322; } $323 = $i; $324 = (($323) + 1)|0; $i = $324; } $325 = $glyph_count; $326 = $dst_font; $327 = ((($326)) + 16|0); HEAP32[$327>>2] = $325; $328 = $dst_font; $329 = ((($328)) + 16|0); $330 = HEAP32[$329>>2]|0; $331 = $glyph_n; $332 = (($331) + ($330))|0; $glyph_n = $332; $333 = $input_i; $334 = (($333) + 1)|0; $input_i = $334; } STACKTOP = sp;return; } function _nk_tt_PackFontRangesRenderIntoRects($spc,$info,$ranges,$num_ranges,$rects,$alloc) { $spc = $spc|0; $info = $info|0; $ranges = $ranges|0; $num_ranges = $num_ranges|0; $rects = $rects|0; $alloc = $alloc|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0, $163 = 0, $164 = 0, $165 = 0.0, $166 = 0.0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0.0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0.0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0.0, $211 = 0.0, $212 = 0.0, $213 = 0, $214 = 0, $215 = 0, $216 = 0.0, $217 = 0.0, $218 = 0, $219 = 0, $22 = 0.0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0.0; var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0.0, $324 = 0, $325 = 0.0, $326 = 0.0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0.0, $331 = 0.0; var $332 = 0.0, $333 = 0.0, $334 = 0.0, $335 = 0, $336 = 0, $337 = 0, $338 = 0.0, $339 = 0.0, $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0.0, $343 = 0, $344 = 0, $345 = 0, $346 = 0.0, $347 = 0, $348 = 0, $349 = 0, $35 = 0; var $350 = 0, $351 = 0.0, $352 = 0.0, $353 = 0.0, $354 = 0.0, $355 = 0.0, $356 = 0.0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0.0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0.0, $366 = 0.0, $367 = 0.0, $368 = 0.0; var $369 = 0.0, $37 = 0, $370 = 0.0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $advance = 0, $bc = 0, $codepoint = 0, $fh = 0.0, $glyph = 0, $i = 0, $j = 0, $k = 0, $lsb = 0, $old_h_over = 0, $old_v_over = 0, $pad = 0, $r = 0, $recip_h = 0.0; var $recip_v = 0.0, $return_value = 0, $scale = 0.0, $sub_x = 0.0, $sub_y = 0.0, $x0 = 0, $x1 = 0, $y0 = 0, $y1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $advance = sp + 28|0; $lsb = sp + 24|0; $x0 = sp + 20|0; $y0 = sp + 16|0; $x1 = sp + 12|0; $y1 = sp + 8|0; $0 = $spc; $1 = $info; $2 = $ranges; $3 = $num_ranges; $4 = $rects; $5 = $alloc; $return_value = 1; $6 = $0; $7 = ((($6)) + 20|0); $8 = HEAP32[$7>>2]|0; $old_h_over = $8; $9 = $0; $10 = ((($9)) + 24|0); $11 = HEAP32[$10>>2]|0; $old_v_over = $11; $k = 0; $i = 0; while(1) { $12 = $i; $13 = $3; $14 = ($12|0)<($13|0); if (!($14)) { break; } $15 = $i; $16 = $2; $17 = (($16) + (($15*24)|0)|0); $18 = +HEAPF32[$17>>2]; $fh = $18; $19 = $fh; $20 = $19 > 0.0; $21 = $1; $22 = $fh; if ($20) { $23 = (+_nk_tt_ScaleForPixelHeight($21,$22)); $26 = $23; } else { $24 = -$22; $25 = (+_nk_tt_ScaleForMappingEmToPixels($21,$24)); $26 = $25; } $scale = $26; $27 = $i; $28 = $2; $29 = (($28) + (($27*24)|0)|0); $30 = ((($29)) + 20|0); $31 = HEAP8[$30>>0]|0; $32 = $31&255; $33 = $0; $34 = ((($33)) + 20|0); HEAP32[$34>>2] = $32; $35 = $i; $36 = $2; $37 = (($36) + (($35*24)|0)|0); $38 = ((($37)) + 21|0); $39 = HEAP8[$38>>0]|0; $40 = $39&255; $41 = $0; $42 = ((($41)) + 24|0); HEAP32[$42>>2] = $40; $43 = $0; $44 = ((($43)) + 20|0); $45 = HEAP32[$44>>2]|0; $46 = (+($45>>>0)); $47 = 1.0 / $46; $recip_h = $47; $48 = $0; $49 = ((($48)) + 24|0); $50 = HEAP32[$49>>2]|0; $51 = (+($50>>>0)); $52 = 1.0 / $51; $recip_v = $52; $53 = $0; $54 = ((($53)) + 20|0); $55 = HEAP32[$54>>2]|0; $56 = (+_nk_tt__oversample_shift($55)); $sub_x = $56; $57 = $0; $58 = ((($57)) + 24|0); $59 = HEAP32[$58>>2]|0; $60 = (+_nk_tt__oversample_shift($59)); $sub_y = $60; $j = 0; while(1) { $61 = $j; $62 = $i; $63 = $2; $64 = (($63) + (($62*24)|0)|0); $65 = ((($64)) + 12|0); $66 = HEAP32[$65>>2]|0; $67 = ($61|0)<($66|0); if (!($67)) { break; } $68 = $k; $69 = $4; $70 = (($69) + ($68<<4)|0); $r = $70; $71 = $r; $72 = ((($71)) + 12|0); $73 = HEAP32[$72>>2]|0; $74 = ($73|0)!=(0); if ($74) { $75 = $j; $76 = $i; $77 = $2; $78 = (($77) + (($76*24)|0)|0); $79 = ((($78)) + 16|0); $80 = HEAP32[$79>>2]|0; $81 = (($80) + (($75*28)|0)|0); $bc = $81; $82 = $i; $83 = $2; $84 = (($83) + (($82*24)|0)|0); $85 = ((($84)) + 4|0); $86 = HEAP32[$85>>2]|0; $87 = ($86|0)!=(0); if ($87) { $88 = $i; $89 = $2; $90 = (($89) + (($88*24)|0)|0); $91 = ((($90)) + 4|0); $92 = HEAP32[$91>>2]|0; $93 = $j; $94 = (($92) + ($93))|0; $103 = $94; } else { $95 = $j; $96 = $i; $97 = $2; $98 = (($97) + (($96*24)|0)|0); $99 = ((($98)) + 8|0); $100 = HEAP32[$99>>2]|0; $101 = (($100) + ($95<<2)|0); $102 = HEAP32[$101>>2]|0; $103 = $102; } $codepoint = $103; $104 = $1; $105 = $codepoint; $106 = (_nk_tt_FindGlyphIndex($104,$105)|0); $glyph = $106; $107 = $0; $108 = ((($107)) + 16|0); $109 = HEAP32[$108>>2]|0; $110 = $109&65535; $pad = $110; $111 = $r; $112 = ((($111)) + 8|0); $113 = HEAP16[$112>>1]|0; $114 = $113&65535; $115 = $pad; $116 = $115&65535; $117 = (($114) + ($116))|0; $118 = $117&65535; $119 = $r; $120 = ((($119)) + 8|0); HEAP16[$120>>1] = $118; $121 = $r; $122 = ((($121)) + 10|0); $123 = HEAP16[$122>>1]|0; $124 = $123&65535; $125 = $pad; $126 = $125&65535; $127 = (($124) + ($126))|0; $128 = $127&65535; $129 = $r; $130 = ((($129)) + 10|0); HEAP16[$130>>1] = $128; $131 = $r; $132 = ((($131)) + 4|0); $133 = HEAP16[$132>>1]|0; $134 = $133&65535; $135 = $pad; $136 = $135&65535; $137 = (($134) - ($136))|0; $138 = $137&65535; $139 = $r; $140 = ((($139)) + 4|0); HEAP16[$140>>1] = $138; $141 = $r; $142 = ((($141)) + 6|0); $143 = HEAP16[$142>>1]|0; $144 = $143&65535; $145 = $pad; $146 = $145&65535; $147 = (($144) - ($146))|0; $148 = $147&65535; $149 = $r; $150 = ((($149)) + 6|0); HEAP16[$150>>1] = $148; $151 = $1; $152 = $glyph; _nk_tt_GetGlyphHMetrics($151,$152,$advance,$lsb); $153 = $1; $154 = $glyph; $155 = $scale; $156 = $0; $157 = ((($156)) + 20|0); $158 = HEAP32[$157>>2]|0; $159 = (+($158>>>0)); $160 = $155 * $159; $161 = $scale; $162 = $0; $163 = ((($162)) + 24|0); $164 = HEAP32[$163>>2]|0; $165 = (+($164>>>0)); $166 = $161 * $165; _nk_tt_GetGlyphBitmapBox($153,$154,$160,$166,$x0,$y0,$x1,$y1); $167 = $1; $168 = $0; $169 = ((($168)) + 28|0); $170 = HEAP32[$169>>2]|0; $171 = $r; $172 = ((($171)) + 8|0); $173 = HEAP16[$172>>1]|0; $174 = $173&65535; $175 = (($170) + ($174)|0); $176 = $r; $177 = ((($176)) + 10|0); $178 = HEAP16[$177>>1]|0; $179 = $178&65535; $180 = $0; $181 = ((($180)) + 12|0); $182 = HEAP32[$181>>2]|0; $183 = Math_imul($179, $182)|0; $184 = (($175) + ($183)|0); $185 = $r; $186 = ((($185)) + 4|0); $187 = HEAP16[$186>>1]|0; $188 = $187&65535; $189 = $0; $190 = ((($189)) + 20|0); $191 = HEAP32[$190>>2]|0; $192 = (($188) - ($191))|0; $193 = (($192) + 1)|0; $194 = $r; $195 = ((($194)) + 6|0); $196 = HEAP16[$195>>1]|0; $197 = $196&65535; $198 = $0; $199 = ((($198)) + 24|0); $200 = HEAP32[$199>>2]|0; $201 = (($197) - ($200))|0; $202 = (($201) + 1)|0; $203 = $0; $204 = ((($203)) + 12|0); $205 = HEAP32[$204>>2]|0; $206 = $scale; $207 = $0; $208 = ((($207)) + 20|0); $209 = HEAP32[$208>>2]|0; $210 = (+($209>>>0)); $211 = $206 * $210; $212 = $scale; $213 = $0; $214 = ((($213)) + 24|0); $215 = HEAP32[$214>>2]|0; $216 = (+($215>>>0)); $217 = $212 * $216; $218 = $glyph; $219 = $5; _nk_tt_MakeGlyphBitmapSubpixel($167,$184,$193,$202,$205,$211,$217,0.0,0.0,$218,$219); $220 = $0; $221 = ((($220)) + 20|0); $222 = HEAP32[$221>>2]|0; $223 = ($222>>>0)>(1); if ($223) { $224 = $0; $225 = ((($224)) + 28|0); $226 = HEAP32[$225>>2]|0; $227 = $r; $228 = ((($227)) + 8|0); $229 = HEAP16[$228>>1]|0; $230 = $229&65535; $231 = (($226) + ($230)|0); $232 = $r; $233 = ((($232)) + 10|0); $234 = HEAP16[$233>>1]|0; $235 = $234&65535; $236 = $0; $237 = ((($236)) + 12|0); $238 = HEAP32[$237>>2]|0; $239 = Math_imul($235, $238)|0; $240 = (($231) + ($239)|0); $241 = $r; $242 = ((($241)) + 4|0); $243 = HEAP16[$242>>1]|0; $244 = $243&65535; $245 = $r; $246 = ((($245)) + 6|0); $247 = HEAP16[$246>>1]|0; $248 = $247&65535; $249 = $0; $250 = ((($249)) + 12|0); $251 = HEAP32[$250>>2]|0; $252 = $0; $253 = ((($252)) + 20|0); $254 = HEAP32[$253>>2]|0; _nk_tt__h_prefilter($240,$244,$248,$251,$254); } $255 = $0; $256 = ((($255)) + 24|0); $257 = HEAP32[$256>>2]|0; $258 = ($257>>>0)>(1); if ($258) { $259 = $0; $260 = ((($259)) + 28|0); $261 = HEAP32[$260>>2]|0; $262 = $r; $263 = ((($262)) + 8|0); $264 = HEAP16[$263>>1]|0; $265 = $264&65535; $266 = (($261) + ($265)|0); $267 = $r; $268 = ((($267)) + 10|0); $269 = HEAP16[$268>>1]|0; $270 = $269&65535; $271 = $0; $272 = ((($271)) + 12|0); $273 = HEAP32[$272>>2]|0; $274 = Math_imul($270, $273)|0; $275 = (($266) + ($274)|0); $276 = $r; $277 = ((($276)) + 4|0); $278 = HEAP16[$277>>1]|0; $279 = $278&65535; $280 = $r; $281 = ((($280)) + 6|0); $282 = HEAP16[$281>>1]|0; $283 = $282&65535; $284 = $0; $285 = ((($284)) + 12|0); $286 = HEAP32[$285>>2]|0; $287 = $0; $288 = ((($287)) + 24|0); $289 = HEAP32[$288>>2]|0; _nk_tt__v_prefilter($275,$279,$283,$286,$289); } $290 = $r; $291 = ((($290)) + 8|0); $292 = HEAP16[$291>>1]|0; $293 = $bc; HEAP16[$293>>1] = $292; $294 = $r; $295 = ((($294)) + 10|0); $296 = HEAP16[$295>>1]|0; $297 = $bc; $298 = ((($297)) + 2|0); HEAP16[$298>>1] = $296; $299 = $r; $300 = ((($299)) + 8|0); $301 = HEAP16[$300>>1]|0; $302 = $301&65535; $303 = $r; $304 = ((($303)) + 4|0); $305 = HEAP16[$304>>1]|0; $306 = $305&65535; $307 = (($302) + ($306))|0; $308 = $307&65535; $309 = $bc; $310 = ((($309)) + 4|0); HEAP16[$310>>1] = $308; $311 = $r; $312 = ((($311)) + 10|0); $313 = HEAP16[$312>>1]|0; $314 = $313&65535; $315 = $r; $316 = ((($315)) + 6|0); $317 = HEAP16[$316>>1]|0; $318 = $317&65535; $319 = (($314) + ($318))|0; $320 = $319&65535; $321 = $bc; $322 = ((($321)) + 6|0); HEAP16[$322>>1] = $320; $323 = $scale; $324 = HEAP32[$advance>>2]|0; $325 = (+($324|0)); $326 = $323 * $325; $327 = $bc; $328 = ((($327)) + 16|0); HEAPF32[$328>>2] = $326; $329 = HEAP32[$x0>>2]|0; $330 = (+($329|0)); $331 = $recip_h; $332 = $330 * $331; $333 = $sub_x; $334 = $332 + $333; $335 = $bc; $336 = ((($335)) + 8|0); HEAPF32[$336>>2] = $334; $337 = HEAP32[$y0>>2]|0; $338 = (+($337|0)); $339 = $recip_v; $340 = $338 * $339; $341 = $sub_y; $342 = $340 + $341; $343 = $bc; $344 = ((($343)) + 12|0); HEAPF32[$344>>2] = $342; $345 = HEAP32[$x0>>2]|0; $346 = (+($345|0)); $347 = $r; $348 = ((($347)) + 4|0); $349 = HEAP16[$348>>1]|0; $350 = $349&65535; $351 = (+($350|0)); $352 = $346 + $351; $353 = $recip_h; $354 = $352 * $353; $355 = $sub_x; $356 = $354 + $355; $357 = $bc; $358 = ((($357)) + 20|0); HEAPF32[$358>>2] = $356; $359 = HEAP32[$y0>>2]|0; $360 = (+($359|0)); $361 = $r; $362 = ((($361)) + 6|0); $363 = HEAP16[$362>>1]|0; $364 = $363&65535; $365 = (+($364|0)); $366 = $360 + $365; $367 = $recip_v; $368 = $366 * $367; $369 = $sub_y; $370 = $368 + $369; $371 = $bc; $372 = ((($371)) + 24|0); HEAPF32[$372>>2] = $370; } else { $return_value = 0; } $373 = $k; $374 = (($373) + 1)|0; $k = $374; $375 = $j; $376 = (($375) + 1)|0; $j = $376; } $377 = $i; $378 = (($377) + 1)|0; $i = $378; } $379 = $old_h_over; $380 = $0; $381 = ((($380)) + 20|0); HEAP32[$381>>2] = $379; $382 = $old_v_over; $383 = $0; $384 = ((($383)) + 24|0); HEAP32[$384>>2] = $382; $385 = $return_value; STACKTOP = sp;return ($385|0); } function _nk_tt_PackEnd($spc,$alloc) { $spc = $spc|0; $alloc = $alloc|0; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy1 = sp + 12|0; $$byval_copy = sp + 8|0; $0 = $spc; $1 = $alloc; $2 = $1; $3 = ((($2)) + 8|0); $4 = HEAP32[$3>>2]|0; $5 = $1; $6 = $0; $7 = ((($6)) + 32|0); $8 = HEAP32[$7>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0; FUNCTION_TABLE_vii[$4 & 31]($$byval_copy,$8); $9 = $1; $10 = ((($9)) + 8|0); $11 = HEAP32[$10>>2]|0; $12 = $1; $13 = $0; $14 = HEAP32[$13>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$12>>2]|0; FUNCTION_TABLE_vii[$11 & 31]($$byval_copy1,$14); STACKTOP = sp;return; } function _nk_tt_ScaleForPixelHeight($info,$height) { $info = $info|0; $height = +$height; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $3 = 0, $4 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $fheight = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $info; $1 = $height; $2 = $0; $3 = HEAP32[$2>>2]|0; $4 = $0; $5 = ((($4)) + 24|0); $6 = HEAP32[$5>>2]|0; $7 = (($3) + ($6)|0); $8 = ((($7)) + 4|0); $9 = (_nk_ttSHORT($8)|0); $10 = $9 << 16 >> 16; $11 = $0; $12 = HEAP32[$11>>2]|0; $13 = $0; $14 = ((($13)) + 24|0); $15 = HEAP32[$14>>2]|0; $16 = (($12) + ($15)|0); $17 = ((($16)) + 6|0); $18 = (_nk_ttSHORT($17)|0); $19 = $18 << 16 >> 16; $20 = (($10) - ($19))|0; $fheight = $20; $21 = $1; $22 = $fheight; $23 = (+($22|0)); $24 = $21 / $23; STACKTOP = sp;return (+$24); } function _nk_tt_GetFontVMetrics($info,$ascent,$descent,$lineGap) { $info = $info|0; $ascent = $ascent|0; $descent = $descent|0; $lineGap = $lineGap|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $info; $1 = $ascent; $2 = $descent; $3 = $lineGap; $4 = $1; $5 = ($4|0)!=(0|0); if ($5) { $6 = $0; $7 = HEAP32[$6>>2]|0; $8 = $0; $9 = ((($8)) + 24|0); $10 = HEAP32[$9>>2]|0; $11 = (($7) + ($10)|0); $12 = ((($11)) + 4|0); $13 = (_nk_ttSHORT($12)|0); $14 = $13 << 16 >> 16; $15 = $1; HEAP32[$15>>2] = $14; } $16 = $2; $17 = ($16|0)!=(0|0); if ($17) { $18 = $0; $19 = HEAP32[$18>>2]|0; $20 = $0; $21 = ((($20)) + 24|0); $22 = HEAP32[$21>>2]|0; $23 = (($19) + ($22)|0); $24 = ((($23)) + 6|0); $25 = (_nk_ttSHORT($24)|0); $26 = $25 << 16 >> 16; $27 = $2; HEAP32[$27>>2] = $26; } $28 = $3; $29 = ($28|0)!=(0|0); if (!($29)) { STACKTOP = sp;return; } $30 = $0; $31 = HEAP32[$30>>2]|0; $32 = $0; $33 = ((($32)) + 24|0); $34 = HEAP32[$33>>2]|0; $35 = (($31) + ($34)|0); $36 = ((($35)) + 8|0); $37 = (_nk_ttSHORT($36)|0); $38 = $37 << 16 >> 16; $39 = $3; HEAP32[$39>>2] = $38; STACKTOP = sp;return; } function _nk_tt_GetPackedQuad($chardata,$pw,$ph,$char_index,$xpos,$ypos,$q,$align_to_integer) { $chardata = $chardata|0; $pw = $pw|0; $ph = $ph|0; $char_index = $char_index|0; $xpos = $xpos|0; $ypos = $ypos|0; $q = $q|0; $align_to_integer = $align_to_integer|0; var $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $14 = 0, $15 = 0; var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0; var $34 = 0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0; var $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0; var $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0; var $89 = 0, $9 = 0.0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $b = 0, $iph = 0.0, $ipw = 0.0, $tx = 0, $ty = 0, $x = 0.0, $y = 0.0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $chardata; $1 = $pw; $2 = $ph; $3 = $char_index; $4 = $xpos; $5 = $ypos; $6 = $q; $7 = $align_to_integer; $8 = $1; $9 = (+($8|0)); $10 = 1.0 / $9; $ipw = $10; $11 = $2; $12 = (+($11|0)); $13 = 1.0 / $12; $iph = $13; $14 = $0; $15 = $3; $16 = (($14) + (($15*28)|0)|0); $b = $16; $17 = $7; $18 = ($17|0)!=(0); $19 = $4; $20 = +HEAPF32[$19>>2]; $21 = $b; $22 = ((($21)) + 8|0); $23 = +HEAPF32[$22>>2]; $24 = $20 + $23; if ($18) { $25 = $24 + 0.5; $26 = (_nk_ifloor($25)|0); $tx = $26; $27 = $5; $28 = +HEAPF32[$27>>2]; $29 = $b; $30 = ((($29)) + 12|0); $31 = +HEAPF32[$30>>2]; $32 = $28 + $31; $33 = $32 + 0.5; $34 = (_nk_ifloor($33)|0); $ty = $34; $35 = $tx; $36 = (+($35|0)); $x = $36; $37 = $ty; $38 = (+($37|0)); $y = $38; $39 = $x; $40 = $6; HEAPF32[$40>>2] = $39; $41 = $y; $42 = $6; $43 = ((($42)) + 4|0); HEAPF32[$43>>2] = $41; $44 = $x; $45 = $b; $46 = ((($45)) + 20|0); $47 = +HEAPF32[$46>>2]; $48 = $44 + $47; $49 = $b; $50 = ((($49)) + 8|0); $51 = +HEAPF32[$50>>2]; $52 = $48 - $51; $53 = $6; $54 = ((($53)) + 16|0); HEAPF32[$54>>2] = $52; $55 = $y; $56 = $b; $57 = ((($56)) + 24|0); $58 = +HEAPF32[$57>>2]; $59 = $55 + $58; $60 = $b; $61 = ((($60)) + 12|0); $62 = +HEAPF32[$61>>2]; $63 = $59 - $62; $64 = $6; $65 = ((($64)) + 20|0); HEAPF32[$65>>2] = $63; } else { $66 = $6; HEAPF32[$66>>2] = $24; $67 = $5; $68 = +HEAPF32[$67>>2]; $69 = $b; $70 = ((($69)) + 12|0); $71 = +HEAPF32[$70>>2]; $72 = $68 + $71; $73 = $6; $74 = ((($73)) + 4|0); HEAPF32[$74>>2] = $72; $75 = $4; $76 = +HEAPF32[$75>>2]; $77 = $b; $78 = ((($77)) + 20|0); $79 = +HEAPF32[$78>>2]; $80 = $76 + $79; $81 = $6; $82 = ((($81)) + 16|0); HEAPF32[$82>>2] = $80; $83 = $5; $84 = +HEAPF32[$83>>2]; $85 = $b; $86 = ((($85)) + 24|0); $87 = +HEAPF32[$86>>2]; $88 = $84 + $87; $89 = $6; $90 = ((($89)) + 20|0); HEAPF32[$90>>2] = $88; } $91 = $b; $92 = HEAP16[$91>>1]|0; $93 = $92&65535; $94 = (+($93|0)); $95 = $ipw; $96 = $94 * $95; $97 = $6; $98 = ((($97)) + 8|0); HEAPF32[$98>>2] = $96; $99 = $b; $100 = ((($99)) + 2|0); $101 = HEAP16[$100>>1]|0; $102 = $101&65535; $103 = (+($102|0)); $104 = $iph; $105 = $103 * $104; $106 = $6; $107 = ((($106)) + 12|0); HEAPF32[$107>>2] = $105; $108 = $b; $109 = ((($108)) + 4|0); $110 = HEAP16[$109>>1]|0; $111 = $110&65535; $112 = (+($111|0)); $113 = $ipw; $114 = $112 * $113; $115 = $6; $116 = ((($115)) + 24|0); HEAPF32[$116>>2] = $114; $117 = $b; $118 = ((($117)) + 6|0); $119 = HEAP16[$118>>1]|0; $120 = $119&65535; $121 = (+($120|0)); $122 = $iph; $123 = $121 * $122; $124 = $6; $125 = ((($124)) + 28|0); HEAPF32[$125>>2] = $123; $126 = $b; $127 = ((($126)) + 16|0); $128 = +HEAPF32[$127>>2]; $129 = $4; $130 = +HEAPF32[$129>>2]; $131 = $130 + $128; HEAPF32[$129>>2] = $131; STACKTOP = sp;return; } function _nk_font_bake_custom_data($img_memory,$img_width,$img_height,$img_dst,$texture_data_mask,$tex_width,$tex_height,$white,$black) { $img_memory = $img_memory|0; $img_width = $img_width|0; $img_height = $img_height|0; $img_dst = $img_dst|0; $texture_data_mask = $texture_data_mask|0; $tex_width = $tex_width|0; $tex_height = $tex_height|0; $white = $white|0; $black = $black|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $8 = 0, $9 = 0, $n = 0; var $off0 = 0, $off1 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $pixels = 0, $x = 0, $y = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $img_memory; $1 = $img_width; $2 = $img_height; $3 = $texture_data_mask; $4 = $tex_width; $5 = $tex_height; $6 = $white; $7 = $black; $y = 0; $x = 0; $n = 0; $8 = $0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((15183|0),(13400|0),9058,(15194|0)); // unreachable; } $10 = $1; $11 = ($10|0)!=(0); if (!($11)) { ___assert_fail((15219|0),(13400|0),9059,(15194|0)); // unreachable; } $12 = $2; $13 = ($12|0)!=(0); if (!($13)) { ___assert_fail((15229|0),(13400|0),9060,(15194|0)); // unreachable; } $14 = $3; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((15240|0),(13400|0),9061,(15194|0)); // unreachable; } $16 = $0; $17 = ($16|0)!=(0|0); $18 = $1; $19 = ($18|0)!=(0); $or$cond = $17 & $19; $20 = $2; $21 = ($20|0)!=(0); $or$cond3 = $or$cond & $21; $22 = $3; $23 = ($22|0)!=(0|0); $or$cond5 = $or$cond3 & $23; if (!($or$cond5)) { STACKTOP = sp;return; } $24 = $0; $pixels = $24; $y = 0; $n = 0; while(1) { $25 = $y; $26 = $5; $27 = ($25|0)<($26|0); if (!($27)) { break; } $x = 0; while(1) { $28 = $x; $29 = $4; $30 = ($28|0)<($29|0); if (!($30)) { break; } $31 = HEAP16[$img_dst>>1]|0; $32 = $31 << 16 >> 16; $33 = $x; $34 = (($32) + ($33))|0; $35 = ((($img_dst)) + 2|0); $36 = HEAP16[$35>>1]|0; $37 = $36 << 16 >> 16; $38 = $y; $39 = (($37) + ($38))|0; $40 = $1; $41 = Math_imul($39, $40)|0; $42 = (($34) + ($41))|0; $off0 = $42; $43 = $off0; $44 = (($43) + 1)|0; $45 = $4; $46 = (($44) + ($45))|0; $off1 = $46; $47 = $n; $48 = $3; $49 = (($48) + ($47)|0); $50 = HEAP8[$49>>0]|0; $51 = $50 << 24 >> 24; $52 = $6; $53 = $52 << 24 >> 24; $54 = ($51|0)==($53|0); $55 = $54 ? 255 : 0; $56 = $55&255; $57 = $off0; $58 = $pixels; $59 = (($58) + ($57)|0); HEAP8[$59>>0] = $56; $60 = $n; $61 = $3; $62 = (($61) + ($60)|0); $63 = HEAP8[$62>>0]|0; $64 = $63 << 24 >> 24; $65 = $7; $66 = $65 << 24 >> 24; $67 = ($64|0)==($66|0); $68 = $67 ? 255 : 0; $69 = $68&255; $70 = $off1; $71 = $pixels; $72 = (($71) + ($70)|0); HEAP8[$72>>0] = $69; $73 = $x; $74 = (($73) + 1)|0; $x = $74; $75 = $n; $76 = (($75) + 1)|0; $n = $76; } $77 = $y; $78 = (($77) + 1)|0; $y = $78; } STACKTOP = sp;return; } function _nk_font_bake_convert($out_memory,$img_width,$img_height,$in_memory) { $out_memory = $out_memory|0; $img_width = $img_width|0; $img_height = $img_height|0; $in_memory = $in_memory|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dst = 0, $n = 0, $or$cond = 0; var $or$cond3 = 0, $or$cond5 = 0, $src = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $out_memory; $1 = $img_width; $2 = $img_height; $3 = $in_memory; $n = 0; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((15258|0),(13400|0),9085,(15269|0)); // unreachable; } $6 = $3; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((15290|0),(13400|0),9086,(15269|0)); // unreachable; } $8 = $1; $9 = ($8|0)!=(0); if (!($9)) { ___assert_fail((15219|0),(13400|0),9087,(15269|0)); // unreachable; } $10 = $2; $11 = ($10|0)!=(0); if (!($11)) { ___assert_fail((15229|0),(13400|0),9088,(15269|0)); // unreachable; } $12 = $0; $13 = ($12|0)!=(0|0); $14 = $3; $15 = ($14|0)!=(0|0); $or$cond = $13 & $15; $16 = $2; $17 = ($16|0)!=(0); $or$cond3 = $or$cond & $17; $18 = $1; $19 = ($18|0)!=(0); $or$cond5 = $or$cond3 & $19; if (!($or$cond5)) { STACKTOP = sp;return; } $20 = $0; $dst = $20; $21 = $3; $src = $21; $22 = $1; $23 = $2; $24 = Math_imul($22, $23)|0; $n = $24; while(1) { $25 = $n; $26 = ($25|0)>(0); if (!($26)) { break; } $27 = $src; $28 = ((($27)) + 1|0); $src = $28; $29 = HEAP8[$27>>0]|0; $30 = $29&255; $31 = $30 << 24; $32 = $31 | 16777215; $33 = $dst; $34 = ((($33)) + 4|0); $dst = $34; HEAP32[$33>>2] = $32; $35 = $n; $36 = (($35) + -1)|0; $n = $36; } STACKTOP = sp;return; } function _nk_font_find_glyph($font,$unicode) { $font = $font|0; $unicode = $unicode|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $7 = 0, $8 = 0, $9 = 0, $count = 0, $diff = 0, $f = 0, $glyph = 0, $i = 0, $t = 0, $total_glyphs = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $font; $2 = $unicode; $i = 0; $total_glyphs = 0; $glyph = 0; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14249|0),(13400|0),9171,(15300|0)); // unreachable; } $5 = $1; $6 = ((($5)) + 48|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((15319|0),(13400|0),9172,(15300|0)); // unreachable; } $9 = $1; $10 = ((($9)) + 52|0); $11 = HEAP32[$10>>2]|0; $glyph = $11; $12 = $1; $13 = ((($12)) + 20|0); $14 = ((($13)) + 20|0); $15 = HEAP32[$14>>2]|0; $16 = (_nk_range_count($15)|0); $count = $16; $i = 0; while(1) { $17 = $i; $18 = $count; $19 = ($17|0)<($18|0); if (!($19)) { label = 11; break; } $20 = $i; $21 = $20<<1; $22 = (($21) + 0)|0; $23 = $1; $24 = ((($23)) + 20|0); $25 = ((($24)) + 20|0); $26 = HEAP32[$25>>2]|0; $27 = (($26) + ($22<<2)|0); $28 = HEAP32[$27>>2]|0; $f = $28; $29 = $i; $30 = $29<<1; $31 = (($30) + 1)|0; $32 = $1; $33 = ((($32)) + 20|0); $34 = ((($33)) + 20|0); $35 = HEAP32[$34>>2]|0; $36 = (($35) + ($31<<2)|0); $37 = HEAP32[$36>>2]|0; $t = $37; $38 = $t; $39 = $f; $40 = (($38) - ($39))|0; $41 = (($40) + 1)|0; $diff = $41; $42 = $2; $43 = $f; $44 = ($42>>>0)>=($43>>>0); if ($44) { $45 = $2; $46 = $t; $47 = ($45>>>0)<=($46>>>0); if ($47) { label = 9; break; } } $57 = $diff; $58 = $total_glyphs; $59 = (($58) + ($57))|0; $total_glyphs = $59; $60 = $i; $61 = (($60) + 1)|0; $i = $61; } if ((label|0) == 9) { $48 = $total_glyphs; $49 = $2; $50 = $f; $51 = (($49) - ($50))|0; $52 = (($48) + ($51))|0; $53 = $1; $54 = ((($53)) + 48|0); $55 = HEAP32[$54>>2]|0; $56 = (($55) + (($52*48)|0)|0); $0 = $56; $63 = $0; STACKTOP = sp;return ($63|0); } else if ((label|0) == 11) { $62 = $glyph; $0 = $62; $63 = $0; STACKTOP = sp;return ($63|0); } return (0)|0; } function _nk_font_init($font,$pixel_height,$fallback_codepoint,$glyphs,$baked_font,$atlas) { $font = $font|0; $pixel_height = +$pixel_height; $fallback_codepoint = $fallback_codepoint|0; $glyphs = $glyphs|0; $baked_font = $baked_font|0; $atlas = $atlas|0; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $7 = 0, $8 = 0, $9 = 0, $baked = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $baked = sp; $0 = $font; $1 = $pixel_height; $2 = $fallback_codepoint; $3 = $glyphs; $4 = $baked_font; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14249|0),(13400|0),9194,(15332|0)); // unreachable; } $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((15345|0),(13400|0),9195,(15332|0)); // unreachable; } $9 = $4; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((15352|0),(13400|0),9196,(15332|0)); // unreachable; } $11 = $0; $12 = ($11|0)!=(0|0); $13 = $3; $14 = ($13|0)!=(0|0); $or$cond = $12 & $14; $15 = $4; $16 = ($15|0)!=(0|0); $or$cond3 = $or$cond & $16; if (!($or$cond3)) { STACKTOP = sp;return; } $17 = $4; ;HEAP32[$baked>>2]=HEAP32[$17>>2]|0;HEAP32[$baked+4>>2]=HEAP32[$17+4>>2]|0;HEAP32[$baked+8>>2]=HEAP32[$17+8>>2]|0;HEAP32[$baked+12>>2]=HEAP32[$17+12>>2]|0;HEAP32[$baked+16>>2]=HEAP32[$17+16>>2]|0;HEAP32[$baked+20>>2]=HEAP32[$17+20>>2]|0; $18 = $0; _nk_zero($18,68); $19 = $0; $20 = ((($19)) + 20|0); ;HEAP32[$20>>2]=HEAP32[$baked>>2]|0;HEAP32[$20+4>>2]=HEAP32[$baked+4>>2]|0;HEAP32[$20+8>>2]=HEAP32[$baked+8>>2]|0;HEAP32[$20+12>>2]=HEAP32[$baked+12>>2]|0;HEAP32[$20+16>>2]=HEAP32[$baked+16>>2]|0;HEAP32[$20+20>>2]=HEAP32[$baked+20>>2]|0; $21 = $1; $22 = $0; $23 = ((($22)) + 20|0); $24 = +HEAPF32[$23>>2]; $25 = $21 / $24; $26 = $0; $27 = ((($26)) + 44|0); HEAPF32[$27>>2] = $25; $28 = $4; $29 = ((($28)) + 12|0); $30 = HEAP32[$29>>2]|0; $31 = $3; $32 = (($31) + (($30*48)|0)|0); $33 = $0; $34 = ((($33)) + 48|0); HEAP32[$34>>2] = $32; $35 = $0; $36 = ((($35)) + 60|0); ;HEAP32[$36>>2]=HEAP32[$atlas>>2]|0; $37 = $2; $38 = $0; $39 = ((($38)) + 56|0); HEAP32[$39>>2] = $37; $40 = $0; $41 = $2; $42 = (_nk_font_find_glyph($40,$41)|0); $43 = $0; $44 = ((($43)) + 52|0); HEAP32[$44>>2] = $42; $45 = $0; $46 = ((($45)) + 20|0); $47 = +HEAPF32[$46>>2]; $48 = $0; $49 = ((($48)) + 44|0); $50 = +HEAPF32[$49>>2]; $51 = $47 * $50; $52 = $0; $53 = ((($52)) + 4|0); HEAPF32[$53>>2] = $51; $54 = $0; $55 = ((($54)) + 8|0); HEAP32[$55>>2] = 11; $56 = $0; $57 = $0; HEAP32[$57>>2] = $56; $58 = $0; $59 = ((($58)) + 12|0); HEAP32[$59>>2] = 12; $60 = $0; $61 = ((($60)) + 16|0); $62 = $0; $63 = ((($62)) + 60|0); ;HEAP32[$61>>2]=HEAP32[$63>>2]|0; STACKTOP = sp;return; } function _nk_font_text_width($handle,$height,$text,$len) { $handle = $handle|0; $height = +$height; $text = $text|0; $len = $len|0; var $$not = 0, $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0; var $44 = 0.0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $font = 0, $g = 0; var $glyph_len = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $scale = 0.0, $text_len = 0, $text_width = 0.0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $unicode = sp + 24|0; $1 = $height; $2 = $text; $3 = $len; $text_len = 0; $text_width = 0.0; $glyph_len = 0; $scale = 0.0; $4 = HEAP32[$handle>>2]|0; $font = $4; $5 = $font; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14249|0),(13400|0),9112,(31022|0)); // unreachable; } $7 = $font; $8 = ((($7)) + 48|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((15319|0),(13400|0),9113,(31022|0)); // unreachable; } $11 = $font; $12 = ($11|0)!=(0|0); $13 = $2; $14 = ($13|0)!=(0|0); $or$cond = $12 & $14; $15 = $3; $16 = ($15|0)!=(0); $or$cond3 = $or$cond & $16; if (!($or$cond3)) { $0 = 0.0; $56 = $0; STACKTOP = sp;return (+$56); } $17 = $1; $18 = $font; $19 = ((($18)) + 20|0); $20 = +HEAPF32[$19>>2]; $21 = $17 / $20; $scale = $21; $22 = $2; $23 = $3; $24 = (_nk_utf_decode($22,$unicode,$23)|0); $text_len = $24; $glyph_len = $24; $25 = $glyph_len; $26 = ($25|0)!=(0); if (!($26)) { $0 = 0.0; $56 = $0; STACKTOP = sp;return (+$56); } while(1) { $27 = $text_len; $28 = $3; $29 = ($27|0)<=($28|0); $30 = $glyph_len; $31 = ($30|0)!=(0); $32 = $29 ? $31 : 0; $$not = $32 ^ 1; $33 = HEAP32[$unicode>>2]|0; $34 = ($33|0)==(65533); $or$cond5 = $$not | $34; if ($or$cond5) { break; } $35 = $font; $36 = HEAP32[$unicode>>2]|0; $37 = (_nk_font_find_glyph($35,$36)|0); $g = $37; $38 = $g; $39 = ((($38)) + 4|0); $40 = +HEAPF32[$39>>2]; $41 = $scale; $42 = $40 * $41; $43 = $text_width; $44 = $43 + $42; $text_width = $44; $45 = $2; $46 = $text_len; $47 = (($45) + ($46)|0); $48 = $3; $49 = $text_len; $50 = (($48) - ($49))|0; $51 = (_nk_utf_decode($47,$unicode,$50)|0); $glyph_len = $51; $52 = $glyph_len; $53 = $text_len; $54 = (($53) + ($52))|0; $text_len = $54; } $55 = $text_width; $0 = $55; $56 = $0; STACKTOP = sp;return (+$56); } function _nk_font_query_font_glyph($handle,$height,$glyph,$codepoint,$next_codepoint) { $handle = $handle|0; $height = +$height; $glyph = $glyph|0; $codepoint = $codepoint|0; $next_codepoint = $next_codepoint|0; var $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0; var $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0; var $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0; var $81 = 0, $82 = 0, $83 = 0.0, $9 = 0, $font = 0, $g = 0, $or$cond = 0, $scale = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $4 = sp + 16|0; $5 = sp + 8|0; $6 = sp; $0 = $height; $1 = $glyph; $2 = $codepoint; $3 = $next_codepoint; $7 = $1; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((31041|0),(13400|0),9144,(31047|0)); // unreachable; } $9 = HEAP32[$handle>>2]|0; $font = $9; $10 = $font; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((14249|0),(13400|0),9148,(31047|0)); // unreachable; } $12 = $font; $13 = ((($12)) + 48|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((15319|0),(13400|0),9149,(31047|0)); // unreachable; } $16 = $font; $17 = ($16|0)!=(0|0); $18 = $1; $19 = ($18|0)!=(0|0); $or$cond = $17 & $19; if (!($or$cond)) { STACKTOP = sp;return; } $20 = $0; $21 = $font; $22 = ((($21)) + 20|0); $23 = +HEAPF32[$22>>2]; $24 = $20 / $23; $scale = $24; $25 = $font; $26 = $2; $27 = (_nk_font_find_glyph($25,$26)|0); $g = $27; $28 = $g; $29 = ((($28)) + 16|0); $30 = +HEAPF32[$29>>2]; $31 = $g; $32 = ((($31)) + 8|0); $33 = +HEAPF32[$32>>2]; $34 = $30 - $33; $35 = $scale; $36 = $34 * $35; $37 = $1; $38 = ((($37)) + 24|0); HEAPF32[$38>>2] = $36; $39 = $g; $40 = ((($39)) + 20|0); $41 = +HEAPF32[$40>>2]; $42 = $g; $43 = ((($42)) + 12|0); $44 = +HEAPF32[$43>>2]; $45 = $41 - $44; $46 = $scale; $47 = $45 * $46; $48 = $1; $49 = ((($48)) + 28|0); HEAPF32[$49>>2] = $47; $50 = $1; $51 = ((($50)) + 16|0); $52 = $g; $53 = ((($52)) + 8|0); $54 = +HEAPF32[$53>>2]; $55 = $scale; $56 = $54 * $55; $57 = $g; $58 = ((($57)) + 12|0); $59 = +HEAPF32[$58>>2]; $60 = $scale; $61 = $59 * $60; _nk_vec2($4,$56,$61); ;HEAP32[$51>>2]=HEAP32[$4>>2]|0;HEAP32[$51+4>>2]=HEAP32[$4+4>>2]|0; $62 = $g; $63 = ((($62)) + 4|0); $64 = +HEAPF32[$63>>2]; $65 = $scale; $66 = $64 * $65; $67 = $1; $68 = ((($67)) + 32|0); HEAPF32[$68>>2] = $66; $69 = $1; $70 = $g; $71 = ((($70)) + 32|0); $72 = +HEAPF32[$71>>2]; $73 = $g; $74 = ((($73)) + 36|0); $75 = +HEAPF32[$74>>2]; _nk_vec2($5,$72,$75); ;HEAP32[$69>>2]=HEAP32[$5>>2]|0;HEAP32[$69+4>>2]=HEAP32[$5+4>>2]|0; $76 = $1; $77 = ((($76)) + 8|0); $78 = $g; $79 = ((($78)) + 40|0); $80 = +HEAPF32[$79>>2]; $81 = $g; $82 = ((($81)) + 44|0); $83 = +HEAPF32[$82>>2]; _nk_vec2($6,$80,$83); ;HEAP32[$77>>2]=HEAP32[$6>>2]|0;HEAP32[$77+4>>2]=HEAP32[$6+4>>2]|0; STACKTOP = sp;return; } function _nk_font_config($agg$result,$pixel_height) { $agg$result = $agg$result|0; $pixel_height = +$pixel_height; var $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cfg = 0, dest = 0, label = 0, sp = 0; var src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $cfg = sp + 8|0; $1 = sp; $0 = $pixel_height; _nk_zero($cfg,44); HEAP32[$cfg>>2] = 0; $2 = ((($cfg)) + 4|0); HEAP32[$2>>2] = 0; $3 = ((($cfg)) + 8|0); HEAP8[$3>>0] = 0; $4 = $0; $5 = ((($cfg)) + 16|0); HEAPF32[$5>>2] = $4; $6 = ((($cfg)) + 12|0); HEAP8[$6>>0] = 3; $7 = ((($cfg)) + 11|0); HEAP8[$7>>0] = 1; $8 = ((($cfg)) + 10|0); HEAP8[$8>>0] = 0; $9 = ((($cfg)) + 20|0); HEAP32[$9>>2] = 0; $10 = ((($cfg)) + 24|0); _nk_vec2($1,0.0,0.0); ;HEAP32[$10>>2]=HEAP32[$1>>2]|0;HEAP32[$10+4>>2]=HEAP32[$1+4>>2]|0; $11 = (_nk_font_default_glyph_ranges()|0); $12 = ((($cfg)) + 32|0); HEAP32[$12>>2] = $11; $13 = ((($cfg)) + 40|0); HEAP32[$13>>2] = 63; $14 = ((($cfg)) + 36|0); HEAP32[$14>>2] = 0; $15 = ((($cfg)) + 9|0); HEAP8[$15>>0] = 0; dest=$agg$result; src=$cfg; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); STACKTOP = sp;return; } function _nk_font_atlas_init_default($atlas) { $atlas = $atlas|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $atlas; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((15363|0),(13400|0),9511,(15369|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; _nk_zero($5,72); $6 = $0; $7 = ((($6)) + 24|0); HEAP32[$7>>2] = 0; $8 = $0; $9 = ((($8)) + 24|0); $10 = ((($9)) + 4|0); HEAP32[$10>>2] = 7; $11 = $0; $12 = ((($11)) + 24|0); $13 = ((($12)) + 8|0); HEAP32[$13>>2] = 8; $14 = $0; $15 = ((($14)) + 12|0); HEAP32[$15>>2] = 0; $16 = $0; $17 = ((($16)) + 12|0); $18 = ((($17)) + 4|0); HEAP32[$18>>2] = 7; $19 = $0; $20 = ((($19)) + 12|0); $21 = ((($20)) + 8|0); HEAP32[$21>>2] = 8; STACKTOP = sp;return; } function _nk_font_atlas_begin($atlas) { $atlas = $atlas|0; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy1 = sp + 8|0; $$byval_copy = sp + 4|0; $0 = $atlas; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((15363|0),(13400|0),9550,(15396|0)); // unreachable; } $3 = $0; $4 = ((($3)) + 24|0); $5 = ((($4)) + 4|0); $6 = HEAP32[$5>>2]|0; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((15416|0),(13400|0),9551,(15396|0)); // unreachable; } $8 = $0; $9 = ((($8)) + 24|0); $10 = ((($9)) + 8|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((15416|0),(13400|0),9551,(15396|0)); // unreachable; } $13 = $0; $14 = ((($13)) + 12|0); $15 = ((($14)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((15464|0),(13400|0),9552,(15396|0)); // unreachable; } $18 = $0; $19 = ((($18)) + 12|0); $20 = ((($19)) + 8|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { ___assert_fail((15464|0),(13400|0),9552,(15396|0)); // unreachable; } $23 = $0; $24 = ($23|0)!=(0|0); if (!($24)) { STACKTOP = sp;return; } $25 = $0; $26 = ((($25)) + 12|0); $27 = ((($26)) + 4|0); $28 = HEAP32[$27>>2]|0; $29 = ($28|0)!=(0|0); if (!($29)) { STACKTOP = sp;return; } $30 = $0; $31 = ((($30)) + 12|0); $32 = ((($31)) + 8|0); $33 = HEAP32[$32>>2]|0; $34 = ($33|0)!=(0|0); if (!($34)) { STACKTOP = sp;return; } $35 = $0; $36 = ((($35)) + 24|0); $37 = ((($36)) + 4|0); $38 = HEAP32[$37>>2]|0; $39 = ($38|0)!=(0|0); if (!($39)) { STACKTOP = sp;return; } $40 = $0; $41 = ((($40)) + 24|0); $42 = ((($41)) + 8|0); $43 = HEAP32[$42>>2]|0; $44 = ($43|0)!=(0|0); if (!($44)) { STACKTOP = sp;return; } $45 = $0; $46 = ((($45)) + 52|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)!=(0|0); if ($48) { $49 = $0; $50 = ((($49)) + 12|0); $51 = ((($50)) + 8|0); $52 = HEAP32[$51>>2]|0; $53 = $0; $54 = ((($53)) + 12|0); $55 = $0; $56 = ((($55)) + 52|0); $57 = HEAP32[$56>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$54>>2]|0; FUNCTION_TABLE_vii[$52 & 31]($$byval_copy,$57); $58 = $0; $59 = ((($58)) + 52|0); HEAP32[$59>>2] = 0; } $60 = $0; $61 = HEAP32[$60>>2]|0; $62 = ($61|0)!=(0|0); if (!($62)) { STACKTOP = sp;return; } $63 = $0; $64 = ((($63)) + 12|0); $65 = ((($64)) + 8|0); $66 = HEAP32[$65>>2]|0; $67 = $0; $68 = ((($67)) + 12|0); $69 = $0; $70 = HEAP32[$69>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$68>>2]|0; FUNCTION_TABLE_vii[$66 & 31]($$byval_copy1,$70); $71 = $0; HEAP32[$71>>2] = 0; STACKTOP = sp;return; } function _nk_font_atlas_add($atlas,$config) { $atlas = $atlas|0; $config = $config|0; var $$byval_copy = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0; var $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0; var $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0; var $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0; var $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0; var $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0; var $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0; var $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0; var $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0; var $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $28 = 0; var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0; var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0; var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0; var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c = 0, $font = 0; var $or$cond = 0, $tmp_config = 0, $tmp_font = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 48|0; $$byval_copy5 = sp + 44|0; $$byval_copy4 = sp + 40|0; $$byval_copy3 = sp + 36|0; $$byval_copy2 = sp + 32|0; $$byval_copy = sp + 28|0; $1 = $atlas; $2 = $config; $font = 0; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((15363|0),(13400|0),9570,(15512|0)); // unreachable; } $5 = $2; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14951|0),(13400|0),9571,(15512|0)); // unreachable; } $7 = $1; $8 = ((($7)) + 12|0); $9 = ((($8)) + 4|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((15530|0),(13400|0),9572,(15512|0)); // unreachable; } $12 = $1; $13 = ((($12)) + 12|0); $14 = ((($13)) + 8|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((15553|0),(13400|0),9573,(15512|0)); // unreachable; } $17 = $1; $18 = ((($17)) + 24|0); $19 = ((($18)) + 4|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); if (!($21)) { ___assert_fail((15575|0),(13400|0),9574,(15512|0)); // unreachable; } $22 = $1; $23 = ((($22)) + 24|0); $24 = ((($23)) + 8|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0|0); if (!($26)) { ___assert_fail((15598|0),(13400|0),9575,(15512|0)); // unreachable; } $27 = $2; $28 = HEAP32[$27>>2]|0; $29 = ($28|0)!=(0|0); if (!($29)) { ___assert_fail((15620|0),(13400|0),9576,(15512|0)); // unreachable; } $30 = $2; $31 = ((($30)) + 4|0); $32 = HEAP32[$31>>2]|0; $33 = ($32|0)!=(0); if (!($33)) { ___assert_fail((15637|0),(13400|0),9577,(15512|0)); // unreachable; } $34 = $2; $35 = ((($34)) + 16|0); $36 = +HEAPF32[$35>>2]; $37 = $36 > 0.0; if (!($37)) { ___assert_fail((15654|0),(13400|0),9578,(15512|0)); // unreachable; } $38 = $1; $39 = ($38|0)!=(0|0); $40 = $2; $41 = ($40|0)!=(0|0); $or$cond = $39 & $41; if ($or$cond) { $42 = $2; $43 = HEAP32[$42>>2]|0; $44 = ($43|0)!=(0|0); if ($44) { $45 = $2; $46 = ((($45)) + 4|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)!=(0); if ($48) { $49 = $2; $50 = ((($49)) + 16|0); $51 = +HEAPF32[$50>>2]; $52 = $51 <= 0.0; if (!($52)) { $53 = $1; $54 = ((($53)) + 12|0); $55 = ((($54)) + 4|0); $56 = HEAP32[$55>>2]|0; $57 = ($56|0)!=(0|0); if ($57) { $58 = $1; $59 = ((($58)) + 12|0); $60 = ((($59)) + 8|0); $61 = HEAP32[$60>>2]|0; $62 = ($61|0)!=(0|0); if ($62) { $63 = $1; $64 = ((($63)) + 24|0); $65 = ((($64)) + 4|0); $66 = HEAP32[$65>>2]|0; $67 = ($66|0)!=(0|0); if ($67) { $68 = $1; $69 = ((($68)) + 24|0); $70 = ((($69)) + 8|0); $71 = HEAP32[$70>>2]|0; $72 = ($71|0)!=(0|0); if ($72) { $73 = $2; $74 = ((($73)) + 9|0); $75 = HEAP8[$74>>0]|0; $76 = ($75<<24>>24)!=(0); $77 = $1; do { if ($76) { $88 = ((($77)) + 64|0); $89 = HEAP32[$88>>2]|0; $90 = ($89|0)!=(0); if ($90) { $91 = $1; $92 = ((($91)) + 64|0); $93 = HEAP32[$92>>2]|0; $94 = (($93) - 1)|0; $95 = $1; $96 = ((($95)) + 56|0); $97 = HEAP32[$96>>2]|0; $98 = (($97) + ($94<<2)|0); $99 = HEAP32[$98>>2]|0; $font = $99; break; } else { ___assert_fail((15674|0),(13400|0),9591,(15512|0)); // unreachable; } } else { $78 = ((($77)) + 12|0); $79 = ((($78)) + 4|0); $80 = HEAP32[$79>>2]|0; $81 = $1; $82 = ((($81)) + 12|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$82>>2]|0; $83 = (FUNCTION_TABLE_iiii[$80 & 7]($$byval_copy,0,68)|0); $font = $83; $84 = $font; $85 = ($84|0)!=(0|0); if (!($85)) { ___assert_fail((14249|0),(13400|0),9588,(15512|0)); // unreachable; } $86 = $font; $87 = ($86|0)!=(0|0); if ($87) { break; } $0 = 0; $271 = $0; STACKTOP = sp;return ($271|0); } } while(0); $100 = $1; $101 = ((($100)) + 60|0); $102 = HEAP32[$101>>2]|0; $103 = ($102|0)!=(0|0); if ($103) { $104 = $1; $105 = ((($104)) + 64|0); $106 = HEAP32[$105>>2]|0; $107 = $1; $108 = ((($107)) + 68|0); $109 = HEAP32[$108>>2]|0; $110 = ($106|0)>=($109|0); if ($110) { label = 38; } } else { label = 38; } do { if ((label|0) == 38) { $111 = $1; $112 = ((($111)) + 60|0); $113 = HEAP32[$112>>2]|0; $114 = ($113|0)!=(0|0); if ($114) { $115 = $1; $116 = ((($115)) + 68|0); $117 = HEAP32[$116>>2]|0; $118 = (+($117|0)); $119 = $118 * 2.7000000476837158; $120 = (~~(($119))); $123 = $120; } else { $123 = 32; } $121 = $1; $122 = ((($121)) + 68|0); HEAP32[$122>>2] = $123; $124 = $1; $125 = ((($124)) + 12|0); $126 = ((($125)) + 4|0); $127 = HEAP32[$126>>2]|0; $128 = $1; $129 = ((($128)) + 12|0); $130 = $1; $131 = ((($130)) + 68|0); $132 = HEAP32[$131>>2]|0; $133 = $132<<2; ;HEAP32[$$byval_copy2>>2]=HEAP32[$129>>2]|0; $134 = (FUNCTION_TABLE_iiii[$127 & 7]($$byval_copy2,0,$133)|0); $tmp_font = $134; $135 = $1; $136 = ((($135)) + 12|0); $137 = ((($136)) + 4|0); $138 = HEAP32[$137>>2]|0; $139 = $1; $140 = ((($139)) + 12|0); $141 = $1; $142 = ((($141)) + 68|0); $143 = HEAP32[$142>>2]|0; $144 = ($143*44)|0; ;HEAP32[$$byval_copy3>>2]=HEAP32[$140>>2]|0; $145 = (FUNCTION_TABLE_iiii[$138 & 7]($$byval_copy3,0,$144)|0); $tmp_config = $145; $146 = $1; $147 = ((($146)) + 60|0); $148 = HEAP32[$147>>2]|0; $149 = ($148|0)!=(0|0); $150 = $tmp_font; if ($149) { $156 = $1; $157 = ((($156)) + 56|0); $158 = HEAP32[$157>>2]|0; $159 = $1; $160 = ((($159)) + 64|0); $161 = HEAP32[$160>>2]|0; $162 = $161<<2; (_nk_memcopy($150,$158,$162)|0); $163 = $tmp_config; $164 = $1; $165 = ((($164)) + 60|0); $166 = HEAP32[$165>>2]|0; $167 = $1; $168 = ((($167)) + 64|0); $169 = HEAP32[$168>>2]|0; $170 = ($169*44)|0; (_nk_memcopy($163,$166,$170)|0); $171 = $1; $172 = ((($171)) + 12|0); $173 = ((($172)) + 8|0); $174 = HEAP32[$173>>2]|0; $175 = $1; $176 = ((($175)) + 12|0); $177 = $1; $178 = ((($177)) + 56|0); $179 = HEAP32[$178>>2]|0; ;HEAP32[$$byval_copy4>>2]=HEAP32[$176>>2]|0; FUNCTION_TABLE_vii[$174 & 31]($$byval_copy4,$179); $180 = $1; $181 = ((($180)) + 12|0); $182 = ((($181)) + 8|0); $183 = HEAP32[$182>>2]|0; $184 = $1; $185 = ((($184)) + 12|0); $186 = $1; $187 = ((($186)) + 60|0); $188 = HEAP32[$187>>2]|0; ;HEAP32[$$byval_copy5>>2]=HEAP32[$185>>2]|0; FUNCTION_TABLE_vii[$183 & 31]($$byval_copy5,$188); $189 = $tmp_font; $190 = $1; $191 = ((($190)) + 56|0); HEAP32[$191>>2] = $189; $192 = $tmp_config; $193 = $1; $194 = ((($193)) + 60|0); HEAP32[$194>>2] = $192; break; } else { $151 = $1; $152 = ((($151)) + 56|0); HEAP32[$152>>2] = $150; $153 = $tmp_config; $154 = $1; $155 = ((($154)) + 60|0); HEAP32[$155>>2] = $153; break; } } } while(0); $195 = $1; $196 = ((($195)) + 64|0); $197 = HEAP32[$196>>2]|0; $198 = $1; $199 = ((($198)) + 60|0); $200 = HEAP32[$199>>2]|0; $201 = (($200) + (($197*44)|0)|0); $202 = $2; dest=$201; src=$202; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $203 = $2; $204 = ((($203)) + 9|0); $205 = HEAP8[$204>>0]|0; $206 = ($205<<24>>24)!=(0); if (!($206)) { $207 = $font; $208 = $1; $209 = ((($208)) + 64|0); $210 = HEAP32[$209>>2]|0; $211 = $1; $212 = ((($211)) + 56|0); $213 = HEAP32[$212>>2]|0; $214 = (($213) + ($210<<2)|0); HEAP32[$214>>2] = $207; $215 = $font; $216 = ((($215)) + 20|0); $217 = $1; $218 = ((($217)) + 64|0); $219 = HEAP32[$218>>2]|0; $220 = $1; $221 = ((($220)) + 60|0); $222 = HEAP32[$221>>2]|0; $223 = (($222) + (($219*44)|0)|0); $224 = ((($223)) + 36|0); HEAP32[$224>>2] = $216; } $225 = $2; $226 = ((($225)) + 8|0); $227 = HEAP8[$226>>0]|0; $228 = ($227<<24>>24)!=(0); do { if (!($228)) { $229 = $1; $230 = ((($229)) + 64|0); $231 = HEAP32[$230>>2]|0; $232 = $1; $233 = ((($232)) + 60|0); $234 = HEAP32[$233>>2]|0; $235 = (($234) + (($231*44)|0)|0); $c = $235; $236 = $1; $237 = ((($236)) + 12|0); $238 = ((($237)) + 4|0); $239 = HEAP32[$238>>2]|0; $240 = $1; $241 = ((($240)) + 12|0); $242 = $c; $243 = ((($242)) + 4|0); $244 = HEAP32[$243>>2]|0; ;HEAP32[$$byval_copy6>>2]=HEAP32[$241>>2]|0; $245 = (FUNCTION_TABLE_iiii[$239 & 7]($$byval_copy6,0,$244)|0); $246 = $c; HEAP32[$246>>2] = $245; $247 = $c; $248 = HEAP32[$247>>2]|0; $249 = ($248|0)!=(0|0); if (!($249)) { ___assert_fail((15690|0),(13400|0),9633,(15512|0)); // unreachable; } $250 = $c; $251 = HEAP32[$250>>2]|0; $252 = ($251|0)!=(0|0); if ($252) { $257 = $c; $258 = HEAP32[$257>>2]|0; $259 = $2; $260 = HEAP32[$259>>2]|0; $261 = $c; $262 = ((($261)) + 4|0); $263 = HEAP32[$262>>2]|0; (_nk_memcopy($258,$260,$263)|0); $264 = $c; $265 = ((($264)) + 8|0); HEAP8[$265>>0] = 1; break; } $253 = $1; $254 = ((($253)) + 64|0); $255 = HEAP32[$254>>2]|0; $256 = (($255) + 1)|0; HEAP32[$254>>2] = $256; $0 = 0; $271 = $0; STACKTOP = sp;return ($271|0); } } while(0); $266 = $1; $267 = ((($266)) + 64|0); $268 = HEAP32[$267>>2]|0; $269 = (($268) + 1)|0; HEAP32[$267>>2] = $269; $270 = $font; $0 = $270; $271 = $0; STACKTOP = sp;return ($271|0); } } } } } } } } $0 = 0; $271 = $0; STACKTOP = sp;return ($271|0); } function _nk_font_atlas_add_compressed($atlas,$compressed_data,$compressed_size,$height,$config) { $atlas = $atlas|0; $compressed_data = $compressed_data|0; $compressed_size = $compressed_size|0; $height = +$height; $config = $config|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $cfg = 0, $decompressed_data = 0, $decompressed_size = 0, $or$cond = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 120|0; $cfg = sp + 44|0; $6 = sp; $1 = $atlas; $2 = $compressed_data; $3 = $compressed_size; $4 = $height; $5 = $config; $7 = $2; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((15702|0),(13400|0),9705,(15718|0)); // unreachable; } $9 = $3; $10 = ($9|0)!=(0); if (!($10)) { ___assert_fail((15747|0),(13400|0),9706,(15718|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((15363|0),(13400|0),9707,(15718|0)); // unreachable; } $13 = $1; $14 = ((($13)) + 24|0); $15 = ((($14)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((15575|0),(13400|0),9708,(15718|0)); // unreachable; } $18 = $1; $19 = ((($18)) + 24|0); $20 = ((($19)) + 8|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { ___assert_fail((15598|0),(13400|0),9709,(15718|0)); // unreachable; } $23 = $1; $24 = ((($23)) + 12|0); $25 = ((($24)) + 4|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)!=(0|0); if (!($27)) { ___assert_fail((15530|0),(13400|0),9710,(15718|0)); // unreachable; } $28 = $1; $29 = ((($28)) + 12|0); $30 = ((($29)) + 8|0); $31 = HEAP32[$30>>2]|0; $32 = ($31|0)!=(0|0); if (!($32)) { ___assert_fail((15553|0),(13400|0),9711,(15718|0)); // unreachable; } $33 = $1; $34 = ($33|0)!=(0|0); $35 = $2; $36 = ($35|0)!=(0|0); $or$cond = $34 & $36; if ($or$cond) { $37 = $1; $38 = ((($37)) + 24|0); $39 = ((($38)) + 4|0); $40 = HEAP32[$39>>2]|0; $41 = ($40|0)!=(0|0); if ($41) { $42 = $1; $43 = ((($42)) + 24|0); $44 = ((($43)) + 8|0); $45 = HEAP32[$44>>2]|0; $46 = ($45|0)!=(0|0); if ($46) { $47 = $1; $48 = ((($47)) + 12|0); $49 = ((($48)) + 4|0); $50 = HEAP32[$49>>2]|0; $51 = ($50|0)!=(0|0); if ($51) { $52 = $1; $53 = ((($52)) + 12|0); $54 = ((($53)) + 8|0); $55 = HEAP32[$54>>2]|0; $56 = ($55|0)!=(0|0); if ($56) { $57 = $2; $58 = (_nk_decompress_length($57)|0); $decompressed_size = $58; $59 = $1; $60 = ((($59)) + 12|0); $61 = ((($60)) + 4|0); $62 = HEAP32[$61>>2]|0; $63 = $1; $64 = ((($63)) + 12|0); $65 = $decompressed_size; ;HEAP32[$$byval_copy>>2]=HEAP32[$64>>2]|0; $66 = (FUNCTION_TABLE_iiii[$62 & 7]($$byval_copy,0,$65)|0); $decompressed_data = $66; $67 = $decompressed_data; $68 = ($67|0)!=(0|0); if (!($68)) { ___assert_fail((15763|0),(13400|0),9718,(15718|0)); // unreachable; } $69 = $decompressed_data; $70 = ($69|0)!=(0|0); if (!($70)) { $0 = 0; $86 = $0; STACKTOP = sp;return ($86|0); } $71 = $decompressed_data; $72 = $2; $73 = $3; (_nk_decompress($71,$72,$73)|0); $74 = $5; $75 = ($74|0)!=(0|0); if ($75) { $76 = $5; dest=$cfg; src=$76; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); } else { $77 = $4; _nk_font_config($6,$77); dest=$cfg; src=$6; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); } $78 = $decompressed_data; HEAP32[$cfg>>2] = $78; $79 = $decompressed_size; $80 = ((($cfg)) + 4|0); HEAP32[$80>>2] = $79; $81 = $4; $82 = ((($cfg)) + 16|0); HEAPF32[$82>>2] = $81; $83 = ((($cfg)) + 8|0); HEAP8[$83>>0] = 1; $84 = $1; $85 = (_nk_font_atlas_add($84,$cfg)|0); $0 = $85; $86 = $0; STACKTOP = sp;return ($86|0); } } } } } $0 = 0; $86 = $0; STACKTOP = sp;return ($86|0); } function _nk_decompress_length($input) { $input = $input|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $input; $1 = $0; $2 = ((($1)) + 8|0); $3 = HEAP8[$2>>0]|0; $4 = $3&255; $5 = $4 << 24; $6 = $0; $7 = ((($6)) + 9|0); $8 = HEAP8[$7>>0]|0; $9 = $8&255; $10 = $9 << 16; $11 = (($5) + ($10))|0; $12 = $0; $13 = ((($12)) + 10|0); $14 = HEAP8[$13>>0]|0; $15 = $14&255; $16 = $15 << 8; $17 = (($11) + ($16))|0; $18 = $0; $19 = ((($18)) + 11|0); $20 = HEAP8[$19>>0]|0; $21 = $20&255; $22 = (($17) + ($21))|0; STACKTOP = sp;return ($22|0); } function _nk_decompress($output,$i,$length) { $output = $output|0; $i = $i|0; $length = $length|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0; var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0; var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0; var $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $old_i = 0, $olen = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $output; $2 = $i; $3 = $length; $4 = $2; $5 = HEAP8[$4>>0]|0; $6 = $5&255; $7 = $6 << 24; $8 = $2; $9 = ((($8)) + 1|0); $10 = HEAP8[$9>>0]|0; $11 = $10&255; $12 = $11 << 16; $13 = $2; $14 = ((($13)) + 2|0); $15 = HEAP8[$14>>0]|0; $16 = $15&255; $17 = $16 << 8; $18 = $2; $19 = ((($18)) + 3|0); $20 = HEAP8[$19>>0]|0; $21 = $20&255; $22 = (($17) + ($21))|0; $23 = (($12) + ($22))|0; $24 = (($7) + ($23))|0; $25 = ($24|0)!=(1471938560); if ($25) { $0 = 0; $124 = $0; STACKTOP = sp;return ($124|0); } $26 = $2; $27 = ((($26)) + 4|0); $28 = HEAP8[$27>>0]|0; $29 = $28&255; $30 = $29 << 24; $31 = $2; $32 = ((($31)) + 5|0); $33 = HEAP8[$32>>0]|0; $34 = $33&255; $35 = $34 << 16; $36 = $2; $37 = ((($36)) + 6|0); $38 = HEAP8[$37>>0]|0; $39 = $38&255; $40 = $39 << 8; $41 = $2; $42 = ((($41)) + 7|0); $43 = HEAP8[$42>>0]|0; $44 = $43&255; $45 = (($40) + ($44))|0; $46 = (($35) + ($45))|0; $47 = (($30) + ($46))|0; $48 = ($47|0)!=(0); if ($48) { $0 = 0; $124 = $0; STACKTOP = sp;return ($124|0); } $49 = $2; $50 = (_nk_decompress_length($49)|0); $olen = $50; $51 = $2; HEAP32[12588>>2] = $51; $52 = $2; $53 = $3; $54 = (($52) + ($53)|0); HEAP32[12592>>2] = $54; $55 = $1; $56 = $olen; $57 = (($55) + ($56)|0); HEAP32[12596>>2] = $57; $58 = $1; HEAP32[12600>>2] = $58; $59 = $2; $60 = ((($59)) + 16|0); $2 = $60; $61 = $1; HEAP32[12604>>2] = $61; while(1) { $62 = $2; $old_i = $62; $63 = $2; $64 = (_nk_decompress_token($63)|0); $2 = $64; $65 = $2; $66 = $old_i; $67 = ($65|0)==($66|0); if ($67) { label = 7; break; } $114 = HEAP32[12604>>2]|0; $115 = $1; $116 = $olen; $117 = (($115) + ($116)|0); $118 = ($114>>>0)<=($117>>>0); if (!($118)) { label = 18; break; } $119 = HEAP32[12604>>2]|0; $120 = $1; $121 = $olen; $122 = (($120) + ($121)|0); $123 = ($119>>>0)>($122>>>0); if ($123) { label = 20; break; } } if ((label|0) == 7) { $68 = $2; $69 = HEAP8[$68>>0]|0; $70 = $69&255; $71 = ($70|0)==(5); if (!($71)) { ___assert_fail((30507|0),(13400|0),9444,(31098|0)); // unreachable; } $72 = $2; $73 = ((($72)) + 1|0); $74 = HEAP8[$73>>0]|0; $75 = $74&255; $76 = ($75|0)==(250); if (!($76)) { ___assert_fail((30507|0),(13400|0),9444,(31098|0)); // unreachable; } $77 = HEAP32[12604>>2]|0; $78 = $1; $79 = $olen; $80 = (($78) + ($79)|0); $81 = ($77|0)==($80|0); if (!($81)) { ___assert_fail((31072|0),(13400|0),9438,(31098|0)); // unreachable; } $82 = HEAP32[12604>>2]|0; $83 = $1; $84 = $olen; $85 = (($83) + ($84)|0); $86 = ($82|0)!=($85|0); if ($86) { $0 = 0; $124 = $0; STACKTOP = sp;return ($124|0); } $87 = $1; $88 = $olen; $89 = (_nk_adler32(1,$87,$88)|0); $90 = $2; $91 = ((($90)) + 2|0); $92 = HEAP8[$91>>0]|0; $93 = $92&255; $94 = $93 << 24; $95 = $2; $96 = ((($95)) + 3|0); $97 = HEAP8[$96>>0]|0; $98 = $97&255; $99 = $98 << 16; $100 = $2; $101 = ((($100)) + 4|0); $102 = HEAP8[$101>>0]|0; $103 = $102&255; $104 = $103 << 8; $105 = $2; $106 = ((($105)) + 5|0); $107 = HEAP8[$106>>0]|0; $108 = $107&255; $109 = (($104) + ($108))|0; $110 = (($99) + ($109))|0; $111 = (($94) + ($110))|0; $112 = ($89|0)!=($111|0); if ($112) { $0 = 0; $124 = $0; STACKTOP = sp;return ($124|0); } else { $113 = $olen; $0 = $113; $124 = $0; STACKTOP = sp;return ($124|0); } } else if ((label|0) == 18) { ___assert_fail((31112|0),(13400|0),9448,(31098|0)); // unreachable; } else if ((label|0) == 20) { $0 = 0; $124 = $0; STACKTOP = sp;return ($124|0); } return (0)|0; } function _nk_font_atlas_add_compressed_base85($atlas,$data_base85,$height,$config) { $atlas = $atlas|0; $data_base85 = $data_base85|0; $height = +$height; $config = $config|0; var $$byval_copy = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $compressed_data = 0, $compressed_size = 0, $font = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy2 = sp + 36|0; $$byval_copy = sp + 32|0; $1 = $atlas; $2 = $data_base85; $3 = $height; $4 = $config; $5 = $2; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((15781|0),(13400|0),9739,(15793|0)); // unreachable; } $7 = $1; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((15363|0),(13400|0),9740,(15793|0)); // unreachable; } $9 = $1; $10 = ((($9)) + 24|0); $11 = ((($10)) + 4|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((15575|0),(13400|0),9741,(15793|0)); // unreachable; } $14 = $1; $15 = ((($14)) + 24|0); $16 = ((($15)) + 8|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0|0); if (!($18)) { ___assert_fail((15598|0),(13400|0),9742,(15793|0)); // unreachable; } $19 = $1; $20 = ((($19)) + 12|0); $21 = ((($20)) + 4|0); $22 = HEAP32[$21>>2]|0; $23 = ($22|0)!=(0|0); if (!($23)) { ___assert_fail((15530|0),(13400|0),9743,(15793|0)); // unreachable; } $24 = $1; $25 = ((($24)) + 12|0); $26 = ((($25)) + 8|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if (!($28)) { ___assert_fail((15553|0),(13400|0),9744,(15793|0)); // unreachable; } $29 = $1; $30 = ($29|0)!=(0|0); $31 = $2; $32 = ($31|0)!=(0|0); $or$cond = $30 & $32; if ($or$cond) { $33 = $1; $34 = ((($33)) + 24|0); $35 = ((($34)) + 4|0); $36 = HEAP32[$35>>2]|0; $37 = ($36|0)!=(0|0); if ($37) { $38 = $1; $39 = ((($38)) + 24|0); $40 = ((($39)) + 8|0); $41 = HEAP32[$40>>2]|0; $42 = ($41|0)!=(0|0); if ($42) { $43 = $1; $44 = ((($43)) + 12|0); $45 = ((($44)) + 4|0); $46 = HEAP32[$45>>2]|0; $47 = ($46|0)!=(0|0); if ($47) { $48 = $1; $49 = ((($48)) + 12|0); $50 = ((($49)) + 8|0); $51 = HEAP32[$50>>2]|0; $52 = ($51|0)!=(0|0); if ($52) { $53 = $2; $54 = (_nk_strlen($53)|0); $55 = (($54) + 4)|0; $56 = (($55|0) / 5)&-1; $57 = $56<<2; $compressed_size = $57; $58 = $1; $59 = ((($58)) + 24|0); $60 = ((($59)) + 4|0); $61 = HEAP32[$60>>2]|0; $62 = $1; $63 = ((($62)) + 24|0); $64 = $compressed_size; ;HEAP32[$$byval_copy>>2]=HEAP32[$63>>2]|0; $65 = (FUNCTION_TABLE_iiii[$61 & 7]($$byval_copy,0,$64)|0); $compressed_data = $65; $66 = $compressed_data; $67 = ($66|0)!=(0|0); if (!($67)) { ___assert_fail((15702|0),(13400|0),9751,(15793|0)); // unreachable; } $68 = $compressed_data; $69 = ($68|0)!=(0|0); if ($69) { $70 = $compressed_data; $71 = $2; _nk_decode_85($70,$71); $72 = $1; $73 = $compressed_data; $74 = $compressed_size; $75 = $3; $76 = $4; $77 = (_nk_font_atlas_add_compressed($72,$73,$74,$75,$76)|0); $font = $77; $78 = $1; $79 = ((($78)) + 24|0); $80 = ((($79)) + 8|0); $81 = HEAP32[$80>>2]|0; $82 = $1; $83 = ((($82)) + 24|0); $84 = $compressed_data; ;HEAP32[$$byval_copy2>>2]=HEAP32[$83>>2]|0; FUNCTION_TABLE_vii[$81 & 31]($$byval_copy2,$84); $85 = $font; $0 = $85; $86 = $0; STACKTOP = sp;return ($86|0); } else { $0 = 0; $86 = $0; STACKTOP = sp;return ($86|0); } } } } } } $0 = 0; $86 = $0; STACKTOP = sp;return ($86|0); } function _nk_decode_85($dst,$src) { $dst = $dst|0; $src = $src|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tmp = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $dst; $1 = $src; while(1) { $2 = $1; $3 = HEAP8[$2>>0]|0; $4 = ($3<<24>>24)!=(0); if (!($4)) { break; } $5 = $1; $6 = HEAP8[$5>>0]|0; $7 = (_nk_decode_85_byte($6)|0); $8 = $1; $9 = ((($8)) + 1|0); $10 = HEAP8[$9>>0]|0; $11 = (_nk_decode_85_byte($10)|0); $12 = $1; $13 = ((($12)) + 2|0); $14 = HEAP8[$13>>0]|0; $15 = (_nk_decode_85_byte($14)|0); $16 = $1; $17 = ((($16)) + 3|0); $18 = HEAP8[$17>>0]|0; $19 = (_nk_decode_85_byte($18)|0); $20 = $1; $21 = ((($20)) + 4|0); $22 = HEAP8[$21>>0]|0; $23 = (_nk_decode_85_byte($22)|0); $24 = ($23*85)|0; $25 = (($19) + ($24))|0; $26 = ($25*85)|0; $27 = (($15) + ($26))|0; $28 = ($27*85)|0; $29 = (($11) + ($28))|0; $30 = ($29*85)|0; $31 = (($7) + ($30))|0; $tmp = $31; $32 = $tmp; $33 = $32 >>> 0; $34 = $33 & 255; $35 = $34&255; $36 = $0; HEAP8[$36>>0] = $35; $37 = $tmp; $38 = $37 >>> 8; $39 = $38 & 255; $40 = $39&255; $41 = $0; $42 = ((($41)) + 1|0); HEAP8[$42>>0] = $40; $43 = $tmp; $44 = $43 >>> 16; $45 = $44 & 255; $46 = $45&255; $47 = $0; $48 = ((($47)) + 2|0); HEAP8[$48>>0] = $46; $49 = $tmp; $50 = $49 >>> 24; $51 = $50 & 255; $52 = $51&255; $53 = $0; $54 = ((($53)) + 3|0); HEAP8[$54>>0] = $52; $55 = $1; $56 = ((($55)) + 5|0); $1 = $56; $57 = $0; $58 = ((($57)) + 4|0); $0 = $58; } STACKTOP = sp;return; } function _nk_font_atlas_add_default($atlas,$pixel_height,$config) { $atlas = $atlas|0; $pixel_height = +$pixel_height; $config = $config|0; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $atlas; $1 = $pixel_height; $2 = $config; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((15363|0),(13400|0),9765,(15829|0)); // unreachable; } $5 = $0; $6 = ((($5)) + 24|0); $7 = ((($6)) + 4|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((15575|0),(13400|0),9766,(15829|0)); // unreachable; } $10 = $0; $11 = ((($10)) + 24|0); $12 = ((($11)) + 8|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((15598|0),(13400|0),9767,(15829|0)); // unreachable; } $15 = $0; $16 = ((($15)) + 12|0); $17 = ((($16)) + 4|0); $18 = HEAP32[$17>>2]|0; $19 = ($18|0)!=(0|0); if (!($19)) { ___assert_fail((15530|0),(13400|0),9768,(15829|0)); // unreachable; } $20 = $0; $21 = ((($20)) + 12|0); $22 = ((($21)) + 8|0); $23 = HEAP32[$22>>2]|0; $24 = ($23|0)!=(0|0); if ($24) { $25 = $0; $26 = $1; $27 = $2; $28 = (_nk_font_atlas_add_compressed_base85($25,15855,$26,$27)|0); STACKTOP = sp;return ($28|0); } else { ___assert_fail((15553|0),(13400|0),9769,(15829|0)); // unreachable; } return (0)|0; } function _nk_font_atlas_bake($atlas,$width,$height,$fmt) { $atlas = $atlas|0; $width = $width|0; $height = $height|0; $fmt = $fmt|0; var $$byval_copy = 0, $$byval_copy10 = 0, $$byval_copy11 = 0, $$byval_copy12 = 0, $$byval_copy13 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy8 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0; var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0; var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0; var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0; var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0; var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0; var $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0; var $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0; var $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0.0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0; var $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0; var $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0; var $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0; var $304 = 0, $305 = 0, $306 = 0, $307 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0; var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0; var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0; var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $custom_data = 0; var $i = 0, $img_rgba = 0, $img_size = 0, $or$cond = 0, $or$cond3 = 0, $tmp = 0, $tmp_size = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy13 = sp + 84|0; $$byval_copy12 = sp + 80|0; $$byval_copy11 = sp + 76|0; $$byval_copy10 = sp + 72|0; $$byval_copy9 = sp + 68|0; $$byval_copy8 = sp + 64|0; $$byval_copy7 = sp + 60|0; $$byval_copy6 = sp + 88|0; $$byval_copy5 = sp + 56|0; $$byval_copy4 = sp + 52|0; $$byval_copy = sp + 48|0; $tmp_size = sp + 16|0; $img_size = sp + 12|0; $5 = sp; $1 = $atlas; $2 = $width; $3 = $height; $4 = $fmt; $i = 0; $tmp = 0; $6 = $2; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((15021|0),(13400|0),9783,(27836|0)); // unreachable; } $8 = $3; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((15027|0),(13400|0),9784,(27836|0)); // unreachable; } $10 = $1; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((15363|0),(13400|0),9785,(27836|0)); // unreachable; } $12 = $1; $13 = ((($12)) + 24|0); $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((15575|0),(13400|0),9786,(27836|0)); // unreachable; } $17 = $1; $18 = ((($17)) + 24|0); $19 = ((($18)) + 8|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); if (!($21)) { ___assert_fail((15598|0),(13400|0),9787,(27836|0)); // unreachable; } $22 = $1; $23 = ((($22)) + 12|0); $24 = ((($23)) + 4|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0|0); if (!($26)) { ___assert_fail((15530|0),(13400|0),9788,(27836|0)); // unreachable; } $27 = $1; $28 = ((($27)) + 12|0); $29 = ((($28)) + 8|0); $30 = HEAP32[$29>>2]|0; $31 = ($30|0)!=(0|0); if (!($31)) { ___assert_fail((15553|0),(13400|0),9789,(27836|0)); // unreachable; } $32 = $1; $33 = ($32|0)!=(0|0); $34 = $2; $35 = ($34|0)!=(0|0); $or$cond = $33 & $35; $36 = $3; $37 = ($36|0)!=(0|0); $or$cond3 = $or$cond & $37; if ($or$cond3) { $38 = $1; $39 = ((($38)) + 24|0); $40 = ((($39)) + 4|0); $41 = HEAP32[$40>>2]|0; $42 = ($41|0)!=(0|0); if ($42) { $43 = $1; $44 = ((($43)) + 24|0); $45 = ((($44)) + 8|0); $46 = HEAP32[$45>>2]|0; $47 = ($46|0)!=(0|0); if ($47) { $48 = $1; $49 = ((($48)) + 12|0); $50 = ((($49)) + 4|0); $51 = HEAP32[$50>>2]|0; $52 = ($51|0)!=(0|0); if ($52) { $53 = $1; $54 = ((($53)) + 12|0); $55 = ((($54)) + 8|0); $56 = HEAP32[$55>>2]|0; $57 = ($56|0)!=(0|0); if ($57) { $58 = $1; $59 = ((($58)) + 64|0); $60 = HEAP32[$59>>2]|0; $61 = ($60|0)!=(0); if (!($61)) { $62 = $1; $63 = (_nk_font_atlas_add_default($62,13.0,0)|0); $64 = $1; $65 = ((($64)) + 48|0); HEAP32[$65>>2] = $63; } $66 = $1; $67 = ((($66)) + 64|0); $68 = HEAP32[$67>>2]|0; $69 = ($68|0)!=(0); if (!($69)) { ___assert_fail((15674|0),(13400|0),9800,(27836|0)); // unreachable; } $70 = $1; $71 = ((($70)) + 64|0); $72 = HEAP32[$71>>2]|0; $73 = ($72|0)!=(0); if (!($73)) { $0 = 0; $307 = $0; STACKTOP = sp;return ($307|0); } $74 = $1; $75 = ((($74)) + 44|0); $76 = $1; $77 = ((($76)) + 60|0); $78 = HEAP32[$77>>2]|0; $79 = $1; $80 = ((($79)) + 64|0); $81 = HEAP32[$80>>2]|0; _nk_font_bake_memory($tmp_size,$75,$78,$81); $82 = $1; $83 = ((($82)) + 24|0); $84 = ((($83)) + 4|0); $85 = HEAP32[$84>>2]|0; $86 = $1; $87 = ((($86)) + 24|0); $88 = HEAP32[$tmp_size>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$87>>2]|0; $89 = (FUNCTION_TABLE_iiii[$85 & 7]($$byval_copy,0,$88)|0); $tmp = $89; $90 = $tmp; $91 = ($90|0)!=(0|0); if (!($91)) { ___assert_fail((27855|0),(13400|0),9806,(27836|0)); // unreachable; } $92 = $tmp; $93 = ($92|0)!=(0|0); do { if ($93) { $94 = $1; $95 = ((($94)) + 12|0); $96 = ((($95)) + 4|0); $97 = HEAP32[$96>>2]|0; $98 = $1; $99 = ((($98)) + 12|0); $100 = $1; $101 = ((($100)) + 44|0); $102 = HEAP32[$101>>2]|0; $103 = ($102*48)|0; ;HEAP32[$$byval_copy4>>2]=HEAP32[$99>>2]|0; $104 = (FUNCTION_TABLE_iiii[$97 & 7]($$byval_copy4,0,$103)|0); $105 = $1; $106 = ((($105)) + 52|0); HEAP32[$106>>2] = $104; $107 = $1; $108 = ((($107)) + 52|0); $109 = HEAP32[$108>>2]|0; $110 = ($109|0)!=(0|0); if (!($110)) { ___assert_fail((27859|0),(13400|0),9813,(27836|0)); // unreachable; } $111 = $1; $112 = ((($111)) + 52|0); $113 = HEAP32[$112>>2]|0; $114 = ($113|0)!=(0|0); if (!($114)) { break; } $115 = $1; $116 = ((($115)) + 36|0); $117 = ((($116)) + 4|0); HEAP16[$117>>1] = 2; $118 = $1; $119 = ((($118)) + 36|0); $120 = ((($119)) + 6|0); HEAP16[$120>>1] = 2; $121 = $2; $122 = $3; $123 = $1; $124 = ((($123)) + 36|0); $125 = $tmp; $126 = HEAP32[$tmp_size>>2]|0; $127 = $1; $128 = ((($127)) + 60|0); $129 = HEAP32[$128>>2]|0; $130 = $1; $131 = ((($130)) + 64|0); $132 = HEAP32[$131>>2]|0; $133 = $1; $134 = ((($133)) + 24|0); $135 = (_nk_font_bake_pack($img_size,$121,$122,$124,$125,$126,$129,$132,$134)|0); $136 = ($135|0)!=(0); if (!($136)) { break; } $137 = $1; $138 = ((($137)) + 24|0); $139 = ((($138)) + 4|0); $140 = HEAP32[$139>>2]|0; $141 = $1; $142 = ((($141)) + 24|0); $143 = HEAP32[$img_size>>2]|0; ;HEAP32[$$byval_copy5>>2]=HEAP32[$142>>2]|0; $144 = (FUNCTION_TABLE_iiii[$140 & 7]($$byval_copy5,0,$143)|0); $145 = $1; HEAP32[$145>>2] = $144; $146 = $1; $147 = HEAP32[$146>>2]|0; $148 = ($147|0)!=(0|0); if (!($148)) { ___assert_fail((27873|0),(13400|0),9825,(27836|0)); // unreachable; } $149 = $1; $150 = HEAP32[$149>>2]|0; $151 = ($150|0)!=(0|0); if (!($151)) { break; } $custom_data = 27886; $152 = $1; $153 = HEAP32[$152>>2]|0; $154 = $2; $155 = HEAP32[$154>>2]|0; $156 = $3; $157 = HEAP32[$156>>2]|0; $158 = $tmp; $159 = HEAP32[$tmp_size>>2]|0; $160 = $1; $161 = ((($160)) + 52|0); $162 = HEAP32[$161>>2]|0; $163 = $1; $164 = ((($163)) + 44|0); $165 = HEAP32[$164>>2]|0; $166 = $1; $167 = ((($166)) + 60|0); $168 = HEAP32[$167>>2]|0; $169 = $1; $170 = ((($169)) + 64|0); $171 = HEAP32[$170>>2]|0; _nk_font_bake($153,$155,$157,$158,$159,$162,$165,$168,$171); $172 = $1; $173 = HEAP32[$172>>2]|0; $174 = $2; $175 = HEAP32[$174>>2]|0; $176 = $3; $177 = HEAP32[$176>>2]|0; $178 = $1; $179 = ((($178)) + 36|0); $180 = $custom_data; ;HEAP16[$$byval_copy6>>1]=HEAP16[$179>>1]|0;HEAP16[$$byval_copy6+2>>1]=HEAP16[$179+2>>1]|0;HEAP16[$$byval_copy6+4>>1]=HEAP16[$179+4>>1]|0;HEAP16[$$byval_copy6+6>>1]=HEAP16[$179+6>>1]|0; _nk_font_bake_custom_data($173,$175,$177,$$byval_copy6,$180,2,2,46,88); $181 = $4; $182 = ($181|0)==(1); if ($182) { $183 = $1; $184 = ((($183)) + 24|0); $185 = ((($184)) + 4|0); $186 = HEAP32[$185>>2]|0; $187 = $1; $188 = ((($187)) + 24|0); $189 = $2; $190 = HEAP32[$189>>2]|0; $191 = $3; $192 = HEAP32[$191>>2]|0; $193 = Math_imul($190, $192)|0; $194 = $193<<2; ;HEAP32[$$byval_copy7>>2]=HEAP32[$188>>2]|0; $195 = (FUNCTION_TABLE_iiii[$186 & 7]($$byval_copy7,0,$194)|0); $img_rgba = $195; $196 = $img_rgba; $197 = ($196|0)!=(0|0); if (!($197)) { ___assert_fail((27891|0),(13400|0),9840,(27836|0)); // unreachable; } $198 = $img_rgba; $199 = ($198|0)!=(0|0); if (!($199)) { break; } $200 = $img_rgba; $201 = $2; $202 = HEAP32[$201>>2]|0; $203 = $3; $204 = HEAP32[$203>>2]|0; $205 = $1; $206 = HEAP32[$205>>2]|0; _nk_font_bake_convert($200,$202,$204,$206); $207 = $1; $208 = ((($207)) + 24|0); $209 = ((($208)) + 8|0); $210 = HEAP32[$209>>2]|0; $211 = $1; $212 = ((($211)) + 24|0); $213 = $1; $214 = HEAP32[$213>>2]|0; ;HEAP32[$$byval_copy8>>2]=HEAP32[$212>>2]|0; FUNCTION_TABLE_vii[$210 & 31]($$byval_copy8,$214); $215 = $img_rgba; $216 = $1; HEAP32[$216>>2] = $215; } $217 = $2; $218 = HEAP32[$217>>2]|0; $219 = $1; $220 = ((($219)) + 4|0); HEAP32[$220>>2] = $218; $221 = $3; $222 = HEAP32[$221>>2]|0; $223 = $1; $224 = ((($223)) + 8|0); HEAP32[$224>>2] = $222; $i = 0; while(1) { $225 = $i; $226 = $1; $227 = ((($226)) + 64|0); $228 = HEAP32[$227>>2]|0; $229 = ($225|0)<($228|0); if (!($229)) { break; } $230 = $i; $231 = $1; $232 = ((($231)) + 56|0); $233 = HEAP32[$232>>2]|0; $234 = (($233) + ($230<<2)|0); $235 = HEAP32[$234>>2]|0; $236 = $i; $237 = $1; $238 = ((($237)) + 60|0); $239 = HEAP32[$238>>2]|0; $240 = (($239) + (($236*44)|0)|0); $241 = ((($240)) + 16|0); $242 = +HEAPF32[$241>>2]; $243 = $i; $244 = $1; $245 = ((($244)) + 60|0); $246 = HEAP32[$245>>2]|0; $247 = (($246) + (($243*44)|0)|0); $248 = ((($247)) + 40|0); $249 = HEAP32[$248>>2]|0; $250 = $1; $251 = ((($250)) + 52|0); $252 = HEAP32[$251>>2]|0; $253 = $i; $254 = $1; $255 = ((($254)) + 60|0); $256 = HEAP32[$255>>2]|0; $257 = (($256) + (($253*44)|0)|0); $258 = ((($257)) + 36|0); $259 = HEAP32[$258>>2]|0; _nk_handle_ptr($5,0); ;HEAP32[$$byval_copy9>>2]=HEAP32[$5>>2]|0; _nk_font_init($235,$242,$249,$252,$259,$$byval_copy9); $260 = $i; $261 = (($260) + 1)|0; $i = $261; } $262 = $1; $263 = ((($262)) + 24|0); $264 = ((($263)) + 8|0); $265 = HEAP32[$264>>2]|0; $266 = $1; $267 = ((($266)) + 24|0); $268 = $tmp; ;HEAP32[$$byval_copy10>>2]=HEAP32[$267>>2]|0; FUNCTION_TABLE_vii[$265 & 31]($$byval_copy10,$268); $269 = $1; $270 = HEAP32[$269>>2]|0; $0 = $270; $307 = $0; STACKTOP = sp;return ($307|0); } } while(0); $271 = $tmp; $272 = ($271|0)!=(0|0); if ($272) { $273 = $1; $274 = ((($273)) + 24|0); $275 = ((($274)) + 8|0); $276 = HEAP32[$275>>2]|0; $277 = $1; $278 = ((($277)) + 24|0); $279 = $tmp; ;HEAP32[$$byval_copy11>>2]=HEAP32[$278>>2]|0; FUNCTION_TABLE_vii[$276 & 31]($$byval_copy11,$279); } $280 = $1; $281 = ((($280)) + 52|0); $282 = HEAP32[$281>>2]|0; $283 = ($282|0)!=(0|0); if ($283) { $284 = $1; $285 = ((($284)) + 12|0); $286 = ((($285)) + 8|0); $287 = HEAP32[$286>>2]|0; $288 = $1; $289 = ((($288)) + 12|0); $290 = $1; $291 = ((($290)) + 52|0); $292 = HEAP32[$291>>2]|0; ;HEAP32[$$byval_copy12>>2]=HEAP32[$289>>2]|0; FUNCTION_TABLE_vii[$287 & 31]($$byval_copy12,$292); $293 = $1; $294 = ((($293)) + 52|0); HEAP32[$294>>2] = 0; } $295 = $1; $296 = HEAP32[$295>>2]|0; $297 = ($296|0)!=(0|0); if ($297) { $298 = $1; $299 = ((($298)) + 24|0); $300 = ((($299)) + 8|0); $301 = HEAP32[$300>>2]|0; $302 = $1; $303 = ((($302)) + 24|0); $304 = $1; $305 = HEAP32[$304>>2]|0; ;HEAP32[$$byval_copy13>>2]=HEAP32[$303>>2]|0; FUNCTION_TABLE_vii[$301 & 31]($$byval_copy13,$305); $306 = $1; HEAP32[$306>>2] = 0; } $0 = 0; $307 = $0; STACKTOP = sp;return ($307|0); } } } } } $0 = 0; $307 = $0; STACKTOP = sp;return ($307|0); } function _nk_font_atlas_end($atlas,$texture,$null) { $atlas = $atlas|0; $texture = $texture|0; $null = $null|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 28|0; $2 = sp + 8|0; $3 = sp; $0 = $atlas; $1 = $null; $i = 0; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((15363|0),(13400|0),9879,(27900|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); do { if (!($7)) { $8 = $1; $9 = ($8|0)!=(0|0); if ($9) { $10 = $1; ;HEAP32[$10>>2]=HEAP32[$texture>>2]|0; $11 = $1; $12 = ((($11)) + 4|0); _nk_vec2($2,0.5,0.5); ;HEAP32[$12>>2]=HEAP32[$2>>2]|0;HEAP32[$12+4>>2]=HEAP32[$2+4>>2]|0; break; } else { STACKTOP = sp;return; } } } while(0); $13 = $1; $14 = ($13|0)!=(0|0); if ($14) { $15 = $1; ;HEAP32[$15>>2]=HEAP32[$texture>>2]|0; $16 = $1; $17 = ((($16)) + 4|0); $18 = $0; $19 = ((($18)) + 36|0); $20 = HEAP16[$19>>1]|0; $21 = $20 << 16 >> 16; $22 = (+($21|0)); $23 = $22 + 0.5; $24 = $0; $25 = ((($24)) + 4|0); $26 = HEAP32[$25>>2]|0; $27 = (+($26|0)); $28 = $23 / $27; $29 = $0; $30 = ((($29)) + 36|0); $31 = ((($30)) + 2|0); $32 = HEAP16[$31>>1]|0; $33 = $32 << 16 >> 16; $34 = (+($33|0)); $35 = $34 + 0.5; $36 = $0; $37 = ((($36)) + 8|0); $38 = HEAP32[$37>>2]|0; $39 = (+($38|0)); $40 = $35 / $39; _nk_vec2($3,$28,$40); ;HEAP32[$17>>2]=HEAP32[$3>>2]|0;HEAP32[$17+4>>2]=HEAP32[$3+4>>2]|0; } $i = 0; while(1) { $41 = $i; $42 = $0; $43 = ((($42)) + 64|0); $44 = HEAP32[$43>>2]|0; $45 = ($41|0)<($44|0); if (!($45)) { break; } $46 = $i; $47 = $0; $48 = ((($47)) + 56|0); $49 = HEAP32[$48>>2]|0; $50 = (($49) + ($46<<2)|0); $51 = HEAP32[$50>>2]|0; $52 = ((($51)) + 60|0); ;HEAP32[$52>>2]=HEAP32[$texture>>2]|0; $53 = $i; $54 = $0; $55 = ((($54)) + 56|0); $56 = HEAP32[$55>>2]|0; $57 = (($56) + ($53<<2)|0); $58 = HEAP32[$57>>2]|0; $59 = ((($58)) + 16|0); ;HEAP32[$59>>2]=HEAP32[$texture>>2]|0; $60 = $i; $61 = (($60) + 1)|0; $i = $61; } $62 = $0; $63 = ((($62)) + 24|0); $64 = ((($63)) + 8|0); $65 = HEAP32[$64>>2]|0; $66 = $0; $67 = ((($66)) + 24|0); $68 = $0; $69 = HEAP32[$68>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$67>>2]|0; FUNCTION_TABLE_vii[$65 & 31]($$byval_copy,$69); $70 = $0; HEAP32[$70>>2] = 0; $71 = $0; $72 = ((($71)) + 4|0); HEAP32[$72>>2] = 0; $73 = $0; $74 = ((($73)) + 8|0); HEAP32[$74>>2] = 0; $75 = $0; $76 = ((($75)) + 36|0); HEAP16[$76>>1] = 0; $77 = $0; $78 = ((($77)) + 36|0); $79 = ((($78)) + 2|0); HEAP16[$79>>1] = 0; $80 = $0; $81 = ((($80)) + 36|0); $82 = ((($81)) + 4|0); HEAP16[$82>>1] = 0; $83 = $0; $84 = ((($83)) + 36|0); $85 = ((($84)) + 6|0); HEAP16[$85>>1] = 0; STACKTOP = sp;return; } function _nk_font_atlas_clear($atlas) { $atlas = $atlas|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0; var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy4 = sp + 24|0; $$byval_copy3 = sp + 20|0; $$byval_copy2 = sp + 16|0; $$byval_copy1 = sp + 12|0; $$byval_copy = sp + 8|0; $0 = $atlas; $i = 0; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((15363|0),(13400|0),9911,(27918|0)); // unreachable; } $3 = $0; $4 = ((($3)) + 24|0); $5 = ((($4)) + 4|0); $6 = HEAP32[$5>>2]|0; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((15575|0),(13400|0),9912,(27918|0)); // unreachable; } $8 = $0; $9 = ((($8)) + 24|0); $10 = ((($9)) + 8|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((15598|0),(13400|0),9913,(27918|0)); // unreachable; } $13 = $0; $14 = ((($13)) + 12|0); $15 = ((($14)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((15530|0),(13400|0),9914,(27918|0)); // unreachable; } $18 = $0; $19 = ((($18)) + 12|0); $20 = ((($19)) + 8|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { ___assert_fail((15553|0),(13400|0),9915,(27918|0)); // unreachable; } $23 = $0; $24 = ($23|0)!=(0|0); if (!($24)) { STACKTOP = sp;return; } $25 = $0; $26 = ((($25)) + 24|0); $27 = ((($26)) + 4|0); $28 = HEAP32[$27>>2]|0; $29 = ($28|0)!=(0|0); if (!($29)) { STACKTOP = sp;return; } $30 = $0; $31 = ((($30)) + 24|0); $32 = ((($31)) + 8|0); $33 = HEAP32[$32>>2]|0; $34 = ($33|0)!=(0|0); if (!($34)) { STACKTOP = sp;return; } $35 = $0; $36 = ((($35)) + 12|0); $37 = ((($36)) + 4|0); $38 = HEAP32[$37>>2]|0; $39 = ($38|0)!=(0|0); if (!($39)) { STACKTOP = sp;return; } $40 = $0; $41 = ((($40)) + 12|0); $42 = ((($41)) + 8|0); $43 = HEAP32[$42>>2]|0; $44 = ($43|0)!=(0|0); if (!($44)) { STACKTOP = sp;return; } $45 = $0; $46 = ((($45)) + 56|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)!=(0|0); if ($48) { $i = 0; while(1) { $49 = $i; $50 = $0; $51 = ((($50)) + 64|0); $52 = HEAP32[$51>>2]|0; $53 = ($49|0)<($52|0); $54 = $0; $55 = ((($54)) + 12|0); $56 = ((($55)) + 8|0); $57 = HEAP32[$56>>2]|0; $58 = $0; $59 = ((($58)) + 12|0); if (!($53)) { break; } $60 = $i; $61 = $0; $62 = ((($61)) + 56|0); $63 = HEAP32[$62>>2]|0; $64 = (($63) + ($60<<2)|0); $65 = HEAP32[$64>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$59>>2]|0; FUNCTION_TABLE_vii[$57 & 31]($$byval_copy,$65); $66 = $i; $67 = (($66) + 1)|0; $i = $67; } $68 = $0; $69 = ((($68)) + 56|0); $70 = HEAP32[$69>>2]|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$59>>2]|0; FUNCTION_TABLE_vii[$57 & 31]($$byval_copy1,$70); } $71 = $0; $72 = ((($71)) + 60|0); $73 = HEAP32[$72>>2]|0; $74 = ($73|0)!=(0|0); if ($74) { $i = 0; while(1) { $75 = $i; $76 = $0; $77 = ((($76)) + 64|0); $78 = HEAP32[$77>>2]|0; $79 = ($75|0)<($78|0); $80 = $0; $81 = ((($80)) + 12|0); $82 = ((($81)) + 8|0); $83 = HEAP32[$82>>2]|0; $84 = $0; $85 = ((($84)) + 12|0); if (!($79)) { break; } $86 = $i; $87 = $0; $88 = ((($87)) + 60|0); $89 = HEAP32[$88>>2]|0; $90 = (($89) + (($86*44)|0)|0); $91 = HEAP32[$90>>2]|0; ;HEAP32[$$byval_copy2>>2]=HEAP32[$85>>2]|0; FUNCTION_TABLE_vii[$83 & 31]($$byval_copy2,$91); $92 = $i; $93 = (($92) + 1)|0; $i = $93; } $94 = $0; $95 = ((($94)) + 60|0); $96 = HEAP32[$95>>2]|0; ;HEAP32[$$byval_copy3>>2]=HEAP32[$85>>2]|0; FUNCTION_TABLE_vii[$83 & 31]($$byval_copy3,$96); } $97 = $0; $98 = ((($97)) + 52|0); $99 = HEAP32[$98>>2]|0; $100 = ($99|0)!=(0|0); if ($100) { $101 = $0; $102 = ((($101)) + 12|0); $103 = ((($102)) + 8|0); $104 = HEAP32[$103>>2]|0; $105 = $0; $106 = ((($105)) + 12|0); $107 = $0; $108 = ((($107)) + 52|0); $109 = HEAP32[$108>>2]|0; ;HEAP32[$$byval_copy4>>2]=HEAP32[$106>>2]|0; FUNCTION_TABLE_vii[$104 & 31]($$byval_copy4,$109); } $110 = $0; _nk_zero($110,72); STACKTOP = sp;return; } function _nk_input_begin($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $in = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),9945,(27938|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $in = $5; $i = 0; while(1) { $6 = $i; $7 = ($6|0)<(3); if (!($7)) { break; } $8 = $i; $9 = $in; $10 = ((($9)) + 220|0); $11 = (($10) + ($8<<4)|0); $12 = ((($11)) + 4|0); HEAP32[$12>>2] = 0; $13 = $i; $14 = (($13) + 1)|0; $i = $14; } $15 = $in; $16 = ((($15)) + 216|0); HEAP32[$16>>2] = 0; $17 = $in; $18 = ((($17)) + 220|0); $19 = ((($18)) + 72|0); HEAPF32[$19>>2] = 0.0; $20 = $in; $21 = ((($20)) + 220|0); $22 = ((($21)) + 48|0); $23 = +HEAPF32[$22>>2]; $24 = $in; $25 = ((($24)) + 220|0); $26 = ((($25)) + 56|0); HEAPF32[$26>>2] = $23; $27 = $in; $28 = ((($27)) + 220|0); $29 = ((($28)) + 48|0); $30 = ((($29)) + 4|0); $31 = +HEAPF32[$30>>2]; $32 = $in; $33 = ((($32)) + 220|0); $34 = ((($33)) + 56|0); $35 = ((($34)) + 4|0); HEAPF32[$35>>2] = $31; $36 = $in; $37 = ((($36)) + 220|0); $38 = ((($37)) + 64|0); HEAPF32[$38>>2] = 0.0; $39 = $in; $40 = ((($39)) + 220|0); $41 = ((($40)) + 64|0); $42 = ((($41)) + 4|0); HEAPF32[$42>>2] = 0.0; $i = 0; while(1) { $43 = $i; $44 = ($43|0)<(25); if (!($44)) { break; } $45 = $i; $46 = $in; $47 = (($46) + ($45<<3)|0); $48 = ((($47)) + 4|0); HEAP32[$48>>2] = 0; $49 = $i; $50 = (($49) + 1)|0; $i = $50; } STACKTOP = sp;return; } function _nk_input_end($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $in = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),9965,(27953|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $in = $5; $6 = $in; $7 = ((($6)) + 220|0); $8 = ((($7)) + 76|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)!=(0); if ($10) { $11 = $in; $12 = ((($11)) + 220|0); $13 = ((($12)) + 76|0); HEAP8[$13>>0] = 0; } $14 = $in; $15 = ((($14)) + 220|0); $16 = ((($15)) + 78|0); $17 = HEAP8[$16>>0]|0; $18 = ($17<<24>>24)!=(0); if (!($18)) { STACKTOP = sp;return; } $19 = $in; $20 = ((($19)) + 220|0); $21 = ((($20)) + 77|0); HEAP8[$21>>0] = 0; $22 = $in; $23 = ((($22)) + 220|0); $24 = ((($23)) + 78|0); HEAP8[$24>>0] = 0; $25 = $in; $26 = ((($25)) + 220|0); $27 = ((($26)) + 76|0); HEAP8[$27>>0] = 0; STACKTOP = sp;return; } function _nk_input_motion($ctx,$x,$y) { $ctx = $ctx|0; $x = $x|0; $y = $y|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, $in = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $x; $2 = $y; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14913|0),(13400|0),9981,(27966|0)); // unreachable; } $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { STACKTOP = sp;return; } $7 = $0; $in = $7; $8 = $1; $9 = (+($8|0)); $10 = $in; $11 = ((($10)) + 220|0); $12 = ((($11)) + 48|0); HEAPF32[$12>>2] = $9; $13 = $2; $14 = (+($13|0)); $15 = $in; $16 = ((($15)) + 220|0); $17 = ((($16)) + 48|0); $18 = ((($17)) + 4|0); HEAPF32[$18>>2] = $14; $19 = $in; $20 = ((($19)) + 220|0); $21 = ((($20)) + 48|0); $22 = +HEAPF32[$21>>2]; $23 = $in; $24 = ((($23)) + 220|0); $25 = ((($24)) + 56|0); $26 = +HEAPF32[$25>>2]; $27 = $22 - $26; $28 = $in; $29 = ((($28)) + 220|0); $30 = ((($29)) + 64|0); HEAPF32[$30>>2] = $27; $31 = $in; $32 = ((($31)) + 220|0); $33 = ((($32)) + 48|0); $34 = ((($33)) + 4|0); $35 = +HEAPF32[$34>>2]; $36 = $in; $37 = ((($36)) + 220|0); $38 = ((($37)) + 56|0); $39 = ((($38)) + 4|0); $40 = +HEAPF32[$39>>2]; $41 = $35 - $40; $42 = $in; $43 = ((($42)) + 220|0); $44 = ((($43)) + 64|0); $45 = ((($44)) + 4|0); HEAPF32[$45>>2] = $41; STACKTOP = sp;return; } function _nk_input_key($ctx,$key,$down) { $ctx = $ctx|0; $key = $key|0; $down = $down|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $in = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $key; $2 = $down; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14913|0),(13400|0),9994,(27982|0)); // unreachable; } $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { STACKTOP = sp;return; } $7 = $0; $in = $7; $8 = $1; $9 = $in; $10 = (($9) + ($8<<3)|0); $11 = HEAP32[$10>>2]|0; $12 = $2; $13 = ($11|0)==($12|0); if ($13) { STACKTOP = sp;return; } $14 = $2; $15 = $1; $16 = $in; $17 = (($16) + ($15<<3)|0); HEAP32[$17>>2] = $14; $18 = $1; $19 = $in; $20 = (($19) + ($18<<3)|0); $21 = ((($20)) + 4|0); $22 = HEAP32[$21>>2]|0; $23 = (($22) + 1)|0; HEAP32[$21>>2] = $23; STACKTOP = sp;return; } function _nk_input_button($ctx,$id,$x,$y,$down) { $ctx = $ctx|0; $id = $id|0; $x = $x|0; $y = $y|0; $down = $down|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $btn = 0, $in = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $id; $2 = $x; $3 = $y; $4 = $down; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),10007,(27995|0)); // unreachable; } $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { STACKTOP = sp;return; } $9 = $0; $in = $9; $10 = $1; $11 = $in; $12 = ((($11)) + 220|0); $13 = (($12) + ($10<<4)|0); $14 = HEAP32[$13>>2]|0; $15 = $4; $16 = ($14|0)==($15|0); if ($16) { STACKTOP = sp;return; } $17 = $1; $18 = $in; $19 = ((($18)) + 220|0); $20 = (($19) + ($17<<4)|0); $btn = $20; $21 = $2; $22 = (+($21|0)); $23 = $btn; $24 = ((($23)) + 8|0); HEAPF32[$24>>2] = $22; $25 = $3; $26 = (+($25|0)); $27 = $btn; $28 = ((($27)) + 8|0); $29 = ((($28)) + 4|0); HEAPF32[$29>>2] = $26; $30 = $4; $31 = $btn; HEAP32[$31>>2] = $30; $32 = $btn; $33 = ((($32)) + 4|0); $34 = HEAP32[$33>>2]|0; $35 = (($34) + 1)|0; HEAP32[$33>>2] = $35; STACKTOP = sp;return; } function _nk_input_scroll($ctx,$y) { $ctx = $ctx|0; $y = +$y; var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $y; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),10022,(28011|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $1; $7 = $0; $8 = ((($7)) + 220|0); $9 = ((($8)) + 72|0); $10 = +HEAPF32[$9>>2]; $11 = $10 + $6; HEAPF32[$9>>2] = $11; STACKTOP = sp;return; } function _nk_input_glyph($ctx,$glyph) { $ctx = $ctx|0; $glyph = $glyph|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $in = 0, $len = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $unicode = sp + 4|0; $0 = $ctx; $1 = $glyph; $len = 0; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),10034,(28027|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $0; $in = $6; $7 = $1; $8 = (_nk_utf_decode($7,$unicode,4)|0); $len = $8; $9 = $len; $10 = ($9|0)!=(0); if (!($10)) { STACKTOP = sp;return; } $11 = $in; $12 = ((($11)) + 216|0); $13 = HEAP32[$12>>2]|0; $14 = $len; $15 = (($13) + ($14))|0; $16 = ($15|0)<(16); if (!($16)) { STACKTOP = sp;return; } $17 = HEAP32[$unicode>>2]|0; $18 = $in; $19 = ((($18)) + 216|0); $20 = HEAP32[$19>>2]|0; $21 = $in; $22 = ((($21)) + 200|0); $23 = (($22) + ($20)|0); $24 = $in; $25 = ((($24)) + 216|0); $26 = HEAP32[$25>>2]|0; $27 = (16 - ($26))|0; (_nk_utf_encode($17,$23,$27)|0); $28 = $len; $29 = $in; $30 = ((($29)) + 216|0); $31 = HEAP32[$30>>2]|0; $32 = (($31) + ($28))|0; HEAP32[$30>>2] = $32; STACKTOP = sp;return; } function _nk_input_unicode($ctx,$unicode) { $ctx = $ctx|0; $unicode = $unicode|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $rune = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $rune = sp + 8|0; $0 = $ctx; $1 = $unicode; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),10060,(28042|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $1; (_nk_utf_encode($6,$rune,4)|0); $7 = $0; _nk_input_glyph($7,$rune); STACKTOP = sp;return; } function _nk_input_has_mouse_click($i,$id) { $i = $i|0; $id = $id|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $btn = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $id; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { $0 = 0; $18 = $0; STACKTOP = sp;return ($18|0); } $5 = $2; $6 = $1; $7 = ((($6)) + 220|0); $8 = (($7) + ($5<<4)|0); $btn = $8; $9 = $btn; $10 = ((($9)) + 4|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0); if ($12) { $13 = $btn; $14 = HEAP32[$13>>2]|0; $15 = ($14|0)==(0); $16 = $15; } else { $16 = 0; } $17 = $16 ? 1 : 0; $0 = $17; $18 = $0; STACKTOP = sp;return ($18|0); } function _nk_input_has_mouse_click_in_rect($i,$id,$b) { $i = $i|0; $id = $id|0; $b = $b|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0; var $btn = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $id; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { $0 = 0; $39 = $0; STACKTOP = sp;return ($39|0); } $5 = $2; $6 = $1; $7 = ((($6)) + 220|0); $8 = (($7) + ($5<<4)|0); $btn = $8; $9 = +HEAPF32[$b>>2]; $10 = $btn; $11 = ((($10)) + 8|0); $12 = +HEAPF32[$11>>2]; $13 = $9 <= $12; if ($13) { $14 = $btn; $15 = ((($14)) + 8|0); $16 = +HEAPF32[$15>>2]; $17 = +HEAPF32[$b>>2]; $18 = ((($b)) + 8|0); $19 = +HEAPF32[$18>>2]; $20 = $17 + $19; $21 = $16 <= $20; if ($21) { $22 = ((($b)) + 4|0); $23 = +HEAPF32[$22>>2]; $24 = $btn; $25 = ((($24)) + 8|0); $26 = ((($25)) + 4|0); $27 = +HEAPF32[$26>>2]; $28 = $23 <= $27; if ($28) { $29 = $btn; $30 = ((($29)) + 8|0); $31 = ((($30)) + 4|0); $32 = +HEAPF32[$31>>2]; $33 = ((($b)) + 4|0); $34 = +HEAPF32[$33>>2]; $35 = ((($b)) + 12|0); $36 = +HEAPF32[$35>>2]; $37 = $34 + $36; $38 = $32 <= $37; if ($38) { $0 = 1; $39 = $0; STACKTOP = sp;return ($39|0); } } } } $0 = 0; $39 = $0; STACKTOP = sp;return ($39|0); } function _nk_input_has_mouse_click_down_in_rect($i,$id,$b,$down) { $i = $i|0; $id = $id|0; $b = $b|0; $down = $down|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $b$byval_copy = 0, $btn = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $b$byval_copy = sp + 24|0; $1 = $i; $2 = $id; $3 = $down; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { $0 = 0; $20 = $0; STACKTOP = sp;return ($20|0); } $6 = $2; $7 = $1; $8 = ((($7)) + 220|0); $9 = (($8) + ($6<<4)|0); $btn = $9; $10 = $1; $11 = $2; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0;HEAP32[$b$byval_copy+8>>2]=HEAP32[$b+8>>2]|0;HEAP32[$b$byval_copy+12>>2]=HEAP32[$b+12>>2]|0; $12 = (_nk_input_has_mouse_click_in_rect($10,$11,$b$byval_copy)|0); $13 = ($12|0)!=(0); if ($13) { $14 = $btn; $15 = HEAP32[$14>>2]|0; $16 = $3; $17 = ($15|0)==($16|0); $19 = $17; } else { $19 = 0; } $18 = $19&1; $0 = $18; $20 = $0; STACKTOP = sp;return ($20|0); } function _nk_input_is_mouse_click_in_rect($i,$id,$b) { $i = $i|0; $id = $id|0; $b = $b|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $b$byval_copy = 0, $btn = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $b$byval_copy = sp + 16|0; $1 = $i; $2 = $id; $3 = $1; $4 = ($3|0)!=(0|0); if (!($4)) { $0 = 0; $19 = $0; STACKTOP = sp;return ($19|0); } $5 = $2; $6 = $1; $7 = ((($6)) + 220|0); $8 = (($7) + ($5<<4)|0); $btn = $8; $9 = $1; $10 = $2; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0;HEAP32[$b$byval_copy+8>>2]=HEAP32[$b+8>>2]|0;HEAP32[$b$byval_copy+12>>2]=HEAP32[$b+12>>2]|0; $11 = (_nk_input_has_mouse_click_down_in_rect($9,$10,$b$byval_copy,0)|0); $12 = ($11|0)!=(0); if ($12) { $13 = $btn; $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0); $17 = $16; } else { $17 = 0; } $18 = $17 ? 1 : 0; $0 = $18; $19 = $0; STACKTOP = sp;return ($19|0); } function _nk_input_is_mouse_click_down_in_rect($i,$id,$b,$down) { $i = $i|0; $id = $id|0; $b = $b|0; $down = $down|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $b$byval_copy = 0, $btn = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $b$byval_copy = sp + 24|0; $1 = $i; $2 = $id; $3 = $down; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { $0 = 0; $21 = $0; STACKTOP = sp;return ($21|0); } $6 = $2; $7 = $1; $8 = ((($7)) + 220|0); $9 = (($8) + ($6<<4)|0); $btn = $9; $10 = $1; $11 = $2; $12 = $3; ;HEAP32[$b$byval_copy>>2]=HEAP32[$b>>2]|0;HEAP32[$b$byval_copy+4>>2]=HEAP32[$b+4>>2]|0;HEAP32[$b$byval_copy+8>>2]=HEAP32[$b+8>>2]|0;HEAP32[$b$byval_copy+12>>2]=HEAP32[$b+12>>2]|0; $13 = (_nk_input_has_mouse_click_down_in_rect($10,$11,$b$byval_copy,$12)|0); $14 = ($13|0)!=(0); if ($14) { $15 = $btn; $16 = ((($15)) + 4|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0); $19 = $18; } else { $19 = 0; } $20 = $19 ? 1 : 0; $0 = $20; $21 = $0; STACKTOP = sp;return ($21|0); } function _nk_input_is_mouse_hovering_rect($i,$rect) { $i = $i|0; $rect = $rect|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0; var $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { $0 = 0; $40 = $0; STACKTOP = sp;return ($40|0); } $4 = +HEAPF32[$rect>>2]; $5 = $1; $6 = ((($5)) + 220|0); $7 = ((($6)) + 48|0); $8 = +HEAPF32[$7>>2]; $9 = $4 <= $8; if ($9) { $10 = $1; $11 = ((($10)) + 220|0); $12 = ((($11)) + 48|0); $13 = +HEAPF32[$12>>2]; $14 = +HEAPF32[$rect>>2]; $15 = ((($rect)) + 8|0); $16 = +HEAPF32[$15>>2]; $17 = $14 + $16; $18 = $13 <= $17; if ($18) { $19 = ((($rect)) + 4|0); $20 = +HEAPF32[$19>>2]; $21 = $1; $22 = ((($21)) + 220|0); $23 = ((($22)) + 48|0); $24 = ((($23)) + 4|0); $25 = +HEAPF32[$24>>2]; $26 = $20 <= $25; if ($26) { $27 = $1; $28 = ((($27)) + 220|0); $29 = ((($28)) + 48|0); $30 = ((($29)) + 4|0); $31 = +HEAPF32[$30>>2]; $32 = ((($rect)) + 4|0); $33 = +HEAPF32[$32>>2]; $34 = ((($rect)) + 12|0); $35 = +HEAPF32[$34>>2]; $36 = $33 + $35; $37 = $31 <= $36; $39 = $37; } else { $39 = 0; } } else { $39 = 0; } } else { $39 = 0; } $38 = $39&1; $0 = $38; $40 = $0; STACKTOP = sp;return ($40|0); } function _nk_input_is_mouse_prev_hovering_rect($i,$rect) { $i = $i|0; $rect = $rect|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0; var $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { $0 = 0; $40 = $0; STACKTOP = sp;return ($40|0); } $4 = +HEAPF32[$rect>>2]; $5 = $1; $6 = ((($5)) + 220|0); $7 = ((($6)) + 56|0); $8 = +HEAPF32[$7>>2]; $9 = $4 <= $8; if ($9) { $10 = $1; $11 = ((($10)) + 220|0); $12 = ((($11)) + 56|0); $13 = +HEAPF32[$12>>2]; $14 = +HEAPF32[$rect>>2]; $15 = ((($rect)) + 8|0); $16 = +HEAPF32[$15>>2]; $17 = $14 + $16; $18 = $13 <= $17; if ($18) { $19 = ((($rect)) + 4|0); $20 = +HEAPF32[$19>>2]; $21 = $1; $22 = ((($21)) + 220|0); $23 = ((($22)) + 56|0); $24 = ((($23)) + 4|0); $25 = +HEAPF32[$24>>2]; $26 = $20 <= $25; if ($26) { $27 = $1; $28 = ((($27)) + 220|0); $29 = ((($28)) + 56|0); $30 = ((($29)) + 4|0); $31 = +HEAPF32[$30>>2]; $32 = ((($rect)) + 4|0); $33 = +HEAPF32[$32>>2]; $34 = ((($rect)) + 12|0); $35 = +HEAPF32[$34>>2]; $36 = $33 + $35; $37 = $31 <= $36; $39 = $37; } else { $39 = 0; } } else { $39 = 0; } } else { $39 = 0; } $38 = $39&1; $0 = $38; $40 = $0; STACKTOP = sp;return ($40|0); } function _nk_input_is_mouse_down($i,$id) { $i = $i|0; $id = $id|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $id; $3 = $1; $4 = ($3|0)!=(0|0); if ($4) { $5 = $2; $6 = $1; $7 = ((($6)) + 220|0); $8 = (($7) + ($5<<4)|0); $9 = HEAP32[$8>>2]|0; $0 = $9; } else { $0 = 0; } $10 = $0; STACKTOP = sp;return ($10|0); } function _nk_input_is_mouse_pressed($i,$id) { $i = $i|0; $id = $id|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $id; $3 = $1; $4 = ($3|0)!=(0|0); do { if ($4) { $5 = $2; $6 = $1; $7 = ((($6)) + 220|0); $8 = (($7) + ($5<<4)|0); $b = $8; $9 = $b; $10 = HEAP32[$9>>2]|0; $11 = ($10|0)!=(0); if ($11) { $12 = $b; $13 = ((($12)) + 4|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0); if ($15) { $0 = 1; break; } } $0 = 0; } else { $0 = 0; } } while(0); $16 = $0; STACKTOP = sp;return ($16|0); } function _nk_input_is_key_pressed($i,$key) { $i = $i|0; $key = $key|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $i; $2 = $key; $3 = $1; $4 = ($3|0)!=(0|0); do { if ($4) { $5 = $2; $6 = $1; $7 = (($6) + ($5<<3)|0); $k = $7; $8 = $k; $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0); if ($10) { $11 = $k; $12 = ((($11)) + 4|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)!=(0); if ($14) { $0 = 1; break; } } $0 = 0; } else { $0 = 0; } } while(0); $15 = $0; STACKTOP = sp;return ($15|0); } function _nk_textedit_delete($state,$where,$len) { $state = $state|0; $where = $where|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $where; $2 = $len; $3 = $0; $4 = $1; $5 = $2; _nk_textedit_makeundo_delete($3,$4,$5); $6 = $0; $7 = ((($6)) + 12|0); $8 = $1; $9 = $2; _nk_str_delete_runes($7,$8,$9); $10 = $0; $11 = ((($10)) + 103|0); HEAP8[$11>>0] = 0; STACKTOP = sp;return; } function _nk_textedit_makeundo_delete($state,$where,$length) { $state = $state|0; $where = $where|0; $length = $length|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $p = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $where; $2 = $length; $3 = $0; $4 = ((($3)) + 112|0); $5 = $1; $6 = $2; $7 = (_nk_textedit_createundo($4,$5,$6,0)|0); $p = $7; $8 = $p; $9 = ($8|0)!=(0|0); if (!($9)) { STACKTOP = sp;return; } $i = 0; while(1) { $10 = $i; $11 = $2; $12 = ($10|0)<($11|0); if (!($12)) { break; } $13 = $0; $14 = ((($13)) + 12|0); $15 = $1; $16 = $i; $17 = (($15) + ($16))|0; $18 = (_nk_str_rune_at($14,$17)|0); $19 = $i; $20 = $p; $21 = (($20) + ($19<<2)|0); HEAP32[$21>>2] = $18; $22 = $i; $23 = (($22) + 1)|0; $i = $23; } STACKTOP = sp;return; } function _nk_textedit_delete_selection($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; _nk_textedit_clamp($1); $2 = $0; $3 = ((($2)) + 92|0); $4 = HEAP32[$3>>2]|0; $5 = $0; $6 = ((($5)) + 96|0); $7 = HEAP32[$6>>2]|0; $8 = ($4|0)!=($7|0); if (!($8)) { STACKTOP = sp;return; } $9 = $0; $10 = ((($9)) + 92|0); $11 = HEAP32[$10>>2]|0; $12 = $0; $13 = ((($12)) + 96|0); $14 = HEAP32[$13>>2]|0; $15 = ($11|0)<($14|0); $16 = $0; $17 = $0; if ($15) { $18 = ((($17)) + 92|0); $19 = HEAP32[$18>>2]|0; $20 = $0; $21 = ((($20)) + 96|0); $22 = HEAP32[$21>>2]|0; $23 = $0; $24 = ((($23)) + 92|0); $25 = HEAP32[$24>>2]|0; $26 = (($22) - ($25))|0; _nk_textedit_delete($16,$19,$26); $27 = $0; $28 = ((($27)) + 92|0); $29 = HEAP32[$28>>2]|0; $30 = $0; $31 = ((($30)) + 88|0); HEAP32[$31>>2] = $29; $32 = $0; $33 = ((($32)) + 96|0); HEAP32[$33>>2] = $29; } else { $34 = ((($17)) + 96|0); $35 = HEAP32[$34>>2]|0; $36 = $0; $37 = ((($36)) + 92|0); $38 = HEAP32[$37>>2]|0; $39 = $0; $40 = ((($39)) + 96|0); $41 = HEAP32[$40>>2]|0; $42 = (($38) - ($41))|0; _nk_textedit_delete($16,$35,$42); $43 = $0; $44 = ((($43)) + 96|0); $45 = HEAP32[$44>>2]|0; $46 = $0; $47 = ((($46)) + 88|0); HEAP32[$47>>2] = $45; $48 = $0; $49 = ((($48)) + 92|0); HEAP32[$49>>2] = $45; } $50 = $0; $51 = ((($50)) + 103|0); HEAP8[$51>>0] = 0; STACKTOP = sp;return; } function _nk_textedit_clamp($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $n = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 12|0); $3 = ((($2)) + 60|0); $4 = HEAP32[$3>>2]|0; $n = $4; $5 = $0; $6 = ((($5)) + 92|0); $7 = HEAP32[$6>>2]|0; $8 = $0; $9 = ((($8)) + 96|0); $10 = HEAP32[$9>>2]|0; $11 = ($7|0)!=($10|0); if ($11) { $12 = $0; $13 = ((($12)) + 92|0); $14 = HEAP32[$13>>2]|0; $15 = $n; $16 = ($14|0)>($15|0); if ($16) { $17 = $n; $18 = $0; $19 = ((($18)) + 92|0); HEAP32[$19>>2] = $17; } $20 = $0; $21 = ((($20)) + 96|0); $22 = HEAP32[$21>>2]|0; $23 = $n; $24 = ($22|0)>($23|0); if ($24) { $25 = $n; $26 = $0; $27 = ((($26)) + 96|0); HEAP32[$27>>2] = $25; } $28 = $0; $29 = ((($28)) + 92|0); $30 = HEAP32[$29>>2]|0; $31 = $0; $32 = ((($31)) + 96|0); $33 = HEAP32[$32>>2]|0; $34 = ($30|0)==($33|0); if ($34) { $35 = $0; $36 = ((($35)) + 92|0); $37 = HEAP32[$36>>2]|0; $38 = $0; $39 = ((($38)) + 88|0); HEAP32[$39>>2] = $37; } } $40 = $0; $41 = ((($40)) + 88|0); $42 = HEAP32[$41>>2]|0; $43 = $n; $44 = ($42|0)>($43|0); if (!($44)) { STACKTOP = sp;return; } $45 = $n; $46 = $0; $47 = ((($46)) + 88|0); HEAP32[$47>>2] = $45; STACKTOP = sp;return; } function _nk_textedit_cut($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $state; $2 = $1; $3 = ((($2)) + 92|0); $4 = HEAP32[$3>>2]|0; $5 = $1; $6 = ((($5)) + 96|0); $7 = HEAP32[$6>>2]|0; $8 = ($4|0)!=($7|0); if ($8) { $9 = $1; _nk_textedit_delete_selection($9); $10 = $1; $11 = ((($10)) + 103|0); HEAP8[$11>>0] = 0; $0 = 1; $12 = $0; STACKTOP = sp;return ($12|0); } else { $0 = 0; $12 = $0; STACKTOP = sp;return ($12|0); } return (0)|0; } function _nk_textedit_paste($state,$ctext,$len) { $state = $state|0; $ctext = $ctext|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $glyphs = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $state; $2 = $ctext; $3 = $len; $4 = $2; $text = $4; $5 = $1; _nk_textedit_clamp($5); $6 = $1; _nk_textedit_delete_selection($6); $7 = $2; $8 = $3; $9 = (_nk_utf_len($7,$8)|0); $glyphs = $9; $10 = $1; $11 = ((($10)) + 12|0); $12 = $1; $13 = ((($12)) + 88|0); $14 = HEAP32[$13>>2]|0; $15 = $text; $16 = $3; $17 = (_nk_str_insert_text_char($11,$14,$15,$16)|0); $18 = ($17|0)!=(0); $19 = $1; if ($18) { $20 = $1; $21 = ((($20)) + 88|0); $22 = HEAP32[$21>>2]|0; $23 = $glyphs; _nk_textedit_makeundo_insert($19,$22,$23); $24 = $3; $25 = $1; $26 = ((($25)) + 88|0); $27 = HEAP32[$26>>2]|0; $28 = (($27) + ($24))|0; HEAP32[$26>>2] = $28; $29 = $1; $30 = ((($29)) + 103|0); HEAP8[$30>>0] = 0; $0 = 1; $40 = $0; STACKTOP = sp;return ($40|0); } $31 = ((($19)) + 112|0); $32 = ((($31)) + 5184|0); $33 = HEAP16[$32>>1]|0; $34 = ($33<<16>>16)!=(0); if ($34) { $35 = $1; $36 = ((($35)) + 112|0); $37 = ((($36)) + 5184|0); $38 = HEAP16[$37>>1]|0; $39 = (($38) + -1)<<16>>16; HEAP16[$37>>1] = $39; } $0 = 0; $40 = $0; STACKTOP = sp;return ($40|0); } function _nk_textedit_makeundo_insert($state,$where,$length) { $state = $state|0; $where = $where|0; $length = $length|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $where; $2 = $length; $3 = $0; $4 = ((($3)) + 112|0); $5 = $1; $6 = $2; (_nk_textedit_createundo($4,$5,0,$6)|0); STACKTOP = sp;return; } function _nk_textedit_text($state,$text,$total_len) { $state = $state|0; $text = $text|0; $total_len = $total_len|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $14 = 0; var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0; var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0; var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0; var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0; var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $glyph_len = 0, $or$cond = 0, $text_len = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $unicode = sp + 8|0; $0 = $state; $1 = $text; $2 = $total_len; $text_len = 0; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((28059|0),(13400|0),10585,(28065|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13893|0),(13400|0),10586,(28065|0)); // unreachable; } $7 = $1; $8 = ($7|0)!=(0|0); $9 = $2; $10 = ($9|0)!=(0); $or$cond = $8 & $10; if (!($or$cond)) { STACKTOP = sp;return; } $11 = $0; $12 = ((($11)) + 100|0); $13 = HEAP8[$12>>0]|0; $14 = $13&255; $15 = ($14|0)==(0); if ($15) { STACKTOP = sp;return; } $16 = $1; $17 = $2; $18 = (_nk_utf_decode($16,$unicode,$17)|0); $glyph_len = $18; $19 = $glyph_len; $20 = ($19|0)!=(0); if (!($20)) { STACKTOP = sp;return; } while(1) { $21 = $text_len; $22 = $2; $23 = ($21|0)<($22|0); $24 = $glyph_len; $25 = ($24|0)!=(0); $26 = $23 ? $25 : 0; if (!($26)) { label = 23; break; } $27 = HEAP32[$unicode>>2]|0; $28 = ($27|0)==(10); if ($28) { $29 = $0; $30 = ((($29)) + 104|0); $31 = HEAP8[$30>>0]|0; $32 = $31&255; $33 = ($32|0)!=(0); if ($33) { label = 23; break; } } $34 = $0; $35 = ((($34)) + 76|0); $36 = HEAP32[$35>>2]|0; $37 = ($36|0)!=(0|0); if ($37) { $38 = $0; $39 = ((($38)) + 76|0); $40 = HEAP32[$39>>2]|0; $41 = $0; $42 = HEAP32[$unicode>>2]|0; $43 = (FUNCTION_TABLE_iii[$40 & 15]($41,$42)|0); $44 = ($43|0)!=(0); if (!($44)) { $45 = $1; $46 = $text_len; $47 = (($45) + ($46)|0); $48 = $2; $49 = $text_len; $50 = (($48) - ($49))|0; $51 = (_nk_utf_decode($47,$unicode,$50)|0); $glyph_len = $51; $52 = $glyph_len; $53 = $text_len; $54 = (($53) + ($52))|0; $text_len = $54; continue; } } $55 = $0; $56 = ((($55)) + 92|0); $57 = HEAP32[$56>>2]|0; $58 = $0; $59 = ((($58)) + 96|0); $60 = HEAP32[$59>>2]|0; $61 = ($57|0)!=($60|0); if ($61) { label = 20; } else { $62 = $0; $63 = ((($62)) + 88|0); $64 = HEAP32[$63>>2]|0; $65 = $0; $66 = ((($65)) + 12|0); $67 = ((($66)) + 60|0); $68 = HEAP32[$67>>2]|0; $69 = ($64|0)<($68|0); if ($69) { $70 = $0; $71 = ((($70)) + 100|0); $72 = HEAP8[$71>>0]|0; $73 = $72&255; $74 = ($73|0)==(2); if ($74) { $75 = $0; $76 = $0; $77 = ((($76)) + 88|0); $78 = HEAP32[$77>>2]|0; _nk_textedit_makeundo_replace($75,$78,1,1); $79 = $0; $80 = ((($79)) + 12|0); $81 = $0; $82 = ((($81)) + 88|0); $83 = HEAP32[$82>>2]|0; _nk_str_delete_runes($80,$83,1); } $84 = $0; $85 = ((($84)) + 12|0); $86 = $0; $87 = ((($86)) + 88|0); $88 = HEAP32[$87>>2]|0; $89 = $1; $90 = $text_len; $91 = (($89) + ($90)|0); $92 = $glyph_len; $93 = (_nk_str_insert_text_char($85,$88,$91,$92)|0); $94 = ($93|0)!=(0); if ($94) { $95 = $0; $96 = ((($95)) + 88|0); $97 = HEAP32[$96>>2]|0; $98 = (($97) + 1)|0; HEAP32[$96>>2] = $98; $99 = $0; $100 = ((($99)) + 103|0); HEAP8[$100>>0] = 0; } } else { label = 20; } } if ((label|0) == 20) { label = 0; $101 = $0; _nk_textedit_delete_selection($101); $102 = $0; $103 = ((($102)) + 12|0); $104 = $0; $105 = ((($104)) + 88|0); $106 = HEAP32[$105>>2]|0; $107 = $1; $108 = $text_len; $109 = (($107) + ($108)|0); $110 = $glyph_len; $111 = (_nk_str_insert_text_char($103,$106,$109,$110)|0); $112 = ($111|0)!=(0); if ($112) { $113 = $0; $114 = $0; $115 = ((($114)) + 88|0); $116 = HEAP32[$115>>2]|0; _nk_textedit_makeundo_insert($113,$116,1); $117 = $0; $118 = ((($117)) + 88|0); $119 = HEAP32[$118>>2]|0; $120 = (($119) + 1)|0; HEAP32[$118>>2] = $120; $121 = $0; $122 = ((($121)) + 103|0); HEAP8[$122>>0] = 0; } } $123 = $1; $124 = $text_len; $125 = (($123) + ($124)|0); $126 = $2; $127 = $text_len; $128 = (($126) - ($127))|0; $129 = (_nk_utf_decode($125,$unicode,$128)|0); $glyph_len = $129; $130 = $glyph_len; $131 = $text_len; $132 = (($131) + ($130))|0; $text_len = $132; } if ((label|0) == 23) { STACKTOP = sp;return; } } function _nk_textedit_makeundo_replace($state,$where,$old_length,$new_length) { $state = $state|0; $where = $where|0; $old_length = $old_length|0; $new_length = $new_length|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $p = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $where; $2 = $old_length; $3 = $new_length; $4 = $0; $5 = ((($4)) + 112|0); $6 = $1; $7 = $2; $8 = $3; $9 = (_nk_textedit_createundo($5,$6,$7,$8)|0); $p = $9; $10 = $p; $11 = ($10|0)!=(0|0); if (!($11)) { STACKTOP = sp;return; } $i = 0; while(1) { $12 = $i; $13 = $2; $14 = ($12|0)<($13|0); if (!($14)) { break; } $15 = $0; $16 = ((($15)) + 12|0); $17 = $1; $18 = $i; $19 = (($17) + ($18))|0; $20 = (_nk_str_rune_at($16,$19)|0); $21 = $i; $22 = $p; $23 = (($22) + ($21<<2)|0); HEAP32[$23>>2] = $20; $24 = $i; $25 = (($24) + 1)|0; $i = $25; } STACKTOP = sp;return; } function _nk_textedit_undo($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i = 0, $r = 0, $s = 0, $u = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $u = sp + 8|0; $0 = $state; $1 = $0; $2 = ((($1)) + 112|0); $s = $2; $3 = $s; $4 = ((($3)) + 5184|0); $5 = HEAP16[$4>>1]|0; $6 = $5 << 16 >> 16; $7 = ($6|0)==(0); if ($7) { STACKTOP = sp;return; } $8 = $s; $9 = ((($8)) + 5184|0); $10 = HEAP16[$9>>1]|0; $11 = $10 << 16 >> 16; $12 = (($11) - 1)|0; $13 = $s; $14 = (($13) + (($12*12)|0)|0); ;HEAP32[$u>>2]=HEAP32[$14>>2]|0;HEAP32[$u+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[$u+8>>2]=HEAP32[$14+8>>2]|0; $15 = $s; $16 = ((($15)) + 5186|0); $17 = HEAP16[$16>>1]|0; $18 = $17 << 16 >> 16; $19 = (($18) - 1)|0; $20 = $s; $21 = (($20) + (($19*12)|0)|0); $r = $21; $22 = $r; $23 = ((($22)) + 8|0); HEAP16[$23>>1] = -1; $24 = ((($u)) + 6|0); $25 = HEAP16[$24>>1]|0; $26 = $r; $27 = ((($26)) + 4|0); HEAP16[$27>>1] = $25; $28 = ((($u)) + 4|0); $29 = HEAP16[$28>>1]|0; $30 = $r; $31 = ((($30)) + 6|0); HEAP16[$31>>1] = $29; $32 = HEAP32[$u>>2]|0; $33 = $r; HEAP32[$33>>2] = $32; $34 = ((($u)) + 6|0); $35 = HEAP16[$34>>1]|0; $36 = ($35<<16>>16)!=(0); if ($36) { $37 = $s; $38 = ((($37)) + 5188|0); $39 = HEAP16[$38>>1]|0; $40 = $39 << 16 >> 16; $41 = ((($u)) + 6|0); $42 = HEAP16[$41>>1]|0; $43 = $42 << 16 >> 16; $44 = (($40) + ($43))|0; $45 = ($44|0)>=(999); L6: do { if ($45) { $46 = $r; $47 = ((($46)) + 4|0); HEAP16[$47>>1] = 0; } else { while(1) { $48 = $s; $49 = ((($48)) + 5188|0); $50 = HEAP16[$49>>1]|0; $51 = $50 << 16 >> 16; $52 = ((($u)) + 6|0); $53 = HEAP16[$52>>1]|0; $54 = $53 << 16 >> 16; $55 = (($51) + ($54))|0; $56 = $s; $57 = ((($56)) + 5190|0); $58 = HEAP16[$57>>1]|0; $59 = $58 << 16 >> 16; $60 = ($55|0)>($59|0); $61 = $s; if (!($60)) { break; } _nk_textedit_discard_redo($61); $62 = $s; $63 = ((($62)) + 5186|0); $64 = HEAP16[$63>>1]|0; $65 = $64 << 16 >> 16; $66 = ($65|0)==(99); if ($66) { label = 14; break; } } if ((label|0) == 14) { STACKTOP = sp;return; } $67 = ((($61)) + 5186|0); $68 = HEAP16[$67>>1]|0; $69 = $68 << 16 >> 16; $70 = (($69) - 1)|0; $71 = $s; $72 = (($71) + (($70*12)|0)|0); $r = $72; $73 = $s; $74 = ((($73)) + 5190|0); $75 = HEAP16[$74>>1]|0; $76 = $75 << 16 >> 16; $77 = ((($u)) + 6|0); $78 = HEAP16[$77>>1]|0; $79 = $78 << 16 >> 16; $80 = (($76) - ($79))|0; $81 = $80&65535; $82 = $r; $83 = ((($82)) + 8|0); HEAP16[$83>>1] = $81; $84 = $s; $85 = ((($84)) + 5190|0); $86 = HEAP16[$85>>1]|0; $87 = $86 << 16 >> 16; $88 = ((($u)) + 6|0); $89 = HEAP16[$88>>1]|0; $90 = $89 << 16 >> 16; $91 = (($87) - ($90))|0; $92 = $91&65535; $93 = $s; $94 = ((($93)) + 5190|0); HEAP16[$94>>1] = $92; $i = 0; while(1) { $95 = $i; $96 = ((($u)) + 6|0); $97 = HEAP16[$96>>1]|0; $98 = $97 << 16 >> 16; $99 = ($95|0)<($98|0); if (!($99)) { break L6; } $100 = $0; $101 = ((($100)) + 12|0); $102 = HEAP32[$u>>2]|0; $103 = $i; $104 = (($102) + ($103))|0; $105 = (_nk_str_rune_at($101,$104)|0); $106 = $r; $107 = ((($106)) + 8|0); $108 = HEAP16[$107>>1]|0; $109 = $108 << 16 >> 16; $110 = $i; $111 = (($109) + ($110))|0; $112 = $s; $113 = ((($112)) + 1188|0); $114 = (($113) + ($111<<2)|0); HEAP32[$114>>2] = $105; $115 = $i; $116 = (($115) + 1)|0; $i = $116; } } } while(0); $117 = $0; $118 = ((($117)) + 12|0); $119 = HEAP32[$u>>2]|0; $120 = ((($u)) + 6|0); $121 = HEAP16[$120>>1]|0; $122 = $121 << 16 >> 16; _nk_str_delete_runes($118,$119,$122); } $123 = ((($u)) + 4|0); $124 = HEAP16[$123>>1]|0; $125 = ($124<<16>>16)!=(0); if ($125) { $126 = $0; $127 = ((($126)) + 12|0); $128 = HEAP32[$u>>2]|0; $129 = ((($u)) + 8|0); $130 = HEAP16[$129>>1]|0; $131 = $130 << 16 >> 16; $132 = $s; $133 = ((($132)) + 1188|0); $134 = (($133) + ($131<<2)|0); $135 = ((($u)) + 4|0); $136 = HEAP16[$135>>1]|0; $137 = $136 << 16 >> 16; (_nk_str_insert_text_runes($127,$128,$134,$137)|0); $138 = $s; $139 = ((($138)) + 5188|0); $140 = HEAP16[$139>>1]|0; $141 = $140 << 16 >> 16; $142 = ((($u)) + 4|0); $143 = HEAP16[$142>>1]|0; $144 = $143 << 16 >> 16; $145 = (($141) - ($144))|0; $146 = $145&65535; $147 = $s; $148 = ((($147)) + 5188|0); HEAP16[$148>>1] = $146; } $149 = HEAP32[$u>>2]|0; $150 = ((($u)) + 4|0); $151 = HEAP16[$150>>1]|0; $152 = $151 << 16 >> 16; $153 = (($149) + ($152))|0; $154 = $153&65535; $155 = $154 << 16 >> 16; $156 = $0; $157 = ((($156)) + 88|0); HEAP32[$157>>2] = $155; $158 = $s; $159 = ((($158)) + 5184|0); $160 = HEAP16[$159>>1]|0; $161 = (($160) + -1)<<16>>16; HEAP16[$159>>1] = $161; $162 = $s; $163 = ((($162)) + 5186|0); $164 = HEAP16[$163>>1]|0; $165 = (($164) + -1)<<16>>16; HEAP16[$163>>1] = $165; STACKTOP = sp;return; } function _nk_textedit_discard_redo($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0; var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0; var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i = 0, $k = 0, $n = 0, $num = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $k = 98; $1 = $0; $2 = ((($1)) + 5186|0); $3 = HEAP16[$2>>1]|0; $4 = $3 << 16 >> 16; $5 = $k; $6 = ($4|0)<=($5|0); if (!($6)) { STACKTOP = sp;return; } $7 = $k; $8 = $0; $9 = (($8) + (($7*12)|0)|0); $10 = ((($9)) + 8|0); $11 = HEAP16[$10>>1]|0; $12 = $11 << 16 >> 16; $13 = ($12|0)>=(0); L4: do { if ($13) { $14 = $k; $15 = $0; $16 = (($15) + (($14*12)|0)|0); $17 = ((($16)) + 4|0); $18 = HEAP16[$17>>1]|0; $19 = $18 << 16 >> 16; $n = $19; $20 = $0; $21 = ((($20)) + 5190|0); $22 = HEAP16[$21>>1]|0; $23 = $22 << 16 >> 16; $24 = $n; $25 = (($23) + ($24))|0; $26 = $25&65535; $27 = $0; $28 = ((($27)) + 5190|0); HEAP16[$28>>1] = $26; $29 = $0; $30 = ((($29)) + 5190|0); $31 = HEAP16[$30>>1]|0; $32 = $31 << 16 >> 16; $33 = (999 - ($32))|0; $num = $33; $34 = $0; $35 = ((($34)) + 1188|0); $36 = $0; $37 = ((($36)) + 5190|0); $38 = HEAP16[$37>>1]|0; $39 = $38 << 16 >> 16; $40 = (($35) + ($39<<2)|0); $41 = $0; $42 = ((($41)) + 1188|0); $43 = $0; $44 = ((($43)) + 5190|0); $45 = HEAP16[$44>>1]|0; $46 = $45 << 16 >> 16; $47 = (($42) + ($46<<2)|0); $48 = $n; $49 = (0 - ($48))|0; $50 = (($47) + ($49<<2)|0); $51 = $num; $52 = $51; (_nk_memcopy($40,$50,$52)|0); $53 = $0; $54 = ((($53)) + 5186|0); $55 = HEAP16[$54>>1]|0; $56 = $55 << 16 >> 16; $i = $56; while(1) { $57 = $i; $58 = $k; $59 = ($57|0)<($58|0); if (!($59)) { break L4; } $60 = $i; $61 = $0; $62 = (($61) + (($60*12)|0)|0); $63 = ((($62)) + 8|0); $64 = HEAP16[$63>>1]|0; $65 = $64 << 16 >> 16; $66 = ($65|0)>=(0); if ($66) { $67 = $i; $68 = $0; $69 = (($68) + (($67*12)|0)|0); $70 = ((($69)) + 8|0); $71 = HEAP16[$70>>1]|0; $72 = $71 << 16 >> 16; $73 = $n; $74 = (($72) + ($73))|0; $75 = $74&65535; $76 = $i; $77 = $0; $78 = (($77) + (($76*12)|0)|0); $79 = ((($78)) + 8|0); HEAP16[$79>>1] = $75; } $80 = $i; $81 = (($80) + 1)|0; $i = $81; } } } while(0); $82 = $0; $83 = ((($82)) + 5186|0); $84 = HEAP16[$83>>1]|0; $85 = (($84) + 1)<<16>>16; HEAP16[$83>>1] = $85; $86 = $0; $87 = ((($86)) + 5186|0); $88 = HEAP16[$87>>1]|0; $89 = $88 << 16 >> 16; $90 = (99 - ($89))|0; $num = $90; $91 = $num; $92 = ($91|0)!=(0); if (!($92)) { STACKTOP = sp;return; } $93 = $0; $94 = $0; $95 = ((($94)) + 5186|0); $96 = HEAP16[$95>>1]|0; $97 = $96 << 16 >> 16; $98 = (($93) + (($97*12)|0)|0); $99 = ((($98)) + -12|0); $100 = $0; $101 = $0; $102 = ((($101)) + 5186|0); $103 = HEAP16[$102>>1]|0; $104 = $103 << 16 >> 16; $105 = (($100) + (($104*12)|0)|0); $106 = $num; $107 = ($106*12)|0; (_nk_memcopy($99,$105,$107)|0); STACKTOP = sp;return; } function _nk_textedit_redo($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0; var $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0; var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0; var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i = 0, $r = 0, $s = 0, $u = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $r = sp + 4|0; $0 = $state; $1 = $0; $2 = ((($1)) + 112|0); $s = $2; $3 = $s; $4 = ((($3)) + 5186|0); $5 = HEAP16[$4>>1]|0; $6 = $5 << 16 >> 16; $7 = ($6|0)==(99); if ($7) { STACKTOP = sp;return; } $8 = $s; $9 = ((($8)) + 5184|0); $10 = HEAP16[$9>>1]|0; $11 = $10 << 16 >> 16; $12 = $s; $13 = (($12) + (($11*12)|0)|0); $u = $13; $14 = $s; $15 = ((($14)) + 5186|0); $16 = HEAP16[$15>>1]|0; $17 = $16 << 16 >> 16; $18 = $s; $19 = (($18) + (($17*12)|0)|0); ;HEAP32[$r>>2]=HEAP32[$19>>2]|0;HEAP32[$r+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$r+8>>2]=HEAP32[$19+8>>2]|0; $20 = ((($r)) + 4|0); $21 = HEAP16[$20>>1]|0; $22 = $u; $23 = ((($22)) + 6|0); HEAP16[$23>>1] = $21; $24 = ((($r)) + 6|0); $25 = HEAP16[$24>>1]|0; $26 = $u; $27 = ((($26)) + 4|0); HEAP16[$27>>1] = $25; $28 = HEAP32[$r>>2]|0; $29 = $u; HEAP32[$29>>2] = $28; $30 = $u; $31 = ((($30)) + 8|0); HEAP16[$31>>1] = -1; $32 = ((($r)) + 6|0); $33 = HEAP16[$32>>1]|0; $34 = ($33<<16>>16)!=(0); if ($34) { $35 = $s; $36 = ((($35)) + 5188|0); $37 = HEAP16[$36>>1]|0; $38 = $37 << 16 >> 16; $39 = $u; $40 = ((($39)) + 4|0); $41 = HEAP16[$40>>1]|0; $42 = $41 << 16 >> 16; $43 = (($38) + ($42))|0; $44 = $s; $45 = ((($44)) + 5190|0); $46 = HEAP16[$45>>1]|0; $47 = $46 << 16 >> 16; $48 = ($43|0)>($47|0); L6: do { if ($48) { $49 = $u; $50 = ((($49)) + 4|0); HEAP16[$50>>1] = 0; $51 = $u; $52 = ((($51)) + 6|0); HEAP16[$52>>1] = 0; } else { $53 = $s; $54 = ((($53)) + 5188|0); $55 = HEAP16[$54>>1]|0; $56 = $u; $57 = ((($56)) + 8|0); HEAP16[$57>>1] = $55; $58 = $s; $59 = ((($58)) + 5188|0); $60 = HEAP16[$59>>1]|0; $61 = $60 << 16 >> 16; $62 = $u; $63 = ((($62)) + 4|0); $64 = HEAP16[$63>>1]|0; $65 = $64 << 16 >> 16; $66 = (($61) + ($65))|0; $67 = $66&65535; $68 = $s; $69 = ((($68)) + 5188|0); HEAP16[$69>>1] = $67; $i = 0; while(1) { $70 = $i; $71 = $u; $72 = ((($71)) + 4|0); $73 = HEAP16[$72>>1]|0; $74 = $73 << 16 >> 16; $75 = ($70|0)<($74|0); if (!($75)) { break L6; } $76 = $0; $77 = ((($76)) + 12|0); $78 = $u; $79 = HEAP32[$78>>2]|0; $80 = $i; $81 = (($79) + ($80))|0; $82 = (_nk_str_rune_at($77,$81)|0); $83 = $u; $84 = ((($83)) + 8|0); $85 = HEAP16[$84>>1]|0; $86 = $85 << 16 >> 16; $87 = $i; $88 = (($86) + ($87))|0; $89 = $s; $90 = ((($89)) + 1188|0); $91 = (($90) + ($88<<2)|0); HEAP32[$91>>2] = $82; $92 = $i; $93 = (($92) + 1)|0; $i = $93; } } } while(0); $94 = $0; $95 = ((($94)) + 12|0); $96 = HEAP32[$r>>2]|0; $97 = ((($r)) + 6|0); $98 = HEAP16[$97>>1]|0; $99 = $98 << 16 >> 16; _nk_str_delete_runes($95,$96,$99); } $100 = ((($r)) + 4|0); $101 = HEAP16[$100>>1]|0; $102 = ($101<<16>>16)!=(0); if ($102) { $103 = $0; $104 = ((($103)) + 12|0); $105 = HEAP32[$r>>2]|0; $106 = ((($r)) + 8|0); $107 = HEAP16[$106>>1]|0; $108 = $107 << 16 >> 16; $109 = $s; $110 = ((($109)) + 1188|0); $111 = (($110) + ($108<<2)|0); $112 = ((($r)) + 4|0); $113 = HEAP16[$112>>1]|0; $114 = $113 << 16 >> 16; (_nk_str_insert_text_runes($104,$105,$111,$114)|0); } $115 = HEAP32[$r>>2]|0; $116 = ((($r)) + 4|0); $117 = HEAP16[$116>>1]|0; $118 = $117 << 16 >> 16; $119 = (($115) + ($118))|0; $120 = $0; $121 = ((($120)) + 88|0); HEAP32[$121>>2] = $119; $122 = $s; $123 = ((($122)) + 5184|0); $124 = HEAP16[$123>>1]|0; $125 = (($124) + 1)<<16>>16; HEAP16[$123>>1] = $125; $126 = $s; $127 = ((($126)) + 5186|0); $128 = HEAP16[$127>>1]|0; $129 = (($128) + 1)<<16>>16; HEAP16[$127>>1] = $129; STACKTOP = sp;return; } function _nk_textedit_clear_state($state,$type,$filter) { $state = $state|0; $type = $type|0; $filter = $filter|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $type; $2 = $filter; $3 = $0; $4 = ((($3)) + 112|0); $5 = ((($4)) + 5184|0); HEAP16[$5>>1] = 0; $6 = $0; $7 = ((($6)) + 112|0); $8 = ((($7)) + 5188|0); HEAP16[$8>>1] = 0; $9 = $0; $10 = ((($9)) + 112|0); $11 = ((($10)) + 5186|0); HEAP16[$11>>1] = 99; $12 = $0; $13 = ((($12)) + 112|0); $14 = ((($13)) + 5190|0); HEAP16[$14>>1] = 999; $15 = $0; $16 = ((($15)) + 92|0); HEAP32[$16>>2] = 0; $17 = $0; $18 = ((($17)) + 96|0); HEAP32[$18>>2] = 0; $19 = $0; $20 = ((($19)) + 88|0); HEAP32[$20>>2] = 0; $21 = $0; $22 = ((($21)) + 103|0); HEAP8[$22>>0] = 0; $23 = $0; $24 = ((($23)) + 108|0); HEAPF32[$24>>2] = 0.0; $25 = $0; $26 = ((($25)) + 101|0); HEAP8[$26>>0] = 0; $27 = $0; $28 = ((($27)) + 102|0); HEAP8[$28>>0] = 1; $29 = $1; $30 = ($29|0)==(0); $31 = $30&1; $32 = $31&255; $33 = $0; $34 = ((($33)) + 104|0); HEAP8[$34>>0] = $32; $35 = $0; $36 = ((($35)) + 100|0); HEAP8[$36>>0] = 0; $37 = $2; $38 = $0; $39 = ((($38)) + 76|0); HEAP32[$39>>2] = $37; STACKTOP = sp;return; } function _nk_textedit_select_all($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ($1|0)!=(0|0); if ($2) { $3 = $0; $4 = ((($3)) + 92|0); HEAP32[$4>>2] = 0; $5 = $0; $6 = ((($5)) + 12|0); $7 = ((($6)) + 60|0); $8 = HEAP32[$7>>2]|0; $9 = $0; $10 = ((($9)) + 96|0); HEAP32[$10>>2] = $8; STACKTOP = sp;return; } else { ___assert_fail((28059|0),(13400|0),11246,(28082|0)); // unreachable; } } function _nk_filter_float($box,$unicode) { $box = $box|0; $unicode = $unicode|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $box; $2 = $unicode; $3 = $2; $4 = ($3>>>0)<(48); $5 = $2; $6 = ($5>>>0)>(57); $or$cond = $4 | $6; $7 = $2; $8 = ($7|0)!=(46); $or$cond3 = $or$cond & $8; $9 = $2; $10 = ($9|0)!=(45); $or$cond5 = $or$cond3 & $10; if ($or$cond5) { $0 = 0; $11 = $0; STACKTOP = sp;return ($11|0); } else { $0 = 1; $11 = $0; STACKTOP = sp;return ($11|0); } return (0)|0; } function _nk_filter_decimal($box,$unicode) { $box = $box|0; $unicode = $unicode|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $box; $2 = $unicode; $3 = $2; $4 = ($3>>>0)<(48); $5 = $2; $6 = ($5>>>0)>(57); $or$cond = $4 | $6; $7 = $2; $8 = ($7|0)!=(45); $or$cond3 = $or$cond & $8; if ($or$cond3) { $0 = 0; $9 = $0; STACKTOP = sp;return ($9|0); } else { $0 = 1; $9 = $0; STACKTOP = sp;return ($9|0); } return (0)|0; } function _nk_style_default($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; _nk_style_from_table($1,0); STACKTOP = sp;return; } function _nk_style_from_table($ctx,$table) { $ctx = $ctx|0; $table = $table|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy10 = 0, $$byval_copy11 = 0, $$byval_copy12 = 0, $$byval_copy13 = 0, $$byval_copy14 = 0, $$byval_copy15 = 0, $$byval_copy16 = 0, $$byval_copy17 = 0, $$byval_copy18 = 0, $$byval_copy19 = 0, $$byval_copy2 = 0, $$byval_copy20 = 0, $$byval_copy21 = 0, $$byval_copy22 = 0, $$byval_copy23 = 0, $$byval_copy24 = 0, $$byval_copy25 = 0, $$byval_copy26 = 0; var $$byval_copy27 = 0, $$byval_copy28 = 0, $$byval_copy29 = 0, $$byval_copy3 = 0, $$byval_copy30 = 0, $$byval_copy31 = 0, $$byval_copy32 = 0, $$byval_copy33 = 0, $$byval_copy34 = 0, $$byval_copy35 = 0, $$byval_copy36 = 0, $$byval_copy37 = 0, $$byval_copy38 = 0, $$byval_copy39 = 0, $$byval_copy4 = 0, $$byval_copy40 = 0, $$byval_copy41 = 0, $$byval_copy42 = 0, $$byval_copy43 = 0, $$byval_copy44 = 0; var $$byval_copy45 = 0, $$byval_copy46 = 0, $$byval_copy47 = 0, $$byval_copy48 = 0, $$byval_copy49 = 0, $$byval_copy5 = 0, $$byval_copy50 = 0, $$byval_copy51 = 0, $$byval_copy52 = 0, $$byval_copy53 = 0, $$byval_copy54 = 0, $$byval_copy55 = 0, $$byval_copy56 = 0, $$byval_copy57 = 0, $$byval_copy58 = 0, $$byval_copy59 = 0, $$byval_copy6 = 0, $$byval_copy60 = 0, $$byval_copy61 = 0, $$byval_copy62 = 0; var $$byval_copy63 = 0, $$byval_copy64 = 0, $$byval_copy65 = 0, $$byval_copy66 = 0, $$byval_copy67 = 0, $$byval_copy68 = 0, $$byval_copy69 = 0, $$byval_copy7 = 0, $$byval_copy70 = 0, $$byval_copy71 = 0, $$byval_copy72 = 0, $$byval_copy73 = 0, $$byval_copy74 = 0, $$byval_copy75 = 0, $$byval_copy76 = 0, $$byval_copy77 = 0, $$byval_copy78 = 0, $$byval_copy79 = 0, $$byval_copy8 = 0, $$byval_copy80 = 0; var $$byval_copy81 = 0, $$byval_copy82 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0, $1010 = 0, $1011 = 0; var $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0, $1029 = 0, $103 = 0; var $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0, $1047 = 0, $1048 = 0; var $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0, $1065 = 0, $1066 = 0; var $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $1071 = 0, $1072 = 0, $1073 = 0, $1074 = 0, $1075 = 0, $1076 = 0, $1077 = 0, $1078 = 0, $1079 = 0, $108 = 0, $1080 = 0, $1081 = 0, $1082 = 0, $1083 = 0, $1084 = 0; var $1085 = 0, $1086 = 0, $1087 = 0, $1088 = 0, $1089 = 0, $109 = 0, $1090 = 0, $1091 = 0, $1092 = 0, $1093 = 0, $1094 = 0, $1095 = 0, $1096 = 0, $1097 = 0, $1098 = 0, $1099 = 0, $11 = 0, $110 = 0, $1100 = 0, $1101 = 0; var $1102 = 0, $1103 = 0, $1104 = 0, $1105 = 0, $1106 = 0, $1107 = 0, $1108 = 0, $1109 = 0, $111 = 0, $1110 = 0, $1111 = 0, $1112 = 0, $1113 = 0, $1114 = 0, $1115 = 0, $1116 = 0, $1117 = 0, $1118 = 0, $1119 = 0, $112 = 0; var $1120 = 0, $1121 = 0, $1122 = 0, $1123 = 0, $1124 = 0, $1125 = 0, $1126 = 0, $1127 = 0, $1128 = 0, $1129 = 0, $113 = 0, $1130 = 0, $1131 = 0, $1132 = 0, $1133 = 0, $1134 = 0, $1135 = 0, $1136 = 0, $1137 = 0, $1138 = 0; var $1139 = 0, $114 = 0, $1140 = 0, $1141 = 0, $1142 = 0, $1143 = 0, $1144 = 0, $1145 = 0, $1146 = 0, $1147 = 0, $1148 = 0, $1149 = 0, $115 = 0, $1150 = 0, $1151 = 0, $1152 = 0, $1153 = 0, $1154 = 0, $1155 = 0, $1156 = 0; var $1157 = 0, $1158 = 0, $1159 = 0, $116 = 0, $1160 = 0, $1161 = 0, $1162 = 0, $1163 = 0, $1164 = 0, $1165 = 0, $1166 = 0, $1167 = 0, $1168 = 0, $1169 = 0, $117 = 0, $1170 = 0, $1171 = 0, $1172 = 0, $1173 = 0, $1174 = 0; var $1175 = 0, $1176 = 0, $1177 = 0, $1178 = 0, $1179 = 0, $118 = 0, $1180 = 0, $1181 = 0, $1182 = 0, $1183 = 0, $1184 = 0, $1185 = 0, $1186 = 0, $1187 = 0, $1188 = 0, $1189 = 0, $119 = 0, $1190 = 0, $1191 = 0, $1192 = 0; var $1193 = 0, $1194 = 0, $1195 = 0, $1196 = 0, $1197 = 0, $1198 = 0, $1199 = 0, $12 = 0, $120 = 0, $1200 = 0, $1201 = 0, $1202 = 0, $1203 = 0, $1204 = 0, $1205 = 0, $1206 = 0, $1207 = 0, $1208 = 0, $1209 = 0, $121 = 0; var $1210 = 0, $1211 = 0, $1212 = 0, $1213 = 0, $1214 = 0, $1215 = 0, $1216 = 0, $1217 = 0, $1218 = 0, $1219 = 0, $122 = 0, $1220 = 0, $1221 = 0, $1222 = 0, $1223 = 0, $1224 = 0, $1225 = 0, $1226 = 0, $1227 = 0, $1228 = 0; var $1229 = 0, $123 = 0, $1230 = 0, $1231 = 0, $1232 = 0, $1233 = 0, $1234 = 0, $1235 = 0, $1236 = 0, $1237 = 0, $1238 = 0, $1239 = 0, $124 = 0, $1240 = 0, $1241 = 0, $1242 = 0, $1243 = 0, $1244 = 0, $1245 = 0, $1246 = 0; var $1247 = 0, $1248 = 0, $1249 = 0, $125 = 0, $1250 = 0, $1251 = 0, $1252 = 0, $1253 = 0, $1254 = 0, $1255 = 0, $1256 = 0, $1257 = 0, $1258 = 0, $1259 = 0, $126 = 0, $1260 = 0, $1261 = 0, $1262 = 0, $1263 = 0, $1264 = 0; var $1265 = 0, $1266 = 0, $1267 = 0, $1268 = 0, $1269 = 0, $127 = 0, $1270 = 0, $1271 = 0, $1272 = 0, $1273 = 0, $1274 = 0, $1275 = 0, $1276 = 0, $1277 = 0, $1278 = 0, $1279 = 0, $128 = 0, $1280 = 0, $1281 = 0, $1282 = 0; var $1283 = 0, $1284 = 0, $1285 = 0, $1286 = 0, $1287 = 0, $1288 = 0, $1289 = 0, $129 = 0, $1290 = 0, $1291 = 0, $1292 = 0, $1293 = 0, $1294 = 0, $1295 = 0, $1296 = 0, $1297 = 0, $1298 = 0, $1299 = 0, $13 = 0, $130 = 0; var $1300 = 0, $1301 = 0, $1302 = 0, $1303 = 0, $1304 = 0, $1305 = 0, $1306 = 0, $1307 = 0, $1308 = 0, $1309 = 0, $131 = 0, $1310 = 0, $1311 = 0, $1312 = 0, $1313 = 0, $1314 = 0, $1315 = 0, $1316 = 0, $1317 = 0, $1318 = 0; var $1319 = 0, $132 = 0, $1320 = 0, $1321 = 0, $1322 = 0, $1323 = 0, $1324 = 0, $1325 = 0, $1326 = 0, $1327 = 0, $1328 = 0, $1329 = 0, $133 = 0, $1330 = 0, $1331 = 0, $1332 = 0, $1333 = 0, $1334 = 0, $1335 = 0, $1336 = 0; var $1337 = 0, $1338 = 0, $1339 = 0, $134 = 0, $1340 = 0, $1341 = 0, $1342 = 0, $1343 = 0, $1344 = 0, $1345 = 0, $1346 = 0, $1347 = 0, $1348 = 0, $1349 = 0, $135 = 0, $1350 = 0, $1351 = 0, $1352 = 0, $1353 = 0, $1354 = 0; var $1355 = 0, $1356 = 0, $1357 = 0, $1358 = 0, $1359 = 0, $136 = 0, $1360 = 0, $1361 = 0, $1362 = 0, $1363 = 0, $1364 = 0, $1365 = 0, $1366 = 0, $1367 = 0, $1368 = 0, $1369 = 0, $137 = 0, $1370 = 0, $1371 = 0, $1372 = 0; var $1373 = 0, $1374 = 0, $1375 = 0, $1376 = 0, $1377 = 0, $1378 = 0, $1379 = 0, $138 = 0, $1380 = 0, $1381 = 0, $1382 = 0, $1383 = 0, $1384 = 0, $1385 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0; var $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0; var $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0; var $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0; var $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0; var $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0; var $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0; var $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0; var $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0; var $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0; var $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0; var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0; var $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0; var $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0; var $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0; var $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0; var $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0; var $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0; var $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0; var $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0; var $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0; var $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0; var $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0; var $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0; var $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0; var $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0; var $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0; var $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0; var $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0; var $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0; var $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0; var $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0; var $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0; var $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0; var $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0; var $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0; var $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0; var $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0; var $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0; var $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0; var $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0; var $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0; var $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0; var $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0; var $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0; var $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0; var $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0; var $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0; var $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $button = 0, $chart = 0, $combo = 0, $edit = 0, $prog = 0, $property = 0, $scroll = 0, $select = 0, $slider = 0, $style = 0, $tab = 0; var $text = 0, $toggle = 0, $win = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 2768|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy82 = sp + 2756|0; $$byval_copy81 = sp + 2752|0; $$byval_copy80 = sp + 2748|0; $$byval_copy79 = sp + 2744|0; $$byval_copy78 = sp + 2740|0; $$byval_copy77 = sp + 2736|0; $$byval_copy76 = sp + 2732|0; $$byval_copy75 = sp + 2728|0; $$byval_copy74 = sp + 2724|0; $$byval_copy73 = sp + 2720|0; $$byval_copy72 = sp + 2716|0; $$byval_copy71 = sp + 2712|0; $$byval_copy70 = sp + 2708|0; $$byval_copy69 = sp + 2704|0; $$byval_copy68 = sp + 2700|0; $$byval_copy67 = sp + 2696|0; $$byval_copy66 = sp + 2692|0; $$byval_copy65 = sp + 2688|0; $$byval_copy64 = sp + 2684|0; $$byval_copy63 = sp + 2680|0; $$byval_copy62 = sp + 2676|0; $$byval_copy61 = sp + 2672|0; $$byval_copy60 = sp + 2668|0; $$byval_copy59 = sp + 2664|0; $$byval_copy58 = sp + 2660|0; $$byval_copy57 = sp + 2656|0; $$byval_copy56 = sp + 2652|0; $$byval_copy55 = sp + 2648|0; $$byval_copy54 = sp + 2644|0; $$byval_copy53 = sp + 2640|0; $$byval_copy52 = sp + 2636|0; $$byval_copy51 = sp + 2632|0; $$byval_copy50 = sp + 2628|0; $$byval_copy49 = sp + 2624|0; $$byval_copy48 = sp + 2620|0; $$byval_copy47 = sp + 2616|0; $$byval_copy46 = sp + 2612|0; $$byval_copy45 = sp + 2608|0; $$byval_copy44 = sp + 2604|0; $$byval_copy43 = sp + 2600|0; $$byval_copy42 = sp + 2596|0; $$byval_copy41 = sp + 2592|0; $$byval_copy40 = sp + 2588|0; $$byval_copy39 = sp + 2584|0; $$byval_copy38 = sp + 2580|0; $$byval_copy37 = sp + 2576|0; $$byval_copy36 = sp + 2572|0; $$byval_copy35 = sp + 2568|0; $$byval_copy34 = sp + 2564|0; $$byval_copy33 = sp + 2560|0; $$byval_copy32 = sp + 2556|0; $$byval_copy31 = sp + 2552|0; $$byval_copy30 = sp + 2548|0; $$byval_copy29 = sp + 2544|0; $$byval_copy28 = sp + 2540|0; $$byval_copy27 = sp + 2536|0; $$byval_copy26 = sp + 2532|0; $$byval_copy25 = sp + 2528|0; $$byval_copy24 = sp + 2524|0; $$byval_copy23 = sp + 2520|0; $$byval_copy22 = sp + 2516|0; $$byval_copy21 = sp + 2512|0; $$byval_copy20 = sp + 2508|0; $$byval_copy19 = sp + 2504|0; $$byval_copy18 = sp + 2500|0; $$byval_copy17 = sp + 2496|0; $$byval_copy16 = sp + 2492|0; $$byval_copy15 = sp + 2488|0; $$byval_copy14 = sp + 2484|0; $$byval_copy13 = sp + 2480|0; $$byval_copy12 = sp + 2476|0; $$byval_copy11 = sp + 2472|0; $$byval_copy10 = sp + 2468|0; $$byval_copy9 = sp + 2464|0; $$byval_copy8 = sp + 2460|0; $$byval_copy7 = sp + 2456|0; $$byval_copy6 = sp + 2452|0; $$byval_copy5 = sp + 2448|0; $$byval_copy4 = sp + 2444|0; $$byval_copy3 = sp + 2440|0; $$byval_copy2 = sp + 2436|0; $$byval_copy1 = sp + 2432|0; $$byval_copy = sp + 2428|0; $2 = sp + 2256|0; $3 = sp + 2232|0; $4 = sp + 2212|0; $5 = sp + 2192|0; $6 = sp + 2184|0; $7 = sp + 2176|0; $8 = sp + 2168|0; $9 = sp + 2164|0; $10 = sp + 2144|0; $11 = sp + 2124|0; $12 = sp + 2104|0; $13 = sp + 2096|0; $14 = sp + 2088|0; $15 = sp + 2084|0; $16 = sp + 2064|0; $17 = sp + 2044|0; $18 = sp + 2024|0; $19 = sp + 2016|0; $20 = sp + 2008|0; $21 = sp + 2000|0; $22 = sp + 1980|0; $23 = sp + 1960|0; $24 = sp + 1940|0; $25 = sp + 1920|0; $26 = sp + 1900|0; $27 = sp + 1896|0; $28 = sp + 1888|0; $29 = sp + 1880|0; $30 = sp + 1860|0; $31 = sp + 1840|0; $32 = sp + 1820|0; $33 = sp + 1800|0; $34 = sp + 1780|0; $35 = sp + 1776|0; $36 = sp + 1768|0; $37 = sp + 1760|0; $38 = sp + 1740|0; $39 = sp + 1720|0; $40 = sp + 1700|0; $41 = sp + 1680|0; $42 = sp + 1660|0; $43 = sp + 1640|0; $44 = sp + 1632|0; $45 = sp + 1624|0; $46 = sp + 1616|0; $47 = sp + 1596|0; $48 = sp + 1576|0; $49 = sp + 1556|0; $50 = sp + 1536|0; $51 = sp + 1516|0; $52 = sp + 1496|0; $53 = sp + 1488|0; $54 = sp + 1480|0; $55 = sp + 1472|0; $56 = sp + 1468|0; $57 = sp + 2424|0; $58 = sp + 1448|0; $59 = sp + 2420|0; $60 = sp + 1428|0; $61 = sp + 2416|0; $62 = sp + 1408|0; $63 = sp + 2412|0; $64 = sp + 2408|0; $65 = sp + 2404|0; $66 = sp + 2400|0; $67 = sp + 2396|0; $68 = sp + 1400|0; $69 = sp + 1392|0; $70 = sp + 1388|0; $71 = sp + 1368|0; $72 = sp + 1348|0; $73 = sp + 1328|0; $74 = sp + 1308|0; $75 = sp + 1288|0; $76 = sp + 1268|0; $77 = sp + 2392|0; $78 = sp + 2388|0; $79 = sp + 1264|0; $80 = sp + 1256|0; $81 = sp + 1232|0; $82 = sp + 1212|0; $83 = sp + 1192|0; $84 = sp + 1172|0; $85 = sp + 1152|0; $86 = sp + 1132|0; $87 = sp + 1128|0; $88 = sp + 1120|0; $89 = sp + 2384|0; $90 = sp + 1096|0; $91 = sp + 2380|0; $92 = sp + 1076|0; $93 = sp + 2376|0; $94 = sp + 1056|0; $95 = sp + 2372|0; $96 = sp + 2368|0; $97 = sp + 2364|0; $98 = sp + 2360|0; $99 = sp + 2356|0; $100 = sp + 1048|0; $101 = sp + 1040|0; $102 = sp + 1036|0; $103 = sp + 1016|0; $104 = sp + 996|0; $105 = sp + 976|0; $106 = sp + 968|0; $107 = sp + 948|0; $108 = sp + 928|0; $109 = sp + 908|0; $110 = sp + 904|0; $111 = sp + 896|0; $112 = sp + 872|0; $113 = sp + 852|0; $114 = sp + 832|0; $115 = sp + 2352|0; $116 = sp + 824|0; $117 = sp + 816|0; $118 = sp + 812|0; $119 = sp + 792|0; $120 = sp + 772|0; $121 = sp + 752|0; $122 = sp + 2348|0; $123 = sp + 744|0; $124 = sp + 720|0; $125 = sp + 712|0; $126 = sp + 688|0; $127 = sp + 668|0; $128 = sp + 648|0; $129 = sp + 640|0; $130 = sp + 632|0; $131 = sp + 624|0; $132 = sp + 600|0; $133 = sp + 580|0; $134 = sp + 560|0; $135 = sp + 2344|0; $136 = sp + 552|0; $137 = sp + 544|0; $138 = sp + 540|0; $139 = sp + 520|0; $140 = sp + 512|0; $141 = sp + 504|0; $142 = sp + 480|0; $143 = sp + 460|0; $144 = sp + 440|0; $145 = sp + 2340|0; $146 = sp + 432|0; $147 = sp + 424|0; $148 = sp + 420|0; $149 = sp + 400|0; $150 = sp + 380|0; $151 = sp + 360|0; $152 = sp + 2336|0; $153 = sp + 352|0; $154 = sp + 344|0; $155 = sp + 340|0; $156 = sp + 320|0; $157 = sp + 300|0; $158 = sp + 280|0; $159 = sp + 272|0; $160 = sp + 264|0; $161 = sp + 256|0; $162 = sp + 232|0; $163 = sp + 212|0; $164 = sp + 192|0; $165 = sp + 2332|0; $166 = sp + 184|0; $167 = sp + 176|0; $168 = sp + 172|0; $169 = sp + 152|0; $170 = sp + 132|0; $171 = sp + 112|0; $172 = sp + 2328|0; $173 = sp + 104|0; $174 = sp + 96|0; $175 = sp + 88|0; $176 = sp + 68|0; $177 = sp + 48|0; $178 = sp + 40|0; $179 = sp + 32|0; $180 = sp + 24|0; $181 = sp + 16|0; $182 = sp + 8|0; $183 = sp; $0 = $ctx; $1 = $table; $184 = $0; $185 = ($184|0)!=(0|0); if (!($185)) { ___assert_fail((14913|0),(13400|0),13755,(28105|0)); // unreachable; } $186 = $0; $187 = ($186|0)!=(0|0); if (!($187)) { STACKTOP = sp;return; } $188 = $0; $189 = ((($188)) + 300|0); $style = $189; $190 = $1; $191 = ($190|0)!=(0|0); $192 = $1; $193 = $191 ? $192 : 28125; $1 = $193; $194 = $style; $195 = ((($194)) + 20|0); $text = $195; $196 = $text; $197 = $1; ;HEAP8[$196>>0]=HEAP8[$197>>0]|0;HEAP8[$196+1>>0]=HEAP8[$197+1>>0]|0;HEAP8[$196+2>>0]=HEAP8[$197+2>>0]|0;HEAP8[$196+3>>0]=HEAP8[$197+3>>0]|0; $198 = $text; $199 = ((($198)) + 4|0); _nk_vec2($2,4.0,4.0); ;HEAP32[$199>>2]=HEAP32[$2>>2]|0;HEAP32[$199+4>>2]=HEAP32[$2+4>>2]|0; $200 = $style; $201 = ((($200)) + 32|0); $button = $201; $202 = $button; _nk_zero($202,128); $203 = $button; $204 = $1; $205 = ((($204)) + 16|0); ;HEAP8[$$byval_copy>>0]=HEAP8[$205>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$205+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$205+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$205+3>>0]|0; _nk_style_item_color($3,$$byval_copy); ;HEAP32[$203>>2]=HEAP32[$3>>2]|0;HEAP32[$203+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$203+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[$203+12>>2]=HEAP32[$3+12>>2]|0;HEAP32[$203+16>>2]=HEAP32[$3+16>>2]|0; $206 = $button; $207 = ((($206)) + 20|0); $208 = $1; $209 = ((($208)) + 20|0); ;HEAP8[$$byval_copy1>>0]=HEAP8[$209>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$209+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$209+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$209+3>>0]|0; _nk_style_item_color($4,$$byval_copy1); ;HEAP32[$207>>2]=HEAP32[$4>>2]|0;HEAP32[$207+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$207+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$207+12>>2]=HEAP32[$4+12>>2]|0;HEAP32[$207+16>>2]=HEAP32[$4+16>>2]|0; $210 = $button; $211 = ((($210)) + 40|0); $212 = $1; $213 = ((($212)) + 24|0); ;HEAP8[$$byval_copy2>>0]=HEAP8[$213>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$213+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$213+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$213+3>>0]|0; _nk_style_item_color($5,$$byval_copy2); ;HEAP32[$211>>2]=HEAP32[$5>>2]|0;HEAP32[$211+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$211+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$211+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$211+16>>2]=HEAP32[$5+16>>2]|0; $214 = $button; $215 = ((($214)) + 60|0); $216 = $1; $217 = ((($216)) + 12|0); ;HEAP8[$215>>0]=HEAP8[$217>>0]|0;HEAP8[$215+1>>0]=HEAP8[$217+1>>0]|0;HEAP8[$215+2>>0]=HEAP8[$217+2>>0]|0;HEAP8[$215+3>>0]=HEAP8[$217+3>>0]|0; $218 = $button; $219 = ((($218)) + 64|0); $220 = $1; $221 = ((($220)) + 16|0); ;HEAP8[$219>>0]=HEAP8[$221>>0]|0;HEAP8[$219+1>>0]=HEAP8[$221+1>>0]|0;HEAP8[$219+2>>0]=HEAP8[$221+2>>0]|0;HEAP8[$219+3>>0]=HEAP8[$221+3>>0]|0; $222 = $button; $223 = ((($222)) + 68|0); $224 = $1; ;HEAP8[$223>>0]=HEAP8[$224>>0]|0;HEAP8[$223+1>>0]=HEAP8[$224+1>>0]|0;HEAP8[$223+2>>0]=HEAP8[$224+2>>0]|0;HEAP8[$223+3>>0]=HEAP8[$224+3>>0]|0; $225 = $button; $226 = ((($225)) + 72|0); $227 = $1; ;HEAP8[$226>>0]=HEAP8[$227>>0]|0;HEAP8[$226+1>>0]=HEAP8[$227+1>>0]|0;HEAP8[$226+2>>0]=HEAP8[$227+2>>0]|0;HEAP8[$226+3>>0]=HEAP8[$227+3>>0]|0; $228 = $button; $229 = ((($228)) + 76|0); $230 = $1; ;HEAP8[$229>>0]=HEAP8[$230>>0]|0;HEAP8[$229+1>>0]=HEAP8[$230+1>>0]|0;HEAP8[$229+2>>0]=HEAP8[$230+2>>0]|0;HEAP8[$229+3>>0]=HEAP8[$230+3>>0]|0; $231 = $button; $232 = ((($231)) + 92|0); _nk_vec2($6,4.0,4.0); ;HEAP32[$232>>2]=HEAP32[$6>>2]|0;HEAP32[$232+4>>2]=HEAP32[$6+4>>2]|0; $233 = $button; $234 = ((($233)) + 100|0); _nk_vec2($7,0.0,0.0); ;HEAP32[$234>>2]=HEAP32[$7>>2]|0;HEAP32[$234+4>>2]=HEAP32[$7+4>>2]|0; $235 = $button; $236 = ((($235)) + 108|0); _nk_vec2($8,0.0,0.0); ;HEAP32[$236>>2]=HEAP32[$8>>2]|0;HEAP32[$236+4>>2]=HEAP32[$8+4>>2]|0; $237 = $button; $238 = ((($237)) + 116|0); _nk_handle_ptr($9,0); ;HEAP32[$238>>2]=HEAP32[$9>>2]|0; $239 = $button; $240 = ((($239)) + 80|0); HEAP32[$240>>2] = 18; $241 = $button; $242 = ((($241)) + 84|0); HEAPF32[$242>>2] = 1.0; $243 = $button; $244 = ((($243)) + 88|0); HEAPF32[$244>>2] = 4.0; $245 = $button; $246 = ((($245)) + 120|0); HEAP32[$246>>2] = 0; $247 = $button; $248 = ((($247)) + 124|0); HEAP32[$248>>2] = 0; $249 = $style; $250 = ((($249)) + 160|0); $button = $250; $251 = $button; _nk_zero($251,128); $252 = $button; $253 = $1; $254 = ((($253)) + 4|0); ;HEAP8[$$byval_copy3>>0]=HEAP8[$254>>0]|0;HEAP8[$$byval_copy3+1>>0]=HEAP8[$254+1>>0]|0;HEAP8[$$byval_copy3+2>>0]=HEAP8[$254+2>>0]|0;HEAP8[$$byval_copy3+3>>0]=HEAP8[$254+3>>0]|0; _nk_style_item_color($10,$$byval_copy3); ;HEAP32[$252>>2]=HEAP32[$10>>2]|0;HEAP32[$252+4>>2]=HEAP32[$10+4>>2]|0;HEAP32[$252+8>>2]=HEAP32[$10+8>>2]|0;HEAP32[$252+12>>2]=HEAP32[$10+12>>2]|0;HEAP32[$252+16>>2]=HEAP32[$10+16>>2]|0; $255 = $button; $256 = ((($255)) + 20|0); $257 = $1; $258 = ((($257)) + 20|0); ;HEAP8[$$byval_copy4>>0]=HEAP8[$258>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$258+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$258+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$258+3>>0]|0; _nk_style_item_color($11,$$byval_copy4); ;HEAP32[$256>>2]=HEAP32[$11>>2]|0;HEAP32[$256+4>>2]=HEAP32[$11+4>>2]|0;HEAP32[$256+8>>2]=HEAP32[$11+8>>2]|0;HEAP32[$256+12>>2]=HEAP32[$11+12>>2]|0;HEAP32[$256+16>>2]=HEAP32[$11+16>>2]|0; $259 = $button; $260 = ((($259)) + 40|0); $261 = $1; $262 = ((($261)) + 24|0); ;HEAP8[$$byval_copy5>>0]=HEAP8[$262>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$262+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$262+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$262+3>>0]|0; _nk_style_item_color($12,$$byval_copy5); ;HEAP32[$260>>2]=HEAP32[$12>>2]|0;HEAP32[$260+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$260+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[$260+12>>2]=HEAP32[$12+12>>2]|0;HEAP32[$260+16>>2]=HEAP32[$12+16>>2]|0; $263 = $button; $264 = ((($263)) + 60|0); $265 = $1; $266 = ((($265)) + 4|0); ;HEAP8[$264>>0]=HEAP8[$266>>0]|0;HEAP8[$264+1>>0]=HEAP8[$266+1>>0]|0;HEAP8[$264+2>>0]=HEAP8[$266+2>>0]|0;HEAP8[$264+3>>0]=HEAP8[$266+3>>0]|0; $267 = $button; $268 = ((($267)) + 64|0); $269 = $1; $270 = ((($269)) + 4|0); ;HEAP8[$268>>0]=HEAP8[$270>>0]|0;HEAP8[$268+1>>0]=HEAP8[$270+1>>0]|0;HEAP8[$268+2>>0]=HEAP8[$270+2>>0]|0;HEAP8[$268+3>>0]=HEAP8[$270+3>>0]|0; $271 = $button; $272 = ((($271)) + 68|0); $273 = $1; ;HEAP8[$272>>0]=HEAP8[$273>>0]|0;HEAP8[$272+1>>0]=HEAP8[$273+1>>0]|0;HEAP8[$272+2>>0]=HEAP8[$273+2>>0]|0;HEAP8[$272+3>>0]=HEAP8[$273+3>>0]|0; $274 = $button; $275 = ((($274)) + 72|0); $276 = $1; ;HEAP8[$275>>0]=HEAP8[$276>>0]|0;HEAP8[$275+1>>0]=HEAP8[$276+1>>0]|0;HEAP8[$275+2>>0]=HEAP8[$276+2>>0]|0;HEAP8[$275+3>>0]=HEAP8[$276+3>>0]|0; $277 = $button; $278 = ((($277)) + 76|0); $279 = $1; ;HEAP8[$278>>0]=HEAP8[$279>>0]|0;HEAP8[$278+1>>0]=HEAP8[$279+1>>0]|0;HEAP8[$278+2>>0]=HEAP8[$279+2>>0]|0;HEAP8[$278+3>>0]=HEAP8[$279+3>>0]|0; $280 = $button; $281 = ((($280)) + 92|0); _nk_vec2($13,4.0,4.0); ;HEAP32[$281>>2]=HEAP32[$13>>2]|0;HEAP32[$281+4>>2]=HEAP32[$13+4>>2]|0; $282 = $button; $283 = ((($282)) + 108|0); _nk_vec2($14,0.0,0.0); ;HEAP32[$283>>2]=HEAP32[$14>>2]|0;HEAP32[$283+4>>2]=HEAP32[$14+4>>2]|0; $284 = $button; $285 = ((($284)) + 116|0); _nk_handle_ptr($15,0); ;HEAP32[$285>>2]=HEAP32[$15>>2]|0; $286 = $button; $287 = ((($286)) + 80|0); HEAP32[$287>>2] = 18; $288 = $button; $289 = ((($288)) + 84|0); HEAPF32[$289>>2] = 0.0; $290 = $button; $291 = ((($290)) + 88|0); HEAPF32[$291>>2] = 0.0; $292 = $button; $293 = ((($292)) + 120|0); HEAP32[$293>>2] = 0; $294 = $button; $295 = ((($294)) + 124|0); HEAP32[$295>>2] = 0; $296 = $style; $297 = ((($296)) + 288|0); $button = $297; $298 = $button; _nk_zero($298,128); $299 = $button; $300 = $1; $301 = ((($300)) + 4|0); ;HEAP8[$$byval_copy6>>0]=HEAP8[$301>>0]|0;HEAP8[$$byval_copy6+1>>0]=HEAP8[$301+1>>0]|0;HEAP8[$$byval_copy6+2>>0]=HEAP8[$301+2>>0]|0;HEAP8[$$byval_copy6+3>>0]=HEAP8[$301+3>>0]|0; _nk_style_item_color($16,$$byval_copy6); ;HEAP32[$299>>2]=HEAP32[$16>>2]|0;HEAP32[$299+4>>2]=HEAP32[$16+4>>2]|0;HEAP32[$299+8>>2]=HEAP32[$16+8>>2]|0;HEAP32[$299+12>>2]=HEAP32[$16+12>>2]|0;HEAP32[$299+16>>2]=HEAP32[$16+16>>2]|0; $302 = $button; $303 = ((($302)) + 20|0); $304 = $1; $305 = ((($304)) + 4|0); ;HEAP8[$$byval_copy7>>0]=HEAP8[$305>>0]|0;HEAP8[$$byval_copy7+1>>0]=HEAP8[$305+1>>0]|0;HEAP8[$$byval_copy7+2>>0]=HEAP8[$305+2>>0]|0;HEAP8[$$byval_copy7+3>>0]=HEAP8[$305+3>>0]|0; _nk_style_item_color($17,$$byval_copy7); ;HEAP32[$303>>2]=HEAP32[$17>>2]|0;HEAP32[$303+4>>2]=HEAP32[$17+4>>2]|0;HEAP32[$303+8>>2]=HEAP32[$17+8>>2]|0;HEAP32[$303+12>>2]=HEAP32[$17+12>>2]|0;HEAP32[$303+16>>2]=HEAP32[$17+16>>2]|0; $306 = $button; $307 = ((($306)) + 40|0); $308 = $1; $309 = ((($308)) + 4|0); ;HEAP8[$$byval_copy8>>0]=HEAP8[$309>>0]|0;HEAP8[$$byval_copy8+1>>0]=HEAP8[$309+1>>0]|0;HEAP8[$$byval_copy8+2>>0]=HEAP8[$309+2>>0]|0;HEAP8[$$byval_copy8+3>>0]=HEAP8[$309+3>>0]|0; _nk_style_item_color($18,$$byval_copy8); ;HEAP32[$307>>2]=HEAP32[$18>>2]|0;HEAP32[$307+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$307+8>>2]=HEAP32[$18+8>>2]|0;HEAP32[$307+12>>2]=HEAP32[$18+12>>2]|0;HEAP32[$307+16>>2]=HEAP32[$18+16>>2]|0; $310 = $button; $311 = ((($310)) + 60|0); $312 = $1; $313 = ((($312)) + 4|0); ;HEAP8[$311>>0]=HEAP8[$313>>0]|0;HEAP8[$311+1>>0]=HEAP8[$313+1>>0]|0;HEAP8[$311+2>>0]=HEAP8[$313+2>>0]|0;HEAP8[$311+3>>0]=HEAP8[$313+3>>0]|0; $314 = $button; $315 = ((($314)) + 64|0); $316 = $1; $317 = ((($316)) + 4|0); ;HEAP8[$315>>0]=HEAP8[$317>>0]|0;HEAP8[$315+1>>0]=HEAP8[$317+1>>0]|0;HEAP8[$315+2>>0]=HEAP8[$317+2>>0]|0;HEAP8[$315+3>>0]=HEAP8[$317+3>>0]|0; $318 = $button; $319 = ((($318)) + 68|0); $320 = $1; ;HEAP8[$319>>0]=HEAP8[$320>>0]|0;HEAP8[$319+1>>0]=HEAP8[$320+1>>0]|0;HEAP8[$319+2>>0]=HEAP8[$320+2>>0]|0;HEAP8[$319+3>>0]=HEAP8[$320+3>>0]|0; $321 = $button; $322 = ((($321)) + 72|0); $323 = $1; ;HEAP8[$322>>0]=HEAP8[$323>>0]|0;HEAP8[$322+1>>0]=HEAP8[$323+1>>0]|0;HEAP8[$322+2>>0]=HEAP8[$323+2>>0]|0;HEAP8[$322+3>>0]=HEAP8[$323+3>>0]|0; $324 = $button; $325 = ((($324)) + 76|0); $326 = $1; ;HEAP8[$325>>0]=HEAP8[$326>>0]|0;HEAP8[$325+1>>0]=HEAP8[$326+1>>0]|0;HEAP8[$325+2>>0]=HEAP8[$326+2>>0]|0;HEAP8[$325+3>>0]=HEAP8[$326+3>>0]|0; $327 = $button; $328 = ((($327)) + 92|0); _nk_vec2($19,4.0,4.0); ;HEAP32[$328>>2]=HEAP32[$19>>2]|0;HEAP32[$328+4>>2]=HEAP32[$19+4>>2]|0; $329 = $button; $330 = ((($329)) + 108|0); _nk_vec2($20,0.0,0.0); ;HEAP32[$330>>2]=HEAP32[$20>>2]|0;HEAP32[$330+4>>2]=HEAP32[$20+4>>2]|0; $331 = $button; $332 = ((($331)) + 116|0); _nk_handle_ptr($21,0); ;HEAP32[$332>>2]=HEAP32[$21>>2]|0; $333 = $button; $334 = ((($333)) + 80|0); HEAP32[$334>>2] = 18; $335 = $button; $336 = ((($335)) + 84|0); HEAPF32[$336>>2] = 0.0; $337 = $button; $338 = ((($337)) + 88|0); HEAPF32[$338>>2] = 1.0; $339 = $button; $340 = ((($339)) + 120|0); HEAP32[$340>>2] = 0; $341 = $button; $342 = ((($341)) + 124|0); HEAP32[$342>>2] = 0; $343 = $style; $344 = ((($343)) + 564|0); $toggle = $344; $345 = $toggle; _nk_zero($345,148); $346 = $toggle; $347 = $1; $348 = ((($347)) + 28|0); ;HEAP8[$$byval_copy9>>0]=HEAP8[$348>>0]|0;HEAP8[$$byval_copy9+1>>0]=HEAP8[$348+1>>0]|0;HEAP8[$$byval_copy9+2>>0]=HEAP8[$348+2>>0]|0;HEAP8[$$byval_copy9+3>>0]=HEAP8[$348+3>>0]|0; _nk_style_item_color($22,$$byval_copy9); ;HEAP32[$346>>2]=HEAP32[$22>>2]|0;HEAP32[$346+4>>2]=HEAP32[$22+4>>2]|0;HEAP32[$346+8>>2]=HEAP32[$22+8>>2]|0;HEAP32[$346+12>>2]=HEAP32[$22+12>>2]|0;HEAP32[$346+16>>2]=HEAP32[$22+16>>2]|0; $349 = $toggle; $350 = ((($349)) + 20|0); $351 = $1; $352 = ((($351)) + 32|0); ;HEAP8[$$byval_copy10>>0]=HEAP8[$352>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$352+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$352+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$352+3>>0]|0; _nk_style_item_color($23,$$byval_copy10); ;HEAP32[$350>>2]=HEAP32[$23>>2]|0;HEAP32[$350+4>>2]=HEAP32[$23+4>>2]|0;HEAP32[$350+8>>2]=HEAP32[$23+8>>2]|0;HEAP32[$350+12>>2]=HEAP32[$23+12>>2]|0;HEAP32[$350+16>>2]=HEAP32[$23+16>>2]|0; $353 = $toggle; $354 = ((($353)) + 40|0); $355 = $1; $356 = ((($355)) + 32|0); ;HEAP8[$$byval_copy11>>0]=HEAP8[$356>>0]|0;HEAP8[$$byval_copy11+1>>0]=HEAP8[$356+1>>0]|0;HEAP8[$$byval_copy11+2>>0]=HEAP8[$356+2>>0]|0;HEAP8[$$byval_copy11+3>>0]=HEAP8[$356+3>>0]|0; _nk_style_item_color($24,$$byval_copy11); ;HEAP32[$354>>2]=HEAP32[$24>>2]|0;HEAP32[$354+4>>2]=HEAP32[$24+4>>2]|0;HEAP32[$354+8>>2]=HEAP32[$24+8>>2]|0;HEAP32[$354+12>>2]=HEAP32[$24+12>>2]|0;HEAP32[$354+16>>2]=HEAP32[$24+16>>2]|0; $357 = $toggle; $358 = ((($357)) + 60|0); $359 = $1; $360 = ((($359)) + 36|0); ;HEAP8[$$byval_copy12>>0]=HEAP8[$360>>0]|0;HEAP8[$$byval_copy12+1>>0]=HEAP8[$360+1>>0]|0;HEAP8[$$byval_copy12+2>>0]=HEAP8[$360+2>>0]|0;HEAP8[$$byval_copy12+3>>0]=HEAP8[$360+3>>0]|0; _nk_style_item_color($25,$$byval_copy12); ;HEAP32[$358>>2]=HEAP32[$25>>2]|0;HEAP32[$358+4>>2]=HEAP32[$25+4>>2]|0;HEAP32[$358+8>>2]=HEAP32[$25+8>>2]|0;HEAP32[$358+12>>2]=HEAP32[$25+12>>2]|0;HEAP32[$358+16>>2]=HEAP32[$25+16>>2]|0; $361 = $toggle; $362 = ((($361)) + 80|0); $363 = $1; $364 = ((($363)) + 36|0); ;HEAP8[$$byval_copy13>>0]=HEAP8[$364>>0]|0;HEAP8[$$byval_copy13+1>>0]=HEAP8[$364+1>>0]|0;HEAP8[$$byval_copy13+2>>0]=HEAP8[$364+2>>0]|0;HEAP8[$$byval_copy13+3>>0]=HEAP8[$364+3>>0]|0; _nk_style_item_color($26,$$byval_copy13); ;HEAP32[$362>>2]=HEAP32[$26>>2]|0;HEAP32[$362+4>>2]=HEAP32[$26+4>>2]|0;HEAP32[$362+8>>2]=HEAP32[$26+8>>2]|0;HEAP32[$362+12>>2]=HEAP32[$26+12>>2]|0;HEAP32[$362+16>>2]=HEAP32[$26+16>>2]|0; $365 = $toggle; $366 = ((($365)) + 136|0); _nk_handle_ptr($27,0); ;HEAP32[$366>>2]=HEAP32[$27>>2]|0; $367 = $toggle; $368 = ((($367)) + 112|0); $369 = $1; $370 = ((($369)) + 4|0); ;HEAP8[$368>>0]=HEAP8[$370>>0]|0;HEAP8[$368+1>>0]=HEAP8[$370+1>>0]|0;HEAP8[$368+2>>0]=HEAP8[$370+2>>0]|0;HEAP8[$368+3>>0]=HEAP8[$370+3>>0]|0; $371 = $toggle; $372 = ((($371)) + 100|0); $373 = $1; ;HEAP8[$372>>0]=HEAP8[$373>>0]|0;HEAP8[$372+1>>0]=HEAP8[$373+1>>0]|0;HEAP8[$372+2>>0]=HEAP8[$373+2>>0]|0;HEAP8[$372+3>>0]=HEAP8[$373+3>>0]|0; $374 = $toggle; $375 = ((($374)) + 104|0); $376 = $1; ;HEAP8[$375>>0]=HEAP8[$376>>0]|0;HEAP8[$375+1>>0]=HEAP8[$376+1>>0]|0;HEAP8[$375+2>>0]=HEAP8[$376+2>>0]|0;HEAP8[$375+3>>0]=HEAP8[$376+3>>0]|0; $377 = $toggle; $378 = ((($377)) + 108|0); $379 = $1; ;HEAP8[$378>>0]=HEAP8[$379>>0]|0;HEAP8[$378+1>>0]=HEAP8[$379+1>>0]|0;HEAP8[$378+2>>0]=HEAP8[$379+2>>0]|0;HEAP8[$378+3>>0]=HEAP8[$379+3>>0]|0; $380 = $toggle; $381 = ((($380)) + 120|0); _nk_vec2($28,4.0,4.0); ;HEAP32[$381>>2]=HEAP32[$28>>2]|0;HEAP32[$381+4>>2]=HEAP32[$28+4>>2]|0; $382 = $toggle; $383 = ((($382)) + 128|0); _nk_vec2($29,0.0,0.0); ;HEAP32[$383>>2]=HEAP32[$29>>2]|0;HEAP32[$383+4>>2]=HEAP32[$29+4>>2]|0; $384 = $style; $385 = ((($384)) + 416|0); $toggle = $385; $386 = $toggle; _nk_zero($386,148); $387 = $toggle; $388 = $1; $389 = ((($388)) + 28|0); ;HEAP8[$$byval_copy14>>0]=HEAP8[$389>>0]|0;HEAP8[$$byval_copy14+1>>0]=HEAP8[$389+1>>0]|0;HEAP8[$$byval_copy14+2>>0]=HEAP8[$389+2>>0]|0;HEAP8[$$byval_copy14+3>>0]=HEAP8[$389+3>>0]|0; _nk_style_item_color($30,$$byval_copy14); ;HEAP32[$387>>2]=HEAP32[$30>>2]|0;HEAP32[$387+4>>2]=HEAP32[$30+4>>2]|0;HEAP32[$387+8>>2]=HEAP32[$30+8>>2]|0;HEAP32[$387+12>>2]=HEAP32[$30+12>>2]|0;HEAP32[$387+16>>2]=HEAP32[$30+16>>2]|0; $390 = $toggle; $391 = ((($390)) + 20|0); $392 = $1; $393 = ((($392)) + 32|0); ;HEAP8[$$byval_copy15>>0]=HEAP8[$393>>0]|0;HEAP8[$$byval_copy15+1>>0]=HEAP8[$393+1>>0]|0;HEAP8[$$byval_copy15+2>>0]=HEAP8[$393+2>>0]|0;HEAP8[$$byval_copy15+3>>0]=HEAP8[$393+3>>0]|0; _nk_style_item_color($31,$$byval_copy15); ;HEAP32[$391>>2]=HEAP32[$31>>2]|0;HEAP32[$391+4>>2]=HEAP32[$31+4>>2]|0;HEAP32[$391+8>>2]=HEAP32[$31+8>>2]|0;HEAP32[$391+12>>2]=HEAP32[$31+12>>2]|0;HEAP32[$391+16>>2]=HEAP32[$31+16>>2]|0; $394 = $toggle; $395 = ((($394)) + 40|0); $396 = $1; $397 = ((($396)) + 32|0); ;HEAP8[$$byval_copy16>>0]=HEAP8[$397>>0]|0;HEAP8[$$byval_copy16+1>>0]=HEAP8[$397+1>>0]|0;HEAP8[$$byval_copy16+2>>0]=HEAP8[$397+2>>0]|0;HEAP8[$$byval_copy16+3>>0]=HEAP8[$397+3>>0]|0; _nk_style_item_color($32,$$byval_copy16); ;HEAP32[$395>>2]=HEAP32[$32>>2]|0;HEAP32[$395+4>>2]=HEAP32[$32+4>>2]|0;HEAP32[$395+8>>2]=HEAP32[$32+8>>2]|0;HEAP32[$395+12>>2]=HEAP32[$32+12>>2]|0;HEAP32[$395+16>>2]=HEAP32[$32+16>>2]|0; $398 = $toggle; $399 = ((($398)) + 60|0); $400 = $1; $401 = ((($400)) + 36|0); ;HEAP8[$$byval_copy17>>0]=HEAP8[$401>>0]|0;HEAP8[$$byval_copy17+1>>0]=HEAP8[$401+1>>0]|0;HEAP8[$$byval_copy17+2>>0]=HEAP8[$401+2>>0]|0;HEAP8[$$byval_copy17+3>>0]=HEAP8[$401+3>>0]|0; _nk_style_item_color($33,$$byval_copy17); ;HEAP32[$399>>2]=HEAP32[$33>>2]|0;HEAP32[$399+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$399+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$399+12>>2]=HEAP32[$33+12>>2]|0;HEAP32[$399+16>>2]=HEAP32[$33+16>>2]|0; $402 = $toggle; $403 = ((($402)) + 80|0); $404 = $1; $405 = ((($404)) + 36|0); ;HEAP8[$$byval_copy18>>0]=HEAP8[$405>>0]|0;HEAP8[$$byval_copy18+1>>0]=HEAP8[$405+1>>0]|0;HEAP8[$$byval_copy18+2>>0]=HEAP8[$405+2>>0]|0;HEAP8[$$byval_copy18+3>>0]=HEAP8[$405+3>>0]|0; _nk_style_item_color($34,$$byval_copy18); ;HEAP32[$403>>2]=HEAP32[$34>>2]|0;HEAP32[$403+4>>2]=HEAP32[$34+4>>2]|0;HEAP32[$403+8>>2]=HEAP32[$34+8>>2]|0;HEAP32[$403+12>>2]=HEAP32[$34+12>>2]|0;HEAP32[$403+16>>2]=HEAP32[$34+16>>2]|0; $406 = $toggle; $407 = ((($406)) + 136|0); _nk_handle_ptr($35,0); ;HEAP32[$407>>2]=HEAP32[$35>>2]|0; $408 = $toggle; $409 = ((($408)) + 112|0); $410 = $1; $411 = ((($410)) + 4|0); ;HEAP8[$409>>0]=HEAP8[$411>>0]|0;HEAP8[$409+1>>0]=HEAP8[$411+1>>0]|0;HEAP8[$409+2>>0]=HEAP8[$411+2>>0]|0;HEAP8[$409+3>>0]=HEAP8[$411+3>>0]|0; $412 = $toggle; $413 = ((($412)) + 100|0); $414 = $1; ;HEAP8[$413>>0]=HEAP8[$414>>0]|0;HEAP8[$413+1>>0]=HEAP8[$414+1>>0]|0;HEAP8[$413+2>>0]=HEAP8[$414+2>>0]|0;HEAP8[$413+3>>0]=HEAP8[$414+3>>0]|0; $415 = $toggle; $416 = ((($415)) + 104|0); $417 = $1; ;HEAP8[$416>>0]=HEAP8[$417>>0]|0;HEAP8[$416+1>>0]=HEAP8[$417+1>>0]|0;HEAP8[$416+2>>0]=HEAP8[$417+2>>0]|0;HEAP8[$416+3>>0]=HEAP8[$417+3>>0]|0; $418 = $toggle; $419 = ((($418)) + 108|0); $420 = $1; ;HEAP8[$419>>0]=HEAP8[$420>>0]|0;HEAP8[$419+1>>0]=HEAP8[$420+1>>0]|0;HEAP8[$419+2>>0]=HEAP8[$420+2>>0]|0;HEAP8[$419+3>>0]=HEAP8[$420+3>>0]|0; $421 = $toggle; $422 = ((($421)) + 120|0); _nk_vec2($36,4.0,4.0); ;HEAP32[$422>>2]=HEAP32[$36>>2]|0;HEAP32[$422+4>>2]=HEAP32[$36+4>>2]|0; $423 = $toggle; $424 = ((($423)) + 128|0); _nk_vec2($37,0.0,0.0); ;HEAP32[$424>>2]=HEAP32[$37>>2]|0;HEAP32[$424+4>>2]=HEAP32[$37+4>>2]|0; $425 = $style; $426 = ((($425)) + 712|0); $select = $426; $427 = $select; _nk_zero($427,192); $428 = $select; $429 = $1; $430 = ((($429)) + 40|0); ;HEAP8[$$byval_copy19>>0]=HEAP8[$430>>0]|0;HEAP8[$$byval_copy19+1>>0]=HEAP8[$430+1>>0]|0;HEAP8[$$byval_copy19+2>>0]=HEAP8[$430+2>>0]|0;HEAP8[$$byval_copy19+3>>0]=HEAP8[$430+3>>0]|0; _nk_style_item_color($38,$$byval_copy19); ;HEAP32[$428>>2]=HEAP32[$38>>2]|0;HEAP32[$428+4>>2]=HEAP32[$38+4>>2]|0;HEAP32[$428+8>>2]=HEAP32[$38+8>>2]|0;HEAP32[$428+12>>2]=HEAP32[$38+12>>2]|0;HEAP32[$428+16>>2]=HEAP32[$38+16>>2]|0; $431 = $select; $432 = ((($431)) + 20|0); $433 = $1; $434 = ((($433)) + 40|0); ;HEAP8[$$byval_copy20>>0]=HEAP8[$434>>0]|0;HEAP8[$$byval_copy20+1>>0]=HEAP8[$434+1>>0]|0;HEAP8[$$byval_copy20+2>>0]=HEAP8[$434+2>>0]|0;HEAP8[$$byval_copy20+3>>0]=HEAP8[$434+3>>0]|0; _nk_style_item_color($39,$$byval_copy20); ;HEAP32[$432>>2]=HEAP32[$39>>2]|0;HEAP32[$432+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$432+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$432+12>>2]=HEAP32[$39+12>>2]|0;HEAP32[$432+16>>2]=HEAP32[$39+16>>2]|0; $435 = $select; $436 = ((($435)) + 40|0); $437 = $1; $438 = ((($437)) + 40|0); ;HEAP8[$$byval_copy21>>0]=HEAP8[$438>>0]|0;HEAP8[$$byval_copy21+1>>0]=HEAP8[$438+1>>0]|0;HEAP8[$$byval_copy21+2>>0]=HEAP8[$438+2>>0]|0;HEAP8[$$byval_copy21+3>>0]=HEAP8[$438+3>>0]|0; _nk_style_item_color($40,$$byval_copy21); ;HEAP32[$436>>2]=HEAP32[$40>>2]|0;HEAP32[$436+4>>2]=HEAP32[$40+4>>2]|0;HEAP32[$436+8>>2]=HEAP32[$40+8>>2]|0;HEAP32[$436+12>>2]=HEAP32[$40+12>>2]|0;HEAP32[$436+16>>2]=HEAP32[$40+16>>2]|0; $439 = $select; $440 = ((($439)) + 60|0); $441 = $1; $442 = ((($441)) + 44|0); ;HEAP8[$$byval_copy22>>0]=HEAP8[$442>>0]|0;HEAP8[$$byval_copy22+1>>0]=HEAP8[$442+1>>0]|0;HEAP8[$$byval_copy22+2>>0]=HEAP8[$442+2>>0]|0;HEAP8[$$byval_copy22+3>>0]=HEAP8[$442+3>>0]|0; _nk_style_item_color($41,$$byval_copy22); ;HEAP32[$440>>2]=HEAP32[$41>>2]|0;HEAP32[$440+4>>2]=HEAP32[$41+4>>2]|0;HEAP32[$440+8>>2]=HEAP32[$41+8>>2]|0;HEAP32[$440+12>>2]=HEAP32[$41+12>>2]|0;HEAP32[$440+16>>2]=HEAP32[$41+16>>2]|0; $443 = $select; $444 = ((($443)) + 80|0); $445 = $1; $446 = ((($445)) + 44|0); ;HEAP8[$$byval_copy23>>0]=HEAP8[$446>>0]|0;HEAP8[$$byval_copy23+1>>0]=HEAP8[$446+1>>0]|0;HEAP8[$$byval_copy23+2>>0]=HEAP8[$446+2>>0]|0;HEAP8[$$byval_copy23+3>>0]=HEAP8[$446+3>>0]|0; _nk_style_item_color($42,$$byval_copy23); ;HEAP32[$444>>2]=HEAP32[$42>>2]|0;HEAP32[$444+4>>2]=HEAP32[$42+4>>2]|0;HEAP32[$444+8>>2]=HEAP32[$42+8>>2]|0;HEAP32[$444+12>>2]=HEAP32[$42+12>>2]|0;HEAP32[$444+16>>2]=HEAP32[$42+16>>2]|0; $447 = $select; $448 = ((($447)) + 100|0); $449 = $1; $450 = ((($449)) + 44|0); ;HEAP8[$$byval_copy24>>0]=HEAP8[$450>>0]|0;HEAP8[$$byval_copy24+1>>0]=HEAP8[$450+1>>0]|0;HEAP8[$$byval_copy24+2>>0]=HEAP8[$450+2>>0]|0;HEAP8[$$byval_copy24+3>>0]=HEAP8[$450+3>>0]|0; _nk_style_item_color($43,$$byval_copy24); ;HEAP32[$448>>2]=HEAP32[$43>>2]|0;HEAP32[$448+4>>2]=HEAP32[$43+4>>2]|0;HEAP32[$448+8>>2]=HEAP32[$43+8>>2]|0;HEAP32[$448+12>>2]=HEAP32[$43+12>>2]|0;HEAP32[$448+16>>2]=HEAP32[$43+16>>2]|0; $451 = $select; $452 = ((($451)) + 120|0); $453 = $1; ;HEAP8[$452>>0]=HEAP8[$453>>0]|0;HEAP8[$452+1>>0]=HEAP8[$453+1>>0]|0;HEAP8[$452+2>>0]=HEAP8[$453+2>>0]|0;HEAP8[$452+3>>0]=HEAP8[$453+3>>0]|0; $454 = $select; $455 = ((($454)) + 124|0); $456 = $1; ;HEAP8[$455>>0]=HEAP8[$456>>0]|0;HEAP8[$455+1>>0]=HEAP8[$456+1>>0]|0;HEAP8[$455+2>>0]=HEAP8[$456+2>>0]|0;HEAP8[$455+3>>0]=HEAP8[$456+3>>0]|0; $457 = $select; $458 = ((($457)) + 128|0); $459 = $1; ;HEAP8[$458>>0]=HEAP8[$459>>0]|0;HEAP8[$458+1>>0]=HEAP8[$459+1>>0]|0;HEAP8[$458+2>>0]=HEAP8[$459+2>>0]|0;HEAP8[$458+3>>0]=HEAP8[$459+3>>0]|0; $460 = $select; $461 = ((($460)) + 132|0); $462 = $1; ;HEAP8[$461>>0]=HEAP8[$462>>0]|0;HEAP8[$461+1>>0]=HEAP8[$462+1>>0]|0;HEAP8[$461+2>>0]=HEAP8[$462+2>>0]|0;HEAP8[$461+3>>0]=HEAP8[$462+3>>0]|0; $463 = $select; $464 = ((($463)) + 136|0); $465 = $1; ;HEAP8[$464>>0]=HEAP8[$465>>0]|0;HEAP8[$464+1>>0]=HEAP8[$465+1>>0]|0;HEAP8[$464+2>>0]=HEAP8[$465+2>>0]|0;HEAP8[$464+3>>0]=HEAP8[$465+3>>0]|0; $466 = $select; $467 = ((($466)) + 140|0); $468 = $1; ;HEAP8[$467>>0]=HEAP8[$468>>0]|0;HEAP8[$467+1>>0]=HEAP8[$468+1>>0]|0;HEAP8[$467+2>>0]=HEAP8[$468+2>>0]|0;HEAP8[$467+3>>0]=HEAP8[$468+3>>0]|0; $469 = $select; $470 = ((($469)) + 156|0); _nk_vec2($44,4.0,4.0); ;HEAP32[$470>>2]=HEAP32[$44>>2]|0;HEAP32[$470+4>>2]=HEAP32[$44+4>>2]|0; $471 = $select; $472 = ((($471)) + 164|0); _nk_vec2($45,0.0,0.0); ;HEAP32[$472>>2]=HEAP32[$45>>2]|0;HEAP32[$472+4>>2]=HEAP32[$45+4>>2]|0; $473 = $select; $474 = ((($473)) + 180|0); _nk_handle_ptr($46,0); ;HEAP32[$474>>2]=HEAP32[$46>>2]|0; $475 = $select; $476 = ((($475)) + 152|0); HEAPF32[$476>>2] = 0.0; $477 = $select; $478 = ((($477)) + 184|0); HEAP32[$478>>2] = 0; $479 = $select; $480 = ((($479)) + 188|0); HEAP32[$480>>2] = 0; $481 = $style; $482 = ((($481)) + 904|0); $slider = $482; $483 = $slider; _nk_zero($483,456); $484 = $slider; _nk_style_item_hide($47); ;HEAP32[$484>>2]=HEAP32[$47>>2]|0;HEAP32[$484+4>>2]=HEAP32[$47+4>>2]|0;HEAP32[$484+8>>2]=HEAP32[$47+8>>2]|0;HEAP32[$484+12>>2]=HEAP32[$47+12>>2]|0;HEAP32[$484+16>>2]=HEAP32[$47+16>>2]|0; $485 = $slider; $486 = ((($485)) + 20|0); _nk_style_item_hide($48); ;HEAP32[$486>>2]=HEAP32[$48>>2]|0;HEAP32[$486+4>>2]=HEAP32[$48+4>>2]|0;HEAP32[$486+8>>2]=HEAP32[$48+8>>2]|0;HEAP32[$486+12>>2]=HEAP32[$48+12>>2]|0;HEAP32[$486+16>>2]=HEAP32[$48+16>>2]|0; $487 = $slider; $488 = ((($487)) + 40|0); _nk_style_item_hide($49); ;HEAP32[$488>>2]=HEAP32[$49>>2]|0;HEAP32[$488+4>>2]=HEAP32[$49+4>>2]|0;HEAP32[$488+8>>2]=HEAP32[$49+8>>2]|0;HEAP32[$488+12>>2]=HEAP32[$49+12>>2]|0;HEAP32[$488+16>>2]=HEAP32[$49+16>>2]|0; $489 = $slider; $490 = ((($489)) + 64|0); $491 = $1; $492 = ((($491)) + 48|0); ;HEAP8[$490>>0]=HEAP8[$492>>0]|0;HEAP8[$490+1>>0]=HEAP8[$492+1>>0]|0;HEAP8[$490+2>>0]=HEAP8[$492+2>>0]|0;HEAP8[$490+3>>0]=HEAP8[$492+3>>0]|0; $493 = $slider; $494 = ((($493)) + 68|0); $495 = $1; $496 = ((($495)) + 48|0); ;HEAP8[$494>>0]=HEAP8[$496>>0]|0;HEAP8[$494+1>>0]=HEAP8[$496+1>>0]|0;HEAP8[$494+2>>0]=HEAP8[$496+2>>0]|0;HEAP8[$494+3>>0]=HEAP8[$496+3>>0]|0; $497 = $slider; $498 = ((($497)) + 72|0); $499 = $1; $500 = ((($499)) + 48|0); ;HEAP8[$498>>0]=HEAP8[$500>>0]|0;HEAP8[$498+1>>0]=HEAP8[$500+1>>0]|0;HEAP8[$498+2>>0]=HEAP8[$500+2>>0]|0;HEAP8[$498+3>>0]=HEAP8[$500+3>>0]|0; $501 = $slider; $502 = ((($501)) + 76|0); $503 = $1; $504 = ((($503)) + 52|0); ;HEAP8[$502>>0]=HEAP8[$504>>0]|0;HEAP8[$502+1>>0]=HEAP8[$504+1>>0]|0;HEAP8[$502+2>>0]=HEAP8[$504+2>>0]|0;HEAP8[$502+3>>0]=HEAP8[$504+3>>0]|0; $505 = $slider; $506 = ((($505)) + 80|0); $507 = $1; $508 = ((($507)) + 52|0); ;HEAP8[$$byval_copy25>>0]=HEAP8[$508>>0]|0;HEAP8[$$byval_copy25+1>>0]=HEAP8[$508+1>>0]|0;HEAP8[$$byval_copy25+2>>0]=HEAP8[$508+2>>0]|0;HEAP8[$$byval_copy25+3>>0]=HEAP8[$508+3>>0]|0; _nk_style_item_color($50,$$byval_copy25); ;HEAP32[$506>>2]=HEAP32[$50>>2]|0;HEAP32[$506+4>>2]=HEAP32[$50+4>>2]|0;HEAP32[$506+8>>2]=HEAP32[$50+8>>2]|0;HEAP32[$506+12>>2]=HEAP32[$50+12>>2]|0;HEAP32[$506+16>>2]=HEAP32[$50+16>>2]|0; $509 = $slider; $510 = ((($509)) + 100|0); $511 = $1; $512 = ((($511)) + 56|0); ;HEAP8[$$byval_copy26>>0]=HEAP8[$512>>0]|0;HEAP8[$$byval_copy26+1>>0]=HEAP8[$512+1>>0]|0;HEAP8[$$byval_copy26+2>>0]=HEAP8[$512+2>>0]|0;HEAP8[$$byval_copy26+3>>0]=HEAP8[$512+3>>0]|0; _nk_style_item_color($51,$$byval_copy26); ;HEAP32[$510>>2]=HEAP32[$51>>2]|0;HEAP32[$510+4>>2]=HEAP32[$51+4>>2]|0;HEAP32[$510+8>>2]=HEAP32[$51+8>>2]|0;HEAP32[$510+12>>2]=HEAP32[$51+12>>2]|0;HEAP32[$510+16>>2]=HEAP32[$51+16>>2]|0; $513 = $slider; $514 = ((($513)) + 120|0); $515 = $1; $516 = ((($515)) + 60|0); ;HEAP8[$$byval_copy27>>0]=HEAP8[$516>>0]|0;HEAP8[$$byval_copy27+1>>0]=HEAP8[$516+1>>0]|0;HEAP8[$$byval_copy27+2>>0]=HEAP8[$516+2>>0]|0;HEAP8[$$byval_copy27+3>>0]=HEAP8[$516+3>>0]|0; _nk_style_item_color($52,$$byval_copy27); ;HEAP32[$514>>2]=HEAP32[$52>>2]|0;HEAP32[$514+4>>2]=HEAP32[$52+4>>2]|0;HEAP32[$514+8>>2]=HEAP32[$52+8>>2]|0;HEAP32[$514+12>>2]=HEAP32[$52+12>>2]|0;HEAP32[$514+16>>2]=HEAP32[$52+16>>2]|0; $517 = $slider; $518 = ((($517)) + 436|0); HEAP32[$518>>2] = 10; $519 = $slider; $520 = ((($519)) + 440|0); HEAP32[$520>>2] = 9; $521 = $slider; $522 = ((($521)) + 168|0); _nk_vec2($53,16.0,16.0); ;HEAP32[$522>>2]=HEAP32[$53>>2]|0;HEAP32[$522+4>>2]=HEAP32[$53+4>>2]|0; $523 = $slider; $524 = ((($523)) + 152|0); _nk_vec2($54,4.0,4.0); ;HEAP32[$524>>2]=HEAP32[$54>>2]|0;HEAP32[$524+4>>2]=HEAP32[$54+4>>2]|0; $525 = $slider; $526 = ((($525)) + 160|0); _nk_vec2($55,4.0,4.0); ;HEAP32[$526>>2]=HEAP32[$55>>2]|0;HEAP32[$526+4>>2]=HEAP32[$55+4>>2]|0; $527 = $slider; $528 = ((($527)) + 444|0); _nk_handle_ptr($56,0); ;HEAP32[$528>>2]=HEAP32[$56>>2]|0; $529 = $slider; $530 = ((($529)) + 176|0); HEAP32[$530>>2] = 0; $531 = $slider; $532 = ((($531)) + 148|0); HEAPF32[$532>>2] = 8.0; $533 = $slider; $534 = ((($533)) + 144|0); HEAPF32[$534>>2] = 0.0; $535 = $slider; $536 = ((($535)) + 448|0); HEAP32[$536>>2] = 0; $537 = $slider; $538 = ((($537)) + 452|0); HEAP32[$538>>2] = 0; $539 = $style; $540 = ((($539)) + 904|0); $541 = ((($540)) + 180|0); $button = $541; $542 = $button; _nk_rgb($57,40,40,40); ;HEAP8[$$byval_copy28>>0]=HEAP8[$57>>0]|0;HEAP8[$$byval_copy28+1>>0]=HEAP8[$57+1>>0]|0;HEAP8[$$byval_copy28+2>>0]=HEAP8[$57+2>>0]|0;HEAP8[$$byval_copy28+3>>0]=HEAP8[$57+3>>0]|0; _nk_style_item_color($58,$$byval_copy28); ;HEAP32[$542>>2]=HEAP32[$58>>2]|0;HEAP32[$542+4>>2]=HEAP32[$58+4>>2]|0;HEAP32[$542+8>>2]=HEAP32[$58+8>>2]|0;HEAP32[$542+12>>2]=HEAP32[$58+12>>2]|0;HEAP32[$542+16>>2]=HEAP32[$58+16>>2]|0; $543 = $button; $544 = ((($543)) + 20|0); _nk_rgb($59,42,42,42); ;HEAP8[$$byval_copy29>>0]=HEAP8[$59>>0]|0;HEAP8[$$byval_copy29+1>>0]=HEAP8[$59+1>>0]|0;HEAP8[$$byval_copy29+2>>0]=HEAP8[$59+2>>0]|0;HEAP8[$$byval_copy29+3>>0]=HEAP8[$59+3>>0]|0; _nk_style_item_color($60,$$byval_copy29); ;HEAP32[$544>>2]=HEAP32[$60>>2]|0;HEAP32[$544+4>>2]=HEAP32[$60+4>>2]|0;HEAP32[$544+8>>2]=HEAP32[$60+8>>2]|0;HEAP32[$544+12>>2]=HEAP32[$60+12>>2]|0;HEAP32[$544+16>>2]=HEAP32[$60+16>>2]|0; $545 = $button; $546 = ((($545)) + 40|0); _nk_rgb($61,44,44,44); ;HEAP8[$$byval_copy30>>0]=HEAP8[$61>>0]|0;HEAP8[$$byval_copy30+1>>0]=HEAP8[$61+1>>0]|0;HEAP8[$$byval_copy30+2>>0]=HEAP8[$61+2>>0]|0;HEAP8[$$byval_copy30+3>>0]=HEAP8[$61+3>>0]|0; _nk_style_item_color($62,$$byval_copy30); ;HEAP32[$546>>2]=HEAP32[$62>>2]|0;HEAP32[$546+4>>2]=HEAP32[$62+4>>2]|0;HEAP32[$546+8>>2]=HEAP32[$62+8>>2]|0;HEAP32[$546+12>>2]=HEAP32[$62+12>>2]|0;HEAP32[$546+16>>2]=HEAP32[$62+16>>2]|0; $547 = $button; $548 = ((($547)) + 60|0); _nk_rgb($63,65,65,65); ;HEAP8[$548>>0]=HEAP8[$63>>0]|0;HEAP8[$548+1>>0]=HEAP8[$63+1>>0]|0;HEAP8[$548+2>>0]=HEAP8[$63+2>>0]|0;HEAP8[$548+3>>0]=HEAP8[$63+3>>0]|0; $549 = $button; $550 = ((($549)) + 64|0); _nk_rgb($64,40,40,40); ;HEAP8[$550>>0]=HEAP8[$64>>0]|0;HEAP8[$550+1>>0]=HEAP8[$64+1>>0]|0;HEAP8[$550+2>>0]=HEAP8[$64+2>>0]|0;HEAP8[$550+3>>0]=HEAP8[$64+3>>0]|0; $551 = $button; $552 = ((($551)) + 68|0); _nk_rgb($65,175,175,175); ;HEAP8[$552>>0]=HEAP8[$65>>0]|0;HEAP8[$552+1>>0]=HEAP8[$65+1>>0]|0;HEAP8[$552+2>>0]=HEAP8[$65+2>>0]|0;HEAP8[$552+3>>0]=HEAP8[$65+3>>0]|0; $553 = $button; $554 = ((($553)) + 72|0); _nk_rgb($66,175,175,175); ;HEAP8[$554>>0]=HEAP8[$66>>0]|0;HEAP8[$554+1>>0]=HEAP8[$66+1>>0]|0;HEAP8[$554+2>>0]=HEAP8[$66+2>>0]|0;HEAP8[$554+3>>0]=HEAP8[$66+3>>0]|0; $555 = $button; $556 = ((($555)) + 76|0); _nk_rgb($67,175,175,175); ;HEAP8[$556>>0]=HEAP8[$67>>0]|0;HEAP8[$556+1>>0]=HEAP8[$67+1>>0]|0;HEAP8[$556+2>>0]=HEAP8[$67+2>>0]|0;HEAP8[$556+3>>0]=HEAP8[$67+3>>0]|0; $557 = $button; $558 = ((($557)) + 92|0); _nk_vec2($68,8.0,8.0); ;HEAP32[$558>>2]=HEAP32[$68>>2]|0;HEAP32[$558+4>>2]=HEAP32[$68+4>>2]|0; $559 = $button; $560 = ((($559)) + 108|0); _nk_vec2($69,0.0,0.0); ;HEAP32[$560>>2]=HEAP32[$69>>2]|0;HEAP32[$560+4>>2]=HEAP32[$69+4>>2]|0; $561 = $button; $562 = ((($561)) + 116|0); _nk_handle_ptr($70,0); ;HEAP32[$562>>2]=HEAP32[$70>>2]|0; $563 = $button; $564 = ((($563)) + 80|0); HEAP32[$564>>2] = 18; $565 = $button; $566 = ((($565)) + 84|0); HEAPF32[$566>>2] = 1.0; $567 = $button; $568 = ((($567)) + 88|0); HEAPF32[$568>>2] = 0.0; $569 = $button; $570 = ((($569)) + 120|0); HEAP32[$570>>2] = 0; $571 = $button; $572 = ((($571)) + 124|0); HEAP32[$572>>2] = 0; $573 = $style; $574 = ((($573)) + 904|0); $575 = ((($574)) + 308|0); $576 = $style; $577 = ((($576)) + 904|0); $578 = ((($577)) + 180|0); dest=$575; src=$578; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $579 = $style; $580 = ((($579)) + 1360|0); $prog = $580; $581 = $prog; _nk_zero($581,164); $582 = $prog; $583 = $1; $584 = ((($583)) + 48|0); ;HEAP8[$$byval_copy31>>0]=HEAP8[$584>>0]|0;HEAP8[$$byval_copy31+1>>0]=HEAP8[$584+1>>0]|0;HEAP8[$$byval_copy31+2>>0]=HEAP8[$584+2>>0]|0;HEAP8[$$byval_copy31+3>>0]=HEAP8[$584+3>>0]|0; _nk_style_item_color($71,$$byval_copy31); ;HEAP32[$582>>2]=HEAP32[$71>>2]|0;HEAP32[$582+4>>2]=HEAP32[$71+4>>2]|0;HEAP32[$582+8>>2]=HEAP32[$71+8>>2]|0;HEAP32[$582+12>>2]=HEAP32[$71+12>>2]|0;HEAP32[$582+16>>2]=HEAP32[$71+16>>2]|0; $585 = $prog; $586 = ((($585)) + 20|0); $587 = $1; $588 = ((($587)) + 48|0); ;HEAP8[$$byval_copy32>>0]=HEAP8[$588>>0]|0;HEAP8[$$byval_copy32+1>>0]=HEAP8[$588+1>>0]|0;HEAP8[$$byval_copy32+2>>0]=HEAP8[$588+2>>0]|0;HEAP8[$$byval_copy32+3>>0]=HEAP8[$588+3>>0]|0; _nk_style_item_color($72,$$byval_copy32); ;HEAP32[$586>>2]=HEAP32[$72>>2]|0;HEAP32[$586+4>>2]=HEAP32[$72+4>>2]|0;HEAP32[$586+8>>2]=HEAP32[$72+8>>2]|0;HEAP32[$586+12>>2]=HEAP32[$72+12>>2]|0;HEAP32[$586+16>>2]=HEAP32[$72+16>>2]|0; $589 = $prog; $590 = ((($589)) + 40|0); $591 = $1; $592 = ((($591)) + 48|0); ;HEAP8[$$byval_copy33>>0]=HEAP8[$592>>0]|0;HEAP8[$$byval_copy33+1>>0]=HEAP8[$592+1>>0]|0;HEAP8[$$byval_copy33+2>>0]=HEAP8[$592+2>>0]|0;HEAP8[$$byval_copy33+3>>0]=HEAP8[$592+3>>0]|0; _nk_style_item_color($73,$$byval_copy33); ;HEAP32[$590>>2]=HEAP32[$73>>2]|0;HEAP32[$590+4>>2]=HEAP32[$73+4>>2]|0;HEAP32[$590+8>>2]=HEAP32[$73+8>>2]|0;HEAP32[$590+12>>2]=HEAP32[$73+12>>2]|0;HEAP32[$590+16>>2]=HEAP32[$73+16>>2]|0; $593 = $prog; $594 = ((($593)) + 64|0); $595 = $1; $596 = ((($595)) + 52|0); ;HEAP8[$$byval_copy34>>0]=HEAP8[$596>>0]|0;HEAP8[$$byval_copy34+1>>0]=HEAP8[$596+1>>0]|0;HEAP8[$$byval_copy34+2>>0]=HEAP8[$596+2>>0]|0;HEAP8[$$byval_copy34+3>>0]=HEAP8[$596+3>>0]|0; _nk_style_item_color($74,$$byval_copy34); ;HEAP32[$594>>2]=HEAP32[$74>>2]|0;HEAP32[$594+4>>2]=HEAP32[$74+4>>2]|0;HEAP32[$594+8>>2]=HEAP32[$74+8>>2]|0;HEAP32[$594+12>>2]=HEAP32[$74+12>>2]|0;HEAP32[$594+16>>2]=HEAP32[$74+16>>2]|0; $597 = $prog; $598 = ((($597)) + 84|0); $599 = $1; $600 = ((($599)) + 56|0); ;HEAP8[$$byval_copy35>>0]=HEAP8[$600>>0]|0;HEAP8[$$byval_copy35+1>>0]=HEAP8[$600+1>>0]|0;HEAP8[$$byval_copy35+2>>0]=HEAP8[$600+2>>0]|0;HEAP8[$$byval_copy35+3>>0]=HEAP8[$600+3>>0]|0; _nk_style_item_color($75,$$byval_copy35); ;HEAP32[$598>>2]=HEAP32[$75>>2]|0;HEAP32[$598+4>>2]=HEAP32[$75+4>>2]|0;HEAP32[$598+8>>2]=HEAP32[$75+8>>2]|0;HEAP32[$598+12>>2]=HEAP32[$75+12>>2]|0;HEAP32[$598+16>>2]=HEAP32[$75+16>>2]|0; $601 = $prog; $602 = ((($601)) + 104|0); $603 = $1; $604 = ((($603)) + 60|0); ;HEAP8[$$byval_copy36>>0]=HEAP8[$604>>0]|0;HEAP8[$$byval_copy36+1>>0]=HEAP8[$604+1>>0]|0;HEAP8[$$byval_copy36+2>>0]=HEAP8[$604+2>>0]|0;HEAP8[$$byval_copy36+3>>0]=HEAP8[$604+3>>0]|0; _nk_style_item_color($76,$$byval_copy36); ;HEAP32[$602>>2]=HEAP32[$76>>2]|0;HEAP32[$602+4>>2]=HEAP32[$76+4>>2]|0;HEAP32[$602+8>>2]=HEAP32[$76+8>>2]|0;HEAP32[$602+12>>2]=HEAP32[$76+12>>2]|0;HEAP32[$602+16>>2]=HEAP32[$76+16>>2]|0; $605 = $prog; $606 = ((($605)) + 60|0); _nk_rgba($77,0,0,0,0); ;HEAP8[$606>>0]=HEAP8[$77>>0]|0;HEAP8[$606+1>>0]=HEAP8[$77+1>>0]|0;HEAP8[$606+2>>0]=HEAP8[$77+2>>0]|0;HEAP8[$606+3>>0]=HEAP8[$77+3>>0]|0; $607 = $prog; $608 = ((($607)) + 124|0); _nk_rgba($78,0,0,0,0); ;HEAP8[$608>>0]=HEAP8[$78>>0]|0;HEAP8[$608+1>>0]=HEAP8[$78+1>>0]|0;HEAP8[$608+2>>0]=HEAP8[$78+2>>0]|0;HEAP8[$608+3>>0]=HEAP8[$78+3>>0]|0; $609 = $prog; $610 = ((($609)) + 152|0); _nk_handle_ptr($79,0); ;HEAP32[$610>>2]=HEAP32[$79>>2]|0; $611 = $prog; $612 = ((($611)) + 144|0); _nk_vec2($80,4.0,4.0); ;HEAP32[$612>>2]=HEAP32[$80>>2]|0;HEAP32[$612+4>>2]=HEAP32[$80+4>>2]|0; $613 = $prog; $614 = ((($613)) + 128|0); HEAPF32[$614>>2] = 0.0; $615 = $prog; $616 = ((($615)) + 132|0); HEAPF32[$616>>2] = 0.0; $617 = $prog; $618 = ((($617)) + 140|0); HEAPF32[$618>>2] = 0.0; $619 = $prog; $620 = ((($619)) + 136|0); HEAPF32[$620>>2] = 0.0; $621 = $prog; $622 = ((($621)) + 156|0); HEAP32[$622>>2] = 0; $623 = $prog; $624 = ((($623)) + 160|0); HEAP32[$624>>2] = 0; $625 = $style; $626 = ((($625)) + 3084|0); $scroll = $626; $627 = $scroll; _nk_zero($627,432); $628 = $scroll; $629 = $1; $630 = ((($629)) + 92|0); ;HEAP8[$$byval_copy37>>0]=HEAP8[$630>>0]|0;HEAP8[$$byval_copy37+1>>0]=HEAP8[$630+1>>0]|0;HEAP8[$$byval_copy37+2>>0]=HEAP8[$630+2>>0]|0;HEAP8[$$byval_copy37+3>>0]=HEAP8[$630+3>>0]|0; _nk_style_item_color($81,$$byval_copy37); ;HEAP32[$628>>2]=HEAP32[$81>>2]|0;HEAP32[$628+4>>2]=HEAP32[$81+4>>2]|0;HEAP32[$628+8>>2]=HEAP32[$81+8>>2]|0;HEAP32[$628+12>>2]=HEAP32[$81+12>>2]|0;HEAP32[$628+16>>2]=HEAP32[$81+16>>2]|0; $631 = $scroll; $632 = ((($631)) + 20|0); $633 = $1; $634 = ((($633)) + 92|0); ;HEAP8[$$byval_copy38>>0]=HEAP8[$634>>0]|0;HEAP8[$$byval_copy38+1>>0]=HEAP8[$634+1>>0]|0;HEAP8[$$byval_copy38+2>>0]=HEAP8[$634+2>>0]|0;HEAP8[$$byval_copy38+3>>0]=HEAP8[$634+3>>0]|0; _nk_style_item_color($82,$$byval_copy38); ;HEAP32[$632>>2]=HEAP32[$82>>2]|0;HEAP32[$632+4>>2]=HEAP32[$82+4>>2]|0;HEAP32[$632+8>>2]=HEAP32[$82+8>>2]|0;HEAP32[$632+12>>2]=HEAP32[$82+12>>2]|0;HEAP32[$632+16>>2]=HEAP32[$82+16>>2]|0; $635 = $scroll; $636 = ((($635)) + 40|0); $637 = $1; $638 = ((($637)) + 92|0); ;HEAP8[$$byval_copy39>>0]=HEAP8[$638>>0]|0;HEAP8[$$byval_copy39+1>>0]=HEAP8[$638+1>>0]|0;HEAP8[$$byval_copy39+2>>0]=HEAP8[$638+2>>0]|0;HEAP8[$$byval_copy39+3>>0]=HEAP8[$638+3>>0]|0; _nk_style_item_color($83,$$byval_copy39); ;HEAP32[$636>>2]=HEAP32[$83>>2]|0;HEAP32[$636+4>>2]=HEAP32[$83+4>>2]|0;HEAP32[$636+8>>2]=HEAP32[$83+8>>2]|0;HEAP32[$636+12>>2]=HEAP32[$83+12>>2]|0;HEAP32[$636+16>>2]=HEAP32[$83+16>>2]|0; $639 = $scroll; $640 = ((($639)) + 64|0); $641 = $1; $642 = ((($641)) + 96|0); ;HEAP8[$$byval_copy40>>0]=HEAP8[$642>>0]|0;HEAP8[$$byval_copy40+1>>0]=HEAP8[$642+1>>0]|0;HEAP8[$$byval_copy40+2>>0]=HEAP8[$642+2>>0]|0;HEAP8[$$byval_copy40+3>>0]=HEAP8[$642+3>>0]|0; _nk_style_item_color($84,$$byval_copy40); ;HEAP32[$640>>2]=HEAP32[$84>>2]|0;HEAP32[$640+4>>2]=HEAP32[$84+4>>2]|0;HEAP32[$640+8>>2]=HEAP32[$84+8>>2]|0;HEAP32[$640+12>>2]=HEAP32[$84+12>>2]|0;HEAP32[$640+16>>2]=HEAP32[$84+16>>2]|0; $643 = $scroll; $644 = ((($643)) + 84|0); $645 = $1; $646 = ((($645)) + 100|0); ;HEAP8[$$byval_copy41>>0]=HEAP8[$646>>0]|0;HEAP8[$$byval_copy41+1>>0]=HEAP8[$646+1>>0]|0;HEAP8[$$byval_copy41+2>>0]=HEAP8[$646+2>>0]|0;HEAP8[$$byval_copy41+3>>0]=HEAP8[$646+3>>0]|0; _nk_style_item_color($85,$$byval_copy41); ;HEAP32[$644>>2]=HEAP32[$85>>2]|0;HEAP32[$644+4>>2]=HEAP32[$85+4>>2]|0;HEAP32[$644+8>>2]=HEAP32[$85+8>>2]|0;HEAP32[$644+12>>2]=HEAP32[$85+12>>2]|0;HEAP32[$644+16>>2]=HEAP32[$85+16>>2]|0; $647 = $scroll; $648 = ((($647)) + 104|0); $649 = $1; $650 = ((($649)) + 104|0); ;HEAP8[$$byval_copy42>>0]=HEAP8[$650>>0]|0;HEAP8[$$byval_copy42+1>>0]=HEAP8[$650+1>>0]|0;HEAP8[$$byval_copy42+2>>0]=HEAP8[$650+2>>0]|0;HEAP8[$$byval_copy42+3>>0]=HEAP8[$650+3>>0]|0; _nk_style_item_color($86,$$byval_copy42); ;HEAP32[$648>>2]=HEAP32[$86>>2]|0;HEAP32[$648+4>>2]=HEAP32[$86+4>>2]|0;HEAP32[$648+8>>2]=HEAP32[$86+8>>2]|0;HEAP32[$648+12>>2]=HEAP32[$86+12>>2]|0;HEAP32[$648+16>>2]=HEAP32[$86+16>>2]|0; $651 = $scroll; $652 = ((($651)) + 416|0); HEAP32[$652>>2] = 4; $653 = $scroll; $654 = ((($653)) + 412|0); HEAP32[$654>>2] = 4; $655 = $scroll; $656 = ((($655)) + 420|0); _nk_handle_ptr($87,0); ;HEAP32[$656>>2]=HEAP32[$87>>2]|0; $657 = $scroll; $658 = ((($657)) + 60|0); $659 = $1; $660 = ((($659)) + 12|0); ;HEAP8[$658>>0]=HEAP8[$660>>0]|0;HEAP8[$658+1>>0]=HEAP8[$660+1>>0]|0;HEAP8[$658+2>>0]=HEAP8[$660+2>>0]|0;HEAP8[$658+3>>0]=HEAP8[$660+3>>0]|0; $661 = $scroll; $662 = ((($661)) + 124|0); $663 = $1; $664 = ((($663)) + 12|0); ;HEAP8[$662>>0]=HEAP8[$664>>0]|0;HEAP8[$662+1>>0]=HEAP8[$664+1>>0]|0;HEAP8[$662+2>>0]=HEAP8[$664+2>>0]|0;HEAP8[$662+3>>0]=HEAP8[$664+3>>0]|0; $665 = $scroll; $666 = ((($665)) + 144|0); _nk_vec2($88,0.0,0.0); ;HEAP32[$666>>2]=HEAP32[$88>>2]|0;HEAP32[$666+4>>2]=HEAP32[$88+4>>2]|0; $667 = $scroll; $668 = ((($667)) + 152|0); HEAP32[$668>>2] = 0; $669 = $scroll; $670 = ((($669)) + 128|0); HEAPF32[$670>>2] = 0.0; $671 = $scroll; $672 = ((($671)) + 132|0); HEAPF32[$672>>2] = 0.0; $673 = $scroll; $674 = ((($673)) + 136|0); HEAPF32[$674>>2] = 0.0; $675 = $scroll; $676 = ((($675)) + 140|0); HEAPF32[$676>>2] = 0.0; $677 = $scroll; $678 = ((($677)) + 424|0); HEAP32[$678>>2] = 0; $679 = $scroll; $680 = ((($679)) + 428|0); HEAP32[$680>>2] = 0; $681 = $style; $682 = ((($681)) + 3516|0); $683 = $style; $684 = ((($683)) + 3084|0); _memcpy(($682|0),($684|0),432)|0; $685 = $style; $686 = ((($685)) + 3084|0); $687 = ((($686)) + 156|0); $button = $687; $688 = $button; _nk_rgb($89,40,40,40); ;HEAP8[$$byval_copy43>>0]=HEAP8[$89>>0]|0;HEAP8[$$byval_copy43+1>>0]=HEAP8[$89+1>>0]|0;HEAP8[$$byval_copy43+2>>0]=HEAP8[$89+2>>0]|0;HEAP8[$$byval_copy43+3>>0]=HEAP8[$89+3>>0]|0; _nk_style_item_color($90,$$byval_copy43); ;HEAP32[$688>>2]=HEAP32[$90>>2]|0;HEAP32[$688+4>>2]=HEAP32[$90+4>>2]|0;HEAP32[$688+8>>2]=HEAP32[$90+8>>2]|0;HEAP32[$688+12>>2]=HEAP32[$90+12>>2]|0;HEAP32[$688+16>>2]=HEAP32[$90+16>>2]|0; $689 = $button; $690 = ((($689)) + 20|0); _nk_rgb($91,42,42,42); ;HEAP8[$$byval_copy44>>0]=HEAP8[$91>>0]|0;HEAP8[$$byval_copy44+1>>0]=HEAP8[$91+1>>0]|0;HEAP8[$$byval_copy44+2>>0]=HEAP8[$91+2>>0]|0;HEAP8[$$byval_copy44+3>>0]=HEAP8[$91+3>>0]|0; _nk_style_item_color($92,$$byval_copy44); ;HEAP32[$690>>2]=HEAP32[$92>>2]|0;HEAP32[$690+4>>2]=HEAP32[$92+4>>2]|0;HEAP32[$690+8>>2]=HEAP32[$92+8>>2]|0;HEAP32[$690+12>>2]=HEAP32[$92+12>>2]|0;HEAP32[$690+16>>2]=HEAP32[$92+16>>2]|0; $691 = $button; $692 = ((($691)) + 40|0); _nk_rgb($93,44,44,44); ;HEAP8[$$byval_copy45>>0]=HEAP8[$93>>0]|0;HEAP8[$$byval_copy45+1>>0]=HEAP8[$93+1>>0]|0;HEAP8[$$byval_copy45+2>>0]=HEAP8[$93+2>>0]|0;HEAP8[$$byval_copy45+3>>0]=HEAP8[$93+3>>0]|0; _nk_style_item_color($94,$$byval_copy45); ;HEAP32[$692>>2]=HEAP32[$94>>2]|0;HEAP32[$692+4>>2]=HEAP32[$94+4>>2]|0;HEAP32[$692+8>>2]=HEAP32[$94+8>>2]|0;HEAP32[$692+12>>2]=HEAP32[$94+12>>2]|0;HEAP32[$692+16>>2]=HEAP32[$94+16>>2]|0; $693 = $button; $694 = ((($693)) + 60|0); _nk_rgb($95,65,65,65); ;HEAP8[$694>>0]=HEAP8[$95>>0]|0;HEAP8[$694+1>>0]=HEAP8[$95+1>>0]|0;HEAP8[$694+2>>0]=HEAP8[$95+2>>0]|0;HEAP8[$694+3>>0]=HEAP8[$95+3>>0]|0; $695 = $button; $696 = ((($695)) + 64|0); _nk_rgb($96,40,40,40); ;HEAP8[$696>>0]=HEAP8[$96>>0]|0;HEAP8[$696+1>>0]=HEAP8[$96+1>>0]|0;HEAP8[$696+2>>0]=HEAP8[$96+2>>0]|0;HEAP8[$696+3>>0]=HEAP8[$96+3>>0]|0; $697 = $button; $698 = ((($697)) + 68|0); _nk_rgb($97,175,175,175); ;HEAP8[$698>>0]=HEAP8[$97>>0]|0;HEAP8[$698+1>>0]=HEAP8[$97+1>>0]|0;HEAP8[$698+2>>0]=HEAP8[$97+2>>0]|0;HEAP8[$698+3>>0]=HEAP8[$97+3>>0]|0; $699 = $button; $700 = ((($699)) + 72|0); _nk_rgb($98,175,175,175); ;HEAP8[$700>>0]=HEAP8[$98>>0]|0;HEAP8[$700+1>>0]=HEAP8[$98+1>>0]|0;HEAP8[$700+2>>0]=HEAP8[$98+2>>0]|0;HEAP8[$700+3>>0]=HEAP8[$98+3>>0]|0; $701 = $button; $702 = ((($701)) + 76|0); _nk_rgb($99,175,175,175); ;HEAP8[$702>>0]=HEAP8[$99>>0]|0;HEAP8[$702+1>>0]=HEAP8[$99+1>>0]|0;HEAP8[$702+2>>0]=HEAP8[$99+2>>0]|0;HEAP8[$702+3>>0]=HEAP8[$99+3>>0]|0; $703 = $button; $704 = ((($703)) + 92|0); _nk_vec2($100,4.0,4.0); ;HEAP32[$704>>2]=HEAP32[$100>>2]|0;HEAP32[$704+4>>2]=HEAP32[$100+4>>2]|0; $705 = $button; $706 = ((($705)) + 108|0); _nk_vec2($101,0.0,0.0); ;HEAP32[$706>>2]=HEAP32[$101>>2]|0;HEAP32[$706+4>>2]=HEAP32[$101+4>>2]|0; $707 = $button; $708 = ((($707)) + 116|0); _nk_handle_ptr($102,0); ;HEAP32[$708>>2]=HEAP32[$102>>2]|0; $709 = $button; $710 = ((($709)) + 80|0); HEAP32[$710>>2] = 18; $711 = $button; $712 = ((($711)) + 84|0); HEAPF32[$712>>2] = 1.0; $713 = $button; $714 = ((($713)) + 88|0); HEAPF32[$714>>2] = 0.0; $715 = $button; $716 = ((($715)) + 120|0); HEAP32[$716>>2] = 0; $717 = $button; $718 = ((($717)) + 124|0); HEAP32[$718>>2] = 0; $719 = $style; $720 = ((($719)) + 3084|0); $721 = ((($720)) + 284|0); $722 = $style; $723 = ((($722)) + 3084|0); $724 = ((($723)) + 156|0); dest=$721; src=$724; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $725 = $style; $726 = ((($725)) + 3516|0); $727 = ((($726)) + 156|0); $728 = $style; $729 = ((($728)) + 3084|0); $730 = ((($729)) + 156|0); dest=$727; src=$730; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $731 = $style; $732 = ((($731)) + 3516|0); $733 = ((($732)) + 284|0); $734 = $style; $735 = ((($734)) + 3084|0); $736 = ((($735)) + 156|0); dest=$733; src=$736; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $737 = $style; $738 = ((($737)) + 2464|0); $edit = $738; $739 = $edit; _nk_zero($739,572); $740 = $edit; $741 = $1; $742 = ((($741)) + 68|0); ;HEAP8[$$byval_copy46>>0]=HEAP8[$742>>0]|0;HEAP8[$$byval_copy46+1>>0]=HEAP8[$742+1>>0]|0;HEAP8[$$byval_copy46+2>>0]=HEAP8[$742+2>>0]|0;HEAP8[$$byval_copy46+3>>0]=HEAP8[$742+3>>0]|0; _nk_style_item_color($103,$$byval_copy46); ;HEAP32[$740>>2]=HEAP32[$103>>2]|0;HEAP32[$740+4>>2]=HEAP32[$103+4>>2]|0;HEAP32[$740+8>>2]=HEAP32[$103+8>>2]|0;HEAP32[$740+12>>2]=HEAP32[$103+12>>2]|0;HEAP32[$740+16>>2]=HEAP32[$103+16>>2]|0; $743 = $edit; $744 = ((($743)) + 20|0); $745 = $1; $746 = ((($745)) + 68|0); ;HEAP8[$$byval_copy47>>0]=HEAP8[$746>>0]|0;HEAP8[$$byval_copy47+1>>0]=HEAP8[$746+1>>0]|0;HEAP8[$$byval_copy47+2>>0]=HEAP8[$746+2>>0]|0;HEAP8[$$byval_copy47+3>>0]=HEAP8[$746+3>>0]|0; _nk_style_item_color($104,$$byval_copy47); ;HEAP32[$744>>2]=HEAP32[$104>>2]|0;HEAP32[$744+4>>2]=HEAP32[$104+4>>2]|0;HEAP32[$744+8>>2]=HEAP32[$104+8>>2]|0;HEAP32[$744+12>>2]=HEAP32[$104+12>>2]|0;HEAP32[$744+16>>2]=HEAP32[$104+16>>2]|0; $747 = $edit; $748 = ((($747)) + 40|0); $749 = $1; $750 = ((($749)) + 68|0); ;HEAP8[$$byval_copy48>>0]=HEAP8[$750>>0]|0;HEAP8[$$byval_copy48+1>>0]=HEAP8[$750+1>>0]|0;HEAP8[$$byval_copy48+2>>0]=HEAP8[$750+2>>0]|0;HEAP8[$$byval_copy48+3>>0]=HEAP8[$750+3>>0]|0; _nk_style_item_color($105,$$byval_copy48); ;HEAP32[$748>>2]=HEAP32[$105>>2]|0;HEAP32[$748+4>>2]=HEAP32[$105+4>>2]|0;HEAP32[$748+8>>2]=HEAP32[$105+8>>2]|0;HEAP32[$748+12>>2]=HEAP32[$105+12>>2]|0;HEAP32[$748+16>>2]=HEAP32[$105+16>>2]|0; $751 = $edit; $752 = ((($751)) + 496|0); $753 = $1; ;HEAP8[$752>>0]=HEAP8[$753>>0]|0;HEAP8[$752+1>>0]=HEAP8[$753+1>>0]|0;HEAP8[$752+2>>0]=HEAP8[$753+2>>0]|0;HEAP8[$752+3>>0]=HEAP8[$753+3>>0]|0; $754 = $edit; $755 = ((($754)) + 500|0); $756 = $1; ;HEAP8[$755>>0]=HEAP8[$756>>0]|0;HEAP8[$755+1>>0]=HEAP8[$756+1>>0]|0;HEAP8[$755+2>>0]=HEAP8[$756+2>>0]|0;HEAP8[$755+3>>0]=HEAP8[$756+3>>0]|0; $757 = $edit; $758 = ((($757)) + 504|0); $759 = $1; $760 = ((($759)) + 68|0); ;HEAP8[$758>>0]=HEAP8[$760>>0]|0;HEAP8[$758+1>>0]=HEAP8[$760+1>>0]|0;HEAP8[$758+2>>0]=HEAP8[$760+2>>0]|0;HEAP8[$758+3>>0]=HEAP8[$760+3>>0]|0; $761 = $edit; $762 = ((($761)) + 508|0); $763 = $1; $764 = ((($763)) + 68|0); ;HEAP8[$762>>0]=HEAP8[$764>>0]|0;HEAP8[$762+1>>0]=HEAP8[$764+1>>0]|0;HEAP8[$762+2>>0]=HEAP8[$764+2>>0]|0;HEAP8[$762+3>>0]=HEAP8[$764+3>>0]|0; $765 = $edit; $766 = ((($765)) + 60|0); $767 = $1; $768 = ((($767)) + 12|0); ;HEAP8[$766>>0]=HEAP8[$768>>0]|0;HEAP8[$766+1>>0]=HEAP8[$768+1>>0]|0;HEAP8[$766+2>>0]=HEAP8[$768+2>>0]|0;HEAP8[$766+3>>0]=HEAP8[$768+3>>0]|0; $769 = $edit; $770 = ((($769)) + 512|0); $771 = $1; ;HEAP8[$770>>0]=HEAP8[$771>>0]|0;HEAP8[$770+1>>0]=HEAP8[$771+1>>0]|0;HEAP8[$770+2>>0]=HEAP8[$771+2>>0]|0;HEAP8[$770+3>>0]=HEAP8[$771+3>>0]|0; $772 = $edit; $773 = ((($772)) + 516|0); $774 = $1; ;HEAP8[$773>>0]=HEAP8[$774>>0]|0;HEAP8[$773+1>>0]=HEAP8[$774+1>>0]|0;HEAP8[$773+2>>0]=HEAP8[$774+2>>0]|0;HEAP8[$773+3>>0]=HEAP8[$774+3>>0]|0; $775 = $edit; $776 = ((($775)) + 520|0); $777 = $1; ;HEAP8[$776>>0]=HEAP8[$777>>0]|0;HEAP8[$776+1>>0]=HEAP8[$777+1>>0]|0;HEAP8[$776+2>>0]=HEAP8[$777+2>>0]|0;HEAP8[$776+3>>0]=HEAP8[$777+3>>0]|0; $778 = $edit; $779 = ((($778)) + 524|0); $780 = $1; ;HEAP8[$779>>0]=HEAP8[$780>>0]|0;HEAP8[$779+1>>0]=HEAP8[$780+1>>0]|0;HEAP8[$779+2>>0]=HEAP8[$780+2>>0]|0;HEAP8[$779+3>>0]=HEAP8[$780+3>>0]|0; $781 = $edit; $782 = ((($781)) + 528|0); $783 = $1; ;HEAP8[$782>>0]=HEAP8[$783>>0]|0;HEAP8[$782+1>>0]=HEAP8[$783+1>>0]|0;HEAP8[$782+2>>0]=HEAP8[$783+2>>0]|0;HEAP8[$782+3>>0]=HEAP8[$783+3>>0]|0; $784 = $edit; $785 = ((($784)) + 532|0); $786 = $1; $787 = ((($786)) + 68|0); ;HEAP8[$785>>0]=HEAP8[$787>>0]|0;HEAP8[$785+1>>0]=HEAP8[$787+1>>0]|0;HEAP8[$785+2>>0]=HEAP8[$787+2>>0]|0;HEAP8[$785+3>>0]=HEAP8[$787+3>>0]|0; $788 = $edit; $789 = ((($788)) + 536|0); $790 = $1; $791 = ((($790)) + 68|0); ;HEAP8[$789>>0]=HEAP8[$791>>0]|0;HEAP8[$789+1>>0]=HEAP8[$791+1>>0]|0;HEAP8[$789+2>>0]=HEAP8[$791+2>>0]|0;HEAP8[$789+3>>0]=HEAP8[$791+3>>0]|0; $792 = $edit; $793 = ((($792)) + 568|0); HEAPF32[$793>>2] = 2.0; $794 = $edit; $795 = ((($794)) + 560|0); _nk_vec2($106,4.0,4.0); ;HEAP32[$795>>2]=HEAP32[$106>>2]|0;HEAP32[$795+4>>2]=HEAP32[$106+4>>2]|0; $796 = $edit; $797 = ((($796)) + 548|0); HEAPF32[$797>>2] = 4.0; $798 = $edit; $799 = ((($798)) + 540|0); HEAPF32[$799>>2] = 1.0; $800 = $edit; $801 = ((($800)) + 544|0); HEAPF32[$801>>2] = 0.0; $802 = $style; $803 = ((($802)) + 1524|0); $property = $803; $804 = $property; _nk_zero($804,940); $805 = $property; $806 = $1; $807 = ((($806)) + 64|0); ;HEAP8[$$byval_copy49>>0]=HEAP8[$807>>0]|0;HEAP8[$$byval_copy49+1>>0]=HEAP8[$807+1>>0]|0;HEAP8[$$byval_copy49+2>>0]=HEAP8[$807+2>>0]|0;HEAP8[$$byval_copy49+3>>0]=HEAP8[$807+3>>0]|0; _nk_style_item_color($107,$$byval_copy49); ;HEAP32[$805>>2]=HEAP32[$107>>2]|0;HEAP32[$805+4>>2]=HEAP32[$107+4>>2]|0;HEAP32[$805+8>>2]=HEAP32[$107+8>>2]|0;HEAP32[$805+12>>2]=HEAP32[$107+12>>2]|0;HEAP32[$805+16>>2]=HEAP32[$107+16>>2]|0; $808 = $property; $809 = ((($808)) + 20|0); $810 = $1; $811 = ((($810)) + 64|0); ;HEAP8[$$byval_copy50>>0]=HEAP8[$811>>0]|0;HEAP8[$$byval_copy50+1>>0]=HEAP8[$811+1>>0]|0;HEAP8[$$byval_copy50+2>>0]=HEAP8[$811+2>>0]|0;HEAP8[$$byval_copy50+3>>0]=HEAP8[$811+3>>0]|0; _nk_style_item_color($108,$$byval_copy50); ;HEAP32[$809>>2]=HEAP32[$108>>2]|0;HEAP32[$809+4>>2]=HEAP32[$108+4>>2]|0;HEAP32[$809+8>>2]=HEAP32[$108+8>>2]|0;HEAP32[$809+12>>2]=HEAP32[$108+12>>2]|0;HEAP32[$809+16>>2]=HEAP32[$108+16>>2]|0; $812 = $property; $813 = ((($812)) + 40|0); $814 = $1; $815 = ((($814)) + 64|0); ;HEAP8[$$byval_copy51>>0]=HEAP8[$815>>0]|0;HEAP8[$$byval_copy51+1>>0]=HEAP8[$815+1>>0]|0;HEAP8[$$byval_copy51+2>>0]=HEAP8[$815+2>>0]|0;HEAP8[$$byval_copy51+3>>0]=HEAP8[$815+3>>0]|0; _nk_style_item_color($109,$$byval_copy51); ;HEAP32[$813>>2]=HEAP32[$109>>2]|0;HEAP32[$813+4>>2]=HEAP32[$109+4>>2]|0;HEAP32[$813+8>>2]=HEAP32[$109+8>>2]|0;HEAP32[$813+12>>2]=HEAP32[$109+12>>2]|0;HEAP32[$813+16>>2]=HEAP32[$109+16>>2]|0; $816 = $property; $817 = ((($816)) + 60|0); $818 = $1; $819 = ((($818)) + 12|0); ;HEAP8[$817>>0]=HEAP8[$819>>0]|0;HEAP8[$817+1>>0]=HEAP8[$819+1>>0]|0;HEAP8[$817+2>>0]=HEAP8[$819+2>>0]|0;HEAP8[$817+3>>0]=HEAP8[$819+3>>0]|0; $820 = $property; $821 = ((($820)) + 64|0); $822 = $1; ;HEAP8[$821>>0]=HEAP8[$822>>0]|0;HEAP8[$821+1>>0]=HEAP8[$822+1>>0]|0;HEAP8[$821+2>>0]=HEAP8[$822+2>>0]|0;HEAP8[$821+3>>0]=HEAP8[$822+3>>0]|0; $823 = $property; $824 = ((($823)) + 68|0); $825 = $1; ;HEAP8[$824>>0]=HEAP8[$825>>0]|0;HEAP8[$824+1>>0]=HEAP8[$825+1>>0]|0;HEAP8[$824+2>>0]=HEAP8[$825+2>>0]|0;HEAP8[$824+3>>0]=HEAP8[$825+3>>0]|0; $826 = $property; $827 = ((($826)) + 72|0); $828 = $1; ;HEAP8[$827>>0]=HEAP8[$828>>0]|0;HEAP8[$827+1>>0]=HEAP8[$828+1>>0]|0;HEAP8[$827+2>>0]=HEAP8[$828+2>>0]|0;HEAP8[$827+3>>0]=HEAP8[$828+3>>0]|0; $829 = $property; $830 = ((($829)) + 76|0); HEAP32[$830>>2] = 9; $831 = $property; $832 = ((($831)) + 80|0); HEAP32[$832>>2] = 10; $833 = $property; $834 = ((($833)) + 928|0); _nk_handle_ptr($110,0); ;HEAP32[$834>>2]=HEAP32[$110>>2]|0; $835 = $property; $836 = ((($835)) + 92|0); _nk_vec2($111,4.0,4.0); ;HEAP32[$836>>2]=HEAP32[$111>>2]|0;HEAP32[$836+4>>2]=HEAP32[$111+4>>2]|0; $837 = $property; $838 = ((($837)) + 84|0); HEAPF32[$838>>2] = 1.0; $839 = $property; $840 = ((($839)) + 88|0); HEAPF32[$840>>2] = 10.0; $841 = $property; $842 = ((($841)) + 932|0); HEAP32[$842>>2] = 0; $843 = $property; $844 = ((($843)) + 936|0); HEAP32[$844>>2] = 0; $845 = $style; $846 = ((($845)) + 1524|0); $847 = ((($846)) + 800|0); $button = $847; $848 = $button; _nk_zero($848,128); $849 = $button; $850 = $1; $851 = ((($850)) + 64|0); ;HEAP8[$$byval_copy52>>0]=HEAP8[$851>>0]|0;HEAP8[$$byval_copy52+1>>0]=HEAP8[$851+1>>0]|0;HEAP8[$$byval_copy52+2>>0]=HEAP8[$851+2>>0]|0;HEAP8[$$byval_copy52+3>>0]=HEAP8[$851+3>>0]|0; _nk_style_item_color($112,$$byval_copy52); ;HEAP32[$849>>2]=HEAP32[$112>>2]|0;HEAP32[$849+4>>2]=HEAP32[$112+4>>2]|0;HEAP32[$849+8>>2]=HEAP32[$112+8>>2]|0;HEAP32[$849+12>>2]=HEAP32[$112+12>>2]|0;HEAP32[$849+16>>2]=HEAP32[$112+16>>2]|0; $852 = $button; $853 = ((($852)) + 20|0); $854 = $1; $855 = ((($854)) + 64|0); ;HEAP8[$$byval_copy53>>0]=HEAP8[$855>>0]|0;HEAP8[$$byval_copy53+1>>0]=HEAP8[$855+1>>0]|0;HEAP8[$$byval_copy53+2>>0]=HEAP8[$855+2>>0]|0;HEAP8[$$byval_copy53+3>>0]=HEAP8[$855+3>>0]|0; _nk_style_item_color($113,$$byval_copy53); ;HEAP32[$853>>2]=HEAP32[$113>>2]|0;HEAP32[$853+4>>2]=HEAP32[$113+4>>2]|0;HEAP32[$853+8>>2]=HEAP32[$113+8>>2]|0;HEAP32[$853+12>>2]=HEAP32[$113+12>>2]|0;HEAP32[$853+16>>2]=HEAP32[$113+16>>2]|0; $856 = $button; $857 = ((($856)) + 40|0); $858 = $1; $859 = ((($858)) + 64|0); ;HEAP8[$$byval_copy54>>0]=HEAP8[$859>>0]|0;HEAP8[$$byval_copy54+1>>0]=HEAP8[$859+1>>0]|0;HEAP8[$$byval_copy54+2>>0]=HEAP8[$859+2>>0]|0;HEAP8[$$byval_copy54+3>>0]=HEAP8[$859+3>>0]|0; _nk_style_item_color($114,$$byval_copy54); ;HEAP32[$857>>2]=HEAP32[$114>>2]|0;HEAP32[$857+4>>2]=HEAP32[$114+4>>2]|0;HEAP32[$857+8>>2]=HEAP32[$114+8>>2]|0;HEAP32[$857+12>>2]=HEAP32[$114+12>>2]|0;HEAP32[$857+16>>2]=HEAP32[$114+16>>2]|0; $860 = $button; $861 = ((($860)) + 60|0); _nk_rgba($115,0,0,0,0); ;HEAP8[$861>>0]=HEAP8[$115>>0]|0;HEAP8[$861+1>>0]=HEAP8[$115+1>>0]|0;HEAP8[$861+2>>0]=HEAP8[$115+2>>0]|0;HEAP8[$861+3>>0]=HEAP8[$115+3>>0]|0; $862 = $button; $863 = ((($862)) + 64|0); $864 = $1; $865 = ((($864)) + 64|0); ;HEAP8[$863>>0]=HEAP8[$865>>0]|0;HEAP8[$863+1>>0]=HEAP8[$865+1>>0]|0;HEAP8[$863+2>>0]=HEAP8[$865+2>>0]|0;HEAP8[$863+3>>0]=HEAP8[$865+3>>0]|0; $866 = $button; $867 = ((($866)) + 68|0); $868 = $1; ;HEAP8[$867>>0]=HEAP8[$868>>0]|0;HEAP8[$867+1>>0]=HEAP8[$868+1>>0]|0;HEAP8[$867+2>>0]=HEAP8[$868+2>>0]|0;HEAP8[$867+3>>0]=HEAP8[$868+3>>0]|0; $869 = $button; $870 = ((($869)) + 72|0); $871 = $1; ;HEAP8[$870>>0]=HEAP8[$871>>0]|0;HEAP8[$870+1>>0]=HEAP8[$871+1>>0]|0;HEAP8[$870+2>>0]=HEAP8[$871+2>>0]|0;HEAP8[$870+3>>0]=HEAP8[$871+3>>0]|0; $872 = $button; $873 = ((($872)) + 76|0); $874 = $1; ;HEAP8[$873>>0]=HEAP8[$874>>0]|0;HEAP8[$873+1>>0]=HEAP8[$874+1>>0]|0;HEAP8[$873+2>>0]=HEAP8[$874+2>>0]|0;HEAP8[$873+3>>0]=HEAP8[$874+3>>0]|0; $875 = $button; $876 = ((($875)) + 92|0); _nk_vec2($116,0.0,0.0); ;HEAP32[$876>>2]=HEAP32[$116>>2]|0;HEAP32[$876+4>>2]=HEAP32[$116+4>>2]|0; $877 = $button; $878 = ((($877)) + 108|0); _nk_vec2($117,0.0,0.0); ;HEAP32[$878>>2]=HEAP32[$117>>2]|0;HEAP32[$878+4>>2]=HEAP32[$117+4>>2]|0; $879 = $button; $880 = ((($879)) + 116|0); _nk_handle_ptr($118,0); ;HEAP32[$880>>2]=HEAP32[$118>>2]|0; $881 = $button; $882 = ((($881)) + 80|0); HEAP32[$882>>2] = 18; $883 = $button; $884 = ((($883)) + 84|0); HEAPF32[$884>>2] = 0.0; $885 = $button; $886 = ((($885)) + 88|0); HEAPF32[$886>>2] = 0.0; $887 = $button; $888 = ((($887)) + 120|0); HEAP32[$888>>2] = 0; $889 = $button; $890 = ((($889)) + 124|0); HEAP32[$890>>2] = 0; $891 = $style; $892 = ((($891)) + 1524|0); $893 = ((($892)) + 672|0); $894 = $style; $895 = ((($894)) + 1524|0); $896 = ((($895)) + 800|0); dest=$893; src=$896; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $897 = $style; $898 = ((($897)) + 1524|0); $899 = ((($898)) + 100|0); $edit = $899; $900 = $edit; _nk_zero($900,572); $901 = $edit; $902 = $1; $903 = ((($902)) + 64|0); ;HEAP8[$$byval_copy55>>0]=HEAP8[$903>>0]|0;HEAP8[$$byval_copy55+1>>0]=HEAP8[$903+1>>0]|0;HEAP8[$$byval_copy55+2>>0]=HEAP8[$903+2>>0]|0;HEAP8[$$byval_copy55+3>>0]=HEAP8[$903+3>>0]|0; _nk_style_item_color($119,$$byval_copy55); ;HEAP32[$901>>2]=HEAP32[$119>>2]|0;HEAP32[$901+4>>2]=HEAP32[$119+4>>2]|0;HEAP32[$901+8>>2]=HEAP32[$119+8>>2]|0;HEAP32[$901+12>>2]=HEAP32[$119+12>>2]|0;HEAP32[$901+16>>2]=HEAP32[$119+16>>2]|0; $904 = $edit; $905 = ((($904)) + 20|0); $906 = $1; $907 = ((($906)) + 64|0); ;HEAP8[$$byval_copy56>>0]=HEAP8[$907>>0]|0;HEAP8[$$byval_copy56+1>>0]=HEAP8[$907+1>>0]|0;HEAP8[$$byval_copy56+2>>0]=HEAP8[$907+2>>0]|0;HEAP8[$$byval_copy56+3>>0]=HEAP8[$907+3>>0]|0; _nk_style_item_color($120,$$byval_copy56); ;HEAP32[$905>>2]=HEAP32[$120>>2]|0;HEAP32[$905+4>>2]=HEAP32[$120+4>>2]|0;HEAP32[$905+8>>2]=HEAP32[$120+8>>2]|0;HEAP32[$905+12>>2]=HEAP32[$120+12>>2]|0;HEAP32[$905+16>>2]=HEAP32[$120+16>>2]|0; $908 = $edit; $909 = ((($908)) + 40|0); $910 = $1; $911 = ((($910)) + 64|0); ;HEAP8[$$byval_copy57>>0]=HEAP8[$911>>0]|0;HEAP8[$$byval_copy57+1>>0]=HEAP8[$911+1>>0]|0;HEAP8[$$byval_copy57+2>>0]=HEAP8[$911+2>>0]|0;HEAP8[$$byval_copy57+3>>0]=HEAP8[$911+3>>0]|0; _nk_style_item_color($121,$$byval_copy57); ;HEAP32[$909>>2]=HEAP32[$121>>2]|0;HEAP32[$909+4>>2]=HEAP32[$121+4>>2]|0;HEAP32[$909+8>>2]=HEAP32[$121+8>>2]|0;HEAP32[$909+12>>2]=HEAP32[$121+12>>2]|0;HEAP32[$909+16>>2]=HEAP32[$121+16>>2]|0; $912 = $edit; $913 = ((($912)) + 60|0); _nk_rgba($122,0,0,0,0); ;HEAP8[$913>>0]=HEAP8[$122>>0]|0;HEAP8[$913+1>>0]=HEAP8[$122+1>>0]|0;HEAP8[$913+2>>0]=HEAP8[$122+2>>0]|0;HEAP8[$913+3>>0]=HEAP8[$122+3>>0]|0; $914 = $edit; $915 = ((($914)) + 496|0); $916 = $1; ;HEAP8[$915>>0]=HEAP8[$916>>0]|0;HEAP8[$915+1>>0]=HEAP8[$916+1>>0]|0;HEAP8[$915+2>>0]=HEAP8[$916+2>>0]|0;HEAP8[$915+3>>0]=HEAP8[$916+3>>0]|0; $917 = $edit; $918 = ((($917)) + 500|0); $919 = $1; ;HEAP8[$918>>0]=HEAP8[$919>>0]|0;HEAP8[$918+1>>0]=HEAP8[$919+1>>0]|0;HEAP8[$918+2>>0]=HEAP8[$919+2>>0]|0;HEAP8[$918+3>>0]=HEAP8[$919+3>>0]|0; $920 = $edit; $921 = ((($920)) + 504|0); $922 = $1; $923 = ((($922)) + 68|0); ;HEAP8[$921>>0]=HEAP8[$923>>0]|0;HEAP8[$921+1>>0]=HEAP8[$923+1>>0]|0;HEAP8[$921+2>>0]=HEAP8[$923+2>>0]|0;HEAP8[$921+3>>0]=HEAP8[$923+3>>0]|0; $924 = $edit; $925 = ((($924)) + 508|0); $926 = $1; $927 = ((($926)) + 68|0); ;HEAP8[$925>>0]=HEAP8[$927>>0]|0;HEAP8[$925+1>>0]=HEAP8[$927+1>>0]|0;HEAP8[$925+2>>0]=HEAP8[$927+2>>0]|0;HEAP8[$925+3>>0]=HEAP8[$927+3>>0]|0; $928 = $edit; $929 = ((($928)) + 512|0); $930 = $1; ;HEAP8[$929>>0]=HEAP8[$930>>0]|0;HEAP8[$929+1>>0]=HEAP8[$930+1>>0]|0;HEAP8[$929+2>>0]=HEAP8[$930+2>>0]|0;HEAP8[$929+3>>0]=HEAP8[$930+3>>0]|0; $931 = $edit; $932 = ((($931)) + 516|0); $933 = $1; ;HEAP8[$932>>0]=HEAP8[$933>>0]|0;HEAP8[$932+1>>0]=HEAP8[$933+1>>0]|0;HEAP8[$932+2>>0]=HEAP8[$933+2>>0]|0;HEAP8[$932+3>>0]=HEAP8[$933+3>>0]|0; $934 = $edit; $935 = ((($934)) + 520|0); $936 = $1; ;HEAP8[$935>>0]=HEAP8[$936>>0]|0;HEAP8[$935+1>>0]=HEAP8[$936+1>>0]|0;HEAP8[$935+2>>0]=HEAP8[$936+2>>0]|0;HEAP8[$935+3>>0]=HEAP8[$936+3>>0]|0; $937 = $edit; $938 = ((($937)) + 524|0); $939 = $1; ;HEAP8[$938>>0]=HEAP8[$939>>0]|0;HEAP8[$938+1>>0]=HEAP8[$939+1>>0]|0;HEAP8[$938+2>>0]=HEAP8[$939+2>>0]|0;HEAP8[$938+3>>0]=HEAP8[$939+3>>0]|0; $940 = $edit; $941 = ((($940)) + 528|0); $942 = $1; ;HEAP8[$941>>0]=HEAP8[$942>>0]|0;HEAP8[$941+1>>0]=HEAP8[$942+1>>0]|0;HEAP8[$941+2>>0]=HEAP8[$942+2>>0]|0;HEAP8[$941+3>>0]=HEAP8[$942+3>>0]|0; $943 = $edit; $944 = ((($943)) + 532|0); $945 = $1; $946 = ((($945)) + 68|0); ;HEAP8[$944>>0]=HEAP8[$946>>0]|0;HEAP8[$944+1>>0]=HEAP8[$946+1>>0]|0;HEAP8[$944+2>>0]=HEAP8[$946+2>>0]|0;HEAP8[$944+3>>0]=HEAP8[$946+3>>0]|0; $947 = $edit; $948 = ((($947)) + 536|0); $949 = $1; $950 = ((($949)) + 68|0); ;HEAP8[$948>>0]=HEAP8[$950>>0]|0;HEAP8[$948+1>>0]=HEAP8[$950+1>>0]|0;HEAP8[$948+2>>0]=HEAP8[$950+2>>0]|0;HEAP8[$948+3>>0]=HEAP8[$950+3>>0]|0; $951 = $edit; $952 = ((($951)) + 560|0); _nk_vec2($123,0.0,0.0); ;HEAP32[$952>>2]=HEAP32[$123>>2]|0;HEAP32[$952+4>>2]=HEAP32[$123+4>>2]|0; $953 = $edit; $954 = ((($953)) + 548|0); HEAPF32[$954>>2] = 8.0; $955 = $edit; $956 = ((($955)) + 540|0); HEAPF32[$956>>2] = 0.0; $957 = $edit; $958 = ((($957)) + 544|0); HEAPF32[$958>>2] = 0.0; $959 = $style; $960 = ((($959)) + 3036|0); $chart = $960; $961 = $chart; _nk_zero($961,48); $962 = $chart; $963 = $1; $964 = ((($963)) + 80|0); ;HEAP8[$$byval_copy58>>0]=HEAP8[$964>>0]|0;HEAP8[$$byval_copy58+1>>0]=HEAP8[$964+1>>0]|0;HEAP8[$$byval_copy58+2>>0]=HEAP8[$964+2>>0]|0;HEAP8[$$byval_copy58+3>>0]=HEAP8[$964+3>>0]|0; _nk_style_item_color($124,$$byval_copy58); ;HEAP32[$962>>2]=HEAP32[$124>>2]|0;HEAP32[$962+4>>2]=HEAP32[$124+4>>2]|0;HEAP32[$962+8>>2]=HEAP32[$124+8>>2]|0;HEAP32[$962+12>>2]=HEAP32[$124+12>>2]|0;HEAP32[$962+16>>2]=HEAP32[$124+16>>2]|0; $965 = $chart; $966 = ((($965)) + 20|0); $967 = $1; $968 = ((($967)) + 12|0); ;HEAP8[$966>>0]=HEAP8[$968>>0]|0;HEAP8[$966+1>>0]=HEAP8[$968+1>>0]|0;HEAP8[$966+2>>0]=HEAP8[$968+2>>0]|0;HEAP8[$966+3>>0]=HEAP8[$968+3>>0]|0; $969 = $chart; $970 = ((($969)) + 24|0); $971 = $1; $972 = ((($971)) + 88|0); ;HEAP8[$970>>0]=HEAP8[$972>>0]|0;HEAP8[$970+1>>0]=HEAP8[$972+1>>0]|0;HEAP8[$970+2>>0]=HEAP8[$972+2>>0]|0;HEAP8[$970+3>>0]=HEAP8[$972+3>>0]|0; $973 = $chart; $974 = ((($973)) + 28|0); $975 = $1; $976 = ((($975)) + 84|0); ;HEAP8[$974>>0]=HEAP8[$976>>0]|0;HEAP8[$974+1>>0]=HEAP8[$976+1>>0]|0;HEAP8[$974+2>>0]=HEAP8[$976+2>>0]|0;HEAP8[$974+3>>0]=HEAP8[$976+3>>0]|0; $977 = $chart; $978 = ((($977)) + 40|0); _nk_vec2($125,4.0,4.0); ;HEAP32[$978>>2]=HEAP32[$125>>2]|0;HEAP32[$978+4>>2]=HEAP32[$125+4>>2]|0; $979 = $chart; $980 = ((($979)) + 32|0); HEAPF32[$980>>2] = 0.0; $981 = $chart; $982 = ((($981)) + 36|0); HEAPF32[$982>>2] = 0.0; $983 = $style; $984 = ((($983)) + 4524|0); $combo = $984; $985 = $combo; $986 = $1; $987 = ((($986)) + 76|0); ;HEAP8[$$byval_copy59>>0]=HEAP8[$987>>0]|0;HEAP8[$$byval_copy59+1>>0]=HEAP8[$987+1>>0]|0;HEAP8[$$byval_copy59+2>>0]=HEAP8[$987+2>>0]|0;HEAP8[$$byval_copy59+3>>0]=HEAP8[$987+3>>0]|0; _nk_style_item_color($126,$$byval_copy59); ;HEAP32[$985>>2]=HEAP32[$126>>2]|0;HEAP32[$985+4>>2]=HEAP32[$126+4>>2]|0;HEAP32[$985+8>>2]=HEAP32[$126+8>>2]|0;HEAP32[$985+12>>2]=HEAP32[$126+12>>2]|0;HEAP32[$985+16>>2]=HEAP32[$126+16>>2]|0; $988 = $combo; $989 = ((($988)) + 20|0); $990 = $1; $991 = ((($990)) + 76|0); ;HEAP8[$$byval_copy60>>0]=HEAP8[$991>>0]|0;HEAP8[$$byval_copy60+1>>0]=HEAP8[$991+1>>0]|0;HEAP8[$$byval_copy60+2>>0]=HEAP8[$991+2>>0]|0;HEAP8[$$byval_copy60+3>>0]=HEAP8[$991+3>>0]|0; _nk_style_item_color($127,$$byval_copy60); ;HEAP32[$989>>2]=HEAP32[$127>>2]|0;HEAP32[$989+4>>2]=HEAP32[$127+4>>2]|0;HEAP32[$989+8>>2]=HEAP32[$127+8>>2]|0;HEAP32[$989+12>>2]=HEAP32[$127+12>>2]|0;HEAP32[$989+16>>2]=HEAP32[$127+16>>2]|0; $992 = $combo; $993 = ((($992)) + 40|0); $994 = $1; $995 = ((($994)) + 76|0); ;HEAP8[$$byval_copy61>>0]=HEAP8[$995>>0]|0;HEAP8[$$byval_copy61+1>>0]=HEAP8[$995+1>>0]|0;HEAP8[$$byval_copy61+2>>0]=HEAP8[$995+2>>0]|0;HEAP8[$$byval_copy61+3>>0]=HEAP8[$995+3>>0]|0; _nk_style_item_color($128,$$byval_copy61); ;HEAP32[$993>>2]=HEAP32[$128>>2]|0;HEAP32[$993+4>>2]=HEAP32[$128+4>>2]|0;HEAP32[$993+8>>2]=HEAP32[$128+8>>2]|0;HEAP32[$993+12>>2]=HEAP32[$128+12>>2]|0;HEAP32[$993+16>>2]=HEAP32[$128+16>>2]|0; $996 = $combo; $997 = ((($996)) + 60|0); $998 = $1; $999 = ((($998)) + 12|0); ;HEAP8[$997>>0]=HEAP8[$999>>0]|0;HEAP8[$997+1>>0]=HEAP8[$999+1>>0]|0;HEAP8[$997+2>>0]=HEAP8[$999+2>>0]|0;HEAP8[$997+3>>0]=HEAP8[$999+3>>0]|0; $1000 = $combo; $1001 = ((($1000)) + 64|0); $1002 = $1; ;HEAP8[$1001>>0]=HEAP8[$1002>>0]|0;HEAP8[$1001+1>>0]=HEAP8[$1002+1>>0]|0;HEAP8[$1001+2>>0]=HEAP8[$1002+2>>0]|0;HEAP8[$1001+3>>0]=HEAP8[$1002+3>>0]|0; $1003 = $combo; $1004 = ((($1003)) + 68|0); $1005 = $1; ;HEAP8[$1004>>0]=HEAP8[$1005>>0]|0;HEAP8[$1004+1>>0]=HEAP8[$1005+1>>0]|0;HEAP8[$1004+2>>0]=HEAP8[$1005+2>>0]|0;HEAP8[$1004+3>>0]=HEAP8[$1005+3>>0]|0; $1006 = $combo; $1007 = ((($1006)) + 72|0); $1008 = $1; ;HEAP8[$1007>>0]=HEAP8[$1008>>0]|0;HEAP8[$1007+1>>0]=HEAP8[$1008+1>>0]|0;HEAP8[$1007+2>>0]=HEAP8[$1008+2>>0]|0;HEAP8[$1007+3>>0]=HEAP8[$1008+3>>0]|0; $1009 = $combo; $1010 = ((($1009)) + 216|0); HEAP32[$1010>>2] = 8; $1011 = $combo; $1012 = ((($1011)) + 220|0); HEAP32[$1012>>2] = 8; $1013 = $combo; $1014 = ((($1013)) + 224|0); HEAP32[$1014>>2] = 8; $1015 = $combo; $1016 = ((($1015)) + 236|0); _nk_vec2($129,4.0,4.0); ;HEAP32[$1016>>2]=HEAP32[$129>>2]|0;HEAP32[$1016+4>>2]=HEAP32[$129+4>>2]|0; $1017 = $combo; $1018 = ((($1017)) + 244|0); _nk_vec2($130,0.0,4.0); ;HEAP32[$1018>>2]=HEAP32[$130>>2]|0;HEAP32[$1018+4>>2]=HEAP32[$130+4>>2]|0; $1019 = $combo; $1020 = ((($1019)) + 252|0); _nk_vec2($131,4.0,0.0); ;HEAP32[$1020>>2]=HEAP32[$131>>2]|0;HEAP32[$1020+4>>2]=HEAP32[$131+4>>2]|0; $1021 = $combo; $1022 = ((($1021)) + 228|0); HEAPF32[$1022>>2] = 1.0; $1023 = $combo; $1024 = ((($1023)) + 232|0); HEAPF32[$1024>>2] = 0.0; $1025 = $style; $1026 = ((($1025)) + 4524|0); $1027 = ((($1026)) + 88|0); $button = $1027; $1028 = $button; _nk_zero($1028,128); $1029 = $button; $1030 = $1; $1031 = ((($1030)) + 76|0); ;HEAP8[$$byval_copy62>>0]=HEAP8[$1031>>0]|0;HEAP8[$$byval_copy62+1>>0]=HEAP8[$1031+1>>0]|0;HEAP8[$$byval_copy62+2>>0]=HEAP8[$1031+2>>0]|0;HEAP8[$$byval_copy62+3>>0]=HEAP8[$1031+3>>0]|0; _nk_style_item_color($132,$$byval_copy62); ;HEAP32[$1029>>2]=HEAP32[$132>>2]|0;HEAP32[$1029+4>>2]=HEAP32[$132+4>>2]|0;HEAP32[$1029+8>>2]=HEAP32[$132+8>>2]|0;HEAP32[$1029+12>>2]=HEAP32[$132+12>>2]|0;HEAP32[$1029+16>>2]=HEAP32[$132+16>>2]|0; $1032 = $button; $1033 = ((($1032)) + 20|0); $1034 = $1; $1035 = ((($1034)) + 76|0); ;HEAP8[$$byval_copy63>>0]=HEAP8[$1035>>0]|0;HEAP8[$$byval_copy63+1>>0]=HEAP8[$1035+1>>0]|0;HEAP8[$$byval_copy63+2>>0]=HEAP8[$1035+2>>0]|0;HEAP8[$$byval_copy63+3>>0]=HEAP8[$1035+3>>0]|0; _nk_style_item_color($133,$$byval_copy63); ;HEAP32[$1033>>2]=HEAP32[$133>>2]|0;HEAP32[$1033+4>>2]=HEAP32[$133+4>>2]|0;HEAP32[$1033+8>>2]=HEAP32[$133+8>>2]|0;HEAP32[$1033+12>>2]=HEAP32[$133+12>>2]|0;HEAP32[$1033+16>>2]=HEAP32[$133+16>>2]|0; $1036 = $button; $1037 = ((($1036)) + 40|0); $1038 = $1; $1039 = ((($1038)) + 76|0); ;HEAP8[$$byval_copy64>>0]=HEAP8[$1039>>0]|0;HEAP8[$$byval_copy64+1>>0]=HEAP8[$1039+1>>0]|0;HEAP8[$$byval_copy64+2>>0]=HEAP8[$1039+2>>0]|0;HEAP8[$$byval_copy64+3>>0]=HEAP8[$1039+3>>0]|0; _nk_style_item_color($134,$$byval_copy64); ;HEAP32[$1037>>2]=HEAP32[$134>>2]|0;HEAP32[$1037+4>>2]=HEAP32[$134+4>>2]|0;HEAP32[$1037+8>>2]=HEAP32[$134+8>>2]|0;HEAP32[$1037+12>>2]=HEAP32[$134+12>>2]|0;HEAP32[$1037+16>>2]=HEAP32[$134+16>>2]|0; $1040 = $button; $1041 = ((($1040)) + 60|0); _nk_rgba($135,0,0,0,0); ;HEAP8[$1041>>0]=HEAP8[$135>>0]|0;HEAP8[$1041+1>>0]=HEAP8[$135+1>>0]|0;HEAP8[$1041+2>>0]=HEAP8[$135+2>>0]|0;HEAP8[$1041+3>>0]=HEAP8[$135+3>>0]|0; $1042 = $button; $1043 = ((($1042)) + 64|0); $1044 = $1; $1045 = ((($1044)) + 76|0); ;HEAP8[$1043>>0]=HEAP8[$1045>>0]|0;HEAP8[$1043+1>>0]=HEAP8[$1045+1>>0]|0;HEAP8[$1043+2>>0]=HEAP8[$1045+2>>0]|0;HEAP8[$1043+3>>0]=HEAP8[$1045+3>>0]|0; $1046 = $button; $1047 = ((($1046)) + 68|0); $1048 = $1; ;HEAP8[$1047>>0]=HEAP8[$1048>>0]|0;HEAP8[$1047+1>>0]=HEAP8[$1048+1>>0]|0;HEAP8[$1047+2>>0]=HEAP8[$1048+2>>0]|0;HEAP8[$1047+3>>0]=HEAP8[$1048+3>>0]|0; $1049 = $button; $1050 = ((($1049)) + 72|0); $1051 = $1; ;HEAP8[$1050>>0]=HEAP8[$1051>>0]|0;HEAP8[$1050+1>>0]=HEAP8[$1051+1>>0]|0;HEAP8[$1050+2>>0]=HEAP8[$1051+2>>0]|0;HEAP8[$1050+3>>0]=HEAP8[$1051+3>>0]|0; $1052 = $button; $1053 = ((($1052)) + 76|0); $1054 = $1; ;HEAP8[$1053>>0]=HEAP8[$1054>>0]|0;HEAP8[$1053+1>>0]=HEAP8[$1054+1>>0]|0;HEAP8[$1053+2>>0]=HEAP8[$1054+2>>0]|0;HEAP8[$1053+3>>0]=HEAP8[$1054+3>>0]|0; $1055 = $button; $1056 = ((($1055)) + 92|0); _nk_vec2($136,2.0,2.0); ;HEAP32[$1056>>2]=HEAP32[$136>>2]|0;HEAP32[$1056+4>>2]=HEAP32[$136+4>>2]|0; $1057 = $button; $1058 = ((($1057)) + 108|0); _nk_vec2($137,0.0,0.0); ;HEAP32[$1058>>2]=HEAP32[$137>>2]|0;HEAP32[$1058+4>>2]=HEAP32[$137+4>>2]|0; $1059 = $button; $1060 = ((($1059)) + 116|0); _nk_handle_ptr($138,0); ;HEAP32[$1060>>2]=HEAP32[$138>>2]|0; $1061 = $button; $1062 = ((($1061)) + 80|0); HEAP32[$1062>>2] = 18; $1063 = $button; $1064 = ((($1063)) + 84|0); HEAPF32[$1064>>2] = 0.0; $1065 = $button; $1066 = ((($1065)) + 88|0); HEAPF32[$1066>>2] = 0.0; $1067 = $button; $1068 = ((($1067)) + 120|0); HEAP32[$1068>>2] = 0; $1069 = $button; $1070 = ((($1069)) + 124|0); HEAP32[$1070>>2] = 0; $1071 = $style; $1072 = ((($1071)) + 3948|0); $tab = $1072; $1073 = $tab; $1074 = $1; $1075 = ((($1074)) + 108|0); ;HEAP8[$$byval_copy65>>0]=HEAP8[$1075>>0]|0;HEAP8[$$byval_copy65+1>>0]=HEAP8[$1075+1>>0]|0;HEAP8[$$byval_copy65+2>>0]=HEAP8[$1075+2>>0]|0;HEAP8[$$byval_copy65+3>>0]=HEAP8[$1075+3>>0]|0; _nk_style_item_color($139,$$byval_copy65); ;HEAP32[$1073>>2]=HEAP32[$139>>2]|0;HEAP32[$1073+4>>2]=HEAP32[$139+4>>2]|0;HEAP32[$1073+8>>2]=HEAP32[$139+8>>2]|0;HEAP32[$1073+12>>2]=HEAP32[$139+12>>2]|0;HEAP32[$1073+16>>2]=HEAP32[$139+16>>2]|0; $1076 = $tab; $1077 = ((($1076)) + 20|0); $1078 = $1; $1079 = ((($1078)) + 12|0); ;HEAP8[$1077>>0]=HEAP8[$1079>>0]|0;HEAP8[$1077+1>>0]=HEAP8[$1079+1>>0]|0;HEAP8[$1077+2>>0]=HEAP8[$1079+2>>0]|0;HEAP8[$1077+3>>0]=HEAP8[$1079+3>>0]|0; $1080 = $tab; $1081 = ((($1080)) + 24|0); $1082 = $1; ;HEAP8[$1081>>0]=HEAP8[$1082>>0]|0;HEAP8[$1081+1>>0]=HEAP8[$1082+1>>0]|0;HEAP8[$1081+2>>0]=HEAP8[$1082+2>>0]|0;HEAP8[$1081+3>>0]=HEAP8[$1082+3>>0]|0; $1083 = $tab; $1084 = ((($1083)) + 540|0); HEAP32[$1084>>2] = 10; $1085 = $tab; $1086 = ((($1085)) + 544|0); HEAP32[$1086>>2] = 8; $1087 = $tab; $1088 = ((($1087)) + 560|0); _nk_vec2($140,4.0,4.0); ;HEAP32[$1088>>2]=HEAP32[$140>>2]|0;HEAP32[$1088+4>>2]=HEAP32[$140+4>>2]|0; $1089 = $tab; $1090 = ((($1089)) + 568|0); _nk_vec2($141,4.0,4.0); ;HEAP32[$1090>>2]=HEAP32[$141>>2]|0;HEAP32[$1090+4>>2]=HEAP32[$141+4>>2]|0; $1091 = $tab; $1092 = ((($1091)) + 556|0); HEAPF32[$1092>>2] = 10.0; $1093 = $tab; $1094 = ((($1093)) + 548|0); HEAPF32[$1094>>2] = 1.0; $1095 = $tab; $1096 = ((($1095)) + 552|0); HEAPF32[$1096>>2] = 0.0; $1097 = $style; $1098 = ((($1097)) + 3948|0); $1099 = ((($1098)) + 156|0); $button = $1099; $1100 = $button; _nk_zero($1100,128); $1101 = $button; $1102 = $1; $1103 = ((($1102)) + 108|0); ;HEAP8[$$byval_copy66>>0]=HEAP8[$1103>>0]|0;HEAP8[$$byval_copy66+1>>0]=HEAP8[$1103+1>>0]|0;HEAP8[$$byval_copy66+2>>0]=HEAP8[$1103+2>>0]|0;HEAP8[$$byval_copy66+3>>0]=HEAP8[$1103+3>>0]|0; _nk_style_item_color($142,$$byval_copy66); ;HEAP32[$1101>>2]=HEAP32[$142>>2]|0;HEAP32[$1101+4>>2]=HEAP32[$142+4>>2]|0;HEAP32[$1101+8>>2]=HEAP32[$142+8>>2]|0;HEAP32[$1101+12>>2]=HEAP32[$142+12>>2]|0;HEAP32[$1101+16>>2]=HEAP32[$142+16>>2]|0; $1104 = $button; $1105 = ((($1104)) + 20|0); $1106 = $1; $1107 = ((($1106)) + 108|0); ;HEAP8[$$byval_copy67>>0]=HEAP8[$1107>>0]|0;HEAP8[$$byval_copy67+1>>0]=HEAP8[$1107+1>>0]|0;HEAP8[$$byval_copy67+2>>0]=HEAP8[$1107+2>>0]|0;HEAP8[$$byval_copy67+3>>0]=HEAP8[$1107+3>>0]|0; _nk_style_item_color($143,$$byval_copy67); ;HEAP32[$1105>>2]=HEAP32[$143>>2]|0;HEAP32[$1105+4>>2]=HEAP32[$143+4>>2]|0;HEAP32[$1105+8>>2]=HEAP32[$143+8>>2]|0;HEAP32[$1105+12>>2]=HEAP32[$143+12>>2]|0;HEAP32[$1105+16>>2]=HEAP32[$143+16>>2]|0; $1108 = $button; $1109 = ((($1108)) + 40|0); $1110 = $1; $1111 = ((($1110)) + 108|0); ;HEAP8[$$byval_copy68>>0]=HEAP8[$1111>>0]|0;HEAP8[$$byval_copy68+1>>0]=HEAP8[$1111+1>>0]|0;HEAP8[$$byval_copy68+2>>0]=HEAP8[$1111+2>>0]|0;HEAP8[$$byval_copy68+3>>0]=HEAP8[$1111+3>>0]|0; _nk_style_item_color($144,$$byval_copy68); ;HEAP32[$1109>>2]=HEAP32[$144>>2]|0;HEAP32[$1109+4>>2]=HEAP32[$144+4>>2]|0;HEAP32[$1109+8>>2]=HEAP32[$144+8>>2]|0;HEAP32[$1109+12>>2]=HEAP32[$144+12>>2]|0;HEAP32[$1109+16>>2]=HEAP32[$144+16>>2]|0; $1112 = $button; $1113 = ((($1112)) + 60|0); _nk_rgba($145,0,0,0,0); ;HEAP8[$1113>>0]=HEAP8[$145>>0]|0;HEAP8[$1113+1>>0]=HEAP8[$145+1>>0]|0;HEAP8[$1113+2>>0]=HEAP8[$145+2>>0]|0;HEAP8[$1113+3>>0]=HEAP8[$145+3>>0]|0; $1114 = $button; $1115 = ((($1114)) + 64|0); $1116 = $1; $1117 = ((($1116)) + 108|0); ;HEAP8[$1115>>0]=HEAP8[$1117>>0]|0;HEAP8[$1115+1>>0]=HEAP8[$1117+1>>0]|0;HEAP8[$1115+2>>0]=HEAP8[$1117+2>>0]|0;HEAP8[$1115+3>>0]=HEAP8[$1117+3>>0]|0; $1118 = $button; $1119 = ((($1118)) + 68|0); $1120 = $1; ;HEAP8[$1119>>0]=HEAP8[$1120>>0]|0;HEAP8[$1119+1>>0]=HEAP8[$1120+1>>0]|0;HEAP8[$1119+2>>0]=HEAP8[$1120+2>>0]|0;HEAP8[$1119+3>>0]=HEAP8[$1120+3>>0]|0; $1121 = $button; $1122 = ((($1121)) + 72|0); $1123 = $1; ;HEAP8[$1122>>0]=HEAP8[$1123>>0]|0;HEAP8[$1122+1>>0]=HEAP8[$1123+1>>0]|0;HEAP8[$1122+2>>0]=HEAP8[$1123+2>>0]|0;HEAP8[$1122+3>>0]=HEAP8[$1123+3>>0]|0; $1124 = $button; $1125 = ((($1124)) + 76|0); $1126 = $1; ;HEAP8[$1125>>0]=HEAP8[$1126>>0]|0;HEAP8[$1125+1>>0]=HEAP8[$1126+1>>0]|0;HEAP8[$1125+2>>0]=HEAP8[$1126+2>>0]|0;HEAP8[$1125+3>>0]=HEAP8[$1126+3>>0]|0; $1127 = $button; $1128 = ((($1127)) + 92|0); _nk_vec2($146,2.0,2.0); ;HEAP32[$1128>>2]=HEAP32[$146>>2]|0;HEAP32[$1128+4>>2]=HEAP32[$146+4>>2]|0; $1129 = $button; $1130 = ((($1129)) + 108|0); _nk_vec2($147,0.0,0.0); ;HEAP32[$1130>>2]=HEAP32[$147>>2]|0;HEAP32[$1130+4>>2]=HEAP32[$147+4>>2]|0; $1131 = $button; $1132 = ((($1131)) + 116|0); _nk_handle_ptr($148,0); ;HEAP32[$1132>>2]=HEAP32[$148>>2]|0; $1133 = $button; $1134 = ((($1133)) + 80|0); HEAP32[$1134>>2] = 18; $1135 = $button; $1136 = ((($1135)) + 84|0); HEAPF32[$1136>>2] = 0.0; $1137 = $button; $1138 = ((($1137)) + 88|0); HEAPF32[$1138>>2] = 0.0; $1139 = $button; $1140 = ((($1139)) + 120|0); HEAP32[$1140>>2] = 0; $1141 = $button; $1142 = ((($1141)) + 124|0); HEAP32[$1142>>2] = 0; $1143 = $style; $1144 = ((($1143)) + 3948|0); $1145 = ((($1144)) + 28|0); $1146 = $button; dest=$1145; src=$1146; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $1147 = $style; $1148 = ((($1147)) + 3948|0); $1149 = ((($1148)) + 412|0); $button = $1149; $1150 = $button; _nk_zero($1150,128); $1151 = $button; $1152 = $1; $1153 = ((($1152)) + 4|0); ;HEAP8[$$byval_copy69>>0]=HEAP8[$1153>>0]|0;HEAP8[$$byval_copy69+1>>0]=HEAP8[$1153+1>>0]|0;HEAP8[$$byval_copy69+2>>0]=HEAP8[$1153+2>>0]|0;HEAP8[$$byval_copy69+3>>0]=HEAP8[$1153+3>>0]|0; _nk_style_item_color($149,$$byval_copy69); ;HEAP32[$1151>>2]=HEAP32[$149>>2]|0;HEAP32[$1151+4>>2]=HEAP32[$149+4>>2]|0;HEAP32[$1151+8>>2]=HEAP32[$149+8>>2]|0;HEAP32[$1151+12>>2]=HEAP32[$149+12>>2]|0;HEAP32[$1151+16>>2]=HEAP32[$149+16>>2]|0; $1154 = $button; $1155 = ((($1154)) + 20|0); $1156 = $1; $1157 = ((($1156)) + 4|0); ;HEAP8[$$byval_copy70>>0]=HEAP8[$1157>>0]|0;HEAP8[$$byval_copy70+1>>0]=HEAP8[$1157+1>>0]|0;HEAP8[$$byval_copy70+2>>0]=HEAP8[$1157+2>>0]|0;HEAP8[$$byval_copy70+3>>0]=HEAP8[$1157+3>>0]|0; _nk_style_item_color($150,$$byval_copy70); ;HEAP32[$1155>>2]=HEAP32[$150>>2]|0;HEAP32[$1155+4>>2]=HEAP32[$150+4>>2]|0;HEAP32[$1155+8>>2]=HEAP32[$150+8>>2]|0;HEAP32[$1155+12>>2]=HEAP32[$150+12>>2]|0;HEAP32[$1155+16>>2]=HEAP32[$150+16>>2]|0; $1158 = $button; $1159 = ((($1158)) + 40|0); $1160 = $1; $1161 = ((($1160)) + 4|0); ;HEAP8[$$byval_copy71>>0]=HEAP8[$1161>>0]|0;HEAP8[$$byval_copy71+1>>0]=HEAP8[$1161+1>>0]|0;HEAP8[$$byval_copy71+2>>0]=HEAP8[$1161+2>>0]|0;HEAP8[$$byval_copy71+3>>0]=HEAP8[$1161+3>>0]|0; _nk_style_item_color($151,$$byval_copy71); ;HEAP32[$1159>>2]=HEAP32[$151>>2]|0;HEAP32[$1159+4>>2]=HEAP32[$151+4>>2]|0;HEAP32[$1159+8>>2]=HEAP32[$151+8>>2]|0;HEAP32[$1159+12>>2]=HEAP32[$151+12>>2]|0;HEAP32[$1159+16>>2]=HEAP32[$151+16>>2]|0; $1162 = $button; $1163 = ((($1162)) + 60|0); _nk_rgba($152,0,0,0,0); ;HEAP8[$1163>>0]=HEAP8[$152>>0]|0;HEAP8[$1163+1>>0]=HEAP8[$152+1>>0]|0;HEAP8[$1163+2>>0]=HEAP8[$152+2>>0]|0;HEAP8[$1163+3>>0]=HEAP8[$152+3>>0]|0; $1164 = $button; $1165 = ((($1164)) + 64|0); $1166 = $1; $1167 = ((($1166)) + 108|0); ;HEAP8[$1165>>0]=HEAP8[$1167>>0]|0;HEAP8[$1165+1>>0]=HEAP8[$1167+1>>0]|0;HEAP8[$1165+2>>0]=HEAP8[$1167+2>>0]|0;HEAP8[$1165+3>>0]=HEAP8[$1167+3>>0]|0; $1168 = $button; $1169 = ((($1168)) + 68|0); $1170 = $1; ;HEAP8[$1169>>0]=HEAP8[$1170>>0]|0;HEAP8[$1169+1>>0]=HEAP8[$1170+1>>0]|0;HEAP8[$1169+2>>0]=HEAP8[$1170+2>>0]|0;HEAP8[$1169+3>>0]=HEAP8[$1170+3>>0]|0; $1171 = $button; $1172 = ((($1171)) + 72|0); $1173 = $1; ;HEAP8[$1172>>0]=HEAP8[$1173>>0]|0;HEAP8[$1172+1>>0]=HEAP8[$1173+1>>0]|0;HEAP8[$1172+2>>0]=HEAP8[$1173+2>>0]|0;HEAP8[$1172+3>>0]=HEAP8[$1173+3>>0]|0; $1174 = $button; $1175 = ((($1174)) + 76|0); $1176 = $1; ;HEAP8[$1175>>0]=HEAP8[$1176>>0]|0;HEAP8[$1175+1>>0]=HEAP8[$1176+1>>0]|0;HEAP8[$1175+2>>0]=HEAP8[$1176+2>>0]|0;HEAP8[$1175+3>>0]=HEAP8[$1176+3>>0]|0; $1177 = $button; $1178 = ((($1177)) + 92|0); _nk_vec2($153,2.0,2.0); ;HEAP32[$1178>>2]=HEAP32[$153>>2]|0;HEAP32[$1178+4>>2]=HEAP32[$153+4>>2]|0; $1179 = $button; $1180 = ((($1179)) + 108|0); _nk_vec2($154,0.0,0.0); ;HEAP32[$1180>>2]=HEAP32[$154>>2]|0;HEAP32[$1180+4>>2]=HEAP32[$154+4>>2]|0; $1181 = $button; $1182 = ((($1181)) + 116|0); _nk_handle_ptr($155,0); ;HEAP32[$1182>>2]=HEAP32[$155>>2]|0; $1183 = $button; $1184 = ((($1183)) + 80|0); HEAP32[$1184>>2] = 18; $1185 = $button; $1186 = ((($1185)) + 84|0); HEAPF32[$1186>>2] = 0.0; $1187 = $button; $1188 = ((($1187)) + 88|0); HEAPF32[$1188>>2] = 0.0; $1189 = $button; $1190 = ((($1189)) + 120|0); HEAP32[$1190>>2] = 0; $1191 = $button; $1192 = ((($1191)) + 124|0); HEAP32[$1192>>2] = 0; $1193 = $style; $1194 = ((($1193)) + 3948|0); $1195 = ((($1194)) + 284|0); $1196 = $button; dest=$1195; src=$1196; stop=dest+128|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $1197 = $style; $1198 = ((($1197)) + 4784|0); $win = $1198; $1199 = $win; $1200 = ((($1199)) + 340|0); HEAP32[$1200>>2] = 1; $1201 = $win; $1202 = ((($1201)) + 316|0); HEAP32[$1202>>2] = 1; $1203 = $win; $1204 = ((($1203)) + 320|0); HEAP32[$1204>>2] = 12; $1205 = $win; $1206 = ((($1205)) + 324|0); HEAP32[$1206>>2] = 11; $1207 = $win; $1208 = $1; $1209 = ((($1208)) + 8|0); ;HEAP8[$$byval_copy72>>0]=HEAP8[$1209>>0]|0;HEAP8[$$byval_copy72+1>>0]=HEAP8[$1209+1>>0]|0;HEAP8[$$byval_copy72+2>>0]=HEAP8[$1209+2>>0]|0;HEAP8[$$byval_copy72+3>>0]=HEAP8[$1209+3>>0]|0; _nk_style_item_color($156,$$byval_copy72); ;HEAP32[$1207>>2]=HEAP32[$156>>2]|0;HEAP32[$1207+4>>2]=HEAP32[$156+4>>2]|0;HEAP32[$1207+8>>2]=HEAP32[$156+8>>2]|0;HEAP32[$1207+12>>2]=HEAP32[$156+12>>2]|0;HEAP32[$1207+16>>2]=HEAP32[$156+16>>2]|0; $1210 = $win; $1211 = ((($1210)) + 20|0); $1212 = $1; $1213 = ((($1212)) + 8|0); ;HEAP8[$$byval_copy73>>0]=HEAP8[$1213>>0]|0;HEAP8[$$byval_copy73+1>>0]=HEAP8[$1213+1>>0]|0;HEAP8[$$byval_copy73+2>>0]=HEAP8[$1213+2>>0]|0;HEAP8[$$byval_copy73+3>>0]=HEAP8[$1213+3>>0]|0; _nk_style_item_color($157,$$byval_copy73); ;HEAP32[$1211>>2]=HEAP32[$157>>2]|0;HEAP32[$1211+4>>2]=HEAP32[$157+4>>2]|0;HEAP32[$1211+8>>2]=HEAP32[$157+8>>2]|0;HEAP32[$1211+12>>2]=HEAP32[$157+12>>2]|0;HEAP32[$1211+16>>2]=HEAP32[$157+16>>2]|0; $1214 = $win; $1215 = ((($1214)) + 40|0); $1216 = $1; $1217 = ((($1216)) + 8|0); ;HEAP8[$$byval_copy74>>0]=HEAP8[$1217>>0]|0;HEAP8[$$byval_copy74+1>>0]=HEAP8[$1217+1>>0]|0;HEAP8[$$byval_copy74+2>>0]=HEAP8[$1217+2>>0]|0;HEAP8[$$byval_copy74+3>>0]=HEAP8[$1217+3>>0]|0; _nk_style_item_color($158,$$byval_copy74); ;HEAP32[$1215>>2]=HEAP32[$158>>2]|0;HEAP32[$1215+4>>2]=HEAP32[$158+4>>2]|0;HEAP32[$1215+8>>2]=HEAP32[$158+8>>2]|0;HEAP32[$1215+12>>2]=HEAP32[$158+12>>2]|0;HEAP32[$1215+16>>2]=HEAP32[$158+16>>2]|0; $1218 = $win; $1219 = ((($1218)) + 328|0); $1220 = $1; ;HEAP8[$1219>>0]=HEAP8[$1220>>0]|0;HEAP8[$1219+1>>0]=HEAP8[$1220+1>>0]|0;HEAP8[$1219+2>>0]=HEAP8[$1220+2>>0]|0;HEAP8[$1219+3>>0]=HEAP8[$1220+3>>0]|0; $1221 = $win; $1222 = ((($1221)) + 332|0); $1223 = $1; ;HEAP8[$1222>>0]=HEAP8[$1223>>0]|0;HEAP8[$1222+1>>0]=HEAP8[$1223+1>>0]|0;HEAP8[$1222+2>>0]=HEAP8[$1223+2>>0]|0;HEAP8[$1222+3>>0]=HEAP8[$1223+3>>0]|0; $1224 = $win; $1225 = ((($1224)) + 336|0); $1226 = $1; ;HEAP8[$1225>>0]=HEAP8[$1226>>0]|0;HEAP8[$1225+1>>0]=HEAP8[$1226+1>>0]|0;HEAP8[$1225+2>>0]=HEAP8[$1226+2>>0]|0;HEAP8[$1225+3>>0]=HEAP8[$1226+3>>0]|0; $1227 = $win; $1228 = ((($1227)) + 352|0); _nk_vec2($159,4.0,4.0); ;HEAP32[$1228>>2]=HEAP32[$159>>2]|0;HEAP32[$1228+4>>2]=HEAP32[$159+4>>2]|0; $1229 = $win; $1230 = ((($1229)) + 344|0); _nk_vec2($160,4.0,4.0); ;HEAP32[$1230>>2]=HEAP32[$160>>2]|0;HEAP32[$1230+4>>2]=HEAP32[$160+4>>2]|0; $1231 = $win; $1232 = ((($1231)) + 360|0); _nk_vec2($161,0.0,0.0); ;HEAP32[$1232>>2]=HEAP32[$161>>2]|0;HEAP32[$1232+4>>2]=HEAP32[$161+4>>2]|0; $1233 = $style; $1234 = ((($1233)) + 4784|0); $1235 = ((($1234)) + 60|0); $button = $1235; $1236 = $button; _nk_zero($1236,128); $1237 = $button; $1238 = $1; $1239 = ((($1238)) + 8|0); ;HEAP8[$$byval_copy75>>0]=HEAP8[$1239>>0]|0;HEAP8[$$byval_copy75+1>>0]=HEAP8[$1239+1>>0]|0;HEAP8[$$byval_copy75+2>>0]=HEAP8[$1239+2>>0]|0;HEAP8[$$byval_copy75+3>>0]=HEAP8[$1239+3>>0]|0; _nk_style_item_color($162,$$byval_copy75); ;HEAP32[$1237>>2]=HEAP32[$162>>2]|0;HEAP32[$1237+4>>2]=HEAP32[$162+4>>2]|0;HEAP32[$1237+8>>2]=HEAP32[$162+8>>2]|0;HEAP32[$1237+12>>2]=HEAP32[$162+12>>2]|0;HEAP32[$1237+16>>2]=HEAP32[$162+16>>2]|0; $1240 = $button; $1241 = ((($1240)) + 20|0); $1242 = $1; $1243 = ((($1242)) + 8|0); ;HEAP8[$$byval_copy76>>0]=HEAP8[$1243>>0]|0;HEAP8[$$byval_copy76+1>>0]=HEAP8[$1243+1>>0]|0;HEAP8[$$byval_copy76+2>>0]=HEAP8[$1243+2>>0]|0;HEAP8[$$byval_copy76+3>>0]=HEAP8[$1243+3>>0]|0; _nk_style_item_color($163,$$byval_copy76); ;HEAP32[$1241>>2]=HEAP32[$163>>2]|0;HEAP32[$1241+4>>2]=HEAP32[$163+4>>2]|0;HEAP32[$1241+8>>2]=HEAP32[$163+8>>2]|0;HEAP32[$1241+12>>2]=HEAP32[$163+12>>2]|0;HEAP32[$1241+16>>2]=HEAP32[$163+16>>2]|0; $1244 = $button; $1245 = ((($1244)) + 40|0); $1246 = $1; $1247 = ((($1246)) + 8|0); ;HEAP8[$$byval_copy77>>0]=HEAP8[$1247>>0]|0;HEAP8[$$byval_copy77+1>>0]=HEAP8[$1247+1>>0]|0;HEAP8[$$byval_copy77+2>>0]=HEAP8[$1247+2>>0]|0;HEAP8[$$byval_copy77+3>>0]=HEAP8[$1247+3>>0]|0; _nk_style_item_color($164,$$byval_copy77); ;HEAP32[$1245>>2]=HEAP32[$164>>2]|0;HEAP32[$1245+4>>2]=HEAP32[$164+4>>2]|0;HEAP32[$1245+8>>2]=HEAP32[$164+8>>2]|0;HEAP32[$1245+12>>2]=HEAP32[$164+12>>2]|0;HEAP32[$1245+16>>2]=HEAP32[$164+16>>2]|0; $1248 = $button; $1249 = ((($1248)) + 60|0); _nk_rgba($165,0,0,0,0); ;HEAP8[$1249>>0]=HEAP8[$165>>0]|0;HEAP8[$1249+1>>0]=HEAP8[$165+1>>0]|0;HEAP8[$1249+2>>0]=HEAP8[$165+2>>0]|0;HEAP8[$1249+3>>0]=HEAP8[$165+3>>0]|0; $1250 = $button; $1251 = ((($1250)) + 64|0); $1252 = $1; $1253 = ((($1252)) + 8|0); ;HEAP8[$1251>>0]=HEAP8[$1253>>0]|0;HEAP8[$1251+1>>0]=HEAP8[$1253+1>>0]|0;HEAP8[$1251+2>>0]=HEAP8[$1253+2>>0]|0;HEAP8[$1251+3>>0]=HEAP8[$1253+3>>0]|0; $1254 = $button; $1255 = ((($1254)) + 68|0); $1256 = $1; ;HEAP8[$1255>>0]=HEAP8[$1256>>0]|0;HEAP8[$1255+1>>0]=HEAP8[$1256+1>>0]|0;HEAP8[$1255+2>>0]=HEAP8[$1256+2>>0]|0;HEAP8[$1255+3>>0]=HEAP8[$1256+3>>0]|0; $1257 = $button; $1258 = ((($1257)) + 72|0); $1259 = $1; ;HEAP8[$1258>>0]=HEAP8[$1259>>0]|0;HEAP8[$1258+1>>0]=HEAP8[$1259+1>>0]|0;HEAP8[$1258+2>>0]=HEAP8[$1259+2>>0]|0;HEAP8[$1258+3>>0]=HEAP8[$1259+3>>0]|0; $1260 = $button; $1261 = ((($1260)) + 76|0); $1262 = $1; ;HEAP8[$1261>>0]=HEAP8[$1262>>0]|0;HEAP8[$1261+1>>0]=HEAP8[$1262+1>>0]|0;HEAP8[$1261+2>>0]=HEAP8[$1262+2>>0]|0;HEAP8[$1261+3>>0]=HEAP8[$1262+3>>0]|0; $1263 = $button; $1264 = ((($1263)) + 92|0); _nk_vec2($166,0.0,0.0); ;HEAP32[$1264>>2]=HEAP32[$166>>2]|0;HEAP32[$1264+4>>2]=HEAP32[$166+4>>2]|0; $1265 = $button; $1266 = ((($1265)) + 108|0); _nk_vec2($167,0.0,0.0); ;HEAP32[$1266>>2]=HEAP32[$167>>2]|0;HEAP32[$1266+4>>2]=HEAP32[$167+4>>2]|0; $1267 = $button; $1268 = ((($1267)) + 116|0); _nk_handle_ptr($168,0); ;HEAP32[$1268>>2]=HEAP32[$168>>2]|0; $1269 = $button; $1270 = ((($1269)) + 80|0); HEAP32[$1270>>2] = 18; $1271 = $button; $1272 = ((($1271)) + 84|0); HEAPF32[$1272>>2] = 0.0; $1273 = $button; $1274 = ((($1273)) + 88|0); HEAPF32[$1274>>2] = 0.0; $1275 = $button; $1276 = ((($1275)) + 120|0); HEAP32[$1276>>2] = 0; $1277 = $button; $1278 = ((($1277)) + 124|0); HEAP32[$1278>>2] = 0; $1279 = $style; $1280 = ((($1279)) + 4784|0); $1281 = ((($1280)) + 188|0); $button = $1281; $1282 = $button; _nk_zero($1282,128); $1283 = $button; $1284 = $1; $1285 = ((($1284)) + 8|0); ;HEAP8[$$byval_copy78>>0]=HEAP8[$1285>>0]|0;HEAP8[$$byval_copy78+1>>0]=HEAP8[$1285+1>>0]|0;HEAP8[$$byval_copy78+2>>0]=HEAP8[$1285+2>>0]|0;HEAP8[$$byval_copy78+3>>0]=HEAP8[$1285+3>>0]|0; _nk_style_item_color($169,$$byval_copy78); ;HEAP32[$1283>>2]=HEAP32[$169>>2]|0;HEAP32[$1283+4>>2]=HEAP32[$169+4>>2]|0;HEAP32[$1283+8>>2]=HEAP32[$169+8>>2]|0;HEAP32[$1283+12>>2]=HEAP32[$169+12>>2]|0;HEAP32[$1283+16>>2]=HEAP32[$169+16>>2]|0; $1286 = $button; $1287 = ((($1286)) + 20|0); $1288 = $1; $1289 = ((($1288)) + 8|0); ;HEAP8[$$byval_copy79>>0]=HEAP8[$1289>>0]|0;HEAP8[$$byval_copy79+1>>0]=HEAP8[$1289+1>>0]|0;HEAP8[$$byval_copy79+2>>0]=HEAP8[$1289+2>>0]|0;HEAP8[$$byval_copy79+3>>0]=HEAP8[$1289+3>>0]|0; _nk_style_item_color($170,$$byval_copy79); ;HEAP32[$1287>>2]=HEAP32[$170>>2]|0;HEAP32[$1287+4>>2]=HEAP32[$170+4>>2]|0;HEAP32[$1287+8>>2]=HEAP32[$170+8>>2]|0;HEAP32[$1287+12>>2]=HEAP32[$170+12>>2]|0;HEAP32[$1287+16>>2]=HEAP32[$170+16>>2]|0; $1290 = $button; $1291 = ((($1290)) + 40|0); $1292 = $1; $1293 = ((($1292)) + 8|0); ;HEAP8[$$byval_copy80>>0]=HEAP8[$1293>>0]|0;HEAP8[$$byval_copy80+1>>0]=HEAP8[$1293+1>>0]|0;HEAP8[$$byval_copy80+2>>0]=HEAP8[$1293+2>>0]|0;HEAP8[$$byval_copy80+3>>0]=HEAP8[$1293+3>>0]|0; _nk_style_item_color($171,$$byval_copy80); ;HEAP32[$1291>>2]=HEAP32[$171>>2]|0;HEAP32[$1291+4>>2]=HEAP32[$171+4>>2]|0;HEAP32[$1291+8>>2]=HEAP32[$171+8>>2]|0;HEAP32[$1291+12>>2]=HEAP32[$171+12>>2]|0;HEAP32[$1291+16>>2]=HEAP32[$171+16>>2]|0; $1294 = $button; $1295 = ((($1294)) + 60|0); _nk_rgba($172,0,0,0,0); ;HEAP8[$1295>>0]=HEAP8[$172>>0]|0;HEAP8[$1295+1>>0]=HEAP8[$172+1>>0]|0;HEAP8[$1295+2>>0]=HEAP8[$172+2>>0]|0;HEAP8[$1295+3>>0]=HEAP8[$172+3>>0]|0; $1296 = $button; $1297 = ((($1296)) + 64|0); $1298 = $1; $1299 = ((($1298)) + 8|0); ;HEAP8[$1297>>0]=HEAP8[$1299>>0]|0;HEAP8[$1297+1>>0]=HEAP8[$1299+1>>0]|0;HEAP8[$1297+2>>0]=HEAP8[$1299+2>>0]|0;HEAP8[$1297+3>>0]=HEAP8[$1299+3>>0]|0; $1300 = $button; $1301 = ((($1300)) + 68|0); $1302 = $1; ;HEAP8[$1301>>0]=HEAP8[$1302>>0]|0;HEAP8[$1301+1>>0]=HEAP8[$1302+1>>0]|0;HEAP8[$1301+2>>0]=HEAP8[$1302+2>>0]|0;HEAP8[$1301+3>>0]=HEAP8[$1302+3>>0]|0; $1303 = $button; $1304 = ((($1303)) + 72|0); $1305 = $1; ;HEAP8[$1304>>0]=HEAP8[$1305>>0]|0;HEAP8[$1304+1>>0]=HEAP8[$1305+1>>0]|0;HEAP8[$1304+2>>0]=HEAP8[$1305+2>>0]|0;HEAP8[$1304+3>>0]=HEAP8[$1305+3>>0]|0; $1306 = $button; $1307 = ((($1306)) + 76|0); $1308 = $1; ;HEAP8[$1307>>0]=HEAP8[$1308>>0]|0;HEAP8[$1307+1>>0]=HEAP8[$1308+1>>0]|0;HEAP8[$1307+2>>0]=HEAP8[$1308+2>>0]|0;HEAP8[$1307+3>>0]=HEAP8[$1308+3>>0]|0; $1309 = $button; $1310 = ((($1309)) + 92|0); _nk_vec2($173,0.0,0.0); ;HEAP32[$1310>>2]=HEAP32[$173>>2]|0;HEAP32[$1310+4>>2]=HEAP32[$173+4>>2]|0; $1311 = $button; $1312 = ((($1311)) + 108|0); _nk_vec2($174,0.0,0.0); ;HEAP32[$1312>>2]=HEAP32[$174>>2]|0;HEAP32[$1312+4>>2]=HEAP32[$174+4>>2]|0; $1313 = $button; $1314 = ((($1313)) + 116|0); _nk_handle_ptr($175,0); ;HEAP32[$1314>>2]=HEAP32[$175>>2]|0; $1315 = $button; $1316 = ((($1315)) + 80|0); HEAP32[$1316>>2] = 18; $1317 = $button; $1318 = ((($1317)) + 84|0); HEAPF32[$1318>>2] = 0.0; $1319 = $button; $1320 = ((($1319)) + 88|0); HEAPF32[$1320>>2] = 0.0; $1321 = $button; $1322 = ((($1321)) + 120|0); HEAP32[$1322>>2] = 0; $1323 = $button; $1324 = ((($1323)) + 124|0); HEAP32[$1324>>2] = 0; $1325 = $win; $1326 = ((($1325)) + 388|0); $1327 = $1; $1328 = ((($1327)) + 4|0); ;HEAP8[$1326>>0]=HEAP8[$1328>>0]|0;HEAP8[$1326+1>>0]=HEAP8[$1328+1>>0]|0;HEAP8[$1326+2>>0]=HEAP8[$1328+2>>0]|0;HEAP8[$1326+3>>0]=HEAP8[$1328+3>>0]|0; $1329 = $win; $1330 = ((($1329)) + 368|0); $1331 = $1; $1332 = ((($1331)) + 4|0); ;HEAP8[$$byval_copy81>>0]=HEAP8[$1332>>0]|0;HEAP8[$$byval_copy81+1>>0]=HEAP8[$1332+1>>0]|0;HEAP8[$$byval_copy81+2>>0]=HEAP8[$1332+2>>0]|0;HEAP8[$$byval_copy81+3>>0]=HEAP8[$1332+3>>0]|0; _nk_style_item_color($176,$$byval_copy81); ;HEAP32[$1330>>2]=HEAP32[$176>>2]|0;HEAP32[$1330+4>>2]=HEAP32[$176+4>>2]|0;HEAP32[$1330+8>>2]=HEAP32[$176+8>>2]|0;HEAP32[$1330+12>>2]=HEAP32[$176+12>>2]|0;HEAP32[$1330+16>>2]=HEAP32[$176+16>>2]|0; $1333 = $win; $1334 = ((($1333)) + 392|0); $1335 = $1; $1336 = ((($1335)) + 12|0); ;HEAP8[$1334>>0]=HEAP8[$1336>>0]|0;HEAP8[$1334+1>>0]=HEAP8[$1336+1>>0]|0;HEAP8[$1334+2>>0]=HEAP8[$1336+2>>0]|0;HEAP8[$1334+3>>0]=HEAP8[$1336+3>>0]|0; $1337 = $win; $1338 = ((($1337)) + 396|0); $1339 = $1; $1340 = ((($1339)) + 12|0); ;HEAP8[$1338>>0]=HEAP8[$1340>>0]|0;HEAP8[$1338+1>>0]=HEAP8[$1340+1>>0]|0;HEAP8[$1338+2>>0]=HEAP8[$1340+2>>0]|0;HEAP8[$1338+3>>0]=HEAP8[$1340+3>>0]|0; $1341 = $win; $1342 = ((($1341)) + 400|0); $1343 = $1; $1344 = ((($1343)) + 12|0); ;HEAP8[$1342>>0]=HEAP8[$1344>>0]|0;HEAP8[$1342+1>>0]=HEAP8[$1344+1>>0]|0;HEAP8[$1342+2>>0]=HEAP8[$1344+2>>0]|0;HEAP8[$1342+3>>0]=HEAP8[$1344+3>>0]|0; $1345 = $win; $1346 = ((($1345)) + 404|0); $1347 = $1; $1348 = ((($1347)) + 12|0); ;HEAP8[$1346>>0]=HEAP8[$1348>>0]|0;HEAP8[$1346+1>>0]=HEAP8[$1348+1>>0]|0;HEAP8[$1346+2>>0]=HEAP8[$1348+2>>0]|0;HEAP8[$1346+3>>0]=HEAP8[$1348+3>>0]|0; $1349 = $win; $1350 = ((($1349)) + 408|0); $1351 = $1; $1352 = ((($1351)) + 12|0); ;HEAP8[$1350>>0]=HEAP8[$1352>>0]|0;HEAP8[$1350+1>>0]=HEAP8[$1352+1>>0]|0;HEAP8[$1350+2>>0]=HEAP8[$1352+2>>0]|0;HEAP8[$1350+3>>0]=HEAP8[$1352+3>>0]|0; $1353 = $win; $1354 = ((($1353)) + 412|0); $1355 = $1; $1356 = ((($1355)) + 12|0); ;HEAP8[$1354>>0]=HEAP8[$1356>>0]|0;HEAP8[$1354+1>>0]=HEAP8[$1356+1>>0]|0;HEAP8[$1354+2>>0]=HEAP8[$1356+2>>0]|0;HEAP8[$1354+3>>0]=HEAP8[$1356+3>>0]|0; $1357 = $win; $1358 = ((($1357)) + 416|0); $1359 = $1; ;HEAP8[$$byval_copy82>>0]=HEAP8[$1359>>0]|0;HEAP8[$$byval_copy82+1>>0]=HEAP8[$1359+1>>0]|0;HEAP8[$$byval_copy82+2>>0]=HEAP8[$1359+2>>0]|0;HEAP8[$$byval_copy82+3>>0]=HEAP8[$1359+3>>0]|0; _nk_style_item_color($177,$$byval_copy82); ;HEAP32[$1358>>2]=HEAP32[$177>>2]|0;HEAP32[$1358+4>>2]=HEAP32[$177+4>>2]|0;HEAP32[$1358+8>>2]=HEAP32[$177+8>>2]|0;HEAP32[$1358+12>>2]=HEAP32[$177+12>>2]|0;HEAP32[$1358+16>>2]=HEAP32[$177+16>>2]|0; $1360 = $win; $1361 = ((($1360)) + 436|0); _nk_vec2($178,4.0,4.0); ;HEAP32[$1361>>2]=HEAP32[$178>>2]|0;HEAP32[$1361+4>>2]=HEAP32[$178+4>>2]|0; $1362 = $win; $1363 = ((($1362)) + 468|0); HEAPF32[$1363>>2] = 0.0; $1364 = $win; $1365 = ((($1364)) + 472|0); _nk_vec2($179,16.0,16.0); ;HEAP32[$1365>>2]=HEAP32[$179>>2]|0;HEAP32[$1365+4>>2]=HEAP32[$179+4>>2]|0; $1366 = $win; $1367 = ((($1366)) + 480|0); _nk_vec2($180,8.0,8.0); ;HEAP32[$1367>>2]=HEAP32[$180>>2]|0;HEAP32[$1367+4>>2]=HEAP32[$180+4>>2]|0; $1368 = $win; $1369 = ((($1368)) + 488|0); _nk_vec2($181,4.0,4.0); ;HEAP32[$1369>>2]=HEAP32[$181>>2]|0;HEAP32[$1369+4>>2]=HEAP32[$181+4>>2]|0; $1370 = $win; $1371 = ((($1370)) + 496|0); _nk_vec2($182,10.0,10.0); ;HEAP32[$1371>>2]=HEAP32[$182>>2]|0;HEAP32[$1371+4>>2]=HEAP32[$182+4>>2]|0; $1372 = $win; $1373 = ((($1372)) + 504|0); _nk_vec2($183,64.0,64.0); ;HEAP32[$1373>>2]=HEAP32[$183>>2]|0;HEAP32[$1373+4>>2]=HEAP32[$183+4>>2]|0; $1374 = $win; $1375 = ((($1374)) + 448|0); HEAPF32[$1375>>2] = 1.0; $1376 = $win; $1377 = ((($1376)) + 452|0); HEAPF32[$1377>>2] = 1.0; $1378 = $win; $1379 = ((($1378)) + 456|0); HEAPF32[$1379>>2] = 1.0; $1380 = $win; $1381 = ((($1380)) + 460|0); HEAPF32[$1381>>2] = 1.0; $1382 = $win; $1383 = ((($1382)) + 464|0); HEAPF32[$1383>>2] = 1.0; $1384 = $win; $1385 = ((($1384)) + 444|0); HEAPF32[$1385>>2] = 2.0; STACKTOP = sp;return; } function _nk_style_item_color($agg$result,$col) { $agg$result = $agg$result|0; $col = $col|0; var $0 = 0, $i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $i = sp; HEAP32[$i>>2] = 0; $0 = ((($i)) + 4|0); ;HEAP8[$0>>0]=HEAP8[$col>>0]|0;HEAP8[$0+1>>0]=HEAP8[$col+1>>0]|0;HEAP8[$0+2>>0]=HEAP8[$col+2>>0]|0;HEAP8[$0+3>>0]=HEAP8[$col+3>>0]|0; ;HEAP32[$agg$result>>2]=HEAP32[$i>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$i+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$i+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$i+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$i+16>>2]|0; STACKTOP = sp;return; } function _nk_style_item_hide($agg$result) { $agg$result = $agg$result|0; var $0 = 0, $1 = 0, $i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $i = sp; $0 = sp + 20|0; HEAP32[$i>>2] = 0; $1 = ((($i)) + 4|0); _nk_rgba($0,0,0,0,0); ;HEAP8[$1>>0]=HEAP8[$0>>0]|0;HEAP8[$1+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$1+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$1+3>>0]=HEAP8[$0+3>>0]|0; ;HEAP32[$agg$result>>2]=HEAP32[$i>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$i+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$i+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$i+12>>2]|0;HEAP32[$agg$result+16>>2]=HEAP32[$i+16>>2]|0; STACKTOP = sp;return; } function _nk_style_set_font($ctx,$font) { $ctx = $ctx|0; $font = $font|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $style = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $font; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14267,(28237|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $0; $7 = ((($6)) + 300|0); $style = $7; $8 = $style; $9 = $1; ;HEAP32[$8>>2]=HEAP32[$9>>2]|0;HEAP32[$8+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$8+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[$8+12>>2]=HEAP32[$9+12>>2]|0;HEAP32[$8+16>>2]=HEAP32[$9+16>>2]|0; STACKTOP = sp;return; } function _nk_init_default($ctx,$font) { $ctx = $ctx|0; $font = $font|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $alloc = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $alloc = sp; $0 = $ctx; $1 = $font; HEAP32[$alloc>>2] = 0; $2 = ((($alloc)) + 4|0); HEAP32[$2>>2] = 7; $3 = ((($alloc)) + 8|0); HEAP32[$3>>2] = 8; $4 = $0; $5 = $1; $6 = (_nk_init($4,$alloc,$5)|0); STACKTOP = sp;return ($6|0); } function _nk_init($ctx,$alloc,$font) { $ctx = $ctx|0; $alloc = $alloc|0; $font = $font|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 16|0; $1 = $ctx; $2 = $alloc; $3 = $font; $4 = $2; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((15055|0),(13400|0),14456,(28255|0)); // unreachable; } $6 = $2; $7 = ($6|0)!=(0|0); if ($7) { $8 = $1; $9 = $3; _nk_setup($8,$9); $10 = $1; $11 = ((($10)) + 5596|0); $12 = $2; _nk_buffer_init($11,$12,4096); $13 = $2; $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = $2; ;HEAP32[$$byval_copy>>2]=HEAP32[$16>>2]|0; $17 = (FUNCTION_TABLE_iiii[$15 & 7]($$byval_copy,0,40)|0); $18 = $1; $19 = ((($18)) + 11152|0); HEAP32[$19>>2] = $17; $20 = $1; $21 = ((($20)) + 11152|0); $22 = HEAP32[$21>>2]|0; $23 = $2; _nk_pool_init($22,$23,16); $0 = 1; $24 = $0; STACKTOP = sp;return ($24|0); } else { $0 = 0; $24 = $0; STACKTOP = sp;return ($24|0); } return (0)|0; } function _nk_setup($ctx,$font) { $ctx = $ctx|0; $font = $font|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $font; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14390,(31189|0)); // unreachable; } $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $0; _nk_zero($6,11184); $7 = $0; _nk_style_default($7); $8 = $1; $9 = ($8|0)!=(0|0); if ($9) { $10 = $0; $11 = ((($10)) + 300|0); $12 = $1; ;HEAP32[$11>>2]=HEAP32[$12>>2]|0;HEAP32[$11+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$11+8>>2]=HEAP32[$12+8>>2]|0;HEAP32[$11+12>>2]=HEAP32[$12+12>>2]|0;HEAP32[$11+16>>2]=HEAP32[$12+16>>2]|0; } $13 = $0; $14 = ((($13)) + 5672|0); _nk_draw_list_init($14); STACKTOP = sp;return; } function _nk_pool_init($pool,$alloc,$capacity) { $pool = $pool|0; $alloc = $alloc|0; $capacity = $capacity|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $pool; $1 = $alloc; $2 = $capacity; $3 = $0; _nk_zero($3,40); $4 = $0; $5 = $1; ;HEAP32[$4>>2]=HEAP32[$5>>2]|0;HEAP32[$4+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$5+8>>2]|0; $6 = $2; $7 = $0; $8 = ((($7)) + 28|0); HEAP32[$8>>2] = $6; $9 = $0; $10 = ((($9)) + 20|0); HEAP32[$10>>2] = 0; $11 = $0; $12 = ((($11)) + 12|0); HEAP32[$12>>2] = 1; STACKTOP = sp;return; } function _nk_free($ctx) { $ctx = $ctx|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $pool = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 8|0; $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),14479,(28263|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 5596|0); _nk_buffer_free($6); $7 = $0; $8 = ((($7)) + 11152|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if ($10) { $11 = $0; $12 = ((($11)) + 11152|0); $13 = HEAP32[$12>>2]|0; $pool = $13; $14 = $pool; _nk_pool_free($14); $15 = $pool; $16 = ((($15)) + 8|0); $17 = HEAP32[$16>>2]|0; $18 = $pool; $19 = $pool; ;HEAP32[$$byval_copy>>2]=HEAP32[$18>>2]|0; FUNCTION_TABLE_vii[$17 & 31]($$byval_copy,$19); } $20 = $0; _nk_zero($20,300); $21 = $0; $22 = ((($21)) + 300|0); _nk_zero($22,5296); $23 = $0; $24 = ((($23)) + 5596|0); _nk_zero($24,60); $25 = $0; $26 = ((($25)) + 11180|0); HEAP32[$26>>2] = 0; $27 = $0; $28 = ((($27)) + 11152|0); HEAP32[$28>>2] = 0; $29 = $0; $30 = ((($29)) + 11148|0); HEAP32[$30>>2] = 0; $31 = $0; $32 = ((($31)) + 11156|0); HEAP32[$32>>2] = 0; $33 = $0; $34 = ((($33)) + 11160|0); HEAP32[$34>>2] = 0; $35 = $0; $36 = ((($35)) + 11164|0); HEAP32[$36>>2] = 0; $37 = $0; $38 = ((($37)) + 11168|0); HEAP32[$38>>2] = 0; $39 = $0; $40 = ((($39)) + 11172|0); HEAP32[$40>>2] = 0; $41 = $0; $42 = ((($41)) + 11176|0); HEAP32[$42>>2] = 0; STACKTOP = sp;return; } function _nk_pool_free($pool) { $pool = $pool|0; var $$byval_copy = 0, $$old = 0, $$old1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $iter = 0, $next = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 12|0; $0 = $pool; $1 = $0; $2 = ((($1)) + 20|0); $3 = HEAP32[$2>>2]|0; $iter = $3; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $0; $7 = ((($6)) + 12|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0); $10 = $iter; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; if (!($or$cond)) { STACKTOP = sp;return; } while(1) { $12 = $iter; $13 = ((($12)) + 4|0); $14 = HEAP32[$13>>2]|0; $next = $14; $15 = $0; $16 = ((($15)) + 8|0); $17 = HEAP32[$16>>2]|0; $18 = $0; $19 = $iter; ;HEAP32[$$byval_copy>>2]=HEAP32[$18>>2]|0; FUNCTION_TABLE_vii[$17 & 31]($$byval_copy,$19); $20 = $next; $iter = $20; $$old = $iter; $$old1 = ($$old|0)!=(0|0); if (!($$old1)) { break; } } STACKTOP = sp;return; } function _nk_clear($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $it = 0, $iter = 0, $n = 0, $next = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),14508,(28271|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 11152|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); $9 = $0; $10 = ((($9)) + 5596|0); if ($8) { _nk_buffer_clear($10); } else { _nk_buffer_reset($10,0); } $11 = $0; $12 = ((($11)) + 11148|0); HEAP32[$12>>2] = 0; $13 = $0; $14 = ((($13)) + 5596|0); $15 = ((($14)) + 52|0); HEAP32[$15>>2] = 0; $16 = $0; $17 = ((($16)) + 5668|0); HEAP32[$17>>2] = 0; $18 = $0; $19 = ((($18)) + 5672|0); _nk_draw_list_clear($19); $20 = $0; $21 = ((($20)) + 11156|0); $22 = HEAP32[$21>>2]|0; $iter = $22; while(1) { $23 = $iter; $24 = ($23|0)!=(0|0); if (!($24)) { break; } $25 = $iter; $26 = ((($25)) + 8|0); $27 = HEAP32[$26>>2]|0; $28 = $27 & 4096; $29 = ($28|0)!=(0); $30 = $iter; if ($29) { $31 = ((($30)) + 264|0); $32 = HEAP32[$31>>2]|0; $iter = $32; continue; } $33 = ((($30)) + 172|0); $34 = HEAP32[$33>>2]|0; $35 = ($34|0)!=(0|0); if ($35) { $36 = $iter; $37 = ((($36)) + 172|0); $38 = HEAP32[$37>>2]|0; $39 = HEAP32[$38>>2]|0; $40 = $0; $41 = ((($40)) + 11180|0); $42 = HEAP32[$41>>2]|0; $43 = ($39|0)!=($42|0); if ($43) { $44 = $0; $45 = $iter; $46 = ((($45)) + 172|0); $47 = HEAP32[$46>>2]|0; _nk_free_window($44,$47); $48 = $iter; $49 = ((($48)) + 172|0); HEAP32[$49>>2] = 0; } } $50 = $iter; $51 = ((($50)) + 256|0); $52 = HEAP32[$51>>2]|0; $it = $52; while(1) { $53 = $it; $54 = ($53|0)!=(0|0); if (!($54)) { break; } $55 = $it; $56 = ((($55)) + 276|0); $57 = HEAP32[$56>>2]|0; $n = $57; $58 = $it; $59 = HEAP32[$58>>2]|0; $60 = $0; $61 = ((($60)) + 11180|0); $62 = HEAP32[$61>>2]|0; $63 = ($59|0)!=($62|0); if ($63) { $64 = $iter; $65 = $it; _nk_remove_table($64,$65); $66 = $it; _nk_zero($66,284); $67 = $0; $68 = $it; _nk_free_table($67,$68); $69 = $it; $70 = $iter; $71 = ((($70)) + 256|0); $72 = HEAP32[$71>>2]|0; $73 = ($69|0)==($72|0); if ($73) { $74 = $n; $75 = $iter; $76 = ((($75)) + 256|0); HEAP32[$76>>2] = $74; } } $77 = $n; $it = $77; } $78 = $iter; $79 = HEAP32[$78>>2]|0; $80 = $0; $81 = ((($80)) + 11180|0); $82 = HEAP32[$81>>2]|0; $83 = ($79|0)!=($82|0); if (!($83)) { $84 = $iter; $85 = ((($84)) + 8|0); $86 = HEAP32[$85>>2]|0; $87 = $86 & 2048; $88 = ($87|0)!=(0); if (!($88)) { $97 = $iter; $98 = ((($97)) + 264|0); $99 = HEAP32[$98>>2]|0; $iter = $99; continue; } } $89 = $iter; $90 = ((($89)) + 264|0); $91 = HEAP32[$90>>2]|0; $next = $91; $92 = $0; $93 = $iter; _nk_remove_window($92,$93); $94 = $0; $95 = $iter; _nk_free_window($94,$95); $96 = $next; $iter = $96; } $100 = $0; $101 = ((($100)) + 11180|0); $102 = HEAP32[$101>>2]|0; $103 = (($102) + 1)|0; HEAP32[$101>>2] = $103; STACKTOP = sp;return; } function _nk_free_window($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $it = 0, $n = 0, $pd = 0, $pe = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $1; $3 = ((($2)) + 256|0); $4 = HEAP32[$3>>2]|0; $it = $4; $5 = $1; $6 = ((($5)) + 172|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); if ($8) { $9 = $0; $10 = $1; $11 = ((($10)) + 172|0); $12 = HEAP32[$11>>2]|0; _nk_free_window($9,$12); $13 = $1; $14 = ((($13)) + 172|0); HEAP32[$14>>2] = 0; } $15 = $1; $16 = ((($15)) + 264|0); HEAP32[$16>>2] = 0; $17 = $1; $18 = ((($17)) + 268|0); HEAP32[$18>>2] = 0; while(1) { $19 = $it; $20 = ($19|0)!=(0|0); if (!($20)) { break; } $21 = $it; $22 = ((($21)) + 276|0); $23 = HEAP32[$22>>2]|0; $n = $23; $24 = $1; $25 = $it; _nk_remove_table($24,$25); $26 = $0; $27 = $it; _nk_free_table($26,$27); $28 = $it; $29 = $1; $30 = ((($29)) + 256|0); $31 = HEAP32[$30>>2]|0; $32 = ($28|0)==($31|0); if ($32) { $33 = $n; $34 = $1; $35 = ((($34)) + 256|0); HEAP32[$35>>2] = $33; } $36 = $n; $it = $36; } $37 = $1; $pd = $37; $38 = $pd; $pe = $38; $39 = $0; $40 = $pe; _nk_free_page_element($39,$40); STACKTOP = sp;return; } function _nk_remove_table($win,$tbl) { $win = $win|0; $tbl = $tbl|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $win; $1 = $tbl; $2 = $0; $3 = ((($2)) + 256|0); $4 = HEAP32[$3>>2]|0; $5 = $1; $6 = ($4|0)==($5|0); if ($6) { $7 = $1; $8 = ((($7)) + 276|0); $9 = HEAP32[$8>>2]|0; $10 = $0; $11 = ((($10)) + 256|0); HEAP32[$11>>2] = $9; } $12 = $1; $13 = ((($12)) + 276|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if ($15) { $16 = $1; $17 = ((($16)) + 280|0); $18 = HEAP32[$17>>2]|0; $19 = $1; $20 = ((($19)) + 276|0); $21 = HEAP32[$20>>2]|0; $22 = ((($21)) + 280|0); HEAP32[$22>>2] = $18; } $23 = $1; $24 = ((($23)) + 280|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0|0); if (!($26)) { $34 = $1; $35 = ((($34)) + 276|0); HEAP32[$35>>2] = 0; $36 = $1; $37 = ((($36)) + 280|0); HEAP32[$37>>2] = 0; STACKTOP = sp;return; } $27 = $1; $28 = ((($27)) + 276|0); $29 = HEAP32[$28>>2]|0; $30 = $1; $31 = ((($30)) + 280|0); $32 = HEAP32[$31>>2]|0; $33 = ((($32)) + 276|0); HEAP32[$33>>2] = $29; $34 = $1; $35 = ((($34)) + 276|0); HEAP32[$35>>2] = 0; $36 = $1; $37 = ((($36)) + 280|0); HEAP32[$37>>2] = 0; STACKTOP = sp;return; } function _nk_free_table($ctx,$tbl) { $ctx = $ctx|0; $tbl = $tbl|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $pd = 0, $pe = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $tbl; $2 = $1; $pd = $2; $3 = $pd; $pe = $3; $4 = $0; $5 = $pe; _nk_free_page_element($4,$5); STACKTOP = sp;return; } function _nk_remove_window($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $1; $3 = $0; $4 = ((($3)) + 11156|0); $5 = HEAP32[$4>>2]|0; $6 = ($2|0)==($5|0); if ($6) { label = 3; } else { $7 = $1; $8 = $0; $9 = ((($8)) + 11160|0); $10 = HEAP32[$9>>2]|0; $11 = ($7|0)==($10|0); if ($11) { label = 3; } else { $48 = $1; $49 = ((($48)) + 264|0); $50 = HEAP32[$49>>2]|0; $51 = ($50|0)!=(0|0); if ($51) { $52 = $1; $53 = ((($52)) + 268|0); $54 = HEAP32[$53>>2]|0; $55 = $1; $56 = ((($55)) + 264|0); $57 = HEAP32[$56>>2]|0; $58 = ((($57)) + 268|0); HEAP32[$58>>2] = $54; } $59 = $1; $60 = ((($59)) + 268|0); $61 = HEAP32[$60>>2]|0; $62 = ($61|0)!=(0|0); if ($62) { $63 = $1; $64 = ((($63)) + 264|0); $65 = HEAP32[$64>>2]|0; $66 = $1; $67 = ((($66)) + 268|0); $68 = HEAP32[$67>>2]|0; $69 = ((($68)) + 264|0); HEAP32[$69>>2] = $65; } } } if ((label|0) == 3) { $12 = $1; $13 = $0; $14 = ((($13)) + 11156|0); $15 = HEAP32[$14>>2]|0; $16 = ($12|0)==($15|0); if ($16) { $17 = $1; $18 = ((($17)) + 264|0); $19 = HEAP32[$18>>2]|0; $20 = $0; $21 = ((($20)) + 11156|0); HEAP32[$21>>2] = $19; $22 = $1; $23 = ((($22)) + 264|0); $24 = HEAP32[$23>>2]|0; $25 = ($24|0)!=(0|0); if ($25) { $26 = $1; $27 = ((($26)) + 264|0); $28 = HEAP32[$27>>2]|0; $29 = ((($28)) + 268|0); HEAP32[$29>>2] = 0; } } $30 = $1; $31 = $0; $32 = ((($31)) + 11160|0); $33 = HEAP32[$32>>2]|0; $34 = ($30|0)==($33|0); if ($34) { $35 = $1; $36 = ((($35)) + 268|0); $37 = HEAP32[$36>>2]|0; $38 = $0; $39 = ((($38)) + 11160|0); HEAP32[$39>>2] = $37; $40 = $1; $41 = ((($40)) + 268|0); $42 = HEAP32[$41>>2]|0; $43 = ($42|0)!=(0|0); if ($43) { $44 = $1; $45 = ((($44)) + 268|0); $46 = HEAP32[$45>>2]|0; $47 = ((($46)) + 264|0); HEAP32[$47>>2] = 0; } } } $70 = $1; $71 = $0; $72 = ((($71)) + 11164|0); $73 = HEAP32[$72>>2]|0; $74 = ($70|0)==($73|0); if ($74) { label = 15; } else { $75 = $0; $76 = ((($75)) + 11164|0); $77 = HEAP32[$76>>2]|0; $78 = ($77|0)!=(0|0); if (!($78)) { label = 15; } } if ((label|0) == 15) { $79 = $0; $80 = ((($79)) + 11160|0); $81 = HEAP32[$80>>2]|0; $82 = $0; $83 = ((($82)) + 11164|0); HEAP32[$83>>2] = $81; $84 = $0; $85 = ((($84)) + 11160|0); $86 = HEAP32[$85>>2]|0; $87 = ($86|0)!=(0|0); if ($87) { $88 = $0; $89 = ((($88)) + 11160|0); $90 = HEAP32[$89>>2]|0; $91 = ((($90)) + 8|0); $92 = HEAP32[$91>>2]|0; $93 = $92 & -1025; HEAP32[$91>>2] = $93; } } $94 = $1; $95 = ((($94)) + 264|0); HEAP32[$95>>2] = 0; $96 = $1; $97 = ((($96)) + 268|0); HEAP32[$97>>2] = 0; $98 = $0; $99 = ((($98)) + 11176|0); $100 = HEAP32[$99>>2]|0; $101 = (($100) + -1)|0; HEAP32[$99>>2] = $101; STACKTOP = sp;return; } function _nk_build($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $7 = 0, $8 = 0, $9 = 0, $buffer = 0, $cmd = 0, $iter = 0, $next = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; $2 = ((($1)) + 11156|0); $3 = HEAP32[$2>>2]|0; $iter = $3; $4 = $0; $5 = ((($4)) + 5596|0); $6 = ((($5)) + 32|0); $7 = HEAP32[$6>>2]|0; $buffer = $7; while(1) { $8 = $iter; $9 = ($8|0)!=(0|0); if (!($9)) { break; } $10 = $iter; $11 = ((($10)) + 264|0); $12 = HEAP32[$11>>2]|0; $next = $12; $13 = $iter; $14 = ((($13)) + 32|0); $15 = ((($14)) + 36|0); $16 = HEAP32[$15>>2]|0; $17 = $iter; $18 = ((($17)) + 32|0); $19 = ((($18)) + 28|0); $20 = HEAP32[$19>>2]|0; $21 = ($16|0)==($20|0); if (!($21)) { $22 = $iter; $23 = ((($22)) + 8|0); $24 = HEAP32[$23>>2]|0; $25 = $24 & 2048; $26 = ($25|0)!=(0); if (!($26)) { $28 = $buffer; $29 = $iter; $30 = ((($29)) + 32|0); $31 = ((($30)) + 36|0); $32 = HEAP32[$31>>2]|0; $33 = (($28) + ($32)|0); $cmd = $33; while(1) { $34 = $next; $35 = ($34|0)!=(0|0); if ($35) { $36 = $next; $37 = ((($36)) + 32|0); $38 = ((($37)) + 36|0); $39 = HEAP32[$38>>2]|0; $40 = $next; $41 = ((($40)) + 32|0); $42 = ((($41)) + 28|0); $43 = HEAP32[$42>>2]|0; $44 = ($39|0)==($43|0); if ($44) { $67 = 1; } else { $45 = $next; $46 = ((($45)) + 8|0); $47 = HEAP32[$46>>2]|0; $48 = $47 & 2048; $49 = ($48|0)!=(0); $67 = $49; } } else { $67 = 0; } $50 = $next; if (!($67)) { break; } $51 = ((($50)) + 264|0); $52 = HEAP32[$51>>2]|0; $next = $52; } $53 = ($50|0)!=(0|0); if ($53) { $54 = $next; $55 = ((($54)) + 32|0); $56 = ((($55)) + 28|0); $57 = HEAP32[$56>>2]|0; $58 = $cmd; $59 = ((($58)) + 4|0); HEAP32[$59>>2] = $57; } else { $60 = $0; $61 = ((($60)) + 5596|0); $62 = ((($61)) + 44|0); $63 = HEAP32[$62>>2]|0; $64 = $cmd; $65 = ((($64)) + 4|0); HEAP32[$65>>2] = $63; } $66 = $next; $iter = $66; continue; } } $27 = $next; $iter = $27; } STACKTOP = sp;return; } function _nk_begin($ctx,$layout,$title,$bounds,$flags) { $ctx = $ctx|0; $layout = $layout|0; $title = $title|0; $bounds = $bounds|0; $flags = $flags|0; var $$byval_copy = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0; var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0; var $150 = 0, $151 = 0.0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0, $164 = 0, $165 = 0, $166 = 0, $167 = 0.0, $168 = 0.0; var $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0, $183 = 0, $184 = 0.0, $185 = 0.0, $186 = 0; var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0.0, $191 = 0, $192 = 0, $193 = 0, $194 = 0.0, $195 = 0.0, $196 = 0, $197 = 0, $198 = 0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0; var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0.0, $213 = 0.0, $214 = 0, $215 = 0, $216 = 0.0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0.0; var $222 = 0, $223 = 0, $224 = 0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0, $230 = 0.0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0; var $240 = 0, $241 = 0.0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0; var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0.0, $267 = 0, $268 = 0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0.0, $274 = 0.0, $275 = 0, $276 = 0; var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0.0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0.0, $287 = 0.0, $288 = 0, $289 = 0, $29 = 0, $290 = 0.0, $291 = 0, $292 = 0, $293 = 0, $294 = 0; var $295 = 0, $296 = 0, $297 = 0.0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0.0, $302 = 0, $303 = 0, $304 = 0, $305 = 0.0, $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0; var $312 = 0, $313 = 0.0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0.0, $321 = 0, $322 = 0, $323 = 0, $324 = 0.0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0; var $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0; var $349 = 0, $35 = 0, $350 = 0.0, $351 = 0, $352 = 0, $353 = 0, $354 = 0.0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0.0, $363 = 0, $364 = 0, $365 = 0, $366 = 0.0; var $367 = 0.0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0.0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0.0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0.0, $384 = 0; var $385 = 0, $386 = 0, $387 = 0.0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0.0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0; var $402 = 0.0, $403 = 0, $404 = 0, $405 = 0.0, $406 = 0, $407 = 0, $408 = 0, $409 = 0.0, $41 = 0, $410 = 0.0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0.0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0; var $420 = 0.0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0.0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0.0, $431 = 0.0, $432 = 0.0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0; var $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0; var $457 = 0.0, $458 = 0, $459 = 0, $46 = 0, $460 = 0.0, $461 = 0, $462 = 0, $463 = 0, $464 = 0.0, $465 = 0.0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0.0, $472 = 0, $473 = 0, $474 = 0; var $475 = 0, $476 = 0, $477 = 0.0, $478 = 0.0, $479 = 0, $48 = 0, $480 = 0, $481 = 0.0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0.0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0.0; var $493 = 0, $494 = 0, $495 = 0, $496 = 0.0, $497 = 0.0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0; var $510 = 0.0, $511 = 0.0, $512 = 0, $513 = 0, $514 = 0, $515 = 0.0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0; var $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0; var $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $57 = 0, $58 = 0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $h = 0.0, $inpanel = 0, $ishovered = 0, $iter = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $ret = 0, $style = 0, $title_hash = 0, $title_len = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 72|0; $$byval_copy = sp + 56|0; $1 = $ctx; $2 = $layout; $3 = $title; $4 = $flags; $ret = 0; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),14983,(28299|0)); // unreachable; } $7 = $1; $8 = ((($7)) + 300|0); $9 = ((($8)) + 8|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((28308|0),(13400|0),14984,(28299|0)); // unreachable; } $12 = $1; $13 = ((($12)) + 11168|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if ($15) { ___assert_fail((28377|0),(13400|0),14985,(28299|0)); // unreachable; } $16 = $1; $17 = ($16|0)!=(0|0); if ($17) { $18 = $1; $19 = ((($18)) + 11168|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)==(0|0); $22 = $3; $23 = ($22|0)!=(0|0); $or$cond = $21 & $23; if ($or$cond) { $24 = $1; $25 = ((($24)) + 300|0); $style = $25; $26 = $3; $27 = (_nk_strlen($26)|0); $title_len = $27; $28 = $3; $29 = $title_len; $30 = (_nk_murmur_hash($28,$29,256)|0); $title_hash = $30; $31 = $1; $32 = $title_hash; $33 = (_nk_find_window($31,$32)|0); $win = $33; $34 = $win; $35 = ($34|0)!=(0|0); do { if ($35) { $65 = $win; $66 = ((($65)) + 8|0); $67 = HEAP32[$66>>2]|0; $68 = $67 & -512; HEAP32[$66>>2] = $68; $69 = $4; $70 = $win; $71 = ((($70)) + 8|0); $72 = HEAP32[$71>>2]|0; $73 = $72 | $69; HEAP32[$71>>2] = $73; $74 = $win; $75 = HEAP32[$74>>2]|0; $76 = (($75) + 1)|0; HEAP32[$74>>2] = $76; $77 = $1; $78 = ((($77)) + 11164|0); $79 = HEAP32[$78>>2]|0; $80 = ($79|0)!=(0|0); if (!($80)) { $81 = $win; $82 = $1; $83 = ((($82)) + 11164|0); HEAP32[$83>>2] = $81; } } else { $36 = $1; $37 = (_nk_create_window($36)|0); $win = $37; $38 = $win; $39 = ($38|0)!=(0|0); if (!($39)) { ___assert_fail((28440|0),(13400|0),14997,(28299|0)); // unreachable; } $40 = $win; $41 = ($40|0)!=(0|0); if ($41) { $42 = $1; $43 = $win; _nk_insert_window($42,$43); $44 = $win; $45 = ((($44)) + 32|0); $46 = $1; $47 = ((($46)) + 5596|0); _nk_command_buffer_init($45,$47,1); $48 = $4; $49 = $win; $50 = ((($49)) + 8|0); HEAP32[$50>>2] = $48; $51 = $win; $52 = ((($51)) + 12|0); ;HEAP32[$52>>2]=HEAP32[$bounds>>2]|0;HEAP32[$52+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$52+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$52+12>>2]=HEAP32[$bounds+12>>2]|0; $53 = $title_hash; $54 = $win; $55 = ((($54)) + 4|0); HEAP32[$55>>2] = $53; $56 = $win; $57 = ((($56)) + 172|0); HEAP32[$57>>2] = 0; $58 = $1; $59 = ((($58)) + 11164|0); $60 = HEAP32[$59>>2]|0; $61 = ($60|0)!=(0|0); if ($61) { break; } $62 = $win; $63 = $1; $64 = ((($63)) + 11164|0); HEAP32[$64>>2] = $62; break; } else { $0 = 0; $561 = $0; STACKTOP = sp;return ($561|0); } } } while(0); $84 = $win; $85 = ((($84)) + 8|0); $86 = HEAP32[$85>>2]|0; $87 = $86 & 2048; $88 = ($87|0)!=(0); $89 = $win; if ($88) { $90 = $1; $91 = ((($90)) + 11168|0); HEAP32[$91>>2] = $89; $0 = 0; $561 = $0; STACKTOP = sp;return ($561|0); } $92 = ((($89)) + 8|0); $93 = HEAP32[$92>>2]|0; $94 = $93 & 8192; $95 = ($94|0)!=(0); if (!($95)) { $96 = $win; $97 = ((($96)) + 8|0); $98 = HEAP32[$97>>2]|0; $99 = $98 & 2048; $100 = ($99|0)!=(0); if (!($100)) { $101 = $win; $iter = $101; $102 = $1; $103 = ((($102)) + 300|0); $104 = ((($103)) + 4|0); $105 = +HEAPF32[$104>>2]; $106 = $style; $107 = ((($106)) + 4784|0); $108 = ((($107)) + 344|0); $109 = ((($108)) + 4|0); $110 = +HEAPF32[$109>>2]; $111 = 2.0 * $110; $112 = $105 + $111; $h = $112; $113 = $1; $114 = $win; _nk_start($113,$114); $115 = $1; $116 = $win; $117 = ((($116)) + 12|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$117>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$117+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$117+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$117+12>>2]|0; $118 = (_nk_input_has_mouse_click_down_in_rect($115,0,$$byval_copy,1)|0); $inpanel = $118; $119 = $inpanel; $120 = ($119|0)!=(0); if ($120) { $121 = $1; $122 = ((($121)) + 220|0); $123 = ((($122)) + 4|0); $124 = HEAP32[$123>>2]|0; $125 = ($124|0)!=(0); $127 = $125; } else { $127 = 0; } $126 = $127&1; $inpanel = $126; $128 = $1; $129 = $win; $130 = ((($129)) + 12|0); ;HEAP32[$$byval_copy6>>2]=HEAP32[$130>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$130+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$130+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$130+12>>2]|0; $131 = (_nk_input_is_mouse_hovering_rect($128,$$byval_copy6)|0); $ishovered = $131; $132 = $win; $133 = $1; $134 = ((($133)) + 11164|0); $135 = HEAP32[$134>>2]|0; $136 = ($132|0)!=($135|0); $137 = $ishovered; $138 = ($137|0)!=(0); $or$cond3 = $136 & $138; L36: do { if ($or$cond3) { $139 = $win; $140 = ((($139)) + 264|0); $141 = HEAP32[$140>>2]|0; $iter = $141; while(1) { $142 = $iter; $143 = ($142|0)!=(0|0); if (!($143)) { break L36; } $144 = $iter; $145 = ((($144)) + 8|0); $146 = HEAP32[$145>>2]|0; $147 = $146 & 4096; $148 = ($147|0)!=(0); $149 = $iter; $150 = ((($149)) + 12|0); $151 = +HEAPF32[$150>>2]; $152 = $win; $153 = ((($152)) + 12|0); $154 = +HEAPF32[$153>>2]; $155 = $win; $156 = ((($155)) + 12|0); $157 = ((($156)) + 8|0); $158 = +HEAPF32[$157>>2]; $159 = $154 + $158; $160 = $151 > $159; do { if ($148) { if (!($160)) { $206 = $iter; $207 = ((($206)) + 12|0); $208 = +HEAPF32[$207>>2]; $209 = $iter; $210 = ((($209)) + 12|0); $211 = ((($210)) + 8|0); $212 = +HEAPF32[$211>>2]; $213 = $208 + $212; $214 = $win; $215 = ((($214)) + 12|0); $216 = +HEAPF32[$215>>2]; $217 = $213 < $216; if (!($217)) { $218 = $iter; $219 = ((($218)) + 12|0); $220 = ((($219)) + 4|0); $221 = +HEAPF32[$220>>2]; $222 = $win; $223 = ((($222)) + 12|0); $224 = ((($223)) + 4|0); $225 = +HEAPF32[$224>>2]; $226 = $win; $227 = ((($226)) + 12|0); $228 = ((($227)) + 12|0); $229 = +HEAPF32[$228>>2]; $230 = $225 + $229; $231 = $221 > $230; if ($231) { break; } $232 = $iter; $233 = ((($232)) + 12|0); $234 = ((($233)) + 4|0); $235 = +HEAPF32[$234>>2]; $236 = $h; $237 = $235 + $236; $238 = $win; $239 = ((($238)) + 12|0); $240 = ((($239)) + 4|0); $241 = +HEAPF32[$240>>2]; $242 = $237 < $241; if ($242) { break; } $243 = $iter; $244 = ((($243)) + 8|0); $245 = HEAP32[$244>>2]|0; $246 = $245 & 2048; $247 = ($246|0)!=(0); if (!($247)) { break L36; } } } } else { if (!($160)) { $161 = $iter; $162 = ((($161)) + 12|0); $163 = +HEAPF32[$162>>2]; $164 = $iter; $165 = ((($164)) + 12|0); $166 = ((($165)) + 8|0); $167 = +HEAPF32[$166>>2]; $168 = $163 + $167; $169 = $win; $170 = ((($169)) + 12|0); $171 = +HEAPF32[$170>>2]; $172 = $168 < $171; if (!($172)) { $173 = $iter; $174 = ((($173)) + 12|0); $175 = ((($174)) + 4|0); $176 = +HEAPF32[$175>>2]; $177 = $win; $178 = ((($177)) + 12|0); $179 = ((($178)) + 4|0); $180 = +HEAPF32[$179>>2]; $181 = $win; $182 = ((($181)) + 12|0); $183 = ((($182)) + 12|0); $184 = +HEAPF32[$183>>2]; $185 = $180 + $184; $186 = $176 > $185; if ($186) { break; } $187 = $iter; $188 = ((($187)) + 12|0); $189 = ((($188)) + 4|0); $190 = +HEAPF32[$189>>2]; $191 = $iter; $192 = ((($191)) + 12|0); $193 = ((($192)) + 12|0); $194 = +HEAPF32[$193>>2]; $195 = $190 + $194; $196 = $win; $197 = ((($196)) + 12|0); $198 = ((($197)) + 4|0); $199 = +HEAPF32[$198>>2]; $200 = $195 < $199; if ($200) { break; } $201 = $iter; $202 = ((($201)) + 8|0); $203 = HEAP32[$202>>2]|0; $204 = $203 & 2048; $205 = ($204|0)!=(0); if (!($205)) { break L36; } } } } } while(0); $248 = $iter; $249 = ((($248)) + 172|0); $250 = HEAP32[$249>>2]|0; $251 = ($250|0)!=(0|0); do { if ($251) { $252 = $iter; $253 = ((($252)) + 172|0); $254 = ((($253)) + 12|0); $255 = HEAP32[$254>>2]|0; $256 = ($255|0)!=(0); if ($256) { $257 = $iter; $258 = ((($257)) + 8|0); $259 = HEAP32[$258>>2]|0; $260 = $259 & 2048; $261 = ($260|0)!=(0); if ($261) { break; } $262 = $iter; $263 = ((($262)) + 172|0); $264 = HEAP32[$263>>2]|0; $265 = ((($264)) + 12|0); $266 = +HEAPF32[$265>>2]; $267 = $win; $268 = ((($267)) + 12|0); $269 = +HEAPF32[$268>>2]; $270 = $win; $271 = ((($270)) + 12|0); $272 = ((($271)) + 8|0); $273 = +HEAPF32[$272>>2]; $274 = $269 + $273; $275 = $266 > $274; if ($275) { break; } $276 = $iter; $277 = ((($276)) + 172|0); $278 = HEAP32[$277>>2]|0; $279 = ((($278)) + 12|0); $280 = +HEAPF32[$279>>2]; $281 = $iter; $282 = ((($281)) + 172|0); $283 = HEAP32[$282>>2]|0; $284 = ((($283)) + 12|0); $285 = ((($284)) + 8|0); $286 = +HEAPF32[$285>>2]; $287 = $280 + $286; $288 = $win; $289 = ((($288)) + 12|0); $290 = +HEAPF32[$289>>2]; $291 = $287 < $290; if ($291) { break; } $292 = $iter; $293 = ((($292)) + 172|0); $294 = HEAP32[$293>>2]|0; $295 = ((($294)) + 12|0); $296 = ((($295)) + 4|0); $297 = +HEAPF32[$296>>2]; $298 = $win; $299 = ((($298)) + 12|0); $300 = ((($299)) + 4|0); $301 = +HEAPF32[$300>>2]; $302 = $win; $303 = ((($302)) + 12|0); $304 = ((($303)) + 12|0); $305 = +HEAPF32[$304>>2]; $306 = $301 + $305; $307 = $297 > $306; if ($307) { break; } $308 = $iter; $309 = ((($308)) + 172|0); $310 = HEAP32[$309>>2]|0; $311 = ((($310)) + 12|0); $312 = ((($311)) + 4|0); $313 = +HEAPF32[$312>>2]; $314 = $iter; $315 = ((($314)) + 172|0); $316 = HEAP32[$315>>2]|0; $317 = ((($316)) + 12|0); $318 = ((($317)) + 12|0); $319 = +HEAPF32[$318>>2]; $320 = $313 + $319; $321 = $win; $322 = ((($321)) + 12|0); $323 = ((($322)) + 4|0); $324 = +HEAPF32[$323>>2]; $325 = $320 < $324; if (!($325)) { break L36; } } } } while(0); $326 = $iter; $327 = ((($326)) + 264|0); $328 = HEAP32[$327>>2]|0; $iter = $328; } } } while(0); $329 = $iter; $330 = ($329|0)!=(0|0); $331 = $inpanel; $332 = ($331|0)!=(0); $or$cond5 = $330 & $332; L62: do { if ($or$cond5) { $333 = $win; $334 = $1; $335 = ((($334)) + 11160|0); $336 = HEAP32[$335>>2]|0; $337 = ($333|0)!=($336|0); if ($337) { $338 = $win; $339 = ((($338)) + 264|0); $340 = HEAP32[$339>>2]|0; $iter = $340; while(1) { $341 = $iter; $342 = ($341|0)!=(0|0); if (!($342)) { break L62; } $343 = $iter; $344 = ((($343)) + 8|0); $345 = HEAP32[$344>>2]|0; $346 = $345 & 4096; $347 = ($346|0)!=(0); $348 = $iter; $349 = ((($348)) + 12|0); $350 = +HEAPF32[$349>>2]; $351 = $1; $352 = ((($351)) + 220|0); $353 = ((($352)) + 48|0); $354 = +HEAPF32[$353>>2]; $355 = $350 <= $354; do { if ($347) { if (!($355)) { break; } $399 = $1; $400 = ((($399)) + 220|0); $401 = ((($400)) + 48|0); $402 = +HEAPF32[$401>>2]; $403 = $iter; $404 = ((($403)) + 12|0); $405 = +HEAPF32[$404>>2]; $406 = $iter; $407 = ((($406)) + 12|0); $408 = ((($407)) + 8|0); $409 = +HEAPF32[$408>>2]; $410 = $405 + $409; $411 = $402 <= $410; if (!($411)) { break; } $412 = $iter; $413 = ((($412)) + 12|0); $414 = ((($413)) + 4|0); $415 = +HEAPF32[$414>>2]; $416 = $1; $417 = ((($416)) + 220|0); $418 = ((($417)) + 48|0); $419 = ((($418)) + 4|0); $420 = +HEAPF32[$419>>2]; $421 = $415 <= $420; if (!($421)) { break; } $422 = $1; $423 = ((($422)) + 220|0); $424 = ((($423)) + 48|0); $425 = ((($424)) + 4|0); $426 = +HEAPF32[$425>>2]; $427 = $iter; $428 = ((($427)) + 12|0); $429 = ((($428)) + 4|0); $430 = +HEAPF32[$429>>2]; $431 = $h; $432 = $430 + $431; $433 = $426 <= $432; if (!($433)) { break; } $434 = $iter; $435 = ((($434)) + 8|0); $436 = HEAP32[$435>>2]|0; $437 = $436 & 2048; $438 = ($437|0)!=(0); if (!($438)) { break L62; } } else { if (!($355)) { break; } $356 = $1; $357 = ((($356)) + 220|0); $358 = ((($357)) + 48|0); $359 = +HEAPF32[$358>>2]; $360 = $iter; $361 = ((($360)) + 12|0); $362 = +HEAPF32[$361>>2]; $363 = $iter; $364 = ((($363)) + 12|0); $365 = ((($364)) + 8|0); $366 = +HEAPF32[$365>>2]; $367 = $362 + $366; $368 = $359 <= $367; if (!($368)) { break; } $369 = $iter; $370 = ((($369)) + 12|0); $371 = ((($370)) + 4|0); $372 = +HEAPF32[$371>>2]; $373 = $1; $374 = ((($373)) + 220|0); $375 = ((($374)) + 48|0); $376 = ((($375)) + 4|0); $377 = +HEAPF32[$376>>2]; $378 = $372 <= $377; if (!($378)) { break; } $379 = $1; $380 = ((($379)) + 220|0); $381 = ((($380)) + 48|0); $382 = ((($381)) + 4|0); $383 = +HEAPF32[$382>>2]; $384 = $iter; $385 = ((($384)) + 12|0); $386 = ((($385)) + 4|0); $387 = +HEAPF32[$386>>2]; $388 = $iter; $389 = ((($388)) + 12|0); $390 = ((($389)) + 12|0); $391 = +HEAPF32[$390>>2]; $392 = $387 + $391; $393 = $383 <= $392; if (!($393)) { break; } $394 = $iter; $395 = ((($394)) + 8|0); $396 = HEAP32[$395>>2]|0; $397 = $396 & 2048; $398 = ($397|0)!=(0); if (!($398)) { break L62; } } } while(0); $439 = $iter; $440 = ((($439)) + 172|0); $441 = HEAP32[$440>>2]|0; $442 = ($441|0)!=(0|0); do { if ($442) { $443 = $iter; $444 = ((($443)) + 172|0); $445 = ((($444)) + 12|0); $446 = HEAP32[$445>>2]|0; $447 = ($446|0)!=(0); if (!($447)) { break; } $448 = $iter; $449 = ((($448)) + 8|0); $450 = HEAP32[$449>>2]|0; $451 = $450 & 2048; $452 = ($451|0)!=(0); if ($452) { break; } $453 = $iter; $454 = ((($453)) + 172|0); $455 = HEAP32[$454>>2]|0; $456 = ((($455)) + 12|0); $457 = +HEAPF32[$456>>2]; $458 = $win; $459 = ((($458)) + 12|0); $460 = +HEAPF32[$459>>2]; $461 = $win; $462 = ((($461)) + 12|0); $463 = ((($462)) + 8|0); $464 = +HEAPF32[$463>>2]; $465 = $460 + $464; $466 = $457 > $465; if ($466) { break; } $467 = $iter; $468 = ((($467)) + 172|0); $469 = HEAP32[$468>>2]|0; $470 = ((($469)) + 12|0); $471 = +HEAPF32[$470>>2]; $472 = $iter; $473 = ((($472)) + 172|0); $474 = HEAP32[$473>>2]|0; $475 = ((($474)) + 12|0); $476 = ((($475)) + 8|0); $477 = +HEAPF32[$476>>2]; $478 = $471 + $477; $479 = $win; $480 = ((($479)) + 12|0); $481 = +HEAPF32[$480>>2]; $482 = $478 < $481; if ($482) { break; } $483 = $iter; $484 = ((($483)) + 172|0); $485 = HEAP32[$484>>2]|0; $486 = ((($485)) + 12|0); $487 = ((($486)) + 4|0); $488 = +HEAPF32[$487>>2]; $489 = $win; $490 = ((($489)) + 12|0); $491 = ((($490)) + 4|0); $492 = +HEAPF32[$491>>2]; $493 = $win; $494 = ((($493)) + 12|0); $495 = ((($494)) + 12|0); $496 = +HEAPF32[$495>>2]; $497 = $492 + $496; $498 = $488 > $497; if ($498) { break; } $499 = $iter; $500 = ((($499)) + 172|0); $501 = HEAP32[$500>>2]|0; $502 = ((($501)) + 12|0); $503 = ((($502)) + 4|0); $504 = +HEAPF32[$503>>2]; $505 = $iter; $506 = ((($505)) + 172|0); $507 = HEAP32[$506>>2]|0; $508 = ((($507)) + 12|0); $509 = ((($508)) + 12|0); $510 = +HEAPF32[$509>>2]; $511 = $504 + $510; $512 = $win; $513 = ((($512)) + 12|0); $514 = ((($513)) + 4|0); $515 = +HEAPF32[$514>>2]; $516 = $511 < $515; if (!($516)) { break L62; } } } while(0); $517 = $iter; $518 = ((($517)) + 264|0); $519 = HEAP32[$518>>2]|0; $iter = $519; } } } } while(0); $520 = $iter; $521 = ($520|0)!=(0|0); if (!($521)) { $522 = $1; $523 = ((($522)) + 11160|0); $524 = HEAP32[$523>>2]|0; $525 = $win; $526 = ($524|0)!=($525|0); if ($526) { $527 = $1; $528 = $win; _nk_remove_window($527,$528); $529 = $1; $530 = $win; _nk_insert_window($529,$530); $531 = $win; $532 = ((($531)) + 8|0); $533 = HEAP32[$532>>2]|0; $534 = $533 & -1025; HEAP32[$532>>2] = $534; $535 = $win; $536 = $1; $537 = ((($536)) + 11164|0); HEAP32[$537>>2] = $535; } } $538 = $1; $539 = ((($538)) + 11160|0); $540 = HEAP32[$539>>2]|0; $541 = $win; $542 = ($540|0)!=($541|0); if ($542) { $543 = $win; $544 = ((($543)) + 8|0); $545 = HEAP32[$544>>2]|0; $546 = $545 | 1024; HEAP32[$544>>2] = $546; } } } $547 = $2; $548 = $win; $549 = ((($548)) + 72|0); HEAP32[$549>>2] = $547; $550 = $win; $551 = $1; $552 = ((($551)) + 11168|0); HEAP32[$552>>2] = $550; $553 = $1; $554 = $3; $555 = (_nk_panel_begin($553,$554)|0); $ret = $555; $556 = $win; $557 = ((($556)) + 28|0); $558 = $2; $559 = ((($558)) + 20|0); HEAP32[$559>>2] = $557; $560 = $ret; $0 = $560; $561 = $0; STACKTOP = sp;return ($561|0); } } $0 = 0; $561 = $0; STACKTOP = sp;return ($561|0); } function _nk_find_window($ctx,$hash) { $ctx = $ctx|0; $hash = $hash|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $iter = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $ctx; $2 = $hash; $3 = $1; $4 = ((($3)) + 11156|0); $5 = HEAP32[$4>>2]|0; $iter = $5; while(1) { $6 = $iter; $7 = ($6|0)!=(0|0); if (!($7)) { label = 8; break; } $8 = $iter; $9 = $iter; $10 = ((($9)) + 264|0); $11 = HEAP32[$10>>2]|0; $12 = ($8|0)!=($11|0); if (!($12)) { label = 4; break; } $13 = $iter; $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = $2; $17 = ($15|0)==($16|0); $18 = $iter; if ($17) { label = 6; break; } $19 = ((($18)) + 264|0); $20 = HEAP32[$19>>2]|0; $iter = $20; } if ((label|0) == 4) { ___assert_fail((31198|0),(13400|0),14897,(31217|0)); // unreachable; } else if ((label|0) == 6) { $0 = $18; $21 = $0; STACKTOP = sp;return ($21|0); } else if ((label|0) == 8) { $0 = 0; $21 = $0; STACKTOP = sp;return ($21|0); } return (0)|0; } function _nk_create_window($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $elem = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $ctx; $2 = $1; $3 = (_nk_create_page_element($2)|0); $elem = $3; $4 = $elem; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 11180|0); $8 = HEAP32[$7>>2]|0; $9 = $elem; HEAP32[$9>>2] = $8; $10 = $elem; $0 = $10; $11 = $0; STACKTOP = sp;return ($11|0); } else { $0 = 0; $11 = $0; STACKTOP = sp;return ($11|0); } return (0)|0; } function _nk_insert_window($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $9 = 0; var $end = 0, $iter = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14910,(31321|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((28440|0),(13400|0),14911,(31321|0)); // unreachable; } $6 = $1; $7 = ($6|0)!=(0|0); $8 = $0; $9 = ($8|0)!=(0|0); $or$cond = $7 & $9; if (!($or$cond)) { STACKTOP = sp;return; } $10 = $0; $11 = ((($10)) + 11156|0); $12 = HEAP32[$11>>2]|0; $iter = $12; while(1) { $13 = $iter; $14 = ($13|0)!=(0|0); if (!($14)) { label = 14; break; } $15 = $iter; $16 = $iter; $17 = ((($16)) + 264|0); $18 = HEAP32[$17>>2]|0; $19 = ($15|0)!=($18|0); if (!($19)) { label = 9; break; } $20 = $iter; $21 = $1; $22 = ($20|0)!=($21|0); if (!($22)) { label = 11; break; } $23 = $iter; $24 = $1; $25 = ($23|0)==($24|0); if ($25) { label = 17; break; } $26 = $iter; $27 = ((($26)) + 264|0); $28 = HEAP32[$27>>2]|0; $iter = $28; } if ((label|0) == 9) { ___assert_fail((31198|0),(13400|0),14916,(31321|0)); // unreachable; } else if ((label|0) == 11) { ___assert_fail((31338|0),(13400|0),14917,(31321|0)); // unreachable; } else if ((label|0) == 14) { $29 = $0; $30 = ((($29)) + 11156|0); $31 = HEAP32[$30>>2]|0; $32 = ($31|0)!=(0|0); if ($32) { $45 = $0; $46 = ((($45)) + 11160|0); $47 = HEAP32[$46>>2]|0; $end = $47; $48 = $end; $49 = ((($48)) + 8|0); $50 = HEAP32[$49>>2]|0; $51 = $50 | 1024; HEAP32[$49>>2] = $51; $52 = $1; $53 = $end; $54 = ((($53)) + 264|0); HEAP32[$54>>2] = $52; $55 = $0; $56 = ((($55)) + 11160|0); $57 = HEAP32[$56>>2]|0; $58 = $1; $59 = ((($58)) + 268|0); HEAP32[$59>>2] = $57; $60 = $1; $61 = ((($60)) + 264|0); HEAP32[$61>>2] = 0; $62 = $1; $63 = $0; $64 = ((($63)) + 11160|0); HEAP32[$64>>2] = $62; $65 = $0; $66 = ((($65)) + 11176|0); $67 = HEAP32[$66>>2]|0; $68 = (($67) + 1)|0; HEAP32[$66>>2] = $68; $69 = $0; $70 = ((($69)) + 11160|0); $71 = HEAP32[$70>>2]|0; $72 = $0; $73 = ((($72)) + 11164|0); HEAP32[$73>>2] = $71; $74 = $0; $75 = ((($74)) + 11160|0); $76 = HEAP32[$75>>2]|0; $77 = ((($76)) + 8|0); $78 = HEAP32[$77>>2]|0; $79 = $78 & -1025; HEAP32[$77>>2] = $79; STACKTOP = sp;return; } else { $33 = $1; $34 = ((($33)) + 264|0); HEAP32[$34>>2] = 0; $35 = $1; $36 = ((($35)) + 268|0); HEAP32[$36>>2] = 0; $37 = $1; $38 = $0; $39 = ((($38)) + 11156|0); HEAP32[$39>>2] = $37; $40 = $1; $41 = $0; $42 = ((($41)) + 11160|0); HEAP32[$42>>2] = $40; $43 = $0; $44 = ((($43)) + 11176|0); HEAP32[$44>>2] = 1; STACKTOP = sp;return; } } else if ((label|0) == 17) { STACKTOP = sp;return; } } function _nk_command_buffer_init($cmdbuf,$buffer,$clip) { $cmdbuf = $cmdbuf|0; $buffer = $buffer|0; $clip = $clip|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $cmdbuf; $1 = $buffer; $2 = $clip; $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((31350|0),(13400|0),4975,(31357|0)); // unreachable; } $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((13445|0),(13400|0),4976,(31357|0)); // unreachable; } $7 = $0; $8 = ($7|0)!=(0|0); $9 = $1; $10 = ($9|0)!=(0|0); $or$cond = $8 & $10; if (!($or$cond)) { STACKTOP = sp;return; } $11 = $1; $12 = $0; HEAP32[$12>>2] = $11; $13 = $2; $14 = $0; $15 = ((($14)) + 20|0); HEAP32[$15>>2] = $13; $16 = $1; $17 = ((($16)) + 44|0); $18 = HEAP32[$17>>2]|0; $19 = $0; $20 = ((($19)) + 28|0); HEAP32[$20>>2] = $18; $21 = $1; $22 = ((($21)) + 44|0); $23 = HEAP32[$22>>2]|0; $24 = $0; $25 = ((($24)) + 32|0); HEAP32[$25>>2] = $23; $26 = $1; $27 = ((($26)) + 44|0); $28 = HEAP32[$27>>2]|0; $29 = $0; $30 = ((($29)) + 36|0); HEAP32[$30>>2] = $28; STACKTOP = sp;return; } function _nk_start($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14570,(31380|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((28440|0),(13400|0),14571,(31380|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); $8 = $1; $9 = ($8|0)!=(0|0); $or$cond = $7 & $9; if (!($or$cond)) { STACKTOP = sp;return; } $10 = $0; $11 = ((($10)) + 5596|0); $12 = ((($11)) + 44|0); $13 = HEAP32[$12>>2]|0; $14 = $1; $15 = ((($14)) + 32|0); $16 = ((($15)) + 28|0); HEAP32[$16>>2] = $13; $17 = $1; $18 = ((($17)) + 32|0); $19 = ((($18)) + 28|0); $20 = HEAP32[$19>>2]|0; $21 = $1; $22 = ((($21)) + 32|0); $23 = ((($22)) + 32|0); HEAP32[$23>>2] = $20; $24 = $1; $25 = ((($24)) + 32|0); $26 = ((($25)) + 28|0); $27 = HEAP32[$26>>2]|0; $28 = $1; $29 = ((($28)) + 32|0); $30 = ((($29)) + 36|0); HEAP32[$30>>2] = $27; $31 = $1; $32 = ((($31)) + 32|0); $33 = ((($32)) + 4|0); ;HEAP32[$33>>2]=HEAP32[8>>2]|0;HEAP32[$33+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$33+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$33+12>>2]=HEAP32[8+12>>2]|0; STACKTOP = sp;return; } function _nk_panel_begin($ctx,$title) { $ctx = $ctx|0; $title = $title|0; var $$byval_copy = 0, $$byval_copy10 = 0, $$byval_copy12 = 0, $$byval_copy13 = 0, $$byval_copy14 = 0, $$byval_copy16 = 0, $$byval_copy17 = 0, $$byval_copy18 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $1000 = 0; var $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0.0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0, $1010 = 0, $1011 = 0.0, $1012 = 0.0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0; var $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0; var $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0.0, $136 = 0, $137 = 0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0.0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0.0; var $152 = 0.0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0.0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0.0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0.0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0.0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0.0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0.0, $259 = 0, $26 = 0; var $260 = 0.0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0.0, $268 = 0, $269 = 0, $27 = 0, $270 = 0.0, $271 = 0.0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0.0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0.0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0.0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0.0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0.0, $335 = 0, $336 = 0.0, $337 = 0.0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0; var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0.0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0.0, $363 = 0.0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0; var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0.0, $377 = 0.0, $378 = 0.0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0.0, $385 = 0, $386 = 0; var $387 = 0.0, $388 = 0, $389 = 0.0, $39 = 0, $390 = 0.0, $391 = 0, $392 = 0.0, $393 = 0.0, $394 = 0.0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0.0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0.0, $403 = 0.0; var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0, $413 = 0, $414 = 0, $415 = 0.0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0.0, $421 = 0; var $422 = 0, $423 = 0, $424 = 0.0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0.0, $43 = 0, $430 = 0.0, $431 = 0.0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0.0, $439 = 0.0, $44 = 0; var $440 = 0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0.0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0.0, $451 = 0.0, $452 = 0, $453 = 0, $454 = 0.0, $455 = 0.0, $456 = 0, $457 = 0, $458 = 0; var $459 = 0, $46 = 0, $460 = 0.0, $461 = 0, $462 = 0.0, $463 = 0, $464 = 0.0, $465 = 0.0, $466 = 0.0, $467 = 0.0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0.0, $473 = 0, $474 = 0, $475 = 0.0, $476 = 0.0; var $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0; var $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0; var $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0.0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0.0, $521 = 0, $522 = 0, $523 = 0, $524 = 0.0, $525 = 0, $526 = 0, $527 = 0.0, $528 = 0, $529 = 0, $53 = 0; var $530 = 0, $531 = 0.0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0.0, $537 = 0.0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0.0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0.0, $547 = 0.0, $548 = 0.0; var $549 = 0, $55 = 0, $550 = 0, $551 = 0.0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0.0, $565 = 0.0, $566 = 0.0; var $567 = 0, $568 = 0.0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0.0, $573 = 0.0, $574 = 0.0, $575 = 0, $576 = 0.0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0.0, $581 = 0.0, $582 = 0, $583 = 0, $584 = 0; var $585 = 0.0, $586 = 0.0, $587 = 0, $588 = 0.0, $589 = 0.0, $59 = 0, $590 = 0.0, $591 = 0, $592 = 0, $593 = 0, $594 = 0.0, $595 = 0.0, $596 = 0, $597 = 0.0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0.0; var $602 = 0.0, $603 = 0, $604 = 0, $605 = 0, $606 = 0.0, $607 = 0.0, $608 = 0.0, $609 = 0.0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0; var $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0.0, $638 = 0.0; var $639 = 0.0, $64 = 0, $640 = 0, $641 = 0.0, $642 = 0.0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0.0, $652 = 0.0, $653 = 0.0, $654 = 0, $655 = 0, $656 = 0; var $657 = 0.0, $658 = 0, $659 = 0.0, $66 = 0, $660 = 0.0, $661 = 0, $662 = 0.0, $663 = 0, $664 = 0, $665 = 0, $666 = 0.0, $667 = 0.0, $668 = 0, $669 = 0.0, $67 = 0, $670 = 0.0, $671 = 0.0, $672 = 0, $673 = 0.0, $674 = 0; var $675 = 0, $676 = 0, $677 = 0.0, $678 = 0.0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0.0, $683 = 0.0, $684 = 0.0, $685 = 0.0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0; var $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0; var $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0.0, $725 = 0, $726 = 0, $727 = 0.0, $728 = 0.0; var $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0.0, $733 = 0.0, $734 = 0, $735 = 0, $736 = 0, $737 = 0.0, $738 = 0.0, $739 = 0.0, $74 = 0, $740 = 0, $741 = 0.0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0.0; var $747 = 0.0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0.0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0.0, $757 = 0.0, $758 = 0.0, $759 = 0, $76 = 0, $760 = 0.0, $761 = 0, $762 = 0, $763 = 0, $764 = 0.0; var $765 = 0.0, $766 = 0.0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0.0; var $783 = 0.0, $784 = 0, $785 = 0, $786 = 0, $787 = 0.0, $788 = 0.0, $789 = 0, $79 = 0.0, $790 = 0, $791 = 0, $792 = 0.0, $793 = 0.0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0; var $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0.0, $805 = 0, $806 = 0, $807 = 0, $808 = 0.0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0.0, $813 = 0, $814 = 0, $815 = 0, $816 = 0.0, $817 = 0, $818 = 0; var $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0.0, $83 = 0.0, $830 = 0.0, $831 = 0, $832 = 0.0, $833 = 0.0, $834 = 0, $835 = 0, $836 = 0.0; var $837 = 0, $838 = 0.0, $839 = 0.0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0.0, $854 = 0; var $855 = 0, $856 = 0, $857 = 0.0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0.0, $862 = 0, $863 = 0, $864 = 0, $865 = 0.0, $866 = 0, $867 = 0.0, $868 = 0.0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0; var $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0.0, $88 = 0.0, $880 = 0.0, $881 = 0.0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0.0, $887 = 0.0, $888 = 0.0, $889 = 0.0, $89 = 0, $890 = 0; var $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0.0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0.0, $905 = 0, $906 = 0, $907 = 0.0, $908 = 0; var $909 = 0, $91 = 0, $910 = 0.0, $911 = 0.0, $912 = 0.0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0.0, $920 = 0.0, $921 = 0.0, $922 = 0, $923 = 0, $924 = 0, $925 = 0.0, $926 = 0.0; var $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0.0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0; var $945 = 0, $946 = 0.0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0.0, $952 = 0.0, $953 = 0, $954 = 0, $955 = 0, $956 = 0.0, $957 = 0.0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0; var $963 = 0.0, $964 = 0, $965 = 0, $966 = 0, $967 = 0.0, $968 = 0, $969 = 0, $97 = 0, $970 = 0.0, $971 = 0, $972 = 0, $973 = 0, $974 = 0.0, $975 = 0.0, $976 = 0, $977 = 0, $978 = 0, $979 = 0.0, $98 = 0, $980 = 0; var $981 = 0, $982 = 0, $983 = 0.0, $984 = 0.0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0.0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0.0, $997 = 0, $998 = 0, $999 = 0; var $background = 0, $body = 0, $body$byval_copy = 0, $body$byval_copy15 = 0, $button = 0, $button$byval_copy = 0, $button$byval_copy11 = 0, $clip = 0, $clip$byval_copy = 0, $font = 0, $header = 0, $header$byval_copy = 0, $header$byval_copy8 = 0, $header_active = 0, $in = 0, $item_spacing = 0, $label = 0, $label$byval_copy = 0, $layout = 0, $left_mouse_click_in_cursor = 0; var $left_mouse_down = 0, $move = 0, $move$byval_copy = 0, $or$cond = 0, $out = 0, $scaler_size = 0, $scrollbar_size = 0, $style = 0, $t = 0.0, $text = 0, $text_len = 0, $win = 0, $window_padding = 0, $ws = 0, $ws1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 736|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $clip$byval_copy = sp + 688|0; $$byval_copy18 = sp + 720|0; $$byval_copy17 = sp + 672|0; $$byval_copy16 = sp + 716|0; $body$byval_copy15 = sp + 656|0; $body$byval_copy = sp + 640|0; $$byval_copy14 = sp + 712|0; $$byval_copy13 = sp + 624|0; $label$byval_copy = sp + 608|0; $$byval_copy12 = sp + 600|0; $button$byval_copy11 = sp + 584|0; $button$byval_copy = sp + 568|0; $$byval_copy10 = sp + 708|0; $$byval_copy9 = sp + 552|0; $header$byval_copy8 = sp + 536|0; $header$byval_copy = sp + 520|0; $$byval_copy7 = sp + 504|0; $$byval_copy6 = sp + 488|0; $$byval_copy5 = sp + 472|0; $$byval_copy4 = sp + 456|0; $$byval_copy3 = sp + 440|0; $$byval_copy2 = sp + 424|0; $$byval_copy = sp + 408|0; $move$byval_copy = sp + 392|0; $scrollbar_size = sp + 344|0; $item_spacing = sp + 336|0; $window_padding = sp + 328|0; $scaler_size = sp + 320|0; $move = sp + 296|0; $3 = sp + 280|0; $4 = sp + 264|0; $5 = sp + 248|0; $6 = sp + 232|0; $7 = sp + 216|0; $8 = sp + 200|0; $9 = sp + 184|0; $header = sp + 168|0; $button = sp + 152|0; $text = sp + 136|0; $10 = sp + 704|0; $11 = sp + 112|0; $ws = sp + 104|0; $ws1 = sp + 100|0; $label = sp + 80|0; $12 = sp + 64|0; $13 = sp + 48|0; $body = sp + 32|0; $14 = sp + 16|0; $clip = sp; $1 = $ctx; $2 = $title; $header_active = 0; $15 = $1; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((14913|0),(13400|0),15475,(31389|0)); // unreachable; } $17 = $1; $18 = ((($17)) + 11168|0); $19 = HEAP32[$18>>2]|0; $20 = ($19|0)!=(0|0); if (!($20)) { ___assert_fail((28537|0),(13400|0),15476,(31389|0)); // unreachable; } $21 = $1; $22 = ((($21)) + 11168|0); $23 = HEAP32[$22>>2]|0; $24 = ((($23)) + 72|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0|0); if (!($26)) { ___assert_fail((28516|0),(13400|0),15477,(31389|0)); // unreachable; } $27 = $1; $28 = ($27|0)!=(0|0); if ($28) { $29 = $1; $30 = ((($29)) + 11168|0); $31 = HEAP32[$30>>2]|0; $32 = ($31|0)!=(0|0); if ($32) { $33 = $1; $34 = ((($33)) + 11168|0); $35 = HEAP32[$34>>2]|0; $36 = ((($35)) + 72|0); $37 = HEAP32[$36>>2]|0; $38 = ($37|0)!=(0|0); if ($38) { $39 = $1; $40 = ((($39)) + 300|0); $style = $40; $41 = $style; $font = $41; $42 = $1; $in = $42; $43 = $1; $44 = ((($43)) + 11168|0); $45 = HEAP32[$44>>2]|0; $win = $45; $46 = $win; $47 = ((($46)) + 72|0); $48 = HEAP32[$47>>2]|0; $layout = $48; $49 = $style; $50 = ((($49)) + 4784|0); $51 = ((($50)) + 496|0); ;HEAP32[$scrollbar_size>>2]=HEAP32[$51>>2]|0;HEAP32[$scrollbar_size+4>>2]=HEAP32[$51+4>>2]|0; $52 = $style; $53 = ((($52)) + 4784|0); $54 = ((($53)) + 480|0); ;HEAP32[$window_padding>>2]=HEAP32[$54>>2]|0;HEAP32[$window_padding+4>>2]=HEAP32[$54+4>>2]|0; $55 = $style; $56 = ((($55)) + 4784|0); $57 = ((($56)) + 488|0); ;HEAP32[$item_spacing>>2]=HEAP32[$57>>2]|0;HEAP32[$item_spacing+4>>2]=HEAP32[$57+4>>2]|0; $58 = $style; $59 = ((($58)) + 4784|0); $60 = ((($59)) + 472|0); ;HEAP32[$scaler_size>>2]=HEAP32[$60>>2]|0;HEAP32[$scaler_size+4>>2]=HEAP32[$60+4>>2]|0; $61 = $layout; _nk_zero($61,356); $62 = $win; $63 = ((($62)) + 8|0); $64 = HEAP32[$63>>2]|0; $65 = $64 & 2048; $66 = ($65|0)!=(0); if ($66) { $0 = 0; $1024 = $0; STACKTOP = sp;return ($1024|0); } $67 = $win; $68 = ((($67)) + 8|0); $69 = HEAP32[$68>>2]|0; $70 = $69 & 4; $71 = ($70|0)!=(0); if ($71) { $72 = $1; $73 = ((($72)) + 11164|0); $74 = HEAP32[$73>>2]|0; $75 = $win; $76 = ($74|0)==($75|0); if ($76) { $77 = $win; $78 = ((($77)) + 12|0); $79 = +HEAPF32[$78>>2]; HEAPF32[$move>>2] = $79; $80 = $win; $81 = ((($80)) + 12|0); $82 = ((($81)) + 4|0); $83 = +HEAPF32[$82>>2]; $84 = ((($move)) + 4|0); HEAPF32[$84>>2] = $83; $85 = $win; $86 = ((($85)) + 12|0); $87 = ((($86)) + 8|0); $88 = +HEAPF32[$87>>2]; $89 = ((($move)) + 8|0); HEAPF32[$89>>2] = $88; $90 = $layout; $91 = ((($90)) + 48|0); $92 = +HEAPF32[$91>>2]; $93 = ((($move)) + 12|0); HEAPF32[$93>>2] = $92; $94 = $win; $95 = $2; $96 = (_nk_window_has_header($94,$95)|0); $97 = ($96|0)!=(0); if ($97) { $98 = $font; $99 = ((($98)) + 4|0); $100 = +HEAPF32[$99>>2]; $101 = $style; $102 = ((($101)) + 4784|0); $103 = ((($102)) + 344|0); $104 = ((($103)) + 4|0); $105 = +HEAPF32[$104>>2]; $106 = 2.0 * $105; $107 = $100 + $106; $108 = ((($move)) + 12|0); HEAPF32[$108>>2] = $107; $109 = $style; $110 = ((($109)) + 4784|0); $111 = ((($110)) + 352|0); $112 = ((($111)) + 4|0); $113 = +HEAPF32[$112>>2]; $114 = 2.0 * $113; $115 = ((($move)) + 12|0); $116 = +HEAPF32[$115>>2]; $117 = $116 + $114; HEAPF32[$115>>2] = $117; } else { $118 = ((($window_padding)) + 4|0); $119 = +HEAPF32[$118>>2]; $120 = ((($item_spacing)) + 4|0); $121 = +HEAPF32[$120>>2]; $122 = $119 + $121; $123 = ((($move)) + 12|0); HEAPF32[$123>>2] = $122; } $124 = $in; $125 = ((($124)) + 220|0); $126 = HEAP32[$125>>2]|0; $left_mouse_down = $126; $127 = $in; ;HEAP32[$move$byval_copy>>2]=HEAP32[$move>>2]|0;HEAP32[$move$byval_copy+4>>2]=HEAP32[$move+4>>2]|0;HEAP32[$move$byval_copy+8>>2]=HEAP32[$move+8>>2]|0;HEAP32[$move$byval_copy+12>>2]=HEAP32[$move+12>>2]|0; $128 = (_nk_input_has_mouse_click_down_in_rect($127,0,$move$byval_copy,1)|0); $left_mouse_click_in_cursor = $128; $129 = $left_mouse_down; $130 = ($129|0)!=(0); $131 = $left_mouse_click_in_cursor; $132 = ($131|0)!=(0); $or$cond = $130 & $132; if ($or$cond) { $133 = $win; $134 = ((($133)) + 12|0); $135 = +HEAPF32[$134>>2]; $136 = $in; $137 = ((($136)) + 220|0); $138 = ((($137)) + 64|0); $139 = +HEAPF32[$138>>2]; $140 = $135 + $139; $141 = $win; $142 = ((($141)) + 12|0); HEAPF32[$142>>2] = $140; $143 = $win; $144 = ((($143)) + 12|0); $145 = ((($144)) + 4|0); $146 = +HEAPF32[$145>>2]; $147 = $in; $148 = ((($147)) + 220|0); $149 = ((($148)) + 64|0); $150 = ((($149)) + 4|0); $151 = +HEAPF32[$150>>2]; $152 = $146 + $151; $153 = $win; $154 = ((($153)) + 12|0); $155 = ((($154)) + 4|0); HEAPF32[$155>>2] = $152; $156 = $in; $157 = ((($156)) + 220|0); $158 = ((($157)) + 64|0); $159 = +HEAPF32[$158>>2]; $160 = $in; $161 = ((($160)) + 220|0); $162 = ((($161)) + 8|0); $163 = +HEAPF32[$162>>2]; $164 = $163 + $159; HEAPF32[$162>>2] = $164; $165 = $in; $166 = ((($165)) + 220|0); $167 = ((($166)) + 64|0); $168 = ((($167)) + 4|0); $169 = +HEAPF32[$168>>2]; $170 = $in; $171 = ((($170)) + 220|0); $172 = ((($171)) + 8|0); $173 = ((($172)) + 4|0); $174 = +HEAPF32[$173>>2]; $175 = $174 + $169; HEAPF32[$173>>2] = $175; } } } $176 = $win; $177 = ((($176)) + 8|0); $178 = HEAP32[$177>>2]|0; $179 = $178 & 1; $180 = ($179|0)!=(0); do { if ($180) { $181 = $win; $182 = ((($181)) + 8|0); $183 = HEAP32[$182>>2]|0; $184 = $183 & 8192; $185 = ($184|0)!=(0); if (!($185)) { $186 = $layout; $187 = ((($186)) + 4|0); $188 = $win; $189 = ((($188)) + 12|0); $190 = $style; $191 = ((($190)) + 4784|0); $192 = ((($191)) + 444|0); $193 = +HEAPF32[$192>>2]; ;HEAP32[$$byval_copy>>2]=HEAP32[$189>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$189+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$189+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$189+12>>2]|0; _nk_shrink_rect($3,$$byval_copy,$193); ;HEAP32[$187>>2]=HEAP32[$3>>2]|0;HEAP32[$187+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$187+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[$187+12>>2]=HEAP32[$3+12>>2]|0; break; } $194 = $win; $195 = ((($194)) + 8|0); $196 = HEAP32[$195>>2]|0; $197 = $196 & 262144; $198 = ($197|0)!=(0); if ($198) { $199 = $layout; $200 = ((($199)) + 4|0); $201 = $win; $202 = ((($201)) + 12|0); $203 = $style; $204 = ((($203)) + 4784|0); $205 = ((($204)) + 448|0); $206 = +HEAPF32[$205>>2]; ;HEAP32[$$byval_copy2>>2]=HEAP32[$202>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$202+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$202+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$202+12>>2]|0; _nk_shrink_rect($4,$$byval_copy2,$206); ;HEAP32[$200>>2]=HEAP32[$4>>2]|0;HEAP32[$200+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$200+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$200+12>>2]=HEAP32[$4+12>>2]|0; break; } $207 = $win; $208 = ((($207)) + 8|0); $209 = HEAP32[$208>>2]|0; $210 = $209 & 131072; $211 = ($210|0)!=(0); if ($211) { $212 = $layout; $213 = ((($212)) + 4|0); $214 = $win; $215 = ((($214)) + 12|0); $216 = $style; $217 = ((($216)) + 4784|0); $218 = ((($217)) + 452|0); $219 = +HEAPF32[$218>>2]; ;HEAP32[$$byval_copy3>>2]=HEAP32[$215>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$215+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$215+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$215+12>>2]|0; _nk_shrink_rect($5,$$byval_copy3,$219); ;HEAP32[$213>>2]=HEAP32[$5>>2]|0;HEAP32[$213+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$213+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$213+12>>2]=HEAP32[$5+12>>2]|0; break; } $220 = $win; $221 = ((($220)) + 8|0); $222 = HEAP32[$221>>2]|0; $223 = $222 & 524288; $224 = ($223|0)!=(0); if ($224) { $225 = $layout; $226 = ((($225)) + 4|0); $227 = $win; $228 = ((($227)) + 12|0); $229 = $style; $230 = ((($229)) + 4784|0); $231 = ((($230)) + 456|0); $232 = +HEAPF32[$231>>2]; ;HEAP32[$$byval_copy4>>2]=HEAP32[$228>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$228+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$228+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$228+12>>2]|0; _nk_shrink_rect($6,$$byval_copy4,$232); ;HEAP32[$226>>2]=HEAP32[$6>>2]|0;HEAP32[$226+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$226+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$226+12>>2]=HEAP32[$6+12>>2]|0; break; } $233 = $win; $234 = ((($233)) + 8|0); $235 = HEAP32[$234>>2]|0; $236 = $235 & 16384; $237 = ($236|0)!=(0); if ($237) { $238 = $layout; $239 = ((($238)) + 4|0); $240 = $win; $241 = ((($240)) + 12|0); $242 = $style; $243 = ((($242)) + 4784|0); $244 = ((($243)) + 460|0); $245 = +HEAPF32[$244>>2]; ;HEAP32[$$byval_copy5>>2]=HEAP32[$241>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$241+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$241+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$241+12>>2]|0; _nk_shrink_rect($7,$$byval_copy5,$245); ;HEAP32[$239>>2]=HEAP32[$7>>2]|0;HEAP32[$239+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$239+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$239+12>>2]=HEAP32[$7+12>>2]|0; break; } $246 = $win; $247 = ((($246)) + 8|0); $248 = HEAP32[$247>>2]|0; $249 = $248 & 1048576; $250 = ($249|0)!=(0); $251 = $layout; $252 = ((($251)) + 4|0); $253 = $win; $254 = ((($253)) + 12|0); $255 = $style; $256 = ((($255)) + 4784|0); if ($250) { $257 = ((($256)) + 464|0); $258 = +HEAPF32[$257>>2]; ;HEAP32[$$byval_copy6>>2]=HEAP32[$254>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$254+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$254+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$254+12>>2]|0; _nk_shrink_rect($8,$$byval_copy6,$258); ;HEAP32[$252>>2]=HEAP32[$8>>2]|0;HEAP32[$252+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$252+8>>2]=HEAP32[$8+8>>2]|0;HEAP32[$252+12>>2]=HEAP32[$8+12>>2]|0; break; } else { $259 = ((($256)) + 444|0); $260 = +HEAPF32[$259>>2]; ;HEAP32[$$byval_copy7>>2]=HEAP32[$254>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$254+4>>2]|0;HEAP32[$$byval_copy7+8>>2]=HEAP32[$254+8>>2]|0;HEAP32[$$byval_copy7+12>>2]=HEAP32[$254+12>>2]|0; _nk_shrink_rect($9,$$byval_copy7,$260); ;HEAP32[$252>>2]=HEAP32[$9>>2]|0;HEAP32[$252+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$252+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[$252+12>>2]=HEAP32[$9+12>>2]|0; break; } } else { $261 = $layout; $262 = ((($261)) + 4|0); $263 = $win; $264 = ((($263)) + 12|0); ;HEAP32[$262>>2]=HEAP32[$264>>2]|0;HEAP32[$262+4>>2]=HEAP32[$264+4>>2]|0;HEAP32[$262+8>>2]=HEAP32[$264+8>>2]|0;HEAP32[$262+12>>2]=HEAP32[$264+12>>2]|0; } } while(0); $265 = $layout; $266 = ((($265)) + 4|0); $267 = +HEAPF32[$266>>2]; $268 = $win; $269 = ((($268)) + 12|0); $270 = +HEAPF32[$269>>2]; $271 = $267 - $270; $272 = $layout; $273 = ((($272)) + 52|0); HEAPF32[$273>>2] = $271; $274 = $layout; $275 = ((($274)) + 4|0); $276 = +HEAPF32[$275>>2]; $277 = $layout; $278 = ((($277)) + 24|0); HEAPF32[$278>>2] = $276; $279 = $layout; $280 = ((($279)) + 4|0); $281 = ((($280)) + 4|0); $282 = +HEAPF32[$281>>2]; $283 = $layout; $284 = ((($283)) + 28|0); HEAPF32[$284>>2] = $282; $285 = $layout; $286 = ((($285)) + 4|0); $287 = ((($286)) + 8|0); $288 = +HEAPF32[$287>>2]; $289 = $layout; $290 = ((($289)) + 36|0); HEAPF32[$290>>2] = $288; $291 = $layout; $292 = ((($291)) + 4|0); $293 = ((($292)) + 12|0); $294 = +HEAPF32[$293>>2]; $295 = $layout; $296 = ((($295)) + 40|0); HEAPF32[$296>>2] = $294; $297 = $layout; $298 = ((($297)) + 32|0); HEAPF32[$298>>2] = 0.0; $299 = $layout; $300 = ((($299)) + 92|0); $301 = ((($300)) + 4|0); HEAP32[$301>>2] = 0; $302 = $layout; $303 = ((($302)) + 92|0); $304 = ((($303)) + 12|0); HEAP32[$304>>2] = 0; $305 = $layout; $306 = ((($305)) + 92|0); $307 = ((($306)) + 8|0); HEAPF32[$307>>2] = 0.0; $308 = $layout; $309 = ((($308)) + 92|0); $310 = ((($309)) + 16|0); HEAP32[$310>>2] = 0; $311 = $layout; $312 = ((($311)) + 92|0); $313 = ((($312)) + 20|0); HEAPF32[$313>>2] = 0.0; $314 = $layout; $315 = ((($314)) + 92|0); $316 = ((($315)) + 52|0); HEAP32[$316>>2] = 0; $317 = $win; $318 = ((($317)) + 8|0); $319 = HEAP32[$318>>2]|0; $320 = $layout; HEAP32[$320>>2] = $319; $321 = $win; $322 = ((($321)) + 32|0); $out = $322; $323 = $win; $324 = ((($323)) + 8|0); $325 = HEAP32[$324>>2]|0; $326 = $325 & 4096; $327 = ($326|0)!=(0); $328 = $layout; $329 = ((($328)) + 48|0); HEAPF32[$329>>2] = 0.0; if ($327) { $330 = $layout; $331 = ((($330)) + 92|0); $332 = ((($331)) + 8|0); HEAPF32[$332>>2] = 0.0; } else { $333 = ((($item_spacing)) + 4|0); $334 = +HEAPF32[$333>>2]; $335 = ((($window_padding)) + 4|0); $336 = +HEAPF32[$335>>2]; $337 = $334 + $336; $338 = $layout; $339 = ((($338)) + 92|0); $340 = ((($339)) + 8|0); HEAPF32[$340>>2] = $337; } $341 = $win; $342 = ((($341)) + 8|0); $343 = HEAP32[$342>>2]|0; $344 = $343 & 65536; $345 = ($344|0)!=(0); do { if ($345) { label = 42; } else { $346 = $win; $347 = ((($346)) + 8|0); $348 = HEAP32[$347>>2]|0; $349 = $348 & 128; $350 = ($349|0)!=(0); if ($350) { $351 = $win; $352 = ((($351)) + 8|0); $353 = HEAP32[$352>>2]|0; $354 = $353 & 8; $355 = ($354|0)!=(0); if (!($355)) { label = 42; break; } } $356 = ((($scaler_size)) + 4|0); $357 = +HEAPF32[$356>>2]; $358 = $style; $359 = ((($358)) + 4784|0); $360 = ((($359)) + 436|0); $361 = ((($360)) + 4|0); $362 = +HEAPF32[$361>>2]; $363 = $357 + $362; $364 = $layout; $365 = ((($364)) + 44|0); HEAPF32[$365>>2] = $363; } } while(0); if ((label|0) == 42) { $366 = $layout; $367 = ((($366)) + 44|0); HEAPF32[$367>>2] = 0.0; } $368 = $win; $369 = ((($368)) + 8|0); $370 = HEAP32[$369>>2]|0; $371 = $370 & 128; $372 = ($371|0)!=(0); if (!($372)) { $373 = $layout; $374 = ((($373)) + 4|0); $375 = ((($374)) + 8|0); $376 = +HEAPF32[$375>>2]; $377 = +HEAPF32[$scrollbar_size>>2]; $378 = $376 - $377; $379 = $layout; $380 = ((($379)) + 36|0); HEAPF32[$380>>2] = $378; } $381 = $layout; $382 = ((($381)) + 4|0); $383 = ((($382)) + 12|0); $384 = +HEAPF32[$383>>2]; $385 = $layout; $386 = ((($385)) + 48|0); $387 = +HEAPF32[$386>>2]; $388 = ((($item_spacing)) + 4|0); $389 = +HEAPF32[$388>>2]; $390 = $387 + $389; $391 = ((($window_padding)) + 4|0); $392 = +HEAPF32[$391>>2]; $393 = $390 + $392; $394 = $384 - $393; $395 = $layout; $396 = ((($395)) + 40|0); HEAPF32[$396>>2] = $394; $397 = $layout; $398 = ((($397)) + 44|0); $399 = +HEAPF32[$398>>2]; $400 = $layout; $401 = ((($400)) + 40|0); $402 = +HEAPF32[$401>>2]; $403 = $402 - $399; HEAPF32[$401>>2] = $403; $404 = $win; $405 = $2; $406 = (_nk_window_has_header($404,$405)|0); $header_active = $406; $407 = $header_active; $408 = ($407|0)!=(0); if ($408) { $background = 0; $409 = $layout; $410 = ((($409)) + 4|0); $411 = +HEAPF32[$410>>2]; HEAPF32[$header>>2] = $411; $412 = $layout; $413 = ((($412)) + 4|0); $414 = ((($413)) + 4|0); $415 = +HEAPF32[$414>>2]; $416 = ((($header)) + 4|0); HEAPF32[$416>>2] = $415; $417 = $layout; $418 = ((($417)) + 4|0); $419 = ((($418)) + 8|0); $420 = +HEAPF32[$419>>2]; $421 = ((($header)) + 8|0); HEAPF32[$421>>2] = $420; $422 = $font; $423 = ((($422)) + 4|0); $424 = +HEAPF32[$423>>2]; $425 = $style; $426 = ((($425)) + 4784|0); $427 = ((($426)) + 344|0); $428 = ((($427)) + 4|0); $429 = +HEAPF32[$428>>2]; $430 = 2.0 * $429; $431 = $424 + $430; $432 = $layout; $433 = ((($432)) + 48|0); HEAPF32[$433>>2] = $431; $434 = $style; $435 = ((($434)) + 4784|0); $436 = ((($435)) + 352|0); $437 = ((($436)) + 4|0); $438 = +HEAPF32[$437>>2]; $439 = 2.0 * $438; $440 = $layout; $441 = ((($440)) + 48|0); $442 = +HEAPF32[$441>>2]; $443 = $442 + $439; HEAPF32[$441>>2] = $443; $444 = $layout; $445 = ((($444)) + 48|0); $446 = +HEAPF32[$445>>2]; $447 = $layout; $448 = ((($447)) + 92|0); $449 = ((($448)) + 8|0); $450 = +HEAPF32[$449>>2]; $451 = $450 + $446; HEAPF32[$449>>2] = $451; $452 = $layout; $453 = ((($452)) + 48|0); $454 = +HEAPF32[$453>>2]; $455 = $454 + 0.5; $456 = ((($header)) + 12|0); HEAPF32[$456>>2] = $455; $457 = $layout; $458 = ((($457)) + 4|0); $459 = ((($458)) + 12|0); $460 = +HEAPF32[$459>>2]; $461 = ((($header)) + 12|0); $462 = +HEAPF32[$461>>2]; $463 = ((($item_spacing)) + 4|0); $464 = +HEAPF32[$463>>2]; $465 = 2.0 * $464; $466 = $462 + $465; $467 = $460 - $466; $468 = $layout; $469 = ((($468)) + 40|0); HEAPF32[$469>>2] = $467; $470 = $layout; $471 = ((($470)) + 44|0); $472 = +HEAPF32[$471>>2]; $473 = $layout; $474 = ((($473)) + 40|0); $475 = +HEAPF32[$474>>2]; $476 = $475 - $472; HEAPF32[$474>>2] = $476; $477 = $1; $478 = ((($477)) + 11164|0); $479 = HEAP32[$478>>2]|0; $480 = $win; $481 = ($479|0)==($480|0); do { if ($481) { $482 = $style; $483 = ((($482)) + 4784|0); $484 = ((($483)) + 40|0); $background = $484; $485 = ((($text)) + 12|0); $486 = $style; $487 = ((($486)) + 4784|0); $488 = ((($487)) + 336|0); ;HEAP8[$485>>0]=HEAP8[$488>>0]|0;HEAP8[$485+1>>0]=HEAP8[$488+1>>0]|0;HEAP8[$485+2>>0]=HEAP8[$488+2>>0]|0;HEAP8[$485+3>>0]=HEAP8[$488+3>>0]|0; } else { $489 = $1; ;HEAP32[$header$byval_copy>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy+12>>2]=HEAP32[$header+12>>2]|0; $490 = (_nk_input_is_mouse_hovering_rect($489,$header$byval_copy)|0); $491 = ($490|0)!=(0); $492 = $style; $493 = ((($492)) + 4784|0); if ($491) { $494 = ((($493)) + 20|0); $background = $494; $495 = ((($text)) + 12|0); $496 = $style; $497 = ((($496)) + 4784|0); $498 = ((($497)) + 332|0); ;HEAP8[$495>>0]=HEAP8[$498>>0]|0;HEAP8[$495+1>>0]=HEAP8[$498+1>>0]|0;HEAP8[$495+2>>0]=HEAP8[$498+2>>0]|0;HEAP8[$495+3>>0]=HEAP8[$498+3>>0]|0; break; } else { $background = $493; $499 = ((($text)) + 12|0); $500 = $style; $501 = ((($500)) + 4784|0); $502 = ((($501)) + 328|0); ;HEAP8[$499>>0]=HEAP8[$502>>0]|0;HEAP8[$499+1>>0]=HEAP8[$502+1>>0]|0;HEAP8[$499+2>>0]=HEAP8[$502+2>>0]|0;HEAP8[$499+3>>0]=HEAP8[$502+3>>0]|0; break; } } } while(0); $503 = $background; $504 = HEAP32[$503>>2]|0; $505 = ($504|0)==(1); $506 = ((($text)) + 8|0); if ($505) { _nk_rgba($10,0,0,0,0); ;HEAP8[$506>>0]=HEAP8[$10>>0]|0;HEAP8[$506+1>>0]=HEAP8[$10+1>>0]|0;HEAP8[$506+2>>0]=HEAP8[$10+2>>0]|0;HEAP8[$506+3>>0]=HEAP8[$10+3>>0]|0; $507 = $win; $508 = ((($507)) + 32|0); $509 = $background; $510 = ((($509)) + 4|0); ;HEAP32[$header$byval_copy8>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy8+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy8+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy8+12>>2]=HEAP32[$header+12>>2]|0; _nk_draw_image($508,$header$byval_copy8,$510); } else { $511 = $background; $512 = ((($511)) + 4|0); ;HEAP8[$506>>0]=HEAP8[$512>>0]|0;HEAP8[$506+1>>0]=HEAP8[$512+1>>0]|0;HEAP8[$506+2>>0]=HEAP8[$512+2>>0]|0;HEAP8[$506+3>>0]=HEAP8[$512+3>>0]|0; $513 = $out; $514 = $layout; $515 = ((($514)) + 4|0); $516 = +HEAPF32[$515>>2]; $517 = $layout; $518 = ((($517)) + 4|0); $519 = ((($518)) + 4|0); $520 = +HEAPF32[$519>>2]; $521 = $layout; $522 = ((($521)) + 4|0); $523 = ((($522)) + 8|0); $524 = +HEAPF32[$523>>2]; $525 = $layout; $526 = ((($525)) + 48|0); $527 = +HEAPF32[$526>>2]; _nk_rect($11,$516,$520,$524,$527); $528 = $background; $529 = ((($528)) + 4|0); ;HEAP32[$$byval_copy9>>2]=HEAP32[$11>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$11+4>>2]|0;HEAP32[$$byval_copy9+8>>2]=HEAP32[$11+8>>2]|0;HEAP32[$$byval_copy9+12>>2]=HEAP32[$11+12>>2]|0; ;HEAP8[$$byval_copy10>>0]=HEAP8[$529>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$529+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$529+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$529+3>>0]|0; _nk_fill_rect($513,$$byval_copy9,0.0,$$byval_copy10); } $530 = ((($header)) + 4|0); $531 = +HEAPF32[$530>>2]; $532 = $style; $533 = ((($532)) + 4784|0); $534 = ((($533)) + 344|0); $535 = ((($534)) + 4|0); $536 = +HEAPF32[$535>>2]; $537 = $531 + $536; $538 = ((($button)) + 4|0); HEAPF32[$538>>2] = $537; $539 = $layout; $540 = ((($539)) + 48|0); $541 = +HEAPF32[$540>>2]; $542 = $style; $543 = ((($542)) + 4784|0); $544 = ((($543)) + 344|0); $545 = ((($544)) + 4|0); $546 = +HEAPF32[$545>>2]; $547 = 2.0 * $546; $548 = $541 - $547; $549 = ((($button)) + 12|0); HEAPF32[$549>>2] = $548; $550 = ((($button)) + 12|0); $551 = +HEAPF32[$550>>2]; $552 = ((($button)) + 8|0); HEAPF32[$552>>2] = $551; $553 = $win; $554 = ((($553)) + 8|0); $555 = HEAP32[$554>>2]|0; $556 = $555 & 16; $557 = ($556|0)!=(0); do { if ($557) { HEAP32[$ws>>2] = 0; $558 = $style; $559 = ((($558)) + 4784|0); $560 = ((($559)) + 340|0); $561 = HEAP32[$560>>2]|0; $562 = ($561|0)==(1); if ($562) { $563 = ((($header)) + 8|0); $564 = +HEAPF32[$563>>2]; $565 = +HEAPF32[$header>>2]; $566 = $564 + $565; $567 = ((($button)) + 8|0); $568 = +HEAPF32[$567>>2]; $569 = $style; $570 = ((($569)) + 4784|0); $571 = ((($570)) + 344|0); $572 = +HEAPF32[$571>>2]; $573 = $568 + $572; $574 = $566 - $573; HEAPF32[$button>>2] = $574; $575 = ((($button)) + 8|0); $576 = +HEAPF32[$575>>2]; $577 = $style; $578 = ((($577)) + 4784|0); $579 = ((($578)) + 360|0); $580 = +HEAPF32[$579>>2]; $581 = $576 + $580; $582 = $style; $583 = ((($582)) + 4784|0); $584 = ((($583)) + 344|0); $585 = +HEAPF32[$584>>2]; $586 = $581 + $585; $587 = ((($header)) + 8|0); $588 = +HEAPF32[$587>>2]; $589 = $588 - $586; HEAPF32[$587>>2] = $589; } else { $590 = +HEAPF32[$header>>2]; $591 = $style; $592 = ((($591)) + 4784|0); $593 = ((($592)) + 344|0); $594 = +HEAPF32[$593>>2]; $595 = $590 + $594; HEAPF32[$button>>2] = $595; $596 = ((($button)) + 8|0); $597 = +HEAPF32[$596>>2]; $598 = $style; $599 = ((($598)) + 4784|0); $600 = ((($599)) + 360|0); $601 = +HEAPF32[$600>>2]; $602 = $597 + $601; $603 = $style; $604 = ((($603)) + 4784|0); $605 = ((($604)) + 344|0); $606 = +HEAPF32[$605>>2]; $607 = $602 + $606; $608 = +HEAPF32[$header>>2]; $609 = $608 + $607; HEAPF32[$header>>2] = $609; } $610 = $win; $611 = ((($610)) + 32|0); $612 = $style; $613 = ((($612)) + 4784|0); $614 = ((($613)) + 316|0); $615 = HEAP32[$614>>2]|0; $616 = $style; $617 = ((($616)) + 4784|0); $618 = ((($617)) + 60|0); $619 = $in; $620 = $style; ;HEAP32[$button$byval_copy>>2]=HEAP32[$button>>2]|0;HEAP32[$button$byval_copy+4>>2]=HEAP32[$button+4>>2]|0;HEAP32[$button$byval_copy+8>>2]=HEAP32[$button+8>>2]|0;HEAP32[$button$byval_copy+12>>2]=HEAP32[$button+12>>2]|0; $621 = (_nk_do_button_symbol($ws,$611,$button$byval_copy,$615,0,$618,$619,$620)|0); $622 = ($621|0)!=(0); if (!($622)) { break; } $623 = $layout; $624 = HEAP32[$623>>2]|0; $625 = $624 | 2048; HEAP32[$623>>2] = $625; } } while(0); $626 = $win; $627 = ((($626)) + 8|0); $628 = HEAP32[$627>>2]|0; $629 = $628 & 32; $630 = ($629|0)!=(0); do { if ($630) { HEAP32[$ws1>>2] = 0; $631 = $style; $632 = ((($631)) + 4784|0); $633 = ((($632)) + 340|0); $634 = HEAP32[$633>>2]|0; $635 = ($634|0)==(1); if ($635) { $636 = ((($header)) + 8|0); $637 = +HEAPF32[$636>>2]; $638 = +HEAPF32[$header>>2]; $639 = $637 + $638; $640 = ((($button)) + 8|0); $641 = +HEAPF32[$640>>2]; $642 = $639 - $641; HEAPF32[$button>>2] = $642; $643 = $win; $644 = ((($643)) + 8|0); $645 = HEAP32[$644>>2]|0; $646 = $645 & 16; $647 = ($646|0)!=(0); if (!($647)) { $648 = $style; $649 = ((($648)) + 4784|0); $650 = ((($649)) + 344|0); $651 = +HEAPF32[$650>>2]; $652 = +HEAPF32[$button>>2]; $653 = $652 - $651; HEAPF32[$button>>2] = $653; $654 = $style; $655 = ((($654)) + 4784|0); $656 = ((($655)) + 344|0); $657 = +HEAPF32[$656>>2]; $658 = ((($header)) + 8|0); $659 = +HEAPF32[$658>>2]; $660 = $659 - $657; HEAPF32[$658>>2] = $660; } $661 = ((($button)) + 8|0); $662 = +HEAPF32[$661>>2]; $663 = $style; $664 = ((($663)) + 4784|0); $665 = ((($664)) + 360|0); $666 = +HEAPF32[$665>>2]; $667 = $662 + $666; $668 = ((($header)) + 8|0); $669 = +HEAPF32[$668>>2]; $670 = $669 - $667; HEAPF32[$668>>2] = $670; } else { $671 = +HEAPF32[$header>>2]; HEAPF32[$button>>2] = $671; $672 = ((($button)) + 8|0); $673 = +HEAPF32[$672>>2]; $674 = $style; $675 = ((($674)) + 4784|0); $676 = ((($675)) + 360|0); $677 = +HEAPF32[$676>>2]; $678 = $673 + $677; $679 = $style; $680 = ((($679)) + 4784|0); $681 = ((($680)) + 344|0); $682 = +HEAPF32[$681>>2]; $683 = $678 + $682; $684 = +HEAPF32[$header>>2]; $685 = $684 + $683; HEAPF32[$header>>2] = $685; } $686 = $win; $687 = ((($686)) + 32|0); $688 = $layout; $689 = HEAP32[$688>>2]|0; $690 = $689 & 4096; $691 = ($690|0)!=(0); $692 = $style; $693 = ((($692)) + 4784|0); if ($691) { $694 = ((($693)) + 324|0); $695 = HEAP32[$694>>2]|0; $703 = $695; } else { $696 = ((($693)) + 320|0); $697 = HEAP32[$696>>2]|0; $703 = $697; } $698 = $style; $699 = ((($698)) + 4784|0); $700 = ((($699)) + 188|0); $701 = $in; $702 = $style; ;HEAP32[$button$byval_copy11>>2]=HEAP32[$button>>2]|0;HEAP32[$button$byval_copy11+4>>2]=HEAP32[$button+4>>2]|0;HEAP32[$button$byval_copy11+8>>2]=HEAP32[$button+8>>2]|0;HEAP32[$button$byval_copy11+12>>2]=HEAP32[$button+12>>2]|0; $704 = (_nk_do_button_symbol($ws1,$687,$button$byval_copy11,$703,0,$700,$701,$702)|0); $705 = ($704|0)!=(0); if (!($705)) { break; } $706 = $layout; $707 = HEAP32[$706>>2]|0; $708 = $707 & 4096; $709 = ($708|0)!=(0); $710 = $layout; $711 = HEAP32[$710>>2]|0; $712 = $711 & -4097; $713 = $711 | 4096; $714 = $709 ? $712 : $713; $715 = $layout; HEAP32[$715>>2] = $714; } } while(0); $716 = $2; $717 = (_nk_strlen($716)|0); $text_len = $717; ;HEAP32[$label>>2]=0|0;HEAP32[$label+4>>2]=0|0;HEAP32[$label+8>>2]=0|0;HEAP32[$label+12>>2]=0|0; $718 = $font; $719 = ((($718)) + 8|0); $720 = HEAP32[$719>>2]|0; $721 = $font; $722 = $font; $723 = ((($722)) + 4|0); $724 = +HEAPF32[$723>>2]; $725 = $2; $726 = $text_len; ;HEAP32[$$byval_copy12>>2]=HEAP32[$721>>2]|0; $727 = (+FUNCTION_TABLE_didii[$720 & 15]($$byval_copy12,$724,$725,$726)); $t = $727; $728 = +HEAPF32[$header>>2]; $729 = $style; $730 = ((($729)) + 4784|0); $731 = ((($730)) + 344|0); $732 = +HEAPF32[$731>>2]; $733 = $728 + $732; HEAPF32[$label>>2] = $733; $734 = $style; $735 = ((($734)) + 4784|0); $736 = ((($735)) + 352|0); $737 = +HEAPF32[$736>>2]; $738 = +HEAPF32[$label>>2]; $739 = $738 + $737; HEAPF32[$label>>2] = $739; $740 = ((($header)) + 4|0); $741 = +HEAPF32[$740>>2]; $742 = $style; $743 = ((($742)) + 4784|0); $744 = ((($743)) + 352|0); $745 = ((($744)) + 4|0); $746 = +HEAPF32[$745>>2]; $747 = $741 + $746; $748 = ((($label)) + 4|0); HEAPF32[$748>>2] = $747; $749 = $font; $750 = ((($749)) + 4|0); $751 = +HEAPF32[$750>>2]; $752 = $style; $753 = ((($752)) + 4784|0); $754 = ((($753)) + 352|0); $755 = ((($754)) + 4|0); $756 = +HEAPF32[$755>>2]; $757 = 2.0 * $756; $758 = $751 + $757; $759 = ((($label)) + 12|0); HEAPF32[$759>>2] = $758; $760 = $t; $761 = $style; $762 = ((($761)) + 4784|0); $763 = ((($762)) + 360|0); $764 = +HEAPF32[$763>>2]; $765 = 2.0 * $764; $766 = $760 + $765; $767 = ((($label)) + 8|0); HEAPF32[$767>>2] = $766; _nk_vec2($12,0.0,0.0); ;HEAP32[$text>>2]=HEAP32[$12>>2]|0;HEAP32[$text+4>>2]=HEAP32[$12+4>>2]|0; $768 = $out; $769 = $2; $770 = $text_len; $771 = $font; ;HEAP32[$label$byval_copy>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy+12>>2]=HEAP32[$label+12>>2]|0; _nk_widget_text($768,$label$byval_copy,$769,$770,$text,17,$771); } $772 = $win; $773 = ((($772)) + 8|0); $774 = HEAP32[$773>>2]|0; $775 = $774 & 4096; $776 = ($775|0)!=(0); if ($776) { $777 = $layout; $778 = HEAP32[$777>>2]|0; $779 = $778 & 4096; $780 = ($779|0)!=(0); if (!($780)) { $781 = ((($item_spacing)) + 4|0); $782 = +HEAPF32[$781>>2]; $783 = 2.0 * $782; $784 = $style; $785 = ((($784)) + 4784|0); $786 = ((($785)) + 444|0); $787 = +HEAPF32[$786>>2]; $788 = $783 + $787; $789 = $layout; $790 = ((($789)) + 92|0); $791 = ((($790)) + 8|0); $792 = +HEAPF32[$791>>2]; $793 = $792 + $788; HEAPF32[$791>>2] = $793; } } $794 = $layout; $795 = HEAP32[$794>>2]|0; $796 = $795 & 4096; $797 = ($796|0)!=(0); $798 = $layout; do { if ($797) { $799 = ((($798)) + 92|0); $800 = ((($799)) + 8|0); HEAPF32[$800>>2] = 0.0; $801 = $out; $802 = $layout; $803 = ((($802)) + 4|0); $804 = +HEAPF32[$803>>2]; $805 = $layout; $806 = ((($805)) + 4|0); $807 = ((($806)) + 4|0); $808 = +HEAPF32[$807>>2]; $809 = $layout; $810 = ((($809)) + 4|0); $811 = ((($810)) + 8|0); $812 = +HEAPF32[$811>>2]; $813 = $layout; $814 = ((($813)) + 92|0); $815 = ((($814)) + 8|0); $816 = +HEAPF32[$815>>2]; _nk_rect($13,$804,$808,$812,$816); $817 = $style; $818 = ((($817)) + 4784|0); $819 = ((($818)) + 388|0); ;HEAP32[$$byval_copy13>>2]=HEAP32[$13>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[$$byval_copy13+8>>2]=HEAP32[$13+8>>2]|0;HEAP32[$$byval_copy13+12>>2]=HEAP32[$13+12>>2]|0; ;HEAP8[$$byval_copy14>>0]=HEAP8[$819>>0]|0;HEAP8[$$byval_copy14+1>>0]=HEAP8[$819+1>>0]|0;HEAP8[$$byval_copy14+2>>0]=HEAP8[$819+2>>0]|0;HEAP8[$$byval_copy14+3>>0]=HEAP8[$819+3>>0]|0; _nk_fill_rect($801,$$byval_copy13,0.0,$$byval_copy14); } else { $820 = HEAP32[$798>>2]|0; $821 = $820 & 64; $822 = ($821|0)!=(0); if ($822) { $850 = $out; $851 = $layout; $852 = ((($851)) + 4|0); $853 = +HEAPF32[$852>>2]; $854 = $layout; $855 = ((($854)) + 4|0); $856 = ((($855)) + 4|0); $857 = +HEAPF32[$856>>2]; $858 = $layout; $859 = ((($858)) + 4|0); $860 = ((($859)) + 8|0); $861 = +HEAPF32[$860>>2]; $862 = $layout; $863 = ((($862)) + 92|0); $864 = ((($863)) + 8|0); $865 = +HEAPF32[$864>>2]; $866 = ((($window_padding)) + 4|0); $867 = +HEAPF32[$866>>2]; $868 = $865 + $867; _nk_rect($14,$853,$857,$861,$868); $869 = $style; $870 = ((($869)) + 4784|0); $871 = ((($870)) + 388|0); ;HEAP32[$$byval_copy17>>2]=HEAP32[$14>>2]|0;HEAP32[$$byval_copy17+4>>2]=HEAP32[$14+4>>2]|0;HEAP32[$$byval_copy17+8>>2]=HEAP32[$14+8>>2]|0;HEAP32[$$byval_copy17+12>>2]=HEAP32[$14+12>>2]|0; ;HEAP8[$$byval_copy18>>0]=HEAP8[$871>>0]|0;HEAP8[$$byval_copy18+1>>0]=HEAP8[$871+1>>0]|0;HEAP8[$$byval_copy18+2>>0]=HEAP8[$871+2>>0]|0;HEAP8[$$byval_copy18+3>>0]=HEAP8[$871+3>>0]|0; _nk_fill_rect($850,$$byval_copy17,0.0,$$byval_copy18); break; } $823 = $layout; $824 = ((($823)) + 4|0); ;HEAP32[$body>>2]=HEAP32[$824>>2]|0;HEAP32[$body+4>>2]=HEAP32[$824+4>>2]|0;HEAP32[$body+8>>2]=HEAP32[$824+8>>2]|0;HEAP32[$body+12>>2]=HEAP32[$824+12>>2]|0; $825 = $header_active; $826 = ($825|0)!=(0); if ($826) { $827 = $layout; $828 = ((($827)) + 48|0); $829 = +HEAPF32[$828>>2]; $830 = $829 - 0.5; $831 = ((($body)) + 4|0); $832 = +HEAPF32[$831>>2]; $833 = $832 + $830; HEAPF32[$831>>2] = $833; $834 = $layout; $835 = ((($834)) + 48|0); $836 = +HEAPF32[$835>>2]; $837 = ((($body)) + 12|0); $838 = +HEAPF32[$837>>2]; $839 = $838 - $836; HEAPF32[$837>>2] = $839; } $840 = $style; $841 = ((($840)) + 4784|0); $842 = ((($841)) + 368|0); $843 = HEAP32[$842>>2]|0; $844 = ($843|0)==(1); $845 = $out; $846 = $style; $847 = ((($846)) + 4784|0); $848 = ((($847)) + 368|0); $849 = ((($848)) + 4|0); if ($844) { ;HEAP32[$body$byval_copy>>2]=HEAP32[$body>>2]|0;HEAP32[$body$byval_copy+4>>2]=HEAP32[$body+4>>2]|0;HEAP32[$body$byval_copy+8>>2]=HEAP32[$body+8>>2]|0;HEAP32[$body$byval_copy+12>>2]=HEAP32[$body+12>>2]|0; _nk_draw_image($845,$body$byval_copy,$849); break; } else { ;HEAP32[$body$byval_copy15>>2]=HEAP32[$body>>2]|0;HEAP32[$body$byval_copy15+4>>2]=HEAP32[$body+4>>2]|0;HEAP32[$body$byval_copy15+8>>2]=HEAP32[$body+8>>2]|0;HEAP32[$body$byval_copy15+12>>2]=HEAP32[$body+12>>2]|0; ;HEAP8[$$byval_copy16>>0]=HEAP8[$849>>0]|0;HEAP8[$$byval_copy16+1>>0]=HEAP8[$849+1>>0]|0;HEAP8[$$byval_copy16+2>>0]=HEAP8[$849+2>>0]|0;HEAP8[$$byval_copy16+3>>0]=HEAP8[$849+3>>0]|0; _nk_fill_rect($845,$body$byval_copy15,0.0,$$byval_copy16); break; } } } while(0); $872 = $win; $873 = ((($872)) + 8|0); $874 = HEAP32[$873>>2]|0; $875 = $874 & 64; $876 = ($875|0)!=(0); $877 = $layout; $878 = ((($877)) + 4|0); $879 = +HEAPF32[$878>>2]; if ($876) { $893 = $layout; $894 = ((($893)) + 56|0); HEAPF32[$894>>2] = $879; $895 = $layout; $896 = ((($895)) + 36|0); $897 = +HEAPF32[$896>>2]; $898 = $layout; $899 = ((($898)) + 56|0); $900 = ((($899)) + 8|0); HEAPF32[$900>>2] = $897; } else { $880 = +HEAPF32[$window_padding>>2]; $881 = $879 + $880; $882 = $layout; $883 = ((($882)) + 56|0); HEAPF32[$883>>2] = $881; $884 = $layout; $885 = ((($884)) + 36|0); $886 = +HEAPF32[$885>>2]; $887 = +HEAPF32[$window_padding>>2]; $888 = 2.0 * $887; $889 = $886 - $888; $890 = $layout; $891 = ((($890)) + 56|0); $892 = ((($891)) + 8|0); HEAPF32[$892>>2] = $889; } $901 = $layout; $902 = ((($901)) + 4|0); $903 = ((($902)) + 12|0); $904 = +HEAPF32[$903>>2]; $905 = $layout; $906 = ((($905)) + 44|0); $907 = +HEAPF32[$906>>2]; $908 = $layout; $909 = ((($908)) + 48|0); $910 = +HEAPF32[$909>>2]; $911 = $907 + $910; $912 = $904 - $911; $913 = $layout; $914 = ((($913)) + 56|0); $915 = ((($914)) + 12|0); HEAPF32[$915>>2] = $912; $916 = $style; $917 = ((($916)) + 4784|0); $918 = ((($917)) + 480|0); $919 = ((($918)) + 4|0); $920 = +HEAPF32[$919>>2]; $921 = 2.0 * $920; $922 = $layout; $923 = ((($922)) + 56|0); $924 = ((($923)) + 12|0); $925 = +HEAPF32[$924>>2]; $926 = $925 - $921; HEAPF32[$924>>2] = $926; $927 = $layout; $928 = ((($927)) + 4|0); $929 = ((($928)) + 4|0); $930 = +HEAPF32[$929>>2]; $931 = $layout; $932 = ((($931)) + 56|0); $933 = ((($932)) + 4|0); HEAPF32[$933>>2] = $930; $934 = $win; $935 = ((($934)) + 8|0); $936 = HEAP32[$935>>2]|0; $937 = $936 & 262144; $938 = ($937|0)!=(0); if (!($938)) { $939 = $win; $940 = ((($939)) + 8|0); $941 = HEAP32[$940>>2]|0; $942 = $941 & 524288; $943 = ($942|0)!=(0); if (!($943)) { $944 = $layout; $945 = ((($944)) + 48|0); $946 = +HEAPF32[$945>>2]; $947 = $style; $948 = ((($947)) + 4784|0); $949 = ((($948)) + 480|0); $950 = ((($949)) + 4|0); $951 = +HEAPF32[$950>>2]; $952 = $946 + $951; $953 = $layout; $954 = ((($953)) + 56|0); $955 = ((($954)) + 4|0); $956 = +HEAPF32[$955>>2]; $957 = $956 + $952; HEAPF32[$955>>2] = $957; } } $958 = $win; $959 = ((($958)) + 32|0); $960 = ((($959)) + 4|0); $961 = $layout; $962 = ((($961)) + 56|0); $963 = +HEAPF32[$962>>2]; $964 = $layout; $965 = ((($964)) + 56|0); $966 = ((($965)) + 4|0); $967 = +HEAPF32[$966>>2]; $968 = $layout; $969 = ((($968)) + 56|0); $970 = +HEAPF32[$969>>2]; $971 = $layout; $972 = ((($971)) + 56|0); $973 = ((($972)) + 8|0); $974 = +HEAPF32[$973>>2]; $975 = $970 + $974; $976 = $layout; $977 = ((($976)) + 56|0); $978 = ((($977)) + 4|0); $979 = +HEAPF32[$978>>2]; $980 = $layout; $981 = ((($980)) + 56|0); $982 = ((($981)) + 12|0); $983 = +HEAPF32[$982>>2]; $984 = $979 + $983; _nk_unify($clip,$960,$963,$967,$975,$984); $985 = $out; ;HEAP32[$clip$byval_copy>>2]=HEAP32[$clip>>2]|0;HEAP32[$clip$byval_copy+4>>2]=HEAP32[$clip+4>>2]|0;HEAP32[$clip$byval_copy+8>>2]=HEAP32[$clip+8>>2]|0;HEAP32[$clip$byval_copy+12>>2]=HEAP32[$clip+12>>2]|0; _nk_push_scissor($985,$clip$byval_copy); $986 = $layout; $987 = ((($986)) + 56|0); ;HEAP32[$987>>2]=HEAP32[$clip>>2]|0;HEAP32[$987+4>>2]=HEAP32[$clip+4>>2]|0;HEAP32[$987+8>>2]=HEAP32[$clip+8>>2]|0;HEAP32[$987+12>>2]=HEAP32[$clip+12>>2]|0; $988 = $layout; $989 = ((($988)) + 4|0); $990 = +HEAPF32[$989>>2]; $991 = $win; $992 = ((($991)) + 32|0); $993 = ((($992)) + 4|0); HEAPF32[$993>>2] = $990; $994 = $layout; $995 = ((($994)) + 36|0); $996 = +HEAPF32[$995>>2]; $997 = $win; $998 = ((($997)) + 32|0); $999 = ((($998)) + 4|0); $1000 = ((($999)) + 8|0); HEAPF32[$1000>>2] = $996; $1001 = $win; $1002 = ((($1001)) + 8|0); $1003 = HEAP32[$1002>>2]|0; $1004 = $1003 & 128; $1005 = ($1004|0)!=(0); if (!($1005)) { $1006 = +HEAPF32[$scrollbar_size>>2]; $1007 = $win; $1008 = ((($1007)) + 32|0); $1009 = ((($1008)) + 4|0); $1010 = ((($1009)) + 8|0); $1011 = +HEAPF32[$1010>>2]; $1012 = $1011 + $1006; HEAPF32[$1010>>2] = $1012; } $1013 = $layout; $1014 = HEAP32[$1013>>2]|0; $1015 = $1014 & 2048; $1016 = ($1015|0)!=(0); if ($1016) { $1023 = 0; } else { $1017 = $layout; $1018 = HEAP32[$1017>>2]|0; $1019 = $1018 & 4096; $1020 = ($1019|0)!=(0); $1021 = $1020 ^ 1; $1023 = $1021; } $1022 = $1023&1; $0 = $1022; $1024 = $0; STACKTOP = sp;return ($1024|0); } } } $0 = 0; $1024 = $0; STACKTOP = sp;return ($1024|0); } function _nk_end($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),15104,(28444|0)); // unreachable; } $3 = $0; $4 = ((($3)) + 11168|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((28451|0),(13400|0),15105,(28444|0)); // unreachable; } $7 = $0; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ((($9)) + 72|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((28516|0),(13400|0),15106,(28444|0)); // unreachable; } $13 = $0; $14 = ($13|0)!=(0|0); if (!($14)) { STACKTOP = sp;return; } $15 = $0; $16 = ((($15)) + 11168|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0|0); if (!($18)) { STACKTOP = sp;return; } $19 = $0; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ((($21)) + 8|0); $23 = HEAP32[$22>>2]|0; $24 = $23 & 2048; $25 = ($24|0)!=(0); $26 = $0; if ($25) { $27 = ((($26)) + 11168|0); HEAP32[$27>>2] = 0; STACKTOP = sp;return; } else { _nk_panel_end($26); $28 = $0; $29 = ((($28)) + 11168|0); HEAP32[$29>>2] = 0; STACKTOP = sp;return; } } function _nk_panel_end($ctx) { $ctx = $ctx|0; var $$byval_copy = 0, $$byval_copy10 = 0, $$byval_copy11 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0.0, $1001 = 0.0, $1002 = 0, $1003 = 0, $1004 = 0.0, $1005 = 0.0, $1006 = 0.0, $1007 = 0, $1008 = 0, $1009 = 0; var $101 = 0.0, $1010 = 0.0, $1011 = 0.0, $1012 = 0.0, $1013 = 0.0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0.0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0.0, $1026 = 0, $1027 = 0.0; var $1028 = 0.0, $1029 = 0, $103 = 0, $1030 = 0.0, $1031 = 0, $1032 = 0, $1033 = 0.0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0.0, $1038 = 0, $1039 = 0.0, $104 = 0.0, $1040 = 0.0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0.0, $1045 = 0; var $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0; var $1064 = 0, $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $1071 = 0, $1072 = 0, $1073 = 0, $1074 = 0, $1075 = 0, $1076 = 0, $1077 = 0, $1078 = 0, $1079 = 0, $108 = 0, $1080 = 0, $1081 = 0; var $1082 = 0, $1083 = 0, $1084 = 0, $1085 = 0, $1086 = 0, $1087 = 0, $1088 = 0, $1089 = 0, $109 = 0, $1090 = 0, $1091 = 0, $1092 = 0, $1093 = 0, $1094 = 0, $1095 = 0, $1096 = 0, $1097 = 0, $1098 = 0, $1099 = 0, $11 = 0; var $110 = 0, $1100 = 0, $1101 = 0, $1102 = 0, $1103 = 0, $1104 = 0, $1105 = 0, $1106 = 0, $1107 = 0, $1108 = 0, $1109 = 0, $111 = 0, $1110 = 0, $1111 = 0, $1112 = 0, $1113 = 0, $1114 = 0, $1115 = 0, $1116 = 0, $1117 = 0; var $1118 = 0, $1119 = 0, $112 = 0, $1120 = 0, $1121 = 0, $1122 = 0, $1123 = 0, $1124 = 0, $1125 = 0, $1126 = 0, $1127 = 0, $1128 = 0, $1129 = 0, $113 = 0, $1130 = 0, $1131 = 0, $1132 = 0, $1133 = 0, $1134 = 0, $1135 = 0; var $1136 = 0, $1137 = 0, $1138 = 0, $1139 = 0, $114 = 0, $1140 = 0, $1141 = 0, $1142 = 0, $1143 = 0, $1144 = 0, $1145 = 0, $1146 = 0, $1147 = 0, $1148 = 0, $1149 = 0, $115 = 0, $1150 = 0, $1151 = 0, $1152 = 0, $1153 = 0; var $1154 = 0, $1155 = 0, $1156 = 0, $1157 = 0, $1158 = 0, $1159 = 0, $116 = 0, $1160 = 0, $1161 = 0, $1162 = 0, $1163 = 0, $1164 = 0, $1165 = 0, $1166 = 0, $1167 = 0, $1168 = 0, $1169 = 0, $117 = 0.0, $1170 = 0, $1171 = 0; var $1172 = 0, $1173 = 0, $1174 = 0, $1175 = 0, $1176 = 0, $1177 = 0, $1178 = 0, $1179 = 0, $118 = 0, $1180 = 0, $1181 = 0, $1182 = 0, $1183 = 0, $1184 = 0, $1185 = 0, $1186 = 0, $1187 = 0, $1188 = 0, $1189 = 0, $119 = 0; var $1190 = 0, $1191 = 0, $1192 = 0, $1193 = 0, $1194 = 0, $1195 = 0, $1196 = 0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0, $123 = 0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0; var $131 = 0, $132 = 0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; var $15 = 0, $150 = 0, $151 = 0, $152 = 0.0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0.0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0, $164 = 0, $165 = 0, $166 = 0.0, $167 = 0; var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0, $176 = 0, $177 = 0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0, $183 = 0, $184 = 0.0, $185 = 0; var $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0.0, $202 = 0; var $203 = 0, $204 = 0.0, $205 = 0.0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0.0, $215 = 0, $216 = 0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0, $220 = 0; var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0.0, $235 = 0, $236 = 0, $237 = 0, $238 = 0.0, $239 = 0; var $24 = 0, $240 = 0, $241 = 0.0, $242 = 0.0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0.0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0; var $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0.0, $269 = 0, $27 = 0, $270 = 0, $271 = 0.0, $272 = 0.0, $273 = 0, $274 = 0, $275 = 0; var $276 = 0.0, $277 = 0, $278 = 0, $279 = 0.0, $28 = 0, $280 = 0.0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0.0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0.0, $291 = 0.0, $292 = 0, $293 = 0; var $294 = 0.0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0.0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0.0, $303 = 0, $304 = 0, $305 = 0.0, $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0; var $311 = 0.0, $312 = 0.0, $313 = 0, $314 = 0, $315 = 0.0, $316 = 0.0, $317 = 0, $318 = 0.0, $319 = 0.0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0.0, $327 = 0.0, $328 = 0.0, $329 = 0; var $33 = 0, $330 = 0, $331 = 0, $332 = 0.0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0.0, $338 = 0, $339 = 0.0, $34 = 0, $340 = 0.0, $341 = 0, $342 = 0, $343 = 0, $344 = 0.0, $345 = 0, $346 = 0, $347 = 0; var $348 = 0.0, $349 = 0.0, $35 = 0, $350 = 0, $351 = 0.0, $352 = 0.0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0.0, $359 = 0, $36 = 0, $360 = 0.0, $361 = 0.0, $362 = 0, $363 = 0.0, $364 = 0.0, $365 = 0; var $366 = 0, $367 = 0.0, $368 = 0, $369 = 0.0, $37 = 0, $370 = 0.0, $371 = 0, $372 = 0.0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0.0, $382 = 0.0, $383 = 0.0; var $384 = 0.0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0.0, $391 = 0.0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0.0, $4 = 0, $40 = 0, $400 = 0.0; var $401 = 0.0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0.0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0.0, $416 = 0.0, $417 = 0.0, $418 = 0, $419 = 0; var $42 = 0, $420 = 0, $421 = 0.0, $422 = 0, $423 = 0, $424 = 0, $425 = 0.0, $426 = 0.0, $427 = 0, $428 = 0, $429 = 0.0, $43 = 0, $430 = 0.0, $431 = 0, $432 = 0.0, $433 = 0.0, $434 = 0, $435 = 0, $436 = 0.0, $437 = 0; var $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0.0, $443 = 0, $444 = 0, $445 = 0.0, $446 = 0, $447 = 0.0, $448 = 0, $449 = 0, $45 = 0, $450 = 0.0, $451 = 0, $452 = 0.0, $453 = 0, $454 = 0, $455 = 0; var $456 = 0.0, $457 = 0, $458 = 0, $459 = 0.0, $46 = 0, $460 = 0, $461 = 0.0, $462 = 0, $463 = 0, $464 = 0.0, $465 = 0, $466 = 0.0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0.0, $471 = 0, $472 = 0, $473 = 0; var $474 = 0.0, $475 = 0.0, $476 = 0, $477 = 0, $478 = 0, $479 = 0.0, $48 = 0, $480 = 0.0, $481 = 0, $482 = 0.0, $483 = 0, $484 = 0, $485 = 0.0, $486 = 0, $487 = 0.0, $488 = 0.0, $489 = 0.0, $49 = 0, $490 = 0, $491 = 0; var $492 = 0.0, $493 = 0.0, $494 = 0.0, $495 = 0.0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0.0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0.0, $506 = 0.0, $507 = 0, $508 = 0.0, $509 = 0; var $51 = 0, $510 = 0, $511 = 0.0, $512 = 0.0, $513 = 0, $514 = 0, $515 = 0.0, $516 = 0.0, $517 = 0, $518 = 0, $519 = 0.0, $52 = 0, $520 = 0.0, $521 = 0.0, $522 = 0.0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0; var $528 = 0.0, $529 = 0.0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0.0; var $546 = 0.0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0.0, $551 = 0.0, $552 = 0, $553 = 0, $554 = 0.0, $555 = 0.0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0.0, $563 = 0; var $564 = 0.0, $565 = 0.0, $566 = 0, $567 = 0, $568 = 0.0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0.0, $573 = 0.0, $574 = 0.0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0; var $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0; var $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0; var $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0.0, $627 = 0, $628 = 0, $629 = 0.0, $63 = 0, $630 = 0.0, $631 = 0.0, $632 = 0, $633 = 0, $634 = 0, $635 = 0.0; var $636 = 0, $637 = 0, $638 = 0.0, $639 = 0.0, $64 = 0, $640 = 0, $641 = 0, $642 = 0.0, $643 = 0.0, $644 = 0, $645 = 0, $646 = 0.0, $647 = 0, $648 = 0, $649 = 0, $65 = 0.0, $650 = 0.0, $651 = 0.0, $652 = 0, $653 = 0; var $654 = 0.0, $655 = 0.0, $656 = 0, $657 = 0, $658 = 0, $659 = 0.0, $66 = 0, $660 = 0, $661 = 0, $662 = 0.0, $663 = 0.0, $664 = 0, $665 = 0, $666 = 0.0, $667 = 0.0, $668 = 0, $669 = 0, $67 = 0, $670 = 0.0, $671 = 0; var $672 = 0, $673 = 0, $674 = 0.0, $675 = 0, $676 = 0, $677 = 0.0, $678 = 0.0, $679 = 0.0, $68 = 0.0, $680 = 0, $681 = 0, $682 = 0, $683 = 0.0, $684 = 0, $685 = 0, $686 = 0.0, $687 = 0.0, $688 = 0.0, $689 = 0, $69 = 0.0; var $690 = 0, $691 = 0.0, $692 = 0, $693 = 0, $694 = 0, $695 = 0.0, $696 = 0.0, $697 = 0, $698 = 0, $699 = 0.0, $7 = 0, $70 = 0, $700 = 0.0, $701 = 0, $702 = 0, $703 = 0, $704 = 0.0, $705 = 0, $706 = 0, $707 = 0.0; var $708 = 0.0, $709 = 0.0, $71 = 0, $710 = 0, $711 = 0, $712 = 0.0, $713 = 0, $714 = 0, $715 = 0, $716 = 0.0, $717 = 0, $718 = 0, $719 = 0.0, $72 = 0, $720 = 0.0, $721 = 0.0, $722 = 0.0, $723 = 0, $724 = 0, $725 = 0.0; var $726 = 0.0, $727 = 0, $728 = 0, $729 = 0.0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0.0, $734 = 0.0, $735 = 0, $736 = 0, $737 = 0.0, $738 = 0.0, $739 = 0.0, $74 = 0, $740 = 0, $741 = 0, $742 = 0.0, $743 = 0.0; var $744 = 0, $745 = 0, $746 = 0.0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0.0, $751 = 0, $752 = 0, $753 = 0.0, $754 = 0.0, $755 = 0.0, $756 = 0, $757 = 0, $758 = 0, $759 = 0.0, $76 = 0, $760 = 0, $761 = 0; var $762 = 0.0, $763 = 0.0, $764 = 0.0, $765 = 0, $766 = 0, $767 = 0.0, $768 = 0, $769 = 0, $77 = 0, $770 = 0.0, $771 = 0.0, $772 = 0.0, $773 = 0.0, $774 = 0, $775 = 0, $776 = 0.0, $777 = 0.0, $778 = 0, $779 = 0, $78 = 0; var $780 = 0.0, $781 = 0, $782 = 0, $783 = 0, $784 = 0.0, $785 = 0, $786 = 0, $787 = 0, $788 = 0.0, $789 = 0.0, $79 = 0, $790 = 0, $791 = 0, $792 = 0.0, $793 = 0.0, $794 = 0, $795 = 0, $796 = 0, $797 = 0.0, $798 = 0; var $799 = 0, $8 = 0, $80 = 0.0, $800 = 0.0, $801 = 0.0, $802 = 0.0, $803 = 0, $804 = 0, $805 = 0.0, $806 = 0, $807 = 0, $808 = 0, $809 = 0.0, $81 = 0, $810 = 0.0, $811 = 0, $812 = 0, $813 = 0.0, $814 = 0.0, $815 = 0.0; var $816 = 0, $817 = 0, $818 = 0.0, $819 = 0.0, $82 = 0, $820 = 0, $821 = 0, $822 = 0.0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0.0; var $834 = 0.0, $835 = 0.0, $836 = 0, $837 = 0.0, $838 = 0.0, $839 = 0.0, $84 = 0.0, $840 = 0.0, $841 = 0, $842 = 0.0, $843 = 0, $844 = 0.0, $845 = 0.0, $846 = 0, $847 = 0, $848 = 0.0, $849 = 0, $85 = 0.0, $850 = 0.0, $851 = 0.0; var $852 = 0.0, $853 = 0, $854 = 0, $855 = 0.0, $856 = 0, $857 = 0, $858 = 0, $859 = 0.0, $86 = 0, $860 = 0.0, $861 = 0.0, $862 = 0.0, $863 = 0.0, $864 = 0.0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0; var $870 = 0.0, $871 = 0, $872 = 0, $873 = 0.0, $874 = 0.0, $875 = 0, $876 = 0.0, $877 = 0.0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0.0, $882 = 0, $883 = 0, $884 = 0, $885 = 0.0, $886 = 0.0, $887 = 0, $888 = 0.0; var $889 = 0.0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0.0, $898 = 0.0, $899 = 0.0, $9 = 0, $90 = 0.0, $900 = 0.0, $901 = 0, $902 = 0, $903 = 0.0, $904 = 0.0, $905 = 0.0; var $906 = 0.0, $907 = 0.0, $908 = 0.0, $909 = 0.0, $91 = 0, $910 = 0.0, $911 = 0.0, $912 = 0.0, $913 = 0.0, $914 = 0.0, $915 = 0.0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0; var $924 = 0, $925 = 0, $926 = 0.0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0.0, $932 = 0, $933 = 0, $934 = 0, $935 = 0.0, $936 = 0.0, $937 = 0, $938 = 0.0, $939 = 0.0, $94 = 0.0, $940 = 0.0, $941 = 0.0; var $942 = 0, $943 = 0.0, $944 = 0.0, $945 = 0, $946 = 0.0, $947 = 0.0, $948 = 0.0, $949 = 0.0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0; var $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0; var $979 = 0, $98 = 0.0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0.0, $985 = 0, $986 = 0, $987 = 0, $988 = 0.0, $989 = 0.0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0.0, $995 = 0, $996 = 0; var $997 = 0, $998 = 0, $999 = 0.0, $border = 0, $border$byval_copy = 0, $border$byval_copy5 = 0, $border$byval_copy6 = 0, $border$byval_copy7 = 0, $border$byval_copy8 = 0, $bounds = 0, $bounds$byval_copy = 0, $bounds1 = 0, $bounds1$byval_copy = 0, $bounds2 = 0, $bounds2$byval_copy = 0, $bounds2$byval_copy4 = 0, $delta = 0, $footer = 0, $footer$byval_copy = 0, $in = 0; var $incursor = 0, $item_spacing = 0, $layout = 0, $nk_null_rect$byval_copy = 0, $or$cond = 0, $out = 0, $padding_y = 0.0, $prev_x = 0.0, $prev_y = 0.0, $scaler = 0, $scaler_h = 0.0, $scaler_size = 0, $scaler_w = 0.0, $scaler_x = 0.0, $scaler_y = 0.0, $scroll_has_scrolling = 0, $scroll_inc = 0.0, $scroll_offset = 0.0, $scroll_step = 0.0, $scroll_target = 0.0; var $scrollbar_size = 0, $state = 0, $state3 = 0, $style = 0, $window = 0, $window_padding = 0, $window_size = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 416|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy11 = sp + 360|0; $$byval_copy10 = sp + 412|0; $$byval_copy9 = sp + 344|0; $border$byval_copy8 = sp + 408|0; $border$byval_copy7 = sp + 404|0; $border$byval_copy6 = sp + 400|0; $border$byval_copy5 = sp + 396|0; $border$byval_copy = sp + 392|0; $bounds2$byval_copy4 = sp + 328|0; $bounds2$byval_copy = sp + 312|0; $$byval_copy3 = sp + 388|0; $bounds1$byval_copy = sp + 296|0; $$byval_copy2 = sp + 384|0; $footer$byval_copy = sp + 280|0; $$byval_copy = sp + 380|0; $bounds$byval_copy = sp + 264|0; $nk_null_rect$byval_copy = sp + 248|0; $scrollbar_size = sp + 216|0; $scaler_size = sp + 208|0; $item_spacing = sp + 200|0; $window_padding = sp + 192|0; $footer = sp + 176|0; $bounds = sp + 160|0; $bounds1 = sp + 144|0; $bounds2 = sp + 128|0; $state = sp + 100|0; $state3 = sp + 96|0; $border = sp + 376|0; $1 = sp + 56|0; $delta = sp + 48|0; $window_size = sp + 32|0; $2 = sp + 16|0; $3 = sp + 8|0; $4 = sp; $0 = $ctx; ;HEAP32[$footer>>2]=0|0;HEAP32[$footer+4>>2]=0|0;HEAP32[$footer+8>>2]=0|0;HEAP32[$footer+12>>2]=0|0; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),15761,(31404|0)); // unreachable; } $7 = $0; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28537|0),(13400|0),15762,(31404|0)); // unreachable; } $11 = $0; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($13)) + 72|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28516|0),(13400|0),15763,(31404|0)); // unreachable; } $17 = $0; $18 = ($17|0)!=(0|0); if (!($18)) { STACKTOP = sp;return; } $19 = $0; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { STACKTOP = sp;return; } $23 = $0; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ((($25)) + 72|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if (!($28)) { STACKTOP = sp;return; } $29 = $0; $30 = ((($29)) + 11168|0); $31 = HEAP32[$30>>2]|0; $window = $31; $32 = $window; $33 = ((($32)) + 72|0); $34 = HEAP32[$33>>2]|0; $layout = $34; $35 = $0; $36 = ((($35)) + 300|0); $style = $36; $37 = $window; $38 = ((($37)) + 32|0); $out = $38; $39 = $layout; $40 = HEAP32[$39>>2]|0; $41 = $40 & 1024; $42 = ($41|0)!=(0); $43 = $0; $44 = $42 ? 0 : $43; $in = $44; $45 = $layout; $46 = HEAP32[$45>>2]|0; $47 = $46 & 8192; $48 = ($47|0)!=(0); if (!($48)) { $49 = $out; ;HEAP32[$nk_null_rect$byval_copy>>2]=HEAP32[8>>2]|0;HEAP32[$nk_null_rect$byval_copy+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$nk_null_rect$byval_copy+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$nk_null_rect$byval_copy+12>>2]=HEAP32[8+12>>2]|0; _nk_push_scissor($49,$nk_null_rect$byval_copy); } $50 = $style; $51 = ((($50)) + 4784|0); $52 = ((($51)) + 488|0); ;HEAP32[$item_spacing>>2]=HEAP32[$52>>2]|0;HEAP32[$item_spacing+4>>2]=HEAP32[$52+4>>2]|0; $53 = $style; $54 = ((($53)) + 4784|0); $55 = ((($54)) + 480|0); ;HEAP32[$window_padding>>2]=HEAP32[$55>>2]|0;HEAP32[$window_padding+4>>2]=HEAP32[$55+4>>2]|0; $56 = $style; $57 = ((($56)) + 4784|0); $58 = ((($57)) + 496|0); ;HEAP32[$scrollbar_size>>2]=HEAP32[$58>>2]|0;HEAP32[$scrollbar_size+4>>2]=HEAP32[$58+4>>2]|0; $59 = $style; $60 = ((($59)) + 4784|0); $61 = ((($60)) + 472|0); ;HEAP32[$scaler_size>>2]=HEAP32[$61>>2]|0;HEAP32[$scaler_size+4>>2]=HEAP32[$61+4>>2]|0; $62 = $layout; $63 = ((($62)) + 92|0); $64 = ((($63)) + 8|0); $65 = +HEAPF32[$64>>2]; $66 = $layout; $67 = ((($66)) + 28|0); $68 = +HEAPF32[$67>>2]; $69 = $68 + $65; HEAPF32[$67>>2] = $69; $70 = $layout; $71 = HEAP32[$70>>2]|0; $72 = $71 & 64; $73 = ($72|0)!=(0); do { if ($73) { $74 = $layout; $75 = HEAP32[$74>>2]|0; $76 = $75 & 4096; $77 = ($76|0)!=(0); if (!($77)) { $78 = $layout; $79 = ((($78)) + 28|0); $80 = +HEAPF32[$79>>2]; $81 = $layout; $82 = ((($81)) + 4|0); $83 = ((($82)) + 4|0); $84 = +HEAPF32[$83>>2]; $85 = $80 - $84; $86 = $layout; $87 = ((($86)) + 40|0); HEAPF32[$87>>2] = $85; $88 = $layout; $89 = ((($88)) + 40|0); $90 = +HEAPF32[$89>>2]; $91 = $layout; $92 = ((($91)) + 4|0); $93 = ((($92)) + 12|0); $94 = +HEAPF32[$93>>2]; $95 = $90 < $94; $96 = $layout; if ($95) { $97 = ((($96)) + 40|0); $98 = +HEAPF32[$97>>2]; $104 = $98; } else { $99 = ((($96)) + 4|0); $100 = ((($99)) + 12|0); $101 = +HEAPF32[$100>>2]; $104 = $101; } $102 = $layout; $103 = ((($102)) + 40|0); HEAPF32[$103>>2] = $104; $105 = $layout; $106 = ((($105)) + 20|0); $107 = HEAP32[$106>>2]|0; $108 = HEAP16[$107>>1]|0; $109 = $108&65535; $110 = ($109|0)==(0); if (!($110)) { $111 = $layout; $112 = HEAP32[$111>>2]|0; $113 = $112 & 128; $114 = ($113|0)!=(0); if (!($114)) { $172 = $window; $173 = ((($172)) + 12|0); $174 = +HEAPF32[$173>>2]; HEAPF32[$footer>>2] = $174; $175 = $window; $176 = ((($175)) + 12|0); $177 = ((($176)) + 8|0); $178 = +HEAPF32[$177>>2]; $179 = +HEAPF32[$scrollbar_size>>2]; $180 = $178 + $179; $181 = ((($footer)) + 8|0); HEAPF32[$181>>2] = $180; $182 = $layout; $183 = ((($182)) + 44|0); $184 = +HEAPF32[$183>>2]; $185 = ((($footer)) + 12|0); HEAPF32[$185>>2] = $184; $186 = $layout; $187 = HEAP32[$186>>2]|0; $188 = $187 & 262144; $189 = ($188|0)!=(0); if ($189) { label = 25; } else { $190 = $layout; $191 = HEAP32[$190>>2]|0; $192 = $191 & 524288; $193 = ($192|0)!=(0); if ($193) { label = 25; } else { $194 = $layout; $195 = HEAP32[$194>>2]|0; $196 = $195 & 131072; $197 = ($196|0)!=(0); if ($197) { label = 25; } else { $207 = $window; $208 = ((($207)) + 12|0); $209 = ((($208)) + 4|0); $210 = +HEAPF32[$209>>2]; $211 = $layout; $212 = ((($211)) + 40|0); $213 = +HEAPF32[$212>>2]; $214 = $210 + $213; $215 = $layout; $216 = ((($215)) + 44|0); $217 = +HEAPF32[$216>>2]; $218 = $214 + $217; $219 = ((($footer)) + 4|0); HEAPF32[$219>>2] = $218; } } } if ((label|0) == 25) { $198 = $window; $199 = ((($198)) + 12|0); $200 = ((($199)) + 4|0); $201 = +HEAPF32[$200>>2]; $202 = $layout; $203 = ((($202)) + 40|0); $204 = +HEAPF32[$203>>2]; $205 = $201 + $204; $206 = ((($footer)) + 4|0); HEAPF32[$206>>2] = $205; } $220 = $out; $221 = $style; $222 = ((($221)) + 4784|0); $223 = ((($222)) + 388|0); ;HEAP32[$footer$byval_copy>>2]=HEAP32[$footer>>2]|0;HEAP32[$footer$byval_copy+4>>2]=HEAP32[$footer+4>>2]|0;HEAP32[$footer$byval_copy+8>>2]=HEAP32[$footer+8>>2]|0;HEAP32[$footer$byval_copy+12>>2]=HEAP32[$footer+12>>2]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$223>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$223+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$223+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$223+3>>0]|0; _nk_fill_rect($220,$footer$byval_copy,0.0,$$byval_copy2); $224 = $layout; $225 = HEAP32[$224>>2]|0; $226 = $225 & 262144; $227 = ($226|0)!=(0); if ($227) { break; } $228 = $layout; $229 = HEAP32[$228>>2]|0; $230 = $229 & 524288; $231 = ($230|0)!=(0); if ($231) { break; } $232 = $layout; $233 = ((($232)) + 4|0); $234 = +HEAPF32[$233>>2]; HEAPF32[$bounds1>>2] = $234; $235 = $window; $236 = ((($235)) + 12|0); $237 = ((($236)) + 4|0); $238 = +HEAPF32[$237>>2]; $239 = $layout; $240 = ((($239)) + 40|0); $241 = +HEAPF32[$240>>2]; $242 = $238 + $241; $243 = ((($bounds1)) + 4|0); HEAPF32[$243>>2] = $242; $244 = $layout; $245 = ((($244)) + 4|0); $246 = ((($245)) + 8|0); $247 = +HEAPF32[$246>>2]; $248 = ((($bounds1)) + 8|0); HEAPF32[$248>>2] = $247; $249 = $layout; $250 = ((($249)) + 92|0); $251 = ((($250)) + 8|0); $252 = +HEAPF32[$251>>2]; $253 = ((($bounds1)) + 12|0); HEAPF32[$253>>2] = $252; $254 = $out; $255 = $style; $256 = ((($255)) + 4784|0); $257 = ((($256)) + 388|0); ;HEAP32[$bounds1$byval_copy>>2]=HEAP32[$bounds1>>2]|0;HEAP32[$bounds1$byval_copy+4>>2]=HEAP32[$bounds1+4>>2]|0;HEAP32[$bounds1$byval_copy+8>>2]=HEAP32[$bounds1+8>>2]|0;HEAP32[$bounds1$byval_copy+12>>2]=HEAP32[$bounds1+12>>2]|0; ;HEAP8[$$byval_copy3>>0]=HEAP8[$257>>0]|0;HEAP8[$$byval_copy3+1>>0]=HEAP8[$257+1>>0]|0;HEAP8[$$byval_copy3+2>>0]=HEAP8[$257+2>>0]|0;HEAP8[$$byval_copy3+3>>0]=HEAP8[$257+3>>0]|0; _nk_fill_rect($254,$bounds1$byval_copy,0.0,$$byval_copy3); break; } } $115 = $window; $116 = ((($115)) + 12|0); $117 = +HEAPF32[$116>>2]; HEAPF32[$footer>>2] = $117; $118 = $window; $119 = ((($118)) + 12|0); $120 = ((($119)) + 4|0); $121 = +HEAPF32[$120>>2]; $122 = $layout; $123 = ((($122)) + 40|0); $124 = +HEAPF32[$123>>2]; $125 = $121 + $124; $126 = ((($item_spacing)) + 4|0); $127 = +HEAPF32[$126>>2]; $128 = $125 + $127; $129 = ((($footer)) + 4|0); HEAPF32[$129>>2] = $128; $130 = $window; $131 = ((($130)) + 12|0); $132 = ((($131)) + 8|0); $133 = +HEAPF32[$132>>2]; $134 = +HEAPF32[$scrollbar_size>>2]; $135 = $133 + $134; $136 = ((($footer)) + 8|0); HEAPF32[$136>>2] = $135; $137 = $layout; $138 = ((($137)) + 44|0); HEAPF32[$138>>2] = 0.0; $139 = ((($footer)) + 12|0); HEAPF32[$139>>2] = 0.0; $140 = $layout; $141 = ((($140)) + 20|0); $142 = HEAP32[$141>>2]|0; $143 = HEAP16[$142>>1]|0; $144 = $143&65535; $145 = ($144|0)==(0); if ($145) { $146 = $layout; $147 = HEAP32[$146>>2]|0; $148 = $147 & 128; $149 = ($148|0)!=(0); if (!($149)) { $150 = $layout; $151 = ((($150)) + 4|0); $152 = +HEAPF32[$151>>2]; $153 = $layout; $154 = ((($153)) + 36|0); $155 = +HEAPF32[$154>>2]; $156 = $152 + $155; HEAPF32[$bounds>>2] = $156; $157 = $layout; $158 = ((($157)) + 56|0); $159 = ((($158)) + 4|0); $160 = +HEAPF32[$159>>2]; $161 = ((($bounds)) + 4|0); HEAPF32[$161>>2] = $160; $162 = +HEAPF32[$scrollbar_size>>2]; $163 = ((($bounds)) + 8|0); HEAPF32[$163>>2] = $162; $164 = $layout; $165 = ((($164)) + 40|0); $166 = +HEAPF32[$165>>2]; $167 = ((($bounds)) + 12|0); HEAPF32[$167>>2] = $166; $168 = $out; $169 = $style; $170 = ((($169)) + 4784|0); $171 = ((($170)) + 388|0); ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; ;HEAP8[$$byval_copy>>0]=HEAP8[$171>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$171+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$171+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$171+3>>0]|0; _nk_fill_rect($168,$bounds$byval_copy,0.0,$$byval_copy); } } } } } while(0); $258 = $layout; $259 = HEAP32[$258>>2]|0; $260 = $259 & 128; $261 = ($260|0)!=(0); if (!($261)) { $262 = $layout; $263 = HEAP32[$262>>2]|0; $264 = $263 & 4096; $265 = ($264|0)!=(0); if (!($265)) { HEAP32[$state>>2] = 0; $266 = $layout; $267 = ((($266)) + 4|0); $268 = +HEAPF32[$267>>2]; $269 = $layout; $270 = ((($269)) + 36|0); $271 = +HEAPF32[$270>>2]; $272 = $268 + $271; HEAPF32[$bounds2>>2] = $272; $273 = $layout; $274 = ((($273)) + 4|0); $275 = ((($274)) + 4|0); $276 = +HEAPF32[$275>>2]; $277 = $layout; $278 = ((($277)) + 48|0); $279 = +HEAPF32[$278>>2]; $280 = $276 + $279; $281 = $style; $282 = ((($281)) + 4784|0); $283 = ((($282)) + 480|0); $284 = ((($283)) + 4|0); $285 = +HEAPF32[$284>>2]; $286 = $280 + $285; $287 = $layout; $288 = ((($287)) + 72|0); $289 = ((($288)) + 12|0); $290 = +HEAPF32[$289>>2]; $291 = $286 + $290; $292 = ((($bounds2)) + 4|0); HEAPF32[$292>>2] = $291; $293 = ((($scrollbar_size)) + 4|0); $294 = +HEAPF32[$293>>2]; $295 = ((($bounds2)) + 8|0); HEAPF32[$295>>2] = $294; $296 = $layout; $297 = ((($296)) + 4|0); $298 = ((($297)) + 12|0); $299 = +HEAPF32[$298>>2]; $300 = $layout; $301 = ((($300)) + 44|0); $302 = +HEAPF32[$301>>2]; $303 = $layout; $304 = ((($303)) + 48|0); $305 = +HEAPF32[$304>>2]; $306 = $302 + $305; $307 = $layout; $308 = ((($307)) + 72|0); $309 = ((($308)) + 12|0); $310 = +HEAPF32[$309>>2]; $311 = $306 + $310; $312 = $299 - $311; $313 = ((($bounds2)) + 12|0); HEAPF32[$313>>2] = $312; $314 = ((($window_padding)) + 4|0); $315 = +HEAPF32[$314>>2]; $316 = 2.0 * $315; $317 = ((($bounds2)) + 12|0); $318 = +HEAPF32[$317>>2]; $319 = $318 - $316; HEAPF32[$317>>2] = $319; $320 = $layout; $321 = HEAP32[$320>>2]|0; $322 = $321 & 1; $323 = ($322|0)!=(0); if ($323) { $324 = $layout; $325 = ((($324)) + 52|0); $326 = +HEAPF32[$325>>2]; $327 = +HEAPF32[$bounds2>>2]; $328 = $327 - $326; HEAPF32[$bounds2>>2] = $328; } $329 = $layout; $330 = ((($329)) + 72|0); $331 = ((($330)) + 12|0); $332 = +HEAPF32[$331>>2]; $333 = $332 != 0.0; if ($333) { $334 = $layout; $335 = ((($334)) + 72|0); $336 = ((($335)) + 12|0); $337 = +HEAPF32[$336>>2]; $338 = ((($bounds2)) + 4|0); $339 = +HEAPF32[$338>>2]; $340 = $339 + $337; HEAPF32[$338>>2] = $340; $341 = $layout; $342 = ((($341)) + 72|0); $343 = ((($342)) + 12|0); $344 = +HEAPF32[$343>>2]; $345 = $layout; $346 = ((($345)) + 92|0); $347 = ((($346)) + 8|0); $348 = +HEAPF32[$347>>2]; $349 = $344 + $348; $350 = ((($bounds2)) + 12|0); $351 = +HEAPF32[$350>>2]; $352 = $351 - $349; HEAPF32[$350>>2] = $352; } $353 = $layout; $354 = ((($353)) + 20|0); $355 = HEAP32[$354>>2]|0; $356 = ((($355)) + 2|0); $357 = HEAP16[$356>>1]|0; $358 = (+($357&65535)); $scroll_offset = $358; $359 = ((($bounds2)) + 12|0); $360 = +HEAPF32[$359>>2]; $361 = $360 * 0.10000000149011612; $scroll_step = $361; $362 = ((($bounds2)) + 12|0); $363 = +HEAPF32[$362>>2]; $364 = $363 * 0.0099999997764825821; $scroll_inc = $364; $365 = $layout; $366 = ((($365)) + 28|0); $367 = +HEAPF32[$366>>2]; $368 = ((($bounds2)) + 4|0); $369 = +HEAPF32[$368>>2]; $370 = $367 - $369; $371 = (~~(($370))); $372 = (+($371|0)); $scroll_target = $372; $373 = $window; $374 = $0; $375 = ((($374)) + 11164|0); $376 = HEAP32[$375>>2]|0; $377 = ($373|0)==($376|0); $378 = $377&1; $scroll_has_scrolling = $378; $379 = $out; $380 = $scroll_has_scrolling; $381 = $scroll_offset; $382 = $scroll_target; $383 = $scroll_step; $384 = $scroll_inc; $385 = $0; $386 = ((($385)) + 300|0); $387 = ((($386)) + 3516|0); $388 = $in; $389 = $style; ;HEAP32[$bounds2$byval_copy>>2]=HEAP32[$bounds2>>2]|0;HEAP32[$bounds2$byval_copy+4>>2]=HEAP32[$bounds2+4>>2]|0;HEAP32[$bounds2$byval_copy+8>>2]=HEAP32[$bounds2+8>>2]|0;HEAP32[$bounds2$byval_copy+12>>2]=HEAP32[$bounds2+12>>2]|0; $390 = (+_nk_do_scrollbarv($state,$379,$bounds2$byval_copy,$380,$381,$382,$383,$384,$387,$388,$389)); $scroll_offset = $390; $391 = $scroll_offset; $392 = (~~(($391))&65535); $393 = $layout; $394 = ((($393)) + 20|0); $395 = HEAP32[$394>>2]|0; $396 = ((($395)) + 2|0); HEAP16[$396>>1] = $392; HEAP32[$state3>>2] = 0; $397 = $layout; $398 = ((($397)) + 4|0); $399 = +HEAPF32[$398>>2]; $400 = +HEAPF32[$window_padding>>2]; $401 = $399 + $400; HEAPF32[$bounds2>>2] = $401; $402 = $layout; $403 = HEAP32[$402>>2]|0; $404 = $403 & 8192; $405 = ($404|0)!=(0); do { if ($405) { $406 = +HEAPF32[$scrollbar_size>>2]; $407 = ((($bounds2)) + 12|0); HEAPF32[$407>>2] = $406; $408 = $layout; $409 = HEAP32[$408>>2]|0; $410 = $409 & 1; $411 = ($410|0)!=(0); $412 = $layout; $413 = ((($412)) + 4|0); $414 = ((($413)) + 4|0); $415 = +HEAPF32[$414>>2]; $416 = $415 + 1.0; $417 = $411 ? $416 : $415; $418 = ((($bounds2)) + 4|0); HEAPF32[$418>>2] = $417; $419 = $layout; $420 = ((($419)) + 48|0); $421 = +HEAPF32[$420>>2]; $422 = $layout; $423 = ((($422)) + 72|0); $424 = ((($423)) + 12|0); $425 = +HEAPF32[$424>>2]; $426 = $421 + $425; $427 = $layout; $428 = ((($427)) + 40|0); $429 = +HEAPF32[$428>>2]; $430 = $426 + $429; $431 = ((($bounds2)) + 4|0); $432 = +HEAPF32[$431>>2]; $433 = $432 + $430; HEAPF32[$431>>2] = $433; $434 = $layout; $435 = ((($434)) + 36|0); $436 = +HEAPF32[$435>>2]; $437 = ((($bounds2)) + 8|0); HEAPF32[$437>>2] = $436; } else { $438 = $layout; $439 = HEAP32[$438>>2]|0; $440 = $439 & 64; $441 = ($440|0)!=(0); $442 = +HEAPF32[$scrollbar_size>>2]; $443 = $layout; $444 = ((($443)) + 44|0); $445 = +HEAPF32[$444>>2]; $446 = $442 < $445; if ($441) { if ($446) { $447 = +HEAPF32[$scrollbar_size>>2]; $452 = $447; } else { $448 = $layout; $449 = ((($448)) + 44|0); $450 = +HEAPF32[$449>>2]; $452 = $450; } $451 = ((($bounds2)) + 12|0); HEAPF32[$451>>2] = $452; $453 = $layout; $454 = ((($453)) + 4|0); $455 = ((($454)) + 8|0); $456 = +HEAPF32[$455>>2]; $457 = ((($bounds2)) + 8|0); HEAPF32[$457>>2] = $456; $458 = ((($footer)) + 4|0); $459 = +HEAPF32[$458>>2]; $460 = ((($bounds2)) + 4|0); HEAPF32[$460>>2] = $459; break; } if ($446) { $461 = +HEAPF32[$scrollbar_size>>2]; $466 = $461; } else { $462 = $layout; $463 = ((($462)) + 44|0); $464 = +HEAPF32[$463>>2]; $466 = $464; } $465 = ((($bounds2)) + 12|0); HEAPF32[$465>>2] = $466; $467 = $layout; $468 = ((($467)) + 4|0); $469 = ((($468)) + 4|0); $470 = +HEAPF32[$469>>2]; $471 = $window; $472 = ((($471)) + 12|0); $473 = ((($472)) + 12|0); $474 = +HEAPF32[$473>>2]; $475 = $470 + $474; $476 = ((($bounds2)) + 4|0); HEAPF32[$476>>2] = $475; $477 = $layout; $478 = ((($477)) + 44|0); $479 = +HEAPF32[$478>>2]; $480 = +HEAPF32[$scrollbar_size>>2]; $481 = $479 < $480; if ($481) { $482 = +HEAPF32[$scrollbar_size>>2]; $489 = $482; } else { $483 = $layout; $484 = ((($483)) + 44|0); $485 = +HEAPF32[$484>>2]; $489 = $485; } $486 = ((($bounds2)) + 4|0); $487 = +HEAPF32[$486>>2]; $488 = $487 - $489; HEAPF32[$486>>2] = $488; $490 = $layout; $491 = ((($490)) + 36|0); $492 = +HEAPF32[$491>>2]; $493 = +HEAPF32[$window_padding>>2]; $494 = 2.0 * $493; $495 = $492 - $494; $496 = ((($bounds2)) + 8|0); HEAPF32[$496>>2] = $495; } } while(0); $497 = $layout; $498 = ((($497)) + 20|0); $499 = HEAP32[$498>>2]|0; $500 = HEAP16[$499>>1]|0; $501 = (+($500&65535)); $scroll_offset = $501; $502 = $layout; $503 = ((($502)) + 32|0); $504 = +HEAPF32[$503>>2]; $505 = +HEAPF32[$bounds2>>2]; $506 = $504 - $505; $507 = (~~(($506))); $508 = (+($507|0)); $scroll_target = $508; $509 = $layout; $510 = ((($509)) + 32|0); $511 = +HEAPF32[$510>>2]; $512 = $511 * 0.05000000074505806; $scroll_step = $512; $513 = $layout; $514 = ((($513)) + 32|0); $515 = +HEAPF32[$514>>2]; $516 = $515 * 0.004999999888241291; $scroll_inc = $516; $scroll_has_scrolling = 0; $517 = $out; $518 = $scroll_has_scrolling; $519 = $scroll_offset; $520 = $scroll_target; $521 = $scroll_step; $522 = $scroll_inc; $523 = $0; $524 = ((($523)) + 300|0); $525 = ((($524)) + 3084|0); $526 = $in; $527 = $style; ;HEAP32[$bounds2$byval_copy4>>2]=HEAP32[$bounds2>>2]|0;HEAP32[$bounds2$byval_copy4+4>>2]=HEAP32[$bounds2+4>>2]|0;HEAP32[$bounds2$byval_copy4+8>>2]=HEAP32[$bounds2+8>>2]|0;HEAP32[$bounds2$byval_copy4+12>>2]=HEAP32[$bounds2+12>>2]|0; $528 = (+_nk_do_scrollbarh($state3,$517,$bounds2$byval_copy4,$518,$519,$520,$521,$522,$525,$526,$527)); $scroll_offset = $528; $529 = $scroll_offset; $530 = (~~(($529))&65535); $531 = $layout; $532 = ((($531)) + 20|0); $533 = HEAP32[$532>>2]|0; HEAP16[$533>>1] = $530; } } $534 = $layout; $535 = HEAP32[$534>>2]|0; $536 = $535 & 1; $537 = ($536|0)!=(0); if ($537) { $538 = $layout; $539 = HEAP32[$538>>2]|0; $540 = $539 & 4096; $541 = ($540|0)!=(0); do { if ($541) { $542 = $style; $543 = ((($542)) + 4784|0); $544 = ((($543)) + 444|0); $545 = +HEAPF32[$544>>2]; $546 = 2.0 * $545; $547 = $window; $548 = ((($547)) + 12|0); $549 = ((($548)) + 4|0); $550 = +HEAPF32[$549>>2]; $551 = $546 + $550; $552 = $layout; $553 = ((($552)) + 48|0); $554 = +HEAPF32[$553>>2]; $555 = $551 + $554; $574 = $555; } else { $556 = $layout; $557 = HEAP32[$556>>2]|0; $558 = $557 & 64; $559 = ($558|0)!=(0); $560 = $layout; if ($559) { $561 = ((($560)) + 44|0); $562 = +HEAPF32[$561>>2]; $563 = ((($footer)) + 4|0); $564 = +HEAPF32[$563>>2]; $565 = $562 + $564; $574 = $565; break; } else { $566 = ((($560)) + 4|0); $567 = ((($566)) + 4|0); $568 = +HEAPF32[$567>>2]; $569 = $layout; $570 = ((($569)) + 4|0); $571 = ((($570)) + 12|0); $572 = +HEAPF32[$571>>2]; $573 = $568 + $572; $574 = $573; break; } } } while(0); $padding_y = $574; $575 = $layout; $576 = HEAP32[$575>>2]|0; $577 = $576 & 8192; $578 = ($577|0)!=(0); do { if ($578) { $582 = $layout; $583 = HEAP32[$582>>2]|0; $584 = $583 & 262144; $585 = ($584|0)!=(0); if ($585) { $586 = $style; $587 = ((($586)) + 4784|0); $588 = ((($587)) + 396|0); ;HEAP8[$border>>0]=HEAP8[$588>>0]|0;HEAP8[$border+1>>0]=HEAP8[$588+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$588+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$588+3>>0]|0; break; } $589 = $layout; $590 = HEAP32[$589>>2]|0; $591 = $590 & 131072; $592 = ($591|0)!=(0); if ($592) { $593 = $style; $594 = ((($593)) + 4784|0); $595 = ((($594)) + 400|0); ;HEAP8[$border>>0]=HEAP8[$595>>0]|0;HEAP8[$border+1>>0]=HEAP8[$595+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$595+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$595+3>>0]|0; break; } $596 = $layout; $597 = HEAP32[$596>>2]|0; $598 = $597 & 524288; $599 = ($598|0)!=(0); if ($599) { $600 = $style; $601 = ((($600)) + 4784|0); $602 = ((($601)) + 404|0); ;HEAP8[$border>>0]=HEAP8[$602>>0]|0;HEAP8[$border+1>>0]=HEAP8[$602+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$602+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$602+3>>0]|0; break; } $603 = $layout; $604 = HEAP32[$603>>2]|0; $605 = $604 & 16384; $606 = ($605|0)!=(0); if ($606) { $607 = $style; $608 = ((($607)) + 4784|0); $609 = ((($608)) + 408|0); ;HEAP8[$border>>0]=HEAP8[$609>>0]|0;HEAP8[$border+1>>0]=HEAP8[$609+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$609+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$609+3>>0]|0; break; } $610 = $layout; $611 = HEAP32[$610>>2]|0; $612 = $611 & 1048576; $613 = ($612|0)!=(0); $614 = $style; $615 = ((($614)) + 4784|0); if ($613) { $616 = ((($615)) + 412|0); ;HEAP8[$border>>0]=HEAP8[$616>>0]|0;HEAP8[$border+1>>0]=HEAP8[$616+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$616+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$616+3>>0]|0; break; } else { $617 = ((($615)) + 392|0); ;HEAP8[$border>>0]=HEAP8[$617>>0]|0;HEAP8[$border+1>>0]=HEAP8[$617+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$617+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$617+3>>0]|0; break; } } else { $579 = $style; $580 = ((($579)) + 4784|0); $581 = ((($580)) + 392|0); ;HEAP8[$border>>0]=HEAP8[$581>>0]|0;HEAP8[$border+1>>0]=HEAP8[$581+1>>0]|0;HEAP8[$border+2>>0]=HEAP8[$581+2>>0]|0;HEAP8[$border+3>>0]=HEAP8[$581+3>>0]|0; } } while(0); $618 = $window; $619 = ((($618)) + 8|0); $620 = HEAP32[$619>>2]|0; $621 = $620 & 2; $622 = ($621|0)!=(0); if ($622) { $623 = $out; $624 = $window; $625 = ((($624)) + 12|0); $626 = +HEAPF32[$625>>2]; $627 = $layout; $628 = ((($627)) + 52|0); $629 = +HEAPF32[$628>>2]; $630 = $629 / 2.0; $631 = $626 + $630; $632 = $window; $633 = ((($632)) + 12|0); $634 = ((($633)) + 4|0); $635 = +HEAPF32[$634>>2]; $636 = $layout; $637 = ((($636)) + 48|0); $638 = +HEAPF32[$637>>2]; $639 = $635 + $638; $640 = $layout; $641 = ((($640)) + 52|0); $642 = +HEAPF32[$641>>2]; $643 = $639 - $642; $644 = $window; $645 = ((($644)) + 12|0); $646 = +HEAPF32[$645>>2]; $647 = $window; $648 = ((($647)) + 12|0); $649 = ((($648)) + 8|0); $650 = +HEAPF32[$649>>2]; $651 = $646 + $650; $652 = $layout; $653 = ((($652)) + 52|0); $654 = +HEAPF32[$653>>2]; $655 = $651 - $654; $656 = $window; $657 = ((($656)) + 12|0); $658 = ((($657)) + 4|0); $659 = +HEAPF32[$658>>2]; $660 = $layout; $661 = ((($660)) + 48|0); $662 = +HEAPF32[$661>>2]; $663 = $659 + $662; $664 = $layout; $665 = ((($664)) + 52|0); $666 = +HEAPF32[$665>>2]; $667 = $663 - $666; $668 = $layout; $669 = ((($668)) + 52|0); $670 = +HEAPF32[$669>>2]; ;HEAP8[$border$byval_copy>>0]=HEAP8[$border>>0]|0;HEAP8[$border$byval_copy+1>>0]=HEAP8[$border+1>>0]|0;HEAP8[$border$byval_copy+2>>0]=HEAP8[$border+2>>0]|0;HEAP8[$border$byval_copy+3>>0]=HEAP8[$border+3>>0]|0; _nk_stroke_line($623,$631,$643,$655,$667,$670,$border$byval_copy); } $671 = $out; $672 = $window; $673 = ((($672)) + 12|0); $674 = +HEAPF32[$673>>2]; $675 = $layout; $676 = ((($675)) + 52|0); $677 = +HEAPF32[$676>>2]; $678 = $677 / 2.0; $679 = $674 + $678; $680 = $window; $681 = ((($680)) + 12|0); $682 = ((($681)) + 4|0); $683 = +HEAPF32[$682>>2]; $684 = $layout; $685 = ((($684)) + 52|0); $686 = +HEAPF32[$685>>2]; $687 = $686 / 2.0; $688 = $683 + $687; $689 = $window; $690 = ((($689)) + 12|0); $691 = +HEAPF32[$690>>2]; $692 = $window; $693 = ((($692)) + 12|0); $694 = ((($693)) + 8|0); $695 = +HEAPF32[$694>>2]; $696 = $691 + $695; $697 = $layout; $698 = ((($697)) + 52|0); $699 = +HEAPF32[$698>>2]; $700 = $696 - $699; $701 = $window; $702 = ((($701)) + 12|0); $703 = ((($702)) + 4|0); $704 = +HEAPF32[$703>>2]; $705 = $layout; $706 = ((($705)) + 52|0); $707 = +HEAPF32[$706>>2]; $708 = $707 / 2.0; $709 = $704 + $708; $710 = $layout; $711 = ((($710)) + 52|0); $712 = +HEAPF32[$711>>2]; ;HEAP8[$border$byval_copy5>>0]=HEAP8[$border>>0]|0;HEAP8[$border$byval_copy5+1>>0]=HEAP8[$border+1>>0]|0;HEAP8[$border$byval_copy5+2>>0]=HEAP8[$border+2>>0]|0;HEAP8[$border$byval_copy5+3>>0]=HEAP8[$border+3>>0]|0; _nk_stroke_line($671,$679,$688,$700,$709,$712,$border$byval_copy5); $713 = $out; $714 = $window; $715 = ((($714)) + 12|0); $716 = +HEAPF32[$715>>2]; $717 = $layout; $718 = ((($717)) + 52|0); $719 = +HEAPF32[$718>>2]; $720 = $719 / 2.0; $721 = $716 + $720; $722 = $padding_y; $723 = $layout; $724 = ((($723)) + 52|0); $725 = +HEAPF32[$724>>2]; $726 = $722 - $725; $727 = $window; $728 = ((($727)) + 12|0); $729 = +HEAPF32[$728>>2]; $730 = $window; $731 = ((($730)) + 12|0); $732 = ((($731)) + 8|0); $733 = +HEAPF32[$732>>2]; $734 = $729 + $733; $735 = $layout; $736 = ((($735)) + 52|0); $737 = +HEAPF32[$736>>2]; $738 = $734 - $737; $739 = $padding_y; $740 = $layout; $741 = ((($740)) + 52|0); $742 = +HEAPF32[$741>>2]; $743 = $739 - $742; $744 = $layout; $745 = ((($744)) + 52|0); $746 = +HEAPF32[$745>>2]; ;HEAP8[$border$byval_copy6>>0]=HEAP8[$border>>0]|0;HEAP8[$border$byval_copy6+1>>0]=HEAP8[$border+1>>0]|0;HEAP8[$border$byval_copy6+2>>0]=HEAP8[$border+2>>0]|0;HEAP8[$border$byval_copy6+3>>0]=HEAP8[$border+3>>0]|0; _nk_stroke_line($713,$721,$726,$738,$743,$746,$border$byval_copy6); $747 = $out; $748 = $window; $749 = ((($748)) + 12|0); $750 = +HEAPF32[$749>>2]; $751 = $layout; $752 = ((($751)) + 52|0); $753 = +HEAPF32[$752>>2]; $754 = $753 / 2.0; $755 = $750 + $754; $756 = $window; $757 = ((($756)) + 12|0); $758 = ((($757)) + 4|0); $759 = +HEAPF32[$758>>2]; $760 = $layout; $761 = ((($760)) + 52|0); $762 = +HEAPF32[$761>>2]; $763 = $762 / 2.0; $764 = $759 + $763; $765 = $window; $766 = ((($765)) + 12|0); $767 = +HEAPF32[$766>>2]; $768 = $layout; $769 = ((($768)) + 52|0); $770 = +HEAPF32[$769>>2]; $771 = $770 / 2.0; $772 = $767 + $771; $773 = $padding_y; $774 = $layout; $775 = ((($774)) + 52|0); $776 = +HEAPF32[$775>>2]; $777 = $773 - $776; $778 = $layout; $779 = ((($778)) + 52|0); $780 = +HEAPF32[$779>>2]; ;HEAP8[$border$byval_copy7>>0]=HEAP8[$border>>0]|0;HEAP8[$border$byval_copy7+1>>0]=HEAP8[$border+1>>0]|0;HEAP8[$border$byval_copy7+2>>0]=HEAP8[$border+2>>0]|0;HEAP8[$border$byval_copy7+3>>0]=HEAP8[$border+3>>0]|0; _nk_stroke_line($747,$755,$764,$772,$777,$780,$border$byval_copy7); $781 = $out; $782 = $window; $783 = ((($782)) + 12|0); $784 = +HEAPF32[$783>>2]; $785 = $window; $786 = ((($785)) + 12|0); $787 = ((($786)) + 8|0); $788 = +HEAPF32[$787>>2]; $789 = $784 + $788; $790 = $layout; $791 = ((($790)) + 52|0); $792 = +HEAPF32[$791>>2]; $793 = $789 - $792; $794 = $window; $795 = ((($794)) + 12|0); $796 = ((($795)) + 4|0); $797 = +HEAPF32[$796>>2]; $798 = $layout; $799 = ((($798)) + 52|0); $800 = +HEAPF32[$799>>2]; $801 = $800 / 2.0; $802 = $797 + $801; $803 = $window; $804 = ((($803)) + 12|0); $805 = +HEAPF32[$804>>2]; $806 = $window; $807 = ((($806)) + 12|0); $808 = ((($807)) + 8|0); $809 = +HEAPF32[$808>>2]; $810 = $805 + $809; $811 = $layout; $812 = ((($811)) + 52|0); $813 = +HEAPF32[$812>>2]; $814 = $810 - $813; $815 = $padding_y; $816 = $layout; $817 = ((($816)) + 52|0); $818 = +HEAPF32[$817>>2]; $819 = $815 - $818; $820 = $layout; $821 = ((($820)) + 52|0); $822 = +HEAPF32[$821>>2]; ;HEAP8[$border$byval_copy8>>0]=HEAP8[$border>>0]|0;HEAP8[$border$byval_copy8+1>>0]=HEAP8[$border+1>>0]|0;HEAP8[$border$byval_copy8+2>>0]=HEAP8[$border+2>>0]|0;HEAP8[$border$byval_copy8+3>>0]=HEAP8[$border+3>>0]|0; _nk_stroke_line($781,$793,$802,$814,$819,$822,$border$byval_copy8); } $823 = $layout; $824 = HEAP32[$823>>2]|0; $825 = $824 & 8; $826 = ($825|0)!=(0); $827 = $in; $828 = ($827|0)!=(0|0); $or$cond = $826 & $828; L106: do { if ($or$cond) { $829 = $layout; $830 = HEAP32[$829>>2]|0; $831 = $830 & 4096; $832 = ($831|0)!=(0); if (!($832)) { $833 = +HEAPF32[$scaler_size>>2]; $834 = +HEAPF32[$window_padding>>2]; $835 = $833 - $834; $836 = 0.0 < $835; if ($836) { $837 = +HEAPF32[$scaler_size>>2]; $838 = +HEAPF32[$window_padding>>2]; $839 = $837 - $838; $840 = $839; } else { $840 = 0.0; } $scaler_w = $840; $841 = ((($scaler_size)) + 4|0); $842 = +HEAPF32[$841>>2]; $843 = ((($window_padding)) + 4|0); $844 = +HEAPF32[$843>>2]; $845 = $842 - $844; $846 = 0.0 < $845; if ($846) { $847 = ((($scaler_size)) + 4|0); $848 = +HEAPF32[$847>>2]; $849 = ((($window_padding)) + 4|0); $850 = +HEAPF32[$849>>2]; $851 = $848 - $850; $852 = $851; } else { $852 = 0.0; } $scaler_h = $852; $853 = $layout; $854 = ((($853)) + 4|0); $855 = +HEAPF32[$854>>2]; $856 = $layout; $857 = ((($856)) + 4|0); $858 = ((($857)) + 8|0); $859 = +HEAPF32[$858>>2]; $860 = $855 + $859; $861 = +HEAPF32[$window_padding>>2]; $862 = $scaler_w; $863 = $861 + $862; $864 = $860 - $863; $scaler_x = $864; $865 = $layout; $866 = HEAP32[$865>>2]|0; $867 = $866 & 64; $868 = ($867|0)!=(0); if ($868) { $869 = ((($footer)) + 4|0); $870 = +HEAPF32[$869>>2]; $871 = $layout; $872 = ((($871)) + 44|0); $873 = +HEAPF32[$872>>2]; $874 = $870 + $873; $875 = ((($scaler_size)) + 4|0); $876 = +HEAPF32[$875>>2]; $877 = $874 - $876; $scaler_y = $877; } else { $878 = $layout; $879 = ((($878)) + 4|0); $880 = ((($879)) + 4|0); $881 = +HEAPF32[$880>>2]; $882 = $layout; $883 = ((($882)) + 4|0); $884 = ((($883)) + 12|0); $885 = +HEAPF32[$884>>2]; $886 = $881 + $885; $887 = ((($scaler_size)) + 4|0); $888 = +HEAPF32[$887>>2]; $889 = $886 - $888; $scaler_y = $889; } $890 = $style; $891 = ((($890)) + 4784|0); $892 = ((($891)) + 416|0); $scaler = $892; $893 = $scaler; $894 = HEAP32[$893>>2]|0; $895 = ($894|0)==(1); $896 = $out; $897 = $scaler_x; if ($895) { $898 = $scaler_y; $899 = $scaler_w; $900 = $scaler_h; _nk_rect($1,$897,$898,$899,$900); $901 = $scaler; $902 = ((($901)) + 4|0); ;HEAP32[$$byval_copy9>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy9+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$$byval_copy9+12>>2]=HEAP32[$1+12>>2]|0; _nk_draw_image($896,$$byval_copy9,$902); } else { $903 = $scaler_w; $904 = $897 + $903; $905 = $scaler_y; $906 = $scaler_x; $907 = $scaler_w; $908 = $906 + $907; $909 = $scaler_y; $910 = $scaler_h; $911 = $909 + $910; $912 = $scaler_x; $913 = $scaler_y; $914 = $scaler_h; $915 = $913 + $914; $916 = $scaler; $917 = ((($916)) + 4|0); ;HEAP8[$$byval_copy10>>0]=HEAP8[$917>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$917+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$917+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$917+3>>0]|0; _nk_fill_triangle($896,$904,$905,$908,$911,$912,$915,$$byval_copy10); } $918 = $window; $919 = ((($918)) + 8|0); $920 = HEAP32[$919>>2]|0; $921 = $920 & 1024; $922 = ($921|0)!=(0); if (!($922)) { $923 = $in; $924 = ((($923)) + 220|0); $925 = ((($924)) + 56|0); $926 = +HEAPF32[$925>>2]; $prev_x = $926; $927 = $in; $928 = ((($927)) + 220|0); $929 = ((($928)) + 56|0); $930 = ((($929)) + 4|0); $931 = +HEAPF32[$930>>2]; $prev_y = $931; $932 = $style; $933 = ((($932)) + 4784|0); $934 = ((($933)) + 504|0); ;HEAP32[$window_size>>2]=HEAP32[$934>>2]|0;HEAP32[$window_size+4>>2]=HEAP32[$934+4>>2]|0; $935 = $scaler_x; $936 = $prev_x; $937 = $935 <= $936; do { if ($937) { $938 = $prev_x; $939 = $scaler_x; $940 = $scaler_w; $941 = $939 + $940; $942 = $938 <= $941; if (!($942)) { $952 = 0; break; } $943 = $scaler_y; $944 = $prev_y; $945 = $943 <= $944; if (!($945)) { $952 = 0; break; } $946 = $prev_y; $947 = $scaler_y; $948 = $scaler_h; $949 = $947 + $948; $950 = $946 <= $949; $952 = $950; } else { $952 = 0; } } while(0); $951 = $952&1; $incursor = $951; $953 = $in; $954 = (_nk_input_is_mouse_down($953,0)|0); $955 = ($954|0)!=(0); do { if ($955) { $956 = $incursor; $957 = ($956|0)!=(0); if (!($957)) { $958 = $window; $959 = ((($958)) + 244|0); $960 = ((($959)) + 8|0); $961 = HEAP32[$960>>2]|0; $962 = ($961|0)==(1); if (!($962)) { break; } } $963 = $window; $964 = ((($963)) + 244|0); $965 = ((($964)) + 8|0); $966 = HEAP32[$965>>2]|0; $967 = ($966|0)==(0); if ($967) { $968 = $window; $969 = ((($968)) + 244|0); $970 = $window; $971 = ((($970)) + 12|0); ;HEAP32[$$byval_copy11>>2]=HEAP32[$971>>2]|0;HEAP32[$$byval_copy11+4>>2]=HEAP32[$971+4>>2]|0;HEAP32[$$byval_copy11+8>>2]=HEAP32[$971+8>>2]|0;HEAP32[$$byval_copy11+12>>2]=HEAP32[$971+12>>2]|0; _nk_rect_size($2,$$byval_copy11); ;HEAP32[$969>>2]=HEAP32[$2>>2]|0;HEAP32[$969+4>>2]=HEAP32[$2+4>>2]|0; } $972 = $window; $973 = ((($972)) + 244|0); $974 = ((($973)) + 8|0); HEAP32[$974>>2] = 1; $975 = $in; $976 = ($975|0)!=(0|0); do { if ($976) { $977 = $in; $978 = ((($977)) + 220|0); $979 = HEAP32[$978>>2]|0; $980 = ($979|0)!=(0); if (!($980)) { label = 97; break; } $981 = $in; $982 = ((($981)) + 220|0); $983 = ((($982)) + 48|0); $984 = +HEAPF32[$983>>2]; $985 = $in; $986 = ((($985)) + 220|0); $987 = ((($986)) + 8|0); $988 = +HEAPF32[$987>>2]; $989 = $984 - $988; $990 = $in; $991 = ((($990)) + 220|0); $992 = ((($991)) + 48|0); $993 = ((($992)) + 4|0); $994 = +HEAPF32[$993>>2]; $995 = $in; $996 = ((($995)) + 220|0); $997 = ((($996)) + 8|0); $998 = ((($997)) + 4|0); $999 = +HEAPF32[$998>>2]; $1000 = $994 - $999; _nk_vec2($4,$989,$1000); ;HEAP32[$delta>>2]=HEAP32[$4>>2]|0;HEAP32[$delta+4>>2]=HEAP32[$4+4>>2]|0; } else { label = 97; } } while(0); if ((label|0) == 97) { _nk_vec2($3,0.0,0.0); ;HEAP32[$delta>>2]=HEAP32[$3>>2]|0;HEAP32[$delta+4>>2]=HEAP32[$3+4>>2]|0; } $1001 = +HEAPF32[$window_size>>2]; $1002 = $window; $1003 = ((($1002)) + 244|0); $1004 = +HEAPF32[$1003>>2]; $1005 = +HEAPF32[$delta>>2]; $1006 = $1004 + $1005; $1007 = $1001 < $1006; if ($1007) { $1008 = $window; $1009 = ((($1008)) + 244|0); $1010 = +HEAPF32[$1009>>2]; $1011 = +HEAPF32[$delta>>2]; $1012 = $1010 + $1011; $1017 = $1012; } else { $1013 = +HEAPF32[$window_size>>2]; $1017 = $1013; } $1014 = $window; $1015 = ((($1014)) + 12|0); $1016 = ((($1015)) + 8|0); HEAPF32[$1016>>2] = $1017; $1018 = $layout; $1019 = HEAP32[$1018>>2]|0; $1020 = $1019 & 64; $1021 = ($1020|0)!=(0); if ($1021) { break L106; } $1022 = $window; $1023 = ((($1022)) + 244|0); $1024 = ((($1023)) + 4|0); $1025 = +HEAPF32[$1024>>2]; $1026 = ((($delta)) + 4|0); $1027 = +HEAPF32[$1026>>2]; $1028 = $1025 + $1027; $1029 = ((($window_size)) + 4|0); $1030 = +HEAPF32[$1029>>2]; $1031 = $1028 < $1030; if ($1031) { $1032 = ((($window_size)) + 4|0); $1033 = +HEAPF32[$1032>>2]; $1044 = $1033; } else { $1034 = $window; $1035 = ((($1034)) + 244|0); $1036 = ((($1035)) + 4|0); $1037 = +HEAPF32[$1036>>2]; $1038 = ((($delta)) + 4|0); $1039 = +HEAPF32[$1038>>2]; $1040 = $1037 + $1039; $1044 = $1040; } $1041 = $window; $1042 = ((($1041)) + 12|0); $1043 = ((($1042)) + 12|0); HEAPF32[$1043>>2] = $1044; break L106; } } while(0); $1045 = $window; $1046 = ((($1045)) + 244|0); $1047 = ((($1046)) + 8|0); HEAP32[$1047>>2] = 0; } } } } while(0); $1048 = $window; $1049 = ((($1048)) + 8|0); $1050 = HEAP32[$1049>>2]|0; $1051 = $1050 & 8192; $1052 = ($1051|0)!=(0); do { if (!($1052)) { $1053 = $layout; $1054 = HEAP32[$1053>>2]|0; $1055 = $1054 & 2048; $1056 = ($1055|0)!=(0); if ($1056) { $1057 = $window; $1058 = ((($1057)) + 32|0); _nk_command_buffer_reset($1058); break; } else { $1059 = $0; $1060 = $window; _nk_finish($1059,$1060); break; } } } while(0); $1061 = $layout; $1062 = HEAP32[$1061>>2]|0; $1063 = $1062 & 2097152; $1064 = ($1063|0)!=(0); if ($1064) { $1065 = $layout; $1066 = HEAP32[$1065>>2]|0; $1067 = $1066 & -1025; HEAP32[$1065>>2] = $1067; $1068 = $layout; $1069 = HEAP32[$1068>>2]|0; $1070 = $1069 & -2097153; HEAP32[$1068>>2] = $1070; } $1071 = $layout; $1072 = HEAP32[$1071>>2]|0; $1073 = $window; $1074 = ((($1073)) + 8|0); HEAP32[$1074>>2] = $1072; $1075 = $window; $1076 = ((($1075)) + 76|0); $1077 = HEAP32[$1076>>2]|0; $1078 = ($1077|0)!=(0); if ($1078) { $1079 = $window; $1080 = ((($1079)) + 76|0); $1081 = ((($1080)) + 88|0); $1082 = HEAP32[$1081>>2]|0; $1083 = $window; $1084 = ((($1083)) + 76|0); $1085 = ((($1084)) + 84|0); $1086 = HEAP32[$1085>>2]|0; $1087 = ($1082|0)!=($1086|0); if ($1087) { $1088 = $window; $1089 = ((($1088)) + 76|0); $1090 = HEAP32[$1089>>2]|0; $1091 = $window; $1092 = ((($1091)) + 76|0); $1093 = ((($1092)) + 4|0); $1094 = HEAP32[$1093>>2]|0; $1095 = ($1090|0)==($1094|0); if ($1095) { $1096 = $window; $1097 = ((($1096)) + 76|0); _nk_zero($1097,96); } else { label = 118; } } else { label = 118; } } else { label = 118; } if ((label|0) == 118) { $1098 = $window; $1099 = ((($1098)) + 76|0); $1100 = ((($1099)) + 84|0); $1101 = HEAP32[$1100>>2]|0; $1102 = $window; $1103 = ((($1102)) + 76|0); $1104 = ((($1103)) + 88|0); HEAP32[$1104>>2] = $1101; $1105 = $window; $1106 = ((($1105)) + 76|0); $1107 = HEAP32[$1106>>2]|0; $1108 = $window; $1109 = ((($1108)) + 76|0); $1110 = ((($1109)) + 4|0); HEAP32[$1110>>2] = $1107; $1111 = $window; $1112 = ((($1111)) + 76|0); $1113 = ((($1112)) + 84|0); HEAP32[$1113>>2] = 0; } $1114 = $window; $1115 = ((($1114)) + 204|0); $1116 = ((($1115)) + 12|0); $1117 = HEAP32[$1116>>2]|0; $1118 = ($1117|0)!=(0); if ($1118) { $1119 = $window; $1120 = ((($1119)) + 204|0); $1121 = ((($1120)) + 8|0); $1122 = HEAP32[$1121>>2]|0; $1123 = $window; $1124 = ((($1123)) + 204|0); $1125 = ((($1124)) + 4|0); $1126 = HEAP32[$1125>>2]|0; $1127 = ($1122|0)!=($1126|0); if ($1127) { $1128 = $window; $1129 = ((($1128)) + 204|0); $1130 = ((($1129)) + 12|0); $1131 = HEAP32[$1130>>2]|0; $1132 = $window; $1133 = ((($1132)) + 204|0); $1134 = ((($1133)) + 16|0); $1135 = HEAP32[$1134>>2]|0; $1136 = ($1131|0)==($1135|0); if ($1136) { $1137 = $window; $1138 = ((($1137)) + 204|0); _nk_zero($1138,40); } else { label = 123; } } else { label = 123; } } else { label = 123; } if ((label|0) == 123) { $1139 = $window; $1140 = ((($1139)) + 204|0); $1141 = ((($1140)) + 4|0); $1142 = HEAP32[$1141>>2]|0; $1143 = $window; $1144 = ((($1143)) + 204|0); $1145 = ((($1144)) + 8|0); HEAP32[$1145>>2] = $1142; $1146 = $window; $1147 = ((($1146)) + 204|0); $1148 = ((($1147)) + 12|0); $1149 = HEAP32[$1148>>2]|0; $1150 = $window; $1151 = ((($1150)) + 204|0); $1152 = ((($1151)) + 16|0); HEAP32[$1152>>2] = $1149; $1153 = $window; $1154 = ((($1153)) + 204|0); $1155 = ((($1154)) + 4|0); HEAP32[$1155>>2] = 0; } $1156 = $window; $1157 = ((($1156)) + 172|0); $1158 = ((($1157)) + 28|0); $1159 = HEAP32[$1158>>2]|0; $1160 = ($1159|0)!=(0); if ($1160) { $1161 = $window; $1162 = ((($1161)) + 172|0); $1163 = ((($1162)) + 24|0); $1164 = HEAP32[$1163>>2]|0; $1165 = $window; $1166 = ((($1165)) + 172|0); $1167 = ((($1166)) + 20|0); $1168 = HEAP32[$1167>>2]|0; $1169 = ($1164|0)!=($1168|0); if ($1169) { $1170 = $window; $1171 = ((($1170)) + 172|0); $1172 = ((($1171)) + 20|0); HEAP32[$1172>>2] = 0; $1173 = $window; $1174 = ((($1173)) + 172|0); $1175 = ((($1174)) + 24|0); HEAP32[$1175>>2] = 0; $1176 = $window; $1177 = ((($1176)) + 172|0); $1178 = ((($1177)) + 28|0); HEAP32[$1178>>2] = 0; } else { label = 127; } } else { label = 127; } if ((label|0) == 127) { $1179 = $window; $1180 = ((($1179)) + 172|0); $1181 = ((($1180)) + 20|0); $1182 = HEAP32[$1181>>2]|0; $1183 = $window; $1184 = ((($1183)) + 172|0); $1185 = ((($1184)) + 24|0); HEAP32[$1185>>2] = $1182; $1186 = $window; $1187 = ((($1186)) + 172|0); $1188 = ((($1187)) + 20|0); HEAP32[$1188>>2] = 0; } $1189 = $window; $1190 = ((($1189)) + 172|0); $1191 = ((($1190)) + 16|0); HEAP32[$1191>>2] = 0; $1192 = $layout; $1193 = ((($1192)) + 92|0); $1194 = ((($1193)) + 52|0); $1195 = HEAP32[$1194>>2]|0; $1196 = ($1195|0)!=(0); if ($1196) { ___assert_fail((31417|0),(13400|0),16054,(31404|0)); // unreachable; } STACKTOP = sp;return; } function _nk_layout_row_dynamic($ctx,$height,$cols) { $ctx = $ctx|0; $height = +$height; $cols = $cols|0; var $0 = 0, $1 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $height; $2 = $cols; $3 = $0; $4 = $1; $5 = $2; _nk_row_layout($3,0,$4,$5,0); STACKTOP = sp;return; } function _nk_row_layout($ctx,$fmt,$height,$cols,$width) { $ctx = $ctx|0; $fmt = $fmt|0; $height = +$height; $cols = $cols|0; $width = $width|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $7 = 0, $8 = 0, $9 = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $fmt; $2 = $height; $3 = $cols; $4 = $width; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),16162,(31519|0)); // unreachable; } $7 = $0; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28537|0),(13400|0),16163,(31519|0)); // unreachable; } $11 = $0; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($13)) + 72|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28516|0),(13400|0),16164,(31519|0)); // unreachable; } $17 = $0; $18 = ($17|0)!=(0|0); if (!($18)) { STACKTOP = sp;return; } $19 = $0; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { STACKTOP = sp;return; } $23 = $0; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ((($25)) + 72|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if (!($28)) { STACKTOP = sp;return; } $29 = $0; $30 = ((($29)) + 11168|0); $31 = HEAP32[$30>>2]|0; $win = $31; $32 = $0; $33 = $win; $34 = $2; $35 = $3; _nk_panel_layout($32,$33,$34,$35); $36 = $1; $37 = ($36|0)==(0); $38 = $win; $39 = ((($38)) + 72|0); $40 = HEAP32[$39>>2]|0; $41 = ((($40)) + 92|0); if ($37) { HEAP32[$41>>2] = 0; } else { HEAP32[$41>>2] = 4; } $42 = $4; $43 = (+($42|0)); $44 = $win; $45 = ((($44)) + 72|0); $46 = HEAP32[$45>>2]|0; $47 = ((($46)) + 92|0); $48 = ((($47)) + 20|0); HEAPF32[$48>>2] = $43; $49 = $win; $50 = ((($49)) + 72|0); $51 = HEAP32[$50>>2]|0; $52 = ((($51)) + 92|0); $53 = ((($52)) + 16|0); HEAP32[$53>>2] = 0; $54 = $win; $55 = ((($54)) + 72|0); $56 = HEAP32[$55>>2]|0; $57 = ((($56)) + 92|0); $58 = ((($57)) + 28|0); HEAPF32[$58>>2] = 0.0; $59 = $win; $60 = ((($59)) + 72|0); $61 = HEAP32[$60>>2]|0; $62 = ((($61)) + 92|0); $63 = ((($62)) + 32|0); HEAPF32[$63>>2] = 0.0; STACKTOP = sp;return; } function _nk_layout_row_static($ctx,$height,$item_width,$cols) { $ctx = $ctx|0; $height = +$height; $item_width = $item_width|0; $cols = $cols|0; var $0 = 0, $1 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $height; $2 = $item_width; $3 = $cols; $4 = $0; $5 = $1; $6 = $3; $7 = $2; _nk_row_layout($4,1,$5,$6,$7); STACKTOP = sp;return; } function _nk_panel_layout($ctx,$win,$height,$cols) { $ctx = $ctx|0; $win = $win|0; $height = +$height; $cols = $cols|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0; var $62 = 0.0, $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0.0, $81 = 0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0, $87 = 0.0, $88 = 0.0, $9 = 0, $color = 0, $color$byval_copy = 0, $item_spacing = 0, $layout = 0, $out = 0, $panel_padding = 0, $style = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $color$byval_copy = sp + 84|0; $$byval_copy = sp + 64|0; $item_spacing = sp + 24|0; $panel_padding = sp + 16|0; $color = sp + 80|0; $4 = sp; $0 = $ctx; $1 = $win; $2 = $height; $3 = $cols; $5 = $0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),16131,(31533|0)); // unreachable; } $7 = $0; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28537|0),(13400|0),16132,(31533|0)); // unreachable; } $11 = $0; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($13)) + 72|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28516|0),(13400|0),16133,(31533|0)); // unreachable; } $17 = $0; $18 = ($17|0)!=(0|0); if (!($18)) { STACKTOP = sp;return; } $19 = $0; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if (!($22)) { STACKTOP = sp;return; } $23 = $0; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ((($25)) + 72|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if (!($28)) { STACKTOP = sp;return; } $29 = $1; $30 = ((($29)) + 72|0); $31 = HEAP32[$30>>2]|0; $layout = $31; $32 = $0; $33 = ((($32)) + 300|0); $style = $33; $34 = $1; $35 = ((($34)) + 32|0); $out = $35; $36 = $style; $37 = ((($36)) + 4784|0); $38 = ((($37)) + 388|0); ;HEAP8[$color>>0]=HEAP8[$38>>0]|0;HEAP8[$color+1>>0]=HEAP8[$38+1>>0]|0;HEAP8[$color+2>>0]=HEAP8[$38+2>>0]|0;HEAP8[$color+3>>0]=HEAP8[$38+3>>0]|0; $39 = $style; $40 = ((($39)) + 4784|0); $41 = ((($40)) + 488|0); ;HEAP32[$item_spacing>>2]=HEAP32[$41>>2]|0;HEAP32[$item_spacing+4>>2]=HEAP32[$41+4>>2]|0; $42 = $style; $43 = ((($42)) + 4784|0); $44 = ((($43)) + 480|0); ;HEAP32[$panel_padding>>2]=HEAP32[$44>>2]|0;HEAP32[$panel_padding+4>>2]=HEAP32[$44+4>>2]|0; $45 = $layout; $46 = ((($45)) + 92|0); $47 = ((($46)) + 4|0); HEAP32[$47>>2] = 0; $48 = $layout; $49 = ((($48)) + 92|0); $50 = ((($49)) + 8|0); $51 = +HEAPF32[$50>>2]; $52 = $layout; $53 = ((($52)) + 28|0); $54 = +HEAPF32[$53>>2]; $55 = $54 + $51; HEAPF32[$53>>2] = $55; $56 = $3; $57 = $layout; $58 = ((($57)) + 92|0); $59 = ((($58)) + 12|0); HEAP32[$59>>2] = $56; $60 = $2; $61 = ((($item_spacing)) + 4|0); $62 = +HEAPF32[$61>>2]; $63 = $60 + $62; $64 = $layout; $65 = ((($64)) + 92|0); $66 = ((($65)) + 8|0); HEAPF32[$66>>2] = $63; $67 = $layout; $68 = ((($67)) + 92|0); $69 = ((($68)) + 28|0); HEAPF32[$69>>2] = 0.0; $70 = $layout; $71 = HEAP32[$70>>2]|0; $72 = $71 & 64; $73 = ($72|0)!=(0); if (!($73)) { STACKTOP = sp;return; } $74 = $out; $75 = $layout; $76 = ((($75)) + 4|0); $77 = +HEAPF32[$76>>2]; $78 = $layout; $79 = ((($78)) + 28|0); $80 = +HEAPF32[$79>>2]; $81 = $layout; $82 = ((($81)) + 4|0); $83 = ((($82)) + 8|0); $84 = +HEAPF32[$83>>2]; $85 = $2; $86 = ((($panel_padding)) + 4|0); $87 = +HEAPF32[$86>>2]; $88 = $85 + $87; _nk_rect($4,$77,$80,$84,$88); ;HEAP32[$$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$4+12>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _nk_fill_rect($74,$$byval_copy,0.0,$color$byval_copy); STACKTOP = sp;return; } function _nk_widget($bounds,$ctx) { $bounds = $bounds|0; $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0; var $116 = 0, $117 = 0.0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0.0, $124 = 0, $125 = 0, $126 = 0.0, $127 = 0.0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0, $133 = 0; var $134 = 0.0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0.0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0, $148 = 0, $149 = 0.0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0.0, $153 = 0.0, $154 = 0, $155 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0; var $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0; var $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0, $72 = 0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0; var $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0, $c = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $bounds; $2 = $ctx; $c = 0; $3 = $2; $4 = ($3|0)!=(0|0); if (!($4)) { ___assert_fail((14913|0),(13400|0),16888,(28550|0)); // unreachable; } $5 = $2; $6 = ((($5)) + 11168|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((28537|0),(13400|0),16889,(28550|0)); // unreachable; } $9 = $2; $10 = ((($9)) + 11168|0); $11 = HEAP32[$10>>2]|0; $12 = ((($11)) + 72|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((28516|0),(13400|0),16890,(28550|0)); // unreachable; } $15 = $2; $16 = ($15|0)!=(0|0); if ($16) { $17 = $2; $18 = ((($17)) + 11168|0); $19 = HEAP32[$18>>2]|0; $20 = ($19|0)!=(0|0); if ($20) { $21 = $2; $22 = ((($21)) + 11168|0); $23 = HEAP32[$22>>2]|0; $24 = ((($23)) + 72|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0|0); if ($26) { $27 = $1; $28 = $2; _nk_panel_alloc_space($27,$28); $29 = $2; $30 = ((($29)) + 11168|0); $31 = HEAP32[$30>>2]|0; $32 = ((($31)) + 72|0); $33 = HEAP32[$32>>2]|0; $34 = ((($33)) + 56|0); $c = $34; $35 = $1; $36 = +HEAPF32[$35>>2]; $37 = $c; $38 = +HEAPF32[$37>>2]; $39 = $c; $40 = ((($39)) + 8|0); $41 = +HEAPF32[$40>>2]; $42 = $38 + $41; $43 = $36 > $42; if (!($43)) { $44 = $1; $45 = +HEAPF32[$44>>2]; $46 = $1; $47 = ((($46)) + 8|0); $48 = +HEAPF32[$47>>2]; $49 = $45 + $48; $50 = $c; $51 = +HEAPF32[$50>>2]; $52 = $49 < $51; if (!($52)) { $53 = $1; $54 = ((($53)) + 4|0); $55 = +HEAPF32[$54>>2]; $56 = $c; $57 = ((($56)) + 4|0); $58 = +HEAPF32[$57>>2]; $59 = $c; $60 = ((($59)) + 12|0); $61 = +HEAPF32[$60>>2]; $62 = $58 + $61; $63 = $55 > $62; if (!($63)) { $64 = $1; $65 = ((($64)) + 4|0); $66 = +HEAPF32[$65>>2]; $67 = $1; $68 = ((($67)) + 12|0); $69 = +HEAPF32[$68>>2]; $70 = $66 + $69; $71 = $c; $72 = ((($71)) + 4|0); $73 = +HEAPF32[$72>>2]; $74 = $70 < $73; if (!($74)) { $75 = $c; $76 = +HEAPF32[$75>>2]; $77 = $1; $78 = +HEAPF32[$77>>2]; $79 = $76 <= $78; do { if ($79) { $80 = $1; $81 = +HEAPF32[$80>>2]; $82 = $c; $83 = +HEAPF32[$82>>2]; $84 = $c; $85 = ((($84)) + 8|0); $86 = +HEAPF32[$85>>2]; $87 = $83 + $86; $88 = $81 <= $87; if ($88) { $89 = $c; $90 = ((($89)) + 4|0); $91 = +HEAPF32[$90>>2]; $92 = $1; $93 = ((($92)) + 4|0); $94 = +HEAPF32[$93>>2]; $95 = $91 <= $94; if ($95) { $96 = $1; $97 = ((($96)) + 4|0); $98 = +HEAPF32[$97>>2]; $99 = $c; $100 = ((($99)) + 4|0); $101 = +HEAPF32[$100>>2]; $102 = $c; $103 = ((($102)) + 12|0); $104 = +HEAPF32[$103>>2]; $105 = $101 + $104; $106 = $98 <= $105; if ($106) { $107 = $c; $108 = +HEAPF32[$107>>2]; $109 = $1; $110 = +HEAPF32[$109>>2]; $111 = $1; $112 = ((($111)) + 8|0); $113 = +HEAPF32[$112>>2]; $114 = $110 + $113; $115 = $108 <= $114; if ($115) { $116 = $1; $117 = +HEAPF32[$116>>2]; $118 = $1; $119 = ((($118)) + 8|0); $120 = +HEAPF32[$119>>2]; $121 = $117 + $120; $122 = $c; $123 = +HEAPF32[$122>>2]; $124 = $c; $125 = ((($124)) + 8|0); $126 = +HEAPF32[$125>>2]; $127 = $123 + $126; $128 = $121 <= $127; if ($128) { $129 = $c; $130 = ((($129)) + 4|0); $131 = +HEAPF32[$130>>2]; $132 = $1; $133 = ((($132)) + 4|0); $134 = +HEAPF32[$133>>2]; $135 = $1; $136 = ((($135)) + 12|0); $137 = +HEAPF32[$136>>2]; $138 = $134 + $137; $139 = $131 <= $138; if ($139) { $140 = $1; $141 = ((($140)) + 4|0); $142 = +HEAPF32[$141>>2]; $143 = $1; $144 = ((($143)) + 12|0); $145 = +HEAPF32[$144>>2]; $146 = $142 + $145; $147 = $c; $148 = ((($147)) + 4|0); $149 = +HEAPF32[$148>>2]; $150 = $c; $151 = ((($150)) + 12|0); $152 = +HEAPF32[$151>>2]; $153 = $149 + $152; $154 = $146 <= $153; if (!($154)) { break; } $0 = 1; $155 = $0; STACKTOP = sp;return ($155|0); } } } } } } } } while(0); $0 = 2; $155 = $0; STACKTOP = sp;return ($155|0); } } } } $0 = 0; $155 = $0; STACKTOP = sp;return ($155|0); } } } $0 = 0; $155 = $0; STACKTOP = sp;return ($155|0); } function _nk_panel_alloc_space($bounds,$ctx) { $bounds = $bounds|0; $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $layout = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $bounds; $1 = $ctx; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),16596,(31597|0)); // unreachable; } $4 = $1; $5 = ((($4)) + 11168|0); $6 = HEAP32[$5>>2]|0; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((28537|0),(13400|0),16597,(31597|0)); // unreachable; } $8 = $1; $9 = ((($8)) + 11168|0); $10 = HEAP32[$9>>2]|0; $11 = ((($10)) + 72|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((28516|0),(13400|0),16598,(31597|0)); // unreachable; } $14 = $1; $15 = ($14|0)!=(0|0); if (!($15)) { STACKTOP = sp;return; } $16 = $1; $17 = ((($16)) + 11168|0); $18 = HEAP32[$17>>2]|0; $19 = ($18|0)!=(0|0); if (!($19)) { STACKTOP = sp;return; } $20 = $1; $21 = ((($20)) + 11168|0); $22 = HEAP32[$21>>2]|0; $23 = ((($22)) + 72|0); $24 = HEAP32[$23>>2]|0; $25 = ($24|0)!=(0|0); if (!($25)) { STACKTOP = sp;return; } $26 = $1; $27 = ((($26)) + 11168|0); $28 = HEAP32[$27>>2]|0; $win = $28; $29 = $win; $30 = ((($29)) + 72|0); $31 = HEAP32[$30>>2]|0; $layout = $31; $32 = $layout; $33 = ((($32)) + 92|0); $34 = ((($33)) + 4|0); $35 = HEAP32[$34>>2]|0; $36 = $layout; $37 = ((($36)) + 92|0); $38 = ((($37)) + 12|0); $39 = HEAP32[$38>>2]|0; $40 = ($35|0)>=($39|0); if ($40) { $41 = $1; $42 = $win; _nk_panel_alloc_row($41,$42); } $43 = $0; $44 = $1; $45 = $win; _nk_layout_widget_space($43,$44,$45,1); $46 = $layout; $47 = ((($46)) + 92|0); $48 = ((($47)) + 4|0); $49 = HEAP32[$48>>2]|0; $50 = (($49) + 1)|0; HEAP32[$48>>2] = $50; STACKTOP = sp;return; } function _nk_panel_alloc_row($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $layout = 0, $row_height = 0.0, $spacing = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $spacing = sp + 8|0; $0 = $ctx; $1 = $win; $2 = $1; $3 = ((($2)) + 72|0); $4 = HEAP32[$3>>2]|0; $layout = $4; $5 = $0; $6 = ((($5)) + 300|0); $7 = ((($6)) + 4784|0); $8 = ((($7)) + 488|0); ;HEAP32[$spacing>>2]=HEAP32[$8>>2]|0;HEAP32[$spacing+4>>2]=HEAP32[$8+4>>2]|0; $9 = $layout; $10 = ((($9)) + 92|0); $11 = ((($10)) + 8|0); $12 = +HEAPF32[$11>>2]; $13 = ((($spacing)) + 4|0); $14 = +HEAPF32[$13>>2]; $15 = $12 - $14; $row_height = $15; $16 = $0; $17 = $1; $18 = $row_height; $19 = $layout; $20 = ((($19)) + 92|0); $21 = ((($20)) + 12|0); $22 = HEAP32[$21>>2]|0; _nk_panel_layout($16,$17,$18,$22); STACKTOP = sp;return; } function _nk_text_colored($ctx,$str,$len,$alignment,$color) { $ctx = $ctx|0; $str = $str|0; $len = $len|0; $alignment = $alignment|0; $color = $color|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $bounds = 0, $bounds$byval_copy = 0, $item_padding = 0, $style = 0, $text = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $bounds$byval_copy = sp + 64|0; $item_padding = sp + 32|0; $bounds = sp + 16|0; $text = sp; $0 = $ctx; $1 = $str; $2 = $len; $3 = $alignment; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14913|0),(13400|0),16990,(28560|0)); // unreachable; } $6 = $0; $7 = ((($6)) + 11168|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((28537|0),(13400|0),16991,(28560|0)); // unreachable; } $10 = $0; $11 = ((($10)) + 11168|0); $12 = HEAP32[$11>>2]|0; $13 = ((($12)) + 72|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((28516|0),(13400|0),16992,(28560|0)); // unreachable; } $16 = $0; $17 = ($16|0)!=(0|0); if (!($17)) { STACKTOP = sp;return; } $18 = $0; $19 = ((($18)) + 11168|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); if (!($21)) { STACKTOP = sp;return; } $22 = $0; $23 = ((($22)) + 11168|0); $24 = HEAP32[$23>>2]|0; $25 = ((($24)) + 72|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)!=(0|0); if (!($27)) { STACKTOP = sp;return; } $28 = $0; $29 = ((($28)) + 11168|0); $30 = HEAP32[$29>>2]|0; $win = $30; $31 = $0; $32 = ((($31)) + 300|0); $style = $32; $33 = $0; _nk_panel_alloc_space($bounds,$33); $34 = $style; $35 = ((($34)) + 20|0); $36 = ((($35)) + 4|0); ;HEAP32[$item_padding>>2]=HEAP32[$36>>2]|0;HEAP32[$item_padding+4>>2]=HEAP32[$36+4>>2]|0; $37 = +HEAPF32[$item_padding>>2]; HEAPF32[$text>>2] = $37; $38 = ((($item_padding)) + 4|0); $39 = +HEAPF32[$38>>2]; $40 = ((($text)) + 4|0); HEAPF32[$40>>2] = $39; $41 = ((($text)) + 8|0); $42 = $style; $43 = ((($42)) + 4784|0); $44 = ((($43)) + 388|0); ;HEAP8[$41>>0]=HEAP8[$44>>0]|0;HEAP8[$41+1>>0]=HEAP8[$44+1>>0]|0;HEAP8[$41+2>>0]=HEAP8[$44+2>>0]|0;HEAP8[$41+3>>0]=HEAP8[$44+3>>0]|0; $45 = ((($text)) + 12|0); ;HEAP8[$45>>0]=HEAP8[$color>>0]|0;HEAP8[$45+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$45+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$45+3>>0]=HEAP8[$color+3>>0]|0; $46 = $win; $47 = ((($46)) + 32|0); $48 = $1; $49 = $2; $50 = $3; $51 = $style; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; _nk_widget_text($47,$bounds$byval_copy,$48,$49,$text,$50,$51); STACKTOP = sp;return; } function _nk_widget_text($o,$b,$string,$len,$t,$a,$f) { $o = $o|0; $b = $b|0; $string = $string|0; $len = $len|0; $t = $t|0; $a = $a|0; $f = $f|0; var $$byval_copy = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0; var $113 = 0.0, $114 = 0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0; var $131 = 0.0, $132 = 0.0, $133 = 0, $134 = 0.0, $135 = 0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0, $143 = 0.0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0, $148 = 0.0, $149 = 0; var $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0.0, $162 = 0.0, $163 = 0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0; var $168 = 0.0, $169 = 0, $17 = 0, $170 = 0.0, $171 = 0, $172 = 0.0, $173 = 0.0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0, $18 = 0.0, $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0; var $186 = 0.0, $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0.0, $195 = 0, $196 = 0.0, $197 = 0.0, $198 = 0.0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0.0, $202 = 0.0; var $203 = 0.0, $204 = 0, $205 = 0, $206 = 0.0, $207 = 0.0, $208 = 0, $209 = 0.0, $21 = 0, $210 = 0, $211 = 0.0, $212 = 0.0, $213 = 0, $214 = 0, $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0, $220 = 0; var $221 = 0.0, $222 = 0, $223 = 0.0, $224 = 0.0, $225 = 0, $226 = 0, $227 = 0.0, $228 = 0.0, $229 = 0.0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0.0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0.0, $239 = 0; var $24 = 0.0, $240 = 0.0, $241 = 0.0, $242 = 0, $243 = 0, $244 = 0.0, $245 = 0.0, $246 = 0, $247 = 0, $248 = 0, $249 = 0.0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0; var $258 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0; var $43 = 0.0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0; var $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0; var $98 = 0.0, $99 = 0, $label = 0, $label$byval_copy = 0, $or$cond = 0, $text_width = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy3 = sp + 76|0; $$byval_copy2 = sp + 72|0; $label$byval_copy = sp + 56|0; $$byval_copy = sp + 48|0; $label = sp + 8|0; $0 = $o; $1 = $string; $2 = $len; $3 = $t; $4 = $a; $5 = $f; $6 = $0; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((31618|0),(13400|0),11283,(31620|0)); // unreachable; } $8 = $3; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((31635|0),(13400|0),11284,(31620|0)); // unreachable; } $10 = $0; $11 = ($10|0)!=(0|0); $12 = $3; $13 = ($12|0)!=(0|0); $or$cond = $11 & $13; if (!($or$cond)) { STACKTOP = sp;return; } $14 = ((($b)) + 12|0); $15 = +HEAPF32[$14>>2]; $16 = $3; $17 = ((($16)) + 4|0); $18 = +HEAPF32[$17>>2]; $19 = 2.0 * $18; $20 = $15 < $19; if ($20) { $21 = $3; $22 = ((($21)) + 4|0); $23 = +HEAPF32[$22>>2]; $24 = 2.0 * $23; $28 = $24; } else { $25 = ((($b)) + 12|0); $26 = +HEAPF32[$25>>2]; $28 = $26; } $27 = ((($b)) + 12|0); HEAPF32[$27>>2] = $28; HEAPF32[$label>>2] = 0.0; $29 = ((($label)) + 8|0); HEAPF32[$29>>2] = 0.0; $30 = ((($b)) + 4|0); $31 = +HEAPF32[$30>>2]; $32 = $3; $33 = ((($32)) + 4|0); $34 = +HEAPF32[$33>>2]; $35 = $31 + $34; $36 = ((($label)) + 4|0); HEAPF32[$36>>2] = $35; $37 = ((($b)) + 12|0); $38 = +HEAPF32[$37>>2]; $39 = $3; $40 = ((($39)) + 4|0); $41 = +HEAPF32[$40>>2]; $42 = 2.0 * $41; $43 = $38 - $42; $44 = ((($label)) + 12|0); HEAPF32[$44>>2] = $43; $45 = $5; $46 = ((($45)) + 8|0); $47 = HEAP32[$46>>2]|0; $48 = $5; $49 = $5; $50 = ((($49)) + 4|0); $51 = +HEAPF32[$50>>2]; $52 = $1; $53 = $2; ;HEAP32[$$byval_copy>>2]=HEAP32[$48>>2]|0; $54 = (+FUNCTION_TABLE_didii[$47 & 15]($$byval_copy,$51,$52,$53)); $text_width = $54; $55 = $3; $56 = +HEAPF32[$55>>2]; $57 = 2.0 * $56; $58 = $text_width; $59 = $58 + $57; $text_width = $59; $60 = $4; $61 = $60 & 1; $62 = ($61|0)!=(0); do { if ($62) { $63 = +HEAPF32[$b>>2]; $64 = $3; $65 = +HEAPF32[$64>>2]; $66 = $63 + $65; HEAPF32[$label>>2] = $66; $67 = ((($b)) + 8|0); $68 = +HEAPF32[$67>>2]; $69 = $3; $70 = +HEAPF32[$69>>2]; $71 = 2.0 * $70; $72 = $68 - $71; $73 = 0.0 < $72; if ($73) { $74 = ((($b)) + 8|0); $75 = +HEAPF32[$74>>2]; $76 = $3; $77 = +HEAPF32[$76>>2]; $78 = 2.0 * $77; $79 = $75 - $78; $81 = $79; } else { $81 = 0.0; } $80 = ((($label)) + 8|0); HEAPF32[$80>>2] = $81; } else { $82 = $4; $83 = $82 & 2; $84 = ($83|0)!=(0); if (!($84)) { $152 = $4; $153 = $152 & 4; $154 = ($153|0)!=(0); if (!($154)) { STACKTOP = sp;return; } $155 = +HEAPF32[$b>>2]; $156 = $3; $157 = +HEAPF32[$156>>2]; $158 = $155 + $157; $159 = +HEAPF32[$b>>2]; $160 = ((($b)) + 8|0); $161 = +HEAPF32[$160>>2]; $162 = $159 + $161; $163 = $3; $164 = +HEAPF32[$163>>2]; $165 = 2.0 * $164; $166 = $text_width; $167 = $165 + $166; $168 = $162 - $167; $169 = $158 < $168; $170 = +HEAPF32[$b>>2]; if ($169) { $171 = ((($b)) + 8|0); $172 = +HEAPF32[$171>>2]; $173 = $170 + $172; $174 = $3; $175 = +HEAPF32[$174>>2]; $176 = 2.0 * $175; $177 = $text_width; $178 = $176 + $177; $179 = $173 - $178; $183 = $179; } else { $180 = $3; $181 = +HEAPF32[$180>>2]; $182 = $170 + $181; $183 = $182; } HEAPF32[$label>>2] = $183; $184 = $text_width; $185 = $3; $186 = +HEAPF32[$185>>2]; $187 = 2.0 * $186; $188 = $184 + $187; $189 = ((($label)) + 8|0); HEAPF32[$189>>2] = $188; break; } $85 = $3; $86 = +HEAPF32[$85>>2]; $87 = 2.0 * $86; $88 = $text_width; $89 = $87 + $88; $90 = 1.0 < $89; if ($90) { $91 = $3; $92 = +HEAPF32[$91>>2]; $93 = 2.0 * $92; $94 = $text_width; $95 = $93 + $94; $97 = $95; } else { $97 = 1.0; } $96 = ((($label)) + 8|0); HEAPF32[$96>>2] = $97; $98 = +HEAPF32[$b>>2]; $99 = $3; $100 = +HEAPF32[$99>>2]; $101 = $98 + $100; $102 = ((($b)) + 8|0); $103 = +HEAPF32[$102>>2]; $104 = $3; $105 = +HEAPF32[$104>>2]; $106 = 2.0 * $105; $107 = $103 - $106; $108 = ((($label)) + 8|0); $109 = +HEAPF32[$108>>2]; $110 = $107 - $109; $111 = $110 / 2.0; $112 = $101 + $111; HEAPF32[$label>>2] = $112; $113 = +HEAPF32[$b>>2]; $114 = $3; $115 = +HEAPF32[$114>>2]; $116 = $113 + $115; $117 = +HEAPF32[$label>>2]; $118 = $116 < $117; if ($118) { $119 = +HEAPF32[$label>>2]; $124 = $119; } else { $120 = +HEAPF32[$b>>2]; $121 = $3; $122 = +HEAPF32[$121>>2]; $123 = $120 + $122; $124 = $123; } HEAPF32[$label>>2] = $124; $125 = +HEAPF32[$b>>2]; $126 = ((($b)) + 8|0); $127 = +HEAPF32[$126>>2]; $128 = $125 + $127; $129 = +HEAPF32[$label>>2]; $130 = ((($label)) + 8|0); $131 = +HEAPF32[$130>>2]; $132 = $129 + $131; $133 = $128 < $132; if ($133) { $134 = +HEAPF32[$b>>2]; $135 = ((($b)) + 8|0); $136 = +HEAPF32[$135>>2]; $137 = $134 + $136; $143 = $137; } else { $138 = +HEAPF32[$label>>2]; $139 = ((($label)) + 8|0); $140 = +HEAPF32[$139>>2]; $141 = $138 + $140; $143 = $141; } $142 = ((($label)) + 8|0); HEAPF32[$142>>2] = $143; $144 = ((($label)) + 8|0); $145 = +HEAPF32[$144>>2]; $146 = +HEAPF32[$label>>2]; $147 = $145 >= $146; if ($147) { $148 = +HEAPF32[$label>>2]; $149 = ((($label)) + 8|0); $150 = +HEAPF32[$149>>2]; $151 = $150 - $148; HEAPF32[$149>>2] = $151; } } } while(0); $190 = $4; $191 = $190 & 16; $192 = ($191|0)!=(0); if ($192) { $193 = ((($b)) + 4|0); $194 = +HEAPF32[$193>>2]; $195 = ((($b)) + 12|0); $196 = +HEAPF32[$195>>2]; $197 = $196 / 2.0; $198 = $194 + $197; $199 = $5; $200 = ((($199)) + 4|0); $201 = +HEAPF32[$200>>2]; $202 = $201 / 2.0; $203 = $198 - $202; $204 = ((($label)) + 4|0); HEAPF32[$204>>2] = $203; $205 = ((($b)) + 12|0); $206 = +HEAPF32[$205>>2]; $207 = $206 / 2.0; $208 = ((($b)) + 12|0); $209 = +HEAPF32[$208>>2]; $210 = ((($b)) + 12|0); $211 = +HEAPF32[$210>>2]; $212 = $211 / 2.0; $213 = $5; $214 = ((($213)) + 4|0); $215 = +HEAPF32[$214>>2]; $216 = $215 / 2.0; $217 = $212 + $216; $218 = $209 - $217; $219 = $207 < $218; $220 = ((($b)) + 12|0); $221 = +HEAPF32[$220>>2]; if ($219) { $222 = ((($b)) + 12|0); $223 = +HEAPF32[$222>>2]; $224 = $223 / 2.0; $225 = $5; $226 = ((($225)) + 4|0); $227 = +HEAPF32[$226>>2]; $228 = $227 / 2.0; $229 = $224 + $228; $230 = $221 - $229; $233 = $230; } else { $231 = $221 / 2.0; $233 = $231; } $232 = ((($label)) + 12|0); HEAPF32[$232>>2] = $233; } else { $234 = $4; $235 = $234 & 32; $236 = ($235|0)!=(0); if ($236) { $237 = ((($b)) + 4|0); $238 = +HEAPF32[$237>>2]; $239 = ((($b)) + 12|0); $240 = +HEAPF32[$239>>2]; $241 = $238 + $240; $242 = $5; $243 = ((($242)) + 4|0); $244 = +HEAPF32[$243>>2]; $245 = $241 - $244; $246 = ((($label)) + 4|0); HEAPF32[$246>>2] = $245; $247 = $5; $248 = ((($247)) + 4|0); $249 = +HEAPF32[$248>>2]; $250 = ((($label)) + 12|0); HEAPF32[$250>>2] = $249; } } $251 = $0; $252 = $1; $253 = $2; $254 = $5; $255 = $3; $256 = ((($255)) + 8|0); $257 = $3; $258 = ((($257)) + 12|0); ;HEAP32[$label$byval_copy>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy+12>>2]=HEAP32[$label+12>>2]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$256>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$256+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$256+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$256+3>>0]|0; ;HEAP8[$$byval_copy3>>0]=HEAP8[$258>>0]|0;HEAP8[$$byval_copy3+1>>0]=HEAP8[$258+1>>0]|0;HEAP8[$$byval_copy3+2>>0]=HEAP8[$258+2>>0]|0;HEAP8[$$byval_copy3+3>>0]=HEAP8[$258+3>>0]|0; _nk_draw_text($251,$label$byval_copy,$252,$253,$254,$$byval_copy2,$$byval_copy3); STACKTOP = sp;return; } function _nk_label($ctx,$str,$alignment) { $ctx = $ctx|0; $str = $str|0; $alignment = $alignment|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $str; $2 = $alignment; $3 = $0; $4 = $1; $5 = $1; $6 = (_nk_strlen($5)|0); $7 = $2; _nk_text($3,$4,$6,$7); STACKTOP = sp;return; } function _nk_text($ctx,$str,$len,$alignment) { $ctx = $ctx|0; $str = $str|0; $len = $len|0; $alignment = $alignment|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 16|0; $0 = $ctx; $1 = $str; $2 = $len; $3 = $alignment; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14913|0),(13400|0),17122,(28576|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); if (!($7)) { STACKTOP = sp;return; } $8 = $0; $9 = $1; $10 = $2; $11 = $3; $12 = $0; $13 = ((($12)) + 300|0); $14 = ((($13)) + 20|0); ;HEAP8[$$byval_copy>>0]=HEAP8[$14>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$14+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$14+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$14+3>>0]|0; _nk_text_colored($8,$9,$10,$11,$$byval_copy); STACKTOP = sp;return; } function _nk_button_text($ctx,$title,$len,$behavior) { $ctx = $ctx|0; $title = $title|0; $len = $len|0; $behavior = $behavior|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, $bounds = 0, $bounds$byval_copy = 0, $in = 0, $layout = 0, $state = 0, $style = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $bounds$byval_copy = sp + 64|0; $bounds = sp + 8|0; $1 = $ctx; $2 = $title; $3 = $len; $4 = $behavior; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),17185,(28584|0)); // unreachable; } $7 = $1; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28537|0),(13400|0),17186,(28584|0)); // unreachable; } $11 = $1; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($13)) + 72|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28516|0),(13400|0),17187,(28584|0)); // unreachable; } $17 = $1; $18 = ($17|0)!=(0|0); if ($18) { $19 = $1; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if ($22) { $23 = $1; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ((($25)) + 72|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if ($28) { $29 = $1; $30 = ((($29)) + 11168|0); $31 = HEAP32[$30>>2]|0; $win = $31; $32 = $1; $33 = ((($32)) + 300|0); $style = $33; $34 = $win; $35 = ((($34)) + 72|0); $36 = HEAP32[$35>>2]|0; $layout = $36; $37 = $1; $38 = (_nk_widget($bounds,$37)|0); $state = $38; $39 = $state; $40 = ($39|0)!=(0); if (!($40)) { $0 = 0; $65 = $0; STACKTOP = sp;return ($65|0); } $41 = $state; $42 = ($41|0)==(2); if ($42) { $48 = 0; } else { $43 = $layout; $44 = HEAP32[$43>>2]|0; $45 = $44 & 1024; $46 = ($45|0)!=(0); if ($46) { $48 = 0; } else { $47 = $1; $48 = $47; } } $in = $48; $49 = $1; $50 = ((($49)) + 5668|0); $51 = $win; $52 = ((($51)) + 32|0); $53 = $2; $54 = $3; $55 = $style; $56 = ((($55)) + 32|0); $57 = ((($56)) + 80|0); $58 = HEAP32[$57>>2]|0; $59 = $4; $60 = $style; $61 = ((($60)) + 32|0); $62 = $in; $63 = $style; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $64 = (_nk_do_button_text($50,$52,$bounds$byval_copy,$53,$54,$58,$59,$61,$62,$63)|0); $0 = $64; $65 = $0; STACKTOP = sp;return ($65|0); } } } $0 = 0; $65 = $0; STACKTOP = sp;return ($65|0); } function _nk_do_button_text($state,$out,$bounds,$string,$len,$align,$behavior,$style,$in,$font) { $state = $state|0; $out = $out|0; $bounds = $bounds|0; $string = $string|0; $len = $len|0; $align = $align|0; $behavior = $behavior|0; $style = $style|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $7 = 0, $8 = 0, $9 = 0, $bounds$byval_copy = 0, $content = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 84|0; $$byval_copy = sp + 80|0; $bounds$byval_copy = sp + 64|0; $content = sp + 8|0; $1 = $state; $2 = $out; $3 = $string; $4 = $len; $5 = $align; $6 = $behavior; $7 = $style; $8 = $in; $9 = $font; $ret = 0; $10 = $1; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((28059|0),(13400|0),11531,(31637|0)); // unreachable; } $12 = $7; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((31462|0),(13400|0),11532,(31637|0)); // unreachable; } $14 = $2; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((31441|0),(13400|0),11533,(31637|0)); // unreachable; } $16 = $3; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((31655|0),(13400|0),11534,(31637|0)); // unreachable; } $18 = $9; $19 = ($18|0)!=(0|0); if (!($19)) { ___assert_fail((14249|0),(13400|0),11535,(31637|0)); // unreachable; } $20 = $2; $21 = ($20|0)!=(0|0); $22 = $7; $23 = ($22|0)!=(0|0); $or$cond = $21 & $23; $24 = $9; $25 = ($24|0)!=(0|0); $or$cond3 = $or$cond & $25; $26 = $3; $27 = ($26|0)!=(0|0); $or$cond5 = $or$cond3 & $27; if (!($or$cond5)) { $0 = 0; $63 = $0; STACKTOP = sp;return ($63|0); } $28 = $1; $29 = $2; $30 = $7; $31 = $8; $32 = $6; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $33 = (_nk_do_button($28,$29,$bounds$byval_copy,$30,$31,$32,$content)|0); $ret = $33; $34 = $7; $35 = ((($34)) + 120|0); $36 = HEAP32[$35>>2]|0; $37 = ($36|0)!=(0|0); if ($37) { $38 = $7; $39 = ((($38)) + 120|0); $40 = HEAP32[$39>>2]|0; $41 = $2; $42 = $7; $43 = ((($42)) + 116|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$43>>2]|0; FUNCTION_TABLE_vii[$40 & 31]($41,$$byval_copy); } $44 = $2; $45 = $1; $46 = HEAP32[$45>>2]|0; $47 = $7; $48 = $3; $49 = $4; $50 = $5; $51 = $9; _nk_draw_button_text($44,$bounds,$content,$46,$47,$48,$49,$50,$51); $52 = $7; $53 = ((($52)) + 124|0); $54 = HEAP32[$53>>2]|0; $55 = ($54|0)!=(0|0); if ($55) { $56 = $7; $57 = ((($56)) + 124|0); $58 = HEAP32[$57>>2]|0; $59 = $2; $60 = $7; $61 = ((($60)) + 116|0); ;HEAP32[$$byval_copy6>>2]=HEAP32[$61>>2]|0; FUNCTION_TABLE_vii[$58 & 31]($59,$$byval_copy6); } $62 = $ret; $0 = $62; $63 = $0; STACKTOP = sp;return ($63|0); } function _nk_button_label($ctx,$title,$behavior) { $ctx = $ctx|0; $title = $title|0; $behavior = $behavior|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $title; $2 = $behavior; $3 = $0; $4 = $1; $5 = $1; $6 = (_nk_strlen($5)|0); $7 = $2; $8 = (_nk_button_text($3,$4,$6,$7)|0); STACKTOP = sp;return ($8|0); } function _nk_do_button($state,$out,$r,$style,$in,$behavior,$content) { $state = $state|0; $out = $out|0; $r = $r|0; $style = $style|0; $in = $in|0; $behavior = $behavior|0; $content = $content|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0; var $25 = 0.0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0; var $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0; var $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0.0, $68 = 0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $bounds = 0, $bounds$byval_copy = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $bounds$byval_copy = sp + 48|0; $bounds = sp; $1 = $state; $2 = $out; $3 = $style; $4 = $in; $5 = $behavior; $6 = $content; $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((31462|0),(13400|0),11477,(31662|0)); // unreachable; } $9 = $1; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28059|0),(13400|0),11478,(31662|0)); // unreachable; } $11 = $2; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((31441|0),(13400|0),11479,(31662|0)); // unreachable; } $13 = $2; $14 = ($13|0)!=(0|0); $15 = $3; $16 = ($15|0)!=(0|0); $or$cond = $14 & $16; if ($or$cond) { $17 = +HEAPF32[$r>>2]; $18 = $3; $19 = ((($18)) + 92|0); $20 = +HEAPF32[$19>>2]; $21 = $17 + $20; $22 = $3; $23 = ((($22)) + 84|0); $24 = +HEAPF32[$23>>2]; $25 = $21 + $24; $26 = $6; HEAPF32[$26>>2] = $25; $27 = ((($r)) + 4|0); $28 = +HEAPF32[$27>>2]; $29 = $3; $30 = ((($29)) + 92|0); $31 = ((($30)) + 4|0); $32 = +HEAPF32[$31>>2]; $33 = $28 + $32; $34 = $3; $35 = ((($34)) + 84|0); $36 = +HEAPF32[$35>>2]; $37 = $33 + $36; $38 = $6; $39 = ((($38)) + 4|0); HEAPF32[$39>>2] = $37; $40 = ((($r)) + 8|0); $41 = +HEAPF32[$40>>2]; $42 = $3; $43 = ((($42)) + 92|0); $44 = +HEAPF32[$43>>2]; $45 = 2.0 * $44; $46 = $41 - $45; $47 = $3; $48 = ((($47)) + 84|0); $49 = +HEAPF32[$48>>2]; $50 = $46 + $49; $51 = $6; $52 = ((($51)) + 8|0); HEAPF32[$52>>2] = $50; $53 = ((($r)) + 12|0); $54 = +HEAPF32[$53>>2]; $55 = $3; $56 = ((($55)) + 92|0); $57 = ((($56)) + 4|0); $58 = +HEAPF32[$57>>2]; $59 = 2.0 * $58; $60 = $54 - $59; $61 = $3; $62 = ((($61)) + 84|0); $63 = +HEAPF32[$62>>2]; $64 = $60 + $63; $65 = $6; $66 = ((($65)) + 12|0); HEAPF32[$66>>2] = $64; $67 = +HEAPF32[$r>>2]; $68 = $3; $69 = ((($68)) + 108|0); $70 = +HEAPF32[$69>>2]; $71 = $67 - $70; HEAPF32[$bounds>>2] = $71; $72 = ((($r)) + 4|0); $73 = +HEAPF32[$72>>2]; $74 = $3; $75 = ((($74)) + 108|0); $76 = ((($75)) + 4|0); $77 = +HEAPF32[$76>>2]; $78 = $73 - $77; $79 = ((($bounds)) + 4|0); HEAPF32[$79>>2] = $78; $80 = ((($r)) + 8|0); $81 = +HEAPF32[$80>>2]; $82 = $3; $83 = ((($82)) + 108|0); $84 = +HEAPF32[$83>>2]; $85 = 2.0 * $84; $86 = $81 + $85; $87 = ((($bounds)) + 8|0); HEAPF32[$87>>2] = $86; $88 = ((($r)) + 12|0); $89 = +HEAPF32[$88>>2]; $90 = $3; $91 = ((($90)) + 108|0); $92 = ((($91)) + 4|0); $93 = +HEAPF32[$92>>2]; $94 = 2.0 * $93; $95 = $89 + $94; $96 = ((($bounds)) + 12|0); HEAPF32[$96>>2] = $95; $97 = $1; $98 = $4; $99 = $5; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $100 = (_nk_button_behavior($97,$bounds$byval_copy,$98,$99)|0); $0 = $100; $101 = $0; STACKTOP = sp;return ($101|0); } else { $0 = 0; $101 = $0; STACKTOP = sp;return ($101|0); } return (0)|0; } function _nk_draw_button($out,$bounds,$state,$style) { $out = $out|0; $bounds = $bounds|0; $state = $state|0; $style = $style|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $background = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy5 = sp + 108|0; $$byval_copy4 = sp + 88|0; $$byval_copy3 = sp + 72|0; $$byval_copy2 = sp + 104|0; $$byval_copy1 = sp + 56|0; $$byval_copy = sp + 40|0; $4 = sp; $0 = $out; $1 = $bounds; $2 = $state; $3 = $style; $5 = $2; $6 = $5 & 16; $7 = ($6|0)!=(0); do { if ($7) { $8 = $3; $9 = ((($8)) + 20|0); $background = $9; } else { $10 = $2; $11 = $10 & 32; $12 = ($11|0)!=(0); $13 = $3; if ($12) { $14 = ((($13)) + 40|0); $background = $14; break; } else { $background = $13; break; } } } while(0); $15 = $background; $16 = HEAP32[$15>>2]|0; $17 = ($16|0)==(1); $18 = $0; $19 = $1; if ($17) { $20 = $background; $21 = ((($20)) + 4|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$19+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$19+12>>2]|0; _nk_draw_image($18,$$byval_copy,$21); $37 = $background; STACKTOP = sp;return ($37|0); } else { $22 = $3; $23 = ((($22)) + 88|0); $24 = +HEAPF32[$23>>2]; $25 = $3; $26 = ((($25)) + 60|0); ;HEAP32[$$byval_copy1>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$19+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$19+12>>2]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$26>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$26+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$26+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$26+3>>0]|0; _nk_fill_rect($18,$$byval_copy1,$24,$$byval_copy2); $27 = $0; $28 = $1; $29 = $3; $30 = ((($29)) + 84|0); $31 = +HEAPF32[$30>>2]; ;HEAP32[$$byval_copy3>>2]=HEAP32[$28>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$28+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$28+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$28+12>>2]|0; _nk_shrink_rect($4,$$byval_copy3,$31); $32 = $3; $33 = ((($32)) + 88|0); $34 = +HEAPF32[$33>>2]; $35 = $background; $36 = ((($35)) + 4|0); ;HEAP32[$$byval_copy4>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$4+12>>2]|0; ;HEAP8[$$byval_copy5>>0]=HEAP8[$36>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$36+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$36+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$36+3>>0]|0; _nk_fill_rect($27,$$byval_copy4,$34,$$byval_copy5); $37 = $background; STACKTOP = sp;return ($37|0); } return (0)|0; } function _nk_do_button_symbol($state,$out,$bounds,$symbol,$behavior,$style,$in,$font) { $state = $state|0; $out = $out|0; $bounds = $bounds|0; $symbol = $symbol|0; $behavior = $behavior|0; $style = $style|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $bounds$byval_copy = 0, $content = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 76|0; $$byval_copy = sp + 72|0; $bounds$byval_copy = sp + 56|0; $content = sp; $1 = $state; $2 = $out; $3 = $symbol; $4 = $behavior; $5 = $style; $6 = $in; $7 = $font; $8 = $1; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((28059|0),(13400|0),11579,(31675|0)); // unreachable; } $10 = $5; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((31462|0),(13400|0),11580,(31675|0)); // unreachable; } $12 = $7; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((14249|0),(13400|0),11581,(31675|0)); // unreachable; } $14 = $2; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((31441|0),(13400|0),11582,(31675|0)); // unreachable; } $16 = $2; $17 = ($16|0)!=(0|0); $18 = $5; $19 = ($18|0)!=(0|0); $or$cond = $17 & $19; $20 = $7; $21 = ($20|0)!=(0|0); $or$cond3 = $or$cond & $21; $22 = $1; $23 = ($22|0)!=(0|0); $or$cond5 = $or$cond3 & $23; if (!($or$cond5)) { $0 = 0; $57 = $0; STACKTOP = sp;return ($57|0); } $24 = $1; $25 = $2; $26 = $5; $27 = $6; $28 = $4; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $29 = (_nk_do_button($24,$25,$bounds$byval_copy,$26,$27,$28,$content)|0); $ret = $29; $30 = $5; $31 = ((($30)) + 120|0); $32 = HEAP32[$31>>2]|0; $33 = ($32|0)!=(0|0); if ($33) { $34 = $5; $35 = ((($34)) + 120|0); $36 = HEAP32[$35>>2]|0; $37 = $2; $38 = $5; $39 = ((($38)) + 116|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$39>>2]|0; FUNCTION_TABLE_vii[$36 & 31]($37,$$byval_copy); } $40 = $2; $41 = $1; $42 = HEAP32[$41>>2]|0; $43 = $5; $44 = $3; $45 = $7; _nk_draw_button_symbol($40,$bounds,$content,$42,$43,$44,$45); $46 = $5; $47 = ((($46)) + 124|0); $48 = HEAP32[$47>>2]|0; $49 = ($48|0)!=(0|0); if ($49) { $50 = $5; $51 = ((($50)) + 124|0); $52 = HEAP32[$51>>2]|0; $53 = $2; $54 = $5; $55 = ((($54)) + 116|0); ;HEAP32[$$byval_copy6>>2]=HEAP32[$55>>2]|0; FUNCTION_TABLE_vii[$52 & 31]($53,$$byval_copy6); } $56 = $ret; $0 = $56; $57 = $0; STACKTOP = sp;return ($57|0); } function _nk_do_toggle($state,$out,$r,$active,$str,$len,$type,$style,$in,$font) { $state = $state|0; $out = $out|0; $r = $r|0; $active = $active|0; $str = $str|0; $len = $len|0; $type = $type|0; $style = $style|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy7 = 0, $$sink6 = 0.0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0; var $113 = 0, $114 = 0.0, $115 = 0, $116 = 0, $117 = 0.0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0, $124 = 0.0, $125 = 0, $126 = 0.0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0; var $131 = 0.0, $132 = 0.0, $133 = 0, $134 = 0.0, $135 = 0, $136 = 0, $137 = 0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0.0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0; var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0, $156 = 0.0, $157 = 0.0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0, $165 = 0.0, $166 = 0.0, $167 = 0; var $168 = 0.0, $169 = 0.0, $17 = 0, $170 = 0, $171 = 0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0.0, $183 = 0, $184 = 0.0, $185 = 0.0; var $186 = 0.0, $187 = 0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0.0, $191 = 0.0, $192 = 0, $193 = 0, $194 = 0.0, $195 = 0.0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0, $202 = 0.0; var $203 = 0.0, $204 = 0.0, $205 = 0, $206 = 0, $207 = 0.0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0.0, $215 = 0.0, $216 = 0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0, $220 = 0.0; var $221 = 0.0, $222 = 0, $223 = 0, $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0.0, $228 = 0.0, $229 = 0, $23 = 0, $230 = 0.0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0; var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0; var $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0; var $276 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0; var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0; var $bounds = 0, $bounds$byval_copy = 0, $cursor = 0, $cursor_pad = 0.0, $label = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $select = 0, $was_active = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy7 = sp + 140|0; $$byval_copy = sp + 136|0; $bounds$byval_copy = sp + 120|0; $bounds = sp + 56|0; $select = sp + 40|0; $cursor = sp + 24|0; $label = sp + 8|0; $1 = $state; $2 = $out; $3 = $active; $4 = $str; $5 = $len; $6 = $type; $7 = $style; $8 = $in; $9 = $font; $10 = $7; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((31462|0),(13400|0),11883,(31695|0)); // unreachable; } $12 = $2; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((31441|0),(13400|0),11884,(31695|0)); // unreachable; } $14 = $9; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((14249|0),(13400|0),11885,(31695|0)); // unreachable; } $16 = $2; $17 = ($16|0)!=(0|0); $18 = $7; $19 = ($18|0)!=(0|0); $or$cond = $17 & $19; $20 = $9; $21 = ($20|0)!=(0|0); $or$cond3 = $or$cond & $21; $22 = $3; $23 = ($22|0)!=(0|0); $or$cond5 = $or$cond3 & $23; if (!($or$cond5)) { $0 = 0; $276 = $0; STACKTOP = sp;return ($276|0); } $24 = ((($r)) + 8|0); $25 = +HEAPF32[$24>>2]; $26 = $9; $27 = ((($26)) + 4|0); $28 = +HEAPF32[$27>>2]; $29 = $7; $30 = ((($29)) + 120|0); $31 = +HEAPF32[$30>>2]; $32 = 2.0 * $31; $33 = $28 + $32; $34 = $25 < $33; if ($34) { $35 = $9; $36 = ((($35)) + 4|0); $37 = +HEAPF32[$36>>2]; $38 = $7; $39 = ((($38)) + 120|0); $40 = +HEAPF32[$39>>2]; $41 = 2.0 * $40; $42 = $37 + $41; $46 = $42; } else { $43 = ((($r)) + 8|0); $44 = +HEAPF32[$43>>2]; $46 = $44; } $45 = ((($r)) + 8|0); HEAPF32[$45>>2] = $46; $47 = ((($r)) + 12|0); $48 = +HEAPF32[$47>>2]; $49 = $9; $50 = ((($49)) + 4|0); $51 = +HEAPF32[$50>>2]; $52 = $7; $53 = ((($52)) + 120|0); $54 = ((($53)) + 4|0); $55 = +HEAPF32[$54>>2]; $56 = 2.0 * $55; $57 = $51 + $56; $58 = $48 < $57; if ($58) { $59 = $9; $60 = ((($59)) + 4|0); $61 = +HEAPF32[$60>>2]; $62 = $7; $63 = ((($62)) + 120|0); $64 = ((($63)) + 4|0); $65 = +HEAPF32[$64>>2]; $66 = 2.0 * $65; $67 = $61 + $66; $71 = $67; } else { $68 = ((($r)) + 12|0); $69 = +HEAPF32[$68>>2]; $71 = $69; } $70 = ((($r)) + 12|0); HEAPF32[$70>>2] = $71; $72 = +HEAPF32[$r>>2]; $73 = $7; $74 = ((($73)) + 128|0); $75 = +HEAPF32[$74>>2]; $76 = $72 - $75; HEAPF32[$bounds>>2] = $76; $77 = ((($r)) + 4|0); $78 = +HEAPF32[$77>>2]; $79 = $7; $80 = ((($79)) + 128|0); $81 = ((($80)) + 4|0); $82 = +HEAPF32[$81>>2]; $83 = $78 - $82; $84 = ((($bounds)) + 4|0); HEAPF32[$84>>2] = $83; $85 = ((($r)) + 8|0); $86 = +HEAPF32[$85>>2]; $87 = $7; $88 = ((($87)) + 128|0); $89 = +HEAPF32[$88>>2]; $90 = 2.0 * $89; $91 = $86 + $90; $92 = ((($bounds)) + 8|0); HEAPF32[$92>>2] = $91; $93 = ((($r)) + 12|0); $94 = +HEAPF32[$93>>2]; $95 = $7; $96 = ((($95)) + 128|0); $97 = ((($96)) + 4|0); $98 = +HEAPF32[$97>>2]; $99 = 2.0 * $98; $100 = $94 + $99; $101 = ((($bounds)) + 12|0); HEAPF32[$101>>2] = $100; $102 = ((($r)) + 12|0); $103 = +HEAPF32[$102>>2]; $104 = $9; $105 = ((($104)) + 4|0); $106 = +HEAPF32[$105>>2]; $107 = $7; $108 = ((($107)) + 120|0); $109 = ((($108)) + 4|0); $110 = +HEAPF32[$109>>2]; $111 = $106 + $110; $112 = $103 < $111; if ($112) { $113 = ((($r)) + 12|0); $114 = +HEAPF32[$113>>2]; $124 = $114; } else { $115 = $9; $116 = ((($115)) + 4|0); $117 = +HEAPF32[$116>>2]; $118 = $7; $119 = ((($118)) + 120|0); $120 = ((($119)) + 4|0); $121 = +HEAPF32[$120>>2]; $122 = $117 + $121; $124 = $122; } $123 = ((($select)) + 8|0); HEAPF32[$123>>2] = $124; $125 = ((($select)) + 8|0); $126 = +HEAPF32[$125>>2]; $127 = ((($select)) + 12|0); HEAPF32[$127>>2] = $126; $128 = +HEAPF32[$r>>2]; $129 = $7; $130 = ((($129)) + 120|0); $131 = +HEAPF32[$130>>2]; $132 = $128 + $131; HEAPF32[$select>>2] = $132; $133 = ((($r)) + 4|0); $134 = +HEAPF32[$133>>2]; $135 = $7; $136 = ((($135)) + 120|0); $137 = ((($136)) + 4|0); $138 = +HEAPF32[$137>>2]; $139 = $134 + $138; $140 = ((($select)) + 8|0); $141 = +HEAPF32[$140>>2]; $142 = $141 / 2.0; $143 = $139 + $142; $144 = $9; $145 = ((($144)) + 4|0); $146 = +HEAPF32[$145>>2]; $147 = $146 / 2.0; $148 = $143 - $147; $149 = ((($select)) + 4|0); HEAPF32[$149>>2] = $148; $150 = $6; $151 = ($150|0)==(1); $152 = ((($select)) + 8|0); $153 = +HEAPF32[$152>>2]; $154 = $153 / 4.0; $155 = ((($select)) + 12|0); $156 = +HEAPF32[$155>>2]; $157 = $156 / 6.0; $$sink6 = $151 ? $154 : $157; $158 = (~~(($$sink6))); $159 = (+($158|0)); $cursor_pad = $159; $160 = ((($select)) + 8|0); $161 = +HEAPF32[$160>>2]; $162 = $cursor_pad; $163 = $162 * 2.0; $164 = $161 < $163; $165 = $cursor_pad; $166 = $165 * 2.0; $167 = ((($select)) + 8|0); $168 = +HEAPF32[$167>>2]; $169 = $164 ? $166 : $168; $170 = ((($select)) + 12|0); HEAPF32[$170>>2] = $169; $171 = ((($select)) + 12|0); $172 = +HEAPF32[$171>>2]; $173 = $cursor_pad; $174 = $173 * 2.0; $175 = $172 - $174; $176 = ((($cursor)) + 12|0); HEAPF32[$176>>2] = $175; $177 = ((($cursor)) + 12|0); $178 = +HEAPF32[$177>>2]; $179 = ((($cursor)) + 8|0); HEAPF32[$179>>2] = $178; $180 = +HEAPF32[$select>>2]; $181 = $cursor_pad; $182 = $180 + $181; HEAPF32[$cursor>>2] = $182; $183 = ((($select)) + 4|0); $184 = +HEAPF32[$183>>2]; $185 = $cursor_pad; $186 = $184 + $185; $187 = ((($cursor)) + 4|0); HEAPF32[$187>>2] = $186; $188 = +HEAPF32[$r>>2]; $189 = ((($select)) + 8|0); $190 = +HEAPF32[$189>>2]; $191 = $188 + $190; $192 = $7; $193 = ((($192)) + 120|0); $194 = +HEAPF32[$193>>2]; $195 = $194 * 2.0; $196 = $191 + $195; HEAPF32[$label>>2] = $196; $197 = ((($select)) + 4|0); $198 = +HEAPF32[$197>>2]; $199 = ((($label)) + 4|0); HEAPF32[$199>>2] = $198; $200 = +HEAPF32[$r>>2]; $201 = ((($r)) + 8|0); $202 = +HEAPF32[$201>>2]; $203 = $200 + $202; $204 = +HEAPF32[$label>>2]; $205 = $7; $206 = ((($205)) + 120|0); $207 = +HEAPF32[$206>>2]; $208 = $204 + $207; $209 = $203 < $208; if ($209) { $210 = +HEAPF32[$label>>2]; $211 = $7; $212 = ((($211)) + 120|0); $213 = +HEAPF32[$212>>2]; $214 = $210 + $213; $220 = $214; } else { $215 = +HEAPF32[$r>>2]; $216 = ((($r)) + 8|0); $217 = +HEAPF32[$216>>2]; $218 = $215 + $217; $220 = $218; } $219 = ((($label)) + 8|0); HEAPF32[$219>>2] = $220; $221 = +HEAPF32[$label>>2]; $222 = $7; $223 = ((($222)) + 120|0); $224 = +HEAPF32[$223>>2]; $225 = $221 + $224; $226 = ((($label)) + 8|0); $227 = +HEAPF32[$226>>2]; $228 = $227 - $225; HEAPF32[$226>>2] = $228; $229 = ((($select)) + 8|0); $230 = +HEAPF32[$229>>2]; $231 = ((($label)) + 12|0); HEAPF32[$231>>2] = $230; $232 = $3; $233 = HEAP32[$232>>2]|0; $was_active = $233; $234 = $8; $235 = $1; $236 = $3; $237 = HEAP32[$236>>2]|0; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $238 = (_nk_toggle_behavior($234,$bounds$byval_copy,$235,$237)|0); $239 = $3; HEAP32[$239>>2] = $238; $240 = $7; $241 = ((($240)) + 140|0); $242 = HEAP32[$241>>2]|0; $243 = ($242|0)!=(0|0); if ($243) { $244 = $7; $245 = ((($244)) + 140|0); $246 = HEAP32[$245>>2]|0; $247 = $2; $248 = $7; $249 = ((($248)) + 136|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$249>>2]|0; FUNCTION_TABLE_vii[$246 & 31]($247,$$byval_copy); } $250 = $6; $251 = ($250|0)==(0); $252 = $2; $253 = $1; $254 = HEAP32[$253>>2]|0; $255 = $7; $256 = $3; $257 = HEAP32[$256>>2]|0; $258 = $4; $259 = $5; $260 = $9; if ($251) { _nk_draw_checkbox($252,$254,$255,$257,$label,$select,$cursor,$258,$259,$260); } else { _nk_draw_option($252,$254,$255,$257,$label,$select,$cursor,$258,$259,$260); } $261 = $7; $262 = ((($261)) + 144|0); $263 = HEAP32[$262>>2]|0; $264 = ($263|0)!=(0|0); if ($264) { $265 = $7; $266 = ((($265)) + 144|0); $267 = HEAP32[$266>>2]|0; $268 = $2; $269 = $7; $270 = ((($269)) + 136|0); ;HEAP32[$$byval_copy7>>2]=HEAP32[$270>>2]|0; FUNCTION_TABLE_vii[$267 & 31]($268,$$byval_copy7); } $271 = $was_active; $272 = $3; $273 = HEAP32[$272>>2]|0; $274 = ($271|0)!=($273|0); $275 = $274&1; $0 = $275; $276 = $0; STACKTOP = sp;return ($276|0); } function _nk_option_text($ctx,$text,$len,$is_active) { $ctx = $ctx|0; $text = $text|0; $len = $len|0; $is_active = $is_active|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0; var $8 = 0, $9 = 0, $bounds = 0, $bounds$byval_copy = 0, $in = 0, $layout = 0, $state = 0, $style = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $bounds$byval_copy = sp + 64|0; $4 = sp + 40|0; $bounds = sp + 8|0; $1 = $ctx; $2 = $text; $3 = $len; HEAP32[$4>>2] = $is_active; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),17561,(28599|0)); // unreachable; } $7 = $1; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28537|0),(13400|0),17562,(28599|0)); // unreachable; } $11 = $1; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($13)) + 72|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28516|0),(13400|0),17563,(28599|0)); // unreachable; } $17 = $1; $18 = ($17|0)!=(0|0); if ($18) { $19 = $1; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if ($22) { $23 = $1; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ((($25)) + 72|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if ($28) { $30 = $1; $31 = ((($30)) + 11168|0); $32 = HEAP32[$31>>2]|0; $win = $32; $33 = $1; $34 = ((($33)) + 300|0); $style = $34; $35 = $win; $36 = ((($35)) + 72|0); $37 = HEAP32[$36>>2]|0; $layout = $37; $38 = $1; $39 = (_nk_widget($bounds,$38)|0); $state = $39; $40 = $state; $41 = ($40|0)!=(0); $42 = $state; if (!($41)) { $0 = $42; $61 = $0; STACKTOP = sp;return ($61|0); } $43 = ($42|0)==(2); if ($43) { $49 = 0; } else { $44 = $layout; $45 = HEAP32[$44>>2]|0; $46 = $45 & 1024; $47 = ($46|0)!=(0); if ($47) { $49 = 0; } else { $48 = $1; $49 = $48; } } $in = $49; $50 = $1; $51 = ((($50)) + 5668|0); $52 = $win; $53 = ((($52)) + 32|0); $54 = $2; $55 = $3; $56 = $style; $57 = ((($56)) + 416|0); $58 = $in; $59 = $style; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; (_nk_do_toggle($51,$53,$bounds$byval_copy,$4,$54,$55,1,$57,$58,$59)|0); $60 = HEAP32[$4>>2]|0; $0 = $60; $61 = $0; STACKTOP = sp;return ($61|0); } } } $29 = HEAP32[$4>>2]|0; $0 = $29; $61 = $0; STACKTOP = sp;return ($61|0); } function _nk_option_label($ctx,$label,$active) { $ctx = $ctx|0; $label = $label|0; $active = $active|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $label; $2 = $active; $3 = $0; $4 = $1; $5 = $1; $6 = (_nk_strlen($5)|0); $7 = $2; $8 = (_nk_option_text($3,$4,$6,$7)|0); STACKTOP = sp;return ($8|0); } function _nk_do_edit($state,$out,$bounds,$flags,$filter,$edit,$style,$in,$font) { $state = $state|0; $out = $out|0; $bounds = $bounds|0; $flags = $flags|0; $filter = $filter|0; $edit = $edit|0; $style = $style|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy16 = 0, $$byval_copy18 = 0, $$byval_copy20 = 0, $$byval_copy21 = 0, $$byval_copy23 = 0, $$byval_copy24 = 0, $$byval_copy30 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $1000 = 0.0, $1001 = 0, $1002 = 0, $1003 = 0.0, $1004 = 0.0, $1005 = 0, $1006 = 0.0, $1007 = 0; var $1008 = 0.0, $1009 = 0.0, $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0.0, $1014 = 0.0, $1015 = 0.0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0.0, $1023 = 0, $1024 = 0, $1025 = 0; var $1026 = 0, $1027 = 0, $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0; var $1044 = 0, $1045 = 0, $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0.0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0.0, $1053 = 0.0, $1054 = 0, $1055 = 0.0, $1056 = 0, $1057 = 0.0, $1058 = 0.0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0; var $1062 = 0.0, $1063 = 0.0, $1064 = 0.0, $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $1071 = 0.0, $1072 = 0, $1073 = 0, $1074 = 0, $1075 = 0, $1076 = 0, $1077 = 0, $1078 = 0, $1079 = 0, $108 = 0; var $1080 = 0, $1081 = 0, $1082 = 0, $1083 = 0, $1084 = 0, $1085 = 0, $1086 = 0, $1087 = 0, $1088 = 0, $1089 = 0, $109 = 0, $1090 = 0, $1091 = 0, $1092 = 0, $1093 = 0, $1094 = 0, $1095 = 0.0, $1096 = 0, $1097 = 0, $1098 = 0; var $1099 = 0.0, $11 = 0, $110 = 0, $1100 = 0, $1101 = 0.0, $1102 = 0.0, $1103 = 0.0, $1104 = 0, $1105 = 0, $1106 = 0.0, $1107 = 0.0, $1108 = 0, $1109 = 0.0, $111 = 0, $1110 = 0, $1111 = 0.0, $1112 = 0.0, $1113 = 0.0, $1114 = 0.0, $1115 = 0.0; var $1116 = 0, $1117 = 0.0, $1118 = 0.0, $1119 = 0.0, $112 = 0, $1120 = 0, $1121 = 0, $1122 = 0, $1123 = 0, $1124 = 0.0, $1125 = 0, $1126 = 0.0, $1127 = 0.0, $1128 = 0, $1129 = 0, $113 = 0, $1130 = 0, $1131 = 0, $1132 = 0, $1133 = 0.0; var $1134 = 0.0, $1135 = 0.0, $1136 = 0, $1137 = 0, $1138 = 0.0, $1139 = 0.0, $114 = 0, $1140 = 0, $1141 = 0.0, $1142 = 0, $1143 = 0.0, $1144 = 0.0, $1145 = 0, $1146 = 0, $1147 = 0, $1148 = 0.0, $1149 = 0.0, $115 = 0, $1150 = 0, $1151 = 0; var $1152 = 0, $1153 = 0, $1154 = 0, $1155 = 0, $1156 = 0, $1157 = 0.0, $1158 = 0, $1159 = 0, $116 = 0, $1160 = 0.0, $1161 = 0, $1162 = 0.0, $1163 = 0, $1164 = 0, $1165 = 0, $1166 = 0, $1167 = 0, $1168 = 0, $1169 = 0, $117 = 0; var $1170 = 0, $1171 = 0, $1172 = 0, $1173 = 0, $1174 = 0, $1175 = 0, $1176 = 0, $1177 = 0, $1178 = 0, $1179 = 0, $118 = 0.0, $1180 = 0, $1181 = 0, $1182 = 0, $1183 = 0, $1184 = 0, $1185 = 0, $1186 = 0, $1187 = 0, $1188 = 0; var $1189 = 0, $119 = 0, $1190 = 0, $1191 = 0, $1192 = 0, $1193 = 0, $1194 = 0, $1195 = 0, $1196 = 0, $1197 = 0, $1198 = 0, $1199 = 0, $12 = 0, $120 = 0, $1200 = 0, $1201 = 0, $1202 = 0.0, $1203 = 0, $1204 = 0, $1205 = 0.0; var $1206 = 0.0, $1207 = 0, $1208 = 0.0, $1209 = 0, $121 = 0, $1210 = 0, $1211 = 0, $1212 = 0.0, $1213 = 0.0, $1214 = 0, $1215 = 0, $1216 = 0.0, $1217 = 0, $1218 = 0, $1219 = 0, $122 = 0.0, $1220 = 0, $123 = 0, $124 = 0, $125 = 0; var $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0, $133 = 0, $134 = 0.0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0; var $144 = 0, $145 = 0.0, $146 = 0, $147 = 0.0, $148 = 0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0; var $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0; var $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0; var $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0; var $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0.0, $223 = 0.0, $224 = 0.0, $225 = 0, $226 = 0, $227 = 0.0, $228 = 0.0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0; var $234 = 0, $235 = 0, $236 = 0.0, $237 = 0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0.0, $241 = 0.0, $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0, $250 = 0, $251 = 0; var $252 = 0, $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0; var $270 = 0, $271 = 0, $272 = 0.0, $273 = 0.0, $274 = 0, $275 = 0.0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0.0, $287 = 0, $288 = 0; var $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0.0, $293 = 0, $294 = 0, $295 = 0.0, $296 = 0.0, $297 = 0, $298 = 0.0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0; var $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0.0, $316 = 0, $317 = 0, $318 = 0.0, $319 = 0, $32 = 0.0, $320 = 0, $321 = 0, $322 = 0, $323 = 0; var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0.0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0.0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0; var $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0.0; var $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0.0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0; var $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0.0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0; var $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0; var $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0.0, $430 = 0, $431 = 0; var $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0.0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0; var $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0; var $469 = 0, $47 = 0.0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0.0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0; var $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0.0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0.0, $501 = 0, $502 = 0, $503 = 0.0; var $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0.0, $510 = 0.0, $511 = 0, $512 = 0.0, $513 = 0.0, $514 = 0.0, $515 = 0, $516 = 0.0, $517 = 0.0, $518 = 0, $519 = 0.0, $52 = 0, $520 = 0.0, $521 = 0; var $522 = 0.0, $523 = 0, $524 = 0.0, $525 = 0.0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0.0; var $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0.0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0; var $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0.0, $571 = 0, $572 = 0, $573 = 0.0, $574 = 0, $575 = 0, $576 = 0; var $577 = 0, $578 = 0, $579 = 0, $58 = 0.0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0.0, $59 = 0.0, $590 = 0.0, $591 = 0.0, $592 = 0, $593 = 0, $594 = 0; var $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0.0, $600 = 0.0, $601 = 0.0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0.0, $610 = 0, $611 = 0; var $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0.0, $62 = 0, $620 = 0.0, $621 = 0.0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0; var $630 = 0.0, $631 = 0.0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0.0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0; var $649 = 0.0, $65 = 0, $650 = 0.0, $651 = 0.0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0.0, $661 = 0.0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0; var $667 = 0.0, $668 = 0.0, $669 = 0, $67 = 0, $670 = 0.0, $671 = 0.0, $672 = 0.0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0.0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0; var $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0.0, $690 = 0, $691 = 0, $692 = 0.0, $693 = 0.0, $694 = 0.0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0.0; var $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0.0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0.0, $716 = 0.0, $717 = 0.0, $718 = 0, $719 = 0, $72 = 0.0; var $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0.0, $73 = 0.0, $730 = 0, $731 = 0.0, $732 = 0.0, $733 = 0.0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0; var $739 = 0, $74 = 0.0, $740 = 0, $741 = 0.0, $742 = 0.0, $743 = 0.0, $744 = 0, $745 = 0, $746 = 0.0, $747 = 0, $748 = 0.0, $749 = 0.0, $75 = 0.0, $750 = 0.0, $751 = 0, $752 = 0.0, $753 = 0.0, $754 = 0.0, $755 = 0, $756 = 0.0; var $757 = 0.0, $758 = 0, $759 = 0, $76 = 0, $760 = 0.0, $761 = 0, $762 = 0, $763 = 0.0, $764 = 0, $765 = 0.0, $766 = 0.0, $767 = 0, $768 = 0.0, $769 = 0, $77 = 0, $770 = 0.0, $771 = 0.0, $772 = 0, $773 = 0.0, $774 = 0; var $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0.0, $783 = 0, $784 = 0, $785 = 0, $786 = 0.0, $787 = 0, $788 = 0, $789 = 0.0, $79 = 0, $790 = 0.0, $791 = 0.0, $792 = 0; var $793 = 0, $794 = 0.0, $795 = 0.0, $796 = 0.0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0.0, $801 = 0, $802 = 0.0, $803 = 0, $804 = 0, $805 = 0, $806 = 0.0, $807 = 0, $808 = 0.0, $809 = 0.0, $81 = 0.0; var $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0.0, $815 = 0.0, $816 = 0.0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0.0, $824 = 0, $825 = 0.0, $826 = 0.0, $827 = 0, $828 = 0; var $829 = 0.0, $83 = 0, $830 = 0.0, $831 = 0, $832 = 0.0, $833 = 0, $834 = 0, $835 = 0, $836 = 0.0, $837 = 0, $838 = 0, $839 = 0.0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0.0, $845 = 0, $846 = 0.0; var $847 = 0.0, $848 = 0, $849 = 0.0, $85 = 0.0, $850 = 0.0, $851 = 0, $852 = 0.0, $853 = 0, $854 = 0.0, $855 = 0.0, $856 = 0.0, $857 = 0.0, $858 = 0, $859 = 0, $86 = 0.0, $860 = 0, $861 = 0, $862 = 0.0, $863 = 0, $864 = 0; var $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0; var $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0; var $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0; var $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0.0, $929 = 0, $93 = 0.0, $930 = 0, $931 = 0.0, $932 = 0.0, $933 = 0, $934 = 0.0, $935 = 0, $936 = 0; var $937 = 0, $938 = 0.0, $939 = 0.0, $94 = 0, $940 = 0, $941 = 0, $942 = 0.0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0; var $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0.0, $96 = 0.0, $960 = 0, $961 = 0, $962 = 0.0, $963 = 0.0, $964 = 0, $965 = 0.0, $966 = 0, $967 = 0, $968 = 0, $969 = 0.0, $97 = 0.0, $970 = 0.0, $971 = 0, $972 = 0; var $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0.0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0.0, $990 = 0; var $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $area = 0, $b = 0, $background = 0, $background12 = 0, $background22 = 0, $background_color = 0, $background_color$byval_copy = 0, $background_color$byval_copy26 = 0, $background_color$byval_copy28 = 0, $background_color23 = 0, $background_color23$byval_copy = 0; var $begin = 0, $begin13 = 0, $begin14 = 0, $begin15 = 0, $begin16 = 0, $begin21 = 0, $bounds$byval_copy = 0, $bounds$byval_copy17 = 0, $bounds$byval_copy19 = 0, $bounds$byval_copy22 = 0, $bounds$byval_copy25 = 0, $clip = 0, $clip$byval_copy = 0, $copy = 0, $cursor = 0, $cursor$byval_copy = 0, $cursor_color = 0, $cursor_color$byval_copy = 0, $cursor_color$byval_copy31 = 0, $cursor_follow = 0; var $cursor_pos = 0, $cursor_ptr = 0, $cursor_text_color = 0, $cut = 0, $e = 0, $end = 0, $end17 = 0, $glyph_len = 0, $glyph_len18 = 0, $glyph_len2 = 0, $glyph_offset = 0, $glyph_offset4 = 0, $glyph_offset8 = 0, $glyph_width = 0.0, $glyphs = 0, $i = 0, $is_hovered = 0, $l = 0, $l20 = 0, $label = 0; var $label$byval_copy = 0, $label$byval_copy32 = 0, $len = 0, $line_width = 0.0, $mouse_x = 0.0, $mouse_y = 0.0, $old_clip = 0, $old_clip$byval_copy = 0, $old_mode = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $out_offset = 0, $out_offset5 = 0, $out_offset9 = 0; var $paste = 0, $prev_state = 0, $remaining = 0, $remaining11 = 0, $remaining7 = 0, $ret = 0, $row_begin = 0, $row_height = 0.0, $row_size = 0, $row_size10 = 0, $row_size6 = 0, $scroll = 0, $scroll_inc = 0.0, $scroll_increment = 0.0, $scroll_offset = 0.0, $scroll_step = 0.0, $scroll_target = 0.0, $sel_background_color = 0, $sel_background_color$byval_copy = 0, $sel_text_color = 0; var $sel_text_color$byval_copy = 0, $select_all = 0, $select_begin_ptr = 0, $select_end_ptr = 0, $selection_begin = 0, $selection_end = 0, $selection_offset_end = 0, $selection_offset_start = 0, $shift_mod = 0, $tab = 0, $text = 0, $text1 = 0, $text_color = 0, $text_color$byval_copy = 0, $text_color$byval_copy27 = 0, $text_color$byval_copy29 = 0, $text_color24 = 0, $text_color24$byval_copy = 0, $text_len = 0, $text_size = 0; var $total_lines = 0, $txt = 0, $type = 0, $unicode = 0, $unicode19 = 0, $unicode3 = 0, $ws = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 880|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $old_clip$byval_copy = sp + 752|0; $text_color24$byval_copy = sp + 864|0; $background_color23$byval_copy = sp + 860|0; $label$byval_copy32 = sp + 736|0; $cursor_color$byval_copy31 = sp + 856|0; $label$byval_copy = sp + 720|0; $$byval_copy30 = sp + 712|0; $cursor_color$byval_copy = sp + 852|0; $cursor$byval_copy = sp + 696|0; $text_color$byval_copy29 = sp + 848|0; $background_color$byval_copy28 = sp + 844|0; $sel_text_color$byval_copy = sp + 840|0; $sel_background_color$byval_copy = sp + 836|0; $text_color$byval_copy27 = sp + 832|0; $background_color$byval_copy26 = sp + 828|0; $text_color$byval_copy = sp + 824|0; $background_color$byval_copy = sp + 820|0; $bounds$byval_copy25 = sp + 680|0; $$byval_copy24 = sp + 676|0; $$byval_copy23 = sp + 672|0; $clip$byval_copy = sp + 656|0; $bounds$byval_copy22 = sp + 640|0; $$byval_copy21 = sp + 816|0; $$byval_copy20 = sp + 624|0; $bounds$byval_copy19 = sp + 608|0; $$byval_copy18 = sp + 812|0; $bounds$byval_copy17 = sp + 592|0; $$byval_copy16 = sp + 588|0; $$byval_copy = sp + 584|0; $bounds$byval_copy = sp + 568|0; $area = sp + 512|0; $glyph_len = sp + 464|0; $unicode = sp + 460|0; $clip = sp + 416|0; $old_clip = sp + 400|0; $9 = sp + 368|0; $text_size = sp + 352|0; $cursor_pos = sp + 328|0; $selection_offset_start = sp + 320|0; $selection_offset_end = sp + 312|0; $unicode3 = sp + 288|0; $glyph_offset = sp + 272|0; $out_offset = sp + 264|0; $row_size = sp + 256|0; $remaining = sp + 248|0; $10 = sp + 240|0; $glyph_offset4 = sp + 232|0; $out_offset5 = sp + 224|0; $row_size6 = sp + 216|0; $remaining7 = sp + 208|0; $11 = sp + 200|0; $glyph_offset8 = sp + 192|0; $out_offset9 = sp + 184|0; $row_size10 = sp + 176|0; $remaining11 = sp + 168|0; $12 = sp + 160|0; $ws = sp + 152|0; $scroll = sp + 136|0; $background_color = sp + 804|0; $text_color = sp + 800|0; $sel_background_color = sp + 796|0; $sel_text_color = sp + 792|0; $cursor_color = sp + 788|0; $cursor_text_color = sp + 784|0; $13 = sp + 780|0; $cursor = sp + 72|0; $label = sp + 48|0; $txt = sp + 32|0; $unicode19 = sp + 24|0; $14 = sp + 16|0; $background_color23 = sp + 776|0; $text_color24 = sp + 772|0; $15 = sp + 768|0; $1 = $state; $2 = $out; $3 = $flags; $4 = $filter; $5 = $edit; $6 = $style; $7 = $in; $8 = $font; $ret = 0; $prev_state = 0; $is_hovered = 0; $select_all = 0; $cursor_follow = 0; $16 = $1; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((28059|0),(13400|0),12787,(31708|0)); // unreachable; } $18 = $2; $19 = ($18|0)!=(0|0); if (!($19)) { ___assert_fail((31441|0),(13400|0),12788,(31708|0)); // unreachable; } $20 = $6; $21 = ($20|0)!=(0|0); if (!($21)) { ___assert_fail((31462|0),(13400|0),12789,(31708|0)); // unreachable; } $22 = $1; $23 = ($22|0)!=(0|0); $24 = $2; $25 = ($24|0)!=(0|0); $or$cond = $23 & $25; $26 = $6; $27 = ($26|0)!=(0|0); $or$cond3 = $or$cond & $27; if (!($or$cond3)) { $28 = $ret; $0 = $28; $1220 = $0; STACKTOP = sp;return ($1220|0); } $29 = +HEAPF32[$bounds>>2]; $30 = $6; $31 = ((($30)) + 560|0); $32 = +HEAPF32[$31>>2]; $33 = $29 + $32; $34 = $6; $35 = ((($34)) + 540|0); $36 = +HEAPF32[$35>>2]; $37 = $33 + $36; HEAPF32[$area>>2] = $37; $38 = ((($bounds)) + 4|0); $39 = +HEAPF32[$38>>2]; $40 = $6; $41 = ((($40)) + 560|0); $42 = ((($41)) + 4|0); $43 = +HEAPF32[$42>>2]; $44 = $39 + $43; $45 = $6; $46 = ((($45)) + 540|0); $47 = +HEAPF32[$46>>2]; $48 = $44 + $47; $49 = ((($area)) + 4|0); HEAPF32[$49>>2] = $48; $50 = ((($bounds)) + 8|0); $51 = +HEAPF32[$50>>2]; $52 = $6; $53 = ((($52)) + 560|0); $54 = +HEAPF32[$53>>2]; $55 = 2.0 * $54; $56 = $6; $57 = ((($56)) + 540|0); $58 = +HEAPF32[$57>>2]; $59 = 2.0 * $58; $60 = $55 + $59; $61 = $51 - $60; $62 = ((($area)) + 8|0); HEAPF32[$62>>2] = $61; $63 = ((($bounds)) + 12|0); $64 = +HEAPF32[$63>>2]; $65 = $6; $66 = ((($65)) + 560|0); $67 = ((($66)) + 4|0); $68 = +HEAPF32[$67>>2]; $69 = 2.0 * $68; $70 = $6; $71 = ((($70)) + 540|0); $72 = +HEAPF32[$71>>2]; $73 = 2.0 * $72; $74 = $69 + $73; $75 = $64 - $74; $76 = ((($area)) + 12|0); HEAPF32[$76>>2] = $75; $77 = $3; $78 = $77 & 2048; $79 = ($78|0)!=(0); if ($79) { $80 = ((($area)) + 12|0); $81 = +HEAPF32[$80>>2]; $82 = $6; $83 = ((($82)) + 552|0); $84 = ((($83)) + 4|0); $85 = +HEAPF32[$84>>2]; $86 = $81 - $85; $87 = ((($area)) + 12|0); HEAPF32[$87>>2] = $86; } $88 = $3; $89 = $88 & 2048; $90 = ($89|0)!=(0); if ($90) { $91 = $8; $92 = ((($91)) + 4|0); $93 = +HEAPF32[$92>>2]; $94 = $6; $95 = ((($94)) + 568|0); $96 = +HEAPF32[$95>>2]; $97 = $93 + $96; $100 = $97; } else { $98 = ((($area)) + 12|0); $99 = +HEAPF32[$98>>2]; $100 = $99; } $row_height = $100; $101 = $5; $102 = ((($101)) + 105|0); $103 = HEAP8[$102>>0]|0; $prev_state = $103; $104 = $7; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $105 = (_nk_input_is_mouse_hovering_rect($104,$bounds$byval_copy)|0); $106 = $105&255; $is_hovered = $106; $107 = $7; $108 = ($107|0)!=(0|0); if ($108) { $109 = $7; $110 = ((($109)) + 220|0); $111 = ((($110)) + 4|0); $112 = HEAP32[$111>>2]|0; $113 = ($112|0)!=(0); if ($113) { $114 = $7; $115 = ((($114)) + 220|0); $116 = HEAP32[$115>>2]|0; $117 = ($116|0)!=(0); if ($117) { $118 = +HEAPF32[$bounds>>2]; $119 = $7; $120 = ((($119)) + 220|0); $121 = ((($120)) + 48|0); $122 = +HEAPF32[$121>>2]; $123 = $118 <= $122; if ($123) { $124 = $7; $125 = ((($124)) + 220|0); $126 = ((($125)) + 48|0); $127 = +HEAPF32[$126>>2]; $128 = +HEAPF32[$bounds>>2]; $129 = ((($bounds)) + 8|0); $130 = +HEAPF32[$129>>2]; $131 = $128 + $130; $132 = $127 <= $131; if ($132) { $133 = ((($bounds)) + 4|0); $134 = +HEAPF32[$133>>2]; $135 = $7; $136 = ((($135)) + 220|0); $137 = ((($136)) + 48|0); $138 = ((($137)) + 4|0); $139 = +HEAPF32[$138>>2]; $140 = $134 <= $139; if ($140) { $141 = $7; $142 = ((($141)) + 220|0); $143 = ((($142)) + 48|0); $144 = ((($143)) + 4|0); $145 = +HEAPF32[$144>>2]; $146 = ((($bounds)) + 4|0); $147 = +HEAPF32[$146>>2]; $148 = ((($bounds)) + 12|0); $149 = +HEAPF32[$148>>2]; $150 = $147 + $149; $151 = $145 <= $150; $153 = $151; } else { $153 = 0; } } else { $153 = 0; } } else { $153 = 0; } $152 = $153&1; $154 = $152&255; $155 = $5; $156 = ((($155)) + 105|0); HEAP8[$156>>0] = $154; } } } $157 = $prev_state; $158 = ($157<<24>>24)!=(0); if ($158) { label = 28; } else { $159 = $5; $160 = ((($159)) + 105|0); $161 = HEAP8[$160>>0]|0; $162 = $161&255; $163 = ($162|0)!=(0); if ($163) { $164 = $3; $165 = $164 & 2048; $166 = ($165|0)!=(0); $167 = $166 ? 1 : 0; $type = $167; $168 = $5; $169 = $type; $170 = $4; _nk_textedit_clear_state($168,$169,$170); $171 = $3; $172 = $171 & 512; $173 = ($172|0)!=(0); if ($173) { $174 = $5; $175 = ((($174)) + 100|0); HEAP8[$175>>0] = 1; } $176 = $3; $177 = $176 & 2; $178 = ($177|0)!=(0); if ($178) { $select_all = 1; } } else { label = 28; } } if ((label|0) == 28) { $179 = $5; $180 = ((($179)) + 105|0); $181 = HEAP8[$180>>0]|0; $182 = ($181<<24>>24)!=(0); if (!($182)) { $183 = $5; $184 = ((($183)) + 100|0); HEAP8[$184>>0] = 0; } } $185 = $5; $186 = ((($185)) + 105|0); $187 = HEAP8[$186>>0]|0; $188 = $187&255; $189 = ($188|0)!=(0); $190 = $189 ? 1 : 2; $ret = $190; $191 = $prev_state; $192 = $191 << 24 >> 24; $193 = $5; $194 = ((($193)) + 105|0); $195 = HEAP8[$194>>0]|0; $196 = $195&255; $197 = ($192|0)!=($196|0); if ($197) { $198 = $5; $199 = ((($198)) + 105|0); $200 = HEAP8[$199>>0]|0; $201 = $200&255; $202 = ($201|0)!=(0); $203 = $202 ? 4 : 8; $204 = $ret; $205 = $204 | $203; $ret = $205; } $206 = $5; $207 = ((($206)) + 105|0); $208 = HEAP8[$207>>0]|0; $209 = $208&255; $210 = ($209|0)!=(0); $211 = $7; $212 = ($211|0)!=(0|0); $or$cond5 = $210 & $212; do { if ($or$cond5) { $213 = $3; $214 = $213 & 1; $215 = ($214|0)!=(0); if (!($215)) { $216 = $7; $217 = ((($216)) + 8|0); $218 = HEAP32[$217>>2]|0; $shift_mod = $218; $219 = $7; $220 = ((($219)) + 220|0); $221 = ((($220)) + 48|0); $222 = +HEAPF32[$221>>2]; $223 = +HEAPF32[$area>>2]; $224 = $222 - $223; $225 = $5; $226 = ((($225)) + 80|0); $227 = +HEAPF32[$226>>2]; $228 = $224 + $227; $mouse_x = $228; $229 = $3; $230 = $229 & 2048; $231 = ($230|0)!=(0); $232 = $7; $233 = ((($232)) + 220|0); $234 = ((($233)) + 48|0); $235 = ((($234)) + 4|0); $236 = +HEAPF32[$235>>2]; $237 = ((($area)) + 4|0); $238 = +HEAPF32[$237>>2]; if ($231) { $249 = $236 - $238; $250 = $5; $251 = ((($250)) + 80|0); $252 = ((($251)) + 4|0); $253 = +HEAPF32[$252>>2]; $254 = $249 + $253; $255 = $254; } else { $239 = ((($area)) + 12|0); $240 = +HEAPF32[$239>>2]; $241 = $240 * 0.5; $242 = $238 + $241; $243 = $236 - $242; $244 = $5; $245 = ((($244)) + 80|0); $246 = ((($245)) + 4|0); $247 = +HEAPF32[$246>>2]; $248 = $243 + $247; $255 = $248; } $mouse_y = $255; $256 = $select_all; $257 = ($256<<24>>24)!=(0); L52: do { if ($257) { $258 = $5; _nk_textedit_select_all($258); } else { $259 = $is_hovered; $260 = $259 << 24 >> 24; $261 = ($260|0)!=(0); if ($261) { $262 = $7; $263 = ((($262)) + 220|0); $264 = HEAP32[$263>>2]|0; $265 = ($264|0)!=(0); if ($265) { $266 = $7; $267 = ((($266)) + 220|0); $268 = ((($267)) + 4|0); $269 = HEAP32[$268>>2]|0; $270 = ($269|0)!=(0); if ($270) { $271 = $5; $272 = $mouse_x; $273 = $mouse_y; $274 = $8; $275 = $row_height; _nk_textedit_click($271,$272,$273,$274,$275); break; } } } $276 = $is_hovered; $277 = $276 << 24 >> 24; $278 = ($277|0)!=(0); do { if ($278) { $279 = $7; $280 = ((($279)) + 220|0); $281 = HEAP32[$280>>2]|0; $282 = ($281|0)!=(0); if ($282) { $283 = $7; $284 = ((($283)) + 220|0); $285 = ((($284)) + 64|0); $286 = +HEAPF32[$285>>2]; $287 = $286 != 0.0; if (!($287)) { $288 = $7; $289 = ((($288)) + 220|0); $290 = ((($289)) + 64|0); $291 = ((($290)) + 4|0); $292 = +HEAPF32[$291>>2]; $293 = $292 != 0.0; if (!($293)) { break; } } $294 = $5; $295 = $mouse_x; $296 = $mouse_y; $297 = $8; $298 = $row_height; _nk_textedit_drag($294,$295,$296,$297,$298); $cursor_follow = 1; break L52; } } } while(0); $299 = $is_hovered; $300 = $299 << 24 >> 24; $301 = ($300|0)!=(0); if ($301) { $302 = $7; $303 = ((($302)) + 220|0); $304 = ((($303)) + 32|0); $305 = ((($304)) + 4|0); $306 = HEAP32[$305>>2]|0; $307 = ($306|0)!=(0); if ($307) { $308 = $7; $309 = ((($308)) + 220|0); $310 = ((($309)) + 32|0); $311 = HEAP32[$310>>2]|0; $312 = ($311|0)!=(0); if ($312) { $313 = $5; $314 = $8; $315 = $row_height; _nk_textedit_key($313,23,0,$314,$315); $316 = $5; $317 = $8; $318 = $row_height; _nk_textedit_key($316,24,1,$317,$318); $cursor_follow = 1; } } } } } while(0); $319 = $5; $320 = ((($319)) + 100|0); $321 = HEAP8[$320>>0]|0; $322 = $321&255; $old_mode = $322; $i = 0; while(1) { $323 = $i; $324 = ($323|0)<(25); if (!($324)) { break; } $325 = $i; $326 = ($325|0)==(4); $327 = $i; $328 = ($327|0)==(5); $or$cond7 = $326 | $328; if (!($or$cond7)) { $329 = $7; $330 = $i; $331 = (_nk_input_is_key_pressed($329,$330)|0); $332 = ($331|0)!=(0); if ($332) { $333 = $5; $334 = $i; $335 = $shift_mod; $336 = $8; $337 = $row_height; _nk_textedit_key($333,$334,$335,$336,$337); $cursor_follow = 1; } } $338 = $i; $339 = (($338) + 1)|0; $i = $339; } $340 = $old_mode; $341 = $5; $342 = ((($341)) + 100|0); $343 = HEAP8[$342>>0]|0; $344 = $343&255; $345 = ($340|0)!=($344|0); if ($345) { $346 = $7; $347 = ((($346)) + 216|0); HEAP32[$347>>2] = 0; } $348 = $4; $349 = $5; $350 = ((($349)) + 76|0); HEAP32[$350>>2] = $348; $351 = $7; $352 = ((($351)) + 216|0); $353 = HEAP32[$352>>2]|0; $354 = ($353|0)!=(0); if ($354) { $355 = $5; $356 = $7; $357 = ((($356)) + 200|0); $358 = $7; $359 = ((($358)) + 216|0); $360 = HEAP32[$359>>2]|0; _nk_textedit_text($355,$357,$360); $cursor_follow = 1; $361 = $7; $362 = ((($361)) + 216|0); HEAP32[$362>>2] = 0; } $363 = $7; $364 = (_nk_input_is_key_pressed($363,4)|0); $365 = ($364|0)!=(0); do { if ($365) { $cursor_follow = 1; $366 = $3; $367 = $366 & 128; $368 = ($367|0)!=(0); $369 = $shift_mod; $370 = ($369|0)!=(0); $or$cond9 = $368 & $370; if ($or$cond9) { $371 = $5; _nk_textedit_text($371,31719,1); break; } $372 = $3; $373 = $372 & 4; $374 = ($373|0)!=(0); if ($374) { $ret = 2; $375 = $ret; $376 = $375 | 8; $ret = $376; $377 = $ret; $378 = $377 | 16; $ret = $378; $379 = $5; $380 = ((($379)) + 105|0); HEAP8[$380>>0] = 0; break; } else { $381 = $5; _nk_textedit_text($381,31719,1); break; } } } while(0); $382 = $7; $383 = (_nk_input_is_key_pressed($382,7)|0); $copy = $383; $384 = $7; $385 = (_nk_input_is_key_pressed($384,8)|0); $cut = $385; $386 = $copy; $387 = ($386|0)!=(0); $388 = $cut; $389 = ($388|0)!=(0); $or$cond11 = $387 | $389; do { if ($or$cond11) { $390 = $3; $391 = $390 & 64; $392 = ($391|0)!=(0); if ($392) { $393 = $5; $394 = ((($393)) + 92|0); $395 = HEAP32[$394>>2]|0; $b = $395; $396 = $5; $397 = ((($396)) + 96|0); $398 = HEAP32[$397>>2]|0; $e = $398; $399 = $b; $400 = $e; $401 = ($399|0)<($400|0); $402 = $b; $403 = $e; $404 = $401 ? $402 : $403; $begin = $404; $405 = $b; $406 = $e; $407 = ($405|0)<($406|0); $408 = $e; $409 = $b; $410 = $407 ? $408 : $409; $end = $410; $411 = $5; $412 = ((($411)) + 12|0); $413 = $begin; $414 = (_nk_str_at_const($412,$413,$unicode,$glyph_len)|0); $text = $414; $415 = $5; $416 = ((($415)) + 8|0); $417 = HEAP32[$416>>2]|0; $418 = ($417|0)!=(0|0); if ($418) { $419 = $5; $420 = ((($419)) + 8|0); $421 = HEAP32[$420>>2]|0; $422 = $5; $423 = $text; $424 = $end; $425 = $begin; $426 = (($424) - ($425))|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$422>>2]|0; FUNCTION_TABLE_viii[$421 & 31]($$byval_copy,$423,$426); } $427 = $cut; $428 = ($427|0)!=(0); if (!($428)) { break; } $429 = $5; (_nk_textedit_cut($429)|0); $cursor_follow = 1; } } } while(0); $430 = $7; $431 = (_nk_input_is_key_pressed($430,9)|0); $paste = $431; $432 = $paste; $433 = ($432|0)!=(0); do { if ($433) { $434 = $3; $435 = $434 & 64; $436 = ($435|0)!=(0); if (!($436)) { break; } $437 = $5; $438 = ((($437)) + 4|0); $439 = HEAP32[$438>>2]|0; $440 = ($439|0)!=(0|0); if (!($440)) { break; } $441 = $5; $442 = ((($441)) + 4|0); $443 = HEAP32[$442>>2]|0; $444 = $5; $445 = $5; ;HEAP32[$$byval_copy16>>2]=HEAP32[$444>>2]|0; FUNCTION_TABLE_vii[$443 & 31]($$byval_copy16,$445); $cursor_follow = 1; } } while(0); $446 = $7; $447 = (_nk_input_is_key_pressed($446,5)|0); $tab = $447; $448 = $tab; $449 = ($448|0)!=(0); if ($449) { $450 = $3; $451 = $450 & 8; $452 = ($451|0)!=(0); if (!($452)) { break; } $453 = $5; _nk_textedit_text($453,31721,4); $cursor_follow = 1; } } } } while(0); $454 = $5; $455 = ((($454)) + 105|0); $456 = HEAP8[$455>>0]|0; $457 = ($456<<24>>24)!=(0); $458 = $1; do { if ($457) { HEAP32[$458>>2] = 34; } else { $459 = HEAP32[$458>>2]|0; $460 = $459 & 2; $461 = ($460|0)!=(0); $462 = $1; if ($461) { HEAP32[$462>>2] = 6; break; } else { HEAP32[$462>>2] = 4; break; } } } while(0); $463 = $is_hovered; $464 = ($463<<24>>24)!=(0); if ($464) { $465 = $1; $466 = HEAP32[$465>>2]|0; $467 = $466 | 18; HEAP32[$465>>2] = $467; } $468 = $2; $469 = ((($468)) + 4|0); ;HEAP32[$old_clip>>2]=HEAP32[$469>>2]|0;HEAP32[$old_clip+4>>2]=HEAP32[$469+4>>2]|0;HEAP32[$old_clip+8>>2]=HEAP32[$469+8>>2]|0;HEAP32[$old_clip+12>>2]=HEAP32[$469+12>>2]|0; $470 = $5; $471 = ((($470)) + 12|0); $472 = (_nk_str_get_const($471)|0); $text1 = $472; $473 = $5; $474 = ((($473)) + 12|0); $475 = (_nk_str_len_char($474)|0); $len = $475; $476 = $1; $477 = HEAP32[$476>>2]|0; $478 = $477 & 32; $479 = ($478|0)!=(0); do { if ($479) { $480 = $6; $481 = ((($480)) + 40|0); $background = $481; } else { $482 = $1; $483 = HEAP32[$482>>2]|0; $484 = $483 & 16; $485 = ($484|0)!=(0); $486 = $6; if ($485) { $487 = ((($486)) + 20|0); $background = $487; break; } else { $background = $486; break; } } } while(0); $488 = $background; $489 = HEAP32[$488>>2]|0; $490 = ($489|0)==(0); $491 = $2; if ($490) { $492 = $6; $493 = ((($492)) + 544|0); $494 = +HEAPF32[$493>>2]; $495 = $6; $496 = ((($495)) + 60|0); ;HEAP32[$bounds$byval_copy17>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy17+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy17+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy17+12>>2]=HEAP32[$bounds+12>>2]|0; ;HEAP8[$$byval_copy18>>0]=HEAP8[$496>>0]|0;HEAP8[$$byval_copy18+1>>0]=HEAP8[$496+1>>0]|0;HEAP8[$$byval_copy18+2>>0]=HEAP8[$496+2>>0]|0;HEAP8[$$byval_copy18+3>>0]=HEAP8[$496+3>>0]|0; _nk_fill_rect($491,$bounds$byval_copy17,$494,$$byval_copy18); $497 = $2; $498 = $6; $499 = ((($498)) + 540|0); $500 = +HEAPF32[$499>>2]; ;HEAP32[$bounds$byval_copy19>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy19+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy19+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy19+12>>2]=HEAP32[$bounds+12>>2]|0; _nk_shrink_rect($9,$bounds$byval_copy19,$500); $501 = $6; $502 = ((($501)) + 544|0); $503 = +HEAPF32[$502>>2]; $504 = $background; $505 = ((($504)) + 4|0); ;HEAP32[$$byval_copy20>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy20+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$$byval_copy20+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[$$byval_copy20+12>>2]=HEAP32[$9+12>>2]|0; ;HEAP8[$$byval_copy21>>0]=HEAP8[$505>>0]|0;HEAP8[$$byval_copy21+1>>0]=HEAP8[$505+1>>0]|0;HEAP8[$$byval_copy21+2>>0]=HEAP8[$505+2>>0]|0;HEAP8[$$byval_copy21+3>>0]=HEAP8[$505+3>>0]|0; _nk_fill_rect($497,$$byval_copy20,$503,$$byval_copy21); } else { $506 = $background; $507 = ((($506)) + 4|0); ;HEAP32[$bounds$byval_copy22>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy22+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy22+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy22+12>>2]=HEAP32[$bounds+12>>2]|0; _nk_draw_image($491,$bounds$byval_copy22,$507); } $508 = $6; $509 = ((($508)) + 548|0); $510 = +HEAPF32[$509>>2]; $511 = ((($area)) + 8|0); $512 = +HEAPF32[$511>>2]; $513 = $512 - $510; HEAPF32[$511>>2] = $513; $514 = +HEAPF32[$area>>2]; $515 = ((($area)) + 4|0); $516 = +HEAPF32[$515>>2]; $517 = +HEAPF32[$area>>2]; $518 = ((($area)) + 8|0); $519 = +HEAPF32[$518>>2]; $520 = $517 + $519; $521 = ((($area)) + 4|0); $522 = +HEAPF32[$521>>2]; $523 = ((($area)) + 12|0); $524 = +HEAPF32[$523>>2]; $525 = $522 + $524; _nk_unify($clip,$old_clip,$514,$516,$520,$525); $526 = $2; ;HEAP32[$clip$byval_copy>>2]=HEAP32[$clip>>2]|0;HEAP32[$clip$byval_copy+4>>2]=HEAP32[$clip+4>>2]|0;HEAP32[$clip$byval_copy+8>>2]=HEAP32[$clip+8>>2]|0;HEAP32[$clip$byval_copy+12>>2]=HEAP32[$clip+12>>2]|0; _nk_push_scissor($526,$clip$byval_copy); $527 = $5; $528 = ((($527)) + 105|0); $529 = HEAP8[$528>>0]|0; $530 = ($529<<24>>24)!=(0); L131: do { if ($530) { $total_lines = 1; _nk_vec2($text_size,0.0,0.0); $cursor_ptr = 0; $select_begin_ptr = 0; $select_end_ptr = 0; _nk_vec2($cursor_pos,0.0,0.0); _nk_vec2($selection_offset_start,0.0,0.0); _nk_vec2($selection_offset_end,0.0,0.0); $531 = $5; $532 = ((($531)) + 92|0); $533 = HEAP32[$532>>2]|0; $534 = $5; $535 = ((($534)) + 96|0); $536 = HEAP32[$535>>2]|0; $537 = ($533|0)<($536|0); $538 = $5; if ($537) { $539 = ((($538)) + 92|0); $540 = HEAP32[$539>>2]|0; $543 = $540; } else { $541 = ((($538)) + 96|0); $542 = HEAP32[$541>>2]|0; $543 = $542; } $selection_begin = $543; $544 = $5; $545 = ((($544)) + 92|0); $546 = HEAP32[$545>>2]|0; $547 = $5; $548 = ((($547)) + 96|0); $549 = HEAP32[$548>>2]|0; $550 = ($546|0)<($549|0); $551 = $5; if ($550) { $552 = ((($551)) + 96|0); $553 = HEAP32[$552>>2]|0; $556 = $553; } else { $554 = ((($551)) + 92|0); $555 = HEAP32[$554>>2]|0; $556 = $555; } $selection_end = $556; $line_width = 0.0; $557 = $text1; $558 = ($557|0)!=(0|0); $559 = $len; $560 = ($559|0)!=(0); $or$cond13 = $558 & $560; do { if ($or$cond13) { $glyph_len2 = 0; HEAP32[$unicode3>>2] = 0; $text_len = 0; $glyphs = 0; $row_begin = 0; $561 = $text1; $562 = $len; $563 = (_nk_utf_decode($561,$unicode3,$562)|0); $glyph_len2 = $563; $564 = $8; $565 = ((($564)) + 8|0); $566 = HEAP32[$565>>2]|0; $567 = $8; $568 = $8; $569 = ((($568)) + 4|0); $570 = +HEAPF32[$569>>2]; $571 = $text1; $572 = $glyph_len2; ;HEAP32[$$byval_copy23>>2]=HEAP32[$567>>2]|0; $573 = (+FUNCTION_TABLE_didii[$566 & 15]($$byval_copy23,$570,$571,$572)); $glyph_width = $573; $line_width = 0.0; while(1) { $574 = $text_len; $575 = $len; $576 = ($574|0)<($575|0); $577 = $glyph_len2; $578 = ($577|0)!=(0); $579 = $576 ? $578 : 0; if (!($579)) { break; } $580 = $cursor_ptr; $581 = ($580|0)!=(0|0); do { if (!($581)) { $582 = $glyphs; $583 = $5; $584 = ((($583)) + 88|0); $585 = HEAP32[$584>>2]|0; $586 = ($582|0)==($585|0); if (!($586)) { break; } $587 = $total_lines; $588 = (($587) - 1)|0; $589 = (+($588|0)); $590 = $row_height; $591 = $589 * $590; $592 = ((($cursor_pos)) + 4|0); HEAPF32[$592>>2] = $591; $593 = $8; $594 = $text1; $595 = $row_begin; $596 = (($594) + ($595)|0); $597 = $text_len; $598 = $row_begin; $599 = (($597) - ($598))|0; $600 = $row_height; _nk_text_calculate_text_bounds($10,$593,$596,$599,$600,$remaining,$out_offset,$glyph_offset,1); ;HEAP32[$row_size>>2]=HEAP32[$10>>2]|0;HEAP32[$row_size+4>>2]=HEAP32[$10+4>>2]|0; $601 = +HEAPF32[$row_size>>2]; HEAPF32[$cursor_pos>>2] = $601; $602 = $text1; $603 = $text_len; $604 = (($602) + ($603)|0); $cursor_ptr = $604; } } while(0); $605 = $select_begin_ptr; $606 = ($605|0)!=(0|0); do { if (!($606)) { $607 = $5; $608 = ((($607)) + 92|0); $609 = HEAP32[$608>>2]|0; $610 = $5; $611 = ((($610)) + 96|0); $612 = HEAP32[$611>>2]|0; $613 = ($609|0)!=($612|0); if (!($613)) { break; } $614 = $glyphs; $615 = $selection_begin; $616 = ($614|0)==($615|0); if (!($616)) { break; } $617 = $total_lines; $618 = (($617) - 1)|0; $619 = (+($618|0)); $620 = $row_height; $621 = $619 * $620; $622 = ((($selection_offset_start)) + 4|0); HEAPF32[$622>>2] = $621; $623 = $8; $624 = $text1; $625 = $row_begin; $626 = (($624) + ($625)|0); $627 = $text_len; $628 = $row_begin; $629 = (($627) - ($628))|0; $630 = $row_height; _nk_text_calculate_text_bounds($11,$623,$626,$629,$630,$remaining7,$out_offset5,$glyph_offset4,1); ;HEAP32[$row_size6>>2]=HEAP32[$11>>2]|0;HEAP32[$row_size6+4>>2]=HEAP32[$11+4>>2]|0; $631 = +HEAPF32[$row_size6>>2]; HEAPF32[$selection_offset_start>>2] = $631; $632 = $text1; $633 = $text_len; $634 = (($632) + ($633)|0); $select_begin_ptr = $634; } } while(0); $635 = $select_end_ptr; $636 = ($635|0)!=(0|0); do { if (!($636)) { $637 = $5; $638 = ((($637)) + 92|0); $639 = HEAP32[$638>>2]|0; $640 = $5; $641 = ((($640)) + 96|0); $642 = HEAP32[$641>>2]|0; $643 = ($639|0)!=($642|0); if (!($643)) { break; } $644 = $glyphs; $645 = $selection_end; $646 = ($644|0)==($645|0); if (!($646)) { break; } $647 = $total_lines; $648 = (($647) - 1)|0; $649 = (+($648|0)); $650 = $row_height; $651 = $649 * $650; $652 = ((($selection_offset_end)) + 4|0); HEAPF32[$652>>2] = $651; $653 = $8; $654 = $text1; $655 = $row_begin; $656 = (($654) + ($655)|0); $657 = $text_len; $658 = $row_begin; $659 = (($657) - ($658))|0; $660 = $row_height; _nk_text_calculate_text_bounds($12,$653,$656,$659,$660,$remaining11,$out_offset9,$glyph_offset8,1); ;HEAP32[$row_size10>>2]=HEAP32[$12>>2]|0;HEAP32[$row_size10+4>>2]=HEAP32[$12+4>>2]|0; $661 = +HEAPF32[$row_size10>>2]; HEAPF32[$selection_offset_end>>2] = $661; $662 = $text1; $663 = $text_len; $664 = (($662) + ($663)|0); $select_end_ptr = $664; } } while(0); $665 = HEAP32[$unicode3>>2]|0; $666 = ($665|0)==(10); if ($666) { $667 = +HEAPF32[$text_size>>2]; $668 = $line_width; $669 = $667 < $668; $670 = $line_width; $671 = +HEAPF32[$text_size>>2]; $672 = $669 ? $670 : $671; HEAPF32[$text_size>>2] = $672; $673 = $total_lines; $674 = (($673) + 1)|0; $total_lines = $674; $line_width = 0.0; $675 = $text_len; $676 = (($675) + 1)|0; $text_len = $676; $677 = $glyphs; $678 = (($677) + 1)|0; $glyphs = $678; $679 = $text_len; $row_begin = $679; $680 = $text1; $681 = $text_len; $682 = (($680) + ($681)|0); $683 = $len; $684 = $text_len; $685 = (($683) - ($684))|0; $686 = (_nk_utf_decode($682,$unicode3,$685)|0); $glyph_len2 = $686; continue; } else { $687 = $glyphs; $688 = (($687) + 1)|0; $glyphs = $688; $689 = $glyph_len2; $690 = $text_len; $691 = (($690) + ($689))|0; $text_len = $691; $692 = $glyph_width; $693 = $line_width; $694 = $693 + $692; $line_width = $694; $695 = $8; $696 = ((($695)) + 8|0); $697 = HEAP32[$696>>2]|0; $698 = $8; $699 = $8; $700 = ((($699)) + 4|0); $701 = +HEAPF32[$700>>2]; $702 = $text1; $703 = $text_len; $704 = (($702) + ($703)|0); $705 = $glyph_len2; ;HEAP32[$$byval_copy24>>2]=HEAP32[$698>>2]|0; $706 = (+FUNCTION_TABLE_didii[$697 & 15]($$byval_copy24,$701,$704,$705)); $glyph_width = $706; $707 = $text1; $708 = $text_len; $709 = (($707) + ($708)|0); $710 = $len; $711 = $text_len; $712 = (($710) - ($711))|0; $713 = (_nk_utf_decode($709,$unicode3,$712)|0); $glyph_len2 = $713; continue; } } $714 = $total_lines; $715 = (+($714|0)); $716 = $row_height; $717 = $715 * $716; $718 = ((($text_size)) + 4|0); HEAPF32[$718>>2] = $717; $719 = $cursor_ptr; $720 = ($719|0)!=(0|0); if ($720) { break; } $721 = $5; $722 = ((($721)) + 88|0); $723 = HEAP32[$722>>2]|0; $724 = $5; $725 = ((($724)) + 12|0); $726 = ((($725)) + 60|0); $727 = HEAP32[$726>>2]|0; $728 = ($723|0)==($727|0); if (!($728)) { break; } $729 = $line_width; HEAPF32[$cursor_pos>>2] = $729; $730 = ((($text_size)) + 4|0); $731 = +HEAPF32[$730>>2]; $732 = $row_height; $733 = $731 - $732; $734 = ((($cursor_pos)) + 4|0); HEAPF32[$734>>2] = $733; } } while(0); $735 = $cursor_follow; $736 = ($735<<24>>24)!=(0); do { if ($736) { $737 = $3; $738 = $737 & 256; $739 = ($738|0)!=(0); do { if ($739) { $776 = $5; $777 = ((($776)) + 80|0); HEAPF32[$777>>2] = 0.0; } else { $740 = ((($area)) + 8|0); $741 = +HEAPF32[$740>>2]; $742 = $741 * 0.25; $scroll_increment = $742; $743 = +HEAPF32[$cursor_pos>>2]; $744 = $5; $745 = ((($744)) + 80|0); $746 = +HEAPF32[$745>>2]; $747 = $743 < $746; if ($747) { $748 = +HEAPF32[$cursor_pos>>2]; $749 = $scroll_increment; $750 = $748 - $749; $751 = 0.0 < $750; if ($751) { $752 = +HEAPF32[$cursor_pos>>2]; $753 = $scroll_increment; $754 = $752 - $753; $756 = $754; } else { $756 = 0.0; } $755 = (~~(($756))); $757 = (+($755|0)); $758 = $5; $759 = ((($758)) + 80|0); HEAPF32[$759>>2] = $757; } $760 = +HEAPF32[$cursor_pos>>2]; $761 = $5; $762 = ((($761)) + 80|0); $763 = +HEAPF32[$762>>2]; $764 = ((($area)) + 8|0); $765 = +HEAPF32[$764>>2]; $766 = $763 + $765; $767 = $760 >= $766; if (!($767)) { break; } $768 = +HEAPF32[$cursor_pos>>2]; $769 = 0.0 < $768; $770 = +HEAPF32[$cursor_pos>>2]; $771 = $769 ? $770 : 0.0; $772 = (~~(($771))); $773 = (+($772|0)); $774 = $5; $775 = ((($774)) + 80|0); HEAPF32[$775>>2] = $773; } } while(0); $778 = $3; $779 = $778 & 2048; $780 = ($779|0)!=(0); if (!($780)) { $820 = $5; $821 = ((($820)) + 80|0); $822 = ((($821)) + 4|0); HEAPF32[$822>>2] = 0.0; break; } $781 = ((($cursor_pos)) + 4|0); $782 = +HEAPF32[$781>>2]; $783 = $5; $784 = ((($783)) + 80|0); $785 = ((($784)) + 4|0); $786 = +HEAPF32[$785>>2]; $787 = $782 < $786; if ($787) { $788 = ((($cursor_pos)) + 4|0); $789 = +HEAPF32[$788>>2]; $790 = $row_height; $791 = $789 - $790; $792 = 0.0 < $791; if ($792) { $793 = ((($cursor_pos)) + 4|0); $794 = +HEAPF32[$793>>2]; $795 = $row_height; $796 = $794 - $795; $800 = $796; } else { $800 = 0.0; } $797 = $5; $798 = ((($797)) + 80|0); $799 = ((($798)) + 4|0); HEAPF32[$799>>2] = $800; } $801 = ((($cursor_pos)) + 4|0); $802 = +HEAPF32[$801>>2]; $803 = $5; $804 = ((($803)) + 80|0); $805 = ((($804)) + 4|0); $806 = +HEAPF32[$805>>2]; $807 = ((($area)) + 12|0); $808 = +HEAPF32[$807>>2]; $809 = $806 + $808; $810 = $802 >= $809; if (!($810)) { break; } $811 = $5; $812 = ((($811)) + 80|0); $813 = ((($812)) + 4|0); $814 = +HEAPF32[$813>>2]; $815 = $row_height; $816 = $814 + $815; $817 = $5; $818 = ((($817)) + 80|0); $819 = ((($818)) + 4|0); HEAPF32[$819>>2] = $816; } } while(0); $823 = +HEAPF32[$bounds>>2]; $824 = ((($bounds)) + 8|0); $825 = +HEAPF32[$824>>2]; $826 = $823 + $825; $827 = $6; $828 = ((($827)) + 552|0); $829 = +HEAPF32[$828>>2]; $830 = $826 - $829; HEAPF32[$scroll>>2] = $830; $831 = ((($bounds)) + 4|0); $832 = +HEAPF32[$831>>2]; $833 = ((($scroll)) + 4|0); HEAPF32[$833>>2] = $832; $834 = $6; $835 = ((($834)) + 552|0); $836 = +HEAPF32[$835>>2]; $837 = ((($scroll)) + 8|0); HEAPF32[$837>>2] = $836; $838 = ((($bounds)) + 12|0); $839 = +HEAPF32[$838>>2]; $840 = ((($scroll)) + 12|0); HEAPF32[$840>>2] = $839; $841 = $5; $842 = ((($841)) + 80|0); $843 = ((($842)) + 4|0); $844 = +HEAPF32[$843>>2]; $scroll_offset = $844; $845 = ((($scroll)) + 12|0); $846 = +HEAPF32[$845>>2]; $847 = $846 * 0.10000000149011612; $scroll_step = $847; $848 = ((($scroll)) + 12|0); $849 = +HEAPF32[$848>>2]; $850 = $849 * 0.0099999997764825821; $scroll_inc = $850; $851 = ((($text_size)) + 4|0); $852 = +HEAPF32[$851>>2]; $scroll_target = $852; $853 = $2; $854 = $scroll_offset; $855 = $scroll_target; $856 = $scroll_step; $857 = $scroll_inc; $858 = $6; $859 = ((($858)) + 64|0); $860 = $7; $861 = $8; ;HEAP32[$bounds$byval_copy25>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy25+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy25+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy25+12>>2]=HEAP32[$bounds+12>>2]|0; $862 = (+_nk_do_scrollbarv($ws,$853,$bounds$byval_copy25,0,$854,$855,$856,$857,$859,$860,$861)); $863 = $5; $864 = ((($863)) + 80|0); $865 = ((($864)) + 4|0); HEAPF32[$865>>2] = $862; $866 = $1; $867 = HEAP32[$866>>2]|0; $868 = $867 & 32; $869 = ($868|0)!=(0); do { if ($869) { $870 = $6; $871 = ((($870)) + 40|0); $background12 = $871; $872 = $6; $873 = ((($872)) + 520|0); ;HEAP8[$text_color>>0]=HEAP8[$873>>0]|0;HEAP8[$text_color+1>>0]=HEAP8[$873+1>>0]|0;HEAP8[$text_color+2>>0]=HEAP8[$873+2>>0]|0;HEAP8[$text_color+3>>0]=HEAP8[$873+3>>0]|0; $874 = $6; $875 = ((($874)) + 536|0); ;HEAP8[$sel_text_color>>0]=HEAP8[$875>>0]|0;HEAP8[$sel_text_color+1>>0]=HEAP8[$875+1>>0]|0;HEAP8[$sel_text_color+2>>0]=HEAP8[$875+2>>0]|0;HEAP8[$sel_text_color+3>>0]=HEAP8[$875+3>>0]|0; $876 = $6; $877 = ((($876)) + 528|0); ;HEAP8[$sel_background_color>>0]=HEAP8[$877>>0]|0;HEAP8[$sel_background_color+1>>0]=HEAP8[$877+1>>0]|0;HEAP8[$sel_background_color+2>>0]=HEAP8[$877+2>>0]|0;HEAP8[$sel_background_color+3>>0]=HEAP8[$877+3>>0]|0; $878 = $6; $879 = ((($878)) + 500|0); ;HEAP8[$cursor_color>>0]=HEAP8[$879>>0]|0;HEAP8[$cursor_color+1>>0]=HEAP8[$879+1>>0]|0;HEAP8[$cursor_color+2>>0]=HEAP8[$879+2>>0]|0;HEAP8[$cursor_color+3>>0]=HEAP8[$879+3>>0]|0; $880 = $6; $881 = ((($880)) + 508|0); ;HEAP8[$cursor_text_color>>0]=HEAP8[$881>>0]|0;HEAP8[$cursor_text_color+1>>0]=HEAP8[$881+1>>0]|0;HEAP8[$cursor_text_color+2>>0]=HEAP8[$881+2>>0]|0;HEAP8[$cursor_text_color+3>>0]=HEAP8[$881+3>>0]|0; } else { $882 = $1; $883 = HEAP32[$882>>2]|0; $884 = $883 & 16; $885 = ($884|0)!=(0); $886 = $6; if ($885) { $887 = ((($886)) + 20|0); $background12 = $887; $888 = $6; $889 = ((($888)) + 516|0); ;HEAP8[$text_color>>0]=HEAP8[$889>>0]|0;HEAP8[$text_color+1>>0]=HEAP8[$889+1>>0]|0;HEAP8[$text_color+2>>0]=HEAP8[$889+2>>0]|0;HEAP8[$text_color+3>>0]=HEAP8[$889+3>>0]|0; $890 = $6; $891 = ((($890)) + 536|0); ;HEAP8[$sel_text_color>>0]=HEAP8[$891>>0]|0;HEAP8[$sel_text_color+1>>0]=HEAP8[$891+1>>0]|0;HEAP8[$sel_text_color+2>>0]=HEAP8[$891+2>>0]|0;HEAP8[$sel_text_color+3>>0]=HEAP8[$891+3>>0]|0; $892 = $6; $893 = ((($892)) + 528|0); ;HEAP8[$sel_background_color>>0]=HEAP8[$893>>0]|0;HEAP8[$sel_background_color+1>>0]=HEAP8[$893+1>>0]|0;HEAP8[$sel_background_color+2>>0]=HEAP8[$893+2>>0]|0;HEAP8[$sel_background_color+3>>0]=HEAP8[$893+3>>0]|0; $894 = $6; $895 = ((($894)) + 508|0); ;HEAP8[$cursor_text_color>>0]=HEAP8[$895>>0]|0;HEAP8[$cursor_text_color+1>>0]=HEAP8[$895+1>>0]|0;HEAP8[$cursor_text_color+2>>0]=HEAP8[$895+2>>0]|0;HEAP8[$cursor_text_color+3>>0]=HEAP8[$895+3>>0]|0; $896 = $6; $897 = ((($896)) + 500|0); ;HEAP8[$cursor_color>>0]=HEAP8[$897>>0]|0;HEAP8[$cursor_color+1>>0]=HEAP8[$897+1>>0]|0;HEAP8[$cursor_color+2>>0]=HEAP8[$897+2>>0]|0;HEAP8[$cursor_color+3>>0]=HEAP8[$897+3>>0]|0; break; } else { $background12 = $886; $898 = $6; $899 = ((($898)) + 512|0); ;HEAP8[$text_color>>0]=HEAP8[$899>>0]|0;HEAP8[$text_color+1>>0]=HEAP8[$899+1>>0]|0;HEAP8[$text_color+2>>0]=HEAP8[$899+2>>0]|0;HEAP8[$text_color+3>>0]=HEAP8[$899+3>>0]|0; $900 = $6; $901 = ((($900)) + 532|0); ;HEAP8[$sel_text_color>>0]=HEAP8[$901>>0]|0;HEAP8[$sel_text_color+1>>0]=HEAP8[$901+1>>0]|0;HEAP8[$sel_text_color+2>>0]=HEAP8[$901+2>>0]|0;HEAP8[$sel_text_color+3>>0]=HEAP8[$901+3>>0]|0; $902 = $6; $903 = ((($902)) + 524|0); ;HEAP8[$sel_background_color>>0]=HEAP8[$903>>0]|0;HEAP8[$sel_background_color+1>>0]=HEAP8[$903+1>>0]|0;HEAP8[$sel_background_color+2>>0]=HEAP8[$903+2>>0]|0;HEAP8[$sel_background_color+3>>0]=HEAP8[$903+3>>0]|0; $904 = $6; $905 = ((($904)) + 496|0); ;HEAP8[$cursor_color>>0]=HEAP8[$905>>0]|0;HEAP8[$cursor_color+1>>0]=HEAP8[$905+1>>0]|0;HEAP8[$cursor_color+2>>0]=HEAP8[$905+2>>0]|0;HEAP8[$cursor_color+3>>0]=HEAP8[$905+3>>0]|0; $906 = $6; $907 = ((($906)) + 504|0); ;HEAP8[$cursor_text_color>>0]=HEAP8[$907>>0]|0;HEAP8[$cursor_text_color+1>>0]=HEAP8[$907+1>>0]|0;HEAP8[$cursor_text_color+2>>0]=HEAP8[$907+2>>0]|0;HEAP8[$cursor_text_color+3>>0]=HEAP8[$907+3>>0]|0; break; } } } while(0); $908 = $background12; $909 = HEAP32[$908>>2]|0; $910 = ($909|0)==(1); if ($910) { _nk_rgba($13,0,0,0,0); ;HEAP8[$background_color>>0]=HEAP8[$13>>0]|0;HEAP8[$background_color+1>>0]=HEAP8[$13+1>>0]|0;HEAP8[$background_color+2>>0]=HEAP8[$13+2>>0]|0;HEAP8[$background_color+3>>0]=HEAP8[$13+3>>0]|0; } else { $911 = $background12; $912 = ((($911)) + 4|0); ;HEAP8[$background_color>>0]=HEAP8[$912>>0]|0;HEAP8[$background_color+1>>0]=HEAP8[$912+1>>0]|0;HEAP8[$background_color+2>>0]=HEAP8[$912+2>>0]|0;HEAP8[$background_color+3>>0]=HEAP8[$912+3>>0]|0; } $913 = $5; $914 = ((($913)) + 92|0); $915 = HEAP32[$914>>2]|0; $916 = $5; $917 = ((($916)) + 96|0); $918 = HEAP32[$917>>2]|0; $919 = ($915|0)==($918|0); $920 = $5; do { if ($919) { $921 = ((($920)) + 12|0); $922 = (_nk_str_get_const($921)|0); $begin13 = $922; $923 = $5; $924 = ((($923)) + 12|0); $925 = (_nk_str_len_char($924)|0); $l = $925; $926 = $2; $927 = $6; $928 = +HEAPF32[$area>>2]; $929 = $5; $930 = ((($929)) + 80|0); $931 = +HEAPF32[$930>>2]; $932 = $928 - $931; $933 = ((($area)) + 4|0); $934 = +HEAPF32[$933>>2]; $935 = $5; $936 = ((($935)) + 80|0); $937 = ((($936)) + 4|0); $938 = +HEAPF32[$937>>2]; $939 = $934 - $938; $940 = $begin13; $941 = $l; $942 = $row_height; $943 = $8; ;HEAP8[$background_color$byval_copy>>0]=HEAP8[$background_color>>0]|0;HEAP8[$background_color$byval_copy+1>>0]=HEAP8[$background_color+1>>0]|0;HEAP8[$background_color$byval_copy+2>>0]=HEAP8[$background_color+2>>0]|0;HEAP8[$background_color$byval_copy+3>>0]=HEAP8[$background_color+3>>0]|0; ;HEAP8[$text_color$byval_copy>>0]=HEAP8[$text_color>>0]|0;HEAP8[$text_color$byval_copy+1>>0]=HEAP8[$text_color+1>>0]|0;HEAP8[$text_color$byval_copy+2>>0]=HEAP8[$text_color+2>>0]|0;HEAP8[$text_color$byval_copy+3>>0]=HEAP8[$text_color+3>>0]|0; _nk_edit_draw_text($926,$927,$932,$939,0.0,$940,$941,$942,$943,$background_color$byval_copy,$text_color$byval_copy,0); } else { $944 = ((($920)) + 92|0); $945 = HEAP32[$944>>2]|0; $946 = $5; $947 = ((($946)) + 96|0); $948 = HEAP32[$947>>2]|0; $949 = ($945|0)!=($948|0); $950 = $selection_begin; $951 = ($950|0)>(0); $or$cond15 = $949 & $951; do { if ($or$cond15) { $952 = $5; $953 = ((($952)) + 12|0); $954 = (_nk_str_get_const($953)|0); $begin14 = $954; $955 = $select_begin_ptr; $956 = ($955|0)!=(0|0); if ($956) { $957 = $2; $958 = $6; $959 = +HEAPF32[$area>>2]; $960 = $5; $961 = ((($960)) + 80|0); $962 = +HEAPF32[$961>>2]; $963 = $959 - $962; $964 = ((($area)) + 4|0); $965 = +HEAPF32[$964>>2]; $966 = $5; $967 = ((($966)) + 80|0); $968 = ((($967)) + 4|0); $969 = +HEAPF32[$968>>2]; $970 = $965 - $969; $971 = $begin14; $972 = $select_begin_ptr; $973 = $begin14; $974 = $972; $975 = $973; $976 = (($974) - ($975))|0; $977 = $row_height; $978 = $8; ;HEAP8[$background_color$byval_copy26>>0]=HEAP8[$background_color>>0]|0;HEAP8[$background_color$byval_copy26+1>>0]=HEAP8[$background_color+1>>0]|0;HEAP8[$background_color$byval_copy26+2>>0]=HEAP8[$background_color+2>>0]|0;HEAP8[$background_color$byval_copy26+3>>0]=HEAP8[$background_color+3>>0]|0; ;HEAP8[$text_color$byval_copy27>>0]=HEAP8[$text_color>>0]|0;HEAP8[$text_color$byval_copy27+1>>0]=HEAP8[$text_color+1>>0]|0;HEAP8[$text_color$byval_copy27+2>>0]=HEAP8[$text_color+2>>0]|0;HEAP8[$text_color$byval_copy27+3>>0]=HEAP8[$text_color+3>>0]|0; _nk_edit_draw_text($957,$958,$963,$970,0.0,$971,$976,$977,$978,$background_color$byval_copy26,$text_color$byval_copy27,0); break; } else { ___assert_fail((31726|0),(13400|0),13166,(31708|0)); // unreachable; } } } while(0); $979 = $5; $980 = ((($979)) + 92|0); $981 = HEAP32[$980>>2]|0; $982 = $5; $983 = ((($982)) + 96|0); $984 = HEAP32[$983>>2]|0; $985 = ($981|0)!=($984|0); if ($985) { $986 = $select_begin_ptr; $987 = ($986|0)!=(0|0); if (!($987)) { ___assert_fail((31726|0),(13400|0),13173,(31708|0)); // unreachable; } $988 = $select_end_ptr; $989 = ($988|0)!=(0|0); if (!($989)) { $990 = $5; $991 = ((($990)) + 12|0); $992 = (_nk_str_get_const($991)|0); $begin15 = $992; $993 = $begin15; $994 = $5; $995 = ((($994)) + 12|0); $996 = (_nk_str_len_char($995)|0); $997 = (($993) + ($996)|0); $select_end_ptr = $997; } $998 = $2; $999 = $6; $1000 = +HEAPF32[$area>>2]; $1001 = $5; $1002 = ((($1001)) + 80|0); $1003 = +HEAPF32[$1002>>2]; $1004 = $1000 - $1003; $1005 = ((($area)) + 4|0); $1006 = +HEAPF32[$1005>>2]; $1007 = ((($selection_offset_start)) + 4|0); $1008 = +HEAPF32[$1007>>2]; $1009 = $1006 + $1008; $1010 = $5; $1011 = ((($1010)) + 80|0); $1012 = ((($1011)) + 4|0); $1013 = +HEAPF32[$1012>>2]; $1014 = $1009 - $1013; $1015 = +HEAPF32[$selection_offset_start>>2]; $1016 = $select_begin_ptr; $1017 = $select_end_ptr; $1018 = $select_begin_ptr; $1019 = $1017; $1020 = $1018; $1021 = (($1019) - ($1020))|0; $1022 = $row_height; $1023 = $8; ;HEAP8[$sel_background_color$byval_copy>>0]=HEAP8[$sel_background_color>>0]|0;HEAP8[$sel_background_color$byval_copy+1>>0]=HEAP8[$sel_background_color+1>>0]|0;HEAP8[$sel_background_color$byval_copy+2>>0]=HEAP8[$sel_background_color+2>>0]|0;HEAP8[$sel_background_color$byval_copy+3>>0]=HEAP8[$sel_background_color+3>>0]|0; ;HEAP8[$sel_text_color$byval_copy>>0]=HEAP8[$sel_text_color>>0]|0;HEAP8[$sel_text_color$byval_copy+1>>0]=HEAP8[$sel_text_color+1>>0]|0;HEAP8[$sel_text_color$byval_copy+2>>0]=HEAP8[$sel_text_color+2>>0]|0;HEAP8[$sel_text_color$byval_copy+3>>0]=HEAP8[$sel_text_color+3>>0]|0; _nk_edit_draw_text($998,$999,$1004,$1014,$1015,$1016,$1021,$1022,$1023,$sel_background_color$byval_copy,$sel_text_color$byval_copy,1); } $1024 = $5; $1025 = ((($1024)) + 92|0); $1026 = HEAP32[$1025>>2]|0; $1027 = $5; $1028 = ((($1027)) + 96|0); $1029 = HEAP32[$1028>>2]|0; $1030 = ($1026|0)!=($1029|0); if (!($1030)) { break; } $1031 = $selection_end; $1032 = $5; $1033 = ((($1032)) + 12|0); $1034 = ((($1033)) + 60|0); $1035 = HEAP32[$1034>>2]|0; $1036 = ($1031|0)<($1035|0); if (!($1036)) { break; } $1037 = $select_end_ptr; $begin16 = $1037; $1038 = $5; $1039 = ((($1038)) + 12|0); $1040 = (_nk_str_get_const($1039)|0); $1041 = $5; $1042 = ((($1041)) + 12|0); $1043 = (_nk_str_len_char($1042)|0); $1044 = (($1040) + ($1043)|0); $end17 = $1044; $1045 = $select_end_ptr; $1046 = ($1045|0)!=(0|0); if ($1046) { $1047 = $2; $1048 = $6; $1049 = +HEAPF32[$area>>2]; $1050 = $5; $1051 = ((($1050)) + 80|0); $1052 = +HEAPF32[$1051>>2]; $1053 = $1049 - $1052; $1054 = ((($area)) + 4|0); $1055 = +HEAPF32[$1054>>2]; $1056 = ((($selection_offset_end)) + 4|0); $1057 = +HEAPF32[$1056>>2]; $1058 = $1055 + $1057; $1059 = $5; $1060 = ((($1059)) + 80|0); $1061 = ((($1060)) + 4|0); $1062 = +HEAPF32[$1061>>2]; $1063 = $1058 - $1062; $1064 = +HEAPF32[$selection_offset_end>>2]; $1065 = $begin16; $1066 = $end17; $1067 = $begin16; $1068 = $1066; $1069 = $1067; $1070 = (($1068) - ($1069))|0; $1071 = $row_height; $1072 = $8; ;HEAP8[$background_color$byval_copy28>>0]=HEAP8[$background_color>>0]|0;HEAP8[$background_color$byval_copy28+1>>0]=HEAP8[$background_color+1>>0]|0;HEAP8[$background_color$byval_copy28+2>>0]=HEAP8[$background_color+2>>0]|0;HEAP8[$background_color$byval_copy28+3>>0]=HEAP8[$background_color+3>>0]|0; ;HEAP8[$text_color$byval_copy29>>0]=HEAP8[$text_color>>0]|0;HEAP8[$text_color$byval_copy29+1>>0]=HEAP8[$text_color+1>>0]|0;HEAP8[$text_color$byval_copy29+2>>0]=HEAP8[$text_color+2>>0]|0;HEAP8[$text_color$byval_copy29+3>>0]=HEAP8[$text_color+3>>0]|0; _nk_edit_draw_text($1047,$1048,$1053,$1063,$1064,$1065,$1070,$1071,$1072,$background_color$byval_copy28,$text_color$byval_copy29,1); break; } else { ___assert_fail((31743|0),(13400|0),13192,(31708|0)); // unreachable; } } } while(0); $1073 = $5; $1074 = ((($1073)) + 92|0); $1075 = HEAP32[$1074>>2]|0; $1076 = $5; $1077 = ((($1076)) + 96|0); $1078 = HEAP32[$1077>>2]|0; $1079 = ($1075|0)==($1078|0); if (!($1079)) { break; } $1080 = $5; $1081 = ((($1080)) + 88|0); $1082 = HEAP32[$1081>>2]|0; $1083 = $5; $1084 = ((($1083)) + 12|0); $1085 = (_nk_str_len($1084)|0); $1086 = ($1082|0)>=($1085|0); do { if (!($1086)) { $1087 = $cursor_ptr; $1088 = ($1087|0)!=(0|0); if ($1088) { $1089 = $cursor_ptr; $1090 = HEAP8[$1089>>0]|0; $1091 = $1090 << 24 >> 24; $1092 = ($1091|0)==(10); if ($1092) { break; } } $1129 = $cursor_ptr; $1130 = ($1129|0)!=(0|0); if ($1130) { $1131 = $cursor_ptr; $1132 = (_nk_utf_decode($1131,$unicode19,4)|0); $glyph_len18 = $1132; $1133 = +HEAPF32[$area>>2]; $1134 = +HEAPF32[$cursor_pos>>2]; $1135 = $1133 + $1134; $1136 = $5; $1137 = ((($1136)) + 80|0); $1138 = +HEAPF32[$1137>>2]; $1139 = $1135 - $1138; HEAPF32[$label>>2] = $1139; $1140 = ((($area)) + 4|0); $1141 = +HEAPF32[$1140>>2]; $1142 = ((($cursor_pos)) + 4|0); $1143 = +HEAPF32[$1142>>2]; $1144 = $1141 + $1143; $1145 = $5; $1146 = ((($1145)) + 80|0); $1147 = ((($1146)) + 4|0); $1148 = +HEAPF32[$1147>>2]; $1149 = $1144 - $1148; $1150 = ((($label)) + 4|0); HEAPF32[$1150>>2] = $1149; $1151 = $8; $1152 = ((($1151)) + 8|0); $1153 = HEAP32[$1152>>2]|0; $1154 = $8; $1155 = $8; $1156 = ((($1155)) + 4|0); $1157 = +HEAPF32[$1156>>2]; $1158 = $cursor_ptr; $1159 = $glyph_len18; ;HEAP32[$$byval_copy30>>2]=HEAP32[$1154>>2]|0; $1160 = (+FUNCTION_TABLE_didii[$1153 & 15]($$byval_copy30,$1157,$1158,$1159)); $1161 = ((($label)) + 8|0); HEAPF32[$1161>>2] = $1160; $1162 = $row_height; $1163 = ((($label)) + 12|0); HEAPF32[$1163>>2] = $1162; _nk_vec2($14,0.0,0.0); ;HEAP32[$txt>>2]=HEAP32[$14>>2]|0;HEAP32[$txt+4>>2]=HEAP32[$14+4>>2]|0; $1164 = ((($txt)) + 8|0); ;HEAP8[$1164>>0]=HEAP8[$cursor_color>>0]|0;HEAP8[$1164+1>>0]=HEAP8[$cursor_color+1>>0]|0;HEAP8[$1164+2>>0]=HEAP8[$cursor_color+2>>0]|0;HEAP8[$1164+3>>0]=HEAP8[$cursor_color+3>>0]|0; $1165 = ((($txt)) + 12|0); ;HEAP8[$1165>>0]=HEAP8[$cursor_text_color>>0]|0;HEAP8[$1165+1>>0]=HEAP8[$cursor_text_color+1>>0]|0;HEAP8[$1165+2>>0]=HEAP8[$cursor_text_color+2>>0]|0;HEAP8[$1165+3>>0]=HEAP8[$cursor_text_color+3>>0]|0; $1166 = $2; ;HEAP32[$label$byval_copy>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy+12>>2]=HEAP32[$label+12>>2]|0; ;HEAP8[$cursor_color$byval_copy31>>0]=HEAP8[$cursor_color>>0]|0;HEAP8[$cursor_color$byval_copy31+1>>0]=HEAP8[$cursor_color+1>>0]|0;HEAP8[$cursor_color$byval_copy31+2>>0]=HEAP8[$cursor_color+2>>0]|0;HEAP8[$cursor_color$byval_copy31+3>>0]=HEAP8[$cursor_color+3>>0]|0; _nk_fill_rect($1166,$label$byval_copy,0.0,$cursor_color$byval_copy31); $1167 = $2; $1168 = $cursor_ptr; $1169 = $glyph_len18; $1170 = $8; ;HEAP32[$label$byval_copy32>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy32+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy32+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy32+12>>2]=HEAP32[$label+12>>2]|0; _nk_widget_text($1167,$label$byval_copy32,$1168,$1169,$txt,17,$1170); break L131; } else { ___assert_fail((31758|0),(13400|0),13222,(31708|0)); // unreachable; } } } while(0); $1093 = $6; $1094 = ((($1093)) + 548|0); $1095 = +HEAPF32[$1094>>2]; $1096 = ((($cursor)) + 8|0); HEAPF32[$1096>>2] = $1095; $1097 = $8; $1098 = ((($1097)) + 4|0); $1099 = +HEAPF32[$1098>>2]; $1100 = ((($cursor)) + 12|0); HEAPF32[$1100>>2] = $1099; $1101 = +HEAPF32[$area>>2]; $1102 = +HEAPF32[$cursor_pos>>2]; $1103 = $1101 + $1102; $1104 = $5; $1105 = ((($1104)) + 80|0); $1106 = +HEAPF32[$1105>>2]; $1107 = $1103 - $1106; HEAPF32[$cursor>>2] = $1107; $1108 = ((($area)) + 4|0); $1109 = +HEAPF32[$1108>>2]; $1110 = ((($cursor_pos)) + 4|0); $1111 = +HEAPF32[$1110>>2]; $1112 = $1109 + $1111; $1113 = $row_height; $1114 = $1113 / 2.0; $1115 = $1112 + $1114; $1116 = ((($cursor)) + 12|0); $1117 = +HEAPF32[$1116>>2]; $1118 = $1117 / 2.0; $1119 = $1115 - $1118; $1120 = ((($cursor)) + 4|0); HEAPF32[$1120>>2] = $1119; $1121 = $5; $1122 = ((($1121)) + 80|0); $1123 = ((($1122)) + 4|0); $1124 = +HEAPF32[$1123>>2]; $1125 = ((($cursor)) + 4|0); $1126 = +HEAPF32[$1125>>2]; $1127 = $1126 - $1124; HEAPF32[$1125>>2] = $1127; $1128 = $2; ;HEAP32[$cursor$byval_copy>>2]=HEAP32[$cursor>>2]|0;HEAP32[$cursor$byval_copy+4>>2]=HEAP32[$cursor+4>>2]|0;HEAP32[$cursor$byval_copy+8>>2]=HEAP32[$cursor+8>>2]|0;HEAP32[$cursor$byval_copy+12>>2]=HEAP32[$cursor+12>>2]|0; ;HEAP8[$cursor_color$byval_copy>>0]=HEAP8[$cursor_color>>0]|0;HEAP8[$cursor_color$byval_copy+1>>0]=HEAP8[$cursor_color+1>>0]|0;HEAP8[$cursor_color$byval_copy+2>>0]=HEAP8[$cursor_color+2>>0]|0;HEAP8[$cursor_color$byval_copy+3>>0]=HEAP8[$cursor_color+3>>0]|0; _nk_fill_rect($1128,$cursor$byval_copy,0.0,$cursor_color$byval_copy); } else { $1171 = $5; $1172 = ((($1171)) + 12|0); $1173 = (_nk_str_len($1172)|0); $l20 = $1173; $1174 = $5; $1175 = ((($1174)) + 12|0); $1176 = (_nk_str_get_const($1175)|0); $begin21 = $1176; $1177 = $1; $1178 = HEAP32[$1177>>2]|0; $1179 = $1178 & 32; $1180 = ($1179|0)!=(0); do { if ($1180) { $1181 = $6; $1182 = ((($1181)) + 40|0); $background22 = $1182; $1183 = $6; $1184 = ((($1183)) + 520|0); ;HEAP8[$text_color24>>0]=HEAP8[$1184>>0]|0;HEAP8[$text_color24+1>>0]=HEAP8[$1184+1>>0]|0;HEAP8[$text_color24+2>>0]=HEAP8[$1184+2>>0]|0;HEAP8[$text_color24+3>>0]=HEAP8[$1184+3>>0]|0; } else { $1185 = $1; $1186 = HEAP32[$1185>>2]|0; $1187 = $1186 & 16; $1188 = ($1187|0)!=(0); $1189 = $6; if ($1188) { $1190 = ((($1189)) + 20|0); $background22 = $1190; $1191 = $6; $1192 = ((($1191)) + 516|0); ;HEAP8[$text_color24>>0]=HEAP8[$1192>>0]|0;HEAP8[$text_color24+1>>0]=HEAP8[$1192+1>>0]|0;HEAP8[$text_color24+2>>0]=HEAP8[$1192+2>>0]|0;HEAP8[$text_color24+3>>0]=HEAP8[$1192+3>>0]|0; break; } else { $background22 = $1189; $1193 = $6; $1194 = ((($1193)) + 512|0); ;HEAP8[$text_color24>>0]=HEAP8[$1194>>0]|0;HEAP8[$text_color24+1>>0]=HEAP8[$1194+1>>0]|0;HEAP8[$text_color24+2>>0]=HEAP8[$1194+2>>0]|0;HEAP8[$text_color24+3>>0]=HEAP8[$1194+3>>0]|0; break; } } } while(0); $1195 = $background22; $1196 = HEAP32[$1195>>2]|0; $1197 = ($1196|0)==(1); if ($1197) { _nk_rgba($15,0,0,0,0); ;HEAP8[$background_color23>>0]=HEAP8[$15>>0]|0;HEAP8[$background_color23+1>>0]=HEAP8[$15+1>>0]|0;HEAP8[$background_color23+2>>0]=HEAP8[$15+2>>0]|0;HEAP8[$background_color23+3>>0]=HEAP8[$15+3>>0]|0; } else { $1198 = $background22; $1199 = ((($1198)) + 4|0); ;HEAP8[$background_color23>>0]=HEAP8[$1199>>0]|0;HEAP8[$background_color23+1>>0]=HEAP8[$1199+1>>0]|0;HEAP8[$background_color23+2>>0]=HEAP8[$1199+2>>0]|0;HEAP8[$background_color23+3>>0]=HEAP8[$1199+3>>0]|0; } $1200 = $2; $1201 = $6; $1202 = +HEAPF32[$area>>2]; $1203 = $5; $1204 = ((($1203)) + 80|0); $1205 = +HEAPF32[$1204>>2]; $1206 = $1202 - $1205; $1207 = ((($area)) + 4|0); $1208 = +HEAPF32[$1207>>2]; $1209 = $5; $1210 = ((($1209)) + 80|0); $1211 = ((($1210)) + 4|0); $1212 = +HEAPF32[$1211>>2]; $1213 = $1208 - $1212; $1214 = $begin21; $1215 = $l20; $1216 = $row_height; $1217 = $8; ;HEAP8[$background_color23$byval_copy>>0]=HEAP8[$background_color23>>0]|0;HEAP8[$background_color23$byval_copy+1>>0]=HEAP8[$background_color23+1>>0]|0;HEAP8[$background_color23$byval_copy+2>>0]=HEAP8[$background_color23+2>>0]|0;HEAP8[$background_color23$byval_copy+3>>0]=HEAP8[$background_color23+3>>0]|0; ;HEAP8[$text_color24$byval_copy>>0]=HEAP8[$text_color24>>0]|0;HEAP8[$text_color24$byval_copy+1>>0]=HEAP8[$text_color24+1>>0]|0;HEAP8[$text_color24$byval_copy+2>>0]=HEAP8[$text_color24+2>>0]|0;HEAP8[$text_color24$byval_copy+3>>0]=HEAP8[$text_color24+3>>0]|0; _nk_edit_draw_text($1200,$1201,$1206,$1213,0.0,$1214,$1215,$1216,$1217,$background_color23$byval_copy,$text_color24$byval_copy,0); } } while(0); $1218 = $2; ;HEAP32[$old_clip$byval_copy>>2]=HEAP32[$old_clip>>2]|0;HEAP32[$old_clip$byval_copy+4>>2]=HEAP32[$old_clip+4>>2]|0;HEAP32[$old_clip$byval_copy+8>>2]=HEAP32[$old_clip+8>>2]|0;HEAP32[$old_clip$byval_copy+12>>2]=HEAP32[$old_clip+12>>2]|0; _nk_push_scissor($1218,$old_clip$byval_copy); $1219 = $ret; $0 = $1219; $1220 = $0; STACKTOP = sp;return ($1220|0); } function _nk_property($ctx,$name,$min,$val,$max,$step,$inc_per_pixel,$filter) { $ctx = $ctx|0; $name = $name|0; $min = +$min; $val = +$val; $max = +$max; $step = +$step; $inc_per_pixel = +$inc_per_pixel; $filter = $filter|0; var $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $bounds = 0, $bounds$byval_copy = 0, $buffer = 0, $cursor = 0, $dummy_buffer = 0, $dummy_cursor = 0, $dummy_length = 0, $dummy_state = 0, $hash = 0, $in = 0, $layout = 0, $len = 0, $old_state = 0, $or$cond = 0, $s = 0, $state = 0, $style = 0, $win = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $bounds$byval_copy = sp + 112|0; $bounds = sp + 40|0; $dummy_buffer = sp + 128|0; $dummy_state = sp + 8|0; $dummy_length = sp + 4|0; $dummy_cursor = sp; $1 = $ctx; $2 = $name; $3 = $min; $4 = $val; $5 = $max; $6 = $step; $7 = $inc_per_pixel; $8 = $filter; $state = 0; $hash = 0; $buffer = 0; $len = 0; $cursor = 0; HEAP32[$dummy_state>>2] = 0; HEAP32[$dummy_length>>2] = 0; HEAP32[$dummy_cursor>>2] = 0; $9 = $1; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((14913|0),(13400|0),17853,(31787|0)); // unreachable; } $11 = $1; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((28537|0),(13400|0),17854,(31787|0)); // unreachable; } $15 = $1; $16 = ((($15)) + 11168|0); $17 = HEAP32[$16>>2]|0; $18 = ((($17)) + 72|0); $19 = HEAP32[$18>>2]|0; $20 = ($19|0)!=(0|0); if (!($20)) { ___assert_fail((28516|0),(13400|0),17855,(31787|0)); // unreachable; } $21 = $1; $22 = ($21|0)!=(0|0); if ($22) { $23 = $1; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ($25|0)!=(0|0); if ($26) { $27 = $1; $28 = ((($27)) + 11168|0); $29 = HEAP32[$28>>2]|0; $30 = ((($29)) + 72|0); $31 = HEAP32[$30>>2]|0; $32 = ($31|0)!=(0|0); if ($32) { $34 = $1; $35 = ((($34)) + 11168|0); $36 = HEAP32[$35>>2]|0; $win = $36; $37 = $win; $38 = ((($37)) + 72|0); $39 = HEAP32[$38>>2]|0; $layout = $39; $40 = $1; $41 = ((($40)) + 300|0); $style = $41; $42 = $1; $43 = (_nk_widget($bounds,$42)|0); $s = $43; $44 = $s; $45 = ($44|0)!=(0); if (!($45)) { $46 = $4; $0 = $46; $181 = $0; STACKTOP = sp;return (+$181); } $47 = $s; $48 = ($47|0)==(2); if ($48) { $54 = 0; } else { $49 = $layout; $50 = HEAP32[$49>>2]|0; $51 = $50 & 1024; $52 = ($51|0)!=(0); if ($52) { $54 = 0; } else { $53 = $1; $54 = $53; } } $in = $54; $55 = $2; $56 = HEAP8[$55>>0]|0; $57 = $56 << 24 >> 24; $58 = ($57|0)==(35); $59 = $2; $60 = $2; $61 = (_nk_strlen($60)|0); if ($58) { $62 = $win; $63 = ((($62)) + 76|0); $64 = ((($63)) + 84|0); $65 = HEAP32[$64>>2]|0; $66 = (($65) + 1)|0; HEAP32[$64>>2] = $66; $67 = (_nk_murmur_hash($59,$61,$65)|0); $hash = $67; $68 = $2; $69 = ((($68)) + 1|0); $2 = $69; } else { $70 = (_nk_murmur_hash($59,$61,42)|0); $hash = $70; } $71 = $win; $72 = ((($71)) + 76|0); $73 = HEAP32[$72>>2]|0; $74 = ($73|0)!=(0); if ($74) { $75 = $hash; $76 = $win; $77 = ((($76)) + 76|0); $78 = ((($77)) + 80|0); $79 = HEAP32[$78>>2]|0; $80 = ($75|0)==($79|0); if ($80) { $81 = $win; $82 = ((($81)) + 76|0); $83 = ((($82)) + 8|0); $buffer = $83; $84 = $win; $85 = ((($84)) + 76|0); $86 = ((($85)) + 72|0); $len = $86; $87 = $win; $88 = ((($87)) + 76|0); $89 = ((($88)) + 76|0); $cursor = $89; $90 = $win; $91 = ((($90)) + 76|0); $92 = ((($91)) + 92|0); $state = $92; } else { label = 22; } } else { label = 22; } if ((label|0) == 22) { $buffer = $dummy_buffer; $len = $dummy_length; $cursor = $dummy_cursor; $state = $dummy_state; } $93 = $state; $94 = HEAP32[$93>>2]|0; $old_state = $94; $95 = $1; $96 = ((($95)) + 5668|0); $97 = $win; $98 = ((($97)) + 32|0); $99 = $2; $100 = $3; $101 = $4; $102 = $5; $103 = $6; $104 = $7; $105 = $buffer; $106 = $len; $107 = $state; $108 = $cursor; $109 = $style; $110 = ((($109)) + 1524|0); $111 = $8; $112 = $in; $113 = $style; $114 = $1; $115 = ((($114)) + 5844|0); ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; $116 = (+_nk_do_property($96,$98,$bounds$byval_copy,$99,$100,$101,$102,$103,$104,$105,$106,$107,$108,$110,$111,$112,$113,$115)); $4 = $116; $117 = $in; $118 = ($117|0)!=(0|0); if ($118) { $119 = $state; $120 = HEAP32[$119>>2]|0; $121 = ($120|0)!=(0); if ($121) { $122 = $win; $123 = ((($122)) + 76|0); $124 = HEAP32[$123>>2]|0; $125 = ($124|0)!=(0); if (!($125)) { $126 = $win; $127 = ((($126)) + 76|0); HEAP32[$127>>2] = 1; $128 = $win; $129 = ((($128)) + 76|0); $130 = ((($129)) + 8|0); $131 = $buffer; $132 = $len; $133 = HEAP32[$132>>2]|0; (_nk_memcopy($130,$131,$133)|0); $134 = $len; $135 = HEAP32[$134>>2]|0; $136 = $win; $137 = ((($136)) + 76|0); $138 = ((($137)) + 72|0); HEAP32[$138>>2] = $135; $139 = $cursor; $140 = HEAP32[$139>>2]|0; $141 = $win; $142 = ((($141)) + 76|0); $143 = ((($142)) + 76|0); HEAP32[$143>>2] = $140; $144 = $state; $145 = HEAP32[$144>>2]|0; $146 = $win; $147 = ((($146)) + 76|0); $148 = ((($147)) + 92|0); HEAP32[$148>>2] = $145; $149 = $hash; $150 = $win; $151 = ((($150)) + 76|0); $152 = ((($151)) + 80|0); HEAP32[$152>>2] = $149; $153 = $state; $154 = HEAP32[$153>>2]|0; $155 = ($154|0)==(2); if ($155) { $156 = $1; $157 = ((($156)) + 220|0); $158 = ((($157)) + 76|0); HEAP8[$158>>0] = 1; $159 = $1; $160 = ((($159)) + 220|0); $161 = ((($160)) + 77|0); HEAP8[$161>>0] = 1; } } } } $162 = $state; $163 = HEAP32[$162>>2]|0; $164 = ($163|0)==(0); $165 = $old_state; $166 = ($165|0)!=(0); $or$cond = $164 & $166; if ($or$cond) { $167 = $old_state; $168 = ($167|0)==(2); if ($168) { $169 = $1; $170 = ((($169)) + 220|0); $171 = ((($170)) + 76|0); HEAP8[$171>>0] = 0; $172 = $1; $173 = ((($172)) + 220|0); $174 = ((($173)) + 77|0); HEAP8[$174>>0] = 0; $175 = $1; $176 = ((($175)) + 220|0); $177 = ((($176)) + 78|0); HEAP8[$177>>0] = 1; } $178 = $win; $179 = ((($178)) + 76|0); HEAP32[$179>>2] = 0; } $180 = $4; $0 = $180; $181 = $0; STACKTOP = sp;return (+$181); } } } $33 = $4; $0 = $33; $181 = $0; STACKTOP = sp;return (+$181); } function _nk_property_int($ctx,$name,$min,$val,$max,$step,$inc_per_pixel) { $ctx = $ctx|0; $name = $name|0; $min = $min|0; $val = $val|0; $max = $max|0; $step = $step|0; $inc_per_pixel = $inc_per_pixel|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0; var $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $or$cond = 0, $or$cond3 = 0, $value = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $name; $2 = $min; $3 = $val; $4 = $max; $5 = $step; $6 = $inc_per_pixel; $7 = $0; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((14913|0),(13400|0),17933,(28623|0)); // unreachable; } $9 = $1; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28614|0),(13400|0),17934,(28623|0)); // unreachable; } $11 = $3; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((28619|0),(13400|0),17935,(28623|0)); // unreachable; } $13 = $0; $14 = ($13|0)!=(0|0); if (!($14)) { STACKTOP = sp;return; } $15 = $0; $16 = ((($15)) + 11168|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0|0); $19 = $1; $20 = ($19|0)!=(0|0); $or$cond = $18 & $20; $21 = $3; $22 = ($21|0)!=(0|0); $or$cond3 = $or$cond & $22; if (!($or$cond3)) { STACKTOP = sp;return; } $23 = $0; $24 = $1; $25 = $2; $26 = (+($25|0)); $27 = $3; $28 = HEAP32[$27>>2]|0; $29 = (+($28|0)); $30 = $4; $31 = (+($30|0)); $32 = $5; $33 = (+($32|0)); $34 = $6; $35 = (+($34|0)); $36 = (+_nk_property($23,$24,$26,$29,$31,$33,$35,1)); $value = $36; $37 = $value; $38 = (~~(($37))); $39 = $3; HEAP32[$39>>2] = $38; STACKTOP = sp;return; } function _nk_propertyi($ctx,$name,$min,$val,$max,$step,$inc_per_pixel) { $ctx = $ctx|0; $name = $name|0; $min = $min|0; $val = $val|0; $max = $max|0; $step = $step|0; $inc_per_pixel = $inc_per_pixel|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0; var $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $value = 0.0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $ctx; $2 = $name; $3 = $min; $4 = $val; $5 = $max; $6 = $step; $7 = $inc_per_pixel; $8 = $1; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((14913|0),(13400|0),17957,(28639|0)); // unreachable; } $10 = $2; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((28614|0),(13400|0),17958,(28639|0)); // unreachable; } $12 = $1; $13 = ($12|0)!=(0|0); if ($13) { $14 = $1; $15 = ((($14)) + 11168|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)!=(0|0); $18 = $2; $19 = ($18|0)!=(0|0); $or$cond = $17 & $19; if ($or$cond) { $21 = $1; $22 = $2; $23 = $3; $24 = (+($23|0)); $25 = $4; $26 = (+($25|0)); $27 = $5; $28 = (+($27|0)); $29 = $6; $30 = (+($29|0)); $31 = $7; $32 = (+($31|0)); $33 = (+_nk_property($21,$22,$24,$26,$28,$30,$32,1)); $value = $33; $34 = $value; $35 = (~~(($34))); $0 = $35; $36 = $0; STACKTOP = sp;return ($36|0); } } $20 = $4; $0 = $20; $36 = $0; STACKTOP = sp;return ($36|0); } function _nk_color_pick($ctx,$color,$fmt) { $ctx = $ctx|0; $color = $color|0; $fmt = $fmt|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $7 = 0, $8 = 0, $9 = 0, $bounds = 0, $bounds$byval_copy = 0, $config = 0, $in = 0, $layout = 0, $or$cond = 0, $state = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 80|0; $bounds$byval_copy = sp + 64|0; $bounds = sp + 8|0; $4 = sp; $1 = $ctx; $2 = $color; $3 = $fmt; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),17982,(28652|0)); // unreachable; } $7 = $2; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((28666|0),(13400|0),17983,(28652|0)); // unreachable; } $9 = $1; $10 = ((($9)) + 11168|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((28537|0),(13400|0),17984,(28652|0)); // unreachable; } $13 = $1; $14 = ((($13)) + 11168|0); $15 = HEAP32[$14>>2]|0; $16 = ((($15)) + 72|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0|0); if (!($18)) { ___assert_fail((28516|0),(13400|0),17985,(28652|0)); // unreachable; } $19 = $1; $20 = ($19|0)!=(0|0); if ($20) { $21 = $1; $22 = ((($21)) + 11168|0); $23 = HEAP32[$22>>2]|0; $24 = ($23|0)!=(0|0); if ($24) { $25 = $1; $26 = ((($25)) + 11168|0); $27 = HEAP32[$26>>2]|0; $28 = ((($27)) + 72|0); $29 = HEAP32[$28>>2]|0; $30 = ($29|0)!=(0|0); $31 = $2; $32 = ($31|0)!=(0|0); $or$cond = $30 & $32; if ($or$cond) { $33 = $1; $34 = ((($33)) + 11168|0); $35 = HEAP32[$34>>2]|0; $win = $35; $36 = $1; $37 = ((($36)) + 300|0); $config = $37; $38 = $win; $39 = ((($38)) + 72|0); $40 = HEAP32[$39>>2]|0; $layout = $40; $41 = $1; $42 = (_nk_widget($bounds,$41)|0); $state = $42; $43 = $state; $44 = ($43|0)!=(0); if (!($44)) { $0 = 0; $62 = $0; STACKTOP = sp;return ($62|0); } $45 = $state; $46 = ($45|0)==(2); if ($46) { $52 = 0; } else { $47 = $layout; $48 = HEAP32[$47>>2]|0; $49 = $48 & 1024; $50 = ($49|0)!=(0); if ($50) { $52 = 0; } else { $51 = $1; $52 = $51; } } $in = $52; $53 = $1; $54 = ((($53)) + 5668|0); $55 = $win; $56 = ((($55)) + 32|0); $57 = $2; $58 = $3; _nk_vec2($4,0.0,0.0); $59 = $in; $60 = $config; ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$4+4>>2]|0; $61 = (_nk_do_color_picker($54,$56,$57,$58,$bounds$byval_copy,$$byval_copy,$59,$60)|0); $0 = $61; $62 = $0; STACKTOP = sp;return ($62|0); } } } $0 = 0; $62 = $0; STACKTOP = sp;return ($62|0); } function _nk_do_color_picker($state,$out,$color,$fmt,$bounds,$padding,$in,$font) { $state = $state|0; $out = $out|0; $color = $color|0; $fmt = $fmt|0; $bounds = $bounds|0; $padding = $padding|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0; var $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0; var $60 = 0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0; var $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0.0, $83 = 0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; var $97 = 0, $98 = 0, $99 = 0, $alpha_bar = 0, $alpha_bar$ = 0, $bar_w = 0.0, $hue_bar = 0, $matrix = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 88|0; $matrix = sp + 40|0; $hue_bar = sp + 24|0; $alpha_bar = sp + 8|0; $1 = $state; $2 = $out; $3 = $color; $4 = $fmt; $5 = $in; $6 = $font; $ret = 0; $7 = $2; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((31441|0),(13400|0),13642,(31799|0)); // unreachable; } $9 = $3; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28666|0),(13400|0),13643,(31799|0)); // unreachable; } $11 = $1; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((28059|0),(13400|0),13644,(31799|0)); // unreachable; } $13 = $6; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((14249|0),(13400|0),13645,(31799|0)); // unreachable; } $15 = $2; $16 = ($15|0)!=(0|0); $17 = $3; $18 = ($17|0)!=(0|0); $or$cond = $16 & $18; $19 = $1; $20 = ($19|0)!=(0|0); $or$cond3 = $or$cond & $20; $21 = $6; $22 = ($21|0)!=(0|0); $or$cond5 = $or$cond3 & $22; if ($or$cond5) { $24 = $6; $25 = ((($24)) + 4|0); $26 = +HEAPF32[$25>>2]; $bar_w = $26; $27 = +HEAPF32[$padding>>2]; $28 = +HEAPF32[$bounds>>2]; $29 = $28 + $27; HEAPF32[$bounds>>2] = $29; $30 = +HEAPF32[$padding>>2]; $31 = ((($bounds)) + 4|0); $32 = +HEAPF32[$31>>2]; $33 = $32 + $30; HEAPF32[$31>>2] = $33; $34 = +HEAPF32[$padding>>2]; $35 = 2.0 * $34; $36 = ((($bounds)) + 8|0); $37 = +HEAPF32[$36>>2]; $38 = $37 - $35; HEAPF32[$36>>2] = $38; $39 = ((($padding)) + 4|0); $40 = +HEAPF32[$39>>2]; $41 = 2.0 * $40; $42 = ((($bounds)) + 12|0); $43 = +HEAPF32[$42>>2]; $44 = $43 - $41; HEAPF32[$42>>2] = $44; $45 = +HEAPF32[$bounds>>2]; HEAPF32[$matrix>>2] = $45; $46 = ((($bounds)) + 4|0); $47 = +HEAPF32[$46>>2]; $48 = ((($matrix)) + 4|0); HEAPF32[$48>>2] = $47; $49 = ((($bounds)) + 12|0); $50 = +HEAPF32[$49>>2]; $51 = ((($matrix)) + 12|0); HEAPF32[$51>>2] = $50; $52 = ((($bounds)) + 8|0); $53 = +HEAPF32[$52>>2]; $54 = +HEAPF32[$padding>>2]; $55 = 3.0 * $54; $56 = $bar_w; $57 = 2.0 * $56; $58 = $55 + $57; $59 = $53 - $58; $60 = ((($matrix)) + 8|0); HEAPF32[$60>>2] = $59; $61 = $bar_w; $62 = ((($hue_bar)) + 8|0); HEAPF32[$62>>2] = $61; $63 = ((($bounds)) + 4|0); $64 = +HEAPF32[$63>>2]; $65 = ((($hue_bar)) + 4|0); HEAPF32[$65>>2] = $64; $66 = ((($matrix)) + 12|0); $67 = +HEAPF32[$66>>2]; $68 = ((($hue_bar)) + 12|0); HEAPF32[$68>>2] = $67; $69 = +HEAPF32[$matrix>>2]; $70 = ((($matrix)) + 8|0); $71 = +HEAPF32[$70>>2]; $72 = $69 + $71; $73 = +HEAPF32[$padding>>2]; $74 = $72 + $73; HEAPF32[$hue_bar>>2] = $74; $75 = +HEAPF32[$hue_bar>>2]; $76 = ((($hue_bar)) + 8|0); $77 = +HEAPF32[$76>>2]; $78 = $75 + $77; $79 = +HEAPF32[$padding>>2]; $80 = $78 + $79; HEAPF32[$alpha_bar>>2] = $80; $81 = ((($bounds)) + 4|0); $82 = +HEAPF32[$81>>2]; $83 = ((($alpha_bar)) + 4|0); HEAPF32[$83>>2] = $82; $84 = $bar_w; $85 = ((($alpha_bar)) + 8|0); HEAPF32[$85>>2] = $84; $86 = ((($matrix)) + 12|0); $87 = +HEAPF32[$86>>2]; $88 = ((($alpha_bar)) + 12|0); HEAPF32[$88>>2] = $87; $89 = $1; $90 = $4; $91 = ($90|0)==(1); $alpha_bar$ = $91 ? $alpha_bar : 0; $92 = $3; $93 = $5; $94 = (_nk_color_picker_behavior($89,$bounds,$matrix,$hue_bar,$alpha_bar$,$92,$93)|0); $ret = $94; $95 = $2; $96 = $4; $97 = ($96|0)==(1); $98 = $97 ? $alpha_bar : 0; $99 = $3; ;HEAP8[$$byval_copy>>0]=HEAP8[$99>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$99+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$99+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$99+3>>0]|0; _nk_draw_color_picker($95,$matrix,$hue_bar,$98,$$byval_copy); $100 = $ret; $0 = $100; $101 = $0; STACKTOP = sp;return ($101|0); } else { $23 = $ret; $0 = $23; $101 = $0; STACKTOP = sp;return ($101|0); } return (0)|0; } function _nk_color_picker($agg$result,$ctx,$color,$fmt) { $agg$result = $agg$result|0; $ctx = $ctx|0; $color = $color|0; $fmt = $fmt|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $fmt; $2 = $0; $3 = $1; (_nk_color_pick($2,$color,$3)|0); ;HEAP8[$agg$result>>0]=HEAP8[$color>>0]|0;HEAP8[$agg$result+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$agg$result+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$agg$result+3>>0]=HEAP8[$color+3>>0]|0; STACKTOP = sp;return; } function _nk_shrink_rect($agg$result,$r,$amount) { $agg$result = $agg$result|0; $r = $r|0; $amount = +$amount; var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $5 = 0, $6 = 0.0; var $7 = 0.0, $8 = 0, $9 = 0.0, $res = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $res = sp; $0 = $amount; $1 = ((($r)) + 8|0); $2 = +HEAPF32[$1>>2]; $3 = $0; $4 = 2.0 * $3; $5 = $2 < $4; $6 = $0; $7 = 2.0 * $6; $8 = ((($r)) + 8|0); $9 = +HEAPF32[$8>>2]; $10 = $5 ? $7 : $9; $11 = ((($r)) + 8|0); HEAPF32[$11>>2] = $10; $12 = ((($r)) + 12|0); $13 = +HEAPF32[$12>>2]; $14 = $0; $15 = 2.0 * $14; $16 = $13 < $15; $17 = $0; $18 = 2.0 * $17; $19 = ((($r)) + 12|0); $20 = +HEAPF32[$19>>2]; $21 = $16 ? $18 : $20; $22 = ((($r)) + 12|0); HEAPF32[$22>>2] = $21; $23 = +HEAPF32[$r>>2]; $24 = $0; $25 = $23 + $24; HEAPF32[$res>>2] = $25; $26 = ((($r)) + 4|0); $27 = +HEAPF32[$26>>2]; $28 = $0; $29 = $27 + $28; $30 = ((($res)) + 4|0); HEAPF32[$30>>2] = $29; $31 = ((($r)) + 8|0); $32 = +HEAPF32[$31>>2]; $33 = $0; $34 = 2.0 * $33; $35 = $32 - $34; $36 = ((($res)) + 8|0); HEAPF32[$36>>2] = $35; $37 = ((($r)) + 12|0); $38 = +HEAPF32[$37>>2]; $39 = $0; $40 = 2.0 * $39; $41 = $38 - $40; $42 = ((($res)) + 12|0); HEAPF32[$42>>2] = $41; ;HEAP32[$agg$result>>2]=HEAP32[$res>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$res+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$res+8>>2]|0;HEAP32[$agg$result+12>>2]=HEAP32[$res+12>>2]|0; STACKTOP = sp;return; } function _nk_unify($clip,$a,$x0,$y0,$x1,$y1) { $clip = $clip|0; $a = $a|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; var $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0.0; var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0, $87 = 0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $clip; $1 = $a; $2 = $x0; $3 = $y0; $4 = $x1; $5 = $y1; $6 = $1; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((13573|0),(13400|0),3930,(31929|0)); // unreachable; } $8 = $0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((31938|0),(13400|0),3931,(31929|0)); // unreachable; } $10 = $1; $11 = +HEAPF32[$10>>2]; $12 = $2; $13 = $11 < $12; if ($13) { $14 = $2; $18 = $14; } else { $15 = $1; $16 = +HEAPF32[$15>>2]; $18 = $16; } $17 = $0; HEAPF32[$17>>2] = $18; $19 = $1; $20 = ((($19)) + 4|0); $21 = +HEAPF32[$20>>2]; $22 = $3; $23 = $21 < $22; if ($23) { $24 = $3; $30 = $24; } else { $25 = $1; $26 = ((($25)) + 4|0); $27 = +HEAPF32[$26>>2]; $30 = $27; } $28 = $0; $29 = ((($28)) + 4|0); HEAPF32[$29>>2] = $30; $31 = $1; $32 = +HEAPF32[$31>>2]; $33 = $1; $34 = ((($33)) + 8|0); $35 = +HEAPF32[$34>>2]; $36 = $32 + $35; $37 = $4; $38 = $36 < $37; if ($38) { $39 = $1; $40 = +HEAPF32[$39>>2]; $41 = $1; $42 = ((($41)) + 8|0); $43 = +HEAPF32[$42>>2]; $44 = $40 + $43; $49 = $44; } else { $45 = $4; $49 = $45; } $46 = $0; $47 = +HEAPF32[$46>>2]; $48 = $49 - $47; $50 = $0; $51 = ((($50)) + 8|0); HEAPF32[$51>>2] = $48; $52 = $1; $53 = ((($52)) + 4|0); $54 = +HEAPF32[$53>>2]; $55 = $1; $56 = ((($55)) + 12|0); $57 = +HEAPF32[$56>>2]; $58 = $54 + $57; $59 = $5; $60 = $58 < $59; if ($60) { $61 = $1; $62 = ((($61)) + 4|0); $63 = +HEAPF32[$62>>2]; $64 = $1; $65 = ((($64)) + 12|0); $66 = +HEAPF32[$65>>2]; $67 = $63 + $66; $73 = $67; } else { $68 = $5; $73 = $68; } $69 = $0; $70 = ((($69)) + 4|0); $71 = +HEAPF32[$70>>2]; $72 = $73 - $71; $74 = $0; $75 = ((($74)) + 12|0); HEAPF32[$75>>2] = $72; $76 = $0; $77 = ((($76)) + 8|0); $78 = +HEAPF32[$77>>2]; $79 = 0.0 < $78; if ($79) { $80 = $0; $81 = ((($80)) + 8|0); $82 = +HEAPF32[$81>>2]; $85 = $82; } else { $85 = 0.0; } $83 = $0; $84 = ((($83)) + 8|0); HEAPF32[$84>>2] = $85; $86 = $0; $87 = ((($86)) + 12|0); $88 = +HEAPF32[$87>>2]; $89 = 0.0 < $88; if (!($89)) { $95 = 0.0; $93 = $0; $94 = ((($93)) + 12|0); HEAPF32[$94>>2] = $95; STACKTOP = sp;return; } $90 = $0; $91 = ((($90)) + 12|0); $92 = +HEAPF32[$91>>2]; $95 = $92; $93 = $0; $94 = ((($93)) + 12|0); HEAPF32[$94>>2] = $95; STACKTOP = sp;return; } function _nk_start_popup($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $buf = 0, $iter = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14584,(31943|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((28440|0),(13400|0),14585,(31943|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); $8 = $1; $9 = ($8|0)!=(0|0); $or$cond = $7 & $9; if (!($or$cond)) { STACKTOP = sp;return; } $10 = $1; $11 = ((($10)) + 72|0); $12 = HEAP32[$11>>2]|0; $iter = $12; while(1) { $13 = $iter; $14 = ((($13)) + 352|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); $17 = $iter; if (!($16)) { break; } $18 = ((($17)) + 352|0); $19 = HEAP32[$18>>2]|0; $iter = $19; } $20 = ((($17)) + 328|0); $buf = $20; $21 = $1; $22 = ((($21)) + 32|0); $23 = ((($22)) + 32|0); $24 = HEAP32[$23>>2]|0; $25 = $buf; HEAP32[$25>>2] = $24; $26 = $1; $27 = ((($26)) + 32|0); $28 = ((($27)) + 32|0); $29 = HEAP32[$28>>2]|0; $30 = $buf; $31 = ((($30)) + 12|0); HEAP32[$31>>2] = $29; $32 = $1; $33 = ((($32)) + 32|0); $34 = ((($33)) + 36|0); $35 = HEAP32[$34>>2]|0; $36 = $buf; $37 = ((($36)) + 4|0); HEAP32[$37>>2] = $35; $38 = $buf; $39 = HEAP32[$38>>2]|0; $40 = $buf; $41 = ((($40)) + 8|0); HEAP32[$41>>2] = $39; $42 = $buf; $43 = ((($42)) + 16|0); HEAP32[$43>>2] = 1; STACKTOP = sp;return; } function _nk_popup_end($ctx) { $ctx = $ctx|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, $nk_null_rect$byval_copy = 0, $popup = 0, $win = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 32|0; $nk_null_rect$byval_copy = sp + 16|0; $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),18602,(28718|0)); // unreachable; } $3 = $0; $4 = ((($3)) + 11168|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((28537|0),(13400|0),18603,(28718|0)); // unreachable; } $7 = $0; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ((($9)) + 72|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((28516|0),(13400|0),18604,(28718|0)); // unreachable; } $13 = $0; $14 = ($13|0)!=(0|0); if (!($14)) { STACKTOP = sp;return; } $15 = $0; $16 = ((($15)) + 11168|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0|0); if (!($18)) { STACKTOP = sp;return; } $19 = $0; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ((($21)) + 72|0); $23 = HEAP32[$22>>2]|0; $24 = ($23|0)!=(0|0); if (!($24)) { STACKTOP = sp;return; } $25 = $0; $26 = ((($25)) + 11168|0); $27 = HEAP32[$26>>2]|0; $popup = $27; $28 = $popup; $29 = ((($28)) + 272|0); $30 = HEAP32[$29>>2]|0; $31 = ($30|0)!=(0|0); if (!($31)) { STACKTOP = sp;return; } $32 = $popup; $33 = ((($32)) + 272|0); $34 = HEAP32[$33>>2]|0; $win = $34; $35 = $popup; $36 = ((($35)) + 8|0); $37 = HEAP32[$36>>2]|0; $38 = $37 & 2048; $39 = ($38|0)!=(0); if ($39) { $40 = $win; $41 = ((($40)) + 72|0); $42 = HEAP32[$41>>2]|0; $43 = HEAP32[$42>>2]|0; $44 = $43 | 2097152; HEAP32[$42>>2] = $44; $45 = $win; $46 = ((($45)) + 172|0); $47 = ((($46)) + 12|0); HEAP32[$47>>2] = 0; } $48 = $popup; $49 = ((($48)) + 32|0); ;HEAP32[$nk_null_rect$byval_copy>>2]=HEAP32[8>>2]|0;HEAP32[$nk_null_rect$byval_copy+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$nk_null_rect$byval_copy+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$nk_null_rect$byval_copy+12>>2]=HEAP32[8+12>>2]|0; _nk_push_scissor($49,$nk_null_rect$byval_copy); $50 = $0; _nk_end($50); $51 = $win; $52 = ((($51)) + 32|0); $53 = $popup; $54 = ((($53)) + 32|0); dest=$52; src=$54; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $55 = $0; $56 = $win; _nk_finish_popup($55,$56); $57 = $win; $58 = $0; $59 = ((($58)) + 11168|0); HEAP32[$59>>2] = $57; $60 = $win; $61 = ((($60)) + 32|0); $62 = $win; $63 = ((($62)) + 72|0); $64 = HEAP32[$63>>2]|0; $65 = ((($64)) + 56|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$65>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$65+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$65+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$65+12>>2]|0; _nk_push_scissor($61,$$byval_copy); STACKTOP = sp;return; } function _nk_finish_popup($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $buf = 0, $iter = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14607,(31958|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((28440|0),(13400|0),14608,(31958|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); $8 = $1; $9 = ($8|0)!=(0|0); $or$cond = $7 & $9; if (!($or$cond)) { STACKTOP = sp;return; } $10 = $1; $11 = ((($10)) + 72|0); $12 = HEAP32[$11>>2]|0; $iter = $12; while(1) { $13 = $iter; $14 = ((($13)) + 352|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); $17 = $iter; if (!($16)) { break; } $18 = ((($17)) + 352|0); $19 = HEAP32[$18>>2]|0; $iter = $19; } $20 = ((($17)) + 328|0); $buf = $20; $21 = $1; $22 = ((($21)) + 32|0); $23 = ((($22)) + 36|0); $24 = HEAP32[$23>>2]|0; $25 = $buf; $26 = ((($25)) + 8|0); HEAP32[$26>>2] = $24; $27 = $1; $28 = ((($27)) + 32|0); $29 = ((($28)) + 32|0); $30 = HEAP32[$29>>2]|0; $31 = $buf; $32 = ((($31)) + 12|0); HEAP32[$32>>2] = $30; STACKTOP = sp;return; } function _nk_nonblock_begin($layout,$ctx,$flags,$body,$header) { $layout = $layout|0; $ctx = $ctx|0; $flags = $flags|0; $body = $body|0; $header = $header|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $body$byval_copy = 0, $clicked = 0, $header$byval_copy = 0, $in_body = 0, $in_header = 0, $is_active = 0, $nk_null_rect$byval_copy = 0, $or$cond = 0, $or$cond3 = 0, $popup = 0, $win = 0, dest = 0, label = 0, sp = 0; var src = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $nk_null_rect$byval_copy = sp + 72|0; $header$byval_copy = sp + 56|0; $body$byval_copy = sp + 40|0; $1 = $layout; $2 = $ctx; $3 = $flags; $is_active = 1; $4 = $2; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14913|0),(13400|0),18530,(31974|0)); // unreachable; } $6 = $2; $7 = ((($6)) + 11168|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((28537|0),(13400|0),18531,(31974|0)); // unreachable; } $10 = $2; $11 = ((($10)) + 11168|0); $12 = HEAP32[$11>>2]|0; $13 = ((($12)) + 72|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((28516|0),(13400|0),18532,(31974|0)); // unreachable; } $16 = $2; $17 = ($16|0)!=(0|0); if ($17) { $18 = $2; $19 = ((($18)) + 11168|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); if ($21) { $22 = $2; $23 = ((($22)) + 11168|0); $24 = HEAP32[$23>>2]|0; $25 = ((($24)) + 72|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)!=(0|0); if ($27) { $28 = $2; $29 = ((($28)) + 11168|0); $30 = HEAP32[$29>>2]|0; $win = $30; $31 = $win; $32 = ((($31)) + 8|0); $33 = HEAP32[$32>>2]|0; $34 = $33 & 32768; $35 = ($34|0)!=(0); if ($35) { ___assert_fail((28672|0),(13400|0),18538,(31974|0)); // unreachable; } $36 = $win; $37 = ((($36)) + 172|0); $38 = HEAP32[$37>>2]|0; $popup = $38; $39 = $popup; $40 = ($39|0)!=(0|0); $41 = $2; if ($40) { $50 = (_nk_input_has_mouse_click($41,0)|0); $clicked = $50; $51 = $2; ;HEAP32[$body$byval_copy>>2]=HEAP32[$body>>2]|0;HEAP32[$body$byval_copy+4>>2]=HEAP32[$body+4>>2]|0;HEAP32[$body$byval_copy+8>>2]=HEAP32[$body+8>>2]|0;HEAP32[$body$byval_copy+12>>2]=HEAP32[$body+12>>2]|0; $52 = (_nk_input_is_mouse_click_in_rect($51,0,$body$byval_copy)|0); $in_body = $52; $53 = $2; ;HEAP32[$header$byval_copy>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy+12>>2]=HEAP32[$header+12>>2]|0; $54 = (_nk_input_is_mouse_click_in_rect($53,0,$header$byval_copy)|0); $in_header = $54; $55 = $clicked; $56 = ($55|0)==(0); $57 = $in_body; $58 = ($57|0)!=(0); $or$cond = $56 | $58; $59 = $in_header; $60 = ($59|0)!=(0); $or$cond3 = $or$cond | $60; if (!($or$cond3)) { $is_active = 0; } } else { $42 = (_nk_create_window($41)|0); $popup = $42; $43 = $popup; $44 = $win; $45 = ((($44)) + 172|0); HEAP32[$45>>2] = $43; $46 = $popup; $47 = ((($46)) + 32|0); $48 = $2; $49 = ((($48)) + 5596|0); _nk_command_buffer_init($47,$49,1); } $61 = $is_active; $62 = ($61|0)!=(0); if ($62) { $69 = $popup; $70 = ((($69)) + 12|0); ;HEAP32[$70>>2]=HEAP32[$body>>2]|0;HEAP32[$70+4>>2]=HEAP32[$body+4>>2]|0;HEAP32[$70+8>>2]=HEAP32[$body+8>>2]|0;HEAP32[$70+12>>2]=HEAP32[$body+12>>2]|0; $71 = $win; $72 = $popup; $73 = ((($72)) + 272|0); HEAP32[$73>>2] = $71; $74 = $1; $75 = $popup; $76 = ((($75)) + 72|0); HEAP32[$76>>2] = $74; $77 = $3; $78 = $popup; $79 = ((($78)) + 8|0); HEAP32[$79>>2] = $77; $80 = $popup; $81 = ((($80)) + 8|0); $82 = HEAP32[$81>>2]|0; $83 = $82 | 32769; HEAP32[$81>>2] = $83; $84 = $popup; $85 = ((($84)) + 8|0); $86 = HEAP32[$85>>2]|0; $87 = $86 | 8256; HEAP32[$85>>2] = $87; $88 = $popup; $89 = ((($88)) + 8|0); $90 = HEAP32[$89>>2]|0; $91 = $90 | 65536; HEAP32[$89>>2] = $91; $92 = $2; $93 = ((($92)) + 11180|0); $94 = HEAP32[$93>>2]|0; $95 = $popup; HEAP32[$95>>2] = $94; $96 = $win; $97 = ((($96)) + 172|0); $98 = ((($97)) + 12|0); HEAP32[$98>>2] = 1; $99 = $2; $100 = $win; _nk_start_popup($99,$100); $101 = $popup; $102 = ((($101)) + 32|0); $103 = $win; $104 = ((($103)) + 32|0); dest=$102; src=$104; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $105 = $popup; $106 = ((($105)) + 32|0); ;HEAP32[$nk_null_rect$byval_copy>>2]=HEAP32[8>>2]|0;HEAP32[$nk_null_rect$byval_copy+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$nk_null_rect$byval_copy+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$nk_null_rect$byval_copy+12>>2]=HEAP32[8+12>>2]|0; _nk_push_scissor($106,$nk_null_rect$byval_copy); $107 = $popup; $108 = $2; $109 = ((($108)) + 11168|0); HEAP32[$109>>2] = $107; $110 = $2; (_nk_panel_begin($110,0)|0); $111 = $win; $112 = ((($111)) + 32|0); $113 = $popup; $114 = ((($113)) + 32|0); dest=$112; src=$114; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); $115 = $win; $116 = ((($115)) + 72|0); $117 = HEAP32[$116>>2]|0; $118 = HEAP32[$117>>2]|0; $119 = $118 | 1024; HEAP32[$117>>2] = $119; $120 = $popup; $121 = ((($120)) + 28|0); $122 = $1; $123 = ((($122)) + 20|0); HEAP32[$123>>2] = $121; $124 = $is_active; $0 = $124; $125 = $0; STACKTOP = sp;return ($125|0); } else { $63 = $win; $64 = ((($63)) + 72|0); $65 = HEAP32[$64>>2]|0; $66 = HEAP32[$65>>2]|0; $67 = $66 | 2097152; HEAP32[$65>>2] = $67; $68 = $is_active; $0 = $68; $125 = $0; STACKTOP = sp;return ($125|0); } } } } $0 = 0; $125 = $0; STACKTOP = sp;return ($125|0); } function _nk_contextual_end($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $popup = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((14913|0),(13400|0),18888,(28731|0)); // unreachable; } $3 = $0; $4 = ((($3)) + 11168|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((28537|0),(13400|0),18889,(28731|0)); // unreachable; } $7 = $0; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $popup = $9; $10 = $popup; $11 = ((($10)) + 272|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((28704|0),(13400|0),18891,(28731|0)); // unreachable; } $14 = $popup; $15 = ((($14)) + 8|0); $16 = HEAP32[$15>>2]|0; $17 = $16 & 2048; $18 = ($17|0)!=(0); if (!($18)) { $20 = $0; _nk_popup_end($20); STACKTOP = sp;return; } $19 = $popup; HEAP32[$19>>2] = 0; $20 = $0; _nk_popup_end($20); STACKTOP = sp;return; } function _nk_button_behavior($state,$r,$i,$behavior) { $state = $state|0; $r = $r|0; $i = $i|0; $behavior = $behavior|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $r$byval_copy = 0, $r$byval_copy1 = 0, $r$byval_copy2 = 0, $r$byval_copy3 = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $r$byval_copy3 = sp + 72|0; $r$byval_copy2 = sp + 56|0; $r$byval_copy1 = sp + 40|0; $r$byval_copy = sp + 24|0; $1 = $state; $2 = $i; $3 = $behavior; $ret = 0; $4 = $1; $5 = HEAP32[$4>>2]|0; $6 = $5 & 2; $7 = ($6|0)!=(0); $8 = $1; if ($7) { HEAP32[$8>>2] = 6; } else { HEAP32[$8>>2] = 4; } $9 = $2; $10 = ($9|0)!=(0|0); if (!($10)) { $0 = 0; $45 = $0; STACKTOP = sp;return ($45|0); } $11 = $2; ;HEAP32[$r$byval_copy>>2]=HEAP32[$r>>2]|0;HEAP32[$r$byval_copy+4>>2]=HEAP32[$r+4>>2]|0;HEAP32[$r$byval_copy+8>>2]=HEAP32[$r+8>>2]|0;HEAP32[$r$byval_copy+12>>2]=HEAP32[$r+12>>2]|0; $12 = (_nk_input_is_mouse_hovering_rect($11,$r$byval_copy)|0); $13 = ($12|0)!=(0); if ($13) { $14 = $1; HEAP32[$14>>2] = 18; $15 = $2; $16 = (_nk_input_is_mouse_down($15,0)|0); $17 = ($16|0)!=(0); if ($17) { $18 = $1; HEAP32[$18>>2] = 34; } $19 = $2; ;HEAP32[$r$byval_copy1>>2]=HEAP32[$r>>2]|0;HEAP32[$r$byval_copy1+4>>2]=HEAP32[$r+4>>2]|0;HEAP32[$r$byval_copy1+8>>2]=HEAP32[$r+8>>2]|0;HEAP32[$r$byval_copy1+12>>2]=HEAP32[$r+12>>2]|0; $20 = (_nk_input_has_mouse_click_in_rect($19,0,$r$byval_copy1)|0); $21 = ($20|0)!=(0); if ($21) { $22 = $3; $23 = ($22|0)!=(0); $24 = $2; if ($23) { $25 = (_nk_input_is_mouse_down($24,0)|0); $27 = $25; } else { $26 = (_nk_input_is_mouse_pressed($24,0)|0); $27 = $26; } $ret = $27; } } $28 = $1; $29 = HEAP32[$28>>2]|0; $30 = $29 & 16; $31 = ($30|0)!=(0); if ($31) { $32 = $2; ;HEAP32[$r$byval_copy2>>2]=HEAP32[$r>>2]|0;HEAP32[$r$byval_copy2+4>>2]=HEAP32[$r+4>>2]|0;HEAP32[$r$byval_copy2+8>>2]=HEAP32[$r+8>>2]|0;HEAP32[$r$byval_copy2+12>>2]=HEAP32[$r+12>>2]|0; $33 = (_nk_input_is_mouse_prev_hovering_rect($32,$r$byval_copy2)|0); $34 = ($33|0)!=(0); if ($34) { label = 17; } else { $35 = $1; $36 = HEAP32[$35>>2]|0; $37 = $36 | 8; HEAP32[$35>>2] = $37; } } else { label = 17; } if ((label|0) == 17) { $38 = $2; ;HEAP32[$r$byval_copy3>>2]=HEAP32[$r>>2]|0;HEAP32[$r$byval_copy3+4>>2]=HEAP32[$r+4>>2]|0;HEAP32[$r$byval_copy3+8>>2]=HEAP32[$r+8>>2]|0;HEAP32[$r$byval_copy3+12>>2]=HEAP32[$r+12>>2]|0; $39 = (_nk_input_is_mouse_prev_hovering_rect($38,$r$byval_copy3)|0); $40 = ($39|0)!=(0); if ($40) { $41 = $1; $42 = HEAP32[$41>>2]|0; $43 = $42 | 64; HEAP32[$41>>2] = $43; } } $44 = $ret; $0 = $44; $45 = $0; STACKTOP = sp;return ($45|0); } function _nk_draw_button_symbol($out,$bounds,$content,$state,$style,$type,$font) { $out = $out|0; $bounds = $bounds|0; $content = $content|0; $state = $state|0; $style = $style|0; $type = $type|0; $font = $font|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $background = 0, $bg = 0, $bg$byval_copy = 0, $sym = 0, $sym$byval_copy = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $sym$byval_copy = sp + 60|0; $bg$byval_copy = sp + 56|0; $$byval_copy = sp + 32|0; $sym = sp + 52|0; $bg = sp + 48|0; $0 = $out; $1 = $bounds; $2 = $content; $3 = $state; $4 = $style; $5 = $type; $6 = $font; $7 = $0; $8 = $1; $9 = $3; $10 = $4; $11 = (_nk_draw_button($7,$8,$9,$10)|0); $background = $11; $12 = $background; $13 = HEAP32[$12>>2]|0; $14 = ($13|0)==(0); if ($14) { $15 = $background; $16 = ((($15)) + 4|0); ;HEAP8[$bg>>0]=HEAP8[$16>>0]|0;HEAP8[$bg+1>>0]=HEAP8[$16+1>>0]|0;HEAP8[$bg+2>>0]=HEAP8[$16+2>>0]|0;HEAP8[$bg+3>>0]=HEAP8[$16+3>>0]|0; } else { $17 = $4; $18 = ((($17)) + 64|0); ;HEAP8[$bg>>0]=HEAP8[$18>>0]|0;HEAP8[$bg+1>>0]=HEAP8[$18+1>>0]|0;HEAP8[$bg+2>>0]=HEAP8[$18+2>>0]|0;HEAP8[$bg+3>>0]=HEAP8[$18+3>>0]|0; } $19 = $3; $20 = $19 & 16; $21 = ($20|0)!=(0); do { if ($21) { $22 = $4; $23 = ((($22)) + 72|0); ;HEAP8[$sym>>0]=HEAP8[$23>>0]|0;HEAP8[$sym+1>>0]=HEAP8[$23+1>>0]|0;HEAP8[$sym+2>>0]=HEAP8[$23+2>>0]|0;HEAP8[$sym+3>>0]=HEAP8[$23+3>>0]|0; } else { $24 = $3; $25 = $24 & 32; $26 = ($25|0)!=(0); $27 = $4; if ($26) { $28 = ((($27)) + 76|0); ;HEAP8[$sym>>0]=HEAP8[$28>>0]|0;HEAP8[$sym+1>>0]=HEAP8[$28+1>>0]|0;HEAP8[$sym+2>>0]=HEAP8[$28+2>>0]|0;HEAP8[$sym+3>>0]=HEAP8[$28+3>>0]|0; break; } else { $29 = ((($27)) + 68|0); ;HEAP8[$sym>>0]=HEAP8[$29>>0]|0;HEAP8[$sym+1>>0]=HEAP8[$29+1>>0]|0;HEAP8[$sym+2>>0]=HEAP8[$29+2>>0]|0;HEAP8[$sym+3>>0]=HEAP8[$29+3>>0]|0; break; } } } while(0); $30 = $0; $31 = $5; $32 = $2; $33 = $6; ;HEAP32[$$byval_copy>>2]=HEAP32[$32>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$32+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$32+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$32+12>>2]|0; ;HEAP8[$bg$byval_copy>>0]=HEAP8[$bg>>0]|0;HEAP8[$bg$byval_copy+1>>0]=HEAP8[$bg+1>>0]|0;HEAP8[$bg$byval_copy+2>>0]=HEAP8[$bg+2>>0]|0;HEAP8[$bg$byval_copy+3>>0]=HEAP8[$bg+3>>0]|0; ;HEAP8[$sym$byval_copy>>0]=HEAP8[$sym>>0]|0;HEAP8[$sym$byval_copy+1>>0]=HEAP8[$sym+1>>0]|0;HEAP8[$sym$byval_copy+2>>0]=HEAP8[$sym+2>>0]|0;HEAP8[$sym$byval_copy+3>>0]=HEAP8[$sym+3>>0]|0; _nk_draw_symbol($30,$31,$$byval_copy,$bg$byval_copy,$sym$byval_copy,1.0,$33); STACKTOP = sp;return; } function _nk_combo_begin($layout,$ctx,$win,$height,$is_clicked,$header) { $layout = $layout|0; $ctx = $ctx|0; $win = $win|0; $height = $height|0; $is_clicked = $is_clicked|0; $header = $header|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0; var $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0; var $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0; var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $body = 0, $body$byval_copy = 0, $hash = 0, $is_active = 0, $is_open = 0, $or$cond = 0, $or$cond$not = 0, $or$cond11 = 0, $or$cond3 = 0, $or$cond5 = 0; var $or$cond7 = 0, $or$cond9 = 0, $popup = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 96|0; $body$byval_copy = sp + 80|0; $body = sp + 24|0; $6 = sp; $1 = $layout; $2 = $ctx; $3 = $win; $4 = $height; $5 = $is_clicked; $is_open = 0; $is_active = 0; $7 = $2; $8 = ($7|0)!=(0|0); if (!($8)) { ___assert_fail((14913|0),(13400|0),18912,(31992|0)); // unreachable; } $9 = $2; $10 = ((($9)) + 11168|0); $11 = HEAP32[$10>>2]|0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((28537|0),(13400|0),18913,(31992|0)); // unreachable; } $13 = $2; $14 = ((($13)) + 11168|0); $15 = HEAP32[$14>>2]|0; $16 = ((($15)) + 72|0); $17 = HEAP32[$16>>2]|0; $18 = ($17|0)!=(0|0); if (!($18)) { ___assert_fail((28516|0),(13400|0),18914,(31992|0)); // unreachable; } $19 = $2; $20 = ($19|0)!=(0|0); if ($20) { $21 = $2; $22 = ((($21)) + 11168|0); $23 = HEAP32[$22>>2]|0; $24 = ($23|0)!=(0|0); if ($24) { $25 = $2; $26 = ((($25)) + 11168|0); $27 = HEAP32[$26>>2]|0; $28 = ((($27)) + 72|0); $29 = HEAP32[$28>>2]|0; $30 = ($29|0)!=(0|0); if ($30) { $31 = $3; $32 = ((($31)) + 172|0); $33 = HEAP32[$32>>2]|0; $popup = $33; $34 = +HEAPF32[$header>>2]; HEAPF32[$body>>2] = $34; $35 = ((($header)) + 8|0); $36 = +HEAPF32[$35>>2]; $37 = ((($body)) + 8|0); HEAPF32[$37>>2] = $36; $38 = ((($header)) + 4|0); $39 = +HEAPF32[$38>>2]; $40 = ((($header)) + 12|0); $41 = +HEAPF32[$40>>2]; $42 = $39 + $41; $43 = $42 - 1.0; $44 = ((($body)) + 4|0); HEAPF32[$44>>2] = $43; $45 = $4; $46 = (+($45|0)); $47 = ((($body)) + 12|0); HEAPF32[$47>>2] = $46; $48 = $3; $49 = ((($48)) + 172|0); $50 = ((($49)) + 16|0); $51 = HEAP32[$50>>2]|0; $52 = (($51) + 1)|0; HEAP32[$50>>2] = $52; $hash = $51; $53 = $popup; $54 = ($53|0)!=(0|0); if ($54) { $55 = $popup; $56 = ((($55)) + 8|0); $57 = HEAP32[$56>>2]|0; $58 = $57 & 262144; $59 = ($58|0)!=(0); $61 = $59; } else { $61 = 0; } $60 = $61&1; $is_open = $60; $62 = $popup; $63 = ($62|0)!=(0|0); if ($63) { $64 = $3; $65 = ((($64)) + 172|0); $66 = ((($65)) + 8|0); $67 = HEAP32[$66>>2]|0; $68 = $hash; $69 = ($67|0)==($68|0); if ($69) { $70 = $3; $71 = ((($70)) + 172|0); $72 = ((($71)) + 4|0); $73 = HEAP32[$72>>2]|0; $74 = ($73|0)==(262144); $76 = $74; } else { $76 = 0; } } else { $76 = 0; } $75 = $76&1; $is_active = $75; $77 = $5; $78 = ($77|0)!=(0); $79 = $is_open; $80 = ($79|0)!=(0); $or$cond = $78 & $80; $or$cond$not = $or$cond ^ 1; $81 = $is_active; $82 = ($81|0)!=(0); $or$cond3 = $or$cond$not | $82; if ($or$cond3) { $83 = $is_open; $84 = ($83|0)==(0); $85 = $is_active; $86 = ($85|0)!=(0); $or$cond5 = $84 | $86; if ($or$cond5) { $87 = $is_open; $88 = ($87|0)!=(0); $89 = $is_active; $90 = ($89|0)!=(0); $or$cond7 = $88 | $90; $91 = $5; $92 = ($91|0)!=(0); $or$cond9 = $or$cond7 | $92; if ($or$cond9) { $93 = $1; $94 = $2; $95 = $5; $96 = ($95|0)!=(0); $97 = $is_open; $98 = ($97|0)!=(0); $or$cond11 = $96 & $98; if ($or$cond11) { _nk_rect($6,0.0,0.0,0.0,0.0); } else { ;HEAP32[$6>>2]=HEAP32[$header>>2]|0;HEAP32[$6+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$6+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$6+12>>2]=HEAP32[$header+12>>2]|0; } ;HEAP32[$body$byval_copy>>2]=HEAP32[$body>>2]|0;HEAP32[$body$byval_copy+4>>2]=HEAP32[$body+4>>2]|0;HEAP32[$body$byval_copy+8>>2]=HEAP32[$body+8>>2]|0;HEAP32[$body$byval_copy+12>>2]=HEAP32[$body+12>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$6+12>>2]|0; $99 = (_nk_nonblock_begin($93,$94,262144,$body$byval_copy,$$byval_copy)|0); $100 = ($99|0)!=(0); if ($100) { $101 = $3; $102 = ((($101)) + 172|0); $103 = ((($102)) + 4|0); HEAP32[$103>>2] = 262144; $104 = $hash; $105 = $3; $106 = ((($105)) + 172|0); $107 = ((($106)) + 8|0); HEAP32[$107>>2] = $104; $0 = 1; $108 = $0; STACKTOP = sp;return ($108|0); } else { $0 = 0; $108 = $0; STACKTOP = sp;return ($108|0); } } } } $0 = 0; $108 = $0; STACKTOP = sp;return ($108|0); } } } $0 = 0; $108 = $0; STACKTOP = sp;return ($108|0); } function _nk_combo_begin_color($ctx,$layout,$color,$height) { $ctx = $ctx|0; $layout = $layout|0; $color = $color|0; $height = $height|0; var $$byval_copy = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0.0; var $113 = 0.0, $114 = 0, $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0.0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0; var $131 = 0, $132 = 0.0, $133 = 0, $134 = 0.0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0.0, $149 = 0.0; var $15 = 0, $150 = 0, $151 = 0, $152 = 0.0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0.0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0; var $168 = 0.0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0, $183 = 0.0, $184 = 0, $185 = 0; var $186 = 0, $187 = 0, $188 = 0.0, $189 = 0.0, $19 = 0, $190 = 0.0, $191 = 0, $192 = 0.0, $193 = 0, $194 = 0, $195 = 0, $196 = 0.0, $197 = 0.0, $198 = 0.0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0; var $203 = 0.0, $204 = 0, $205 = 0, $206 = 0, $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0.0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0; var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $background = 0, $bounds = 0, $bounds$byval_copy = 0, $button = 0; var $color$byval_copy = 0, $content = 0, $header = 0, $header$byval_copy = 0, $header$byval_copy2 = 0, $header$byval_copy3 = 0, $header$byval_copy4 = 0, $header$byval_copy7 = 0, $in = 0, $is_clicked = 0, $or$cond = 0, $s = 0, $style = 0, $sym = 0, $win = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $header$byval_copy7 = sp + 232|0; $color$byval_copy = sp + 256|0; $bounds$byval_copy = sp + 216|0; $$byval_copy6 = sp + 252|0; $$byval_copy5 = sp + 200|0; $header$byval_copy4 = sp + 184|0; $$byval_copy = sp + 248|0; $header$byval_copy3 = sp + 168|0; $header$byval_copy2 = sp + 152|0; $header$byval_copy = sp + 136|0; $header = sp + 88|0; $4 = sp + 56|0; $content = sp + 40|0; $button = sp + 24|0; $bounds = sp + 8|0; $1 = $ctx; $2 = $layout; $3 = $height; $is_clicked = 0; $5 = $1; $6 = ($5|0)!=(0|0); if (!($6)) { ___assert_fail((14913|0),(13400|0),19046,(28749|0)); // unreachable; } $7 = $1; $8 = ((($7)) + 11168|0); $9 = HEAP32[$8>>2]|0; $10 = ($9|0)!=(0|0); if (!($10)) { ___assert_fail((28537|0),(13400|0),19047,(28749|0)); // unreachable; } $11 = $1; $12 = ((($11)) + 11168|0); $13 = HEAP32[$12>>2]|0; $14 = ((($13)) + 72|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28516|0),(13400|0),19048,(28749|0)); // unreachable; } $17 = $1; $18 = ($17|0)!=(0|0); if ($18) { $19 = $1; $20 = ((($19)) + 11168|0); $21 = HEAP32[$20>>2]|0; $22 = ($21|0)!=(0|0); if ($22) { $23 = $1; $24 = ((($23)) + 11168|0); $25 = HEAP32[$24>>2]|0; $26 = ((($25)) + 72|0); $27 = HEAP32[$26>>2]|0; $28 = ($27|0)!=(0|0); if ($28) { $29 = $1; $30 = ((($29)) + 11168|0); $31 = HEAP32[$30>>2]|0; $win = $31; $32 = $1; $33 = ((($32)) + 300|0); $style = $33; $34 = $1; $35 = (_nk_widget($header,$34)|0); $s = $35; $36 = $s; $37 = ($36|0)==(0); if ($37) { $0 = 0; $232 = $0; STACKTOP = sp;return ($232|0); } $38 = $win; $39 = ((($38)) + 72|0); $40 = HEAP32[$39>>2]|0; $41 = HEAP32[$40>>2]|0; $42 = $41 & 1024; $43 = ($42|0)!=(0); $44 = $s; $45 = ($44|0)==(2); $or$cond = $43 | $45; $46 = $1; $47 = $or$cond ? 0 : $46; $in = $47; $48 = $1; $49 = ((($48)) + 5668|0); $50 = $in; ;HEAP32[$header$byval_copy>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy+12>>2]=HEAP32[$header+12>>2]|0; $51 = (_nk_button_behavior($49,$header$byval_copy,$50,0)|0); $52 = ($51|0)!=(0); if ($52) { $is_clicked = 1; } $53 = $1; $54 = ((($53)) + 5668|0); $55 = HEAP32[$54>>2]|0; $56 = $55 & 32; $57 = ($56|0)!=(0); do { if ($57) { $58 = $style; $59 = ((($58)) + 4524|0); $60 = ((($59)) + 40|0); $background = $60; } else { $61 = $1; $62 = ((($61)) + 5668|0); $63 = HEAP32[$62>>2]|0; $64 = $63 & 16; $65 = ($64|0)!=(0); $66 = $style; $67 = ((($66)) + 4524|0); if ($65) { $68 = ((($67)) + 20|0); $background = $68; break; } else { $background = $67; break; } } } while(0); $69 = $background; $70 = HEAP32[$69>>2]|0; $71 = ($70|0)==(1); $72 = $win; $73 = ((($72)) + 32|0); if ($71) { $74 = $background; $75 = ((($74)) + 4|0); ;HEAP32[$header$byval_copy2>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy2+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy2+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy2+12>>2]=HEAP32[$header+12>>2]|0; _nk_draw_image($73,$header$byval_copy2,$75); } else { $76 = $style; $77 = ((($76)) + 4524|0); $78 = ((($77)) + 60|0); ;HEAP32[$header$byval_copy3>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy3+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy3+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy3+12>>2]=HEAP32[$header+12>>2]|0; ;HEAP8[$$byval_copy>>0]=HEAP8[$78>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$78+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$78+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$78+3>>0]|0; _nk_fill_rect($73,$header$byval_copy3,0.0,$$byval_copy); $79 = $win; $80 = ((($79)) + 32|0); ;HEAP32[$header$byval_copy4>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy4+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy4+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy4+12>>2]=HEAP32[$header+12>>2]|0; _nk_shrink_rect($4,$header$byval_copy4,1.0); $81 = $background; $82 = ((($81)) + 4|0); ;HEAP32[$$byval_copy5>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$4+12>>2]|0; ;HEAP8[$$byval_copy6>>0]=HEAP8[$82>>0]|0;HEAP8[$$byval_copy6+1>>0]=HEAP8[$82+1>>0]|0;HEAP8[$$byval_copy6+2>>0]=HEAP8[$82+2>>0]|0;HEAP8[$$byval_copy6+3>>0]=HEAP8[$82+3>>0]|0; _nk_fill_rect($80,$$byval_copy5,0.0,$$byval_copy6); } $83 = $1; $84 = ((($83)) + 5668|0); $85 = HEAP32[$84>>2]|0; $86 = $85 & 16; $87 = ($86|0)!=(0); do { if ($87) { $88 = $style; $89 = ((($88)) + 4524|0); $90 = ((($89)) + 220|0); $91 = HEAP32[$90>>2]|0; $sym = $91; } else { $92 = $is_clicked; $93 = ($92|0)!=(0); $94 = $style; $95 = ((($94)) + 4524|0); if ($93) { $96 = ((($95)) + 224|0); $97 = HEAP32[$96>>2]|0; $sym = $97; break; } else { $98 = ((($95)) + 216|0); $99 = HEAP32[$98>>2]|0; $sym = $99; break; } } } while(0); $100 = ((($header)) + 12|0); $101 = +HEAPF32[$100>>2]; $102 = $style; $103 = ((($102)) + 4524|0); $104 = ((($103)) + 244|0); $105 = ((($104)) + 4|0); $106 = +HEAPF32[$105>>2]; $107 = 2.0 * $106; $108 = $101 - $107; $109 = ((($button)) + 8|0); HEAPF32[$109>>2] = $108; $110 = +HEAPF32[$header>>2]; $111 = ((($header)) + 8|0); $112 = +HEAPF32[$111>>2]; $113 = $110 + $112; $114 = ((($header)) + 12|0); $115 = +HEAPF32[$114>>2]; $116 = $113 - $115; $117 = $style; $118 = ((($117)) + 4524|0); $119 = ((($118)) + 244|0); $120 = +HEAPF32[$119>>2]; $121 = $116 - $120; HEAPF32[$button>>2] = $121; $122 = ((($header)) + 4|0); $123 = +HEAPF32[$122>>2]; $124 = $style; $125 = ((($124)) + 4524|0); $126 = ((($125)) + 244|0); $127 = ((($126)) + 4|0); $128 = +HEAPF32[$127>>2]; $129 = $123 + $128; $130 = ((($button)) + 4|0); HEAPF32[$130>>2] = $129; $131 = ((($button)) + 8|0); $132 = +HEAPF32[$131>>2]; $133 = ((($button)) + 12|0); HEAPF32[$133>>2] = $132; $134 = +HEAPF32[$button>>2]; $135 = $style; $136 = ((($135)) + 4524|0); $137 = ((($136)) + 88|0); $138 = ((($137)) + 92|0); $139 = +HEAPF32[$138>>2]; $140 = $134 + $139; HEAPF32[$content>>2] = $140; $141 = ((($button)) + 4|0); $142 = +HEAPF32[$141>>2]; $143 = $style; $144 = ((($143)) + 4524|0); $145 = ((($144)) + 88|0); $146 = ((($145)) + 92|0); $147 = ((($146)) + 4|0); $148 = +HEAPF32[$147>>2]; $149 = $142 + $148; $150 = ((($content)) + 4|0); HEAPF32[$150>>2] = $149; $151 = ((($button)) + 8|0); $152 = +HEAPF32[$151>>2]; $153 = $style; $154 = ((($153)) + 4524|0); $155 = ((($154)) + 88|0); $156 = ((($155)) + 92|0); $157 = +HEAPF32[$156>>2]; $158 = 2.0 * $157; $159 = $152 - $158; $160 = ((($content)) + 8|0); HEAPF32[$160>>2] = $159; $161 = ((($button)) + 12|0); $162 = +HEAPF32[$161>>2]; $163 = $style; $164 = ((($163)) + 4524|0); $165 = ((($164)) + 88|0); $166 = ((($165)) + 92|0); $167 = ((($166)) + 4|0); $168 = +HEAPF32[$167>>2]; $169 = 2.0 * $168; $170 = $162 - $169; $171 = ((($content)) + 12|0); HEAPF32[$171>>2] = $170; $172 = ((($header)) + 12|0); $173 = +HEAPF32[$172>>2]; $174 = $style; $175 = ((($174)) + 4524|0); $176 = ((($175)) + 236|0); $177 = ((($176)) + 4|0); $178 = +HEAPF32[$177>>2]; $179 = 4.0 * $178; $180 = $173 - $179; $181 = ((($bounds)) + 12|0); HEAPF32[$181>>2] = $180; $182 = ((($header)) + 4|0); $183 = +HEAPF32[$182>>2]; $184 = $style; $185 = ((($184)) + 4524|0); $186 = ((($185)) + 236|0); $187 = ((($186)) + 4|0); $188 = +HEAPF32[$187>>2]; $189 = 2.0 * $188; $190 = $183 + $189; $191 = ((($bounds)) + 4|0); HEAPF32[$191>>2] = $190; $192 = +HEAPF32[$header>>2]; $193 = $style; $194 = ((($193)) + 4524|0); $195 = ((($194)) + 236|0); $196 = +HEAPF32[$195>>2]; $197 = 2.0 * $196; $198 = $192 + $197; HEAPF32[$bounds>>2] = $198; $199 = +HEAPF32[$button>>2]; $200 = $style; $201 = ((($200)) + 4524|0); $202 = ((($201)) + 236|0); $203 = +HEAPF32[$202>>2]; $204 = $style; $205 = ((($204)) + 4524|0); $206 = ((($205)) + 252|0); $207 = +HEAPF32[$206>>2]; $208 = $203 + $207; $209 = $199 - $208; $210 = +HEAPF32[$bounds>>2]; $211 = $209 - $210; $212 = ((($bounds)) + 8|0); HEAPF32[$212>>2] = $211; $213 = $win; $214 = ((($213)) + 32|0); ;HEAP32[$bounds$byval_copy>>2]=HEAP32[$bounds>>2]|0;HEAP32[$bounds$byval_copy+4>>2]=HEAP32[$bounds+4>>2]|0;HEAP32[$bounds$byval_copy+8>>2]=HEAP32[$bounds+8>>2]|0;HEAP32[$bounds$byval_copy+12>>2]=HEAP32[$bounds+12>>2]|0; ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _nk_fill_rect($214,$bounds$byval_copy,0.0,$color$byval_copy); $215 = $win; $216 = ((($215)) + 32|0); $217 = $1; $218 = ((($217)) + 5668|0); $219 = HEAP32[$218>>2]|0; $220 = $1; $221 = ((($220)) + 300|0); $222 = ((($221)) + 4524|0); $223 = ((($222)) + 88|0); $224 = $sym; $225 = $style; _nk_draw_button_symbol($216,$button,$content,$219,$223,$224,$225); $226 = $2; $227 = $1; $228 = $win; $229 = $3; $230 = $is_clicked; ;HEAP32[$header$byval_copy7>>2]=HEAP32[$header>>2]|0;HEAP32[$header$byval_copy7+4>>2]=HEAP32[$header+4>>2]|0;HEAP32[$header$byval_copy7+8>>2]=HEAP32[$header+8>>2]|0;HEAP32[$header$byval_copy7+12>>2]=HEAP32[$header+12>>2]|0; $231 = (_nk_combo_begin($226,$227,$228,$229,$230,$header$byval_copy7)|0); $0 = $231; $232 = $0; STACKTOP = sp;return ($232|0); } } } $0 = 0; $232 = $0; STACKTOP = sp;return ($232|0); } function _nk_draw_symbol($out,$type,$content,$background,$foreground,$border_width,$font) { $out = $out|0; $type = $type|0; $content = $content|0; $background = $background|0; $foreground = $foreground|0; $border_width = +$border_width; $font = $font|0; var $$byval_copy = 0, $$byval_copy7 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0.0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $X = 0, $background$byval_copy = 0; var $background$byval_copy8 = 0, $content$byval_copy = 0, $content$byval_copy2 = 0, $content$byval_copy3 = 0, $content$byval_copy4 = 0, $content$byval_copy6 = 0, $content$byval_copy9 = 0, $foreground$byval_copy = 0, $foreground$byval_copy10 = 0, $foreground$byval_copy5 = 0, $heading = 0, $or$cond = 0, $points = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $foreground$byval_copy10 = sp + 256|0; $content$byval_copy9 = sp + 224|0; $background$byval_copy8 = sp + 252|0; $$byval_copy7 = sp + 208|0; $content$byval_copy6 = sp + 192|0; $foreground$byval_copy5 = sp + 248|0; $content$byval_copy4 = sp + 176|0; $background$byval_copy = sp + 244|0; $$byval_copy = sp + 160|0; $content$byval_copy3 = sp + 144|0; $foreground$byval_copy = sp + 240|0; $content$byval_copy2 = sp + 128|0; $content$byval_copy = sp + 112|0; $text = sp + 72|0; $4 = sp + 64|0; $5 = sp + 48|0; $6 = sp + 32|0; $points = sp; $0 = $out; $1 = $type; $2 = $border_width; $3 = $font; $7 = $1; switch ($7|0) { case 12: case 11: case 2: case 1: { $8 = $1; $9 = ($8|0)==(1); if ($9) { $15 = 32007; } else { $10 = $1; $11 = ($10|0)==(2); if ($11) { $15 = 32009; } else { $12 = $1; $13 = ($12|0)==(11); $14 = $13 ? 32011 : 32013; $15 = $14; } } $X = $15; _nk_vec2($4,0.0,0.0); ;HEAP32[$text>>2]=HEAP32[$4>>2]|0;HEAP32[$text+4>>2]=HEAP32[$4+4>>2]|0; $16 = ((($text)) + 8|0); ;HEAP8[$16>>0]=HEAP8[$background>>0]|0;HEAP8[$16+1>>0]=HEAP8[$background+1>>0]|0;HEAP8[$16+2>>0]=HEAP8[$background+2>>0]|0;HEAP8[$16+3>>0]=HEAP8[$background+3>>0]|0; $17 = ((($text)) + 12|0); ;HEAP8[$17>>0]=HEAP8[$foreground>>0]|0;HEAP8[$17+1>>0]=HEAP8[$foreground+1>>0]|0;HEAP8[$17+2>>0]=HEAP8[$foreground+2>>0]|0;HEAP8[$17+3>>0]=HEAP8[$foreground+3>>0]|0; $18 = $0; $19 = $X; $20 = $3; ;HEAP32[$content$byval_copy>>2]=HEAP32[$content>>2]|0;HEAP32[$content$byval_copy+4>>2]=HEAP32[$content+4>>2]|0;HEAP32[$content$byval_copy+8>>2]=HEAP32[$content+8>>2]|0;HEAP32[$content$byval_copy+12>>2]=HEAP32[$content+12>>2]|0; _nk_widget_text($18,$content$byval_copy,$19,1,$text,18,$20); STACKTOP = sp;return; break; } case 6: case 5: case 4: case 3: { $21 = $1; $22 = ($21|0)==(5); $23 = $1; $24 = ($23|0)==(6); $or$cond = $22 | $24; $25 = $0; if ($or$cond) { ;HEAP32[$content$byval_copy2>>2]=HEAP32[$content>>2]|0;HEAP32[$content$byval_copy2+4>>2]=HEAP32[$content+4>>2]|0;HEAP32[$content$byval_copy2+8>>2]=HEAP32[$content+8>>2]|0;HEAP32[$content$byval_copy2+12>>2]=HEAP32[$content+12>>2]|0; ;HEAP8[$foreground$byval_copy>>0]=HEAP8[$foreground>>0]|0;HEAP8[$foreground$byval_copy+1>>0]=HEAP8[$foreground+1>>0]|0;HEAP8[$foreground$byval_copy+2>>0]=HEAP8[$foreground+2>>0]|0;HEAP8[$foreground$byval_copy+3>>0]=HEAP8[$foreground+3>>0]|0; _nk_fill_rect($25,$content$byval_copy2,0.0,$foreground$byval_copy); $26 = $1; $27 = ($26|0)==(6); if (!($27)) { STACKTOP = sp;return; } $28 = $0; $29 = $2; ;HEAP32[$content$byval_copy3>>2]=HEAP32[$content>>2]|0;HEAP32[$content$byval_copy3+4>>2]=HEAP32[$content+4>>2]|0;HEAP32[$content$byval_copy3+8>>2]=HEAP32[$content+8>>2]|0;HEAP32[$content$byval_copy3+12>>2]=HEAP32[$content+12>>2]|0; _nk_shrink_rect($5,$content$byval_copy3,$29); ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$5+12>>2]|0; ;HEAP8[$background$byval_copy>>0]=HEAP8[$background>>0]|0;HEAP8[$background$byval_copy+1>>0]=HEAP8[$background+1>>0]|0;HEAP8[$background$byval_copy+2>>0]=HEAP8[$background+2>>0]|0;HEAP8[$background$byval_copy+3>>0]=HEAP8[$background+3>>0]|0; _nk_fill_rect($28,$$byval_copy,0.0,$background$byval_copy); STACKTOP = sp;return; } else { ;HEAP32[$content$byval_copy4>>2]=HEAP32[$content>>2]|0;HEAP32[$content$byval_copy4+4>>2]=HEAP32[$content+4>>2]|0;HEAP32[$content$byval_copy4+8>>2]=HEAP32[$content+8>>2]|0;HEAP32[$content$byval_copy4+12>>2]=HEAP32[$content+12>>2]|0; ;HEAP8[$foreground$byval_copy5>>0]=HEAP8[$foreground>>0]|0;HEAP8[$foreground$byval_copy5+1>>0]=HEAP8[$foreground+1>>0]|0;HEAP8[$foreground$byval_copy5+2>>0]=HEAP8[$foreground+2>>0]|0;HEAP8[$foreground$byval_copy5+3>>0]=HEAP8[$foreground+3>>0]|0; _nk_fill_circle($25,$content$byval_copy4,$foreground$byval_copy5); $30 = $1; $31 = ($30|0)==(4); if (!($31)) { STACKTOP = sp;return; } $32 = $0; ;HEAP32[$content$byval_copy6>>2]=HEAP32[$content>>2]|0;HEAP32[$content$byval_copy6+4>>2]=HEAP32[$content+4>>2]|0;HEAP32[$content$byval_copy6+8>>2]=HEAP32[$content+8>>2]|0;HEAP32[$content$byval_copy6+12>>2]=HEAP32[$content+12>>2]|0; _nk_shrink_rect($6,$content$byval_copy6,1.0); ;HEAP32[$$byval_copy7>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy7+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy7+12>>2]=HEAP32[$6+12>>2]|0; ;HEAP8[$background$byval_copy8>>0]=HEAP8[$background>>0]|0;HEAP8[$background$byval_copy8+1>>0]=HEAP8[$background+1>>0]|0;HEAP8[$background$byval_copy8+2>>0]=HEAP8[$background+2>>0]|0;HEAP8[$background$byval_copy8+3>>0]=HEAP8[$background+3>>0]|0; _nk_fill_circle($32,$$byval_copy7,$background$byval_copy8); STACKTOP = sp;return; } break; } case 10: case 9: case 8: case 7: { $33 = $1; $34 = ($33|0)==(10); if ($34) { $40 = 1; } else { $35 = $1; $36 = ($35|0)==(9); if ($36) { $40 = 3; } else { $37 = $1; $38 = ($37|0)==(7); $39 = $38 ? 0 : 2; $40 = $39; } } $heading = $40; $41 = $heading; ;HEAP32[$content$byval_copy9>>2]=HEAP32[$content>>2]|0;HEAP32[$content$byval_copy9+4>>2]=HEAP32[$content+4>>2]|0;HEAP32[$content$byval_copy9+8>>2]=HEAP32[$content+8>>2]|0;HEAP32[$content$byval_copy9+12>>2]=HEAP32[$content+12>>2]|0; _nk_triangle_from_direction($points,$content$byval_copy9,0.0,0.0,$41); $42 = $0; $43 = +HEAPF32[$points>>2]; $44 = ((($points)) + 4|0); $45 = +HEAPF32[$44>>2]; $46 = ((($points)) + 8|0); $47 = +HEAPF32[$46>>2]; $48 = ((($points)) + 8|0); $49 = ((($48)) + 4|0); $50 = +HEAPF32[$49>>2]; $51 = ((($points)) + 16|0); $52 = +HEAPF32[$51>>2]; $53 = ((($points)) + 16|0); $54 = ((($53)) + 4|0); $55 = +HEAPF32[$54>>2]; ;HEAP8[$foreground$byval_copy10>>0]=HEAP8[$foreground>>0]|0;HEAP8[$foreground$byval_copy10+1>>0]=HEAP8[$foreground+1>>0]|0;HEAP8[$foreground$byval_copy10+2>>0]=HEAP8[$foreground+2>>0]|0;HEAP8[$foreground$byval_copy10+3>>0]=HEAP8[$foreground+3>>0]|0; _nk_fill_triangle($42,$43,$45,$47,$50,$52,$55,$foreground$byval_copy10); STACKTOP = sp;return; break; } default: { STACKTOP = sp;return; } } } function _nk_combo_end($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $0; _nk_contextual_end($1); STACKTOP = sp;return; } function _nk_glfw3_device_create() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $dev = 0, $status = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $status = sp + 4|0; $dev = (64); $0 = $dev; _nk_buffer_init_default($0); $1 = (_glCreateProgram()|0); $2 = $dev; $3 = ((($2)) + 80|0); HEAP32[$3>>2] = $1; $4 = (_glCreateShader(35633)|0); $5 = $dev; $6 = ((($5)) + 84|0); HEAP32[$6>>2] = $4; $7 = (_glCreateShader(35632)|0); $8 = $dev; $9 = ((($8)) + 88|0); HEAP32[$9>>2] = $7; $10 = $dev; $11 = ((($10)) + 84|0); $12 = HEAP32[$11>>2]|0; _glShaderSource(($12|0),1,(36|0),(0|0)); $13 = $dev; $14 = ((($13)) + 88|0); $15 = HEAP32[$14>>2]|0; _glShaderSource(($15|0),1,(40|0),(0|0)); $16 = $dev; $17 = ((($16)) + 84|0); $18 = HEAP32[$17>>2]|0; _glCompileShader(($18|0)); $19 = $dev; $20 = ((($19)) + 88|0); $21 = HEAP32[$20>>2]|0; _glCompileShader(($21|0)); $22 = $dev; $23 = ((($22)) + 84|0); $24 = HEAP32[$23>>2]|0; _glGetShaderiv(($24|0),35713,($status|0)); $25 = HEAP32[$status>>2]|0; $26 = ($25|0)==(1); if (!($26)) { ___assert_fail((29227|0),(29245|0),168,(29266|0)); // unreachable; } $27 = $dev; $28 = ((($27)) + 88|0); $29 = HEAP32[$28>>2]|0; _glGetShaderiv(($29|0),35713,($status|0)); $30 = HEAP32[$status>>2]|0; $31 = ($30|0)==(1); if (!($31)) { ___assert_fail((29227|0),(29245|0),170,(29266|0)); // unreachable; } $32 = $dev; $33 = ((($32)) + 80|0); $34 = HEAP32[$33>>2]|0; $35 = $dev; $36 = ((($35)) + 84|0); $37 = HEAP32[$36>>2]|0; _glAttachShader(($34|0),($37|0)); $38 = $dev; $39 = ((($38)) + 80|0); $40 = HEAP32[$39>>2]|0; $41 = $dev; $42 = ((($41)) + 88|0); $43 = HEAP32[$42>>2]|0; _glAttachShader(($40|0),($43|0)); $44 = $dev; $45 = ((($44)) + 80|0); $46 = HEAP32[$45>>2]|0; _glLinkProgram(($46|0)); $47 = $dev; $48 = ((($47)) + 80|0); $49 = HEAP32[$48>>2]|0; _glGetProgramiv(($49|0),35714,($status|0)); $50 = HEAP32[$status>>2]|0; $51 = ($50|0)==(1); if ($51) { $52 = $dev; $53 = ((($52)) + 80|0); $54 = HEAP32[$53>>2]|0; $55 = (_glGetUniformLocation(($54|0),(29289|0))|0); $56 = $dev; $57 = ((($56)) + 104|0); HEAP32[$57>>2] = $55; $58 = $dev; $59 = ((($58)) + 80|0); $60 = HEAP32[$59>>2]|0; $61 = (_glGetUniformLocation(($60|0),(29297|0))|0); $62 = $dev; $63 = ((($62)) + 108|0); HEAP32[$63>>2] = $61; $64 = $dev; $65 = ((($64)) + 80|0); $66 = HEAP32[$65>>2]|0; $67 = (_glGetAttribLocation(($66|0),(29305|0))|0); $68 = $dev; $69 = ((($68)) + 92|0); HEAP32[$69>>2] = $67; $70 = $dev; $71 = ((($70)) + 80|0); $72 = HEAP32[$71>>2]|0; $73 = (_glGetAttribLocation(($72|0),(29314|0))|0); $74 = $dev; $75 = ((($74)) + 96|0); HEAP32[$75>>2] = $73; $76 = $dev; $77 = ((($76)) + 80|0); $78 = HEAP32[$77>>2]|0; $79 = (_glGetAttribLocation(($78|0),(29323|0))|0); $80 = $dev; $81 = ((($80)) + 100|0); HEAP32[$81>>2] = $79; $82 = $dev; $83 = ((($82)) + 116|0); HEAP32[$83>>2] = 20; $84 = $dev; $85 = ((($84)) + 120|0); HEAP32[$85>>2] = 0; $86 = $dev; $87 = ((($86)) + 124|0); HEAP32[$87>>2] = 8; $88 = $dev; $89 = ((($88)) + 128|0); HEAP32[$89>>2] = 16; $90 = $dev; $91 = ((($90)) + 72|0); _glGenBuffers(1,($91|0)); $92 = $dev; $93 = ((($92)) + 76|0); _glGenBuffers(1,($93|0)); _glBindTexture(3553,0); _glBindBuffer(34962,0); _glBindBuffer(34963,0); STACKTOP = sp;return; } else { ___assert_fail((29227|0),(29245|0),175,(29266|0)); // unreachable; } } function _nk_glfw3_device_destroy() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dev = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $dev = (64); $0 = $dev; $1 = ((($0)) + 80|0); $2 = HEAP32[$1>>2]|0; $3 = $dev; $4 = ((($3)) + 84|0); $5 = HEAP32[$4>>2]|0; _glDetachShader(($2|0),($5|0)); $6 = $dev; $7 = ((($6)) + 80|0); $8 = HEAP32[$7>>2]|0; $9 = $dev; $10 = ((($9)) + 88|0); $11 = HEAP32[$10>>2]|0; _glDetachShader(($8|0),($11|0)); $12 = $dev; $13 = ((($12)) + 84|0); $14 = HEAP32[$13>>2]|0; _glDeleteShader(($14|0)); $15 = $dev; $16 = ((($15)) + 88|0); $17 = HEAP32[$16>>2]|0; _glDeleteShader(($17|0)); $18 = $dev; $19 = ((($18)) + 80|0); $20 = HEAP32[$19>>2]|0; _glDeleteProgram(($20|0)); $21 = $dev; $22 = ((($21)) + 112|0); _glDeleteTextures(1,($22|0)); $23 = $dev; $24 = ((($23)) + 72|0); _glDeleteBuffers(1,($24|0)); $25 = $dev; $26 = ((($25)) + 76|0); _glDeleteBuffers(1,($26|0)); $27 = $dev; _nk_buffer_free($27); STACKTOP = sp;return; } function _nk_glfw3_render($AA,$max_vertex_buffer,$max_element_buffer) { $AA = $AA|0; $max_vertex_buffer = $max_vertex_buffer|0; $max_element_buffer = $max_element_buffer|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0; var $134 = 0.0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0, $150 = 0, $151 = 0.0; var $152 = 0.0, $153 = 0.0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0; var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0; var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0; var $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cmd = 0, $config = 0, $dev = 0, $ebuf = 0, $elements = 0, $offset = 0, $ortho = 0, $vbuf = 0, $vertices = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ortho = sp + 176|0; $config = sp + 120|0; $vbuf = sp + 60|0; $ebuf = sp; $0 = $AA; $1 = $max_vertex_buffer; $2 = $max_element_buffer; $dev = (64); dest=$ortho; stop=dest+64|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); HEAPF32[$ortho>>2] = 2.0; $3 = ((($ortho)) + 16|0); $4 = ((($3)) + 4|0); HEAPF32[$4>>2] = -2.0; $5 = ((($ortho)) + 32|0); $6 = ((($5)) + 8|0); HEAPF32[$6>>2] = -1.0; $7 = ((($ortho)) + 48|0); HEAPF32[$7>>2] = -1.0; $8 = ((($7)) + 4|0); HEAPF32[$8>>2] = 1.0; $9 = ((($7)) + 12|0); HEAPF32[$9>>2] = 1.0; $10 = HEAP32[(48)>>2]|0; $11 = (+($10|0)); $12 = +HEAPF32[$ortho>>2]; $13 = $12 / $11; HEAPF32[$ortho>>2] = $13; $14 = HEAP32[(52)>>2]|0; $15 = (+($14|0)); $16 = ((($ortho)) + 16|0); $17 = ((($16)) + 4|0); $18 = +HEAPF32[$17>>2]; $19 = $18 / $15; HEAPF32[$17>>2] = $19; _glEnable(3042); _glBlendEquation(32774); _glBlendFunc(770,771); _glDisable(2884); _glDisable(2929); _glEnable(3089); _glActiveTexture(33984); $20 = $dev; $21 = ((($20)) + 80|0); $22 = HEAP32[$21>>2]|0; _glUseProgram(($22|0)); $23 = $dev; $24 = ((($23)) + 104|0); $25 = HEAP32[$24>>2]|0; _glUniform1i(($25|0),0); $26 = $dev; $27 = ((($26)) + 108|0); $28 = HEAP32[$27>>2]|0; _glUniformMatrix4fv(($28|0),1,0,($ortho|0)); $29 = HEAP32[(56)>>2]|0; $30 = HEAP32[(60)>>2]|0; _glViewport(0,0,($29|0),($30|0)); $offset = 0; $31 = $dev; $32 = ((($31)) + 72|0); $33 = HEAP32[$32>>2]|0; _glBindBuffer(34962,($33|0)); $34 = $dev; $35 = ((($34)) + 76|0); $36 = HEAP32[$35>>2]|0; _glBindBuffer(34963,($36|0)); $37 = $dev; $38 = ((($37)) + 92|0); $39 = HEAP32[$38>>2]|0; _glEnableVertexAttribArray(($39|0)); $40 = $dev; $41 = ((($40)) + 96|0); $42 = HEAP32[$41>>2]|0; _glEnableVertexAttribArray(($42|0)); $43 = $dev; $44 = ((($43)) + 100|0); $45 = HEAP32[$44>>2]|0; _glEnableVertexAttribArray(($45|0)); $46 = $dev; $47 = ((($46)) + 92|0); $48 = HEAP32[$47>>2]|0; $49 = $dev; $50 = ((($49)) + 116|0); $51 = HEAP32[$50>>2]|0; $52 = $dev; $53 = ((($52)) + 120|0); $54 = HEAP32[$53>>2]|0; $55 = $54; _glVertexAttribPointer(($48|0),2,5126,0,($51|0),($55|0)); $56 = $dev; $57 = ((($56)) + 96|0); $58 = HEAP32[$57>>2]|0; $59 = $dev; $60 = ((($59)) + 116|0); $61 = HEAP32[$60>>2]|0; $62 = $dev; $63 = ((($62)) + 124|0); $64 = HEAP32[$63>>2]|0; $65 = $64; _glVertexAttribPointer(($58|0),2,5126,0,($61|0),($65|0)); $66 = $dev; $67 = ((($66)) + 100|0); $68 = HEAP32[$67>>2]|0; $69 = $dev; $70 = ((($69)) + 116|0); $71 = HEAP32[$70>>2]|0; $72 = $dev; $73 = ((($72)) + 128|0); $74 = HEAP32[$73>>2]|0; $75 = $74; _glVertexAttribPointer(($68|0),4,5121,1,($71|0),($75|0)); $76 = $dev; $77 = ((($76)) + 72|0); $78 = HEAP32[$77>>2]|0; _glBindBuffer(34962,($78|0)); $79 = $dev; $80 = ((($79)) + 76|0); $81 = HEAP32[$80>>2]|0; _glBindBuffer(34963,($81|0)); $82 = $1; _glBufferData(34962,($82|0),(0|0),35040); $83 = $2; _glBufferData(34963,($83|0),(0|0),35040); $84 = $1; $85 = (_malloc($84)|0); $vertices = $85; $86 = $2; $87 = (_malloc($86)|0); $elements = $87; dest=$config; stop=dest+36|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); HEAPF32[$config>>2] = 1.0; $88 = $0; $89 = ((($config)) + 8|0); HEAP32[$89>>2] = $88; $90 = $0; $91 = ((($config)) + 4|0); HEAP32[$91>>2] = $90; $92 = ((($config)) + 12|0); HEAP32[$92>>2] = 22; $93 = ((($config)) + 20|0); HEAP32[$93>>2] = 22; $94 = ((($config)) + 16|0); HEAP32[$94>>2] = 22; $95 = ((($config)) + 24|0); $96 = $dev; $97 = ((($96)) + 60|0); ;HEAP32[$95>>2]=HEAP32[$97>>2]|0;HEAP32[$95+4>>2]=HEAP32[$97+4>>2]|0;HEAP32[$95+8>>2]=HEAP32[$97+8>>2]|0; $98 = $vertices; $99 = $1; _nk_buffer_init_fixed($vbuf,$98,$99); $100 = $elements; $101 = $2; _nk_buffer_init_fixed($ebuf,$100,$101); $102 = $dev; _nk_convert((196),$102,$vbuf,$ebuf,$config); $103 = $1; $104 = $vertices; _glBufferSubData(34962,0,($103|0),($104|0)); $105 = $2; $106 = $elements; _glBufferSubData(34963,0,($105|0),($106|0)); $107 = $vertices; _free($107); $108 = $elements; _free($108); $109 = $dev; $110 = (_nk__draw_begin((196),$109)|0); $cmd = $110; while(1) { $111 = $cmd; $112 = ($111|0)!=(0|0); if (!($112)) { break; } $113 = $cmd; $114 = HEAP32[$113>>2]|0; $115 = ($114|0)!=(0); if ($115) { $116 = $cmd; $117 = ((($116)) + 20|0); $118 = HEAP32[$117>>2]|0; _glBindTexture(3553,($118|0)); $119 = $cmd; $120 = ((($119)) + 4|0); $121 = +HEAPF32[$120>>2]; $122 = +HEAPF32[(11452)>>2]; $123 = $121 * $122; $124 = (~~(($123))); $125 = HEAP32[(52)>>2]|0; $126 = $cmd; $127 = ((($126)) + 4|0); $128 = ((($127)) + 4|0); $129 = +HEAPF32[$128>>2]; $130 = $cmd; $131 = ((($130)) + 4|0); $132 = ((($131)) + 12|0); $133 = +HEAPF32[$132>>2]; $134 = $129 + $133; $135 = (~~(($134))); $136 = (($125) - ($135))|0; $137 = (+($136|0)); $138 = +HEAPF32[(11456)>>2]; $139 = $137 * $138; $140 = (~~(($139))); $141 = $cmd; $142 = ((($141)) + 4|0); $143 = ((($142)) + 8|0); $144 = +HEAPF32[$143>>2]; $145 = +HEAPF32[(11452)>>2]; $146 = $144 * $145; $147 = (~~(($146))); $148 = $cmd; $149 = ((($148)) + 4|0); $150 = ((($149)) + 12|0); $151 = +HEAPF32[$150>>2]; $152 = +HEAPF32[(11456)>>2]; $153 = $151 * $152; $154 = (~~(($153))); _glScissor(($124|0),($140|0),($147|0),($154|0)); $155 = $cmd; $156 = HEAP32[$155>>2]|0; $157 = $offset; _glDrawElements(4,($156|0),5123,($157|0)); $158 = $cmd; $159 = HEAP32[$158>>2]|0; $160 = $offset; $161 = (($160) + ($159<<1)|0); $offset = $161; } $162 = $cmd; $163 = $dev; $164 = (_nk__draw_next($162,$163,(196))|0); $cmd = $164; } _nk_clear((196)); _glUseProgram(0); _glBindBuffer(34962,0); _glBindBuffer(34963,0); _glDisable(3042); _glDisable(3089); STACKTOP = sp;return; } function _nk_glfw3_char_callback($win,$codepoint) { $win = $win|0; $codepoint = $codepoint|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $win; $1 = $codepoint; $2 = HEAP32[(12484)>>2]|0; $3 = ($2|0)<(256); if (!($3)) { STACKTOP = sp;return; } $4 = $1; $5 = HEAP32[(12484)>>2]|0; $6 = (($5) + 1)|0; HEAP32[(12484)>>2] = $6; $7 = ((11460) + ($5<<2)|0); HEAP32[$7>>2] = $4; STACKTOP = sp;return; } function _nk_gflw3_scroll_callback($win,$xoff,$yoff) { $win = $win|0; $xoff = +$xoff; $yoff = +$yoff; var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $win; $1 = $xoff; $2 = $yoff; $3 = $2; $4 = $3; $5 = +HEAPF32[(12488)>>2]; $6 = $5 + $4; HEAPF32[(12488)>>2] = $6; STACKTOP = sp;return; } function _nk_glfw3_init($win,$init_state) { $win = $win|0; $init_state = $init_state|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $2 = sp; $0 = $win; $1 = $init_state; $3 = $0; HEAP32[44>>2] = $3; $4 = $1; $5 = ($4|0)==(1); if ($5) { $6 = $0; (_glfwSetScrollCallback(($6|0),(13|0))|0); $7 = $0; (_glfwSetCharCallback(($7|0),(14|0))|0); } (_nk_init_default((196),0)|0); HEAP32[(5860)>>2] = 15; HEAP32[(5856)>>2] = 16; _nk_handle_ptr($2,0); ;HEAP32[(5852)>>2]=HEAP32[$2>>2]|0; _nk_glfw3_device_create(); STACKTOP = sp;return ((196)|0); } function _nk_glfw3_clipbard_copy($usr,$text,$len) { $usr = $usr|0; $text = $text|0; $len = $len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $str = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $text; $1 = $len; $str = 0; $2 = $1; $3 = ($2|0)!=(0); if (!($3)) { STACKTOP = sp;return; } $4 = $1; $5 = (($4) + 1)|0; $6 = (_malloc($5)|0); $str = $6; $7 = $str; $8 = ($7|0)!=(0|0); if (!($8)) { STACKTOP = sp;return; } $9 = $str; $10 = $0; $11 = $1; _memcpy(($9|0),($10|0),($11|0))|0; $12 = $1; $13 = $str; $14 = (($13) + ($12)|0); HEAP8[$14>>0] = 0; $15 = HEAP32[44>>2]|0; $16 = $str; _glfwSetClipboardString(($15|0),($16|0)); $17 = $str; _free($17); STACKTOP = sp;return; } function _nk_glfw3_clipbard_paste($usr,$edit) { $usr = $usr|0; $edit = $edit|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $edit; $1 = HEAP32[44>>2]|0; $2 = (_glfwGetClipboardString(($1|0))|0); $text = $2; $3 = $text; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = $text; $7 = $text; $8 = (_nk_strlen($7)|0); (_nk_textedit_paste($5,$6,$8)|0); STACKTOP = sp;return; } function _nk_glfw3_font_stash_begin($atlas) { $atlas = $atlas|0; var $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $atlas; _nk_font_atlas_init_default((11380)); _nk_font_atlas_begin((11380)); $1 = $0; HEAP32[$1>>2] = (11380); STACKTOP = sp;return; } function _nk_glfw3_font_stash_end() { var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $h = 0, $image = 0, $w = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 16|0; $w = sp + 8|0; $h = sp + 4|0; $0 = sp; $1 = (_nk_font_atlas_bake((11380),$w,$h,1)|0); $image = $1; $2 = $image; $3 = HEAP32[$w>>2]|0; $4 = HEAP32[$h>>2]|0; _nk_glfw3_device_upload_atlas($2,$3,$4); $5 = HEAP32[(176)>>2]|0; _nk_handle_id($0,$5); ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0; _nk_font_atlas_end((11380),$$byval_copy,(124)); $6 = HEAP32[(11428)>>2]|0; $7 = ($6|0)!=(0|0); if (!($7)) { STACKTOP = sp;return; } $8 = HEAP32[(11428)>>2]|0; _nk_style_set_font((196),$8); STACKTOP = sp;return; } function _nk_glfw3_device_upload_atlas($image,$width,$height) { $image = $image|0; $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dev = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $image; $1 = $width; $2 = $height; $dev = (64); $3 = $dev; $4 = ((($3)) + 112|0); _glGenTextures(1,($4|0)); $5 = $dev; $6 = ((($5)) + 112|0); $7 = HEAP32[$6>>2]|0; _glBindTexture(3553,($7|0)); _glTexParameteri(3553,10241,9729); _glTexParameteri(3553,10240,9729); $8 = $1; $9 = $2; $10 = $0; _glTexImage2D(3553,0,6408,($8|0),($9|0),0,6408,5121,($10|0)); STACKTOP = sp;return; } function _nk_glfw3_new_frame() { var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0; var $152 = 0.0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0; var $170 = 0.0, $171 = 0, $172 = 0, $173 = 0, $174 = 0.0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0.0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0.0; var $189 = 0, $19 = 0, $190 = 0.0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0.0, $198 = 0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0.0, $207 = 0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0.0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $ctx = 0, $i = 0, $win = 0, $x = 0; var $y = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $x = sp + 8|0; $y = sp; $ctx = (196); $0 = HEAP32[44>>2]|0; $win = $0; $1 = $win; _glfwGetWindowSize(($1|0),((48)|0),((52)|0)); $2 = $win; _glfwGetFramebufferSize(($2|0),((56)|0),((60)|0)); $3 = HEAP32[(56)>>2]|0; $4 = (+($3|0)); $5 = HEAP32[(48)>>2]|0; $6 = (+($5|0)); $7 = $4 / $6; HEAPF32[(11452)>>2] = $7; $8 = HEAP32[(60)>>2]|0; $9 = (+($8|0)); $10 = HEAP32[(52)>>2]|0; $11 = (+($10|0)); $12 = $9 / $11; HEAPF32[(11456)>>2] = $12; $13 = $ctx; _nk_input_begin($13); $i = 0; while(1) { $14 = $i; $15 = HEAP32[(12484)>>2]|0; $16 = ($14|0)<($15|0); $17 = $ctx; if (!($16)) { break; } $18 = $i; $19 = ((11460) + ($18<<2)|0); $20 = HEAP32[$19>>2]|0; _nk_input_unicode($17,$20); $21 = $i; $22 = (($21) + 1)|0; $i = $22; } $23 = ((($17)) + 220|0); $24 = ((($23)) + 76|0); $25 = HEAP8[$24>>0]|0; $26 = ($25<<24>>24)!=(0); if ($26) { $27 = HEAP32[44>>2]|0; _glfwSetInputMode(($27|0),208897,212994); } else { $28 = $ctx; $29 = ((($28)) + 220|0); $30 = ((($29)) + 78|0); $31 = HEAP8[$30>>0]|0; $32 = ($31<<24>>24)!=(0); if ($32) { $33 = HEAP32[44>>2]|0; _glfwSetInputMode(($33|0),208897,212993); } } $34 = $ctx; $35 = $win; $36 = (_glfwGetKey(($35|0),261)|0); $37 = ($36|0)==(1); $38 = $37&1; _nk_input_key($34,3,$38); $39 = $ctx; $40 = $win; $41 = (_glfwGetKey(($40|0),257)|0); $42 = ($41|0)==(1); $43 = $42&1; _nk_input_key($39,4,$43); $44 = $ctx; $45 = $win; $46 = (_glfwGetKey(($45|0),258)|0); $47 = ($46|0)==(1); $48 = $47&1; _nk_input_key($44,5,$48); $49 = $ctx; $50 = $win; $51 = (_glfwGetKey(($50|0),259)|0); $52 = ($51|0)==(1); $53 = $52&1; _nk_input_key($49,6,$53); $54 = $ctx; $55 = $win; $56 = (_glfwGetKey(($55|0),265)|0); $57 = ($56|0)==(1); $58 = $57&1; _nk_input_key($54,10,$58); $59 = $ctx; $60 = $win; $61 = (_glfwGetKey(($60|0),264)|0); $62 = ($61|0)==(1); $63 = $62&1; _nk_input_key($59,11,$63); $64 = $ctx; $65 = $win; $66 = (_glfwGetKey(($65|0),268)|0); $67 = ($66|0)==(1); $68 = $67&1; _nk_input_key($64,19,$68); $69 = $ctx; $70 = $win; $71 = (_glfwGetKey(($70|0),269)|0); $72 = ($71|0)==(1); $73 = $72&1; _nk_input_key($69,20,$73); $74 = $ctx; $75 = $win; $76 = (_glfwGetKey(($75|0),340)|0); $77 = ($76|0)==(1); if ($77) { $82 = 1; } else { $78 = $win; $79 = (_glfwGetKey(($78|0),344)|0); $80 = ($79|0)==(1); $82 = $80; } $81 = $82&1; _nk_input_key($74,1,$81); $83 = $win; $84 = (_glfwGetKey(($83|0),341)|0); $85 = ($84|0)==(1); if ($85) { label = 12; } else { $86 = $win; $87 = (_glfwGetKey(($86|0),345)|0); $88 = ($87|0)==(1); if ($88) { label = 12; } else { $134 = $ctx; $135 = $win; $136 = (_glfwGetKey(($135|0),263)|0); $137 = ($136|0)==(1); $138 = $137&1; _nk_input_key($134,12,$138); $139 = $ctx; $140 = $win; $141 = (_glfwGetKey(($140|0),262)|0); $142 = ($141|0)==(1); $143 = $142&1; _nk_input_key($139,13,$143); $144 = $ctx; _nk_input_key($144,7,0); $145 = $ctx; _nk_input_key($145,9,0); $146 = $ctx; _nk_input_key($146,8,0); $147 = $ctx; _nk_input_key($147,1,0); } } if ((label|0) == 12) { $89 = $ctx; $90 = $win; $91 = (_glfwGetKey(($90|0),67)|0); $92 = ($91|0)==(1); $93 = $92&1; _nk_input_key($89,7,$93); $94 = $ctx; $95 = $win; $96 = (_glfwGetKey(($95|0),80)|0); $97 = ($96|0)==(1); $98 = $97&1; _nk_input_key($94,9,$98); $99 = $ctx; $100 = $win; $101 = (_glfwGetKey(($100|0),88)|0); $102 = ($101|0)==(1); $103 = $102&1; _nk_input_key($99,8,$103); $104 = $ctx; $105 = $win; $106 = (_glfwGetKey(($105|0),90)|0); $107 = ($106|0)==(1); $108 = $107&1; _nk_input_key($104,21,$108); $109 = $ctx; $110 = $win; $111 = (_glfwGetKey(($110|0),82)|0); $112 = ($111|0)==(1); $113 = $112&1; _nk_input_key($109,22,$113); $114 = $ctx; $115 = $win; $116 = (_glfwGetKey(($115|0),263)|0); $117 = ($116|0)==(1); $118 = $117&1; _nk_input_key($114,23,$118); $119 = $ctx; $120 = $win; $121 = (_glfwGetKey(($120|0),262)|0); $122 = ($121|0)==(1); $123 = $122&1; _nk_input_key($119,24,$123); $124 = $ctx; $125 = $win; $126 = (_glfwGetKey(($125|0),66)|0); $127 = ($126|0)==(1); $128 = $127&1; _nk_input_key($124,17,$128); $129 = $ctx; $130 = $win; $131 = (_glfwGetKey(($130|0),69)|0); $132 = ($131|0)==(1); $133 = $132&1; _nk_input_key($129,18,$133); } $148 = $win; _glfwGetCursorPos(($148|0),($x|0),($y|0)); $149 = $ctx; $150 = +HEAPF64[$x>>3]; $151 = (~~(($150))); $152 = +HEAPF64[$y>>3]; $153 = (~~(($152))); _nk_input_motion($149,$151,$153); $154 = $ctx; $155 = ((($154)) + 220|0); $156 = ((($155)) + 77|0); $157 = HEAP8[$156>>0]|0; $158 = ($157<<24>>24)!=(0); if (!($158)) { $187 = $ctx; $188 = +HEAPF64[$x>>3]; $189 = (~~(($188))); $190 = +HEAPF64[$y>>3]; $191 = (~~(($190))); $192 = $win; $193 = (_glfwGetMouseButton(($192|0),0)|0); $194 = ($193|0)==(1); $195 = $194&1; _nk_input_button($187,0,$189,$191,$195); $196 = $ctx; $197 = +HEAPF64[$x>>3]; $198 = (~~(($197))); $199 = +HEAPF64[$y>>3]; $200 = (~~(($199))); $201 = $win; $202 = (_glfwGetMouseButton(($201|0),2)|0); $203 = ($202|0)==(1); $204 = $203&1; _nk_input_button($196,1,$198,$200,$204); $205 = $ctx; $206 = +HEAPF64[$x>>3]; $207 = (~~(($206))); $208 = +HEAPF64[$y>>3]; $209 = (~~(($208))); $210 = $win; $211 = (_glfwGetMouseButton(($210|0),1)|0); $212 = ($211|0)==(1); $213 = $212&1; _nk_input_button($205,2,$207,$209,$213); $214 = $ctx; $215 = +HEAPF32[(12488)>>2]; _nk_input_scroll($214,$215); _nk_input_end((196)); HEAP32[(12484)>>2] = 0; HEAPF32[(12488)>>2] = 0.0; STACKTOP = sp;return; } $159 = HEAP32[44>>2]|0; $160 = $ctx; $161 = ((($160)) + 220|0); $162 = ((($161)) + 56|0); $163 = +HEAPF32[$162>>2]; $164 = $163; $165 = $ctx; $166 = ((($165)) + 220|0); $167 = ((($166)) + 56|0); $168 = ((($167)) + 4|0); $169 = +HEAPF32[$168>>2]; $170 = $169; _glfwSetCursorPos(($159|0),(+$164),(+$170)); $171 = $ctx; $172 = ((($171)) + 220|0); $173 = ((($172)) + 56|0); $174 = +HEAPF32[$173>>2]; $175 = $ctx; $176 = ((($175)) + 220|0); $177 = ((($176)) + 48|0); HEAPF32[$177>>2] = $174; $178 = $ctx; $179 = ((($178)) + 220|0); $180 = ((($179)) + 56|0); $181 = ((($180)) + 4|0); $182 = +HEAPF32[$181>>2]; $183 = $ctx; $184 = ((($183)) + 220|0); $185 = ((($184)) + 48|0); $186 = ((($185)) + 4|0); HEAPF32[$186>>2] = $182; $187 = $ctx; $188 = +HEAPF64[$x>>3]; $189 = (~~(($188))); $190 = +HEAPF64[$y>>3]; $191 = (~~(($190))); $192 = $win; $193 = (_glfwGetMouseButton(($192|0),0)|0); $194 = ($193|0)==(1); $195 = $194&1; _nk_input_button($187,0,$189,$191,$195); $196 = $ctx; $197 = +HEAPF64[$x>>3]; $198 = (~~(($197))); $199 = +HEAPF64[$y>>3]; $200 = (~~(($199))); $201 = $win; $202 = (_glfwGetMouseButton(($201|0),2)|0); $203 = ($202|0)==(1); $204 = $203&1; _nk_input_button($196,1,$198,$200,$204); $205 = $ctx; $206 = +HEAPF64[$x>>3]; $207 = (~~(($206))); $208 = +HEAPF64[$y>>3]; $209 = (~~(($208))); $210 = $win; $211 = (_glfwGetMouseButton(($210|0),1)|0); $212 = ($211|0)==(1); $213 = $212&1; _nk_input_button($205,2,$207,$209,$213); $214 = $ctx; $215 = +HEAPF32[(12488)>>2]; _nk_input_scroll($214,$215); _nk_input_end((196)); HEAP32[(12484)>>2] = 0; HEAPF32[(12488)>>2] = 0.0; STACKTOP = sp;return; } function _nk_glfw3_shutdown() { var label = 0, sp = 0; sp = STACKTOP; _nk_font_atlas_clear((11380)); _nk_free((196)); _nk_glfw3_device_destroy(); _memset((44|0),0,12448)|0; return; } function _render() { var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0.0; var $62 = 0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0, $7 = 0, $8 = 0, $9 = 0, $background$byval_copy = 0, $background$byval_copy1 = 0, $background$byval_copy2 = 0, $bg = 0, $combo = 0, $layout = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 800|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $background$byval_copy2 = sp + 788|0; $background$byval_copy1 = sp + 784|0; $background$byval_copy = sp + 780|0; $$byval_copy = sp + 760|0; $vararg_buffer = sp; $layout = sp + 400|0; $0 = sp + 384|0; $combo = sp + 24|0; $1 = sp + 776|0; $bg = sp + 8|0; _glfwPollEvents(); _nk_glfw3_new_frame(); $2 = HEAP32[12508>>2]|0; _nk_rect($0,50.0,50.0,230.0,250.0); ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0; $3 = (_nk_begin($2,$layout,29329,$$byval_copy,301)|0); $4 = ($3|0)!=(0); if ($4) { $5 = HEAP32[12508>>2]|0; _nk_layout_row_static($5,30.0,80,1); $6 = HEAP32[12508>>2]|0; $7 = (_nk_button_label($6,29334,0)|0); $8 = ($7|0)!=(0); if ($8) { $9 = HEAP32[12664>>2]|0; (_fprintf($9,29341,$vararg_buffer)|0); } $10 = HEAP32[12508>>2]|0; _nk_layout_row_dynamic($10,30.0,2); $11 = HEAP32[12508>>2]|0; $12 = HEAP32[12512>>2]|0; $13 = ($12|0)==(0); $14 = $13&1; $15 = (_nk_option_label($11,29357,$14)|0); $16 = ($15|0)!=(0); if ($16) { HEAP32[12512>>2] = 0; } $17 = HEAP32[12508>>2]|0; $18 = HEAP32[12512>>2]|0; $19 = ($18|0)==(1); $20 = $19&1; $21 = (_nk_option_label($17,29362,$20)|0); $22 = ($21|0)!=(0); if ($22) { HEAP32[12512>>2] = 1; } $23 = HEAP32[12508>>2]|0; _nk_layout_row_dynamic($23,25.0,1); $24 = HEAP32[12508>>2]|0; _nk_property_int($24,29367,0,12516,100,10,1); $25 = HEAP32[12508>>2]|0; _nk_layout_row_dynamic($25,20.0,1); $26 = HEAP32[12508>>2]|0; _nk_label($26,29380,17); $27 = HEAP32[12508>>2]|0; _nk_layout_row_dynamic($27,25.0,1); $28 = HEAP32[12508>>2]|0; ;HEAP8[$background$byval_copy>>0]=HEAP8[29392>>0]|0;HEAP8[$background$byval_copy+1>>0]=HEAP8[29392+1>>0]|0;HEAP8[$background$byval_copy+2>>0]=HEAP8[29392+2>>0]|0;HEAP8[$background$byval_copy+3>>0]=HEAP8[29392+3>>0]|0; $29 = (_nk_combo_begin_color($28,$combo,$background$byval_copy,400)|0); $30 = ($29|0)!=(0); if ($30) { $31 = HEAP32[12508>>2]|0; _nk_layout_row_dynamic($31,120.0,1); $32 = HEAP32[12508>>2]|0; ;HEAP8[$background$byval_copy1>>0]=HEAP8[29392>>0]|0;HEAP8[$background$byval_copy1+1>>0]=HEAP8[29392+1>>0]|0;HEAP8[$background$byval_copy1+2>>0]=HEAP8[29392+2>>0]|0;HEAP8[$background$byval_copy1+3>>0]=HEAP8[29392+3>>0]|0; _nk_color_picker($1,$32,$background$byval_copy1,1); ;HEAP8[29392>>0]=HEAP8[$1>>0]|0;HEAP8[29392+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[29392+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[29392+3>>0]=HEAP8[$1+3>>0]|0; $33 = HEAP32[12508>>2]|0; _nk_layout_row_dynamic($33,25.0,1); $34 = HEAP32[12508>>2]|0; $35 = HEAP8[29392>>0]|0; $36 = $35&255; $37 = (_nk_propertyi($34,29396,0,$36,255,1,1)|0); $38 = $37&255; HEAP8[29392>>0] = $38; $39 = HEAP32[12508>>2]|0; $40 = HEAP8[(29393)>>0]|0; $41 = $40&255; $42 = (_nk_propertyi($39,29400,0,$41,255,1,1)|0); $43 = $42&255; HEAP8[(29393)>>0] = $43; $44 = HEAP32[12508>>2]|0; $45 = HEAP8[(29394)>>0]|0; $46 = $45&255; $47 = (_nk_propertyi($44,29404,0,$46,255,1,1)|0); $48 = $47&255; HEAP8[(29394)>>0] = $48; $49 = HEAP32[12508>>2]|0; $50 = HEAP8[(29395)>>0]|0; $51 = $50&255; $52 = (_nk_propertyi($49,29408,0,$51,255,1,1)|0); $53 = $52&255; HEAP8[(29395)>>0] = $53; $54 = HEAP32[12508>>2]|0; _nk_combo_end($54); } } $55 = HEAP32[12508>>2]|0; _nk_end($55); ;HEAP8[$background$byval_copy2>>0]=HEAP8[29392>>0]|0;HEAP8[$background$byval_copy2+1>>0]=HEAP8[29392+1>>0]|0;HEAP8[$background$byval_copy2+2>>0]=HEAP8[29392+2>>0]|0;HEAP8[$background$byval_copy2+3>>0]=HEAP8[29392+3>>0]|0; _nk_color_fv($bg,$background$byval_copy2); $56 = HEAP32[12520>>2]|0; _glfwGetWindowSize(($56|0),(12500|0),(12504|0)); $57 = HEAP32[12500>>2]|0; $58 = HEAP32[12504>>2]|0; _glViewport(0,0,($57|0),($58|0)); _glClear(16384); $59 = +HEAPF32[$bg>>2]; $60 = ((($bg)) + 4|0); $61 = +HEAPF32[$60>>2]; $62 = ((($bg)) + 8|0); $63 = +HEAPF32[$62>>2]; $64 = ((($bg)) + 12|0); $65 = +HEAPF32[$64>>2]; _glClearColor((+$59),(+$61),(+$63),(+$65)); _nk_glfw3_render(1,524288,131072); $66 = HEAP32[12520>>2]|0; _glfwSwapBuffers(($66|0)); STACKTOP = sp;return; } function _error_callback($error,$description) { $error = $error|0; $description = $description|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer = sp; $0 = $error; $1 = $description; $2 = HEAP32[12660>>2]|0; $3 = $0; $4 = $1; HEAP32[$vararg_buffer>>2] = $3; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $4; (_fprintf($2,29412,$vararg_buffer)|0); STACKTOP = sp;return; } function _windowSizeCallback($window,$width,$height) { $window = $window|0; $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $isInFullscreen = 0, $or$cond = 0, $or$cond3 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer4 = sp + 8|0; $vararg_buffer = sp; $0 = $window; $1 = $width; $2 = $height; $3 = _emscripten_asm_const_0(0)|0; $isInFullscreen = $3; $4 = $isInFullscreen; $5 = ($4|0)==(0); $6 = HEAP32[12496>>2]|0; $7 = ($6|0)!=(0); $or$cond = $5 | $7; if (!($or$cond)) { (_printf(29565,$vararg_buffer)|0); $8 = $isInFullscreen; HEAP32[12496>>2] = $8; } $9 = HEAP32[12496>>2]|0; $10 = ($9|0)==(0); $11 = $isInFullscreen; $12 = ($11|0)!=(0); $or$cond3 = $10 | $12; if ($or$cond3) { STACKTOP = sp;return; } (_printf(29612,$vararg_buffer4)|0); HEAP32[12492>>2] = 1; $13 = $isInFullscreen; HEAP32[12496>>2] = $13; _emscripten_cancel_main_loop(); STACKTOP = sp;return; } function _main() { var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $atlas = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer1 = sp + 8|0; $vararg_buffer = sp; $atlas = sp + 12|0; $1 = sp + 20|0; $0 = 0; (_glfwSetErrorCallback((17|0))|0); $2 = (_glfwInit()|0); $3 = ($2|0)!=(0); if (!($3)) { HEAP32[12492>>2] = 0; (_printf(29648,$vararg_buffer)|0); $0 = -1; $11 = $0; STACKTOP = sp;return ($11|0); } _glfwWindowHint(131075,1); $4 = (_glfwCreateWindow(1024,1024,(29687|0),(0|0),(0|0))|0); HEAP32[12520>>2] = $4; $5 = HEAP32[12520>>2]|0; $6 = ($5|0)!=(0|0); if ($6) { $7 = HEAP32[12520>>2]|0; _glfwMakeContextCurrent(($7|0)); $8 = HEAP32[12520>>2]|0; (_glfwSetWindowSizeCallback(($8|0),(18|0))|0); $9 = HEAP32[12520>>2]|0; $10 = (_nk_glfw3_init($9,1)|0); HEAP32[12508>>2] = $10; _nk_glfw3_font_stash_begin($atlas); _nk_glfw3_font_stash_end(); _nk_rgb($1,190,205,255); ;HEAP8[29392>>0]=HEAP8[$1>>0]|0;HEAP8[29392+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[29392+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[29392+3>>0]=HEAP8[$1+3>>0]|0; _emscripten_set_main_loop((19|0),0,1); _nk_glfw3_shutdown(); _glfwTerminate(); $0 = 0; $11 = $0; STACKTOP = sp;return ($11|0); } else { HEAP32[12492>>2] = 0; (_printf(29648,$vararg_buffer1)|0); _glfwTerminate(); $0 = -1; $11 = $0; STACKTOP = sp;return ($11|0); } return (0)|0; } function _nk_memset($ptr,$c0,$size) { $ptr = $ptr|0; $c0 = $c0|0; $size = $size|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0; var $8 = 0, $9 = 0, $c = 0, $dst = 0, $t = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ptr; $1 = $c0; $2 = $size; $3 = $0; $dst = $3; $c = 0; $t = 0; $4 = $1; $5 = $4&255; $6 = $5&255; $c = $6; $7 = ($6|0)!=(0); if ($7) { $8 = $c; $9 = $8 << 8; $10 = $c; $11 = $9 | $10; $c = $11; $12 = $c; $13 = $12 << 16; $14 = $c; $15 = $13 | $14; $c = $15; } $16 = $0; $dst = $16; $17 = $2; $18 = ($17>>>0)<(12); if ($18) { while(1) { $19 = $2; $20 = (($19) + -1)|0; $2 = $20; $21 = ($19|0)!=(0); if (!($21)) { break; } $22 = $1; $23 = $22&255; $24 = $dst; $25 = ((($24)) + 1|0); $dst = $25; HEAP8[$24>>0] = $23; } STACKTOP = sp;return; } $26 = $dst; $27 = $26; $28 = $27 & 3; $t = $28; $29 = ($28|0)!=(0); if ($29) { $30 = $t; $31 = (4 - ($30))|0; $t = $31; $32 = $t; $33 = $2; $34 = (($33) - ($32))|0; $2 = $34; while(1) { $35 = $1; $36 = $35&255; $37 = $dst; $38 = ((($37)) + 1|0); $dst = $38; HEAP8[$37>>0] = $36; $39 = $t; $40 = (($39) + -1)|0; $t = $40; $41 = ($40|0)!=(0); if (!($41)) { break; } } } $42 = $2; $43 = (($42>>>0) / 4)&-1; $t = $43; while(1) { $44 = $c; $45 = $dst; HEAP32[$45>>2] = $44; $46 = $dst; $47 = ((($46)) + 4|0); $dst = $47; $48 = $t; $49 = (($48) + -1)|0; $t = $49; $50 = ($49|0)!=(0); if (!($50)) { break; } } $51 = $2; $52 = $51 & 3; $t = $52; $53 = $t; $54 = ($53|0)!=(0); if (!($54)) { STACKTOP = sp;return; } while(1) { $55 = $1; $56 = $55&255; $57 = $dst; $58 = ((($57)) + 1|0); $dst = $58; HEAP8[$57>>0] = $56; $59 = $t; $60 = (($59) + -1)|0; $t = $60; $61 = ($60|0)!=(0); if (!($61)) { break; } } STACKTOP = sp;return; } function _nk_buffer_align($unaligned,$align,$alignment,$type) { $unaligned = $unaligned|0; $align = $align|0; $alignment = $alignment|0; $type = $type|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cond = 0, $memory = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $unaligned; $1 = $align; $2 = $alignment; $3 = $type; $memory = 0; $4 = $3; $cond = ($4|0)==(1); $5 = $1; $6 = ($5|0)!=(0); $7 = $0; if ($cond) { if ($6) { $24 = $7; $25 = $1; $26 = (($25) - 1)|0; $27 = $26 ^ -1; $28 = $24 & $27; $29 = $28; $memory = $29; $30 = $0; $31 = $memory; $32 = $30; $33 = $31; $34 = (($32) - ($33))|0; $35 = $2; HEAP32[$35>>2] = $34; $37 = $memory; STACKTOP = sp;return ($37|0); } else { $memory = $7; $36 = $2; HEAP32[$36>>2] = 0; $37 = $memory; STACKTOP = sp;return ($37|0); } } else { if ($6) { $8 = $1; $9 = (($8) - 1)|0; $10 = (($7) + ($9)|0); $11 = $10; $12 = $1; $13 = (($12) - 1)|0; $14 = $13 ^ -1; $15 = $11 & $14; $16 = $15; $memory = $16; $17 = $memory; $18 = $0; $19 = $17; $20 = $18; $21 = (($19) - ($20))|0; $22 = $2; HEAP32[$22>>2] = $21; $37 = $memory; STACKTOP = sp;return ($37|0); } else { $memory = $7; $23 = $2; HEAP32[$23>>2] = 0; $37 = $memory; STACKTOP = sp;return ($37|0); } } return (0)|0; } function _nk_buffer_realloc($b,$capacity,$size) { $b = $b|0; $capacity = $capacity|0; $size = $size|0; var $$byval_copy = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $back_size = 0, $buffer_size = 0; var $dst = 0, $or$cond = 0, $src = 0, $temp = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy2 = sp + 40|0; $$byval_copy = sp + 36|0; $1 = $b; $2 = $capacity; $3 = $size; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((13556|0),(13400|0),4305,(29847|0)); // unreachable; } $6 = $3; $7 = ($6|0)!=(0|0); if (!($7)) { ___assert_fail((13611|0),(13400|0),4306,(29847|0)); // unreachable; } $8 = $1; $9 = ($8|0)!=(0|0); $10 = $3; $11 = ($10|0)!=(0|0); $or$cond = $9 & $11; if ($or$cond) { $12 = $1; $13 = ((($12)) + 16|0); $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); if ($16) { $17 = $1; $18 = ((($17)) + 16|0); $19 = ((($18)) + 8|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); if ($21) { $22 = $1; $23 = ((($22)) + 32|0); $24 = ((($23)) + 4|0); $25 = HEAP32[$24>>2]|0; $buffer_size = $25; $26 = $1; $27 = ((($26)) + 16|0); $28 = ((($27)) + 4|0); $29 = HEAP32[$28>>2]|0; $30 = $1; $31 = ((($30)) + 16|0); $32 = $1; $33 = ((($32)) + 32|0); $34 = HEAP32[$33>>2]|0; $35 = $2; ;HEAP32[$$byval_copy>>2]=HEAP32[$31>>2]|0; $36 = (FUNCTION_TABLE_iiii[$29 & 7]($$byval_copy,$34,$35)|0); $temp = $36; $37 = $temp; $38 = ($37|0)!=(0|0); if (!($38)) { ___assert_fail((15034|0),(13400|0),4312,(29847|0)); // unreachable; } $39 = $temp; $40 = ($39|0)!=(0|0); if (!($40)) { $0 = 0; $95 = $0; STACKTOP = sp;return ($95|0); } $41 = $2; $42 = $3; HEAP32[$42>>2] = $41; $43 = $temp; $44 = $1; $45 = ((($44)) + 32|0); $46 = HEAP32[$45>>2]|0; $47 = ($43|0)!=($46|0); if ($47) { $48 = $temp; $49 = $1; $50 = ((($49)) + 32|0); $51 = HEAP32[$50>>2]|0; $52 = $buffer_size; (_nk_memcopy($48,$51,$52)|0); $53 = $1; $54 = ((($53)) + 16|0); $55 = ((($54)) + 8|0); $56 = HEAP32[$55>>2]|0; $57 = $1; $58 = ((($57)) + 16|0); $59 = $1; $60 = ((($59)) + 32|0); $61 = HEAP32[$60>>2]|0; ;HEAP32[$$byval_copy2>>2]=HEAP32[$58>>2]|0; FUNCTION_TABLE_vii[$56 & 31]($$byval_copy2,$61); } $62 = $1; $63 = ((($62)) + 56|0); $64 = HEAP32[$63>>2]|0; $65 = $buffer_size; $66 = ($64|0)==($65|0); if ($66) { $67 = $2; $68 = $1; $69 = ((($68)) + 56|0); HEAP32[$69>>2] = $67; $70 = $temp; $0 = $70; $95 = $0; STACKTOP = sp;return ($95|0); } else { $71 = $buffer_size; $72 = $1; $73 = ((($72)) + 56|0); $74 = HEAP32[$73>>2]|0; $75 = (($71) - ($74))|0; $back_size = $75; $76 = $temp; $77 = $2; $78 = $back_size; $79 = (($77) - ($78))|0; $80 = (($76) + ($79)|0); $dst = $80; $81 = $temp; $82 = $1; $83 = ((($82)) + 56|0); $84 = HEAP32[$83>>2]|0; $85 = (($81) + ($84)|0); $src = $85; $86 = $dst; $87 = $src; $88 = $back_size; (_nk_memcopy($86,$87,$88)|0); $89 = $2; $90 = $back_size; $91 = (($89) - ($90))|0; $92 = $1; $93 = ((($92)) + 56|0); HEAP32[$93>>2] = $91; $94 = $temp; $0 = $94; $95 = $0; STACKTOP = sp;return ($95|0); } } } } $0 = 0; $95 = $0; STACKTOP = sp;return ($95|0); } function _nk_draw_list_push_command($list,$clip,$texture) { $list = $list|0; $clip = $clip|0; $texture = $texture|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cmd = 0, $memory = 0, $total = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $list; $2 = $1; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14300|0),(13400|0),5574,(29974|0)); // unreachable; } $4 = $1; $5 = ((($4)) + 40|0); $6 = HEAP32[$5>>2]|0; $7 = (_nk_buffer_alloc($6,1,24,4)|0); $cmd = $7; $8 = $cmd; $9 = ($8|0)!=(0|0); if (!($9)) { $0 = 0; $44 = $0; STACKTOP = sp;return ($44|0); } $10 = $1; $11 = ((($10)) + 64|0); $12 = HEAP32[$11>>2]|0; $13 = ($12|0)!=(0); if (!($13)) { $14 = $1; $15 = ((($14)) + 40|0); $16 = HEAP32[$15>>2]|0; $17 = (_nk_buffer_memory($16)|0); $memory = $17; $18 = $1; $19 = ((($18)) + 40|0); $20 = HEAP32[$19>>2]|0; $21 = (_nk_buffer_total($20)|0); $total = $21; $22 = $memory; $23 = $total; $24 = (($22) + ($23)|0); $memory = $24; $25 = $memory; $26 = $cmd; $27 = $25; $28 = $26; $29 = (($27) - ($28))|0; $30 = $1; $31 = ((($30)) + 60|0); HEAP32[$31>>2] = $29; } $32 = $cmd; HEAP32[$32>>2] = 0; $33 = $cmd; $34 = ((($33)) + 4|0); ;HEAP32[$34>>2]=HEAP32[$clip>>2]|0;HEAP32[$34+4>>2]=HEAP32[$clip+4>>2]|0;HEAP32[$34+8>>2]=HEAP32[$clip+8>>2]|0;HEAP32[$34+12>>2]=HEAP32[$clip+12>>2]|0; $35 = $cmd; $36 = ((($35)) + 20|0); ;HEAP32[$36>>2]=HEAP32[$texture>>2]|0; $37 = $1; $38 = ((($37)) + 64|0); $39 = HEAP32[$38>>2]|0; $40 = (($39) + 1)|0; HEAP32[$38>>2] = $40; $41 = $1; $42 = ((($41)) + 24|0); ;HEAP32[$42>>2]=HEAP32[$clip>>2]|0;HEAP32[$42+4>>2]=HEAP32[$clip+4>>2]|0;HEAP32[$42+8>>2]=HEAP32[$clip+8>>2]|0;HEAP32[$42+12>>2]=HEAP32[$clip+12>>2]|0; $43 = $cmd; $0 = $43; $44 = $0; STACKTOP = sp;return ($44|0); } function _nk_tt__find_table($data,$fontstart,$tag) { $data = $data|0; $fontstart = $fontstart|0; $tag = $tag|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $loc = 0, $num_tables = 0, $tabledir = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $data; $2 = $fontstart; $3 = $tag; $4 = $1; $5 = $2; $6 = (($4) + ($5)|0); $7 = ((($6)) + 4|0); $8 = (_nk_ttUSHORT($7)|0); $9 = $8&65535; $num_tables = $9; $10 = $2; $11 = (($10) + 12)|0; $tabledir = $11; $i = 0; while(1) { $12 = $i; $13 = $num_tables; $14 = ($12|0)<($13|0); if (!($14)) { label = 9; break; } $15 = $tabledir; $16 = $i; $17 = $16<<4; $18 = (($15) + ($17))|0; $loc = $18; $19 = $1; $20 = $loc; $21 = (($19) + ($20)|0); $22 = HEAP8[$21>>0]|0; $23 = $22&255; $24 = $3; $25 = HEAP8[$24>>0]|0; $26 = $25 << 24 >> 24; $27 = ($23|0)==($26|0); if ($27) { $28 = $1; $29 = $loc; $30 = (($28) + ($29)|0); $31 = ((($30)) + 1|0); $32 = HEAP8[$31>>0]|0; $33 = $32&255; $34 = $3; $35 = ((($34)) + 1|0); $36 = HEAP8[$35>>0]|0; $37 = $36 << 24 >> 24; $38 = ($33|0)==($37|0); if ($38) { $39 = $1; $40 = $loc; $41 = (($39) + ($40)|0); $42 = ((($41)) + 2|0); $43 = HEAP8[$42>>0]|0; $44 = $43&255; $45 = $3; $46 = ((($45)) + 2|0); $47 = HEAP8[$46>>0]|0; $48 = $47 << 24 >> 24; $49 = ($44|0)==($48|0); if ($49) { $50 = $1; $51 = $loc; $52 = (($50) + ($51)|0); $53 = ((($52)) + 3|0); $54 = HEAP8[$53>>0]|0; $55 = $54&255; $56 = $3; $57 = ((($56)) + 3|0); $58 = HEAP8[$57>>0]|0; $59 = $58 << 24 >> 24; $60 = ($55|0)==($59|0); if ($60) { label = 7; break; } } } } $66 = $i; $67 = (($66) + 1)|0; $i = $67; } if ((label|0) == 7) { $61 = $1; $62 = $loc; $63 = (($61) + ($62)|0); $64 = ((($63)) + 8|0); $65 = (_nk_ttULONG($64)|0); $0 = $65; $68 = $0; STACKTOP = sp;return ($68|0); } else if ((label|0) == 9) { $0 = 0; $68 = $0; STACKTOP = sp;return ($68|0); } return (0)|0; } function _nk_ttUSHORT($p) { $p = $p|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $p; $1 = $0; $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = $3<<8; $5 = $0; $6 = ((($5)) + 1|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = (($4) + ($8))|0; $10 = $9&65535; STACKTOP = sp;return ($10|0); } function _nk_ttULONG($p) { $p = $p|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $p; $1 = $0; $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = $3 << 24; $5 = $0; $6 = ((($5)) + 1|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = $8 << 16; $10 = (($4) + ($9))|0; $11 = $0; $12 = ((($11)) + 2|0); $13 = HEAP8[$12>>0]|0; $14 = $13&255; $15 = $14 << 8; $16 = (($10) + ($15))|0; $17 = $0; $18 = ((($17)) + 3|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $21 = (($16) + ($20))|0; STACKTOP = sp;return ($21|0); } function _nk_rp_init_target($context,$width,$height,$nodes,$num_nodes) { $context = $context|0; $width = $width|0; $height = $height|0; $nodes = $nodes|0; $num_nodes = $num_nodes|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $8 = 0, $9 = 0, $i = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $context; $1 = $width; $2 = $height; $3 = $nodes; $4 = $num_nodes; $5 = $1; $6 = ($5|0)<=(65535); $7 = $2; $8 = ($7|0)<=(65535); $or$cond = $6 & $8; if (!($or$cond)) { ___assert_fail((30204|0),(13400|0),6676,(30240|0)); // unreachable; } $i = 0; while(1) { $9 = $i; $10 = $4; $11 = (($10) - 1)|0; $12 = ($9|0)<($11|0); $13 = $i; if (!($12)) { break; } $14 = (($13) + 1)|0; $15 = $3; $16 = (($15) + ($14<<3)|0); $17 = $i; $18 = $3; $19 = (($18) + ($17<<3)|0); $20 = ((($19)) + 4|0); HEAP32[$20>>2] = $16; $21 = $i; $22 = (($21) + 1)|0; $i = $22; } $23 = $3; $24 = (($23) + ($13<<3)|0); $25 = ((($24)) + 4|0); HEAP32[$25>>2] = 0; $26 = $0; $27 = ((($26)) + 12|0); HEAP32[$27>>2] = 1; $28 = $0; $29 = ((($28)) + 16|0); HEAP32[$29>>2] = 0; $30 = $3; $31 = $0; $32 = ((($31)) + 28|0); HEAP32[$32>>2] = $30; $33 = $0; $34 = ((($33)) + 32|0); $35 = $0; $36 = ((($35)) + 24|0); HEAP32[$36>>2] = $34; $37 = $1; $38 = $0; HEAP32[$38>>2] = $37; $39 = $2; $40 = $0; $41 = ((($40)) + 4|0); HEAP32[$41>>2] = $39; $42 = $4; $43 = $0; $44 = ((($43)) + 20|0); HEAP32[$44>>2] = $42; $45 = $0; _nk_rp_setup_allow_out_of_mem($45,0); $46 = $0; $47 = ((($46)) + 32|0); HEAP16[$47>>1] = 0; $48 = $0; $49 = ((($48)) + 32|0); $50 = ((($49)) + 2|0); HEAP16[$50>>1] = 0; $51 = $0; $52 = ((($51)) + 32|0); $53 = ((($52)) + 8|0); $54 = $0; $55 = ((($54)) + 32|0); $56 = ((($55)) + 4|0); HEAP32[$56>>2] = $53; $57 = $1; $58 = $57&65535; $59 = $0; $60 = ((($59)) + 32|0); $61 = ((($60)) + 8|0); HEAP16[$61>>1] = $58; $62 = $0; $63 = ((($62)) + 32|0); $64 = ((($63)) + 8|0); $65 = ((($64)) + 2|0); HEAP16[$65>>1] = -1; $66 = $0; $67 = ((($66)) + 32|0); $68 = ((($67)) + 8|0); $69 = ((($68)) + 4|0); HEAP32[$69>>2] = 0; STACKTOP = sp;return; } function _nk_rp_setup_allow_out_of_mem($context,$allow_out_of_mem) { $context = $context|0; $allow_out_of_mem = $allow_out_of_mem|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $context; $1 = $allow_out_of_mem; $2 = $1; $3 = ($2|0)!=(0); $4 = $0; if ($3) { $5 = ((($4)) + 8|0); HEAP32[$5>>2] = 1; STACKTOP = sp;return; } else { $6 = HEAP32[$4>>2]|0; $7 = $0; $8 = ((($7)) + 20|0); $9 = HEAP32[$8>>2]|0; $10 = (($6) + ($9))|0; $11 = (($10) - 1)|0; $12 = $0; $13 = ((($12)) + 20|0); $14 = HEAP32[$13>>2]|0; $15 = (($11|0) / ($14|0))&-1; $16 = $0; $17 = ((($16)) + 8|0); HEAP32[$17>>2] = $15; STACKTOP = sp;return; } } function _nk_rp_qsort($array,$len,$cmp) { $array = $array|0; $len = $len|0; $cmp = $cmp|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $7 = 0, $8 = 0, $9 = 0, $left = 0, $pivot = 0, $pos = 0, $right = 0, $seed = 0, $stack = 0, $tmp = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 320|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $stack = sp + 40|0; $pivot = sp + 16|0; $tmp = sp; $0 = $array; $1 = $len; $2 = $cmp; $left = 0; $pos = 0; $3 = $1; $4 = (($3>>>0) / 2)&-1; $5 = ($4*69069)|0; $6 = (($5) + 1)|0; $seed = $6; while(1) { $7 = $left; $8 = (($7) + 1)|0; $9 = $1; $10 = ($8>>>0)<($9>>>0); $11 = $pos; if (!($10)) { $63 = ($11|0)==(0); if ($63) { break; } $64 = $1; $left = $64; $65 = $pos; $66 = (($65) + -1)|0; $pos = $66; $67 = (($stack) + ($66<<2)|0); $68 = HEAP32[$67>>2]|0; $1 = $68; continue; } $12 = ($11|0)==(64); if ($12) { $pos = 0; $13 = HEAP32[$stack>>2]|0; $1 = $13; } $14 = $left; $15 = $seed; $16 = $1; $17 = $left; $18 = (($16) - ($17))|0; $19 = (($15>>>0) % ($18>>>0))&-1; $20 = (($14) + ($19))|0; $21 = $0; $22 = (($21) + ($20<<4)|0); ;HEAP32[$pivot>>2]=HEAP32[$22>>2]|0;HEAP32[$pivot+4>>2]=HEAP32[$22+4>>2]|0;HEAP32[$pivot+8>>2]=HEAP32[$22+8>>2]|0;HEAP32[$pivot+12>>2]=HEAP32[$22+12>>2]|0; $23 = $seed; $24 = ($23*69069)|0; $25 = (($24) + 1)|0; $seed = $25; $26 = $1; $27 = $pos; $28 = (($27) + 1)|0; $pos = $28; $29 = (($stack) + ($27<<2)|0); HEAP32[$29>>2] = $26; $30 = $left; $31 = (($30) - 1)|0; $right = $31; while(1) { $32 = $2; $33 = $right; $34 = (($33) + 1)|0; $right = $34; $35 = $0; $36 = (($35) + ($34<<4)|0); $37 = (FUNCTION_TABLE_iii[$32 & 15]($36,$pivot)|0); $38 = ($37|0)<(0); if ($38) { continue; } while(1) { $39 = $2; $40 = $1; $41 = (($40) + -1)|0; $1 = $41; $42 = $0; $43 = (($42) + ($41<<4)|0); $44 = (FUNCTION_TABLE_iii[$39 & 15]($pivot,$43)|0); $45 = ($44|0)<(0); if (!($45)) { break; } } $46 = $right; $47 = $1; $48 = ($46>>>0)>=($47>>>0); if ($48) { break; } $49 = $right; $50 = $0; $51 = (($50) + ($49<<4)|0); ;HEAP32[$tmp>>2]=HEAP32[$51>>2]|0;HEAP32[$tmp+4>>2]=HEAP32[$51+4>>2]|0;HEAP32[$tmp+8>>2]=HEAP32[$51+8>>2]|0;HEAP32[$tmp+12>>2]=HEAP32[$51+12>>2]|0; $52 = $right; $53 = $0; $54 = (($53) + ($52<<4)|0); $55 = $1; $56 = $0; $57 = (($56) + ($55<<4)|0); ;HEAP32[$54>>2]=HEAP32[$57>>2]|0;HEAP32[$54+4>>2]=HEAP32[$57+4>>2]|0;HEAP32[$54+8>>2]=HEAP32[$57+8>>2]|0;HEAP32[$54+12>>2]=HEAP32[$57+12>>2]|0; $58 = $1; $59 = $0; $60 = (($59) + ($58<<4)|0); ;HEAP32[$60>>2]=HEAP32[$tmp>>2]|0;HEAP32[$60+4>>2]=HEAP32[$tmp+4>>2]|0;HEAP32[$60+8>>2]=HEAP32[$tmp+8>>2]|0;HEAP32[$60+12>>2]=HEAP32[$tmp+12>>2]|0; } $61 = $1; $62 = (($61) + 1)|0; $1 = $62; } STACKTOP = sp;return; } function _nk_rect_height_compare($a,$b) { $a = $a|0; $b = $b|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $p = 0, $q = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $a; $2 = $b; $3 = $1; $p = $3; $4 = $2; $q = $4; $5 = $p; $6 = ((($5)) + 6|0); $7 = HEAP16[$6>>1]|0; $8 = $7&65535; $9 = $q; $10 = ((($9)) + 6|0); $11 = HEAP16[$10>>1]|0; $12 = $11&65535; $13 = ($8|0)>($12|0); if ($13) { $0 = -1; $43 = $0; STACKTOP = sp;return ($43|0); } $14 = $p; $15 = ((($14)) + 6|0); $16 = HEAP16[$15>>1]|0; $17 = $16&65535; $18 = $q; $19 = ((($18)) + 6|0); $20 = HEAP16[$19>>1]|0; $21 = $20&65535; $22 = ($17|0)<($21|0); if ($22) { $0 = 1; $43 = $0; STACKTOP = sp;return ($43|0); } $23 = $p; $24 = ((($23)) + 4|0); $25 = HEAP16[$24>>1]|0; $26 = $25&65535; $27 = $q; $28 = ((($27)) + 4|0); $29 = HEAP16[$28>>1]|0; $30 = $29&65535; $31 = ($26|0)>($30|0); if ($31) { $42 = -1; } else { $32 = $p; $33 = ((($32)) + 4|0); $34 = HEAP16[$33>>1]|0; $35 = $34&65535; $36 = $q; $37 = ((($36)) + 4|0); $38 = HEAP16[$37>>1]|0; $39 = $38&65535; $40 = ($35|0)<($39|0); $41 = $40&1; $42 = $41; } $0 = $42; $43 = $0; STACKTOP = sp;return ($43|0); } function _nk_rp__skyline_pack_rectangle($agg$result,$context,$width,$height) { $agg$result = $agg$result|0; $context = $context|0; $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $cur = 0, $next = 0; var $next1 = 0, $node = 0, $res = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $res = sp + 16|0; $0 = $context; $1 = $width; $2 = $height; $3 = $0; $4 = $1; $5 = $2; _nk_rp__skyline_find_best_pos($res,$3,$4,$5); $6 = ((($res)) + 8|0); $7 = HEAP32[$6>>2]|0; $8 = ($7|0)==(0|0); if (!($8)) { $9 = ((($res)) + 4|0); $10 = HEAP32[$9>>2]|0; $11 = $2; $12 = (($10) + ($11))|0; $13 = $0; $14 = ((($13)) + 4|0); $15 = HEAP32[$14>>2]|0; $16 = ($12|0)>($15|0); if (!($16)) { $17 = $0; $18 = ((($17)) + 28|0); $19 = HEAP32[$18>>2]|0; $20 = ($19|0)==(0|0); if (!($20)) { $22 = $0; $23 = ((($22)) + 28|0); $24 = HEAP32[$23>>2]|0; $node = $24; $25 = HEAP32[$res>>2]|0; $26 = $25&65535; $27 = $node; HEAP16[$27>>1] = $26; $28 = ((($res)) + 4|0); $29 = HEAP32[$28>>2]|0; $30 = $2; $31 = (($29) + ($30))|0; $32 = $31&65535; $33 = $node; $34 = ((($33)) + 2|0); HEAP16[$34>>1] = $32; $35 = $node; $36 = ((($35)) + 4|0); $37 = HEAP32[$36>>2]|0; $38 = $0; $39 = ((($38)) + 28|0); HEAP32[$39>>2] = $37; $40 = ((($res)) + 8|0); $41 = HEAP32[$40>>2]|0; $42 = HEAP32[$41>>2]|0; $cur = $42; $43 = $cur; $44 = HEAP16[$43>>1]|0; $45 = $44&65535; $46 = HEAP32[$res>>2]|0; $47 = ($45|0)<($46|0); if ($47) { $48 = $cur; $49 = ((($48)) + 4|0); $50 = HEAP32[$49>>2]|0; $next = $50; $51 = $node; $52 = $cur; $53 = ((($52)) + 4|0); HEAP32[$53>>2] = $51; $54 = $next; $cur = $54; } else { $55 = $node; $56 = ((($res)) + 8|0); $57 = HEAP32[$56>>2]|0; HEAP32[$57>>2] = $55; } while(1) { $58 = $cur; $59 = ((($58)) + 4|0); $60 = HEAP32[$59>>2]|0; $61 = ($60|0)!=(0|0); if ($61) { $62 = $cur; $63 = ((($62)) + 4|0); $64 = HEAP32[$63>>2]|0; $65 = HEAP16[$64>>1]|0; $66 = $65&65535; $67 = HEAP32[$res>>2]|0; $68 = $1; $69 = (($67) + ($68))|0; $70 = ($66|0)<=($69|0); $97 = $70; } else { $97 = 0; } $71 = $cur; if (!($97)) { break; } $72 = ((($71)) + 4|0); $73 = HEAP32[$72>>2]|0; $next1 = $73; $74 = $0; $75 = ((($74)) + 28|0); $76 = HEAP32[$75>>2]|0; $77 = $cur; $78 = ((($77)) + 4|0); HEAP32[$78>>2] = $76; $79 = $cur; $80 = $0; $81 = ((($80)) + 28|0); HEAP32[$81>>2] = $79; $82 = $next1; $cur = $82; } $83 = $node; $84 = ((($83)) + 4|0); HEAP32[$84>>2] = $71; $85 = $cur; $86 = HEAP16[$85>>1]|0; $87 = $86&65535; $88 = HEAP32[$res>>2]|0; $89 = $1; $90 = (($88) + ($89))|0; $91 = ($87|0)<($90|0); if ($91) { $92 = HEAP32[$res>>2]|0; $93 = $1; $94 = (($92) + ($93))|0; $95 = $94&65535; $96 = $cur; HEAP16[$96>>1] = $95; } ;HEAP32[$agg$result>>2]=HEAP32[$res>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$res+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$res+8>>2]|0; STACKTOP = sp;return; } } } $21 = ((($res)) + 8|0); HEAP32[$21>>2] = 0; ;HEAP32[$agg$result>>2]=HEAP32[$res>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$res+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$res+8>>2]|0; STACKTOP = sp;return; } function _nk_rect_original_order($a,$b) { $a = $a|0; $b = $b|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $p = 0, $q = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $a; $1 = $b; $2 = $0; $p = $2; $3 = $1; $q = $3; $4 = $p; $5 = ((($4)) + 12|0); $6 = HEAP32[$5>>2]|0; $7 = $q; $8 = ((($7)) + 12|0); $9 = HEAP32[$8>>2]|0; $10 = ($6|0)<($9|0); if ($10) { $19 = -1; STACKTOP = sp;return ($19|0); } $11 = $p; $12 = ((($11)) + 12|0); $13 = HEAP32[$12>>2]|0; $14 = $q; $15 = ((($14)) + 12|0); $16 = HEAP32[$15>>2]|0; $17 = ($13|0)>($16|0); $18 = $17&1; $19 = $18; STACKTOP = sp;return ($19|0); } function _nk_rp__skyline_find_best_pos($agg$result,$c,$width,$height) { $agg$result = $agg$result|0; $c = $c|0; $width = $width|0; $height = $height|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0; var $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0; var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0; var $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0; var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $best = 0, $best_waste = 0, $best_x = 0, $best_y = 0, $fr = 0, $node = 0; var $prev = 0, $tail = 0, $waste = 0, $waste2 = 0, $xpos = 0, $y = 0, $y1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $fr = sp + 36|0; $waste = sp + 12|0; $waste2 = sp; $0 = $c; $1 = $width; $2 = $height; $best_waste = 1073741824; $best_y = 1073741824; $best = 0; $3 = $1; $4 = $0; $5 = ((($4)) + 8|0); $6 = HEAP32[$5>>2]|0; $7 = (($3) + ($6))|0; $8 = (($7) - 1)|0; $1 = $8; $9 = $1; $10 = $0; $11 = ((($10)) + 8|0); $12 = HEAP32[$11>>2]|0; $13 = (($9|0) % ($12|0))&-1; $14 = $1; $15 = (($14) - ($13))|0; $1 = $15; $16 = $1; $17 = $0; $18 = ((($17)) + 8|0); $19 = HEAP32[$18>>2]|0; $20 = (($16|0) % ($19|0))&-1; $21 = ($20|0)==(0); if (!($21)) { ___assert_fail((30320|0),(13400|0),6755,(30342|0)); // unreachable; } $22 = $0; $23 = ((($22)) + 24|0); $24 = HEAP32[$23>>2]|0; $node = $24; $25 = $0; $26 = ((($25)) + 24|0); $prev = $26; while(1) { $27 = $node; $28 = HEAP16[$27>>1]|0; $29 = $28&65535; $30 = $1; $31 = (($29) + ($30))|0; $32 = $0; $33 = HEAP32[$32>>2]|0; $34 = ($31|0)<=($33|0); if (!($34)) { break; } $35 = $0; $36 = $node; $37 = $node; $38 = HEAP16[$37>>1]|0; $39 = $38&65535; $40 = $1; $41 = (_nk_rp__skyline_find_min_y($35,$36,$39,$40,$waste)|0); $y = $41; $42 = $0; $43 = ((($42)) + 16|0); $44 = HEAP32[$43>>2]|0; $45 = ($44|0)==(0); $46 = $y; do { if ($45) { $47 = $best_y; $48 = ($46|0)<($47|0); if ($48) { $49 = $y; $best_y = $49; $50 = $prev; $best = $50; } } else { $51 = $2; $52 = (($46) + ($51))|0; $53 = $0; $54 = ((($53)) + 4|0); $55 = HEAP32[$54>>2]|0; $56 = ($52|0)<=($55|0); if ($56) { $57 = $y; $58 = $best_y; $59 = ($57|0)<($58|0); if (!($59)) { $60 = $y; $61 = $best_y; $62 = ($60|0)==($61|0); if (!($62)) { break; } $63 = HEAP32[$waste>>2]|0; $64 = $best_waste; $65 = ($63|0)<($64|0); if (!($65)) { break; } } $66 = $y; $best_y = $66; $67 = HEAP32[$waste>>2]|0; $best_waste = $67; $68 = $prev; $best = $68; } } } while(0); $69 = $node; $70 = ((($69)) + 4|0); $prev = $70; $71 = $node; $72 = ((($71)) + 4|0); $73 = HEAP32[$72>>2]|0; $node = $73; } $74 = $best; $75 = ($74|0)==(0|0); if ($75) { $80 = 0; } else { $76 = $best; $77 = HEAP32[$76>>2]|0; $78 = HEAP16[$77>>1]|0; $79 = $78&65535; $80 = $79; } $best_x = $80; $81 = $0; $82 = ((($81)) + 16|0); $83 = HEAP32[$82>>2]|0; $84 = ($83|0)==(1); if (!($84)) { $169 = $best; $170 = ((($fr)) + 8|0); HEAP32[$170>>2] = $169; $171 = $best_x; HEAP32[$fr>>2] = $171; $172 = $best_y; $173 = ((($fr)) + 4|0); HEAP32[$173>>2] = $172; ;HEAP32[$agg$result>>2]=HEAP32[$fr>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$fr+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$fr+8>>2]|0; STACKTOP = sp;return; } $85 = $0; $86 = ((($85)) + 24|0); $87 = HEAP32[$86>>2]|0; $tail = $87; $88 = $0; $89 = ((($88)) + 24|0); $90 = HEAP32[$89>>2]|0; $node = $90; $91 = $0; $92 = ((($91)) + 24|0); $prev = $92; while(1) { $93 = $tail; $94 = HEAP16[$93>>1]|0; $95 = $94&65535; $96 = $1; $97 = ($95|0)<($96|0); if (!($97)) { break; } $98 = $tail; $99 = ((($98)) + 4|0); $100 = HEAP32[$99>>2]|0; $tail = $100; } L27: while(1) { $101 = $tail; $102 = ($101|0)!=(0|0); if (!($102)) { label = 39; break; } $103 = $tail; $104 = HEAP16[$103>>1]|0; $105 = $104&65535; $106 = $1; $107 = (($105) - ($106))|0; $xpos = $107; $108 = $xpos; $109 = ($108|0)>=(0); if (!($109)) { label = 22; break; } while(1) { $110 = $node; $111 = ((($110)) + 4|0); $112 = HEAP32[$111>>2]|0; $113 = HEAP16[$112>>1]|0; $114 = $113&65535; $115 = $xpos; $116 = ($114|0)<=($115|0); $117 = $node; $118 = ((($117)) + 4|0); if (!($116)) { break; } $prev = $118; $119 = $node; $120 = ((($119)) + 4|0); $121 = HEAP32[$120>>2]|0; $node = $121; } $122 = HEAP32[$118>>2]|0; $123 = HEAP16[$122>>1]|0; $124 = $123&65535; $125 = $xpos; $126 = ($124|0)>($125|0); if (!($126)) { label = 28; break; } $127 = $node; $128 = HEAP16[$127>>1]|0; $129 = $128&65535; $130 = $xpos; $131 = ($129|0)<=($130|0); if (!($131)) { label = 28; break; } $132 = $0; $133 = $node; $134 = $xpos; $135 = $1; $136 = (_nk_rp__skyline_find_min_y($132,$133,$134,$135,$waste2)|0); $y1 = $136; $137 = $y1; $138 = $2; $139 = (($137) + ($138))|0; $140 = $0; $141 = ((($140)) + 4|0); $142 = HEAP32[$141>>2]|0; $143 = ($139|0)<($142|0); do { if ($143) { $144 = $y1; $145 = $best_y; $146 = ($144|0)<=($145|0); if ($146) { $147 = $y1; $148 = $best_y; $149 = ($147|0)<($148|0); if (!($149)) { $150 = HEAP32[$waste2>>2]|0; $151 = $best_waste; $152 = ($150|0)<($151|0); if (!($152)) { $153 = HEAP32[$waste2>>2]|0; $154 = $best_waste; $155 = ($153|0)==($154|0); if (!($155)) { break; } $156 = $xpos; $157 = $best_x; $158 = ($156|0)<($157|0); if (!($158)) { break; } } } $159 = $xpos; $best_x = $159; $160 = $y1; $161 = $best_y; $162 = ($160|0)<=($161|0); if (!($162)) { label = 36; break L27; } $163 = $y1; $best_y = $163; $164 = HEAP32[$waste2>>2]|0; $best_waste = $164; $165 = $prev; $best = $165; } } } while(0); $166 = $tail; $167 = ((($166)) + 4|0); $168 = HEAP32[$167>>2]|0; $tail = $168; } if ((label|0) == 22) { ___assert_fail((30371|0),(13400|0),6813,(30342|0)); // unreachable; } else if ((label|0) == 28) { ___assert_fail((30381|0),(13400|0),6819,(30342|0)); // unreachable; } else if ((label|0) == 36) { ___assert_fail((30421|0),(13400|0),6825,(30342|0)); // unreachable; } else if ((label|0) == 39) { $169 = $best; $170 = ((($fr)) + 8|0); HEAP32[$170>>2] = $169; $171 = $best_x; HEAP32[$fr>>2] = $171; $172 = $best_y; $173 = ((($fr)) + 4|0); HEAP32[$173>>2] = $172; ;HEAP32[$agg$result>>2]=HEAP32[$fr>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$fr+4>>2]|0;HEAP32[$agg$result+8>>2]=HEAP32[$fr+8>>2]|0; STACKTOP = sp;return; } } function _nk_rp__skyline_find_min_y($c,$first,$x0,$width,$pwaste) { $c = $c|0; $first = $first|0; $x0 = $x0|0; $width = $width|0; $pwaste = $pwaste|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0; var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0; var $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0; var $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $min_y = 0, $node = 0, $under_width = 0, $visited_width = 0, $waste_area = 0, $x1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $c; $1 = $first; $2 = $x0; $3 = $width; $4 = $pwaste; $5 = $1; $node = $5; $6 = $2; $7 = $3; $8 = (($6) + ($7))|0; $x1 = $8; $9 = $1; $10 = HEAP16[$9>>1]|0; $11 = $10&65535; $12 = $2; $13 = ($11|0)<=($12|0); if (!($13)) { ___assert_fail((30433|0),(13400|0),6708,(30448|0)); // unreachable; } $14 = $node; $15 = ((($14)) + 4|0); $16 = HEAP32[$15>>2]|0; $17 = HEAP16[$16>>1]|0; $18 = $17&65535; $19 = $2; $20 = ($18|0)>($19|0); if (!($20)) { ___assert_fail((30474|0),(13400|0),6711,(30448|0)); // unreachable; } $21 = $node; $22 = HEAP16[$21>>1]|0; $23 = $22&65535; $24 = $2; $25 = ($23|0)<=($24|0); if (!($25)) { ___assert_fail((30493|0),(13400|0),6713,(30448|0)); // unreachable; } $min_y = 0; $waste_area = 0; $visited_width = 0; while(1) { $26 = $node; $27 = HEAP16[$26>>1]|0; $28 = $27&65535; $29 = $x1; $30 = ($28|0)<($29|0); if (!($30)) { break; } $31 = $node; $32 = ((($31)) + 2|0); $33 = HEAP16[$32>>1]|0; $34 = $33&65535; $35 = $min_y; $36 = ($34|0)>($35|0); do { if ($36) { $37 = $visited_width; $38 = $node; $39 = ((($38)) + 2|0); $40 = HEAP16[$39>>1]|0; $41 = $40&65535; $42 = $min_y; $43 = (($41) - ($42))|0; $44 = Math_imul($37, $43)|0; $45 = $waste_area; $46 = (($45) + ($44))|0; $waste_area = $46; $47 = $node; $48 = ((($47)) + 2|0); $49 = HEAP16[$48>>1]|0; $50 = $49&65535; $min_y = $50; $51 = $node; $52 = HEAP16[$51>>1]|0; $53 = $52&65535; $54 = $2; $55 = ($53|0)<($54|0); $56 = $node; $57 = ((($56)) + 4|0); $58 = HEAP32[$57>>2]|0; $59 = HEAP16[$58>>1]|0; $60 = $59&65535; if ($55) { $61 = $2; $62 = (($60) - ($61))|0; $63 = $visited_width; $64 = (($63) + ($62))|0; $visited_width = $64; break; } else { $65 = $node; $66 = HEAP16[$65>>1]|0; $67 = $66&65535; $68 = (($60) - ($67))|0; $69 = $visited_width; $70 = (($69) + ($68))|0; $visited_width = $70; break; } } else { $71 = $node; $72 = ((($71)) + 4|0); $73 = HEAP32[$72>>2]|0; $74 = HEAP16[$73>>1]|0; $75 = $74&65535; $76 = $node; $77 = HEAP16[$76>>1]|0; $78 = $77&65535; $79 = (($75) - ($78))|0; $under_width = $79; $80 = $under_width; $81 = $visited_width; $82 = (($80) + ($81))|0; $83 = $3; $84 = ($82|0)>($83|0); if ($84) { $85 = $3; $86 = $visited_width; $87 = (($85) - ($86))|0; $under_width = $87; } $88 = $under_width; $89 = $min_y; $90 = $node; $91 = ((($90)) + 2|0); $92 = HEAP16[$91>>1]|0; $93 = $92&65535; $94 = (($89) - ($93))|0; $95 = Math_imul($88, $94)|0; $96 = $waste_area; $97 = (($96) + ($95))|0; $waste_area = $97; $98 = $under_width; $99 = $visited_width; $100 = (($99) + ($98))|0; $visited_width = $100; } } while(0); $101 = $node; $102 = ((($101)) + 4|0); $103 = HEAP32[$102>>2]|0; $node = $103; } $104 = $waste_area; $105 = $4; HEAP32[$105>>2] = $104; $106 = $min_y; STACKTOP = sp;return ($106|0); } function _nk_tt_ScaleForMappingEmToPixels($info,$pixels) { $info = $info|0; $pixels = +$pixels; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $unitsPerEm = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $info; $1 = $pixels; $2 = $0; $3 = HEAP32[$2>>2]|0; $4 = $0; $5 = ((($4)) + 16|0); $6 = HEAP32[$5>>2]|0; $7 = (($3) + ($6)|0); $8 = ((($7)) + 18|0); $9 = (_nk_ttUSHORT($8)|0); $10 = $9&65535; $unitsPerEm = $10; $11 = $1; $12 = $unitsPerEm; $13 = (+($12|0)); $14 = $11 / $13; STACKTOP = sp;return (+$14); } function _nk_tt_FindGlyphIndex($info,$unicode_codepoint) { $info = $info|0; $unicode_codepoint = $unicode_codepoint|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $32 = 0, $33 = 0, $34 = 0; var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0; var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0; var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0; var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $bytes = 0, $count = 0, $data = 0, $end = 0, $endCount = 0, $end_char = 0, $entrySelector = 0, $first = 0, $format = 0; var $high = 0, $index_map = 0, $item = 0, $low = 0, $mid = 0, $ngroups = 0, $offset = 0, $rangeShift = 0, $search = 0, $searchRange = 0, $segcount = 0, $start = 0, $start_char = 0, $start_glyph = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $info; $2 = $unicode_codepoint; $3 = $1; $4 = HEAP32[$3>>2]|0; $data = $4; $5 = $1; $6 = ((($5)) + 36|0); $7 = HEAP32[$6>>2]|0; $index_map = $7; $8 = $data; $9 = $index_map; $10 = (($8) + ($9)|0); $11 = (_nk_ttUSHORT($10)|0); $format = $11; $12 = $format; $13 = $12&65535; $14 = ($13|0)==(0); if ($14) { $15 = $data; $16 = $index_map; $17 = (($15) + ($16)|0); $18 = ((($17)) + 2|0); $19 = (_nk_ttUSHORT($18)|0); $20 = $19&65535; $bytes = $20; $21 = $2; $22 = $bytes; $23 = (($22) - 6)|0; $24 = ($21|0)<($23|0); if ($24) { $25 = $data; $26 = $index_map; $27 = (($25) + ($26)|0); $28 = ((($27)) + 6|0); $29 = $2; $30 = (($28) + ($29)|0); $31 = HEAP8[$30>>0]|0; $32 = $31&255; $0 = $32; $310 = $0; STACKTOP = sp;return ($310|0); } else { $0 = 0; $310 = $0; STACKTOP = sp;return ($310|0); } } $33 = $format; $34 = $33&65535; $35 = ($34|0)==(6); if ($35) { $36 = $data; $37 = $index_map; $38 = (($36) + ($37)|0); $39 = ((($38)) + 6|0); $40 = (_nk_ttUSHORT($39)|0); $41 = $40&65535; $first = $41; $42 = $data; $43 = $index_map; $44 = (($42) + ($43)|0); $45 = ((($44)) + 8|0); $46 = (_nk_ttUSHORT($45)|0); $47 = $46&65535; $count = $47; $48 = $2; $49 = $first; $50 = ($48>>>0)>=($49>>>0); if ($50) { $51 = $2; $52 = $first; $53 = $count; $54 = (($52) + ($53))|0; $55 = ($51>>>0)<($54>>>0); if ($55) { $56 = $data; $57 = $index_map; $58 = (($56) + ($57)|0); $59 = ((($58)) + 10|0); $60 = $2; $61 = $first; $62 = (($60) - ($61))|0; $63 = $62<<1; $64 = (($59) + ($63)|0); $65 = (_nk_ttUSHORT($64)|0); $66 = $65&65535; $0 = $66; $310 = $0; STACKTOP = sp;return ($310|0); } } $0 = 0; $310 = $0; STACKTOP = sp;return ($310|0); } $67 = $format; $68 = $67&65535; $69 = ($68|0)==(2); if ($69) { ___assert_fail((30507|0),(13400|0),7243,(30509|0)); // unreachable; } $70 = $format; $71 = $70&65535; $72 = ($71|0)==(4); if (!($72)) { $246 = $format; $247 = $246&65535; $248 = ($247|0)==(12); if (!($248)) { $249 = $format; $250 = $249&65535; $251 = ($250|0)==(13); if (!($251)) { ___assert_fail((30507|0),(13400|0),7314,(30509|0)); // unreachable; } } $252 = $data; $253 = $index_map; $254 = (($252) + ($253)|0); $255 = ((($254)) + 12|0); $256 = (_nk_ttULONG($255)|0); $ngroups = $256; $low = 0; $257 = $ngroups; $high = $257; while(1) { $258 = $low; $259 = $high; $260 = ($258|0)<($259|0); if (!($260)) { label = 40; break; } $261 = $low; $262 = $high; $263 = $low; $264 = (($262) - ($263))|0; $265 = $264 >> 1; $266 = (($261) + ($265))|0; $mid = $266; $267 = $data; $268 = $index_map; $269 = (($267) + ($268)|0); $270 = ((($269)) + 16|0); $271 = $mid; $272 = ($271*12)|0; $273 = (($270) + ($272)|0); $274 = (_nk_ttULONG($273)|0); $start_char = $274; $275 = $data; $276 = $index_map; $277 = (($275) + ($276)|0); $278 = ((($277)) + 16|0); $279 = $mid; $280 = ($279*12)|0; $281 = (($278) + ($280)|0); $282 = ((($281)) + 4|0); $283 = (_nk_ttULONG($282)|0); $end_char = $283; $284 = $2; $285 = $start_char; $286 = ($284>>>0)<($285>>>0); if ($286) { $287 = $mid; $high = $287; continue; } $288 = $2; $289 = $end_char; $290 = ($288>>>0)>($289>>>0); if (!($290)) { break; } $291 = $mid; $292 = (($291) + 1)|0; $low = $292; } if ((label|0) == 40) { $0 = 0; $310 = $0; STACKTOP = sp;return ($310|0); } $293 = $data; $294 = $index_map; $295 = (($293) + ($294)|0); $296 = ((($295)) + 16|0); $297 = $mid; $298 = ($297*12)|0; $299 = (($296) + ($298)|0); $300 = ((($299)) + 8|0); $301 = (_nk_ttULONG($300)|0); $start_glyph = $301; $302 = $format; $303 = $302&65535; $304 = ($303|0)==(12); $305 = $start_glyph; if ($304) { $306 = $2; $307 = (($305) + ($306))|0; $308 = $start_char; $309 = (($307) - ($308))|0; $0 = $309; $310 = $0; STACKTOP = sp;return ($310|0); } else { $0 = $305; $310 = $0; STACKTOP = sp;return ($310|0); } } $73 = $data; $74 = $index_map; $75 = (($73) + ($74)|0); $76 = ((($75)) + 6|0); $77 = (_nk_ttUSHORT($76)|0); $78 = $77&65535; $79 = $78 >> 1; $80 = $79&65535; $segcount = $80; $81 = $data; $82 = $index_map; $83 = (($81) + ($82)|0); $84 = ((($83)) + 8|0); $85 = (_nk_ttUSHORT($84)|0); $86 = $85&65535; $87 = $86 >> 1; $88 = $87&65535; $searchRange = $88; $89 = $data; $90 = $index_map; $91 = (($89) + ($90)|0); $92 = ((($91)) + 10|0); $93 = (_nk_ttUSHORT($92)|0); $entrySelector = $93; $94 = $data; $95 = $index_map; $96 = (($94) + ($95)|0); $97 = ((($96)) + 12|0); $98 = (_nk_ttUSHORT($97)|0); $99 = $98&65535; $100 = $99 >> 1; $101 = $100&65535; $rangeShift = $101; $102 = $index_map; $103 = (($102) + 14)|0; $endCount = $103; $104 = $endCount; $search = $104; $105 = $2; $106 = ($105|0)>(65535); if ($106) { $0 = 0; $310 = $0; STACKTOP = sp;return ($310|0); } $107 = $2; $108 = $data; $109 = $search; $110 = (($108) + ($109)|0); $111 = $rangeShift; $112 = $111&65535; $113 = $112<<1; $114 = (($110) + ($113)|0); $115 = (_nk_ttUSHORT($114)|0); $116 = $115&65535; $117 = ($107|0)>=($116|0); if ($117) { $118 = $rangeShift; $119 = $118&65535; $120 = $119<<1; $121 = $search; $122 = (($121) + ($120))|0; $search = $122; } $123 = $search; $124 = (($123) - 2)|0; $search = $124; while(1) { $125 = $entrySelector; $126 = ($125<<16>>16)!=(0); if (!($126)) { break; } $127 = $searchRange; $128 = $127&65535; $129 = $128 >> 1; $130 = $129&65535; $searchRange = $130; $131 = $data; $132 = $search; $133 = (($131) + ($132)|0); $134 = $searchRange; $135 = $134&65535; $136 = $135<<1; $137 = (($133) + ($136)|0); $138 = (_nk_ttUSHORT($137)|0); $end = $138; $139 = $2; $140 = $end; $141 = $140&65535; $142 = ($139|0)>($141|0); if ($142) { $143 = $searchRange; $144 = $143&65535; $145 = $144<<1; $146 = $search; $147 = (($146) + ($145))|0; $search = $147; } $148 = $entrySelector; $149 = (($148) + -1)<<16>>16; $entrySelector = $149; } $150 = $search; $151 = (($150) + 2)|0; $search = $151; $152 = $search; $153 = $endCount; $154 = (($152) - ($153))|0; $155 = $154 >>> 1; $156 = $155&65535; $item = $156; $157 = $2; $158 = $data; $159 = $endCount; $160 = (($158) + ($159)|0); $161 = $item; $162 = $161&65535; $163 = $162<<1; $164 = (($160) + ($163)|0); $165 = (_nk_ttUSHORT($164)|0); $166 = $165&65535; $167 = ($157|0)<=($166|0); if (!($167)) { ___assert_fail((30530|0),(13400|0),7279,(30509|0)); // unreachable; } $168 = $data; $169 = $index_map; $170 = (($168) + ($169)|0); $171 = ((($170)) + 14|0); $172 = $segcount; $173 = $172&65535; $174 = $173<<1; $175 = (($171) + ($174)|0); $176 = ((($175)) + 2|0); $177 = $item; $178 = $177&65535; $179 = $178<<1; $180 = (($176) + ($179)|0); $181 = (_nk_ttUSHORT($180)|0); $start = $181; $182 = $2; $183 = $start; $184 = $183&65535; $185 = ($182|0)<($184|0); if ($185) { $0 = 0; $310 = $0; STACKTOP = sp;return ($310|0); } $186 = $data; $187 = $index_map; $188 = (($186) + ($187)|0); $189 = ((($188)) + 14|0); $190 = $segcount; $191 = $190&65535; $192 = ($191*6)|0; $193 = (($189) + ($192)|0); $194 = ((($193)) + 2|0); $195 = $item; $196 = $195&65535; $197 = $196<<1; $198 = (($194) + ($197)|0); $199 = (_nk_ttUSHORT($198)|0); $offset = $199; $200 = $offset; $201 = $200&65535; $202 = ($201|0)==(0); if ($202) { $203 = $2; $204 = $data; $205 = $index_map; $206 = (($204) + ($205)|0); $207 = ((($206)) + 14|0); $208 = $segcount; $209 = $208&65535; $210 = $209<<2; $211 = (($207) + ($210)|0); $212 = ((($211)) + 2|0); $213 = $item; $214 = $213&65535; $215 = $214<<1; $216 = (($212) + ($215)|0); $217 = (_nk_ttSHORT($216)|0); $218 = $217 << 16 >> 16; $219 = (($203) + ($218))|0; $220 = $219&65535; $221 = $220&65535; $0 = $221; $310 = $0; STACKTOP = sp;return ($310|0); } else { $222 = $data; $223 = $offset; $224 = $223&65535; $225 = (($222) + ($224)|0); $226 = $2; $227 = $start; $228 = $227&65535; $229 = (($226) - ($228))|0; $230 = $229<<1; $231 = (($225) + ($230)|0); $232 = $index_map; $233 = (($231) + ($232)|0); $234 = ((($233)) + 14|0); $235 = $segcount; $236 = $235&65535; $237 = ($236*6)|0; $238 = (($234) + ($237)|0); $239 = ((($238)) + 2|0); $240 = $item; $241 = $240&65535; $242 = $241<<1; $243 = (($239) + ($242)|0); $244 = (_nk_ttUSHORT($243)|0); $245 = $244&65535; $0 = $245; $310 = $0; STACKTOP = sp;return ($310|0); } return (0)|0; } function _nk_tt_GetGlyphBitmapBoxSubpixel($font,$glyph,$scale_x,$scale_y,$shift_x,$shift_y,$ix0,$iy0,$ix1,$iy1) { $font = $font|0; $glyph = $glyph|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $ix0 = $ix0|0; $iy0 = $iy0|0; $ix1 = $ix1|0; $iy1 = $iy1|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0; var $63 = 0.0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, $x0 = 0, $x1 = 0, $y0 = 0, $y1 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $x0 = sp + 12|0; $y0 = sp + 8|0; $x1 = sp + 4|0; $y1 = sp; $0 = $font; $1 = $glyph; $2 = $scale_x; $3 = $scale_y; $4 = $shift_x; $5 = $shift_y; $6 = $ix0; $7 = $iy0; $8 = $ix1; $9 = $iy1; $10 = $0; $11 = $1; $12 = (_nk_tt_GetGlyphBox($10,$11,$x0,$y0,$x1,$y1)|0); $13 = ($12|0)!=(0); $14 = $6; $15 = ($14|0)!=(0|0); if ($13) { if ($15) { $26 = HEAP32[$x0>>2]|0; $27 = (+($26|0)); $28 = $2; $29 = $27 * $28; $30 = $4; $31 = $29 + $30; $32 = (_nk_ifloor($31)|0); $33 = $6; HEAP32[$33>>2] = $32; } $34 = $7; $35 = ($34|0)!=(0|0); if ($35) { $36 = HEAP32[$y1>>2]|0; $37 = (0 - ($36))|0; $38 = (+($37|0)); $39 = $3; $40 = $38 * $39; $41 = $5; $42 = $40 + $41; $43 = (_nk_ifloor($42)|0); $44 = $7; HEAP32[$44>>2] = $43; } $45 = $8; $46 = ($45|0)!=(0|0); if ($46) { $47 = HEAP32[$x1>>2]|0; $48 = (+($47|0)); $49 = $2; $50 = $48 * $49; $51 = $4; $52 = $50 + $51; $53 = (_nk_iceil($52)|0); $54 = $8; HEAP32[$54>>2] = $53; } $55 = $9; $56 = ($55|0)!=(0|0); if (!($56)) { STACKTOP = sp;return; } $57 = HEAP32[$y0>>2]|0; $58 = (0 - ($57))|0; $59 = (+($58|0)); $60 = $3; $61 = $59 * $60; $62 = $5; $63 = $61 + $62; $64 = (_nk_iceil($63)|0); $65 = $9; HEAP32[$65>>2] = $64; STACKTOP = sp;return; } else { if ($15) { $16 = $6; HEAP32[$16>>2] = 0; } $17 = $7; $18 = ($17|0)!=(0|0); if ($18) { $19 = $7; HEAP32[$19>>2] = 0; } $20 = $8; $21 = ($20|0)!=(0|0); if ($21) { $22 = $8; HEAP32[$22>>2] = 0; } $23 = $9; $24 = ($23|0)!=(0|0); if (!($24)) { STACKTOP = sp;return; } $25 = $9; HEAP32[$25>>2] = 0; STACKTOP = sp;return; } } function _nk_ttSHORT($p) { $p = $p|0; var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $p; $1 = $0; $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = $3<<8; $5 = $0; $6 = ((($5)) + 1|0); $7 = HEAP8[$6>>0]|0; $8 = $7&255; $9 = (($4) + ($8))|0; $10 = $9&65535; STACKTOP = sp;return ($10|0); } function _nk_tt_GetGlyphBox($info,$glyph_index,$x0,$y0,$x1,$y1) { $info = $info|0; $glyph_index = $glyph_index|0; $x0 = $x0|0; $y0 = $y0|0; $x1 = $x1|0; $y1 = $y1|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $g = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $info; $2 = $glyph_index; $3 = $x0; $4 = $y0; $5 = $x1; $6 = $y1; $7 = $1; $8 = $2; $9 = (_nk_tt__GetGlyfOffset($7,$8)|0); $g = $9; $10 = $g; $11 = ($10|0)<(0); if ($11) { $0 = 0; $52 = $0; STACKTOP = sp;return ($52|0); } $12 = $3; $13 = ($12|0)!=(0|0); if ($13) { $14 = $1; $15 = HEAP32[$14>>2]|0; $16 = $g; $17 = (($15) + ($16)|0); $18 = ((($17)) + 2|0); $19 = (_nk_ttSHORT($18)|0); $20 = $19 << 16 >> 16; $21 = $3; HEAP32[$21>>2] = $20; } $22 = $4; $23 = ($22|0)!=(0|0); if ($23) { $24 = $1; $25 = HEAP32[$24>>2]|0; $26 = $g; $27 = (($25) + ($26)|0); $28 = ((($27)) + 4|0); $29 = (_nk_ttSHORT($28)|0); $30 = $29 << 16 >> 16; $31 = $4; HEAP32[$31>>2] = $30; } $32 = $5; $33 = ($32|0)!=(0|0); if ($33) { $34 = $1; $35 = HEAP32[$34>>2]|0; $36 = $g; $37 = (($35) + ($36)|0); $38 = ((($37)) + 6|0); $39 = (_nk_ttSHORT($38)|0); $40 = $39 << 16 >> 16; $41 = $5; HEAP32[$41>>2] = $40; } $42 = $6; $43 = ($42|0)!=(0|0); if ($43) { $44 = $1; $45 = HEAP32[$44>>2]|0; $46 = $g; $47 = (($45) + ($46)|0); $48 = ((($47)) + 8|0); $49 = (_nk_ttSHORT($48)|0); $50 = $49 << 16 >> 16; $51 = $6; HEAP32[$51>>2] = $50; } $0 = 1; $52 = $0; STACKTOP = sp;return ($52|0); } function _nk_ifloor($x) { $x = +$x; var $0 = 0.0, $1 = 0.0, $10 = 0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $x; $1 = $0; $2 = (~~(($1))); $3 = $0; $4 = $3; $5 = $4 < 0.0; $6 = $5 ? 1 : 0; $7 = (($2) - ($6))|0; $8 = (+($7|0)); $0 = $8; $9 = $0; $10 = (~~(($9))); STACKTOP = sp;return ($10|0); } function _nk_iceil($x) { $x = +$x; var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, $i = 0, $r = 0.0, $t = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $x; $2 = $1; $3 = $2 >= 0.0; $4 = $1; $5 = (~~(($4))); if ($3) { $i = $5; $6 = $i; $0 = $6; $16 = $0; STACKTOP = sp;return ($16|0); } else { $t = $5; $7 = $1; $8 = $t; $9 = (+($8|0)); $10 = $7 - $9; $r = $10; $11 = $r; $12 = $11 > 0.0; $13 = $t; $14 = (($13) + 1)|0; $15 = $12 ? $14 : $13; $0 = $15; $16 = $0; STACKTOP = sp;return ($16|0); } return (0)|0; } function _nk_tt__GetGlyfOffset($info,$glyph_index) { $info = $info|0; $glyph_index = $glyph_index|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $8 = 0, $9 = 0, $g1 = 0, $g2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $info; $2 = $glyph_index; $3 = $2; $4 = $1; $5 = ((($4)) + 8|0); $6 = HEAP32[$5>>2]|0; $7 = ($3|0)>=($6|0); if ($7) { $0 = -1; $73 = $0; STACKTOP = sp;return ($73|0); } $8 = $1; $9 = ((($8)) + 40|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)>=(2); if ($11) { $0 = -1; $73 = $0; STACKTOP = sp;return ($73|0); } $12 = $1; $13 = ((($12)) + 40|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)==(0); $16 = $1; $17 = ((($16)) + 20|0); $18 = HEAP32[$17>>2]|0; $19 = $1; $20 = HEAP32[$19>>2]|0; $21 = $1; $22 = ((($21)) + 12|0); $23 = HEAP32[$22>>2]|0; $24 = (($20) + ($23)|0); $25 = $2; if ($15) { $26 = $25<<1; $27 = (($24) + ($26)|0); $28 = (_nk_ttUSHORT($27)|0); $29 = $28&65535; $30 = $29<<1; $31 = (($18) + ($30))|0; $g1 = $31; $32 = $1; $33 = ((($32)) + 20|0); $34 = HEAP32[$33>>2]|0; $35 = $1; $36 = HEAP32[$35>>2]|0; $37 = $1; $38 = ((($37)) + 12|0); $39 = HEAP32[$38>>2]|0; $40 = (($36) + ($39)|0); $41 = $2; $42 = $41<<1; $43 = (($40) + ($42)|0); $44 = ((($43)) + 2|0); $45 = (_nk_ttUSHORT($44)|0); $46 = $45&65535; $47 = $46<<1; $48 = (($34) + ($47))|0; $g2 = $48; } else { $49 = $25<<2; $50 = (($24) + ($49)|0); $51 = (_nk_ttULONG($50)|0); $52 = (($18) + ($51))|0; $g1 = $52; $53 = $1; $54 = ((($53)) + 20|0); $55 = HEAP32[$54>>2]|0; $56 = $1; $57 = HEAP32[$56>>2]|0; $58 = $1; $59 = ((($58)) + 12|0); $60 = HEAP32[$59>>2]|0; $61 = (($57) + ($60)|0); $62 = $2; $63 = $62<<2; $64 = (($61) + ($63)|0); $65 = ((($64)) + 4|0); $66 = (_nk_ttULONG($65)|0); $67 = (($55) + ($66))|0; $g2 = $67; } $68 = $g1; $69 = $g2; $70 = ($68|0)==($69|0); $71 = $g1; $72 = $70 ? -1 : $71; $0 = $72; $73 = $0; STACKTOP = sp;return ($73|0); } function _nk_tt__oversample_shift($oversample) { $oversample = $oversample|0; var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $oversample; $2 = $1; $3 = ($2|0)!=(0); if ($3) { $4 = $1; $5 = (($4) - 1)|0; $6 = (0 - ($5))|0; $7 = (+($6|0)); $8 = $1; $9 = (+($8|0)); $10 = 2.0 * $9; $11 = $7 / $10; $0 = $11; $12 = $0; STACKTOP = sp;return (+$12); } else { $0 = 0.0; $12 = $0; STACKTOP = sp;return (+$12); } return +(0.0); } function _nk_tt_GetGlyphHMetrics($info,$glyph_index,$advanceWidth,$leftSideBearing) { $info = $info|0; $glyph_index = $glyph_index|0; $advanceWidth = $advanceWidth|0; $leftSideBearing = $leftSideBearing|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $9 = 0; var $numOfLongHorMetrics = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $info; $1 = $glyph_index; $2 = $advanceWidth; $3 = $leftSideBearing; $4 = $0; $5 = HEAP32[$4>>2]|0; $6 = $0; $7 = ((($6)) + 24|0); $8 = HEAP32[$7>>2]|0; $9 = (($5) + ($8)|0); $10 = ((($9)) + 34|0); $11 = (_nk_ttUSHORT($10)|0); $numOfLongHorMetrics = $11; $12 = $1; $13 = $numOfLongHorMetrics; $14 = $13&65535; $15 = ($12|0)<($14|0); $16 = $2; $17 = ($16|0)!=(0|0); if ($15) { if ($17) { $18 = $0; $19 = HEAP32[$18>>2]|0; $20 = $0; $21 = ((($20)) + 28|0); $22 = HEAP32[$21>>2]|0; $23 = (($19) + ($22)|0); $24 = $1; $25 = $24<<2; $26 = (($23) + ($25)|0); $27 = (_nk_ttSHORT($26)|0); $28 = $27 << 16 >> 16; $29 = $2; HEAP32[$29>>2] = $28; } $30 = $3; $31 = ($30|0)!=(0|0); if (!($31)) { STACKTOP = sp;return; } $32 = $0; $33 = HEAP32[$32>>2]|0; $34 = $0; $35 = ((($34)) + 28|0); $36 = HEAP32[$35>>2]|0; $37 = (($33) + ($36)|0); $38 = $1; $39 = $38<<2; $40 = (($37) + ($39)|0); $41 = ((($40)) + 2|0); $42 = (_nk_ttSHORT($41)|0); $43 = $42 << 16 >> 16; $44 = $3; HEAP32[$44>>2] = $43; STACKTOP = sp;return; } else { if ($17) { $45 = $0; $46 = HEAP32[$45>>2]|0; $47 = $0; $48 = ((($47)) + 28|0); $49 = HEAP32[$48>>2]|0; $50 = (($46) + ($49)|0); $51 = $numOfLongHorMetrics; $52 = $51&65535; $53 = (($52) - 1)|0; $54 = $53<<2; $55 = (($50) + ($54)|0); $56 = (_nk_ttSHORT($55)|0); $57 = $56 << 16 >> 16; $58 = $2; HEAP32[$58>>2] = $57; } $59 = $3; $60 = ($59|0)!=(0|0); if (!($60)) { STACKTOP = sp;return; } $61 = $0; $62 = HEAP32[$61>>2]|0; $63 = $0; $64 = ((($63)) + 28|0); $65 = HEAP32[$64>>2]|0; $66 = (($62) + ($65)|0); $67 = $numOfLongHorMetrics; $68 = $67&65535; $69 = $68<<2; $70 = (($66) + ($69)|0); $71 = $1; $72 = $numOfLongHorMetrics; $73 = $72&65535; $74 = (($71) - ($73))|0; $75 = $74<<1; $76 = (($70) + ($75)|0); $77 = (_nk_ttSHORT($76)|0); $78 = $77 << 16 >> 16; $79 = $3; HEAP32[$79>>2] = $78; STACKTOP = sp;return; } } function _nk_tt_GetGlyphBitmapBox($font,$glyph,$scale_x,$scale_y,$ix0,$iy0,$ix1,$iy1) { $font = $font|0; $glyph = $glyph|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $ix0 = $ix0|0; $iy0 = $iy0|0; $ix1 = $ix1|0; $iy1 = $iy1|0; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $font; $1 = $glyph; $2 = $scale_x; $3 = $scale_y; $4 = $ix0; $5 = $iy0; $6 = $ix1; $7 = $iy1; $8 = $0; $9 = $1; $10 = $2; $11 = $3; $12 = $4; $13 = $5; $14 = $6; $15 = $7; _nk_tt_GetGlyphBitmapBoxSubpixel($8,$9,$10,$11,0.0,0.0,$12,$13,$14,$15); STACKTOP = sp;return; } function _nk_tt_MakeGlyphBitmapSubpixel($info,$output,$out_w,$out_h,$out_stride,$scale_x,$scale_y,$shift_x,$shift_y,$glyph,$alloc) { $info = $info|0; $output = $output|0; $out_w = $out_w|0; $out_h = $out_h|0; $out_stride = $out_stride|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $glyph = $glyph|0; $alloc = $alloc|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, $gbm = 0, $ix0 = 0, $iy0 = 0, $num_verts = 0, $vertices = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 76|0; $ix0 = sp + 28|0; $iy0 = sp + 24|0; $vertices = sp + 20|0; $gbm = sp; $0 = $info; $1 = $output; $2 = $out_w; $3 = $out_h; $4 = $out_stride; $5 = $scale_x; $6 = $scale_y; $7 = $shift_x; $8 = $shift_y; $9 = $glyph; $10 = $alloc; $11 = $0; $12 = $10; $13 = $9; $14 = (_nk_tt_GetGlyphShape($11,$12,$13,$vertices)|0); $num_verts = $14; $15 = $0; $16 = $9; $17 = $5; $18 = $6; $19 = $7; $20 = $8; _nk_tt_GetGlyphBitmapBoxSubpixel($15,$16,$17,$18,$19,$20,$ix0,$iy0,0,0); $21 = $1; $22 = ((($gbm)) + 12|0); HEAP32[$22>>2] = $21; $23 = $2; HEAP32[$gbm>>2] = $23; $24 = $3; $25 = ((($gbm)) + 4|0); HEAP32[$25>>2] = $24; $26 = $4; $27 = ((($gbm)) + 8|0); HEAP32[$27>>2] = $26; $28 = HEAP32[$gbm>>2]|0; $29 = ($28|0)!=(0); if ($29) { $30 = ((($gbm)) + 4|0); $31 = HEAP32[$30>>2]|0; $32 = ($31|0)!=(0); if ($32) { $33 = HEAP32[$vertices>>2]|0; $34 = $num_verts; $35 = $5; $36 = $6; $37 = $7; $38 = $8; $39 = HEAP32[$ix0>>2]|0; $40 = HEAP32[$iy0>>2]|0; $41 = $10; _nk_tt_Rasterize($gbm,0.34999999403953552,$33,$34,$35,$36,$37,$38,$39,$40,1,$41); } } $42 = $10; $43 = ((($42)) + 8|0); $44 = HEAP32[$43>>2]|0; $45 = $10; $46 = HEAP32[$vertices>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$45>>2]|0; FUNCTION_TABLE_vii[$44 & 31]($$byval_copy,$46); STACKTOP = sp;return; } function _nk_tt__h_prefilter($pixels,$w,$h,$stride_in_bytes,$kernel_width) { $pixels = $pixels|0; $w = $w|0; $h = $h|0; $stride_in_bytes = $stride_in_bytes|0; $kernel_width = $kernel_width|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0; var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0; var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0; var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $buffer = 0, $i = 0, $j = 0, $safe_w = 0, $total = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $buffer = sp + 40|0; $0 = $pixels; $1 = $w; $2 = $h; $3 = $stride_in_bytes; $4 = $kernel_width; $5 = $1; $6 = $4; $7 = (($5) - ($6))|0; $safe_w = $7; $j = 0; L1: while(1) { $8 = $j; $9 = $2; $10 = ($8|0)<($9|0); if (!($10)) { label = 24; break; } $11 = $4; _nk_memset($buffer,0,$11); $total = 0; $12 = $4; L4: do { switch ($12|0) { case 2: { $i = 0; while(1) { $13 = $i; $14 = $safe_w; $15 = ($13|0)<=($14|0); if (!($15)) { break L4; } $16 = $i; $17 = $0; $18 = (($17) + ($16)|0); $19 = HEAP8[$18>>0]|0; $20 = $19&255; $21 = $i; $22 = $21 & 7; $23 = (($buffer) + ($22)|0); $24 = HEAP8[$23>>0]|0; $25 = $24&255; $26 = (($20) - ($25))|0; $27 = $total; $28 = (($27) + ($26))|0; $total = $28; $29 = $i; $30 = $0; $31 = (($30) + ($29)|0); $32 = HEAP8[$31>>0]|0; $33 = $i; $34 = $4; $35 = (($33) + ($34))|0; $36 = $35 & 7; $37 = (($buffer) + ($36)|0); HEAP8[$37>>0] = $32; $38 = $total; $39 = (($38>>>0) / 2)&-1; $40 = $39&255; $41 = $i; $42 = $0; $43 = (($42) + ($41)|0); HEAP8[$43>>0] = $40; $44 = $i; $45 = (($44) + 1)|0; $i = $45; } break; } case 3: { $i = 0; while(1) { $46 = $i; $47 = $safe_w; $48 = ($46|0)<=($47|0); if (!($48)) { break L4; } $49 = $i; $50 = $0; $51 = (($50) + ($49)|0); $52 = HEAP8[$51>>0]|0; $53 = $52&255; $54 = $i; $55 = $54 & 7; $56 = (($buffer) + ($55)|0); $57 = HEAP8[$56>>0]|0; $58 = $57&255; $59 = (($53) - ($58))|0; $60 = $total; $61 = (($60) + ($59))|0; $total = $61; $62 = $i; $63 = $0; $64 = (($63) + ($62)|0); $65 = HEAP8[$64>>0]|0; $66 = $i; $67 = $4; $68 = (($66) + ($67))|0; $69 = $68 & 7; $70 = (($buffer) + ($69)|0); HEAP8[$70>>0] = $65; $71 = $total; $72 = (($71>>>0) / 3)&-1; $73 = $72&255; $74 = $i; $75 = $0; $76 = (($75) + ($74)|0); HEAP8[$76>>0] = $73; $77 = $i; $78 = (($77) + 1)|0; $i = $78; } break; } case 4: { $i = 0; while(1) { $79 = $i; $80 = $safe_w; $81 = ($79|0)<=($80|0); if (!($81)) { break L4; } $82 = $i; $83 = $0; $84 = (($83) + ($82)|0); $85 = HEAP8[$84>>0]|0; $86 = $85&255; $87 = $i; $88 = $87 & 7; $89 = (($buffer) + ($88)|0); $90 = HEAP8[$89>>0]|0; $91 = $90&255; $92 = (($86) - ($91))|0; $93 = $total; $94 = (($93) + ($92))|0; $total = $94; $95 = $i; $96 = $0; $97 = (($96) + ($95)|0); $98 = HEAP8[$97>>0]|0; $99 = $i; $100 = $4; $101 = (($99) + ($100))|0; $102 = $101 & 7; $103 = (($buffer) + ($102)|0); HEAP8[$103>>0] = $98; $104 = $total; $105 = (($104>>>0) / 4)&-1; $106 = $105&255; $107 = $i; $108 = $0; $109 = (($108) + ($107)|0); HEAP8[$109>>0] = $106; $110 = $i; $111 = (($110) + 1)|0; $i = $111; } break; } case 5: { $i = 0; while(1) { $112 = $i; $113 = $safe_w; $114 = ($112|0)<=($113|0); if (!($114)) { break L4; } $115 = $i; $116 = $0; $117 = (($116) + ($115)|0); $118 = HEAP8[$117>>0]|0; $119 = $118&255; $120 = $i; $121 = $120 & 7; $122 = (($buffer) + ($121)|0); $123 = HEAP8[$122>>0]|0; $124 = $123&255; $125 = (($119) - ($124))|0; $126 = $total; $127 = (($126) + ($125))|0; $total = $127; $128 = $i; $129 = $0; $130 = (($129) + ($128)|0); $131 = HEAP8[$130>>0]|0; $132 = $i; $133 = $4; $134 = (($132) + ($133))|0; $135 = $134 & 7; $136 = (($buffer) + ($135)|0); HEAP8[$136>>0] = $131; $137 = $total; $138 = (($137>>>0) / 5)&-1; $139 = $138&255; $140 = $i; $141 = $0; $142 = (($141) + ($140)|0); HEAP8[$142>>0] = $139; $143 = $i; $144 = (($143) + 1)|0; $i = $144; } break; } default: { $i = 0; while(1) { $145 = $i; $146 = $safe_w; $147 = ($145|0)<=($146|0); if (!($147)) { break L4; } $148 = $i; $149 = $0; $150 = (($149) + ($148)|0); $151 = HEAP8[$150>>0]|0; $152 = $151&255; $153 = $i; $154 = $153 & 7; $155 = (($buffer) + ($154)|0); $156 = HEAP8[$155>>0]|0; $157 = $156&255; $158 = (($152) - ($157))|0; $159 = $total; $160 = (($159) + ($158))|0; $total = $160; $161 = $i; $162 = $0; $163 = (($162) + ($161)|0); $164 = HEAP8[$163>>0]|0; $165 = $i; $166 = $4; $167 = (($165) + ($166))|0; $168 = $167 & 7; $169 = (($buffer) + ($168)|0); HEAP8[$169>>0] = $164; $170 = $total; $171 = $4; $172 = (($170>>>0) / ($171>>>0))&-1; $173 = $172&255; $174 = $i; $175 = $0; $176 = (($175) + ($174)|0); HEAP8[$176>>0] = $173; $177 = $i; $178 = (($177) + 1)|0; $i = $178; } } } } while(0); while(1) { $179 = $i; $180 = $1; $181 = ($179|0)<($180|0); if (!($181)) { break; } $182 = $i; $183 = $0; $184 = (($183) + ($182)|0); $185 = HEAP8[$184>>0]|0; $186 = $185&255; $187 = ($186|0)==(0); if (!($187)) { label = 21; break L1; } $188 = $i; $189 = $188 & 7; $190 = (($buffer) + ($189)|0); $191 = HEAP8[$190>>0]|0; $192 = $191&255; $193 = $total; $194 = (($193) - ($192))|0; $total = $194; $195 = $total; $196 = $4; $197 = (($195>>>0) / ($196>>>0))&-1; $198 = $197&255; $199 = $i; $200 = $0; $201 = (($200) + ($199)|0); HEAP8[$201>>0] = $198; $202 = $i; $203 = (($202) + 1)|0; $i = $203; } $204 = $3; $205 = $0; $206 = (($205) + ($204)|0); $0 = $206; $207 = $j; $208 = (($207) + 1)|0; $j = $208; } if ((label|0) == 21) { ___assert_fail((30938|0),(13400|0),8443,(30953|0)); // unreachable; } else if ((label|0) == 24) { STACKTOP = sp;return; } } function _nk_tt__v_prefilter($pixels,$w,$h,$stride_in_bytes,$kernel_width) { $pixels = $pixels|0; $w = $w|0; $h = $h|0; $stride_in_bytes = $stride_in_bytes|0; $kernel_width = $kernel_width|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $buffer = 0, $i = 0, $j = 0, $safe_h = 0, $total = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $buffer = sp + 40|0; $0 = $pixels; $1 = $w; $2 = $h; $3 = $stride_in_bytes; $4 = $kernel_width; $5 = $2; $6 = $4; $7 = (($5) - ($6))|0; $safe_h = $7; $j = 0; L1: while(1) { $8 = $j; $9 = $1; $10 = ($8|0)<($9|0); if (!($10)) { label = 24; break; } $11 = $4; _nk_memset($buffer,0,$11); $total = 0; $12 = $4; L4: do { switch ($12|0) { case 2: { $i = 0; while(1) { $13 = $i; $14 = $safe_h; $15 = ($13|0)<=($14|0); if (!($15)) { break L4; } $16 = $i; $17 = $3; $18 = Math_imul($16, $17)|0; $19 = $0; $20 = (($19) + ($18)|0); $21 = HEAP8[$20>>0]|0; $22 = $21&255; $23 = $i; $24 = $23 & 7; $25 = (($buffer) + ($24)|0); $26 = HEAP8[$25>>0]|0; $27 = $26&255; $28 = (($22) - ($27))|0; $29 = $total; $30 = (($29) + ($28))|0; $total = $30; $31 = $i; $32 = $3; $33 = Math_imul($31, $32)|0; $34 = $0; $35 = (($34) + ($33)|0); $36 = HEAP8[$35>>0]|0; $37 = $i; $38 = $4; $39 = (($37) + ($38))|0; $40 = $39 & 7; $41 = (($buffer) + ($40)|0); HEAP8[$41>>0] = $36; $42 = $total; $43 = (($42>>>0) / 2)&-1; $44 = $43&255; $45 = $i; $46 = $3; $47 = Math_imul($45, $46)|0; $48 = $0; $49 = (($48) + ($47)|0); HEAP8[$49>>0] = $44; $50 = $i; $51 = (($50) + 1)|0; $i = $51; } break; } case 3: { $i = 0; while(1) { $52 = $i; $53 = $safe_h; $54 = ($52|0)<=($53|0); if (!($54)) { break L4; } $55 = $i; $56 = $3; $57 = Math_imul($55, $56)|0; $58 = $0; $59 = (($58) + ($57)|0); $60 = HEAP8[$59>>0]|0; $61 = $60&255; $62 = $i; $63 = $62 & 7; $64 = (($buffer) + ($63)|0); $65 = HEAP8[$64>>0]|0; $66 = $65&255; $67 = (($61) - ($66))|0; $68 = $total; $69 = (($68) + ($67))|0; $total = $69; $70 = $i; $71 = $3; $72 = Math_imul($70, $71)|0; $73 = $0; $74 = (($73) + ($72)|0); $75 = HEAP8[$74>>0]|0; $76 = $i; $77 = $4; $78 = (($76) + ($77))|0; $79 = $78 & 7; $80 = (($buffer) + ($79)|0); HEAP8[$80>>0] = $75; $81 = $total; $82 = (($81>>>0) / 3)&-1; $83 = $82&255; $84 = $i; $85 = $3; $86 = Math_imul($84, $85)|0; $87 = $0; $88 = (($87) + ($86)|0); HEAP8[$88>>0] = $83; $89 = $i; $90 = (($89) + 1)|0; $i = $90; } break; } case 4: { $i = 0; while(1) { $91 = $i; $92 = $safe_h; $93 = ($91|0)<=($92|0); if (!($93)) { break L4; } $94 = $i; $95 = $3; $96 = Math_imul($94, $95)|0; $97 = $0; $98 = (($97) + ($96)|0); $99 = HEAP8[$98>>0]|0; $100 = $99&255; $101 = $i; $102 = $101 & 7; $103 = (($buffer) + ($102)|0); $104 = HEAP8[$103>>0]|0; $105 = $104&255; $106 = (($100) - ($105))|0; $107 = $total; $108 = (($107) + ($106))|0; $total = $108; $109 = $i; $110 = $3; $111 = Math_imul($109, $110)|0; $112 = $0; $113 = (($112) + ($111)|0); $114 = HEAP8[$113>>0]|0; $115 = $i; $116 = $4; $117 = (($115) + ($116))|0; $118 = $117 & 7; $119 = (($buffer) + ($118)|0); HEAP8[$119>>0] = $114; $120 = $total; $121 = (($120>>>0) / 4)&-1; $122 = $121&255; $123 = $i; $124 = $3; $125 = Math_imul($123, $124)|0; $126 = $0; $127 = (($126) + ($125)|0); HEAP8[$127>>0] = $122; $128 = $i; $129 = (($128) + 1)|0; $i = $129; } break; } case 5: { $i = 0; while(1) { $130 = $i; $131 = $safe_h; $132 = ($130|0)<=($131|0); if (!($132)) { break L4; } $133 = $i; $134 = $3; $135 = Math_imul($133, $134)|0; $136 = $0; $137 = (($136) + ($135)|0); $138 = HEAP8[$137>>0]|0; $139 = $138&255; $140 = $i; $141 = $140 & 7; $142 = (($buffer) + ($141)|0); $143 = HEAP8[$142>>0]|0; $144 = $143&255; $145 = (($139) - ($144))|0; $146 = $total; $147 = (($146) + ($145))|0; $total = $147; $148 = $i; $149 = $3; $150 = Math_imul($148, $149)|0; $151 = $0; $152 = (($151) + ($150)|0); $153 = HEAP8[$152>>0]|0; $154 = $i; $155 = $4; $156 = (($154) + ($155))|0; $157 = $156 & 7; $158 = (($buffer) + ($157)|0); HEAP8[$158>>0] = $153; $159 = $total; $160 = (($159>>>0) / 5)&-1; $161 = $160&255; $162 = $i; $163 = $3; $164 = Math_imul($162, $163)|0; $165 = $0; $166 = (($165) + ($164)|0); HEAP8[$166>>0] = $161; $167 = $i; $168 = (($167) + 1)|0; $i = $168; } break; } default: { $i = 0; while(1) { $169 = $i; $170 = $safe_h; $171 = ($169|0)<=($170|0); if (!($171)) { break L4; } $172 = $i; $173 = $3; $174 = Math_imul($172, $173)|0; $175 = $0; $176 = (($175) + ($174)|0); $177 = HEAP8[$176>>0]|0; $178 = $177&255; $179 = $i; $180 = $179 & 7; $181 = (($buffer) + ($180)|0); $182 = HEAP8[$181>>0]|0; $183 = $182&255; $184 = (($178) - ($183))|0; $185 = $total; $186 = (($185) + ($184))|0; $total = $186; $187 = $i; $188 = $3; $189 = Math_imul($187, $188)|0; $190 = $0; $191 = (($190) + ($189)|0); $192 = HEAP8[$191>>0]|0; $193 = $i; $194 = $4; $195 = (($193) + ($194))|0; $196 = $195 & 7; $197 = (($buffer) + ($196)|0); HEAP8[$197>>0] = $192; $198 = $total; $199 = $4; $200 = (($198>>>0) / ($199>>>0))&-1; $201 = $200&255; $202 = $i; $203 = $3; $204 = Math_imul($202, $203)|0; $205 = $0; $206 = (($205) + ($204)|0); HEAP8[$206>>0] = $201; $207 = $i; $208 = (($207) + 1)|0; $i = $208; } } } } while(0); while(1) { $209 = $i; $210 = $2; $211 = ($209|0)<($210|0); if (!($211)) { break; } $212 = $i; $213 = $3; $214 = Math_imul($212, $213)|0; $215 = $0; $216 = (($215) + ($214)|0); $217 = HEAP8[$216>>0]|0; $218 = $217&255; $219 = ($218|0)==(0); if (!($219)) { label = 21; break L1; } $220 = $i; $221 = $220 & 7; $222 = (($buffer) + ($221)|0); $223 = HEAP8[$222>>0]|0; $224 = $223&255; $225 = $total; $226 = (($225) - ($224))|0; $total = $226; $227 = $total; $228 = $4; $229 = (($227>>>0) / ($228>>>0))&-1; $230 = $229&255; $231 = $i; $232 = $3; $233 = Math_imul($231, $232)|0; $234 = $0; $235 = (($234) + ($233)|0); HEAP8[$235>>0] = $230; $236 = $i; $237 = (($236) + 1)|0; $i = $237; } $238 = $0; $239 = ((($238)) + 1|0); $0 = $239; $240 = $j; $241 = (($240) + 1)|0; $j = $241; } if ((label|0) == 21) { ___assert_fail((30972|0),(13400|0),8507,(31003|0)); // unreachable; } else if ((label|0) == 24) { STACKTOP = sp;return; } } function _nk_tt_GetGlyphShape($info,$alloc,$glyph_index,$pvertices) { $info = $info|0; $alloc = $alloc|0; $glyph_index = $glyph_index|0; $pvertices = $pvertices|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0; var $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0; var $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0; var $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0; var $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0; var $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0; var $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0; var $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0; var $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0; var $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0; var $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0; var $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0; var $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0; var $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0; var $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0; var $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0; var $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0; var $4 = 0, $40 = 0, $400 = 0, $401 = 0.0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0.0, $413 = 0, $414 = 0, $415 = 0, $416 = 0; var $417 = 0, $418 = 0.0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0.0, $43 = 0, $430 = 0.0, $431 = 0, $432 = 0, $433 = 0, $434 = 0; var $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0.0, $444 = 0.0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0.0; var $453 = 0.0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0.0, $465 = 0.0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0; var $471 = 0.0, $472 = 0.0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0.0, $48 = 0, $480 = 0.0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0.0, $488 = 0.0, $489 = 0; var $49 = 0, $490 = 0, $491 = 0, $492 = 0.0, $493 = 0.0, $494 = 0.0, $495 = 0, $496 = 0.0, $497 = 0, $498 = 0.0, $499 = 0.0, $5 = 0, $50 = 0, $500 = 0.0, $501 = 0.0, $502 = 0, $503 = 0.0, $504 = 0, $505 = 0.0, $506 = 0.0; var $507 = 0, $508 = 0.0, $509 = 0, $51 = 0, $510 = 0.0, $511 = 0.0, $512 = 0.0, $513 = 0.0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0; var $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0.0, $533 = 0.0, $534 = 0, $535 = 0, $536 = 0.0, $537 = 0.0, $538 = 0, $539 = 0.0, $54 = 0, $540 = 0, $541 = 0, $542 = 0.0; var $543 = 0.0, $544 = 0.0, $545 = 0, $546 = 0.0, $547 = 0.0, $548 = 0.0, $549 = 0, $55 = 0, $550 = 0, $551 = 0.0, $552 = 0, $553 = 0.0, $554 = 0, $555 = 0, $556 = 0.0, $557 = 0.0, $558 = 0, $559 = 0.0, $56 = 0, $560 = 0; var $561 = 0, $562 = 0.0, $563 = 0.0, $564 = 0.0, $565 = 0, $566 = 0.0, $567 = 0.0, $568 = 0.0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0.0, $579 = 0.0; var $58 = 0, $580 = 0, $581 = 0, $582 = 0.0, $583 = 0.0, $584 = 0, $585 = 0.0, $586 = 0, $587 = 0, $588 = 0.0, $589 = 0.0, $59 = 0, $590 = 0.0, $591 = 0, $592 = 0.0, $593 = 0.0, $594 = 0.0, $595 = 0, $596 = 0, $597 = 0; var $598 = 0.0, $599 = 0, $6 = 0, $60 = 0, $600 = 0.0, $601 = 0, $602 = 0, $603 = 0.0, $604 = 0.0, $605 = 0, $606 = 0.0, $607 = 0, $608 = 0, $609 = 0.0, $61 = 0, $610 = 0.0, $611 = 0.0, $612 = 0, $613 = 0.0, $614 = 0.0; var $615 = 0.0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0; var $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0; var $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0; var $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $comp = 0, $comp_num_verts = 0, $comp_verts = 0, $cx = 0, $cy = 0, $data = 0, $dx = 0, $dy = 0, $endPtsOfContours = 0, $flagcount = 0; var $flags = 0, $flags1 = 0, $g = 0, $gidx = 0, $i = 0, $i2 = 0, $ins = 0, $j = 0, $m = 0, $m3 = 0.0, $more = 0, $mtx = 0, $n = 0, $n4 = 0.0, $next_move = 0, $num_vertices = 0, $numberOfContours = 0, $off = 0, $points = 0, $scx = 0; var $scy = 0, $start_off = 0, $sx = 0, $sy = 0, $tmp = 0, $v = 0, $vertices = 0, $was_off = 0, $x = 0, $x5 = 0, $y = 0, $y6 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy5 = sp + 196|0; $$byval_copy4 = sp + 192|0; $$byval_copy3 = sp + 188|0; $$byval_copy2 = sp + 184|0; $$byval_copy1 = sp + 180|0; $$byval_copy = sp + 176|0; $comp_verts = sp + 44|0; $mtx = sp + 16|0; $1 = $info; $2 = $alloc; $3 = $glyph_index; $4 = $pvertices; $5 = $1; $6 = HEAP32[$5>>2]|0; $data = $6; $vertices = 0; $num_vertices = 0; $7 = $1; $8 = $3; $9 = (_nk_tt__GetGlyfOffset($7,$8)|0); $g = $9; $10 = $4; HEAP32[$10>>2] = 0; $11 = $g; $12 = ($11|0)<(0); if ($12) { $0 = 0; $683 = $0; STACKTOP = sp;return ($683|0); } $13 = $data; $14 = $g; $15 = (($13) + ($14)|0); $16 = (_nk_ttSHORT($15)|0); $numberOfContours = $16; $17 = $numberOfContours; $18 = $17 << 16 >> 16; $19 = ($18|0)>(0); L5: do { if ($19) { $flags = 0; $j = 0; $was_off = 0; $start_off = 0; $20 = $data; $21 = $g; $22 = (($20) + ($21)|0); $23 = ((($22)) + 10|0); $endPtsOfContours = $23; $24 = $data; $25 = $g; $26 = (($24) + ($25)|0); $27 = ((($26)) + 10|0); $28 = $numberOfContours; $29 = $28 << 16 >> 16; $30 = $29<<1; $31 = (($27) + ($30)|0); $32 = (_nk_ttUSHORT($31)|0); $33 = $32&65535; $ins = $33; $34 = $data; $35 = $g; $36 = (($34) + ($35)|0); $37 = ((($36)) + 10|0); $38 = $numberOfContours; $39 = $38 << 16 >> 16; $40 = $39<<1; $41 = (($37) + ($40)|0); $42 = ((($41)) + 2|0); $43 = $ins; $44 = (($42) + ($43)|0); $points = $44; $45 = $endPtsOfContours; $46 = $numberOfContours; $47 = $46 << 16 >> 16; $48 = $47<<1; $49 = (($45) + ($48)|0); $50 = ((($49)) + -2|0); $51 = (_nk_ttUSHORT($50)|0); $52 = $51&65535; $53 = (1 + ($52))|0; $n = $53; $54 = $n; $55 = $numberOfContours; $56 = $55 << 16 >> 16; $57 = $56<<1; $58 = (($54) + ($57))|0; $m = $58; $59 = $2; $60 = ((($59)) + 4|0); $61 = HEAP32[$60>>2]|0; $62 = $2; $63 = $m; $64 = ($63*10)|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$62>>2]|0; $65 = (FUNCTION_TABLE_iiii[$61 & 7]($$byval_copy,0,$64)|0); $vertices = $65; $66 = $vertices; $67 = ($66|0)==(0|0); if ($67) { $0 = 0; $683 = $0; STACKTOP = sp;return ($683|0); } $next_move = 0; $flagcount = 0; $68 = $m; $69 = $n; $70 = (($68) - ($69))|0; $off = $70; $i = 0; while(1) { $71 = $i; $72 = $n; $73 = ($71|0)<($72|0); if (!($73)) { break; } $74 = $flagcount; $75 = $74&255; $76 = ($75|0)==(0); if ($76) { $77 = $points; $78 = ((($77)) + 1|0); $points = $78; $79 = HEAP8[$77>>0]|0; $flags = $79; $80 = $flags; $81 = $80&255; $82 = $81 & 8; $83 = ($82|0)!=(0); if ($83) { $84 = $points; $85 = ((($84)) + 1|0); $points = $85; $86 = HEAP8[$84>>0]|0; $flagcount = $86; } } else { $87 = $flagcount; $88 = (($87) + -1)<<24>>24; $flagcount = $88; } $89 = $flags; $90 = $off; $91 = $i; $92 = (($90) + ($91))|0; $93 = $vertices; $94 = (($93) + (($92*10)|0)|0); $95 = ((($94)) + 8|0); HEAP8[$95>>0] = $89; $96 = $i; $97 = (($96) + 1)|0; $i = $97; } $x = 0; $i = 0; while(1) { $98 = $i; $99 = $n; $100 = ($98|0)<($99|0); if (!($100)) { break; } $101 = $off; $102 = $i; $103 = (($101) + ($102))|0; $104 = $vertices; $105 = (($104) + (($103*10)|0)|0); $106 = ((($105)) + 8|0); $107 = HEAP8[$106>>0]|0; $flags = $107; $108 = $flags; $109 = $108&255; $110 = $109 & 2; $111 = ($110|0)!=(0); if ($111) { $112 = $points; $113 = ((($112)) + 1|0); $points = $113; $114 = HEAP8[$112>>0]|0; $115 = $114&255; $dx = $115; $116 = $flags; $117 = $116&255; $118 = $117 & 16; $119 = ($118|0)!=(0); $120 = $dx; $121 = $120 << 16 >> 16; $122 = (0 - ($121))|0; $123 = $119 ? $121 : $122; $124 = $x; $125 = (($124) + ($123))|0; $x = $125; } else { $126 = $flags; $127 = $126&255; $128 = $127 & 16; $129 = ($128|0)!=(0); if (!($129)) { $130 = $x; $131 = $points; $132 = HEAP8[$131>>0]|0; $133 = $132&255; $134 = $133<<8; $135 = $points; $136 = ((($135)) + 1|0); $137 = HEAP8[$136>>0]|0; $138 = $137&255; $139 = (($134) + ($138))|0; $140 = $139&65535; $141 = $140 << 16 >> 16; $142 = (($130) + ($141))|0; $x = $142; $143 = $points; $144 = ((($143)) + 2|0); $points = $144; } } $145 = $x; $146 = $145&65535; $147 = $off; $148 = $i; $149 = (($147) + ($148))|0; $150 = $vertices; $151 = (($150) + (($149*10)|0)|0); HEAP16[$151>>1] = $146; $152 = $i; $153 = (($152) + 1)|0; $i = $153; } $y = 0; $i = 0; while(1) { $154 = $i; $155 = $n; $156 = ($154|0)<($155|0); if (!($156)) { break; } $157 = $off; $158 = $i; $159 = (($157) + ($158))|0; $160 = $vertices; $161 = (($160) + (($159*10)|0)|0); $162 = ((($161)) + 8|0); $163 = HEAP8[$162>>0]|0; $flags = $163; $164 = $flags; $165 = $164&255; $166 = $165 & 4; $167 = ($166|0)!=(0); if ($167) { $168 = $points; $169 = ((($168)) + 1|0); $points = $169; $170 = HEAP8[$168>>0]|0; $171 = $170&255; $dy = $171; $172 = $flags; $173 = $172&255; $174 = $173 & 32; $175 = ($174|0)!=(0); $176 = $dy; $177 = $176 << 16 >> 16; $178 = (0 - ($177))|0; $179 = $175 ? $177 : $178; $180 = $y; $181 = (($180) + ($179))|0; $y = $181; } else { $182 = $flags; $183 = $182&255; $184 = $183 & 32; $185 = ($184|0)!=(0); if (!($185)) { $186 = $y; $187 = $points; $188 = HEAP8[$187>>0]|0; $189 = $188&255; $190 = $189<<8; $191 = $points; $192 = ((($191)) + 1|0); $193 = HEAP8[$192>>0]|0; $194 = $193&255; $195 = (($190) + ($194))|0; $196 = $195&65535; $197 = $196 << 16 >> 16; $198 = (($186) + ($197))|0; $y = $198; $199 = $points; $200 = ((($199)) + 2|0); $points = $200; } } $201 = $y; $202 = $201&65535; $203 = $off; $204 = $i; $205 = (($203) + ($204))|0; $206 = $vertices; $207 = (($206) + (($205*10)|0)|0); $208 = ((($207)) + 2|0); HEAP16[$208>>1] = $202; $209 = $i; $210 = (($209) + 1)|0; $i = $210; } $num_vertices = 0; $scy = 0; $scx = 0; $cy = 0; $cx = 0; $sy = 0; $sx = 0; $i = 0; while(1) { $211 = $i; $212 = $n; $213 = ($211|0)<($212|0); if (!($213)) { break; } $214 = $off; $215 = $i; $216 = (($214) + ($215))|0; $217 = $vertices; $218 = (($217) + (($216*10)|0)|0); $219 = ((($218)) + 8|0); $220 = HEAP8[$219>>0]|0; $flags = $220; $221 = $off; $222 = $i; $223 = (($221) + ($222))|0; $224 = $vertices; $225 = (($224) + (($223*10)|0)|0); $226 = HEAP16[$225>>1]|0; $227 = $226 << 16 >> 16; $x = $227; $228 = $off; $229 = $i; $230 = (($228) + ($229))|0; $231 = $vertices; $232 = (($231) + (($230*10)|0)|0); $233 = ((($232)) + 2|0); $234 = HEAP16[$233>>1]|0; $235 = $234 << 16 >> 16; $y = $235; $236 = $next_move; $237 = $i; $238 = ($236|0)==($237|0); do { if ($238) { $239 = $i; $240 = ($239|0)!=(0); if ($240) { $241 = $vertices; $242 = $num_vertices; $243 = $was_off; $244 = $start_off; $245 = $sx; $246 = $sy; $247 = $scx; $248 = $scy; $249 = $cx; $250 = $cy; $251 = (_stbtt__close_shape($241,$242,$243,$244,$245,$246,$247,$248,$249,$250)|0); $num_vertices = $251; } $252 = $flags; $253 = $252&255; $254 = $253 & 1; $255 = ($254|0)!=(0); $256 = $255 ^ 1; $257 = $256&1; $start_off = $257; $258 = $start_off; $259 = ($258|0)!=(0); $260 = $x; do { if ($259) { $scx = $260; $261 = $y; $scy = $261; $262 = $off; $263 = $i; $264 = (($262) + ($263))|0; $265 = (($264) + 1)|0; $266 = $vertices; $267 = (($266) + (($265*10)|0)|0); $268 = ((($267)) + 8|0); $269 = HEAP8[$268>>0]|0; $270 = $269&255; $271 = $270 & 1; $272 = ($271|0)!=(0); if ($272) { $296 = $off; $297 = $i; $298 = (($296) + ($297))|0; $299 = (($298) + 1)|0; $300 = $vertices; $301 = (($300) + (($299*10)|0)|0); $302 = HEAP16[$301>>1]|0; $303 = $302 << 16 >> 16; $sx = $303; $304 = $off; $305 = $i; $306 = (($304) + ($305))|0; $307 = (($306) + 1)|0; $308 = $vertices; $309 = (($308) + (($307*10)|0)|0); $310 = ((($309)) + 2|0); $311 = HEAP16[$310>>1]|0; $312 = $311 << 16 >> 16; $sy = $312; $313 = $i; $314 = (($313) + 1)|0; $i = $314; break; } else { $273 = $x; $274 = $off; $275 = $i; $276 = (($274) + ($275))|0; $277 = (($276) + 1)|0; $278 = $vertices; $279 = (($278) + (($277*10)|0)|0); $280 = HEAP16[$279>>1]|0; $281 = $280 << 16 >> 16; $282 = (($273) + ($281))|0; $283 = $282 >> 1; $sx = $283; $284 = $y; $285 = $off; $286 = $i; $287 = (($285) + ($286))|0; $288 = (($287) + 1)|0; $289 = $vertices; $290 = (($289) + (($288*10)|0)|0); $291 = ((($290)) + 2|0); $292 = HEAP16[$291>>1]|0; $293 = $292 << 16 >> 16; $294 = (($284) + ($293))|0; $295 = $294 >> 1; $sy = $295; break; } } else { $sx = $260; $315 = $y; $sy = $315; } } while(0); $316 = $num_vertices; $317 = (($316) + 1)|0; $num_vertices = $317; $318 = $vertices; $319 = (($318) + (($316*10)|0)|0); $320 = $sx; $321 = $sy; _nk_tt_setvertex($319,1,$320,$321,0,0); $was_off = 0; $322 = $endPtsOfContours; $323 = $j; $324 = $323<<1; $325 = (($322) + ($324)|0); $326 = (_nk_ttUSHORT($325)|0); $327 = $326&65535; $328 = (1 + ($327))|0; $next_move = $328; $329 = $j; $330 = (($329) + 1)|0; $j = $330; } else { $331 = $flags; $332 = $331&255; $333 = $332 & 1; $334 = ($333|0)!=(0); $335 = $was_off; $336 = ($335|0)!=(0); if (!($334)) { if ($336) { $337 = $num_vertices; $338 = (($337) + 1)|0; $num_vertices = $338; $339 = $vertices; $340 = (($339) + (($337*10)|0)|0); $341 = $cx; $342 = $x; $343 = (($341) + ($342))|0; $344 = $343 >> 1; $345 = $cy; $346 = $y; $347 = (($345) + ($346))|0; $348 = $347 >> 1; $349 = $cx; $350 = $cy; _nk_tt_setvertex($340,3,$344,$348,$349,$350); } $351 = $x; $cx = $351; $352 = $y; $cy = $352; $was_off = 1; break; } $353 = $num_vertices; $354 = (($353) + 1)|0; $num_vertices = $354; $355 = $vertices; $356 = (($355) + (($353*10)|0)|0); $357 = $x; $358 = $y; if ($336) { $359 = $cx; $360 = $cy; _nk_tt_setvertex($356,3,$357,$358,$359,$360); } else { _nk_tt_setvertex($356,2,$357,$358,0,0); } $was_off = 0; } } while(0); $361 = $i; $362 = (($361) + 1)|0; $i = $362; } $363 = $vertices; $364 = $num_vertices; $365 = $was_off; $366 = $start_off; $367 = $sx; $368 = $sy; $369 = $scx; $370 = $scy; $371 = $cx; $372 = $cy; $373 = (_stbtt__close_shape($363,$364,$365,$366,$367,$368,$369,$370,$371,$372)|0); $num_vertices = $373; } else { $374 = $numberOfContours; $375 = $374 << 16 >> 16; $376 = ($375|0)==(-1); if (!($376)) { $677 = $numberOfContours; $678 = $677 << 16 >> 16; $679 = ($678|0)<(0); if (!($679)) { break; } ___assert_fail((30507|0),(13400|0),7592,(30589|0)); // unreachable; } $more = 1; $377 = $data; $378 = $g; $379 = (($377) + ($378)|0); $380 = ((($379)) + 10|0); $comp = $380; $num_vertices = 0; $vertices = 0; while(1) { $381 = $more; $382 = ($381|0)!=(0); if (!($382)) { break L5; } $comp_num_verts = 0; HEAP32[$comp_verts>>2] = 0; $tmp = 0; ;HEAP32[$mtx>>2]=HEAP32[12564>>2]|0;HEAP32[$mtx+4>>2]=HEAP32[12564+4>>2]|0;HEAP32[$mtx+8>>2]=HEAP32[12564+8>>2]|0;HEAP32[$mtx+12>>2]=HEAP32[12564+12>>2]|0;HEAP32[$mtx+16>>2]=HEAP32[12564+16>>2]|0;HEAP32[$mtx+20>>2]=HEAP32[12564+20>>2]|0; $383 = $comp; $384 = (_nk_ttSHORT($383)|0); $flags1 = $384; $385 = $comp; $386 = ((($385)) + 2|0); $comp = $386; $387 = $comp; $388 = (_nk_ttSHORT($387)|0); $gidx = $388; $389 = $comp; $390 = ((($389)) + 2|0); $comp = $390; $391 = $flags1; $392 = $391&65535; $393 = $392 & 2; $394 = ($393|0)!=(0); if (!($394)) { label = 55; break; } $395 = $flags1; $396 = $395&65535; $397 = $396 & 1; $398 = ($397|0)!=(0); $399 = $comp; if ($398) { $400 = (_nk_ttSHORT($399)|0); $401 = (+($400<<16>>16)); $402 = ((($mtx)) + 16|0); HEAPF32[$402>>2] = $401; $403 = $comp; $404 = ((($403)) + 2|0); $comp = $404; $405 = $comp; $406 = (_nk_ttSHORT($405)|0); $407 = (+($406<<16>>16)); $408 = ((($mtx)) + 20|0); HEAPF32[$408>>2] = $407; $409 = $comp; $410 = ((($409)) + 2|0); $comp = $410; } else { $411 = HEAP8[$399>>0]|0; $412 = (+($411<<24>>24)); $413 = ((($mtx)) + 16|0); HEAPF32[$413>>2] = $412; $414 = $comp; $415 = ((($414)) + 1|0); $comp = $415; $416 = $comp; $417 = HEAP8[$416>>0]|0; $418 = (+($417<<24>>24)); $419 = ((($mtx)) + 20|0); HEAPF32[$419>>2] = $418; $420 = $comp; $421 = ((($420)) + 1|0); $comp = $421; } $422 = $flags1; $423 = $422&65535; $424 = $423 & 8; $425 = ($424|0)!=(0); do { if ($425) { $426 = $comp; $427 = (_nk_ttSHORT($426)|0); $428 = $427 << 16 >> 16; $429 = (+($428|0)); $430 = $429 / 16384.0; $431 = ((($mtx)) + 12|0); HEAPF32[$431>>2] = $430; HEAPF32[$mtx>>2] = $430; $432 = $comp; $433 = ((($432)) + 2|0); $comp = $433; $434 = ((($mtx)) + 8|0); HEAPF32[$434>>2] = 0.0; $435 = ((($mtx)) + 4|0); HEAPF32[$435>>2] = 0.0; } else { $436 = $flags1; $437 = $436&65535; $438 = $437 & 64; $439 = ($438|0)!=(0); if ($439) { $440 = $comp; $441 = (_nk_ttSHORT($440)|0); $442 = $441 << 16 >> 16; $443 = (+($442|0)); $444 = $443 / 16384.0; HEAPF32[$mtx>>2] = $444; $445 = $comp; $446 = ((($445)) + 2|0); $comp = $446; $447 = ((($mtx)) + 8|0); HEAPF32[$447>>2] = 0.0; $448 = ((($mtx)) + 4|0); HEAPF32[$448>>2] = 0.0; $449 = $comp; $450 = (_nk_ttSHORT($449)|0); $451 = $450 << 16 >> 16; $452 = (+($451|0)); $453 = $452 / 16384.0; $454 = ((($mtx)) + 12|0); HEAPF32[$454>>2] = $453; $455 = $comp; $456 = ((($455)) + 2|0); $comp = $456; break; } $457 = $flags1; $458 = $457&65535; $459 = $458 & 128; $460 = ($459|0)!=(0); if ($460) { $461 = $comp; $462 = (_nk_ttSHORT($461)|0); $463 = $462 << 16 >> 16; $464 = (+($463|0)); $465 = $464 / 16384.0; HEAPF32[$mtx>>2] = $465; $466 = $comp; $467 = ((($466)) + 2|0); $comp = $467; $468 = $comp; $469 = (_nk_ttSHORT($468)|0); $470 = $469 << 16 >> 16; $471 = (+($470|0)); $472 = $471 / 16384.0; $473 = ((($mtx)) + 4|0); HEAPF32[$473>>2] = $472; $474 = $comp; $475 = ((($474)) + 2|0); $comp = $475; $476 = $comp; $477 = (_nk_ttSHORT($476)|0); $478 = $477 << 16 >> 16; $479 = (+($478|0)); $480 = $479 / 16384.0; $481 = ((($mtx)) + 8|0); HEAPF32[$481>>2] = $480; $482 = $comp; $483 = ((($482)) + 2|0); $comp = $483; $484 = $comp; $485 = (_nk_ttSHORT($484)|0); $486 = $485 << 16 >> 16; $487 = (+($486|0)); $488 = $487 / 16384.0; $489 = ((($mtx)) + 12|0); HEAPF32[$489>>2] = $488; $490 = $comp; $491 = ((($490)) + 2|0); $comp = $491; } } } while(0); $492 = +HEAPF32[$mtx>>2]; $493 = +HEAPF32[$mtx>>2]; $494 = $492 * $493; $495 = ((($mtx)) + 4|0); $496 = +HEAPF32[$495>>2]; $497 = ((($mtx)) + 4|0); $498 = +HEAPF32[$497>>2]; $499 = $496 * $498; $500 = $494 + $499; $501 = (+_nk_sqrt($500)); $m3 = $501; $502 = ((($mtx)) + 8|0); $503 = +HEAPF32[$502>>2]; $504 = ((($mtx)) + 8|0); $505 = +HEAPF32[$504>>2]; $506 = $503 * $505; $507 = ((($mtx)) + 12|0); $508 = +HEAPF32[$507>>2]; $509 = ((($mtx)) + 12|0); $510 = +HEAPF32[$509>>2]; $511 = $508 * $510; $512 = $506 + $511; $513 = (+_nk_sqrt($512)); $n4 = $513; $514 = $1; $515 = $2; $516 = $gidx; $517 = $516&65535; $518 = (_nk_tt_GetGlyphShape($514,$515,$517,$comp_verts)|0); $comp_num_verts = $518; $519 = $comp_num_verts; $520 = ($519|0)>(0); if ($520) { $i2 = 0; while(1) { $521 = $i2; $522 = $comp_num_verts; $523 = ($521|0)<($522|0); if (!($523)) { break; } $524 = $i2; $525 = HEAP32[$comp_verts>>2]|0; $526 = (($525) + (($524*10)|0)|0); $v = $526; $527 = $v; $528 = HEAP16[$527>>1]|0; $x5 = $528; $529 = $v; $530 = ((($529)) + 2|0); $531 = HEAP16[$530>>1]|0; $y6 = $531; $532 = $m3; $533 = +HEAPF32[$mtx>>2]; $534 = $x5; $535 = $534 << 16 >> 16; $536 = (+($535|0)); $537 = $533 * $536; $538 = ((($mtx)) + 8|0); $539 = +HEAPF32[$538>>2]; $540 = $y6; $541 = $540 << 16 >> 16; $542 = (+($541|0)); $543 = $539 * $542; $544 = $537 + $543; $545 = ((($mtx)) + 16|0); $546 = +HEAPF32[$545>>2]; $547 = $544 + $546; $548 = $532 * $547; $549 = (~~(($548))); $550 = $v; HEAP16[$550>>1] = $549; $551 = $n4; $552 = ((($mtx)) + 4|0); $553 = +HEAPF32[$552>>2]; $554 = $x5; $555 = $554 << 16 >> 16; $556 = (+($555|0)); $557 = $553 * $556; $558 = ((($mtx)) + 12|0); $559 = +HEAPF32[$558>>2]; $560 = $y6; $561 = $560 << 16 >> 16; $562 = (+($561|0)); $563 = $559 * $562; $564 = $557 + $563; $565 = ((($mtx)) + 20|0); $566 = +HEAPF32[$565>>2]; $567 = $564 + $566; $568 = $551 * $567; $569 = (~~(($568))); $570 = $v; $571 = ((($570)) + 2|0); HEAP16[$571>>1] = $569; $572 = $v; $573 = ((($572)) + 4|0); $574 = HEAP16[$573>>1]|0; $x5 = $574; $575 = $v; $576 = ((($575)) + 6|0); $577 = HEAP16[$576>>1]|0; $y6 = $577; $578 = $m3; $579 = +HEAPF32[$mtx>>2]; $580 = $x5; $581 = $580 << 16 >> 16; $582 = (+($581|0)); $583 = $579 * $582; $584 = ((($mtx)) + 8|0); $585 = +HEAPF32[$584>>2]; $586 = $y6; $587 = $586 << 16 >> 16; $588 = (+($587|0)); $589 = $585 * $588; $590 = $583 + $589; $591 = ((($mtx)) + 16|0); $592 = +HEAPF32[$591>>2]; $593 = $590 + $592; $594 = $578 * $593; $595 = (~~(($594))); $596 = $v; $597 = ((($596)) + 4|0); HEAP16[$597>>1] = $595; $598 = $n4; $599 = ((($mtx)) + 4|0); $600 = +HEAPF32[$599>>2]; $601 = $x5; $602 = $601 << 16 >> 16; $603 = (+($602|0)); $604 = $600 * $603; $605 = ((($mtx)) + 12|0); $606 = +HEAPF32[$605>>2]; $607 = $y6; $608 = $607 << 16 >> 16; $609 = (+($608|0)); $610 = $606 * $609; $611 = $604 + $610; $612 = ((($mtx)) + 20|0); $613 = +HEAPF32[$612>>2]; $614 = $611 + $613; $615 = $598 * $614; $616 = (~~(($615))); $617 = $v; $618 = ((($617)) + 6|0); HEAP16[$618>>1] = $616; $619 = $i2; $620 = (($619) + 1)|0; $i2 = $620; } $621 = $2; $622 = ((($621)) + 4|0); $623 = HEAP32[$622>>2]|0; $624 = $2; $625 = $num_vertices; $626 = $comp_num_verts; $627 = (($625) + ($626))|0; $628 = ($627*10)|0; ;HEAP32[$$byval_copy1>>2]=HEAP32[$624>>2]|0; $629 = (FUNCTION_TABLE_iiii[$623 & 7]($$byval_copy1,0,$628)|0); $tmp = $629; $630 = $tmp; $631 = ($630|0)!=(0|0); if (!($631)) { break; } $646 = $num_vertices; $647 = ($646|0)>(0); if ($647) { $648 = $tmp; $649 = $vertices; $650 = $num_vertices; $651 = ($650*10)|0; (_nk_memcopy($648,$649,$651)|0); } $652 = $tmp; $653 = $num_vertices; $654 = (($652) + (($653*10)|0)|0); $655 = HEAP32[$comp_verts>>2]|0; $656 = $comp_num_verts; $657 = ($656*10)|0; (_nk_memcopy($654,$655,$657)|0); $658 = $vertices; $659 = ($658|0)!=(0|0); if ($659) { $660 = $2; $661 = ((($660)) + 8|0); $662 = HEAP32[$661>>2]|0; $663 = $2; $664 = $vertices; ;HEAP32[$$byval_copy4>>2]=HEAP32[$663>>2]|0; FUNCTION_TABLE_vii[$662 & 31]($$byval_copy4,$664); } $665 = $tmp; $vertices = $665; $666 = $2; $667 = ((($666)) + 8|0); $668 = HEAP32[$667>>2]|0; $669 = $2; $670 = HEAP32[$comp_verts>>2]|0; ;HEAP32[$$byval_copy5>>2]=HEAP32[$669>>2]|0; FUNCTION_TABLE_vii[$668 & 31]($$byval_copy5,$670); $671 = $comp_num_verts; $672 = $num_vertices; $673 = (($672) + ($671))|0; $num_vertices = $673; } $674 = $flags1; $675 = $674&65535; $676 = $675 & 32; $more = $676; } if ((label|0) == 55) { ___assert_fail((30507|0),(13400|0),7537,(30589|0)); // unreachable; } $632 = $vertices; $633 = ($632|0)!=(0|0); if ($633) { $634 = $2; $635 = ((($634)) + 8|0); $636 = HEAP32[$635>>2]|0; $637 = $2; $638 = $vertices; ;HEAP32[$$byval_copy2>>2]=HEAP32[$637>>2]|0; FUNCTION_TABLE_vii[$636 & 31]($$byval_copy2,$638); } $639 = HEAP32[$comp_verts>>2]|0; $640 = ($639|0)!=(0|0); if ($640) { $641 = $2; $642 = ((($641)) + 8|0); $643 = HEAP32[$642>>2]|0; $644 = $2; $645 = HEAP32[$comp_verts>>2]|0; ;HEAP32[$$byval_copy3>>2]=HEAP32[$644>>2]|0; FUNCTION_TABLE_vii[$643 & 31]($$byval_copy3,$645); } $0 = 0; $683 = $0; STACKTOP = sp;return ($683|0); } } while(0); $680 = $vertices; $681 = $4; HEAP32[$681>>2] = $680; $682 = $num_vertices; $0 = $682; $683 = $0; STACKTOP = sp;return ($683|0); } function _nk_tt_Rasterize($result,$flatness_in_pixels,$vertices,$num_verts,$scale_x,$scale_y,$shift_x,$shift_y,$x_off,$y_off,$invert,$alloc) { $result = $result|0; $flatness_in_pixels = +$flatness_in_pixels; $vertices = $vertices|0; $num_verts = $num_verts|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $x_off = $x_off|0; $y_off = $y_off|0; $invert = $invert|0; $alloc = $alloc|0; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0; var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $scale = 0.0, $winding_count = 0, $winding_lengths = 0, $windings = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy1 = sp + 68|0; $$byval_copy = sp + 64|0; $winding_count = sp + 8|0; $winding_lengths = sp + 4|0; $0 = $result; $1 = $flatness_in_pixels; $2 = $vertices; $3 = $num_verts; $4 = $scale_x; $5 = $scale_y; $6 = $shift_x; $7 = $shift_y; $8 = $x_off; $9 = $y_off; $10 = $invert; $11 = $alloc; $12 = $4; $13 = $5; $14 = $12 > $13; $15 = $5; $16 = $4; $17 = $14 ? $15 : $16; $scale = $17; $18 = $2; $19 = $3; $20 = $1; $21 = $scale; $22 = $20 / $21; $23 = $11; $24 = (_nk_tt_FlattenCurves($18,$19,$22,$winding_lengths,$winding_count,$23)|0); $windings = $24; $25 = $11; $26 = ($25|0)!=(0|0); if (!($26)) { ___assert_fail((15055|0),(13400|0),8301,(30609|0)); // unreachable; } $27 = $windings; $28 = ($27|0)!=(0|0); if (!($28)) { STACKTOP = sp;return; } $29 = $0; $30 = $windings; $31 = HEAP32[$winding_lengths>>2]|0; $32 = HEAP32[$winding_count>>2]|0; $33 = $4; $34 = $5; $35 = $6; $36 = $7; $37 = $8; $38 = $9; $39 = $10; $40 = $11; _nk_tt__rasterize($29,$30,$31,$32,$33,$34,$35,$36,$37,$38,$39,$40); $41 = $11; $42 = ((($41)) + 8|0); $43 = HEAP32[$42>>2]|0; $44 = $11; $45 = HEAP32[$winding_lengths>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$44>>2]|0; FUNCTION_TABLE_vii[$43 & 31]($$byval_copy,$45); $46 = $11; $47 = ((($46)) + 8|0); $48 = HEAP32[$47>>2]|0; $49 = $11; $50 = $windings; ;HEAP32[$$byval_copy1>>2]=HEAP32[$49>>2]|0; FUNCTION_TABLE_vii[$48 & 31]($$byval_copy1,$50); STACKTOP = sp;return; } function _stbtt__close_shape($vertices,$num_vertices,$was_off,$start_off,$sx,$sy,$scx,$scy,$cx,$cy) { $vertices = $vertices|0; $num_vertices = $num_vertices|0; $was_off = $was_off|0; $start_off = $start_off|0; $sx = $sx|0; $sy = $sy|0; $scx = $scx|0; $scy = $scy|0; $cx = $cx|0; $cy = $cy|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $vertices; $1 = $num_vertices; $2 = $was_off; $3 = $start_off; $4 = $sx; $5 = $sy; $6 = $scx; $7 = $scy; $8 = $cx; $9 = $cy; $10 = $3; $11 = ($10|0)!=(0); $12 = $2; $13 = ($12|0)!=(0); if ($11) { if ($13) { $14 = $1; $15 = (($14) + 1)|0; $1 = $15; $16 = $0; $17 = (($16) + (($14*10)|0)|0); $18 = $8; $19 = $6; $20 = (($18) + ($19))|0; $21 = $20 >> 1; $22 = $9; $23 = $7; $24 = (($22) + ($23))|0; $25 = $24 >> 1; $26 = $8; $27 = $9; _nk_tt_setvertex($17,3,$21,$25,$26,$27); } $28 = $1; $29 = (($28) + 1)|0; $1 = $29; $30 = $0; $31 = (($30) + (($28*10)|0)|0); $32 = $4; $33 = $5; $34 = $6; $35 = $7; _nk_tt_setvertex($31,3,$32,$33,$34,$35); $44 = $1; STACKTOP = sp;return ($44|0); } $36 = $1; $37 = (($36) + 1)|0; $1 = $37; $38 = $0; $39 = (($38) + (($36*10)|0)|0); $40 = $4; $41 = $5; if ($13) { $42 = $8; $43 = $9; _nk_tt_setvertex($39,3,$40,$41,$42,$43); $44 = $1; STACKTOP = sp;return ($44|0); } else { _nk_tt_setvertex($39,2,$40,$41,0,0); $44 = $1; STACKTOP = sp;return ($44|0); } return (0)|0; } function _nk_tt_setvertex($v,$type,$x,$y,$cx,$cy) { $v = $v|0; $type = $type|0; $x = $x|0; $y = $y|0; $cx = $cx|0; $cy = $cy|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $v; $1 = $type; $2 = $x; $3 = $y; $4 = $cx; $5 = $cy; $6 = $1; $7 = $0; $8 = ((($7)) + 8|0); HEAP8[$8>>0] = $6; $9 = $2; $10 = $9&65535; $11 = $0; HEAP16[$11>>1] = $10; $12 = $3; $13 = $12&65535; $14 = $0; $15 = ((($14)) + 2|0); HEAP16[$15>>1] = $13; $16 = $4; $17 = $16&65535; $18 = $0; $19 = ((($18)) + 4|0); HEAP16[$19>>1] = $17; $20 = $5; $21 = $20&65535; $22 = $0; $23 = ((($22)) + 6|0); HEAP16[$23>>1] = $21; STACKTOP = sp;return; } function _nk_sqrt($x) { $x = +$x; var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $x; $1 = $0; $2 = $0; $3 = (+_nk_inv_sqrt($2)); $4 = $1 * $3; STACKTOP = sp;return (+$4); } function _nk_tt_FlattenCurves($vertices,$num_verts,$objspace_flatness,$contour_lengths,$num_contours,$alloc) { $vertices = $vertices|0; $num_verts = $num_verts|0; $objspace_flatness = +$objspace_flatness; $contour_lengths = $contour_lengths|0; $num_contours = $num_contours|0; $alloc = $alloc|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; var $112 = 0, $113 = 0, $114 = 0.0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; var $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0.0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0; var $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0; var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0; var $69 = 0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0.0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0, $86 = 0; var $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $i = 0, $n = 0, $num_points = 0, $objspace_flatness_squared = 0.0, $pass = 0, $points = 0; var $start = 0, $x = 0.0, $y = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy3 = sp + 76|0; $$byval_copy2 = sp + 72|0; $$byval_copy1 = sp + 68|0; $$byval_copy = sp + 64|0; $num_points = sp + 28|0; $1 = $vertices; $2 = $num_verts; $3 = $objspace_flatness; $4 = $contour_lengths; $5 = $num_contours; $6 = $alloc; $points = 0; HEAP32[$num_points>>2] = 0; $7 = $3; $8 = $3; $9 = $7 * $8; $objspace_flatness_squared = $9; $n = 0; $start = 0; $i = 0; while(1) { $10 = $i; $11 = $2; $12 = ($10|0)<($11|0); if (!($12)) { break; } $13 = $i; $14 = $1; $15 = (($14) + (($13*10)|0)|0); $16 = ((($15)) + 8|0); $17 = HEAP8[$16>>0]|0; $18 = $17&255; $19 = ($18|0)==(1); if ($19) { $20 = $n; $21 = (($20) + 1)|0; $n = $21; } $22 = $i; $23 = (($22) + 1)|0; $i = $23; } $24 = $n; $25 = $5; HEAP32[$25>>2] = $24; $26 = $n; $27 = ($26|0)==(0); if ($27) { $0 = 0; $169 = $0; STACKTOP = sp;return ($169|0); } $28 = $6; $29 = ((($28)) + 4|0); $30 = HEAP32[$29>>2]|0; $31 = $6; $32 = $n; $33 = $32<<2; ;HEAP32[$$byval_copy>>2]=HEAP32[$31>>2]|0; $34 = (FUNCTION_TABLE_iiii[$30 & 7]($$byval_copy,0,$33)|0); $35 = $4; HEAP32[$35>>2] = $34; $36 = $4; $37 = HEAP32[$36>>2]|0; $38 = ($37|0)==(0|0); if ($38) { $39 = $5; HEAP32[$39>>2] = 0; $0 = 0; $169 = $0; STACKTOP = sp;return ($169|0); } $pass = 0; while(1) { $40 = $pass; $41 = ($40|0)<(2); if (!($41)) { label = 24; break; } $x = 0.0; $y = 0.0; $42 = $pass; $43 = ($42|0)==(1); if ($43) { $44 = $6; $45 = ((($44)) + 4|0); $46 = HEAP32[$45>>2]|0; $47 = $6; $48 = HEAP32[$num_points>>2]|0; $49 = $48<<3; ;HEAP32[$$byval_copy1>>2]=HEAP32[$47>>2]|0; $50 = (FUNCTION_TABLE_iiii[$46 & 7]($$byval_copy1,0,$49)|0); $points = $50; $51 = $points; $52 = ($51|0)==(0|0); if ($52) { label = 25; break; } } HEAP32[$num_points>>2] = 0; $n = -1; $i = 0; while(1) { $53 = $i; $54 = $2; $55 = ($53|0)<($54|0); if (!($55)) { break; } $56 = $i; $57 = $1; $58 = (($57) + (($56*10)|0)|0); $59 = ((($58)) + 8|0); $60 = HEAP8[$59>>0]|0; $61 = $60&255; switch ($61|0) { case 1: { $62 = $n; $63 = ($62|0)>=(0); if ($63) { $64 = HEAP32[$num_points>>2]|0; $65 = $start; $66 = (($64) - ($65))|0; $67 = $n; $68 = $4; $69 = HEAP32[$68>>2]|0; $70 = (($69) + ($67<<2)|0); HEAP32[$70>>2] = $66; } $71 = $n; $72 = (($71) + 1)|0; $n = $72; $73 = HEAP32[$num_points>>2]|0; $start = $73; $74 = $i; $75 = $1; $76 = (($75) + (($74*10)|0)|0); $77 = HEAP16[$76>>1]|0; $78 = (+($77<<16>>16)); $x = $78; $79 = $i; $80 = $1; $81 = (($80) + (($79*10)|0)|0); $82 = ((($81)) + 2|0); $83 = HEAP16[$82>>1]|0; $84 = (+($83<<16>>16)); $y = $84; $85 = $points; $86 = HEAP32[$num_points>>2]|0; $87 = (($86) + 1)|0; HEAP32[$num_points>>2] = $87; $88 = $x; $89 = $y; _nk_tt__add_point($85,$86,$88,$89); break; } case 2: { $90 = $i; $91 = $1; $92 = (($91) + (($90*10)|0)|0); $93 = HEAP16[$92>>1]|0; $94 = (+($93<<16>>16)); $x = $94; $95 = $i; $96 = $1; $97 = (($96) + (($95*10)|0)|0); $98 = ((($97)) + 2|0); $99 = HEAP16[$98>>1]|0; $100 = (+($99<<16>>16)); $y = $100; $101 = $points; $102 = HEAP32[$num_points>>2]|0; $103 = (($102) + 1)|0; HEAP32[$num_points>>2] = $103; $104 = $x; $105 = $y; _nk_tt__add_point($101,$102,$104,$105); break; } case 3: { $106 = $points; $107 = $x; $108 = $y; $109 = $i; $110 = $1; $111 = (($110) + (($109*10)|0)|0); $112 = ((($111)) + 4|0); $113 = HEAP16[$112>>1]|0; $114 = (+($113<<16>>16)); $115 = $i; $116 = $1; $117 = (($116) + (($115*10)|0)|0); $118 = ((($117)) + 6|0); $119 = HEAP16[$118>>1]|0; $120 = (+($119<<16>>16)); $121 = $i; $122 = $1; $123 = (($122) + (($121*10)|0)|0); $124 = HEAP16[$123>>1]|0; $125 = (+($124<<16>>16)); $126 = $i; $127 = $1; $128 = (($127) + (($126*10)|0)|0); $129 = ((($128)) + 2|0); $130 = HEAP16[$129>>1]|0; $131 = (+($130<<16>>16)); $132 = $objspace_flatness_squared; (_nk_tt__tesselate_curve($106,$num_points,$107,$108,$114,$120,$125,$131,$132,0)|0); $133 = $i; $134 = $1; $135 = (($134) + (($133*10)|0)|0); $136 = HEAP16[$135>>1]|0; $137 = (+($136<<16>>16)); $x = $137; $138 = $i; $139 = $1; $140 = (($139) + (($138*10)|0)|0); $141 = ((($140)) + 2|0); $142 = HEAP16[$141>>1]|0; $143 = (+($142<<16>>16)); $y = $143; break; } default: { } } $144 = $i; $145 = (($144) + 1)|0; $i = $145; } $146 = HEAP32[$num_points>>2]|0; $147 = $start; $148 = (($146) - ($147))|0; $149 = $n; $150 = $4; $151 = HEAP32[$150>>2]|0; $152 = (($151) + ($149<<2)|0); HEAP32[$152>>2] = $148; $153 = $pass; $154 = (($153) + 1)|0; $pass = $154; } if ((label|0) == 24) { $155 = $points; $0 = $155; $169 = $0; STACKTOP = sp;return ($169|0); } else if ((label|0) == 25) { $156 = $6; $157 = ((($156)) + 8|0); $158 = HEAP32[$157>>2]|0; $159 = $6; $160 = $points; ;HEAP32[$$byval_copy2>>2]=HEAP32[$159>>2]|0; FUNCTION_TABLE_vii[$158 & 31]($$byval_copy2,$160); $161 = $6; $162 = ((($161)) + 8|0); $163 = HEAP32[$162>>2]|0; $164 = $6; $165 = $4; $166 = HEAP32[$165>>2]|0; ;HEAP32[$$byval_copy3>>2]=HEAP32[$164>>2]|0; FUNCTION_TABLE_vii[$163 & 31]($$byval_copy3,$166); $167 = $4; HEAP32[$167>>2] = 0; $168 = $5; HEAP32[$168>>2] = 0; $0 = 0; $169 = $0; STACKTOP = sp;return ($169|0); } return (0)|0; } function _nk_tt__rasterize($result,$pts,$wcount,$windings,$scale_x,$scale_y,$shift_x,$shift_y,$off_x,$off_y,$invert,$alloc) { $result = $result|0; $pts = $pts|0; $wcount = $wcount|0; $windings = $windings|0; $scale_x = +$scale_x; $scale_y = +$scale_y; $shift_x = +$shift_x; $shift_y = +$shift_y; $off_x = $off_x|0; $off_y = $off_y|0; $invert = $invert|0; $alloc = $alloc|0; var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0; var $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0; var $132 = 0.0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0.0, $140 = 0, $141 = 0.0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0.0; var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0.0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0; var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0; var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0; var $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0.0; var $68 = 0, $69 = 0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0; var $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $a = 0, $b = 0, $e = 0, $i = 0, $j = 0; var $k = 0, $m = 0, $n = 0, $p = 0, $vsubsample = 0, $y_scale_inv = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy1 = sp + 96|0; $$byval_copy = sp + 92|0; $0 = $result; $1 = $pts; $2 = $wcount; $3 = $windings; $4 = $scale_x; $5 = $scale_y; $6 = $shift_x; $7 = $shift_y; $8 = $off_x; $9 = $off_y; $10 = $invert; $11 = $alloc; $12 = $10; $13 = ($12|0)!=(0); $14 = $5; $15 = -$14; $16 = $13 ? $15 : $14; $y_scale_inv = $16; $vsubsample = 1; $n = 0; $i = 0; while(1) { $17 = $i; $18 = $3; $19 = ($17|0)<($18|0); if (!($19)) { break; } $20 = $i; $21 = $2; $22 = (($21) + ($20<<2)|0); $23 = HEAP32[$22>>2]|0; $24 = $n; $25 = (($24) + ($23))|0; $n = $25; $26 = $i; $27 = (($26) + 1)|0; $i = $27; } $28 = $11; $29 = ((($28)) + 4|0); $30 = HEAP32[$29>>2]|0; $31 = $11; $32 = $n; $33 = (($32) + 1)|0; $34 = ($33*20)|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$31>>2]|0; $35 = (FUNCTION_TABLE_iiii[$30 & 7]($$byval_copy,0,$34)|0); $e = $35; $36 = $e; $37 = ($36|0)==(0|0); if ($37) { STACKTOP = sp;return; } $n = 0; $m = 0; $i = 0; while(1) { $38 = $i; $39 = $3; $40 = ($38|0)<($39|0); if (!($40)) { break; } $41 = $1; $42 = $m; $43 = (($41) + ($42<<3)|0); $p = $43; $44 = $i; $45 = $2; $46 = (($45) + ($44<<2)|0); $47 = HEAP32[$46>>2]|0; $48 = $m; $49 = (($48) + ($47))|0; $m = $49; $50 = $i; $51 = $2; $52 = (($51) + ($50<<2)|0); $53 = HEAP32[$52>>2]|0; $54 = (($53) - 1)|0; $j = $54; $k = 0; while(1) { $55 = $k; $56 = $i; $57 = $2; $58 = (($57) + ($56<<2)|0); $59 = HEAP32[$58>>2]|0; $60 = ($55|0)<($59|0); if (!($60)) { break; } $61 = $k; $a = $61; $62 = $j; $b = $62; $63 = $j; $64 = $p; $65 = (($64) + ($63<<3)|0); $66 = ((($65)) + 4|0); $67 = +HEAPF32[$66>>2]; $68 = $k; $69 = $p; $70 = (($69) + ($68<<3)|0); $71 = ((($70)) + 4|0); $72 = +HEAPF32[$71>>2]; $73 = $67 == $72; if (!($73)) { $74 = $n; $75 = $e; $76 = (($75) + (($74*20)|0)|0); $77 = ((($76)) + 16|0); HEAP32[$77>>2] = 0; $78 = $10; $79 = ($78|0)!=(0); $80 = $j; $81 = $p; $82 = (($81) + ($80<<3)|0); $83 = ((($82)) + 4|0); $84 = +HEAPF32[$83>>2]; $85 = $k; $86 = $p; $87 = (($86) + ($85<<3)|0); $88 = ((($87)) + 4|0); $89 = +HEAPF32[$88>>2]; if ($79) { $90 = $84 > $89; if ($90) { label = 13; } } else { $91 = $84 < $89; if ($91) { label = 13; } } if ((label|0) == 13) { label = 0; $92 = $n; $93 = $e; $94 = (($93) + (($92*20)|0)|0); $95 = ((($94)) + 16|0); HEAP32[$95>>2] = 1; $96 = $j; $a = $96; $97 = $k; $b = $97; } $98 = $a; $99 = $p; $100 = (($99) + ($98<<3)|0); $101 = +HEAPF32[$100>>2]; $102 = $4; $103 = $101 * $102; $104 = $6; $105 = $103 + $104; $106 = $n; $107 = $e; $108 = (($107) + (($106*20)|0)|0); HEAPF32[$108>>2] = $105; $109 = $a; $110 = $p; $111 = (($110) + ($109<<3)|0); $112 = ((($111)) + 4|0); $113 = +HEAPF32[$112>>2]; $114 = $y_scale_inv; $115 = $113 * $114; $116 = $7; $117 = $115 + $116; $118 = $vsubsample; $119 = (+($118|0)); $120 = $117 * $119; $121 = $n; $122 = $e; $123 = (($122) + (($121*20)|0)|0); $124 = ((($123)) + 4|0); HEAPF32[$124>>2] = $120; $125 = $b; $126 = $p; $127 = (($126) + ($125<<3)|0); $128 = +HEAPF32[$127>>2]; $129 = $4; $130 = $128 * $129; $131 = $6; $132 = $130 + $131; $133 = $n; $134 = $e; $135 = (($134) + (($133*20)|0)|0); $136 = ((($135)) + 8|0); HEAPF32[$136>>2] = $132; $137 = $b; $138 = $p; $139 = (($138) + ($137<<3)|0); $140 = ((($139)) + 4|0); $141 = +HEAPF32[$140>>2]; $142 = $y_scale_inv; $143 = $141 * $142; $144 = $7; $145 = $143 + $144; $146 = $vsubsample; $147 = (+($146|0)); $148 = $145 * $147; $149 = $n; $150 = $e; $151 = (($150) + (($149*20)|0)|0); $152 = ((($151)) + 12|0); HEAPF32[$152>>2] = $148; $153 = $n; $154 = (($153) + 1)|0; $n = $154; } $155 = $k; $156 = (($155) + 1)|0; $k = $156; $j = $155; } $157 = $i; $158 = (($157) + 1)|0; $i = $158; } $159 = $e; $160 = $n; _nk_tt__sort_edges($159,$160); $161 = $0; $162 = $e; $163 = $n; $164 = $vsubsample; $165 = $8; $166 = $9; $167 = $11; _nk_tt__rasterize_sorted_edges($161,$162,$163,$164,$165,$166,$167); $168 = $11; $169 = ((($168)) + 8|0); $170 = HEAP32[$169>>2]|0; $171 = $11; $172 = $e; ;HEAP32[$$byval_copy1>>2]=HEAP32[$171>>2]|0; FUNCTION_TABLE_vii[$170 & 31]($$byval_copy1,$172); STACKTOP = sp;return; } function _nk_tt__add_point($points,$n,$x,$y) { $points = $points|0; $n = $n|0; $x = +$x; $y = +$y; var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $points; $1 = $n; $2 = $x; $3 = $y; $4 = $0; $5 = ($4|0)!=(0|0); if (!($5)) { STACKTOP = sp;return; } $6 = $2; $7 = $1; $8 = $0; $9 = (($8) + ($7<<3)|0); HEAPF32[$9>>2] = $6; $10 = $3; $11 = $1; $12 = $0; $13 = (($12) + ($11<<3)|0); $14 = ((($13)) + 4|0); HEAPF32[$14>>2] = $10; STACKTOP = sp;return; } function _nk_tt__tesselate_curve($points,$num_points,$x0,$y0,$x1,$y1,$x2,$y2,$objspace_flatness_squared,$n) { $points = $points|0; $num_points = $num_points|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; $x2 = +$x2; $y2 = +$y2; $objspace_flatness_squared = +$objspace_flatness_squared; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0; var $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0; var $81 = 0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0.0, $dx = 0.0, $dy = 0.0, $mx = 0.0, $my = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $points; $2 = $num_points; $3 = $x0; $4 = $y0; $5 = $x1; $6 = $y1; $7 = $x2; $8 = $y2; $9 = $objspace_flatness_squared; $10 = $n; $11 = $3; $12 = $5; $13 = 2.0 * $12; $14 = $11 + $13; $15 = $7; $16 = $14 + $15; $17 = $16 / 4.0; $mx = $17; $18 = $4; $19 = $6; $20 = 2.0 * $19; $21 = $18 + $20; $22 = $8; $23 = $21 + $22; $24 = $23 / 4.0; $my = $24; $25 = $3; $26 = $7; $27 = $25 + $26; $28 = $27 / 2.0; $29 = $mx; $30 = $28 - $29; $dx = $30; $31 = $4; $32 = $8; $33 = $31 + $32; $34 = $33 / 2.0; $35 = $my; $36 = $34 - $35; $dy = $36; $37 = $10; $38 = ($37|0)>(16); if ($38) { $0 = 1; $89 = $0; STACKTOP = sp;return ($89|0); } $39 = $dx; $40 = $dx; $41 = $39 * $40; $42 = $dy; $43 = $dy; $44 = $42 * $43; $45 = $41 + $44; $46 = $9; $47 = $45 > $46; $48 = $1; $49 = $2; if ($47) { $50 = $3; $51 = $4; $52 = $3; $53 = $5; $54 = $52 + $53; $55 = $54 / 2.0; $56 = $4; $57 = $6; $58 = $56 + $57; $59 = $58 / 2.0; $60 = $mx; $61 = $my; $62 = $9; $63 = $10; $64 = (($63) + 1)|0; (_nk_tt__tesselate_curve($48,$49,$50,$51,$55,$59,$60,$61,$62,$64)|0); $65 = $1; $66 = $2; $67 = $mx; $68 = $my; $69 = $5; $70 = $7; $71 = $69 + $70; $72 = $71 / 2.0; $73 = $6; $74 = $8; $75 = $73 + $74; $76 = $75 / 2.0; $77 = $7; $78 = $8; $79 = $9; $80 = $10; $81 = (($80) + 1)|0; (_nk_tt__tesselate_curve($65,$66,$67,$68,$72,$76,$77,$78,$79,$81)|0); } else { $82 = HEAP32[$49>>2]|0; $83 = $7; $84 = $8; _nk_tt__add_point($48,$82,$83,$84); $85 = $2; $86 = HEAP32[$85>>2]|0; $87 = (($86) + 1)|0; $88 = $2; HEAP32[$88>>2] = $87; } $0 = 1; $89 = $0; STACKTOP = sp;return ($89|0); } function _nk_tt__sort_edges($p,$n) { $p = $p|0; $n = $n|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $p; $1 = $n; $2 = $0; $3 = $1; _nk_tt__sort_edges_quicksort($2,$3); $4 = $0; $5 = $1; _nk_tt__sort_edges_ins_sort($4,$5); STACKTOP = sp;return; } function _nk_tt__rasterize_sorted_edges($result,$e,$n,$vsubsample,$off_x,$off_y,$alloc) { $result = $result|0; $e = $e|0; $n = $n|0; $vsubsample = $vsubsample|0; $off_x = $off_x|0; $off_y = $off_y|0; $alloc = $alloc|0; var $$ = 0, $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; var $113 = 0, $114 = 0, $115 = 0.0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0.0; var $131 = 0.0, $132 = 0.0, $133 = 0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0.0, $166 = 0, $167 = 0; var $168 = 0.0, $169 = 0.0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $19 = 0, $2 = 0, $20 = 0; var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0; var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0.0; var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0, $active = 0, $hh = 0, $i = 0, $j = 0, $k = 0.0, $m = 0, $scan_y_bottom = 0.0, $scan_y_top = 0.0, $scanline = 0, $scanline2 = 0, $scanline_data = 0, $step = 0, $sum = 0.0, $y = 0; var $z = 0, $z1 = 0, $z2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 640|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy1 = sp + 632|0; $$byval_copy = sp + 628|0; $hh = sp + 576|0; $active = sp + 572|0; $scanline_data = sp + 44|0; $0 = $result; $1 = $e; $2 = $n; $3 = $vsubsample; $4 = $off_x; $5 = $off_y; $6 = $alloc; HEAP32[$active>>2] = 0; $j = 0; _nk_zero($hh,24); $7 = $6; ;HEAP32[$hh>>2]=HEAP32[$7>>2]|0;HEAP32[$hh+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$hh+8>>2]=HEAP32[$7+8>>2]|0; $8 = $0; $9 = HEAP32[$8>>2]|0; $10 = ($9|0)>(64); if ($10) { $11 = $6; $12 = ((($11)) + 4|0); $13 = HEAP32[$12>>2]|0; $14 = $6; $15 = $0; $16 = HEAP32[$15>>2]|0; $17 = $16<<1; $18 = (($17) + 1)|0; $19 = $18<<2; ;HEAP32[$$byval_copy>>2]=HEAP32[$14>>2]|0; $20 = (FUNCTION_TABLE_iiii[$13 & 7]($$byval_copy,0,$19)|0); $scanline = $20; } else { $scanline = $scanline_data; } $21 = $scanline; $22 = $0; $23 = HEAP32[$22>>2]|0; $24 = (($21) + ($23<<2)|0); $scanline2 = $24; $25 = $5; $y = $25; $26 = $5; $27 = $0; $28 = ((($27)) + 4|0); $29 = HEAP32[$28>>2]|0; $30 = (($26) + ($29))|0; $31 = (+($30|0)); $32 = $31 + 1.0; $33 = $2; $34 = $1; $35 = (($34) + (($33*20)|0)|0); $36 = ((($35)) + 4|0); HEAPF32[$36>>2] = $32; L5: while(1) { $37 = $j; $38 = $0; $39 = ((($38)) + 4|0); $40 = HEAP32[$39>>2]|0; $41 = ($37|0)<($40|0); if (!($41)) { label = 29; break; } $42 = $y; $43 = (+($42|0)); $44 = $43 + 0.0; $scan_y_top = $44; $45 = $y; $46 = (+($45|0)); $47 = $46 + 1.0; $scan_y_bottom = $47; $step = $active; $48 = $scanline; $49 = $0; $50 = HEAP32[$49>>2]|0; $51 = $50<<2; _nk_memset($48,0,$51); $52 = $scanline2; $53 = $0; $54 = HEAP32[$53>>2]|0; $55 = (($54) + 1)|0; $56 = $55<<2; _nk_memset($52,0,$56); while(1) { $57 = $step; $58 = HEAP32[$57>>2]|0; $59 = ($58|0)!=(0|0); if (!($59)) { break; } $60 = $step; $61 = HEAP32[$60>>2]|0; $z = $61; $62 = $z; $63 = ((($62)) + 24|0); $64 = +HEAPF32[$63>>2]; $65 = $scan_y_top; $66 = $64 <= $65; if (!($66)) { $77 = $step; $78 = HEAP32[$77>>2]|0; $step = $78; continue; } $67 = $z; $68 = HEAP32[$67>>2]|0; $69 = $step; HEAP32[$69>>2] = $68; $70 = $z; $71 = ((($70)) + 16|0); $72 = +HEAPF32[$71>>2]; $73 = $72 != 0.0; if (!($73)) { label = 10; break L5; } $74 = $z; $75 = ((($74)) + 16|0); HEAPF32[$75>>2] = 0.0; $76 = $z; _nk_tt__hheap_free($hh,$76); } while(1) { $79 = $1; $80 = ((($79)) + 4|0); $81 = +HEAPF32[$80>>2]; $82 = $scan_y_bottom; $83 = $81 <= $82; if (!($83)) { break; } $84 = $1; $85 = ((($84)) + 4|0); $86 = +HEAPF32[$85>>2]; $87 = $1; $88 = ((($87)) + 12|0); $89 = +HEAPF32[$88>>2]; $90 = $86 != $89; if ($90) { $91 = $1; $92 = $4; $93 = $scan_y_top; $94 = (_nk_tt__new_active($hh,$91,$92,$93)|0); $z1 = $94; $95 = $z1; $96 = ($95|0)!=(0|0); if ($96) { $97 = $z1; $98 = ((($97)) + 24|0); $99 = +HEAPF32[$98>>2]; $100 = $scan_y_top; $101 = $99 >= $100; if (!($101)) { label = 17; break L5; } $102 = HEAP32[$active>>2]|0; $103 = $z1; HEAP32[$103>>2] = $102; $104 = $z1; HEAP32[$active>>2] = $104; } } $105 = $1; $106 = ((($105)) + 20|0); $1 = $106; } $107 = HEAP32[$active>>2]|0; $108 = ($107|0)!=(0|0); if ($108) { $109 = $scanline; $110 = $scanline2; $111 = ((($110)) + 4|0); $112 = $0; $113 = HEAP32[$112>>2]|0; $114 = HEAP32[$active>>2]|0; $115 = $scan_y_top; _nk_tt__fill_active_edges_new($109,$111,$113,$114,$115); } $sum = 0.0; $i = 0; while(1) { $116 = $i; $117 = $0; $118 = HEAP32[$117>>2]|0; $119 = ($116|0)<($118|0); if (!($119)) { break; } $120 = $i; $121 = $scanline2; $122 = (($121) + ($120<<2)|0); $123 = +HEAPF32[$122>>2]; $124 = $sum; $125 = $124 + $123; $sum = $125; $126 = $i; $127 = $scanline; $128 = (($127) + ($126<<2)|0); $129 = +HEAPF32[$128>>2]; $130 = $sum; $131 = $129 + $130; $k = $131; $132 = $k; $133 = $132 < 0.0; $134 = $k; $135 = -$134; $136 = $133 ? $135 : $134; $137 = $136 * 255.0; $138 = $137 + 0.5; $k = $138; $139 = $k; $140 = (~~(($139))); $m = $140; $141 = $m; $142 = ($141|0)>(255); $$ = $142 ? 255 : $140; $m = $$; $143 = $m; $144 = $143&255; $145 = $j; $146 = $0; $147 = ((($146)) + 8|0); $148 = HEAP32[$147>>2]|0; $149 = Math_imul($145, $148)|0; $150 = $i; $151 = (($149) + ($150))|0; $152 = $0; $153 = ((($152)) + 12|0); $154 = HEAP32[$153>>2]|0; $155 = (($154) + ($151)|0); HEAP8[$155>>0] = $144; $156 = $i; $157 = (($156) + 1)|0; $i = $157; } $step = $active; while(1) { $158 = $step; $159 = HEAP32[$158>>2]|0; $160 = ($159|0)!=(0|0); if (!($160)) { break; } $161 = $step; $162 = HEAP32[$161>>2]|0; $z2 = $162; $163 = $z2; $164 = ((($163)) + 8|0); $165 = +HEAPF32[$164>>2]; $166 = $z2; $167 = ((($166)) + 4|0); $168 = +HEAPF32[$167>>2]; $169 = $168 + $165; HEAPF32[$167>>2] = $169; $170 = $step; $171 = HEAP32[$170>>2]|0; $step = $171; } $172 = $y; $173 = (($172) + 1)|0; $y = $173; $174 = $j; $175 = (($174) + 1)|0; $j = $175; } if ((label|0) == 10) { ___assert_fail((30625|0),(13400|0),7969,(30638|0)); // unreachable; } else if ((label|0) == 17) { ___assert_fail((30668|0),(13400|0),7982,(30638|0)); // unreachable; } else if ((label|0) == 29) { _nk_tt__hheap_cleanup($hh); $176 = $scanline; $177 = ($176|0)!=($scanline_data|0); if (!($177)) { STACKTOP = sp;return; } $178 = $6; $179 = ((($178)) + 8|0); $180 = HEAP32[$179>>2]|0; $181 = $6; $182 = $scanline; ;HEAP32[$$byval_copy1>>2]=HEAP32[$181>>2]|0; FUNCTION_TABLE_vii[$180 & 31]($$byval_copy1,$182); STACKTOP = sp;return; } } function _nk_tt__sort_edges_quicksort($p,$n) { $p = $p|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $14 = 0, $15 = 0, $16 = 0; var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0; var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0; var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0; var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0.0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0; var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c = 0, $c01 = 0, $c12 = 0, $i = 0, $j = 0, $m = 0, $t = 0, $z = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $t = sp + 28|0; $0 = $p; $1 = $n; while(1) { $2 = $1; $3 = ($2|0)>(12); if (!($3)) { break; } $4 = $1; $5 = $4 >> 1; $m = $5; $6 = $0; $7 = ((($6)) + 4|0); $8 = +HEAPF32[$7>>2]; $9 = $m; $10 = $0; $11 = (($10) + (($9*20)|0)|0); $12 = ((($11)) + 4|0); $13 = +HEAPF32[$12>>2]; $14 = $8 < $13; $15 = $14&1; $c01 = $15; $16 = $m; $17 = $0; $18 = (($17) + (($16*20)|0)|0); $19 = ((($18)) + 4|0); $20 = +HEAPF32[$19>>2]; $21 = $1; $22 = (($21) - 1)|0; $23 = $0; $24 = (($23) + (($22*20)|0)|0); $25 = ((($24)) + 4|0); $26 = +HEAPF32[$25>>2]; $27 = $20 < $26; $28 = $27&1; $c12 = $28; $29 = $c01; $30 = $c12; $31 = ($29|0)!=($30|0); if ($31) { $32 = $0; $33 = ((($32)) + 4|0); $34 = +HEAPF32[$33>>2]; $35 = $1; $36 = (($35) - 1)|0; $37 = $0; $38 = (($37) + (($36*20)|0)|0); $39 = ((($38)) + 4|0); $40 = +HEAPF32[$39>>2]; $41 = $34 < $40; $42 = $41&1; $c = $42; $43 = $c; $44 = $c12; $45 = ($43|0)==($44|0); $46 = $1; $47 = (($46) - 1)|0; $48 = $45 ? 0 : $47; $z = $48; $49 = $z; $50 = $0; $51 = (($50) + (($49*20)|0)|0); ;HEAP32[$t>>2]=HEAP32[$51>>2]|0;HEAP32[$t+4>>2]=HEAP32[$51+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$51+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$51+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$51+16>>2]|0; $52 = $z; $53 = $0; $54 = (($53) + (($52*20)|0)|0); $55 = $m; $56 = $0; $57 = (($56) + (($55*20)|0)|0); ;HEAP32[$54>>2]=HEAP32[$57>>2]|0;HEAP32[$54+4>>2]=HEAP32[$57+4>>2]|0;HEAP32[$54+8>>2]=HEAP32[$57+8>>2]|0;HEAP32[$54+12>>2]=HEAP32[$57+12>>2]|0;HEAP32[$54+16>>2]=HEAP32[$57+16>>2]|0; $58 = $m; $59 = $0; $60 = (($59) + (($58*20)|0)|0); ;HEAP32[$60>>2]=HEAP32[$t>>2]|0;HEAP32[$60+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$60+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$60+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$60+16>>2]=HEAP32[$t+16>>2]|0; } $61 = $0; ;HEAP32[$t>>2]=HEAP32[$61>>2]|0;HEAP32[$t+4>>2]=HEAP32[$61+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$61+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$61+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$61+16>>2]|0; $62 = $0; $63 = $m; $64 = $0; $65 = (($64) + (($63*20)|0)|0); ;HEAP32[$62>>2]=HEAP32[$65>>2]|0;HEAP32[$62+4>>2]=HEAP32[$65+4>>2]|0;HEAP32[$62+8>>2]=HEAP32[$65+8>>2]|0;HEAP32[$62+12>>2]=HEAP32[$65+12>>2]|0;HEAP32[$62+16>>2]=HEAP32[$65+16>>2]|0; $66 = $m; $67 = $0; $68 = (($67) + (($66*20)|0)|0); ;HEAP32[$68>>2]=HEAP32[$t>>2]|0;HEAP32[$68+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$68+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$68+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$68+16>>2]=HEAP32[$t+16>>2]|0; $i = 1; $69 = $1; $70 = (($69) - 1)|0; $j = $70; while(1) { $71 = $i; $72 = $0; $73 = (($72) + (($71*20)|0)|0); $74 = ((($73)) + 4|0); $75 = +HEAPF32[$74>>2]; $76 = $0; $77 = ((($76)) + 4|0); $78 = +HEAPF32[$77>>2]; $79 = $75 < $78; if ($79) { $80 = $i; $81 = (($80) + 1)|0; $i = $81; continue; } while(1) { $82 = $0; $83 = ((($82)) + 4|0); $84 = +HEAPF32[$83>>2]; $85 = $j; $86 = $0; $87 = (($86) + (($85*20)|0)|0); $88 = ((($87)) + 4|0); $89 = +HEAPF32[$88>>2]; $90 = $84 < $89; if (!($90)) { break; } $91 = $j; $92 = (($91) + -1)|0; $j = $92; } $93 = $i; $94 = $j; $95 = ($93|0)>=($94|0); if ($95) { break; } $96 = $i; $97 = $0; $98 = (($97) + (($96*20)|0)|0); ;HEAP32[$t>>2]=HEAP32[$98>>2]|0;HEAP32[$t+4>>2]=HEAP32[$98+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$98+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$98+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$98+16>>2]|0; $99 = $i; $100 = $0; $101 = (($100) + (($99*20)|0)|0); $102 = $j; $103 = $0; $104 = (($103) + (($102*20)|0)|0); ;HEAP32[$101>>2]=HEAP32[$104>>2]|0;HEAP32[$101+4>>2]=HEAP32[$104+4>>2]|0;HEAP32[$101+8>>2]=HEAP32[$104+8>>2]|0;HEAP32[$101+12>>2]=HEAP32[$104+12>>2]|0;HEAP32[$101+16>>2]=HEAP32[$104+16>>2]|0; $105 = $j; $106 = $0; $107 = (($106) + (($105*20)|0)|0); ;HEAP32[$107>>2]=HEAP32[$t>>2]|0;HEAP32[$107+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$107+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$107+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$107+16>>2]=HEAP32[$t+16>>2]|0; $108 = $i; $109 = (($108) + 1)|0; $i = $109; $110 = $j; $111 = (($110) + -1)|0; $j = $111; } $112 = $j; $113 = $1; $114 = $i; $115 = (($113) - ($114))|0; $116 = ($112|0)<($115|0); $117 = $0; if ($116) { $118 = $j; _nk_tt__sort_edges_quicksort($117,$118); $119 = $0; $120 = $i; $121 = (($119) + (($120*20)|0)|0); $0 = $121; $122 = $1; $123 = $i; $124 = (($122) - ($123))|0; $1 = $124; continue; } else { $125 = $i; $126 = (($117) + (($125*20)|0)|0); $127 = $1; $128 = $i; $129 = (($127) - ($128))|0; _nk_tt__sort_edges_quicksort($126,$129); $130 = $j; $1 = $130; continue; } } STACKTOP = sp;return; } function _nk_tt__sort_edges_ins_sort($p,$n) { $p = $p|0; $n = $n|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $a = 0, $b = 0, $c = 0, $i = 0, $j = 0, $t = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $t = sp + 12|0; $0 = $p; $1 = $n; $i = 1; while(1) { $2 = $i; $3 = $1; $4 = ($2|0)<($3|0); if (!($4)) { break; } $5 = $i; $6 = $0; $7 = (($6) + (($5*20)|0)|0); ;HEAP32[$t>>2]=HEAP32[$7>>2]|0;HEAP32[$t+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$t+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$t+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$t+16>>2]=HEAP32[$7+16>>2]|0; $a = $t; $8 = $i; $j = $8; while(1) { $9 = $j; $10 = ($9|0)>(0); if (!($10)) { break; } $11 = $j; $12 = (($11) - 1)|0; $13 = $0; $14 = (($13) + (($12*20)|0)|0); $b = $14; $15 = $a; $16 = ((($15)) + 4|0); $17 = +HEAPF32[$16>>2]; $18 = $b; $19 = ((($18)) + 4|0); $20 = +HEAPF32[$19>>2]; $21 = $17 < $20; $22 = $21&1; $c = $22; $23 = $c; $24 = ($23|0)!=(0); if (!($24)) { break; } $25 = $j; $26 = $0; $27 = (($26) + (($25*20)|0)|0); $28 = $j; $29 = (($28) - 1)|0; $30 = $0; $31 = (($30) + (($29*20)|0)|0); ;HEAP32[$27>>2]=HEAP32[$31>>2]|0;HEAP32[$27+4>>2]=HEAP32[$31+4>>2]|0;HEAP32[$27+8>>2]=HEAP32[$31+8>>2]|0;HEAP32[$27+12>>2]=HEAP32[$31+12>>2]|0;HEAP32[$27+16>>2]=HEAP32[$31+16>>2]|0; $32 = $j; $33 = (($32) + -1)|0; $j = $33; } $34 = $i; $35 = $j; $36 = ($34|0)!=($35|0); if ($36) { $37 = $j; $38 = $0; $39 = (($38) + (($37*20)|0)|0); ;HEAP32[$39>>2]=HEAP32[$t>>2]|0;HEAP32[$39+4>>2]=HEAP32[$t+4>>2]|0;HEAP32[$39+8>>2]=HEAP32[$t+8>>2]|0;HEAP32[$39+12>>2]=HEAP32[$t+12>>2]|0;HEAP32[$39+16>>2]=HEAP32[$t+16>>2]|0; } $40 = $i; $41 = (($40) + 1)|0; $i = $41; } STACKTOP = sp;return; } function _nk_tt__hheap_free($hh,$p) { $hh = $hh|0; $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $hh; $1 = $p; $2 = $0; $3 = ((($2)) + 16|0); $4 = HEAP32[$3>>2]|0; $5 = $1; HEAP32[$5>>2] = $4; $6 = $1; $7 = $0; $8 = ((($7)) + 16|0); HEAP32[$8>>2] = $6; STACKTOP = sp;return; } function _nk_tt__new_active($hh,$e,$off_x,$start_point) { $hh = $hh|0; $e = $e|0; $off_x = $off_x|0; $start_point = +$start_point; var $0 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0; var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $8 = 0, $9 = 0.0, $dxdy = 0.0, $z = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $hh; $2 = $e; $3 = $off_x; $4 = $start_point; $5 = $1; $6 = (_nk_tt__hheap_alloc($5,28)|0); $z = $6; $7 = $2; $8 = ((($7)) + 8|0); $9 = +HEAPF32[$8>>2]; $10 = $2; $11 = +HEAPF32[$10>>2]; $12 = $9 - $11; $13 = $2; $14 = ((($13)) + 12|0); $15 = +HEAPF32[$14>>2]; $16 = $2; $17 = ((($16)) + 4|0); $18 = +HEAPF32[$17>>2]; $19 = $15 - $18; $20 = $12 / $19; $dxdy = $20; $21 = $z; $22 = ($21|0)!=(0|0); if ($22) { $24 = $dxdy; $25 = $z; $26 = ((($25)) + 8|0); HEAPF32[$26>>2] = $24; $27 = $dxdy; $28 = $27 != 0.0; $29 = $dxdy; $30 = 1.0 / $29; $31 = $28 ? $30 : 0.0; $32 = $z; $33 = ((($32)) + 12|0); HEAPF32[$33>>2] = $31; $34 = $2; $35 = +HEAPF32[$34>>2]; $36 = $dxdy; $37 = $4; $38 = $2; $39 = ((($38)) + 4|0); $40 = +HEAPF32[$39>>2]; $41 = $37 - $40; $42 = $36 * $41; $43 = $35 + $42; $44 = $z; $45 = ((($44)) + 4|0); HEAPF32[$45>>2] = $43; $46 = $3; $47 = (+($46|0)); $48 = $z; $49 = ((($48)) + 4|0); $50 = +HEAPF32[$49>>2]; $51 = $50 - $47; HEAPF32[$49>>2] = $51; $52 = $2; $53 = ((($52)) + 16|0); $54 = HEAP32[$53>>2]|0; $55 = ($54|0)!=(0); $56 = $55 ? 1.0 : -1.0; $57 = $z; $58 = ((($57)) + 16|0); HEAPF32[$58>>2] = $56; $59 = $2; $60 = ((($59)) + 4|0); $61 = +HEAPF32[$60>>2]; $62 = $z; $63 = ((($62)) + 20|0); HEAPF32[$63>>2] = $61; $64 = $2; $65 = ((($64)) + 12|0); $66 = +HEAPF32[$65>>2]; $67 = $z; $68 = ((($67)) + 24|0); HEAPF32[$68>>2] = $66; $69 = $z; HEAP32[$69>>2] = 0; $70 = $z; $0 = $70; $71 = $0; STACKTOP = sp;return ($71|0); } else { $23 = $z; $0 = $23; $71 = $0; STACKTOP = sp;return ($71|0); } return (0)|0; } function _nk_tt__fill_active_edges_new($scanline,$scanline_fill,$len,$e,$y_top) { $scanline = $scanline|0; $scanline_fill = $scanline_fill|0; $len = $len|0; $e = $e|0; $y_top = +$y_top; var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0.0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0; var $116 = 0.0, $117 = 0, $118 = 0.0, $119 = 0, $12 = 0.0, $120 = 0.0, $121 = 0, $122 = 0.0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0.0, $139 = 0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0.0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0, $163 = 0, $164 = 0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0, $169 = 0.0, $17 = 0; var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0.0; var $189 = 0.0, $19 = 0, $190 = 0.0, $191 = 0.0, $192 = 0.0, $193 = 0, $194 = 0.0, $195 = 0, $196 = 0, $197 = 0.0, $198 = 0.0, $199 = 0.0, $2 = 0, $20 = 0.0, $200 = 0.0, $201 = 0.0, $202 = 0.0, $203 = 0.0, $204 = 0.0, $205 = 0; var $206 = 0, $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0.0, $210 = 0.0, $211 = 0.0, $212 = 0.0, $213 = 0.0, $214 = 0.0, $215 = 0, $216 = 0.0, $217 = 0.0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0.0, $223 = 0.0; var $224 = 0.0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0.0, $234 = 0.0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0.0, $241 = 0.0; var $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0.0, $250 = 0.0, $251 = 0.0, $252 = 0, $253 = 0, $254 = 0.0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0.0, $26 = 0; var $260 = 0.0, $261 = 0.0, $262 = 0.0, $263 = 0.0, $264 = 0.0, $265 = 0, $266 = 0, $267 = 0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0.0, $272 = 0.0, $273 = 0.0, $274 = 0.0, $275 = 0.0, $276 = 0.0, $277 = 0.0, $278 = 0.0; var $279 = 0.0, $28 = 0.0, $280 = 0.0, $281 = 0.0, $282 = 0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0.0, $287 = 0.0, $288 = 0.0, $289 = 0.0, $29 = 0, $290 = 0.0, $291 = 0.0, $292 = 0, $293 = 0, $294 = 0, $295 = 0.0, $296 = 0.0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0.0, $301 = 0, $302 = 0.0, $303 = 0, $304 = 0, $305 = 0.0, $306 = 0.0, $307 = 0.0, $308 = 0, $309 = 0.0, $31 = 0.0, $310 = 0.0, $311 = 0.0, $312 = 0.0, $313 = 0.0; var $314 = 0.0, $315 = 0.0, $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0.0, $32 = 0.0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0.0, $325 = 0.0, $326 = 0.0, $327 = 0, $328 = 0.0, $329 = 0.0, $33 = 0.0, $330 = 0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0.0, $335 = 0.0, $336 = 0.0, $337 = 0.0, $338 = 0, $339 = 0, $34 = 0.0, $340 = 0, $341 = 0.0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0, $346 = 0, $347 = 0, $348 = 0.0, $349 = 0.0, $35 = 0; var $350 = 0.0, $351 = 0.0, $352 = 0.0, $353 = 0.0, $354 = 0, $355 = 0.0, $356 = 0.0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0.0, $362 = 0.0, $363 = 0.0, $364 = 0.0, $365 = 0, $366 = 0, $367 = 0, $368 = 0.0; var $369 = 0.0, $37 = 0.0, $370 = 0.0, $371 = 0.0, $372 = 0, $373 = 0, $374 = 0, $375 = 0.0, $376 = 0.0, $377 = 0.0, $378 = 0.0, $379 = 0.0, $38 = 0, $380 = 0.0, $381 = 0, $382 = 0.0, $383 = 0.0, $384 = 0, $385 = 0, $386 = 0; var $387 = 0, $388 = 0.0, $389 = 0.0, $39 = 0, $390 = 0.0, $391 = 0.0, $392 = 0, $393 = 0, $394 = 0, $395 = 0.0, $396 = 0.0, $397 = 0.0, $398 = 0.0, $399 = 0.0, $4 = 0.0, $40 = 0, $400 = 0.0, $401 = 0, $402 = 0.0, $403 = 0.0; var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0.0, $409 = 0.0, $41 = 0.0, $410 = 0.0, $411 = 0.0, $412 = 0, $413 = 0, $414 = 0, $415 = 0.0, $416 = 0.0, $417 = 0.0, $418 = 0.0, $419 = 0.0, $42 = 0.0, $420 = 0.0, $421 = 0; var $422 = 0.0, $423 = 0.0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0.0, $429 = 0.0, $43 = 0.0, $430 = 0.0, $431 = 0.0, $432 = 0, $433 = 0, $434 = 0, $435 = 0.0, $436 = 0.0, $437 = 0.0, $438 = 0.0, $439 = 0.0, $44 = 0.0; var $440 = 0.0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0.0, $449 = 0.0, $45 = 0, $450 = 0.0, $451 = 0.0, $452 = 0, $453 = 0, $454 = 0, $455 = 0.0, $456 = 0.0, $457 = 0.0, $458 = 0.0; var $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0.0, $463 = 0.0, $464 = 0.0, $465 = 0.0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0; var $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0; var $72 = 0, $73 = 0.0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0; var $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $area = 0.0, $dx = 0.0, $dy = 0.0, $height = 0.0, $or$cond = 0, $sign = 0.0, $step = 0.0, $t = 0.0, $x = 0, $x0 = 0.0; var $x01 = 0.0, $x1 = 0, $x15 = 0.0, $x2 = 0, $x23 = 0, $x26 = 0.0, $x3 = 0.0, $x4 = 0, $x_bottom = 0.0, $x_top = 0.0, $xb = 0.0, $y0 = 0.0, $y1 = 0.0, $y2 = 0.0, $y3 = 0.0, $y_bottom = 0.0, $y_crossing = 0.0, $ya = 0.0, $yb = 0.0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $scanline; $1 = $scanline_fill; $2 = $len; $3 = $e; $4 = $y_top; $5 = $4; $6 = $5 + 1.0; $y_bottom = $6; L1: while(1) { $7 = $3; $8 = ($7|0)!=(0|0); if (!($8)) { label = 56; break; } $9 = $3; $10 = ((($9)) + 24|0); $11 = +HEAPF32[$10>>2]; $12 = $4; $13 = $11 >= $12; if (!($13)) { label = 4; break; } $14 = $3; $15 = ((($14)) + 8|0); $16 = +HEAPF32[$15>>2]; $17 = $16 == 0.0; $18 = $3; $19 = ((($18)) + 4|0); $20 = +HEAPF32[$19>>2]; L5: do { if ($17) { $x0 = $20; $21 = $x0; $22 = $2; $23 = (+($22|0)); $24 = $21 < $23; if ($24) { $25 = $x0; $26 = $25 >= 0.0; if ($26) { $27 = $0; $28 = $x0; $29 = (~~(($28))); $30 = $3; $31 = $x0; $32 = $4; $33 = $x0; $34 = $y_bottom; _nk_tt__handle_clipped_edge($27,$29,$30,$31,$32,$33,$34); $35 = $1; $36 = ((($35)) + -4|0); $37 = $x0; $38 = (~~(($37))); $39 = (($38) + 1)|0; $40 = $3; $41 = $x0; $42 = $4; $43 = $x0; $44 = $y_bottom; _nk_tt__handle_clipped_edge($36,$39,$40,$41,$42,$43,$44); break; } else { $45 = $1; $46 = ((($45)) + -4|0); $47 = $3; $48 = $x0; $49 = $4; $50 = $x0; $51 = $y_bottom; _nk_tt__handle_clipped_edge($46,0,$47,$48,$49,$50,$51); break; } } } else { $x01 = $20; $52 = $3; $53 = ((($52)) + 8|0); $54 = +HEAPF32[$53>>2]; $dx = $54; $55 = $x01; $56 = $dx; $57 = $55 + $56; $xb = $57; $58 = $3; $59 = ((($58)) + 12|0); $60 = +HEAPF32[$59>>2]; $dy = $60; $61 = $3; $62 = ((($61)) + 20|0); $63 = +HEAPF32[$62>>2]; $64 = $y_bottom; $65 = $63 <= $64; if (!($65)) { label = 12; break L1; } $66 = $3; $67 = ((($66)) + 24|0); $68 = +HEAPF32[$67>>2]; $69 = $4; $70 = $68 >= $69; if (!($70)) { label = 12; break L1; } $71 = $3; $72 = ((($71)) + 20|0); $73 = +HEAPF32[$72>>2]; $74 = $4; $75 = $73 > $74; $76 = $x01; if ($75) { $77 = $dx; $78 = $3; $79 = ((($78)) + 20|0); $80 = +HEAPF32[$79>>2]; $81 = $4; $82 = $80 - $81; $83 = $77 * $82; $84 = $76 + $83; $x_top = $84; $85 = $3; $86 = ((($85)) + 20|0); $87 = +HEAPF32[$86>>2]; $y0 = $87; } else { $x_top = $76; $88 = $4; $y0 = $88; } $89 = $3; $90 = ((($89)) + 24|0); $91 = +HEAPF32[$90>>2]; $92 = $y_bottom; $93 = $91 < $92; if ($93) { $94 = $x01; $95 = $dx; $96 = $3; $97 = ((($96)) + 24|0); $98 = +HEAPF32[$97>>2]; $99 = $4; $100 = $98 - $99; $101 = $95 * $100; $102 = $94 + $101; $x_bottom = $102; $103 = $3; $104 = ((($103)) + 24|0); $105 = +HEAPF32[$104>>2]; $y1 = $105; } else { $106 = $xb; $x_bottom = $106; $107 = $y_bottom; $y1 = $107; } $108 = $x_top; $109 = $108 >= 0.0; $110 = $x_bottom; $111 = $110 >= 0.0; $or$cond = $109 & $111; if ($or$cond) { $112 = $x_top; $113 = $2; $114 = (+($113|0)); $115 = $112 < $114; if ($115) { $116 = $x_bottom; $117 = $2; $118 = (+($117|0)); $119 = $116 < $118; if ($119) { $120 = $x_top; $121 = (~~(($120))); $122 = $x_bottom; $123 = (~~(($122))); $124 = ($121|0)==($123|0); $125 = $x_top; if ($124) { $126 = (~~(($125))); $x = $126; $127 = $y1; $128 = $y0; $129 = $127 - $128; $height = $129; $130 = $x; $131 = ($130|0)>=(0); if (!($131)) { label = 25; break L1; } $132 = $x; $133 = $2; $134 = ($132|0)<($133|0); if (!($134)) { label = 25; break L1; } $135 = $3; $136 = ((($135)) + 16|0); $137 = +HEAPF32[$136>>2]; $138 = $x_top; $139 = $x; $140 = (+($139|0)); $141 = $138 - $140; $142 = $x_bottom; $143 = $x; $144 = (+($143|0)); $145 = $142 - $144; $146 = $141 + $145; $147 = $146 / 2.0; $148 = 1.0 - $147; $149 = $137 * $148; $150 = $height; $151 = $149 * $150; $152 = $x; $153 = $0; $154 = (($153) + ($152<<2)|0); $155 = +HEAPF32[$154>>2]; $156 = $155 + $151; HEAPF32[$154>>2] = $156; $157 = $3; $158 = ((($157)) + 16|0); $159 = +HEAPF32[$158>>2]; $160 = $height; $161 = $159 * $160; $162 = $x; $163 = $1; $164 = (($163) + ($162<<2)|0); $165 = +HEAPF32[$164>>2]; $166 = $165 + $161; HEAPF32[$164>>2] = $166; break; } $167 = $x_bottom; $168 = $125 > $167; if ($168) { $169 = $y_bottom; $170 = $y0; $171 = $4; $172 = $170 - $171; $173 = $169 - $172; $y0 = $173; $174 = $y_bottom; $175 = $y1; $176 = $4; $177 = $175 - $176; $178 = $174 - $177; $y1 = $178; $179 = $y0; $t = $179; $180 = $y1; $y0 = $180; $181 = $t; $y1 = $181; $182 = $x_bottom; $t = $182; $183 = $x_top; $x_bottom = $183; $184 = $t; $x_top = $184; $185 = $dx; $186 = -$185; $dx = $186; $187 = $dy; $188 = -$187; $dy = $188; $189 = $x01; $t = $189; $190 = $xb; $x01 = $190; $191 = $t; $xb = $191; } $192 = $x_top; $193 = (~~(($192))); $x1 = $193; $194 = $x_bottom; $195 = (~~(($194))); $x23 = $195; $196 = $x1; $197 = (+($196|0)); $198 = $197 + 1.0; $199 = $x01; $200 = $198 - $199; $201 = $dy; $202 = $200 * $201; $203 = $4; $204 = $202 + $203; $y_crossing = $204; $205 = $3; $206 = ((($205)) + 16|0); $207 = +HEAPF32[$206>>2]; $sign = $207; $208 = $sign; $209 = $y_crossing; $210 = $y0; $211 = $209 - $210; $212 = $208 * $211; $area = $212; $213 = $area; $214 = $x_top; $215 = $x1; $216 = (+($215|0)); $217 = $214 - $216; $218 = $x1; $219 = (($218) + 1)|0; $220 = $x1; $221 = (($219) - ($220))|0; $222 = (+($221|0)); $223 = $217 + $222; $224 = $223 / 2.0; $225 = 1.0 - $224; $226 = $213 * $225; $227 = $x1; $228 = $0; $229 = (($228) + ($227<<2)|0); $230 = +HEAPF32[$229>>2]; $231 = $230 + $226; HEAPF32[$229>>2] = $231; $232 = $sign; $233 = $dy; $234 = $232 * $233; $step = $234; $235 = $x1; $236 = (($235) + 1)|0; $x2 = $236; while(1) { $237 = $x2; $238 = $x23; $239 = ($237|0)<($238|0); if (!($239)) { break; } $240 = $area; $241 = $step; $242 = $241 / 2.0; $243 = $240 + $242; $244 = $x2; $245 = $0; $246 = (($245) + ($244<<2)|0); $247 = +HEAPF32[$246>>2]; $248 = $247 + $243; HEAPF32[$246>>2] = $248; $249 = $step; $250 = $area; $251 = $250 + $249; $area = $251; $252 = $x2; $253 = (($252) + 1)|0; $x2 = $253; } $254 = $dy; $255 = $x23; $256 = $x1; $257 = (($256) + 1)|0; $258 = (($255) - ($257))|0; $259 = (+($258|0)); $260 = $254 * $259; $261 = $y_crossing; $262 = $261 + $260; $y_crossing = $262; $263 = $area; $264 = $sign; $265 = $x23; $266 = $x23; $267 = (($265) - ($266))|0; $268 = (+($267|0)); $269 = $x_bottom; $270 = $x23; $271 = (+($270|0)); $272 = $269 - $271; $273 = $268 + $272; $274 = $273 / 2.0; $275 = 1.0 - $274; $276 = $264 * $275; $277 = $y1; $278 = $y_crossing; $279 = $277 - $278; $280 = $276 * $279; $281 = $263 + $280; $282 = $x23; $283 = $0; $284 = (($283) + ($282<<2)|0); $285 = +HEAPF32[$284>>2]; $286 = $285 + $281; HEAPF32[$284>>2] = $286; $287 = $sign; $288 = $y1; $289 = $y0; $290 = $288 - $289; $291 = $287 * $290; $292 = $x23; $293 = $1; $294 = (($293) + ($292<<2)|0); $295 = +HEAPF32[$294>>2]; $296 = $295 + $291; HEAPF32[$294>>2] = $296; break; } } } $x4 = 0; while(1) { $297 = $x4; $298 = $2; $299 = ($297|0)<($298|0); if (!($299)) { break L5; } $300 = $4; $ya = $300; $301 = $x4; $302 = (+($301|0)); $x15 = $302; $303 = $x4; $304 = (($303) + 1)|0; $305 = (+($304|0)); $x26 = $305; $306 = $xb; $x3 = $306; $307 = $y_bottom; $y3 = $307; $308 = $x4; $309 = (+($308|0)); $310 = $x01; $311 = $309 - $310; $312 = $dx; $313 = $311 / $312; $314 = $4; $315 = $313 + $314; $yb = $315; $316 = $x4; $317 = (+($316|0)); $318 = $317 + 1.0; $319 = $x01; $320 = $318 - $319; $321 = $dx; $322 = $320 / $321; $323 = $4; $324 = $322 + $323; $y2 = $324; $325 = $x01; $326 = $x15; $327 = $325 < $326; if ($327) { $328 = $x3; $329 = $x26; $330 = $328 > $329; if ($330) { $331 = $0; $332 = $x4; $333 = $3; $334 = $x01; $335 = $ya; $336 = $x15; $337 = $yb; _nk_tt__handle_clipped_edge($331,$332,$333,$334,$335,$336,$337); $338 = $0; $339 = $x4; $340 = $3; $341 = $x15; $342 = $yb; $343 = $x26; $344 = $y2; _nk_tt__handle_clipped_edge($338,$339,$340,$341,$342,$343,$344); $345 = $0; $346 = $x4; $347 = $3; $348 = $x26; $349 = $y2; $350 = $x3; $351 = $y3; _nk_tt__handle_clipped_edge($345,$346,$347,$348,$349,$350,$351); } else { label = 38; } } else { label = 38; } L45: do { if ((label|0) == 38) { label = 0; $352 = $x3; $353 = $x15; $354 = $352 < $353; if ($354) { $355 = $x01; $356 = $x26; $357 = $355 > $356; if ($357) { $358 = $0; $359 = $x4; $360 = $3; $361 = $x01; $362 = $ya; $363 = $x26; $364 = $y2; _nk_tt__handle_clipped_edge($358,$359,$360,$361,$362,$363,$364); $365 = $0; $366 = $x4; $367 = $3; $368 = $x26; $369 = $y2; $370 = $x15; $371 = $yb; _nk_tt__handle_clipped_edge($365,$366,$367,$368,$369,$370,$371); $372 = $0; $373 = $x4; $374 = $3; $375 = $x15; $376 = $yb; $377 = $x3; $378 = $y3; _nk_tt__handle_clipped_edge($372,$373,$374,$375,$376,$377,$378); break; } } $379 = $x01; $380 = $x15; $381 = $379 < $380; if ($381) { $382 = $x3; $383 = $x15; $384 = $382 > $383; if ($384) { $385 = $0; $386 = $x4; $387 = $3; $388 = $x01; $389 = $ya; $390 = $x15; $391 = $yb; _nk_tt__handle_clipped_edge($385,$386,$387,$388,$389,$390,$391); $392 = $0; $393 = $x4; $394 = $3; $395 = $x15; $396 = $yb; $397 = $x3; $398 = $y3; _nk_tt__handle_clipped_edge($392,$393,$394,$395,$396,$397,$398); break; } } $399 = $x3; $400 = $x15; $401 = $399 < $400; if ($401) { $402 = $x01; $403 = $x15; $404 = $402 > $403; if ($404) { $405 = $0; $406 = $x4; $407 = $3; $408 = $x01; $409 = $ya; $410 = $x15; $411 = $yb; _nk_tt__handle_clipped_edge($405,$406,$407,$408,$409,$410,$411); $412 = $0; $413 = $x4; $414 = $3; $415 = $x15; $416 = $yb; $417 = $x3; $418 = $y3; _nk_tt__handle_clipped_edge($412,$413,$414,$415,$416,$417,$418); break; } } $419 = $x01; $420 = $x26; $421 = $419 < $420; if ($421) { $422 = $x3; $423 = $x26; $424 = $422 > $423; if ($424) { $425 = $0; $426 = $x4; $427 = $3; $428 = $x01; $429 = $ya; $430 = $x26; $431 = $y2; _nk_tt__handle_clipped_edge($425,$426,$427,$428,$429,$430,$431); $432 = $0; $433 = $x4; $434 = $3; $435 = $x26; $436 = $y2; $437 = $x3; $438 = $y3; _nk_tt__handle_clipped_edge($432,$433,$434,$435,$436,$437,$438); break; } } $439 = $x3; $440 = $x26; $441 = $439 < $440; do { if ($441) { $442 = $x01; $443 = $x26; $444 = $442 > $443; if (!($444)) { break; } $445 = $0; $446 = $x4; $447 = $3; $448 = $x01; $449 = $ya; $450 = $x26; $451 = $y2; _nk_tt__handle_clipped_edge($445,$446,$447,$448,$449,$450,$451); $452 = $0; $453 = $x4; $454 = $3; $455 = $x26; $456 = $y2; $457 = $x3; $458 = $y3; _nk_tt__handle_clipped_edge($452,$453,$454,$455,$456,$457,$458); break L45; } } while(0); $459 = $0; $460 = $x4; $461 = $3; $462 = $x01; $463 = $ya; $464 = $x3; $465 = $y3; _nk_tt__handle_clipped_edge($459,$460,$461,$462,$463,$464,$465); } } while(0); $466 = $x4; $467 = (($466) + 1)|0; $x4 = $467; } } } while(0); $468 = $3; $469 = HEAP32[$468>>2]|0; $3 = $469; } if ((label|0) == 4) { ___assert_fail((30688|0),(13400|0),7779,(30703|0)); // unreachable; } else if ((label|0) == 12) { ___assert_fail((30732|0),(13400|0),7797,(30703|0)); // unreachable; } else if ((label|0) == 25) { ___assert_fail((30768|0),(13400|0),7826,(30703|0)); // unreachable; } else if ((label|0) == 56) { STACKTOP = sp;return; } } function _nk_tt__hheap_cleanup($hh) { $hh = $hh|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $n = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 12|0; $0 = $hh; $1 = $0; $2 = ((($1)) + 12|0); $3 = HEAP32[$2>>2]|0; $c = $3; while(1) { $4 = $c; $5 = ($4|0)!=(0|0); if (!($5)) { break; } $6 = $c; $7 = HEAP32[$6>>2]|0; $n = $7; $8 = $0; $9 = ((($8)) + 8|0); $10 = HEAP32[$9>>2]|0; $11 = $0; $12 = $c; ;HEAP32[$$byval_copy>>2]=HEAP32[$11>>2]|0; FUNCTION_TABLE_vii[$10 & 31]($$byval_copy,$12); $13 = $n; $c = $13; } STACKTOP = sp;return; } function _nk_tt__hheap_alloc($hh,$size) { $hh = $hh|0; $size = $size|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $c = 0, $count = 0, $p = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 24|0; $1 = $hh; $2 = $size; $3 = $1; $4 = ((($3)) + 16|0); $5 = HEAP32[$4>>2]|0; $6 = ($5|0)!=(0|0); $7 = $1; if ($6) { $8 = ((($7)) + 16|0); $9 = HEAP32[$8>>2]|0; $p = $9; $10 = $p; $11 = HEAP32[$10>>2]|0; $12 = $1; $13 = ((($12)) + 16|0); HEAP32[$13>>2] = $11; $14 = $p; $0 = $14; $58 = $0; STACKTOP = sp;return ($58|0); } $15 = ((($7)) + 20|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)==(0); do { if ($17) { $18 = $2; $19 = ($18>>>0)<(32); if ($19) { $23 = 2000; } else { $20 = $2; $21 = ($20>>>0)<(128); $22 = $21 ? 800 : 100; $23 = $22; } $count = $23; $24 = $1; $25 = ((($24)) + 4|0); $26 = HEAP32[$25>>2]|0; $27 = $1; $28 = $2; $29 = $count; $30 = Math_imul($28, $29)|0; $31 = (4 + ($30))|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$27>>2]|0; $32 = (FUNCTION_TABLE_iiii[$26 & 7]($$byval_copy,0,$31)|0); $c = $32; $33 = $c; $34 = ($33|0)==(0|0); if (!($34)) { $35 = $1; $36 = ((($35)) + 12|0); $37 = HEAP32[$36>>2]|0; $38 = $c; HEAP32[$38>>2] = $37; $39 = $c; $40 = $1; $41 = ((($40)) + 12|0); HEAP32[$41>>2] = $39; $42 = $count; $43 = $1; $44 = ((($43)) + 20|0); HEAP32[$44>>2] = $42; break; } $0 = 0; $58 = $0; STACKTOP = sp;return ($58|0); } } while(0); $45 = $1; $46 = ((($45)) + 20|0); $47 = HEAP32[$46>>2]|0; $48 = (($47) + -1)|0; HEAP32[$46>>2] = $48; $49 = $1; $50 = ((($49)) + 12|0); $51 = HEAP32[$50>>2]|0; $52 = $2; $53 = $1; $54 = ((($53)) + 20|0); $55 = HEAP32[$54>>2]|0; $56 = Math_imul($52, $55)|0; $57 = (($51) + ($56)|0); $0 = $57; $58 = $0; STACKTOP = sp;return ($58|0); } function _nk_tt__handle_clipped_edge($scanline,$x,$e,$x0,$y0,$x1,$y1) { $scanline = $scanline|0; $x = $x|0; $e = $e|0; $x0 = +$x0; $y0 = +$y0; $x1 = +$x1; $y1 = +$y1; var $0 = 0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0.0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0; var $116 = 0, $117 = 0.0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0, $123 = 0.0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0, $144 = 0.0, $145 = 0, $146 = 0, $147 = 0.0, $148 = 0, $149 = 0.0, $15 = 0.0, $150 = 0, $151 = 0.0; var $152 = 0, $153 = 0.0, $154 = 0, $155 = 0, $156 = 0.0, $157 = 0, $158 = 0.0, $159 = 0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0, $164 = 0, $165 = 0.0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0; var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0.0, $180 = 0.0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0.0, $19 = 0, $190 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0; var $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0.0; var $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0; var $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0.0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0, $87 = 0, $88 = 0.0, $89 = 0; var $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0, $96 = 0.0, $97 = 0, $98 = 0.0, $99 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $scanline; $1 = $x; $2 = $e; $3 = $x0; $4 = $y0; $5 = $x1; $6 = $y1; $7 = $4; $8 = $6; $9 = $7 == $8; if ($9) { STACKTOP = sp;return; } $10 = $4; $11 = $6; $12 = $10 < $11; if (!($12)) { ___assert_fail((30786|0),(13400|0),7741,(30794|0)); // unreachable; } $13 = $2; $14 = ((($13)) + 20|0); $15 = +HEAPF32[$14>>2]; $16 = $2; $17 = ((($16)) + 24|0); $18 = +HEAPF32[$17>>2]; $19 = $15 <= $18; if (!($19)) { ___assert_fail((30821|0),(13400|0),7742,(30794|0)); // unreachable; } $20 = $4; $21 = $2; $22 = ((($21)) + 24|0); $23 = +HEAPF32[$22>>2]; $24 = $20 > $23; if ($24) { STACKTOP = sp;return; } $25 = $6; $26 = $2; $27 = ((($26)) + 20|0); $28 = +HEAPF32[$27>>2]; $29 = $25 < $28; if ($29) { STACKTOP = sp;return; } $30 = $4; $31 = $2; $32 = ((($31)) + 20|0); $33 = +HEAPF32[$32>>2]; $34 = $30 < $33; if ($34) { $35 = $5; $36 = $3; $37 = $35 - $36; $38 = $2; $39 = ((($38)) + 20|0); $40 = +HEAPF32[$39>>2]; $41 = $4; $42 = $40 - $41; $43 = $37 * $42; $44 = $6; $45 = $4; $46 = $44 - $45; $47 = $43 / $46; $48 = $3; $49 = $48 + $47; $3 = $49; $50 = $2; $51 = ((($50)) + 20|0); $52 = +HEAPF32[$51>>2]; $4 = $52; } $53 = $6; $54 = $2; $55 = ((($54)) + 24|0); $56 = +HEAPF32[$55>>2]; $57 = $53 > $56; if ($57) { $58 = $5; $59 = $3; $60 = $58 - $59; $61 = $2; $62 = ((($61)) + 24|0); $63 = +HEAPF32[$62>>2]; $64 = $6; $65 = $63 - $64; $66 = $60 * $65; $67 = $6; $68 = $4; $69 = $67 - $68; $70 = $66 / $69; $71 = $5; $72 = $71 + $70; $5 = $72; $73 = $2; $74 = ((($73)) + 24|0); $75 = +HEAPF32[$74>>2]; $6 = $75; } $76 = $3; $77 = $1; $78 = (+($77|0)); $79 = $76 == $78; do { if ($79) { $80 = $5; $81 = $1; $82 = (($81) + 1)|0; $83 = (+($82|0)); $84 = $80 <= $83; if ($84) { break; } else { ___assert_fail((30836|0),(13400|0),7754,(30794|0)); // unreachable; } } else { $85 = $3; $86 = $1; $87 = (($86) + 1)|0; $88 = (+($87|0)); $89 = $85 == $88; if ($89) { $90 = $5; $91 = $1; $92 = (+($91|0)); $93 = $90 >= $92; if ($93) { break; } else { ___assert_fail((30846|0),(13400|0),7755,(30794|0)); // unreachable; } } $94 = $3; $95 = $1; $96 = (+($95|0)); $97 = $94 <= $96; if ($97) { $98 = $5; $99 = $1; $100 = (+($99|0)); $101 = $98 <= $100; if ($101) { break; } else { ___assert_fail((30854|0),(13400|0),7756,(30794|0)); // unreachable; } } $102 = $3; $103 = $1; $104 = (($103) + 1)|0; $105 = (+($104|0)); $106 = $102 >= $105; $107 = $5; $108 = $1; if ($106) { $109 = (($108) + 1)|0; $110 = (+($109|0)); $111 = $107 >= $110; if ($111) { break; } else { ___assert_fail((30862|0),(13400|0),7757,(30794|0)); // unreachable; } } $112 = (+($108|0)); $113 = $107 >= $112; if (!($113)) { ___assert_fail((30872|0),(13400|0),7758,(30794|0)); // unreachable; } $114 = $5; $115 = $1; $116 = (($115) + 1)|0; $117 = (+($116|0)); $118 = $114 <= $117; if ($118) { break; } else { ___assert_fail((30872|0),(13400|0),7758,(30794|0)); // unreachable; } } } while(0); $119 = $3; $120 = $1; $121 = (+($120|0)); $122 = $119 <= $121; if ($122) { $123 = $5; $124 = $1; $125 = (+($124|0)); $126 = $123 <= $125; if ($126) { $127 = $2; $128 = ((($127)) + 16|0); $129 = +HEAPF32[$128>>2]; $130 = $6; $131 = $4; $132 = $130 - $131; $133 = $129 * $132; $134 = $1; $135 = $0; $136 = (($135) + ($134<<2)|0); $137 = +HEAPF32[$136>>2]; $138 = $137 + $133; HEAPF32[$136>>2] = $138; STACKTOP = sp;return; } } $139 = $3; $140 = $1; $141 = (($140) + 1)|0; $142 = (+($141|0)); $143 = $139 >= $142; if ($143) { $144 = $5; $145 = $1; $146 = (($145) + 1)|0; $147 = (+($146|0)); $148 = $144 >= $147; if ($148) { STACKTOP = sp;return; } } $149 = $3; $150 = $1; $151 = (+($150|0)); $152 = $149 >= $151; if (!($152)) { ___assert_fail((30893|0),(13400|0),7764,(30794|0)); // unreachable; } $153 = $3; $154 = $1; $155 = (($154) + 1)|0; $156 = (+($155|0)); $157 = $153 <= $156; if (!($157)) { ___assert_fail((30893|0),(13400|0),7764,(30794|0)); // unreachable; } $158 = $5; $159 = $1; $160 = (+($159|0)); $161 = $158 >= $160; if (!($161)) { ___assert_fail((30893|0),(13400|0),7764,(30794|0)); // unreachable; } $162 = $5; $163 = $1; $164 = (($163) + 1)|0; $165 = (+($164|0)); $166 = $162 <= $165; if (!($166)) { ___assert_fail((30893|0),(13400|0),7764,(30794|0)); // unreachable; } $167 = $2; $168 = ((($167)) + 16|0); $169 = +HEAPF32[$168>>2]; $170 = $6; $171 = $4; $172 = $170 - $171; $173 = $169 * $172; $174 = $3; $175 = $1; $176 = (+($175|0)); $177 = $174 - $176; $178 = $5; $179 = $1; $180 = (+($179|0)); $181 = $178 - $180; $182 = $177 + $181; $183 = $182 / 2.0; $184 = 1.0 - $183; $185 = $173 * $184; $186 = $1; $187 = $0; $188 = (($187) + ($186<<2)|0); $189 = +HEAPF32[$188>>2]; $190 = $189 + $185; HEAPF32[$188>>2] = $190; STACKTOP = sp;return; } function _nk_decompress_token($i) { $i = $i|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $26 = 0, $27 = 0, $28 = 0; var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0; var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0; var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0; var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $i; $1 = $0; $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = ($3|0)>=(32); $5 = $0; $6 = HEAP8[$5>>0]|0; $7 = $6&255; if ($4) { $8 = ($7|0)>=(128); if ($8) { $9 = HEAP32[12604>>2]|0; $10 = $0; $11 = ((($10)) + 1|0); $12 = HEAP8[$11>>0]|0; $13 = $12&255; $14 = (0 - ($13))|0; $15 = (($9) + ($14)|0); $16 = ((($15)) + -1|0); $17 = $0; $18 = HEAP8[$17>>0]|0; $19 = $18&255; $20 = (($19) - 128)|0; $21 = (($20) + 1)|0; _nk__match($16,$21); $22 = $0; $23 = ((($22)) + 2|0); $0 = $23; $257 = $0; STACKTOP = sp;return ($257|0); } $24 = $0; $25 = HEAP8[$24>>0]|0; $26 = $25&255; $27 = ($26|0)>=(64); if ($27) { $28 = HEAP32[12604>>2]|0; $29 = $0; $30 = HEAP8[$29>>0]|0; $31 = $30&255; $32 = $31 << 8; $33 = $0; $34 = ((($33)) + 1|0); $35 = HEAP8[$34>>0]|0; $36 = $35&255; $37 = (($32) + ($36))|0; $38 = (($37) - 16384)|0; $39 = (($38) + 1)|0; $40 = (0 - ($39))|0; $41 = (($28) + ($40)|0); $42 = $0; $43 = ((($42)) + 2|0); $44 = HEAP8[$43>>0]|0; $45 = $44&255; $46 = (($45) + 1)|0; _nk__match($41,$46); $47 = $0; $48 = ((($47)) + 3|0); $0 = $48; $257 = $0; STACKTOP = sp;return ($257|0); } else { $49 = $0; $50 = ((($49)) + 1|0); $51 = $0; $52 = HEAP8[$51>>0]|0; $53 = $52&255; $54 = (($53) - 32)|0; $55 = (($54) + 1)|0; _nk__lit($50,$55); $56 = $0; $57 = HEAP8[$56>>0]|0; $58 = $57&255; $59 = (($58) - 32)|0; $60 = (($59) + 1)|0; $61 = (1 + ($60))|0; $62 = $0; $63 = (($62) + ($61)|0); $0 = $63; $257 = $0; STACKTOP = sp;return ($257|0); } } $64 = ($7|0)>=(24); if ($64) { $65 = HEAP32[12604>>2]|0; $66 = $0; $67 = HEAP8[$66>>0]|0; $68 = $67&255; $69 = $68 << 16; $70 = $0; $71 = ((($70)) + 1|0); $72 = HEAP8[$71>>0]|0; $73 = $72&255; $74 = $73 << 8; $75 = $0; $76 = ((($75)) + 2|0); $77 = HEAP8[$76>>0]|0; $78 = $77&255; $79 = (($74) + ($78))|0; $80 = (($69) + ($79))|0; $81 = (($80) - 1572864)|0; $82 = (($81) + 1)|0; $83 = (0 - ($82))|0; $84 = (($65) + ($83)|0); $85 = $0; $86 = ((($85)) + 3|0); $87 = HEAP8[$86>>0]|0; $88 = $87&255; $89 = (($88) + 1)|0; _nk__match($84,$89); $90 = $0; $91 = ((($90)) + 4|0); $0 = $91; $257 = $0; STACKTOP = sp;return ($257|0); } $92 = $0; $93 = HEAP8[$92>>0]|0; $94 = $93&255; $95 = ($94|0)>=(16); if ($95) { $96 = HEAP32[12604>>2]|0; $97 = $0; $98 = HEAP8[$97>>0]|0; $99 = $98&255; $100 = $99 << 16; $101 = $0; $102 = ((($101)) + 1|0); $103 = HEAP8[$102>>0]|0; $104 = $103&255; $105 = $104 << 8; $106 = $0; $107 = ((($106)) + 2|0); $108 = HEAP8[$107>>0]|0; $109 = $108&255; $110 = (($105) + ($109))|0; $111 = (($100) + ($110))|0; $112 = (($111) - 1048576)|0; $113 = (($112) + 1)|0; $114 = (0 - ($113))|0; $115 = (($96) + ($114)|0); $116 = $0; $117 = ((($116)) + 3|0); $118 = HEAP8[$117>>0]|0; $119 = $118&255; $120 = $119 << 8; $121 = $0; $122 = ((($121)) + 4|0); $123 = HEAP8[$122>>0]|0; $124 = $123&255; $125 = (($120) + ($124))|0; $126 = (($125) + 1)|0; _nk__match($115,$126); $127 = $0; $128 = ((($127)) + 5|0); $0 = $128; $257 = $0; STACKTOP = sp;return ($257|0); } $129 = $0; $130 = HEAP8[$129>>0]|0; $131 = $130&255; $132 = ($131|0)>=(8); $133 = $0; if ($132) { $134 = ((($133)) + 2|0); $135 = $0; $136 = HEAP8[$135>>0]|0; $137 = $136&255; $138 = $137 << 8; $139 = $0; $140 = ((($139)) + 1|0); $141 = HEAP8[$140>>0]|0; $142 = $141&255; $143 = (($138) + ($142))|0; $144 = (($143) - 2048)|0; $145 = (($144) + 1)|0; _nk__lit($134,$145); $146 = $0; $147 = HEAP8[$146>>0]|0; $148 = $147&255; $149 = $148 << 8; $150 = $0; $151 = ((($150)) + 1|0); $152 = HEAP8[$151>>0]|0; $153 = $152&255; $154 = (($149) + ($153))|0; $155 = (($154) - 2048)|0; $156 = (($155) + 1)|0; $157 = (2 + ($156))|0; $158 = $0; $159 = (($158) + ($157)|0); $0 = $159; $257 = $0; STACKTOP = sp;return ($257|0); } $160 = HEAP8[$133>>0]|0; $161 = $160&255; $162 = ($161|0)==(7); $163 = $0; if ($162) { $164 = ((($163)) + 3|0); $165 = $0; $166 = ((($165)) + 1|0); $167 = HEAP8[$166>>0]|0; $168 = $167&255; $169 = $168 << 8; $170 = $0; $171 = ((($170)) + 2|0); $172 = HEAP8[$171>>0]|0; $173 = $172&255; $174 = (($169) + ($173))|0; $175 = (($174) + 1)|0; _nk__lit($164,$175); $176 = $0; $177 = ((($176)) + 1|0); $178 = HEAP8[$177>>0]|0; $179 = $178&255; $180 = $179 << 8; $181 = $0; $182 = ((($181)) + 2|0); $183 = HEAP8[$182>>0]|0; $184 = $183&255; $185 = (($180) + ($184))|0; $186 = (($185) + 1)|0; $187 = (3 + ($186))|0; $188 = $0; $189 = (($188) + ($187)|0); $0 = $189; $257 = $0; STACKTOP = sp;return ($257|0); } $190 = HEAP8[$163>>0]|0; $191 = $190&255; $192 = ($191|0)==(6); if ($192) { $193 = HEAP32[12604>>2]|0; $194 = $0; $195 = ((($194)) + 1|0); $196 = HEAP8[$195>>0]|0; $197 = $196&255; $198 = $197 << 16; $199 = $0; $200 = ((($199)) + 2|0); $201 = HEAP8[$200>>0]|0; $202 = $201&255; $203 = $202 << 8; $204 = $0; $205 = ((($204)) + 3|0); $206 = HEAP8[$205>>0]|0; $207 = $206&255; $208 = (($203) + ($207))|0; $209 = (($198) + ($208))|0; $210 = (($209) + 1)|0; $211 = (0 - ($210))|0; $212 = (($193) + ($211)|0); $213 = $0; $214 = ((($213)) + 4|0); $215 = HEAP8[$214>>0]|0; $216 = $215&255; $217 = (($216) + 1)|0; _nk__match($212,$217); $218 = $0; $219 = ((($218)) + 5|0); $0 = $219; $257 = $0; STACKTOP = sp;return ($257|0); } $220 = $0; $221 = HEAP8[$220>>0]|0; $222 = $221&255; $223 = ($222|0)==(4); if (!($223)) { $257 = $0; STACKTOP = sp;return ($257|0); } $224 = HEAP32[12604>>2]|0; $225 = $0; $226 = ((($225)) + 1|0); $227 = HEAP8[$226>>0]|0; $228 = $227&255; $229 = $228 << 16; $230 = $0; $231 = ((($230)) + 2|0); $232 = HEAP8[$231>>0]|0; $233 = $232&255; $234 = $233 << 8; $235 = $0; $236 = ((($235)) + 3|0); $237 = HEAP8[$236>>0]|0; $238 = $237&255; $239 = (($234) + ($238))|0; $240 = (($229) + ($239))|0; $241 = (($240) + 1)|0; $242 = (0 - ($241))|0; $243 = (($224) + ($242)|0); $244 = $0; $245 = ((($244)) + 4|0); $246 = HEAP8[$245>>0]|0; $247 = $246&255; $248 = $247 << 8; $249 = $0; $250 = ((($249)) + 5|0); $251 = HEAP8[$250>>0]|0; $252 = $251&255; $253 = (($248) + ($252))|0; $254 = (($253) + 1)|0; _nk__match($243,$254); $255 = $0; $256 = ((($255)) + 6|0); $0 = $256; $257 = $0; STACKTOP = sp;return ($257|0); } function _nk_adler32($adler32,$buffer,$buflen) { $adler32 = $adler32|0; $buffer = $buffer|0; $buflen = $buflen|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $12 = 0; var $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0; var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0; var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0; var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0; var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $ADLER_MOD = 0, $blocklen = 0, $i = 0, $s1 = 0, $s2 = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $adler32; $1 = $buffer; $2 = $buflen; $ADLER_MOD = 65521; $3 = $0; $4 = $3 & 65535; $s1 = $4; $5 = $0; $6 = $5 >>> 16; $s2 = $6; $7 = $2; $8 = (($7>>>0) % 5552)&-1; $blocklen = $8; while(1) { $9 = $2; $10 = ($9|0)!=(0); if (!($10)) { break; } $i = 0; while(1) { $11 = $i; $12 = (($11) + 7)|0; $13 = $blocklen; $14 = ($12>>>0)<($13>>>0); if (!($14)) { break; } $15 = $1; $16 = HEAP8[$15>>0]|0; $17 = $16&255; $18 = $s1; $19 = (($18) + ($17))|0; $s1 = $19; $20 = $s1; $21 = $s2; $22 = (($21) + ($20))|0; $s2 = $22; $23 = $1; $24 = ((($23)) + 1|0); $25 = HEAP8[$24>>0]|0; $26 = $25&255; $27 = $s1; $28 = (($27) + ($26))|0; $s1 = $28; $29 = $s1; $30 = $s2; $31 = (($30) + ($29))|0; $s2 = $31; $32 = $1; $33 = ((($32)) + 2|0); $34 = HEAP8[$33>>0]|0; $35 = $34&255; $36 = $s1; $37 = (($36) + ($35))|0; $s1 = $37; $38 = $s1; $39 = $s2; $40 = (($39) + ($38))|0; $s2 = $40; $41 = $1; $42 = ((($41)) + 3|0); $43 = HEAP8[$42>>0]|0; $44 = $43&255; $45 = $s1; $46 = (($45) + ($44))|0; $s1 = $46; $47 = $s1; $48 = $s2; $49 = (($48) + ($47))|0; $s2 = $49; $50 = $1; $51 = ((($50)) + 4|0); $52 = HEAP8[$51>>0]|0; $53 = $52&255; $54 = $s1; $55 = (($54) + ($53))|0; $s1 = $55; $56 = $s1; $57 = $s2; $58 = (($57) + ($56))|0; $s2 = $58; $59 = $1; $60 = ((($59)) + 5|0); $61 = HEAP8[$60>>0]|0; $62 = $61&255; $63 = $s1; $64 = (($63) + ($62))|0; $s1 = $64; $65 = $s1; $66 = $s2; $67 = (($66) + ($65))|0; $s2 = $67; $68 = $1; $69 = ((($68)) + 6|0); $70 = HEAP8[$69>>0]|0; $71 = $70&255; $72 = $s1; $73 = (($72) + ($71))|0; $s1 = $73; $74 = $s1; $75 = $s2; $76 = (($75) + ($74))|0; $s2 = $76; $77 = $1; $78 = ((($77)) + 7|0); $79 = HEAP8[$78>>0]|0; $80 = $79&255; $81 = $s1; $82 = (($81) + ($80))|0; $s1 = $82; $83 = $s1; $84 = $s2; $85 = (($84) + ($83))|0; $s2 = $85; $86 = $1; $87 = ((($86)) + 8|0); $1 = $87; $88 = $i; $89 = (($88) + 8)|0; $i = $89; } while(1) { $90 = $i; $91 = $blocklen; $92 = ($90>>>0)<($91>>>0); if (!($92)) { break; } $93 = $1; $94 = ((($93)) + 1|0); $1 = $94; $95 = HEAP8[$93>>0]|0; $96 = $95&255; $97 = $s1; $98 = (($97) + ($96))|0; $s1 = $98; $99 = $s1; $100 = $s2; $101 = (($100) + ($99))|0; $s2 = $101; $102 = $i; $103 = (($102) + 1)|0; $i = $103; } $104 = $s1; $105 = (($104>>>0) % 65521)&-1; $s1 = $105; $106 = $s2; $107 = (($106>>>0) % 65521)&-1; $s2 = $107; $108 = $blocklen; $109 = $2; $110 = (($109) - ($108))|0; $2 = $110; $blocklen = 5552; } $111 = $s2; $112 = $111 << 16; $113 = $s1; $114 = (($112) + ($113))|0; STACKTOP = sp;return ($114|0); } function _nk__match($data,$length) { $data = $data|0; $length = $length|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $data; $1 = $length; $2 = HEAP32[12604>>2]|0; $3 = $1; $4 = (($2) + ($3)|0); $5 = HEAP32[12596>>2]|0; $6 = ($4>>>0)<=($5>>>0); if (!($6)) { ___assert_fail((31138|0),(13400|0),9349,(31171|0)); // unreachable; } $7 = HEAP32[12604>>2]|0; $8 = $1; $9 = (($7) + ($8)|0); $10 = HEAP32[12596>>2]|0; $11 = ($9>>>0)>($10>>>0); if ($11) { $12 = $1; $13 = HEAP32[12604>>2]|0; $14 = (($13) + ($12)|0); HEAP32[12604>>2] = $14; STACKTOP = sp;return; } $15 = $0; $16 = HEAP32[12600>>2]|0; $17 = ($15>>>0)<($16>>>0); if ($17) { $18 = HEAP32[12596>>2]|0; $19 = ((($18)) + 1|0); HEAP32[12604>>2] = $19; STACKTOP = sp;return; } while(1) { $20 = $1; $21 = (($20) + -1)|0; $1 = $21; $22 = ($20|0)!=(0); if (!($22)) { break; } $23 = $0; $24 = ((($23)) + 1|0); $0 = $24; $25 = HEAP8[$23>>0]|0; $26 = HEAP32[12604>>2]|0; $27 = ((($26)) + 1|0); HEAP32[12604>>2] = $27; HEAP8[$26>>0] = $25; } STACKTOP = sp;return; } function _nk__lit($data,$length) { $data = $data|0; $length = $length|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $data; $1 = $length; $2 = HEAP32[12604>>2]|0; $3 = $1; $4 = (($2) + ($3)|0); $5 = HEAP32[12596>>2]|0; $6 = ($4>>>0)<=($5>>>0); if (!($6)) { ___assert_fail((31138|0),(13400|0),9358,(31181|0)); // unreachable; } $7 = HEAP32[12604>>2]|0; $8 = $1; $9 = (($7) + ($8)|0); $10 = HEAP32[12596>>2]|0; $11 = ($9>>>0)>($10>>>0); if ($11) { $12 = $1; $13 = HEAP32[12604>>2]|0; $14 = (($13) + ($12)|0); HEAP32[12604>>2] = $14; STACKTOP = sp;return; } $15 = $0; $16 = HEAP32[12588>>2]|0; $17 = ($15>>>0)<($16>>>0); if ($17) { $18 = HEAP32[12596>>2]|0; $19 = ((($18)) + 1|0); HEAP32[12604>>2] = $19; STACKTOP = sp;return; } else { $20 = HEAP32[12604>>2]|0; $21 = $0; $22 = $1; (_nk_memcopy($20,$21,$22)|0); $23 = $1; $24 = HEAP32[12604>>2]|0; $25 = (($24) + ($23)|0); HEAP32[12604>>2] = $25; STACKTOP = sp;return; } } function _nk_decode_85_byte($c) { $c = $c|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $c; $1 = $0; $2 = $1 << 24 >> 24; $3 = ($2|0)>=(92); $4 = $0; $5 = $4 << 24 >> 24; $6 = (($5) - 36)|0; $7 = (($5) - 35)|0; $8 = $3 ? $6 : $7; STACKTOP = sp;return ($8|0); } function _nk_textedit_createundo($state,$pos,$insert_len,$delete_len) { $state = $state|0; $pos = $pos|0; $insert_len = $insert_len|0; $delete_len = $delete_len|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $r = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $state; $2 = $pos; $3 = $insert_len; $4 = $delete_len; $5 = $1; $6 = $3; $7 = (_nk_textedit_create_undo_record($5,$6)|0); $r = $7; $8 = $r; $9 = ($8|0)==(0|0); if ($9) { $0 = 0; $45 = $0; STACKTOP = sp;return ($45|0); } $10 = $2; $11 = $r; HEAP32[$11>>2] = $10; $12 = $3; $13 = $12&65535; $14 = $r; $15 = ((($14)) + 4|0); HEAP16[$15>>1] = $13; $16 = $4; $17 = $16&65535; $18 = $r; $19 = ((($18)) + 6|0); HEAP16[$19>>1] = $17; $20 = $3; $21 = ($20|0)==(0); if ($21) { $22 = $r; $23 = ((($22)) + 8|0); HEAP16[$23>>1] = -1; $0 = 0; $45 = $0; STACKTOP = sp;return ($45|0); } else { $24 = $1; $25 = ((($24)) + 5188|0); $26 = HEAP16[$25>>1]|0; $27 = $r; $28 = ((($27)) + 8|0); HEAP16[$28>>1] = $26; $29 = $1; $30 = ((($29)) + 5188|0); $31 = HEAP16[$30>>1]|0; $32 = $31 << 16 >> 16; $33 = $3; $34 = (($32) + ($33))|0; $35 = $34&65535; $36 = $1; $37 = ((($36)) + 5188|0); HEAP16[$37>>1] = $35; $38 = $r; $39 = ((($38)) + 8|0); $40 = HEAP16[$39>>1]|0; $41 = $40 << 16 >> 16; $42 = $1; $43 = ((($42)) + 1188|0); $44 = (($43) + ($41<<2)|0); $0 = $44; $45 = $0; STACKTOP = sp;return ($45|0); } return (0)|0; } function _nk_textedit_create_undo_record($state,$numchars) { $state = $state|0; $numchars = $numchars|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $state; $2 = $numchars; $3 = $1; _nk_textedit_flush_redo($3); $4 = $1; $5 = ((($4)) + 5184|0); $6 = HEAP16[$5>>1]|0; $7 = $6 << 16 >> 16; $8 = ($7|0)==(99); if ($8) { $9 = $1; _nk_textedit_discard_undo($9); } $10 = $2; $11 = ($10|0)>(999); if ($11) { $12 = $1; $13 = ((($12)) + 5184|0); HEAP16[$13>>1] = 0; $14 = $1; $15 = ((($14)) + 5188|0); HEAP16[$15>>1] = 0; $0 = 0; $30 = $0; STACKTOP = sp;return ($30|0); } while(1) { $16 = $1; $17 = ((($16)) + 5188|0); $18 = HEAP16[$17>>1]|0; $19 = $18 << 16 >> 16; $20 = $2; $21 = (($19) + ($20))|0; $22 = ($21|0)>(999); $23 = $1; if (!($22)) { break; } _nk_textedit_discard_undo($23); } $24 = ((($23)) + 5184|0); $25 = HEAP16[$24>>1]|0; $26 = (($25) + 1)<<16>>16; HEAP16[$24>>1] = $26; $27 = $25 << 16 >> 16; $28 = $1; $29 = (($28) + (($27*12)|0)|0); $0 = $29; $30 = $0; STACKTOP = sp;return ($30|0); } function _nk_textedit_flush_redo($state) { $state = $state|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 5186|0); HEAP16[$2>>1] = 99; $3 = $0; $4 = ((($3)) + 5190|0); HEAP16[$4>>1] = 999; STACKTOP = sp;return; } function _nk_textedit_discard_undo($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $8 = 0, $9 = 0, $i = 0, $n = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 5184|0); $3 = HEAP16[$2>>1]|0; $4 = $3 << 16 >> 16; $5 = ($4|0)>(0); if (!($5)) { STACKTOP = sp;return; } $6 = $0; $7 = ((($6)) + 8|0); $8 = HEAP16[$7>>1]|0; $9 = $8 << 16 >> 16; $10 = ($9|0)>=(0); L4: do { if ($10) { $11 = $0; $12 = ((($11)) + 4|0); $13 = HEAP16[$12>>1]|0; $14 = $13 << 16 >> 16; $n = $14; $15 = $0; $16 = ((($15)) + 5188|0); $17 = HEAP16[$16>>1]|0; $18 = $17 << 16 >> 16; $19 = $n; $20 = (($18) - ($19))|0; $21 = $20&65535; $22 = $0; $23 = ((($22)) + 5188|0); HEAP16[$23>>1] = $21; $24 = $0; $25 = ((($24)) + 1188|0); $26 = $0; $27 = ((($26)) + 1188|0); $28 = $n; $29 = (($27) + ($28<<2)|0); $30 = $0; $31 = ((($30)) + 5188|0); $32 = HEAP16[$31>>1]|0; $33 = $32 << 16 >> 16; $34 = $33<<2; (_nk_memcopy($25,$29,$34)|0); $i = 0; while(1) { $35 = $i; $36 = $0; $37 = ((($36)) + 5184|0); $38 = HEAP16[$37>>1]|0; $39 = $38 << 16 >> 16; $40 = ($35|0)<($39|0); if (!($40)) { break L4; } $41 = $i; $42 = $0; $43 = (($42) + (($41*12)|0)|0); $44 = ((($43)) + 8|0); $45 = HEAP16[$44>>1]|0; $46 = $45 << 16 >> 16; $47 = ($46|0)>=(0); if ($47) { $48 = $i; $49 = $0; $50 = (($49) + (($48*12)|0)|0); $51 = ((($50)) + 8|0); $52 = HEAP16[$51>>1]|0; $53 = $52 << 16 >> 16; $54 = $n; $55 = (($53) - ($54))|0; $56 = $55&65535; $57 = $i; $58 = $0; $59 = (($58) + (($57*12)|0)|0); $60 = ((($59)) + 8|0); HEAP16[$60>>1] = $56; } $61 = $i; $62 = (($61) + 1)|0; $i = $62; } } } while(0); $63 = $0; $64 = ((($63)) + 5184|0); $65 = HEAP16[$64>>1]|0; $66 = (($65) + -1)<<16>>16; HEAP16[$64>>1] = $66; $67 = $0; $68 = $0; $69 = ((($68)) + 12|0); $70 = $0; $71 = ((($70)) + 5184|0); $72 = HEAP16[$71>>1]|0; $73 = $72 << 16 >> 16; $74 = ($73*12)|0; (_nk_memcopy($67,$69,$74)|0); STACKTOP = sp;return; } function _nk_free_page_element($ctx,$elem) { $ctx = $ctx|0; $elem = $elem|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $elem; $2 = $0; $3 = ((($2)) + 11172|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)!=(0|0); if ($5) { $9 = $0; $10 = ((($9)) + 11172|0); $11 = HEAP32[$10>>2]|0; $12 = $1; $13 = ((($12)) + 284|0); HEAP32[$13>>2] = $11; $14 = $1; $15 = $0; $16 = ((($15)) + 11172|0); HEAP32[$16>>2] = $14; STACKTOP = sp;return; } else { $6 = $1; $7 = $0; $8 = ((($7)) + 11172|0); HEAP32[$8>>2] = $6; STACKTOP = sp;return; } } function _nk_create_page_element($ctx) { $ctx = $ctx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $elem = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $ctx; $2 = $1; $3 = ((($2)) + 11172|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)!=(0|0); $6 = $1; do { if ($5) { $7 = ((($6)) + 11172|0); $8 = HEAP32[$7>>2]|0; $elem = $8; $9 = $elem; $10 = ((($9)) + 284|0); $11 = HEAP32[$10>>2]|0; $12 = $1; $13 = ((($12)) + 11172|0); HEAP32[$13>>2] = $11; } else { $14 = ((($6)) + 11152|0); $15 = HEAP32[$14>>2]|0; $16 = ($15|0)!=(0|0); $17 = $1; if ($16) { $18 = ((($17)) + 11152|0); $19 = HEAP32[$18>>2]|0; $20 = (_nk_pool_alloc($19)|0); $elem = $20; $21 = $elem; $22 = ($21|0)!=(0|0); if (!($22)) { ___assert_fail((31232|0),(13400|0),14732,(31237|0)); // unreachable; } $23 = $elem; $24 = ($23|0)!=(0|0); if ($24) { break; } $0 = 0; $37 = $0; STACKTOP = sp;return ($37|0); } else { $25 = ((($17)) + 5596|0); $26 = (_nk_buffer_alloc($25,1,292,4)|0); $elem = $26; $27 = $elem; $28 = ($27|0)!=(0|0); if (!($28)) { ___assert_fail((31232|0),(13400|0),14739,(31237|0)); // unreachable; } $29 = $elem; $30 = ($29|0)!=(0|0); if ($30) { break; } $0 = 0; $37 = $0; STACKTOP = sp;return ($37|0); } } } while(0); $31 = $elem; _nk_zero($31,292); $32 = $elem; $33 = ((($32)) + 284|0); HEAP32[$33>>2] = 0; $34 = $elem; $35 = ((($34)) + 288|0); HEAP32[$35>>2] = 0; $36 = $elem; $0 = $36; $37 = $0; STACKTOP = sp;return ($37|0); } function _nk_pool_alloc($pool) { $pool = $pool|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; var $page = 0, $size = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 16|0; $1 = $pool; $2 = $1; $3 = ((($2)) + 20|0); $4 = HEAP32[$3>>2]|0; $5 = ($4|0)!=(0|0); if ($5) { $6 = $1; $7 = ((($6)) + 20|0); $8 = HEAP32[$7>>2]|0; $9 = HEAP32[$8>>2]|0; $10 = $1; $11 = ((($10)) + 28|0); $12 = HEAP32[$11>>2]|0; $13 = ($9>>>0)>=($12>>>0); if ($13) { label = 3; } } else { label = 3; } do { if ((label|0) == 3) { $14 = $1; $15 = ((($14)) + 12|0); $16 = HEAP32[$15>>2]|0; $17 = ($16|0)==(0); if (!($17)) { $size = 300; $31 = $size; $32 = (($31) + 4544)|0; $size = $32; $33 = $1; $34 = ((($33)) + 4|0); $35 = HEAP32[$34>>2]|0; $36 = $1; $37 = $size; ;HEAP32[$$byval_copy>>2]=HEAP32[$36>>2]|0; $38 = (FUNCTION_TABLE_iiii[$35 & 7]($$byval_copy,0,$37)|0); $page = $38; $39 = $page; HEAP32[$39>>2] = 0; $40 = $1; $41 = ((($40)) + 20|0); $42 = HEAP32[$41>>2]|0; $43 = $page; $44 = ((($43)) + 4|0); HEAP32[$44>>2] = $42; $45 = $page; $46 = $1; $47 = ((($46)) + 20|0); HEAP32[$47>>2] = $45; break; } $18 = $1; $19 = ((($18)) + 20|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); $22 = $1; $23 = ((($22)) + 20|0); $24 = HEAP32[$23>>2]|0; if ($21) { $26 = HEAP32[$24>>2]|0; $27 = $1; $28 = ((($27)) + 28|0); $29 = HEAP32[$28>>2]|0; $30 = ($26>>>0)<($29>>>0); if (!($30)) { ___assert_fail((31286|0),(13400|0),14362,(31272|0)); // unreachable; } $0 = 0; $58 = $0; STACKTOP = sp;return ($58|0); } else { $25 = ($24|0)!=(0|0); if (!($25)) { ___assert_fail((31260|0),(13400|0),14359,(31272|0)); // unreachable; } $0 = 0; $58 = $0; STACKTOP = sp;return ($58|0); } } } while(0); $48 = $1; $49 = ((($48)) + 20|0); $50 = HEAP32[$49>>2]|0; $51 = HEAP32[$50>>2]|0; $52 = (($51) + 1)|0; HEAP32[$50>>2] = $52; $53 = $1; $54 = ((($53)) + 20|0); $55 = HEAP32[$54>>2]|0; $56 = ((($55)) + 8|0); $57 = (($56) + (($51*292)|0)|0); $0 = $57; $58 = $0; STACKTOP = sp;return ($58|0); } function _nk_window_has_header($win,$title) { $win = $win|0; $title = $title|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $active = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $win; $1 = $title; $active = 0; $2 = $0; $3 = ((($2)) + 8|0); $4 = HEAP32[$3>>2]|0; $5 = $4 & 48; $active = $5; $6 = $active; $7 = ($6|0)!=(0); if ($7) { $14 = 1; } else { $8 = $0; $9 = ((($8)) + 8|0); $10 = HEAP32[$9>>2]|0; $11 = $10 & 256; $12 = ($11|0)!=(0); $14 = $12; } $13 = $14&1; $active = $13; $15 = $active; $16 = ($15|0)!=(0); if ($16) { $17 = $0; $18 = ((($17)) + 8|0); $19 = HEAP32[$18>>2]|0; $20 = $19 & 2048; $21 = ($20|0)!=(0); if ($21) { $25 = 0; } else { $22 = $1; $23 = ($22|0)!=(0|0); $25 = $23; } } else { $25 = 0; } $24 = $25&1; $active = $24; $26 = $active; STACKTOP = sp;return ($26|0); } function _nk_do_scrollbarv($state,$out,$scroll,$has_scrolling,$offset,$target,$step,$button_pixel_inc,$style,$in,$font) { $state = $state|0; $out = $out|0; $scroll = $scroll|0; $has_scrolling = $has_scrolling|0; $offset = +$offset; $target = +$target; $step = +$step; $button_pixel_inc = +$button_pixel_inc; $style = $style|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy3 = 0, $0 = 0.0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0; var $114 = 0.0, $115 = 0, $116 = 0.0, $117 = 0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0.0; var $132 = 0.0, $133 = 0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0.0, $142 = 0.0, $143 = 0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0, $148 = 0.0, $149 = 0.0, $15 = 0; var $150 = 0.0, $151 = 0.0, $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0, $156 = 0.0, $157 = 0.0, $158 = 0, $159 = 0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0, $163 = 0, $164 = 0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0; var $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0.0, $173 = 0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0, $183 = 0, $184 = 0.0, $185 = 0.0, $186 = 0; var $187 = 0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0.0, $192 = 0.0, $193 = 0, $194 = 0, $195 = 0.0, $196 = 0.0, $197 = 0.0, $198 = 0.0, $199 = 0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0, $202 = 0, $203 = 0.0; var $204 = 0.0, $205 = 0, $206 = 0, $207 = 0.0, $208 = 0.0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0.0, $213 = 0.0, $214 = 0.0, $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0.0, $220 = 0.0, $221 = 0.0; var $222 = 0, $223 = 0.0, $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0.0, $234 = 0.0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0; var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0; var $259 = 0, $26 = 0.0, $260 = 0.0, $261 = 0.0, $27 = 0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0; var $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0, $59 = 0.0; var $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0, $85 = 0.0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $button = 0, $button$byval_copy = 0, $button$byval_copy2 = 0, $cursor = 0, $cursor$byval_copy = 0, $or$cond = 0, $scroll$byval_copy = 0, $scroll_h = 0.0, $scroll_off = 0.0, $scroll_offset = 0.0, $scroll_ratio = 0.0, $scroll_step = 0.0, $ws = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 176|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy3 = sp + 172|0; $$byval_copy = sp + 168|0; $cursor$byval_copy = sp + 152|0; $scroll$byval_copy = sp + 136|0; $button$byval_copy2 = sp + 120|0; $button$byval_copy = sp + 104|0; $cursor = sp + 40|0; $ws = sp + 20|0; $button = sp; $1 = $state; $2 = $out; $3 = $has_scrolling; $4 = $offset; $5 = $target; $6 = $step; $7 = $button_pixel_inc; $8 = $style; $9 = $in; $10 = $font; $11 = $2; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((31441|0),(13400|0),12487,(31445|0)); // unreachable; } $13 = $8; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((31462|0),(13400|0),12488,(31445|0)); // unreachable; } $15 = $1; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((28059|0),(13400|0),12489,(31445|0)); // unreachable; } $17 = $2; $18 = ($17|0)!=(0|0); $19 = $8; $20 = ($19|0)!=(0|0); $or$cond = $18 & $20; if (!($or$cond)) { $0 = 0.0; $261 = $0; STACKTOP = sp;return (+$261); } $21 = ((($scroll)) + 8|0); $22 = +HEAPF32[$21>>2]; $23 = $22 < 1.0; $24 = ((($scroll)) + 8|0); $25 = +HEAPF32[$24>>2]; $26 = $23 ? 1.0 : $25; $27 = ((($scroll)) + 8|0); HEAPF32[$27>>2] = $26; $28 = ((($scroll)) + 12|0); $29 = +HEAPF32[$28>>2]; $30 = ((($scroll)) + 8|0); $31 = +HEAPF32[$30>>2]; $32 = 2.0 * $31; $33 = $29 < $32; $34 = ((($scroll)) + 8|0); $35 = +HEAPF32[$34>>2]; $36 = 2.0 * $35; $37 = ((($scroll)) + 12|0); $38 = +HEAPF32[$37>>2]; $39 = $33 ? $36 : $38; $40 = ((($scroll)) + 12|0); HEAPF32[$40>>2] = $39; $41 = $5; $42 = ((($scroll)) + 12|0); $43 = +HEAPF32[$42>>2]; $44 = $41 <= $43; if ($44) { $0 = 0.0; $261 = $0; STACKTOP = sp;return (+$261); } $45 = $8; $46 = ((($45)) + 152|0); $47 = HEAP32[$46>>2]|0; $48 = ($47|0)!=(0); if ($48) { $49 = +HEAPF32[$scroll>>2]; HEAPF32[$button>>2] = $49; $50 = ((($scroll)) + 8|0); $51 = +HEAPF32[$50>>2]; $52 = ((($button)) + 8|0); HEAPF32[$52>>2] = $51; $53 = ((($scroll)) + 8|0); $54 = +HEAPF32[$53>>2]; $55 = ((($button)) + 12|0); HEAPF32[$55>>2] = $54; $56 = ((($scroll)) + 12|0); $57 = +HEAPF32[$56>>2]; $58 = ((($button)) + 12|0); $59 = +HEAPF32[$58>>2]; $60 = 2.0 * $59; $61 = $57 - $60; $scroll_h = $61; $62 = $6; $63 = $7; $64 = $62 < $63; $65 = $6; $66 = $7; $67 = $64 ? $65 : $66; $scroll_step = $67; $68 = ((($scroll)) + 4|0); $69 = +HEAPF32[$68>>2]; $70 = ((($button)) + 4|0); HEAPF32[$70>>2] = $69; $71 = $2; $72 = $8; $73 = ((($72)) + 416|0); $74 = HEAP32[$73>>2]|0; $75 = $8; $76 = ((($75)) + 284|0); $77 = $9; $78 = $10; ;HEAP32[$button$byval_copy>>2]=HEAP32[$button>>2]|0;HEAP32[$button$byval_copy+4>>2]=HEAP32[$button+4>>2]|0;HEAP32[$button$byval_copy+8>>2]=HEAP32[$button+8>>2]|0;HEAP32[$button$byval_copy+12>>2]=HEAP32[$button+12>>2]|0; $79 = (_nk_do_button_symbol($ws,$71,$button$byval_copy,$74,1,$76,$77,$78)|0); $80 = ($79|0)!=(0); if ($80) { $81 = $4; $82 = $scroll_step; $83 = $81 - $82; $4 = $83; } $84 = ((($scroll)) + 4|0); $85 = +HEAPF32[$84>>2]; $86 = ((($scroll)) + 12|0); $87 = +HEAPF32[$86>>2]; $88 = $85 + $87; $89 = ((($button)) + 12|0); $90 = +HEAPF32[$89>>2]; $91 = $88 - $90; $92 = ((($button)) + 4|0); HEAPF32[$92>>2] = $91; $93 = $2; $94 = $8; $95 = ((($94)) + 412|0); $96 = HEAP32[$95>>2]|0; $97 = $8; $98 = ((($97)) + 156|0); $99 = $9; $100 = $10; ;HEAP32[$button$byval_copy2>>2]=HEAP32[$button>>2]|0;HEAP32[$button$byval_copy2+4>>2]=HEAP32[$button+4>>2]|0;HEAP32[$button$byval_copy2+8>>2]=HEAP32[$button+8>>2]|0;HEAP32[$button$byval_copy2+12>>2]=HEAP32[$button+12>>2]|0; $101 = (_nk_do_button_symbol($ws,$93,$button$byval_copy2,$96,1,$98,$99,$100)|0); $102 = ($101|0)!=(0); if ($102) { $103 = $4; $104 = $scroll_step; $105 = $103 + $104; $4 = $105; } $106 = ((($scroll)) + 4|0); $107 = +HEAPF32[$106>>2]; $108 = ((($button)) + 12|0); $109 = +HEAPF32[$108>>2]; $110 = $107 + $109; $111 = ((($scroll)) + 4|0); HEAPF32[$111>>2] = $110; $112 = $scroll_h; $113 = ((($scroll)) + 12|0); HEAPF32[$113>>2] = $112; } $114 = $6; $115 = ((($scroll)) + 12|0); $116 = +HEAPF32[$115>>2]; $117 = $114 < $116; $118 = $6; $119 = ((($scroll)) + 12|0); $120 = +HEAPF32[$119>>2]; $121 = $117 ? $118 : $120; $scroll_step = $121; $122 = $4; $123 = $5; $124 = ((($scroll)) + 12|0); $125 = +HEAPF32[$124>>2]; $126 = $123 - $125; $127 = $122 < $126; if ($127) { $128 = $4; $134 = $128; } else { $129 = $5; $130 = ((($scroll)) + 12|0); $131 = +HEAPF32[$130>>2]; $132 = $129 - $131; $134 = $132; } $133 = $134 < 0.0; do { if ($133) { $146 = 0.0; } else { $135 = $4; $136 = $5; $137 = ((($scroll)) + 12|0); $138 = +HEAPF32[$137>>2]; $139 = $136 - $138; $140 = $135 < $139; if ($140) { $141 = $4; $146 = $141; break; } else { $142 = $5; $143 = ((($scroll)) + 12|0); $144 = +HEAPF32[$143>>2]; $145 = $142 - $144; $146 = $145; break; } } } while(0); $scroll_offset = $146; $147 = ((($scroll)) + 12|0); $148 = +HEAPF32[$147>>2]; $149 = $5; $150 = $148 / $149; $scroll_ratio = $150; $151 = $scroll_offset; $152 = $5; $153 = $151 / $152; $scroll_off = $153; $154 = $scroll_ratio; $155 = ((($scroll)) + 12|0); $156 = +HEAPF32[$155>>2]; $157 = $154 * $156; $158 = $8; $159 = ((($158)) + 128|0); $160 = +HEAPF32[$159>>2]; $161 = 2.0 * $160; $162 = $8; $163 = ((($162)) + 144|0); $164 = ((($163)) + 4|0); $165 = +HEAPF32[$164>>2]; $166 = 2.0 * $165; $167 = $161 + $166; $168 = $157 - $167; $169 = ((($cursor)) + 12|0); HEAPF32[$169>>2] = $168; $170 = ((($scroll)) + 4|0); $171 = +HEAPF32[$170>>2]; $172 = $scroll_off; $173 = ((($scroll)) + 12|0); $174 = +HEAPF32[$173>>2]; $175 = $172 * $174; $176 = $171 + $175; $177 = $8; $178 = ((($177)) + 128|0); $179 = +HEAPF32[$178>>2]; $180 = $176 + $179; $181 = $8; $182 = ((($181)) + 144|0); $183 = ((($182)) + 4|0); $184 = +HEAPF32[$183>>2]; $185 = $180 + $184; $186 = ((($cursor)) + 4|0); HEAPF32[$186>>2] = $185; $187 = ((($scroll)) + 8|0); $188 = +HEAPF32[$187>>2]; $189 = $8; $190 = ((($189)) + 128|0); $191 = +HEAPF32[$190>>2]; $192 = 2.0 * $191; $193 = $8; $194 = ((($193)) + 144|0); $195 = +HEAPF32[$194>>2]; $196 = 2.0 * $195; $197 = $192 + $196; $198 = $188 - $197; $199 = ((($cursor)) + 8|0); HEAPF32[$199>>2] = $198; $200 = +HEAPF32[$scroll>>2]; $201 = $8; $202 = ((($201)) + 128|0); $203 = +HEAPF32[$202>>2]; $204 = $200 + $203; $205 = $8; $206 = ((($205)) + 144|0); $207 = +HEAPF32[$206>>2]; $208 = $204 + $207; HEAPF32[$cursor>>2] = $208; $209 = $1; $210 = $9; $211 = $3; $212 = $scroll_offset; $213 = $5; $214 = $scroll_step; ;HEAP32[$scroll$byval_copy>>2]=HEAP32[$scroll>>2]|0;HEAP32[$scroll$byval_copy+4>>2]=HEAP32[$scroll+4>>2]|0;HEAP32[$scroll$byval_copy+8>>2]=HEAP32[$scroll+8>>2]|0;HEAP32[$scroll$byval_copy+12>>2]=HEAP32[$scroll+12>>2]|0; ;HEAP32[$cursor$byval_copy>>2]=HEAP32[$cursor>>2]|0;HEAP32[$cursor$byval_copy+4>>2]=HEAP32[$cursor+4>>2]|0;HEAP32[$cursor$byval_copy+8>>2]=HEAP32[$cursor+8>>2]|0;HEAP32[$cursor$byval_copy+12>>2]=HEAP32[$cursor+12>>2]|0; $215 = (+_nk_scrollbar_behavior($209,$210,$211,$scroll$byval_copy,$cursor$byval_copy,$212,$213,$214,0)); $scroll_offset = $215; $216 = $scroll_offset; $217 = $5; $218 = $216 / $217; $scroll_off = $218; $219 = ((($scroll)) + 4|0); $220 = +HEAPF32[$219>>2]; $221 = $scroll_off; $222 = ((($scroll)) + 12|0); $223 = +HEAPF32[$222>>2]; $224 = $221 * $223; $225 = $220 + $224; $226 = $8; $227 = ((($226)) + 136|0); $228 = +HEAPF32[$227>>2]; $229 = $225 + $228; $230 = $8; $231 = ((($230)) + 144|0); $232 = ((($231)) + 4|0); $233 = +HEAPF32[$232>>2]; $234 = $229 + $233; $235 = ((($cursor)) + 4|0); HEAPF32[$235>>2] = $234; $236 = $8; $237 = ((($236)) + 424|0); $238 = HEAP32[$237>>2]|0; $239 = ($238|0)!=(0|0); if ($239) { $240 = $8; $241 = ((($240)) + 424|0); $242 = HEAP32[$241>>2]|0; $243 = $2; $244 = $8; $245 = ((($244)) + 420|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$245>>2]|0; FUNCTION_TABLE_vii[$242 & 31]($243,$$byval_copy); } $246 = $2; $247 = $1; $248 = HEAP32[$247>>2]|0; $249 = $8; _nk_draw_scrollbar($246,$248,$249,$scroll,$cursor); $250 = $8; $251 = ((($250)) + 428|0); $252 = HEAP32[$251>>2]|0; $253 = ($252|0)!=(0|0); if ($253) { $254 = $8; $255 = ((($254)) + 428|0); $256 = HEAP32[$255>>2]|0; $257 = $2; $258 = $8; $259 = ((($258)) + 420|0); ;HEAP32[$$byval_copy3>>2]=HEAP32[$259>>2]|0; FUNCTION_TABLE_vii[$256 & 31]($257,$$byval_copy3); } $260 = $scroll_offset; $0 = $260; $261 = $0; STACKTOP = sp;return (+$261); } function _nk_do_scrollbarh($state,$out,$scroll,$has_scrolling,$offset,$target,$step,$button_pixel_inc,$style,$in,$font) { $state = $state|0; $out = $out|0; $scroll = $scroll|0; $has_scrolling = $has_scrolling|0; $offset = +$offset; $target = +$target; $step = +$step; $button_pixel_inc = +$button_pixel_inc; $style = $style|0; $in = $in|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy3 = 0, $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0; var $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0.0, $123 = 0.0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0; var $132 = 0.0, $133 = 0.0, $134 = 0, $135 = 0.0, $136 = 0.0, $137 = 0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0; var $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0.0; var $169 = 0, $17 = 0, $170 = 0, $171 = 0.0, $172 = 0.0, $173 = 0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0, $184 = 0, $185 = 0, $186 = 0.0; var $187 = 0.0, $188 = 0.0, $189 = 0.0, $19 = 0, $190 = 0, $191 = 0, $192 = 0.0, $193 = 0, $194 = 0, $195 = 0.0, $196 = 0.0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0.0, $200 = 0.0, $201 = 0.0, $202 = 0, $203 = 0; var $204 = 0, $205 = 0, $206 = 0.0, $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0.0, $212 = 0.0, $213 = 0.0, $214 = 0.0, $215 = 0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0, $220 = 0, $221 = 0; var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0.0; var $240 = 0, $241 = 0, $242 = 0, $243 = 0.0, $244 = 0.0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0; var $39 = 0.0, $4 = 0.0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0, $56 = 0; var $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0; var $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0; var $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0, $button = 0, $button$byval_copy = 0, $button$byval_copy2 = 0, $cursor = 0, $cursor$byval_copy = 0, $or$cond = 0, $scroll$byval_copy = 0, $scroll_off = 0.0, $scroll_offset = 0.0, $scroll_ratio = 0.0, $scroll_step = 0.0, $scroll_w = 0.0, $ws = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 176|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy3 = sp + 172|0; $$byval_copy = sp + 168|0; $cursor$byval_copy = sp + 152|0; $scroll$byval_copy = sp + 136|0; $button$byval_copy2 = sp + 120|0; $button$byval_copy = sp + 104|0; $cursor = sp + 40|0; $ws = sp + 20|0; $button = sp; $1 = $state; $2 = $out; $3 = $has_scrolling; $4 = $offset; $5 = $target; $6 = $step; $7 = $button_pixel_inc; $8 = $style; $9 = $in; $10 = $font; $11 = $2; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((31441|0),(13400|0),12562,(31468|0)); // unreachable; } $13 = $8; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((31462|0),(13400|0),12563,(31468|0)); // unreachable; } $15 = $2; $16 = ($15|0)!=(0|0); $17 = $8; $18 = ($17|0)!=(0|0); $or$cond = $16 & $18; if (!($or$cond)) { $0 = 0.0; $244 = $0; STACKTOP = sp;return (+$244); } $19 = ((($scroll)) + 12|0); $20 = +HEAPF32[$19>>2]; $21 = $20 < 1.0; $22 = ((($scroll)) + 12|0); $23 = +HEAPF32[$22>>2]; $24 = $21 ? 1.0 : $23; $25 = ((($scroll)) + 12|0); HEAPF32[$25>>2] = $24; $26 = ((($scroll)) + 8|0); $27 = +HEAPF32[$26>>2]; $28 = ((($scroll)) + 12|0); $29 = +HEAPF32[$28>>2]; $30 = 2.0 * $29; $31 = $27 < $30; $32 = ((($scroll)) + 12|0); $33 = +HEAPF32[$32>>2]; $34 = 2.0 * $33; $35 = ((($scroll)) + 8|0); $36 = +HEAPF32[$35>>2]; $37 = $31 ? $34 : $36; $38 = ((($scroll)) + 8|0); HEAPF32[$38>>2] = $37; $39 = $5; $40 = ((($scroll)) + 8|0); $41 = +HEAPF32[$40>>2]; $42 = $39 <= $41; if ($42) { $0 = 0.0; $244 = $0; STACKTOP = sp;return (+$244); } $43 = $8; $44 = ((($43)) + 152|0); $45 = HEAP32[$44>>2]|0; $46 = ($45|0)!=(0); if ($46) { $47 = ((($scroll)) + 4|0); $48 = +HEAPF32[$47>>2]; $49 = ((($button)) + 4|0); HEAPF32[$49>>2] = $48; $50 = ((($scroll)) + 12|0); $51 = +HEAPF32[$50>>2]; $52 = ((($button)) + 8|0); HEAPF32[$52>>2] = $51; $53 = ((($scroll)) + 12|0); $54 = +HEAPF32[$53>>2]; $55 = ((($button)) + 12|0); HEAPF32[$55>>2] = $54; $56 = ((($scroll)) + 8|0); $57 = +HEAPF32[$56>>2]; $58 = ((($button)) + 8|0); $59 = +HEAPF32[$58>>2]; $60 = 2.0 * $59; $61 = $57 - $60; $scroll_w = $61; $62 = $6; $63 = $7; $64 = $62 < $63; $65 = $6; $66 = $7; $67 = $64 ? $65 : $66; $scroll_step = $67; $68 = +HEAPF32[$scroll>>2]; HEAPF32[$button>>2] = $68; $69 = $2; $70 = $8; $71 = ((($70)) + 416|0); $72 = HEAP32[$71>>2]|0; $73 = $8; $74 = ((($73)) + 284|0); $75 = $9; $76 = $10; ;HEAP32[$button$byval_copy>>2]=HEAP32[$button>>2]|0;HEAP32[$button$byval_copy+4>>2]=HEAP32[$button+4>>2]|0;HEAP32[$button$byval_copy+8>>2]=HEAP32[$button+8>>2]|0;HEAP32[$button$byval_copy+12>>2]=HEAP32[$button+12>>2]|0; $77 = (_nk_do_button_symbol($ws,$69,$button$byval_copy,$72,1,$74,$75,$76)|0); $78 = ($77|0)!=(0); if ($78) { $79 = $4; $80 = $scroll_step; $81 = $79 - $80; $4 = $81; } $82 = +HEAPF32[$scroll>>2]; $83 = ((($scroll)) + 8|0); $84 = +HEAPF32[$83>>2]; $85 = $82 + $84; $86 = ((($button)) + 8|0); $87 = +HEAPF32[$86>>2]; $88 = $85 - $87; HEAPF32[$button>>2] = $88; $89 = $2; $90 = $8; $91 = ((($90)) + 412|0); $92 = HEAP32[$91>>2]|0; $93 = $8; $94 = ((($93)) + 156|0); $95 = $9; $96 = $10; ;HEAP32[$button$byval_copy2>>2]=HEAP32[$button>>2]|0;HEAP32[$button$byval_copy2+4>>2]=HEAP32[$button+4>>2]|0;HEAP32[$button$byval_copy2+8>>2]=HEAP32[$button+8>>2]|0;HEAP32[$button$byval_copy2+12>>2]=HEAP32[$button+12>>2]|0; $97 = (_nk_do_button_symbol($ws,$89,$button$byval_copy2,$92,1,$94,$95,$96)|0); $98 = ($97|0)!=(0); if ($98) { $99 = $4; $100 = $scroll_step; $101 = $99 + $100; $4 = $101; } $102 = +HEAPF32[$scroll>>2]; $103 = ((($button)) + 8|0); $104 = +HEAPF32[$103>>2]; $105 = $102 + $104; HEAPF32[$scroll>>2] = $105; $106 = $scroll_w; $107 = ((($scroll)) + 8|0); HEAPF32[$107>>2] = $106; } $108 = $6; $109 = ((($scroll)) + 8|0); $110 = +HEAPF32[$109>>2]; $111 = $108 < $110; $112 = $6; $113 = ((($scroll)) + 8|0); $114 = +HEAPF32[$113>>2]; $115 = $111 ? $112 : $114; $scroll_step = $115; $116 = $4; $117 = $5; $118 = ((($scroll)) + 8|0); $119 = +HEAPF32[$118>>2]; $120 = $117 - $119; $121 = $116 < $120; if ($121) { $122 = $4; $128 = $122; } else { $123 = $5; $124 = ((($scroll)) + 8|0); $125 = +HEAPF32[$124>>2]; $126 = $123 - $125; $128 = $126; } $127 = $128 < 0.0; do { if ($127) { $140 = 0.0; } else { $129 = $4; $130 = $5; $131 = ((($scroll)) + 8|0); $132 = +HEAPF32[$131>>2]; $133 = $130 - $132; $134 = $129 < $133; if ($134) { $135 = $4; $140 = $135; break; } else { $136 = $5; $137 = ((($scroll)) + 8|0); $138 = +HEAPF32[$137>>2]; $139 = $136 - $138; $140 = $139; break; } } } while(0); $scroll_offset = $140; $141 = ((($scroll)) + 8|0); $142 = +HEAPF32[$141>>2]; $143 = $5; $144 = $142 / $143; $scroll_ratio = $144; $145 = $scroll_offset; $146 = $5; $147 = $145 / $146; $scroll_off = $147; $148 = $scroll_ratio; $149 = ((($scroll)) + 8|0); $150 = +HEAPF32[$149>>2]; $151 = $148 * $150; $152 = $8; $153 = ((($152)) + 128|0); $154 = +HEAPF32[$153>>2]; $155 = 2.0 * $154; $156 = $8; $157 = ((($156)) + 144|0); $158 = +HEAPF32[$157>>2]; $159 = 2.0 * $158; $160 = $155 + $159; $161 = $151 - $160; $162 = ((($cursor)) + 8|0); HEAPF32[$162>>2] = $161; $163 = +HEAPF32[$scroll>>2]; $164 = $scroll_off; $165 = ((($scroll)) + 8|0); $166 = +HEAPF32[$165>>2]; $167 = $164 * $166; $168 = $163 + $167; $169 = $8; $170 = ((($169)) + 128|0); $171 = +HEAPF32[$170>>2]; $172 = $168 + $171; $173 = $8; $174 = ((($173)) + 144|0); $175 = +HEAPF32[$174>>2]; $176 = $172 + $175; HEAPF32[$cursor>>2] = $176; $177 = ((($scroll)) + 12|0); $178 = +HEAPF32[$177>>2]; $179 = $8; $180 = ((($179)) + 128|0); $181 = +HEAPF32[$180>>2]; $182 = 2.0 * $181; $183 = $8; $184 = ((($183)) + 144|0); $185 = ((($184)) + 4|0); $186 = +HEAPF32[$185>>2]; $187 = 2.0 * $186; $188 = $182 + $187; $189 = $178 - $188; $190 = ((($cursor)) + 12|0); HEAPF32[$190>>2] = $189; $191 = ((($scroll)) + 4|0); $192 = +HEAPF32[$191>>2]; $193 = $8; $194 = ((($193)) + 128|0); $195 = +HEAPF32[$194>>2]; $196 = $192 + $195; $197 = $8; $198 = ((($197)) + 144|0); $199 = ((($198)) + 4|0); $200 = +HEAPF32[$199>>2]; $201 = $196 + $200; $202 = ((($cursor)) + 4|0); HEAPF32[$202>>2] = $201; $203 = $1; $204 = $9; $205 = $3; $206 = $scroll_offset; $207 = $5; $208 = $scroll_step; ;HEAP32[$scroll$byval_copy>>2]=HEAP32[$scroll>>2]|0;HEAP32[$scroll$byval_copy+4>>2]=HEAP32[$scroll+4>>2]|0;HEAP32[$scroll$byval_copy+8>>2]=HEAP32[$scroll+8>>2]|0;HEAP32[$scroll$byval_copy+12>>2]=HEAP32[$scroll+12>>2]|0; ;HEAP32[$cursor$byval_copy>>2]=HEAP32[$cursor>>2]|0;HEAP32[$cursor$byval_copy+4>>2]=HEAP32[$cursor+4>>2]|0;HEAP32[$cursor$byval_copy+8>>2]=HEAP32[$cursor+8>>2]|0;HEAP32[$cursor$byval_copy+12>>2]=HEAP32[$cursor+12>>2]|0; $209 = (+_nk_scrollbar_behavior($203,$204,$205,$scroll$byval_copy,$cursor$byval_copy,$206,$207,$208,1)); $scroll_offset = $209; $210 = $scroll_offset; $211 = $5; $212 = $210 / $211; $scroll_off = $212; $213 = +HEAPF32[$scroll>>2]; $214 = $scroll_off; $215 = ((($scroll)) + 8|0); $216 = +HEAPF32[$215>>2]; $217 = $214 * $216; $218 = $213 + $217; HEAPF32[$cursor>>2] = $218; $219 = $8; $220 = ((($219)) + 424|0); $221 = HEAP32[$220>>2]|0; $222 = ($221|0)!=(0|0); if ($222) { $223 = $8; $224 = ((($223)) + 424|0); $225 = HEAP32[$224>>2]|0; $226 = $2; $227 = $8; $228 = ((($227)) + 420|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$228>>2]|0; FUNCTION_TABLE_vii[$225 & 31]($226,$$byval_copy); } $229 = $2; $230 = $1; $231 = HEAP32[$230>>2]|0; $232 = $8; _nk_draw_scrollbar($229,$231,$232,$scroll,$cursor); $233 = $8; $234 = ((($233)) + 428|0); $235 = HEAP32[$234>>2]|0; $236 = ($235|0)!=(0|0); if ($236) { $237 = $8; $238 = ((($237)) + 428|0); $239 = HEAP32[$238>>2]|0; $240 = $2; $241 = $8; $242 = ((($241)) + 420|0); ;HEAP32[$$byval_copy3>>2]=HEAP32[$242>>2]|0; FUNCTION_TABLE_vii[$239 & 31]($240,$$byval_copy3); } $243 = $scroll_offset; $0 = $243; $244 = $0; STACKTOP = sp;return (+$244); } function _nk_command_buffer_reset($buffer) { $buffer = $buffer|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $buffer; $1 = $0; $2 = ($1|0)!=(0|0); if (!($2)) { ___assert_fail((13445|0),(13400|0),4988,(31485|0)); // unreachable; } $3 = $0; $4 = ($3|0)!=(0|0); if (!($4)) { STACKTOP = sp;return; } $5 = $0; $6 = ((($5)) + 28|0); HEAP32[$6>>2] = 0; $7 = $0; $8 = ((($7)) + 32|0); HEAP32[$8>>2] = 0; $9 = $0; $10 = ((($9)) + 36|0); HEAP32[$10>>2] = 0; $11 = $0; $12 = ((($11)) + 4|0); ;HEAP32[$12>>2]=HEAP32[8>>2]|0;HEAP32[$12+4>>2]=HEAP32[8+4>>2]|0;HEAP32[$12+8>>2]=HEAP32[8+8>>2]|0;HEAP32[$12+12>>2]=HEAP32[8+12>>2]|0; STACKTOP = sp;return; } function _nk_finish($ctx,$win) { $ctx = $ctx|0; $win = $win|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $8 = 0, $9 = 0, $buf = 0, $last = 0, $memory = 0, $or$cond = 0; var $parent_last = 0, $sublast = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $ctx; $1 = $win; $2 = $0; $3 = ($2|0)!=(0|0); if (!($3)) { ___assert_fail((14913|0),(13400|0),14630,(31509|0)); // unreachable; } $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((28440|0),(13400|0),14631,(31509|0)); // unreachable; } $6 = $0; $7 = ($6|0)!=(0|0); $8 = $1; $9 = ($8|0)!=(0|0); $or$cond = $7 & $9; if (!($or$cond)) { STACKTOP = sp;return; } $10 = $0; $11 = ((($10)) + 5596|0); $12 = ((($11)) + 44|0); $13 = HEAP32[$12>>2]|0; $14 = $1; $15 = ((($14)) + 32|0); $16 = ((($15)) + 32|0); HEAP32[$16>>2] = $13; $17 = $1; $18 = ((($17)) + 72|0); $19 = HEAP32[$18>>2]|0; $20 = ((($19)) + 328|0); $21 = ((($20)) + 16|0); $22 = HEAP32[$21>>2]|0; $23 = ($22|0)!=(0); if (!($23)) { STACKTOP = sp;return; } $24 = $1; $25 = ((($24)) + 72|0); $26 = HEAP32[$25>>2]|0; $27 = ((($26)) + 328|0); $buf = $27; $28 = $0; $29 = ((($28)) + 5596|0); $30 = ((($29)) + 32|0); $31 = HEAP32[$30>>2]|0; $memory = $31; $32 = $memory; $33 = $buf; $34 = ((($33)) + 4|0); $35 = HEAP32[$34>>2]|0; $36 = (($32) + ($35)|0); $parent_last = $36; $37 = $memory; $38 = $buf; $39 = ((($38)) + 8|0); $40 = HEAP32[$39>>2]|0; $41 = (($37) + ($40)|0); $sublast = $41; $42 = $memory; $43 = $1; $44 = ((($43)) + 32|0); $45 = ((($44)) + 36|0); $46 = HEAP32[$45>>2]|0; $47 = (($42) + ($46)|0); $last = $47; $48 = $buf; $49 = ((($48)) + 12|0); $50 = HEAP32[$49>>2]|0; $51 = $parent_last; $52 = ((($51)) + 4|0); HEAP32[$52>>2] = $50; $53 = $last; $54 = ((($53)) + 4|0); $55 = HEAP32[$54>>2]|0; $56 = $sublast; $57 = ((($56)) + 4|0); HEAP32[$57>>2] = $55; $58 = $buf; $59 = HEAP32[$58>>2]|0; $60 = $last; $61 = ((($60)) + 4|0); HEAP32[$61>>2] = $59; $62 = $buf; $63 = ((($62)) + 8|0); $64 = HEAP32[$63>>2]|0; $65 = $1; $66 = ((($65)) + 32|0); $67 = ((($66)) + 36|0); HEAP32[$67>>2] = $64; $68 = $buf; $69 = ((($68)) + 12|0); $70 = HEAP32[$69>>2]|0; $71 = $1; $72 = ((($71)) + 32|0); $73 = ((($72)) + 32|0); HEAP32[$73>>2] = $70; $74 = $buf; $75 = ((($74)) + 16|0); HEAP32[$75>>2] = 0; STACKTOP = sp;return; } function _nk_scrollbar_behavior($state,$in,$has_scrolling,$scroll,$cursor,$scroll_offset,$target,$scroll_step,$o) { $state = $state|0; $in = $in|0; $has_scrolling = $has_scrolling|0; $scroll = $scroll|0; $cursor = $cursor|0; $scroll_offset = +$scroll_offset; $target = +$target; $scroll_step = +$scroll_step; $o = $o|0; var $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0.0; var $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0.0, $124 = 0.0, $125 = 0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0.0; var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0.0, $164 = 0, $165 = 0, $166 = 0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0; var $170 = 0.0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0.0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0; var $189 = 0.0, $19 = 0, $190 = 0.0, $191 = 0, $192 = 0.0, $193 = 0.0, $194 = 0, $195 = 0.0, $196 = 0.0, $197 = 0.0, $198 = 0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0, $202 = 0.0, $203 = 0.0, $204 = 0, $205 = 0.0; var $206 = 0.0, $207 = 0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0.0, $213 = 0.0, $214 = 0, $215 = 0.0, $216 = 0.0, $217 = 0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0.0, $238 = 0.0, $24 = 0, $25 = 0, $26 = 0, $27 = 0; var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0; var $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0; var $64 = 0, $65 = 0.0, $66 = 0.0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0; var $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $cursor$byval_copy = 0; var $cursor_x = 0.0, $cursor_y = 0.0, $delta = 0.0, $left_mouse_click_in_cursor = 0, $left_mouse_down = 0, $or$cond = 0, $pixel = 0.0, $scroll$byval_copy = 0, $scroll$byval_copy2 = 0, $scroll$byval_copy3 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $scroll$byval_copy3 = sp + 104|0; $scroll$byval_copy2 = sp + 88|0; $scroll$byval_copy = sp + 72|0; $cursor$byval_copy = sp + 56|0; $1 = $state; $2 = $in; $3 = $has_scrolling; $4 = $scroll_offset; $5 = $target; $6 = $scroll_step; $7 = $o; $8 = $1; $9 = HEAP32[$8>>2]|0; $10 = $9 & 2; $11 = ($10|0)!=(0); $12 = $1; if ($11) { HEAP32[$12>>2] = 6; } else { HEAP32[$12>>2] = 4; } $13 = $2; $14 = ($13|0)!=(0|0); if (!($14)) { $15 = $4; $0 = $15; $238 = $0; STACKTOP = sp;return (+$238); } $16 = $2; $17 = ((($16)) + 220|0); $18 = HEAP32[$17>>2]|0; $left_mouse_down = $18; $19 = $2; ;HEAP32[$cursor$byval_copy>>2]=HEAP32[$cursor>>2]|0;HEAP32[$cursor$byval_copy+4>>2]=HEAP32[$cursor+4>>2]|0;HEAP32[$cursor$byval_copy+8>>2]=HEAP32[$cursor+8>>2]|0;HEAP32[$cursor$byval_copy+12>>2]=HEAP32[$cursor+12>>2]|0; $20 = (_nk_input_has_mouse_click_down_in_rect($19,0,$cursor$byval_copy,1)|0); $left_mouse_click_in_cursor = $20; $21 = $2; ;HEAP32[$scroll$byval_copy>>2]=HEAP32[$scroll>>2]|0;HEAP32[$scroll$byval_copy+4>>2]=HEAP32[$scroll+4>>2]|0;HEAP32[$scroll$byval_copy+8>>2]=HEAP32[$scroll+8>>2]|0;HEAP32[$scroll$byval_copy+12>>2]=HEAP32[$scroll+12>>2]|0; $22 = (_nk_input_is_mouse_hovering_rect($21,$scroll$byval_copy)|0); $23 = ($22|0)!=(0); if ($23) { $24 = $1; HEAP32[$24>>2] = 18; } $25 = $left_mouse_down; $26 = ($25|0)!=(0); $27 = $left_mouse_click_in_cursor; $28 = ($27|0)!=(0); $or$cond = $26 & $28; do { if ($or$cond) { $29 = $1; HEAP32[$29>>2] = 34; $30 = $7; $31 = ($30|0)==(0); $32 = $2; $33 = ((($32)) + 220|0); $34 = ((($33)) + 64|0); if ($31) { $35 = ((($34)) + 4|0); $36 = +HEAPF32[$35>>2]; $pixel = $36; $37 = $pixel; $38 = ((($scroll)) + 12|0); $39 = +HEAPF32[$38>>2]; $40 = $37 / $39; $41 = $5; $42 = $40 * $41; $delta = $42; $43 = $4; $44 = $delta; $45 = $43 + $44; $46 = $5; $47 = ((($scroll)) + 12|0); $48 = +HEAPF32[$47>>2]; $49 = $46 - $48; $50 = $45 < $49; if ($50) { $51 = $4; $52 = $delta; $53 = $51 + $52; $59 = $53; } else { $54 = $5; $55 = ((($scroll)) + 12|0); $56 = +HEAPF32[$55>>2]; $57 = $54 - $56; $59 = $57; } $58 = $59 < 0.0; do { if ($58) { $75 = 0.0; } else { $60 = $4; $61 = $delta; $62 = $60 + $61; $63 = $5; $64 = ((($scroll)) + 12|0); $65 = +HEAPF32[$64>>2]; $66 = $63 - $65; $67 = $62 < $66; if ($67) { $68 = $4; $69 = $delta; $70 = $68 + $69; $75 = $70; break; } else { $71 = $5; $72 = ((($scroll)) + 12|0); $73 = +HEAPF32[$72>>2]; $74 = $71 - $73; $75 = $74; break; } } } while(0); $4 = $75; $76 = ((($scroll)) + 4|0); $77 = +HEAPF32[$76>>2]; $78 = $4; $79 = $5; $80 = $78 / $79; $81 = ((($scroll)) + 12|0); $82 = +HEAPF32[$81>>2]; $83 = $80 * $82; $84 = $77 + $83; $cursor_y = $84; $85 = $cursor_y; $86 = ((($cursor)) + 12|0); $87 = +HEAPF32[$86>>2]; $88 = $87 / 2.0; $89 = $85 + $88; $90 = $2; $91 = ((($90)) + 220|0); $92 = ((($91)) + 8|0); $93 = ((($92)) + 4|0); HEAPF32[$93>>2] = $89; break; } else { $94 = +HEAPF32[$34>>2]; $pixel = $94; $95 = $pixel; $96 = ((($scroll)) + 8|0); $97 = +HEAPF32[$96>>2]; $98 = $95 / $97; $99 = $5; $100 = $98 * $99; $delta = $100; $101 = $4; $102 = $delta; $103 = $101 + $102; $104 = $5; $105 = ((($scroll)) + 8|0); $106 = +HEAPF32[$105>>2]; $107 = $104 - $106; $108 = $103 < $107; if ($108) { $109 = $4; $110 = $delta; $111 = $109 + $110; $117 = $111; } else { $112 = $5; $113 = ((($scroll)) + 8|0); $114 = +HEAPF32[$113>>2]; $115 = $112 - $114; $117 = $115; } $116 = $117 < 0.0; do { if ($116) { $133 = 0.0; } else { $118 = $4; $119 = $delta; $120 = $118 + $119; $121 = $5; $122 = ((($scroll)) + 8|0); $123 = +HEAPF32[$122>>2]; $124 = $121 - $123; $125 = $120 < $124; if ($125) { $126 = $4; $127 = $delta; $128 = $126 + $127; $133 = $128; break; } else { $129 = $5; $130 = ((($scroll)) + 8|0); $131 = +HEAPF32[$130>>2]; $132 = $129 - $131; $133 = $132; break; } } } while(0); $4 = $133; $134 = +HEAPF32[$scroll>>2]; $135 = $4; $136 = $5; $137 = $135 / $136; $138 = ((($scroll)) + 8|0); $139 = +HEAPF32[$138>>2]; $140 = $137 * $139; $141 = $134 + $140; $cursor_x = $141; $142 = $cursor_x; $143 = ((($cursor)) + 8|0); $144 = +HEAPF32[$143>>2]; $145 = $144 / 2.0; $146 = $142 + $145; $147 = $2; $148 = ((($147)) + 220|0); $149 = ((($148)) + 8|0); HEAPF32[$149>>2] = $146; break; } } else { $150 = $3; $151 = ($150|0)!=(0); if ($151) { $152 = $2; $153 = ((($152)) + 220|0); $154 = ((($153)) + 72|0); $155 = +HEAPF32[$154>>2]; $156 = $155 < 0.0; if (!($156)) { $157 = $2; $158 = ((($157)) + 220|0); $159 = ((($158)) + 72|0); $160 = +HEAPF32[$159>>2]; $161 = $160 > 0.0; if (!($161)) { break; } } $162 = $4; $163 = $6; $164 = $2; $165 = ((($164)) + 220|0); $166 = ((($165)) + 72|0); $167 = +HEAPF32[$166>>2]; $168 = -$167; $169 = $163 * $168; $170 = $162 + $169; $4 = $170; $171 = $7; $172 = ($171|0)==(0); $173 = $4; $174 = $5; if ($172) { $175 = ((($scroll)) + 12|0); $176 = +HEAPF32[$175>>2]; $177 = $174 - $176; $178 = $173 < $177; if ($178) { $179 = $4; $185 = $179; } else { $180 = $5; $181 = ((($scroll)) + 12|0); $182 = +HEAPF32[$181>>2]; $183 = $180 - $182; $185 = $183; } $184 = $185 < 0.0; do { if ($184) { $197 = 0.0; } else { $186 = $4; $187 = $5; $188 = ((($scroll)) + 12|0); $189 = +HEAPF32[$188>>2]; $190 = $187 - $189; $191 = $186 < $190; if ($191) { $192 = $4; $197 = $192; break; } else { $193 = $5; $194 = ((($scroll)) + 12|0); $195 = +HEAPF32[$194>>2]; $196 = $193 - $195; $197 = $196; break; } } } while(0); $4 = $197; break; } else { $198 = ((($scroll)) + 8|0); $199 = +HEAPF32[$198>>2]; $200 = $174 - $199; $201 = $173 < $200; if ($201) { $202 = $4; $208 = $202; } else { $203 = $5; $204 = ((($scroll)) + 8|0); $205 = +HEAPF32[$204>>2]; $206 = $203 - $205; $208 = $206; } $207 = $208 < 0.0; do { if ($207) { $220 = 0.0; } else { $209 = $4; $210 = $5; $211 = ((($scroll)) + 8|0); $212 = +HEAPF32[$211>>2]; $213 = $210 - $212; $214 = $209 < $213; if ($214) { $215 = $4; $220 = $215; break; } else { $216 = $5; $217 = ((($scroll)) + 8|0); $218 = +HEAPF32[$217>>2]; $219 = $216 - $218; $220 = $219; break; } } } while(0); $4 = $220; break; } } } } while(0); $221 = $1; $222 = HEAP32[$221>>2]|0; $223 = $222 & 16; $224 = ($223|0)!=(0); if ($224) { $225 = $2; ;HEAP32[$scroll$byval_copy2>>2]=HEAP32[$scroll>>2]|0;HEAP32[$scroll$byval_copy2+4>>2]=HEAP32[$scroll+4>>2]|0;HEAP32[$scroll$byval_copy2+8>>2]=HEAP32[$scroll+8>>2]|0;HEAP32[$scroll$byval_copy2+12>>2]=HEAP32[$scroll+12>>2]|0; $226 = (_nk_input_is_mouse_prev_hovering_rect($225,$scroll$byval_copy2)|0); $227 = ($226|0)!=(0); if ($227) { label = 49; } else { $228 = $1; $229 = HEAP32[$228>>2]|0; $230 = $229 | 8; HEAP32[$228>>2] = $230; } } else { label = 49; } if ((label|0) == 49) { $231 = $2; ;HEAP32[$scroll$byval_copy3>>2]=HEAP32[$scroll>>2]|0;HEAP32[$scroll$byval_copy3+4>>2]=HEAP32[$scroll+4>>2]|0;HEAP32[$scroll$byval_copy3+8>>2]=HEAP32[$scroll+8>>2]|0;HEAP32[$scroll$byval_copy3+12>>2]=HEAP32[$scroll+12>>2]|0; $232 = (_nk_input_is_mouse_prev_hovering_rect($231,$scroll$byval_copy3)|0); $233 = ($232|0)!=(0); if ($233) { $234 = $1; $235 = HEAP32[$234>>2]|0; $236 = $235 | 64; HEAP32[$234>>2] = $236; } } $237 = $4; $0 = $237; $238 = $0; STACKTOP = sp;return (+$238); } function _nk_draw_scrollbar($out,$state,$style,$bounds,$scroll) { $out = $out|0; $state = $state|0; $style = $style|0; $bounds = $bounds|0; $scroll = $scroll|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy10 = 0, $$byval_copy11 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $$byval_copy8 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0; var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0; var $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; var $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $7 = 0, $8 = 0, $9 = 0, $background = 0; var $cursor = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 208|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy11 = sp + 176|0; $$byval_copy10 = sp + 204|0; $$byval_copy9 = sp + 160|0; $$byval_copy8 = sp + 144|0; $$byval_copy7 = sp + 200|0; $$byval_copy6 = sp + 128|0; $$byval_copy5 = sp + 112|0; $$byval_copy4 = sp + 196|0; $$byval_copy3 = sp + 96|0; $$byval_copy2 = sp + 80|0; $$byval_copy1 = sp + 192|0; $$byval_copy = sp + 64|0; $5 = sp + 16|0; $6 = sp; $0 = $out; $1 = $state; $2 = $style; $3 = $bounds; $4 = $scroll; $7 = $1; $8 = $7 & 32; $9 = ($8|0)!=(0); do { if ($9) { $10 = $2; $11 = ((($10)) + 40|0); $background = $11; $12 = $2; $13 = ((($12)) + 104|0); $cursor = $13; } else { $14 = $1; $15 = $14 & 16; $16 = ($15|0)!=(0); $17 = $2; if ($16) { $18 = ((($17)) + 20|0); $background = $18; $19 = $2; $20 = ((($19)) + 84|0); $cursor = $20; break; } else { $background = $17; $21 = $2; $22 = ((($21)) + 64|0); $cursor = $22; break; } } } while(0); $23 = $background; $24 = HEAP32[$23>>2]|0; $25 = ($24|0)==(0); $26 = $0; $27 = $3; if ($25) { $28 = $2; $29 = ((($28)) + 132|0); $30 = +HEAPF32[$29>>2]; $31 = $2; $32 = ((($31)) + 60|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$27>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$27+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$27+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$27+12>>2]|0; ;HEAP8[$$byval_copy1>>0]=HEAP8[$32>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$32+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$32+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$32+3>>0]|0; _nk_fill_rect($26,$$byval_copy,$30,$$byval_copy1); $33 = $0; $34 = $3; $35 = $2; $36 = ((($35)) + 128|0); $37 = +HEAPF32[$36>>2]; ;HEAP32[$$byval_copy2>>2]=HEAP32[$34>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$34+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$34+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$34+12>>2]|0; _nk_shrink_rect($5,$$byval_copy2,$37); $38 = $2; $39 = ((($38)) + 132|0); $40 = +HEAPF32[$39>>2]; $41 = $background; $42 = ((($41)) + 4|0); ;HEAP32[$$byval_copy3>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$5+12>>2]|0; ;HEAP8[$$byval_copy4>>0]=HEAP8[$42>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$42+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$42+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$42+3>>0]|0; _nk_fill_rect($33,$$byval_copy3,$40,$$byval_copy4); } else { $43 = $background; $44 = ((($43)) + 4|0); ;HEAP32[$$byval_copy5>>2]=HEAP32[$27>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$27+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$27+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$27+12>>2]|0; _nk_draw_image($26,$$byval_copy5,$44); } $45 = $background; $46 = HEAP32[$45>>2]|0; $47 = ($46|0)==(0); $48 = $0; $49 = $4; if ($47) { $50 = $2; $51 = ((($50)) + 140|0); $52 = +HEAPF32[$51>>2]; $53 = $2; $54 = ((($53)) + 124|0); ;HEAP32[$$byval_copy6>>2]=HEAP32[$49>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$49+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$49+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$49+12>>2]|0; ;HEAP8[$$byval_copy7>>0]=HEAP8[$54>>0]|0;HEAP8[$$byval_copy7+1>>0]=HEAP8[$54+1>>0]|0;HEAP8[$$byval_copy7+2>>0]=HEAP8[$54+2>>0]|0;HEAP8[$$byval_copy7+3>>0]=HEAP8[$54+3>>0]|0; _nk_fill_rect($48,$$byval_copy6,$52,$$byval_copy7); $55 = $0; $56 = $4; $57 = $2; $58 = ((($57)) + 136|0); $59 = +HEAPF32[$58>>2]; ;HEAP32[$$byval_copy8>>2]=HEAP32[$56>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$56+4>>2]|0;HEAP32[$$byval_copy8+8>>2]=HEAP32[$56+8>>2]|0;HEAP32[$$byval_copy8+12>>2]=HEAP32[$56+12>>2]|0; _nk_shrink_rect($6,$$byval_copy8,$59); $60 = $2; $61 = ((($60)) + 140|0); $62 = +HEAPF32[$61>>2]; $63 = $cursor; $64 = ((($63)) + 4|0); ;HEAP32[$$byval_copy9>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy9+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy9+12>>2]=HEAP32[$6+12>>2]|0; ;HEAP8[$$byval_copy10>>0]=HEAP8[$64>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$64+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$64+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$64+3>>0]|0; _nk_fill_rect($55,$$byval_copy9,$62,$$byval_copy10); STACKTOP = sp;return; } else { $65 = $cursor; $66 = ((($65)) + 4|0); ;HEAP32[$$byval_copy11>>2]=HEAP32[$49>>2]|0;HEAP32[$$byval_copy11+4>>2]=HEAP32[$49+4>>2]|0;HEAP32[$$byval_copy11+8>>2]=HEAP32[$49+8>>2]|0;HEAP32[$$byval_copy11+12>>2]=HEAP32[$49+12>>2]|0; _nk_draw_image($48,$$byval_copy11,$66); STACKTOP = sp;return; } } function _nk_layout_widget_space($bounds,$ctx,$win,$modify) { $bounds = $bounds|0; $ctx = $ctx|0; $win = $win|0; $modify = $modify|0; var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0, $113 = 0, $114 = 0, $115 = 0.0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0.0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0; var $134 = 0.0, $135 = 0.0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0, $144 = 0.0, $145 = 0.0, $146 = 0, $147 = 0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0.0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0.0, $172 = 0.0, $173 = 0, $174 = 0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0.0, $188 = 0; var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0.0, $193 = 0.0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0.0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0.0; var $224 = 0.0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0.0, $234 = 0.0, $235 = 0, $236 = 0, $237 = 0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0, $241 = 0.0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0.0, $246 = 0.0, $247 = 0.0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0.0, $252 = 0.0, $253 = 0, $254 = 0, $255 = 0, $256 = 0.0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; var $260 = 0, $261 = 0.0, $262 = 0.0, $263 = 0.0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0.0, $271 = 0, $272 = 0, $273 = 0, $274 = 0.0, $275 = 0, $276 = 0, $277 = 0, $278 = 0.0; var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0.0, $284 = 0.0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0.0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0.0, $293 = 0.0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0.0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0.0, $304 = 0.0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0.0, $315 = 0, $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0, $32 = 0, $320 = 0, $321 = 0.0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0.0, $327 = 0, $328 = 0, $329 = 0.0, $33 = 0, $330 = 0.0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0, $343 = 0, $344 = 0.0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0.0, $35 = 0; var $350 = 0.0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0.0, $363 = 0.0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0.0; var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0.0, $376 = 0.0, $377 = 0.0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0; var $387 = 0.0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0, $393 = 0, $394 = 0.0, $395 = 0, $396 = 0, $397 = 0, $398 = 0.0, $399 = 0.0, $4 = 0, $40 = 0, $400 = 0.0, $401 = 0, $402 = 0, $403 = 0; var $404 = 0, $405 = 0, $406 = 0.0, $407 = 0, $408 = 0.0, $409 = 0.0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0.0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0.0; var $422 = 0.0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0.0, $428 = 0.0, $429 = 0.0, $43 = 0, $430 = 0.0, $431 = 0.0, $432 = 0.0, $433 = 0.0, $434 = 0, $435 = 0, $436 = 0.0, $437 = 0, $438 = 0, $439 = 0.0, $44 = 0.0; var $440 = 0.0, $441 = 0, $442 = 0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0.0, $449 = 0, $45 = 0.0, $450 = 0, $451 = 0.0, $452 = 0.0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0; var $459 = 0, $46 = 0, $460 = 0.0, $461 = 0, $462 = 0.0, $463 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0; var $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0.0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0.0, $item_offset = 0.0, $item_spacing = 0.0, $item_width = 0.0, $layout = 0, $or$cond = 0, $or$cond3 = 0, $padding = 0, $panel_padding = 0.0, $panel_space = 0.0, $panel_spacing = 0.0, $ratio = 0.0, $spacing = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $spacing = sp + 16|0; $padding = sp + 8|0; $0 = $bounds; $1 = $ctx; $2 = $win; $3 = $modify; $item_offset = 0.0; $item_width = 0.0; $item_spacing = 0.0; $4 = $1; $5 = ($4|0)!=(0|0); if (!($5)) { ___assert_fail((14913|0),(13400|0),16478,(31549|0)); // unreachable; } $6 = $1; $7 = ((($6)) + 11168|0); $8 = HEAP32[$7>>2]|0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((28537|0),(13400|0),16479,(31549|0)); // unreachable; } $10 = $1; $11 = ((($10)) + 11168|0); $12 = HEAP32[$11>>2]|0; $13 = ((($12)) + 72|0); $14 = HEAP32[$13>>2]|0; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((28516|0),(13400|0),16480,(31549|0)); // unreachable; } $16 = $1; $17 = ($16|0)!=(0|0); if (!($17)) { STACKTOP = sp;return; } $18 = $1; $19 = ((($18)) + 11168|0); $20 = HEAP32[$19>>2]|0; $21 = ($20|0)!=(0|0); if (!($21)) { STACKTOP = sp;return; } $22 = $1; $23 = ((($22)) + 11168|0); $24 = HEAP32[$23>>2]|0; $25 = ((($24)) + 72|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)!=(0|0); if (!($27)) { STACKTOP = sp;return; } $28 = $1; $29 = ((($28)) + 11168|0); $30 = HEAP32[$29>>2]|0; $2 = $30; $31 = $2; $32 = ((($31)) + 72|0); $33 = HEAP32[$32>>2]|0; $layout = $33; $34 = $0; $35 = ($34|0)!=(0|0); if (!($35)) { ___assert_fail((31572|0),(13400|0),16486,(31549|0)); // unreachable; } $36 = $1; $37 = ((($36)) + 300|0); $38 = ((($37)) + 4784|0); $39 = ((($38)) + 488|0); ;HEAP32[$spacing>>2]=HEAP32[$39>>2]|0;HEAP32[$spacing+4>>2]=HEAP32[$39+4>>2]|0; $40 = $1; $41 = ((($40)) + 300|0); $42 = ((($41)) + 4784|0); $43 = ((($42)) + 480|0); ;HEAP32[$padding>>2]=HEAP32[$43>>2]|0;HEAP32[$padding+4>>2]=HEAP32[$43+4>>2]|0; $44 = +HEAPF32[$padding>>2]; $45 = 2.0 * $44; $panel_padding = $45; $46 = $layout; $47 = ((($46)) + 92|0); $48 = ((($47)) + 12|0); $49 = HEAP32[$48>>2]|0; $50 = (($49) - 1)|0; $51 = (+($50|0)); $52 = +HEAPF32[$spacing>>2]; $53 = $51 * $52; $panel_spacing = $53; $54 = $layout; $55 = ((($54)) + 36|0); $56 = +HEAPF32[$55>>2]; $57 = $panel_padding; $58 = $56 - $57; $59 = $panel_spacing; $60 = $58 - $59; $panel_space = $60; $61 = $layout; $62 = ((($61)) + 92|0); $63 = HEAP32[$62>>2]|0; switch ($63|0) { case 0: { $64 = $panel_space; $65 = $layout; $66 = ((($65)) + 92|0); $67 = ((($66)) + 12|0); $68 = HEAP32[$67>>2]|0; $69 = (+($68|0)); $70 = $64 / $69; $item_width = $70; $71 = $layout; $72 = ((($71)) + 92|0); $73 = ((($72)) + 4|0); $74 = HEAP32[$73>>2]|0; $75 = (+($74|0)); $76 = $item_width; $77 = $75 * $76; $item_offset = $77; $78 = $layout; $79 = ((($78)) + 92|0); $80 = ((($79)) + 4|0); $81 = HEAP32[$80>>2]|0; $82 = (+($81|0)); $83 = +HEAPF32[$spacing>>2]; $84 = $82 * $83; $item_spacing = $84; break; } case 1: { $85 = $layout; $86 = ((($85)) + 92|0); $87 = ((($86)) + 20|0); $88 = +HEAPF32[$87>>2]; $89 = $panel_space; $90 = $88 * $89; $item_width = $90; $91 = $layout; $92 = ((($91)) + 92|0); $93 = ((($92)) + 28|0); $94 = +HEAPF32[$93>>2]; $item_offset = $94; $95 = $layout; $96 = ((($95)) + 92|0); $97 = ((($96)) + 4|0); $98 = HEAP32[$97>>2]|0; $99 = (+($98|0)); $100 = +HEAPF32[$spacing>>2]; $101 = $99 * $100; $item_spacing = $101; $102 = $3; $103 = ($102|0)!=(0); if ($103) { $104 = $item_width; $105 = +HEAPF32[$spacing>>2]; $106 = $104 + $105; $107 = $layout; $108 = ((($107)) + 92|0); $109 = ((($108)) + 28|0); $110 = +HEAPF32[$109>>2]; $111 = $110 + $106; HEAPF32[$109>>2] = $111; $112 = $layout; $113 = ((($112)) + 92|0); $114 = ((($113)) + 20|0); $115 = +HEAPF32[$114>>2]; $116 = $layout; $117 = ((($116)) + 92|0); $118 = ((($117)) + 32|0); $119 = +HEAPF32[$118>>2]; $120 = $119 + $115; HEAPF32[$118>>2] = $120; $121 = $layout; $122 = ((($121)) + 92|0); $123 = ((($122)) + 4|0); HEAP32[$123>>2] = 0; } break; } case 2: { $124 = $layout; $125 = ((($124)) + 24|0); $126 = +HEAPF32[$125>>2]; $127 = $layout; $128 = ((($127)) + 36|0); $129 = +HEAPF32[$128>>2]; $130 = $layout; $131 = ((($130)) + 92|0); $132 = ((($131)) + 36|0); $133 = +HEAPF32[$132>>2]; $134 = $129 * $133; $135 = $126 + $134; $136 = $0; HEAPF32[$136>>2] = $135; $137 = $layout; $138 = ((($137)) + 20|0); $139 = HEAP32[$138>>2]|0; $140 = HEAP16[$139>>1]|0; $141 = $140&65535; $142 = (+($141|0)); $143 = $0; $144 = +HEAPF32[$143>>2]; $145 = $144 - $142; HEAPF32[$143>>2] = $145; $146 = $layout; $147 = ((($146)) + 28|0); $148 = +HEAPF32[$147>>2]; $149 = $layout; $150 = ((($149)) + 92|0); $151 = ((($150)) + 8|0); $152 = +HEAPF32[$151>>2]; $153 = $layout; $154 = ((($153)) + 92|0); $155 = ((($154)) + 36|0); $156 = ((($155)) + 4|0); $157 = +HEAPF32[$156>>2]; $158 = $152 * $157; $159 = $148 + $158; $160 = $0; $161 = ((($160)) + 4|0); HEAPF32[$161>>2] = $159; $162 = $layout; $163 = ((($162)) + 20|0); $164 = HEAP32[$163>>2]|0; $165 = ((($164)) + 2|0); $166 = HEAP16[$165>>1]|0; $167 = $166&65535; $168 = (+($167|0)); $169 = $0; $170 = ((($169)) + 4|0); $171 = +HEAPF32[$170>>2]; $172 = $171 - $168; HEAPF32[$170>>2] = $172; $173 = $layout; $174 = ((($173)) + 36|0); $175 = +HEAPF32[$174>>2]; $176 = $layout; $177 = ((($176)) + 92|0); $178 = ((($177)) + 36|0); $179 = ((($178)) + 8|0); $180 = +HEAPF32[$179>>2]; $181 = $175 * $180; $182 = $0; $183 = ((($182)) + 8|0); HEAPF32[$183>>2] = $181; $184 = $layout; $185 = ((($184)) + 92|0); $186 = ((($185)) + 8|0); $187 = +HEAPF32[$186>>2]; $188 = $layout; $189 = ((($188)) + 92|0); $190 = ((($189)) + 36|0); $191 = ((($190)) + 12|0); $192 = +HEAPF32[$191>>2]; $193 = $187 * $192; $194 = $0; $195 = ((($194)) + 12|0); HEAPF32[$195>>2] = $193; STACKTOP = sp;return; break; } case 3: { $196 = $layout; $197 = ((($196)) + 92|0); $198 = ((($197)) + 16|0); $199 = HEAP32[$198>>2]|0; $200 = ($199|0)!=(0|0); if (!($200)) { ___assert_fail((31579|0),(13400|0),16530,(31549|0)); // unreachable; } $201 = $layout; $202 = ((($201)) + 92|0); $203 = ((($202)) + 4|0); $204 = HEAP32[$203>>2]|0; $205 = $layout; $206 = ((($205)) + 92|0); $207 = ((($206)) + 16|0); $208 = HEAP32[$207>>2]|0; $209 = (($208) + ($204<<2)|0); $210 = +HEAPF32[$209>>2]; $211 = $210 < 0.0; $212 = $layout; $213 = ((($212)) + 92|0); if ($211) { $214 = ((($213)) + 20|0); $215 = +HEAPF32[$214>>2]; $224 = $215; } else { $216 = ((($213)) + 4|0); $217 = HEAP32[$216>>2]|0; $218 = $layout; $219 = ((($218)) + 92|0); $220 = ((($219)) + 16|0); $221 = HEAP32[$220>>2]|0; $222 = (($221) + ($217<<2)|0); $223 = +HEAPF32[$222>>2]; $224 = $223; } $ratio = $224; $225 = $layout; $226 = ((($225)) + 92|0); $227 = ((($226)) + 4|0); $228 = HEAP32[$227>>2]|0; $229 = (+($228|0)); $230 = +HEAPF32[$spacing>>2]; $231 = $229 * $230; $item_spacing = $231; $232 = $ratio; $233 = $panel_space; $234 = $232 * $233; $item_width = $234; $235 = $layout; $236 = ((($235)) + 92|0); $237 = ((($236)) + 28|0); $238 = +HEAPF32[$237>>2]; $item_offset = $238; $239 = $3; $240 = ($239|0)!=(0); if ($240) { $241 = $item_width; $242 = $layout; $243 = ((($242)) + 92|0); $244 = ((($243)) + 28|0); $245 = +HEAPF32[$244>>2]; $246 = $245 + $241; HEAPF32[$244>>2] = $246; $247 = $ratio; $248 = $layout; $249 = ((($248)) + 92|0); $250 = ((($249)) + 32|0); $251 = +HEAPF32[$250>>2]; $252 = $251 + $247; HEAPF32[$250>>2] = $252; } break; } case 4: { $253 = $layout; $254 = ((($253)) + 92|0); $255 = ((($254)) + 20|0); $256 = +HEAPF32[$255>>2]; $item_width = $256; $257 = $layout; $258 = ((($257)) + 92|0); $259 = ((($258)) + 4|0); $260 = HEAP32[$259>>2]|0; $261 = (+($260|0)); $262 = $item_width; $263 = $261 * $262; $item_offset = $263; $264 = $layout; $265 = ((($264)) + 92|0); $266 = ((($265)) + 4|0); $267 = HEAP32[$266>>2]|0; $268 = (+($267|0)); $269 = +HEAPF32[$spacing>>2]; $270 = $268 * $269; $item_spacing = $270; break; } case 5: { $271 = $layout; $272 = ((($271)) + 92|0); $273 = ((($272)) + 20|0); $274 = +HEAPF32[$273>>2]; $item_width = $274; $275 = $layout; $276 = ((($275)) + 92|0); $277 = ((($276)) + 28|0); $278 = +HEAPF32[$277>>2]; $item_offset = $278; $279 = $layout; $280 = ((($279)) + 92|0); $281 = ((($280)) + 4|0); $282 = HEAP32[$281>>2]|0; $283 = (+($282|0)); $284 = +HEAPF32[$spacing>>2]; $285 = $283 * $284; $item_spacing = $285; $286 = $3; $287 = ($286|0)!=(0); if ($287) { $288 = $item_width; $289 = $layout; $290 = ((($289)) + 92|0); $291 = ((($290)) + 28|0); $292 = +HEAPF32[$291>>2]; $293 = $292 + $288; HEAPF32[$291>>2] = $293; $294 = $layout; $295 = ((($294)) + 92|0); $296 = ((($295)) + 4|0); HEAP32[$296>>2] = 0; } break; } case 6: { $297 = $layout; $298 = ((($297)) + 24|0); $299 = +HEAPF32[$298>>2]; $300 = $layout; $301 = ((($300)) + 92|0); $302 = ((($301)) + 36|0); $303 = +HEAPF32[$302>>2]; $304 = $299 + $303; $305 = $0; HEAPF32[$305>>2] = $304; $306 = $layout; $307 = ((($306)) + 92|0); $308 = ((($307)) + 36|0); $309 = ((($308)) + 8|0); $310 = +HEAPF32[$309>>2]; $311 = $0; $312 = ((($311)) + 8|0); HEAPF32[$312>>2] = $310; $313 = $0; $314 = +HEAPF32[$313>>2]; $315 = $0; $316 = ((($315)) + 8|0); $317 = +HEAPF32[$316>>2]; $318 = $314 + $317; $319 = $layout; $320 = ((($319)) + 32|0); $321 = +HEAPF32[$320>>2]; $322 = $318 > $321; $323 = $3; $324 = ($323|0)!=(0); $or$cond = $322 & $324; if ($or$cond) { $325 = $0; $326 = +HEAPF32[$325>>2]; $327 = $0; $328 = ((($327)) + 8|0); $329 = +HEAPF32[$328>>2]; $330 = $326 + $329; $331 = $layout; $332 = ((($331)) + 32|0); HEAPF32[$332>>2] = $330; } $333 = $layout; $334 = ((($333)) + 20|0); $335 = HEAP32[$334>>2]|0; $336 = HEAP16[$335>>1]|0; $337 = $336&65535; $338 = (+($337|0)); $339 = $0; $340 = +HEAPF32[$339>>2]; $341 = $340 - $338; HEAPF32[$339>>2] = $341; $342 = $layout; $343 = ((($342)) + 28|0); $344 = +HEAPF32[$343>>2]; $345 = $layout; $346 = ((($345)) + 92|0); $347 = ((($346)) + 36|0); $348 = ((($347)) + 4|0); $349 = +HEAPF32[$348>>2]; $350 = $344 + $349; $351 = $0; $352 = ((($351)) + 4|0); HEAPF32[$352>>2] = $350; $353 = $layout; $354 = ((($353)) + 20|0); $355 = HEAP32[$354>>2]|0; $356 = ((($355)) + 2|0); $357 = HEAP16[$356>>1]|0; $358 = $357&65535; $359 = (+($358|0)); $360 = $0; $361 = ((($360)) + 4|0); $362 = +HEAPF32[$361>>2]; $363 = $362 - $359; HEAPF32[$361>>2] = $363; $364 = $layout; $365 = ((($364)) + 92|0); $366 = ((($365)) + 36|0); $367 = ((($366)) + 12|0); $368 = +HEAPF32[$367>>2]; $369 = $0; $370 = ((($369)) + 12|0); HEAPF32[$370>>2] = $368; STACKTOP = sp;return; break; } case 7: { $371 = $layout; $372 = ((($371)) + 92|0); $373 = ((($372)) + 4|0); $374 = HEAP32[$373>>2]|0; $375 = (+($374|0)); $376 = +HEAPF32[$spacing>>2]; $377 = $375 * $376; $item_spacing = $377; $378 = $layout; $379 = ((($378)) + 92|0); $380 = ((($379)) + 4|0); $381 = HEAP32[$380>>2]|0; $382 = $layout; $383 = ((($382)) + 92|0); $384 = ((($383)) + 16|0); $385 = HEAP32[$384>>2]|0; $386 = (($385) + ($381<<2)|0); $387 = +HEAPF32[$386>>2]; $item_width = $387; $388 = $layout; $389 = ((($388)) + 92|0); $390 = ((($389)) + 28|0); $391 = +HEAPF32[$390>>2]; $item_offset = $391; $392 = $3; $393 = ($392|0)!=(0); if ($393) { $394 = $item_width; $395 = $layout; $396 = ((($395)) + 92|0); $397 = ((($396)) + 28|0); $398 = +HEAPF32[$397>>2]; $399 = $398 + $394; HEAPF32[$397>>2] = $399; } break; } default: { ___assert_fail((30507|0),(13400|0),16577,(31549|0)); // unreachable; } } $400 = $item_width; $401 = $0; $402 = ((($401)) + 8|0); HEAPF32[$402>>2] = $400; $403 = $layout; $404 = ((($403)) + 92|0); $405 = ((($404)) + 8|0); $406 = +HEAPF32[$405>>2]; $407 = ((($spacing)) + 4|0); $408 = +HEAPF32[$407>>2]; $409 = $406 - $408; $410 = $0; $411 = ((($410)) + 12|0); HEAPF32[$411>>2] = $409; $412 = $layout; $413 = ((($412)) + 28|0); $414 = +HEAPF32[$413>>2]; $415 = $layout; $416 = ((($415)) + 20|0); $417 = HEAP32[$416>>2]|0; $418 = ((($417)) + 2|0); $419 = HEAP16[$418>>1]|0; $420 = $419&65535; $421 = (+($420|0)); $422 = $414 - $421; $423 = $0; $424 = ((($423)) + 4|0); HEAPF32[$424>>2] = $422; $425 = $layout; $426 = ((($425)) + 24|0); $427 = +HEAPF32[$426>>2]; $428 = $item_offset; $429 = $427 + $428; $430 = $item_spacing; $431 = $429 + $430; $432 = +HEAPF32[$padding>>2]; $433 = $431 + $432; $434 = $0; HEAPF32[$434>>2] = $433; $435 = $0; $436 = +HEAPF32[$435>>2]; $437 = $0; $438 = ((($437)) + 8|0); $439 = +HEAPF32[$438>>2]; $440 = $436 + $439; $441 = $layout; $442 = ((($441)) + 32|0); $443 = +HEAPF32[$442>>2]; $444 = $440 > $443; $445 = $3; $446 = ($445|0)!=(0); $or$cond3 = $444 & $446; if ($or$cond3) { $447 = $0; $448 = +HEAPF32[$447>>2]; $449 = $0; $450 = ((($449)) + 8|0); $451 = +HEAPF32[$450>>2]; $452 = $448 + $451; $453 = $layout; $454 = ((($453)) + 32|0); HEAPF32[$454>>2] = $452; } $455 = $layout; $456 = ((($455)) + 20|0); $457 = HEAP32[$456>>2]|0; $458 = HEAP16[$457>>1]|0; $459 = $458&65535; $460 = (+($459|0)); $461 = $0; $462 = +HEAPF32[$461>>2]; $463 = $462 - $460; HEAPF32[$461>>2] = $463; STACKTOP = sp;return; } function _nk_draw_button_text($out,$bounds,$content,$state,$style,$txt,$len,$text_alignment,$font) { $out = $out|0; $bounds = $bounds|0; $content = $content|0; $state = $state|0; $style = $style|0; $txt = $txt|0; $len = $len|0; $text_alignment = $text_alignment|0; $font = $font|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0; var $7 = 0, $8 = 0, $9 = 0, $background = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 72|0; $text = sp + 16|0; $9 = sp; $0 = $out; $1 = $bounds; $2 = $content; $3 = $state; $4 = $style; $5 = $txt; $6 = $len; $7 = $text_alignment; $8 = $font; $10 = $0; $11 = $1; $12 = $3; $13 = $4; $14 = (_nk_draw_button($10,$11,$12,$13)|0); $background = $14; $15 = $background; $16 = HEAP32[$15>>2]|0; $17 = ($16|0)==(0); $18 = ((($text)) + 8|0); if ($17) { $19 = $background; $20 = ((($19)) + 4|0); ;HEAP8[$18>>0]=HEAP8[$20>>0]|0;HEAP8[$18+1>>0]=HEAP8[$20+1>>0]|0;HEAP8[$18+2>>0]=HEAP8[$20+2>>0]|0;HEAP8[$18+3>>0]=HEAP8[$20+3>>0]|0; } else { $21 = $4; $22 = ((($21)) + 64|0); ;HEAP8[$18>>0]=HEAP8[$22>>0]|0;HEAP8[$18+1>>0]=HEAP8[$22+1>>0]|0;HEAP8[$18+2>>0]=HEAP8[$22+2>>0]|0;HEAP8[$18+3>>0]=HEAP8[$22+3>>0]|0; } $23 = $3; $24 = $23 & 16; $25 = ($24|0)!=(0); do { if ($25) { $26 = ((($text)) + 12|0); $27 = $4; $28 = ((($27)) + 72|0); ;HEAP8[$26>>0]=HEAP8[$28>>0]|0;HEAP8[$26+1>>0]=HEAP8[$28+1>>0]|0;HEAP8[$26+2>>0]=HEAP8[$28+2>>0]|0;HEAP8[$26+3>>0]=HEAP8[$28+3>>0]|0; } else { $29 = $3; $30 = $29 & 32; $31 = ($30|0)!=(0); $32 = ((($text)) + 12|0); $33 = $4; if ($31) { $34 = ((($33)) + 76|0); ;HEAP8[$32>>0]=HEAP8[$34>>0]|0;HEAP8[$32+1>>0]=HEAP8[$34+1>>0]|0;HEAP8[$32+2>>0]=HEAP8[$34+2>>0]|0;HEAP8[$32+3>>0]=HEAP8[$34+3>>0]|0; break; } else { $35 = ((($33)) + 68|0); ;HEAP8[$32>>0]=HEAP8[$35>>0]|0;HEAP8[$32+1>>0]=HEAP8[$35+1>>0]|0;HEAP8[$32+2>>0]=HEAP8[$35+2>>0]|0;HEAP8[$32+3>>0]=HEAP8[$35+3>>0]|0; break; } } } while(0); _nk_vec2($9,0.0,0.0); ;HEAP32[$text>>2]=HEAP32[$9>>2]|0;HEAP32[$text+4>>2]=HEAP32[$9+4>>2]|0; $36 = $0; $37 = $2; $38 = $5; $39 = $6; $40 = $7; $41 = $8; ;HEAP32[$$byval_copy>>2]=HEAP32[$37>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$37+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$37+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$37+12>>2]|0; _nk_widget_text($36,$$byval_copy,$38,$39,$text,$40,$41); STACKTOP = sp;return; } function _nk_toggle_behavior($in,$select,$state,$active) { $in = $in|0; $select = $select|0; $state = $state|0; $active = $active|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $select$byval_copy = 0, $select$byval_copy1 = 0, $select$byval_copy2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $select$byval_copy2 = sp + 48|0; $select$byval_copy1 = sp + 32|0; $select$byval_copy = sp + 16|0; $0 = $in; $1 = $state; $2 = $active; $3 = $1; $4 = HEAP32[$3>>2]|0; $5 = $4 & 2; $6 = ($5|0)!=(0); $7 = $1; if ($6) { HEAP32[$7>>2] = 6; } else { HEAP32[$7>>2] = 4; } $8 = $1; $9 = $0; ;HEAP32[$select$byval_copy>>2]=HEAP32[$select>>2]|0;HEAP32[$select$byval_copy+4>>2]=HEAP32[$select+4>>2]|0;HEAP32[$select$byval_copy+8>>2]=HEAP32[$select+8>>2]|0;HEAP32[$select$byval_copy+12>>2]=HEAP32[$select+12>>2]|0; $10 = (_nk_button_behavior($8,$select$byval_copy,$9,0)|0); $11 = ($10|0)!=(0); if ($11) { $12 = $1; HEAP32[$12>>2] = 34; $13 = $2; $14 = ($13|0)!=(0); $15 = $14 ^ 1; $16 = $15&1; $2 = $16; } $17 = $1; $18 = HEAP32[$17>>2]|0; $19 = $18 & 16; $20 = ($19|0)!=(0); if ($20) { $21 = $0; ;HEAP32[$select$byval_copy1>>2]=HEAP32[$select>>2]|0;HEAP32[$select$byval_copy1+4>>2]=HEAP32[$select+4>>2]|0;HEAP32[$select$byval_copy1+8>>2]=HEAP32[$select+8>>2]|0;HEAP32[$select$byval_copy1+12>>2]=HEAP32[$select+12>>2]|0; $22 = (_nk_input_is_mouse_prev_hovering_rect($21,$select$byval_copy1)|0); $23 = ($22|0)!=(0); if (!($23)) { $24 = $1; $25 = HEAP32[$24>>2]|0; $26 = $25 | 8; HEAP32[$24>>2] = $26; $33 = $2; STACKTOP = sp;return ($33|0); } } $27 = $0; ;HEAP32[$select$byval_copy2>>2]=HEAP32[$select>>2]|0;HEAP32[$select$byval_copy2+4>>2]=HEAP32[$select+4>>2]|0;HEAP32[$select$byval_copy2+8>>2]=HEAP32[$select+8>>2]|0;HEAP32[$select$byval_copy2+12>>2]=HEAP32[$select+12>>2]|0; $28 = (_nk_input_is_mouse_prev_hovering_rect($27,$select$byval_copy2)|0); $29 = ($28|0)!=(0); if (!($29)) { $33 = $2; STACKTOP = sp;return ($33|0); } $30 = $1; $31 = HEAP32[$30>>2]|0; $32 = $31 | 64; HEAP32[$30>>2] = $32; $33 = $2; STACKTOP = sp;return ($33|0); } function _nk_draw_checkbox($out,$state,$style,$active,$label,$selector,$cursors,$string,$len,$font) { $out = $out|0; $state = $state|0; $style = $style|0; $active = $active|0; $label = $label|0; $selector = $selector|0; $cursors = $cursors|0; $string = $string|0; $len = $len|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0; var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $background = 0, $cursor = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 160|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 128|0; $$byval_copy5 = sp + 148|0; $$byval_copy4 = sp + 112|0; $$byval_copy3 = sp + 96|0; $$byval_copy2 = sp + 144|0; $$byval_copy1 = sp + 80|0; $$byval_copy = sp + 64|0; $text = sp; $0 = $out; $1 = $state; $2 = $style; $3 = $active; $4 = $label; $5 = $selector; $6 = $cursors; $7 = $string; $8 = $len; $9 = $font; $10 = $1; $11 = $10 & 16; $12 = ($11|0)!=(0); do { if ($12) { $13 = $2; $14 = ((($13)) + 20|0); $background = $14; $15 = $2; $16 = ((($15)) + 80|0); $cursor = $16; $17 = ((($text)) + 12|0); $18 = $2; $19 = ((($18)) + 104|0); ;HEAP8[$17>>0]=HEAP8[$19>>0]|0;HEAP8[$17+1>>0]=HEAP8[$19+1>>0]|0;HEAP8[$17+2>>0]=HEAP8[$19+2>>0]|0;HEAP8[$17+3>>0]=HEAP8[$19+3>>0]|0; } else { $20 = $1; $21 = $20 & 32; $22 = ($21|0)!=(0); $23 = $2; if ($22) { $24 = ((($23)) + 20|0); $background = $24; $25 = $2; $26 = ((($25)) + 80|0); $cursor = $26; $27 = ((($text)) + 12|0); $28 = $2; $29 = ((($28)) + 108|0); ;HEAP8[$27>>0]=HEAP8[$29>>0]|0;HEAP8[$27+1>>0]=HEAP8[$29+1>>0]|0;HEAP8[$27+2>>0]=HEAP8[$29+2>>0]|0;HEAP8[$27+3>>0]=HEAP8[$29+3>>0]|0; break; } else { $background = $23; $30 = $2; $31 = ((($30)) + 60|0); $cursor = $31; $32 = ((($text)) + 12|0); $33 = $2; $34 = ((($33)) + 100|0); ;HEAP8[$32>>0]=HEAP8[$34>>0]|0;HEAP8[$32+1>>0]=HEAP8[$34+1>>0]|0;HEAP8[$32+2>>0]=HEAP8[$34+2>>0]|0;HEAP8[$32+3>>0]=HEAP8[$34+3>>0]|0; break; } } } while(0); $35 = $background; $36 = HEAP32[$35>>2]|0; $37 = ($36|0)==(1); $38 = $0; $39 = $5; $40 = $background; $41 = ((($40)) + 4|0); if ($37) { ;HEAP32[$$byval_copy>>2]=HEAP32[$39>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$39+12>>2]|0; _nk_draw_image($38,$$byval_copy,$41); } else { ;HEAP32[$$byval_copy1>>2]=HEAP32[$39>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$39+12>>2]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$41>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$41+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$41+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$41+3>>0]|0; _nk_fill_rect($38,$$byval_copy1,0.0,$$byval_copy2); } $42 = $3; $43 = ($42|0)!=(0); do { if ($43) { $44 = $cursor; $45 = HEAP32[$44>>2]|0; $46 = ($45|0)==(1); $47 = $0; $48 = $6; $49 = $cursor; $50 = ((($49)) + 4|0); if ($46) { ;HEAP32[$$byval_copy3>>2]=HEAP32[$48>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$48+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$48+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$48+12>>2]|0; _nk_draw_image($47,$$byval_copy3,$50); break; } else { ;HEAP32[$$byval_copy4>>2]=HEAP32[$48>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$48+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$48+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$48+12>>2]|0; ;HEAP8[$$byval_copy5>>0]=HEAP8[$50>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$50+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$50+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$50+3>>0]|0; _nk_fill_rect($47,$$byval_copy4,0.0,$$byval_copy5); break; } } } while(0); HEAPF32[$text>>2] = 0.0; $51 = ((($text)) + 4|0); HEAPF32[$51>>2] = 0.0; $52 = ((($text)) + 8|0); $53 = $2; $54 = ((($53)) + 112|0); ;HEAP8[$52>>0]=HEAP8[$54>>0]|0;HEAP8[$52+1>>0]=HEAP8[$54+1>>0]|0;HEAP8[$52+2>>0]=HEAP8[$54+2>>0]|0;HEAP8[$52+3>>0]=HEAP8[$54+3>>0]|0; $55 = $0; $56 = $4; $57 = $7; $58 = $8; $59 = $9; ;HEAP32[$$byval_copy6>>2]=HEAP32[$56>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$56+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$56+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$56+12>>2]|0; _nk_widget_text($55,$$byval_copy6,$57,$58,$text,17,$59); STACKTOP = sp;return; } function _nk_draw_option($out,$state,$style,$active,$label,$selector,$cursors,$string,$len,$font) { $out = $out|0; $state = $state|0; $style = $style|0; $active = $active|0; $label = $label|0; $selector = $selector|0; $cursors = $cursors|0; $string = $string|0; $len = $len|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0; var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $background = 0, $cursor = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 160|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 128|0; $$byval_copy5 = sp + 148|0; $$byval_copy4 = sp + 112|0; $$byval_copy3 = sp + 96|0; $$byval_copy2 = sp + 144|0; $$byval_copy1 = sp + 80|0; $$byval_copy = sp + 64|0; $text = sp; $0 = $out; $1 = $state; $2 = $style; $3 = $active; $4 = $label; $5 = $selector; $6 = $cursors; $7 = $string; $8 = $len; $9 = $font; $10 = $1; $11 = $10 & 16; $12 = ($11|0)!=(0); do { if ($12) { $13 = $2; $14 = ((($13)) + 20|0); $background = $14; $15 = $2; $16 = ((($15)) + 80|0); $cursor = $16; $17 = ((($text)) + 12|0); $18 = $2; $19 = ((($18)) + 104|0); ;HEAP8[$17>>0]=HEAP8[$19>>0]|0;HEAP8[$17+1>>0]=HEAP8[$19+1>>0]|0;HEAP8[$17+2>>0]=HEAP8[$19+2>>0]|0;HEAP8[$17+3>>0]=HEAP8[$19+3>>0]|0; } else { $20 = $1; $21 = $20 & 32; $22 = ($21|0)!=(0); $23 = $2; if ($22) { $24 = ((($23)) + 20|0); $background = $24; $25 = $2; $26 = ((($25)) + 80|0); $cursor = $26; $27 = ((($text)) + 12|0); $28 = $2; $29 = ((($28)) + 108|0); ;HEAP8[$27>>0]=HEAP8[$29>>0]|0;HEAP8[$27+1>>0]=HEAP8[$29+1>>0]|0;HEAP8[$27+2>>0]=HEAP8[$29+2>>0]|0;HEAP8[$27+3>>0]=HEAP8[$29+3>>0]|0; break; } else { $background = $23; $30 = $2; $31 = ((($30)) + 60|0); $cursor = $31; $32 = ((($text)) + 12|0); $33 = $2; $34 = ((($33)) + 100|0); ;HEAP8[$32>>0]=HEAP8[$34>>0]|0;HEAP8[$32+1>>0]=HEAP8[$34+1>>0]|0;HEAP8[$32+2>>0]=HEAP8[$34+2>>0]|0;HEAP8[$32+3>>0]=HEAP8[$34+3>>0]|0; break; } } } while(0); $35 = $background; $36 = HEAP32[$35>>2]|0; $37 = ($36|0)==(1); $38 = $0; $39 = $5; $40 = $background; $41 = ((($40)) + 4|0); if ($37) { ;HEAP32[$$byval_copy>>2]=HEAP32[$39>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$39+12>>2]|0; _nk_draw_image($38,$$byval_copy,$41); } else { ;HEAP32[$$byval_copy1>>2]=HEAP32[$39>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$39+12>>2]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$41>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$41+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$41+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$41+3>>0]|0; _nk_fill_circle($38,$$byval_copy1,$$byval_copy2); } $42 = $3; $43 = ($42|0)!=(0); do { if ($43) { $44 = $cursor; $45 = HEAP32[$44>>2]|0; $46 = ($45|0)==(1); $47 = $0; $48 = $6; $49 = $cursor; $50 = ((($49)) + 4|0); if ($46) { ;HEAP32[$$byval_copy3>>2]=HEAP32[$48>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$48+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$48+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$48+12>>2]|0; _nk_draw_image($47,$$byval_copy3,$50); break; } else { ;HEAP32[$$byval_copy4>>2]=HEAP32[$48>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$48+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$48+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$48+12>>2]|0; ;HEAP8[$$byval_copy5>>0]=HEAP8[$50>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$50+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$50+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$50+3>>0]|0; _nk_fill_circle($47,$$byval_copy4,$$byval_copy5); break; } } } while(0); HEAPF32[$text>>2] = 0.0; $51 = ((($text)) + 4|0); HEAPF32[$51>>2] = 0.0; $52 = ((($text)) + 8|0); $53 = $2; $54 = ((($53)) + 112|0); ;HEAP8[$52>>0]=HEAP8[$54>>0]|0;HEAP8[$52+1>>0]=HEAP8[$54+1>>0]|0;HEAP8[$52+2>>0]=HEAP8[$54+2>>0]|0;HEAP8[$52+3>>0]=HEAP8[$54+3>>0]|0; $55 = $0; $56 = $4; $57 = $7; $58 = $8; $59 = $9; ;HEAP32[$$byval_copy6>>2]=HEAP32[$56>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$56+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$56+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$56+12>>2]|0; _nk_widget_text($55,$$byval_copy6,$57,$58,$text,17,$59); STACKTOP = sp;return; } function _nk_textedit_click($state,$x,$y,$font,$row_height) { $state = $state|0; $x = +$x; $y = +$y; $font = $font|0; $row_height = +$row_height; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0.0; var $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $x; $2 = $y; $3 = $font; $4 = $row_height; $5 = $0; $6 = $1; $7 = $2; $8 = $3; $9 = $4; $10 = (_nk_textedit_locate_coord($5,$6,$7,$8,$9)|0); $11 = $0; $12 = ((($11)) + 88|0); HEAP32[$12>>2] = $10; $13 = $0; $14 = ((($13)) + 88|0); $15 = HEAP32[$14>>2]|0; $16 = $0; $17 = ((($16)) + 92|0); HEAP32[$17>>2] = $15; $18 = $0; $19 = ((($18)) + 88|0); $20 = HEAP32[$19>>2]|0; $21 = $0; $22 = ((($21)) + 96|0); HEAP32[$22>>2] = $20; $23 = $0; $24 = ((($23)) + 103|0); HEAP8[$24>>0] = 0; STACKTOP = sp;return; } function _nk_textedit_drag($state,$x,$y,$font,$row_height) { $state = $state|0; $x = +$x; $y = +$y; $font = $font|0; $row_height = +$row_height; var $0 = 0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $p = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $x; $2 = $y; $3 = $font; $4 = $row_height; $5 = $0; $6 = $1; $7 = $2; $8 = $3; $9 = $4; $10 = (_nk_textedit_locate_coord($5,$6,$7,$8,$9)|0); $p = $10; $11 = $0; $12 = ((($11)) + 92|0); $13 = HEAP32[$12>>2]|0; $14 = $0; $15 = ((($14)) + 96|0); $16 = HEAP32[$15>>2]|0; $17 = ($13|0)==($16|0); if ($17) { $18 = $0; $19 = ((($18)) + 88|0); $20 = HEAP32[$19>>2]|0; $21 = $0; $22 = ((($21)) + 92|0); HEAP32[$22>>2] = $20; } $23 = $p; $24 = $0; $25 = ((($24)) + 96|0); HEAP32[$25>>2] = $23; $26 = $0; $27 = ((($26)) + 88|0); HEAP32[$27>>2] = $23; STACKTOP = sp;return; } function _nk_textedit_key($state,$key,$shift_mod,$font,$row_height) { $state = $state|0; $key = $key|0; $shift_mod = $shift_mod|0; $font = $font|0; $row_height = +$row_height; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0.0, $188 = 0.0; var $189 = 0.0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0.0, $203 = 0, $204 = 0.0, $205 = 0; var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0.0, $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0.0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0.0, $278 = 0.0; var $279 = 0.0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0.0, $289 = 0, $29 = 0, $290 = 0.0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0.0, $301 = 0.0, $302 = 0.0, $303 = 0.0, $304 = 0.0, $305 = 0.0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; var $314 = 0, $315 = 0, $316 = 0.0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0; var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0; var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0; var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0; var $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0.0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0; var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0; var $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0; var $440 = 0, $441 = 0.0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0; var $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0; var $477 = 0.0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0; var $495 = 0, $496 = 0, $497 = 0.0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0; var $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0; var $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0.0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0; var $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0; var $99 = 0, $dx = 0.0, $dx7 = 0.0, $find = 0, $find1 = 0, $find10 = 0, $find11 = 0, $find8 = 0, $find9 = 0, $goal_x = 0.0, $goal_x6 = 0.0, $i = 0, $i3 = 0, $n = 0, $row = 0, $row2 = 0, $sel = 0, $sel4 = 0, $start = 0, $x = 0.0; var $x5 = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $find = sp + 216|0; $row = sp + 192|0; $find1 = sp + 144|0; $row2 = sp + 120|0; $find8 = sp + 72|0; $find9 = sp + 48|0; $find10 = sp + 24|0; $find11 = sp; $0 = $state; $1 = $key; $2 = $shift_mod; $3 = $font; $4 = $row_height; L1: while(1) { $5 = $1; switch ($5|0) { case 18: { label = 98; break L1; break; } case 17: { label = 89; break L1; break; } case 20: { label = 86; break L1; break; } case 19: { label = 83; break L1; break; } case 6: { label = 78; break L1; break; } case 3: { label = 73; break L1; break; } case 24: { label = 34; break L1; break; } case 21: { label = 3; break L1; break; } case 22: { label = 4; break L1; break; } case 14: { label = 5; break L1; break; } case 15: { label = 7; break L1; break; } case 16: { label = 9; break L1; break; } case 12: { label = 12; break L1; break; } case 13: { label = 21; break L1; break; } case 23: { label = 27; break L1; break; } case 10: { $239 = $2; $sel4 = $239; $240 = $0; $241 = ((($240)) + 104|0); $242 = HEAP8[$241>>0]|0; $243 = ($242<<24>>24)!=(0); if (!($243)) { label = 59; break L1; } $1 = 12; continue L1; break; } case 11: { $151 = $2; $sel = $151; $152 = $0; $153 = ((($152)) + 104|0); $154 = HEAP8[$153>>0]|0; $155 = ($154<<24>>24)!=(0); if (!($155)) { label = 43; break L1; } $1 = 13; continue L1; break; } default: { label = 106; break L1; } } } switch (label|0) { case 3: { $6 = $0; _nk_textedit_undo($6); $7 = $0; $8 = ((($7)) + 103|0); HEAP8[$8>>0] = 0; STACKTOP = sp;return; break; } case 4: { $9 = $0; _nk_textedit_redo($9); $10 = $0; $11 = ((($10)) + 103|0); HEAP8[$11>>0] = 0; STACKTOP = sp;return; break; } case 5: { $12 = $0; $13 = ((($12)) + 100|0); $14 = HEAP8[$13>>0]|0; $15 = $14&255; $16 = ($15|0)==(0); if (!($16)) { STACKTOP = sp;return; } $17 = $0; $18 = ((($17)) + 100|0); HEAP8[$18>>0] = 1; STACKTOP = sp;return; break; } case 7: { $19 = $0; $20 = ((($19)) + 100|0); $21 = HEAP8[$20>>0]|0; $22 = $21&255; $23 = ($22|0)==(0); if (!($23)) { STACKTOP = sp;return; } $24 = $0; $25 = ((($24)) + 100|0); HEAP8[$25>>0] = 2; STACKTOP = sp;return; break; } case 9: { $26 = $0; $27 = ((($26)) + 100|0); $28 = HEAP8[$27>>0]|0; $29 = $28&255; $30 = ($29|0)==(1); if (!($30)) { $31 = $0; $32 = ((($31)) + 100|0); $33 = HEAP8[$32>>0]|0; $34 = $33&255; $35 = ($34|0)==(2); if (!($35)) { STACKTOP = sp;return; } } $36 = $0; $37 = ((($36)) + 100|0); HEAP8[$37>>0] = 0; STACKTOP = sp;return; break; } case 12: { $38 = $2; $39 = ($38|0)!=(0); $40 = $0; if ($39) { _nk_textedit_clamp($40); $41 = $0; _nk_textedit_prep_selection_at_cursor($41); $42 = $0; $43 = ((($42)) + 96|0); $44 = HEAP32[$43>>2]|0; $45 = ($44|0)>(0); if ($45) { $46 = $0; $47 = ((($46)) + 96|0); $48 = HEAP32[$47>>2]|0; $49 = (($48) + -1)|0; HEAP32[$47>>2] = $49; } $50 = $0; $51 = ((($50)) + 96|0); $52 = HEAP32[$51>>2]|0; $53 = $0; $54 = ((($53)) + 88|0); HEAP32[$54>>2] = $52; $55 = $0; $56 = ((($55)) + 103|0); HEAP8[$56>>0] = 0; STACKTOP = sp;return; } $57 = ((($40)) + 92|0); $58 = HEAP32[$57>>2]|0; $59 = $0; $60 = ((($59)) + 96|0); $61 = HEAP32[$60>>2]|0; $62 = ($58|0)!=($61|0); $63 = $0; if ($62) { _nk_textedit_move_to_first($63); } else { $64 = ((($63)) + 88|0); $65 = HEAP32[$64>>2]|0; $66 = ($65|0)>(0); if ($66) { $67 = $0; $68 = ((($67)) + 88|0); $69 = HEAP32[$68>>2]|0; $70 = (($69) + -1)|0; HEAP32[$68>>2] = $70; } } $71 = $0; $72 = ((($71)) + 103|0); HEAP8[$72>>0] = 0; STACKTOP = sp;return; break; } case 21: { $73 = $2; $74 = ($73|0)!=(0); $75 = $0; if ($74) { _nk_textedit_prep_selection_at_cursor($75); $76 = $0; $77 = ((($76)) + 96|0); $78 = HEAP32[$77>>2]|0; $79 = (($78) + 1)|0; HEAP32[$77>>2] = $79; $80 = $0; _nk_textedit_clamp($80); $81 = $0; $82 = ((($81)) + 96|0); $83 = HEAP32[$82>>2]|0; $84 = $0; $85 = ((($84)) + 88|0); HEAP32[$85>>2] = $83; $86 = $0; $87 = ((($86)) + 103|0); HEAP8[$87>>0] = 0; STACKTOP = sp;return; } $88 = ((($75)) + 92|0); $89 = HEAP32[$88>>2]|0; $90 = $0; $91 = ((($90)) + 96|0); $92 = HEAP32[$91>>2]|0; $93 = ($89|0)!=($92|0); $94 = $0; if ($93) { _nk_textedit_move_to_last($94); } else { $95 = ((($94)) + 88|0); $96 = HEAP32[$95>>2]|0; $97 = (($96) + 1)|0; HEAP32[$95>>2] = $97; } $98 = $0; _nk_textedit_clamp($98); $99 = $0; $100 = ((($99)) + 103|0); HEAP8[$100>>0] = 0; STACKTOP = sp;return; break; } case 27: { $101 = $2; $102 = ($101|0)!=(0); $103 = $0; $104 = ((($103)) + 92|0); $105 = HEAP32[$104>>2]|0; $106 = $0; $107 = ((($106)) + 96|0); $108 = HEAP32[$107>>2]|0; $109 = ($105|0)!=($108|0); if ($102) { if (!($109)) { $110 = $0; _nk_textedit_prep_selection_at_cursor($110); } $111 = $0; $112 = (_nk_textedit_move_to_word_previous($111)|0); $113 = $0; $114 = ((($113)) + 88|0); HEAP32[$114>>2] = $112; $115 = $0; $116 = ((($115)) + 88|0); $117 = HEAP32[$116>>2]|0; $118 = $0; $119 = ((($118)) + 96|0); HEAP32[$119>>2] = $117; $120 = $0; _nk_textedit_clamp($120); STACKTOP = sp;return; } $121 = $0; if ($109) { _nk_textedit_move_to_first($121); STACKTOP = sp;return; } else { $122 = (_nk_textedit_move_to_word_previous($121)|0); $123 = $0; $124 = ((($123)) + 88|0); HEAP32[$124>>2] = $122; $125 = $0; _nk_textedit_clamp($125); STACKTOP = sp;return; } break; } case 34: { $126 = $2; $127 = ($126|0)!=(0); $128 = $0; $129 = ((($128)) + 92|0); $130 = HEAP32[$129>>2]|0; $131 = $0; $132 = ((($131)) + 96|0); $133 = HEAP32[$132>>2]|0; $134 = ($130|0)!=($133|0); if ($127) { if (!($134)) { $135 = $0; _nk_textedit_prep_selection_at_cursor($135); } $136 = $0; $137 = (_nk_textedit_move_to_word_next($136)|0); $138 = $0; $139 = ((($138)) + 88|0); HEAP32[$139>>2] = $137; $140 = $0; $141 = ((($140)) + 88|0); $142 = HEAP32[$141>>2]|0; $143 = $0; $144 = ((($143)) + 96|0); HEAP32[$144>>2] = $142; $145 = $0; _nk_textedit_clamp($145); STACKTOP = sp;return; } $146 = $0; if ($134) { _nk_textedit_move_to_last($146); STACKTOP = sp;return; } else { $147 = (_nk_textedit_move_to_word_next($146)|0); $148 = $0; $149 = ((($148)) + 88|0); HEAP32[$149>>2] = $147; $150 = $0; _nk_textedit_clamp($150); STACKTOP = sp;return; } break; } case 43: { $156 = $sel; $157 = ($156|0)!=(0); $158 = $0; if ($157) { _nk_textedit_prep_selection_at_cursor($158); } else { $159 = ((($158)) + 92|0); $160 = HEAP32[$159>>2]|0; $161 = $0; $162 = ((($161)) + 96|0); $163 = HEAP32[$162>>2]|0; $164 = ($160|0)!=($163|0); if ($164) { $165 = $0; _nk_textedit_move_to_last($165); } } $166 = $0; _nk_textedit_clamp($166); $167 = $0; $168 = $0; $169 = ((($168)) + 88|0); $170 = HEAP32[$169>>2]|0; $171 = $0; $172 = ((($171)) + 104|0); $173 = HEAP8[$172>>0]|0; $174 = $173&255; $175 = $3; $176 = $4; _nk_textedit_find_charpos($find,$167,$170,$174,$175,$176); $177 = ((($find)) + 16|0); $178 = HEAP32[$177>>2]|0; $179 = ($178|0)!=(0); if (!($179)) { STACKTOP = sp;return; } $180 = $0; $181 = ((($180)) + 103|0); $182 = HEAP8[$181>>0]|0; $183 = $182&255; $184 = ($183|0)!=(0); if ($184) { $185 = $0; $186 = ((($185)) + 108|0); $187 = +HEAPF32[$186>>2]; $189 = $187; } else { $188 = +HEAPF32[$find>>2]; $189 = $188; } $goal_x = $189; $190 = ((($find)) + 12|0); $191 = HEAP32[$190>>2]|0; $192 = ((($find)) + 16|0); $193 = HEAP32[$192>>2]|0; $194 = (($191) + ($193))|0; $start = $194; $195 = $start; $196 = $0; $197 = ((($196)) + 88|0); HEAP32[$197>>2] = $195; $198 = $0; $199 = $0; $200 = ((($199)) + 88|0); $201 = HEAP32[$200>>2]|0; $202 = $4; $203 = $3; _nk_textedit_layout_row($row,$198,$201,$202,$203); $204 = +HEAPF32[$row>>2]; $x = $204; $i = 0; while(1) { $205 = $i; $206 = ((($row)) + 20|0); $207 = HEAP32[$206>>2]|0; $208 = ($205|0)<($207|0); if (!($208)) { break; } $209 = $0; $210 = $start; $211 = $i; $212 = $3; $213 = (+_nk_textedit_get_width($209,$210,$211,$212)); $dx = $213; $214 = $dx; $215 = $x; $216 = $215 + $214; $x = $216; $217 = $x; $218 = $goal_x; $219 = $217 > $218; if ($219) { break; } $220 = $0; $221 = ((($220)) + 88|0); $222 = HEAP32[$221>>2]|0; $223 = (($222) + 1)|0; HEAP32[$221>>2] = $223; $224 = $i; $225 = (($224) + 1)|0; $i = $225; } $226 = $0; _nk_textedit_clamp($226); $227 = $0; $228 = ((($227)) + 103|0); HEAP8[$228>>0] = 1; $229 = $goal_x; $230 = $0; $231 = ((($230)) + 108|0); HEAPF32[$231>>2] = $229; $232 = $sel; $233 = ($232|0)!=(0); if (!($233)) { STACKTOP = sp;return; } $234 = $0; $235 = ((($234)) + 88|0); $236 = HEAP32[$235>>2]|0; $237 = $0; $238 = ((($237)) + 96|0); HEAP32[$238>>2] = $236; STACKTOP = sp;return; break; } case 59: { $244 = $sel4; $245 = ($244|0)!=(0); $246 = $0; if ($245) { _nk_textedit_prep_selection_at_cursor($246); } else { $247 = ((($246)) + 92|0); $248 = HEAP32[$247>>2]|0; $249 = $0; $250 = ((($249)) + 96|0); $251 = HEAP32[$250>>2]|0; $252 = ($248|0)!=($251|0); if ($252) { $253 = $0; _nk_textedit_move_to_first($253); } } $254 = $0; _nk_textedit_clamp($254); $255 = $0; $256 = $0; $257 = ((($256)) + 88|0); $258 = HEAP32[$257>>2]|0; $259 = $0; $260 = ((($259)) + 104|0); $261 = HEAP8[$260>>0]|0; $262 = $261&255; $263 = $3; $264 = $4; _nk_textedit_find_charpos($find1,$255,$258,$262,$263,$264); $265 = ((($find1)) + 20|0); $266 = HEAP32[$265>>2]|0; $267 = ((($find1)) + 12|0); $268 = HEAP32[$267>>2]|0; $269 = ($266|0)!=($268|0); if (!($269)) { STACKTOP = sp;return; } $270 = $0; $271 = ((($270)) + 103|0); $272 = HEAP8[$271>>0]|0; $273 = $272&255; $274 = ($273|0)!=(0); if ($274) { $275 = $0; $276 = ((($275)) + 108|0); $277 = +HEAPF32[$276>>2]; $279 = $277; } else { $278 = +HEAPF32[$find1>>2]; $279 = $278; } $goal_x6 = $279; $280 = ((($find1)) + 20|0); $281 = HEAP32[$280>>2]|0; $282 = $0; $283 = ((($282)) + 88|0); HEAP32[$283>>2] = $281; $284 = $0; $285 = $0; $286 = ((($285)) + 88|0); $287 = HEAP32[$286>>2]|0; $288 = $4; $289 = $3; _nk_textedit_layout_row($row2,$284,$287,$288,$289); $290 = +HEAPF32[$row2>>2]; $x5 = $290; $i3 = 0; while(1) { $291 = $i3; $292 = ((($row2)) + 20|0); $293 = HEAP32[$292>>2]|0; $294 = ($291|0)<($293|0); if (!($294)) { break; } $295 = $0; $296 = ((($find1)) + 20|0); $297 = HEAP32[$296>>2]|0; $298 = $i3; $299 = $3; $300 = (+_nk_textedit_get_width($295,$297,$298,$299)); $dx7 = $300; $301 = $dx7; $302 = $x5; $303 = $302 + $301; $x5 = $303; $304 = $x5; $305 = $goal_x6; $306 = $304 > $305; if ($306) { break; } $307 = $0; $308 = ((($307)) + 88|0); $309 = HEAP32[$308>>2]|0; $310 = (($309) + 1)|0; HEAP32[$308>>2] = $310; $311 = $i3; $312 = (($311) + 1)|0; $i3 = $312; } $313 = $0; _nk_textedit_clamp($313); $314 = $0; $315 = ((($314)) + 103|0); HEAP8[$315>>0] = 1; $316 = $goal_x6; $317 = $0; $318 = ((($317)) + 108|0); HEAPF32[$318>>2] = $316; $319 = $sel4; $320 = ($319|0)!=(0); if (!($320)) { STACKTOP = sp;return; } $321 = $0; $322 = ((($321)) + 88|0); $323 = HEAP32[$322>>2]|0; $324 = $0; $325 = ((($324)) + 96|0); HEAP32[$325>>2] = $323; STACKTOP = sp;return; break; } case 73: { $326 = $0; $327 = ((($326)) + 92|0); $328 = HEAP32[$327>>2]|0; $329 = $0; $330 = ((($329)) + 96|0); $331 = HEAP32[$330>>2]|0; $332 = ($328|0)!=($331|0); $333 = $0; if ($332) { _nk_textedit_delete_selection($333); } else { $334 = ((($333)) + 12|0); $335 = ((($334)) + 60|0); $336 = HEAP32[$335>>2]|0; $n = $336; $337 = $0; $338 = ((($337)) + 88|0); $339 = HEAP32[$338>>2]|0; $340 = $n; $341 = ($339|0)<($340|0); if ($341) { $342 = $0; $343 = $0; $344 = ((($343)) + 88|0); $345 = HEAP32[$344>>2]|0; _nk_textedit_delete($342,$345,1); } } $346 = $0; $347 = ((($346)) + 103|0); HEAP8[$347>>0] = 0; STACKTOP = sp;return; break; } case 78: { $348 = $0; $349 = ((($348)) + 92|0); $350 = HEAP32[$349>>2]|0; $351 = $0; $352 = ((($351)) + 96|0); $353 = HEAP32[$352>>2]|0; $354 = ($350|0)!=($353|0); $355 = $0; if ($354) { _nk_textedit_delete_selection($355); } else { _nk_textedit_clamp($355); $356 = $0; $357 = ((($356)) + 88|0); $358 = HEAP32[$357>>2]|0; $359 = ($358|0)>(0); if ($359) { $360 = $0; $361 = $0; $362 = ((($361)) + 88|0); $363 = HEAP32[$362>>2]|0; $364 = (($363) - 1)|0; _nk_textedit_delete($360,$364,1); $365 = $0; $366 = ((($365)) + 88|0); $367 = HEAP32[$366>>2]|0; $368 = (($367) + -1)|0; HEAP32[$366>>2] = $368; } } $369 = $0; $370 = ((($369)) + 103|0); HEAP8[$370>>0] = 0; STACKTOP = sp;return; break; } case 83: { $371 = $2; $372 = ($371|0)!=(0); $373 = $0; if ($372) { _nk_textedit_prep_selection_at_cursor($373); $374 = $0; $375 = ((($374)) + 96|0); HEAP32[$375>>2] = 0; $376 = $0; $377 = ((($376)) + 88|0); HEAP32[$377>>2] = 0; $378 = $0; $379 = ((($378)) + 103|0); HEAP8[$379>>0] = 0; STACKTOP = sp;return; } else { $380 = ((($373)) + 96|0); HEAP32[$380>>2] = 0; $381 = $0; $382 = ((($381)) + 92|0); HEAP32[$382>>2] = 0; $383 = $0; $384 = ((($383)) + 88|0); HEAP32[$384>>2] = 0; $385 = $0; $386 = ((($385)) + 103|0); HEAP8[$386>>0] = 0; STACKTOP = sp;return; } break; } case 86: { $387 = $2; $388 = ($387|0)!=(0); $389 = $0; if ($388) { _nk_textedit_prep_selection_at_cursor($389); $390 = $0; $391 = ((($390)) + 12|0); $392 = ((($391)) + 60|0); $393 = HEAP32[$392>>2]|0; $394 = $0; $395 = ((($394)) + 96|0); HEAP32[$395>>2] = $393; $396 = $0; $397 = ((($396)) + 88|0); HEAP32[$397>>2] = $393; $398 = $0; $399 = ((($398)) + 103|0); HEAP8[$399>>0] = 0; STACKTOP = sp;return; } else { $400 = ((($389)) + 12|0); $401 = ((($400)) + 60|0); $402 = HEAP32[$401>>2]|0; $403 = $0; $404 = ((($403)) + 88|0); HEAP32[$404>>2] = $402; $405 = $0; $406 = ((($405)) + 96|0); HEAP32[$406>>2] = 0; $407 = $0; $408 = ((($407)) + 92|0); HEAP32[$408>>2] = 0; $409 = $0; $410 = ((($409)) + 103|0); HEAP8[$410>>0] = 0; STACKTOP = sp;return; } break; } case 89: { $411 = $2; $412 = ($411|0)!=(0); $413 = $0; if ($412) { _nk_textedit_clamp($413); $414 = $0; _nk_textedit_prep_selection_at_cursor($414); $415 = $0; $416 = ((($415)) + 12|0); $417 = ((($416)) + 60|0); $418 = HEAP32[$417>>2]|0; $419 = ($418|0)!=(0); if ($419) { $420 = $0; $421 = ((($420)) + 88|0); $422 = HEAP32[$421>>2]|0; $423 = $0; $424 = ((($423)) + 12|0); $425 = ((($424)) + 60|0); $426 = HEAP32[$425>>2]|0; $427 = ($422|0)==($426|0); if ($427) { $428 = $0; $429 = ((($428)) + 88|0); $430 = HEAP32[$429>>2]|0; $431 = (($430) + -1)|0; HEAP32[$429>>2] = $431; } } $432 = $0; $433 = $0; $434 = ((($433)) + 88|0); $435 = HEAP32[$434>>2]|0; $436 = $0; $437 = ((($436)) + 104|0); $438 = HEAP8[$437>>0]|0; $439 = $438&255; $440 = $3; $441 = $4; _nk_textedit_find_charpos($find8,$432,$435,$439,$440,$441); $442 = ((($find8)) + 12|0); $443 = HEAP32[$442>>2]|0; $444 = $0; $445 = ((($444)) + 96|0); HEAP32[$445>>2] = $443; $446 = $0; $447 = ((($446)) + 88|0); HEAP32[$447>>2] = $443; $448 = $0; $449 = ((($448)) + 103|0); HEAP8[$449>>0] = 0; STACKTOP = sp;return; } else { $450 = ((($413)) + 12|0); $451 = ((($450)) + 60|0); $452 = HEAP32[$451>>2]|0; $453 = ($452|0)!=(0); if ($453) { $454 = $0; $455 = ((($454)) + 88|0); $456 = HEAP32[$455>>2]|0; $457 = $0; $458 = ((($457)) + 12|0); $459 = ((($458)) + 60|0); $460 = HEAP32[$459>>2]|0; $461 = ($456|0)==($460|0); if ($461) { $462 = $0; $463 = ((($462)) + 88|0); $464 = HEAP32[$463>>2]|0; $465 = (($464) + -1)|0; HEAP32[$463>>2] = $465; } } $466 = $0; _nk_textedit_clamp($466); $467 = $0; _nk_textedit_move_to_first($467); $468 = $0; $469 = $0; $470 = ((($469)) + 88|0); $471 = HEAP32[$470>>2]|0; $472 = $0; $473 = ((($472)) + 104|0); $474 = HEAP8[$473>>0]|0; $475 = $474&255; $476 = $3; $477 = $4; _nk_textedit_find_charpos($find9,$468,$471,$475,$476,$477); $478 = ((($find9)) + 12|0); $479 = HEAP32[$478>>2]|0; $480 = $0; $481 = ((($480)) + 88|0); HEAP32[$481>>2] = $479; $482 = $0; $483 = ((($482)) + 103|0); HEAP8[$483>>0] = 0; STACKTOP = sp;return; } break; } case 98: { $484 = $2; $485 = ($484|0)!=(0); $486 = $0; _nk_textedit_clamp($486); $487 = $0; if ($485) { _nk_textedit_prep_selection_at_cursor($487); $488 = $0; $489 = $0; $490 = ((($489)) + 88|0); $491 = HEAP32[$490>>2]|0; $492 = $0; $493 = ((($492)) + 104|0); $494 = HEAP8[$493>>0]|0; $495 = $494&255; $496 = $3; $497 = $4; _nk_textedit_find_charpos($find10,$488,$491,$495,$496,$497); $498 = $0; $499 = ((($498)) + 103|0); HEAP8[$499>>0] = 0; $500 = ((($find10)) + 12|0); $501 = HEAP32[$500>>2]|0; $502 = ((($find10)) + 16|0); $503 = HEAP32[$502>>2]|0; $504 = (($501) + ($503))|0; $505 = $0; $506 = ((($505)) + 88|0); HEAP32[$506>>2] = $504; $507 = ((($find10)) + 16|0); $508 = HEAP32[$507>>2]|0; $509 = ($508|0)>(0); if ($509) { $510 = $0; $511 = ((($510)) + 12|0); $512 = $0; $513 = ((($512)) + 88|0); $514 = HEAP32[$513>>2]|0; $515 = (($514) - 1)|0; $516 = (_nk_str_rune_at($511,$515)|0); $517 = ($516|0)==(10); if ($517) { $518 = $0; $519 = ((($518)) + 88|0); $520 = HEAP32[$519>>2]|0; $521 = (($520) + -1)|0; HEAP32[$519>>2] = $521; } } $522 = $0; $523 = ((($522)) + 88|0); $524 = HEAP32[$523>>2]|0; $525 = $0; $526 = ((($525)) + 96|0); HEAP32[$526>>2] = $524; STACKTOP = sp;return; } _nk_textedit_move_to_first($487); $527 = $0; $528 = $0; $529 = ((($528)) + 88|0); $530 = HEAP32[$529>>2]|0; $531 = $0; $532 = ((($531)) + 104|0); $533 = HEAP8[$532>>0]|0; $534 = $533&255; $535 = $3; $536 = $4; _nk_textedit_find_charpos($find11,$527,$530,$534,$535,$536); $537 = $0; $538 = ((($537)) + 103|0); HEAP8[$538>>0] = 0; $539 = ((($find11)) + 12|0); $540 = HEAP32[$539>>2]|0; $541 = ((($find11)) + 16|0); $542 = HEAP32[$541>>2]|0; $543 = (($540) + ($542))|0; $544 = $0; $545 = ((($544)) + 88|0); HEAP32[$545>>2] = $543; $546 = ((($find11)) + 16|0); $547 = HEAP32[$546>>2]|0; $548 = ($547|0)>(0); if (!($548)) { STACKTOP = sp;return; } $549 = $0; $550 = ((($549)) + 12|0); $551 = $0; $552 = ((($551)) + 88|0); $553 = HEAP32[$552>>2]|0; $554 = (($553) - 1)|0; $555 = (_nk_str_rune_at($550,$554)|0); $556 = ($555|0)==(10); if (!($556)) { STACKTOP = sp;return; } $557 = $0; $558 = ((($557)) + 88|0); $559 = HEAP32[$558>>2]|0; $560 = (($559) + -1)|0; HEAP32[$558>>2] = $560; STACKTOP = sp;return; break; } case 106: { STACKTOP = sp;return; break; } } } function _nk_text_calculate_text_bounds($agg$result,$font,$begin,$byte_len,$row_height,$remaining,$out_offset,$glyphs,$op) { $agg$result = $agg$result|0; $font = $font|0; $begin = $begin|0; $byte_len = $byte_len|0; $row_height = +$row_height; $remaining = $remaining|0; $out_offset = $out_offset|0; $glyphs = $glyphs|0; $op = $op|0; var $$byval_copy = 0, $$byval_copy4 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0, $113 = 0; var $114 = 0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0, $123 = 0.0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; var $132 = 0, $133 = 0, $134 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0; var $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0; var $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0; var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0; var $84 = 0, $85 = 0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0, $9 = 0.0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $glyph_len = 0, $glyph_width = 0.0, $line_height = 0.0; var $line_width = 0.0, $or$cond = 0, $or$cond$not = 0, $or$cond3 = 0, $text_len = 0, $text_size = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy4 = sp + 80|0; $$byval_copy = sp + 76|0; $text_size = sp + 32|0; $unicode = sp + 12|0; $8 = sp; $0 = $font; $1 = $begin; $2 = $byte_len; $3 = $row_height; $4 = $remaining; $5 = $out_offset; $6 = $glyphs; $7 = $op; $9 = $3; $line_height = $9; _nk_vec2($text_size,0.0,0.0); $line_width = 0.0; $glyph_len = 0; HEAP32[$unicode>>2] = 0; $text_len = 0; $10 = $1; $11 = ($10|0)==(0|0); $12 = $2; $13 = ($12|0)<=(0); $or$cond = $11 | $13; $or$cond$not = $or$cond ^ 1; $14 = $0; $15 = ($14|0)!=(0|0); $or$cond3 = $or$cond$not & $15; if (!($or$cond3)) { $16 = $3; _nk_vec2($agg$result,0.0,$16); STACKTOP = sp;return; } $17 = $1; $18 = $2; $19 = (_nk_utf_decode($17,$unicode,$18)|0); $glyph_len = $19; $20 = $glyph_len; $21 = ($20|0)!=(0); if (!($21)) { ;HEAP32[$agg$result>>2]=HEAP32[$text_size>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$text_size+4>>2]|0; STACKTOP = sp;return; } $22 = $0; $23 = ((($22)) + 8|0); $24 = HEAP32[$23>>2]|0; $25 = $0; $26 = $0; $27 = ((($26)) + 4|0); $28 = +HEAPF32[$27>>2]; $29 = $1; $30 = $glyph_len; ;HEAP32[$$byval_copy>>2]=HEAP32[$25>>2]|0; $31 = (+FUNCTION_TABLE_didii[$24 & 15]($$byval_copy,$28,$29,$30)); $glyph_width = $31; $32 = $6; HEAP32[$32>>2] = 0; while(1) { $33 = $text_len; $34 = $2; $35 = ($33|0)<($34|0); $36 = $glyph_len; $37 = ($36|0)!=(0); $38 = $35 ? $37 : 0; if (!($38)) { break; } $39 = HEAP32[$unicode>>2]|0; $40 = ($39|0)==(10); if ($40) { $41 = +HEAPF32[$text_size>>2]; $42 = $line_width; $43 = $41 < $42; $44 = $line_width; $45 = +HEAPF32[$text_size>>2]; $46 = $43 ? $44 : $45; HEAPF32[$text_size>>2] = $46; $47 = $line_height; $48 = ((($text_size)) + 4|0); $49 = +HEAPF32[$48>>2]; $50 = $49 + $47; HEAPF32[$48>>2] = $50; $line_width = 0.0; $51 = $6; $52 = HEAP32[$51>>2]|0; $53 = (($52) + 1)|0; HEAP32[$51>>2] = $53; $54 = $7; $55 = ($54|0)==(1); if ($55) { break; } $56 = $text_len; $57 = (($56) + 1)|0; $text_len = $57; $58 = $1; $59 = $text_len; $60 = (($58) + ($59)|0); $61 = $2; $62 = $text_len; $63 = (($61) - ($62))|0; $64 = (_nk_utf_decode($60,$unicode,$63)|0); $glyph_len = $64; continue; } $65 = HEAP32[$unicode>>2]|0; $66 = ($65|0)==(13); if ($66) { $67 = $text_len; $68 = (($67) + 1)|0; $text_len = $68; $69 = $6; $70 = HEAP32[$69>>2]|0; $71 = (($70) + 1)|0; HEAP32[$69>>2] = $71; $72 = $1; $73 = $text_len; $74 = (($72) + ($73)|0); $75 = $2; $76 = $text_len; $77 = (($75) - ($76))|0; $78 = (_nk_utf_decode($74,$unicode,$77)|0); $glyph_len = $78; continue; } else { $79 = $6; $80 = HEAP32[$79>>2]|0; $81 = (($80) + 1)|0; $82 = $6; HEAP32[$82>>2] = $81; $83 = $glyph_len; $84 = $text_len; $85 = (($84) + ($83))|0; $text_len = $85; $86 = $glyph_width; $87 = $line_width; $88 = $87 + $86; $line_width = $88; $89 = $0; $90 = ((($89)) + 8|0); $91 = HEAP32[$90>>2]|0; $92 = $0; $93 = $0; $94 = ((($93)) + 4|0); $95 = +HEAPF32[$94>>2]; $96 = $1; $97 = $text_len; $98 = (($96) + ($97)|0); $99 = $glyph_len; ;HEAP32[$$byval_copy4>>2]=HEAP32[$92>>2]|0; $100 = (+FUNCTION_TABLE_didii[$91 & 15]($$byval_copy4,$95,$98,$99)); $glyph_width = $100; $101 = $1; $102 = $text_len; $103 = (($101) + ($102)|0); $104 = $2; $105 = $text_len; $106 = (($104) - ($105))|0; $107 = (_nk_utf_decode($103,$unicode,$106)|0); $glyph_len = $107; continue; } } $108 = +HEAPF32[$text_size>>2]; $109 = $line_width; $110 = $108 < $109; if ($110) { $111 = $line_width; HEAPF32[$text_size>>2] = $111; } $112 = $5; $113 = ($112|0)!=(0|0); if ($113) { $114 = $5; $115 = $line_width; $116 = ((($text_size)) + 4|0); $117 = +HEAPF32[$116>>2]; $118 = $line_height; $119 = $117 + $118; _nk_vec2($8,$115,$119); ;HEAP32[$114>>2]=HEAP32[$8>>2]|0;HEAP32[$114+4>>2]=HEAP32[$8+4>>2]|0; } $120 = $line_width; $121 = $120 > 0.0; if ($121) { label = 19; } else { $122 = ((($text_size)) + 4|0); $123 = +HEAPF32[$122>>2]; $124 = $123 == 0.0; if ($124) { label = 19; } } if ((label|0) == 19) { $125 = $line_height; $126 = ((($text_size)) + 4|0); $127 = +HEAPF32[$126>>2]; $128 = $127 + $125; HEAPF32[$126>>2] = $128; } $129 = $4; $130 = ($129|0)!=(0|0); if ($130) { $131 = $1; $132 = $text_len; $133 = (($131) + ($132)|0); $134 = $4; HEAP32[$134>>2] = $133; } ;HEAP32[$agg$result>>2]=HEAP32[$text_size>>2]|0;HEAP32[$agg$result+4>>2]=HEAP32[$text_size+4>>2]|0; STACKTOP = sp;return; } function _nk_edit_draw_text($out,$style,$pos_x,$pos_y,$x_offset,$text,$byte_len,$row_height,$font,$background,$foreground,$is_selected) { $out = $out|0; $style = $style|0; $pos_x = +$pos_x; $pos_y = +$pos_y; $x_offset = +$x_offset; $text = $text|0; $byte_len = $byte_len|0; $row_height = +$row_height; $font = $font|0; $background = $background|0; $foreground = $foreground|0; $is_selected = $is_selected|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0; var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0; var $133 = 0.0, $134 = 0, $135 = 0.0, $136 = 0, $137 = 0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0; var $151 = 0, $152 = 0, $153 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0; var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0.0; var $5 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0; var $68 = 0, $69 = 0, $7 = 0.0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0, $83 = 0, $84 = 0, $85 = 0; var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $background$byval_copy = 0, $background$byval_copy7 = 0, $glyph_len = 0, $glyph_width = 0.0, $label = 0; var $label$byval_copy = 0, $label$byval_copy6 = 0, $label1 = 0, $label1$byval_copy = 0, $label1$byval_copy8 = 0, $line = 0, $line_count = 0, $line_offset = 0.0, $line_width = 0.0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $text_len = 0, $txt = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 208|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $label1$byval_copy8 = sp + 184|0; $background$byval_copy7 = sp + 204|0; $label1$byval_copy = sp + 168|0; $$byval_copy = sp + 160|0; $label$byval_copy6 = sp + 144|0; $background$byval_copy = sp + 200|0; $label$byval_copy = sp + 128|0; $unicode = sp + 80|0; $txt = sp + 40|0; $10 = sp + 32|0; $label = sp + 16|0; $label1 = sp; $0 = $out; $1 = $style; $2 = $pos_x; $3 = $pos_y; $4 = $x_offset; $5 = $text; $6 = $byte_len; $7 = $row_height; $8 = $font; $9 = $is_selected; $11 = $0; $12 = ($11|0)!=(0|0); if (!($12)) { ___assert_fail((31441|0),(13400|0),12699,(31769|0)); // unreachable; } $13 = $8; $14 = ($13|0)!=(0|0); if (!($14)) { ___assert_fail((14249|0),(13400|0),12700,(31769|0)); // unreachable; } $15 = $1; $16 = ($15|0)!=(0|0); if (!($16)) { ___assert_fail((31462|0),(13400|0),12701,(31769|0)); // unreachable; } $17 = $5; $18 = ($17|0)!=(0|0); $19 = $6; $20 = ($19|0)!=(0); $or$cond = $18 & $20; $21 = $0; $22 = ($21|0)!=(0|0); $or$cond3 = $or$cond & $22; $23 = $1; $24 = ($23|0)!=(0|0); $or$cond5 = $or$cond3 & $24; if (!($or$cond5)) { STACKTOP = sp;return; } $glyph_len = 0; HEAP32[$unicode>>2] = 0; $text_len = 0; $line_width = 0.0; $25 = $5; $line = $25; $line_offset = 0.0; $line_count = 0; _nk_vec2($10,0.0,0.0); ;HEAP32[$txt>>2]=HEAP32[$10>>2]|0;HEAP32[$txt+4>>2]=HEAP32[$10+4>>2]|0; $26 = ((($txt)) + 8|0); ;HEAP8[$26>>0]=HEAP8[$background>>0]|0;HEAP8[$26+1>>0]=HEAP8[$background+1>>0]|0;HEAP8[$26+2>>0]=HEAP8[$background+2>>0]|0;HEAP8[$26+3>>0]=HEAP8[$background+3>>0]|0; $27 = ((($txt)) + 12|0); ;HEAP8[$27>>0]=HEAP8[$foreground>>0]|0;HEAP8[$27+1>>0]=HEAP8[$foreground+1>>0]|0;HEAP8[$27+2>>0]=HEAP8[$foreground+2>>0]|0;HEAP8[$27+3>>0]=HEAP8[$foreground+3>>0]|0; $28 = $5; $29 = $text_len; $30 = (($28) + ($29)|0); $31 = $6; $32 = $text_len; $33 = (($31) - ($32))|0; $34 = (_nk_utf_decode($30,$unicode,$33)|0); $glyph_len = $34; $35 = $glyph_len; $36 = ($35|0)!=(0); if (!($36)) { STACKTOP = sp;return; } while(1) { $37 = $text_len; $38 = $6; $39 = ($37|0)<($38|0); $40 = $glyph_len; $41 = ($40|0)!=(0); $42 = $39 ? $41 : 0; if (!($42)) { break; } $43 = HEAP32[$unicode>>2]|0; $44 = ($43|0)==(10); if (!($44)) { $89 = HEAP32[$unicode>>2]|0; $90 = ($89|0)==(13); if ($90) { $91 = $text_len; $92 = (($91) + 1)|0; $text_len = $92; $93 = $5; $94 = $text_len; $95 = (($93) + ($94)|0); $96 = $6; $97 = $text_len; $98 = (($96) - ($97))|0; $99 = (_nk_utf_decode($95,$unicode,$98)|0); $glyph_len = $99; continue; } else { $100 = $8; $101 = ((($100)) + 8|0); $102 = HEAP32[$101>>2]|0; $103 = $8; $104 = $8; $105 = ((($104)) + 4|0); $106 = +HEAPF32[$105>>2]; $107 = $5; $108 = $text_len; $109 = (($107) + ($108)|0); $110 = $glyph_len; ;HEAP32[$$byval_copy>>2]=HEAP32[$103>>2]|0; $111 = (+FUNCTION_TABLE_didii[$102 & 15]($$byval_copy,$106,$109,$110)); $glyph_width = $111; $112 = $glyph_width; $113 = $line_width; $114 = $113 + $112; $line_width = $114; $115 = $glyph_len; $116 = $text_len; $117 = (($116) + ($115))|0; $text_len = $117; $118 = $5; $119 = $text_len; $120 = (($118) + ($119)|0); $121 = $6; $122 = $text_len; $123 = (($121) - ($122))|0; $124 = (_nk_utf_decode($120,$unicode,$123)|0); $glyph_len = $124; continue; } } $45 = $3; $46 = $line_offset; $47 = $45 + $46; $48 = ((($label)) + 4|0); HEAPF32[$48>>2] = $47; $49 = $7; $50 = ((($label)) + 12|0); HEAPF32[$50>>2] = $49; $51 = $line_width; $52 = ((($label)) + 8|0); HEAPF32[$52>>2] = $51; $53 = $2; HEAPF32[$label>>2] = $53; $54 = $line_count; $55 = ($54|0)!=(0); if (!($55)) { $56 = $4; $57 = +HEAPF32[$label>>2]; $58 = $57 + $56; HEAPF32[$label>>2] = $58; } $59 = $9; $60 = ($59|0)!=(0); if ($60) { $61 = $0; ;HEAP32[$label$byval_copy>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy+12>>2]=HEAP32[$label+12>>2]|0; ;HEAP8[$background$byval_copy>>0]=HEAP8[$background>>0]|0;HEAP8[$background$byval_copy+1>>0]=HEAP8[$background+1>>0]|0;HEAP8[$background$byval_copy+2>>0]=HEAP8[$background+2>>0]|0;HEAP8[$background$byval_copy+3>>0]=HEAP8[$background+3>>0]|0; _nk_fill_rect($61,$label$byval_copy,0.0,$background$byval_copy); } $62 = $0; $63 = $line; $64 = $5; $65 = $text_len; $66 = (($64) + ($65)|0); $67 = $line; $68 = $66; $69 = $67; $70 = (($68) - ($69))|0; $71 = $8; ;HEAP32[$label$byval_copy6>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy6+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy6+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy6+12>>2]=HEAP32[$label+12>>2]|0; _nk_widget_text($62,$label$byval_copy6,$63,$70,$txt,18,$71); $72 = $text_len; $73 = (($72) + 1)|0; $text_len = $73; $74 = $line_count; $75 = (($74) + 1)|0; $line_count = $75; $line_width = 0.0; $76 = $5; $77 = $text_len; $78 = (($76) + ($77)|0); $line = $78; $79 = $7; $80 = $line_offset; $81 = $80 + $79; $line_offset = $81; $82 = $5; $83 = $text_len; $84 = (($82) + ($83)|0); $85 = $6; $86 = $text_len; $87 = (($85) - ($86))|0; $88 = (_nk_utf_decode($84,$unicode,$87)|0); $glyph_len = $88; } $125 = $line_width; $126 = $125 > 0.0; if (!($126)) { STACKTOP = sp;return; } $127 = $3; $128 = $line_offset; $129 = $127 + $128; $130 = ((($label1)) + 4|0); HEAPF32[$130>>2] = $129; $131 = $7; $132 = ((($label1)) + 12|0); HEAPF32[$132>>2] = $131; $133 = $line_width; $134 = ((($label1)) + 8|0); HEAPF32[$134>>2] = $133; $135 = $2; HEAPF32[$label1>>2] = $135; $136 = $line_count; $137 = ($136|0)!=(0); if (!($137)) { $138 = $4; $139 = +HEAPF32[$label1>>2]; $140 = $139 + $138; HEAPF32[$label1>>2] = $140; } $141 = $9; $142 = ($141|0)!=(0); if ($142) { $143 = $0; ;HEAP32[$label1$byval_copy>>2]=HEAP32[$label1>>2]|0;HEAP32[$label1$byval_copy+4>>2]=HEAP32[$label1+4>>2]|0;HEAP32[$label1$byval_copy+8>>2]=HEAP32[$label1+8>>2]|0;HEAP32[$label1$byval_copy+12>>2]=HEAP32[$label1+12>>2]|0; ;HEAP8[$background$byval_copy7>>0]=HEAP8[$background>>0]|0;HEAP8[$background$byval_copy7+1>>0]=HEAP8[$background+1>>0]|0;HEAP8[$background$byval_copy7+2>>0]=HEAP8[$background+2>>0]|0;HEAP8[$background$byval_copy7+3>>0]=HEAP8[$background+3>>0]|0; _nk_fill_rect($143,$label1$byval_copy,0.0,$background$byval_copy7); } $144 = $0; $145 = $line; $146 = $5; $147 = $text_len; $148 = (($146) + ($147)|0); $149 = $line; $150 = $148; $151 = $149; $152 = (($150) - ($151))|0; $153 = $8; ;HEAP32[$label1$byval_copy8>>2]=HEAP32[$label1>>2]|0;HEAP32[$label1$byval_copy8+4>>2]=HEAP32[$label1+4>>2]|0;HEAP32[$label1$byval_copy8+8>>2]=HEAP32[$label1+8>>2]|0;HEAP32[$label1$byval_copy8+12>>2]=HEAP32[$label1+12>>2]|0; _nk_widget_text($144,$label1$byval_copy8,$145,$152,$txt,17,$153); STACKTOP = sp;return; } function _nk_textedit_locate_coord($edit,$x,$y,$font,$row_height) { $edit = $edit|0; $x = +$x; $y = +$y; $font = $font|0; $row_height = +$row_height; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0; var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0; var $59 = 0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0.0, $76 = 0.0; var $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0; var $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $base_y = 0.0, $i = 0, $k = 0, $n = 0, $prev_x = 0.0, $r = 0, $w = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $r = sp + 24|0; $1 = $edit; $2 = $x; $3 = $y; $4 = $font; $5 = $row_height; $6 = $1; $7 = ((($6)) + 12|0); $8 = ((($7)) + 60|0); $9 = HEAP32[$8>>2]|0; $n = $9; $base_y = 0.0; $i = 0; $10 = ((($r)) + 4|0); HEAPF32[$10>>2] = 0.0; HEAPF32[$r>>2] = 0.0; $11 = ((($r)) + 16|0); HEAPF32[$11>>2] = 0.0; $12 = ((($r)) + 12|0); HEAPF32[$12>>2] = 0.0; $13 = ((($r)) + 20|0); HEAP32[$13>>2] = 0; while(1) { $14 = $i; $15 = $n; $16 = ($14|0)<($15|0); if (!($16)) { label = 10; break; } $17 = $1; $18 = $i; $19 = $5; $20 = $4; _nk_textedit_layout_row($r,$17,$18,$19,$20); $21 = ((($r)) + 20|0); $22 = HEAP32[$21>>2]|0; $23 = ($22|0)<=(0); if ($23) { label = 4; break; } $25 = $i; $26 = ($25|0)==(0); if ($26) { $27 = $3; $28 = $base_y; $29 = ((($r)) + 12|0); $30 = +HEAPF32[$29>>2]; $31 = $28 + $30; $32 = $27 < $31; if ($32) { label = 7; break; } } $33 = $3; $34 = $base_y; $35 = ((($r)) + 16|0); $36 = +HEAPF32[$35>>2]; $37 = $34 + $36; $38 = $33 < $37; if ($38) { label = 10; break; } $39 = ((($r)) + 20|0); $40 = HEAP32[$39>>2]|0; $41 = $i; $42 = (($41) + ($40))|0; $i = $42; $43 = ((($r)) + 8|0); $44 = +HEAPF32[$43>>2]; $45 = $base_y; $46 = $45 + $44; $base_y = $46; } if ((label|0) == 4) { $24 = $n; $0 = $24; $104 = $0; STACKTOP = sp;return ($104|0); } else if ((label|0) == 7) { $0 = 0; $104 = $0; STACKTOP = sp;return ($104|0); } else if ((label|0) == 10) { $47 = $i; $48 = $n; $49 = ($47|0)>=($48|0); if ($49) { $50 = $n; $0 = $50; $104 = $0; STACKTOP = sp;return ($104|0); } $51 = $2; $52 = +HEAPF32[$r>>2]; $53 = $51 < $52; if ($53) { $54 = $i; $0 = $54; $104 = $0; STACKTOP = sp;return ($104|0); } $55 = $2; $56 = ((($r)) + 4|0); $57 = +HEAPF32[$56>>2]; $58 = $55 < $57; L19: do { if ($58) { $59 = $i; $k = $59; $60 = +HEAPF32[$r>>2]; $prev_x = $60; $i = 0; while(1) { $61 = $i; $62 = ((($r)) + 20|0); $63 = HEAP32[$62>>2]|0; $64 = ($61|0)<($63|0); if (!($64)) { break L19; } $65 = $1; $66 = $k; $67 = $i; $68 = $4; $69 = (+_nk_textedit_get_width($65,$66,$67,$68)); $w = $69; $70 = $2; $71 = $prev_x; $72 = $w; $73 = $71 + $72; $74 = $70 < $73; if ($74) { break; } $85 = $w; $86 = $prev_x; $87 = $86 + $85; $prev_x = $87; $88 = $i; $89 = (($88) + 1)|0; $i = $89; } $75 = $2; $76 = $prev_x; $77 = $w; $78 = $77 / 2.0; $79 = $76 + $78; $80 = $75 < $79; $81 = $k; $82 = $i; $83 = (($81) + ($82))|0; if ($80) { $0 = $83; $104 = $0; STACKTOP = sp;return ($104|0); } else { $84 = (($83) + 1)|0; $0 = $84; $104 = $0; STACKTOP = sp;return ($104|0); } } } while(0); $90 = $1; $91 = ((($90)) + 12|0); $92 = $i; $93 = ((($r)) + 20|0); $94 = HEAP32[$93>>2]|0; $95 = (($92) + ($94))|0; $96 = (($95) - 1)|0; $97 = (_nk_str_rune_at($91,$96)|0); $98 = ($97|0)==(10); $99 = $i; $100 = ((($r)) + 20|0); $101 = HEAP32[$100>>2]|0; $102 = (($99) + ($101))|0; if ($98) { $103 = (($102) - 1)|0; $0 = $103; $104 = $0; STACKTOP = sp;return ($104|0); } else { $0 = $102; $104 = $0; STACKTOP = sp;return ($104|0); } } return (0)|0; } function _nk_textedit_layout_row($r,$edit,$line_start_id,$row_height,$font) { $r = $r|0; $edit = $edit|0; $line_start_id = $line_start_id|0; $row_height = +$row_height; $font = $font|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $end = 0, $glyphs = 0, $l = 0, $len = 0, $remaining = 0, $size = 0, $text = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $l = sp + 32|0; $glyphs = sp + 28|0; $unicode = sp + 24|0; $remaining = sp + 20|0; $size = sp; $0 = $r; $1 = $edit; $2 = $line_start_id; $3 = $row_height; $4 = $font; HEAP32[$glyphs>>2] = 0; $5 = $1; $6 = ((($5)) + 12|0); $7 = (_nk_str_len_char($6)|0); $len = $7; $8 = $1; $9 = ((($8)) + 12|0); $10 = (_nk_str_get_const($9)|0); $11 = $len; $12 = (($10) + ($11)|0); $end = $12; $13 = $1; $14 = ((($13)) + 12|0); $15 = $2; $16 = (_nk_str_at_const($14,$15,$unicode,$l)|0); $text = $16; $17 = $4; $18 = $text; $19 = $end; $20 = $text; $21 = $19; $22 = $20; $23 = (($21) - ($22))|0; $24 = $3; _nk_text_calculate_text_bounds($size,$17,$18,$23,$24,$remaining,0,$glyphs,1); $25 = $0; HEAPF32[$25>>2] = 0.0; $26 = +HEAPF32[$size>>2]; $27 = $0; $28 = ((($27)) + 4|0); HEAPF32[$28>>2] = $26; $29 = ((($size)) + 4|0); $30 = +HEAPF32[$29>>2]; $31 = $0; $32 = ((($31)) + 8|0); HEAPF32[$32>>2] = $30; $33 = $0; $34 = ((($33)) + 12|0); HEAPF32[$34>>2] = 0.0; $35 = ((($size)) + 4|0); $36 = +HEAPF32[$35>>2]; $37 = $0; $38 = ((($37)) + 16|0); HEAPF32[$38>>2] = $36; $39 = HEAP32[$glyphs>>2]|0; $40 = $0; $41 = ((($40)) + 20|0); HEAP32[$41>>2] = $39; STACKTOP = sp;return; } function _nk_textedit_get_width($edit,$line_start,$char_id,$font) { $edit = $edit|0; $line_start = $line_start|0; $char_id = $char_id|0; $font = $font|0; var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, $len = 0, $str = 0, $unicode = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy = sp + 28|0; $len = sp + 8|0; $unicode = sp + 4|0; $0 = $edit; $1 = $line_start; $2 = $char_id; $3 = $font; HEAP32[$len>>2] = 0; HEAP32[$unicode>>2] = 0; $4 = $0; $5 = ((($4)) + 12|0); $6 = $1; $7 = $2; $8 = (($6) + ($7))|0; $9 = (_nk_str_at_const($5,$8,$unicode,$len)|0); $str = $9; $10 = $3; $11 = ((($10)) + 8|0); $12 = HEAP32[$11>>2]|0; $13 = $3; $14 = $3; $15 = ((($14)) + 4|0); $16 = +HEAPF32[$15>>2]; $17 = $str; $18 = HEAP32[$len>>2]|0; ;HEAP32[$$byval_copy>>2]=HEAP32[$13>>2]|0; $19 = (+FUNCTION_TABLE_didii[$12 & 15]($$byval_copy,$16,$17,$18)); STACKTOP = sp;return (+$19); } function _nk_textedit_prep_selection_at_cursor($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0; var sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 92|0); $3 = HEAP32[$2>>2]|0; $4 = $0; $5 = ((($4)) + 96|0); $6 = HEAP32[$5>>2]|0; $7 = ($3|0)!=($6|0); $8 = $0; if ($7) { $15 = ((($8)) + 96|0); $16 = HEAP32[$15>>2]|0; $17 = $0; $18 = ((($17)) + 88|0); HEAP32[$18>>2] = $16; STACKTOP = sp;return; } else { $9 = ((($8)) + 88|0); $10 = HEAP32[$9>>2]|0; $11 = $0; $12 = ((($11)) + 96|0); HEAP32[$12>>2] = $10; $13 = $0; $14 = ((($13)) + 92|0); HEAP32[$14>>2] = $10; STACKTOP = sp;return; } } function _nk_textedit_move_to_first($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 92|0); $3 = HEAP32[$2>>2]|0; $4 = $0; $5 = ((($4)) + 96|0); $6 = HEAP32[$5>>2]|0; $7 = ($3|0)!=($6|0); if (!($7)) { STACKTOP = sp;return; } $8 = $0; _nk_textedit_sortselection($8); $9 = $0; $10 = ((($9)) + 92|0); $11 = HEAP32[$10>>2]|0; $12 = $0; $13 = ((($12)) + 88|0); HEAP32[$13>>2] = $11; $14 = $0; $15 = ((($14)) + 92|0); $16 = HEAP32[$15>>2]|0; $17 = $0; $18 = ((($17)) + 96|0); HEAP32[$18>>2] = $16; $19 = $0; $20 = ((($19)) + 103|0); HEAP8[$20>>0] = 0; STACKTOP = sp;return; } function _nk_textedit_move_to_last($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 92|0); $3 = HEAP32[$2>>2]|0; $4 = $0; $5 = ((($4)) + 96|0); $6 = HEAP32[$5>>2]|0; $7 = ($3|0)!=($6|0); if (!($7)) { STACKTOP = sp;return; } $8 = $0; _nk_textedit_sortselection($8); $9 = $0; _nk_textedit_clamp($9); $10 = $0; $11 = ((($10)) + 96|0); $12 = HEAP32[$11>>2]|0; $13 = $0; $14 = ((($13)) + 88|0); HEAP32[$14>>2] = $12; $15 = $0; $16 = ((($15)) + 96|0); $17 = HEAP32[$16>>2]|0; $18 = $0; $19 = ((($18)) + 92|0); HEAP32[$19>>2] = $17; $20 = $0; $21 = ((($20)) + 103|0); HEAP8[$21>>0] = 0; STACKTOP = sp;return; } function _nk_textedit_move_to_word_previous($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 88|0); $3 = HEAP32[$2>>2]|0; $4 = (($3) - 1)|0; $c = $4; while(1) { $5 = $c; $6 = ($5|0)>=(0); if ($6) { $7 = $0; $8 = $c; $9 = (_nk_is_word_boundary($7,$8)|0); $10 = ($9|0)!=(0); $11 = $10 ^ 1; $16 = $11; } else { $16 = 0; } $12 = $c; if (!($16)) { break; } $13 = (($12) + -1)|0; $c = $13; } $14 = ($12|0)<(0); if (!($14)) { $15 = $c; STACKTOP = sp;return ($15|0); } $c = 0; $15 = $c; STACKTOP = sp;return ($15|0); } function _nk_textedit_move_to_word_next($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $len = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 12|0); $3 = ((($2)) + 60|0); $4 = HEAP32[$3>>2]|0; $len = $4; $5 = $0; $6 = ((($5)) + 88|0); $7 = HEAP32[$6>>2]|0; $8 = (($7) + 1)|0; $c = $8; while(1) { $9 = $c; $10 = $len; $11 = ($9|0)<($10|0); if ($11) { $12 = $0; $13 = $c; $14 = (_nk_is_word_boundary($12,$13)|0); $15 = ($14|0)!=(0); $16 = $15 ^ 1; $23 = $16; } else { $23 = 0; } $17 = $c; if (!($23)) { break; } $18 = (($17) + 1)|0; $c = $18; } $19 = $len; $20 = ($17|0)>($19|0); if (!($20)) { $22 = $c; STACKTOP = sp;return ($22|0); } $21 = $len; $c = $21; $22 = $c; STACKTOP = sp;return ($22|0); } function _nk_textedit_find_charpos($find,$state,$n,$single_line,$font,$row_height) { $find = $find|0; $state = $state|0; $n = $n|0; $single_line = $single_line|0; $font = $font|0; $row_height = +$row_height; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0.0, $113 = 0.0, $114 = 0, $115 = 0; var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0, $first = 0, $i = 0, $prev_start = 0, $r = 0; var $z = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $r = sp + 16|0; $0 = $find; $1 = $state; $2 = $n; $3 = $single_line; $4 = $font; $5 = $row_height; $prev_start = 0; $6 = $1; $7 = ((($6)) + 12|0); $8 = ((($7)) + 60|0); $9 = HEAP32[$8>>2]|0; $z = $9; $i = 0; $10 = $2; $11 = $z; $12 = ($10|0)==($11|0); if (!($12)) { $60 = $0; $61 = ((($60)) + 4|0); HEAPF32[$61>>2] = 0.0; while(1) { $62 = $1; $63 = $i; $64 = $5; $65 = $4; _nk_textedit_layout_row($r,$62,$63,$64,$65); $66 = $2; $67 = $i; $68 = ((($r)) + 20|0); $69 = HEAP32[$68>>2]|0; $70 = (($67) + ($69))|0; $71 = ($66|0)<($70|0); $72 = $i; if ($71) { break; } $prev_start = $72; $73 = ((($r)) + 20|0); $74 = HEAP32[$73>>2]|0; $75 = $i; $76 = (($75) + ($74))|0; $i = $76; $77 = ((($r)) + 8|0); $78 = +HEAPF32[$77>>2]; $79 = $0; $80 = ((($79)) + 4|0); $81 = +HEAPF32[$80>>2]; $82 = $81 + $78; HEAPF32[$80>>2] = $82; } $first = $72; $83 = $0; $84 = ((($83)) + 12|0); HEAP32[$84>>2] = $72; $85 = ((($r)) + 20|0); $86 = HEAP32[$85>>2]|0; $87 = $0; $88 = ((($87)) + 16|0); HEAP32[$88>>2] = $86; $89 = ((($r)) + 16|0); $90 = +HEAPF32[$89>>2]; $91 = ((($r)) + 12|0); $92 = +HEAPF32[$91>>2]; $93 = $90 - $92; $94 = $0; $95 = ((($94)) + 8|0); HEAPF32[$95>>2] = $93; $96 = $prev_start; $97 = $0; $98 = ((($97)) + 20|0); HEAP32[$98>>2] = $96; $99 = +HEAPF32[$r>>2]; $100 = $0; HEAPF32[$100>>2] = $99; $i = 0; while(1) { $101 = $first; $102 = $i; $103 = (($101) + ($102))|0; $104 = $2; $105 = ($103|0)<($104|0); if (!($105)) { break; } $106 = $1; $107 = $first; $108 = $i; $109 = $4; $110 = (+_nk_textedit_get_width($106,$107,$108,$109)); $111 = $0; $112 = +HEAPF32[$111>>2]; $113 = $112 + $110; HEAPF32[$111>>2] = $113; $114 = $i; $115 = (($114) + 1)|0; $i = $115; } STACKTOP = sp;return; } $13 = $3; $14 = ($13|0)!=(0); if ($14) { $15 = $1; $16 = $5; $17 = $4; _nk_textedit_layout_row($r,$15,0,$16,$17); $18 = $0; $19 = ((($18)) + 4|0); HEAPF32[$19>>2] = 0.0; $20 = $0; $21 = ((($20)) + 12|0); HEAP32[$21>>2] = 0; $22 = $z; $23 = $0; $24 = ((($23)) + 16|0); HEAP32[$24>>2] = $22; $25 = ((($r)) + 16|0); $26 = +HEAPF32[$25>>2]; $27 = ((($r)) + 12|0); $28 = +HEAPF32[$27>>2]; $29 = $26 - $28; $30 = $0; $31 = ((($30)) + 8|0); HEAPF32[$31>>2] = $29; $32 = ((($r)) + 4|0); $33 = +HEAPF32[$32>>2]; $34 = $0; HEAPF32[$34>>2] = $33; STACKTOP = sp;return; } $35 = $0; $36 = ((($35)) + 4|0); HEAPF32[$36>>2] = 0.0; $37 = $0; HEAPF32[$37>>2] = 0.0; $38 = $0; $39 = ((($38)) + 8|0); HEAPF32[$39>>2] = 1.0; while(1) { $40 = $i; $41 = $z; $42 = ($40|0)<($41|0); if (!($42)) { break; } $43 = $1; $44 = $i; $45 = $5; $46 = $4; _nk_textedit_layout_row($r,$43,$44,$45,$46); $47 = $i; $prev_start = $47; $48 = ((($r)) + 20|0); $49 = HEAP32[$48>>2]|0; $50 = $i; $51 = (($50) + ($49))|0; $i = $51; } $52 = $i; $53 = $0; $54 = ((($53)) + 12|0); HEAP32[$54>>2] = $52; $55 = $0; $56 = ((($55)) + 16|0); HEAP32[$56>>2] = 0; $57 = $prev_start; $58 = $0; $59 = ((($58)) + 20|0); HEAP32[$59>>2] = $57; STACKTOP = sp;return; } function _nk_textedit_sortselection($state) { $state = $state|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $temp = 0; var label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $state; $1 = $0; $2 = ((($1)) + 96|0); $3 = HEAP32[$2>>2]|0; $4 = $0; $5 = ((($4)) + 92|0); $6 = HEAP32[$5>>2]|0; $7 = ($3|0)<($6|0); if (!($7)) { STACKTOP = sp;return; } $8 = $0; $9 = ((($8)) + 96|0); $10 = HEAP32[$9>>2]|0; $temp = $10; $11 = $0; $12 = ((($11)) + 92|0); $13 = HEAP32[$12>>2]|0; $14 = $0; $15 = ((($14)) + 96|0); HEAP32[$15>>2] = $13; $16 = $temp; $17 = $0; $18 = ((($17)) + 92|0); HEAP32[$18>>2] = $16; STACKTOP = sp;return; } function _nk_is_word_boundary($state,$idx) { $state = $state|0; $idx = $idx|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $len = 0, $or$cond = 0; var $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond17 = 0, $or$cond19 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $len = sp + 4|0; $c = sp; $1 = $state; $2 = $idx; $3 = $2; $4 = ($3|0)<=(0); if ($4) { $0 = 1; $36 = $0; STACKTOP = sp;return ($36|0); } $5 = $1; $6 = ((($5)) + 12|0); $7 = $2; $8 = (_nk_str_at_rune($6,$7,$c,$len)|0); $9 = ($8|0)!=(0|0); if (!($9)) { $0 = 1; $36 = $0; STACKTOP = sp;return ($36|0); } $10 = HEAP32[$c>>2]|0; $11 = ($10|0)==(32); $12 = HEAP32[$c>>2]|0; $13 = ($12|0)==(9); $or$cond = $11 | $13; $14 = HEAP32[$c>>2]|0; $15 = ($14|0)==(12288); $or$cond3 = $or$cond | $15; $16 = HEAP32[$c>>2]|0; $17 = ($16|0)==(44); $or$cond5 = $or$cond3 | $17; $18 = HEAP32[$c>>2]|0; $19 = ($18|0)==(59); $or$cond7 = $or$cond5 | $19; $20 = HEAP32[$c>>2]|0; $21 = ($20|0)==(40); $or$cond9 = $or$cond7 | $21; $22 = HEAP32[$c>>2]|0; $23 = ($22|0)==(41); $or$cond11 = $or$cond9 | $23; $24 = HEAP32[$c>>2]|0; $25 = ($24|0)==(123); $or$cond13 = $or$cond11 | $25; $26 = HEAP32[$c>>2]|0; $27 = ($26|0)==(125); $or$cond15 = $or$cond13 | $27; $28 = HEAP32[$c>>2]|0; $29 = ($28|0)==(91); $or$cond17 = $or$cond15 | $29; $30 = HEAP32[$c>>2]|0; $31 = ($30|0)==(93); $or$cond19 = $or$cond17 | $31; if ($or$cond19) { $35 = 1; } else { $32 = HEAP32[$c>>2]|0; $33 = ($32|0)==(124); $35 = $33; } $34 = $35&1; $0 = $34; $36 = $0; STACKTOP = sp;return ($36|0); } function _nk_do_property($ws,$out,$property,$name,$min,$val,$max,$step,$inc_per_pixel,$buffer,$len,$state,$cursor,$style,$filter,$in,$font,$text_edit) { $ws = $ws|0; $out = $out|0; $property = $property|0; $name = $name|0; $min = +$min; $val = +$val; $max = +$max; $step = +$step; $inc_per_pixel = +$inc_per_pixel; $buffer = $buffer|0; $len = $len|0; $state = $state|0; $cursor = $cursor|0; $style = $style|0; $filter = $filter|0; $in = $in|0; $font = $font|0; $text_edit = $text_edit|0; var $$byval_copy = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0; var $111 = 0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0, $116 = 0, $117 = 0.0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0; var $13 = 0, $130 = 0, $131 = 0.0, $132 = 0, $133 = 0, $134 = 0.0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0, $141 = 0.0, $142 = 0.0, $143 = 0, $144 = 0.0, $145 = 0, $146 = 0, $147 = 0.0; var $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0, $164 = 0, $165 = 0; var $166 = 0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0, $171 = 0, $172 = 0.0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0.0, $180 = 0.0, $181 = 0, $182 = 0.0, $183 = 0.0; var $184 = 0, $185 = 0, $186 = 0.0, $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0.0, $192 = 0.0, $193 = 0.0, $194 = 0, $195 = 0.0, $196 = 0.0, $197 = 0.0, $198 = 0, $199 = 0, $2 = 0, $20 = 0.0, $200 = 0.0; var $201 = 0.0, $202 = 0.0, $203 = 0, $204 = 0.0, $205 = 0.0, $206 = 0.0, $207 = 0, $208 = 0.0, $209 = 0.0, $21 = 0.0, $210 = 0, $211 = 0.0, $212 = 0, $213 = 0, $214 = 0.0, $215 = 0.0, $216 = 0.0, $217 = 0, $218 = 0.0, $219 = 0; var $22 = 0.0, $220 = 0, $221 = 0.0, $222 = 0.0, $223 = 0, $224 = 0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0.0, $230 = 0.0, $231 = 0, $232 = 0.0, $233 = 0.0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0; var $238 = 0, $239 = 0.0, $24 = 0.0, $240 = 0, $241 = 0.0, $242 = 0.0, $243 = 0, $244 = 0.0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0; var $256 = 0.0, $257 = 0.0, $258 = 0.0, $259 = 0.0, $26 = 0.0, $260 = 0.0, $261 = 0.0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0.0, $270 = 0, $271 = 0, $272 = 0, $273 = 0; var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0; var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0.0, $30 = 0.0, $300 = 0.0, $301 = 0.0, $302 = 0.0, $303 = 0.0, $304 = 0, $305 = 0.0, $306 = 0.0, $307 = 0.0, $308 = 0.0, $309 = 0.0; var $31 = 0, $310 = 0, $311 = 0.0, $312 = 0.0, $313 = 0.0, $314 = 0.0, $315 = 0.0, $316 = 0.0, $317 = 0, $318 = 0.0, $319 = 0.0, $32 = 0.0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0; var $328 = 0, $329 = 0, $33 = 0.0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0.0, $335 = 0.0, $336 = 0.0, $337 = 0.0, $338 = 0, $339 = 0.0, $34 = 0.0, $340 = 0.0, $341 = 0.0, $342 = 0.0, $343 = 0.0, $344 = 0, $345 = 0.0; var $346 = 0.0, $347 = 0.0, $348 = 0.0, $349 = 0.0, $35 = 0.0, $350 = 0.0, $351 = 0, $352 = 0.0, $353 = 0.0, $354 = 0.0, $355 = 0.0, $356 = 0.0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0; var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0.0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0.0, $380 = 0, $381 = 0; var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0.0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0.0; var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0.0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0; var $418 = 0, $419 = 0, $42 = 0.0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0.0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0; var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0.0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0; var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0.0, $470 = 0, $471 = 0; var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0.0, $480 = 0.0, $481 = 0.0, $482 = 0, $483 = 0.0, $484 = 0.0, $485 = 0.0, $486 = 0.0, $487 = 0, $488 = 0.0, $489 = 0.0, $49 = 0; var $490 = 0.0, $491 = 0, $492 = 0.0, $493 = 0.0, $494 = 0.0, $495 = 0.0, $496 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0.0; var $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0, $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0.0; var $98 = 0, $99 = 0, $active = 0, $dst = 0, $edit = 0, $edit$byval_copy = 0, $edit$byval_copy8 = 0, $empty = 0, $empty$byval_copy = 0, $label = 0, $label$byval_copy = 0, $left = 0, $left$byval_copy = 0, $length = 0, $name_len = 0, $num_len = 0, $old = 0, $or$cond = 0, $or$cond3 = 0, $property$byval_copy = 0; var $property_max = 0.0, $property_min = 0.0, $property_value = 0, $right = 0, $right$byval_copy = 0, $size = 0.0, $string = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 384|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $edit$byval_copy8 = sp + 304|0; $right$byval_copy = sp + 288|0; $left$byval_copy = sp + 272|0; $$byval_copy7 = sp + 268|0; $$byval_copy6 = sp + 264|0; $empty$byval_copy = sp + 248|0; $edit$byval_copy = sp + 232|0; $label$byval_copy = sp + 216|0; $property$byval_copy = sp + 200|0; $$byval_copy5 = sp + 196|0; $$byval_copy4 = sp + 192|0; $$byval_copy = sp + 188|0; $num_len = sp + 108|0; $string = sp + 320|0; $property_value = sp + 88|0; $left = sp + 64|0; $right = sp + 48|0; $label = sp + 32|0; $edit = sp + 16|0; $empty = sp; $0 = $ws; $1 = $out; $2 = $name; $3 = $min; $4 = $val; $5 = $max; $6 = $step; $7 = $inc_per_pixel; $8 = $buffer; $9 = $len; $10 = $state; $11 = $cursor; $12 = $style; $13 = $filter; $14 = $in; $15 = $font; $16 = $text_edit; $dst = 0; $17 = $3; $18 = $5; $19 = $17 < $18; $20 = $5; $21 = $3; $22 = $19 ? $20 : $21; $property_max = $22; $23 = $3; $24 = $5; $25 = $23 < $24; $26 = $3; $27 = $5; $28 = $25 ? $26 : $27; $property_min = $28; $29 = $4; $30 = $property_max; $31 = $29 < $30; $32 = $4; $33 = $property_max; $34 = $31 ? $32 : $33; $35 = $property_min; $36 = $34 < $35; if ($36) { $37 = $property_min; $44 = $37; } else { $38 = $4; $39 = $property_max; $40 = $38 < $39; $41 = $4; $42 = $property_max; $43 = $40 ? $41 : $42; $44 = $43; } HEAPF32[$property_value>>2] = $44; $45 = $15; $46 = ((($45)) + 4|0); $47 = +HEAPF32[$46>>2]; $48 = $47 / 2.0; $49 = ((($left)) + 12|0); HEAPF32[$49>>2] = $48; $50 = ((($left)) + 12|0); $51 = +HEAPF32[$50>>2]; $52 = ((($left)) + 8|0); HEAPF32[$52>>2] = $51; $53 = +HEAPF32[$property>>2]; $54 = $12; $55 = ((($54)) + 84|0); $56 = +HEAPF32[$55>>2]; $57 = $53 + $56; $58 = $12; $59 = ((($58)) + 92|0); $60 = +HEAPF32[$59>>2]; $61 = $57 + $60; HEAPF32[$left>>2] = $61; $62 = ((($property)) + 4|0); $63 = +HEAPF32[$62>>2]; $64 = $12; $65 = ((($64)) + 84|0); $66 = +HEAPF32[$65>>2]; $67 = $63 + $66; $68 = ((($property)) + 12|0); $69 = +HEAPF32[$68>>2]; $70 = $69 / 2.0; $71 = $67 + $70; $72 = ((($left)) + 12|0); $73 = +HEAPF32[$72>>2]; $74 = $73 / 2.0; $75 = $71 - $74; $76 = ((($left)) + 4|0); HEAPF32[$76>>2] = $75; $77 = $2; $78 = (_nk_strlen($77)|0); $name_len = $78; $79 = $15; $80 = ((($79)) + 8|0); $81 = HEAP32[$80>>2]|0; $82 = $15; $83 = $15; $84 = ((($83)) + 4|0); $85 = +HEAPF32[$84>>2]; $86 = $2; $87 = $name_len; ;HEAP32[$$byval_copy>>2]=HEAP32[$82>>2]|0; $88 = (+FUNCTION_TABLE_didii[$81 & 15]($$byval_copy,$85,$86,$87)); $size = $88; $89 = +HEAPF32[$left>>2]; $90 = ((($left)) + 8|0); $91 = +HEAPF32[$90>>2]; $92 = $89 + $91; $93 = $12; $94 = ((($93)) + 92|0); $95 = +HEAPF32[$94>>2]; $96 = $92 + $95; HEAPF32[$label>>2] = $96; $97 = $size; $98 = $12; $99 = ((($98)) + 92|0); $100 = +HEAPF32[$99>>2]; $101 = 2.0 * $100; $102 = $97 + $101; $103 = ((($label)) + 8|0); HEAPF32[$103>>2] = $102; $104 = ((($property)) + 4|0); $105 = +HEAPF32[$104>>2]; $106 = $12; $107 = ((($106)) + 84|0); $108 = +HEAPF32[$107>>2]; $109 = $105 + $108; $110 = $12; $111 = ((($110)) + 92|0); $112 = ((($111)) + 4|0); $113 = +HEAPF32[$112>>2]; $114 = $109 + $113; $115 = ((($label)) + 4|0); HEAPF32[$115>>2] = $114; $116 = ((($property)) + 12|0); $117 = +HEAPF32[$116>>2]; $118 = $12; $119 = ((($118)) + 84|0); $120 = +HEAPF32[$119>>2]; $121 = 2.0 * $120; $122 = $12; $123 = ((($122)) + 92|0); $124 = ((($123)) + 4|0); $125 = +HEAPF32[$124>>2]; $126 = 2.0 * $125; $127 = $121 + $126; $128 = $117 - $127; $129 = ((($label)) + 12|0); HEAPF32[$129>>2] = $128; $130 = ((($left)) + 4|0); $131 = +HEAPF32[$130>>2]; $132 = ((($right)) + 4|0); HEAPF32[$132>>2] = $131; $133 = ((($left)) + 8|0); $134 = +HEAPF32[$133>>2]; $135 = ((($right)) + 8|0); HEAPF32[$135>>2] = $134; $136 = ((($left)) + 12|0); $137 = +HEAPF32[$136>>2]; $138 = ((($right)) + 12|0); HEAPF32[$138>>2] = $137; $139 = +HEAPF32[$property>>2]; $140 = ((($property)) + 8|0); $141 = +HEAPF32[$140>>2]; $142 = $139 + $141; $143 = ((($right)) + 8|0); $144 = +HEAPF32[$143>>2]; $145 = $12; $146 = ((($145)) + 92|0); $147 = +HEAPF32[$146>>2]; $148 = $144 + $147; $149 = $142 - $148; HEAPF32[$right>>2] = $149; $150 = $10; $151 = HEAP32[$150>>2]|0; $152 = ($151|0)==(1); if ($152) { $153 = $15; $154 = ((($153)) + 8|0); $155 = HEAP32[$154>>2]|0; $156 = $15; $157 = $15; $158 = ((($157)) + 4|0); $159 = +HEAPF32[$158>>2]; $160 = $8; $161 = $9; $162 = HEAP32[$161>>2]|0; ;HEAP32[$$byval_copy4>>2]=HEAP32[$156>>2]|0; $163 = (+FUNCTION_TABLE_didii[$155 & 15]($$byval_copy4,$159,$160,$162)); $size = $163; $164 = $12; $165 = ((($164)) + 100|0); $166 = ((($165)) + 548|0); $167 = +HEAPF32[$166>>2]; $168 = $size; $169 = $168 + $167; $size = $169; $170 = $9; $length = $170; $171 = $8; $dst = $171; } else { $172 = +HEAPF32[$property_value>>2]; (_nk_ftos($string,$172)|0); $173 = (_nk_string_float_limit($string,2)|0); HEAP32[$num_len>>2] = $173; $174 = $15; $175 = ((($174)) + 8|0); $176 = HEAP32[$175>>2]|0; $177 = $15; $178 = $15; $179 = ((($178)) + 4|0); $180 = +HEAPF32[$179>>2]; $181 = HEAP32[$num_len>>2]|0; ;HEAP32[$$byval_copy5>>2]=HEAP32[$177>>2]|0; $182 = (+FUNCTION_TABLE_didii[$176 & 15]($$byval_copy5,$180,$string,$181)); $size = $182; $dst = $string; $length = $num_len; } $183 = $size; $184 = $12; $185 = ((($184)) + 92|0); $186 = +HEAPF32[$185>>2]; $187 = 2.0 * $186; $188 = $183 + $187; $189 = ((($edit)) + 8|0); HEAPF32[$189>>2] = $188; $190 = ((($edit)) + 8|0); $191 = +HEAPF32[$190>>2]; $192 = +HEAPF32[$right>>2]; $193 = +HEAPF32[$label>>2]; $194 = ((($label)) + 8|0); $195 = +HEAPF32[$194>>2]; $196 = $193 + $195; $197 = $192 - $196; $198 = $191 < $197; if ($198) { $199 = ((($edit)) + 8|0); $200 = +HEAPF32[$199>>2]; $208 = $200; } else { $201 = +HEAPF32[$right>>2]; $202 = +HEAPF32[$label>>2]; $203 = ((($label)) + 8|0); $204 = +HEAPF32[$203>>2]; $205 = $202 + $204; $206 = $201 - $205; $208 = $206; } $207 = ((($edit)) + 8|0); HEAPF32[$207>>2] = $208; $209 = +HEAPF32[$right>>2]; $210 = ((($edit)) + 8|0); $211 = +HEAPF32[$210>>2]; $212 = $12; $213 = ((($212)) + 92|0); $214 = +HEAPF32[$213>>2]; $215 = $211 + $214; $216 = $209 - $215; HEAPF32[$edit>>2] = $216; $217 = ((($property)) + 4|0); $218 = +HEAPF32[$217>>2]; $219 = $12; $220 = ((($219)) + 84|0); $221 = +HEAPF32[$220>>2]; $222 = $218 + $221; $223 = ((($edit)) + 4|0); HEAPF32[$223>>2] = $222; $224 = ((($property)) + 12|0); $225 = +HEAPF32[$224>>2]; $226 = $12; $227 = ((($226)) + 84|0); $228 = +HEAPF32[$227>>2]; $229 = 2.0 * $228; $230 = $225 - $229; $231 = ((($edit)) + 12|0); HEAPF32[$231>>2] = $230; $232 = +HEAPF32[$edit>>2]; $233 = +HEAPF32[$label>>2]; $234 = ((($label)) + 8|0); $235 = +HEAPF32[$234>>2]; $236 = $233 + $235; $237 = $232 - $236; $238 = ((($empty)) + 8|0); HEAPF32[$238>>2] = $237; $239 = +HEAPF32[$label>>2]; $240 = ((($label)) + 8|0); $241 = +HEAPF32[$240>>2]; $242 = $239 + $241; HEAPF32[$empty>>2] = $242; $243 = ((($property)) + 4|0); $244 = +HEAPF32[$243>>2]; $245 = ((($empty)) + 4|0); HEAPF32[$245>>2] = $244; $246 = ((($property)) + 12|0); $247 = +HEAPF32[$246>>2]; $248 = ((($empty)) + 12|0); HEAPF32[$248>>2] = $247; $249 = $10; $250 = HEAP32[$249>>2]|0; $251 = ($250|0)==(1); $252 = $251&1; $old = $252; $253 = $0; $254 = $14; $255 = $10; $256 = $property_min; $257 = +HEAPF32[$property_value>>2]; $258 = $property_max; $259 = $6; $260 = $7; ;HEAP32[$property$byval_copy>>2]=HEAP32[$property>>2]|0;HEAP32[$property$byval_copy+4>>2]=HEAP32[$property+4>>2]|0;HEAP32[$property$byval_copy+8>>2]=HEAP32[$property+8>>2]|0;HEAP32[$property$byval_copy+12>>2]=HEAP32[$property+12>>2]|0; ;HEAP32[$label$byval_copy>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy+12>>2]=HEAP32[$label+12>>2]|0; ;HEAP32[$edit$byval_copy>>2]=HEAP32[$edit>>2]|0;HEAP32[$edit$byval_copy+4>>2]=HEAP32[$edit+4>>2]|0;HEAP32[$edit$byval_copy+8>>2]=HEAP32[$edit+8>>2]|0;HEAP32[$edit$byval_copy+12>>2]=HEAP32[$edit+12>>2]|0; ;HEAP32[$empty$byval_copy>>2]=HEAP32[$empty>>2]|0;HEAP32[$empty$byval_copy+4>>2]=HEAP32[$empty+4>>2]|0;HEAP32[$empty$byval_copy+8>>2]=HEAP32[$empty+8>>2]|0;HEAP32[$empty$byval_copy+12>>2]=HEAP32[$empty+12>>2]|0; $261 = (+_nk_property_behavior($253,$254,$property$byval_copy,$label$byval_copy,$edit$byval_copy,$empty$byval_copy,$255,$256,$257,$258,$259,$260)); HEAPF32[$property_value>>2] = $261; $262 = $12; $263 = ((($262)) + 932|0); $264 = HEAP32[$263>>2]|0; $265 = ($264|0)!=(0|0); if ($265) { $266 = $12; $267 = ((($266)) + 932|0); $268 = HEAP32[$267>>2]|0; $269 = $1; $270 = $12; $271 = ((($270)) + 928|0); ;HEAP32[$$byval_copy6>>2]=HEAP32[$271>>2]|0; FUNCTION_TABLE_vii[$268 & 31]($269,$$byval_copy6); } $272 = $1; $273 = $12; $274 = $0; $275 = HEAP32[$274>>2]|0; $276 = $2; $277 = $name_len; $278 = $15; _nk_draw_property($272,$273,$property,$label,$275,$276,$277,$278); $279 = $12; $280 = ((($279)) + 936|0); $281 = HEAP32[$280>>2]|0; $282 = ($281|0)!=(0|0); if ($282) { $283 = $12; $284 = ((($283)) + 936|0); $285 = HEAP32[$284>>2]|0; $286 = $1; $287 = $12; $288 = ((($287)) + 928|0); ;HEAP32[$$byval_copy7>>2]=HEAP32[$288>>2]|0; FUNCTION_TABLE_vii[$285 & 31]($286,$$byval_copy7); } $289 = $0; $290 = $1; $291 = $12; $292 = ((($291)) + 76|0); $293 = HEAP32[$292>>2]|0; $294 = $12; $295 = ((($294)) + 800|0); $296 = $14; $297 = $15; ;HEAP32[$left$byval_copy>>2]=HEAP32[$left>>2]|0;HEAP32[$left$byval_copy+4>>2]=HEAP32[$left+4>>2]|0;HEAP32[$left$byval_copy+8>>2]=HEAP32[$left+8>>2]|0;HEAP32[$left$byval_copy+12>>2]=HEAP32[$left+12>>2]|0; $298 = (_nk_do_button_symbol($289,$290,$left$byval_copy,$293,0,$295,$296,$297)|0); $299 = ($298|0)!=(0); if ($299) { $300 = +HEAPF32[$property_value>>2]; $301 = $6; $302 = $300 - $301; $303 = $5; $304 = $302 < $303; if ($304) { $305 = +HEAPF32[$property_value>>2]; $306 = $6; $307 = $305 - $306; $311 = $307; } else { $308 = $5; $311 = $308; } $309 = $3; $310 = $311 < $309; do { if ($310) { $312 = $3; $322 = $312; } else { $313 = +HEAPF32[$property_value>>2]; $314 = $6; $315 = $313 - $314; $316 = $5; $317 = $315 < $316; if ($317) { $318 = +HEAPF32[$property_value>>2]; $319 = $6; $320 = $318 - $319; $322 = $320; break; } else { $321 = $5; $322 = $321; break; } } } while(0); HEAPF32[$property_value>>2] = $322; } $323 = $0; $324 = $1; $325 = $12; $326 = ((($325)) + 80|0); $327 = HEAP32[$326>>2]|0; $328 = $12; $329 = ((($328)) + 672|0); $330 = $14; $331 = $15; ;HEAP32[$right$byval_copy>>2]=HEAP32[$right>>2]|0;HEAP32[$right$byval_copy+4>>2]=HEAP32[$right+4>>2]|0;HEAP32[$right$byval_copy+8>>2]=HEAP32[$right+8>>2]|0;HEAP32[$right$byval_copy+12>>2]=HEAP32[$right+12>>2]|0; $332 = (_nk_do_button_symbol($323,$324,$right$byval_copy,$327,0,$329,$330,$331)|0); $333 = ($332|0)!=(0); if ($333) { $334 = +HEAPF32[$property_value>>2]; $335 = $6; $336 = $334 + $335; $337 = $5; $338 = $336 < $337; if ($338) { $339 = +HEAPF32[$property_value>>2]; $340 = $6; $341 = $339 + $340; $345 = $341; } else { $342 = $5; $345 = $342; } $343 = $3; $344 = $345 < $343; do { if ($344) { $346 = $3; $356 = $346; } else { $347 = +HEAPF32[$property_value>>2]; $348 = $6; $349 = $347 + $348; $350 = $5; $351 = $349 < $350; if ($351) { $352 = +HEAPF32[$property_value>>2]; $353 = $6; $354 = $352 + $353; $356 = $354; break; } else { $355 = $5; $356 = $355; break; } } } while(0); HEAPF32[$property_value>>2] = $356; } $357 = $10; $358 = HEAP32[$357>>2]|0; $359 = ($358|0)==(1); $360 = $359&1; $active = $360; $361 = $old; $362 = ($361|0)!=(1); $363 = $active; $364 = ($363|0)!=(0); $or$cond = $362 & $364; if ($or$cond) { $365 = $8; $366 = $dst; $367 = $length; $368 = HEAP32[$367>>2]|0; (_nk_memcopy($365,$366,$368)|0); $369 = $8; $370 = $length; $371 = HEAP32[$370>>2]|0; $372 = (_nk_utf_len($369,$371)|0); $373 = $11; HEAP32[$373>>2] = $372; $374 = $length; $375 = HEAP32[$374>>2]|0; $376 = $9; HEAP32[$376>>2] = $375; $377 = $9; $length = $377; $378 = $8; $dst = $378; } $379 = $16; $380 = $13; $381 = (12608 + ($380<<2)|0); $382 = HEAP32[$381>>2]|0; _nk_textedit_clear_state($379,0,$382); $383 = $active; $384 = $383&255; $385 = $16; $386 = ((($385)) + 105|0); HEAP8[$386>>0] = $384; $387 = $length; $388 = HEAP32[$387>>2]|0; $389 = $16; $390 = ((($389)) + 12|0); $391 = ((($390)) + 60|0); HEAP32[$391>>2] = $388; $392 = $11; $393 = HEAP32[$392>>2]|0; $394 = $length; $395 = HEAP32[$394>>2]|0; $396 = ($393|0)<($395|0); if ($396) { $397 = $11; $398 = HEAP32[$397>>2]|0; $401 = $398; } else { $399 = $length; $400 = HEAP32[$399>>2]|0; $401 = $400; } $402 = ($401|0)<(0); do { if ($402) { $414 = 0; } else { $403 = $11; $404 = HEAP32[$403>>2]|0; $405 = $length; $406 = HEAP32[$405>>2]|0; $407 = ($404|0)<($406|0); if ($407) { $408 = $11; $409 = HEAP32[$408>>2]|0; $414 = $409; break; } else { $410 = $length; $411 = HEAP32[$410>>2]|0; $414 = $411; break; } } } while(0); $412 = $16; $413 = ((($412)) + 88|0); HEAP32[$413>>2] = $414; $415 = $length; $416 = HEAP32[$415>>2]|0; $417 = $16; $418 = ((($417)) + 12|0); $419 = ((($418)) + 44|0); HEAP32[$419>>2] = $416; $420 = $16; $421 = ((($420)) + 12|0); $422 = ((($421)) + 32|0); $423 = ((($422)) + 4|0); HEAP32[$423>>2] = 64; $424 = $dst; $425 = $16; $426 = ((($425)) + 12|0); $427 = ((($426)) + 32|0); HEAP32[$427>>2] = $424; $428 = $16; $429 = ((($428)) + 12|0); $430 = ((($429)) + 56|0); HEAP32[$430>>2] = 64; $431 = $16; $432 = ((($431)) + 100|0); HEAP8[$432>>0] = 1; $433 = $0; $434 = $1; $435 = $13; $436 = (12608 + ($435<<2)|0); $437 = HEAP32[$436>>2]|0; $438 = $16; $439 = $12; $440 = ((($439)) + 100|0); $441 = $10; $442 = HEAP32[$441>>2]|0; $443 = ($442|0)==(1); $444 = $14; $445 = $443 ? $444 : 0; $446 = $15; ;HEAP32[$edit$byval_copy8>>2]=HEAP32[$edit>>2]|0;HEAP32[$edit$byval_copy8+4>>2]=HEAP32[$edit+4>>2]|0;HEAP32[$edit$byval_copy8+8>>2]=HEAP32[$edit+8>>2]|0;HEAP32[$edit$byval_copy8+12>>2]=HEAP32[$edit+12>>2]|0; (_nk_do_edit($433,$434,$edit$byval_copy8,512,$437,$438,$440,$445,$446)|0); $447 = $16; $448 = ((($447)) + 12|0); $449 = ((($448)) + 60|0); $450 = HEAP32[$449>>2]|0; $451 = $length; HEAP32[$451>>2] = $450; $452 = $16; $453 = ((($452)) + 105|0); $454 = HEAP8[$453>>0]|0; $455 = $454&255; $active = $455; $456 = $16; $457 = ((($456)) + 88|0); $458 = HEAP32[$457>>2]|0; $459 = $11; HEAP32[$459>>2] = $458; $460 = $active; $461 = ($460|0)!=(0); if ($461) { $462 = $14; $463 = (_nk_input_is_key_pressed($462,4)|0); $464 = ($463|0)!=(0); if ($464) { $465 = $active; $466 = ($465|0)!=(0); $467 = $466 ^ 1; $468 = $467&1; $active = $468; } } $469 = $old; $470 = ($469|0)==(0); $471 = $active; $472 = ($471|0)!=(0); $or$cond3 = $470 | $472; if ($or$cond3) { $496 = +HEAPF32[$property_value>>2]; STACKTOP = sp;return (+$496); } $473 = $10; HEAP32[$473>>2] = 0; $474 = $9; $475 = HEAP32[$474>>2]|0; $476 = $8; $477 = (($476) + ($475)|0); HEAP8[$477>>0] = 0; $478 = $8; (_nk_string_float_limit($478,2)|0); $479 = $8; (_nk_strtof($property_value,$479)|0); $480 = +HEAPF32[$property_value>>2]; $481 = $5; $482 = $480 < $481; $483 = +HEAPF32[$property_value>>2]; $484 = $5; $485 = $482 ? $483 : $484; $486 = $3; $487 = $485 < $486; if ($487) { $488 = $3; $495 = $488; } else { $489 = +HEAPF32[$property_value>>2]; $490 = $5; $491 = $489 < $490; $492 = +HEAPF32[$property_value>>2]; $493 = $5; $494 = $491 ? $492 : $493; $495 = $494; } HEAPF32[$property_value>>2] = $495; $496 = +HEAPF32[$property_value>>2]; STACKTOP = sp;return (+$496); } function _nk_ftos($s,$n) { $s = $s|0; $n = +$n; var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0, $150 = 0, $151 = 0; var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0.0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0; var $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0; var $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0.0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c = 0, $digit = 0, $i = 0, $j = 0, $m = 0, $m1 = 0, $neg = 0, $or$cond = 0, $or$cond3 = 0, $t = 0.0, $useExp = 0, $weight = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $1 = $s; $2 = $n; $useExp = 0; $digit = 0; $m = 0; $m1 = 0; $3 = $1; $c = $3; $neg = 0; $4 = $2; $5 = $4 == 0.0; if ($5) { $6 = $1; HEAP8[$6>>0] = 48; $7 = $1; $8 = ((($7)) + 1|0); HEAP8[$8>>0] = 0; $0 = 1; $163 = $0; STACKTOP = sp;return ($163|0); } $9 = $2; $10 = $9 < 0.0; $11 = $10&1; $neg = $11; $12 = $neg; $13 = ($12|0)!=(0); if ($13) { $14 = $2; $15 = -$14; $2 = $15; } $16 = $2; $17 = (_nk_log10($16)|0); $m = $17; $18 = $m; $19 = ($18|0)>=(14); if ($19) { $27 = 1; } else { $20 = $neg; $21 = ($20|0)!=(0); $22 = $m; $23 = ($22|0)>=(9); $or$cond = $21 & $23; if ($or$cond) { $27 = 1; } else { $24 = $m; $25 = ($24|0)<=(-9); $27 = $25; } } $26 = $27&1; $useExp = $26; $28 = $neg; $29 = ($28|0)!=(0); if ($29) { $30 = $c; $31 = ((($30)) + 1|0); $c = $31; HEAP8[$30>>0] = 45; } $32 = $useExp; $33 = ($32|0)!=(0); if ($33) { $34 = $m; $35 = ($34|0)<(0); if ($35) { $36 = $m; $37 = (($36) - 1)|0; $m = $37; } $38 = $2; $39 = $m; $40 = (+_nk_pow(10.0,$39)); $41 = $38 / $40; $2 = $41; $42 = $m; $m1 = $42; $m = 0; } $43 = $m; $44 = (+($43|0)); $45 = $44 < 1.0; if ($45) { $m = 0; } while(1) { $46 = $2; $47 = $46 > 9.9999998245167004E-15; $48 = $m; $49 = ($48|0)>=(0); $50 = $47 ? 1 : $49; if (!($50)) { break; } $51 = $m; $52 = (+_nk_pow(10.0,$51)); $weight = $52; $53 = $weight; $54 = $53 > 0.0; if ($54) { $55 = $2; $56 = $weight; $57 = $55 / $56; $t = $57; $58 = $t; $59 = (_nk_ifloor($58)|0); $digit = $59; $60 = $digit; $61 = (+($60|0)); $62 = $weight; $63 = $61 * $62; $64 = $2; $65 = $64 - $63; $2 = $65; $66 = $digit; $67 = $66&255; $68 = $67 << 24 >> 24; $69 = (48 + ($68))|0; $70 = $69&255; $71 = $c; $72 = ((($71)) + 1|0); $c = $72; HEAP8[$71>>0] = $70; } $73 = $m; $74 = ($73|0)==(0); $75 = $2; $76 = $75 > 0.0; $or$cond3 = $74 & $76; if ($or$cond3) { $77 = $c; $78 = ((($77)) + 1|0); $c = $78; HEAP8[$77>>0] = 46; } $79 = $m; $80 = (($79) + -1)|0; $m = $80; } $81 = $useExp; $82 = ($81|0)!=(0); if ($82) { $83 = $c; $84 = ((($83)) + 1|0); $c = $84; HEAP8[$83>>0] = 101; $85 = $m1; $86 = ($85|0)>(0); $87 = $c; $88 = ((($87)) + 1|0); $c = $88; if ($86) { HEAP8[$87>>0] = 43; } else { HEAP8[$87>>0] = 45; $89 = $m1; $90 = (0 - ($89))|0; $m1 = $90; } $m = 0; while(1) { $91 = $m1; $92 = ($91|0)>(0); if (!($92)) { break; } $93 = $m1; $94 = (($93|0) % 10)&-1; $95 = $94&255; $96 = $95 << 24 >> 24; $97 = (48 + ($96))|0; $98 = $97&255; $99 = $c; $100 = ((($99)) + 1|0); $c = $100; HEAP8[$99>>0] = $98; $101 = $m1; $102 = (($101|0) / 10)&-1; $m1 = $102; $103 = $m; $104 = (($103) + 1)|0; $m = $104; } $105 = $m; $106 = $c; $107 = (0 - ($105))|0; $108 = (($106) + ($107)|0); $c = $108; $i = 0; $109 = $m; $110 = (($109) - 1)|0; $j = $110; while(1) { $111 = $i; $112 = $j; $113 = ($111|0)<($112|0); if (!($113)) { break; } $114 = $j; $115 = $c; $116 = (($115) + ($114)|0); $117 = HEAP8[$116>>0]|0; $118 = $117 << 24 >> 24; $119 = $i; $120 = $c; $121 = (($120) + ($119)|0); $122 = HEAP8[$121>>0]|0; $123 = $122 << 24 >> 24; $124 = $123 ^ $118; $125 = $124&255; HEAP8[$121>>0] = $125; $126 = $i; $127 = $c; $128 = (($127) + ($126)|0); $129 = HEAP8[$128>>0]|0; $130 = $129 << 24 >> 24; $131 = $j; $132 = $c; $133 = (($132) + ($131)|0); $134 = HEAP8[$133>>0]|0; $135 = $134 << 24 >> 24; $136 = $135 ^ $130; $137 = $136&255; HEAP8[$133>>0] = $137; $138 = $j; $139 = $c; $140 = (($139) + ($138)|0); $141 = HEAP8[$140>>0]|0; $142 = $141 << 24 >> 24; $143 = $i; $144 = $c; $145 = (($144) + ($143)|0); $146 = HEAP8[$145>>0]|0; $147 = $146 << 24 >> 24; $148 = $147 ^ $142; $149 = $148&255; HEAP8[$145>>0] = $149; $150 = $i; $151 = (($150) + 1)|0; $i = $151; $152 = $j; $153 = (($152) + -1)|0; $j = $153; } $154 = $m; $155 = $c; $156 = (($155) + ($154)|0); $c = $156; } $157 = $c; HEAP8[$157>>0] = 0; $158 = $c; $159 = $1; $160 = $158; $161 = $159; $162 = (($160) - ($161))|0; $0 = $162; $163 = $0; STACKTOP = sp;return ($163|0); } function _nk_string_float_limit($string,$prec) { $string = $string|0; $prec = $prec|0; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $dot = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $string; $1 = $prec; $dot = 0; $2 = $0; $c = $2; while(1) { $3 = $c; $4 = HEAP8[$3>>0]|0; $5 = ($4<<24>>24)!=(0); if (!($5)) { label = 10; break; } $6 = $c; $7 = HEAP8[$6>>0]|0; $8 = $7 << 24 >> 24; $9 = ($8|0)==(46); if ($9) { $dot = 1; $10 = $c; $11 = ((($10)) + 1|0); $c = $11; continue; } $12 = $dot; $13 = $1; $14 = (($13) + 1)|0; $15 = ($12|0)==($14|0); if ($15) { break; } $17 = $dot; $18 = ($17|0)>(0); if ($18) { $19 = $dot; $20 = (($19) + 1)|0; $dot = $20; } $21 = $c; $22 = ((($21)) + 1|0); $c = $22; } if ((label|0) == 10) { $23 = $c; $24 = $0; $25 = $23; $26 = $24; $27 = (($25) - ($26))|0; STACKTOP = sp;return ($27|0); } $16 = $c; HEAP8[$16>>0] = 0; $23 = $c; $24 = $0; $25 = $23; $26 = $24; $27 = (($25) - ($26))|0; STACKTOP = sp;return ($27|0); } function _nk_property_behavior($ws,$in,$property,$label,$edit,$empty,$state,$min,$value,$max,$step,$inc_per_pixel) { $ws = $ws|0; $in = $in|0; $property = $property|0; $label = $label|0; $edit = $edit|0; $empty = $empty|0; $state = $state|0; $min = +$min; $value = +$value; $max = +$max; $step = +$step; $inc_per_pixel = +$inc_per_pixel; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0; var $8 = 0, $9 = 0, $edit$byval_copy = 0, $empty$byval_copy = 0, $label$byval_copy = 0, $property$byval_copy = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $property$byval_copy = sp + 80|0; $empty$byval_copy = sp + 64|0; $label$byval_copy = sp + 48|0; $edit$byval_copy = sp + 32|0; $0 = $ws; $1 = $in; $2 = $state; $3 = $min; $4 = $value; $5 = $max; $6 = $step; $7 = $inc_per_pixel; $8 = $1; $9 = ($8|0)!=(0|0); do { if ($9) { $10 = $2; $11 = HEAP32[$10>>2]|0; $12 = ($11|0)==(0); if ($12) { $13 = $0; $14 = $1; ;HEAP32[$edit$byval_copy>>2]=HEAP32[$edit>>2]|0;HEAP32[$edit$byval_copy+4>>2]=HEAP32[$edit+4>>2]|0;HEAP32[$edit$byval_copy+8>>2]=HEAP32[$edit+8>>2]|0;HEAP32[$edit$byval_copy+12>>2]=HEAP32[$edit+12>>2]|0; $15 = (_nk_button_behavior($13,$edit$byval_copy,$14,0)|0); $16 = ($15|0)!=(0); if ($16) { $17 = $2; HEAP32[$17>>2] = 1; break; } $18 = $1; ;HEAP32[$label$byval_copy>>2]=HEAP32[$label>>2]|0;HEAP32[$label$byval_copy+4>>2]=HEAP32[$label+4>>2]|0;HEAP32[$label$byval_copy+8>>2]=HEAP32[$label+8>>2]|0;HEAP32[$label$byval_copy+12>>2]=HEAP32[$label+12>>2]|0; $19 = (_nk_input_is_mouse_click_down_in_rect($18,0,$label$byval_copy,1)|0); $20 = ($19|0)!=(0); if ($20) { $21 = $2; HEAP32[$21>>2] = 2; break; } $22 = $1; ;HEAP32[$empty$byval_copy>>2]=HEAP32[$empty>>2]|0;HEAP32[$empty$byval_copy+4>>2]=HEAP32[$empty+4>>2]|0;HEAP32[$empty$byval_copy+8>>2]=HEAP32[$empty+8>>2]|0;HEAP32[$empty$byval_copy+12>>2]=HEAP32[$empty+12>>2]|0; $23 = (_nk_input_is_mouse_click_down_in_rect($22,0,$empty$byval_copy,1)|0); $24 = ($23|0)!=(0); if ($24) { $25 = $2; HEAP32[$25>>2] = 2; } } } } while(0); $26 = $2; $27 = HEAP32[$26>>2]|0; $28 = ($27|0)==(2); if (!($28)) { $41 = $4; STACKTOP = sp;return (+$41); } $29 = $0; $30 = $1; $31 = $3; $32 = $4; $33 = $5; $34 = $7; ;HEAP32[$property$byval_copy>>2]=HEAP32[$property>>2]|0;HEAP32[$property$byval_copy+4>>2]=HEAP32[$property+4>>2]|0;HEAP32[$property$byval_copy+8>>2]=HEAP32[$property+8>>2]|0;HEAP32[$property$byval_copy+12>>2]=HEAP32[$property+12>>2]|0; $35 = (+_nk_drag_behavior($29,$30,$property$byval_copy,$31,$32,$33,$34)); $4 = $35; $36 = $0; $37 = HEAP32[$36>>2]|0; $38 = $37 & 32; $39 = ($38|0)!=(0); if ($39) { $41 = $4; STACKTOP = sp;return (+$41); } $40 = $2; HEAP32[$40>>2] = 0; $41 = $4; STACKTOP = sp;return (+$41); } function _nk_draw_property($out,$style,$bounds,$label,$state,$name,$len,$font) { $out = $out|0; $style = $style|0; $bounds = $bounds|0; $label = $label|0; $state = $state|0; $name = $name|0; $len = $len|0; $font = $font|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0; var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $7 = 0, $8 = 0, $9 = 0, $background = 0, $text = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 176|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 144|0; $$byval_copy5 = sp + 168|0; $$byval_copy4 = sp + 128|0; $$byval_copy3 = sp + 112|0; $$byval_copy2 = sp + 164|0; $$byval_copy1 = sp + 96|0; $$byval_copy = sp + 80|0; $text = sp + 32|0; $8 = sp + 160|0; $9 = sp + 8|0; $10 = sp; $0 = $out; $1 = $style; $2 = $bounds; $3 = $label; $4 = $state; $5 = $name; $6 = $len; $7 = $font; $11 = $4; $12 = $11 & 32; $13 = ($12|0)!=(0); do { if ($13) { $14 = $1; $15 = ((($14)) + 40|0); $background = $15; $16 = ((($text)) + 12|0); $17 = $1; $18 = ((($17)) + 72|0); ;HEAP8[$16>>0]=HEAP8[$18>>0]|0;HEAP8[$16+1>>0]=HEAP8[$18+1>>0]|0;HEAP8[$16+2>>0]=HEAP8[$18+2>>0]|0;HEAP8[$16+3>>0]=HEAP8[$18+3>>0]|0; } else { $19 = $4; $20 = $19 & 16; $21 = ($20|0)!=(0); $22 = $1; if ($21) { $23 = ((($22)) + 20|0); $background = $23; $24 = ((($text)) + 12|0); $25 = $1; $26 = ((($25)) + 68|0); ;HEAP8[$24>>0]=HEAP8[$26>>0]|0;HEAP8[$24+1>>0]=HEAP8[$26+1>>0]|0;HEAP8[$24+2>>0]=HEAP8[$26+2>>0]|0;HEAP8[$24+3>>0]=HEAP8[$26+3>>0]|0; break; } else { $background = $22; $27 = ((($text)) + 12|0); $28 = $1; $29 = ((($28)) + 64|0); ;HEAP8[$27>>0]=HEAP8[$29>>0]|0;HEAP8[$27+1>>0]=HEAP8[$29+1>>0]|0;HEAP8[$27+2>>0]=HEAP8[$29+2>>0]|0;HEAP8[$27+3>>0]=HEAP8[$29+3>>0]|0; break; } } } while(0); $30 = $background; $31 = HEAP32[$30>>2]|0; $32 = ($31|0)==(1); if ($32) { $33 = $0; $34 = $2; $35 = $background; $36 = ((($35)) + 4|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$34>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$34+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$34+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$34+12>>2]|0; _nk_draw_image($33,$$byval_copy,$36); $37 = ((($text)) + 8|0); _nk_rgba($8,0,0,0,0); ;HEAP8[$37>>0]=HEAP8[$8>>0]|0;HEAP8[$37+1>>0]=HEAP8[$8+1>>0]|0;HEAP8[$37+2>>0]=HEAP8[$8+2>>0]|0;HEAP8[$37+3>>0]=HEAP8[$8+3>>0]|0; _nk_vec2($10,0.0,0.0); ;HEAP32[$text>>2]=HEAP32[$10>>2]|0;HEAP32[$text+4>>2]=HEAP32[$10+4>>2]|0; $58 = $0; $59 = $3; $60 = $5; $61 = $6; $62 = $7; ;HEAP32[$$byval_copy6>>2]=HEAP32[$59>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$59+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$59+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$59+12>>2]|0; _nk_widget_text($58,$$byval_copy6,$60,$61,$text,18,$62); STACKTOP = sp;return; } else { $38 = ((($text)) + 8|0); $39 = $background; $40 = ((($39)) + 4|0); ;HEAP8[$38>>0]=HEAP8[$40>>0]|0;HEAP8[$38+1>>0]=HEAP8[$40+1>>0]|0;HEAP8[$38+2>>0]=HEAP8[$40+2>>0]|0;HEAP8[$38+3>>0]=HEAP8[$40+3>>0]|0; $41 = $0; $42 = $2; $43 = $1; $44 = ((($43)) + 88|0); $45 = +HEAPF32[$44>>2]; $46 = $1; $47 = ((($46)) + 60|0); ;HEAP32[$$byval_copy1>>2]=HEAP32[$42>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$42+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$42+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$42+12>>2]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$47>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$47+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$47+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$47+3>>0]|0; _nk_fill_rect($41,$$byval_copy1,$45,$$byval_copy2); $48 = $0; $49 = $2; $50 = $1; $51 = ((($50)) + 84|0); $52 = +HEAPF32[$51>>2]; ;HEAP32[$$byval_copy3>>2]=HEAP32[$49>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$49+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$49+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$49+12>>2]|0; _nk_shrink_rect($9,$$byval_copy3,$52); $53 = $1; $54 = ((($53)) + 88|0); $55 = +HEAPF32[$54>>2]; $56 = $background; $57 = ((($56)) + 4|0); ;HEAP32[$$byval_copy4>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$9+12>>2]|0; ;HEAP8[$$byval_copy5>>0]=HEAP8[$57>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$57+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$57+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$57+3>>0]|0; _nk_fill_rect($48,$$byval_copy4,$55,$$byval_copy5); _nk_vec2($10,0.0,0.0); ;HEAP32[$text>>2]=HEAP32[$10>>2]|0;HEAP32[$text+4>>2]=HEAP32[$10+4>>2]|0; $58 = $0; $59 = $3; $60 = $5; $61 = $6; $62 = $7; ;HEAP32[$$byval_copy6>>2]=HEAP32[$59>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$59+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$59+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$59+12>>2]|0; _nk_widget_text($58,$$byval_copy6,$60,$61,$text,18,$62); STACKTOP = sp;return; } } function _nk_log10($n) { $n = +$n; var $$sink = 0.0, $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0; var $8 = 0, $9 = 0, $exp = 0, $neg = 0, $ret = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $n; $exp = 0; $1 = $0; $2 = $1 < 0.0; $3 = $2 ? 1 : 0; $neg = $3; $4 = $neg; $5 = ($4|0)!=(0); $6 = $0; $7 = -$6; $$sink = $5 ? $7 : $6; $8 = (~~(($$sink))); $ret = $8; while(1) { $9 = $ret; $10 = (($9|0) / 10)&-1; $11 = ($10|0)>(0); if (!($11)) { break; } $12 = $ret; $13 = (($12|0) / 10)&-1; $ret = $13; $14 = $exp; $15 = (($14) + 1)|0; $exp = $15; } $16 = $neg; $17 = ($16|0)!=(0); if (!($17)) { $20 = $exp; STACKTOP = sp;return ($20|0); } $18 = $exp; $19 = (0 - ($18))|0; $exp = $19; $20 = $exp; STACKTOP = sp;return ($20|0); } function _nk_pow($x,$n) { $x = +$x; $n = $n|0; var $0 = 0.0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0.0; var $27 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $plus = 0, $r = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $0 = $x; $1 = $n; $r = 1.0; $2 = $1; $3 = ($2|0)>=(0); $4 = $3&1; $plus = $4; $5 = $plus; $6 = ($5|0)!=(0); $7 = $1; $8 = (0 - ($7))|0; $9 = $6 ? $7 : $8; $1 = $9; while(1) { $10 = $1; $11 = ($10|0)>(0); if (!($11)) { break; } $12 = $1; $13 = $12 & 1; $14 = ($13|0)==(1); if ($14) { $15 = $0; $16 = $r; $17 = $16 * $15; $r = $17; } $18 = $1; $19 = (($18|0) / 2)&-1; $1 = $19; $20 = $0; $21 = $0; $22 = $21 * $20; $0 = $22; } $23 = $plus; $24 = ($23|0)!=(0); $25 = $r; $26 = 1.0 / $25; $27 = $24 ? $25 : $26; STACKTOP = sp;return (+$27); } function _nk_drag_behavior($state,$in,$drag,$min,$val,$max,$inc_per_pixel) { $state = $state|0; $in = $in|0; $drag = $drag|0; $min = +$min; $val = +$val; $max = +$max; $inc_per_pixel = +$inc_per_pixel; var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0.0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0; var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $8 = 0, $9 = 0, $delta = 0.0, $drag$byval_copy = 0; var $drag$byval_copy2 = 0, $drag$byval_copy3 = 0, $drag$byval_copy4 = 0, $left_mouse_click_in_cursor = 0, $left_mouse_down = 0, $or$cond = 0, $pixels = 0.0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $drag$byval_copy4 = sp + 88|0; $drag$byval_copy3 = sp + 72|0; $drag$byval_copy2 = sp + 56|0; $drag$byval_copy = sp + 40|0; $0 = $state; $1 = $in; $2 = $min; $3 = $val; $4 = $max; $5 = $inc_per_pixel; $6 = $1; $7 = ($6|0)!=(0|0); if ($7) { $8 = $1; $9 = ((($8)) + 220|0); $10 = HEAP32[$9>>2]|0; $11 = ($10|0)!=(0); $13 = $11; } else { $13 = 0; } $12 = $13&1; $left_mouse_down = $12; $14 = $1; $15 = ($14|0)!=(0|0); if ($15) { $16 = $1; ;HEAP32[$drag$byval_copy>>2]=HEAP32[$drag>>2]|0;HEAP32[$drag$byval_copy+4>>2]=HEAP32[$drag+4>>2]|0;HEAP32[$drag$byval_copy+8>>2]=HEAP32[$drag+8>>2]|0;HEAP32[$drag$byval_copy+12>>2]=HEAP32[$drag+12>>2]|0; $17 = (_nk_input_has_mouse_click_down_in_rect($16,0,$drag$byval_copy,1)|0); $18 = ($17|0)!=(0); $20 = $18; } else { $20 = 0; } $19 = $20&1; $left_mouse_click_in_cursor = $19; $21 = $0; $22 = HEAP32[$21>>2]|0; $23 = $22 & 2; $24 = ($23|0)!=(0); $25 = $0; if ($24) { HEAP32[$25>>2] = 6; } else { HEAP32[$25>>2] = 4; } $26 = $1; ;HEAP32[$drag$byval_copy2>>2]=HEAP32[$drag>>2]|0;HEAP32[$drag$byval_copy2+4>>2]=HEAP32[$drag+4>>2]|0;HEAP32[$drag$byval_copy2+8>>2]=HEAP32[$drag+8>>2]|0;HEAP32[$drag$byval_copy2+12>>2]=HEAP32[$drag+12>>2]|0; $27 = (_nk_input_is_mouse_hovering_rect($26,$drag$byval_copy2)|0); $28 = ($27|0)!=(0); if ($28) { $29 = $0; HEAP32[$29>>2] = 18; } $30 = $left_mouse_down; $31 = ($30|0)!=(0); $32 = $left_mouse_click_in_cursor; $33 = ($32|0)!=(0); $or$cond = $31 & $33; if ($or$cond) { $34 = $1; $35 = ((($34)) + 220|0); $36 = ((($35)) + 64|0); $37 = +HEAPF32[$36>>2]; $pixels = $37; $38 = $pixels; $39 = $5; $40 = $38 * $39; $delta = $40; $41 = $delta; $42 = $3; $43 = $42 + $41; $3 = $43; $44 = $3; $45 = $4; $46 = $44 < $45; $47 = $3; $48 = $4; $49 = $46 ? $47 : $48; $50 = $2; $51 = $49 < $50; if ($51) { $52 = $2; $59 = $52; } else { $53 = $3; $54 = $4; $55 = $53 < $54; $56 = $3; $57 = $4; $58 = $55 ? $56 : $57; $59 = $58; } $3 = $59; $60 = $0; HEAP32[$60>>2] = 34; } $61 = $0; $62 = HEAP32[$61>>2]|0; $63 = $62 & 16; $64 = ($63|0)!=(0); if ($64) { $65 = $1; ;HEAP32[$drag$byval_copy3>>2]=HEAP32[$drag>>2]|0;HEAP32[$drag$byval_copy3+4>>2]=HEAP32[$drag+4>>2]|0;HEAP32[$drag$byval_copy3+8>>2]=HEAP32[$drag+8>>2]|0;HEAP32[$drag$byval_copy3+12>>2]=HEAP32[$drag+12>>2]|0; $66 = (_nk_input_is_mouse_prev_hovering_rect($65,$drag$byval_copy3)|0); $67 = ($66|0)!=(0); if (!($67)) { $68 = $0; $69 = HEAP32[$68>>2]|0; $70 = $69 | 8; HEAP32[$68>>2] = $70; $77 = $3; STACKTOP = sp;return (+$77); } } $71 = $1; ;HEAP32[$drag$byval_copy4>>2]=HEAP32[$drag>>2]|0;HEAP32[$drag$byval_copy4+4>>2]=HEAP32[$drag+4>>2]|0;HEAP32[$drag$byval_copy4+8>>2]=HEAP32[$drag+8>>2]|0;HEAP32[$drag$byval_copy4+12>>2]=HEAP32[$drag+12>>2]|0; $72 = (_nk_input_is_mouse_prev_hovering_rect($71,$drag$byval_copy4)|0); $73 = ($72|0)!=(0); if (!($73)) { $77 = $3; STACKTOP = sp;return (+$77); } $74 = $0; $75 = HEAP32[$74>>2]|0; $76 = $75 | 64; HEAP32[$74>>2] = $76; $77 = $3; STACKTOP = sp;return (+$77); } function _nk_color_picker_behavior($state,$bounds,$matrix,$hue_bar,$alpha_bar,$color,$in) { $state = $state|0; $bounds = $bounds|0; $matrix = $matrix|0; $hue_bar = $hue_bar|0; $alpha_bar = $alpha_bar|0; $color = $color|0; $in = $in|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0; var $11 = 0, $110 = 0, $111 = 0.0, $112 = 0, $113 = 0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0.0, $127 = 0; var $128 = 0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0; var $146 = 0, $147 = 0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0, $151 = 0.0, $152 = 0.0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0.0; var $164 = 0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0, $169 = 0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0, $174 = 0.0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0, $181 = 0; var $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0, $186 = 0.0, $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0.0, $195 = 0, $196 = 0, $197 = 0.0, $198 = 0.0, $199 = 0, $2 = 0; var $20 = 0, $200 = 0, $201 = 0.0, $202 = 0.0, $203 = 0.0, $204 = 0.0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0.0, $217 = 0; var $218 = 0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0.0, $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0.0, $235 = 0.0; var $236 = 0, $237 = 0, $238 = 0.0, $239 = 0.0, $24 = 0, $240 = 0.0, $241 = 0, $242 = 0.0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0.0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0.0, $251 = 0.0, $252 = 0, $253 = 0; var $254 = 0.0, $255 = 0.0, $256 = 0.0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0.0, $263 = 0, $264 = 0, $265 = 0.0, $266 = 0.0, $267 = 0, $268 = 0, $269 = 0.0, $27 = 0.0, $270 = 0.0, $271 = 0.0; var $272 = 0.0, $273 = 0.0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0.0, $288 = 0.0, $289 = 0, $29 = 0; var $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0; var $308 = 0, $309 = 0, $31 = 0.0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0; var $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0; var $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0.0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0; var $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0.0; var $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $hsv_changed = 0, $hsva = 0, $value_changed = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 160|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy6 = sp + 136|0; $$byval_copy5 = sp + 120|0; $$byval_copy4 = sp + 104|0; $$byval_copy3 = sp + 88|0; $$byval_copy2 = sp + 72|0; $$byval_copy1 = sp + 56|0; $$byval_copy = sp + 156|0; $hsva = sp + 8|0; $7 = sp + 152|0; $0 = $state; $1 = $bounds; $2 = $matrix; $3 = $hue_bar; $4 = $alpha_bar; $5 = $color; $6 = $in; $value_changed = 0; $hsv_changed = 0; $8 = $0; $9 = ($8|0)!=(0|0); if (!($9)) { ___assert_fail((28059|0),(13400|0),13522,(31818|0)); // unreachable; } $10 = $2; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((31843|0),(13400|0),13523,(31818|0)); // unreachable; } $12 = $3; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((31850|0),(13400|0),13524,(31818|0)); // unreachable; } $14 = $5; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((28666|0),(13400|0),13525,(31818|0)); // unreachable; } $16 = $5; ;HEAP8[$$byval_copy>>0]=HEAP8[$16>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$16+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$16+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$16+3>>0]|0; _nk_color_hsva_fv($hsva,$$byval_copy); $17 = $0; $18 = $2; $19 = $6; ;HEAP32[$$byval_copy1>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$18+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$18+12>>2]|0; $20 = (_nk_button_behavior($17,$$byval_copy1,$19,1)|0); $21 = ($20|0)!=(0); if ($21) { $22 = $6; $23 = ((($22)) + 220|0); $24 = ((($23)) + 48|0); $25 = +HEAPF32[$24>>2]; $26 = $2; $27 = +HEAPF32[$26>>2]; $28 = $25 - $27; $29 = $2; $30 = ((($29)) + 8|0); $31 = +HEAPF32[$30>>2]; $32 = $31 - 1.0; $33 = $28 / $32; $34 = 1.0 < $33; if ($34) { $48 = 1.0; } else { $35 = $6; $36 = ((($35)) + 220|0); $37 = ((($36)) + 48|0); $38 = +HEAPF32[$37>>2]; $39 = $2; $40 = +HEAPF32[$39>>2]; $41 = $38 - $40; $42 = $2; $43 = ((($42)) + 8|0); $44 = +HEAPF32[$43>>2]; $45 = $44 - 1.0; $46 = $41 / $45; $48 = $46; } $47 = 0.0 < $48; if ($47) { $49 = $6; $50 = ((($49)) + 220|0); $51 = ((($50)) + 48|0); $52 = +HEAPF32[$51>>2]; $53 = $2; $54 = +HEAPF32[$53>>2]; $55 = $52 - $54; $56 = $2; $57 = ((($56)) + 8|0); $58 = +HEAPF32[$57>>2]; $59 = $58 - 1.0; $60 = $55 / $59; $61 = 1.0 < $60; if ($61) { $75 = 1.0; } else { $62 = $6; $63 = ((($62)) + 220|0); $64 = ((($63)) + 48|0); $65 = +HEAPF32[$64>>2]; $66 = $2; $67 = +HEAPF32[$66>>2]; $68 = $65 - $67; $69 = $2; $70 = ((($69)) + 8|0); $71 = +HEAPF32[$70>>2]; $72 = $71 - 1.0; $73 = $68 / $72; $75 = $73; } } else { $75 = 0.0; } $74 = ((($hsva)) + 4|0); HEAPF32[$74>>2] = $75; $76 = $6; $77 = ((($76)) + 220|0); $78 = ((($77)) + 48|0); $79 = ((($78)) + 4|0); $80 = +HEAPF32[$79>>2]; $81 = $2; $82 = ((($81)) + 4|0); $83 = +HEAPF32[$82>>2]; $84 = $80 - $83; $85 = $2; $86 = ((($85)) + 12|0); $87 = +HEAPF32[$86>>2]; $88 = $87 - 1.0; $89 = $84 / $88; $90 = 1.0 < $89; if ($90) { $106 = 1.0; } else { $91 = $6; $92 = ((($91)) + 220|0); $93 = ((($92)) + 48|0); $94 = ((($93)) + 4|0); $95 = +HEAPF32[$94>>2]; $96 = $2; $97 = ((($96)) + 4|0); $98 = +HEAPF32[$97>>2]; $99 = $95 - $98; $100 = $2; $101 = ((($100)) + 12|0); $102 = +HEAPF32[$101>>2]; $103 = $102 - 1.0; $104 = $99 / $103; $106 = $104; } $105 = 0.0 < $106; if ($105) { $107 = $6; $108 = ((($107)) + 220|0); $109 = ((($108)) + 48|0); $110 = ((($109)) + 4|0); $111 = +HEAPF32[$110>>2]; $112 = $2; $113 = ((($112)) + 4|0); $114 = +HEAPF32[$113>>2]; $115 = $111 - $114; $116 = $2; $117 = ((($116)) + 12|0); $118 = +HEAPF32[$117>>2]; $119 = $118 - 1.0; $120 = $115 / $119; $121 = 1.0 < $120; if ($121) { $137 = 1.0; } else { $122 = $6; $123 = ((($122)) + 220|0); $124 = ((($123)) + 48|0); $125 = ((($124)) + 4|0); $126 = +HEAPF32[$125>>2]; $127 = $2; $128 = ((($127)) + 4|0); $129 = +HEAPF32[$128>>2]; $130 = $126 - $129; $131 = $2; $132 = ((($131)) + 12|0); $133 = +HEAPF32[$132>>2]; $134 = $133 - 1.0; $135 = $130 / $134; $137 = $135; } } else { $137 = 0.0; } $136 = 1.0 - $137; $138 = ((($hsva)) + 8|0); HEAPF32[$138>>2] = $136; $hsv_changed = 1; $value_changed = 1; } $139 = $0; $140 = $3; $141 = $6; ;HEAP32[$$byval_copy2>>2]=HEAP32[$140>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$140+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$140+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$140+12>>2]|0; $142 = (_nk_button_behavior($139,$$byval_copy2,$141,1)|0); $143 = ($142|0)!=(0); if ($143) { $144 = $6; $145 = ((($144)) + 220|0); $146 = ((($145)) + 48|0); $147 = ((($146)) + 4|0); $148 = +HEAPF32[$147>>2]; $149 = $3; $150 = ((($149)) + 4|0); $151 = +HEAPF32[$150>>2]; $152 = $148 - $151; $153 = $3; $154 = ((($153)) + 12|0); $155 = +HEAPF32[$154>>2]; $156 = $155 - 1.0; $157 = $152 / $156; $158 = 1.0 < $157; if ($158) { $174 = 1.0; } else { $159 = $6; $160 = ((($159)) + 220|0); $161 = ((($160)) + 48|0); $162 = ((($161)) + 4|0); $163 = +HEAPF32[$162>>2]; $164 = $3; $165 = ((($164)) + 4|0); $166 = +HEAPF32[$165>>2]; $167 = $163 - $166; $168 = $3; $169 = ((($168)) + 12|0); $170 = +HEAPF32[$169>>2]; $171 = $170 - 1.0; $172 = $167 / $171; $174 = $172; } $173 = 0.0 < $174; if ($173) { $175 = $6; $176 = ((($175)) + 220|0); $177 = ((($176)) + 48|0); $178 = ((($177)) + 4|0); $179 = +HEAPF32[$178>>2]; $180 = $3; $181 = ((($180)) + 4|0); $182 = +HEAPF32[$181>>2]; $183 = $179 - $182; $184 = $3; $185 = ((($184)) + 12|0); $186 = +HEAPF32[$185>>2]; $187 = $186 - 1.0; $188 = $183 / $187; $189 = 1.0 < $188; if ($189) { $204 = 1.0; } else { $190 = $6; $191 = ((($190)) + 220|0); $192 = ((($191)) + 48|0); $193 = ((($192)) + 4|0); $194 = +HEAPF32[$193>>2]; $195 = $3; $196 = ((($195)) + 4|0); $197 = +HEAPF32[$196>>2]; $198 = $194 - $197; $199 = $3; $200 = ((($199)) + 12|0); $201 = +HEAPF32[$200>>2]; $202 = $201 - 1.0; $203 = $198 / $202; $204 = $203; } } else { $204 = 0.0; } HEAPF32[$hsva>>2] = $204; $hsv_changed = 1; $value_changed = 1; } $205 = $4; $206 = ($205|0)!=(0|0); if ($206) { $207 = $0; $208 = $4; $209 = $6; ;HEAP32[$$byval_copy3>>2]=HEAP32[$208>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$208+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$208+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$208+12>>2]|0; $210 = (_nk_button_behavior($207,$$byval_copy3,$209,1)|0); $211 = ($210|0)!=(0); if ($211) { $212 = $6; $213 = ((($212)) + 220|0); $214 = ((($213)) + 48|0); $215 = ((($214)) + 4|0); $216 = +HEAPF32[$215>>2]; $217 = $4; $218 = ((($217)) + 4|0); $219 = +HEAPF32[$218>>2]; $220 = $216 - $219; $221 = $4; $222 = ((($221)) + 12|0); $223 = +HEAPF32[$222>>2]; $224 = $223 - 1.0; $225 = $220 / $224; $226 = 1.0 < $225; if ($226) { $242 = 1.0; } else { $227 = $6; $228 = ((($227)) + 220|0); $229 = ((($228)) + 48|0); $230 = ((($229)) + 4|0); $231 = +HEAPF32[$230>>2]; $232 = $4; $233 = ((($232)) + 4|0); $234 = +HEAPF32[$233>>2]; $235 = $231 - $234; $236 = $4; $237 = ((($236)) + 12|0); $238 = +HEAPF32[$237>>2]; $239 = $238 - 1.0; $240 = $235 / $239; $242 = $240; } $241 = 0.0 < $242; if ($241) { $243 = $6; $244 = ((($243)) + 220|0); $245 = ((($244)) + 48|0); $246 = ((($245)) + 4|0); $247 = +HEAPF32[$246>>2]; $248 = $4; $249 = ((($248)) + 4|0); $250 = +HEAPF32[$249>>2]; $251 = $247 - $250; $252 = $4; $253 = ((($252)) + 12|0); $254 = +HEAPF32[$253>>2]; $255 = $254 - 1.0; $256 = $251 / $255; $257 = 1.0 < $256; if ($257) { $273 = 1.0; } else { $258 = $6; $259 = ((($258)) + 220|0); $260 = ((($259)) + 48|0); $261 = ((($260)) + 4|0); $262 = +HEAPF32[$261>>2]; $263 = $4; $264 = ((($263)) + 4|0); $265 = +HEAPF32[$264>>2]; $266 = $262 - $265; $267 = $4; $268 = ((($267)) + 12|0); $269 = +HEAPF32[$268>>2]; $270 = $269 - 1.0; $271 = $266 / $270; $273 = $271; } } else { $273 = 0.0; } $272 = 1.0 - $273; $274 = ((($hsva)) + 12|0); HEAPF32[$274>>2] = $272; $value_changed = 1; } } $275 = $0; $276 = HEAP32[$275>>2]|0; $277 = $276 & 2; $278 = ($277|0)!=(0); $279 = $0; if ($278) { HEAP32[$279>>2] = 6; } else { HEAP32[$279>>2] = 4; } $280 = $hsv_changed; $281 = ($280|0)!=(0); if ($281) { $282 = $5; _nk_hsva_fv($7,$hsva); ;HEAP8[$282>>0]=HEAP8[$7>>0]|0;HEAP8[$282+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$282+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$282+3>>0]=HEAP8[$7+3>>0]|0; $283 = $0; HEAP32[$283>>2] = 34; } $284 = $value_changed; $285 = ($284|0)!=(0); if ($285) { $286 = ((($hsva)) + 12|0); $287 = +HEAPF32[$286>>2]; $288 = $287 * 255.0; $289 = (~~(($288))&255); $290 = $5; $291 = ((($290)) + 3|0); HEAP8[$291>>0] = $289; $292 = $0; HEAP32[$292>>2] = 34; } $293 = $6; $294 = $1; ;HEAP32[$$byval_copy4>>2]=HEAP32[$294>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$294+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$294+8>>2]|0;HEAP32[$$byval_copy4+12>>2]=HEAP32[$294+12>>2]|0; $295 = (_nk_input_is_mouse_hovering_rect($293,$$byval_copy4)|0); $296 = ($295|0)!=(0); if ($296) { $297 = $0; HEAP32[$297>>2] = 18; } $298 = $0; $299 = HEAP32[$298>>2]|0; $300 = $299 & 16; $301 = ($300|0)!=(0); if ($301) { $302 = $6; $303 = $1; ;HEAP32[$$byval_copy5>>2]=HEAP32[$303>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$303+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$303+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$303+12>>2]|0; $304 = (_nk_input_is_mouse_prev_hovering_rect($302,$$byval_copy5)|0); $305 = ($304|0)!=(0); if (!($305)) { $306 = $0; $307 = HEAP32[$306>>2]|0; $308 = $307 | 8; HEAP32[$306>>2] = $308; $316 = $value_changed; STACKTOP = sp;return ($316|0); } } $309 = $6; $310 = $1; ;HEAP32[$$byval_copy6>>2]=HEAP32[$310>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$310+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$310+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$310+12>>2]|0; $311 = (_nk_input_is_mouse_prev_hovering_rect($309,$$byval_copy6)|0); $312 = ($311|0)!=(0); if (!($312)) { $316 = $value_changed; STACKTOP = sp;return ($316|0); } $313 = $0; $314 = HEAP32[$313>>2]|0; $315 = $314 | 64; HEAP32[$313>>2] = $315; $316 = $value_changed; STACKTOP = sp;return ($316|0); } function _nk_draw_color_picker($o,$matrix,$hue_bar,$alpha_bar,$color) { $o = $o|0; $matrix = $matrix|0; $hue_bar = $hue_bar|0; $alpha_bar = $alpha_bar|0; $color = $color|0; var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy10 = 0, $$byval_copy14 = 0, $$byval_copy2 = 0, $$byval_copy20 = 0, $$byval_copy21 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$byval_copy6 = 0, $$byval_copy9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0; var $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0, $115 = 0.0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0; var $123 = 0, $124 = 0.0, $125 = 0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0; var $141 = 0.0, $142 = 0.0, $143 = 0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0, $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0; var $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0, $163 = 0.0, $164 = 0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0.0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0; var $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0.0, $183 = 0, $184 = 0.0, $185 = 0, $186 = 0.0, $187 = 0.0, $188 = 0.0, $189 = 0, $19 = 0, $190 = 0.0, $191 = 0.0, $192 = 0, $193 = 0.0, $194 = 0, $195 = 0.0; var $196 = 0.0, $197 = 0.0, $198 = 0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0.0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0; var $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0; var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0, $68 = 0, $69 = 0.0; var $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0, $87 = 0; var $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $S = 0.0, $V = 0.0, $alpha = 0.0, $color$byval_copy = 0, $crosshair_size = 0.0, $hsva = 0, $i = 0; var $line_y = 0.0, $nk_draw_color_picker$black$byval_copy = 0, $nk_draw_color_picker$black$byval_copy16 = 0, $nk_draw_color_picker$black$byval_copy17 = 0, $nk_draw_color_picker$black$byval_copy8 = 0, $nk_draw_color_picker$black_trans$byval_copy = 0, $nk_draw_color_picker$black_trans$byval_copy15 = 0, $nk_draw_color_picker$white$byval_copy = 0, $nk_draw_color_picker$white$byval_copy11 = 0, $nk_draw_color_picker$white$byval_copy13 = 0, $nk_draw_color_picker$white$byval_copy18 = 0, $nk_draw_color_picker$white$byval_copy19 = 0, $nk_draw_color_picker$white$byval_copy7 = 0, $p = 0, $temp = 0, $temp$byval_copy = 0, $temp$byval_copy12 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $$byval_copy21 = sp + 264|0; $$byval_copy20 = sp + 260|0; $nk_draw_color_picker$white$byval_copy19 = sp + 256|0; $nk_draw_color_picker$white$byval_copy18 = sp + 252|0; $nk_draw_color_picker$black$byval_copy17 = sp + 248|0; $nk_draw_color_picker$black$byval_copy16 = sp + 244|0; $nk_draw_color_picker$black_trans$byval_copy15 = sp + 240|0; $nk_draw_color_picker$black_trans$byval_copy = sp + 236|0; $$byval_copy14 = sp + 136|0; $nk_draw_color_picker$white$byval_copy13 = sp + 232|0; $temp$byval_copy12 = sp + 228|0; $temp$byval_copy = sp + 224|0; $nk_draw_color_picker$white$byval_copy11 = sp + 220|0; $$byval_copy10 = sp + 120|0; $$byval_copy9 = sp + 216|0; $nk_draw_color_picker$black$byval_copy8 = sp + 212|0; $nk_draw_color_picker$black$byval_copy = sp + 208|0; $nk_draw_color_picker$white$byval_copy7 = sp + 204|0; $nk_draw_color_picker$white$byval_copy = sp + 200|0; $$byval_copy6 = sp + 104|0; $$byval_copy5 = sp + 196|0; $$byval_copy4 = sp + 192|0; $$byval_copy3 = sp + 188|0; $$byval_copy2 = sp + 184|0; $$byval_copy1 = sp + 180|0; $$byval_copy = sp + 88|0; $color$byval_copy = sp + 176|0; $temp = sp + 172|0; $hsva = sp + 48|0; $4 = sp + 24|0; $5 = sp + 168|0; $6 = sp + 164|0; $7 = sp + 160|0; $p = sp + 8|0; $8 = sp + 156|0; $9 = sp + 152|0; $0 = $o; $1 = $matrix; $2 = $hue_bar; $3 = $alpha_bar; $crosshair_size = 7.0; $10 = $0; $11 = ($10|0)!=(0|0); if (!($11)) { ___assert_fail((31618|0),(13400|0),13584,(31870|0)); // unreachable; } $12 = $1; $13 = ($12|0)!=(0|0); if (!($13)) { ___assert_fail((31843|0),(13400|0),13585,(31870|0)); // unreachable; } $14 = $2; $15 = ($14|0)!=(0|0); if (!($15)) { ___assert_fail((31850|0),(13400|0),13586,(31870|0)); // unreachable; } $16 = $3; $17 = ($16|0)!=(0|0); if (!($17)) { ___assert_fail((31891|0),(13400|0),13587,(31870|0)); // unreachable; } ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; _nk_color_hsv_fv($hsva,$color$byval_copy); $i = 0; while(1) { $18 = $i; $19 = ($18|0)<(6); if (!($19)) { break; } $20 = $0; $21 = $2; $22 = +HEAPF32[$21>>2]; $23 = $2; $24 = ((($23)) + 4|0); $25 = +HEAPF32[$24>>2]; $26 = $i; $27 = (+($26|0)); $28 = $2; $29 = ((($28)) + 12|0); $30 = +HEAPF32[$29>>2]; $31 = $30 / 6.0; $32 = $27 * $31; $33 = $25 + $32; $34 = $33 + 0.5; $35 = $2; $36 = ((($35)) + 8|0); $37 = +HEAPF32[$36>>2]; $38 = $2; $39 = ((($38)) + 12|0); $40 = +HEAPF32[$39>>2]; $41 = $40 / 6.0; $42 = $41 + 0.5; _nk_rect($4,$22,$34,$37,$42); $43 = $i; $44 = (31901 + ($43<<2)|0); $45 = $i; $46 = (31901 + ($45<<2)|0); $47 = $i; $48 = (($47) + 1)|0; $49 = (31901 + ($48<<2)|0); $50 = $i; $51 = (($50) + 1)|0; $52 = (31901 + ($51<<2)|0); ;HEAP32[$$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$4+12>>2]|0; ;HEAP8[$$byval_copy1>>0]=HEAP8[$44>>0]|0;HEAP8[$$byval_copy1+1>>0]=HEAP8[$44+1>>0]|0;HEAP8[$$byval_copy1+2>>0]=HEAP8[$44+2>>0]|0;HEAP8[$$byval_copy1+3>>0]=HEAP8[$44+3>>0]|0; ;HEAP8[$$byval_copy2>>0]=HEAP8[$46>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$46+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$46+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$46+3>>0]|0; ;HEAP8[$$byval_copy3>>0]=HEAP8[$49>>0]|0;HEAP8[$$byval_copy3+1>>0]=HEAP8[$49+1>>0]|0;HEAP8[$$byval_copy3+2>>0]=HEAP8[$49+2>>0]|0;HEAP8[$$byval_copy3+3>>0]=HEAP8[$49+3>>0]|0; ;HEAP8[$$byval_copy4>>0]=HEAP8[$52>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$52+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$52+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$52+3>>0]|0; _nk_fill_rect_multi_color($20,$$byval_copy,$$byval_copy1,$$byval_copy2,$$byval_copy3,$$byval_copy4); $53 = $i; $54 = (($53) + 1)|0; $i = $54; } $55 = $2; $56 = ((($55)) + 4|0); $57 = +HEAPF32[$56>>2]; $58 = +HEAPF32[$hsva>>2]; $59 = $1; $60 = ((($59)) + 12|0); $61 = +HEAPF32[$60>>2]; $62 = $58 * $61; $63 = $57 + $62; $64 = $63 + 0.5; $65 = (~~(($64))); $66 = (+($65|0)); $line_y = $66; $67 = $0; $68 = $2; $69 = +HEAPF32[$68>>2]; $70 = $69 - 1.0; $71 = $line_y; $72 = $2; $73 = +HEAPF32[$72>>2]; $74 = $2; $75 = ((($74)) + 8|0); $76 = +HEAPF32[$75>>2]; $77 = $73 + $76; $78 = $77 + 2.0; $79 = $line_y; _nk_rgb($5,255,255,255); ;HEAP8[$$byval_copy5>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$5+3>>0]|0; _nk_stroke_line($67,$70,$71,$78,$79,1.0,$$byval_copy5); $80 = $3; $81 = ($80|0)!=(0|0); if ($81) { $82 = ((($color)) + 3|0); $83 = HEAP8[$82>>0]|0; $84 = (+($83&255)); $85 = $84 / 255.0; $86 = 1.0 < $85; if ($86) { $92 = 1.0; } else { $87 = ((($color)) + 3|0); $88 = HEAP8[$87>>0]|0; $89 = (+($88&255)); $90 = $89 / 255.0; $92 = $90; } $91 = 0.0 < $92; if ($91) { $93 = ((($color)) + 3|0); $94 = HEAP8[$93>>0]|0; $95 = (+($94&255)); $96 = $95 / 255.0; $97 = 1.0 < $96; if ($97) { $102 = 1.0; } else { $98 = ((($color)) + 3|0); $99 = HEAP8[$98>>0]|0; $100 = (+($99&255)); $101 = $100 / 255.0; $102 = $101; } } else { $102 = 0.0; } $alpha = $102; $103 = $3; $104 = ((($103)) + 4|0); $105 = +HEAPF32[$104>>2]; $106 = $alpha; $107 = 1.0 - $106; $108 = $1; $109 = ((($108)) + 12|0); $110 = +HEAPF32[$109>>2]; $111 = $107 * $110; $112 = $105 + $111; $113 = $112 + 0.5; $114 = (~~(($113))); $115 = (+($114|0)); $line_y = $115; $116 = $0; $117 = $3; ;HEAP32[$$byval_copy6>>2]=HEAP32[$117>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$117+4>>2]|0;HEAP32[$$byval_copy6+8>>2]=HEAP32[$117+8>>2]|0;HEAP32[$$byval_copy6+12>>2]=HEAP32[$117+12>>2]|0; ;HEAP8[$nk_draw_color_picker$white$byval_copy>>0]=HEAP8[31862>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy+1>>0]=HEAP8[31862+1>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy+2>>0]=HEAP8[31862+2>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy+3>>0]=HEAP8[31862+3>>0]|0; ;HEAP8[$nk_draw_color_picker$white$byval_copy7>>0]=HEAP8[31862>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy7+1>>0]=HEAP8[31862+1>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy7+2>>0]=HEAP8[31862+2>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy7+3>>0]=HEAP8[31862+3>>0]|0; ;HEAP8[$nk_draw_color_picker$black$byval_copy>>0]=HEAP8[31858>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy+1>>0]=HEAP8[31858+1>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy+2>>0]=HEAP8[31858+2>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy+3>>0]=HEAP8[31858+3>>0]|0; ;HEAP8[$nk_draw_color_picker$black$byval_copy8>>0]=HEAP8[31858>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy8+1>>0]=HEAP8[31858+1>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy8+2>>0]=HEAP8[31858+2>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy8+3>>0]=HEAP8[31858+3>>0]|0; _nk_fill_rect_multi_color($116,$$byval_copy6,$nk_draw_color_picker$white$byval_copy,$nk_draw_color_picker$white$byval_copy7,$nk_draw_color_picker$black$byval_copy,$nk_draw_color_picker$black$byval_copy8); $118 = $0; $119 = $3; $120 = +HEAPF32[$119>>2]; $121 = $120 - 1.0; $122 = $line_y; $123 = $3; $124 = +HEAPF32[$123>>2]; $125 = $3; $126 = ((($125)) + 8|0); $127 = +HEAPF32[$126>>2]; $128 = $124 + $127; $129 = $128 + 2.0; $130 = $line_y; _nk_rgb($6,255,255,255); ;HEAP8[$$byval_copy9>>0]=HEAP8[$6>>0]|0;HEAP8[$$byval_copy9+1>>0]=HEAP8[$6+1>>0]|0;HEAP8[$$byval_copy9+2>>0]=HEAP8[$6+2>>0]|0;HEAP8[$$byval_copy9+3>>0]=HEAP8[$6+3>>0]|0; _nk_stroke_line($118,$121,$122,$129,$130,1.0,$$byval_copy9); } $131 = +HEAPF32[$hsva>>2]; _nk_hsv_f($7,$131,1.0,1.0); ;HEAP8[$temp>>0]=HEAP8[$7>>0]|0;HEAP8[$temp+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$temp+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$temp+3>>0]=HEAP8[$7+3>>0]|0; $132 = $0; $133 = $1; ;HEAP32[$$byval_copy10>>2]=HEAP32[$133>>2]|0;HEAP32[$$byval_copy10+4>>2]=HEAP32[$133+4>>2]|0;HEAP32[$$byval_copy10+8>>2]=HEAP32[$133+8>>2]|0;HEAP32[$$byval_copy10+12>>2]=HEAP32[$133+12>>2]|0; ;HEAP8[$nk_draw_color_picker$white$byval_copy11>>0]=HEAP8[31862>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy11+1>>0]=HEAP8[31862+1>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy11+2>>0]=HEAP8[31862+2>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy11+3>>0]=HEAP8[31862+3>>0]|0; ;HEAP8[$temp$byval_copy>>0]=HEAP8[$temp>>0]|0;HEAP8[$temp$byval_copy+1>>0]=HEAP8[$temp+1>>0]|0;HEAP8[$temp$byval_copy+2>>0]=HEAP8[$temp+2>>0]|0;HEAP8[$temp$byval_copy+3>>0]=HEAP8[$temp+3>>0]|0; ;HEAP8[$temp$byval_copy12>>0]=HEAP8[$temp>>0]|0;HEAP8[$temp$byval_copy12+1>>0]=HEAP8[$temp+1>>0]|0;HEAP8[$temp$byval_copy12+2>>0]=HEAP8[$temp+2>>0]|0;HEAP8[$temp$byval_copy12+3>>0]=HEAP8[$temp+3>>0]|0; ;HEAP8[$nk_draw_color_picker$white$byval_copy13>>0]=HEAP8[31862>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy13+1>>0]=HEAP8[31862+1>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy13+2>>0]=HEAP8[31862+2>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy13+3>>0]=HEAP8[31862+3>>0]|0; _nk_fill_rect_multi_color($132,$$byval_copy10,$nk_draw_color_picker$white$byval_copy11,$temp$byval_copy,$temp$byval_copy12,$nk_draw_color_picker$white$byval_copy13); $134 = $0; $135 = $1; ;HEAP32[$$byval_copy14>>2]=HEAP32[$135>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$135+4>>2]|0;HEAP32[$$byval_copy14+8>>2]=HEAP32[$135+8>>2]|0;HEAP32[$$byval_copy14+12>>2]=HEAP32[$135+12>>2]|0; ;HEAP8[$nk_draw_color_picker$black_trans$byval_copy>>0]=HEAP8[31866>>0]|0;HEAP8[$nk_draw_color_picker$black_trans$byval_copy+1>>0]=HEAP8[31866+1>>0]|0;HEAP8[$nk_draw_color_picker$black_trans$byval_copy+2>>0]=HEAP8[31866+2>>0]|0;HEAP8[$nk_draw_color_picker$black_trans$byval_copy+3>>0]=HEAP8[31866+3>>0]|0; ;HEAP8[$nk_draw_color_picker$black_trans$byval_copy15>>0]=HEAP8[31866>>0]|0;HEAP8[$nk_draw_color_picker$black_trans$byval_copy15+1>>0]=HEAP8[31866+1>>0]|0;HEAP8[$nk_draw_color_picker$black_trans$byval_copy15+2>>0]=HEAP8[31866+2>>0]|0;HEAP8[$nk_draw_color_picker$black_trans$byval_copy15+3>>0]=HEAP8[31866+3>>0]|0; ;HEAP8[$nk_draw_color_picker$black$byval_copy16>>0]=HEAP8[31858>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy16+1>>0]=HEAP8[31858+1>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy16+2>>0]=HEAP8[31858+2>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy16+3>>0]=HEAP8[31858+3>>0]|0; ;HEAP8[$nk_draw_color_picker$black$byval_copy17>>0]=HEAP8[31858>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy17+1>>0]=HEAP8[31858+1>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy17+2>>0]=HEAP8[31858+2>>0]|0;HEAP8[$nk_draw_color_picker$black$byval_copy17+3>>0]=HEAP8[31858+3>>0]|0; _nk_fill_rect_multi_color($134,$$byval_copy14,$nk_draw_color_picker$black_trans$byval_copy,$nk_draw_color_picker$black_trans$byval_copy15,$nk_draw_color_picker$black$byval_copy16,$nk_draw_color_picker$black$byval_copy17); $136 = ((($hsva)) + 4|0); $137 = +HEAPF32[$136>>2]; $S = $137; $138 = ((($hsva)) + 8|0); $139 = +HEAPF32[$138>>2]; $V = $139; $140 = $1; $141 = +HEAPF32[$140>>2]; $142 = $S; $143 = $1; $144 = ((($143)) + 8|0); $145 = +HEAPF32[$144>>2]; $146 = $142 * $145; $147 = $141 + $146; $148 = $147 + 0.5; $149 = (~~(($148))); $150 = (+($149|0)); HEAPF32[$p>>2] = $150; $151 = $1; $152 = ((($151)) + 4|0); $153 = +HEAPF32[$152>>2]; $154 = $V; $155 = 1.0 - $154; $156 = $1; $157 = ((($156)) + 12|0); $158 = +HEAPF32[$157>>2]; $159 = $155 * $158; $160 = $153 + $159; $161 = $160 + 0.5; $162 = (~~(($161))); $163 = (+($162|0)); $164 = ((($p)) + 4|0); HEAPF32[$164>>2] = $163; $165 = $0; $166 = +HEAPF32[$p>>2]; $167 = $166 - 7.0; $168 = ((($p)) + 4|0); $169 = +HEAPF32[$168>>2]; $170 = +HEAPF32[$p>>2]; $171 = $170 - 2.0; $172 = ((($p)) + 4|0); $173 = +HEAPF32[$172>>2]; ;HEAP8[$nk_draw_color_picker$white$byval_copy18>>0]=HEAP8[31862>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy18+1>>0]=HEAP8[31862+1>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy18+2>>0]=HEAP8[31862+2>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy18+3>>0]=HEAP8[31862+3>>0]|0; _nk_stroke_line($165,$167,$169,$171,$173,1.0,$nk_draw_color_picker$white$byval_copy18); $174 = $0; $175 = +HEAPF32[$p>>2]; $176 = $175 + 7.0; $177 = ((($p)) + 4|0); $178 = +HEAPF32[$177>>2]; $179 = +HEAPF32[$p>>2]; $180 = $179 + 2.0; $181 = ((($p)) + 4|0); $182 = +HEAPF32[$181>>2]; ;HEAP8[$nk_draw_color_picker$white$byval_copy19>>0]=HEAP8[31862>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy19+1>>0]=HEAP8[31862+1>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy19+2>>0]=HEAP8[31862+2>>0]|0;HEAP8[$nk_draw_color_picker$white$byval_copy19+3>>0]=HEAP8[31862+3>>0]|0; _nk_stroke_line($174,$176,$178,$180,$182,1.0,$nk_draw_color_picker$white$byval_copy19); $183 = $0; $184 = +HEAPF32[$p>>2]; $185 = ((($p)) + 4|0); $186 = +HEAPF32[$185>>2]; $187 = $186 + 7.0; $188 = +HEAPF32[$p>>2]; $189 = ((($p)) + 4|0); $190 = +HEAPF32[$189>>2]; $191 = $190 + 2.0; _nk_rgb($8,255,255,255); ;HEAP8[$$byval_copy20>>0]=HEAP8[$8>>0]|0;HEAP8[$$byval_copy20+1>>0]=HEAP8[$8+1>>0]|0;HEAP8[$$byval_copy20+2>>0]=HEAP8[$8+2>>0]|0;HEAP8[$$byval_copy20+3>>0]=HEAP8[$8+3>>0]|0; _nk_stroke_line($183,$184,$187,$188,$191,1.0,$$byval_copy20); $192 = $0; $193 = +HEAPF32[$p>>2]; $194 = ((($p)) + 4|0); $195 = +HEAPF32[$194>>2]; $196 = $195 - 7.0; $197 = +HEAPF32[$p>>2]; $198 = ((($p)) + 4|0); $199 = +HEAPF32[$198>>2]; $200 = $199 - 2.0; _nk_rgb($9,255,255,255); ;HEAP8[$$byval_copy21>>0]=HEAP8[$9>>0]|0;HEAP8[$$byval_copy21+1>>0]=HEAP8[$9+1>>0]|0;HEAP8[$$byval_copy21+2>>0]=HEAP8[$9+2>>0]|0;HEAP8[$$byval_copy21+3>>0]=HEAP8[$9+3>>0]|0; _nk_stroke_line($192,$193,$196,$197,$200,1.0,$$byval_copy21); STACKTOP = sp;return; } function _strerror($e) { $e = $e|0; var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$03 = 0, $i$03$lcssa = 0, $i$12 = 0, $s$0$lcssa = 0, $s$01 = 0, $s$1 = 0, label = 0; var sp = 0; sp = STACKTOP; $i$03 = 0; while(1) { $1 = (32015 + ($i$03)|0); $2 = HEAP8[$1>>0]|0; $3 = $2&255; $4 = ($3|0)==($e|0); if ($4) { $i$03$lcssa = $i$03; label = 2; break; } $5 = (($i$03) + 1)|0; $6 = ($5|0)==(87); if ($6) { $i$12 = 87;$s$01 = 32103; label = 5; break; } else { $i$03 = $5; } } if ((label|0) == 2) { $0 = ($i$03$lcssa|0)==(0); if ($0) { $s$0$lcssa = 32103; } else { $i$12 = $i$03$lcssa;$s$01 = 32103; label = 5; } } if ((label|0) == 5) { while(1) { label = 0; $s$1 = $s$01; while(1) { $7 = HEAP8[$s$1>>0]|0; $8 = ($7<<24>>24)==(0); $9 = ((($s$1)) + 1|0); if ($8) { $$lcssa = $9; break; } else { $s$1 = $9; } } $10 = (($i$12) + -1)|0; $11 = ($10|0)==(0); if ($11) { $s$0$lcssa = $$lcssa; break; } else { $i$12 = $10;$s$01 = $$lcssa; label = 5; } } } return ($s$0$lcssa|0); } function ___errno_location() { var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = HEAP32[12616>>2]|0; $1 = ($0|0)==(0|0); if ($1) { $$0 = 12672; } else { $2 = (_pthread_self()|0); $3 = ((($2)) + 60|0); $4 = HEAP32[$3>>2]|0; $$0 = $4; } return ($$0|0); } function ___syscall_ret($r) { $r = $r|0; var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($r>>>0)>(4294963200); if ($0) { $1 = (0 - ($r))|0; $2 = (___errno_location()|0); HEAP32[$2>>2] = $1; $$0 = -1; } else { $$0 = $r; } return ($$0|0); } function _frexp($x,$e) { $x = +$x; $e = $e|0; var $$0 = 0.0, $$01 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $storemerge = 0, label = 0, sp = 0; sp = STACKTOP; HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; $1 = HEAP32[tempDoublePtr+4>>2]|0; $2 = (_bitshift64Lshr(($0|0),($1|0),52)|0); $3 = tempRet0; $4 = $2 & 2047; switch ($4|0) { case 0: { $5 = $x != 0.0; if ($5) { $6 = $x * 1.8446744073709552E+19; $7 = (+_frexp($6,$e)); $8 = HEAP32[$e>>2]|0; $9 = (($8) + -64)|0; $$01 = $7;$storemerge = $9; } else { $$01 = $x;$storemerge = 0; } HEAP32[$e>>2] = $storemerge; $$0 = $$01; break; } case 2047: { $$0 = $x; break; } default: { $10 = (($4) + -1022)|0; HEAP32[$e>>2] = $10; $11 = $1 & -2146435073; $12 = $11 | 1071644672; HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $12;$13 = +HEAPF64[tempDoublePtr>>3]; $$0 = $13; } } return (+$$0); } function _frexpl($x,$e) { $x = +$x; $e = $e|0; var $0 = 0.0, label = 0, sp = 0; sp = STACKTOP; $0 = (+_frexp($x,$e)); return (+$0); } function _wcrtomb($s,$wc,$st) { $s = $s|0; $wc = $wc|0; $st = $st|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; var $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($s|0)==(0|0); do { if ($0) { $$0 = 1; } else { $1 = ($wc>>>0)<(128); if ($1) { $2 = $wc&255; HEAP8[$s>>0] = $2; $$0 = 1; break; } $3 = ($wc>>>0)<(2048); if ($3) { $4 = $wc >>> 6; $5 = $4 | 192; $6 = $5&255; $7 = ((($s)) + 1|0); HEAP8[$s>>0] = $6; $8 = $wc & 63; $9 = $8 | 128; $10 = $9&255; HEAP8[$7>>0] = $10; $$0 = 2; break; } $11 = ($wc>>>0)<(55296); $12 = $wc & -8192; $13 = ($12|0)==(57344); $or$cond = $11 | $13; if ($or$cond) { $14 = $wc >>> 12; $15 = $14 | 224; $16 = $15&255; $17 = ((($s)) + 1|0); HEAP8[$s>>0] = $16; $18 = $wc >>> 6; $19 = $18 & 63; $20 = $19 | 128; $21 = $20&255; $22 = ((($s)) + 2|0); HEAP8[$17>>0] = $21; $23 = $wc & 63; $24 = $23 | 128; $25 = $24&255; HEAP8[$22>>0] = $25; $$0 = 3; break; } $26 = (($wc) + -65536)|0; $27 = ($26>>>0)<(1048576); if ($27) { $28 = $wc >>> 18; $29 = $28 | 240; $30 = $29&255; $31 = ((($s)) + 1|0); HEAP8[$s>>0] = $30; $32 = $wc >>> 12; $33 = $32 & 63; $34 = $33 | 128; $35 = $34&255; $36 = ((($s)) + 2|0); HEAP8[$31>>0] = $35; $37 = $wc >>> 6; $38 = $37 & 63; $39 = $38 | 128; $40 = $39&255; $41 = ((($s)) + 3|0); HEAP8[$36>>0] = $40; $42 = $wc & 63; $43 = $42 | 128; $44 = $43&255; HEAP8[$41>>0] = $44; $$0 = 4; break; } else { $45 = (___errno_location()|0); HEAP32[$45>>2] = 84; $$0 = -1; break; } } } while(0); return ($$0|0); } function _wctomb($s,$wc) { $s = $s|0; $wc = $wc|0; var $$0 = 0, $0 = 0, $1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($s|0)==(0|0); if ($0) { $$0 = 0; } else { $1 = (_wcrtomb($s,$wc,0)|0); $$0 = $1; } return ($$0|0); } function _fflush($f) { $f = $f|0; var $$0 = 0, $$01 = 0, $$012 = 0, $$014 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, $r$0$lcssa = 0, $r$03 = 0, $r$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($f|0)==(0|0); do { if ($0) { $7 = HEAP32[12668>>2]|0; $8 = ($7|0)==(0|0); if ($8) { $27 = 0; } else { $9 = HEAP32[12668>>2]|0; $10 = (_fflush($9)|0); $27 = $10; } ___lock(((12644)|0)); $$012 = HEAP32[(12640)>>2]|0; $11 = ($$012|0)==(0|0); if ($11) { $r$0$lcssa = $27; } else { $$014 = $$012;$r$03 = $27; while(1) { $12 = ((($$014)) + 76|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)>(-1); if ($14) { $15 = (___lockfile($$014)|0); $23 = $15; } else { $23 = 0; } $16 = ((($$014)) + 20|0); $17 = HEAP32[$16>>2]|0; $18 = ((($$014)) + 28|0); $19 = HEAP32[$18>>2]|0; $20 = ($17>>>0)>($19>>>0); if ($20) { $21 = (___fflush_unlocked($$014)|0); $22 = $21 | $r$03; $r$1 = $22; } else { $r$1 = $r$03; } $24 = ($23|0)==(0); if (!($24)) { ___unlockfile($$014); } $25 = ((($$014)) + 56|0); $$01 = HEAP32[$25>>2]|0; $26 = ($$01|0)==(0|0); if ($26) { $r$0$lcssa = $r$1; break; } else { $$014 = $$01;$r$03 = $r$1; } } } ___unlock(((12644)|0)); $$0 = $r$0$lcssa; } else { $1 = ((($f)) + 76|0); $2 = HEAP32[$1>>2]|0; $3 = ($2|0)>(-1); if (!($3)) { $4 = (___fflush_unlocked($f)|0); $$0 = $4; break; } $5 = (___lockfile($f)|0); $phitmp = ($5|0)==(0); $6 = (___fflush_unlocked($f)|0); if ($phitmp) { $$0 = $6; } else { ___unlockfile($f); $$0 = $6; } } } while(0); return ($$0|0); } function _fprintf($f,$fmt,$varargs) { $f = $f|0; $fmt = $fmt|0; $varargs = $varargs|0; var $0 = 0, $ap = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ap = sp; HEAP32[$ap>>2] = $varargs; $0 = (_vfprintf($f,$fmt,$ap)|0); STACKTOP = sp;return ($0|0); } function ___fwritex($s,$l,$f) { $s = $s|0; $l = $l|0; $f = $f|0; var $$0 = 0, $$01 = 0, $$02 = 0, $$pre = 0, $$pre6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$lcssa10 = 0; var $i$1 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 16|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0|0); if ($2) { $3 = (___towrite($f)|0); $4 = ($3|0)==(0); if ($4) { $$pre = HEAP32[$0>>2]|0; $7 = $$pre; label = 4; } else { $$0 = 0; } } else { $7 = $1; label = 4; } L4: do { if ((label|0) == 4) { $5 = ((($f)) + 20|0); $6 = HEAP32[$5>>2]|0; $8 = $7; $9 = $6; $10 = (($8) - ($9))|0; $11 = ($10>>>0)<($l>>>0); if ($11) { $12 = ((($f)) + 36|0); $13 = HEAP32[$12>>2]|0; $14 = (FUNCTION_TABLE_iiii[$13 & 7]($f,$s,$l)|0); $$0 = $14; break; } $15 = ((($f)) + 75|0); $16 = HEAP8[$15>>0]|0; $17 = ($16<<24>>24)>(-1); L9: do { if ($17) { $i$0 = $l; while(1) { $18 = ($i$0|0)==(0); if ($18) { $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0; break L9; } $19 = (($i$0) + -1)|0; $20 = (($s) + ($19)|0); $21 = HEAP8[$20>>0]|0; $22 = ($21<<24>>24)==(10); if ($22) { $i$0$lcssa10 = $i$0; break; } else { $i$0 = $19; } } $23 = ((($f)) + 36|0); $24 = HEAP32[$23>>2]|0; $25 = (FUNCTION_TABLE_iiii[$24 & 7]($f,$s,$i$0$lcssa10)|0); $26 = ($25>>>0)<($i$0$lcssa10>>>0); if ($26) { $$0 = $i$0$lcssa10; break L4; } $27 = (($s) + ($i$0$lcssa10)|0); $28 = (($l) - ($i$0$lcssa10))|0; $$pre6 = HEAP32[$5>>2]|0; $$01 = $28;$$02 = $27;$29 = $$pre6;$i$1 = $i$0$lcssa10; } else { $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0; } } while(0); _memcpy(($29|0),($$02|0),($$01|0))|0; $30 = HEAP32[$5>>2]|0; $31 = (($30) + ($$01)|0); HEAP32[$5>>2] = $31; $32 = (($i$1) + ($$01))|0; $$0 = $32; } } while(0); return ($$0|0); } function _printf($fmt,$varargs) { $fmt = $fmt|0; $varargs = $varargs|0; var $0 = 0, $1 = 0, $ap = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ap = sp; HEAP32[$ap>>2] = $varargs; $0 = HEAP32[12664>>2]|0; $1 = (_vfprintf($0,$fmt,$ap)|0); STACKTOP = sp;return ($1|0); } function _vfprintf($f,$fmt,$ap) { $f = $f|0; $fmt = $fmt|0; $ap = $ap|0; var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ap2 = 0, $internal_buf = 0, $nl_arg = 0, $nl_type = 0; var $ret$1 = 0, $ret$1$ = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0; sp = STACKTOP; STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $ap2 = sp + 120|0; $nl_type = sp + 80|0; $nl_arg = sp; $internal_buf = sp + 136|0; dest=$nl_type; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); $vacopy_currentptr = HEAP32[$ap>>2]|0; HEAP32[$ap2>>2] = $vacopy_currentptr; $0 = (_printf_core(0,$fmt,$ap2,$nl_arg,$nl_type)|0); $1 = ($0|0)<(0); if ($1) { $$0 = -1; } else { $2 = ((($f)) + 76|0); $3 = HEAP32[$2>>2]|0; $4 = ($3|0)>(-1); if ($4) { $5 = (___lockfile($f)|0); $32 = $5; } else { $32 = 0; } $6 = HEAP32[$f>>2]|0; $7 = $6 & 32; $8 = ((($f)) + 74|0); $9 = HEAP8[$8>>0]|0; $10 = ($9<<24>>24)<(1); if ($10) { $11 = $6 & -33; HEAP32[$f>>2] = $11; } $12 = ((($f)) + 48|0); $13 = HEAP32[$12>>2]|0; $14 = ($13|0)==(0); if ($14) { $16 = ((($f)) + 44|0); $17 = HEAP32[$16>>2]|0; HEAP32[$16>>2] = $internal_buf; $18 = ((($f)) + 28|0); HEAP32[$18>>2] = $internal_buf; $19 = ((($f)) + 20|0); HEAP32[$19>>2] = $internal_buf; HEAP32[$12>>2] = 80; $20 = ((($internal_buf)) + 80|0); $21 = ((($f)) + 16|0); HEAP32[$21>>2] = $20; $22 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0); $23 = ($17|0)==(0|0); if ($23) { $ret$1 = $22; } else { $24 = ((($f)) + 36|0); $25 = HEAP32[$24>>2]|0; (FUNCTION_TABLE_iiii[$25 & 7]($f,0,0)|0); $26 = HEAP32[$19>>2]|0; $27 = ($26|0)==(0|0); $$ = $27 ? -1 : $22; HEAP32[$16>>2] = $17; HEAP32[$12>>2] = 0; HEAP32[$21>>2] = 0; HEAP32[$18>>2] = 0; HEAP32[$19>>2] = 0; $ret$1 = $$; } } else { $15 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0); $ret$1 = $15; } $28 = HEAP32[$f>>2]|0; $29 = $28 & 32; $30 = ($29|0)==(0); $ret$1$ = $30 ? $ret$1 : -1; $31 = $28 | $7; HEAP32[$f>>2] = $31; $33 = ($32|0)==(0); if (!($33)) { ___unlockfile($f); } $$0 = $ret$1$; } STACKTOP = sp;return ($$0|0); } function ___lockfile($f) { $f = $f|0; var label = 0, sp = 0; sp = STACKTOP; return 0; } function ___unlockfile($f) { $f = $f|0; var label = 0, sp = 0; sp = STACKTOP; return; } function ___stdio_close($f) { $f = $f|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer = sp; $0 = ((($f)) + 60|0); $1 = HEAP32[$0>>2]|0; HEAP32[$vararg_buffer>>2] = $1; $2 = (___syscall6(6,($vararg_buffer|0))|0); $3 = (___syscall_ret($2)|0); STACKTOP = sp;return ($3|0); } function ___stdio_seek($f,$off,$whence) { $f = $f|0; $off = $off|0; $whence = $whence|0; var $$pre = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $ret = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer = sp; $ret = sp + 20|0; $0 = ((($f)) + 60|0); $1 = HEAP32[$0>>2]|0; HEAP32[$vararg_buffer>>2] = $1; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = 0; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $off; $vararg_ptr3 = ((($vararg_buffer)) + 12|0); HEAP32[$vararg_ptr3>>2] = $ret; $vararg_ptr4 = ((($vararg_buffer)) + 16|0); HEAP32[$vararg_ptr4>>2] = $whence; $2 = (___syscall140(140,($vararg_buffer|0))|0); $3 = (___syscall_ret($2)|0); $4 = ($3|0)<(0); if ($4) { HEAP32[$ret>>2] = -1; $5 = -1; } else { $$pre = HEAP32[$ret>>2]|0; $5 = $$pre; } STACKTOP = sp;return ($5|0); } function ___stdio_write($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $$0 = 0, $$phi$trans$insert = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cnt$0 = 0, $cnt$1 = 0, $iov$0 = 0, $iov$0$lcssa11 = 0, $iov$1 = 0, $iovcnt$0 = 0; var $iovcnt$0$lcssa12 = 0, $iovcnt$1 = 0, $iovs = 0, $rem$0 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer3 = sp + 16|0; $vararg_buffer = sp; $iovs = sp + 32|0; $0 = ((($f)) + 28|0); $1 = HEAP32[$0>>2]|0; HEAP32[$iovs>>2] = $1; $2 = ((($iovs)) + 4|0); $3 = ((($f)) + 20|0); $4 = HEAP32[$3>>2]|0; $5 = $4; $6 = (($5) - ($1))|0; HEAP32[$2>>2] = $6; $7 = ((($iovs)) + 8|0); HEAP32[$7>>2] = $buf; $8 = ((($iovs)) + 12|0); HEAP32[$8>>2] = $len; $9 = (($6) + ($len))|0; $10 = ((($f)) + 60|0); $11 = ((($f)) + 44|0); $iov$0 = $iovs;$iovcnt$0 = 2;$rem$0 = $9; while(1) { $12 = HEAP32[12616>>2]|0; $13 = ($12|0)==(0|0); if ($13) { $17 = HEAP32[$10>>2]|0; HEAP32[$vararg_buffer3>>2] = $17; $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); HEAP32[$vararg_ptr6>>2] = $iov$0; $vararg_ptr7 = ((($vararg_buffer3)) + 8|0); HEAP32[$vararg_ptr7>>2] = $iovcnt$0; $18 = (___syscall146(146,($vararg_buffer3|0))|0); $19 = (___syscall_ret($18)|0); $cnt$0 = $19; } else { _pthread_cleanup_push((20|0),($f|0)); $14 = HEAP32[$10>>2]|0; HEAP32[$vararg_buffer>>2] = $14; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = $iov$0; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $iovcnt$0; $15 = (___syscall146(146,($vararg_buffer|0))|0); $16 = (___syscall_ret($15)|0); _pthread_cleanup_pop(0); $cnt$0 = $16; } $20 = ($rem$0|0)==($cnt$0|0); if ($20) { label = 6; break; } $27 = ($cnt$0|0)<(0); if ($27) { $iov$0$lcssa11 = $iov$0;$iovcnt$0$lcssa12 = $iovcnt$0; label = 8; break; } $35 = (($rem$0) - ($cnt$0))|0; $36 = ((($iov$0)) + 4|0); $37 = HEAP32[$36>>2]|0; $38 = ($cnt$0>>>0)>($37>>>0); if ($38) { $39 = HEAP32[$11>>2]|0; HEAP32[$0>>2] = $39; HEAP32[$3>>2] = $39; $40 = (($cnt$0) - ($37))|0; $41 = ((($iov$0)) + 8|0); $42 = (($iovcnt$0) + -1)|0; $$phi$trans$insert = ((($iov$0)) + 12|0); $$pre = HEAP32[$$phi$trans$insert>>2]|0; $50 = $$pre;$cnt$1 = $40;$iov$1 = $41;$iovcnt$1 = $42; } else { $43 = ($iovcnt$0|0)==(2); if ($43) { $44 = HEAP32[$0>>2]|0; $45 = (($44) + ($cnt$0)|0); HEAP32[$0>>2] = $45; $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = 2; } else { $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = $iovcnt$0; } } $46 = HEAP32[$iov$1>>2]|0; $47 = (($46) + ($cnt$1)|0); HEAP32[$iov$1>>2] = $47; $48 = ((($iov$1)) + 4|0); $49 = (($50) - ($cnt$1))|0; HEAP32[$48>>2] = $49; $iov$0 = $iov$1;$iovcnt$0 = $iovcnt$1;$rem$0 = $35; } if ((label|0) == 6) { $21 = HEAP32[$11>>2]|0; $22 = ((($f)) + 48|0); $23 = HEAP32[$22>>2]|0; $24 = (($21) + ($23)|0); $25 = ((($f)) + 16|0); HEAP32[$25>>2] = $24; $26 = $21; HEAP32[$0>>2] = $26; HEAP32[$3>>2] = $26; $$0 = $len; } else if ((label|0) == 8) { $28 = ((($f)) + 16|0); HEAP32[$28>>2] = 0; HEAP32[$0>>2] = 0; HEAP32[$3>>2] = 0; $29 = HEAP32[$f>>2]|0; $30 = $29 | 32; HEAP32[$f>>2] = $30; $31 = ($iovcnt$0$lcssa12|0)==(2); if ($31) { $$0 = 0; } else { $32 = ((($iov$0$lcssa11)) + 4|0); $33 = HEAP32[$32>>2]|0; $34 = (($len) - ($33))|0; $$0 = $34; } } STACKTOP = sp;return ($$0|0); } function ___stdout_write($f,$buf,$len) { $f = $f|0; $buf = $buf|0; $len = $len|0; var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tio = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $vararg_buffer = sp; $tio = sp + 12|0; $0 = ((($f)) + 36|0); HEAP32[$0>>2] = 4; $1 = HEAP32[$f>>2]|0; $2 = $1 & 64; $3 = ($2|0)==(0); if ($3) { $4 = ((($f)) + 60|0); $5 = HEAP32[$4>>2]|0; HEAP32[$vararg_buffer>>2] = $5; $vararg_ptr1 = ((($vararg_buffer)) + 4|0); HEAP32[$vararg_ptr1>>2] = 21505; $vararg_ptr2 = ((($vararg_buffer)) + 8|0); HEAP32[$vararg_ptr2>>2] = $tio; $6 = (___syscall54(54,($vararg_buffer|0))|0); $7 = ($6|0)==(0); if (!($7)) { $8 = ((($f)) + 75|0); HEAP8[$8>>0] = -1; } } $9 = (___stdio_write($f,$buf,$len)|0); STACKTOP = sp;return ($9|0); } function ___towrite($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 74|0); $1 = HEAP8[$0>>0]|0; $2 = $1 << 24 >> 24; $3 = (($2) + 255)|0; $4 = $3 | $2; $5 = $4&255; HEAP8[$0>>0] = $5; $6 = HEAP32[$f>>2]|0; $7 = $6 & 8; $8 = ($7|0)==(0); if ($8) { $10 = ((($f)) + 8|0); HEAP32[$10>>2] = 0; $11 = ((($f)) + 4|0); HEAP32[$11>>2] = 0; $12 = ((($f)) + 44|0); $13 = HEAP32[$12>>2]|0; $14 = ((($f)) + 28|0); HEAP32[$14>>2] = $13; $15 = ((($f)) + 20|0); HEAP32[$15>>2] = $13; $16 = $13; $17 = ((($f)) + 48|0); $18 = HEAP32[$17>>2]|0; $19 = (($16) + ($18)|0); $20 = ((($f)) + 16|0); HEAP32[$20>>2] = $19; $$0 = 0; } else { $9 = $6 | 32; HEAP32[$f>>2] = $9; $$0 = -1; } return ($$0|0); } function _memchr($src,$c,$n) { $src = $src|0; $c = $c|0; $n = $n|0; var $$0$lcssa = 0, $$0$lcssa44 = 0, $$019 = 0, $$1$lcssa = 0, $$110 = 0, $$110$lcssa = 0, $$24 = 0, $$3 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, $s$0$lcssa = 0, $s$0$lcssa43 = 0, $s$020 = 0, $s$15 = 0, $s$2 = 0, $w$0$lcssa = 0, $w$011 = 0, $w$011$lcssa = 0, label = 0, sp = 0; sp = STACKTOP; $0 = $c & 255; $1 = $src; $2 = $1 & 3; $3 = ($2|0)!=(0); $4 = ($n|0)!=(0); $or$cond18 = $4 & $3; L1: do { if ($or$cond18) { $5 = $c&255; $$019 = $n;$s$020 = $src; while(1) { $6 = HEAP8[$s$020>>0]|0; $7 = ($6<<24>>24)==($5<<24>>24); if ($7) { $$0$lcssa44 = $$019;$s$0$lcssa43 = $s$020; label = 6; break L1; } $8 = ((($s$020)) + 1|0); $9 = (($$019) + -1)|0; $10 = $8; $11 = $10 & 3; $12 = ($11|0)!=(0); $13 = ($9|0)!=(0); $or$cond = $13 & $12; if ($or$cond) { $$019 = $9;$s$020 = $8; } else { $$0$lcssa = $9;$$lcssa = $13;$s$0$lcssa = $8; label = 5; break; } } } else { $$0$lcssa = $n;$$lcssa = $4;$s$0$lcssa = $src; label = 5; } } while(0); if ((label|0) == 5) { if ($$lcssa) { $$0$lcssa44 = $$0$lcssa;$s$0$lcssa43 = $s$0$lcssa; label = 6; } else { $$3 = 0;$s$2 = $s$0$lcssa; } } L8: do { if ((label|0) == 6) { $14 = HEAP8[$s$0$lcssa43>>0]|0; $15 = $c&255; $16 = ($14<<24>>24)==($15<<24>>24); if ($16) { $$3 = $$0$lcssa44;$s$2 = $s$0$lcssa43; } else { $17 = Math_imul($0, 16843009)|0; $18 = ($$0$lcssa44>>>0)>(3); L11: do { if ($18) { $$110 = $$0$lcssa44;$w$011 = $s$0$lcssa43; while(1) { $19 = HEAP32[$w$011>>2]|0; $20 = $19 ^ $17; $21 = (($20) + -16843009)|0; $22 = $20 & -2139062144; $23 = $22 ^ -2139062144; $24 = $23 & $21; $25 = ($24|0)==(0); if (!($25)) { $$110$lcssa = $$110;$w$011$lcssa = $w$011; break; } $26 = ((($w$011)) + 4|0); $27 = (($$110) + -4)|0; $28 = ($27>>>0)>(3); if ($28) { $$110 = $27;$w$011 = $26; } else { $$1$lcssa = $27;$w$0$lcssa = $26; label = 11; break L11; } } $$24 = $$110$lcssa;$s$15 = $w$011$lcssa; } else { $$1$lcssa = $$0$lcssa44;$w$0$lcssa = $s$0$lcssa43; label = 11; } } while(0); if ((label|0) == 11) { $29 = ($$1$lcssa|0)==(0); if ($29) { $$3 = 0;$s$2 = $w$0$lcssa; break; } else { $$24 = $$1$lcssa;$s$15 = $w$0$lcssa; } } while(1) { $30 = HEAP8[$s$15>>0]|0; $31 = ($30<<24>>24)==($15<<24>>24); if ($31) { $$3 = $$24;$s$2 = $s$15; break L8; } $32 = ((($s$15)) + 1|0); $33 = (($$24) + -1)|0; $34 = ($33|0)==(0); if ($34) { $$3 = 0;$s$2 = $32; break; } else { $$24 = $33;$s$15 = $32; } } } } } while(0); $35 = ($$3|0)!=(0); $36 = $35 ? $s$2 : 0; return ($36|0); } function ___fflush_unlocked($f) { $f = $f|0; var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; var $9 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($f)) + 20|0); $1 = HEAP32[$0>>2]|0; $2 = ((($f)) + 28|0); $3 = HEAP32[$2>>2]|0; $4 = ($1>>>0)>($3>>>0); if ($4) { $5 = ((($f)) + 36|0); $6 = HEAP32[$5>>2]|0; (FUNCTION_TABLE_iiii[$6 & 7]($f,0,0)|0); $7 = HEAP32[$0>>2]|0; $8 = ($7|0)==(0|0); if ($8) { $$0 = -1; } else { label = 3; } } else { label = 3; } if ((label|0) == 3) { $9 = ((($f)) + 4|0); $10 = HEAP32[$9>>2]|0; $11 = ((($f)) + 8|0); $12 = HEAP32[$11>>2]|0; $13 = ($10>>>0)<($12>>>0); if ($13) { $14 = ((($f)) + 40|0); $15 = HEAP32[$14>>2]|0; $16 = $10; $17 = $12; $18 = (($16) - ($17))|0; (FUNCTION_TABLE_iiii[$15 & 7]($f,$18,1)|0); } $19 = ((($f)) + 16|0); HEAP32[$19>>2] = 0; HEAP32[$2>>2] = 0; HEAP32[$0>>2] = 0; HEAP32[$11>>2] = 0; HEAP32[$9>>2] = 0; $$0 = 0; } return ($$0|0); } function _printf_core($f,$fmt,$ap,$nl_arg,$nl_type) { $f = $f|0; $fmt = $fmt|0; $ap = $ap|0; $nl_arg = $nl_arg|0; $nl_type = $nl_type|0; var $$ = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$012$i = 0, $$013$i = 0, $$03$i33 = 0, $$07$i = 0.0, $$1$i = 0.0, $$114$i = 0, $$2$i = 0.0, $$20$i = 0.0, $$21$i = 0, $$210$$22$i = 0, $$210$$24$i = 0, $$210$i = 0, $$23$i = 0, $$3$i = 0.0, $$31$i = 0; var $$311$i = 0, $$4$i = 0.0, $$412$lcssa$i = 0, $$41276$i = 0, $$5$lcssa$i = 0, $$51 = 0, $$587$i = 0, $$a$3$i = 0, $$a$3185$i = 0, $$a$3186$i = 0, $$fl$4 = 0, $$l10n$0 = 0, $$lcssa = 0, $$lcssa159$i = 0, $$lcssa318 = 0, $$lcssa323 = 0, $$lcssa324 = 0, $$lcssa325 = 0, $$lcssa326 = 0, $$lcssa327 = 0; var $$lcssa329 = 0, $$lcssa339 = 0, $$lcssa342 = 0.0, $$lcssa344 = 0, $$neg52$i = 0, $$neg53$i = 0, $$p$$i = 0, $$p$0 = 0, $$p$5 = 0, $$p$i = 0, $$pn$i = 0, $$pr$i = 0, $$pr47$i = 0, $$pre = 0, $$pre$i = 0, $$pre$phi184$iZ2D = 0, $$pre179$i = 0, $$pre182$i = 0, $$pre183$i = 0, $$pre193 = 0; var $$sum$i = 0, $$sum15$i = 0, $$sum16$i = 0, $$z$3$i = 0, $$z$4$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0; var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0; var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0; var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0; var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0; var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0; var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0; var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0; var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0; var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0; var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0; var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0; var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0; var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0; var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0.0; var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0; var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0.0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0; var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0.0, $413 = 0.0, $414 = 0.0, $415 = 0.0, $416 = 0.0, $417 = 0; var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0; var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0.0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0; var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0; var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0.0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0.0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0; var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0; var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0; var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0; var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0; var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0; var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0.0, $597 = 0.0, $598 = 0; var $599 = 0.0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0; var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0; var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0; var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0; var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0; var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0; var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0; var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0; var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0; var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0; var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0; var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; var $98 = 0, $99 = 0, $a$0 = 0, $a$1 = 0, $a$1$lcssa$i = 0, $a$1147$i = 0, $a$2 = 0, $a$2$ph$i = 0, $a$3$lcssa$i = 0, $a$3134$i = 0, $a$5$lcssa$i = 0, $a$5109$i = 0, $a$6$i = 0, $a$7$i = 0, $a$8$ph$i = 0, $arg = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0; var $argpos$0 = 0, $big$i = 0, $buf = 0, $buf$i = 0, $carry$0140$i = 0, $carry3$0128$i = 0, $cnt$0 = 0, $cnt$1 = 0, $cnt$1$lcssa = 0, $d$0$i = 0, $d$0139$i = 0, $d$0141$i = 0, $d$1127$i = 0, $d$2$lcssa$i = 0, $d$2108$i = 0, $d$3$i = 0, $d$482$i = 0, $d$575$i = 0, $d$686$i = 0, $e$0123$i = 0; var $e$1$i = 0, $e$2104$i = 0, $e$3$i = 0, $e$4$ph$i = 0, $e2$i = 0, $ebuf0$i = 0, $estr$0$i = 0, $estr$1$lcssa$i = 0, $estr$193$i = 0, $estr$2$i = 0, $exitcond$i = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0; var $expanded8 = 0, $fl$0109 = 0, $fl$062 = 0, $fl$1 = 0, $fl$1$ = 0, $fl$3 = 0, $fl$4 = 0, $fl$6 = 0, $fmt39$lcssa = 0, $fmt39101 = 0, $fmt40 = 0, $fmt41 = 0, $fmt42 = 0, $fmt44 = 0, $fmt44$lcssa321 = 0, $fmt45 = 0, $i$0$lcssa = 0, $i$0$lcssa200 = 0, $i$0114 = 0, $i$0122$i = 0; var $i$03$i = 0, $i$03$i25 = 0, $i$1$lcssa$i = 0, $i$1116$i = 0, $i$1125 = 0, $i$2100 = 0, $i$2100$lcssa = 0, $i$2103$i = 0, $i$398 = 0, $i$399$i = 0, $isdigit = 0, $isdigit$i = 0, $isdigit$i27 = 0, $isdigit10 = 0, $isdigit12 = 0, $isdigit2$i = 0, $isdigit2$i23 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp$i = 0; var $isdigittmp$i26 = 0, $isdigittmp1$i = 0, $isdigittmp1$i22 = 0, $isdigittmp11 = 0, $isdigittmp4$i = 0, $isdigittmp4$i24 = 0, $isdigittmp9 = 0, $j$0$i = 0, $j$0115$i = 0, $j$0117$i = 0, $j$1100$i = 0, $j$2$i = 0, $l$0 = 0, $l$0$i = 0, $l$1$i = 0, $l$1113 = 0, $l$2 = 0, $l10n$0 = 0, $l10n$0$lcssa = 0, $l10n$0$phi = 0; var $l10n$1 = 0, $l10n$2 = 0, $l10n$3 = 0, $mb = 0, $notlhs$i = 0, $notrhs$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond15 = 0, $or$cond17 = 0, $or$cond20 = 0, $or$cond240 = 0, $or$cond29$i = 0, $or$cond3$not$i = 0, $or$cond6$i = 0, $p$0 = 0, $p$1 = 0, $p$2 = 0, $p$2$ = 0, $p$3 = 0; var $p$4198 = 0, $p$5 = 0, $pl$0 = 0, $pl$0$i = 0, $pl$1 = 0, $pl$1$i = 0, $pl$2 = 0, $prefix$0 = 0, $prefix$0$$i = 0, $prefix$0$i = 0, $prefix$1 = 0, $prefix$2 = 0, $r$0$a$8$i = 0, $re$169$i = 0, $round$068$i = 0.0, $round6$1$i = 0.0, $s$0$i = 0, $s$1$i = 0, $s$1$i$lcssa = 0, $s1$0$i = 0; var $s7$079$i = 0, $s7$1$i = 0, $s8$0$lcssa$i = 0, $s8$070$i = 0, $s9$0$i = 0, $s9$183$i = 0, $s9$2$i = 0, $small$0$i = 0.0, $small$1$i = 0.0, $st$0 = 0, $st$0$lcssa322 = 0, $storemerge = 0, $storemerge13 = 0, $storemerge8108 = 0, $storemerge860 = 0, $sum = 0, $t$0 = 0, $t$1 = 0, $w$$i = 0, $w$0 = 0; var $w$1 = 0, $w$2 = 0, $w$30$i = 0, $wc = 0, $ws$0115 = 0, $ws$1126 = 0, $z$0$i = 0, $z$0$lcssa = 0, $z$0102 = 0, $z$1 = 0, $z$1$lcssa$i = 0, $z$1146$i = 0, $z$2 = 0, $z$2$i = 0, $z$2$i$lcssa = 0, $z$3$lcssa$i = 0, $z$3133$i = 0, $z$4$i = 0, $z$6$$i = 0, $z$6$i = 0; var $z$6$i$lcssa = 0, $z$6$ph$i = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 624|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $big$i = sp + 24|0; $e2$i = sp + 16|0; $buf$i = sp + 588|0; $ebuf0$i = sp + 576|0; $arg = sp; $buf = sp + 536|0; $wc = sp + 8|0; $mb = sp + 528|0; $0 = ($f|0)!=(0|0); $1 = ((($buf)) + 40|0); $2 = $1; $3 = ((($buf)) + 39|0); $4 = ((($wc)) + 4|0); $5 = ((($ebuf0$i)) + 12|0); $6 = ((($ebuf0$i)) + 11|0); $7 = $buf$i; $8 = $5; $9 = (($8) - ($7))|0; $10 = (-2 - ($7))|0; $11 = (($8) + 2)|0; $12 = ((($big$i)) + 288|0); $13 = ((($buf$i)) + 9|0); $14 = $13; $15 = ((($buf$i)) + 8|0); $cnt$0 = 0;$fmt41 = $fmt;$l$0 = 0;$l10n$0 = 0; L1: while(1) { $16 = ($cnt$0|0)>(-1); do { if ($16) { $17 = (2147483647 - ($cnt$0))|0; $18 = ($l$0|0)>($17|0); if ($18) { $19 = (___errno_location()|0); HEAP32[$19>>2] = 75; $cnt$1 = -1; break; } else { $20 = (($l$0) + ($cnt$0))|0; $cnt$1 = $20; break; } } else { $cnt$1 = $cnt$0; } } while(0); $21 = HEAP8[$fmt41>>0]|0; $22 = ($21<<24>>24)==(0); if ($22) { $cnt$1$lcssa = $cnt$1;$l10n$0$lcssa = $l10n$0; label = 245; break; } else { $23 = $21;$fmt40 = $fmt41; } L9: while(1) { switch ($23<<24>>24) { case 37: { $fmt39101 = $fmt40;$z$0102 = $fmt40; label = 9; break L9; break; } case 0: { $fmt39$lcssa = $fmt40;$z$0$lcssa = $fmt40; break L9; break; } default: { } } $24 = ((($fmt40)) + 1|0); $$pre = HEAP8[$24>>0]|0; $23 = $$pre;$fmt40 = $24; } L12: do { if ((label|0) == 9) { while(1) { label = 0; $25 = ((($fmt39101)) + 1|0); $26 = HEAP8[$25>>0]|0; $27 = ($26<<24>>24)==(37); if (!($27)) { $fmt39$lcssa = $fmt39101;$z$0$lcssa = $z$0102; break L12; } $28 = ((($z$0102)) + 1|0); $29 = ((($fmt39101)) + 2|0); $30 = HEAP8[$29>>0]|0; $31 = ($30<<24>>24)==(37); if ($31) { $fmt39101 = $29;$z$0102 = $28; label = 9; } else { $fmt39$lcssa = $29;$z$0$lcssa = $28; break; } } } } while(0); $32 = $z$0$lcssa; $33 = $fmt41; $34 = (($32) - ($33))|0; if ($0) { $35 = HEAP32[$f>>2]|0; $36 = $35 & 32; $37 = ($36|0)==(0); if ($37) { (___fwritex($fmt41,$34,$f)|0); } } $38 = ($z$0$lcssa|0)==($fmt41|0); if (!($38)) { $l10n$0$phi = $l10n$0;$cnt$0 = $cnt$1;$fmt41 = $fmt39$lcssa;$l$0 = $34;$l10n$0 = $l10n$0$phi; continue; } $39 = ((($fmt39$lcssa)) + 1|0); $40 = HEAP8[$39>>0]|0; $41 = $40 << 24 >> 24; $isdigittmp = (($41) + -48)|0; $isdigit = ($isdigittmp>>>0)<(10); if ($isdigit) { $42 = ((($fmt39$lcssa)) + 2|0); $43 = HEAP8[$42>>0]|0; $44 = ($43<<24>>24)==(36); $45 = ((($fmt39$lcssa)) + 3|0); $$51 = $44 ? $45 : $39; $$l10n$0 = $44 ? 1 : $l10n$0; $isdigittmp$ = $44 ? $isdigittmp : -1; $$pre193 = HEAP8[$$51>>0]|0; $47 = $$pre193;$argpos$0 = $isdigittmp$;$l10n$1 = $$l10n$0;$storemerge = $$51; } else { $47 = $40;$argpos$0 = -1;$l10n$1 = $l10n$0;$storemerge = $39; } $46 = $47 << 24 >> 24; $48 = $46 & -32; $49 = ($48|0)==(32); L25: do { if ($49) { $51 = $46;$56 = $47;$fl$0109 = 0;$storemerge8108 = $storemerge; while(1) { $50 = (($51) + -32)|0; $52 = 1 << $50; $53 = $52 & 75913; $54 = ($53|0)==(0); if ($54) { $65 = $56;$fl$062 = $fl$0109;$storemerge860 = $storemerge8108; break L25; } $55 = $56 << 24 >> 24; $57 = (($55) + -32)|0; $58 = 1 << $57; $59 = $58 | $fl$0109; $60 = ((($storemerge8108)) + 1|0); $61 = HEAP8[$60>>0]|0; $62 = $61 << 24 >> 24; $63 = $62 & -32; $64 = ($63|0)==(32); if ($64) { $51 = $62;$56 = $61;$fl$0109 = $59;$storemerge8108 = $60; } else { $65 = $61;$fl$062 = $59;$storemerge860 = $60; break; } } } else { $65 = $47;$fl$062 = 0;$storemerge860 = $storemerge; } } while(0); $66 = ($65<<24>>24)==(42); do { if ($66) { $67 = ((($storemerge860)) + 1|0); $68 = HEAP8[$67>>0]|0; $69 = $68 << 24 >> 24; $isdigittmp11 = (($69) + -48)|0; $isdigit12 = ($isdigittmp11>>>0)<(10); if ($isdigit12) { $70 = ((($storemerge860)) + 2|0); $71 = HEAP8[$70>>0]|0; $72 = ($71<<24>>24)==(36); if ($72) { $73 = (($nl_type) + ($isdigittmp11<<2)|0); HEAP32[$73>>2] = 10; $74 = HEAP8[$67>>0]|0; $75 = $74 << 24 >> 24; $76 = (($75) + -48)|0; $77 = (($nl_arg) + ($76<<3)|0); $78 = $77; $79 = $78; $80 = HEAP32[$79>>2]|0; $81 = (($78) + 4)|0; $82 = $81; $83 = HEAP32[$82>>2]|0; $84 = ((($storemerge860)) + 3|0); $l10n$2 = 1;$storemerge13 = $84;$w$0 = $80; } else { label = 24; } } else { label = 24; } if ((label|0) == 24) { label = 0; $85 = ($l10n$1|0)==(0); if (!($85)) { $$0 = -1; break L1; } if (!($0)) { $fl$1 = $fl$062;$fmt42 = $67;$l10n$3 = 0;$w$1 = 0; break; } $arglist_current = HEAP32[$ap>>2]|0; $86 = $arglist_current; $87 = ((0) + 4|0); $expanded4 = $87; $expanded = (($expanded4) - 1)|0; $88 = (($86) + ($expanded))|0; $89 = ((0) + 4|0); $expanded8 = $89; $expanded7 = (($expanded8) - 1)|0; $expanded6 = $expanded7 ^ -1; $90 = $88 & $expanded6; $91 = $90; $92 = HEAP32[$91>>2]|0; $arglist_next = ((($91)) + 4|0); HEAP32[$ap>>2] = $arglist_next; $l10n$2 = 0;$storemerge13 = $67;$w$0 = $92; } $93 = ($w$0|0)<(0); if ($93) { $94 = $fl$062 | 8192; $95 = (0 - ($w$0))|0; $fl$1 = $94;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $95; } else { $fl$1 = $fl$062;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $w$0; } } else { $96 = $65 << 24 >> 24; $isdigittmp1$i = (($96) + -48)|0; $isdigit2$i = ($isdigittmp1$i>>>0)<(10); if ($isdigit2$i) { $100 = $storemerge860;$i$03$i = 0;$isdigittmp4$i = $isdigittmp1$i; while(1) { $97 = ($i$03$i*10)|0; $98 = (($97) + ($isdigittmp4$i))|0; $99 = ((($100)) + 1|0); $101 = HEAP8[$99>>0]|0; $102 = $101 << 24 >> 24; $isdigittmp$i = (($102) + -48)|0; $isdigit$i = ($isdigittmp$i>>>0)<(10); if ($isdigit$i) { $100 = $99;$i$03$i = $98;$isdigittmp4$i = $isdigittmp$i; } else { $$lcssa = $98;$$lcssa318 = $99; break; } } $103 = ($$lcssa|0)<(0); if ($103) { $$0 = -1; break L1; } else { $fl$1 = $fl$062;$fmt42 = $$lcssa318;$l10n$3 = $l10n$1;$w$1 = $$lcssa; } } else { $fl$1 = $fl$062;$fmt42 = $storemerge860;$l10n$3 = $l10n$1;$w$1 = 0; } } } while(0); $104 = HEAP8[$fmt42>>0]|0; $105 = ($104<<24>>24)==(46); L46: do { if ($105) { $106 = ((($fmt42)) + 1|0); $107 = HEAP8[$106>>0]|0; $108 = ($107<<24>>24)==(42); if (!($108)) { $135 = $107 << 24 >> 24; $isdigittmp1$i22 = (($135) + -48)|0; $isdigit2$i23 = ($isdigittmp1$i22>>>0)<(10); if ($isdigit2$i23) { $139 = $106;$i$03$i25 = 0;$isdigittmp4$i24 = $isdigittmp1$i22; } else { $fmt45 = $106;$p$0 = 0; break; } while(1) { $136 = ($i$03$i25*10)|0; $137 = (($136) + ($isdigittmp4$i24))|0; $138 = ((($139)) + 1|0); $140 = HEAP8[$138>>0]|0; $141 = $140 << 24 >> 24; $isdigittmp$i26 = (($141) + -48)|0; $isdigit$i27 = ($isdigittmp$i26>>>0)<(10); if ($isdigit$i27) { $139 = $138;$i$03$i25 = $137;$isdigittmp4$i24 = $isdigittmp$i26; } else { $fmt45 = $138;$p$0 = $137; break L46; } } } $109 = ((($fmt42)) + 2|0); $110 = HEAP8[$109>>0]|0; $111 = $110 << 24 >> 24; $isdigittmp9 = (($111) + -48)|0; $isdigit10 = ($isdigittmp9>>>0)<(10); if ($isdigit10) { $112 = ((($fmt42)) + 3|0); $113 = HEAP8[$112>>0]|0; $114 = ($113<<24>>24)==(36); if ($114) { $115 = (($nl_type) + ($isdigittmp9<<2)|0); HEAP32[$115>>2] = 10; $116 = HEAP8[$109>>0]|0; $117 = $116 << 24 >> 24; $118 = (($117) + -48)|0; $119 = (($nl_arg) + ($118<<3)|0); $120 = $119; $121 = $120; $122 = HEAP32[$121>>2]|0; $123 = (($120) + 4)|0; $124 = $123; $125 = HEAP32[$124>>2]|0; $126 = ((($fmt42)) + 4|0); $fmt45 = $126;$p$0 = $122; break; } } $127 = ($l10n$3|0)==(0); if (!($127)) { $$0 = -1; break L1; } if ($0) { $arglist_current2 = HEAP32[$ap>>2]|0; $128 = $arglist_current2; $129 = ((0) + 4|0); $expanded11 = $129; $expanded10 = (($expanded11) - 1)|0; $130 = (($128) + ($expanded10))|0; $131 = ((0) + 4|0); $expanded15 = $131; $expanded14 = (($expanded15) - 1)|0; $expanded13 = $expanded14 ^ -1; $132 = $130 & $expanded13; $133 = $132; $134 = HEAP32[$133>>2]|0; $arglist_next3 = ((($133)) + 4|0); HEAP32[$ap>>2] = $arglist_next3; $fmt45 = $109;$p$0 = $134; } else { $fmt45 = $109;$p$0 = 0; } } else { $fmt45 = $fmt42;$p$0 = -1; } } while(0); $fmt44 = $fmt45;$st$0 = 0; while(1) { $142 = HEAP8[$fmt44>>0]|0; $143 = $142 << 24 >> 24; $144 = (($143) + -65)|0; $145 = ($144>>>0)>(57); if ($145) { $$0 = -1; break L1; } $146 = ((($fmt44)) + 1|0); $147 = ((34947 + (($st$0*58)|0)|0) + ($144)|0); $148 = HEAP8[$147>>0]|0; $149 = $148&255; $150 = (($149) + -1)|0; $151 = ($150>>>0)<(8); if ($151) { $fmt44 = $146;$st$0 = $149; } else { $$lcssa323 = $146;$$lcssa324 = $148;$$lcssa325 = $149;$fmt44$lcssa321 = $fmt44;$st$0$lcssa322 = $st$0; break; } } $152 = ($$lcssa324<<24>>24)==(0); if ($152) { $$0 = -1; break; } $153 = ($$lcssa324<<24>>24)==(19); $154 = ($argpos$0|0)>(-1); do { if ($153) { if ($154) { $$0 = -1; break L1; } else { label = 52; } } else { if ($154) { $155 = (($nl_type) + ($argpos$0<<2)|0); HEAP32[$155>>2] = $$lcssa325; $156 = (($nl_arg) + ($argpos$0<<3)|0); $157 = $156; $158 = $157; $159 = HEAP32[$158>>2]|0; $160 = (($157) + 4)|0; $161 = $160; $162 = HEAP32[$161>>2]|0; $163 = $arg; $164 = $163; HEAP32[$164>>2] = $159; $165 = (($163) + 4)|0; $166 = $165; HEAP32[$166>>2] = $162; label = 52; break; } if (!($0)) { $$0 = 0; break L1; } _pop_arg($arg,$$lcssa325,$ap); } } while(0); if ((label|0) == 52) { label = 0; if (!($0)) { $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue; } } $167 = HEAP8[$fmt44$lcssa321>>0]|0; $168 = $167 << 24 >> 24; $169 = ($st$0$lcssa322|0)!=(0); $170 = $168 & 15; $171 = ($170|0)==(3); $or$cond15 = $169 & $171; $172 = $168 & -33; $t$0 = $or$cond15 ? $172 : $168; $173 = $fl$1 & 8192; $174 = ($173|0)==(0); $175 = $fl$1 & -65537; $fl$1$ = $174 ? $fl$1 : $175; L75: do { switch ($t$0|0) { case 110: { switch ($st$0$lcssa322|0) { case 0: { $182 = HEAP32[$arg>>2]|0; HEAP32[$182>>2] = $cnt$1; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 1: { $183 = HEAP32[$arg>>2]|0; HEAP32[$183>>2] = $cnt$1; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 2: { $184 = ($cnt$1|0)<(0); $185 = $184 << 31 >> 31; $186 = HEAP32[$arg>>2]|0; $187 = $186; $188 = $187; HEAP32[$188>>2] = $cnt$1; $189 = (($187) + 4)|0; $190 = $189; HEAP32[$190>>2] = $185; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 3: { $191 = $cnt$1&65535; $192 = HEAP32[$arg>>2]|0; HEAP16[$192>>1] = $191; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 4: { $193 = $cnt$1&255; $194 = HEAP32[$arg>>2]|0; HEAP8[$194>>0] = $193; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 6: { $195 = HEAP32[$arg>>2]|0; HEAP32[$195>>2] = $cnt$1; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } case 7: { $196 = ($cnt$1|0)<(0); $197 = $196 << 31 >> 31; $198 = HEAP32[$arg>>2]|0; $199 = $198; $200 = $199; HEAP32[$200>>2] = $cnt$1; $201 = (($199) + 4)|0; $202 = $201; HEAP32[$202>>2] = $197; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; break; } default: { $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; continue L1; } } break; } case 112: { $203 = ($p$0>>>0)>(8); $204 = $203 ? $p$0 : 8; $205 = $fl$1$ | 8; $fl$3 = $205;$p$1 = $204;$t$1 = 120; label = 64; break; } case 88: case 120: { $fl$3 = $fl$1$;$p$1 = $p$0;$t$1 = $t$0; label = 64; break; } case 111: { $243 = $arg; $244 = $243; $245 = HEAP32[$244>>2]|0; $246 = (($243) + 4)|0; $247 = $246; $248 = HEAP32[$247>>2]|0; $249 = ($245|0)==(0); $250 = ($248|0)==(0); $251 = $249 & $250; if ($251) { $$0$lcssa$i = $1; } else { $$03$i33 = $1;$253 = $245;$257 = $248; while(1) { $252 = $253 & 7; $254 = $252 | 48; $255 = $254&255; $256 = ((($$03$i33)) + -1|0); HEAP8[$256>>0] = $255; $258 = (_bitshift64Lshr(($253|0),($257|0),3)|0); $259 = tempRet0; $260 = ($258|0)==(0); $261 = ($259|0)==(0); $262 = $260 & $261; if ($262) { $$0$lcssa$i = $256; break; } else { $$03$i33 = $256;$253 = $258;$257 = $259; } } } $263 = $fl$1$ & 8; $264 = ($263|0)==(0); if ($264) { $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = 0;$prefix$1 = 35427; label = 77; } else { $265 = $$0$lcssa$i; $266 = (($2) - ($265))|0; $267 = (($266) + 1)|0; $268 = ($p$0|0)<($267|0); $$p$0 = $268 ? $267 : $p$0; $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $$p$0;$pl$1 = 0;$prefix$1 = 35427; label = 77; } break; } case 105: case 100: { $269 = $arg; $270 = $269; $271 = HEAP32[$270>>2]|0; $272 = (($269) + 4)|0; $273 = $272; $274 = HEAP32[$273>>2]|0; $275 = ($274|0)<(0); if ($275) { $276 = (_i64Subtract(0,0,($271|0),($274|0))|0); $277 = tempRet0; $278 = $arg; $279 = $278; HEAP32[$279>>2] = $276; $280 = (($278) + 4)|0; $281 = $280; HEAP32[$281>>2] = $277; $286 = $276;$287 = $277;$pl$0 = 1;$prefix$0 = 35427; label = 76; break L75; } $282 = $fl$1$ & 2048; $283 = ($282|0)==(0); if ($283) { $284 = $fl$1$ & 1; $285 = ($284|0)==(0); $$ = $285 ? 35427 : (35429); $286 = $271;$287 = $274;$pl$0 = $284;$prefix$0 = $$; label = 76; } else { $286 = $271;$287 = $274;$pl$0 = 1;$prefix$0 = (35428); label = 76; } break; } case 117: { $176 = $arg; $177 = $176; $178 = HEAP32[$177>>2]|0; $179 = (($176) + 4)|0; $180 = $179; $181 = HEAP32[$180>>2]|0; $286 = $178;$287 = $181;$pl$0 = 0;$prefix$0 = 35427; label = 76; break; } case 99: { $307 = $arg; $308 = $307; $309 = HEAP32[$308>>2]|0; $310 = (($307) + 4)|0; $311 = $310; $312 = HEAP32[$311>>2]|0; $313 = $309&255; HEAP8[$3>>0] = $313; $a$2 = $3;$fl$6 = $175;$p$5 = 1;$pl$2 = 0;$prefix$2 = 35427;$z$2 = $1; break; } case 109: { $314 = (___errno_location()|0); $315 = HEAP32[$314>>2]|0; $316 = (_strerror($315)|0); $a$1 = $316; label = 82; break; } case 115: { $317 = HEAP32[$arg>>2]|0; $318 = ($317|0)!=(0|0); $319 = $318 ? $317 : 35437; $a$1 = $319; label = 82; break; } case 67: { $326 = $arg; $327 = $326; $328 = HEAP32[$327>>2]|0; $329 = (($326) + 4)|0; $330 = $329; $331 = HEAP32[$330>>2]|0; HEAP32[$wc>>2] = $328; HEAP32[$4>>2] = 0; HEAP32[$arg>>2] = $wc; $p$4198 = -1; label = 86; break; } case 83: { $332 = ($p$0|0)==(0); if ($332) { _pad($f,32,$w$1,0,$fl$1$); $i$0$lcssa200 = 0; label = 98; } else { $p$4198 = $p$0; label = 86; } break; } case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: { $359 = +HEAPF64[$arg>>3]; HEAP32[$e2$i>>2] = 0; HEAPF64[tempDoublePtr>>3] = $359;$360 = HEAP32[tempDoublePtr>>2]|0; $361 = HEAP32[tempDoublePtr+4>>2]|0; $362 = ($361|0)<(0); if ($362) { $363 = -$359; $$07$i = $363;$pl$0$i = 1;$prefix$0$i = 35444; } else { $364 = $fl$1$ & 2048; $365 = ($364|0)==(0); if ($365) { $366 = $fl$1$ & 1; $367 = ($366|0)==(0); $$$i = $367 ? (35445) : (35450); $$07$i = $359;$pl$0$i = $366;$prefix$0$i = $$$i; } else { $$07$i = $359;$pl$0$i = 1;$prefix$0$i = (35447); } } HEAPF64[tempDoublePtr>>3] = $$07$i;$368 = HEAP32[tempDoublePtr>>2]|0; $369 = HEAP32[tempDoublePtr+4>>2]|0; $370 = $369 & 2146435072; $371 = ($370>>>0)<(2146435072); $372 = (0)<(0); $373 = ($370|0)==(2146435072); $374 = $373 & $372; $375 = $371 | $374; do { if ($375) { $391 = (+_frexpl($$07$i,$e2$i)); $392 = $391 * 2.0; $393 = $392 != 0.0; if ($393) { $394 = HEAP32[$e2$i>>2]|0; $395 = (($394) + -1)|0; HEAP32[$e2$i>>2] = $395; } $396 = $t$0 | 32; $397 = ($396|0)==(97); if ($397) { $398 = $t$0 & 32; $399 = ($398|0)==(0); $400 = ((($prefix$0$i)) + 9|0); $prefix$0$$i = $399 ? $prefix$0$i : $400; $401 = $pl$0$i | 2; $402 = ($p$0>>>0)>(11); $403 = (12 - ($p$0))|0; $404 = ($403|0)==(0); $405 = $402 | $404; do { if ($405) { $$1$i = $392; } else { $re$169$i = $403;$round$068$i = 8.0; while(1) { $406 = (($re$169$i) + -1)|0; $407 = $round$068$i * 16.0; $408 = ($406|0)==(0); if ($408) { $$lcssa342 = $407; break; } else { $re$169$i = $406;$round$068$i = $407; } } $409 = HEAP8[$prefix$0$$i>>0]|0; $410 = ($409<<24>>24)==(45); if ($410) { $411 = -$392; $412 = $411 - $$lcssa342; $413 = $$lcssa342 + $412; $414 = -$413; $$1$i = $414; break; } else { $415 = $392 + $$lcssa342; $416 = $415 - $$lcssa342; $$1$i = $416; break; } } } while(0); $417 = HEAP32[$e2$i>>2]|0; $418 = ($417|0)<(0); $419 = (0 - ($417))|0; $420 = $418 ? $419 : $417; $421 = ($420|0)<(0); $422 = $421 << 31 >> 31; $423 = (_fmt_u($420,$422,$5)|0); $424 = ($423|0)==($5|0); if ($424) { HEAP8[$6>>0] = 48; $estr$0$i = $6; } else { $estr$0$i = $423; } $425 = $417 >> 31; $426 = $425 & 2; $427 = (($426) + 43)|0; $428 = $427&255; $429 = ((($estr$0$i)) + -1|0); HEAP8[$429>>0] = $428; $430 = (($t$0) + 15)|0; $431 = $430&255; $432 = ((($estr$0$i)) + -2|0); HEAP8[$432>>0] = $431; $notrhs$i = ($p$0|0)<(1); $433 = $fl$1$ & 8; $434 = ($433|0)==(0); $$2$i = $$1$i;$s$0$i = $buf$i; while(1) { $435 = (~~(($$2$i))); $436 = (35411 + ($435)|0); $437 = HEAP8[$436>>0]|0; $438 = $437&255; $439 = $438 | $398; $440 = $439&255; $441 = ((($s$0$i)) + 1|0); HEAP8[$s$0$i>>0] = $440; $442 = (+($435|0)); $443 = $$2$i - $442; $444 = $443 * 16.0; $445 = $441; $446 = (($445) - ($7))|0; $447 = ($446|0)==(1); do { if ($447) { $notlhs$i = $444 == 0.0; $or$cond3$not$i = $notrhs$i & $notlhs$i; $or$cond$i = $434 & $or$cond3$not$i; if ($or$cond$i) { $s$1$i = $441; break; } $448 = ((($s$0$i)) + 2|0); HEAP8[$441>>0] = 46; $s$1$i = $448; } else { $s$1$i = $441; } } while(0); $449 = $444 != 0.0; if ($449) { $$2$i = $444;$s$0$i = $s$1$i; } else { $s$1$i$lcssa = $s$1$i; break; } } $450 = ($p$0|0)!=(0); $$pre182$i = $s$1$i$lcssa; $451 = (($10) + ($$pre182$i))|0; $452 = ($451|0)<($p$0|0); $or$cond240 = $450 & $452; $453 = $432; $454 = (($11) + ($p$0))|0; $455 = (($454) - ($453))|0; $456 = $432; $457 = (($9) - ($456))|0; $458 = (($457) + ($$pre182$i))|0; $l$0$i = $or$cond240 ? $455 : $458; $459 = (($l$0$i) + ($401))|0; _pad($f,32,$w$1,$459,$fl$1$); $460 = HEAP32[$f>>2]|0; $461 = $460 & 32; $462 = ($461|0)==(0); if ($462) { (___fwritex($prefix$0$$i,$401,$f)|0); } $463 = $fl$1$ ^ 65536; _pad($f,48,$w$1,$459,$463); $464 = (($$pre182$i) - ($7))|0; $465 = HEAP32[$f>>2]|0; $466 = $465 & 32; $467 = ($466|0)==(0); if ($467) { (___fwritex($buf$i,$464,$f)|0); } $468 = $432; $469 = (($8) - ($468))|0; $sum = (($464) + ($469))|0; $470 = (($l$0$i) - ($sum))|0; _pad($f,48,$470,0,0); $471 = HEAP32[$f>>2]|0; $472 = $471 & 32; $473 = ($472|0)==(0); if ($473) { (___fwritex($432,$469,$f)|0); } $474 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$459,$474); $475 = ($459|0)<($w$1|0); $w$$i = $475 ? $w$1 : $459; $$0$i = $w$$i; break; } $476 = ($p$0|0)<(0); $$p$i = $476 ? 6 : $p$0; if ($393) { $477 = $392 * 268435456.0; $478 = HEAP32[$e2$i>>2]|0; $479 = (($478) + -28)|0; HEAP32[$e2$i>>2] = $479; $$3$i = $477;$480 = $479; } else { $$pre179$i = HEAP32[$e2$i>>2]|0; $$3$i = $392;$480 = $$pre179$i; } $481 = ($480|0)<(0); $$31$i = $481 ? $big$i : $12; $482 = $$31$i; $$4$i = $$3$i;$z$0$i = $$31$i; while(1) { $483 = (~~(($$4$i))>>>0); HEAP32[$z$0$i>>2] = $483; $484 = ((($z$0$i)) + 4|0); $485 = (+($483>>>0)); $486 = $$4$i - $485; $487 = $486 * 1.0E+9; $488 = $487 != 0.0; if ($488) { $$4$i = $487;$z$0$i = $484; } else { $$lcssa326 = $484; break; } } $$pr$i = HEAP32[$e2$i>>2]|0; $489 = ($$pr$i|0)>(0); if ($489) { $490 = $$pr$i;$a$1147$i = $$31$i;$z$1146$i = $$lcssa326; while(1) { $491 = ($490|0)>(29); $492 = $491 ? 29 : $490; $d$0139$i = ((($z$1146$i)) + -4|0); $493 = ($d$0139$i>>>0)<($a$1147$i>>>0); do { if ($493) { $a$2$ph$i = $a$1147$i; } else { $carry$0140$i = 0;$d$0141$i = $d$0139$i; while(1) { $494 = HEAP32[$d$0141$i>>2]|0; $495 = (_bitshift64Shl(($494|0),0,($492|0))|0); $496 = tempRet0; $497 = (_i64Add(($495|0),($496|0),($carry$0140$i|0),0)|0); $498 = tempRet0; $499 = (___uremdi3(($497|0),($498|0),1000000000,0)|0); $500 = tempRet0; HEAP32[$d$0141$i>>2] = $499; $501 = (___udivdi3(($497|0),($498|0),1000000000,0)|0); $502 = tempRet0; $d$0$i = ((($d$0141$i)) + -4|0); $503 = ($d$0$i>>>0)<($a$1147$i>>>0); if ($503) { $$lcssa327 = $501; break; } else { $carry$0140$i = $501;$d$0141$i = $d$0$i; } } $504 = ($$lcssa327|0)==(0); if ($504) { $a$2$ph$i = $a$1147$i; break; } $505 = ((($a$1147$i)) + -4|0); HEAP32[$505>>2] = $$lcssa327; $a$2$ph$i = $505; } } while(0); $z$2$i = $z$1146$i; while(1) { $506 = ($z$2$i>>>0)>($a$2$ph$i>>>0); if (!($506)) { $z$2$i$lcssa = $z$2$i; break; } $507 = ((($z$2$i)) + -4|0); $508 = HEAP32[$507>>2]|0; $509 = ($508|0)==(0); if ($509) { $z$2$i = $507; } else { $z$2$i$lcssa = $z$2$i; break; } } $510 = HEAP32[$e2$i>>2]|0; $511 = (($510) - ($492))|0; HEAP32[$e2$i>>2] = $511; $512 = ($511|0)>(0); if ($512) { $490 = $511;$a$1147$i = $a$2$ph$i;$z$1146$i = $z$2$i$lcssa; } else { $$pr47$i = $511;$a$1$lcssa$i = $a$2$ph$i;$z$1$lcssa$i = $z$2$i$lcssa; break; } } } else { $$pr47$i = $$pr$i;$a$1$lcssa$i = $$31$i;$z$1$lcssa$i = $$lcssa326; } $513 = ($$pr47$i|0)<(0); if ($513) { $514 = (($$p$i) + 25)|0; $515 = (($514|0) / 9)&-1; $516 = (($515) + 1)|0; $517 = ($396|0)==(102); $519 = $$pr47$i;$a$3134$i = $a$1$lcssa$i;$z$3133$i = $z$1$lcssa$i; while(1) { $518 = (0 - ($519))|0; $520 = ($518|0)>(9); $521 = $520 ? 9 : $518; $522 = ($a$3134$i>>>0)<($z$3133$i>>>0); do { if ($522) { $526 = 1 << $521; $527 = (($526) + -1)|0; $528 = 1000000000 >>> $521; $carry3$0128$i = 0;$d$1127$i = $a$3134$i; while(1) { $529 = HEAP32[$d$1127$i>>2]|0; $530 = $529 & $527; $531 = $529 >>> $521; $532 = (($531) + ($carry3$0128$i))|0; HEAP32[$d$1127$i>>2] = $532; $533 = Math_imul($530, $528)|0; $534 = ((($d$1127$i)) + 4|0); $535 = ($534>>>0)<($z$3133$i>>>0); if ($535) { $carry3$0128$i = $533;$d$1127$i = $534; } else { $$lcssa329 = $533; break; } } $536 = HEAP32[$a$3134$i>>2]|0; $537 = ($536|0)==(0); $538 = ((($a$3134$i)) + 4|0); $$a$3$i = $537 ? $538 : $a$3134$i; $539 = ($$lcssa329|0)==(0); if ($539) { $$a$3186$i = $$a$3$i;$z$4$i = $z$3133$i; break; } $540 = ((($z$3133$i)) + 4|0); HEAP32[$z$3133$i>>2] = $$lcssa329; $$a$3186$i = $$a$3$i;$z$4$i = $540; } else { $523 = HEAP32[$a$3134$i>>2]|0; $524 = ($523|0)==(0); $525 = ((($a$3134$i)) + 4|0); $$a$3185$i = $524 ? $525 : $a$3134$i; $$a$3186$i = $$a$3185$i;$z$4$i = $z$3133$i; } } while(0); $541 = $517 ? $$31$i : $$a$3186$i; $542 = $z$4$i; $543 = $541; $544 = (($542) - ($543))|0; $545 = $544 >> 2; $546 = ($545|0)>($516|0); $547 = (($541) + ($516<<2)|0); $$z$4$i = $546 ? $547 : $z$4$i; $548 = HEAP32[$e2$i>>2]|0; $549 = (($548) + ($521))|0; HEAP32[$e2$i>>2] = $549; $550 = ($549|0)<(0); if ($550) { $519 = $549;$a$3134$i = $$a$3186$i;$z$3133$i = $$z$4$i; } else { $a$3$lcssa$i = $$a$3186$i;$z$3$lcssa$i = $$z$4$i; break; } } } else { $a$3$lcssa$i = $a$1$lcssa$i;$z$3$lcssa$i = $z$1$lcssa$i; } $551 = ($a$3$lcssa$i>>>0)<($z$3$lcssa$i>>>0); do { if ($551) { $552 = $a$3$lcssa$i; $553 = (($482) - ($552))|0; $554 = $553 >> 2; $555 = ($554*9)|0; $556 = HEAP32[$a$3$lcssa$i>>2]|0; $557 = ($556>>>0)<(10); if ($557) { $e$1$i = $555; break; } else { $e$0123$i = $555;$i$0122$i = 10; } while(1) { $558 = ($i$0122$i*10)|0; $559 = (($e$0123$i) + 1)|0; $560 = ($556>>>0)<($558>>>0); if ($560) { $e$1$i = $559; break; } else { $e$0123$i = $559;$i$0122$i = $558; } } } else { $e$1$i = 0; } } while(0); $561 = ($396|0)!=(102); $562 = $561 ? $e$1$i : 0; $563 = (($$p$i) - ($562))|0; $564 = ($396|0)==(103); $565 = ($$p$i|0)!=(0); $566 = $565 & $564; $$neg52$i = $566 << 31 >> 31; $567 = (($563) + ($$neg52$i))|0; $568 = $z$3$lcssa$i; $569 = (($568) - ($482))|0; $570 = $569 >> 2; $571 = ($570*9)|0; $572 = (($571) + -9)|0; $573 = ($567|0)<($572|0); if ($573) { $574 = (($567) + 9216)|0; $575 = (($574|0) / 9)&-1; $$sum$i = (($575) + -1023)|0; $576 = (($$31$i) + ($$sum$i<<2)|0); $577 = (($574|0) % 9)&-1; $j$0115$i = (($577) + 1)|0; $578 = ($j$0115$i|0)<(9); if ($578) { $i$1116$i = 10;$j$0117$i = $j$0115$i; while(1) { $579 = ($i$1116$i*10)|0; $j$0$i = (($j$0117$i) + 1)|0; $exitcond$i = ($j$0$i|0)==(9); if ($exitcond$i) { $i$1$lcssa$i = $579; break; } else { $i$1116$i = $579;$j$0117$i = $j$0$i; } } } else { $i$1$lcssa$i = 10; } $580 = HEAP32[$576>>2]|0; $581 = (($580>>>0) % ($i$1$lcssa$i>>>0))&-1; $582 = ($581|0)==(0); if ($582) { $$sum15$i = (($575) + -1022)|0; $583 = (($$31$i) + ($$sum15$i<<2)|0); $584 = ($583|0)==($z$3$lcssa$i|0); if ($584) { $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i; } else { label = 163; } } else { label = 163; } do { if ((label|0) == 163) { label = 0; $585 = (($580>>>0) / ($i$1$lcssa$i>>>0))&-1; $586 = $585 & 1; $587 = ($586|0)==(0); $$20$i = $587 ? 9007199254740992.0 : 9007199254740994.0; $588 = (($i$1$lcssa$i|0) / 2)&-1; $589 = ($581>>>0)<($588>>>0); do { if ($589) { $small$0$i = 0.5; } else { $590 = ($581|0)==($588|0); if ($590) { $$sum16$i = (($575) + -1022)|0; $591 = (($$31$i) + ($$sum16$i<<2)|0); $592 = ($591|0)==($z$3$lcssa$i|0); if ($592) { $small$0$i = 1.0; break; } } $small$0$i = 1.5; } } while(0); $593 = ($pl$0$i|0)==(0); do { if ($593) { $round6$1$i = $$20$i;$small$1$i = $small$0$i; } else { $594 = HEAP8[$prefix$0$i>>0]|0; $595 = ($594<<24>>24)==(45); if (!($595)) { $round6$1$i = $$20$i;$small$1$i = $small$0$i; break; } $596 = -$$20$i; $597 = -$small$0$i; $round6$1$i = $596;$small$1$i = $597; } } while(0); $598 = (($580) - ($581))|0; HEAP32[$576>>2] = $598; $599 = $round6$1$i + $small$1$i; $600 = $599 != $round6$1$i; if (!($600)) { $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i; break; } $601 = (($598) + ($i$1$lcssa$i))|0; HEAP32[$576>>2] = $601; $602 = ($601>>>0)>(999999999); if ($602) { $a$5109$i = $a$3$lcssa$i;$d$2108$i = $576; while(1) { $603 = ((($d$2108$i)) + -4|0); HEAP32[$d$2108$i>>2] = 0; $604 = ($603>>>0)<($a$5109$i>>>0); if ($604) { $605 = ((($a$5109$i)) + -4|0); HEAP32[$605>>2] = 0; $a$6$i = $605; } else { $a$6$i = $a$5109$i; } $606 = HEAP32[$603>>2]|0; $607 = (($606) + 1)|0; HEAP32[$603>>2] = $607; $608 = ($607>>>0)>(999999999); if ($608) { $a$5109$i = $a$6$i;$d$2108$i = $603; } else { $a$5$lcssa$i = $a$6$i;$d$2$lcssa$i = $603; break; } } } else { $a$5$lcssa$i = $a$3$lcssa$i;$d$2$lcssa$i = $576; } $609 = $a$5$lcssa$i; $610 = (($482) - ($609))|0; $611 = $610 >> 2; $612 = ($611*9)|0; $613 = HEAP32[$a$5$lcssa$i>>2]|0; $614 = ($613>>>0)<(10); if ($614) { $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $612; break; } else { $e$2104$i = $612;$i$2103$i = 10; } while(1) { $615 = ($i$2103$i*10)|0; $616 = (($e$2104$i) + 1)|0; $617 = ($613>>>0)<($615>>>0); if ($617) { $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $616; break; } else { $e$2104$i = $616;$i$2103$i = $615; } } } } while(0); $618 = ((($d$3$i)) + 4|0); $619 = ($z$3$lcssa$i>>>0)>($618>>>0); $$z$3$i = $619 ? $618 : $z$3$lcssa$i; $a$8$ph$i = $a$7$i;$e$4$ph$i = $e$3$i;$z$6$ph$i = $$z$3$i; } else { $a$8$ph$i = $a$3$lcssa$i;$e$4$ph$i = $e$1$i;$z$6$ph$i = $z$3$lcssa$i; } $620 = (0 - ($e$4$ph$i))|0; $z$6$i = $z$6$ph$i; while(1) { $621 = ($z$6$i>>>0)>($a$8$ph$i>>>0); if (!($621)) { $$lcssa159$i = 0;$z$6$i$lcssa = $z$6$i; break; } $622 = ((($z$6$i)) + -4|0); $623 = HEAP32[$622>>2]|0; $624 = ($623|0)==(0); if ($624) { $z$6$i = $622; } else { $$lcssa159$i = 1;$z$6$i$lcssa = $z$6$i; break; } } do { if ($564) { $625 = $565&1; $626 = $625 ^ 1; $$p$$i = (($626) + ($$p$i))|0; $627 = ($$p$$i|0)>($e$4$ph$i|0); $628 = ($e$4$ph$i|0)>(-5); $or$cond6$i = $627 & $628; if ($or$cond6$i) { $629 = (($t$0) + -1)|0; $$neg53$i = (($$p$$i) + -1)|0; $630 = (($$neg53$i) - ($e$4$ph$i))|0; $$013$i = $629;$$210$i = $630; } else { $631 = (($t$0) + -2)|0; $632 = (($$p$$i) + -1)|0; $$013$i = $631;$$210$i = $632; } $633 = $fl$1$ & 8; $634 = ($633|0)==(0); if (!($634)) { $$114$i = $$013$i;$$311$i = $$210$i;$$pre$phi184$iZ2D = $633; break; } do { if ($$lcssa159$i) { $635 = ((($z$6$i$lcssa)) + -4|0); $636 = HEAP32[$635>>2]|0; $637 = ($636|0)==(0); if ($637) { $j$2$i = 9; break; } $638 = (($636>>>0) % 10)&-1; $639 = ($638|0)==(0); if ($639) { $i$399$i = 10;$j$1100$i = 0; } else { $j$2$i = 0; break; } while(1) { $640 = ($i$399$i*10)|0; $641 = (($j$1100$i) + 1)|0; $642 = (($636>>>0) % ($640>>>0))&-1; $643 = ($642|0)==(0); if ($643) { $i$399$i = $640;$j$1100$i = $641; } else { $j$2$i = $641; break; } } } else { $j$2$i = 9; } } while(0); $644 = $$013$i | 32; $645 = ($644|0)==(102); $646 = $z$6$i$lcssa; $647 = (($646) - ($482))|0; $648 = $647 >> 2; $649 = ($648*9)|0; $650 = (($649) + -9)|0; if ($645) { $651 = (($650) - ($j$2$i))|0; $652 = ($651|0)<(0); $$21$i = $652 ? 0 : $651; $653 = ($$210$i|0)<($$21$i|0); $$210$$22$i = $653 ? $$210$i : $$21$i; $$114$i = $$013$i;$$311$i = $$210$$22$i;$$pre$phi184$iZ2D = 0; break; } else { $654 = (($650) + ($e$4$ph$i))|0; $655 = (($654) - ($j$2$i))|0; $656 = ($655|0)<(0); $$23$i = $656 ? 0 : $655; $657 = ($$210$i|0)<($$23$i|0); $$210$$24$i = $657 ? $$210$i : $$23$i; $$114$i = $$013$i;$$311$i = $$210$$24$i;$$pre$phi184$iZ2D = 0; break; } } else { $$pre183$i = $fl$1$ & 8; $$114$i = $t$0;$$311$i = $$p$i;$$pre$phi184$iZ2D = $$pre183$i; } } while(0); $658 = $$311$i | $$pre$phi184$iZ2D; $659 = ($658|0)!=(0); $660 = $659&1; $661 = $$114$i | 32; $662 = ($661|0)==(102); if ($662) { $663 = ($e$4$ph$i|0)>(0); $664 = $663 ? $e$4$ph$i : 0; $$pn$i = $664;$estr$2$i = 0; } else { $665 = ($e$4$ph$i|0)<(0); $666 = $665 ? $620 : $e$4$ph$i; $667 = ($666|0)<(0); $668 = $667 << 31 >> 31; $669 = (_fmt_u($666,$668,$5)|0); $670 = $669; $671 = (($8) - ($670))|0; $672 = ($671|0)<(2); if ($672) { $estr$193$i = $669; while(1) { $673 = ((($estr$193$i)) + -1|0); HEAP8[$673>>0] = 48; $674 = $673; $675 = (($8) - ($674))|0; $676 = ($675|0)<(2); if ($676) { $estr$193$i = $673; } else { $estr$1$lcssa$i = $673; break; } } } else { $estr$1$lcssa$i = $669; } $677 = $e$4$ph$i >> 31; $678 = $677 & 2; $679 = (($678) + 43)|0; $680 = $679&255; $681 = ((($estr$1$lcssa$i)) + -1|0); HEAP8[$681>>0] = $680; $682 = $$114$i&255; $683 = ((($estr$1$lcssa$i)) + -2|0); HEAP8[$683>>0] = $682; $684 = $683; $685 = (($8) - ($684))|0; $$pn$i = $685;$estr$2$i = $683; } $686 = (($pl$0$i) + 1)|0; $687 = (($686) + ($$311$i))|0; $l$1$i = (($687) + ($660))|0; $688 = (($l$1$i) + ($$pn$i))|0; _pad($f,32,$w$1,$688,$fl$1$); $689 = HEAP32[$f>>2]|0; $690 = $689 & 32; $691 = ($690|0)==(0); if ($691) { (___fwritex($prefix$0$i,$pl$0$i,$f)|0); } $692 = $fl$1$ ^ 65536; _pad($f,48,$w$1,$688,$692); do { if ($662) { $693 = ($a$8$ph$i>>>0)>($$31$i>>>0); $r$0$a$8$i = $693 ? $$31$i : $a$8$ph$i; $d$482$i = $r$0$a$8$i; while(1) { $694 = HEAP32[$d$482$i>>2]|0; $695 = (_fmt_u($694,0,$13)|0); $696 = ($d$482$i|0)==($r$0$a$8$i|0); do { if ($696) { $700 = ($695|0)==($13|0); if (!($700)) { $s7$1$i = $695; break; } HEAP8[$15>>0] = 48; $s7$1$i = $15; } else { $697 = ($695>>>0)>($buf$i>>>0); if ($697) { $s7$079$i = $695; } else { $s7$1$i = $695; break; } while(1) { $698 = ((($s7$079$i)) + -1|0); HEAP8[$698>>0] = 48; $699 = ($698>>>0)>($buf$i>>>0); if ($699) { $s7$079$i = $698; } else { $s7$1$i = $698; break; } } } } while(0); $701 = HEAP32[$f>>2]|0; $702 = $701 & 32; $703 = ($702|0)==(0); if ($703) { $704 = $s7$1$i; $705 = (($14) - ($704))|0; (___fwritex($s7$1$i,$705,$f)|0); } $706 = ((($d$482$i)) + 4|0); $707 = ($706>>>0)>($$31$i>>>0); if ($707) { $$lcssa339 = $706; break; } else { $d$482$i = $706; } } $708 = ($658|0)==(0); do { if (!($708)) { $709 = HEAP32[$f>>2]|0; $710 = $709 & 32; $711 = ($710|0)==(0); if (!($711)) { break; } (___fwritex(35479,1,$f)|0); } } while(0); $712 = ($$lcssa339>>>0)<($z$6$i$lcssa>>>0); $713 = ($$311$i|0)>(0); $714 = $713 & $712; if ($714) { $$41276$i = $$311$i;$d$575$i = $$lcssa339; while(1) { $715 = HEAP32[$d$575$i>>2]|0; $716 = (_fmt_u($715,0,$13)|0); $717 = ($716>>>0)>($buf$i>>>0); if ($717) { $s8$070$i = $716; while(1) { $718 = ((($s8$070$i)) + -1|0); HEAP8[$718>>0] = 48; $719 = ($718>>>0)>($buf$i>>>0); if ($719) { $s8$070$i = $718; } else { $s8$0$lcssa$i = $718; break; } } } else { $s8$0$lcssa$i = $716; } $720 = HEAP32[$f>>2]|0; $721 = $720 & 32; $722 = ($721|0)==(0); if ($722) { $723 = ($$41276$i|0)>(9); $724 = $723 ? 9 : $$41276$i; (___fwritex($s8$0$lcssa$i,$724,$f)|0); } $725 = ((($d$575$i)) + 4|0); $726 = (($$41276$i) + -9)|0; $727 = ($725>>>0)<($z$6$i$lcssa>>>0); $728 = ($$41276$i|0)>(9); $729 = $728 & $727; if ($729) { $$41276$i = $726;$d$575$i = $725; } else { $$412$lcssa$i = $726; break; } } } else { $$412$lcssa$i = $$311$i; } $730 = (($$412$lcssa$i) + 9)|0; _pad($f,48,$730,9,0); } else { $731 = ((($a$8$ph$i)) + 4|0); $z$6$$i = $$lcssa159$i ? $z$6$i$lcssa : $731; $732 = ($$311$i|0)>(-1); if ($732) { $733 = ($$pre$phi184$iZ2D|0)==(0); $$587$i = $$311$i;$d$686$i = $a$8$ph$i; while(1) { $734 = HEAP32[$d$686$i>>2]|0; $735 = (_fmt_u($734,0,$13)|0); $736 = ($735|0)==($13|0); if ($736) { HEAP8[$15>>0] = 48; $s9$0$i = $15; } else { $s9$0$i = $735; } $737 = ($d$686$i|0)==($a$8$ph$i|0); do { if ($737) { $741 = ((($s9$0$i)) + 1|0); $742 = HEAP32[$f>>2]|0; $743 = $742 & 32; $744 = ($743|0)==(0); if ($744) { (___fwritex($s9$0$i,1,$f)|0); } $745 = ($$587$i|0)<(1); $or$cond29$i = $733 & $745; if ($or$cond29$i) { $s9$2$i = $741; break; } $746 = HEAP32[$f>>2]|0; $747 = $746 & 32; $748 = ($747|0)==(0); if (!($748)) { $s9$2$i = $741; break; } (___fwritex(35479,1,$f)|0); $s9$2$i = $741; } else { $738 = ($s9$0$i>>>0)>($buf$i>>>0); if ($738) { $s9$183$i = $s9$0$i; } else { $s9$2$i = $s9$0$i; break; } while(1) { $739 = ((($s9$183$i)) + -1|0); HEAP8[$739>>0] = 48; $740 = ($739>>>0)>($buf$i>>>0); if ($740) { $s9$183$i = $739; } else { $s9$2$i = $739; break; } } } } while(0); $749 = $s9$2$i; $750 = (($14) - ($749))|0; $751 = HEAP32[$f>>2]|0; $752 = $751 & 32; $753 = ($752|0)==(0); if ($753) { $754 = ($$587$i|0)>($750|0); $755 = $754 ? $750 : $$587$i; (___fwritex($s9$2$i,$755,$f)|0); } $756 = (($$587$i) - ($750))|0; $757 = ((($d$686$i)) + 4|0); $758 = ($757>>>0)<($z$6$$i>>>0); $759 = ($756|0)>(-1); $760 = $758 & $759; if ($760) { $$587$i = $756;$d$686$i = $757; } else { $$5$lcssa$i = $756; break; } } } else { $$5$lcssa$i = $$311$i; } $761 = (($$5$lcssa$i) + 18)|0; _pad($f,48,$761,18,0); $762 = HEAP32[$f>>2]|0; $763 = $762 & 32; $764 = ($763|0)==(0); if (!($764)) { break; } $765 = $estr$2$i; $766 = (($8) - ($765))|0; (___fwritex($estr$2$i,$766,$f)|0); } } while(0); $767 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$688,$767); $768 = ($688|0)<($w$1|0); $w$30$i = $768 ? $w$1 : $688; $$0$i = $w$30$i; } else { $376 = $t$0 & 32; $377 = ($376|0)!=(0); $378 = $377 ? 35463 : 35467; $379 = ($$07$i != $$07$i) | (0.0 != 0.0); $380 = $377 ? 35471 : 35475; $pl$1$i = $379 ? 0 : $pl$0$i; $s1$0$i = $379 ? $380 : $378; $381 = (($pl$1$i) + 3)|0; _pad($f,32,$w$1,$381,$175); $382 = HEAP32[$f>>2]|0; $383 = $382 & 32; $384 = ($383|0)==(0); if ($384) { (___fwritex($prefix$0$i,$pl$1$i,$f)|0); $$pre$i = HEAP32[$f>>2]|0; $386 = $$pre$i; } else { $386 = $382; } $385 = $386 & 32; $387 = ($385|0)==(0); if ($387) { (___fwritex($s1$0$i,3,$f)|0); } $388 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$381,$388); $389 = ($381|0)<($w$1|0); $390 = $389 ? $w$1 : $381; $$0$i = $390; } } while(0); $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $$0$i;$l10n$0 = $l10n$3; continue L1; break; } default: { $a$2 = $fmt41;$fl$6 = $fl$1$;$p$5 = $p$0;$pl$2 = 0;$prefix$2 = 35427;$z$2 = $1; } } } while(0); L313: do { if ((label|0) == 64) { label = 0; $206 = $arg; $207 = $206; $208 = HEAP32[$207>>2]|0; $209 = (($206) + 4)|0; $210 = $209; $211 = HEAP32[$210>>2]|0; $212 = $t$1 & 32; $213 = ($208|0)==(0); $214 = ($211|0)==(0); $215 = $213 & $214; if ($215) { $a$0 = $1;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 35427; label = 77; } else { $$012$i = $1;$217 = $208;$224 = $211; while(1) { $216 = $217 & 15; $218 = (35411 + ($216)|0); $219 = HEAP8[$218>>0]|0; $220 = $219&255; $221 = $220 | $212; $222 = $221&255; $223 = ((($$012$i)) + -1|0); HEAP8[$223>>0] = $222; $225 = (_bitshift64Lshr(($217|0),($224|0),4)|0); $226 = tempRet0; $227 = ($225|0)==(0); $228 = ($226|0)==(0); $229 = $227 & $228; if ($229) { $$lcssa344 = $223; break; } else { $$012$i = $223;$217 = $225;$224 = $226; } } $230 = $arg; $231 = $230; $232 = HEAP32[$231>>2]|0; $233 = (($230) + 4)|0; $234 = $233; $235 = HEAP32[$234>>2]|0; $236 = ($232|0)==(0); $237 = ($235|0)==(0); $238 = $236 & $237; $239 = $fl$3 & 8; $240 = ($239|0)==(0); $or$cond17 = $240 | $238; if ($or$cond17) { $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 35427; label = 77; } else { $241 = $t$1 >> 4; $242 = (35427 + ($241)|0); $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 2;$prefix$1 = $242; label = 77; } } } else if ((label|0) == 76) { label = 0; $288 = (_fmt_u($286,$287,$1)|0); $a$0 = $288;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = $pl$0;$prefix$1 = $prefix$0; label = 77; } else if ((label|0) == 82) { label = 0; $320 = (_memchr($a$1,0,$p$0)|0); $321 = ($320|0)==(0|0); $322 = $320; $323 = $a$1; $324 = (($322) - ($323))|0; $325 = (($a$1) + ($p$0)|0); $z$1 = $321 ? $325 : $320; $p$3 = $321 ? $p$0 : $324; $a$2 = $a$1;$fl$6 = $175;$p$5 = $p$3;$pl$2 = 0;$prefix$2 = 35427;$z$2 = $z$1; } else if ((label|0) == 86) { label = 0; $333 = HEAP32[$arg>>2]|0; $i$0114 = 0;$l$1113 = 0;$ws$0115 = $333; while(1) { $334 = HEAP32[$ws$0115>>2]|0; $335 = ($334|0)==(0); if ($335) { $i$0$lcssa = $i$0114;$l$2 = $l$1113; break; } $336 = (_wctomb($mb,$334)|0); $337 = ($336|0)<(0); $338 = (($p$4198) - ($i$0114))|0; $339 = ($336>>>0)>($338>>>0); $or$cond20 = $337 | $339; if ($or$cond20) { $i$0$lcssa = $i$0114;$l$2 = $336; break; } $340 = ((($ws$0115)) + 4|0); $341 = (($336) + ($i$0114))|0; $342 = ($p$4198>>>0)>($341>>>0); if ($342) { $i$0114 = $341;$l$1113 = $336;$ws$0115 = $340; } else { $i$0$lcssa = $341;$l$2 = $336; break; } } $343 = ($l$2|0)<(0); if ($343) { $$0 = -1; break L1; } _pad($f,32,$w$1,$i$0$lcssa,$fl$1$); $344 = ($i$0$lcssa|0)==(0); if ($344) { $i$0$lcssa200 = 0; label = 98; } else { $345 = HEAP32[$arg>>2]|0; $i$1125 = 0;$ws$1126 = $345; while(1) { $346 = HEAP32[$ws$1126>>2]|0; $347 = ($346|0)==(0); if ($347) { $i$0$lcssa200 = $i$0$lcssa; label = 98; break L313; } $348 = ((($ws$1126)) + 4|0); $349 = (_wctomb($mb,$346)|0); $350 = (($349) + ($i$1125))|0; $351 = ($350|0)>($i$0$lcssa|0); if ($351) { $i$0$lcssa200 = $i$0$lcssa; label = 98; break L313; } $352 = HEAP32[$f>>2]|0; $353 = $352 & 32; $354 = ($353|0)==(0); if ($354) { (___fwritex($mb,$349,$f)|0); } $355 = ($350>>>0)<($i$0$lcssa>>>0); if ($355) { $i$1125 = $350;$ws$1126 = $348; } else { $i$0$lcssa200 = $i$0$lcssa; label = 98; break; } } } } } while(0); if ((label|0) == 98) { label = 0; $356 = $fl$1$ ^ 8192; _pad($f,32,$w$1,$i$0$lcssa200,$356); $357 = ($w$1|0)>($i$0$lcssa200|0); $358 = $357 ? $w$1 : $i$0$lcssa200; $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $358;$l10n$0 = $l10n$3; continue; } if ((label|0) == 77) { label = 0; $289 = ($p$2|0)>(-1); $290 = $fl$4 & -65537; $$fl$4 = $289 ? $290 : $fl$4; $291 = $arg; $292 = $291; $293 = HEAP32[$292>>2]|0; $294 = (($291) + 4)|0; $295 = $294; $296 = HEAP32[$295>>2]|0; $297 = ($293|0)!=(0); $298 = ($296|0)!=(0); $299 = $297 | $298; $300 = ($p$2|0)!=(0); $or$cond = $300 | $299; if ($or$cond) { $301 = $a$0; $302 = (($2) - ($301))|0; $303 = $299&1; $304 = $303 ^ 1; $305 = (($304) + ($302))|0; $306 = ($p$2|0)>($305|0); $p$2$ = $306 ? $p$2 : $305; $a$2 = $a$0;$fl$6 = $$fl$4;$p$5 = $p$2$;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1; } else { $a$2 = $1;$fl$6 = $$fl$4;$p$5 = 0;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1; } } $769 = $z$2; $770 = $a$2; $771 = (($769) - ($770))|0; $772 = ($p$5|0)<($771|0); $$p$5 = $772 ? $771 : $p$5; $773 = (($pl$2) + ($$p$5))|0; $774 = ($w$1|0)<($773|0); $w$2 = $774 ? $773 : $w$1; _pad($f,32,$w$2,$773,$fl$6); $775 = HEAP32[$f>>2]|0; $776 = $775 & 32; $777 = ($776|0)==(0); if ($777) { (___fwritex($prefix$2,$pl$2,$f)|0); } $778 = $fl$6 ^ 65536; _pad($f,48,$w$2,$773,$778); _pad($f,48,$$p$5,$771,0); $779 = HEAP32[$f>>2]|0; $780 = $779 & 32; $781 = ($780|0)==(0); if ($781) { (___fwritex($a$2,$771,$f)|0); } $782 = $fl$6 ^ 8192; _pad($f,32,$w$2,$773,$782); $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $w$2;$l10n$0 = $l10n$3; } L348: do { if ((label|0) == 245) { $783 = ($f|0)==(0|0); if ($783) { $784 = ($l10n$0$lcssa|0)==(0); if ($784) { $$0 = 0; } else { $i$2100 = 1; while(1) { $785 = (($nl_type) + ($i$2100<<2)|0); $786 = HEAP32[$785>>2]|0; $787 = ($786|0)==(0); if ($787) { $i$2100$lcssa = $i$2100; break; } $789 = (($nl_arg) + ($i$2100<<3)|0); _pop_arg($789,$786,$ap); $790 = (($i$2100) + 1)|0; $791 = ($790|0)<(10); if ($791) { $i$2100 = $790; } else { $$0 = 1; break L348; } } $788 = ($i$2100$lcssa|0)<(10); if ($788) { $i$398 = $i$2100$lcssa; while(1) { $794 = (($nl_type) + ($i$398<<2)|0); $795 = HEAP32[$794>>2]|0; $796 = ($795|0)==(0); $792 = (($i$398) + 1)|0; if (!($796)) { $$0 = -1; break L348; } $793 = ($792|0)<(10); if ($793) { $i$398 = $792; } else { $$0 = 1; break; } } } else { $$0 = 1; } } } else { $$0 = $cnt$1$lcssa; } } } while(0); STACKTOP = sp;return ($$0|0); } function _cleanup526($p) { $p = $p|0; var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ((($p)) + 68|0); $1 = HEAP32[$0>>2]|0; $2 = ($1|0)==(0); if ($2) { ___unlockfile($p); } return; } function _pop_arg($arg,$type,$ap) { $arg = $arg|0; $type = $type|0; $ap = $ap|0; var $$mask = 0, $$mask1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0; var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0; var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0; var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0; var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0; var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($type>>>0)>(20); L1: do { if (!($0)) { do { switch ($type|0) { case 9: { $arglist_current = HEAP32[$ap>>2]|0; $1 = $arglist_current; $2 = ((0) + 4|0); $expanded28 = $2; $expanded = (($expanded28) - 1)|0; $3 = (($1) + ($expanded))|0; $4 = ((0) + 4|0); $expanded32 = $4; $expanded31 = (($expanded32) - 1)|0; $expanded30 = $expanded31 ^ -1; $5 = $3 & $expanded30; $6 = $5; $7 = HEAP32[$6>>2]|0; $arglist_next = ((($6)) + 4|0); HEAP32[$ap>>2] = $arglist_next; HEAP32[$arg>>2] = $7; break L1; break; } case 10: { $arglist_current2 = HEAP32[$ap>>2]|0; $8 = $arglist_current2; $9 = ((0) + 4|0); $expanded35 = $9; $expanded34 = (($expanded35) - 1)|0; $10 = (($8) + ($expanded34))|0; $11 = ((0) + 4|0); $expanded39 = $11; $expanded38 = (($expanded39) - 1)|0; $expanded37 = $expanded38 ^ -1; $12 = $10 & $expanded37; $13 = $12; $14 = HEAP32[$13>>2]|0; $arglist_next3 = ((($13)) + 4|0); HEAP32[$ap>>2] = $arglist_next3; $15 = ($14|0)<(0); $16 = $15 << 31 >> 31; $17 = $arg; $18 = $17; HEAP32[$18>>2] = $14; $19 = (($17) + 4)|0; $20 = $19; HEAP32[$20>>2] = $16; break L1; break; } case 11: { $arglist_current5 = HEAP32[$ap>>2]|0; $21 = $arglist_current5; $22 = ((0) + 4|0); $expanded42 = $22; $expanded41 = (($expanded42) - 1)|0; $23 = (($21) + ($expanded41))|0; $24 = ((0) + 4|0); $expanded46 = $24; $expanded45 = (($expanded46) - 1)|0; $expanded44 = $expanded45 ^ -1; $25 = $23 & $expanded44; $26 = $25; $27 = HEAP32[$26>>2]|0; $arglist_next6 = ((($26)) + 4|0); HEAP32[$ap>>2] = $arglist_next6; $28 = $arg; $29 = $28; HEAP32[$29>>2] = $27; $30 = (($28) + 4)|0; $31 = $30; HEAP32[$31>>2] = 0; break L1; break; } case 12: { $arglist_current8 = HEAP32[$ap>>2]|0; $32 = $arglist_current8; $33 = ((0) + 8|0); $expanded49 = $33; $expanded48 = (($expanded49) - 1)|0; $34 = (($32) + ($expanded48))|0; $35 = ((0) + 8|0); $expanded53 = $35; $expanded52 = (($expanded53) - 1)|0; $expanded51 = $expanded52 ^ -1; $36 = $34 & $expanded51; $37 = $36; $38 = $37; $39 = $38; $40 = HEAP32[$39>>2]|0; $41 = (($38) + 4)|0; $42 = $41; $43 = HEAP32[$42>>2]|0; $arglist_next9 = ((($37)) + 8|0); HEAP32[$ap>>2] = $arglist_next9; $44 = $arg; $45 = $44; HEAP32[$45>>2] = $40; $46 = (($44) + 4)|0; $47 = $46; HEAP32[$47>>2] = $43; break L1; break; } case 13: { $arglist_current11 = HEAP32[$ap>>2]|0; $48 = $arglist_current11; $49 = ((0) + 4|0); $expanded56 = $49; $expanded55 = (($expanded56) - 1)|0; $50 = (($48) + ($expanded55))|0; $51 = ((0) + 4|0); $expanded60 = $51; $expanded59 = (($expanded60) - 1)|0; $expanded58 = $expanded59 ^ -1; $52 = $50 & $expanded58; $53 = $52; $54 = HEAP32[$53>>2]|0; $arglist_next12 = ((($53)) + 4|0); HEAP32[$ap>>2] = $arglist_next12; $55 = $54&65535; $56 = $55 << 16 >> 16; $57 = ($56|0)<(0); $58 = $57 << 31 >> 31; $59 = $arg; $60 = $59; HEAP32[$60>>2] = $56; $61 = (($59) + 4)|0; $62 = $61; HEAP32[$62>>2] = $58; break L1; break; } case 14: { $arglist_current14 = HEAP32[$ap>>2]|0; $63 = $arglist_current14; $64 = ((0) + 4|0); $expanded63 = $64; $expanded62 = (($expanded63) - 1)|0; $65 = (($63) + ($expanded62))|0; $66 = ((0) + 4|0); $expanded67 = $66; $expanded66 = (($expanded67) - 1)|0; $expanded65 = $expanded66 ^ -1; $67 = $65 & $expanded65; $68 = $67; $69 = HEAP32[$68>>2]|0; $arglist_next15 = ((($68)) + 4|0); HEAP32[$ap>>2] = $arglist_next15; $$mask1 = $69 & 65535; $70 = $arg; $71 = $70; HEAP32[$71>>2] = $$mask1; $72 = (($70) + 4)|0; $73 = $72; HEAP32[$73>>2] = 0; break L1; break; } case 15: { $arglist_current17 = HEAP32[$ap>>2]|0; $74 = $arglist_current17; $75 = ((0) + 4|0); $expanded70 = $75; $expanded69 = (($expanded70) - 1)|0; $76 = (($74) + ($expanded69))|0; $77 = ((0) + 4|0); $expanded74 = $77; $expanded73 = (($expanded74) - 1)|0; $expanded72 = $expanded73 ^ -1; $78 = $76 & $expanded72; $79 = $78; $80 = HEAP32[$79>>2]|0; $arglist_next18 = ((($79)) + 4|0); HEAP32[$ap>>2] = $arglist_next18; $81 = $80&255; $82 = $81 << 24 >> 24; $83 = ($82|0)<(0); $84 = $83 << 31 >> 31; $85 = $arg; $86 = $85; HEAP32[$86>>2] = $82; $87 = (($85) + 4)|0; $88 = $87; HEAP32[$88>>2] = $84; break L1; break; } case 16: { $arglist_current20 = HEAP32[$ap>>2]|0; $89 = $arglist_current20; $90 = ((0) + 4|0); $expanded77 = $90; $expanded76 = (($expanded77) - 1)|0; $91 = (($89) + ($expanded76))|0; $92 = ((0) + 4|0); $expanded81 = $92; $expanded80 = (($expanded81) - 1)|0; $expanded79 = $expanded80 ^ -1; $93 = $91 & $expanded79; $94 = $93; $95 = HEAP32[$94>>2]|0; $arglist_next21 = ((($94)) + 4|0); HEAP32[$ap>>2] = $arglist_next21; $$mask = $95 & 255; $96 = $arg; $97 = $96; HEAP32[$97>>2] = $$mask; $98 = (($96) + 4)|0; $99 = $98; HEAP32[$99>>2] = 0; break L1; break; } case 17: { $arglist_current23 = HEAP32[$ap>>2]|0; $100 = $arglist_current23; $101 = ((0) + 8|0); $expanded84 = $101; $expanded83 = (($expanded84) - 1)|0; $102 = (($100) + ($expanded83))|0; $103 = ((0) + 8|0); $expanded88 = $103; $expanded87 = (($expanded88) - 1)|0; $expanded86 = $expanded87 ^ -1; $104 = $102 & $expanded86; $105 = $104; $106 = +HEAPF64[$105>>3]; $arglist_next24 = ((($105)) + 8|0); HEAP32[$ap>>2] = $arglist_next24; HEAPF64[$arg>>3] = $106; break L1; break; } case 18: { $arglist_current26 = HEAP32[$ap>>2]|0; $107 = $arglist_current26; $108 = ((0) + 8|0); $expanded91 = $108; $expanded90 = (($expanded91) - 1)|0; $109 = (($107) + ($expanded90))|0; $110 = ((0) + 8|0); $expanded95 = $110; $expanded94 = (($expanded95) - 1)|0; $expanded93 = $expanded94 ^ -1; $111 = $109 & $expanded93; $112 = $111; $113 = +HEAPF64[$112>>3]; $arglist_next27 = ((($112)) + 8|0); HEAP32[$ap>>2] = $arglist_next27; HEAPF64[$arg>>3] = $113; break L1; break; } default: { break L1; } } } while(0); } } while(0); return; } function _fmt_u($0,$1,$s) { $0 = $0|0; $1 = $1|0; $s = $s|0; var $$0$lcssa = 0, $$01$lcssa$off0 = 0, $$05 = 0, $$1$lcssa = 0, $$12 = 0, $$lcssa20 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $y$03 = 0, label = 0, sp = 0; sp = STACKTOP; $2 = ($1>>>0)>(0); $3 = ($0>>>0)>(4294967295); $4 = ($1|0)==(0); $5 = $4 & $3; $6 = $2 | $5; if ($6) { $$05 = $s;$7 = $0;$8 = $1; while(1) { $9 = (___uremdi3(($7|0),($8|0),10,0)|0); $10 = tempRet0; $11 = $9 | 48; $12 = $11&255; $13 = ((($$05)) + -1|0); HEAP8[$13>>0] = $12; $14 = (___udivdi3(($7|0),($8|0),10,0)|0); $15 = tempRet0; $16 = ($8>>>0)>(9); $17 = ($7>>>0)>(4294967295); $18 = ($8|0)==(9); $19 = $18 & $17; $20 = $16 | $19; if ($20) { $$05 = $13;$7 = $14;$8 = $15; } else { $$lcssa20 = $13;$28 = $14;$29 = $15; break; } } $$0$lcssa = $$lcssa20;$$01$lcssa$off0 = $28; } else { $$0$lcssa = $s;$$01$lcssa$off0 = $0; } $21 = ($$01$lcssa$off0|0)==(0); if ($21) { $$1$lcssa = $$0$lcssa; } else { $$12 = $$0$lcssa;$y$03 = $$01$lcssa$off0; while(1) { $22 = (($y$03>>>0) % 10)&-1; $23 = $22 | 48; $24 = $23&255; $25 = ((($$12)) + -1|0); HEAP8[$25>>0] = $24; $26 = (($y$03>>>0) / 10)&-1; $27 = ($y$03>>>0)<(10); if ($27) { $$1$lcssa = $25; break; } else { $$12 = $25;$y$03 = $26; } } } return ($$1$lcssa|0); } function _pad($f,$c,$w,$l,$fl) { $f = $f|0; $c = $c|0; $w = $w|0; $l = $l|0; $fl = $fl|0; var $$0$lcssa6 = 0, $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; var $8 = 0, $9 = 0, $or$cond = 0, $pad = 0, label = 0, sp = 0; sp = STACKTOP; STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abort(); $pad = sp; $0 = $fl & 73728; $1 = ($0|0)==(0); $2 = ($w|0)>($l|0); $or$cond = $2 & $1; do { if ($or$cond) { $3 = (($w) - ($l))|0; $4 = ($3>>>0)>(256); $5 = $4 ? 256 : $3; _memset(($pad|0),($c|0),($5|0))|0; $6 = ($3>>>0)>(255); $7 = HEAP32[$f>>2]|0; $8 = $7 & 32; $9 = ($8|0)==(0); if ($6) { $10 = (($w) - ($l))|0; $$02 = $3;$17 = $7;$18 = $9; while(1) { if ($18) { (___fwritex($pad,256,$f)|0); $$pre = HEAP32[$f>>2]|0; $14 = $$pre; } else { $14 = $17; } $11 = (($$02) + -256)|0; $12 = ($11>>>0)>(255); $13 = $14 & 32; $15 = ($13|0)==(0); if ($12) { $$02 = $11;$17 = $14;$18 = $15; } else { break; } } $16 = $10 & 255; if ($15) { $$0$lcssa6 = $16; } else { break; } } else { if ($9) { $$0$lcssa6 = $3; } else { break; } } (___fwritex($pad,$$0$lcssa6,$f)|0); } } while(0); STACKTOP = sp;return; } function _malloc($bytes) { $bytes = $bytes|0; var $$3$i = 0, $$lcssa = 0, $$lcssa211 = 0, $$lcssa215 = 0, $$lcssa216 = 0, $$lcssa217 = 0, $$lcssa219 = 0, $$lcssa222 = 0, $$lcssa224 = 0, $$lcssa226 = 0, $$lcssa228 = 0, $$lcssa230 = 0, $$lcssa232 = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i22$i = 0, $$pre$i25 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i23$iZ2D = 0; var $$pre$phi$i26Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi58$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre105 = 0, $$pre106 = 0, $$pre14$i$i = 0, $$pre43$i = 0, $$pre56$i$i = 0, $$pre57$i$i = 0, $$pre8$i = 0, $$rsize$0$i = 0, $$rsize$3$i = 0, $$sum = 0, $$sum$i$i = 0, $$sum$i$i$i = 0, $$sum$i13$i = 0, $$sum$i14$i = 0, $$sum$i17$i = 0, $$sum$i19$i = 0; var $$sum$i2334 = 0, $$sum$i32 = 0, $$sum$i35 = 0, $$sum1 = 0, $$sum1$i = 0, $$sum1$i$i = 0, $$sum1$i15$i = 0, $$sum1$i20$i = 0, $$sum1$i24 = 0, $$sum10 = 0, $$sum10$i = 0, $$sum10$i$i = 0, $$sum11$i = 0, $$sum11$i$i = 0, $$sum1112 = 0, $$sum112$i = 0, $$sum113$i = 0, $$sum114$i = 0, $$sum115$i = 0, $$sum116$i = 0; var $$sum117$i = 0, $$sum118$i = 0, $$sum119$i = 0, $$sum12$i = 0, $$sum12$i$i = 0, $$sum120$i = 0, $$sum121$i = 0, $$sum122$i = 0, $$sum123$i = 0, $$sum124$i = 0, $$sum125$i = 0, $$sum13$i = 0, $$sum13$i$i = 0, $$sum14$i$i = 0, $$sum15$i = 0, $$sum15$i$i = 0, $$sum16$i = 0, $$sum16$i$i = 0, $$sum17$i = 0, $$sum17$i$i = 0; var $$sum18$i = 0, $$sum1819$i$i = 0, $$sum2 = 0, $$sum2$i = 0, $$sum2$i$i = 0, $$sum2$i$i$i = 0, $$sum2$i16$i = 0, $$sum2$i18$i = 0, $$sum2$i21$i = 0, $$sum20$i$i = 0, $$sum21$i$i = 0, $$sum22$i$i = 0, $$sum23$i$i = 0, $$sum24$i$i = 0, $$sum25$i$i = 0, $$sum27$i$i = 0, $$sum28$i$i = 0, $$sum29$i$i = 0, $$sum3$i = 0, $$sum3$i27 = 0; var $$sum30$i$i = 0, $$sum3132$i$i = 0, $$sum34$i$i = 0, $$sum3536$i$i = 0, $$sum3738$i$i = 0, $$sum39$i$i = 0, $$sum4 = 0, $$sum4$i = 0, $$sum4$i$i = 0, $$sum4$i28 = 0, $$sum40$i$i = 0, $$sum41$i$i = 0, $$sum42$i$i = 0, $$sum5$i = 0, $$sum5$i$i = 0, $$sum56 = 0, $$sum6$i = 0, $$sum67$i$i = 0, $$sum7$i = 0, $$sum8$i = 0; var $$sum9 = 0, $$sum9$i = 0, $$sum9$i$i = 0, $$tsize$1$i = 0, $$v$0$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0; var $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0; var $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0; var $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0; var $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0; var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0; var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0; var $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0; var $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0; var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0; var $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0; var $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0; var $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0; var $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0; var $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0; var $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0; var $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0; var $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0; var $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0; var $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0; var $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0; var $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0; var $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0; var $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0; var $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0; var $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0; var $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0; var $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0; var $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0; var $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0; var $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0; var $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0; var $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0; var $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0; var $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0; var $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0; var $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0; var $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0; var $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0; var $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0; var $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0; var $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0; var $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0; var $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0; var $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0; var $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0; var $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0; var $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0; var $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0; var $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0; var $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0; var $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0; var $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0; var $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $F$0$i$i = 0, $F1$0$i = 0, $F4$0 = 0, $F4$0$i$i = 0; var $F5$0$i = 0, $I1$0$i$i = 0, $I7$0$i = 0, $I7$0$i$i = 0, $K12$029$i = 0, $K2$07$i$i = 0, $K8$051$i$i = 0, $R$0$i = 0, $R$0$i$i = 0, $R$0$i$i$lcssa = 0, $R$0$i$lcssa = 0, $R$0$i18 = 0, $R$0$i18$lcssa = 0, $R$1$i = 0, $R$1$i$i = 0, $R$1$i20 = 0, $RP$0$i = 0, $RP$0$i$i = 0, $RP$0$i$i$lcssa = 0, $RP$0$i$lcssa = 0; var $RP$0$i17 = 0, $RP$0$i17$lcssa = 0, $T$0$lcssa$i = 0, $T$0$lcssa$i$i = 0, $T$0$lcssa$i25$i = 0, $T$028$i = 0, $T$028$i$lcssa = 0, $T$050$i$i = 0, $T$050$i$i$lcssa = 0, $T$06$i$i = 0, $T$06$i$i$lcssa = 0, $br$0$ph$i = 0, $cond$i = 0, $cond$i$i = 0, $cond$i21 = 0, $exitcond$i$i = 0, $i$02$i$i = 0, $idx$0$i = 0, $mem$0 = 0, $nb$0 = 0; var $not$$i = 0, $not$$i$i = 0, $not$$i26$i = 0, $oldfirst$0$i$i = 0, $or$cond$i = 0, $or$cond$i30 = 0, $or$cond1$i = 0, $or$cond19$i = 0, $or$cond2$i = 0, $or$cond3$i = 0, $or$cond5$i = 0, $or$cond57$i = 0, $or$cond6$i = 0, $or$cond8$i = 0, $or$cond9$i = 0, $qsize$0$i$i = 0, $rsize$0$i = 0, $rsize$0$i$lcssa = 0, $rsize$0$i15 = 0, $rsize$1$i = 0; var $rsize$2$i = 0, $rsize$3$lcssa$i = 0, $rsize$331$i = 0, $rst$0$i = 0, $rst$1$i = 0, $sizebits$0$i = 0, $sp$0$i$i = 0, $sp$0$i$i$i = 0, $sp$084$i = 0, $sp$084$i$lcssa = 0, $sp$183$i = 0, $sp$183$i$lcssa = 0, $ssize$0$$i = 0, $ssize$0$i = 0, $ssize$1$ph$i = 0, $ssize$2$i = 0, $t$0$i = 0, $t$0$i14 = 0, $t$1$i = 0, $t$2$ph$i = 0; var $t$2$v$3$i = 0, $t$230$i = 0, $tbase$255$i = 0, $tsize$0$ph$i = 0, $tsize$0323944$i = 0, $tsize$1$i = 0, $tsize$254$i = 0, $v$0$i = 0, $v$0$i$lcssa = 0, $v$0$i16 = 0, $v$1$i = 0, $v$2$i = 0, $v$3$lcssa$i = 0, $v$3$ph$i = 0, $v$332$i = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($bytes>>>0)<(245); do { if ($0) { $1 = ($bytes>>>0)<(11); $2 = (($bytes) + 11)|0; $3 = $2 & -8; $4 = $1 ? 16 : $3; $5 = $4 >>> 3; $6 = HEAP32[12900>>2]|0; $7 = $6 >>> $5; $8 = $7 & 3; $9 = ($8|0)==(0); if (!($9)) { $10 = $7 & 1; $11 = $10 ^ 1; $12 = (($11) + ($5))|0; $13 = $12 << 1; $14 = (12940 + ($13<<2)|0); $$sum10 = (($13) + 2)|0; $15 = (12940 + ($$sum10<<2)|0); $16 = HEAP32[$15>>2]|0; $17 = ((($16)) + 8|0); $18 = HEAP32[$17>>2]|0; $19 = ($14|0)==($18|0); do { if ($19) { $20 = 1 << $12; $21 = $20 ^ -1; $22 = $6 & $21; HEAP32[12900>>2] = $22; } else { $23 = HEAP32[(12916)>>2]|0; $24 = ($18>>>0)<($23>>>0); if ($24) { _abort(); // unreachable; } $25 = ((($18)) + 12|0); $26 = HEAP32[$25>>2]|0; $27 = ($26|0)==($16|0); if ($27) { HEAP32[$25>>2] = $14; HEAP32[$15>>2] = $18; break; } else { _abort(); // unreachable; } } } while(0); $28 = $12 << 3; $29 = $28 | 3; $30 = ((($16)) + 4|0); HEAP32[$30>>2] = $29; $$sum1112 = $28 | 4; $31 = (($16) + ($$sum1112)|0); $32 = HEAP32[$31>>2]|0; $33 = $32 | 1; HEAP32[$31>>2] = $33; $mem$0 = $17; return ($mem$0|0); } $34 = HEAP32[(12908)>>2]|0; $35 = ($4>>>0)>($34>>>0); if ($35) { $36 = ($7|0)==(0); if (!($36)) { $37 = $7 << $5; $38 = 2 << $5; $39 = (0 - ($38))|0; $40 = $38 | $39; $41 = $37 & $40; $42 = (0 - ($41))|0; $43 = $41 & $42; $44 = (($43) + -1)|0; $45 = $44 >>> 12; $46 = $45 & 16; $47 = $44 >>> $46; $48 = $47 >>> 5; $49 = $48 & 8; $50 = $49 | $46; $51 = $47 >>> $49; $52 = $51 >>> 2; $53 = $52 & 4; $54 = $50 | $53; $55 = $51 >>> $53; $56 = $55 >>> 1; $57 = $56 & 2; $58 = $54 | $57; $59 = $55 >>> $57; $60 = $59 >>> 1; $61 = $60 & 1; $62 = $58 | $61; $63 = $59 >>> $61; $64 = (($62) + ($63))|0; $65 = $64 << 1; $66 = (12940 + ($65<<2)|0); $$sum4 = (($65) + 2)|0; $67 = (12940 + ($$sum4<<2)|0); $68 = HEAP32[$67>>2]|0; $69 = ((($68)) + 8|0); $70 = HEAP32[$69>>2]|0; $71 = ($66|0)==($70|0); do { if ($71) { $72 = 1 << $64; $73 = $72 ^ -1; $74 = $6 & $73; HEAP32[12900>>2] = $74; $88 = $34; } else { $75 = HEAP32[(12916)>>2]|0; $76 = ($70>>>0)<($75>>>0); if ($76) { _abort(); // unreachable; } $77 = ((($70)) + 12|0); $78 = HEAP32[$77>>2]|0; $79 = ($78|0)==($68|0); if ($79) { HEAP32[$77>>2] = $66; HEAP32[$67>>2] = $70; $$pre = HEAP32[(12908)>>2]|0; $88 = $$pre; break; } else { _abort(); // unreachable; } } } while(0); $80 = $64 << 3; $81 = (($80) - ($4))|0; $82 = $4 | 3; $83 = ((($68)) + 4|0); HEAP32[$83>>2] = $82; $84 = (($68) + ($4)|0); $85 = $81 | 1; $$sum56 = $4 | 4; $86 = (($68) + ($$sum56)|0); HEAP32[$86>>2] = $85; $87 = (($68) + ($80)|0); HEAP32[$87>>2] = $81; $89 = ($88|0)==(0); if (!($89)) { $90 = HEAP32[(12920)>>2]|0; $91 = $88 >>> 3; $92 = $91 << 1; $93 = (12940 + ($92<<2)|0); $94 = HEAP32[12900>>2]|0; $95 = 1 << $91; $96 = $94 & $95; $97 = ($96|0)==(0); if ($97) { $98 = $94 | $95; HEAP32[12900>>2] = $98; $$pre105 = (($92) + 2)|0; $$pre106 = (12940 + ($$pre105<<2)|0); $$pre$phiZ2D = $$pre106;$F4$0 = $93; } else { $$sum9 = (($92) + 2)|0; $99 = (12940 + ($$sum9<<2)|0); $100 = HEAP32[$99>>2]|0; $101 = HEAP32[(12916)>>2]|0; $102 = ($100>>>0)<($101>>>0); if ($102) { _abort(); // unreachable; } else { $$pre$phiZ2D = $99;$F4$0 = $100; } } HEAP32[$$pre$phiZ2D>>2] = $90; $103 = ((($F4$0)) + 12|0); HEAP32[$103>>2] = $90; $104 = ((($90)) + 8|0); HEAP32[$104>>2] = $F4$0; $105 = ((($90)) + 12|0); HEAP32[$105>>2] = $93; } HEAP32[(12908)>>2] = $81; HEAP32[(12920)>>2] = $84; $mem$0 = $69; return ($mem$0|0); } $106 = HEAP32[(12904)>>2]|0; $107 = ($106|0)==(0); if ($107) { $nb$0 = $4; } else { $108 = (0 - ($106))|0; $109 = $106 & $108; $110 = (($109) + -1)|0; $111 = $110 >>> 12; $112 = $111 & 16; $113 = $110 >>> $112; $114 = $113 >>> 5; $115 = $114 & 8; $116 = $115 | $112; $117 = $113 >>> $115; $118 = $117 >>> 2; $119 = $118 & 4; $120 = $116 | $119; $121 = $117 >>> $119; $122 = $121 >>> 1; $123 = $122 & 2; $124 = $120 | $123; $125 = $121 >>> $123; $126 = $125 >>> 1; $127 = $126 & 1; $128 = $124 | $127; $129 = $125 >>> $127; $130 = (($128) + ($129))|0; $131 = (13204 + ($130<<2)|0); $132 = HEAP32[$131>>2]|0; $133 = ((($132)) + 4|0); $134 = HEAP32[$133>>2]|0; $135 = $134 & -8; $136 = (($135) - ($4))|0; $rsize$0$i = $136;$t$0$i = $132;$v$0$i = $132; while(1) { $137 = ((($t$0$i)) + 16|0); $138 = HEAP32[$137>>2]|0; $139 = ($138|0)==(0|0); if ($139) { $140 = ((($t$0$i)) + 20|0); $141 = HEAP32[$140>>2]|0; $142 = ($141|0)==(0|0); if ($142) { $rsize$0$i$lcssa = $rsize$0$i;$v$0$i$lcssa = $v$0$i; break; } else { $144 = $141; } } else { $144 = $138; } $143 = ((($144)) + 4|0); $145 = HEAP32[$143>>2]|0; $146 = $145 & -8; $147 = (($146) - ($4))|0; $148 = ($147>>>0)<($rsize$0$i>>>0); $$rsize$0$i = $148 ? $147 : $rsize$0$i; $$v$0$i = $148 ? $144 : $v$0$i; $rsize$0$i = $$rsize$0$i;$t$0$i = $144;$v$0$i = $$v$0$i; } $149 = HEAP32[(12916)>>2]|0; $150 = ($v$0$i$lcssa>>>0)<($149>>>0); if ($150) { _abort(); // unreachable; } $151 = (($v$0$i$lcssa) + ($4)|0); $152 = ($v$0$i$lcssa>>>0)<($151>>>0); if (!($152)) { _abort(); // unreachable; } $153 = ((($v$0$i$lcssa)) + 24|0); $154 = HEAP32[$153>>2]|0; $155 = ((($v$0$i$lcssa)) + 12|0); $156 = HEAP32[$155>>2]|0; $157 = ($156|0)==($v$0$i$lcssa|0); do { if ($157) { $167 = ((($v$0$i$lcssa)) + 20|0); $168 = HEAP32[$167>>2]|0; $169 = ($168|0)==(0|0); if ($169) { $170 = ((($v$0$i$lcssa)) + 16|0); $171 = HEAP32[$170>>2]|0; $172 = ($171|0)==(0|0); if ($172) { $R$1$i = 0; break; } else { $R$0$i = $171;$RP$0$i = $170; } } else { $R$0$i = $168;$RP$0$i = $167; } while(1) { $173 = ((($R$0$i)) + 20|0); $174 = HEAP32[$173>>2]|0; $175 = ($174|0)==(0|0); if (!($175)) { $R$0$i = $174;$RP$0$i = $173; continue; } $176 = ((($R$0$i)) + 16|0); $177 = HEAP32[$176>>2]|0; $178 = ($177|0)==(0|0); if ($178) { $R$0$i$lcssa = $R$0$i;$RP$0$i$lcssa = $RP$0$i; break; } else { $R$0$i = $177;$RP$0$i = $176; } } $179 = ($RP$0$i$lcssa>>>0)<($149>>>0); if ($179) { _abort(); // unreachable; } else { HEAP32[$RP$0$i$lcssa>>2] = 0; $R$1$i = $R$0$i$lcssa; break; } } else { $158 = ((($v$0$i$lcssa)) + 8|0); $159 = HEAP32[$158>>2]|0; $160 = ($159>>>0)<($149>>>0); if ($160) { _abort(); // unreachable; } $161 = ((($159)) + 12|0); $162 = HEAP32[$161>>2]|0; $163 = ($162|0)==($v$0$i$lcssa|0); if (!($163)) { _abort(); // unreachable; } $164 = ((($156)) + 8|0); $165 = HEAP32[$164>>2]|0; $166 = ($165|0)==($v$0$i$lcssa|0); if ($166) { HEAP32[$161>>2] = $156; HEAP32[$164>>2] = $159; $R$1$i = $156; break; } else { _abort(); // unreachable; } } } while(0); $180 = ($154|0)==(0|0); do { if (!($180)) { $181 = ((($v$0$i$lcssa)) + 28|0); $182 = HEAP32[$181>>2]|0; $183 = (13204 + ($182<<2)|0); $184 = HEAP32[$183>>2]|0; $185 = ($v$0$i$lcssa|0)==($184|0); if ($185) { HEAP32[$183>>2] = $R$1$i; $cond$i = ($R$1$i|0)==(0|0); if ($cond$i) { $186 = 1 << $182; $187 = $186 ^ -1; $188 = HEAP32[(12904)>>2]|0; $189 = $188 & $187; HEAP32[(12904)>>2] = $189; break; } } else { $190 = HEAP32[(12916)>>2]|0; $191 = ($154>>>0)<($190>>>0); if ($191) { _abort(); // unreachable; } $192 = ((($154)) + 16|0); $193 = HEAP32[$192>>2]|0; $194 = ($193|0)==($v$0$i$lcssa|0); if ($194) { HEAP32[$192>>2] = $R$1$i; } else { $195 = ((($154)) + 20|0); HEAP32[$195>>2] = $R$1$i; } $196 = ($R$1$i|0)==(0|0); if ($196) { break; } } $197 = HEAP32[(12916)>>2]|0; $198 = ($R$1$i>>>0)<($197>>>0); if ($198) { _abort(); // unreachable; } $199 = ((($R$1$i)) + 24|0); HEAP32[$199>>2] = $154; $200 = ((($v$0$i$lcssa)) + 16|0); $201 = HEAP32[$200>>2]|0; $202 = ($201|0)==(0|0); do { if (!($202)) { $203 = ($201>>>0)<($197>>>0); if ($203) { _abort(); // unreachable; } else { $204 = ((($R$1$i)) + 16|0); HEAP32[$204>>2] = $201; $205 = ((($201)) + 24|0); HEAP32[$205>>2] = $R$1$i; break; } } } while(0); $206 = ((($v$0$i$lcssa)) + 20|0); $207 = HEAP32[$206>>2]|0; $208 = ($207|0)==(0|0); if (!($208)) { $209 = HEAP32[(12916)>>2]|0; $210 = ($207>>>0)<($209>>>0); if ($210) { _abort(); // unreachable; } else { $211 = ((($R$1$i)) + 20|0); HEAP32[$211>>2] = $207; $212 = ((($207)) + 24|0); HEAP32[$212>>2] = $R$1$i; break; } } } } while(0); $213 = ($rsize$0$i$lcssa>>>0)<(16); if ($213) { $214 = (($rsize$0$i$lcssa) + ($4))|0; $215 = $214 | 3; $216 = ((($v$0$i$lcssa)) + 4|0); HEAP32[$216>>2] = $215; $$sum4$i = (($214) + 4)|0; $217 = (($v$0$i$lcssa) + ($$sum4$i)|0); $218 = HEAP32[$217>>2]|0; $219 = $218 | 1; HEAP32[$217>>2] = $219; } else { $220 = $4 | 3; $221 = ((($v$0$i$lcssa)) + 4|0); HEAP32[$221>>2] = $220; $222 = $rsize$0$i$lcssa | 1; $$sum$i35 = $4 | 4; $223 = (($v$0$i$lcssa) + ($$sum$i35)|0); HEAP32[$223>>2] = $222; $$sum1$i = (($rsize$0$i$lcssa) + ($4))|0; $224 = (($v$0$i$lcssa) + ($$sum1$i)|0); HEAP32[$224>>2] = $rsize$0$i$lcssa; $225 = HEAP32[(12908)>>2]|0; $226 = ($225|0)==(0); if (!($226)) { $227 = HEAP32[(12920)>>2]|0; $228 = $225 >>> 3; $229 = $228 << 1; $230 = (12940 + ($229<<2)|0); $231 = HEAP32[12900>>2]|0; $232 = 1 << $228; $233 = $231 & $232; $234 = ($233|0)==(0); if ($234) { $235 = $231 | $232; HEAP32[12900>>2] = $235; $$pre$i = (($229) + 2)|0; $$pre8$i = (12940 + ($$pre$i<<2)|0); $$pre$phi$iZ2D = $$pre8$i;$F1$0$i = $230; } else { $$sum3$i = (($229) + 2)|0; $236 = (12940 + ($$sum3$i<<2)|0); $237 = HEAP32[$236>>2]|0; $238 = HEAP32[(12916)>>2]|0; $239 = ($237>>>0)<($238>>>0); if ($239) { _abort(); // unreachable; } else { $$pre$phi$iZ2D = $236;$F1$0$i = $237; } } HEAP32[$$pre$phi$iZ2D>>2] = $227; $240 = ((($F1$0$i)) + 12|0); HEAP32[$240>>2] = $227; $241 = ((($227)) + 8|0); HEAP32[$241>>2] = $F1$0$i; $242 = ((($227)) + 12|0); HEAP32[$242>>2] = $230; } HEAP32[(12908)>>2] = $rsize$0$i$lcssa; HEAP32[(12920)>>2] = $151; } $243 = ((($v$0$i$lcssa)) + 8|0); $mem$0 = $243; return ($mem$0|0); } } else { $nb$0 = $4; } } else { $244 = ($bytes>>>0)>(4294967231); if ($244) { $nb$0 = -1; } else { $245 = (($bytes) + 11)|0; $246 = $245 & -8; $247 = HEAP32[(12904)>>2]|0; $248 = ($247|0)==(0); if ($248) { $nb$0 = $246; } else { $249 = (0 - ($246))|0; $250 = $245 >>> 8; $251 = ($250|0)==(0); if ($251) { $idx$0$i = 0; } else { $252 = ($246>>>0)>(16777215); if ($252) { $idx$0$i = 31; } else { $253 = (($250) + 1048320)|0; $254 = $253 >>> 16; $255 = $254 & 8; $256 = $250 << $255; $257 = (($256) + 520192)|0; $258 = $257 >>> 16; $259 = $258 & 4; $260 = $259 | $255; $261 = $256 << $259; $262 = (($261) + 245760)|0; $263 = $262 >>> 16; $264 = $263 & 2; $265 = $260 | $264; $266 = (14 - ($265))|0; $267 = $261 << $264; $268 = $267 >>> 15; $269 = (($266) + ($268))|0; $270 = $269 << 1; $271 = (($269) + 7)|0; $272 = $246 >>> $271; $273 = $272 & 1; $274 = $273 | $270; $idx$0$i = $274; } } $275 = (13204 + ($idx$0$i<<2)|0); $276 = HEAP32[$275>>2]|0; $277 = ($276|0)==(0|0); L123: do { if ($277) { $rsize$2$i = $249;$t$1$i = 0;$v$2$i = 0; label = 86; } else { $278 = ($idx$0$i|0)==(31); $279 = $idx$0$i >>> 1; $280 = (25 - ($279))|0; $281 = $278 ? 0 : $280; $282 = $246 << $281; $rsize$0$i15 = $249;$rst$0$i = 0;$sizebits$0$i = $282;$t$0$i14 = $276;$v$0$i16 = 0; while(1) { $283 = ((($t$0$i14)) + 4|0); $284 = HEAP32[$283>>2]|0; $285 = $284 & -8; $286 = (($285) - ($246))|0; $287 = ($286>>>0)<($rsize$0$i15>>>0); if ($287) { $288 = ($285|0)==($246|0); if ($288) { $rsize$331$i = $286;$t$230$i = $t$0$i14;$v$332$i = $t$0$i14; label = 90; break L123; } else { $rsize$1$i = $286;$v$1$i = $t$0$i14; } } else { $rsize$1$i = $rsize$0$i15;$v$1$i = $v$0$i16; } $289 = ((($t$0$i14)) + 20|0); $290 = HEAP32[$289>>2]|0; $291 = $sizebits$0$i >>> 31; $292 = (((($t$0$i14)) + 16|0) + ($291<<2)|0); $293 = HEAP32[$292>>2]|0; $294 = ($290|0)==(0|0); $295 = ($290|0)==($293|0); $or$cond19$i = $294 | $295; $rst$1$i = $or$cond19$i ? $rst$0$i : $290; $296 = ($293|0)==(0|0); $297 = $sizebits$0$i << 1; if ($296) { $rsize$2$i = $rsize$1$i;$t$1$i = $rst$1$i;$v$2$i = $v$1$i; label = 86; break; } else { $rsize$0$i15 = $rsize$1$i;$rst$0$i = $rst$1$i;$sizebits$0$i = $297;$t$0$i14 = $293;$v$0$i16 = $v$1$i; } } } } while(0); if ((label|0) == 86) { $298 = ($t$1$i|0)==(0|0); $299 = ($v$2$i|0)==(0|0); $or$cond$i = $298 & $299; if ($or$cond$i) { $300 = 2 << $idx$0$i; $301 = (0 - ($300))|0; $302 = $300 | $301; $303 = $247 & $302; $304 = ($303|0)==(0); if ($304) { $nb$0 = $246; break; } $305 = (0 - ($303))|0; $306 = $303 & $305; $307 = (($306) + -1)|0; $308 = $307 >>> 12; $309 = $308 & 16; $310 = $307 >>> $309; $311 = $310 >>> 5; $312 = $311 & 8; $313 = $312 | $309; $314 = $310 >>> $312; $315 = $314 >>> 2; $316 = $315 & 4; $317 = $313 | $316; $318 = $314 >>> $316; $319 = $318 >>> 1; $320 = $319 & 2; $321 = $317 | $320; $322 = $318 >>> $320; $323 = $322 >>> 1; $324 = $323 & 1; $325 = $321 | $324; $326 = $322 >>> $324; $327 = (($325) + ($326))|0; $328 = (13204 + ($327<<2)|0); $329 = HEAP32[$328>>2]|0; $t$2$ph$i = $329;$v$3$ph$i = 0; } else { $t$2$ph$i = $t$1$i;$v$3$ph$i = $v$2$i; } $330 = ($t$2$ph$i|0)==(0|0); if ($330) { $rsize$3$lcssa$i = $rsize$2$i;$v$3$lcssa$i = $v$3$ph$i; } else { $rsize$331$i = $rsize$2$i;$t$230$i = $t$2$ph$i;$v$332$i = $v$3$ph$i; label = 90; } } if ((label|0) == 90) { while(1) { label = 0; $331 = ((($t$230$i)) + 4|0); $332 = HEAP32[$331>>2]|0; $333 = $332 & -8; $334 = (($333) - ($246))|0; $335 = ($334>>>0)<($rsize$331$i>>>0); $$rsize$3$i = $335 ? $334 : $rsize$331$i; $t$2$v$3$i = $335 ? $t$230$i : $v$332$i; $336 = ((($t$230$i)) + 16|0); $337 = HEAP32[$336>>2]|0; $338 = ($337|0)==(0|0); if (!($338)) { $rsize$331$i = $$rsize$3$i;$t$230$i = $337;$v$332$i = $t$2$v$3$i; label = 90; continue; } $339 = ((($t$230$i)) + 20|0); $340 = HEAP32[$339>>2]|0; $341 = ($340|0)==(0|0); if ($341) { $rsize$3$lcssa$i = $$rsize$3$i;$v$3$lcssa$i = $t$2$v$3$i; break; } else { $rsize$331$i = $$rsize$3$i;$t$230$i = $340;$v$332$i = $t$2$v$3$i; label = 90; } } } $342 = ($v$3$lcssa$i|0)==(0|0); if ($342) { $nb$0 = $246; } else { $343 = HEAP32[(12908)>>2]|0; $344 = (($343) - ($246))|0; $345 = ($rsize$3$lcssa$i>>>0)<($344>>>0); if ($345) { $346 = HEAP32[(12916)>>2]|0; $347 = ($v$3$lcssa$i>>>0)<($346>>>0); if ($347) { _abort(); // unreachable; } $348 = (($v$3$lcssa$i) + ($246)|0); $349 = ($v$3$lcssa$i>>>0)<($348>>>0); if (!($349)) { _abort(); // unreachable; } $350 = ((($v$3$lcssa$i)) + 24|0); $351 = HEAP32[$350>>2]|0; $352 = ((($v$3$lcssa$i)) + 12|0); $353 = HEAP32[$352>>2]|0; $354 = ($353|0)==($v$3$lcssa$i|0); do { if ($354) { $364 = ((($v$3$lcssa$i)) + 20|0); $365 = HEAP32[$364>>2]|0; $366 = ($365|0)==(0|0); if ($366) { $367 = ((($v$3$lcssa$i)) + 16|0); $368 = HEAP32[$367>>2]|0; $369 = ($368|0)==(0|0); if ($369) { $R$1$i20 = 0; break; } else { $R$0$i18 = $368;$RP$0$i17 = $367; } } else { $R$0$i18 = $365;$RP$0$i17 = $364; } while(1) { $370 = ((($R$0$i18)) + 20|0); $371 = HEAP32[$370>>2]|0; $372 = ($371|0)==(0|0); if (!($372)) { $R$0$i18 = $371;$RP$0$i17 = $370; continue; } $373 = ((($R$0$i18)) + 16|0); $374 = HEAP32[$373>>2]|0; $375 = ($374|0)==(0|0); if ($375) { $R$0$i18$lcssa = $R$0$i18;$RP$0$i17$lcssa = $RP$0$i17; break; } else { $R$0$i18 = $374;$RP$0$i17 = $373; } } $376 = ($RP$0$i17$lcssa>>>0)<($346>>>0); if ($376) { _abort(); // unreachable; } else { HEAP32[$RP$0$i17$lcssa>>2] = 0; $R$1$i20 = $R$0$i18$lcssa; break; } } else { $355 = ((($v$3$lcssa$i)) + 8|0); $356 = HEAP32[$355>>2]|0; $357 = ($356>>>0)<($346>>>0); if ($357) { _abort(); // unreachable; } $358 = ((($356)) + 12|0); $359 = HEAP32[$358>>2]|0; $360 = ($359|0)==($v$3$lcssa$i|0); if (!($360)) { _abort(); // unreachable; } $361 = ((($353)) + 8|0); $362 = HEAP32[$361>>2]|0; $363 = ($362|0)==($v$3$lcssa$i|0); if ($363) { HEAP32[$358>>2] = $353; HEAP32[$361>>2] = $356; $R$1$i20 = $353; break; } else { _abort(); // unreachable; } } } while(0); $377 = ($351|0)==(0|0); do { if (!($377)) { $378 = ((($v$3$lcssa$i)) + 28|0); $379 = HEAP32[$378>>2]|0; $380 = (13204 + ($379<<2)|0); $381 = HEAP32[$380>>2]|0; $382 = ($v$3$lcssa$i|0)==($381|0); if ($382) { HEAP32[$380>>2] = $R$1$i20; $cond$i21 = ($R$1$i20|0)==(0|0); if ($cond$i21) { $383 = 1 << $379; $384 = $383 ^ -1; $385 = HEAP32[(12904)>>2]|0; $386 = $385 & $384; HEAP32[(12904)>>2] = $386; break; } } else { $387 = HEAP32[(12916)>>2]|0; $388 = ($351>>>0)<($387>>>0); if ($388) { _abort(); // unreachable; } $389 = ((($351)) + 16|0); $390 = HEAP32[$389>>2]|0; $391 = ($390|0)==($v$3$lcssa$i|0); if ($391) { HEAP32[$389>>2] = $R$1$i20; } else { $392 = ((($351)) + 20|0); HEAP32[$392>>2] = $R$1$i20; } $393 = ($R$1$i20|0)==(0|0); if ($393) { break; } } $394 = HEAP32[(12916)>>2]|0; $395 = ($R$1$i20>>>0)<($394>>>0); if ($395) { _abort(); // unreachable; } $396 = ((($R$1$i20)) + 24|0); HEAP32[$396>>2] = $351; $397 = ((($v$3$lcssa$i)) + 16|0); $398 = HEAP32[$397>>2]|0; $399 = ($398|0)==(0|0); do { if (!($399)) { $400 = ($398>>>0)<($394>>>0); if ($400) { _abort(); // unreachable; } else { $401 = ((($R$1$i20)) + 16|0); HEAP32[$401>>2] = $398; $402 = ((($398)) + 24|0); HEAP32[$402>>2] = $R$1$i20; break; } } } while(0); $403 = ((($v$3$lcssa$i)) + 20|0); $404 = HEAP32[$403>>2]|0; $405 = ($404|0)==(0|0); if (!($405)) { $406 = HEAP32[(12916)>>2]|0; $407 = ($404>>>0)<($406>>>0); if ($407) { _abort(); // unreachable; } else { $408 = ((($R$1$i20)) + 20|0); HEAP32[$408>>2] = $404; $409 = ((($404)) + 24|0); HEAP32[$409>>2] = $R$1$i20; break; } } } } while(0); $410 = ($rsize$3$lcssa$i>>>0)<(16); L199: do { if ($410) { $411 = (($rsize$3$lcssa$i) + ($246))|0; $412 = $411 | 3; $413 = ((($v$3$lcssa$i)) + 4|0); HEAP32[$413>>2] = $412; $$sum18$i = (($411) + 4)|0; $414 = (($v$3$lcssa$i) + ($$sum18$i)|0); $415 = HEAP32[$414>>2]|0; $416 = $415 | 1; HEAP32[$414>>2] = $416; } else { $417 = $246 | 3; $418 = ((($v$3$lcssa$i)) + 4|0); HEAP32[$418>>2] = $417; $419 = $rsize$3$lcssa$i | 1; $$sum$i2334 = $246 | 4; $420 = (($v$3$lcssa$i) + ($$sum$i2334)|0); HEAP32[$420>>2] = $419; $$sum1$i24 = (($rsize$3$lcssa$i) + ($246))|0; $421 = (($v$3$lcssa$i) + ($$sum1$i24)|0); HEAP32[$421>>2] = $rsize$3$lcssa$i; $422 = $rsize$3$lcssa$i >>> 3; $423 = ($rsize$3$lcssa$i>>>0)<(256); if ($423) { $424 = $422 << 1; $425 = (12940 + ($424<<2)|0); $426 = HEAP32[12900>>2]|0; $427 = 1 << $422; $428 = $426 & $427; $429 = ($428|0)==(0); if ($429) { $430 = $426 | $427; HEAP32[12900>>2] = $430; $$pre$i25 = (($424) + 2)|0; $$pre43$i = (12940 + ($$pre$i25<<2)|0); $$pre$phi$i26Z2D = $$pre43$i;$F5$0$i = $425; } else { $$sum17$i = (($424) + 2)|0; $431 = (12940 + ($$sum17$i<<2)|0); $432 = HEAP32[$431>>2]|0; $433 = HEAP32[(12916)>>2]|0; $434 = ($432>>>0)<($433>>>0); if ($434) { _abort(); // unreachable; } else { $$pre$phi$i26Z2D = $431;$F5$0$i = $432; } } HEAP32[$$pre$phi$i26Z2D>>2] = $348; $435 = ((($F5$0$i)) + 12|0); HEAP32[$435>>2] = $348; $$sum15$i = (($246) + 8)|0; $436 = (($v$3$lcssa$i) + ($$sum15$i)|0); HEAP32[$436>>2] = $F5$0$i; $$sum16$i = (($246) + 12)|0; $437 = (($v$3$lcssa$i) + ($$sum16$i)|0); HEAP32[$437>>2] = $425; break; } $438 = $rsize$3$lcssa$i >>> 8; $439 = ($438|0)==(0); if ($439) { $I7$0$i = 0; } else { $440 = ($rsize$3$lcssa$i>>>0)>(16777215); if ($440) { $I7$0$i = 31; } else { $441 = (($438) + 1048320)|0; $442 = $441 >>> 16; $443 = $442 & 8; $444 = $438 << $443; $445 = (($444) + 520192)|0; $446 = $445 >>> 16; $447 = $446 & 4; $448 = $447 | $443; $449 = $444 << $447; $450 = (($449) + 245760)|0; $451 = $450 >>> 16; $452 = $451 & 2; $453 = $448 | $452; $454 = (14 - ($453))|0; $455 = $449 << $452; $456 = $455 >>> 15; $457 = (($454) + ($456))|0; $458 = $457 << 1; $459 = (($457) + 7)|0; $460 = $rsize$3$lcssa$i >>> $459; $461 = $460 & 1; $462 = $461 | $458; $I7$0$i = $462; } } $463 = (13204 + ($I7$0$i<<2)|0); $$sum2$i = (($246) + 28)|0; $464 = (($v$3$lcssa$i) + ($$sum2$i)|0); HEAP32[$464>>2] = $I7$0$i; $$sum3$i27 = (($246) + 16)|0; $465 = (($v$3$lcssa$i) + ($$sum3$i27)|0); $$sum4$i28 = (($246) + 20)|0; $466 = (($v$3$lcssa$i) + ($$sum4$i28)|0); HEAP32[$466>>2] = 0; HEAP32[$465>>2] = 0; $467 = HEAP32[(12904)>>2]|0; $468 = 1 << $I7$0$i; $469 = $467 & $468; $470 = ($469|0)==(0); if ($470) { $471 = $467 | $468; HEAP32[(12904)>>2] = $471; HEAP32[$463>>2] = $348; $$sum5$i = (($246) + 24)|0; $472 = (($v$3$lcssa$i) + ($$sum5$i)|0); HEAP32[$472>>2] = $463; $$sum6$i = (($246) + 12)|0; $473 = (($v$3$lcssa$i) + ($$sum6$i)|0); HEAP32[$473>>2] = $348; $$sum7$i = (($246) + 8)|0; $474 = (($v$3$lcssa$i) + ($$sum7$i)|0); HEAP32[$474>>2] = $348; break; } $475 = HEAP32[$463>>2]|0; $476 = ((($475)) + 4|0); $477 = HEAP32[$476>>2]|0; $478 = $477 & -8; $479 = ($478|0)==($rsize$3$lcssa$i|0); L217: do { if ($479) { $T$0$lcssa$i = $475; } else { $480 = ($I7$0$i|0)==(31); $481 = $I7$0$i >>> 1; $482 = (25 - ($481))|0; $483 = $480 ? 0 : $482; $484 = $rsize$3$lcssa$i << $483; $K12$029$i = $484;$T$028$i = $475; while(1) { $491 = $K12$029$i >>> 31; $492 = (((($T$028$i)) + 16|0) + ($491<<2)|0); $487 = HEAP32[$492>>2]|0; $493 = ($487|0)==(0|0); if ($493) { $$lcssa232 = $492;$T$028$i$lcssa = $T$028$i; break; } $485 = $K12$029$i << 1; $486 = ((($487)) + 4|0); $488 = HEAP32[$486>>2]|0; $489 = $488 & -8; $490 = ($489|0)==($rsize$3$lcssa$i|0); if ($490) { $T$0$lcssa$i = $487; break L217; } else { $K12$029$i = $485;$T$028$i = $487; } } $494 = HEAP32[(12916)>>2]|0; $495 = ($$lcssa232>>>0)<($494>>>0); if ($495) { _abort(); // unreachable; } else { HEAP32[$$lcssa232>>2] = $348; $$sum11$i = (($246) + 24)|0; $496 = (($v$3$lcssa$i) + ($$sum11$i)|0); HEAP32[$496>>2] = $T$028$i$lcssa; $$sum12$i = (($246) + 12)|0; $497 = (($v$3$lcssa$i) + ($$sum12$i)|0); HEAP32[$497>>2] = $348; $$sum13$i = (($246) + 8)|0; $498 = (($v$3$lcssa$i) + ($$sum13$i)|0); HEAP32[$498>>2] = $348; break L199; } } } while(0); $499 = ((($T$0$lcssa$i)) + 8|0); $500 = HEAP32[$499>>2]|0; $501 = HEAP32[(12916)>>2]|0; $502 = ($500>>>0)>=($501>>>0); $not$$i = ($T$0$lcssa$i>>>0)>=($501>>>0); $503 = $502 & $not$$i; if ($503) { $504 = ((($500)) + 12|0); HEAP32[$504>>2] = $348; HEAP32[$499>>2] = $348; $$sum8$i = (($246) + 8)|0; $505 = (($v$3$lcssa$i) + ($$sum8$i)|0); HEAP32[$505>>2] = $500; $$sum9$i = (($246) + 12)|0; $506 = (($v$3$lcssa$i) + ($$sum9$i)|0); HEAP32[$506>>2] = $T$0$lcssa$i; $$sum10$i = (($246) + 24)|0; $507 = (($v$3$lcssa$i) + ($$sum10$i)|0); HEAP32[$507>>2] = 0; break; } else { _abort(); // unreachable; } } } while(0); $508 = ((($v$3$lcssa$i)) + 8|0); $mem$0 = $508; return ($mem$0|0); } else { $nb$0 = $246; } } } } } } while(0); $509 = HEAP32[(12908)>>2]|0; $510 = ($509>>>0)<($nb$0>>>0); if (!($510)) { $511 = (($509) - ($nb$0))|0; $512 = HEAP32[(12920)>>2]|0; $513 = ($511>>>0)>(15); if ($513) { $514 = (($512) + ($nb$0)|0); HEAP32[(12920)>>2] = $514; HEAP32[(12908)>>2] = $511; $515 = $511 | 1; $$sum2 = (($nb$0) + 4)|0; $516 = (($512) + ($$sum2)|0); HEAP32[$516>>2] = $515; $517 = (($512) + ($509)|0); HEAP32[$517>>2] = $511; $518 = $nb$0 | 3; $519 = ((($512)) + 4|0); HEAP32[$519>>2] = $518; } else { HEAP32[(12908)>>2] = 0; HEAP32[(12920)>>2] = 0; $520 = $509 | 3; $521 = ((($512)) + 4|0); HEAP32[$521>>2] = $520; $$sum1 = (($509) + 4)|0; $522 = (($512) + ($$sum1)|0); $523 = HEAP32[$522>>2]|0; $524 = $523 | 1; HEAP32[$522>>2] = $524; } $525 = ((($512)) + 8|0); $mem$0 = $525; return ($mem$0|0); } $526 = HEAP32[(12912)>>2]|0; $527 = ($526>>>0)>($nb$0>>>0); if ($527) { $528 = (($526) - ($nb$0))|0; HEAP32[(12912)>>2] = $528; $529 = HEAP32[(12924)>>2]|0; $530 = (($529) + ($nb$0)|0); HEAP32[(12924)>>2] = $530; $531 = $528 | 1; $$sum = (($nb$0) + 4)|0; $532 = (($529) + ($$sum)|0); HEAP32[$532>>2] = $531; $533 = $nb$0 | 3; $534 = ((($529)) + 4|0); HEAP32[$534>>2] = $533; $535 = ((($529)) + 8|0); $mem$0 = $535; return ($mem$0|0); } $536 = HEAP32[13372>>2]|0; $537 = ($536|0)==(0); do { if ($537) { $538 = (_sysconf(30)|0); $539 = (($538) + -1)|0; $540 = $539 & $538; $541 = ($540|0)==(0); if ($541) { HEAP32[(13380)>>2] = $538; HEAP32[(13376)>>2] = $538; HEAP32[(13384)>>2] = -1; HEAP32[(13388)>>2] = -1; HEAP32[(13392)>>2] = 0; HEAP32[(13344)>>2] = 0; $542 = (_time((0|0))|0); $543 = $542 & -16; $544 = $543 ^ 1431655768; HEAP32[13372>>2] = $544; break; } else { _abort(); // unreachable; } } } while(0); $545 = (($nb$0) + 48)|0; $546 = HEAP32[(13380)>>2]|0; $547 = (($nb$0) + 47)|0; $548 = (($546) + ($547))|0; $549 = (0 - ($546))|0; $550 = $548 & $549; $551 = ($550>>>0)>($nb$0>>>0); if (!($551)) { $mem$0 = 0; return ($mem$0|0); } $552 = HEAP32[(13340)>>2]|0; $553 = ($552|0)==(0); if (!($553)) { $554 = HEAP32[(13332)>>2]|0; $555 = (($554) + ($550))|0; $556 = ($555>>>0)<=($554>>>0); $557 = ($555>>>0)>($552>>>0); $or$cond1$i = $556 | $557; if ($or$cond1$i) { $mem$0 = 0; return ($mem$0|0); } } $558 = HEAP32[(13344)>>2]|0; $559 = $558 & 4; $560 = ($559|0)==(0); L258: do { if ($560) { $561 = HEAP32[(12924)>>2]|0; $562 = ($561|0)==(0|0); L260: do { if ($562) { label = 174; } else { $sp$0$i$i = (13348); while(1) { $563 = HEAP32[$sp$0$i$i>>2]|0; $564 = ($563>>>0)>($561>>>0); if (!($564)) { $565 = ((($sp$0$i$i)) + 4|0); $566 = HEAP32[$565>>2]|0; $567 = (($563) + ($566)|0); $568 = ($567>>>0)>($561>>>0); if ($568) { $$lcssa228 = $sp$0$i$i;$$lcssa230 = $565; break; } } $569 = ((($sp$0$i$i)) + 8|0); $570 = HEAP32[$569>>2]|0; $571 = ($570|0)==(0|0); if ($571) { label = 174; break L260; } else { $sp$0$i$i = $570; } } $594 = HEAP32[(12912)>>2]|0; $595 = (($548) - ($594))|0; $596 = $595 & $549; $597 = ($596>>>0)<(2147483647); if ($597) { $598 = (_sbrk(($596|0))|0); $599 = HEAP32[$$lcssa228>>2]|0; $600 = HEAP32[$$lcssa230>>2]|0; $601 = (($599) + ($600)|0); $602 = ($598|0)==($601|0); $$3$i = $602 ? $596 : 0; if ($602) { $603 = ($598|0)==((-1)|0); if ($603) { $tsize$0323944$i = $$3$i; } else { $tbase$255$i = $598;$tsize$254$i = $$3$i; label = 194; break L258; } } else { $br$0$ph$i = $598;$ssize$1$ph$i = $596;$tsize$0$ph$i = $$3$i; label = 184; } } else { $tsize$0323944$i = 0; } } } while(0); do { if ((label|0) == 174) { $572 = (_sbrk(0)|0); $573 = ($572|0)==((-1)|0); if ($573) { $tsize$0323944$i = 0; } else { $574 = $572; $575 = HEAP32[(13376)>>2]|0; $576 = (($575) + -1)|0; $577 = $576 & $574; $578 = ($577|0)==(0); if ($578) { $ssize$0$i = $550; } else { $579 = (($576) + ($574))|0; $580 = (0 - ($575))|0; $581 = $579 & $580; $582 = (($550) - ($574))|0; $583 = (($582) + ($581))|0; $ssize$0$i = $583; } $584 = HEAP32[(13332)>>2]|0; $585 = (($584) + ($ssize$0$i))|0; $586 = ($ssize$0$i>>>0)>($nb$0>>>0); $587 = ($ssize$0$i>>>0)<(2147483647); $or$cond$i30 = $586 & $587; if ($or$cond$i30) { $588 = HEAP32[(13340)>>2]|0; $589 = ($588|0)==(0); if (!($589)) { $590 = ($585>>>0)<=($584>>>0); $591 = ($585>>>0)>($588>>>0); $or$cond2$i = $590 | $591; if ($or$cond2$i) { $tsize$0323944$i = 0; break; } } $592 = (_sbrk(($ssize$0$i|0))|0); $593 = ($592|0)==($572|0); $ssize$0$$i = $593 ? $ssize$0$i : 0; if ($593) { $tbase$255$i = $572;$tsize$254$i = $ssize$0$$i; label = 194; break L258; } else { $br$0$ph$i = $592;$ssize$1$ph$i = $ssize$0$i;$tsize$0$ph$i = $ssize$0$$i; label = 184; } } else { $tsize$0323944$i = 0; } } } } while(0); L280: do { if ((label|0) == 184) { $604 = (0 - ($ssize$1$ph$i))|0; $605 = ($br$0$ph$i|0)!=((-1)|0); $606 = ($ssize$1$ph$i>>>0)<(2147483647); $or$cond5$i = $606 & $605; $607 = ($545>>>0)>($ssize$1$ph$i>>>0); $or$cond6$i = $607 & $or$cond5$i; do { if ($or$cond6$i) { $608 = HEAP32[(13380)>>2]|0; $609 = (($547) - ($ssize$1$ph$i))|0; $610 = (($609) + ($608))|0; $611 = (0 - ($608))|0; $612 = $610 & $611; $613 = ($612>>>0)<(2147483647); if ($613) { $614 = (_sbrk(($612|0))|0); $615 = ($614|0)==((-1)|0); if ($615) { (_sbrk(($604|0))|0); $tsize$0323944$i = $tsize$0$ph$i; break L280; } else { $616 = (($612) + ($ssize$1$ph$i))|0; $ssize$2$i = $616; break; } } else { $ssize$2$i = $ssize$1$ph$i; } } else { $ssize$2$i = $ssize$1$ph$i; } } while(0); $617 = ($br$0$ph$i|0)==((-1)|0); if ($617) { $tsize$0323944$i = $tsize$0$ph$i; } else { $tbase$255$i = $br$0$ph$i;$tsize$254$i = $ssize$2$i; label = 194; break L258; } } } while(0); $618 = HEAP32[(13344)>>2]|0; $619 = $618 | 4; HEAP32[(13344)>>2] = $619; $tsize$1$i = $tsize$0323944$i; label = 191; } else { $tsize$1$i = 0; label = 191; } } while(0); if ((label|0) == 191) { $620 = ($550>>>0)<(2147483647); if ($620) { $621 = (_sbrk(($550|0))|0); $622 = (_sbrk(0)|0); $623 = ($621|0)!=((-1)|0); $624 = ($622|0)!=((-1)|0); $or$cond3$i = $623 & $624; $625 = ($621>>>0)<($622>>>0); $or$cond8$i = $625 & $or$cond3$i; if ($or$cond8$i) { $626 = $622; $627 = $621; $628 = (($626) - ($627))|0; $629 = (($nb$0) + 40)|0; $630 = ($628>>>0)>($629>>>0); $$tsize$1$i = $630 ? $628 : $tsize$1$i; if ($630) { $tbase$255$i = $621;$tsize$254$i = $$tsize$1$i; label = 194; } } } } if ((label|0) == 194) { $631 = HEAP32[(13332)>>2]|0; $632 = (($631) + ($tsize$254$i))|0; HEAP32[(13332)>>2] = $632; $633 = HEAP32[(13336)>>2]|0; $634 = ($632>>>0)>($633>>>0); if ($634) { HEAP32[(13336)>>2] = $632; } $635 = HEAP32[(12924)>>2]|0; $636 = ($635|0)==(0|0); L299: do { if ($636) { $637 = HEAP32[(12916)>>2]|0; $638 = ($637|0)==(0|0); $639 = ($tbase$255$i>>>0)<($637>>>0); $or$cond9$i = $638 | $639; if ($or$cond9$i) { HEAP32[(12916)>>2] = $tbase$255$i; } HEAP32[(13348)>>2] = $tbase$255$i; HEAP32[(13352)>>2] = $tsize$254$i; HEAP32[(13360)>>2] = 0; $640 = HEAP32[13372>>2]|0; HEAP32[(12936)>>2] = $640; HEAP32[(12932)>>2] = -1; $i$02$i$i = 0; while(1) { $641 = $i$02$i$i << 1; $642 = (12940 + ($641<<2)|0); $$sum$i$i = (($641) + 3)|0; $643 = (12940 + ($$sum$i$i<<2)|0); HEAP32[$643>>2] = $642; $$sum1$i$i = (($641) + 2)|0; $644 = (12940 + ($$sum1$i$i<<2)|0); HEAP32[$644>>2] = $642; $645 = (($i$02$i$i) + 1)|0; $exitcond$i$i = ($645|0)==(32); if ($exitcond$i$i) { break; } else { $i$02$i$i = $645; } } $646 = (($tsize$254$i) + -40)|0; $647 = ((($tbase$255$i)) + 8|0); $648 = $647; $649 = $648 & 7; $650 = ($649|0)==(0); $651 = (0 - ($648))|0; $652 = $651 & 7; $653 = $650 ? 0 : $652; $654 = (($tbase$255$i) + ($653)|0); $655 = (($646) - ($653))|0; HEAP32[(12924)>>2] = $654; HEAP32[(12912)>>2] = $655; $656 = $655 | 1; $$sum$i13$i = (($653) + 4)|0; $657 = (($tbase$255$i) + ($$sum$i13$i)|0); HEAP32[$657>>2] = $656; $$sum2$i$i = (($tsize$254$i) + -36)|0; $658 = (($tbase$255$i) + ($$sum2$i$i)|0); HEAP32[$658>>2] = 40; $659 = HEAP32[(13388)>>2]|0; HEAP32[(12928)>>2] = $659; } else { $sp$084$i = (13348); while(1) { $660 = HEAP32[$sp$084$i>>2]|0; $661 = ((($sp$084$i)) + 4|0); $662 = HEAP32[$661>>2]|0; $663 = (($660) + ($662)|0); $664 = ($tbase$255$i|0)==($663|0); if ($664) { $$lcssa222 = $660;$$lcssa224 = $661;$$lcssa226 = $662;$sp$084$i$lcssa = $sp$084$i; label = 204; break; } $665 = ((($sp$084$i)) + 8|0); $666 = HEAP32[$665>>2]|0; $667 = ($666|0)==(0|0); if ($667) { break; } else { $sp$084$i = $666; } } if ((label|0) == 204) { $668 = ((($sp$084$i$lcssa)) + 12|0); $669 = HEAP32[$668>>2]|0; $670 = $669 & 8; $671 = ($670|0)==(0); if ($671) { $672 = ($635>>>0)>=($$lcssa222>>>0); $673 = ($635>>>0)<($tbase$255$i>>>0); $or$cond57$i = $673 & $672; if ($or$cond57$i) { $674 = (($$lcssa226) + ($tsize$254$i))|0; HEAP32[$$lcssa224>>2] = $674; $675 = HEAP32[(12912)>>2]|0; $676 = (($675) + ($tsize$254$i))|0; $677 = ((($635)) + 8|0); $678 = $677; $679 = $678 & 7; $680 = ($679|0)==(0); $681 = (0 - ($678))|0; $682 = $681 & 7; $683 = $680 ? 0 : $682; $684 = (($635) + ($683)|0); $685 = (($676) - ($683))|0; HEAP32[(12924)>>2] = $684; HEAP32[(12912)>>2] = $685; $686 = $685 | 1; $$sum$i17$i = (($683) + 4)|0; $687 = (($635) + ($$sum$i17$i)|0); HEAP32[$687>>2] = $686; $$sum2$i18$i = (($676) + 4)|0; $688 = (($635) + ($$sum2$i18$i)|0); HEAP32[$688>>2] = 40; $689 = HEAP32[(13388)>>2]|0; HEAP32[(12928)>>2] = $689; break; } } } $690 = HEAP32[(12916)>>2]|0; $691 = ($tbase$255$i>>>0)<($690>>>0); if ($691) { HEAP32[(12916)>>2] = $tbase$255$i; $755 = $tbase$255$i; } else { $755 = $690; } $692 = (($tbase$255$i) + ($tsize$254$i)|0); $sp$183$i = (13348); while(1) { $693 = HEAP32[$sp$183$i>>2]|0; $694 = ($693|0)==($692|0); if ($694) { $$lcssa219 = $sp$183$i;$sp$183$i$lcssa = $sp$183$i; label = 212; break; } $695 = ((($sp$183$i)) + 8|0); $696 = HEAP32[$695>>2]|0; $697 = ($696|0)==(0|0); if ($697) { $sp$0$i$i$i = (13348); break; } else { $sp$183$i = $696; } } if ((label|0) == 212) { $698 = ((($sp$183$i$lcssa)) + 12|0); $699 = HEAP32[$698>>2]|0; $700 = $699 & 8; $701 = ($700|0)==(0); if ($701) { HEAP32[$$lcssa219>>2] = $tbase$255$i; $702 = ((($sp$183$i$lcssa)) + 4|0); $703 = HEAP32[$702>>2]|0; $704 = (($703) + ($tsize$254$i))|0; HEAP32[$702>>2] = $704; $705 = ((($tbase$255$i)) + 8|0); $706 = $705; $707 = $706 & 7; $708 = ($707|0)==(0); $709 = (0 - ($706))|0; $710 = $709 & 7; $711 = $708 ? 0 : $710; $712 = (($tbase$255$i) + ($711)|0); $$sum112$i = (($tsize$254$i) + 8)|0; $713 = (($tbase$255$i) + ($$sum112$i)|0); $714 = $713; $715 = $714 & 7; $716 = ($715|0)==(0); $717 = (0 - ($714))|0; $718 = $717 & 7; $719 = $716 ? 0 : $718; $$sum113$i = (($719) + ($tsize$254$i))|0; $720 = (($tbase$255$i) + ($$sum113$i)|0); $721 = $720; $722 = $712; $723 = (($721) - ($722))|0; $$sum$i19$i = (($711) + ($nb$0))|0; $724 = (($tbase$255$i) + ($$sum$i19$i)|0); $725 = (($723) - ($nb$0))|0; $726 = $nb$0 | 3; $$sum1$i20$i = (($711) + 4)|0; $727 = (($tbase$255$i) + ($$sum1$i20$i)|0); HEAP32[$727>>2] = $726; $728 = ($720|0)==($635|0); L324: do { if ($728) { $729 = HEAP32[(12912)>>2]|0; $730 = (($729) + ($725))|0; HEAP32[(12912)>>2] = $730; HEAP32[(12924)>>2] = $724; $731 = $730 | 1; $$sum42$i$i = (($$sum$i19$i) + 4)|0; $732 = (($tbase$255$i) + ($$sum42$i$i)|0); HEAP32[$732>>2] = $731; } else { $733 = HEAP32[(12920)>>2]|0; $734 = ($720|0)==($733|0); if ($734) { $735 = HEAP32[(12908)>>2]|0; $736 = (($735) + ($725))|0; HEAP32[(12908)>>2] = $736; HEAP32[(12920)>>2] = $724; $737 = $736 | 1; $$sum40$i$i = (($$sum$i19$i) + 4)|0; $738 = (($tbase$255$i) + ($$sum40$i$i)|0); HEAP32[$738>>2] = $737; $$sum41$i$i = (($736) + ($$sum$i19$i))|0; $739 = (($tbase$255$i) + ($$sum41$i$i)|0); HEAP32[$739>>2] = $736; break; } $$sum2$i21$i = (($tsize$254$i) + 4)|0; $$sum114$i = (($$sum2$i21$i) + ($719))|0; $740 = (($tbase$255$i) + ($$sum114$i)|0); $741 = HEAP32[$740>>2]|0; $742 = $741 & 3; $743 = ($742|0)==(1); if ($743) { $744 = $741 & -8; $745 = $741 >>> 3; $746 = ($741>>>0)<(256); L332: do { if ($746) { $$sum3738$i$i = $719 | 8; $$sum124$i = (($$sum3738$i$i) + ($tsize$254$i))|0; $747 = (($tbase$255$i) + ($$sum124$i)|0); $748 = HEAP32[$747>>2]|0; $$sum39$i$i = (($tsize$254$i) + 12)|0; $$sum125$i = (($$sum39$i$i) + ($719))|0; $749 = (($tbase$255$i) + ($$sum125$i)|0); $750 = HEAP32[$749>>2]|0; $751 = $745 << 1; $752 = (12940 + ($751<<2)|0); $753 = ($748|0)==($752|0); do { if (!($753)) { $754 = ($748>>>0)<($755>>>0); if ($754) { _abort(); // unreachable; } $756 = ((($748)) + 12|0); $757 = HEAP32[$756>>2]|0; $758 = ($757|0)==($720|0); if ($758) { break; } _abort(); // unreachable; } } while(0); $759 = ($750|0)==($748|0); if ($759) { $760 = 1 << $745; $761 = $760 ^ -1; $762 = HEAP32[12900>>2]|0; $763 = $762 & $761; HEAP32[12900>>2] = $763; break; } $764 = ($750|0)==($752|0); do { if ($764) { $$pre57$i$i = ((($750)) + 8|0); $$pre$phi58$i$iZ2D = $$pre57$i$i; } else { $765 = ($750>>>0)<($755>>>0); if ($765) { _abort(); // unreachable; } $766 = ((($750)) + 8|0); $767 = HEAP32[$766>>2]|0; $768 = ($767|0)==($720|0); if ($768) { $$pre$phi58$i$iZ2D = $766; break; } _abort(); // unreachable; } } while(0); $769 = ((($748)) + 12|0); HEAP32[$769>>2] = $750; HEAP32[$$pre$phi58$i$iZ2D>>2] = $748; } else { $$sum34$i$i = $719 | 24; $$sum115$i = (($$sum34$i$i) + ($tsize$254$i))|0; $770 = (($tbase$255$i) + ($$sum115$i)|0); $771 = HEAP32[$770>>2]|0; $$sum5$i$i = (($tsize$254$i) + 12)|0; $$sum116$i = (($$sum5$i$i) + ($719))|0; $772 = (($tbase$255$i) + ($$sum116$i)|0); $773 = HEAP32[$772>>2]|0; $774 = ($773|0)==($720|0); do { if ($774) { $$sum67$i$i = $719 | 16; $$sum122$i = (($$sum2$i21$i) + ($$sum67$i$i))|0; $784 = (($tbase$255$i) + ($$sum122$i)|0); $785 = HEAP32[$784>>2]|0; $786 = ($785|0)==(0|0); if ($786) { $$sum123$i = (($$sum67$i$i) + ($tsize$254$i))|0; $787 = (($tbase$255$i) + ($$sum123$i)|0); $788 = HEAP32[$787>>2]|0; $789 = ($788|0)==(0|0); if ($789) { $R$1$i$i = 0; break; } else { $R$0$i$i = $788;$RP$0$i$i = $787; } } else { $R$0$i$i = $785;$RP$0$i$i = $784; } while(1) { $790 = ((($R$0$i$i)) + 20|0); $791 = HEAP32[$790>>2]|0; $792 = ($791|0)==(0|0); if (!($792)) { $R$0$i$i = $791;$RP$0$i$i = $790; continue; } $793 = ((($R$0$i$i)) + 16|0); $794 = HEAP32[$793>>2]|0; $795 = ($794|0)==(0|0); if ($795) { $R$0$i$i$lcssa = $R$0$i$i;$RP$0$i$i$lcssa = $RP$0$i$i; break; } else { $R$0$i$i = $794;$RP$0$i$i = $793; } } $796 = ($RP$0$i$i$lcssa>>>0)<($755>>>0); if ($796) { _abort(); // unreachable; } else { HEAP32[$RP$0$i$i$lcssa>>2] = 0; $R$1$i$i = $R$0$i$i$lcssa; break; } } else { $$sum3536$i$i = $719 | 8; $$sum117$i = (($$sum3536$i$i) + ($tsize$254$i))|0; $775 = (($tbase$255$i) + ($$sum117$i)|0); $776 = HEAP32[$775>>2]|0; $777 = ($776>>>0)<($755>>>0); if ($777) { _abort(); // unreachable; } $778 = ((($776)) + 12|0); $779 = HEAP32[$778>>2]|0; $780 = ($779|0)==($720|0); if (!($780)) { _abort(); // unreachable; } $781 = ((($773)) + 8|0); $782 = HEAP32[$781>>2]|0; $783 = ($782|0)==($720|0); if ($783) { HEAP32[$778>>2] = $773; HEAP32[$781>>2] = $776; $R$1$i$i = $773; break; } else { _abort(); // unreachable; } } } while(0); $797 = ($771|0)==(0|0); if ($797) { break; } $$sum30$i$i = (($tsize$254$i) + 28)|0; $$sum118$i = (($$sum30$i$i) + ($719))|0; $798 = (($tbase$255$i) + ($$sum118$i)|0); $799 = HEAP32[$798>>2]|0; $800 = (13204 + ($799<<2)|0); $801 = HEAP32[$800>>2]|0; $802 = ($720|0)==($801|0); do { if ($802) { HEAP32[$800>>2] = $R$1$i$i; $cond$i$i = ($R$1$i$i|0)==(0|0); if (!($cond$i$i)) { break; } $803 = 1 << $799; $804 = $803 ^ -1; $805 = HEAP32[(12904)>>2]|0; $806 = $805 & $804; HEAP32[(12904)>>2] = $806; break L332; } else { $807 = HEAP32[(12916)>>2]|0; $808 = ($771>>>0)<($807>>>0); if ($808) { _abort(); // unreachable; } $809 = ((($771)) + 16|0); $810 = HEAP32[$809>>2]|0; $811 = ($810|0)==($720|0); if ($811) { HEAP32[$809>>2] = $R$1$i$i; } else { $812 = ((($771)) + 20|0); HEAP32[$812>>2] = $R$1$i$i; } $813 = ($R$1$i$i|0)==(0|0); if ($813) { break L332; } } } while(0); $814 = HEAP32[(12916)>>2]|0; $815 = ($R$1$i$i>>>0)<($814>>>0); if ($815) { _abort(); // unreachable; } $816 = ((($R$1$i$i)) + 24|0); HEAP32[$816>>2] = $771; $$sum3132$i$i = $719 | 16; $$sum119$i = (($$sum3132$i$i) + ($tsize$254$i))|0; $817 = (($tbase$255$i) + ($$sum119$i)|0); $818 = HEAP32[$817>>2]|0; $819 = ($818|0)==(0|0); do { if (!($819)) { $820 = ($818>>>0)<($814>>>0); if ($820) { _abort(); // unreachable; } else { $821 = ((($R$1$i$i)) + 16|0); HEAP32[$821>>2] = $818; $822 = ((($818)) + 24|0); HEAP32[$822>>2] = $R$1$i$i; break; } } } while(0); $$sum120$i = (($$sum2$i21$i) + ($$sum3132$i$i))|0; $823 = (($tbase$255$i) + ($$sum120$i)|0); $824 = HEAP32[$823>>2]|0; $825 = ($824|0)==(0|0); if ($825) { break; } $826 = HEAP32[(12916)>>2]|0; $827 = ($824>>>0)<($826>>>0); if ($827) { _abort(); // unreachable; } else { $828 = ((($R$1$i$i)) + 20|0); HEAP32[$828>>2] = $824; $829 = ((($824)) + 24|0); HEAP32[$829>>2] = $R$1$i$i; break; } } } while(0); $$sum9$i$i = $744 | $719; $$sum121$i = (($$sum9$i$i) + ($tsize$254$i))|0; $830 = (($tbase$255$i) + ($$sum121$i)|0); $831 = (($744) + ($725))|0; $oldfirst$0$i$i = $830;$qsize$0$i$i = $831; } else { $oldfirst$0$i$i = $720;$qsize$0$i$i = $725; } $832 = ((($oldfirst$0$i$i)) + 4|0); $833 = HEAP32[$832>>2]|0; $834 = $833 & -2; HEAP32[$832>>2] = $834; $835 = $qsize$0$i$i | 1; $$sum10$i$i = (($$sum$i19$i) + 4)|0; $836 = (($tbase$255$i) + ($$sum10$i$i)|0); HEAP32[$836>>2] = $835; $$sum11$i$i = (($qsize$0$i$i) + ($$sum$i19$i))|0; $837 = (($tbase$255$i) + ($$sum11$i$i)|0); HEAP32[$837>>2] = $qsize$0$i$i; $838 = $qsize$0$i$i >>> 3; $839 = ($qsize$0$i$i>>>0)<(256); if ($839) { $840 = $838 << 1; $841 = (12940 + ($840<<2)|0); $842 = HEAP32[12900>>2]|0; $843 = 1 << $838; $844 = $842 & $843; $845 = ($844|0)==(0); do { if ($845) { $846 = $842 | $843; HEAP32[12900>>2] = $846; $$pre$i22$i = (($840) + 2)|0; $$pre56$i$i = (12940 + ($$pre$i22$i<<2)|0); $$pre$phi$i23$iZ2D = $$pre56$i$i;$F4$0$i$i = $841; } else { $$sum29$i$i = (($840) + 2)|0; $847 = (12940 + ($$sum29$i$i<<2)|0); $848 = HEAP32[$847>>2]|0; $849 = HEAP32[(12916)>>2]|0; $850 = ($848>>>0)<($849>>>0); if (!($850)) { $$pre$phi$i23$iZ2D = $847;$F4$0$i$i = $848; break; } _abort(); // unreachable; } } while(0); HEAP32[$$pre$phi$i23$iZ2D>>2] = $724; $851 = ((($F4$0$i$i)) + 12|0); HEAP32[$851>>2] = $724; $$sum27$i$i = (($$sum$i19$i) + 8)|0; $852 = (($tbase$255$i) + ($$sum27$i$i)|0); HEAP32[$852>>2] = $F4$0$i$i; $$sum28$i$i = (($$sum$i19$i) + 12)|0; $853 = (($tbase$255$i) + ($$sum28$i$i)|0); HEAP32[$853>>2] = $841; break; } $854 = $qsize$0$i$i >>> 8; $855 = ($854|0)==(0); do { if ($855) { $I7$0$i$i = 0; } else { $856 = ($qsize$0$i$i>>>0)>(16777215); if ($856) { $I7$0$i$i = 31; break; } $857 = (($854) + 1048320)|0; $858 = $857 >>> 16; $859 = $858 & 8; $860 = $854 << $859; $861 = (($860) + 520192)|0; $862 = $861 >>> 16; $863 = $862 & 4; $864 = $863 | $859; $865 = $860 << $863; $866 = (($865) + 245760)|0; $867 = $866 >>> 16; $868 = $867 & 2; $869 = $864 | $868; $870 = (14 - ($869))|0; $871 = $865 << $868; $872 = $871 >>> 15; $873 = (($870) + ($872))|0; $874 = $873 << 1; $875 = (($873) + 7)|0; $876 = $qsize$0$i$i >>> $875; $877 = $876 & 1; $878 = $877 | $874; $I7$0$i$i = $878; } } while(0); $879 = (13204 + ($I7$0$i$i<<2)|0); $$sum12$i$i = (($$sum$i19$i) + 28)|0; $880 = (($tbase$255$i) + ($$sum12$i$i)|0); HEAP32[$880>>2] = $I7$0$i$i; $$sum13$i$i = (($$sum$i19$i) + 16)|0; $881 = (($tbase$255$i) + ($$sum13$i$i)|0); $$sum14$i$i = (($$sum$i19$i) + 20)|0; $882 = (($tbase$255$i) + ($$sum14$i$i)|0); HEAP32[$882>>2] = 0; HEAP32[$881>>2] = 0; $883 = HEAP32[(12904)>>2]|0; $884 = 1 << $I7$0$i$i; $885 = $883 & $884; $886 = ($885|0)==(0); if ($886) { $887 = $883 | $884; HEAP32[(12904)>>2] = $887; HEAP32[$879>>2] = $724; $$sum15$i$i = (($$sum$i19$i) + 24)|0; $888 = (($tbase$255$i) + ($$sum15$i$i)|0); HEAP32[$888>>2] = $879; $$sum16$i$i = (($$sum$i19$i) + 12)|0; $889 = (($tbase$255$i) + ($$sum16$i$i)|0); HEAP32[$889>>2] = $724; $$sum17$i$i = (($$sum$i19$i) + 8)|0; $890 = (($tbase$255$i) + ($$sum17$i$i)|0); HEAP32[$890>>2] = $724; break; } $891 = HEAP32[$879>>2]|0; $892 = ((($891)) + 4|0); $893 = HEAP32[$892>>2]|0; $894 = $893 & -8; $895 = ($894|0)==($qsize$0$i$i|0); L418: do { if ($895) { $T$0$lcssa$i25$i = $891; } else { $896 = ($I7$0$i$i|0)==(31); $897 = $I7$0$i$i >>> 1; $898 = (25 - ($897))|0; $899 = $896 ? 0 : $898; $900 = $qsize$0$i$i << $899; $K8$051$i$i = $900;$T$050$i$i = $891; while(1) { $907 = $K8$051$i$i >>> 31; $908 = (((($T$050$i$i)) + 16|0) + ($907<<2)|0); $903 = HEAP32[$908>>2]|0; $909 = ($903|0)==(0|0); if ($909) { $$lcssa = $908;$T$050$i$i$lcssa = $T$050$i$i; break; } $901 = $K8$051$i$i << 1; $902 = ((($903)) + 4|0); $904 = HEAP32[$902>>2]|0; $905 = $904 & -8; $906 = ($905|0)==($qsize$0$i$i|0); if ($906) { $T$0$lcssa$i25$i = $903; break L418; } else { $K8$051$i$i = $901;$T$050$i$i = $903; } } $910 = HEAP32[(12916)>>2]|0; $911 = ($$lcssa>>>0)<($910>>>0); if ($911) { _abort(); // unreachable; } else { HEAP32[$$lcssa>>2] = $724; $$sum23$i$i = (($$sum$i19$i) + 24)|0; $912 = (($tbase$255$i) + ($$sum23$i$i)|0); HEAP32[$912>>2] = $T$050$i$i$lcssa; $$sum24$i$i = (($$sum$i19$i) + 12)|0; $913 = (($tbase$255$i) + ($$sum24$i$i)|0); HEAP32[$913>>2] = $724; $$sum25$i$i = (($$sum$i19$i) + 8)|0; $914 = (($tbase$255$i) + ($$sum25$i$i)|0); HEAP32[$914>>2] = $724; break L324; } } } while(0); $915 = ((($T$0$lcssa$i25$i)) + 8|0); $916 = HEAP32[$915>>2]|0; $917 = HEAP32[(12916)>>2]|0; $918 = ($916>>>0)>=($917>>>0); $not$$i26$i = ($T$0$lcssa$i25$i>>>0)>=($917>>>0); $919 = $918 & $not$$i26$i; if ($919) { $920 = ((($916)) + 12|0); HEAP32[$920>>2] = $724; HEAP32[$915>>2] = $724; $$sum20$i$i = (($$sum$i19$i) + 8)|0; $921 = (($tbase$255$i) + ($$sum20$i$i)|0); HEAP32[$921>>2] = $916; $$sum21$i$i = (($$sum$i19$i) + 12)|0; $922 = (($tbase$255$i) + ($$sum21$i$i)|0); HEAP32[$922>>2] = $T$0$lcssa$i25$i; $$sum22$i$i = (($$sum$i19$i) + 24)|0; $923 = (($tbase$255$i) + ($$sum22$i$i)|0); HEAP32[$923>>2] = 0; break; } else { _abort(); // unreachable; } } } while(0); $$sum1819$i$i = $711 | 8; $924 = (($tbase$255$i) + ($$sum1819$i$i)|0); $mem$0 = $924; return ($mem$0|0); } else { $sp$0$i$i$i = (13348); } } while(1) { $925 = HEAP32[$sp$0$i$i$i>>2]|0; $926 = ($925>>>0)>($635>>>0); if (!($926)) { $927 = ((($sp$0$i$i$i)) + 4|0); $928 = HEAP32[$927>>2]|0; $929 = (($925) + ($928)|0); $930 = ($929>>>0)>($635>>>0); if ($930) { $$lcssa215 = $925;$$lcssa216 = $928;$$lcssa217 = $929; break; } } $931 = ((($sp$0$i$i$i)) + 8|0); $932 = HEAP32[$931>>2]|0; $sp$0$i$i$i = $932; } $$sum$i14$i = (($$lcssa216) + -47)|0; $$sum1$i15$i = (($$lcssa216) + -39)|0; $933 = (($$lcssa215) + ($$sum1$i15$i)|0); $934 = $933; $935 = $934 & 7; $936 = ($935|0)==(0); $937 = (0 - ($934))|0; $938 = $937 & 7; $939 = $936 ? 0 : $938; $$sum2$i16$i = (($$sum$i14$i) + ($939))|0; $940 = (($$lcssa215) + ($$sum2$i16$i)|0); $941 = ((($635)) + 16|0); $942 = ($940>>>0)<($941>>>0); $943 = $942 ? $635 : $940; $944 = ((($943)) + 8|0); $945 = (($tsize$254$i) + -40)|0; $946 = ((($tbase$255$i)) + 8|0); $947 = $946; $948 = $947 & 7; $949 = ($948|0)==(0); $950 = (0 - ($947))|0; $951 = $950 & 7; $952 = $949 ? 0 : $951; $953 = (($tbase$255$i) + ($952)|0); $954 = (($945) - ($952))|0; HEAP32[(12924)>>2] = $953; HEAP32[(12912)>>2] = $954; $955 = $954 | 1; $$sum$i$i$i = (($952) + 4)|0; $956 = (($tbase$255$i) + ($$sum$i$i$i)|0); HEAP32[$956>>2] = $955; $$sum2$i$i$i = (($tsize$254$i) + -36)|0; $957 = (($tbase$255$i) + ($$sum2$i$i$i)|0); HEAP32[$957>>2] = 40; $958 = HEAP32[(13388)>>2]|0; HEAP32[(12928)>>2] = $958; $959 = ((($943)) + 4|0); HEAP32[$959>>2] = 27; ;HEAP32[$944>>2]=HEAP32[(13348)>>2]|0;HEAP32[$944+4>>2]=HEAP32[(13348)+4>>2]|0;HEAP32[$944+8>>2]=HEAP32[(13348)+8>>2]|0;HEAP32[$944+12>>2]=HEAP32[(13348)+12>>2]|0; HEAP32[(13348)>>2] = $tbase$255$i; HEAP32[(13352)>>2] = $tsize$254$i; HEAP32[(13360)>>2] = 0; HEAP32[(13356)>>2] = $944; $960 = ((($943)) + 28|0); HEAP32[$960>>2] = 7; $961 = ((($943)) + 32|0); $962 = ($961>>>0)<($$lcssa217>>>0); if ($962) { $964 = $960; while(1) { $963 = ((($964)) + 4|0); HEAP32[$963>>2] = 7; $965 = ((($964)) + 8|0); $966 = ($965>>>0)<($$lcssa217>>>0); if ($966) { $964 = $963; } else { break; } } } $967 = ($943|0)==($635|0); if (!($967)) { $968 = $943; $969 = $635; $970 = (($968) - ($969))|0; $971 = HEAP32[$959>>2]|0; $972 = $971 & -2; HEAP32[$959>>2] = $972; $973 = $970 | 1; $974 = ((($635)) + 4|0); HEAP32[$974>>2] = $973; HEAP32[$943>>2] = $970; $975 = $970 >>> 3; $976 = ($970>>>0)<(256); if ($976) { $977 = $975 << 1; $978 = (12940 + ($977<<2)|0); $979 = HEAP32[12900>>2]|0; $980 = 1 << $975; $981 = $979 & $980; $982 = ($981|0)==(0); if ($982) { $983 = $979 | $980; HEAP32[12900>>2] = $983; $$pre$i$i = (($977) + 2)|0; $$pre14$i$i = (12940 + ($$pre$i$i<<2)|0); $$pre$phi$i$iZ2D = $$pre14$i$i;$F$0$i$i = $978; } else { $$sum4$i$i = (($977) + 2)|0; $984 = (12940 + ($$sum4$i$i<<2)|0); $985 = HEAP32[$984>>2]|0; $986 = HEAP32[(12916)>>2]|0; $987 = ($985>>>0)<($986>>>0); if ($987) { _abort(); // unreachable; } else { $$pre$phi$i$iZ2D = $984;$F$0$i$i = $985; } } HEAP32[$$pre$phi$i$iZ2D>>2] = $635; $988 = ((($F$0$i$i)) + 12|0); HEAP32[$988>>2] = $635; $989 = ((($635)) + 8|0); HEAP32[$989>>2] = $F$0$i$i; $990 = ((($635)) + 12|0); HEAP32[$990>>2] = $978; break; } $991 = $970 >>> 8; $992 = ($991|0)==(0); if ($992) { $I1$0$i$i = 0; } else { $993 = ($970>>>0)>(16777215); if ($993) { $I1$0$i$i = 31; } else { $994 = (($991) + 1048320)|0; $995 = $994 >>> 16; $996 = $995 & 8; $997 = $991 << $996; $998 = (($997) + 520192)|0; $999 = $998 >>> 16; $1000 = $999 & 4; $1001 = $1000 | $996; $1002 = $997 << $1000; $1003 = (($1002) + 245760)|0; $1004 = $1003 >>> 16; $1005 = $1004 & 2; $1006 = $1001 | $1005; $1007 = (14 - ($1006))|0; $1008 = $1002 << $1005; $1009 = $1008 >>> 15; $1010 = (($1007) + ($1009))|0; $1011 = $1010 << 1; $1012 = (($1010) + 7)|0; $1013 = $970 >>> $1012; $1014 = $1013 & 1; $1015 = $1014 | $1011; $I1$0$i$i = $1015; } } $1016 = (13204 + ($I1$0$i$i<<2)|0); $1017 = ((($635)) + 28|0); HEAP32[$1017>>2] = $I1$0$i$i; $1018 = ((($635)) + 20|0); HEAP32[$1018>>2] = 0; HEAP32[$941>>2] = 0; $1019 = HEAP32[(12904)>>2]|0; $1020 = 1 << $I1$0$i$i; $1021 = $1019 & $1020; $1022 = ($1021|0)==(0); if ($1022) { $1023 = $1019 | $1020; HEAP32[(12904)>>2] = $1023; HEAP32[$1016>>2] = $635; $1024 = ((($635)) + 24|0); HEAP32[$1024>>2] = $1016; $1025 = ((($635)) + 12|0); HEAP32[$1025>>2] = $635; $1026 = ((($635)) + 8|0); HEAP32[$1026>>2] = $635; break; } $1027 = HEAP32[$1016>>2]|0; $1028 = ((($1027)) + 4|0); $1029 = HEAP32[$1028>>2]|0; $1030 = $1029 & -8; $1031 = ($1030|0)==($970|0); L459: do { if ($1031) { $T$0$lcssa$i$i = $1027; } else { $1032 = ($I1$0$i$i|0)==(31); $1033 = $I1$0$i$i >>> 1; $1034 = (25 - ($1033))|0; $1035 = $1032 ? 0 : $1034; $1036 = $970 << $1035; $K2$07$i$i = $1036;$T$06$i$i = $1027; while(1) { $1043 = $K2$07$i$i >>> 31; $1044 = (((($T$06$i$i)) + 16|0) + ($1043<<2)|0); $1039 = HEAP32[$1044>>2]|0; $1045 = ($1039|0)==(0|0); if ($1045) { $$lcssa211 = $1044;$T$06$i$i$lcssa = $T$06$i$i; break; } $1037 = $K2$07$i$i << 1; $1038 = ((($1039)) + 4|0); $1040 = HEAP32[$1038>>2]|0; $1041 = $1040 & -8; $1042 = ($1041|0)==($970|0); if ($1042) { $T$0$lcssa$i$i = $1039; break L459; } else { $K2$07$i$i = $1037;$T$06$i$i = $1039; } } $1046 = HEAP32[(12916)>>2]|0; $1047 = ($$lcssa211>>>0)<($1046>>>0); if ($1047) { _abort(); // unreachable; } else { HEAP32[$$lcssa211>>2] = $635; $1048 = ((($635)) + 24|0); HEAP32[$1048>>2] = $T$06$i$i$lcssa; $1049 = ((($635)) + 12|0); HEAP32[$1049>>2] = $635; $1050 = ((($635)) + 8|0); HEAP32[$1050>>2] = $635; break L299; } } } while(0); $1051 = ((($T$0$lcssa$i$i)) + 8|0); $1052 = HEAP32[$1051>>2]|0; $1053 = HEAP32[(12916)>>2]|0; $1054 = ($1052>>>0)>=($1053>>>0); $not$$i$i = ($T$0$lcssa$i$i>>>0)>=($1053>>>0); $1055 = $1054 & $not$$i$i; if ($1055) { $1056 = ((($1052)) + 12|0); HEAP32[$1056>>2] = $635; HEAP32[$1051>>2] = $635; $1057 = ((($635)) + 8|0); HEAP32[$1057>>2] = $1052; $1058 = ((($635)) + 12|0); HEAP32[$1058>>2] = $T$0$lcssa$i$i; $1059 = ((($635)) + 24|0); HEAP32[$1059>>2] = 0; break; } else { _abort(); // unreachable; } } } } while(0); $1060 = HEAP32[(12912)>>2]|0; $1061 = ($1060>>>0)>($nb$0>>>0); if ($1061) { $1062 = (($1060) - ($nb$0))|0; HEAP32[(12912)>>2] = $1062; $1063 = HEAP32[(12924)>>2]|0; $1064 = (($1063) + ($nb$0)|0); HEAP32[(12924)>>2] = $1064; $1065 = $1062 | 1; $$sum$i32 = (($nb$0) + 4)|0; $1066 = (($1063) + ($$sum$i32)|0); HEAP32[$1066>>2] = $1065; $1067 = $nb$0 | 3; $1068 = ((($1063)) + 4|0); HEAP32[$1068>>2] = $1067; $1069 = ((($1063)) + 8|0); $mem$0 = $1069; return ($mem$0|0); } } $1070 = (___errno_location()|0); HEAP32[$1070>>2] = 12; $mem$0 = 0; return ($mem$0|0); } function _free($mem) { $mem = $mem|0; var $$lcssa = 0, $$pre = 0, $$pre$phi59Z2D = 0, $$pre$phi61Z2D = 0, $$pre$phiZ2D = 0, $$pre57 = 0, $$pre58 = 0, $$pre60 = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum1718 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0; var $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum5 = 0, $$sum67 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0; var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0; var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0; var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0; var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0; var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0; var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0; var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0; var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0; var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0; var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0; var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0; var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0; var $321 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0; var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0; var $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0; var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I18$0 = 0, $K19$052 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0; var $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$051 = 0, $T$051$lcssa = 0, $cond = 0, $cond47 = 0, $not$ = 0, $p$0 = 0, $psize$0 = 0, $psize$1 = 0, $sp$0$i = 0, $sp$0$in$i = 0, label = 0, sp = 0; sp = STACKTOP; $0 = ($mem|0)==(0|0); if ($0) { return; } $1 = ((($mem)) + -8|0); $2 = HEAP32[(12916)>>2]|0; $3 = ($1>>>0)<($2>>>0); if ($3) { _abort(); // unreachable; } $4 = ((($mem)) + -4|0); $5 = HEAP32[$4>>2]|0; $6 = $5 & 3; $7 = ($6|0)==(1); if ($7) { _abort(); // unreachable; } $8 = $5 & -8; $$sum = (($8) + -8)|0; $9 = (($mem) + ($$sum)|0); $10 = $5 & 1; $11 = ($10|0)==(0); do { if ($11) { $12 = HEAP32[$1>>2]|0; $13 = ($6|0)==(0); if ($13) { return; } $$sum2 = (-8 - ($12))|0; $14 = (($mem) + ($$sum2)|0); $15 = (($12) + ($8))|0; $16 = ($14>>>0)<($2>>>0); if ($16) { _abort(); // unreachable; } $17 = HEAP32[(12920)>>2]|0; $18 = ($14|0)==($17|0); if ($18) { $$sum3 = (($8) + -4)|0; $103 = (($mem) + ($$sum3)|0); $104 = HEAP32[$103>>2]|0; $105 = $104 & 3; $106 = ($105|0)==(3); if (!($106)) { $p$0 = $14;$psize$0 = $15; break; } HEAP32[(12908)>>2] = $15; $107 = $104 & -2; HEAP32[$103>>2] = $107; $108 = $15 | 1; $$sum20 = (($$sum2) + 4)|0; $109 = (($mem) + ($$sum20)|0); HEAP32[$109>>2] = $108; HEAP32[$9>>2] = $15; return; } $19 = $12 >>> 3; $20 = ($12>>>0)<(256); if ($20) { $$sum30 = (($$sum2) + 8)|0; $21 = (($mem) + ($$sum30)|0); $22 = HEAP32[$21>>2]|0; $$sum31 = (($$sum2) + 12)|0; $23 = (($mem) + ($$sum31)|0); $24 = HEAP32[$23>>2]|0; $25 = $19 << 1; $26 = (12940 + ($25<<2)|0); $27 = ($22|0)==($26|0); if (!($27)) { $28 = ($22>>>0)<($2>>>0); if ($28) { _abort(); // unreachable; } $29 = ((($22)) + 12|0); $30 = HEAP32[$29>>2]|0; $31 = ($30|0)==($14|0); if (!($31)) { _abort(); // unreachable; } } $32 = ($24|0)==($22|0); if ($32) { $33 = 1 << $19; $34 = $33 ^ -1; $35 = HEAP32[12900>>2]|0; $36 = $35 & $34; HEAP32[12900>>2] = $36; $p$0 = $14;$psize$0 = $15; break; } $37 = ($24|0)==($26|0); if ($37) { $$pre60 = ((($24)) + 8|0); $$pre$phi61Z2D = $$pre60; } else { $38 = ($24>>>0)<($2>>>0); if ($38) { _abort(); // unreachable; } $39 = ((($24)) + 8|0); $40 = HEAP32[$39>>2]|0; $41 = ($40|0)==($14|0); if ($41) { $$pre$phi61Z2D = $39; } else { _abort(); // unreachable; } } $42 = ((($22)) + 12|0); HEAP32[$42>>2] = $24; HEAP32[$$pre$phi61Z2D>>2] = $22; $p$0 = $14;$psize$0 = $15; break; } $$sum22 = (($$sum2) + 24)|0; $43 = (($mem) + ($$sum22)|0); $44 = HEAP32[$43>>2]|0; $$sum23 = (($$sum2) + 12)|0; $45 = (($mem) + ($$sum23)|0); $46 = HEAP32[$45>>2]|0; $47 = ($46|0)==($14|0); do { if ($47) { $$sum25 = (($$sum2) + 20)|0; $57 = (($mem) + ($$sum25)|0); $58 = HEAP32[$57>>2]|0; $59 = ($58|0)==(0|0); if ($59) { $$sum24 = (($$sum2) + 16)|0; $60 = (($mem) + ($$sum24)|0); $61 = HEAP32[$60>>2]|0; $62 = ($61|0)==(0|0); if ($62) { $R$1 = 0; break; } else { $R$0 = $61;$RP$0 = $60; } } else { $R$0 = $58;$RP$0 = $57; } while(1) { $63 = ((($R$0)) + 20|0); $64 = HEAP32[$63>>2]|0; $65 = ($64|0)==(0|0); if (!($65)) { $R$0 = $64;$RP$0 = $63; continue; } $66 = ((($R$0)) + 16|0); $67 = HEAP32[$66>>2]|0; $68 = ($67|0)==(0|0); if ($68) { $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; break; } else { $R$0 = $67;$RP$0 = $66; } } $69 = ($RP$0$lcssa>>>0)<($2>>>0); if ($69) { _abort(); // unreachable; } else { HEAP32[$RP$0$lcssa>>2] = 0; $R$1 = $R$0$lcssa; break; } } else { $$sum29 = (($$sum2) + 8)|0; $48 = (($mem) + ($$sum29)|0); $49 = HEAP32[$48>>2]|0; $50 = ($49>>>0)<($2>>>0); if ($50) { _abort(); // unreachable; } $51 = ((($49)) + 12|0); $52 = HEAP32[$51>>2]|0; $53 = ($52|0)==($14|0); if (!($53)) { _abort(); // unreachable; } $54 = ((($46)) + 8|0); $55 = HEAP32[$54>>2]|0; $56 = ($55|0)==($14|0); if ($56) { HEAP32[$51>>2] = $46; HEAP32[$54>>2] = $49; $R$1 = $46; break; } else { _abort(); // unreachable; } } } while(0); $70 = ($44|0)==(0|0); if ($70) { $p$0 = $14;$psize$0 = $15; } else { $$sum26 = (($$sum2) + 28)|0; $71 = (($mem) + ($$sum26)|0); $72 = HEAP32[$71>>2]|0; $73 = (13204 + ($72<<2)|0); $74 = HEAP32[$73>>2]|0; $75 = ($14|0)==($74|0); if ($75) { HEAP32[$73>>2] = $R$1; $cond = ($R$1|0)==(0|0); if ($cond) { $76 = 1 << $72; $77 = $76 ^ -1; $78 = HEAP32[(12904)>>2]|0; $79 = $78 & $77; HEAP32[(12904)>>2] = $79; $p$0 = $14;$psize$0 = $15; break; } } else { $80 = HEAP32[(12916)>>2]|0; $81 = ($44>>>0)<($80>>>0); if ($81) { _abort(); // unreachable; } $82 = ((($44)) + 16|0); $83 = HEAP32[$82>>2]|0; $84 = ($83|0)==($14|0); if ($84) { HEAP32[$82>>2] = $R$1; } else { $85 = ((($44)) + 20|0); HEAP32[$85>>2] = $R$1; } $86 = ($R$1|0)==(0|0); if ($86) { $p$0 = $14;$psize$0 = $15; break; } } $87 = HEAP32[(12916)>>2]|0; $88 = ($R$1>>>0)<($87>>>0); if ($88) { _abort(); // unreachable; } $89 = ((($R$1)) + 24|0); HEAP32[$89>>2] = $44; $$sum27 = (($$sum2) + 16)|0; $90 = (($mem) + ($$sum27)|0); $91 = HEAP32[$90>>2]|0; $92 = ($91|0)==(0|0); do { if (!($92)) { $93 = ($91>>>0)<($87>>>0); if ($93) { _abort(); // unreachable; } else { $94 = ((($R$1)) + 16|0); HEAP32[$94>>2] = $91; $95 = ((($91)) + 24|0); HEAP32[$95>>2] = $R$1; break; } } } while(0); $$sum28 = (($$sum2) + 20)|0; $96 = (($mem) + ($$sum28)|0); $97 = HEAP32[$96>>2]|0; $98 = ($97|0)==(0|0); if ($98) { $p$0 = $14;$psize$0 = $15; } else { $99 = HEAP32[(12916)>>2]|0; $100 = ($97>>>0)<($99>>>0); if ($100) { _abort(); // unreachable; } else { $101 = ((($R$1)) + 20|0); HEAP32[$101>>2] = $97; $102 = ((($97)) + 24|0); HEAP32[$102>>2] = $R$1; $p$0 = $14;$psize$0 = $15; break; } } } } else { $p$0 = $1;$psize$0 = $8; } } while(0); $110 = ($p$0>>>0)<($9>>>0); if (!($110)) { _abort(); // unreachable; } $$sum19 = (($8) + -4)|0; $111 = (($mem) + ($$sum19)|0); $112 = HEAP32[$111>>2]|0; $113 = $112 & 1; $114 = ($113|0)==(0); if ($114) { _abort(); // unreachable; } $115 = $112 & 2; $116 = ($115|0)==(0); if ($116) { $117 = HEAP32[(12924)>>2]|0; $118 = ($9|0)==($117|0); if ($118) { $119 = HEAP32[(12912)>>2]|0; $120 = (($119) + ($psize$0))|0; HEAP32[(12912)>>2] = $120; HEAP32[(12924)>>2] = $p$0; $121 = $120 | 1; $122 = ((($p$0)) + 4|0); HEAP32[$122>>2] = $121; $123 = HEAP32[(12920)>>2]|0; $124 = ($p$0|0)==($123|0); if (!($124)) { return; } HEAP32[(12920)>>2] = 0; HEAP32[(12908)>>2] = 0; return; } $125 = HEAP32[(12920)>>2]|0; $126 = ($9|0)==($125|0); if ($126) { $127 = HEAP32[(12908)>>2]|0; $128 = (($127) + ($psize$0))|0; HEAP32[(12908)>>2] = $128; HEAP32[(12920)>>2] = $p$0; $129 = $128 | 1; $130 = ((($p$0)) + 4|0); HEAP32[$130>>2] = $129; $131 = (($p$0) + ($128)|0); HEAP32[$131>>2] = $128; return; } $132 = $112 & -8; $133 = (($132) + ($psize$0))|0; $134 = $112 >>> 3; $135 = ($112>>>0)<(256); do { if ($135) { $136 = (($mem) + ($8)|0); $137 = HEAP32[$136>>2]|0; $$sum1718 = $8 | 4; $138 = (($mem) + ($$sum1718)|0); $139 = HEAP32[$138>>2]|0; $140 = $134 << 1; $141 = (12940 + ($140<<2)|0); $142 = ($137|0)==($141|0); if (!($142)) { $143 = HEAP32[(12916)>>2]|0; $144 = ($137>>>0)<($143>>>0); if ($144) { _abort(); // unreachable; } $145 = ((($137)) + 12|0); $146 = HEAP32[$145>>2]|0; $147 = ($146|0)==($9|0); if (!($147)) { _abort(); // unreachable; } } $148 = ($139|0)==($137|0); if ($148) { $149 = 1 << $134; $150 = $149 ^ -1; $151 = HEAP32[12900>>2]|0; $152 = $151 & $150; HEAP32[12900>>2] = $152; break; } $153 = ($139|0)==($141|0); if ($153) { $$pre58 = ((($139)) + 8|0); $$pre$phi59Z2D = $$pre58; } else { $154 = HEAP32[(12916)>>2]|0; $155 = ($139>>>0)<($154>>>0); if ($155) { _abort(); // unreachable; } $156 = ((($139)) + 8|0); $157 = HEAP32[$156>>2]|0; $158 = ($157|0)==($9|0); if ($158) { $$pre$phi59Z2D = $156; } else { _abort(); // unreachable; } } $159 = ((($137)) + 12|0); HEAP32[$159>>2] = $139; HEAP32[$$pre$phi59Z2D>>2] = $137; } else { $$sum5 = (($8) + 16)|0; $160 = (($mem) + ($$sum5)|0); $161 = HEAP32[$160>>2]|0; $$sum67 = $8 | 4; $162 = (($mem) + ($$sum67)|0); $163 = HEAP32[$162>>2]|0; $164 = ($163|0)==($9|0); do { if ($164) { $$sum9 = (($8) + 12)|0; $175 = (($mem) + ($$sum9)|0); $176 = HEAP32[$175>>2]|0; $177 = ($176|0)==(0|0); if ($177) { $$sum8 = (($8) + 8)|0; $178 = (($mem) + ($$sum8)|0); $179 = HEAP32[$178>>2]|0; $180 = ($179|0)==(0|0); if ($180) { $R7$1 = 0; break; } else { $R7$0 = $179;$RP9$0 = $178; } } else { $R7$0 = $176;$RP9$0 = $175; } while(1) { $181 = ((($R7$0)) + 20|0); $182 = HEAP32[$181>>2]|0; $183 = ($182|0)==(0|0); if (!($183)) { $R7$0 = $182;$RP9$0 = $181; continue; } $184 = ((($R7$0)) + 16|0); $185 = HEAP32[$184>>2]|0; $186 = ($185|0)==(0|0); if ($186) { $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0; break; } else { $R7$0 = $185;$RP9$0 = $184; } } $187 = HEAP32[(12916)>>2]|0; $188 = ($RP9$0$lcssa>>>0)<($187>>>0); if ($188) { _abort(); // unreachable; } else { HEAP32[$RP9$0$lcssa>>2] = 0; $R7$1 = $R7$0$lcssa; break; } } else { $165 = (($mem) + ($8)|0); $166 = HEAP32[$165>>2]|0; $167 = HEAP32[(12916)>>2]|0; $168 = ($166>>>0)<($167>>>0); if ($168) { _abort(); // unreachable; } $169 = ((($166)) + 12|0); $170 = HEAP32[$169>>2]|0; $171 = ($170|0)==($9|0); if (!($171)) { _abort(); // unreachable; } $172 = ((($163)) + 8|0); $173 = HEAP32[$172>>2]|0; $174 = ($173|0)==($9|0); if ($174) { HEAP32[$169>>2] = $163; HEAP32[$172>>2] = $166; $R7$1 = $163; break; } else { _abort(); // unreachable; } } } while(0); $189 = ($161|0)==(0|0); if (!($189)) { $$sum12 = (($8) + 20)|0; $190 = (($mem) + ($$sum12)|0); $191 = HEAP32[$190>>2]|0; $192 = (13204 + ($191<<2)|0); $193 = HEAP32[$192>>2]|0; $194 = ($9|0)==($193|0); if ($194) { HEAP32[$192>>2] = $R7$1; $cond47 = ($R7$1|0)==(0|0); if ($cond47) { $195 = 1 << $191; $196 = $195 ^ -1; $197 = HEAP32[(12904)>>2]|0; $198 = $197 & $196; HEAP32[(12904)>>2] = $198; break; } } else { $199 = HEAP32[(12916)>>2]|0; $200 = ($161>>>0)<($199>>>0); if ($200) { _abort(); // unreachable; } $201 = ((($161)) + 16|0); $202 = HEAP32[$201>>2]|0; $203 = ($202|0)==($9|0); if ($203) { HEAP32[$201>>2] = $R7$1; } else { $204 = ((($161)) + 20|0); HEAP32[$204>>2] = $R7$1; } $205 = ($R7$1|0)==(0|0); if ($205) { break; } } $206 = HEAP32[(12916)>>2]|0; $207 = ($R7$1>>>0)<($206>>>0); if ($207) { _abort(); // unreachable; } $208 = ((($R7$1)) + 24|0); HEAP32[$208>>2] = $161; $$sum13 = (($8) + 8)|0; $209 = (($mem) + ($$sum13)|0); $210 = HEAP32[$209>>2]|0; $211 = ($210|0)==(0|0); do { if (!($211)) { $212 = ($210>>>0)<($206>>>0); if ($212) { _abort(); // unreachable; } else { $213 = ((($R7$1)) + 16|0); HEAP32[$213>>2] = $210; $214 = ((($210)) + 24|0); HEAP32[$214>>2] = $R7$1; break; } } } while(0); $$sum14 = (($8) + 12)|0; $215 = (($mem) + ($$sum14)|0); $216 = HEAP32[$215>>2]|0; $217 = ($216|0)==(0|0); if (!($217)) { $218 = HEAP32[(12916)>>2]|0; $219 = ($216>>>0)<($218>>>0); if ($219) { _abort(); // unreachable; } else { $220 = ((($R7$1)) + 20|0); HEAP32[$220>>2] = $216; $221 = ((($216)) + 24|0); HEAP32[$221>>2] = $R7$1; break; } } } } } while(0); $222 = $133 | 1; $223 = ((($p$0)) + 4|0); HEAP32[$223>>2] = $222; $224 = (($p$0) + ($133)|0); HEAP32[$224>>2] = $133; $225 = HEAP32[(12920)>>2]|0; $226 = ($p$0|0)==($225|0); if ($226) { HEAP32[(12908)>>2] = $133; return; } else { $psize$1 = $133; } } else { $227 = $112 & -2; HEAP32[$111>>2] = $227; $228 = $psize$0 | 1; $229 = ((($p$0)) + 4|0); HEAP32[$229>>2] = $228; $230 = (($p$0) + ($psize$0)|0); HEAP32[$230>>2] = $psize$0; $psize$1 = $psize$0; } $231 = $psize$1 >>> 3; $232 = ($psize$1>>>0)<(256); if ($232) { $233 = $231 << 1; $234 = (12940 + ($233<<2)|0); $235 = HEAP32[12900>>2]|0; $236 = 1 << $231; $237 = $235 & $236; $238 = ($237|0)==(0); if ($238) { $239 = $235 | $236; HEAP32[12900>>2] = $239; $$pre = (($233) + 2)|0; $$pre57 = (12940 + ($$pre<<2)|0); $$pre$phiZ2D = $$pre57;$F16$0 = $234; } else { $$sum11 = (($233) + 2)|0; $240 = (12940 + ($$sum11<<2)|0); $241 = HEAP32[$240>>2]|0; $242 = HEAP32[(12916)>>2]|0; $243 = ($241>>>0)<($242>>>0); if ($243) { _abort(); // unreachable; } else { $$pre$phiZ2D = $240;$F16$0 = $241; } } HEAP32[$$pre$phiZ2D>>2] = $p$0; $244 = ((($F16$0)) + 12|0); HEAP32[$244>>2] = $p$0; $245 = ((($p$0)) + 8|0); HEAP32[$245>>2] = $F16$0; $246 = ((($p$0)) + 12|0); HEAP32[$246>>2] = $234; return; } $247 = $psize$1 >>> 8; $248 = ($247|0)==(0); if ($248) { $I18$0 = 0; } else { $249 = ($psize$1>>>0)>(16777215); if ($249) { $I18$0 = 31; } else { $250 = (($247) + 1048320)|0; $251 = $250 >>> 16; $252 = $251 & 8; $253 = $247 << $252; $254 = (($253) + 520192)|0; $255 = $254 >>> 16; $256 = $255 & 4; $257 = $256 | $252; $258 = $253 << $256; $259 = (($258) + 245760)|0; $260 = $259 >>> 16; $261 = $260 & 2; $262 = $257 | $261; $263 = (14 - ($262))|0; $264 = $258 << $261; $265 = $264 >>> 15; $266 = (($263) + ($265))|0; $267 = $266 << 1; $268 = (($266) + 7)|0; $269 = $psize$1 >>> $268; $270 = $269 & 1; $271 = $270 | $267; $I18$0 = $271; } } $272 = (13204 + ($I18$0<<2)|0); $273 = ((($p$0)) + 28|0); HEAP32[$273>>2] = $I18$0; $274 = ((($p$0)) + 16|0); $275 = ((($p$0)) + 20|0); HEAP32[$275>>2] = 0; HEAP32[$274>>2] = 0; $276 = HEAP32[(12904)>>2]|0; $277 = 1 << $I18$0; $278 = $276 & $277; $279 = ($278|0)==(0); L199: do { if ($279) { $280 = $276 | $277; HEAP32[(12904)>>2] = $280; HEAP32[$272>>2] = $p$0; $281 = ((($p$0)) + 24|0); HEAP32[$281>>2] = $272; $282 = ((($p$0)) + 12|0); HEAP32[$282>>2] = $p$0; $283 = ((($p$0)) + 8|0); HEAP32[$283>>2] = $p$0; } else { $284 = HEAP32[$272>>2]|0; $285 = ((($284)) + 4|0); $286 = HEAP32[$285>>2]|0; $287 = $286 & -8; $288 = ($287|0)==($psize$1|0); L202: do { if ($288) { $T$0$lcssa = $284; } else { $289 = ($I18$0|0)==(31); $290 = $I18$0 >>> 1; $291 = (25 - ($290))|0; $292 = $289 ? 0 : $291; $293 = $psize$1 << $292; $K19$052 = $293;$T$051 = $284; while(1) { $300 = $K19$052 >>> 31; $301 = (((($T$051)) + 16|0) + ($300<<2)|0); $296 = HEAP32[$301>>2]|0; $302 = ($296|0)==(0|0); if ($302) { $$lcssa = $301;$T$051$lcssa = $T$051; break; } $294 = $K19$052 << 1; $295 = ((($296)) + 4|0); $297 = HEAP32[$295>>2]|0; $298 = $297 & -8; $299 = ($298|0)==($psize$1|0); if ($299) { $T$0$lcssa = $296; break L202; } else { $K19$052 = $294;$T$051 = $296; } } $303 = HEAP32[(12916)>>2]|0; $304 = ($$lcssa>>>0)<($303>>>0); if ($304) { _abort(); // unreachable; } else { HEAP32[$$lcssa>>2] = $p$0; $305 = ((($p$0)) + 24|0); HEAP32[$305>>2] = $T$051$lcssa; $306 = ((($p$0)) + 12|0); HEAP32[$306>>2] = $p$0; $307 = ((($p$0)) + 8|0); HEAP32[$307>>2] = $p$0; break L199; } } } while(0); $308 = ((($T$0$lcssa)) + 8|0); $309 = HEAP32[$308>>2]|0; $310 = HEAP32[(12916)>>2]|0; $311 = ($309>>>0)>=($310>>>0); $not$ = ($T$0$lcssa>>>0)>=($310>>>0); $312 = $311 & $not$; if ($312) { $313 = ((($309)) + 12|0); HEAP32[$313>>2] = $p$0; HEAP32[$308>>2] = $p$0; $314 = ((($p$0)) + 8|0); HEAP32[$314>>2] = $309; $315 = ((($p$0)) + 12|0); HEAP32[$315>>2] = $T$0$lcssa; $316 = ((($p$0)) + 24|0); HEAP32[$316>>2] = 0; break; } else { _abort(); // unreachable; } } } while(0); $317 = HEAP32[(12932)>>2]|0; $318 = (($317) + -1)|0; HEAP32[(12932)>>2] = $318; $319 = ($318|0)==(0); if ($319) { $sp$0$in$i = (13356); } else { return; } while(1) { $sp$0$i = HEAP32[$sp$0$in$i>>2]|0; $320 = ($sp$0$i|0)==(0|0); $321 = ((($sp$0$i)) + 8|0); if ($320) { break; } else { $sp$0$in$i = $321; } } HEAP32[(12932)>>2] = -1; return; } function runPostSets() { } function _i64Subtract(a, b, c, d) { a = a|0; b = b|0; c = c|0; d = d|0; var l = 0, h = 0; l = (a - c)>>>0; h = (b - d)>>>0; h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow. return ((tempRet0 = h,l|0)|0); } function _i64Add(a, b, c, d) { /* x = a + b*2^32 y = c + d*2^32 result = l + h*2^32 */ a = a|0; b = b|0; c = c|0; d = d|0; var l = 0, h = 0; l = (a + c)>>>0; h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow. return ((tempRet0 = h,l|0)|0); } function _bitshift64Lshr(low, high, bits) { low = low|0; high = high|0; bits = bits|0; var ander = 0; if ((bits|0) < 32) { ander = ((1 << bits) - 1)|0; tempRet0 = high >>> bits; return (low >>> bits) | ((high&ander) << (32 - bits)); } tempRet0 = 0; return (high >>> (bits - 32))|0; } function _memcpy(dest, src, num) { dest = dest|0; src = src|0; num = num|0; var ret = 0; if ((num|0) >= 4096) return _emscripten_memcpy_big(dest|0, src|0, num|0)|0; ret = dest|0; if ((dest&3) == (src&3)) { while (dest & 3) { if ((num|0) == 0) return ret|0; HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); dest = (dest+1)|0; src = (src+1)|0; num = (num-1)|0; } while ((num|0) >= 4) { HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0); dest = (dest+4)|0; src = (src+4)|0; num = (num-4)|0; } } while ((num|0) > 0) { HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); dest = (dest+1)|0; src = (src+1)|0; num = (num-1)|0; } return ret|0; } function _memset(ptr, value, num) { ptr = ptr|0; value = value|0; num = num|0; var stop = 0, value4 = 0, stop4 = 0, unaligned = 0; stop = (ptr + num)|0; if ((num|0) >= 20) { // This is unaligned, but quite large, so work hard to get to aligned settings value = value & 0xff; unaligned = ptr & 3; value4 = value | (value << 8) | (value << 16) | (value << 24); stop4 = stop & ~3; if (unaligned) { unaligned = (ptr + 4 - unaligned)|0; while ((ptr|0) < (unaligned|0)) { // no need to check for stop, since we have large num HEAP8[((ptr)>>0)]=value; ptr = (ptr+1)|0; } } while ((ptr|0) < (stop4|0)) { HEAP32[((ptr)>>2)]=value4; ptr = (ptr+4)|0; } } while ((ptr|0) < (stop|0)) { HEAP8[((ptr)>>0)]=value; ptr = (ptr+1)|0; } return (ptr-num)|0; } function _bitshift64Shl(low, high, bits) { low = low|0; high = high|0; bits = bits|0; var ander = 0; if ((bits|0) < 32) { ander = ((1 << bits) - 1)|0; tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits)); return low << bits; } tempRet0 = low << (bits - 32); return 0; } function _bitshift64Ashr(low, high, bits) { low = low|0; high = high|0; bits = bits|0; var ander = 0; if ((bits|0) < 32) { ander = ((1 << bits) - 1)|0; tempRet0 = high >> bits; return (low >>> bits) | ((high&ander) << (32 - bits)); } tempRet0 = (high|0) < 0 ? -1 : 0; return (high >> (bits - 32))|0; } function _llvm_cttz_i32(x) { x = x|0; var ret = 0; ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0); if ((ret|0) < 8) return ret|0; ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0); if ((ret|0) < 8) return (ret + 8)|0; ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0); if ((ret|0) < 8) return (ret + 16)|0; return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0; } // ======== compiled code from system/lib/compiler-rt , see readme therein function ___muldsi3($a, $b) { $a = $a | 0; $b = $b | 0; var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0; $1 = $a & 65535; $2 = $b & 65535; $3 = Math_imul($2, $1) | 0; $6 = $a >>> 16; $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0; $11 = $b >>> 16; $12 = Math_imul($11, $1) | 0; return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0; } function ___divdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $7$0 = 0, $7$1 = 0, $8$0 = 0, $10$0 = 0; $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0; $4$1 = tempRet0; $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0; $7$0 = $2$0 ^ $1$0; $7$1 = $2$1 ^ $1$1; $8$0 = ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, 0) | 0; $10$0 = _i64Subtract($8$0 ^ $7$0, tempRet0 ^ $7$1, $7$0, $7$1) | 0; return $10$0 | 0; } function ___remdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $rem = 0, $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $10$0 = 0, $10$1 = 0, __stackBase__ = 0; __stackBase__ = STACKTOP; STACKTOP = STACKTOP + 16 | 0; $rem = __stackBase__ | 0; $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0; $4$1 = tempRet0; $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0; ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, $rem) | 0; $10$0 = _i64Subtract(HEAP32[$rem >> 2] ^ $1$0, HEAP32[$rem + 4 >> 2] ^ $1$1, $1$0, $1$1) | 0; $10$1 = tempRet0; STACKTOP = __stackBase__; return (tempRet0 = $10$1, $10$0) | 0; } function ___muldi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0; $x_sroa_0_0_extract_trunc = $a$0; $y_sroa_0_0_extract_trunc = $b$0; $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0; $1$1 = tempRet0; $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0; return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0; } function ___udivdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $1$0 = 0; $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0; return $1$0 | 0; } function ___uremdi3($a$0, $a$1, $b$0, $b$1) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; var $rem = 0, __stackBase__ = 0; __stackBase__ = STACKTOP; STACKTOP = STACKTOP + 16 | 0; $rem = __stackBase__ | 0; ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0; STACKTOP = __stackBase__; return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0; } function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) { $a$0 = $a$0 | 0; $a$1 = $a$1 | 0; $b$0 = $b$0 | 0; $b$1 = $b$1 | 0; $rem = $rem | 0; var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0; $n_sroa_0_0_extract_trunc = $a$0; $n_sroa_1_4_extract_shift$0 = $a$1; $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0; $d_sroa_0_0_extract_trunc = $b$0; $d_sroa_1_4_extract_shift$0 = $b$1; $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0; if (($n_sroa_1_4_extract_trunc | 0) == 0) { $4 = ($rem | 0) != 0; if (($d_sroa_1_4_extract_trunc | 0) == 0) { if ($4) { HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0); HEAP32[$rem + 4 >> 2] = 0; } $_0$1 = 0; $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0; return (tempRet0 = $_0$1, $_0$0) | 0; } else { if (!$4) { $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } HEAP32[$rem >> 2] = $a$0 & -1; HEAP32[$rem + 4 >> 2] = $a$1 & 0; $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } } $17 = ($d_sroa_1_4_extract_trunc | 0) == 0; do { if (($d_sroa_0_0_extract_trunc | 0) == 0) { if ($17) { if (($rem | 0) != 0) { HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0); HEAP32[$rem + 4 >> 2] = 0; } $_0$1 = 0; $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0; return (tempRet0 = $_0$1, $_0$0) | 0; } if (($n_sroa_0_0_extract_trunc | 0) == 0) { if (($rem | 0) != 0) { HEAP32[$rem >> 2] = 0; HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0); } $_0$1 = 0; $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0; return (tempRet0 = $_0$1, $_0$0) | 0; } $37 = $d_sroa_1_4_extract_trunc - 1 | 0; if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) { if (($rem | 0) != 0) { HEAP32[$rem >> 2] = 0 | $a$0 & -1; HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0; } $_0$1 = 0; $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0); return (tempRet0 = $_0$1, $_0$0) | 0; } $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0; $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; if ($51 >>> 0 <= 30) { $57 = $51 + 1 | 0; $58 = 31 - $51 | 0; $sr_1_ph = $57; $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0); $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0); $q_sroa_0_1_ph = 0; $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58; break; } if (($rem | 0) == 0) { $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } HEAP32[$rem >> 2] = 0 | $a$0 & -1; HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } else { if (!$17) { $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0; $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; if ($119 >>> 0 <= 31) { $125 = $119 + 1 | 0; $126 = 31 - $119 | 0; $130 = $119 - 31 >> 31; $sr_1_ph = $125; $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126; $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130; $q_sroa_0_1_ph = 0; $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126; break; } if (($rem | 0) == 0) { $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } HEAP32[$rem >> 2] = 0 | $a$0 & -1; HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; $_0$1 = 0; $_0$0 = 0; return (tempRet0 = $_0$1, $_0$0) | 0; } $66 = $d_sroa_0_0_extract_trunc - 1 | 0; if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) { $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0; $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; $89 = 64 - $88 | 0; $91 = 32 - $88 | 0; $92 = $91 >> 31; $95 = $88 - 32 | 0; $105 = $95 >> 31; $sr_1_ph = $88; $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105; $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0); $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92; $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31; break; } if (($rem | 0) != 0) { HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc; HEAP32[$rem + 4 >> 2] = 0; } if (($d_sroa_0_0_extract_trunc | 0) == 1) { $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; $_0$0 = 0 | $a$0 & -1; return (tempRet0 = $_0$1, $_0$0) | 0; } else { $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0; $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0); $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0; return (tempRet0 = $_0$1, $_0$0) | 0; } } } while (0); if (($sr_1_ph | 0) == 0) { $q_sroa_1_1_lcssa = $q_sroa_1_1_ph; $q_sroa_0_1_lcssa = $q_sroa_0_1_ph; $r_sroa_1_1_lcssa = $r_sroa_1_1_ph; $r_sroa_0_1_lcssa = $r_sroa_0_1_ph; $carry_0_lcssa$1 = 0; $carry_0_lcssa$0 = 0; } else { $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1; $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0; $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0; $137$1 = tempRet0; $q_sroa_1_1198 = $q_sroa_1_1_ph; $q_sroa_0_1199 = $q_sroa_0_1_ph; $r_sroa_1_1200 = $r_sroa_1_1_ph; $r_sroa_0_1201 = $r_sroa_0_1_ph; $sr_1202 = $sr_1_ph; $carry_0203 = 0; while (1) { $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1; $149 = $carry_0203 | $q_sroa_0_1199 << 1; $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31); $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0; _i64Subtract($137$0, $137$1, $r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1) | 0; $150$1 = tempRet0; $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1; $152 = $151$0 & 1; $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1, $151$0 & $d_sroa_0_0_insert_insert99$0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1) | 0; $r_sroa_0_0_extract_trunc = $154$0; $r_sroa_1_4_extract_trunc = tempRet0; $155 = $sr_1202 - 1 | 0; if (($155 | 0) == 0) { break; } else { $q_sroa_1_1198 = $147; $q_sroa_0_1199 = $149; $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc; $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc; $sr_1202 = $155; $carry_0203 = $152; } } $q_sroa_1_1_lcssa = $147; $q_sroa_0_1_lcssa = $149; $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc; $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc; $carry_0_lcssa$1 = 0; $carry_0_lcssa$0 = $152; } $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa; $q_sroa_0_0_insert_ext75$1 = 0; $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1; if (($rem | 0) != 0) { HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa; HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0; } $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1; $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0; return (tempRet0 = $_0$1, $_0$0) | 0; } // ======================================================================= function dynCall_iiii(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; return FUNCTION_TABLE_iiii[index&7](a1|0,a2|0,a3|0)|0; } function dynCall_vi(index,a1) { index = index|0; a1=a1|0; FUNCTION_TABLE_vi[index&31](a1|0); } function dynCall_vii(index,a1,a2) { index = index|0; a1=a1|0; a2=a2|0; FUNCTION_TABLE_vii[index&31](a1|0,a2|0); } function dynCall_vidd(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=+a2; a3=+a3; FUNCTION_TABLE_vidd[index&15](a1|0,+a2,+a3); } function dynCall_ii(index,a1) { index = index|0; a1=a1|0; return FUNCTION_TABLE_ii[index&3](a1|0)|0; } function dynCall_didii(index,a1,a2,a3,a4) { index = index|0; a1=a1|0; a2=+a2; a3=a3|0; a4=a4|0; return +FUNCTION_TABLE_didii[index&15](a1|0,+a2,a3|0,a4|0); } function dynCall_viii(index,a1,a2,a3) { index = index|0; a1=a1|0; a2=a2|0; a3=a3|0; FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0); } function dynCall_v(index) { index = index|0; FUNCTION_TABLE_v[index&31](); } function dynCall_iii(index,a1,a2) { index = index|0; a1=a1|0; a2=a2|0; return FUNCTION_TABLE_iii[index&15](a1|0,a2|0)|0; } function dynCall_vidiii(index,a1,a2,a3,a4,a5) { index = index|0; a1=a1|0; a2=+a2; a3=a3|0; a4=a4|0; a5=a5|0; FUNCTION_TABLE_vidiii[index&15](a1|0,+a2,a3|0,a4|0,a5|0); } function b0(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_iiii(0);return 0; } function b1(p0) { p0 = p0|0; nullFunc_vi(1); } function b2(p0,p1) { p0 = p0|0;p1 = p1|0; nullFunc_vii(2); } function b3(p0,p1,p2) { p0 = p0|0;p1 = +p1;p2 = +p2; nullFunc_vidd(3); } function b4(p0) { p0 = p0|0; nullFunc_ii(4);return 0; } function b5(p0,p1,p2,p3) { p0 = p0|0;p1 = +p1;p2 = p2|0;p3 = p3|0; nullFunc_didii(5);return +0; } function b6(p0,p1,p2) { p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_viii(6); } function b7() { ; nullFunc_v(7); } function b8(p0,p1) { p0 = p0|0;p1 = p1|0; nullFunc_iii(8);return 0; } function b9(p0,p1,p2,p3,p4) { p0 = p0|0;p1 = +p1;p2 = p2|0;p3 = p3|0;p4 = p4|0; nullFunc_vidiii(9); } // EMSCRIPTEN_END_FUNCS var FUNCTION_TABLE_iiii = [b0,b0,b0,b0,___stdio_write,___stdio_seek,___stdout_write,_nk_malloc]; var FUNCTION_TABLE_vi = [b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,b1,_cleanup526,b1,b1,b1,b1,b1,b1,b1,b1 ,b1,b1,b1]; var FUNCTION_TABLE_vii = [b2,b2,b2,b2,b2,b2,b2,b2,_nk_mfree,b2,b2,b2,b2,b2,_nk_glfw3_char_callback,b2,_nk_glfw3_clipbard_paste,_error_callback,b2,b2,b2,b2,b2,b2,b2,b2,b2,b2,b2 ,b2,b2,b2]; var FUNCTION_TABLE_vidd = [b3,b3,b3,b3,b3,b3,b3,b3,b3,b3,b3,b3,b3,_nk_gflw3_scroll_callback,b3,b3]; var FUNCTION_TABLE_ii = [b4,b4,b4,___stdio_close]; var FUNCTION_TABLE_didii = [b5,b5,b5,b5,b5,b5,b5,b5,b5,b5,b5,_nk_font_text_width,b5,b5,b5,b5]; var FUNCTION_TABLE_viii = [b6,b6,b6,b6,b6,b6,b6,b6,b6,b6,b6,b6,b6,b6,b6,_nk_glfw3_clipbard_copy,b6,b6,_windowSizeCallback,b6,b6,b6,b6,b6,b6,b6,b6,b6,b6 ,b6,b6,b6]; var FUNCTION_TABLE_v = [b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,b7,_render,b7,b7,b7,b7,b7,b7,b7,b7,b7 ,b7,b7,b7]; var FUNCTION_TABLE_iii = [b8,_nk_filter_decimal,_nk_filter_float,b8,b8,b8,b8,b8,b8,_nk_rect_height_compare,_nk_rect_original_order,b8,b8,b8,b8,b8]; var FUNCTION_TABLE_vidiii = [b9,b9,b9,b9,b9,b9,b9,b9,b9,b9,b9,b9,_nk_font_query_font_glyph,b9,b9,b9]; return { _i64Subtract: _i64Subtract, _free: _free, _main: _main, _i64Add: _i64Add, _memset: _memset, _malloc: _malloc, _memcpy: _memcpy, _bitshift64Lshr: _bitshift64Lshr, _fflush: _fflush, ___errno_location: ___errno_location, _bitshift64Shl: _bitshift64Shl, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_iiii: dynCall_iiii, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_vidd: dynCall_vidd, dynCall_ii: dynCall_ii, dynCall_didii: dynCall_didii, dynCall_viii: dynCall_viii, dynCall_v: dynCall_v, dynCall_iii: dynCall_iii, dynCall_vidiii: dynCall_vidiii }; }) // EMSCRIPTEN_END_ASM (Module.asmGlobalArg, Module.asmLibraryArg, buffer); var real__i64Subtract = asm["_i64Subtract"]; asm["_i64Subtract"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__i64Subtract.apply(null, arguments); }; var real__free = asm["_free"]; asm["_free"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__free.apply(null, arguments); }; var real__main = asm["_main"]; asm["_main"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__main.apply(null, arguments); }; var real__i64Add = asm["_i64Add"]; asm["_i64Add"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__i64Add.apply(null, arguments); }; var real__malloc = asm["_malloc"]; asm["_malloc"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__malloc.apply(null, arguments); }; var real__bitshift64Lshr = asm["_bitshift64Lshr"]; asm["_bitshift64Lshr"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__bitshift64Lshr.apply(null, arguments); }; var real__fflush = asm["_fflush"]; asm["_fflush"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__fflush.apply(null, arguments); }; var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real____errno_location.apply(null, arguments); }; var real__bitshift64Shl = asm["_bitshift64Shl"]; asm["_bitshift64Shl"] = function() { assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); return real__bitshift64Shl.apply(null, arguments); }; var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"]; var _free = Module["_free"] = asm["_free"]; var _main = Module["_main"] = asm["_main"]; var _i64Add = Module["_i64Add"] = asm["_i64Add"]; var _memset = Module["_memset"] = asm["_memset"]; var runPostSets = Module["runPostSets"] = asm["runPostSets"]; var _malloc = Module["_malloc"] = asm["_malloc"]; var _memcpy = Module["_memcpy"] = asm["_memcpy"]; var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"]; var _fflush = Module["_fflush"] = asm["_fflush"]; var ___errno_location = Module["___errno_location"] = asm["___errno_location"]; var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"]; var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"]; var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"]; var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"]; var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"]; var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"]; var dynCall_didii = Module["dynCall_didii"] = asm["dynCall_didii"]; var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"]; var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"]; var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"]; var dynCall_vidiii = Module["dynCall_vidiii"] = asm["dynCall_vidiii"]; ; Runtime.stackAlloc = asm['stackAlloc']; Runtime.stackSave = asm['stackSave']; Runtime.stackRestore = asm['stackRestore']; Runtime.establishStackSpace = asm['establishStackSpace']; Runtime.setTempRet0 = asm['setTempRet0']; Runtime.getTempRet0 = asm['getTempRet0']; // === Auto-generated postamble setup entry stuff === function ExitStatus(status) { this.name = "ExitStatus"; this.message = "Program terminated with exit(" + status + ")"; this.status = status; }; ExitStatus.prototype = new Error(); ExitStatus.prototype.constructor = ExitStatus; var initialStackTop; var preloadStartTime = null; var calledMain = false; dependenciesFulfilled = function runCaller() { // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) if (!Module['calledRun']) run(); if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled } Module['callMain'] = Module.callMain = function callMain(args) { assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)'); assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called'); args = args || []; ensureInitRuntime(); var argc = args.length+1; function pad() { for (var i = 0; i < 4-1; i++) { argv.push(0); } } var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ]; pad(); for (var i = 0; i < argc-1; i = i + 1) { argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL)); pad(); } argv.push(0); argv = allocate(argv, 'i32', ALLOC_NORMAL); try { var ret = Module['_main'](argc, argv, 0); // if we're not running an evented main loop, it's time to exit exit(ret, /* implicit = */ true); } catch(e) { if (e instanceof ExitStatus) { // exit() throws this once it's done to make sure execution // has been stopped completely return; } else if (e == 'SimulateInfiniteLoop') { // running an evented main loop, don't immediately exit Module['noExitRuntime'] = true; return; } else { if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); throw e; } } finally { calledMain = true; } } function run(args) { args = args || Module['arguments']; if (preloadStartTime === null) preloadStartTime = Date.now(); if (runDependencies > 0) { Module.printErr('run() called, but dependencies remain, so not running'); return; } preRun(); if (runDependencies > 0) return; // a preRun added a dependency, run will be called later if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame function doRun() { if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening Module['calledRun'] = true; if (ABORT) return; ensureInitRuntime(); preMain(); if (ENVIRONMENT_IS_WEB && preloadStartTime !== null) { Module.printErr('pre-main prep time: ' + (Date.now() - preloadStartTime) + ' ms'); } if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); if (Module['_main'] && shouldRunNow) Module['callMain'](args); postRun(); } if (Module['setStatus']) { Module['setStatus']('Running...'); setTimeout(function() { setTimeout(function() { Module['setStatus'](''); }, 1); doRun(); }, 1); } else { doRun(); } } Module['run'] = Module.run = run; function exit(status, implicit) { if (implicit && Module['noExitRuntime']) { Module.printErr('exit(' + status + ') implicitly called by end of main(), but noExitRuntime, so not exiting the runtime (you can use emscripten_force_exit, if you want to force a true shutdown)'); return; } if (Module['noExitRuntime']) { Module.printErr('exit(' + status + ') called, but noExitRuntime, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)'); } else { ABORT = true; EXITSTATUS = status; STACKTOP = initialStackTop; exitRuntime(); if (Module['onExit']) Module['onExit'](status); } if (ENVIRONMENT_IS_NODE) { // Work around a node.js bug where stdout buffer is not flushed at process exit: // Instead of process.exit() directly, wait for stdout flush event. // See https://github.com/joyent/node/issues/1669 and https://github.com/kripken/emscripten/issues/2582 // Workaround is based on https://github.com/RReverser/acorn/commit/50ab143cecc9ed71a2d66f78b4aec3bb2e9844f6 process['stdout']['once']('drain', function () { process['exit'](status); }); console.log(' '); // Make sure to print something to force the drain event to occur, in case the stdout buffer was empty. // Work around another node bug where sometimes 'drain' is never fired - make another effort // to emit the exit status, after a significant delay (if node hasn't fired drain by then, give up) setTimeout(function() { process['exit'](status); }, 500); } else if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') { quit(status); } // if we reach here, we must throw an exception to halt the current execution throw new ExitStatus(status); } Module['exit'] = Module.exit = exit; var abortDecorators = []; function abort(what) { if (what !== undefined) { Module.print(what); Module.printErr(what); what = JSON.stringify(what) } else { what = ''; } ABORT = true; EXITSTATUS = 1; var extra = ''; var output = 'abort(' + what + ') at ' + stackTrace() + extra; if (abortDecorators) { abortDecorators.forEach(function(decorator) { output = decorator(output, what); }); } throw output; } Module['abort'] = Module.abort = abort; // {{PRE_RUN_ADDITIONS}} if (Module['preInit']) { if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; while (Module['preInit'].length > 0) { Module['preInit'].pop()(); } } // shouldRunNow refers to calling main(), not run(). var shouldRunNow = true; if (Module['noInitialRun']) { shouldRunNow = false; } run(); // {{POST_RUN_ADDITIONS}} // {{MODULE_ADDITIONS}}